Spaces:
Running
Running
Gilmullin Almaz
Refactor error handling in setup_planning_options to raise specific exceptions and improve clarity in SMILES parsing and resource loading.
43616cc
| import base64 | |
| import pickle | |
| import re | |
| import uuid | |
| import io | |
| import zipfile | |
| import pandas as pd | |
| import streamlit as st | |
| from CGRtools.files import SMILESRead | |
| from streamlit_ketcher import st_ketcher | |
| from huggingface_hub import hf_hub_download | |
| from huggingface_hub.utils import disable_progress_bars | |
| from synplan.mcts.expansion import PolicyNetworkFunction | |
| from synplan.mcts.search import extract_tree_stats | |
| from synplan.mcts.tree import Tree | |
| from synplan.chem.utils import mol_from_smiles | |
| from synplan.chem.reaction_routes.route_cgr import * | |
| from synplan.chem.reaction_routes.clustering import * | |
| from synplan.utils.visualisation import ( | |
| routes_clustering_report, | |
| routes_subclustering_report, | |
| generate_results_html, | |
| html_top_routes_cluster, | |
| get_route_svg, | |
| get_route_svg_from_json | |
| ) | |
| from synplan.utils.config import TreeConfig, PolicyNetworkConfig | |
| from synplan.utils.loading import load_reaction_rules, load_building_blocks | |
| import psutil | |
| import gc | |
| disable_progress_bars("huggingface_hub") | |
| smiles_parser = SMILESRead.create_parser(ignore=True) | |
| DEFAULT_MOL = "c1cc(ccc1Cl)C(CCO)NC(C2(CCN(CC2)c3c4cc[nH]c4ncn3)N)=O" | |
| # --- Helper Functions --- | |
| def download_button( | |
| object_to_download, download_filename, button_text, pickle_it=False | |
| ): | |
| """ | |
| Issued from | |
| Generates a link to download the given object_to_download. | |
| Params: | |
| ------ | |
| object_to_download: The object to be downloaded. | |
| download_filename (str): filename and extension of file. e.g. mydata.csv, | |
| some_txt_output.txt download_link_text (str): Text to display for download | |
| link. | |
| button_text (str): Text to display on download button (e.g. 'click here to download file') | |
| pickle_it (bool): If True, pickle file. | |
| Returns: | |
| ------- | |
| (str): the anchor tag to download object_to_download | |
| Examples: | |
| -------- | |
| download_link(your_df, 'YOUR_DF.csv', 'Click to download data!') | |
| download_link(your_str, 'YOUR_STRING.txt', 'Click to download text!') | |
| """ | |
| if pickle_it: | |
| try: | |
| object_to_download = pickle.dumps(object_to_download) | |
| except pickle.PicklingError as e: | |
| st.write(e) | |
| return None | |
| else: | |
| if isinstance(object_to_download, bytes): | |
| pass | |
| elif isinstance(object_to_download, pd.DataFrame): | |
| object_to_download = object_to_download.to_csv(index=False).encode("utf-8") | |
| try: | |
| b64 = base64.b64encode(object_to_download.encode()).decode() | |
| except AttributeError: | |
| b64 = base64.b64encode(object_to_download).decode() | |
| button_uuid = str(uuid.uuid4()).replace("-", "") | |
| button_id = re.sub("\d+", "", button_uuid) | |
| custom_css = f""" | |
| <style> | |
| #{button_id} {{ | |
| background-color: rgb(255, 255, 255); | |
| color: rgb(38, 39, 48); | |
| text-decoration: none; | |
| border-radius: 4px; | |
| border-width: 1px; | |
| border-style: solid; | |
| border-color: rgb(230, 234, 241); | |
| border-image: initial; | |
| }} | |
| #{button_id}:hover {{ | |
| border-color: rgb(246, 51, 102); | |
| color: rgb(246, 51, 102); | |
| }} | |
| #{button_id}:active {{ | |
| box-shadow: none; | |
| background-color: rgb(246, 51, 102); | |
| color: white; | |
| }} | |
| </style> """ | |
| dl_link = ( | |
| custom_css | |
| + f'<a download="{download_filename}" id="{button_id}" href="data:file/txt;base64,{b64}">{button_text}</a><br></br>' | |
| ) | |
| return dl_link | |
| def load_planning_resources_cached(): # Renamed to avoid conflict if main calls it directly | |
| building_blocks_path = hf_hub_download( | |
| repo_id="Laboratoire-De-Chemoinformatique/SynPlanner", | |
| filename="building_blocks_em_sa_ln.smi", | |
| subfolder="building_blocks", | |
| local_dir=".", | |
| ) | |
| ranking_policy_weights_path = hf_hub_download( | |
| repo_id="Laboratoire-De-Chemoinformatique/SynPlanner", | |
| filename="ranking_policy_network.ckpt", | |
| subfolder="uspto/weights", | |
| local_dir=".", | |
| ) | |
| reaction_rules_path = hf_hub_download( | |
| repo_id="Laboratoire-De-Chemoinformatique/SynPlanner", | |
| filename="uspto_reaction_rules.pickle", | |
| subfolder="uspto", | |
| local_dir=".", | |
| ) | |
| return building_blocks_path, ranking_policy_weights_path, reaction_rules_path | |
| # --- GUI Sections --- | |
| def initialize_app(): | |
| """1. Initialization: Setting up the main window, layout, and initial widgets.""" | |
| st.set_page_config(page_title="SynPlanner GUI", page_icon="🧪", layout="wide") | |
| # Initialize session state variables if they don't exist. | |
| if "planning_done" not in st.session_state: | |
| st.session_state.planning_done = False | |
| if "tree" not in st.session_state: | |
| st.session_state.tree = None | |
| if "res" not in st.session_state: | |
| st.session_state.res = None | |
| if "target_smiles" not in st.session_state: | |
| st.session_state.target_smiles = ( | |
| "" # Initial value, might be overwritten by ketcher | |
| ) | |
| # Clustering state | |
| if "clustering_done" not in st.session_state: | |
| st.session_state.clustering_done = False | |
| if "clusters" not in st.session_state: | |
| st.session_state.clusters = None | |
| if "reactions_dict" not in st.session_state: | |
| st.session_state.reactions_dict = None | |
| if "num_clusters_setting" not in st.session_state: # Store the setting used | |
| st.session_state.num_clusters_setting = 10 | |
| if "route_cgrs_dict" not in st.session_state: | |
