Dataset Preview
View in Dataset Viewer
Viewer
The full dataset viewer is not available (click to read why). Only showing a preview of the rows.
The dataset generation failed
Error code: DatasetGenerationError Exception: DatasetGenerationError Message: An error occurred while generating the dataset Traceback: Traceback (most recent call last): File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 2011, in _prepare_split_single writer.write_table(table) File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/arrow_writer.py", line 583, in write_table self._build_writer(inferred_schema=pa_table.schema) File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/arrow_writer.py", line 404, in _build_writer self.pa_writer = self._WRITER_CLASS(self.stream, schema) File "/src/services/worker/.venv/lib/python3.9/site-packages/pyarrow/parquet/core.py", line 1016, in __init__ self.writer = _parquet.ParquetWriter( File "pyarrow/_parquet.pyx", line 1869, in pyarrow._parquet.ParquetWriter.__cinit__ File "pyarrow/error.pxi", line 154, in pyarrow.lib.pyarrow_internal_check_status File "pyarrow/error.pxi", line 91, in pyarrow.lib.check_status pyarrow.lib.ArrowNotImplementedError: Cannot write struct type 'graph' with no child field to Parquet. Consider adding a dummy child field. During handling of the above exception, another exception occurred: Traceback (most recent call last): File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 2027, in _prepare_split_single num_examples, num_bytes = writer.finalize() File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/arrow_writer.py", line 602, in finalize self._build_writer(self.schema) File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/arrow_writer.py", line 404, in _build_writer self.pa_writer = self._WRITER_CLASS(self.stream, schema) File "/src/services/worker/.venv/lib/python3.9/site-packages/pyarrow/parquet/core.py", line 1016, in __init__ self.writer = _parquet.ParquetWriter( File "pyarrow/_parquet.pyx", line 1869, in pyarrow._parquet.ParquetWriter.__cinit__ File "pyarrow/error.pxi", line 154, in pyarrow.lib.pyarrow_internal_check_status File "pyarrow/error.pxi", line 91, in pyarrow.lib.check_status pyarrow.lib.ArrowNotImplementedError: Cannot write struct type 'graph' with no child field to Parquet. Consider adding a dummy child field. The above exception was the direct cause of the following exception: Traceback (most recent call last): File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 1321, in compute_config_parquet_and_info_response parquet_operations = convert_to_parquet(builder) File "/src/services/worker/src/worker/job_runners/config/parquet_and_info.py", line 935, in convert_to_parquet builder.download_and_prepare( File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1027, in download_and_prepare self._download_and_prepare( File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1122, in _download_and_prepare self._prepare_split(split_generator, **prepare_split_kwargs) File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 1882, in _prepare_split for job_id, done, content in self._prepare_split_single( File "/src/services/worker/.venv/lib/python3.9/site-packages/datasets/builder.py", line 2038, in _prepare_split_single raise DatasetGenerationError("An error occurred while generating the dataset") from e datasets.exceptions.DatasetGenerationError: An error occurred while generating the dataset
Need help to make the dataset viewer work? Open a discussion for direct support.
query
dict | id
int64 | domain
string | verbalization
string |
---|---|---|---|
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Material",
"subkey": null,
"target": "UnitCell"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Cl2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "[La+3]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"Cl2\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"[La+3]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Oxygen\" .\n ?Material ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 0 | ontozeolite | What is the unit cell information of zeolite material, which has guest species <span>Cl2</span> and <span>[La+3]</span>, and which is built by elements being Oxygen? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasFrameworkCode",
"source": "Framework",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableVolumePerCell",
"source": "Framework",
"subkey": null,
"target": "OccupiableVolumePerCell"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "IFW",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableVolumePerCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?OccupiableVolumePerCell WHERE {\n ?Framework zeo:hasFrameworkCode \"IFW\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableVolumePerCell ?OccupiableVolumePerCell .\n}"
} | 1 | ontozeolite | What is the occupiable volume per cell of zeolite framework <span>IFW</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificAccessibleArea",
"target": "SpecificAccessibleAreaNumericalValue"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Framework",
"subkey": null,
"target": "UnitCell"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "func",
"source": "SpecificAccessibleAreaNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "piperazine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "InChI=1S/Gd/q+3",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Al",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificAccessibleAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">\n(Decimal('1686'),)",
"literal": null,
"operand": [
1686
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"piperazine\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/Gd/q+3\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Al\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue ?SpecificAccessibleAreaNumericalValue .\n FILTER ( ?SpecificAccessibleAreaNumericalValue > 1686 )\n ?Framework ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 2 | ontozeolite | For zeolite framework, which has guest <span>piperazine</span> and <span>InChI=1S/Gd/q+3</span>, and which has framework components being Al, and whose specific accessible area is higher than 1686, what is the unit cell information? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.CRYSTAL_INFO"
},
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode",
"source": "Framework",
"subkey": "TiledStructure",
"target": "Literal_2"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram",
"source": "Framework",
"subkey": null,
"target": "AccessibleAreaPerGram"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.MATERIALS"
},
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_3"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Na1.2(OH)0.8|[Al2Si2.8O7.8]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "N-methylmethanamine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "t-can",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_3",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleAreaPerGram",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AccessibleAreaPerGram WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasChemicalFormula \"|Na1.2(OH)0.8|[Al2Si2.8O7.8]\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"N-methylmethanamine\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode \"t-can\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram ?AccessibleAreaPerGram .\n}"
} | 3 | ontozeolite | What is the accessible area per gram of zeolite framework, corresponding to zeolite formula <span>|Na1.2(OH)0.8|[Al2Si2.8O7.8]</span>, and which has guest species <span>N-methylmethanamine</span>, and whose tile code is <span>t-can</span>, and which is made up of only Oxygen? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.CRYSTAL_INFO"
},
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode",
"source": "Framework",
"subkey": "TiledStructure",
"target": "Literal_3"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell",
"source": "Framework",
"subkey": null,
"target": "OccupiableAreaPerCell"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "(2-aminocyclohexyl)amine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "[1-(3-fluorophenyl)cyclopentyl]methyl-trimethyl-ammonium",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "germanium(4+)",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_3",
"iri": null,
"key": null,
"label": "t-tun-1*",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableAreaPerCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?OccupiableAreaPerCell WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"(2-aminocyclohexyl)amine\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"[1-(3-fluorophenyl)cyclopentyl]methyl-trimethyl-ammonium\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"germanium(4+)\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode \"t-tun-1*\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell ?OccupiableAreaPerCell .\n}"
} | 4 | ontozeolite | For zeolite, which has guest <span>(2-aminocyclohexyl)amine</span> and <span>[1-(3-fluorophenyl)cyclopentyl]methyl-trimethyl-ammonium</span> and <span>germanium(4+)</span>, and whose tile code is <span>t-tun-1*</span>, what is the occupiable area per cell? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea",
"source": "Framework",
"subkey": null,
"target": "SpecificOccupiableArea"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "[1-(3-fluorophenyl)cyclopentyl]methyl-trimethylammonium",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Mg",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificOccupiableArea",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?SpecificOccupiableArea WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"[1-(3-fluorophenyl)cyclopentyl]methyl-trimethylammonium\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Mg\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea ?SpecificOccupiableArea .\n}"
