Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
1. Let b be i(2). Let m be (2/6)/((-2)/6). Let v be (-3 - -7)m/(-2). Is b at least v? False Suppose 2o - 3k - 40 = 0, -2k + 25 = 4o - 23. Is o < 13? False Let b = 12 + -4. Which is smaller: b or 7? 7 Let g = 5 + -6. Let q = g + 0. Does 0 = q? False Suppose -2j + k = -7, -4j - 3k + 25 = 6. Suppose 0 = -jw - 5c - 19, 2w + w = 2c - 20. Which is smaller: -7 or w? -7 Let d = -74.1 + 74. Which is smaller: d or 34? d Let k = 0.015 + -0.215. Let q(m) = -m - 1. Let w be q(0). Which is smaller: w or k? w Let m(n) = n3 + n2 + n - 1. Let s be m(0). Which is bigger: s or -0.09? -0.09 Let d = -252 + 767/3. Which is smaller: 4 or d? d Let b be (-2 - 1)2/(-6). Let i(a) = a + 4. Let w be i(-3). Is b less than or equal to w? True Let v = -1.82 + 2.12. Let x = -3.1 + 3. Let w = 0 - x. Are w and v equal? False Suppose 298 + 341 = -9d. Is -71 equal to d? True Let v = 0.02 + -0.42. Let p = 0.4 + v. Let o = -0.1 + p. Which is smaller: 0.2 or o? o Let m = 6 - 17/3. Let v be 214/30 + -1. Let o = v - m. Which is smaller: o or -2? -2 Suppose 5u + 8 = 33. Suppose 8 + 17 = -uz. Is -4 >= z? True Let x(r) = r2 - 7r + 11. Let o be x(5). Which is greater: -3/10 or o? o Suppose 4l = 108 + 4. Let w = l + -139/5. Is -1 greater than or equal to w? False Let b be 35/616/(-15). Is b at most -5? True Let q = -0.2 - -0.6. Is q equal to 10? False Let q be (-1 + 2)1/(-1). Which is smaller: q or 0? q Suppose -4 = 5q - 14. Let g be 0((-1)/q + 1). Which is smaller: 1 or g? g Let g = 2/93 - 2143/186. Are g and -11 non-equal? True Let x = 32 - 35. Which is smaller: -22 or x? -22 Suppose 3r - 3a - 18 = -2a, 3r - 6 = 5a. Let c = -5 + r. Which is smaller: 7/3 or c? c Let k = 63 - 57. Which is greater: 13/2 or k? 13/2 Suppose 2r + 544 = -d, -2d = r + 313 + 787. Let w be d/(-56) - (-1)/7. Which is bigger: 8 or w? w Let h(o) = -o - 4 - 1 + 12. Let y be h(7). Which is bigger: y or 2/17? 2/17 Let v be (1 - 3/6)12. Let y be 2/1 + (-10)/v. Let z = 101/35 + -13/5. Which is smaller: y or z? z Let b = -1 - -1.5. Let g = b - 0.8. Which is smaller: g or 0? g Let o be (2 + -4 + 133)1. Let k = -1443/11 + o. Let v(g) = g + 4. Let l be v(-5). Is l > k? False Let b = 0 - 3. Let n be (-37)/b + 2/(-6). Let m be 2(-1 - n/(-11)). Is m less than or equal to 0? False Let r(l) = -3l + 4. Let h be r(3). Let a(s) = s*3 + 4s*2 - 7s - 7. Let f be a(h). Suppose 4v = v - f. Is 1/3 less than v? False Let b be (-8)/10(-2)/(-4). Let g = 0 + -0.4. Let t = g + 0.5. Is t greater than or equal to b? True Let d be (4/(-6))/((-6)/(-477)). Is -53 at least as big as d? True Let k be (1/(-3))/(3/9). Let n(d) = -d3 + d2. Let p be n(k). Which is smaller: 4/5 or p? 4/5 Let z be 2/4255/(-1). Which is greater: 0 or z? 0 Let u be ((-1)/2)/(1/12). Let r = -4 - u. Let y be (2/3)/(r/(-6)). Which is smaller: 0 or y? y Let c = -5 + 5.05. Let v = c + 5.95. Let m = v + -6. Is m greater than 0.2? False Let a = -15 - -13. Let r = -1 - 1. Is a at least as big as r? True Let r = -907/5 - -182. Is -0.11 bigger than r? False Suppose -10g + 5g = -15. Is -2/7 <= g? True Let q(s) = s3 + 12s*2 + 20s - 4. Let g be q(-10). Are g and -3 unequal? True Suppose 2u + 3 = 19. Let c be (u/(-10))/((-5)/(-25)). Is -4 <= c? True Suppose 8j = 6j + 8, 4l + 4j - 12 = 0. Let x = -9803/37 + 265. Which is greater: l or x? x Let q = -5/26 + 97/234. Let r(h) = -h + 9. Let t be r(8). Which is bigger: q or t? t Let k = -0.02 - -0.42. Let u = 0.1 - k. Let i = 1 + 0. Which is smaller: i or u? u Let u be 2/(-132/(-12) + -2). Is 2 greater than u? False Suppose -39 = -p + 4o, 3o = -2p - o + 42. Is p greater than or equal to 25? True Let a(w) = -w3 - 8w2 + 2. Let v be a(-8). Which is bigger: v or 3? 3 Let j be (-4)/(-10) - 3/(-5). Which is bigger: j or 2/39? j Let b(v) be the second derivative of v3/6 - 3v2 - v. Let i be b(7). Let u(q) = -q - 2. Let o be u(-4). Which is bigger: i or o? o Let y = 0.15 + -2.15. Is y less than -0.4? True Let m = 2381/9 - 265. Which is smaller: 1 or m? m Let u = 16 - 22. Let x = u + 4. Let v be x-33/(-18). Is -2/5 > v? True Suppose 0 = 5s - s + 40. Let m be 99/(-30) - (-2)/s. Is -3 not equal to m? True Let c = 24649/19 - 1297. Are 1 and c unequal? True Suppose 0 = 2i + 3c - 14, 3c - 14 = -2. Suppose -l = -2l - i. Let g be ((0 - -2) + -2)/l. Is 0 less than g? False Let r = -1.04 - -0.5. Let w = r - 0.06. Let n = w + 0.3. Which is bigger: 0.1 or n? 0.1 Suppose -3d + 4d + 2 = -3y, -y - 44 = -4d. Let b = d + -7. Suppose -br = r - 8. Is r > 4? False Let r = -39 - -40. Which is bigger: r or -1? r Let k = 3 + -2. Let o = -8.5 + 9. Are o and k non-equal? True