Spaces:
Sleeping
Sleeping
| import sys | |
| import os | |
| from pathlib import Path | |
| # Add project root to path | |
| sys.path.append(str(Path(__file__).parent.parent)) | |
| from bioflow.core import ( | |
| BioFlowOrchestrator, | |
| ToolRegistry, | |
| WorkflowConfig, | |
| Modality, | |
| BioEncoder, | |
| BioPredictor, | |
| BioRetriever, | |
| EmbeddingResult, | |
| PredictionResult, | |
| RetrievalResult | |
| ) | |
| # 1. Create Mock Tools for Verification | |
| class MockEncoder(BioEncoder): | |
| def encode(self, content, modality): | |
| print(f" [Mock] Encoding {modality.value}: {content[:20]}...") | |
| return EmbeddingResult(vector=[0.1]*768, modality=modality, dimension=768) | |
| def dimension(self): return 768 | |
| class MockPredictor(BioPredictor): | |
| def predict(self, drug, target): | |
| print(f" [Mock] Predicting interaction for drug candidate...") | |
| return PredictionResult(score=0.85, confidence=0.9) | |
| class MockRetriever(BioRetriever): | |
| def search(self, query, limit=10, filters=None, **kwargs): | |
| print(f" [Mock] Searching Vector DB for neighbors...") | |
| return [RetrievalResult(id="mol_1", score=0.95, content="CCO", modality=Modality.SMILES)] | |
| def ingest(self, content, modality, payload=None): return "1" | |
| # 2. Setup Registry | |
| print("--- π οΈ Step 1: Tool Registry Setup ---") | |
| ToolRegistry.register_encoder("obm", MockEncoder()) | |
| ToolRegistry.register_predictor("deeppurpose", MockPredictor()) | |
| print(ToolRegistry.summary()) | |
| print() | |
| # 3. Load and Visualize Workflow | |
| print("--- πΊοΈ Step 2: Workflow DAG Resolution ---") | |
| workflow_path = Path("bioflow/workflows/drug_discovery.yaml") | |
| import yaml | |
| with open(workflow_path, 'r') as f: | |
| config_dict = yaml.safe_load(f) | |
| orchestrator = BioFlowOrchestrator() | |
| orchestrator.set_retriever(MockRetriever()) # Configured the retriever | |
| config = WorkflowConfig.from_dict(config_dict) | |
| orchestrator.register_workflow(config) | |
| # Show topological order | |
| order = orchestrator._build_execution_order(config) | |
| print(f"Workflow: {config.name}") | |
| print("Execution Sequence (Topological Sort):") | |
| for i, node in enumerate(order): | |
| deps = f" (depends on: {', '.join(node.inputs)})" if node.inputs else "" | |
| print(f" {i+1}. [{node.id}] Type: {node.type.value}{deps}") | |
| print() | |
| # 4. Perform Dry Run | |
| print("--- π Step 3: Pipeline Execution Dry Run ---") | |
| input_smiles = "CN1C=NC2=C1C(=O)N(C(=O)N2C)C" # Caffeine | |
| result = orchestrator.run("drug_discovery_basic", input_smiles) | |
| print("\n--- π Final Report ---") | |
| if result.success: | |
| print(f"Status: β SUCCESS") | |
| print(f"Final Output Score: {result.output[0].score if isinstance(result.output, list) else result.output.score}") | |
| print(f"Duration: {result.duration_ms:.2f} ms") | |
| else: | |
| print(f"Status: β FAILED") | |
| print(f"Errors: {result.context.errors}") | |