} | 5 | ontozeolite | What is the specific occupiable area of zeolite framework, which has guest species <span>[1-(3-fluorophenyl)cyclopentyl]methyl-trimethylammonium</span>, and which has framework components being Mg only? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK"
},
"label": "^zeo:hasZeoliticMaterial/zeo:hasFrameworkCode",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.CRYSTAL_INFO"
},
"label": "^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Material",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Aluminum",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "AFI",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "=\n(Decimal('5380.9045'),)",
"literal": null,
"operand": [
5380.9045
],
"operator": {
"__enum__": "NumOp.EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Aluminum\" .\n ?Material ^zeo:hasZeoliticMaterial/zeo:hasFrameworkCode \"AFI\" .\n ?Material ^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue = 5380.9045 )\n}"
} | 6 | ontozeolite | what are the zeolite material, which has framework components being Aluminum, and whose framework is <span>AFI</span>, and whose unit cell volume is = 5380.9045? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.CRYSTAL_INFO"
},
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificOccupiableArea",
"target": "SpecificOccupiableAreaNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleVolume",
"target": "AccessibleVolumeNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "SpecificOccupiableAreaNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": null,
"label": "func",
"source": "AccessibleVolumeNumericalValue",
"subkey": null,
"target": "Func_2"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">=\n(Decimal('3881'),)",
"literal": null,
"operand": [
3881
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificOccupiableAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": "=\n(Decimal('1800.23'),)",
"literal": null,
"operand": [
1800.23
],
"operator": {
"__enum__": "NumOp.EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_2",
"iri": null,
"key": null,
"label": "<=\n(Decimal('19.019'),)",
"literal": null,
"operand": [
19.019
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "N'-(2-azanylethyl)ethane-1,2-diamine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Framework WHERE {\n ?Framework ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue >= 3881 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue ?SpecificOccupiableAreaNumericalValue .\n FILTER ( ?SpecificOccupiableAreaNumericalValue = 1800.23 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue ?AccessibleVolumeNumericalValue .\n FILTER ( ?AccessibleVolumeNumericalValue <= 19.019 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"N'-(2-azanylethyl)ethane-1,2-diamine\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n}"
} | 7 | ontozeolite | what are the zeolite framework, whose unit cell volume is greater than or equal to 3881, and whose specific occupiable area is = 1800.23, and whose accessible volume is <= 19.019, and which incorporates <span>N'-(2-azanylethyl)ethane-1,2-diamine</span>, and which has framework building elements being only Silicon? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasAtomicStructure",
"source": "Material",
"subkey": null,
"target": "AtomicStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "silver(1+)",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "[tert-butylimino-bis(dimethylamino)phosphoranyl]-dimethyl-amine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AtomicStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AtomicStructure WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"silver(1+)\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"[tert-butylimino-bis(dimethylamino)phosphoranyl]-dimethyl-amine\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n ?Material ocr:hasCrystalInformation/ocr:hasAtomicStructure ?AtomicStructure .\n}"
} | 8 | ontozeolite | What is the atomic structure of zeolite material, which incorporates <span>silver(1+)</span> and <span>[tert-butylimino-bis(dimethylamino)phosphoranyl]-dimethyl-amine</span>, and which has building elements being Silicon only? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n}"
} | 9 | ontozeolite | what are the zeolite material, which is built by only Silicon? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram",
"source": "Framework",
"subkey": null,
"target": "AccessibleAreaPerGram"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.MATERIALS"
},
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "InChI=1S/CO/c1-2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "|Mg19Na58|[Be96P96O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleAreaPerGram",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AccessibleAreaPerGram WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/CO/c1-2\" .\n ?Material zeo:hasChemicalFormula \"|Mg19Na58|[Be96P96O384]\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram ?AccessibleAreaPerGram .\n}"
} | 10 | ontozeolite | For zeolite, which has guest <span>InChI=1S/CO/c1-2</span>, and corresponding to zeolitic material <span>|Mg19Na58|[Be96P96O384]</span>, what is the accessible area per gram? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_3"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Material",
"subkey": null,
"target": "BN_0"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToCartesian"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToCartesian"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "C1CC[N+]2(CC1)CCCCC2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Aluminum",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_3",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToCartesian ?TransformationVectorToCartesian WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"C1CC[N+]2(CC1)CCCCC2\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Aluminum\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Oxygen\" .\n ?Material ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToCartesian ?TransformationMatrixToCartesian ; ocr:hasTransformationVectorToCartesian ?TransformationVectorToCartesian ] .\n}"
} | 11 | ontozeolite | For zeolite material, which incorporates <span>1,3,5,7-tetrazatricyclo[3.3.1.13,7]decane</span> and <span>C1CC[N+]2(CC1)CCCCC2</span>, and which is built by elements being Aluminum and Oxygen, what is the transformation from fractional to Cartesian coordinate system? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Material",
"subkey": null,
"target": "BN_0"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToCartesian"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToCartesian"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Sr21.44(H2O)36.48|[Si136.5Al55.5O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToCartesian ?TransformationVectorToCartesian WHERE {\n ?Material zeo:hasChemicalFormula \"|Sr21.44(H2O)36.48|[Si136.5Al55.5O384]\" .\n ?Material ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToCartesian ?TransformationMatrixToCartesian ; ocr:hasTransformationVectorToCartesian ?TransformationVectorToCartesian ] .\n}"
} | 12 | ontozeolite | What is the transformation from fractional to Cartesian coordinate system of zeolite with formulation <span>|Sr21.44(H2O)36.48|[Si136.5Al55.5O384]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableVolumePerCell",
"source": "Framework",
"subkey": null,
"target": "OccupiableVolumePerCell"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_3"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_4"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "C5H13N",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "glyoxaline",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "InChI=1S/C13H26N/c1-2-3-4-5-9-14-10-6-13(7-11-14)8-12-14/h13H,2-12H2,1H3/q+1",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_3",
"iri": null,
"key": null,
"label": "pyridine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_4",
"iri": null,
"key": null,
"label": "Cobalt",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableVolumePerCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?OccupiableVolumePerCell WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"C5H13N\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"glyoxaline\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/C13H26N/c1-2-3-4-5-9-14-10-6-13(7-11-14)8-12-14/h13H,2-12H2,1H3/q+1\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"pyridine\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Cobalt\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableVolumePerCell ?OccupiableVolumePerCell .\n}"
} | 13 | ontozeolite | What is the occupiable volume per cell of zeolite framework, which incorporates <span>C5H13N</span> and <span>glyoxaline</span> and <span>InChI=1S/C13H26N/c1-2-3-4-5-9-14-10-6-13(7-11-14)8-12-14/h13H,2-12H2,1H3/q+1</span> and <span>pyridine</span>, and which has building elements being Cobalt? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleVolume",
"target": "AccessibleVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificOccupiableArea",
"target": "SpecificOccupiableAreaNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Framework",
"subkey": null,
"target": "TiledStructure"
},
{
"key": null,
"label": "func",
"source": "AccessibleVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "SpecificOccupiableAreaNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">=\n(Decimal('14'),)",
"literal": null,
"operand": [
14
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificOccupiableAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": "<=\n(Decimal('2092'),)",
"literal": null,
"operand": [
2092
