File size: 1,086 Bytes
80d7c0c 6b4b199 6663bcb 756af86 cb2a590 756af86 |
1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 |
---
license: bigscience-openrail-m
widget:
- text: O=C([C@@H](c1ccc(cc1)O)N)[MASK][C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C
datasets:
- ChEMBL
pipeline_tag: fill-mask
---
# BERT base for SMILES
This is bidirectional transformer pretrained on SMILES (simplified molecular-input line-entry system) strings.
Example: Amoxicillin
```
O=C([C@@H](c1ccc(cc1)O)N)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C
```
Two training objectives were used:
1. masked language modeling
2. molecular-formula validity prediction
## Intended uses
This model is primarily aimed at being fine-tuned on the following tasks:
- molecule classification
- molecule-to-gene-expression mapping
- cell targeting
## How to use in your code
```python
from transformers import BertTokenizerFast, BertModel
checkpoint = 'unikei/bert-base-smiles'
tokenizer = BertTokenizerFast.from_pretrained(checkpoint)
model = BertModel.from_pretrained(checkpoint)
example = 'O=C([C@@H](c1ccc(cc1)O)N)N[C@@H]1C(=O)N2[C@@H]1SC([C@@H]2C(=O)O)(C)C'
tokens = tokenizer(example, return_tensors='pt')
predictions = model(**tokens)
```
|