Let n(b) = -4b - 13. Let u be n(-3). Is -1/4 greater than u? True Suppose 5y + 251 = 3j, y = 2y + 3j + 61. Which is smaller: y or -51? y Let m = -1987/35385 + -1/1011. Is 1 greater than or equal to m? True Let k = 18 - 18.02. Which is greater: -1 or k? k Let l(i) = i*3 - 12i*2. Let u be l(12). Which is smaller: 1/5 or u? u Suppose -c + 5 - 10 = 0. Let k = -7 - c. Is 0 smaller than k? False Suppose -3c - 4 - 5 = 0. Let n be (-7)/6 - c/6. Are -1 and n nonequal? True Suppose 0 = -a - 41 + 5. Let h = a + 250/7. Which is smaller: h or 0? h Let h = 0.8 - 0. Let c = h - 1.1. Which is greater: c or -0.1? -0.1 Let r = 0.783 - -0.017. Which is greater: r or 0.2? r Let z be 6/(-4) + 13/(-26). Is 2 > z? True Let m(b) = 6b - b2 + 37 - 18 - 23. Let v be m(5). Which is greater: 1/3 or v? v Let g = 15 - 14.6. Which is smaller: g or 5? g Let n(y) = -y2 + 3y + 3. Let z be n(4). Suppose f = -3l - 11, 4f = -6l + 8l + 12. Is z bigger than f? False Let c be ((-2)/(-28))/(6/(-36)). Let p = 10 - 11. Which is greater: c or p? c Let z be 1/((-3)/(-3) - 0). Let x be (z/3)/(2/(-6)). Let s be (1 + x - 0)/1. Is s equal to -1? False Let k = -19 - 7. Which is smaller: k or 2/3? k Let w = 1/44 + 83/220. Let p(n) = -n*2 + 6n + 3. Let i be p(7). Which is greater: i or w? w Suppose 5f = 5k - 9k + 3, -k - 3 = 5f. Let i be ((-1)/(-2))/((-2)/12). Is f not equal to i? True Let a(y) = -y*2 - 9y - 9. Let t be a(-8). Let g be 0 + 0 + 2/(-4). Which is smaller: t or g? t Let i = -582 + 1766/3. Which is smaller: i or 6? 6 Let l = -2.196 - 0.184. Let j = l + 2.5. Is j greater than 1? False Let b be (-16)/(-12)(-3)/2. Let n = -1 - b. Is 2 equal to n? False Suppose -13h + 166 = -393. Is h bigger than 45? False Let w = -2327 + 9237/4. Are w and -17 nonequal? True Let f(z) = -z*2 - 3z - 5. Let a be f(-4). Are a and -42/5 nonequal? True Let a = -57 + 57. Is a <= 3/34? True Let p = 6812/601 + -2/1803. Do p and -2/7 have the same value? False Let r(i) = i3 + i2 - 2i - 1. Let v be r(2). Suppose 0 = -d + v - 4. Let s(j) = j + 11. Let y be s(-8). Is d less than or equal to y? True Let j = 5.8 + -7. Let c = -1.1 - j. Which is greater: 3 or c? 3 Suppose y - 5 = -3d, 4y = 3d + 21 - 1. Is 7 < d? False Let a(k) = -k*2 - 10k - 16. Let h be a(-3). Let c(y) = 4y2 + 3y + 2. Let p be c(-2). Let z = h - p. Are z and -6 equal? False Let q(p) = -p*2 - p - 3. Suppose -w + 8 - 1 = -4h, -2h = 5w + 9. Let v be q(h). Are -5 and v non-equal? False Let s = 6.1 - 6. Let h = -0.12 - -8.12. Let c = h - 9. Is c >= s? False Let d = 0.06 - -0.14. Let s = d - 7.2. Is s at least 1? False Let s = 2.7 + 0.3. Let p = s + -2.96. Do p and -1 have the same value? False Let x be 1-3 + 6 + -7 + 3. Are 1/142 and x equal? False Let c be 51/13 + 2/(-3)6. Which is greater: 0 or c? 0 Let u be (-12)/(-2)(-3)/(-6). Let n(y) = y2 + 5y - 3. Let a be n(-6). Is u less than or equal to a? True Let i = -0.04 + 2.04. Let z = 1.9 - i. Is 1/5 equal to z? False Let v = 12.1 - 12. Let y = 1.8 - 0.8. Which is greater: v or y? y Let h = 1/3 - 7/12. Let v(c) = c*3 - 2c*2 + 2c - 3. Let s be v(2). Suppose 0 = -g - s. Are h and g non-equal? True Let f(v) = -v*2 - 3v + 4. Let u be f(-4). Let t = 45 - 139/3. Is u less than t? False Let n = -71 + 72. Which is greater: 2/137 or n? n Let u = -5 - -8. Is 4 <= u? False Let t(o) = -o*2 + 9o - 5. Let c = 17 + -9. Let p be t(c). Let i be (-2)/3p/2. Which is smaller: -2/17 or i? i Suppose 3u + 2 = -4t, 0 = -2u + 2t + t - 7. Is -10/9 equal to u? False Suppose -2d - 5u = 3, -4 = -d - 4d - u. Suppose 3m - 1 = 4o + 39, 32	{ "pile_set_name": "DM Mathematics" }
visor of v and b? 7 Let g be -2 - -1 - (-69)/(-6)-2. What is the highest common divisor of 154 and g? 22 Suppose -2a - 15 = -7a. Calculate the highest common factor of 12 and a. 3 Suppose 0s + 4s - 168 = 0. What is the greatest common divisor of 21 and s? 21 Let c = 51 + -30. Calculate the highest common factor of c and 3. 3 Let i(h) be the first derivative of -3 - 9/2h*2 + 0h. Let p be i(-2). What is the greatest common factor of p and 9? 9 Let g(a) = -a + 9. Let q be g(0). Suppose -5t + q = -61. Let i(o) = 2o - 6. Let c be i(4). Calculate the greatest common factor of t and c. 2 Suppose 6y - 82 = 4y. Suppose -15 = -3x + 4w, 4x = -2w + y + 1. What is the greatest common divisor of x and 1? 1 Suppose 15 = -2v + 5v. Calculate the highest common factor of v and 5. 5 Suppose 8 = -2c + 2n + 54, -32 = -c + 4n. Suppose -3y + 240 = y. What is the highest common divisor of y and c? 20 Let y be (2/(-3)12)/(-1 + 0). What is the greatest common factor of y and 8? 8 Let p be (-2)/(2/1)0. Let t be 3 + p + 19 + 3. What is the highest common factor of t and 10? 