prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(CCCO)Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCl)Nc1ccc(F)cc1F | O=C(CCCO)Nc1ccc(F)cc1F | O=C(CCCl)Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCl",
"old_substring": "O=C2CCCO"
} |
Can you make molecule O=C(CCCO)Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(F)cc1F)N1CCCCO1 | O=C(CCCO)Nc1ccc(F)cc1F | O=C(Nc1ccc(F)cc1F)N1CCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N1CCCCO1",
"old_substring": "O=C2CCCO"
} |
Can you make molecule O=C(CCCO)Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(F)cc1F)C1=CCCCO1 | O=C(CCCO)Nc1ccc(F)cc1F | O=C(Nc1ccc(F)cc1F)C1=CCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CCCCO1",
"old_substring": "O=C2CCCO"
} |
Can you make molecule O=C(CCCO)Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCl)CNc1ccc(F)cc1F | O=C(CCCO)Nc1ccc(F)cc1F | O=C(CCl)CNc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C(C&)CCl",
"old_substring": "O=C2CCCO"
} |
Can you make molecule O=C(CCCO)Nc1ccc(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCOC2=CC=C2C=C1Nc1ccc(F)cc1F | O=C(CCCO)Nc1ccc(F)cc1F | O=C1CCCOC2=CC=C2C=C1Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C1CCCOc2ccc&cc21",
"old_substring": "O=C2CCCO"
} |
Can you make molecule NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCOC(=S)Sc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CCOC(=S)Sc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O56"
} |
Can you make molecule NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1)OCCC(N)=O | NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | N=C(Cc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1)OCCC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O56"
} |
Can you make molecule NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCC(=O)CCC(=O)c1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CCC(=O)CCC(=O)c1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O56"
} |
Can you make molecule NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CC[C@H](O)CCc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CC[C@H](O)CCc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O56"
} |
Can you make molecule NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCC(=O)/C=C/Sc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CCOc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | NC(=O)CCC(=O)/C=C/Sc1ccc(NC(=O)C[C@H]2CCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O56"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | COCc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | COCSc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | CC(=O)Sc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCC(=O)Nc2nnc(C)s2)c(C(=O)CS)c1 | COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | Cc1ccc(OCC(=O)Nc2nnc(C)s2)c(C(=O)CS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCC(=O)Nc2nnc(C)s2)c(C(=O)CI)c1 | COc1cc(C)ccc1OCC(=O)Nc1nnc(C)s1 | Cc1ccc(OCC(=O)Nc2nnc(C)s2)c(C(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CC(=O)c1c(O)cccc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1c(O)cccc1C1=CC=C(Oc2ccccc2)N2CCC2=C1 | CC(=O)c1c(O)cccc1COc1ccccc1 | CC(=O)c1c(O)cccc1C1=CC=C(Oc2ccccc2)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C25"
} |
Can you make molecule CC(=O)c1c(O)cccc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1c(O)cccc1-c1ncnc2sc-2c(C)c1Oc1ccccc1 | CC(=O)c1c(O)cccc1COc1ccccc1 | CC(=O)c1c(O)cccc1-c1ncnc2sc-2c(C)c1Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C25"
} |
Can you make molecule CC(=O)c1c(O)cccc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1c(O)cccc1C1=CC=C2SCCN2C(Oc2ccccc2)=C1 | CC(=O)c1c(O)cccc1COc1ccccc1 | CC(=O)c1c(O)cccc1C1=CC=C2SCCN2C(Oc2ccccc2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C25"
} |
Can you make molecule CC(=O)c1c(O)cccc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1c(O)cccc1C1=C2CCN2CC(Oc2ccccc2)=CC=C1 | CC(=O)c1c(O)cccc1COc1ccccc1 | CC(=O)c1c(O)cccc1C1=C2CCN2CC(Oc2ccccc2)=CC=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C25"
} |
Can you make molecule CC(=O)c1c(O)cccc1COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1c(O)cccc1-c1ccc(Oc2ccccc2)c(C)c2sc-2n1 | CC(=O)c1c(O)cccc1COc1ccccc1 | CC(=O)c1c(O)cccc1-c1ccc(Oc2ccccc2)c(C)c2sc-2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C25"
} |
Can you make molecule CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc(-c3ccc(F)cc3)o2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc(-c3ccc(F)cc3)o2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c16cc7no1"
} |
Can you make molecule CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)oc2C)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)oc2C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&oc1C",
"old_substring": "c16cc7no1"
} |
Can you make molecule CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc3nc(-c4ccc(F)cc4)oc3c2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc3nc(-c4ccc(F)cc4)oc3c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&oc2c1",
"old_substring": "c16cc7no1"
} |
Can you make molecule CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc3noc(-c4ccc(F)cc4)c3c2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc3noc(-c4ccc(F)cc4)c3c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2noc&c2c1",
"old_substring": "c16cc7no1"
} |