| st.session_state.route_cgrs_dict = None | |
| if "sb_cgrs_dict" not in st.session_state: | |
| st.session_state.sb_cgrs_dict = None | |
| if "route_json" not in st.session_state: | |
| st.session_state.route_json = None | |
| # Subclustering state | |
| if "subclustering_done" not in st.session_state: | |
| st.session_state.subclustering_done = False | |
| if "subclusters" not in st.session_state: # Renamed from 'sub' for clarity | |
| st.session_state.subclusters = None | |
| # Download state (less critical now with direct download links) | |
| if "clusters_downloaded" not in st.session_state: # Example, might not be needed | |
| st.session_state.clusters_downloaded = False | |
| if "ketcher" not in st.session_state: # For ketcher persistence | |
| st.session_state.ketcher = DEFAULT_MOL | |
| intro_text = """ | |
| This is a demo of the graphical user interface of | |
| [SynPlanner](https://github.com/Laboratoire-de-Chemoinformatique/SynPlanner/). | |
| SynPlanner is a comprehensive tool for reaction data curation, rule extraction, model training and retrosynthetic planning. | |
| More information on SynPlanner is available in the [official docs](https://synplanner.readthedocs.io/en/latest/index.html). | |
| """ | |
| st.title("`SynPlanner GUI`") | |
| st.write(intro_text) | |
| def setup_sidebar(): | |
| """2. Sidebar: Handling the widgets and logic within the sidebar area.""" | |
| # st.sidebar.image("img/logo.png") # Assuming img/logo.png is available | |
| st.sidebar.title("Docs") | |
| st.sidebar.markdown("https://synplanner.readthedocs.io/en/latest/") | |
| st.sidebar.title("Tutorials") | |
| st.sidebar.markdown( | |
| "https://github.com/Laboratoire-de-Chemoinformatique/SynPlanner/tree/main/tutorials" | |
| ) | |
| st.sidebar.title("Paper") | |
| st.sidebar.markdown( | |
| "https://chemrxiv.org/engage/chemrxiv/article-details/66add90bc9c6a5c07ae65796" | |
| ) | |
| st.sidebar.title("Issues") | |
| st.sidebar.markdown( | |
| "[Report a bug 🐞](https://github.com/Laboratoire-de-Chemoinformatique/SynPlanner/issues/new?assignees=&labels=bug&projects=&template=bug_report.md&title=%5BBUG%5D)" | |
| ) | |
| def handle_molecule_input(): | |
| """3. Molecule Input: Managing the input area for molecule data with two-way synchronization.""" | |
| st.header("Molecule input") | |
| st.markdown( | |
| """ | |
| You can provide a molecular structure by either providing: | |
| * SMILES string + Enter | |
| * Draw it + Apply | |
| """ | |
| ) | |
| if "shared_smiles" not in st.session_state: | |
| st.session_state.shared_smiles = st.session_state.get("ketcher", DEFAULT_MOL) | |
| if "ketcher_render_count" not in st.session_state: | |
| st.session_state.ketcher_render_count = 0 | |
| def text_input_changed_callback(): | |
| new_text_value = ( | |
| st.session_state.smiles_text_input_key_for_sync | |
| ) # Key of the text_input | |
| if new_text_value != st.session_state.shared_smiles: | |
| st.session_state.shared_smiles = new_text_value | |
| st.session_state.ketcher = new_text_value | |
| st.session_state.ketcher_render_count += 1 | |
| # SMILES Text Input | |
| st.text_input( | |
| "SMILES:", | |
| value=st.session_state.shared_smiles, | |
| key="smiles_text_input_key_for_sync", # Unique key for this widget | |
| on_change=text_input_changed_callback, | |
| help="Enter SMILES string and press Enter. The drawing will update, and vice-versa.", | |
| ) | |
| ketcher_key = f"ketcher_widget_for_sync_{st.session_state.ketcher_render_count}" | |
| smile_code_output_from_ketcher = st_ketcher( | |
| st.session_state.shared_smiles, key=ketcher_key | |
| ) | |
| if smile_code_output_from_ketcher != st.session_state.shared_smiles: | |
| st.session_state.shared_smiles = smile_code_output_from_ketcher | |
| st.session_state.ketcher = smile_code_output_from_ketcher | |
| st.rerun() | |
| current_smiles_for_planning = st.session_state.shared_smiles | |
| last_planned_smiles = st.session_state.get("target_smiles") | |
| if ( | |
| last_planned_smiles | |
| and current_smiles_for_planning != last_planned_smiles | |
| and st.session_state.get("planning_done", False) | |
| ): | |
| st.warning( | |
| "Molecule structure has changed since the last successful planning run. " | |
| "Results shown below (if any) are for the previous molecule. " | |
| "Please re-run planning for the current structure." | |
| ) | |
| # Ensure st.session_state.ketcher is consistent for other parts of the app | |
| if st.session_state.get("ketcher") != current_smiles_for_planning: | |
| st.session_state.ketcher = current_smiles_for_planning | |
| return current_smiles_for_planning | |
| def setup_planning_options(): | |
| """4. Planning: Encapsulating the logic related to the "planning" functionality.""" | |
| st.header("Launch calculation") | |
| st.markdown( | |
| """If you modified the structure, please ensure you clicked on `Apply` (bottom right of the molecular editor).""" | |
| ) | |
| st.markdown( | |
| f"The molecule SMILES is actually: ``{st.session_state.get('ketcher', DEFAULT_MOL)}``" | |
| ) | |
| st.subheader("Planning options") | |
| st.markdown( | |
| """ | |
| The description of each option can be found in the | |
| [Retrosynthetic Planning Tutorial](https://synplanner.readthedocs.io/en/latest/tutorial_files/retrosynthetic_planning.html#Configuring-search-tree). | |
| """ | |
| ) | |
| col_options_1, col_options_2 = st.columns(2, gap="medium") | |
| with col_options_1: | |
| search_strategy_input = st.selectbox( | |
| label="Search strategy", | |
| options=( | |
| "Expansion first", | |
| "Evaluation first", | |
| ), | |
| index=0, | |
| key="search_strategy_input", | |
| ) | |
| ucb_type = st.selectbox( | |
| label="UCB type", | |
| options=("uct", "puct", "value"), | |
| index=0, | |
| key="ucb_type_input", | |
| ) | |
