Datasets:
ChemO release 1.0, included ICHO 2025 MAE Problems and Solutions, ChemO Dataset (well-constructed JSON files)
b7dd1a0 verified | [ | |
| { | |
| "name": "IChO-2025_1", | |
| "background": { | |
| "image": "images/1/1_bg.png", | |
| "context": "Sesquiterpenes have the formula C_{15}H_{24}. They are secondary metabolites in plants and both deter insects which eat plants and attract animals which eat the insects. Isocaryophyllene (i-Cy) is a sesquiterpene found in oregano, rosemary, pepper, and cloves. The structural formula of i-Cy can be determined by performing various reactions and analysing the products as shown in the figure." | |
| }, | |
| "points": 34 | |
| }, | |
| { | |
| "name": "IChO-2025_1.1", | |
| "modality": "image + text", | |
| "type": "Structure Construction", | |
| "evaluation": "Structure Match", | |
| "requirement": "", | |
| "points": 7, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Draw the structures of i-Cy, A, and B.", | |
| "image": "images/1/1.1_ques.png", | |
| "requirement": "Convert the drawn structures to SMILES format (stereochemistry not required).", | |
| "parsing_note": "The reaction diagram has been converted to reaction_scheme.", | |
| "reaction_scheme": [ | |
| { | |
| "reactant_name": "i-Cy", | |
| "reactant_formula": "C_{15}H_{24}", | |
| "conditions": "H_{2}, Pd/C", | |
| "product_name": "B", | |
| "product_formula": "C_{15}H_{28}" | |
| }, | |
| { | |
| "reactant_name": "i-Cy", | |
| "reactant_formula": "C_{15}H_{24}", | |
| "conditions": "(1) BH_{3}/THF (1/3 equiv.), THF ; (2) H_{2}O_{2}, NaOH, H_{2}O", | |
| "product_name": "A", | |
| "product_formula": "C_{15}H_{26}O" | |
| }, | |
| { | |
| "reactant_name": "i-Cy", | |
| "reactant_formula": "C_{15}H_{24}", | |
| "conditions": "(1) O_{3}, CH_{2}Cl_{2}; (2) Zn, CH_{3}COOH", | |
| "product_smiles": [ | |
| "C=O", | |
| "CC1([C@]([H])(CCC(C)=O)[C@@](C(CCC([H])=O)=O)(C1)[H])C" | |
| ] | |
| }, | |
| { | |
| "reactant_name": "A", | |
| "reactant_formula": "C_{15}H_{26}O", | |
| "conditions": "(1) O_{3}, CH_{2}Cl_{2}; (2) Zn, CH_{3}COOH", | |
| "product_name": "C", | |
| "product_smiles": "CC1(C)[C@]([C@@]([H])([C@](CO)(CCC([H])=O)[H])C1)([H])CCC(C)=O" | |
| } | |
| ] | |
| }, | |
| "answer": [ | |
| { | |
| "name": "A", | |
| "image": "images/1/1.1_ans_A.png", | |
| "smiles": "CC1=CCC[C@@H](CO)[C@]2([H])[C@]([H])(C(C)(C)C2)CC1", | |
| "alternative_smiles": "CC1=CCCC(CO)C2([H])C([H])(C(C)(C)C2)CC1", | |
| "points": 2, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "if missing a carbon atom in the ring or added another carbon atom in the ring.", | |
| "deduction": -1 | |
| } | |
| ], | |
| "notes": "Stereochemistry will not be marked for A." | |
| } | |
| }, | |
| { | |
| "name": "B", | |
| "image": "images/1/1.1_ans_B.png", | |
| "smiles": "CC1CC[C@@]([H])(C(C)(C)C2)[C@@]2([H])C(C)CCC1", | |
| "alternative_smiles": "CC1CCC([H])(C(C)(C)C2)C2([H])C(C)CCC1", | |
| "points": 2, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "If the structure is incorrect, but consistent with isocaryophyllene (and 2 equivalents of $H_2$ are added).", | |
| "deduction": 0 | |
| } | |
| ], | |
| "notes": "Also 2 pt Stereochemistry will not be marked for B." | |
| } | |