Can you make molecule CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc(-c3ccc(F)cc3)nc2C)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2cc(-c3ccc(F)cc3)no2)cn1 | CCn1cc(S(=O)(=O)N2CCCCC[C@@H]2c2ccc(-c3ccc(F)cc3)nc2C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c16cc7no1"
} |
Can you make molecule COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@](NC(=O)c1c(Cl)cccc1Cl)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1c(Cl)cccc1Cl)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@](NC(=O)c1ccc(Cl)cc1I)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1ccc(Cl)cc1I)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@](NC(=O)c1ccc(Cl)cc1Br)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1ccc(Cl)cc1Br)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@](NC(=O)c1ccc(Cl)c(I)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1ccc(Cl)c(I)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@](NC(=O)c1ccc(Cl)c(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1cccc(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | COC(=O)[C@](NC(=O)c1ccc(Cl)c(Cl)c1)(Nc1ccc(Br)c[nH+]1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccc(C(=O)Nc3cc(C(Cl)(Cl)Cl)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(C(Cl)(Cl)Cl)nn3-c3ncccn3)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)CC(C)(C)C)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)CC(C)(C)C)nn3-c3ncccn3)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccc(C(=O)Nc3cc(CCCC(C)(C)C)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(CCCC(C)(C)C)nn3-c3ncccn3)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccc(C(=O)Nc3cc(CCCC(F)(F)F)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(CCCC(F)(F)F)nn3-c3ncccn3)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c2ccc(C(=O)Nc3cc(CCCCC(F)(F)F)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(C(C)(C)C)nn3-c3ncccn3)cc2c1C | Cc1[nH]c2ccc(C(=O)Nc3cc(CCCCC(F)(F)F)nn3-c3ncccn3)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C[C@H](C)C(=O)N[C@H](CCl)CCCC1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@H](CCl)CCCC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]34C"
} |
Can you make molecule Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H]1N=NC=C1CCC1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H]1N=NC=C1CCC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]34C"
} |
Can you make molecule Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H]1C=C(CC2CCCCC2)N=N1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H]1C=C(CC2CCCCC2)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]34C"
} |
Can you make molecule Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H]1CC[C@@H](C2CCCCC2)C1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H]1CC[C@@H](C2CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]34C"
} |
Can you make molecule Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C[C@H](C)C(=O)N[C@H](C)C(C)(C)CC1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@@H](C)C1CCCCC1 | Cc1noc(C)c1C[C@H](C)C(=O)N[C@H](C)C(C)(C)CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]34C"
} |
Can you make molecule CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C2(C)CCCC2)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C2(C)CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C7(C)C"
} |
Can you make molecule CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(Cl)(Cl)Cl)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(Cl)(Cl)Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C7(C)C"
} |
Can you make molecule CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1nn(CC)cc1C(=O)N[C@H]1CC(=O)N(C)C1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 | CCCC(C)(C)c1nn(CC)cc1C(=O)N[C@H]1CC(=O)N(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C7(C)C"
} |
Can you make molecule CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)(CC)CC)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)(CC)CC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C7(C)C"
} |
Can you make molecule CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C2(C=O)CCCCCC2)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C(C)C)n1 | CCn1cc(C(=O)N[C@H]2CC(=O)N(C)C2)c(C2(C=O)CCCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C7(C)C"
} |
Can you make molecule COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2cncc3ccccc23)c(C(=O)N(C(C)C)C(C)C)cc1I | COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C | COc1cc(-c2cncc3ccccc23)c(C(=O)N(C(C)C)C(C)C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c15cccc9c18"
} |
Can you make molecule COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2cncc3ccccc23)c(C(=O)N(C(C)C)C(C)C)cc1Cl | COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C | COc1cc(-c2cncc3ccccc23)c(C(=O)N(C(C)C)C(C)C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c15cccc9c18"
} |
Can you make molecule COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2cncc3ccccc23)cc(I)c1C(=O)N(C(C)C)C(C)C | COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C | COc1cc(-c2cncc3ccccc23)cc(I)c1C(=O)N(C(C)C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c15cccc9c18"
} |
Can you make molecule COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(C(=O)N(C(C)C)C(C)C)c(-c2cncc3ccccc23)c1 | COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C | COc1cc(Br)c(C(=O)N(C(C)C)C(C)C)c(-c2cncc3ccccc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c15cccc9c18"
} |