| c_ucb = st.number_input( | |
| "C coefficient of UCB", | |
| value=0.1, | |
| placeholder="Type a number...", | |
| key="c_ucb_input", | |
| ) | |
| with col_options_2: | |
| max_iterations = st.slider( | |
| "Total number of MCTS iterations", | |
| min_value=50, | |
| max_value=1000, | |
| value=300, | |
| key="max_iterations_slider", | |
| ) | |
| max_depth = st.slider( | |
| "Maximal number of reaction steps", | |
| min_value=3, | |
| max_value=9, | |
| value=6, | |
| key="max_depth_slider", | |
| ) | |
| min_mol_size = st.slider( | |
| "Minimum size of a molecule to be precursor", | |
| min_value=0, | |
| max_value=7, | |
| value=0, | |
| key="min_mol_size_slider", | |
| help="Number of non-hydrogen atoms in molecule", | |
| ) | |
| search_strategy_translator = { | |
| "Expansion first": "expansion_first", | |
| "Evaluation first": "evaluation_first", | |
| } | |
| search_strategy = search_strategy_translator[search_strategy_input] | |
| planning_params = { | |
| "search_strategy": search_strategy, | |
| "ucb_type": ucb_type, | |
| "c_ucb": c_ucb, | |
| "max_iterations": max_iterations, | |
| "max_depth": max_depth, | |
| "min_mol_size": min_mol_size, | |
| } | |
| if st.button("Start retrosynthetic planning", key="submit_planning_button"): | |
| # Reset downstream states if replanning | |
| st.session_state.planning_done = False | |
| st.session_state.clustering_done = False | |
| st.session_state.subclustering_done = False | |
| st.session_state.tree = None | |
| st.session_state.res = None | |
| st.session_state.clusters = None | |
| st.session_state.reactions_dict = None | |
| st.session_state.subclusters = None | |
| st.session_state.route_cgrs_dict = None | |
| st.session_state.sb_cgrs_dict = None | |
| st.session_state.route_json = None | |
| active_smile_code = st.session_state.get( | |
| "ketcher", DEFAULT_MOL | |
| ) # Get current SMILES | |
| st.session_state.target_smiles = ( | |
| active_smile_code # Store the SMILES used for this run | |
| ) | |
| try: | |
| target_molecule = mol_from_smiles(active_smile_code, clean_stereo=True) | |
| if target_molecule is None: | |
| raise ValueError(f"Could not parse the input SMILES: {active_smile_code}") | |
| ( | |
| building_blocks_path, | |
| ranking_policy_weights_path, | |
| reaction_rules_path, | |
| ) = load_planning_resources_cached() | |
| with st.spinner("Running retrosynthetic planning..."): | |
| with st.status("Loading resources...", expanded=False) as status: | |
| st.write("Loading building blocks...") | |
| building_blocks = load_building_blocks( | |
| building_blocks_path, standardize=False | |
| ) | |
| st.write("Loading reaction rules...") | |
| reaction_rules = load_reaction_rules(reaction_rules_path) | |
| st.write("Loading policy network...") | |
| policy_config = PolicyNetworkConfig( | |
| weights_path=ranking_policy_weights_path | |
| ) | |
| policy_function = PolicyNetworkFunction( | |
| policy_config=policy_config | |
| ) | |
| status.update(label="Resources loaded!", state="complete") | |
| tree_config = TreeConfig( | |
| search_strategy=planning_params["search_strategy"], | |
| evaluation_type="rollout", | |
| max_iterations=planning_params["max_iterations"], | |
| max_depth=planning_params["max_depth"], | |
| min_mol_size=planning_params["min_mol_size"], | |
| init_node_value=0.5, | |
| ucb_type=planning_params["ucb_type"], | |
| c_ucb=planning_params["c_ucb"], | |
| silent=True, | |
| ) | |
| tree = Tree( | |
| target=target_molecule, | |
| config=tree_config, | |
| reaction_rules=reaction_rules, | |
| building_blocks=building_blocks, | |
| expansion_function=policy_function, | |
| evaluation_function=None, | |
| ) | |
| mcts_progress_text = "Running MCTS iterations..." | |
| mcts_bar = st.progress(0, text=mcts_progress_text) | |
| for step, (solved, route_id) in enumerate(tree): | |
| progress_value = min( | |
| 1.0, (step + 1) / planning_params["max_iterations"] | |
| ) | |
| mcts_bar.progress( | |
| progress_value, | |
| text=f"{mcts_progress_text} ({step+1}/{planning_params['max_iterations']})", | |
| ) | |
| res = extract_tree_stats(tree, target_molecule) | |
| st.session_state["tree"] = tree | |
| st.session_state["res"] = res | |
| st.session_state.planning_done = True | |
| st.rerun() | |
| except (ValueError, KeyError, FileNotFoundError, TypeError) as e: | |
| st.error(f"An error occurred during planning: {e}") | |
| st.session_state.planning_done = False | |
| def display_planning_results(): | |
| """5. Planning Results Display: Handling the presentation of results.""" | |
| if st.session_state.get("planning_done", False): | |
| res = st.session_state.res | |
| tree = st.session_state.tree | |
| if res is None or tree is None: | |
| st.error( | |
| "Planning results are missing from session state. Please re-run planning." | |
| ) | |
| st.session_state.planning_done = False # Reset state | |
| return # Exit this function if no results | |
| if res.get("solved", False): # Use .get for safety | |
| st.header("Planning Results") | |
| winning_nodes = ( | |
| sorted(set(tree.winning_nodes)) | |
| if hasattr(tree, "winning_nodes") and tree.winning_nodes | |
| else [] | |
| ) | |
| st.subheader(f"Number of unique routes found: {len(winning_nodes)}") | |
| st.subheader("Examples of found retrosynthetic routes") | |
| image_counter = 0 | |
| visualised_route_ids = set() | |
| if not winning_nodes: | |
| st.warning( | |
| "Planning solved, but no winning nodes found in the tree object." | |
| ) | |
| else: | |
| for n, route_id in enumerate(winning_nodes): | |
| if image_counter >= 3: | |
| break | |
| if route_id not in visualised_route_ids: | |
| try: | |
| visualised_route_ids.add(route_id) | |
| num_steps = len(tree.synthesis_route(route_id)) | |
| route_score = round(tree.route_score(route_id), 3) | |
| svg = get_route_svg(tree, route_id) | |