5 Let u(f) = -14f + 8 - f3 - 7f + 10f2 + 12f. Let m be u(9). Suppose -6w + 200 = -w. What is the highest common divisor of m and w? 8 Suppose 3r = r + 4. Suppose -2l = 2n - 56, 5n - 76 - 70 = -rl. Let j be ((-22)/6)/((-2)/n). Calculate the greatest common divisor of 11 and j. 11 Suppose 2p = -2n + 10, 5 = 4n + 3p - 13. Calculate the highest common divisor of 15 and n. 3 Suppose 29c + 630 = 34c. What is the greatest common divisor of c and 84? 42 Suppose 16 = 5h - 14. Let z be h/(-24) + (-42)/(-8). Calculate the greatest common divisor of 55 and z. 5 Let b = -7 - -12. Suppose b = -t - 1. Let h be 37/3 + 2/t. What is the highest common divisor of h and 48? 12 Suppose -n + 8 = -7. Let j(s) = -18s - 6. Let i be j(-4). Suppose k - 9 = i. Calculate the highest common factor of n and k. 15 Let v(a) = -4a + 2. Suppose -3 = w - 2. Let s be v(w). What is the highest common factor of 48 and s? 6 Let i(t) = 13t + 5. Let g be i(4). Let b be (2 - g/15)-5. Suppose -2x + 86 = 4k - 20, -5k = 4x - 131. What is the greatest common divisor of b and k? 9 Suppose 25 = -0a + a. Suppose 0t + t = 5. Calculate the highest common divisor of a and t. 5 Let z be (-2)/2 - (5 - 8). Suppose -zc + 260 = 64. Calculate the greatest common factor of c and 14. 14 Let g(v) = 2v2 + 7v - 2. Let a be g(-6). What is the highest common divisor of a and 7? 7 Let p(w) = -1 - 5w + w3 - 3w*2 + 5 + 2. Let d be p(4). Calculate the highest common divisor of 1 and d. 1 Let z(o) = -7o + 17. Let b be z(-7). Calculate the greatest common factor of 33 and b. 33 Let l be (-12)/(-2) - (-4)/2. Let i = 1 - -9. Let g be i/1 - (0 + 2). What is the highest common factor of g and l? 8 Let l(v) = -v*3 - 5v*2 + 4v. Let r = 23 + 7. Suppose -6b = -b + r. Let i be l(b). What is the highest common divisor of 12 and i? 12 Suppose -5f - l + 2624 - 757 = 0, 0 = 2f - 5l - 736. Suppose 3k = 2h - f, 4k - 236 = -2h + 116. Calculate the highest common factor of h and 26. 26 Let s(v) = -v*2 + 12v - 15. Let x be s(10). Suppose xu - 684 = u. What is the highest common divisor of 19 and u? 19 Let q(j) = 4j - 5j2 - 5j + 2 + 3j + j3. Let d = -8 - -13. Let c be q(d). Calculate the highest common factor of c and 108. 12 Let n = 21 + -20. Let z be (-51)/(-15) - (-4)/(-10). Suppose -n - z = -t. What is the highest common divisor of 6 and t? 2 Let h(r) = 5r - 44. Let x be h(13). Calculate the greatest common factor of 42 and x. 21 Let h(g) = 9g - 39. Let m be h(6). Calculate the greatest common divisor of 165 and m. 15 Suppose 0 = -3h + r + 136, 4h + 2 - 177 = -5r. Calculate the highest common factor of h and 105. 15 Suppose 5u - 42 = -z, 6z - 2z = -4u + 200. Calculate the highest common factor of 26 and z. 26 Suppose -2y - 9 = -y. Let l = -4 - y. Let i = l + -3. Calculate the highest common divisor of i and 16. 2 Suppose -2w = -6w + 44. Calculate the highest common divisor of w and 55. 11 Let k be 8/32 - 1/4. Suppose -70 = -t - kt. Calculate the highest common divisor of 10 and t. 10 Suppose 4v + 12 + 4 = 0. Let j be 128/9 + v/18. Let s = -8 + j. Calculate the greatest common factor of 24 and s. 6 Let l be (-1)/(-2) - 34/(-4). Let s(c) = -c3 - 6c*2 - 9c - 9. Let b be s(-6). Calculate the greatest common divisor of l and b. 9 Suppose 4i - 2i = 24. What is the greatest common divisor of 8 and i? 4 Let f(h) = 8h2 - h. Let r be f(1). What is the greatest common divisor of r and 35? 7 Suppose -4c = 2a - 66, 2c = -3a + a + 32. Suppose b - 14 = -3i + c, -52 = -4i - 4b. Let k = 30 + -21. Calculate the highest common divisor of i and k. 9 Suppose 2s = -s. Suppose s = 4n + n. Suppose -4c + 35 + 49 = n. What is the greatest common divisor of c and 21? 21 Let b(o) = -o3 - 15o*2 - 18o + 16. Let k be b(-14). Calculate the greatest common factor of 8 and k. 8 Suppose 101 + 76 = -3d. Let g = d - -101. Calculate the greatest common divisor of 21 and g. 21 Let t be (((-48)/15)/2)/((-5)/50). What is the highest common factor of 40 and t? 8 Let f = 43 + -39. Suppose -4 = -3v + 2. Suppose 3k = 5o + 36, vk = -2o + 17 + 7. What is the highest common factor of k and f? 4 Let c(g) = -42g - 1. Let t be c(-1). Let w = -14 + t. Calculate the greatest common divisor of 18 and w. 9 Let i = -35 + 41. Calculate the greatest common factor of i and 66. 6 Let s = 45 + -25. Calculate the greatest common divisor of s and 10. 10 Let v = -4 - -4. Let g be (1 - v)/(4/60). Let z = g + -5. Calculate the highest common divisor of z and 20. 10 Suppose 2m + 4m - 408 = 0. What is the highest common divisor of 4 and m? 4 Let s(n) = -n3 - 12n*2 - 5n - 16. Let h be s(-12). What is the greatest common factor of h and 4? 