| import sys |
| import os |
| import xgboost as xgb |
| import torch |
| import numpy as np |
| from transformers import AutoModelForMaskedLM |
| import warnings |
| import numpy as np |
| from rdkit.Chem import Descriptors, rdMolDescriptors |
| from rdkit import Chem, rdBase, DataStructs |
| from rdkit.Chem import AllChem |
| from typing import List |
| from transformers import AutoModelForMaskedLM |
|
|
|
|
| rdBase.DisableLog('rdApp.error') |
| warnings.filterwarnings("ignore", category=DeprecationWarning) |
| warnings.filterwarnings("ignore", category=UserWarning) |
| warnings.filterwarnings("ignore", category=FutureWarning) |
|
|
| def fingerprints_from_smiles(smiles: List, size=2048): |
| """ Create ECFP fingerprints of smiles, with validity check """ |
| fps = [] |
| valid_mask = [] |
| for i, smile in enumerate(smiles): |
| mol = Chem.MolFromSmiles(smile) |
| valid_mask.append(int(mol is not None)) |
| fp = fingerprints_from_mol(mol, size=size) if mol else np.zeros((1, size)) |
| fps.append(fp) |
|
|
| fps = np.concatenate(fps, axis=0) |
| return fps, valid_mask |
|
|
|
|
| def fingerprints_from_mol(molecule, radius=3, size=2048, hashed=False): |
| """ Create ECFP fingerprint of a molecule """ |
| if hashed: |
| fp_bits = AllChem.GetHashedMorganFingerprint(molecule, radius, nBits=size) |
| else: |
| fp_bits = AllChem.GetMorganFingerprintAsBitVect(molecule, radius, nBits=size) |
| fp_np = np.zeros((1,)) |
| DataStructs.ConvertToNumpyArray(fp_bits, fp_np) |
| return fp_np.reshape(1, -1) |
|
|
| def getMolDescriptors(mol, missingVal=0): |
| """ calculate the full list of descriptors for a molecule """ |
|
|
| values, names = [], [] |
| for nm, fn in Descriptors._descList: |
| try: |
| val = fn(mol) |
| except: |
| val = missingVal |
| values.append(val) |
| names.append(nm) |
|
|
| custom_descriptors = {'hydrogen-bond donors': rdMolDescriptors.CalcNumLipinskiHBD, |
| 'hydrogen-bond acceptors': rdMolDescriptors.CalcNumLipinskiHBA, |
| 'rotatable bonds': rdMolDescriptors.CalcNumRotatableBonds,} |
| |
| for nm, fn in custom_descriptors.items(): |
| try: |
| val = fn(mol) |
| except: |
| val = missingVal |
| values.append(val) |
| names.append(nm) |
| return values, names |
|
|
| def get_pep_dps_from_smi(smi): |
| try: |
| mol = Chem.MolFromSmiles(smi) |
| except: |
| print(f"convert smi {smi} to molecule failed!") |
| mol = None |
| |
| dps, _ = getMolDescriptors(mol) |
| return np.array(dps) |
|
|
|
|
| def get_pep_dps(smi_list): |
| if len(smi_list) == 0: |
| return np.zeros((0, 213)) |
| return np.array([get_pep_dps_from_smi(smi) for smi in smi_list]) |
|
|
| def check_smi_validity(smiles: list): |
| valid_smi, valid_idx = [], [] |
| for idx, smi in enumerate(smiles): |
| try: |
| mol = Chem.MolFromSmiles(smi) if smi else None |
| if mol: |
| valid_smi.append(smi) |
| valid_idx.append(idx) |
| except Exception as e: |
| |
| pass |
| return valid_smi, valid_idx |
|
|
| class Permeability: |
| |
| def __init__(self, tokenizer, base_path, device=None, emb_model=None): |
| self.device = torch.device("cuda" if torch.cuda.is_available() else "cpu") if device is None else device |
| self.predictor = xgb.Booster(model_file=f'{base_path}/TR2-D2/tr2d2-pep/scoring/functions/classifiers/permeability-xgboost.json') |
| if emb_model is not None: |
| self.emb_model = emb_model.to(self.device).eval() |
| else: |
| self.emb_model = AutoModelForMaskedLM.from_pretrained('aaronfeller/PeptideCLM-23M-all').roformer.to(device).eval() |
| |
| self.tokenizer = tokenizer |
|
|
| def generate_embeddings(self, sequences): |
| embeddings = [] |
| for sequence in sequences: |
| tokenized = self.tokenizer(sequence, return_tensors='pt') |
| tokenized = {k: v.to(self.device) for k, v in tokenized.items()} |
| with torch.no_grad(): |
| output = self.emb_model(**tokenized) |
| |
| embedding = output.last_hidden_state.mean(dim=1).squeeze(0).cpu().numpy() |
| embeddings.append(embedding) |
| return np.array(embeddings) |
| |
| def get_features(self, input_seqs: list, dps=False, fps=False): |
| |
| |
|
|
| if fps: |
| fingerprints = fingerprints_from_smiles(input_seqs)[0] |
| else: |
| fingerprints = torch.empty((len(input_seqs), 0)) |
| |
| if dps: |
| descriptors = get_pep_dps(input_seqs) |
| else: |
| descriptors = torch.empty((len(input_seqs), 0)) |
| |
| embeddings = self.generate_embeddings(input_seqs) |
| |
|
|
| features = np.concatenate([fingerprints, descriptors, embeddings], axis=1) |
| |
| return features |
| |
| def get_scores(self, input_seqs: list): |
| scores = -10 * np.ones(len(input_seqs)) |
| features = self.get_features(input_seqs) |
| |
| if len(features) == 0: |
| return scores |
| |
| features = np.nan_to_num(features, nan=0.) |
| features = np.clip(features, np.finfo(np.float32).min, np.finfo(np.float32).max) |
| |
| features = xgb.DMatrix(features) |
| |
| scores = self.predictor.predict(features) |
| return scores |
| |
| def __call__(self, input_seqs: list): |
| scores = self.get_scores(input_seqs) |
| return scores |
| |
| def unittest(): |
| permeability = Permeability() |
| seq = ['N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1cNc2c1cc(O)cc2)C(=O)N[C@@H](CC1=CN=C-N1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H]([C@@H](O)C(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CC(=CN2)C1=C2C=CC=C1)C(=O)O'] |
| scores = permeability(input_seqs=seq) |
| print(scores) |
|
|
|
|
| if __name__ == '__main__': |
| unittest() |