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "CO",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue ?AccessibleVolumeNumericalValue .\n FILTER ( ?AccessibleVolumeNumericalValue >= 14 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue ?SpecificOccupiableAreaNumericalValue .\n FILTER ( ?SpecificOccupiableAreaNumericalValue <= 2092 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"CO\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 14 | ontozeolite | What is the tiling information of zeolite framework, whose accessible volume is greater than or equal to 14, and whose specific occupiable area is <= 2092, and which has guest species <span>CO</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "CC1CC(C[N+](C1)(C)C)C",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "C4H12N+",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"CC1CC(C[N+](C1)(C)C)C\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"C4H12N+\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 15 | ontozeolite | For zeolite material, which has guest <span>CC1CC(C[N+](C1)(C)C)C</span> and <span>C4H12N+</span>, and which has framework building elements being Silicon only, what is the tiling information? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasFrameworkDensity/om:hasNumericalValue",
"source": "Framework",
"subkey": "FrameworkDensity",
"target": "FrameworkDensityNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Framework",
"subkey": null,
"target": "BN_0"
},
{
"key": null,
"label": "func",
"source": "FrameworkDensityNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToFractional",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToFractional"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToFractional",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToFractional"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkDensityNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">\n(Decimal('14.40'),)",
"literal": null,
"operand": [
14.4
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "C1CNCCC1CCCC2CCNCC2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToFractional",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToFractional",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToFractional ?TransformationVectorToFractional WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasFrameworkDensity/om:hasNumericalValue ?FrameworkDensityNumericalValue .\n FILTER ( ?FrameworkDensityNumericalValue > 14.40 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"C1CNCCC1CCCC2CCNCC2\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToFractional ?TransformationMatrixToFractional ; ocr:hasTransformationVectorToFractional ?TransformationVectorToFractional ] .\n}"
} | 16 | ontozeolite | What is the transformation from Cartesian to fractional coordinate system of zeolite framework, whose framework density is bigger than 14.40, and which has guest <span>C1CNCCC1CCCC2CCNCC2</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Material",
"subkey": null,
"target": "UnitCell"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Sr46|[Si100Al92O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Material zeo:hasChemicalFormula \"|Sr46|[Si100Al92O384]\" .\n ?Material ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 17 | ontozeolite | What is the unit cell information of zeolite material <span>|Sr46|[Si100Al92O384]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleAreaPerCell",
"target": "AccessibleAreaPerCellNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Framework",
"subkey": null,
"target": "UnitCell"
},
{
"key": null,
"label": "func",
"source": "AccessibleAreaPerCellNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleAreaPerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">\n(Decimal('375'),)",
"literal": null,
"operand": [
375
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "hydrogen sulfide",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerCell/om:hasNumericalValue ?AccessibleAreaPerCellNumericalValue .\n FILTER ( ?AccessibleAreaPerCellNumericalValue > 375 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"hydrogen sulfide\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 18 | ontozeolite | For zeolite framework, whose accessible area per cell is > 375, and which is made up of elements being only Oxygen, and which has guest species <span>hydrogen sulfide</span>, what is the unit cell dimensions? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Sr26.88|[Si136.5Al55.5O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Material zeo:hasChemicalFormula \"|Sr26.88|[Si136.5Al55.5O384]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 19 | ontozeolite | For zeolite material <span>|Sr26.88|[Si136.5Al55.5O384]</span>, what is the building elements? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.CRYSTAL_INFO"
},
"label": "^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Material",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "in\n(Decimal('4807'), Decimal('5876'))",
"literal": null,
"operand": [
4807,
5876
],
"operator": {
"__enum__": "NumOp.INSIDE_RANGE"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material ^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue > 4807 && ?UnitCellVolumeNumericalValue < 5876 )\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n}"
} | 20 | ontozeolite | what are the zeolite material, whose unit cell volume is between (4807, 5876), and which is built by elements being Silicon and Oxygen only? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableVolume",
"target": "OccupiableVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificAccessibleArea",
"target": "SpecificAccessibleAreaNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasAtomicStructure",
"source": "Framework",
"subkey": null,
"target": "AtomicStructure"
},
{
"key": null,
"label": "func",
"source": "OccupiableVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "SpecificAccessibleAreaNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "in\n(Decimal('13'), Decimal('17'))",
"literal": null,
"operand": [
13,
17
],
"operator": {
"__enum__": "NumOp.INSIDE_RANGE"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificAccessibleAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": ">\n(Decimal('1571'),)",
"literal": null,
"operand": [
1571
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "[In+3]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AtomicStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AtomicStructure WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableVolume/om:hasNumericalValue ?OccupiableVolumeNumericalValue .\n FILTER ( ?OccupiableVolumeNumericalValue > 13 && ?OccupiableVolumeNumericalValue < 17 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue ?SpecificAccessibleAreaNumericalValue .\n FILTER ( ?SpecificAccessibleAreaNumericalValue > 1571 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"[In+3]\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasAtomicStructure ?AtomicStructure .\n}"
} | 21 | ontozeolite | For zeolite framework, whose occupiable volume is in the range between (13, 17), and whose specific accessible area is greater than 1571, and which incorporates <span>[In+3]</span>, what is the atomic structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Zn55H16Al7.904O32|[Si104Al88O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Material zeo:hasChemicalFormula \"|Zn55H16Al7.904O32|[Si104Al88O384]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 22 | ontozeolite | What is the framework components of zeolite material <span>|Zn55H16Al7.904O32|[Si104Al88O384]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Silicon\" .\n}"
} | 23 | ontozeolite | what are the zeolite material, which is made up of Silicon? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableVolumePerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableVolumePerCell",
"target": "OccupiableVolumePerCellNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleVolume",
"target": "AccessibleVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.CRYSTAL_INFO"
},
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode",
"source": "Framework",
"subkey": "TiledStructure",
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "OccupiableVolumePerCellNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "AccessibleVolumeNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": null,
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "GuestCompoundLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableVolumePerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">=\n(Decimal('599.57'),)",
"literal": null,
"operand": [
599.57
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": "<=\n(Decimal('6.55'),)",
"literal": null,
"operand": [
6.55
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "t-bal*",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "GuestCompoundLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?GuestCompoundLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableVolumePerCell/om:hasNumericalValue ?OccupiableVolumePerCellNumericalValue .\n FILTER ( ?OccupiableVolumePerCellNumericalValue >= 599.57 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue ?AccessibleVolumeNumericalValue .\n FILTER ( ?AccessibleVolumeNumericalValue <= 6.55 )\n ?Framework ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode \"t-bal*\" .\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label ?GuestCompoundLabel .\n}"
} | 24 | ontozeolite | What is the guest of zeolite framework, whose occupiable volume per cell is not less than 599.57, and whose accessible volume is not greater than 6.55, and whose tile code is <span>t-bal*</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerGram/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableAreaPerGram",
"target": "OccupiableAreaPerGramNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "OccupiableAreaPerGramNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableAreaPerGramNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<=\n(Decimal('832'),)",
"literal": null,
"operand": [
832