| }, | |
| { | |
| "name": "i-Cy", | |
| "image": "images/1/1.1_ans_i-Cy.png", | |
| "smiles": "C/C(CC[C@]1([H])[C@]2([H])CC1(C)C)=C/CCC2=C", | |
| "alternative_smiles": "C/C(CCC1([H])C2([H])CC1(C)C)=C/CCC2=C", | |
| "points": 3, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "If missing a carbon atom or added another carbon atom in the ring.", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "If a ring is made by combining two other C atoms and added a methyl to the other carbon", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "If no second ring is present; only added CH3 to all/one/two carbonyls in the right-hand structure.", | |
| "deduction": -2 | |
| } | |
| ], | |
| "notes": "The trans-isomer gets full marks. Stereochemistry will not be marked for i-Cy." | |
| } | |
| } | |
| ] | |
| }, | |
| { | |
| "name": "IChO-2025_1.2", | |
| "modality": "image + text", | |
| "type": "Qualitative Identification", | |
| "evaluation": "Selection Check", | |
| "points": 3, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Circle the stereocentres in compound C and assign them as R or S.", | |
| "image": "images/1/1.2_ques.png", | |
| "parsing_note": "The structure in the image has been converted to SMILES format.", | |
| "smiles": "[H][C@@]1(C(C)(C)C[C@]1([H])[C@@](CCC([H])=O)(CO)[H])CCC(C)=O", | |
| "requirement": "1) Count only carbon atoms (C) in the SMILES string from left to right, ignoring all other atoms like H, O, N. Number each carbon sequentially as C-1, C-2, C-3, etc. 2) Assign R or S configuration to each. Output format: 'C-X: R/S'." | |
| }, | |
| "answer": { | |
| "context": "C-1: R, C-6: S, C-7: R", | |
| "image": "images/1/1.2_ans.png", | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "Each centre not correctly circled", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "Each descriptor not correct", | |
| "deduction": -0.5 | |
| }, | |
| { | |
| "condition": "Each incorrect centre is circled.", | |
| "deduction": -1 | |
| } | |
| ], | |
| "notes": "Minimum score is 0" | |
| }, | |
| "points": 3 | |
| } | |
| }, | |
| { | |
| "name": "IChO-2025_1.3", | |
| "modality": "image + text", | |
| "type": "Structure Construction", | |
| "evaluation": "Structure Match", | |
| "points": 6, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Clovene (Cv) can be synthesised from i-Cy under acid catalysis. The synthesis of Cv starts from compound D. Draw the structures of compounds E and F.", | |
| "image": "images/1/1.3_ques.png", | |
| "parsing_note": "The reaction diagram has been converted to reaction_scheme.", | |
| "requirement": "Convert the drawn structures to SMILES format (stereochemistry not required).", | |
| "reaction_scheme": [ | |
| { | |
| "reactant_name": "D", | |
| "reactant_smiles": "C[C@@]1(CCC2)C=CC(O)[C@@]2(CC(OC)=O)C1", | |
| "conditions": "H^{+} (cat.)", | |
| "product_name": "E", | |
| "product_formula": "C_{12}H_{16}O_{2}" | |
| }, | |
| { | |
| "reactant_name": "E", | |
| "reactant_formula": "C_{12}H_{16}O_{2}", | |
| "conditions": "1) LiAlH_{4}, Et_{2}O; 2) H^{+}, H_{2}O", | |
| "product_name": "F" | |
| }, | |
| { | |
| "reactant_name": "F", | |
| "step_name": "1", | |
| "product_name": "G", | |