| # svg = get_route_svg_from_json(st.session_state.route_json, route_id) | |
| if svg: | |
| st.image( | |
| svg, | |
| caption=f"Route {route_id}; {num_steps} steps; Route score: {route_score}", | |
| ) | |
| image_counter += 1 | |
| else: | |
| st.warning( | |
| f"Could not generate SVG for route {route_id}." | |
| ) | |
| except Exception as e: | |
| st.error(f"Error displaying route {route_id}: {e}") | |
| else: # Not solved | |
| st.header("Planning Results") | |
| st.warning( | |
| "No reaction path found for the target molecule with the current settings." | |
| ) | |
| st.write( | |
| "Consider adjusting planning options (e.g., increase iterations, adjust depth, check molecule validity)." | |
| ) | |
| stat_col, _ = st.columns(2) | |
| with stat_col: | |
| st.subheader("Run Statistics (No Solution)") | |
| try: | |
| if ( | |
| "target_smiles" not in res | |
| and "target_smiles" in st.session_state | |
| ): | |
| res["target_smiles"] = st.session_state.target_smiles | |
| cols_to_show = [ | |
| col | |
| for col in [ | |
| "target_smiles", | |
| "num_nodes", | |
| "num_iter", | |
| "search_time", | |
| ] | |
| if col in res | |
| ] | |
| if cols_to_show: | |
| df = pd.DataFrame(res, index=[0])[cols_to_show] | |
| st.dataframe(df) | |
| else: | |
| st.write("No statistics to display for the unsuccessful run.") | |
| except Exception as e: | |
| st.error(f"Error displaying statistics: {e}") | |
| st.write(res) | |
| def download_planning_results(): | |
| """6. Planning Results Download: Providing functionality to download.""" | |
| if ( | |
| st.session_state.get("planning_done", False) | |
| and st.session_state.res | |
| and st.session_state.res.get("solved", False) | |
| ): | |
| res = st.session_state.res | |
| tree = st.session_state.tree | |
| # This section is usually placed within a column in the original script | |
| # We'll assume it's called after display_planning_results and can use a new column or area. | |
| # For proper layout, this should be integrated with display_planning_results' columns. | |
| # For now, creating a placeholder or separate section for downloads: | |
| # st.subheader("Downloads") # This might be redundant if called within a layout context. | |
| # The original code places downloads in the second column of planning results. | |
| # To replicate, we'd need to pass the column object or call this within that context. | |
| # Simulating this by just creating the download links: | |
| try: | |
| html_body = generate_results_html(tree, html_path=None, extended=True) | |
| dl_html = download_button( | |
| html_body, | |
| f"results_synplanner_{st.session_state.target_smiles}.html", | |
| "Download results (HTML)", | |
| ) | |
| if dl_html: | |
| st.markdown(dl_html, unsafe_allow_html=True) | |
| try: | |
| res_df = pd.DataFrame(res, index=[0]) | |
| dl_csv = download_button( | |
| res_df, | |
| f"stats_synplanner_{st.session_state.target_smiles}.csv", | |
| "Download statistics (CSV)", | |
| ) | |
| if dl_csv: | |
| st.markdown(dl_csv, unsafe_allow_html=True) | |
| except Exception as e: | |
| st.error(f"Could not prepare statistics CSV for download: {e}") | |
| except Exception as e: | |
| st.error(f"Error generating download links for planning results: {e}") | |
| def setup_clustering(): | |
| """7. Clustering: Encapsulating the logic related to the "clustering" functionality.""" | |
| if ( | |
| st.session_state.get("planning_done", False) | |
| and st.session_state.res | |
| and st.session_state.res.get("solved", False) | |
| ): | |
| st.divider() | |
| st.header("Clustering the retrosynthetic routes") | |
| if st.button("Run Clustering", key="submit_clustering_button"): | |
| # st.session_state.num_clusters_setting = num_clusters_input | |
| st.session_state.clustering_done = False | |
| st.session_state.subclustering_done = False | |
| st.session_state.clusters = None | |
| st.session_state.reactions_dict = None | |
| st.session_state.subclusters = None | |
| st.session_state.route_cgrs_dict = None | |
| st.session_state.sb_cgrs_dict = None | |
| st.session_state.route_json = None | |
| with st.spinner("Performing clustering..."): | |
| try: | |
| current_tree = st.session_state.tree | |
| if not current_tree: | |
| st.error("Tree object not found. Please re-run planning.") | |
| return | |
| st.write("Calculating RoutesCGRs...") | |
| route_cgrs_dict = compose_all_route_cgrs(current_tree) | |
| st.write("Processing SB-CGRs...") | |
| sb_cgrs_dict = compose_all_sb_cgrs(route_cgrs_dict) | |
| results = cluster_routes( | |
| sb_cgrs_dict, use_strat=False | |
| ) # num_clusters was removed from args | |
| results = dict(sorted(results.items(), key=lambda x: float(x[0]))) | |
| st.session_state.clusters = results | |
| st.session_state.route_cgrs_dict = route_cgrs_dict | |
| st.session_state.sb_cgrs_dict = sb_cgrs_dict | |
| st.write("Extracting reactions...") | |
| st.session_state.reactions_dict = extract_reactions(current_tree) | |
| st.session_state.route_json = make_json(st.session_state.reactions_dict) | |
| if ( | |
| st.session_state.clusters is not None | |
| and st.session_state.reactions_dict is not None | |
| ): # Check for None explicitly | |
| st.session_state.clustering_done = True | |
| st.success( | |
| f"Clustering complete. Found {len(st.session_state.clusters)} clusters." | |
| ) | |
| else: | |
| st.error("Clustering failed or returned empty results.") | |
| st.session_state.clustering_done = False | |
| del results # route_cgrs_dict, sb_cgrs_dict are stored | |
| gc.collect() | |
| st.rerun() | |
| except Exception as e: | |
| st.error(f"An error occurred during clustering: {e}") | |
| st.session_state.clustering_done = False | |
| def display_clustering_results(): | |
| """8. Clustering Results Display: Handling the presentation of results.""" | |