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "C8H20N+",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "dipropylamine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerGram/om:hasNumericalValue ?OccupiableAreaPerGramNumericalValue .\n FILTER ( ?OccupiableAreaPerGramNumericalValue <= 832 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"C8H20N+\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"dipropylamine\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 25 | ontozeolite | What is the framework components of zeolite, whose occupiable area per gram is less than or equal to 832, and which has guest <span>C8H20N+</span> and <span>dipropylamine</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Pd9.8Na12.9H34.8|[Si136.1Al55.9O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Material zeo:hasChemicalFormula \"|Pd9.8Na12.9H34.8|[Si136.1Al55.9O384]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 26 | ontozeolite | For zeolite with formulation <span>|Pd9.8Na12.9H34.8|[Si136.1Al55.9O384]</span>, what is the framework components? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Al0.0068(OH)0.0272|[Al0.2724Si.7276O2]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Material zeo:hasChemicalFormula \"|Al0.0068(OH)0.0272|[Al0.2724Si.7276O2]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 27 | ontozeolite | What is the framework building elements of zeolite material <span>|Al0.0068(OH)0.0272|[Al0.2724Si.7276O2]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasTopologicalDensity",
"source": "Framework",
"subkey": null,
"target": "TopologicalDensity"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TopologicalDensity",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TopologicalDensity WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Silicon\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasTopologicalDensity ?TopologicalDensity .\n}"
} | 28 | ontozeolite | What is the topological density of zeolite framework, which is built by Silicon? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificAccessibleArea",
"target": "SpecificAccessibleAreaNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "GuestCompoundLabel"
},
{
"key": null,
"label": "func",
"source": "SpecificAccessibleAreaNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "P",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "O",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificAccessibleAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<\n(Decimal('1877'),)",
"literal": null,
"operand": [
1877
],
"operator": {
"__enum__": "NumOp.LESS_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "GuestCompoundLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?GuestCompoundLabel WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"P\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"O\" .\n ?Material zeo:hasGuestCompound/rdfs:label ?GuestCompoundLabel .\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue ?SpecificAccessibleAreaNumericalValue .\n FILTER ( ?SpecificAccessibleAreaNumericalValue < 1877 )\n}"
} | 29 | ontozeolite | What is the guest compound of zeolite framework, which has framework building elements being only P and O, and whose specific accessible area is smaller than 1877? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Aluminum",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Aluminum\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 30 | ontozeolite | For zeolite material, which is built by elements being Silicon and Aluminum only, what is the tiled structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleVolume",
"target": "AccessibleVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableAreaPerCell",
"target": "OccupiableAreaPerCellNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.CRYSTAL_INFO"
},
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "GuestCompoundLabel"
},
{
"key": null,
"label": "func",
"source": "AccessibleVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "OccupiableAreaPerCellNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_2"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Al",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">\n(Decimal('14'),)",
"literal": null,
"operand": [
14
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableAreaPerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": "<\n(Decimal('413'),)",
"literal": null,
"operand": [
413
],
"operator": {
"__enum__": "NumOp.LESS_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_2",
"iri": null,
"key": null,
"label": ">=\n(Decimal('1857'),)",
"literal": null,
"operand": [
1857
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "GuestCompoundLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?GuestCompoundLabel WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Al\" .\n ?Material zeo:hasGuestCompound/rdfs:label ?GuestCompoundLabel .\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleVolume/om:hasNumericalValue ?AccessibleVolumeNumericalValue .\n FILTER ( ?AccessibleVolumeNumericalValue > 14 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue ?OccupiableAreaPerCellNumericalValue .\n FILTER ( ?OccupiableAreaPerCellNumericalValue < 413 )\n ?Framework ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue >= 1857 )\n}"
} | 31 | ontozeolite | For zeolite framework, which is built by only Al, and whose accessible volume is bigger than 14, and whose occupiable area per cell is smaller than 413, and whose unit cell volume is >= 1857, what is the incorporated species? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificOccupiableArea",
"target": "SpecificOccupiableAreaNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasAtomicStructure",
"source": "Framework",
"subkey": null,
"target": "AtomicStructure"
},
{
"key": null,
"label": "func",
"source": "SpecificOccupiableAreaNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificOccupiableAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "in\n(Decimal('1766'), Decimal('2160'))",
"literal": null,
"operand": [
1766,
2160
],
"operator": {
"__enum__": "NumOp.INSIDE_RANGE"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "hydrogen phosphate",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AtomicStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AtomicStructure WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue ?SpecificOccupiableAreaNumericalValue .\n FILTER ( ?SpecificOccupiableAreaNumericalValue > 1766 && ?SpecificOccupiableAreaNumericalValue < 2160 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"hydrogen phosphate\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasAtomicStructure ?AtomicStructure .\n}"
} | 32 | ontozeolite | For zeolite framework, whose specific occupiable area is inside the interval (1766, 2160), and which incorporates <span>hydrogen phosphate</span>, what is the atomic structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "GuestCompoundLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Aluminum",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "GuestCompoundLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?GuestCompoundLabel WHERE {\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Aluminum\" .\n ?Material zeo:hasGuestCompound/rdfs:label ?GuestCompoundLabel .\n}"
} | 33 | ontozeolite | For zeolite material, which is made up of elements being Aluminum, what is the incorporated species? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleAreaPerCell",
"target": "AccessibleAreaPerCellNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificOccupiableArea",
"target": "SpecificOccupiableAreaNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "AccessibleAreaPerCellNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "SpecificOccupiableAreaNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleAreaPerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<=\n(Decimal('911'),)",
"literal": null,
"operand": [
911
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificOccupiableAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": ">=\n(Decimal('2622'),)",
"literal": null,
"operand": [
2622
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerCell/om:hasNumericalValue ?AccessibleAreaPerCellNumericalValue .\n FILTER ( ?AccessibleAreaPerCellNumericalValue <= 911 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificOccupiableArea/om:hasNumericalValue ?SpecificOccupiableAreaNumericalValue .\n FILTER ( ?SpecificOccupiableAreaNumericalValue >= 2622 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 34 | ontozeolite | What is the framework components of zeolite framework, whose accessible area per cell is <= 911, and whose specific occupiable area is greater than or equal to 2622? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleAreaPerGram",
"target": "AccessibleAreaPerGramNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificAccessibleArea",
"target": "SpecificAccessibleAreaNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableAreaPerCell",
"target": "OccupiableAreaPerCellNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "AccessibleAreaPerGramNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "SpecificAccessibleAreaNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": null,
"label": "func",
"source": "OccupiableAreaPerCellNumericalValue",
"subkey": null,
"target": "Func_2"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleAreaPerGramNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "in\n(Decimal('684'), Decimal('837.034'))",
"literal": null,
"operand": [
684,
837.034
],
"operator": {
"__enum__": "NumOp.INSIDE_RANGE"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificAccessibleAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": "<\n(Decimal('1844'),)",
"literal": null,
"operand": [
1844
],
"operator": {
"__enum__": "NumOp.LESS_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableAreaPerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_2",
"iri": null,
"key": null,
"label": ">=\n(Decimal('234.47'),)",
"literal": null,
"operand": [
234.47
