Spaces:
Build error
Build error
import gradio as gr | |
def update(smiles): | |
x = ( | |
"""<!DOCTYPE html> | |
<html> | |
<head> | |
<meta charset="utf-8"> | |
<meta name="viewport" content="width=device-width, initial-scale=1"> | |
</head> | |
<body> | |
<img data-smiles="OC(C(=O)O[C@H]1C[N+]2(CCCOC3=CC=CC=C3)CCC1CC2)(C1=CC=CS1)C1=CC=CS1" | |
data-smiles-options="{ 'width': 800, 'height': 800 }" /> | |
<script type="text/javascript" src="https://unpkg.com/smiles-drawer@2.0.1/dist/smiles-drawer.min.js"></script> | |
<script> | |
SmiDrawer.apply(); | |
</script> | |
</body> | |
</html> | |
""" | |
) | |
return f"""<iframe style="width: 800px; height: 800px" name="result" allow="midi; geolocation; microphone; camera; | |
display-capture; encrypted-media;" sandbox="allow-modals allow-forms | |
allow-scripts allow-same-origin allow-popups | |
allow-top-navigation-by-user-activation allow-downloads" allowfullscreen="" | |
allowpaymentrequest="" frameborder="0" srcdoc='{x}'></iframe>""" | |
with gr.Blocks() as demo: | |
gr.Markdown("# Smiles viewer") | |
with gr.Row(): | |
inp = gr.Textbox(label="SMILES string", placeholder="CCCC") | |
out = gr.HTML() | |
btn = gr.Button("Run") | |
btn.click(fn=update, inputs=inp, outputs=out) | |
demo.launch() |