| if st.session_state.get("clustering_done", False): | |
| clusters = st.session_state.clusters | |
| # reactions_dict = st.session_state.reactions_dict # Needed for download, not directly for display here | |
| tree = st.session_state.tree | |
| MAX_DISPLAY_CLUSTERS_DATA = 10 | |
| if ( | |
| clusters is None or tree is None | |
| ): # reactions_dict removed as not critical for display part | |
| st.error( | |
| "Clustering results (clusters or tree) are missing. Please re-run clustering." | |
| ) | |
| st.session_state.clustering_done = False | |
| return | |
| st.subheader(f"Best routes from {len(clusters)} Found Clusters") | |
| clusters_items = list(clusters.items()) | |
| first_items = clusters_items[:MAX_DISPLAY_CLUSTERS_DATA] | |
| remaining_items = clusters_items[MAX_DISPLAY_CLUSTERS_DATA:] | |
| for cluster_num, group_data in first_items: | |
| if ( | |
| not group_data | |
| or "route_ids" not in group_data | |
| or not group_data["route_ids"] | |
| ): | |
| st.warning(f"Cluster {cluster_num} has no data or route_ids.") | |
| continue | |
| st.markdown( | |
| f"**Cluster {cluster_num}** (Size: {group_data.get('group_size', 'N/A')})" | |
| ) | |
| route_id = group_data["route_ids"][0] | |
| try: | |
| num_steps = len(tree.synthesis_route(route_id)) | |
| route_score = round(tree.route_score(route_id), 3) | |
| # svg = get_route_svg(tree, route_id) | |
| svg = get_route_svg_from_json(st.session_state.route_json, route_id) | |
| sb_cgr = group_data.get("sb_cgr") # Safely get sb_cgr | |
| sb_cgr_svg = None | |
| if sb_cgr: | |
| sb_cgr.clean2d() | |
| sb_cgr_svg = cgr_display(sb_cgr) | |
| if svg and sb_cgr_svg: | |
| col1, col2 = st.columns([0.2, 0.8]) | |
| with col1: | |
| st.image(sb_cgr_svg, caption="SB-CGR") | |
| with col2: | |
| st.image( | |
| svg, | |
| caption=f"Route {route_id}; {num_steps} steps; Route score: {route_score}", | |
| ) | |
| elif svg: # Only route SVG available | |
| st.image( | |
| svg, | |
| caption=f"Route {route_id}; {num_steps} steps; Route score: {route_score}", | |
| ) | |
| st.warning( | |
| f"SB-CGR could not be displayed for cluster {cluster_num}." | |
| ) | |
| else: | |
| st.warning( | |
| f"Could not generate SVG for route {route_id} or its SB-CGR." | |
| ) | |
| except Exception as e: | |
| st.error( | |
| f"Error displaying route {route_id} for cluster {cluster_num}: {e}" | |
| ) | |
| if remaining_items: | |
| with st.expander(f"... and {len(remaining_items)} more clusters"): | |
| for cluster_num, group_data in remaining_items: | |
| if ( | |
| not group_data | |
| or "route_ids" not in group_data | |
| or not group_data["route_ids"] | |
| ): | |
| st.warning( | |
| f"Cluster {cluster_num} in expansion has no data or route_ids." | |
| ) | |
| continue | |
| st.markdown( | |
| f"**Cluster {cluster_num}** (Size: {group_data.get('group_size', 'N/A')})" | |
| ) | |
| route_id = group_data["route_ids"][0] | |
| try: | |
| num_steps = len(tree.synthesis_route(route_id)) | |
| route_score = round(tree.route_score(route_id), 3) | |
| # svg = get_route_svg(tree, route_id) | |
| svg = get_route_svg_from_json(st.session_state.route_json, route_id) | |
| sb_cgr = group_data.get("sb_cgr") | |
| sb_cgr_svg = None | |
| if sb_cgr: | |
| sb_cgr.clean2d() | |
| sb_cgr_svg = cgr_display(sb_cgr) | |
| if svg and sb_cgr_svg: | |
| col1, col2 = st.columns([0.2, 0.8]) | |
| with col1: | |
| st.image(sb_cgr_svg, caption="SB-CGR") | |
| with col2: | |
| st.image( | |
| svg, | |
| caption=f"Route {route_id}; {num_steps} steps; Route score: {route_score}", | |
| ) | |
| elif svg: | |
| st.image( | |
| svg, | |
| caption=f"Route {route_id}; {num_steps} steps; Route score: {route_score}", | |
| ) | |
| st.warning( | |
| f"SB-CGR could not be displayed for cluster {cluster_num}." | |
| ) | |
| else: | |
| st.warning( | |
| f"Could not generate SVG for route {route_id} or its SB-CGR." | |
| ) | |
| except Exception as e: | |
| st.error( | |
| f"Error displaying route {route_id} for cluster {cluster_num}: {e}" | |
| ) | |
| def download_clustering_results(): | |
| """10. Clustering Results Download: Providing functionality to download.""" | |
| if st.session_state.get("clustering_done", False): | |
| tree_for_html = st.session_state.get("tree") | |
| clusters_for_html = st.session_state.get("clusters") | |
| sb_cgrs_for_html = st.session_state.get( | |
| "sb_cgrs_dict" | |
| ) # This was used instead of reactions_dict in the original for report | |
| if not tree_for_html: | |
| st.warning("MCTS Tree data not found. Cannot generate cluster reports.") | |
| return | |
| if not clusters_for_html: | |
| st.warning("Cluster data not found. Cannot generate cluster reports.") | |
| return | |
| # sb_cgrs_for_html is optional for routes_clustering_report if not essential | |
| st.subheader("Cluster Reports") # Changed subheader in original | |
| st.write("Generate downloadable HTML reports for each cluster:") | |
| MAX_DOWNLOAD_LINKS_DISPLAYED = 10 | |
| num_clusters_total = len(clusters_for_html) | |
| clusters_items = list(clusters_for_html.items()) | |
| for i, (cluster_idx, group_data) in enumerate( | |
| clusters_items | |
| ): # group_data might not be needed here if report uses cluster_idx | |
| if i >= MAX_DOWNLOAD_LINKS_DISPLAYED: | |
| break | |
| try: | |
| html_content = routes_clustering_report( | |
| tree_for_html, | |
| clusters_for_html, # Pass the whole dict | |
| str(cluster_idx), # Pass the key of the cluster | |
| sb_cgrs_for_html, # Pass the sb_cgrs dict | |
| aam=False, | |
| ) | |
| st.download_button( | |
| label=f"Download report for cluster {cluster_idx}", | |
| data=html_content, | |
| file_name=f"cluster_{cluster_idx}_{st.session_state.target_smiles}.html", | |
| mime="text/html", | |
| key=f"download_cluster_{cluster_idx}", | |
| ) | |
| except Exception as e: | |