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "InChI=1S/Ba/q+2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram/om:hasNumericalValue ?AccessibleAreaPerGramNumericalValue .\n FILTER ( ?AccessibleAreaPerGramNumericalValue > 684 && ?AccessibleAreaPerGramNumericalValue < 837.034 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue ?SpecificAccessibleAreaNumericalValue .\n FILTER ( ?SpecificAccessibleAreaNumericalValue < 1844 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue ?OccupiableAreaPerCellNumericalValue .\n FILTER ( ?OccupiableAreaPerCellNumericalValue >= 234.47 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/Ba/q+2\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 35 | ontozeolite | For zeolite framework, whose accessible area per gram is between (684, 837.034), and whose specific accessible area is less than 1844, and whose occupiable area per cell is not less than 234.47, and which has guest species <span>InChI=1S/Ba/q+2</span>, what is the framework building elements? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Phosphorus",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "InChI=1S/p+1",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Phosphorus\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/p+1\" .\n}"
} | 36 | ontozeolite | what are the zeolite material, which has framework building elements being only Phosphorus, and which incorporates <span>InChI=1S/p+1</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Material",
"subkey": null,
"target": "BN_0"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToCartesian"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToCartesian"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3/p+1",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Aluminum",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToCartesian ?TransformationVectorToCartesian WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3/p+1\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Aluminum\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Oxygen\" .\n ?Material ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToCartesian ?TransformationMatrixToCartesian ; ocr:hasTransformationVectorToCartesian ?TransformationVectorToCartesian ] .\n}"
} | 37 | ontozeolite | For zeolite material, which has guest species <span>InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3/p+1</span>, and which is built by elements being Aluminum and Oxygen, what is the transformation from fractional to Cartesian coordinate system? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.CRYSTAL_INFO"
},
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableVolume",
"source": "Framework",
"subkey": null,
"target": "OccupiableVolume"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "C10H24N4",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">=\n(Decimal('3294'),)",
"literal": null,
"operand": [
3294
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableVolume",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?OccupiableVolume WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"C10H24N4\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue >= 3294 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableVolume ?OccupiableVolume .\n}"
} | 38 | ontozeolite | For zeolite framework, which has guest <span>C10H24N4</span>, and whose unit cell volume is >= 3294, what is the occupiable volume? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "O",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Si",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"O\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Si\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 39 | ontozeolite | What is the tiled structure of zeolite material, which is made up of O and Si only? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerGram/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableAreaPerGram",
"target": "OccupiableAreaPerGramNumericalValue"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasAtomicStructure",
"source": "Framework",
"subkey": null,
"target": "AtomicStructure"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "func",
"source": "OccupiableAreaPerGramNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Cobalt",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Zinc",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableAreaPerGramNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<=\n(Decimal('1082.03'),)",
"literal": null,
"operand": [
1082.03
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AtomicStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AtomicStructure WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Cobalt\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Zinc\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerGram/om:hasNumericalValue ?OccupiableAreaPerGramNumericalValue .\n FILTER ( ?OccupiableAreaPerGramNumericalValue <= 1082.03 )\n ?Framework ocr:hasCrystalInformation/ocr:hasAtomicStructure ?AtomicStructure .\n}"
} | 40 | ontozeolite | What is the atomic structure of zeolite framework, which has framework building elements being Cobalt and Zinc, and whose occupiable area per gram is not greater than 1082.03? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Sr26.56|[Si136.5Al55.5O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Material zeo:hasChemicalFormula \"|Sr26.56|[Si136.5Al55.5O384]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 41 | ontozeolite | For zeolite material with formulation <span>|Sr26.56|[Si136.5Al55.5O384]</span>, what is the framework building elements? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableAreaPerCell",
"target": "OccupiableAreaPerCellNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificAccessibleArea",
"target": "SpecificAccessibleAreaNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "OccupiableAreaPerCellNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "SpecificAccessibleAreaNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "GuestCompoundLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableAreaPerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<\n(Decimal('157'),)",
"literal": null,
"operand": [
157
],
"operator": {
"__enum__": "NumOp.LESS_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificAccessibleAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": "in\n(Decimal('1874.169'), Decimal('2291'))",
"literal": null,
"operand": [
1874.169,
2291
],
"operator": {
"__enum__": "NumOp.INSIDE_RANGE"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Phosphorus",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "GuestCompoundLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?GuestCompoundLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue ?OccupiableAreaPerCellNumericalValue .\n FILTER ( ?OccupiableAreaPerCellNumericalValue < 157 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue ?SpecificAccessibleAreaNumericalValue .\n FILTER ( ?SpecificAccessibleAreaNumericalValue > 1874.169 && ?SpecificAccessibleAreaNumericalValue < 2291 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Phosphorus\" .\n ?Material zeo:hasGuestCompound/rdfs:label ?GuestCompoundLabel .\n}"
} | 42 | ontozeolite | What is the guest compound of zeolite, whose occupiable area per cell is smaller than 157, and whose specific accessible area is inside the interval (1874.169, 2291), and which has framework components being Phosphorus? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "CCCCCC[N+]12CCC(CC1)CC2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "InChI=1S/C15H22N/c1-12-6-5-7-13(2)16(12)10-14-8-3-4-9-15(14)11-16/h3-4,8-9,12-13H,5-7,10-11H2,1-2H3/q+1",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"CCCCCC[N+]12CCC(CC1)CC2\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/C15H22N/c1-12-6-5-7-13(2)16(12)10-14-8-3-4-9-15(14)11-16/h3-4,8-9,12-13H,5-7,10-11H2,1-2H3/q+1\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 43 | ontozeolite | For zeolite, which incorporates <span>CCCCCC[N+]12CCC(CC1)CC2</span> and <span>InChI=1S/C15H22N/c1-12-6-5-7-13(2)16(12)10-14-8-3-4-9-15(14)11-16/h3-4,8-9,12-13H,5-7,10-11H2,1-2H3/q+1</span>, what is the tiled structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Material",
"subkey": null,
"target": "UnitCell"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n ?Material ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 44 | ontozeolite | What is the unit cell information of zeolite material, which has building elements being only Oxygen? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.CRYSTAL_INFO"
},
"label": "^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Material",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">=\n(Decimal('5362.86'),)",
"literal": null,
"operand": [
5362.86
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material ^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue >= 5362.86 )\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H\" .\n}"
} | 45 | ontozeolite | what are the zeolite material, whose unit cell volume is greater than or equal to 5362.86, and which has framework building elements being only Silicon and Oxygen, and which incorporates <span>InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.CRYSTAL_INFO"
},
"label": "^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode",
"source": "Material",
"subkey": "TiledStructure",
"target": "Literal_3"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Aluminum",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "N-methylbutan-1-amine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_3",
"iri": null,
"key": null,
"label": "t-hpr",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Aluminum\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Silicon\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"N-methylbutan-1-amine\" .\n ?Material ^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasTiledStructure/ocr:hasTile/ocr:hasTileCode \"t-hpr\" .\n}"
} | 46 | ontozeolite | what are the zeolite material, which is made up of Aluminum and Silicon, and which has guest species <span>N-methylbutan-1-amine</span>, and whose tile code is <span>t-hpr</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasCompositeBU",
"source": "Framework",
"subkey": null,
