prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccncc1)NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1 | CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 | CC(C)[C@H](CCc1ccncc1)NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "CC[C@@H]57"
} |
Can you make molecule CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccncc1)NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1 | CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 | CCC[C@@H](CCc1ccncc1)NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "CC[C@@H]57"
} |
Can you make molecule CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCC=NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)Cc1ccncc1 | CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 | C[C@H](CCC=NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)Cc1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC[C@@H](C)C&",
"old_substring": "CC[C@@H]57"
} |
Can you make molecule CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccc(-c2ccccc2)cc1)C(=O)NCCC1=CCC[C@@H]1c1ccncc1 | CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 | CN(Cc1ccc(-c2ccccc2)cc1)C(=O)NCCC1=CCC[C@@H]1c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "CC[C@@H]57"
} |
Can you make molecule CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1ccncc1)NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1 | CC[C@@H](NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1)c1ccncc1 | CCCC[C@@H](CCc1ccncc1)NC(=O)N(C)Cc1ccc(-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "CC[C@@H]57"
} |
Can you make molecule O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCCN(S(=O)(=O)c2ccc(F)cc2)C1 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCCN(S(=O)(=O)c2ccc(F)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1",
"old_substring": "[C@H]17CCCN15"
} |
Can you make molecule O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@@H]1CCCN(S(=O)(=O)c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@H]17CCCN15"
} |
Can you make molecule O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NC=C(CS(=O)(=O)c2ccc(F)cc2)[C@@H]1C(=O)Nc1ccc(-c2nc3ccccc3o2)cc1 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 | CC1=NC=C(CS(=O)(=O)c2ccc(F)cc2)[C@@H]1C(=O)Nc1ccc(-c2nc3ccccc3o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C(C&)=CN=C1C",
"old_substring": "[C@H]17CCCN15"
} |
Can you make molecule O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CC12CCN(S(=O)(=O)c1ccc(F)cc1)CC2 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CC12CCN(S(=O)(=O)c1ccc(F)cc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCN&CC2",
"old_substring": "[C@H]17CCCN15"
} |
Can you make molecule O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C[C@@H](C(=O)Nc2ccc(-c3nc4ccccc4o3)cc2)CN1S(=O)(=O)c1ccc(F)cc1 | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 | CC1(C)C[C@@H](C(=O)Nc2ccc(-c3nc4ccccc4o3)cc2)CN1S(=O)(=O)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C(C)(C)C1",
"old_substring": "[C@H]17CCCN15"
} |
Can you make molecule CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)CNc1nc2ccc(Cl)cc2s1 | CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 | CC[C@H](CCCl)CNc1nc2ccc(Cl)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "CC[C@@H](C)C3"
} |
Can you make molecule CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCCNc1nc2ccc(Cl)cc2s1 | CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 | CC[C@@H](Cl)CCCNc1nc2ccc(Cl)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "CC[C@@H](C)C3"
} |
Can you make molecule CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)CNc1nc2ccc(Cl)cc2s1 | CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 | CC[C@@H](CCCl)CNc1nc2ccc(Cl)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "CC[C@@H](C)C3"
} |
Can you make molecule CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)Nc1nc2ccc(Cl)cc2s1)C(C)C | CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 | CC[C@H](CC(=O)Nc1nc2ccc(Cl)cc2s1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](CC&=O)C(C)C",
"old_substring": "CC[C@@H](C)C3"
} |
Can you make molecule CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)Nc1nc2ccc(Cl)cc2s1 | CC[C@@H](C)CNc1nc2ccc(Cl)cc2s1 | CC[C@@H](C)C[C@H](CC)Nc1nc2ccc(Cl)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "CC[C@@H](C)C3"
} |
Can you make molecule Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(=O)(=O)C(C)C)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(=O)(=O)C(C)C)CC3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(=O)(=O)CC(C)C)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(=O)(=O)CC(C)C)CC3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4CCCCS(C)(=O)=O)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4CCCCS(C)(=O)=O)CC3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4C(=O)N=S(C)(C)=O)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4C(=O)N=S(C)(C)=O)CC3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4CS(=O)(=O)C(C)C)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4S(C)(=O)=O)CC3)sc2c1 | Cc1cc(C)c2nc(N3CCN(C(=O)[C@@H]4CCCCN4CS(=O)(=O)C(C)C)CC3)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(Cl)(Cl)Cl)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(Cl)(Cl)Cl)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)CC(C)(C)C)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)CC(C)(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(-c2cc3ccccc3n2CC(=O)NCCCC(C)(C)C)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NCCCC(C)(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(-c2cc3ccccc3n2CC(=O)NCCCC(F)(F)F)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NCCCC(F)(F)F)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(-c2cc3ccccc3n2CC(=O)N=C(C)C(CC)CC)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)NC(C)(C)C)o1 | CCc1nnc(-c2cc3ccccc3n2CC(=O)N=C(C)C(CC)CC)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C(CC)CC",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3ccc(CC)c(I)c3)n2)cc1 | CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3ccc(CC)c(I)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3ccc(Br)c(CC)c3)n2)cc1 | CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3ccc(Br)c(CC)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3ccc(CC)c(Cl)c3)n2)cc1 | CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3ccc(CC)c(Cl)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3cccc(CC)c3Br)n2)cc1 | CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3cccc(CC)c3Br)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3cccc(CC)c3Cl)n2)cc1 | CCc1ccc(NC(=O)c2nn(-c3ccc(CC)cc3)ccc2=O)cc1 | CCc1ccc(-n2ccc(=O)c(C(=O)Nc3cccc(CC)c3Cl)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC(=O)SN[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(CC(=O)SN[C@H]2CCC[NH2+][C@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCCC(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(=O)CCCC(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(C)(C)CC(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(C)(C)CC(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(C)(C)CCC(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(C)(C)CCC(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](C)C(=O)SN[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc(C(=O)N[C@H]2CCC[NH2+][C@H]2C)cc1F | Cc1ccc([C@H](C)C(=O)SN[C@H]2CCC[NH2+][C@H]2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OSC(=O)Cc1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OSC(=O)Cc1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)CCCC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)CCCC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)CC(C)(C)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)CC(C)(C)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)CCC(C)(C)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)CCC(C)(C)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OSC(=O)[C@@H](C)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OC(=O)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | C[C@H](OSC(=O)[C@@H](C)c1nc(C2CC2)n2ccccc12)c1cnc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCC(C)(C)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCCCCC(=O)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCC[C@@H](C)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCCC[C@@H](C)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCCCOc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | CCC(C)(CC)Oc1ccccc1C[C@@H]([NH3+])C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "CCCC2"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)N2CCO[C@H](CCC(C)C)C2)c(Cl)n1 | CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | Cc1ccc(NC(=O)C(=O)N2CCO[C@H](CCC(C)C)C2)c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)N2CCO[C@H](CCCCBr)C2)c(Cl)n1 | CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | Cc1ccc(NC(=O)C(=O)N2CCO[C@H](CCCCBr)C2)c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | C=CCCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)N2CCO[C@H](CCCCCl)C2)c(Cl)n1 | CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | Cc1ccc(NC(=O)C(=O)N2CCO[C@H](CCCCCl)C2)c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | CCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | C=CCCCC[C@@H]1CN(C(=O)C(=O)Nc2ccc(C)nc2Cl)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC6"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1Cl | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c15ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1cc(Cl)cc(Cl)c1Br | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1cc(Cl)cc(Cl)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c15ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1c(Cl)ccc(Cl)c1Cl | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1c(Cl)ccc(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c15ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1c(Cl)cc(Cl)cc1Cl | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1c(Cl)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c15ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1c(Cl)cc(Br)cc1Cl | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1ccc(Cl)c(Cl)c1 | C[C@H]1C(=O)N(c2ccc3c(c2)CCC3)CCN1C(=O)c1c(Cl)cc(Br)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c15ccc(Cl)c(Cl)c1"
} |
Can you make molecule COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1(C)CCC(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CC1 | COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 | COC(=O)C1(C)CCC(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C156CCSCC1"
} |