4 Let v = 12 - 9. Calculate the highest common factor of v and 3. 3 Let b(m) = 2m - 5. Let j be b(6). Suppose -p = -r - 3, r + 3p - 10 - 7 = 0. Suppose -7 = -ru + u. Calculate the highest common factor of u and j. 7 Let m(t) = t2 - t - 5. Let j(s) = 2s*2 - 7s + 3. Let r be j(5). Let a be 188/36 - 4/r. Let d be m(a). What is the highest common factor of d and 15? 15 Let s(a) = a*3 - 18a*2 + 28. Let i be s(18). Calculate the greatest common divisor of 196 and i. 28 Let k = 2 - 0. Suppose x + kx = 0. Suppose 31 = b - w - 2w, x = 4w - 12. Calculate the highest common factor of b and 8. 8 Suppose 0k + 8 = 2k. Suppose ks - 13 = -2o + 11, 5o - s - 49 = 0. Let f be (-2)/(-3) + 148/3. Calculate the highest common factor of f and o. 10 Let l = -6 + 8. Suppose 4k - lk = 12. Suppose -n = -5y - 22, 6n - 2n - 4y = 24. What is the highest common divisor of n and k? 2 Suppose -4t = -3k + 87, 3k + 2k - 110 = -5t. Calculate the greatest common factor of 10 and k. 5 Let j(a) = -4a2 - 1. Let b be j(-1). Let t be ((-4)/b)/(3/75). Calculate the greatest common divisor of t and 4. 4 Let i = 12 + -10. Calculate the highest common factor of 22 and i. 2 Let x(n) = n2 - 2n + 8. Let m be x(-6). Let y be 41 + (-6 - -9). Calculate the highest common factor of m and y. 7 Suppose n - 528 = -5n. Calculate the greatest common factor of n and 11. 11 Suppose 12 = -0m + 3m. Suppose -my = -49 - 59. Let i = 27 + -18. Calculate the greatest common factor of i and y. 9 Suppose -2d = y + 3y - 336, -4y - 4d + 340 = 0. Suppose 5s - y = -18. What is the highest common factor of 117 and s? 13 Suppose 0 = 9q - 10q - 3. Suppose -11 = -j + 3. Let i = j + q. Calculate the greatest common factor of 22 and i. 11 Let o = 32 + -23. What is the highest common divisor of 45 and o? 9 Suppose -3h + 480 = 129. Let z = h + -60. Calculate the greatest common divisor of z and 19. 19 Suppose -5b + 6y - 2y + 238 = 0, -4b = -5y - 194. Suppose 2q - b = -v, -51 - 15 = -v + 2q. Calculate the highest common factor of 14 and v. 14 Let s = -35 - -62. Let k = -17 + s. Calculate the greatest common factor of 80 and k. 10 Let j = 17 + -14. Suppose 0v = jv - k - 16, 0 = 2k + 2. What is the highest common factor of 5 and v? 5 Let o(h) = -1 - 13 - 3h - 1. Let m be o(-10). What is the highest common factor of m and 15? 15 Let x(g) = 2g - 4. Let s be x(3). Let d(z) = 7z - 1. Let f be d(-2). L	{ "pile_set_name": "DM Mathematics" }
picking 4 p? 1/210 What is prob of picking 1 b and 1 w when two letters picked without replacement from pfbpw? 1/10 What is prob of picking 1 c, 1 d, and 1 h when three letters picked without replacement from {f: 1, c: 2, h: 3, d: 1}? 6/35 Calculate prob of picking 1 z and 1 w when two letters picked without replacement from {z: 1, c: 3, w: 5}. 5/36 What is prob of picking 2 k and 1 o when three letters picked without replacement from {k: 2, a: 1, o: 1}? 1/4 Four letters picked without replacement from {x: 4, v: 3}. What is prob of picking 3 x and 1 v? 12/35 Calculate prob of picking 2 y when two letters picked without replacement from {i: 2, u: 7, y: 9}. 4/17 Two letters picked without replacement from {o: 1, e: 1, c: 1, i: 1, b: 1}. What is prob of picking 1 o and 1 e? 1/10 What is prob of picking 1 h and 3 i when four letters picked without replacement from ihhii? 2/5 Four letters picked without replacement from {d: 2, s: 2, r: 1, g: 4, n: 1}. Give prob of picking 2 g, 1 n, and 1 s. 2/35 Three letters picked without replacement from {l: 3, e: 5}. What is prob of picking 2 e and 1 l? 15/28 Two letters picked without replacement from ciwcicwiwiwcii. Give prob of picking 1 i and 1 c. 24/91 Two letters picked without replacement from krhhhhhhkkkkhhhhhhhh. What is prob of picking 1 h and 1 k? 7/19 Two letters picked without replacement from {d: 1, i: 3, c: 3, l: 7, r: 2, v: 1}. Give prob of picking 1 l and 1 v. 7/136 Calculate prob of picking 3 z when three letters picked without replacement from {z: 10, e: 4}. 30/91 Two letters picked without replacement from {s: 3, t: 3, k: 1, u: 2, b: 1}. What is prob of picking 1 s and 1 k? 1/15 What is prob of picking 2 i and 1 y when three letters picked without replacement from {q: 1, y: 3, i: 16}? 6/19 Two letters picked without replacement from {m: 17, j: 3}. Give prob of picking 1 m and 1 j. 51/190 Three letters picked without replacement from {r: 3, u: 6, c: 1, v: 3}. What is prob of picking 2 v and 1 u? 9/143 Calculate prob of picking 3 q when three letters picked without replacement from qeeedxqmeeqm. 