"target": "CompositeBU"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_3"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "InChI=1S/CCl3F/c2-1(3,4)5",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "InChI=1S/C5H14N/c1-5-6(2,3)4/h5H2,1-4H3/q+1",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_3",
"iri": null,
"key": null,
"label": "Al",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "CompositeBU",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?CompositeBU WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/CCl3F/c2-1(3,4)5\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/C5H14N/c1-5-6(2,3)4/h5H2,1-4H3/q+1\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Al\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasCompositeBU ?CompositeBU .\n}"
} | 47 | ontozeolite | For zeolite framework, which has guest <span>InChI=1S/CCl3F/c2-1(3,4)5</span> and <span>InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3</span> and <span>InChI=1S/C5H14N/c1-5-6(2,3)4/h5H2,1-4H3/q+1</span>, and which is made up of Al only, what is the composite building block? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Phosphorus",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Phosphorus\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 48 | ontozeolite | For zeolite material, which has framework building elements being Phosphorus and Silicon only, what is the tiling information? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|K66.56Na21.66(H2O)7.137|[Al88Si104O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasChemicalFormula \"|K66.56Na21.66(H2O)7.137|[Al88Si104O384]\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 49 | ontozeolite | For zeolite material <span>|K66.56Na21.66(H2O)7.137|[Al88Si104O384]</span>, what is the tiling information? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "O",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"O\" .\n}"
} | 50 | ontozeolite | what are the zeolite material, which is made up of only O? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "C2H7N",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "C(C[NH3+])[NH3+]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"C2H7N\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"C(C[NH3+])[NH3+]\" .\n}"
} | 51 | ontozeolite | what are the zeolite material, which incorporates <span>C2H7N</span> and <span>C(C[NH3+])[NH3+]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Material",
"subkey": null,
"target": "UnitCell"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Ca.6Na2.6K2.25(H2O)12|[Al6Si10O32]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Material zeo:hasChemicalFormula \"|Ca.6Na2.6K2.25(H2O)12|[Al6Si10O32]\" .\n ?Material ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 52 | ontozeolite | What is the unit cell of zeolite with formulation <span>|Ca.6Na2.6K2.25(H2O)12|[Al6Si10O32]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.CRYSTAL_INFO"
},
"label": "^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Material",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">\n(Decimal('4826'),)",
"literal": null,
"operand": [
4826
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material ^zeo:hasZeoliticMaterial?/ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue > 4826 )\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n}"
} | 53 | ontozeolite | what are the zeolite material, whose unit cell volume is > 4826, and which is built by elements being Oxygen only? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasAtomicStructure",
"source": "Material",
"subkey": null,
"target": "AtomicStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "[Si36O72]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AtomicStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AtomicStructure WHERE {\n ?Material zeo:hasChemicalFormula \"[Si36O72]\" .\n ?Material ocr:hasCrystalInformation/ocr:hasAtomicStructure ?AtomicStructure .\n}"
} | 54 | ontozeolite | For zeolite material with formulation <span>[Si36O72]</span>, what is the atomic structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Material",
"subkey": null,
"target": "UnitCell"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|K34.9|[Al34.9Si157.1O390.8]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Material zeo:hasChemicalFormula \"|K34.9|[Al34.9Si157.1O390.8]\" .\n ?Material ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 55 | ontozeolite | What is the unit cell of zeolite material with formulation <span>|K34.9|[Al34.9Si157.1O390.8]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasFrameworkDensity/om:hasNumericalValue",
"source": "Framework",
"subkey": "FrameworkDensity",
"target": "FrameworkDensityNumericalValue"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Framework",
"subkey": null,
"target": "BN_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.MATERIALS"
},
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "func",
"source": "FrameworkDensityNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToCartesian"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToCartesian"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "selenium(2-)",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "[Si192O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "B",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkDensityNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "=\n(Decimal('18.4'),)",
"literal": null,
"operand": [
18.4
],
"operator": {
"__enum__": "NumOp.EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToCartesian ?TransformationVectorToCartesian WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"selenium(2-)\" .\n ?Material zeo:hasChemicalFormula \"[Si192O384]\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"B\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasFrameworkDensity/om:hasNumericalValue ?FrameworkDensityNumericalValue .\n FILTER ( ?FrameworkDensityNumericalValue = 18.4 )\n ?Framework ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToCartesian ?TransformationMatrixToCartesian ; ocr:hasTransformationVectorToCartesian ?TransformationVectorToCartesian ] .\n}"
} | 56 | ontozeolite | For zeolite framework, which has guest species <span>selenium(2-)</span>, and corresponding to zeolite <span>[Si192O384]</span>, and which is made up of elements being B only, and whose framework density is equal to 18.4, what is the transformation from fractional to Cartesian coordinate system? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleAreaPerGram",
"target": "AccessibleAreaPerGramNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "AccessibleAreaPerGramNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleAreaPerGramNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "=\n(Decimal('671.09'),)",
"literal": null,
"operand": [
671.09
],
"operator": {
"__enum__": "NumOp.EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "N',N'-bis(2-azanylethyl)ethane-1,2-diamine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerGram/om:hasNumericalValue ?AccessibleAreaPerGramNumericalValue .\n FILTER ( ?AccessibleAreaPerGramNumericalValue = 671.09 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"N',N'-bis(2-azanylethyl)ethane-1,2-diamine\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 57 | ontozeolite | What is the framework building elements of zeolite framework, whose accessible area per gram is equal to 671.09, and which incorporates <span>N',N'-bis(2-azanylethyl)ethane-1,2-diamine</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "InChI=1S/Mg/q+2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Material WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/Mg/q+2\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n}"
} | 58 | ontozeolite | what are the zeolite material, which incorporates <span>InChI=1S/Mg/q+2</span>, and which is made up of Oxygen only? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasDensity/om:hasNumericalValue",
"source": "Framework",
"subkey": "Density",
"target": "DensityNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.CRYSTAL_INFO"
},
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue",
"source": "Framework",
"subkey": "UnitCell",
"target": "UnitCellVolumeNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "DensityNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "UnitCellVolumeNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.MATERIALS"
},
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "DensityNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<\n(Decimal('1.843963'),)",
"literal": null,
"operand": [
1.843963
],
"operator": {
"__enum__": "NumOp.LESS_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCellVolumeNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": "<=\n(Decimal('1414.4492'),)",
"literal": null,
"operand": [
1414.4492
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Na9.4(H2O)37.56|[Al9.4Si26.6O72]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "InChI=1S/Ni/q+2",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasDensity/om:hasNumericalValue ?DensityNumericalValue .\n FILTER ( ?DensityNumericalValue < 1.843963 )\n ?Framework ocr:hasCrystalInformation/ocr:hasUnitCell/ocr:hasUnitCellVolume/om:hasNumericalValue ?UnitCellVolumeNumericalValue .\n FILTER ( ?UnitCellVolumeNumericalValue <= 1414.4492 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasChemicalFormula \"|Na9.4(H2O)37.56|[Al9.4Si26.6O72]\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/Ni/q+2\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 59 | ontozeolite | What is the framework building elements of zeolite framework, whose density is < 1.843963, and whose unit cell volume is not greater than 1414.4492, and corresponding to zeolitic material formula <span>|Na9.4(H2O)37.56|[Al9.4Si26.6O72]</span>, and which has guest species <span>InChI=1S/Ni/q+2</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "1,4,8,11-tetrazacyclotetradecane",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "C(C[NH3+])[NH3+]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Framework WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"1,4,8,11-tetrazacyclotetradecane\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"C(C[NH3+])[NH3+]\" .\n}"