| "product_smiles": "C[C@]1(C=C2)CCC[C@](CCO)(C1)C2=O" | |
| }, | |
| { | |
| "reactant_name": "G", | |
| "reactant_smiles": "C[C@]1(C=C2)CCC[C@](CCO)(C1)C2=O", | |
| "step_name": "2", | |
| "product_name": "H", | |
| "product_smiles": "C[C@]1(C=C2)CCC[C@](CC(O)=O)(C1)C2=O" | |
| } | |
| ] | |
| }, | |
| "answer": [ | |
| { | |
| "name": "E", | |
| "image": "images/1/1.3_ans_E.png", | |
| "smiles": "O=C1C[C@@]23C[C@@](CCC3)(C)C=C[C@H]2O1", | |
| "alternative_smiles": "O=C1CC23CC(CCC3)(C)C=CC2O1", | |
| "points": 3, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "If the structure is not cyclic and only the ester is removed.", | |
| "deduction": -2 | |
| } | |
| ], | |
| "notes": "Stereochemistry will not be marked." | |
| } | |
| }, | |
| { | |
| "name": "F", | |
| "image": "images/1/1.3_ans_F.png", | |
| "smiles": "O[C@H]1[C@@]2(CCO)C[C@@](CCC2)(C)C=C1", | |
| "alternative_smiles": "OC1C2(CCO)CC(CCC2)(C)C=C1", | |
| "points": 3, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "If reducing the ester to an aldehyde (and alcohol).", | |
| "deduction": -2 | |
| } | |
| ], | |
| "notes": "Stereochemistry will not be marked." | |
| } | |
| } | |
| ] | |
| }, | |
| { | |
| "name": "IChO-2025_1.4-5", | |
| "modality": "image + text", | |
| "type": "Qualitative Identification", | |
| "evaluation": "Selection Check", | |
| "points": 2, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Clovene (Cv) can be synthesised from i-Cy under acid catalysis. The synthesis of Cv starts from compound D. For steps '1' and '2' several reagents could be considered. For example: A. PCC B. K_{2}Cr_{2}O_{7}, H_{2}SO_{4}, H_{2}O C. MnO_{2} D. (i) OsO_{4} , (ii) KHSO_{3} From the reagents above, tick which one(s) would be suitable for step '1'. From the reagents above, tick which one(s) would be suitable for step '2'.", | |
| "image": "images/1/1.4-5_ques.png", | |
| "parsing_note": "The structure in the image has been converted to SMILES format.", | |
| "smiles": { | |
| "name": "PCC", | |
| "components": [ | |
| "c1cc[nH+]cc1", | |
| "[O-][Cr](Cl)(=O)=O" | |
| ] | |
| }, | |
| "requirement": "Convert the drawn structures to SMILES format (stereochemistry not required)." | |
| }, | |
| "answer": [ | |
| { | |
| "name": "step 1", | |
| "choice": "C", | |
| "points": 1 | |
| }, | |
| { | |
| "name": "step 2", | |
| "choice": "B", | |
| "points": 1 | |
| } | |
| ] | |
| }, | |
| { | |
| "name": "IChO-2025_1.6", | |
| "modality": "image + text", | |
| "type": "Structure Construction", | |
| "evaluation": "Structure Match", | |
| "points": 8, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Draw the structures of compounds I, J, and K.", | |
| "image": "images/1/1.6_ques.png", | |
| "parsing_note": "The reaction diagram has been converted to reaction_scheme.", | |
| "requirement": "Convert the drawn structures to SMILES format (stereochemistry not required).", | |
| "reaction_scheme": [ | |
| { | |
| "reactant_name": "H", | |
| "reactant_smiles": "C[C@]1(C=C2)CCC[C@](CC(O)=O)(C1)C2=O", | |
| "conditions": "1) H_{2}, Pd/C; 2) CH_{3}OH H^{+}", | |
| "product_name": "I" | |
| }, | |
| { | |
| "reactant_name": "I", | |
| "conditions": "1) HOCH_{2}CH_{2}OH, H^{+}; 2) NaOH, H_{2}O", | |
| "product_name": "J" | |