1/220 Four letters picked without replacement from {r: 7}. Give prob of picking 4 r. 1 Three letters picked without replacement from {i: 2, r: 1, j: 1, s: 2, l: 1, v: 1}. What is prob of picking 1 v and 2 s? 1/56 Three letters picked without replacement from {t: 1, m: 1, c: 2, l: 10}. Give prob of picking 1 c, 1 t, and 1 m. 1/182 Three letters picked without replacement from glmlmlrmvv. Give prob of picking 1 l, 1 m, and 1 g. 3/40 Two letters picked without replacement from kkkkzkkkkkkkzkzkkz. Give prob of picking 2 k. 91/153 Calculate prob of picking 1 l and 1 i when two letters picked without replacement from {i: 2, l: 1}. 2/3 Three letters picked without replacement from mvvvtkvmtavvtvffmtat. What is prob of picking 2 f and 1 k? 1/1140 What is prob of picking 2 g when two letters picked without replacement from {g: 4, s: 1, l: 5}? 2/15 What is prob of picking 3 p when three letters picked without replacement from {p: 10}? 1 What is prob of picking 2 x and 1 v when three letters picked without replacement from {u: 1, e: 2, h: 1, x: 3, v: 3}? 3/40 Calculate prob of picking 1 n and 2 j when three letters picked without replacement from {j: 7, n: 12}. 84/323 What is prob of picking 2 h and 1 n when three letters picked without replacement from {n: 4, h: 3, k: 5}? 3/55 What is prob of picking 1 i and 1 c when two letters picked without replacement from {i: 7, c: 7, u: 2}? 49/120 Three letters picked without replacement from mmmmaalmymmmlaalmmm. Give prob of picking 1 a, 1 y, and 1 m. 44/969 Two letters picked without replacement from gggggaggga. Give prob of picking 2 g. 28/45 Two letters picked without replacement from enwpnjjpjp. What is prob of picking 1 e and 1 w? 1/45 Two letters picked without replacement from trrtrtr. What is prob of picking 2 t? 1/7 Two letters picked without replacement from {q: 2, j: 9}. Give prob of picking 2 q. 1/55 What is prob of picking 3 d when three letters picked without replacement from hhaadahdada? 1/165 Two letters picked without replacement from {k: 11, d: 5}. What is prob of picking 2 k? 11/24 What is prob of picking 1 j and 1 l when two letters picked without replacement from {l: 1, j: 2, p: 4, q: 2}? 1/18 Four letters picked without replacement from {a: 12, e: 2, p: 4, m: 2}. What is prob of picking 3 p and 1 a? 16/1615 What is prob of picking 2 q and 1 m when three letters picked without replacement from qmqmqmmmmqmam? 24/143 Two letters picked without replacement from {y: 1, o: 1, r: 1, i: 1, u: 1}. What is prob of picking 1 i and 1 y? 1/10 Calculate prob of picking 2 n and 1 w when three letters picked without replacement from awnwznanaanananan. 21/340 Three letters picked without replacement from {r: 1, t: 11, i: 3, x: 2, d: 1}. Give prob of picking 1 i, 1 x, and 1 r. 1/136 Calculate prob of picking 2 p when two letters picked without replacement from {p: 3, y: 1}. 1/2 Two letters picked without replacement from lzgz. Give prob of picking 1 g and 1 z. 1/3 Two letters picked without replacement from {q: 11, o: 2, v: 1, z: 1, i: 3}. What is prob of picking 1 o and 1 q? 22/153 Calculate prob of picking 1 f and 3 p when four letters picked without replacement from pfpppfpfpfff. 8/33 Calculate prob of picking 3 r and 1 f when four letters picked without replacement from rxfgx. 0 Three letters picked without replacement from {a: 9}. What is prob of picking 3 a? 1 Two letters picked without replacement from oppaoairjopp. What is prob of picking 2 p? 1/11 What is prob of picking 2 o when two letters picked without replacement from crgzczgccgoccrgzz? 0 Three letters picked without replacement from {y: 2, r: 3, z: 5, v: 5}. Give prob of picking 1 v and 2 z. 10/91 Calculate prob of picking 1 k and 1 p when two letters picked without replacement from {p: 2, l: 4, t: 2, m: 1, k: 1}. 2/45 Calculate prob of picking 2 c when two letters picked without replacement from {u: 2, c: 9}. 36/55 Four letters picked without replacement from {q: 4, g: 3, b: 2}. Give prob of picking 2 g and 2 q. 1/7 What is prob of picking 2 r and 2 t when four letters picked without replacement from {r: 3, t: 2}? 3/5 What is prob of picking 1 u and 3 q when four letters picked without replacement from {s: 1, u: 7, d: 2, n: 4, q: 4}? 7/765 Two letters picked without replacement from qqwsw. Give prob of picking 2 w. 1/10 Four letters picked without replacement from {a: 3, v: 2, x: 6, w: 8}. What is prob of picking 1 w, 1 v, and 2 a? 4/323 Calculate prob of picking 2 b and 1 u when three letters picked without replacement from {k: 1, u: 1, m: 1, b: 2}. 1/10 What is prob of picking 1 v and 2 f when three letters picked without replacement from fvfqflfffqfvffqqfff? 