c/p error fixed

mammal_demo/dti_task.py

@@ -15,7 +15,7 @@ class DtiTask(MammalTask):
             "drug_seq": "CC(=O)NCCC1=CNc2c1cc(OC)cc2",
         }
         self.markup_text = """
-# Mammal based Target-Drug binding affinity demonstration
+# Mammal based Drug-Target binding affinity demonstration
 
 Given a protein sequence and a drug (in SMILES), estimate the binding affinity.
 """
@@ -101,7 +101,7 @@ Given a protein sequence and a drug (in SMILES), estimate the binding affinity.
                 )
             with gr.Row():
                 run_mammal = gr.Button(
-                    "Run Mammal prompt for Protein-Protein Interaction",
+                    "Run Mammal prompt for drug-target binding affinity",
                     variant="primary",
                 )
             with gr.Row():