} | 60 | ontozeolite | what are the zeolite, which has guest <span>1,4,8,11-tetrazacyclotetradecane</span> and <span>C(C[NH3+])[NH3+]</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "1-adamantylamine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "C1CCC(C1)[N+]23CCN(CC2)CC3",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"1-adamantylamine\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"C1CCC(C1)[N+]23CCN(CC2)CC3\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 61 | ontozeolite | What is the building elements of zeolite material, which incorporates <span>1-adamantylamine</span> and <span>C1CCC(C1)[N+]23CCN(CC2)CC3</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasTopologicalDensity",
"source": "Framework",
"subkey": null,
"target": "TopologicalDensity"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "ethyl(trimethyl)azanium",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "O",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "P",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TopologicalDensity",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TopologicalDensity WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"ethyl(trimethyl)azanium\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"O\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"P\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasTopologicalDensity ?TopologicalDensity .\n}"
} | 62 | ontozeolite | For zeolite framework, which has guest species <span>ethyl(trimethyl)azanium</span>, and which is built by O and P, what is the topological density? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK"
},
"label": "^zeo:hasZeoliticMaterial/zeo:hasFrameworkCode",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "GuestCompoundLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "CGF",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Gallium",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "GuestCompoundLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?GuestCompoundLabel WHERE {\n ?Material ^zeo:hasZeoliticMaterial/zeo:hasFrameworkCode \"CGF\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Gallium\" .\n ?Material zeo:hasGuestCompound/rdfs:label ?GuestCompoundLabel .\n}"
} | 63 | ontozeolite | What is the guest compound of zeolite material, whose framework is <span>CGF</span>, and which is made up of only Gallium? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.MATERIALS"
},
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Gallium",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "|Na0.45Ca0.225H0.3|[Al1.2Si2.8O8]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "C12H24O6",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
}
]
},
"sparql": "SELECT ?Framework WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Gallium\" .\n ?Material zeo:hasChemicalFormula \"|Na0.45Ca0.225H0.3|[Al1.2Si2.8O8]\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"C12H24O6\" .\n}"
} | 64 | ontozeolite | what are the zeolite, which has framework components being Gallium, and corresponding to material <span>|Na0.45Ca0.225H0.3|[Al1.2Si2.8O8]</span>, and which has guest species <span>C12H24O6</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasTAtom",
"source": "Framework",
"subkey": null,
"target": "TAtom"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "gadolinium(3+)",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TAtom",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TAtom WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"gadolinium(3+)\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasTAtom ?TAtom .\n}"
} | 65 | ontozeolite | For zeolite framework, which has guest <span>gadolinium(3+)</span>, what is the T atom? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleAreaPerCell",
"target": "AccessibleAreaPerCellNumericalValue"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Framework",
"subkey": null,
"target": "BN_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "func",
"source": "AccessibleAreaPerCellNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToCartesian"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToCartesian"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Al",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleAreaPerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<\n(Decimal('178'),)",
"literal": null,
"operand": [
178
],
"operator": {
"__enum__": "NumOp.LESS_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToCartesian ?TransformationVectorToCartesian WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Al\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleAreaPerCell/om:hasNumericalValue ?AccessibleAreaPerCellNumericalValue .\n FILTER ( ?AccessibleAreaPerCellNumericalValue < 178 )\n ?Framework ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToCartesian ?TransformationMatrixToCartesian ; ocr:hasTransformationVectorToCartesian ?TransformationVectorToCartesian ] .\n}"
} | 66 | ontozeolite | For zeolite framework, which has framework building elements being Al, and whose accessible area per cell is smaller than 178, what is the transformation from fractional to Cartesian coordinate system? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "FrameworkComponentLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Sr26.24|[Si136.5Al55.5O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkComponentLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?FrameworkComponentLabel WHERE {\n ?Material zeo:hasChemicalFormula \"|Sr26.24|[Si136.5Al55.5O384]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label ?FrameworkComponentLabel .\n}"
} | 67 | ontozeolite | For zeolite material <span>|Sr26.24|[Si136.5Al55.5O384]</span>, what is the framework building elements? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|Na77K19(H2O)396.9|[Al96Si96O384]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasChemicalFormula \"|Na77K19(H2O)396.9|[Al96Si96O384]\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 68 | ontozeolite | For zeolite material <span>|Na77K19(H2O)396.9|[Al96Si96O384]</span>, what is the tiled structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasAtomicStructure",
"source": "Material",
"subkey": null,
"target": "AtomicStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "C10H17N",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "InChI=1S/C14H26N/c1-13(2)8-12-9-14(3,10-13)11-15(12)6-4-5-7-15/h12H,4-11H2,1-3H3/q+1",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AtomicStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AtomicStructure WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"C10H17N\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"InChI=1S/C14H26N/c1-13(2)8-12-9-14(3,10-13)11-15(12)6-4-5-7-15/h12H,4-11H2,1-3H3/q+1\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Oxygen\" .\n ?Material ocr:hasCrystalInformation/ocr:hasAtomicStructure ?AtomicStructure .\n}"
} | 69 | ontozeolite | For zeolite material, which has guest <span>C10H17N</span> and <span>InChI=1S/C14H26N/c1-13(2)8-12-9-14(3,10-13)11-15(12)6-4-5-7-15/h12H,4-11H2,1-3H3/q+1</span>, and which has building elements being Oxygen, what is the atomic structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Material",
"subkey": null,
"target": "BN_0"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToCartesian"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToCartesian",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToCartesian"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "aluminum(3+)",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "O",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Si",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToCartesian",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToCartesian ?TransformationVectorToCartesian WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"aluminum(3+)\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"O\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Si\" .\n ?Material ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToCartesian ?TransformationMatrixToCartesian ; ocr:hasTransformationVectorToCartesian ?TransformationVectorToCartesian ] .\n}"
} | 70 | ontozeolite | For zeolite material, which incorporates <span>aluminum(3+)</span>, and which is made up of O and Si only, what is the transformation from fractional to Cartesian coordinate system? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK"
},
"label": "^zeo:hasZeoliticMaterial/zeo:hasFrameworkCode",
"source": "Material",
"subkey": null,
"target": "Literal_3"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasUnitCell",
"source": "Material",
"subkey": null,
"target": "UnitCell"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "cyclohexane-1,2-diamine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "N-isopropylpropan-2-amine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_3",
"iri": null,
"key": null,
"label": "EON",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "UnitCell",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?UnitCell WHERE {\n ?Material zeo:hasGuestCompound/rdfs:label \"cyclohexane-1,2-diamine\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"N-isopropylpropan-2-amine\" .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Silicon\" .\n ?Material ^zeo:hasZeoliticMaterial/zeo:hasFrameworkCode \"EON\" .\n ?Material ocr:hasCrystalInformation/ocr:hasUnitCell ?UnitCell .\n}"
} | 71 | ontozeolite | For zeolite material, which incorporates <span>cyclohexane-1,2-diamine</span> and <span>N-isopropylpropan-2-amine</span>, and which is made up of Silicon only, and whose framework is <span>EON</span>, what is the unit cell? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleVolumePerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleVolumePerCell",
"target": "AccessibleVolumePerCellNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasCoordinateTransformation",
"source": "Framework",
"subkey": null,
"target": "BN_0"