| st.error(f"Error generating report for cluster {cluster_idx}: {e}") | |
| if num_clusters_total > MAX_DOWNLOAD_LINKS_DISPLAYED: | |
| remaining_items = clusters_items[MAX_DOWNLOAD_LINKS_DISPLAYED:] | |
| remaining_count = len(remaining_items) | |
| expander_label = f"Show remaining {remaining_count} cluster reports" | |
| with st.expander(expander_label): | |
| for ( | |
| group_index, | |
| _, | |
| ) in remaining_items: # group_data not needed here either | |
| try: | |
| html_content = routes_clustering_report( | |
| tree_for_html, | |
| clusters_for_html, | |
| str(group_index), | |
| sb_cgrs_for_html, | |
| aam=False, | |
| ) | |
| st.download_button( | |
| label=f"Download report for cluster {group_index}", | |
| data=html_content, | |
| file_name=f"cluster_{group_index}_{st.session_state.target_smiles}.html", | |
| mime="text/html", | |
| key=f"download_cluster_expanded_{group_index}", | |
| ) | |
| except Exception as e: | |
| st.error( | |
| f"Error generating report for cluster {group_index} (expanded): {e}" | |
| ) | |
| try: | |
| buffer = io.BytesIO() | |
| with zipfile.ZipFile( | |
| buffer, mode="w", compression=zipfile.ZIP_DEFLATED | |
| ) as zf: | |
| for idx, _ in clusters_items: # group_data not needed | |
| html_content_zip = routes_clustering_report( | |
| tree_for_html, | |
| clusters_for_html, | |
| str(idx), | |
| sb_cgrs_for_html, | |
| aam=False, | |
| ) | |
| filename = f"cluster_{idx}_{st.session_state.target_smiles}.html" | |
| zf.writestr(filename, html_content_zip) | |
| buffer.seek(0) | |
| st.download_button( | |
| label="📦 Download all cluster reports as ZIP", | |
| data=buffer, | |
| file_name=f"all_cluster_reports_{st.session_state.target_smiles}.zip", | |
| mime="application/zip", | |
| key="download_all_clusters_zip", | |
| ) | |
| except Exception as e: | |
| st.error(f"Error generating ZIP file for cluster reports: {e}") | |
| def setup_subclustering(): | |
| """11. Subclustering: Encapsulating the logic related to the "subclustering" functionality.""" | |
| if st.session_state.get( | |
| "clustering_done", False | |
| ): # Subclustering depends on clustering being done | |
| st.divider() | |
| st.header("Sub-Clustering within a selected Cluster") | |
| if st.button("Run Subclustering Analysis", key="submit_subclustering_button"): | |
| st.session_state.subclustering_done = False | |
| st.session_state.subclusters = None | |
| with st.spinner("Performing subclustering analysis..."): | |
| try: | |
| clusters_for_sub = st.session_state.get("clusters") | |
| sb_cgrs_dict_for_sub = st.session_state.get("sb_cgrs_dict") | |
| route_cgrs_dict_for_sub = st.session_state.get("route_cgrs_dict") | |
| if ( | |
| clusters_for_sub | |
| and sb_cgrs_dict_for_sub | |
| and route_cgrs_dict_for_sub | |
| ): # Ensure all are present | |
| all_subgroups = subcluster_all_clusters( | |
| clusters_for_sub, | |
| sb_cgrs_dict_for_sub, | |
| route_cgrs_dict_for_sub, | |
| ) | |
| st.session_state.subclusters = all_subgroups | |
| st.session_state.subclustering_done = True | |
| st.success("Subclustering analysis complete.") | |
| gc.collect() | |
| st.rerun() | |
| else: | |
| missing = [] | |
| if not clusters_for_sub: | |
| missing.append("clusters") | |
| if not sb_cgrs_dict_for_sub: | |
| missing.append("SB-CGRs dictionary") | |
| if not route_cgrs_dict_for_sub: | |
| missing.append("RouteCGRs dictionary") | |
| st.error( | |
| f"Cannot run subclustering. Missing data: {', '.join(missing)}. Please ensure clustering ran successfully." | |
| ) | |
| st.session_state.subclustering_done = False | |
| except Exception as e: | |
| st.error(f"An error occurred during subclustering: {e}") | |
| st.session_state.subclustering_done = False | |
| def display_subclustering_results(): | |
| """12. Subclustering Results Display: Handling the presentation of results.""" | |
| if st.session_state.get("subclustering_done", False): | |
| sub = st.session_state.get("subclusters") | |
| tree = st.session_state.get("tree") | |
| # clusters_for_sub_display = st.session_state.get('clusters') # Not directly used in display logic from original code snippet | |
| if not sub or not tree: | |
| st.error( | |
| "Subclustering results (subclusters or tree) are missing. Please re-run subclustering." | |
| ) | |
| st.session_state.subclustering_done = False | |
| return | |
| sub_input_col, sub_display_col = st.columns([0.25, 0.75]) | |
| with sub_input_col: | |
| st.subheader("Select Cluster and Subcluster") | |
| available_cluster_nums = list(sub.keys()) | |
| if not available_cluster_nums: | |
| st.warning("No clusters available in subclustering results.") | |
| return # Exit if no clusters to select | |
| user_input_cluster_num_display = st.selectbox( | |
| "Select Cluster #:", | |
| options=sorted(available_cluster_nums), | |
| key="subcluster_num_select_key", | |
| ) | |
| selected_subcluster_idx = 0 | |
| if user_input_cluster_num_display in sub: | |
| sub_step_cluster = sub[user_input_cluster_num_display] | |
| allowed_subclusters_indices = sorted(list(sub_step_cluster.keys())) | |
| if not allowed_subclusters_indices: | |
| st.warning( | |
| f"No reaction steps (subclusters) found for Cluster {user_input_cluster_num_display}." | |
| ) | |
| else: | |
| selected_subcluster_idx = st.selectbox( | |
| "Select Subcluster Index:", | |
| options=allowed_subclusters_indices, | |
| key="subcluster_index_select_key", | |
| ) | |
| if selected_subcluster_idx in sub[user_input_cluster_num_display]: | |
| current_subcluster_data = sub[user_input_cluster_num_display][ | |
| selected_subcluster_idx | |
| ] | |
| if "sb_cgr" in current_subcluster_data: | |
| cluster_sb_cgr_display = current_subcluster_data["sb_cgr"] | |
| cluster_sb_cgr_display.clean2d() | |
| st.image( | |
| cluster_sb_cgr_display.depict(), | |
