prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@]1(CC(=O)SN[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(CC(=O)SN[C@@H]2CONC2=O)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@]1(CC(=C=O)CN[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(CC(=C=O)CN[C@@H]2CONC2=O)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@]1(C(=O)CCCC(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(C(=O)CCCC(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@]1(C(C)(C)CC(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(C(C)(C)CC(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@]1(CCC[S@@+]([O-])CN[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(C(=O)N[C@@H]2CONC2=O)CC[NH2+]C1 | CCC[C@]1(CCC[S@@+]([O-])CN[C@@H]2CONC2=O)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 | O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 | O=C(/C=C/Sc1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCN(Cc3ccccc3)CC2)nc1-c1cc2cc([N+](=O)[O-])ccc2oc1=O | O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 | O=Cc1sc(N2CCN(Cc3ccccc3)CC2)nc1-c1cc2cc([N+](=O)[O-])ccc2oc1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCN(Cc3ccccc3)CC2)sc1-c1cc2cc([N+](=O)[O-])ccc2oc1=O | O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 | O=Cc1nc(N2CCN(Cc3ccccc3)CC2)sc1-c1cc2cc([N+](=O)[O-])ccc2oc1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N1CCN(Cc2ccccc2)CC1)n1nc(-c2cc3cc([N+](=O)[O-])ccc3oc2=O)oc1=S | O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 | O=C(N1CCN(Cc2ccccc2)CC1)n1nc(-c2cc3cc([N+](=O)[O-])ccc3oc2=O)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1oc2ccc([N+](=O)[O-])cc2cc1-c1ccc(/C=N/ON2CCN(Cc3ccccc3)CC2)o1 | O=C(c1cc2cc([N+](=O)[O-])ccc2oc1=O)N1CCN(Cc2ccccc2)CC1 | O=c1oc2ccc([N+](=O)[O-])cc2cc1-c1ccc(/C=N/ON2CCN(Cc3ccccc3)CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | C=CSn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | CC(C)n1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | C=CCCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=c1n(CCO)nc(CC2CC[NH2+]CC2)n1CCCCl | CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | O=c1n(CCO)nc(CC2CC[NH2+]CC2)n1CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=c1n(CCO)nc(CC2CC[NH2+]CC2)n1CCCCS | CCn1c(CC2CC[NH2+]CC2)nn(CCO)c1=O | O=c1n(CCO)nc(CC2CC[NH2+]CC2)n1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(S[C@H](C)C(C)(C)CN2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@H](C)C(C)(C)CN2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(S[C@H](CCl)CCCN2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@H](CCl)CCCN2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(S[C@@H]2C=C(CN3CCC(C)CC3)N=N2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@@H]2C=C(CN3CCC(C)CC3)N=N2)nnc1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(S[C@]2(C)CCCN(N3CCC(C)CC3)C2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@]2(C)CCCN(N3CCC(C)CC3)C2)nnc1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]1&(C)CCCN&C1",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(S[C@@H](CBr)CCN2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@H](C)C(=O)N2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | C=CCn1c(S[C@@H](CBr)CCN2CCC(C)CC2)nnc1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC12CC(O[C@H]3C(=O)O[C@H]([C@@H](O)CO)C3=O)=CC=CC=C1C2 | CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O | CC12CC(O[C@H]3C(=O)O[C@H]([C@@H](O)CO)C3=O)=CC=CC=C1C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC2=C(N=C1O[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O)S2 | CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O | CC1(C)CCCC2=C(N=C1O[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC2=CC2=CC=C(O[C@H]2C(=O)O[C@H]([C@@H](O)CO)C2=O)O1 | CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O | CC1(C)CC2=CC2=CC=C(O[C@H]2C(=O)O[C@H]([C@@H](O)CO)C2=O)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC2=CC2=CC=C1O[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O | CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O | CN1CCC2=CC2=CC=C1O[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C1O[C@H]([C@@H](O)CO)C(=O)[C@H]1OCCCCC12CC1C2 | CCO[C@H]1C(=O)O[C@H]([C@@H](O)CO)C1=O | O=C1O[C@H]([C@@H](O)CO)C(=O)[C@H]1OCCCCC12CC1C2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCO[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 | COCO[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "COCO&",
"old_substring": "C6CO"
} |
Can you make molecule Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CO[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 | C=CO[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C6CO"
} |
Can you make molecule Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 | CCC(=O)[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C6CO"
} |
Can you make molecule Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C=CO[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 | C=C=CO[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C6CO"
} |
Can you make molecule Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | Cc1ccc(-c2nnc(C[NH+](CCO)[C@H]3CCc4ccccc43)o2)cc1 | CC[NH+](Cc1nnc(-c2ccc(C)cc2)o1)[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C6CO"