Can you make molecule COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC#CC#Cc1ccc(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)cc1C | COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 | COC(=O)CC#CC#Cc1ccc(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ccc1C#CC#CC&",
"old_substring": "C156CCSCC1"
} |
Can you make molecule COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCC(=O)OC)NC(=O)[C@H]1C[C@H]1c1c(F)cccc1F | COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 | CCC[C@@H](CCC(=O)OC)NC(=O)[C@H]1C[C@H]1c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C156CCSCC1"
} |
Can you make molecule COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCCC[C@H](NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)C1 | COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 | COC(=O)[C@H]1CCCC[C@H](NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "C156CCSCC1"
} |
Can you make molecule COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCC[C@H](NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CC1 | COC(=O)C1(NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CCSCC1 | COC(=O)[C@H]1CCC[C@H](NC(=O)[C@H]2C[C@H]2c2c(F)cccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "C156CCSCC1"
} |
Can you make molecule N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(SCNC(=O)COc2cccc(Cl)c2)CCCC1 | N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 | N#CC1(SCNC(=O)COc2cccc(Cl)c2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N36"
} |
Can you make molecule N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C2CN(C(=O)COc3cccc(Cl)c3)C2)CCCC1 | N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 | N#CC1(C2CN(C(=O)COc3cccc(Cl)c3)C2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N36"
} |
Can you make molecule N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(SC(=N)NC(=O)COc2cccc(Cl)c2)CCCC1 | N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 | N#CC1(SC(=N)NC(=O)COc2cccc(Cl)c2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N36"
} |
Can you make molecule N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(c2snc(C(=O)COc3cccc(Cl)c3)c2N)CCCC1 | N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 | N#CC1(c2snc(C(=O)COc3cccc(Cl)c3)c2N)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N36"
} |
Can you make molecule N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)COc1cccc(Cl)c1)C(=S)SC1(C#N)CCCC1 | N#CC1(NC(=O)COc2cccc(Cl)c2)CCCC1 | CN(C(=O)COc1cccc(Cl)c1)C(=S)SC1(C#N)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N36"
} |
Can you make molecule COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | COCSC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | CC(=O)SC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc(NCC[NH+]2CCC(C(=O)CI)CC2)c1=O | COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | Cn1ccnc(NCC[NH+]2CCC(C(=O)CI)CC2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C=C1CC[NH+](CCNc2nccn(C)c2=O)CC1 | COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | CC(=O)C=C1CC[NH+](CCNc2nccn(C)c2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)C=&",
"old_substring": "CO3"
} |
Can you make molecule COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc(NCC[NH+]2CCC(C(=O)CBr)CC2)c1=O | COC1CC[NH+](CCNc2nccn(C)c2=O)CC1 | Cn1ccnc(NCC[NH+]2CCC(C(=O)CBr)CC2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CBr",
"old_substring": "CO3"
} |
Can you make molecule C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1=C2OCCN2CC(C(=O)Nc2cc(OC)ccc2Cl)=CC(Cc2cccc([N+](=O)[O-])c2)=C1 | C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl | C=CCC1=C2OCCN2CC(C(=O)Nc2cc(OC)ccc2Cl)=CC(Cc2cccc([N+](=O)[O-])c2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N256"
} |
Can you make molecule C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1(Cc2cccc([N+](=O)[O-])c2)CCN(C(=O)Nc2cc(OC)ccc2Cl)C1 | C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl | C=CCC1(Cc2cccc([N+](=O)[O-])c2)CCN(C(=O)Nc2cc(OC)ccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N256"
} |
Can you make molecule C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1(Cc2cccc([N+](=O)[O-])c2)CCCN(C(=O)Nc2cc(OC)ccc2Cl)C1 | C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl | C=CCC1(Cc2cccc([N+](=O)[O-])c2)CCCN(C(=O)Nc2cc(OC)ccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N256"
} |
Can you make molecule C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1oc(C(=O)Nc2cc(OC)ccc2Cl)c(C#N)c1Cc1cccc([N+](=O)[O-])c1 | C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl | C=CCc1oc(C(=O)Nc2cc(OC)ccc2Cl)c(C#N)c1Cc1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N256"
} |
Can you make molecule C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1(Cc2cccc([N+](=O)[O-])c2)CCC(=O)N(C(=O)Nc2cc(OC)ccc2Cl)C1 | C=CCN(Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1cc(OC)ccc1Cl | C=CCC1(Cc2cccc([N+](=O)[O-])c2)CCC(=O)N(C(=O)Nc2cc(OC)ccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N256"
} |
Can you make molecule Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cc(Cl)c1OCC(=O)N/N=C/c1ccccn1 | Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 | Cc1cc(Cl)cc(Cl)c1OCC(=O)N/N=C/c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Cl)cc(Cl)c1&",
"old_substring": "Cc1cc(Cl)ccc13"
} |