| caption=f"SB-CGR of parent Cluster {user_input_cluster_num_display}", | |
| ) | |
| else: | |
| st.warning("SB-CGR for this subcluster not found.") | |
| else: | |
| st.warning( | |
| f"Selected cluster {user_input_cluster_num_display} not found in subclustering results." | |
| ) | |
| return | |
| with sub_display_col: | |
| st.subheader("Subcluster Details") | |
| if ( | |
| user_input_cluster_num_display in sub | |
| and selected_subcluster_idx in sub[user_input_cluster_num_display] | |
| ): | |
| subcluster_content = sub[user_input_cluster_num_display][ | |
| selected_subcluster_idx | |
| ] | |
| # subcluster_to_display = post_process_subgroup(subcluster_content) #Under development | |
| subcluster_to_display = subcluster_content | |
| if ( | |
| not subcluster_to_display | |
| or "routes_data" not in subcluster_to_display | |
| or not subcluster_to_display["routes_data"] | |
| ): | |
| st.info("No routes or data found for this subcluster selection.") | |
| else: | |
| MAX_ROUTES_PER_SUBCLUSTER = 5 | |
| all_route_ids_in_subcluster = list( | |
| subcluster_to_display["routes_data"].keys() | |
| ) | |
| routes_to_display_direct = all_route_ids_in_subcluster[ | |
| :MAX_ROUTES_PER_SUBCLUSTER | |
| ] | |
| remaining_routes_sub = all_route_ids_in_subcluster[ | |
| MAX_ROUTES_PER_SUBCLUSTER: | |
| ] | |
| st.markdown( | |
| f"--- \n**Subcluster {user_input_cluster_num_display}.{selected_subcluster_idx}** (Size: {len(all_route_ids_in_subcluster)})" | |
| ) | |
| if "synthon_reaction" in subcluster_to_display: | |
| synthon_reaction = subcluster_to_display["synthon_reaction"] | |
| try: | |
| synthon_reaction.clean2d() | |
| st.image( | |
| depict_custom_reaction(synthon_reaction), | |
| caption=f"Markush-like pseudo reaction of subcluster", | |
| ) # Assuming depict_custom_reaction | |
| except Exception as e_depict: | |
| st.warning(f"Could not depict synthon reaction: {e_depict}") | |
| else: | |
| st.info("No synthon reaction data for this subcluster.") | |
| with st.container(height=500): | |
| for route_id in routes_to_display_direct: | |
| try: | |
| route_score_sub = round(tree.route_score(route_id), 3) | |
| # svg_sub = get_route_svg(tree, route_id) | |
| svg_sub = get_route_svg_from_json(st.session_state.route_json, route_id) | |
| if svg_sub: | |
| st.image( | |
| svg_sub, | |
| caption=f"Route {route_id}; Score: {route_score_sub}", | |
| ) | |
| else: | |
| st.warning( | |
| f"Could not generate SVG for route {route_id}." | |
| ) | |
| except Exception as e: | |
| st.error( | |
| f"Error displaying route {route_id} in subcluster: {e}" | |
| ) | |
| if remaining_routes_sub: | |
| with st.expander( | |
| f"... and {len(remaining_routes_sub)} more routes in this subcluster" | |
| ): | |
| for route_id in remaining_routes_sub: | |
| try: | |
| route_score_sub = round( | |
| tree.route_score(route_id), 3 | |
| ) | |
| # svg_sub = get_route_svg(tree, route_id) | |
| svg_sub = get_route_svg_from_json(st.session_state.route_json, route_id) | |
| if svg_sub: | |
| st.image( | |
| svg_sub, | |
| caption=f"Route {route_id}; Score: {route_score_sub}", | |
| ) | |
| else: | |
| st.warning( | |
| f"Could not generate SVG for route {route_id}." | |
| ) | |
| except Exception as e: | |
| st.error( | |
| f"Error displaying route {route_id} in subcluster (expanded): {e}" | |
| ) | |
| else: | |
| st.info("Select a valid cluster and subcluster index to see details.") | |
| def download_subclustering_results(): | |
| """13. Subclustering Results Download: Providing functionality to download.""" | |
| if ( | |
| st.session_state.get("subclustering_done", False) | |
| and "subcluster_num_select_key" in st.session_state | |
| and "subcluster_index_select_key" in st.session_state | |
| ): | |
| sub = st.session_state.get("subclusters") | |
| tree = st.session_state.get("tree") | |
| sb_cgrs_for_report = st.session_state.get( | |
| "sb_cgrs_dict" | |
| ) # Used by routes_subclustering_report | |
| user_input_cluster_num_display = st.session_state.subcluster_num_select_key | |
| selected_subcluster_idx = st.session_state.subcluster_index_select_key | |
| if not tree or not sub or not sb_cgrs_for_report: | |
| st.warning( | |
| "Missing data for subclustering report generation (tree, subclusters, or SB-CGRs)." | |
| ) | |
| return | |
| if ( | |
| user_input_cluster_num_display in sub | |
| and selected_subcluster_idx in sub[user_input_cluster_num_display] | |
| ): | |
| subcluster_data_for_report = sub[user_input_cluster_num_display][ | |
| selected_subcluster_idx | |
| ] | |
| # Apply the same post-processing as in display | |
| processed_subcluster_data = post_process_subgroup( | |
| subcluster_data_for_report | |
| ) | |
| if "routes_data" in subcluster_data_for_report and isinstance( | |
| subcluster_data_for_report["routes_data"], dict | |
| ): | |
| processed_subcluster_data["group_lgs"] = group_by_identical_values( | |
| subcluster_data_for_report["routes_data"] | |
| ) | |
| else: | |
| processed_subcluster_data["group_lgs"] = {} | |
| try: | |
| subcluster_html_content = routes_subclustering_report( | |
| tree, | |
| processed_subcluster_data, # Pass the specific post-processed subcluster data | |
| user_input_cluster_num_display, | |
| selected_subcluster_idx, | |
| sb_cgrs_for_report, # Pass the whole sb_cgrs dict | |
| if_lg_group=True, # This parameter was in the original call | |
| ) | |
| st.download_button( | |
| label=f"Download report for subcluster {user_input_cluster_num_display}.{selected_subcluster_idx}", | |
| data=subcluster_html_content, | |
| file_name=f"subcluster_{user_input_cluster_num_display}.{selected_subcluster_idx}_{st.session_state.target_smiles}.html", | |
| mime="text/html", | |
| key=f"download_subcluster_{user_input_cluster_num_display}_{selected_subcluster_idx}", | |
| ) | |