44/323 Calculate prob of picking 1 m and 1 d when two letters picked without replacement from {n: 2, d: 4, m: 1}. 4/21 Calculate prob of picking 1 s and 2 c when three letters picked without replacement from {u: 1, l: 4, s: 1, d: 2, c: 2}. 1/120 Two letters picked without replacement from {k: 1, c: 2, u: 1, i: 1, t: 2, q: 2}. Give prob of picking 1 q and 1 c. 1/9 What is prob of picking 1 p and 2 y when three letters picked without replacement from jpppppppypyyypppy? 11/68 Three letters picked without replacement from {m: 7, l: 1, u: 4, j: 2, s: 1, z: 4}. Give prob of picking 1 z, 1 l, and 1 s. 4/969 What is prob of picking 3 u when three letters picked without replacement from xewuewueewwuwieuwwxd? 1/285 Three letters picked without replacement from wwwam. What is prob of picking 3 w? 1/10 Calculate prob of picking 1 n and 1 q when two letters picked without replacement from nxxxqxxqqxqqnxqqqq. 2/17 Four letters picked without replacement from eweooofoowwoeoeh. What is prob of picking 1 h, 2 e, and 1 w? 9/910 Three letters picked without replacement from ffbbbqfbfbbfbibbb. What is prob of picking 1 f, 1 b, and 1 q? 5/68 Calculate prob of picking 2 q and 1 p when three letters picked without replacement from {q: 3, r: 3, y: 2, g: 1, p: 4, t: 2}. 12/455 Four letters picked without replacement from {h: 6, u: 5, g: 2}. Give prob of picking 1 h, 1 g, and 2 u. 24/143 Calculate prob of picking 1 e and 3 z when four letters picked without replacem	{ "pile_set_name": "DM Mathematics" }
qrt(2) Simplify (0 + sqrt(108))*2 + -2. 106 Simplify (3sqrt(14)-5)/sqrt(7). -15sqrt(2) Simplify (sqrt(12)/sqrt(6))*2-3 + 0. -6 Simplify -2 + 1sqrt(13) + 3. 1 + sqrt(13) Simplify sqrt(30)/sqrt(6)4 + (sqrt(5) - sqrt(80)/sqrt(4)). 3sqrt(5) Simplify (sqrt(11)5 + 2)4. 8 + 20sqrt(11) Simplify -2 + sqrt(2156). -2 + 14sqrt(11) Simplify 2 + (2 + sqrt(72))2. 24sqrt(2) + 78 Simplify 1(sqrt(11) + sqrt(11) + 2)5-6. -60sqrt(11) - 60 Simplify 6((sqrt(7) - 6-2sqrt(7))2 + (sqrt(7) - (sqrt(1008)-1)*2)). 6sqrt(7) + 1050 Simplify 3 + (sqrt(343) - (2sqrt(343) - sqrt(343))2)5. -1712 + 35sqrt(7) Simplify (-1sqrt(513) - sqrt(57))/(sqrt(147)-2 - sqrt(3)). 4sqrt(19)/15 Simplify -3(-3sqrt(44)/sqrt(4) + sqrt(704)-1)5. 165sqrt(11) Simplify -4 + 4 + sqrt(19)2 + ((sqrt(57)/sqrt(3) - sqrt(19)) + -2)*2. 4 + 2sqrt(19) Simplify ((sqrt(350) - sqrt(350)-1 - sqrt(350)) + sqrt(350))/sqrt(7). 10sqrt(2) Simplify ((sqrt(133)-21)/sqrt(7))*2. 76 Simplify (-2sqrt(5))*2-3 - sqrt(40)/(sqrt(24)/sqrt(3)). -60 - sqrt(5) Simplify 0 + sqrt(1584) + 2. 2 + 12sqrt(11) Simplify ((sqrt(1539) - (sqrt(1539) - sqrt(1539)1))4)2. 24624 Simplify 3sqrt(21)/sqrt(3)1. 3sqrt(7) Simplify (2sqrt(121))/sqrt(11) - (2 + sqrt(44)). -2 Simplify (sqrt(72) + (sqrt(72) - 4sqrt(72)) + 4 + sqrt(72))*2. -48sqrt(2) + 88 Simplify 5 + ((sqrt(3) - (1 + (sqrt(27))*2)) + sqrt(3) + sqrt(3) - -5sqrt(3)-3). -23 - 12sqrt(3) Simplify (2 + (sqrt(5) - sqrt(180)3))2. -68sqrt(5) + 1449 Simplify 2sqrt(51)/(sqrt(3) + (-3sqrt(3) - sqrt(3)) + sqrt(3)). -sqrt(17) Simplify -5 + (-2sqrt(85)-2)/sqrt(5) + -5. -10 + 4sqrt(17) Simplify sqrt(4)/sqrt(2) + -1 + sqrt(72)2 + -1. -2 + 13sqrt(2) Simplify 3(-2 + sqrt(1053)) - sqrt(1053). -6 + 18sqrt(13) Simplify sqrt(18)-4 - (sqrt(12)/sqrt(6) + 3). -13sqrt(2) - 3 Simplify (-1sqrt(190)5 + sqrt(190) + sqrt(190))/sqrt(10)-4. 12sqrt(19) Simplify sqrt(57)/(sqrt(75)-1). -sqrt(19)/5 Simplify ((-2sqrt(88))/sqrt(2))/(3sqrt(4)5 - sqrt(4) - sqrt(4)). -2sqrt(11)/13 Simplify (-1 + sqrt(700) + 5 - (-1 + sqrt(700) + 1))*2. 16 Simplify 4(5sqrt(112) - sqrt(7) - sqrt(7) - ((sqrt(7) - (sqrt(7) + 0))-2)*2). 72sqrt(7) Simplify (sqrt(150)/sqrt(5))/sqrt(6) + (-3(sqrt(5) + sqrt(45) + sqrt(5)))2. sqrt(5) + 1125 Simplify (-1sqrt(2000) - sqrt(2000))/sqrt(10). -20sqrt(2) Simplify ((sqrt(128) + sqrt(2) + (sqrt(2) + sqrt(2)-2 - sqrt(2)) + 2)4)2. 448sqrt(2) + 1632 Simplify sqrt(3) + ((2 + sqrt(3))3)2 + sqrt(3) + 0. 63 + 38sqrt(3) Simplify 5(-1 + sqrt(11)) + 0. -5 + 5sqrt(11) Simplify -2 + sqrt(110)/(sqrt(110)/sqrt(99)). -2 + 3sqrt(11) Simplify (sqrt(18)/(sqrt(9) + sqrt(45)/(sqrt(30)/sqrt(6) + sqrt(5))))24. 32/9 Simplify sqrt(1573) + (sqrt(1573) + 0)-3. -22sqrt(13) Simplify (-1-1sqrt(156))/(1sqrt(12)-4). -sqrt(13)/4 Simplify sqrt(7) + sqrt(672)/sqrt(6) - (-1sqrt(63))2. -63 + 5sqrt(7) Simplify (-5(sqrt(1872) + 2sqrt(1872) - sqrt(1872) - sqrt(1872))1)2. 46800 Simplify (sqrt(48)/(sqrt(12) - sqrt(12)-1) - sqrt(4))/sqrt(2). -sqrt(2)/2 Simplify ((sqrt(1700) - 1(3 + sqrt(1700)))2 + sqrt(1700))4. 36 + 40sqrt(17) Simplify -5(sqrt(5) - sqrt(20)/sqrt(4))6. 