Can you make molecule Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=CC(C)=C(CC(=O)N/N=C/c2ccccn2)C2=COC(=C1)O2 | Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 | CC1=CC(C)=C(CC(=O)N/N=C/c2ccccn2)C2=COC(=C1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C)c2c&coc2c1",
"old_substring": "Cc1cc(Cl)ccc13"
} |
Can you make molecule Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=CC(C)=C(CC(=O)N/N=C/c2ccccn2)C2=COC(=C1C)O2 | Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 | CC1=CC(C)=C(CC(=O)N/N=C/c2ccccn2)C2=COC(=C1C)O2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C)c2c&coc2c1C",
"old_substring": "Cc1cc(Cl)ccc13"
} |
Can you make molecule Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OCC(=O)N/N=C/c2ccccn2)c(Br)c(C)c1Cl | Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 | Cc1cc(OCC(=O)N/N=C/c2ccccn2)c(Br)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Br)c(C)c1Cl",
"old_substring": "Cc1cc(Cl)ccc13"
} |
Can you make molecule Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=CC(CC(=O)N/N=C/c2ccccn2)=C2N=C(Cl)N=C(O2)S1 | Cc1cc(Cl)ccc1OCC(=O)N/N=C/c1ccccn1 | CC1=CC(CC(=O)N/N=C/c2ccccn2)=C2N=C(Cl)N=C(O2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2c&nc(Cl)nc2s1",
"old_substring": "Cc1cc(Cl)ccc13"
} |
Can you make molecule O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC(=S)NC(=O)C1=CNc1ccc([S-])cc1 | O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O | O=C1NC(=S)NC(=O)C1=CNc1ccc([S-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc([S-])cc1",
"old_substring": "c12ccc([N+](=O)[O-])cc1O"
} |
Can you make molecule O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(NC=C2C(=O)NC(=S)NC2=O)c(F)c1 | O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O | Nc1ccc(NC=C2C(=O)NC(=S)NC2=O)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(N)cc1F",
"old_substring": "c12ccc([N+](=O)[O-])cc1O"
} |
Can you make molecule O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC(=S)NC(=O)C1=CNc1ccc(=O)oc1 | O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O | O=C1NC(=S)NC(=O)C1=CNc1ccc(=O)oc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(=O)oc1",
"old_substring": "c12ccc([N+](=O)[O-])cc1O"
} |
Can you make molecule O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O less soluble in water? The output molecule should be similar to the input molecule. | N=C(O)c1cccc(NC=C2C(=O)NC(=S)NC2=O)c1 | O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O | N=C(O)c1cccc(NC=C2C(=O)NC(=S)NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C(=N)O)c1",
"old_substring": "c12ccc([N+](=O)[O-])cc1O"
} |
Can you make molecule O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC=C2C(=O)NC(=S)NC2=O)ccc1O | O=C1NC(=S)NC(=O)C1=CNc1ccc([N+](=O)[O-])cc1O | Cc1cc(NC=C2C(=O)NC(=S)NC2=O)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)c(C)c1",
"old_substring": "c12ccc([N+](=O)[O-])cc1O"
} |
Can you make molecule Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)N2CCCCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCCCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)N2CCSCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCSCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)N2CC=CC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CC=CC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)SSN2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)N2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | Cc1c(C(=O)SSN2CCOCC2)oc2c1-c1nn(CC(=O)NCc3ccco3)cc1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCCCC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCCCC3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCCCCC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCCCCC3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCC(C)(C)C3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCC(C)(C)C3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCC(C)(C)CC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCC(C)(C)CC3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CC4(CCCCC4)C3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CCCCC3)cc2)cc1 | CCc1ccc(CNC(=O)c2ccc(-c3nccnc3N3CC4(CCCCC4)C3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC2(CCCCC2)C1",
"old_substring": "N16CCCCC1"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CO.COc1ccccc1I.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC | CO.COc1ccccc1I.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c16ccc%10cc17"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CO.COc1cccc(Br)c1.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC | CO.COc1cccc(Br)c1.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c16ccc%10cc17"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CO.COc1cccc(Cl)c1.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC | CO.COc1cccc(Cl)c1.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Cl)c1",
"old_substring": "c16ccc%10cc17"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CO.COc1ccccc1Cl.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC | CO.COc1ccccc1Cl.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c16ccc%10cc17"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CO.COc1cccc(I)c1.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NC4CCCCC4)cc3N2)cc1OC | CO.COc1cccc(I)c1.O=C(NC1CCCCC1)c1cc2n(n1)[C@H](C(F)(F)F)CCN2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c16ccc%10cc17"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.