} |
Can you make molecule Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(F)c(F)c1)[NH2+]Cc1cc(C)n(-c2cc(C)on2)c1C | Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 | CC[C@@H](CCc1ccc(F)c(F)c1)[NH2+]Cc1cc(C)n(-c2cc(C)on2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2c(C)cc(C[NH2+][C@@H](CBr)CCc3ccc(F)c(F)c3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@@H](CBr)CCc3ccc(F)c(F)c3)c2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2c(C)cc(C[NH2+][C@@H](CBr)CCCc3ccc(F)c(F)c3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@@H](CBr)CCCc3ccc(F)c(F)c3)c2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2c(C)cc(C[NH2+][C@H](CCl)CCCc3ccc(F)c(F)c3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@H](CCl)CCCc3ccc(F)c(F)c3)c2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2c(C)cc(C[NH2+][C@H]3CCC[C@H](c4ccc(F)c(F)c4)C3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@H](C)c3ccc(F)c(F)c3)c2C)no1 | Cc1cc(-n2c(C)cc(C[NH2+][C@H]3CCC[C@H](c4ccc(F)c(F)c4)C3)c2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]57C"
} |
Can you make molecule C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)c1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)c1)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c16ccn8n1"
} |
Can you make molecule C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)Nc1csc2nc(-c3ncccc3Cl)cn12)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1csc2nc(-c3ncccc3Cl)cn12)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&cn12",
"old_substring": "c16ccn8n1"
} |
Can you make molecule C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)Nc1cc(-c2ncccc2Cl)nc(Cl)n1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1cc(-c2ncccc2Cl)nc(Cl)n1)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc(Cl)n1",
"old_substring": "c16ccn8n1"
} |
Can you make molecule C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)Nc1cc(Cl)nc(-c2ncccc2Cl)n1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1cc(Cl)nc(-c2ncccc2Cl)n1)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)nc&n1",
"old_substring": "c16ccn8n1"
} |
Can you make molecule C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)Nc1c(Br)c(-c2ncccc2Cl)nn1C)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1ccn(-c2ncccc2Cl)n1)[C@@H]1CCCO1 | C[C@@H](NC(=O)Nc1c(Br)c(-c2ncccc2Cl)nn1C)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Br)c&nn1C",
"old_substring": "c16ccn8n1"
} |
Can you make molecule COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2Cl)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c15ccccc1"
} |
Can you make molecule COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccc(I)cc2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccc(I)cc2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c15ccccc1"
} |
Can you make molecule COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccc(C)c(I)c2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccc(C)c(I)c2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c15ccccc1"
} |
Can you make molecule COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(S(=O)(=O)N2CCN=C2Cc2cccc(Br)c2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2cccc(Br)c2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c15ccccc1"
} |
Can you make molecule COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(S(=O)(=O)N2CCN=C2Cc2cccc(C)c2C)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2ccccc2)ccc1Cl | COc1cc(S(=O)(=O)N2CCN=C2Cc2cccc(C)c2C)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15ccccc1"
} |
Can you make molecule COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1cc(Cl)cc(OC)c1 | COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1cc(Cl)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Cl)c1",
"old_substring": "c16ccc7c(C=%10)c1"
} |
Can you make molecule COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1cc(I)cc(OC)c1 | COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1cc(I)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c16ccc7c(C=%10)c1"
} |
Can you make molecule COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1cc(Br)cc(OC)c1 | COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1cc(Br)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c16ccc7c(C=%10)c1"
} |
Can you make molecule COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1ccc2c(C)c(OC)oc2c1 | COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1ccc2c(C)c(OC)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2c(C)c&oc2c1&",
"old_substring": "c16ccc7c(C=%10)c1"
} |
Can you make molecule COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1ccc(Cl)c(OC)c1 | COc1ccc(OC)c(C=C2Oc3cc(OC(=O)c4ccncc4)cc(C)c3C2=O)c1 | C=C1Oc2cc(OC(=O)c3ccncc3)cc(C)c2C1=O.COc1ccc(Cl)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c16ccc7c(C=%10)c1"
} |
Can you make molecule COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@]2(C3CCOCC3)CC[C@H](NC(=O)Nc3cc(C)ccc3Cl)C2)cc1 | COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 | COc1ccc([C@@]2(C3CCOCC3)CC[C@H](NC(=O)Nc3cc(C)ccc3Cl)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@H]689"