0 Simplify -1(sqrt(98) + -1)-6. -6 + 42sqrt(2) Simplify (-3sqrt(132)-2)/(sqrt(300) - 2sqrt(300)). -6sqrt(11)/5 Simplify sqrt(132)/(2(sqrt(12) + sqrt(24)/sqrt(2))). sqrt(11)/4 Simplify ((sqrt(152) + sqrt(152)-2 + sqrt(152))-5)/sqrt(8). 0 Simplify sqrt(700) + -5 - (-6(sqrt(28)/sqrt(4))*2 - sqrt(7)). 11sqrt(7) + 37 Simplify (-5(sqrt(75)/sqrt(3) + sqrt(25)))/(-3sqrt(5)-1). -10sqrt(5)/3 Simplify (sqrt(270)/sqrt(5))/sqrt(2). 3sqrt(3) Simplify -42-4-1sqrt(180). -192sqrt(5) Simplify (sqrt(99) + 0 + sqrt(99) + sqrt(99))*2 - (sqrt(99) + (-5sqrt(99) - sqrt(99)))/sqrt(9). 5sqrt(11) + 891 Simplify -3 + (sqrt(1980)/sqrt(11))2. 177 Simplify (-3 + sqrt(1573) + -3 + sqrt(1573) + 0)2. -264sqrt(13) + 6328 Simplify ((sqrt(119) - 1sqrt(119) - sqrt(119) - sqrt(119))5)/(sqrt(84)/(2sqrt(12))). -20sqrt(17) Simplify (sqrt(5324)-1)/(sqrt(36)/(sqrt(36) + sqrt(9) + sqrt(9))). -44sqrt(11) Simplify 1 + (4 + sqrt(5)3)2 + sqrt(30)/sqrt(6)6. 62 + 30sqrt(5) Simplify (sqrt(39) + (-2sqrt(78) + sqrt(78))/sqrt(2) - sqrt(39))/(sqrt(36)/(sqrt(48)/sqrt(4))). -sqrt(13) Simplify (sqrt(567) - (0 + sqrt(567) + -1))2. 1 Simplify (((sqrt(55) + sqrt(165)/sqrt(3) + sqrt(55))/sqrt(5) + sqrt(11))2 - (sqrt(176) + 4)) + 0 + -1sqrt(1584). -16sqrt(11) + 172 Simplify 2 + 2 + sqrt(252). 4 + 6sqrt(7) Simplify (5 + sqrt(76)/sqrt(4)-4)*2. -40sqrt(19) + 329 Simplify (sqrt(11) - (sqrt(11) + 4 + -4)) + 4. 4 Simplify sqrt(60)/(sqrt(36)/sqrt(3)-1). -sqrt(5) Simplify (sqrt(605) + -1sqrt(605) + sqrt(605) + 3 + -1 + sqrt(605) + (sqrt(605) - (sqrt(605)-1 - sqrt(605))) + sqrt(605))2. 264sqrt(5) + 21784 Simplify sqrt(6)/sqrt(2)24. 8sqrt(3) Simplify ((sqrt(35) - (sqrt(1715) + sqrt(1715)-1))/((sqrt(960) - sqrt(60))/sqrt(12)))*2. 7/9 Simplify (sqrt(117) + 4sqrt(117)2)/sqrt(9) + 0. 9sqrt(13) Simplify -1 + (-4(sqrt(2057)-3 + sqrt(2057)))*2 + sqrt(2057) + sqrt(2057). 22sqrt(17) + 131647 Simplify (((2sqrt(70))/sqrt(10) - sqrt(70)/(sqrt(10) + sqrt(10)1))-3)2. 567/4 Simplify (sqrt(6)/((sqrt(36)-2)/sqrt(12)))*2. 1/2 Simplify 5 + -2 + 1sqrt(5) + -2. 1 + sqrt(5) Simplify (sqrt(99) + 2 + -2)2 - ((sqrt(11) - (-2 + sqrt(11) + -1)) + sqrt(121)/(sqrt(33)/sqrt(3)))2. -6sqrt(11) + 79 Simplify -2 + -3-3sqrt(19). -2 + 9sqrt(19) Simplify (sqrt(2106) + sqrt(2106) + (sqrt(2106) - (sqrt(2106)-1 - sqrt(2106))) + sqrt(2106))/(sqrt(2) - sqrt(128)1). -54sqrt(13)/7 Simplify ((sqrt(76) - sqrt(19)) + 5 + sqrt(19) + -2 + sqrt(19)2)*2. 24sqrt(19) + 313 Simplify (-3 + sqrt(34)/sqrt(2) - (sqrt(272) + -5))*21. -12sqrt(17) + 157 Simplify ((sqrt(88)1 - sqrt(88))/sqrt(8))*2 + (sqrt(1331) - sqrt(1331)1)*2. 0 Simplify (sqrt(2) + 3sqrt(2) + 0)*2 + -4. 28 Simplify 3 + (((sqrt(99)1 + sqrt(99))-3)/sqrt(9))2. 399 Simplify sqrt(931)-15. -35sqrt(19) Simplify 3 + (sqrt(396)/sqrt(4))*2. 102 Simplify 2(sqrt(13) + -1) + sqrt(39)/sqrt(3) + 3. 1 + 3sqrt(13) Simplify (-4sqrt(96)/sqrt(72))*2. 64/3 Simplify (0 + sqrt(1573))-1. -11sqrt(13) Simplify (sqrt(4608) + sqrt(4608) + sqrt(4608)-2 + 0 - ((sqrt(4608) - -2sqrt(4608)) + sqrt(4608) + sqrt(4608) + 5))2. 2400sqrt(2) + 115225 Simplify -1sqrt(240)/(sqrt(5) - (2sqrt(245) + sqrt(245))). sqrt(3)/5 Simplify (5sqrt(25))/sqrt(5) + 3. 3 + 5sqrt(5) Simplify 1(sqrt(1573) + 1)-4. -44sqrt(13) - 4 Simplify -1 + (sqrt(70) + 5sqrt(70)2)/sqrt(10). -1 + 11sqrt(7) Simplify -1 + -5 + sqrt(76)/sqrt(4). -6 + sqrt(19) Simplify -1 + sqrt(5808) - (0 + sqrt(5808)). -1 Simplify ((sqrt(4320) - (2sqrt(4320) - sqrt(4320)))/sqrt(6))2. 0 Simplify ((-2sqrt(1700) - sqrt(1700))126)2. 2203200 Simplify (5sqrt(209)/(sqrt(22)/sqrt(2))1)2. 475 Simplify (sqrt(66) + sqrt(66) + 52sqrt(66))/sqrt(6). 12sqrt(11) Simplify ((sqrt(15) - (61sqrt(15) + sqrt(15) + sqrt(15)))/((sqrt(99)/sqrt(3))/sqrt(11)))*2. 245 Simplify -5(sqrt(931) + 0 + sqrt(931)) + sqrt(931) + (sqrt(931) + 6sqrt(931)-1 + sqrt(931))*2. -63sqrt(19) + 14896 Simplify 5 + (-1 + sqrt(5) + 3)*2. 4sqrt(5) + 14 Simplify (-1sqrt(14)-1 - sqrt(14))/sqrt(7). 0 Simplify ((-2sqrt(39))/sqrt(3) + 2)2. -8sqrt(13) + 56 Simplify 4 + (sqrt(8)2)/sqrt(4). 2sqrt(2) + 4 Simplify sqrt(19) - (sqrt(152)/(4sqrt(8) + sqrt(8)))2 - (sqrt(228)1)/sqrt(12). -19/25 Simplify (-2sqrt(112)3 + 4)*21. -192sqrt(7) + 4048 Simplify (sqrt(1216)-4 + sqrt(1216) + sqrt(1216))*2 - (sqrt(1216) + sqrt(1216) + (-4sqrt(1216))*2). -14592 - 16sqrt(19) Simplify ((sqrt(2) - 5-2sqrt(2))*2 - (sqrt(32) + 2)) + 1. -4sqrt(2) + 241 Simplify (sqrt(26) - 1(sqrt(936) - sqrt(26)))/sqrt(2). -4sqrt(13) Simplify sqrt(405) - (sqrt(405) + -2 + -4). 6 Simplify 0 + -1 + sqrt(153). -1 + 3sqrt(17) Simplify -1 + sqrt(5) + 5 + sqrt(15)/(sqrt(3)-1 - sqrt(3) - sqrt(3)). 2sqrt(5)/3 + 4 Simplify (sqrt(176) + 1 - sqrt(11) - (sqrt(33) + -2sqrt(33))/sqrt(3))*2 + 3. 8sqrt(11) + 180 Simplify ((1sqrt(121) + sqrt(121))-1)/(sqrt(11) + sqrt(704)2 + sqrt(11) - sqrt(11)). -2sqrt(11)/17 Simplify sqrt(117)/(sqrt(27)/sqrt(3)1) - sqrt(26)/((sqrt(12)-2)/sqrt(6)). 3sqrt(13)/2 Simplify (-1sqrt(130)*-1 + sqrt(130)	{ "pile_set_name": "DM Mathematics" }