},
{
"key": null,
"label": "func",
"source": "AccessibleVolumePerCellNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponentOnly/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "ocr:hasTransformationMatrixToFractional",
"source": "BN_0",
"subkey": null,
"target": "TransformationMatrixToFractional"
},
{
"key": null,
"label": "ocr:hasTransformationVectorToFractional",
"source": "BN_0",
"subkey": null,
"target": "TransformationVectorToFractional"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleVolumePerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": ">\n(Decimal('94'),)",
"literal": null,
"operand": [
94
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "hydrogen sulfide",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationMatrixToFractional",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TransformationVectorToFractional",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": true,
"func": null,
"id": "BN_0",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TransformationMatrixToFractional ?TransformationVectorToFractional WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleVolumePerCell/om:hasNumericalValue ?AccessibleVolumePerCellNumericalValue .\n FILTER ( ?AccessibleVolumePerCellNumericalValue > 94 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponentOnly/rdfs:label \"Oxygen\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"hydrogen sulfide\" .\n ?Framework ocr:hasCrystalInformation/ocr:hasCoordinateTransformation [ ocr:hasTransformationMatrixToFractional ?TransformationMatrixToFractional ; ocr:hasTransformationVectorToFractional ?TransformationVectorToFractional ] .\n}"
} | 72 | ontozeolite | What is the transformation from Cartesian to fractional coordinate system of zeolite framework, whose accessible volume per cell is higher than 94, and which is built by elements being only Oxygen, and which incorporates <span>hydrogen sulfide</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasFrameworkDensity/om:hasNumericalValue",
"source": "Framework",
"subkey": "FrameworkDensity",
"target": "FrameworkDensityNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue",
"source": "Framework",
"subkey": "SpecificAccessibleArea",
"target": "SpecificAccessibleAreaNumericalValue"
},
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "func",
"source": "FrameworkDensityNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "SpecificAccessibleAreaNumericalValue",
"subkey": null,
"target": "Func_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": null,
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "GuestCompoundLabel"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "FrameworkDensityNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "<=\n(Decimal('20.7'),)",
"literal": null,
"operand": [
20.7
],
"operator": {
"__enum__": "NumOp.LESS_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SpecificAccessibleAreaNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": ">=\n(Decimal('1727'),)",
"literal": null,
"operand": [
1727
],
"operator": {
"__enum__": "NumOp.GREATER_THAN_EQUAL"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Silicon",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "GuestCompoundLabel",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?GuestCompoundLabel WHERE {\n ?Framework zeo:hasTopologicalProperties/zeo:hasFrameworkDensity/om:hasNumericalValue ?FrameworkDensityNumericalValue .\n FILTER ( ?FrameworkDensityNumericalValue <= 20.7 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasSpecificAccessibleArea/om:hasNumericalValue ?SpecificAccessibleAreaNumericalValue .\n FILTER ( ?SpecificAccessibleAreaNumericalValue >= 1727 )\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Silicon\" .\n ?Material zeo:hasGuestCompound/rdfs:label ?GuestCompoundLabel .\n}"
} | 73 | ontozeolite | For zeolite framework, whose framework density is <= 20.7, and whose specific accessible area is >= 1727, and which has framework components being Silicon, what is the guest species? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": null,
"label": "zeo:hasTopologicalProperties/zeo:hasSecondaryBU",
"source": "Framework",
"subkey": null,
"target": "SecondaryBU"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "C3H8",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "SecondaryBU",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?SecondaryBU WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasGuestCompound/rdfs:label \"C3H8\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasSecondaryBU ?SecondaryBU .\n}"
} | 74 | ontozeolite | What is the secondary building block of zeolite framework, which has guest <span>C3H8</span>? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": null,
"label": "zeo:hasZeoliticMaterial",
"source": "Framework",
"subkey": null,
"target": "Material"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "OccupiableAreaPerCell",
"target": "OccupiableAreaPerCellNumericalValue"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.TOPO_ATTR"
},
"label": "zeo:hasTopologicalProperties/zeo:hasAccessibleVolumePerCell/om:hasNumericalValue",
"source": "Framework",
"subkey": "AccessibleVolumePerCell",
"target": "AccessibleVolumePerCellNumericalValue"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasAtomicStructure",
"source": "Framework",
"subkey": null,
"target": "AtomicStructure"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.MATERIALS"
},
"label": "zeo:hasChemicalFormula",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": {
"__enum__": "OZFrameworkAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_2"
},
{
"key": null,
"label": "func",
"source": "OccupiableAreaPerCellNumericalValue",
"subkey": null,
"target": "Func_0"
},
{
"key": null,
"label": "func",
"source": "AccessibleVolumePerCellNumericalValue",
"subkey": null,
"target": "Func_1"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Framework",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "|K34.9|[Al34.9Si157.1O390.8]",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "OccupiableAreaPerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_0",
"iri": null,
"key": null,
"label": "in\n(Decimal('436'), Decimal('534'))",
"literal": null,
"operand": [
436,
534
],
"operator": {
"__enum__": "NumOp.INSIDE_RANGE"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AccessibleVolumePerCellNumericalValue",
"iri": null,
"key": null,
"label": null,
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": true,
"id": "Func_1",
"iri": null,
"key": null,
"label": ">\n(Decimal('130.194'),)",
"literal": null,
"operand": [
130.194
],
"operator": {
"__enum__": "NumOp.GREATER_THAN"
},
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "Gallium",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_2",
"iri": null,
"key": null,
"label": "fluorane",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "AtomicStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?AtomicStructure WHERE {\n ?Framework zeo:hasZeoliticMaterial ?Material .\n ?Material zeo:hasChemicalFormula \"|K34.9|[Al34.9Si157.1O390.8]\" .\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Gallium\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"fluorane\" .\n ?Framework zeo:hasTopologicalProperties/zeo:hasOccupiableAreaPerCell/om:hasNumericalValue ?OccupiableAreaPerCellNumericalValue .\n FILTER ( ?OccupiableAreaPerCellNumericalValue > 436 && ?OccupiableAreaPerCellNumericalValue < 534 )\n ?Framework zeo:hasTopologicalProperties/zeo:hasAccessibleVolumePerCell/om:hasNumericalValue ?AccessibleVolumePerCellNumericalValue .\n FILTER ( ?AccessibleVolumePerCellNumericalValue > 130.194 )\n ?Framework ocr:hasCrystalInformation/ocr:hasAtomicStructure ?AtomicStructure .\n}"
} | 75 | ontozeolite | For zeolite framework, corresponding to material formula <span>|K34.9|[Al34.9Si157.1O390.8]</span>, and whose occupiable area per cell is in the range between (436, 534), and whose accessible volume per cell is > 130.194, and which has framework building elements being Gallium, and which has guest species <span>fluorane</span>, what is the atomic structure? |
{
"graph": {
"directed": true,
"graph": {},
"links": [
{
"key": {
"__enum__": "OZMaterialAttrKey.FRAMEWORK_COMPONENTS"
},
"label": "zeo:hasFrameworkComponent/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_0"
},
{
"key": {
"__enum__": "OZMaterialAttrKey.GUEST_SPECIES"
},
"label": "zeo:hasGuestCompound/rdfs:label",
"source": "Material",
"subkey": null,
"target": "Literal_1"
},
{
"key": null,
"label": "ocr:hasCrystalInformation/ocr:hasTiledStructure",
"source": "Material",
"subkey": null,
"target": "TiledStructure"
}
],
"multigraph": false,
"nodes": [
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Material",
"iri": "placeholder",
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": null,
"template_node": null,
"topic_entity": true
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_0",
"iri": null,
"key": null,
"label": "Oxygen",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "Literal_1",
"iri": null,
"key": null,
"label": "N',N'-bis(2-aminoethyl)ethane-1,2-diamine",
"literal": true,
"operand": null,
"operator": null,
"question_node": null,
"template_node": true,
"topic_entity": null
},
{
"agg": null,
"blank_node": null,
"func": null,
"id": "TiledStructure",
"iri": null,
"key": null,
"label": null,
"literal": null,
"operand": null,
"operator": null,
"question_node": true,
"template_node": null,
"topic_entity": null
}
]
},
"sparql": "SELECT ?TiledStructure WHERE {\n ?Material zeo:hasFrameworkComponent/rdfs:label \"Oxygen\" .\n ?Material zeo:hasGuestCompound/rdfs:label \"N',N'-bis(2-aminoethyl)ethane-1,2-diamine\" .\n ?Material ocr:hasCrystalInformation/ocr:hasTiledStructure ?TiledStructure .\n}"
} | 76 | ontozeolite | What is the tiled structure of zeolite, which is made up of Oxygen, and which has guest species <span>N',N'-bis(2-aminoethyl)ethane-1,2-diamine</span>? |
End of preview.
No dataset card yet
New: Create and edit this dataset card directly on the website!
Contribute a Dataset Card- Downloads last month
- 0