| }, | |
| { | |
| "reactant_name": "J", | |
| "conditions": "1) SOCl_{2}; 2) Et_{2}CuLi; 3) H^{+}, H_{2}O", | |
| "product_name": "K" | |
| }, | |
| { | |
| "reactant_name": "K", | |
| "conditions": "1) NaOH, H_{2}O, Δ", | |
| "intermediate_smiles": "CC1=C2CC[C@]3(CCC[C@]2(CC1=O)C3)C", | |
| "product_name": "Cv", | |
| "product_smiles": "CC1([C@@]2(CC[C@]3(CCC[C@]2(C=C1)C3)C)[H])C" | |
| } | |
| ] | |
| }, | |
| "answer": [ | |
| { | |
| "name": "I", | |
| "image": "images/1/1.6_ans_I.png", | |
| "smiles": "O=C1C=C[C@]2(CCC[C@]1(CC(OC)=O)C2)C", | |
| "alternative_smiles": "O=C1C=CC2(CCCC1(CC(OC)=O)C2)C", | |
| "points": 3, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "if double bond is not reduced.", | |
| "deduction": -2 | |
| }, | |
| { | |
| "condition": "if ester is not formed", | |
| "deduction": -1 | |
| } | |
| ], | |
| "notes": "Stereochemistry will not be marked for I. Minimum score is 0 pt." | |
| } | |
| }, | |
| { | |
| "name": "J", | |
| "image": "images/1/1.6_ans_J.png", | |
| "smiles": "CC1CC[C@@]([H])(C(C)(C)C2)[C@@]2([H])C(C)CCC1", | |
| "alternative_smiles": "CC1CCC([H])(C(C)(C)C2)C2([H])C(C)CCC1", | |
| "points": 2, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "if acetal group is incorrect/not present.", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "if original ester is still present; protective group is in place.", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "if ester is formed with ethylene glycol.", | |
| "deduction": -1.5 | |
| } | |
| ], | |
| "notes": "Stereochemistry will not be marked for I. Minimum score is 0 pt." | |
| } | |
| }, | |
| { | |
| "name": "K", | |
| "image": "images/1/1.6_ans_K.png", | |
| "smiles": "O=C1C=C[C@]2(CCC[C@]1(CC(CC)=O)C2)C", | |
| "alternative_smiles": "O=C1C=CC2(CCCC1(CC(CC)=O)C2)C", | |
| "points": 3, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "If acetal protecting group is still present.", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "If acid is turned into acid chloride and protective group is removed.", | |
| "deduction": -2 | |
| }, | |
| { | |
| "condition": "If five-membered ring is already formed with an alcohol group still present.", | |
| "deduction": -2 | |
| } | |
| ], | |
| "notes": "Stereochemistry will not be marked for I. Minimum score is 0 pt." | |
| } | |
| } | |
| ] | |
| }, | |
| { | |
| "name": "IChO-2025_1.7-8", | |
| "modality": "image + text", | |
| "type": "Structure Construction", | |
| "evaluation": "Structure Match", | |
| "points": 4, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Humulene (Hu) is another sesquiterpene. It can be converted to α-caryophyllene alcohol (α-Ca), which is similar in structure to Cv. This conversion is an acid-catalysed hydration reaction which takes place via multiple intermediate structures. Incomplete structures of some intermediates, X and Y, are shown. The transformation from Hu to X is an acid-catalysed isomerisation reaction. Intermediate Y is charged.", | |
| "image": "images/1/1.7-8_ques.png", | |
| "parsing_note": "The reaction diagram has been converted to reaction_scheme.", | |
| "requirement": "Convert the completed structures to SMILES format.", | |
| "reaction_scheme": [ | |
| { | |