| except Exception as e: | |
| st.error( | |
| f"Error generating download report for subcluster {user_input_cluster_num_display}.{selected_subcluster_idx}: {e}" | |
| ) | |
| # else: | |
| # This case is handled by the display logic mostly, download button just won't appear or will be for previous valid selection. | |
| def implement_restart(): | |
| """14. Restart: Implementing the logic to reset or restart the application state.""" | |
| st.divider() | |
| st.header("Restart Application State") | |
| if st.button("Clear All Results & Restart", key="restart_button"): | |
| keys_to_clear = [ | |
| "planning_done", | |
| "tree", | |
| "res", | |
| "target_smiles", | |
| "clustering_done", | |
| "clusters", | |
| "reactions_dict", | |
| "num_clusters_setting", | |
| "route_cgrs_dict", | |
| "sb_cgrs_dict", | |
| "route_json", | |
| "subclustering_done", | |
| "subclusters", # "sub" was renamed | |
| "clusters_downloaded", | |
| # Potentially ketcher related keys if they need manual reset beyond new input | |
| "ketcher_widget", | |
| "smiles_text_input_key", # Keys for widgets | |
| "subcluster_num_select_key", | |
| "subcluster_index_select_key", | |
| ] | |
| for key in keys_to_clear: | |
| if key in st.session_state: | |
| del st.session_state[key] | |
| # Reset ketcher input to default by resetting its session state variable | |
| st.session_state.ketcher = DEFAULT_MOL | |
| # Also explicitly set target_smiles to empty or default to avoid stale data | |
| st.session_state.target_smiles = "" | |
| # It's generally better to let Streamlit manage widget state if possible, | |
| # but for a full reset, clearing their explicit session state keys might be needed. | |
| st.rerun() | |
| # --- Main Application Flow --- | |
| def main(): | |
| initialize_app() | |
| setup_sidebar() | |
| current_smile_code = handle_molecule_input() | |
| # Update session_state.ketcher if current_smile_code has changed from ketcher output | |
| if st.session_state.get("ketcher") != current_smile_code: | |
| st.session_state.ketcher = current_smile_code | |
| # No rerun here, let the flow continue. handle_molecule_input already warns. | |
| setup_planning_options() # This function now also handles the button press and logic for planning | |
| # Display planning results and download options together | |
| if st.session_state.get("planning_done", False): | |
| display_planning_results() # Displays stats and routes | |
| if st.session_state.res and st.session_state.res.get("solved", False): | |
| stat_col, download_col = st.columns( | |
| 2, gap="medium" | |
| ) # Placeholder for download column | |
| with stat_col: | |
| st.subheader("Statistics") | |
| try: | |
| res = st.session_state.res | |
| if ( | |
| "target_smiles" not in res | |
| and "target_smiles" in st.session_state | |
| ): | |
| res["target_smiles"] = st.session_state.target_smiles | |
| cols_to_show = [ | |
| col | |
| for col in [ | |
| "target_smiles", | |
| "num_routes", | |
| "num_nodes", | |
| "num_iter", | |
| "search_time", | |
| ] | |
| if col in res | |
| ] | |
| if cols_to_show: # Ensure there are columns to show | |
| df = pd.DataFrame(res, index=[0])[cols_to_show] | |
| st.dataframe(df) | |
| else: | |
| st.write("No statistics to display from planning results.") | |
| except Exception as e: | |
| st.error(f"Error displaying statistics: {e}") | |
| st.write(res) # Show raw dict if DataFrame fails | |
| with download_col: | |
| st.subheader("Planning Downloads") # Adding a subheader for clarity | |
| download_planning_results() | |
| # Clustering section (setup button, display, download) | |
| if ( | |
| st.session_state.get("planning_done", False) | |
| and st.session_state.res | |
| and st.session_state.res.get("solved", False) | |
| ): | |
| setup_clustering() # Contains the "Run Clustering" button and logic | |
| if st.session_state.get("clustering_done", False): | |
| display_clustering_results() # Displays cluster routes and stats | |
| cluster_stat_col, cluster_download_col = st.columns(2, gap="medium") | |
| with cluster_stat_col: | |
| clusters = st.session_state.clusters | |
| cluster_sizes = [ | |
| cluster.get("group_size", 0) | |
| for cluster in clusters.values() | |
| if cluster | |
| ] # Safe get | |
| st.subheader("Cluster Statistics") | |
| if cluster_sizes: | |
| cluster_df = pd.DataFrame( | |
| { | |
| "Cluster": [ | |
| k for k, v in clusters.items() if v | |
| ], # Filter out empty clusters | |
| "Number of Routes": [ | |
| v["group_size"] for v in clusters.values() if v | |
| ], | |
| } | |
| ) | |
| if not cluster_df.empty: | |
| cluster_df.index += 1 | |
| st.dataframe(cluster_df) | |
| best_route_html = html_top_routes_cluster( | |
| clusters, | |
| st.session_state.tree, | |
| st.session_state.target_smiles, | |
| ) | |
| st.download_button( | |
| label=f"Download best route from each cluster", | |
| data=best_route_html, | |
| file_name=f"cluster_best_{st.session_state.target_smiles}.html", | |
| mime="text/html", | |
| key=f"download_cluster_best", | |
| ) | |
| else: | |
| st.write("No valid cluster data to display statistics for.") | |
| # download_top_routes_cluster() | |
| else: | |
| st.write("No cluster data to display statistics for.") | |
| with cluster_download_col: | |
| download_clustering_results() | |
| # Subclustering section (setup button, display, download) | |
| if st.session_state.get("clustering_done", False): # Depends on clustering | |
| setup_subclustering() # Contains "Run Subclustering" button | |
| if st.session_state.get("subclustering_done", False): | |
| display_subclustering_results() # Displays subcluster details and routes | |
| download_subclustering_results() # This needs to be called after selections are made in display. | |
| implement_restart() | |
| if __name__ == "__main__": | |
| main() | |