Can you make molecule COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(-c2cncc3ccccc23)cc1C(=O)N(C(C)C)C(C)C | COc1cccc(-c2cncc3ccccc23)c1C(=O)N(C(C)C)C(C)C | COc1cc(Br)c(-c2cncc3ccccc23)cc1C(=O)N(C(C)C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1&",
"old_substring": "c15cccc9c18"
} |
Can you make molecule COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(OC)cc1)NC(=O)Cc1cccc2ccccc12 | COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 | CC[C@@H](CCc1ccc(OC)cc1)NC(=O)Cc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]67C"
} |
Can you make molecule COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[C@H](CBr)NC(=O)Cc2cccc3ccccc23)cc1 | COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 | COc1ccc(CC[C@H](CBr)NC(=O)Cc2cccc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]67C"
} |
Can you make molecule COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCC[C@H](CBr)NC(=O)Cc2cccc3ccccc23)cc1 | COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 | COc1ccc(CCC[C@H](CBr)NC(=O)Cc2cccc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]67C"
} |
Can you make molecule COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCC[C@@H](CCl)NC(=O)Cc2cccc3ccccc23)cc1 | COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 | COc1ccc(CCC[C@@H](CCl)NC(=O)Cc2cccc3ccccc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]67C"
} |
Can you make molecule COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2CCC[C@H](NC(=O)Cc3cccc4ccccc34)C2)cc1 | COc1ccc([C@@H](C)NC(=O)Cc2cccc3ccccc23)cc1 | COc1ccc([C@H]2CCC[C@H](NC(=O)Cc3cccc4ccccc34)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]67C"
} |
Can you make molecule O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2nc(-c3cccnc3)co2)CN1c1cccc(Cl)c1 | O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 | O=C1C[C@H](c2nc(-c3cccnc3)co2)CN1c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c15nc6no1"
} |
Can you make molecule O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(-c2cccnc2)ncnc1[C@H]1CC(=O)N(c2cccc(Cl)c2)C1 | O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 | Cc1c(-c2cccnc2)ncnc1[C@H]1CC(=O)N(c2cccc(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c15nc6no1"
} |
Can you make molecule O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(-c2cccnc2)nc1[C@H]1CC(=O)N(c2cccc(Cl)c2)C1 | O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 | Cc1cnc(-c2cccnc2)nc1[C@H]1CC(=O)N(c2cccc(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c15nc6no1"
} |
Can you make molecule O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2ncnc(-c3cccnc3)c2F)CN1c1cccc(Cl)c1 | O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 | O=C1C[C@H](c2ncnc(-c3cccnc3)c2F)CN1c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c15nc6no1"
} |
Can you make molecule O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2nc(-c3cccnc3)ncc2I)CN1c1cccc(Cl)c1 | O=C1C[C@H](c2nc(-c3cccnc3)no2)CN1c1cccc(Cl)c1 | O=C1C[C@H](c2nc(-c3cccnc3)ncc2I)CN1c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c15nc6no1"
} |
Can you make molecule C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCCC4)cc3)cc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N18CCOCC1"
} |
Can you make molecule C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCCCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCCCC4)cc3)cc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N18CCOCC1"
} |
Can you make molecule C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCSCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCSCC4)cc3)cc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N18CCOCC1"
} |
Can you make molecule C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CC=CC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CC=CC4)cc3)cc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N18CCOCC1"
} |
Can you make molecule C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(SSN4CCOCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(N4CCOCC4)cc3)cc2[N+](=O)[O-])C1 | C[C@H]1CCCN(c2ccc(C(=O)Nc3ccc(SSN4CCOCC4)cc3)cc2[N+](=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N18CCOCC1"
} |
Can you make molecule C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCCCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCCCCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)N(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCCCC(=O)N(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)N(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CCC(CC=C)N(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC1CCN(N(C(=O)CC=Cc2ccc(C)cc2)[C@@H]2CCS(=O)(=O)C2)CC1 | C=CCN(C(=O)CC=Cc1ccc(C)cc1)[C@@H]1CCS(=O)(=O)C1 | C=CC1CCN(N(C(=O)CC=Cc2ccc(C)cc2)[C@@H]2CCS(=O)(=O)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC1CCN&CC1",
"old_substring": "C=CC3"
} |
Can you make molecule O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 | O=C(/C=C/SSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1cccc(-c2nnc(SN3CCC(=NONc4nncs4)CC3)o2)c1 | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 | O=[N+]([O-])c1cccc(-c2nnc(SN3CCC(=NONc4nncs4)CC3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCN(Sc2nnc(-c3cccc([N+](=O)[O-])c3)o2)CC1)Nc1nncs1 | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 | O=C(NN=C1CCN(Sc2nnc(-c3cccc([N+](=O)[O-])c3)o2)CC1)Nc1nncs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(Sc2nnc(-c3cccc([N+](=O)[O-])c3)o2)CC1)Nc1nncs1 | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 | O=C(NN=C1CCC(Sc2nnc(-c3cccc([N+](=O)[O-])c3)o2)CC1)Nc1nncs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1nncs1)C(=O)SSc1nnc(-c2cccc([N+](=O)[O-])c2)o1 | O=C(CSc1nnc(-c2cccc([N+](=O)[O-])c2)o1)Nc1nncs1 | C/C(=N\ONc1nncs1)C(=O)SSc1nnc(-c2cccc([N+](=O)[O-])c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C4"