} |
Can you make molecule COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@]2(C3CCOCC3)CC[C@H](NC(=O)Nc3cc(C)ccc3Cl)C2)cc1 | COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 | COc1ccc([C@]2(C3CCOCC3)CC[C@H](NC(=O)Nc3cc(C)ccc3Cl)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@H]689"
} |
Can you make molecule COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(C)(C)[C@H](CCCC2CCOCC2)NC(=O)Nc2cc(C)ccc2Cl)cc1 | COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 | COc1ccc(C(C)(C)[C@H](CCCC2CCOCC2)NC(=O)Nc2cc(C)ccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]689"
} |
Can you make molecule COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@]2(C3CCOCC3)CCC[C@@H](NC(=O)Nc3cc(C)ccc3Cl)C2)cc1 | COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 | COc1ccc([C@@]2(C3CCOCC3)CCC[C@@H](NC(=O)Nc3cc(C)ccc3Cl)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@H]689"
} |
Can you make molecule COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)[C@H](CCNC(=O)Nc2cc(C)ccc2Cl)CC2CCOCC2)cc1 | COc1ccc([C@@H](NC(=O)Nc2cc(C)ccc2Cl)C2CCOCC2)cc1 | COc1ccc(C(=O)[C@H](CCNC(=O)Nc2cc(C)ccc2Cl)CC2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@H](C&)C&=O",
"old_substring": "[C@H]689"
} |
Can you make molecule C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccs1)[C@H](N)CCC[C@@H]1CCCC[C@@H]1[NH3+] | C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] | C[C@H](Cc1cccs1)[C@H](N)CCC[C@@H]1CCCC[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccs1)N1CCN=C1CC[C@@H]1CCCC[C@@H]1[NH3+] | C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] | C[C@H](Cc1cccs1)N1CCN=C1CC[C@@H]1CCCC[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccs1)c1nc(C#N)c(C[C@@H]2CCCC[C@@H]2[NH3+])o1 | C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] | C[C@H](Cc1cccs1)c1nc(C#N)c(C[C@@H]2CCCC[C@@H]2[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccs1)c1cc(C#N)c(C[C@@H]2CCCC[C@@H]2[NH3+])s1 | C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] | C[C@H](Cc1cccs1)c1cc(C#N)c(C[C@@H]2CCCC[C@@H]2[NH3+])s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccs1)c1ccc(C[C@@H]2CCCC[C@@H]2[NH3+])c(C#N)c1 | C[C@H](Cc1cccs1)N(C)C[C@@H]1CCCC[C@@H]1[NH3+] | C[C@H](Cc1cccs1)c1ccc(C[C@@H]2CCCC[C@@H]2[NH3+])c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH3+])c1nc2cc(SC(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(SC(F)(F)F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH3+])c1nc2cc(CCCC(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(CCCC(F)(F)F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH3+])c1nc2cc(CCCCC(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(CCCCC(F)(F)F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH3+])c1nc2cc(C(F)(F)C(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(C(F)(F)C(F)(F)F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH3+])c1nc2cc(CC(F)(F)C(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(C(F)(F)F)ccc2n1C | C[C@H]([NH3+])c1nc2cc(CC(F)(F)C(F)(F)F)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCc3nnc(CCCCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(CCCCc4ccccc4)n3CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C7C9"
} |
Can you make molecule COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCc3nnc(CCCCCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(CCCCCc4ccccc4)n3CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C7C9"
} |
Can you make molecule COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCc3nnc(C4CC(c5ccccc5)C4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(C4CC(c5ccccc5)C4)n3CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C7C9"
} |
Can you make molecule COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCc3nnc([C@@H](C)CCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc([C@@H](C)CCc4ccccc4)n3CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C7C9"
} |
Can you make molecule COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCc3nnc(C4CCC(c5ccccc5)CC4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(CCc4ccccc4)n3CC2)c1 | COc1cccc(CN2CCc3nnc(C4CCC(c5ccccc5)CC4)n3CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C7C9"
} |
Can you make molecule O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(N[C@H]2CCS(=O)(=O)C2)CCN1C1CC[NH2+]CC1 | O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 | O=C1C2=CC=CC2=C(N[C@H]2CCS(=O)(=O)C2)CCN1C1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C24"
} |
Can you make molecule O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(N[C@H]2CCS(=O)(=O)C2)cc(C2CC[NH2+]CC2)ccc2oc1-2 | O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 | O=Cc1c(N[C@H]2CCS(=O)(=O)C2)cc(C2CC[NH2+]CC2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C24"
} |
Can you make molecule O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1CC[NH2+]CC1)N[C@H]1CCS(=O)(=O)C1 | O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 | O=C(/C=C/SC1CC[NH2+]CC1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C24"
} |
Can you make molecule O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N[C@H]2CCS(=O)(=O)C2)nc1C1CC[NH2+]CC1 | O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 | O=Cc1sc(N[C@H]2CCS(=O)(=O)C2)nc1C1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C24"