| "reactant_name": "Hu", | |
| "reactant_smiles": "CC1(C)C/C=C(C)/CC/C=C(C)/C/C=C/1", | |
| "conditions": "H^{+} (cat.)", | |
| "product_name": "X", | |
| "product_smiles": "CC1CCC(C)(C)CCC(C)CCC1" | |
| }, | |
| { | |
| "reactant_name": "X", | |
| "reactant_smiles": "CC1CCC(C)(C)CCC(C)CCC1", | |
| "conditions": "+H^{+}", | |
| "product_name": "Y", | |
| "product_smiles": "CC1(CC2C3(C)CCCC(C)C3C2C1)C" | |
| }, | |
| { | |
| "reactant_name": "Y", | |
| "reactant_smiles": "CC1(CC2C3(C)CCCC(C)C3C2C1)C", | |
| "conditions": "1) H_{2}O, -H^{+}", | |
| "product_name": "α-Ca", | |
| "product_smiles": "CC1(C)CC(C2C1)C3(CCCC2(C3O)C)C" | |
| } | |
| ] | |
| }, | |
| "answer": [ | |
| { | |
| "name": "X", | |
| "image": "images/1/1.7-8_ans_X.png", | |
| "smiles": "CC1=C\\CC/C(C)=C/CC(C)(C)C/C=C/1", | |
| "alternative_smiles": "C/C1=C/C=C/C(C)(C)C/C=C(C)/CCC1", | |
| "points": 2, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "for each mistake down to zero.", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "if all double bonds are mirrored.", | |
| "deduction": -1 | |
| } | |
| ] | |
| } | |
| }, | |
| { | |
| "name": "Y", | |
| "image": "images/1/1.7-8_ans_Y.png", | |
| "smiles": "CC1(C)CC2C3(CCC[C+](C3C2C1)C)C", | |
| "points": 2, | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "if any other charge or group has been added to the structure.", | |
| "deduction": -2 | |
| } | |
| ] | |
| } | |
| } | |
| ] | |
| }, | |
| { | |
| "name": "IChO-2025_1.9", | |
| "modality": "image + text", | |
| "type": "Qualitative Identification", | |
| "evaluation": "Selection Check", | |
| "points": 2, | |
| "field": "", | |
| "source": "IChO-2025", | |
| "question": { | |
| "context": "Five carbon atoms are circled in Hu. Through understanding the mechanism we can determine where these five carbon atoms end up in α-Ca. Circle the five corresponding carbon atoms in α-Ca which are circled in Hu.", | |
| "image": [ | |
| { | |
| "Hu": "images/1/1.9_ques_Hu.png" | |
| }, | |
| { | |
| "Y": "images/1/1.9_ques_α-Ca.png" | |
| } | |
| ], | |
| "smiles": { | |
| "Hu": "CC1(C)CC/C=C(C)/CC/C=C(C)/C/C=C/1", | |
| "Y": "CC1(CC(C2(C)CCCC3(C)C2O)C3C1)C" | |
| }, | |
| "parsing_note": "The structure in the image has been converted to SMILES format.", | |
| "requirement": "1) Count only carbon atoms (C) in the SMILES string from left to right, ignoring all other atoms like H, O, N. Number each carbon sequentially as C-1, C-2, C-3, etc. 2) In Hu, C-6, C-7, C-12, C-14, C-15 are circled based on Hu smiles. 2) Give the five corresponding carbon atoms in α-Ca which are circled in Hu, Output format: 'C-X, C-X'." | |
| }, | |
| "answer": { | |
| "context": "C-5, C-6, C-8, C-12, C-13", | |
| "image": "images/1/1.9_ans.png", | |
| "grading": { | |
| "partial_credit": [ | |
| { | |
| "condition": "if five circles are correct.", | |
| "deduction": 0 | |
| }, | |
| { | |
| "condition": "if four circles are correct and one incorrect or missing.", | |
| "deduction": -1 | |
| }, | |
| { | |
| "condition": "for more than five carbons circled or two or more incorrect/missing.", | |
| "deduction": -2 | |
| } | |
| ], | |
| "notes": "Minimum score is 0" | |
| }, | |
| "points": 2 | |
| } | |
| } | |
| ] | |