} |
Can you make molecule CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CN(CCCCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | CN(CCCCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C2C5"
} |
Can you make molecule CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CN(CCCCCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | CN(CCCCCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C2C5"
} |
Can you make molecule CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CN(c1cc(Br)cc(F)c1C(N)=O)C1CC(c2ccc(F)cc2)C1 | CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | CN(c1cc(Br)cc(F)c1C(N)=O)C1CC(c2ccc(F)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C2C5"
} |
Can you make molecule CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCc1ccc(F)cc1)N(C)c1cc(Br)cc(F)c1C(N)=O | CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | C[C@@H](CCc1ccc(F)cc1)N(C)c1cc(Br)cc(F)c1C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C2C5"
} |
Can you make molecule CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CN(c1cc(Br)cc(F)c1C(N)=O)C1CCC(c2ccc(F)cc2)CC1 | CN(CCc1ccc(F)cc1)c1cc(Br)cc(F)c1C(N)=O | CN(c1cc(Br)cc(F)c1C(N)=O)C1CCC(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C2C5"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NSC(=O)CSc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NSC(=O)CSc1ccc(-c2ccccc2OC)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CCCC(=O)Sc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CCCC(=O)Sc1ccc(-c2ccccc2OC)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C6"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CC(C)(C)Sc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CC(C)(C)Sc1ccc(-c2ccccc2OC)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC[S@+]([O-])CCCSc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC[S@+]([O-])CCCSc1ccc(-c2ccccc2OC)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CCC(C)(C)Sc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CSc1ccc(-c2ccccc2OC)nn1 | COc1ccccc1NC(=O)CCC(C)(C)Sc1ccc(-c2ccccc2OC)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)C1=C(N=Cc2cccc(C(F)(F)F)c2)CCS1 | Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C(=O)C1=C(N=Cc2cccc(C(F)(F)F)c2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C2(=O)C=3C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)C(N=Cc1cccc(C(F)(F)F)c1)=C(Cl)Cl | Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C(=O)C(N=Cc1cccc(C(F)(F)F)c1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C2(=O)C=3C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C[S@+]([O-])CCC=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C[S@+]([O-])CCC=Cc1cccc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C=3C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)[C@H](C)CC=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C(=O)[C@H](C)CC=Cc1cccc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C2(=O)C=3C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)C(C)(C)CCC=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C(=O)C(C#N)=Cc1cccc(C(F)(F)F)c1 | Cc1occc1C(=O)C(C)(C)CCC=Cc1cccc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C2(=O)C=3C#N"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | COCc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | COCSc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | CC(=O)Sc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(C(=O)CCSc2ccccn2)c2cc(C(=O)CS)ccc2O1 | COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | C[C@@H]1CN(C(=O)CCSc2ccccn2)c2cc(C(=O)CS)ccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(C(=O)CCSc2ccccn2)c2cc(C(=O)CI)ccc2O1 | COc1ccc2c(c1)N(C(=O)CCSc1ccccn1)C[C@@H](C)O2 | C[C@@H]1CN(C(=O)CCSc2ccccn2)c2cc(C(=O)CI)ccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC[C@H](NC(=O)[C@H](C)n2cccn2)C(C)C)cc1F | CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 | Cc1ccc(CC[C@H](NC(=O)[C@H](C)n2cccn2)C(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "CC[C@@H]35"
} |
Can you make molecule CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc(C)c(F)c1)NC(=O)[C@H](C)n1cccn1 | CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 | CCC[C@@H](CCc1ccc(C)c(F)c1)NC(=O)[C@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "CC[C@@H]35"
} |
Can you make molecule CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](C)CCC=NC(=O)[C@H](C)n2cccn2)cc1F | CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 | Cc1ccc(C[C@H](C)CCC=NC(=O)[C@H](C)n2cccn2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC[C@@H](C)C&",
"old_substring": "CC[C@@H]35"
} |
Can you make molecule CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2CCC=C2CCNC(=O)[C@H](C)n2cccn2)cc1F | CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 | Cc1ccc([C@H]2CCC=C2CCNC(=O)[C@H](C)n2cccn2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "CC[C@@H]35"
} |
Can you make molecule CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1ccc(C)c(F)c1)NC(=O)[C@H](C)n1cccn1 | CC[C@@H](NC(=O)[C@H](C)n1cccn1)c1ccc(C)c(F)c1 | CCCC[C@@H](CCc1ccc(C)c(F)c1)NC(=O)[C@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "CC[C@@H]35"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.