} |
Can you make molecule O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N[C@H]2CCS(=O)(=O)C2)sc1C1CC[NH2+]CC1 | O=C(N[C@H]1CCS(=O)(=O)C1)C1CC[NH2+]CC1 | O=Cc1nc(N[C@H]2CCS(=O)(=O)C2)sc1C1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C24"
} |
Can you make molecule COCC[C@H](C)C(=O)N[C@@H](C)COC less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](C)C(=O)N1CC([C@@H](C)COC)C1 | COCC[C@H](C)C(=O)N[C@@H](C)COC | COCC[C@H](C)C(=O)N1CC([C@@H](C)COC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N14"
} |
Can you make molecule COCC[C@H](C)C(=O)N[C@@H](C)COC less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](C)C(=O)N1CCN=C1S[C@@H](C)COC | COCC[C@H](C)C(=O)N[C@@H](C)COC | COCC[C@H](C)C(=O)N1CCN=C1S[C@@H](C)COC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N14"
} |
Can you make molecule COCC[C@H](C)C(=O)N[C@@H](C)COC less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](C)C(=O)CN1CCC([C@@H](C)COC)CC1 | COCC[C@H](C)C(=O)N[C@@H](C)COC | COCC[C@H](C)C(=O)CN1CCC([C@@H](C)COC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N14"
} |
Can you make molecule COCC[C@H](C)C(=O)N[C@@H](C)COC less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](C)C(=O)SN1CCN([C@@H](C)COC)CC1 | COCC[C@H](C)C(=O)N[C@@H](C)COC | COCC[C@H](C)C(=O)SN1CCN([C@@H](C)COC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N14"
} |
Can you make molecule COCC[C@H](C)C(=O)N[C@@H](C)COC less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](C)C(=O)N1CCN=C1C[C@@H](C)COC | COCC[C@H](C)C(=O)N[C@@H](C)COC | COCC[C@H](C)C(=O)N1CCN=C1C[C@@H](C)COC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N14"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1I | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)c1cc(CN2CC[NH+](C)CC2)ccc1Br | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 | Cc1cc(N(C)C)ccc1NC(=O)c1cc(CN2CC[NH+](C)CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1Cl | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)c1cccc(CN2CC[NH+](C)CC2)c1Br | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 | Cc1cc(N(C)C)ccc1NC(=O)c1cccc(CN2CC[NH+](C)CC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)c1cccc(CN2CC[NH+](C)CC2)c1Cl | Cc1cc(N(C)C)ccc1NC(=O)c1ccc(CN2CC[NH+](C)CC2)cc1 | Cc1cc(N(C)C)ccc1NC(=O)c1cccc(CN2CC[NH+](C)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNSC(=O)C[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNSC(=O)C[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNCC(=C=O)C[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNCC(=C=O)C[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)CCCC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC(=O)CCCC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)CC(C)(C)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC(=O)CC(C)(C)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC[S@+]([O-])CCC[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC(=O)[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | C[C@H](CNC[S@+]([O-])CCC[C@H]1CC[NH2+][C@@H]1C)C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C25=O"
} |
Can you make molecule CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc([C@H](CNC(=O)CCCC(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)CCCC(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc([C@H](CNC(=O)CCC(=O)CNc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)CCC(=O)CNc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc([C@H](CNC[S@+]([O-])CCC(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC[S@+]([O-])CCC(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc([C@H](CNC(=O)CCCS(=O)(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)CCCS(=O)(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc([C@H](CNC(=O)C(C)(F)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | CN(C)c1ccc([C@H](CNC(=O)C(C)(F)C(=O)Nc2ccccc2C#N)N2CC[NH+](C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CCOc1ncnc(S(=O)(=O)CC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ncnc(OC2=CC=CC=C3CC3(C)C2)c1N | CCOc1ncnc(S(=O)(=O)CC)c1N | CCS(=O)(=O)c1ncnc(OC2=CC=CC=C3CC3(C)C2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCOc1ncnc(S(=O)(=O)CC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ncnc(OC2=NC3=C(CCCC2(C)C)S3)c1N | CCOc1ncnc(S(=O)(=O)CC)c1N | CCS(=O)(=O)c1ncnc(OC2=NC3=C(CCCC2(C)C)S3)c1N | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CCOc1ncnc(S(=O)(=O)CC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ncnc(OC2=CC=C3C=C3CC(C)(C)O2)c1N | CCOc1ncnc(S(=O)(=O)CC)c1N | CCS(=O)(=O)c1ncnc(OC2=CC=C3C=C3CC(C)(C)O2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCOc1ncnc(S(=O)(=O)CC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ncnc(OC2=CC=C3C=C3CCN2C)c1N | CCOc1ncnc(S(=O)(=O)CC)c1N | CCS(=O)(=O)c1ncnc(OC2=CC=C3C=C3CCN2C)c1N | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CCOc1ncnc(S(=O)(=O)CC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ncnc(OCCCCC23CC2C3)c1N | CCOc1ncnc(S(=O)(=O)CC)c1N | CCS(=O)(=O)c1ncnc(OCCCCC23CC2C3)c1N | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.