4 for j. 4 Solve 15q = -38q - 53 for q. -1 Solve 0 = 7b + 39 - 60 for b. 3 Solve -11p - 32p = -43 for p. 1 Solve 32t = 36t for t. 0 Solve -20 = 41v - 46v for v. 4 Solve -8c + 7c = 4 for c. -4 Solve 0 = -15l - 60 + 165 for l. 7 Solve 1077y - 1082y = -25 for y. 5 Solve 7a + 26 = -2 for a. -4 Solve -11 = 100m - 111 for m. 1 Solve 0 = -4w - 0w + 20 for w. 5 Solve 4354z - 4370z + 176 = 0 for z. 11 Solve 13v = 15v + 10 for v. -5 Solve 69 = -68b + 45b for b. -3 Solve -115 = -14f - 73 for f. 3 Solve -612 = 106z - 82 for z. -5 Solve 1 = -19v + 58 for v. 3 Solve 81 = -7y + 130 for y. 7 Solve 2i - 4i - 8 = 0 for i. -4 Solve 0 = 7a - 2a for a. 0 Solve 16g - 12g + 12 = 0 for g. -3 Solve -3x + 99 = 87 for x. 4 Solve -88 + 49 = 13m for m. -3 Solve -80t = -56t - 144 for t. 6 Solve 2q = -6q - 24 for q. -3 Solve 0k - 6k = k for k. 0 Solve 0 = 10c + 14c + 144 for c. -6 Solve 9u + 31u + 80 = 0 for u. -2 Solve -c + 66 = 67 for c. -1 Solve 0 = 2j + 5 - 7 for j. 1 Solve -34 = 5x - 59 for x. 5 Solve -9n - 2n + 22 = 0 for n. 2 Solve 2u = 5u - 0u for u. 0 Solve -41v + 35v + 18 = 0 for v. 3 Solve -8x = 3x - 33 for x. 3 Solve 0 = 5q - 10 for q. 2 Solve 58 = h + 54 for h. 4 Solve -8q - 3 = -5q for q. -1 Solve 4o = -4 - 16 for o. -5 Solve 2r - r + 2 = 0 for r. -2 Solve 4l = -7l + 44 for l. 4 Solve 8j + 13 = -19 for j. -4 Solve -173d = -159d + 98 for d. -7 Solve -60 = -40y + 25y for y. 4 Solve -69 = 2c - 69 for c. 0 Solve -8w = -5w - 15 for w. 5 Solve -4b - 1284 + 1264 = 0 for b. -5 Solve 478l - 490l = 84 for l. -7 Solve -3 = 15g - 12g for g. -1 Solve 9z + 3 = -15 for z. -2 Solve 3q - 31 = -16 for q. 5 Solve 365r = 364r + 3 for r. 3 Solve 8z + 8 = 6z for z. -4 Solve 4d + 603 = 631 for d. 7 Solve -b - 1 = 2 for b. -3 Solve -4g + 0g = -4 for g. 1 Solve 30t - 187 = 113 for t. 10 Solve -8z = -3z + 15 for z. -3 Solve 5h - 34h = 87 for h. -3 Solve 17v - 40 + 57 = 0 for v. -1 Solve 285 = 4q + 257 for q. 7 Solve -1 = -10l - 11 for l. -1 Solve 6 = 7j - 10j for j. -2 Solve -6m - 3 = 9 for m. -2 Solve 0 = -21j + 5j + 48 for j. 3 Solve -992 = -d - 987 for d. 5 Solve 10 = -4j + 30 for j. 5 Solve 2238 - 2278 = -8u for u. 5 Solve -5 = 10x + 25 for x. -3 Solve 4r + 22 = 6 for r. -4 Solve 21 = -17g + 14g for g. -7 Solve -3x - 11 = -8 for x. -1 Solve -5m = 5m + 20 for m. -2 Solve 28l + 128 = -68 for l. -7 Solve -40y = 103 - 423 for y. 8 Solve -182a + 15a = -501 for a. 3 Solve -25 = 19p + 32 for p. -3 Solve -50 = 13g + 2 for g. -4 Solve -87 + 101 = 2v for v. 7 Solve 0y = 8y - 32 for y. 4 Solve 0 = -40f + 5 - 125 for f. -3 Solve 7q = -19 + 19 for q. 0 Solve -82 = 8o - 138 for o. 7 Solve 10 = 3n - 5 for n. 5 Solve 31 = 3m + 22 for m. 3 Solve 11b + 0b = -11 for b. -1 Solve 350x - 325x + 175 = 0 for x. -7 Solve 1080n = 1074n - 48 for n. -8 Solve -6 = -i - 3 for i. 3 Solve 228n - 211n = 0 for n. 0 Solve -36 = 3j - 27 for j. -3 Solve 0 = 30i - 8i for i. 0 Solve -97g + 344 = -11g for g. 4 Solve -276i + 268i = 0 for i. 0 Solve 9o = 22 - 4 for o. 2 Solve 4 = -13v + 9v for v. -1 Solve 181j = 161j - 40 for j. -2 Solve -9s - 4s + 91 = 0 for s. 7 Solve -57i + 82 = -32 for i. 2 Solve 0 = 23u - 10 - 128 for u. 6 Solve 751k = 754k + 18 for k. -6 Solve 0 = -3m - 19m - 66 for m. -3 Solve 4x - 8 = -4 for x. 1 Solve 1 - 29 = 14l for l. -2 Solve -2 = 3b + 1 for b. -1 Solve -1112s = -1111s - 6 for s. 6 Solve 57i - 61i = 24 for i. -6 Solve l = 23 - 27 for l. -4 Solve 9d + 16 = -2 for d. -2 Solve 1265s = 1272s for s. 0 Solve 0 = -3g - 11 + 5 for g. -2 Solve 10m + 126 = 31m for m. 6 Solve -12i = -3i + i for i. 0 Solve 33i + 40 = 13i for i. -2 Solve 29d - 30 = 44d for d. -2 Solve 7t = 10t - 9 for t. 3 Solve 19c + 66 = 8c for c. -6 Solve -5j - 152 = -142 for j. -2 Solve 12t = -11t for t. 0 Solve 20 = -19k + 9k for k. -2 Solve 216f - 219f - 6 = 0 for f. -2 Solve -76a + 110 = -131a for a. -2 Solve 0 = 5g - 8 - 17 for g. 5 Solve -6 = -2s + 5s for s. -2 Solve -6 = -60g + 63g for g. -2 Solve -7m + 2m = -11m for m. 0 Solve 113 + 62 = 25y for y. 7 Solve 17s + 1188 = 1239 for s. 3 Solve 5v - 16 = v for v. 4 Solve -60 - 115 = 25v for v. -7 Solve 116x + 424 - 76 = 0 for x. -3 Solve -22l + 22 = -66 for l. 4 Solve -595j = -597j - 6 for j. -3 Solve 5k - 32 = -27 for k. 1 Solve 9i = 14 - 77 for i. -7 Solve -2 = -3x + 1 for x. 1 Solve -2y - 3y = -2y for y. 0 Solve -205n = -200n - 5 for n. 1 Solve 72h - 74h + 6 = 0 for h. 3 Solve -5 = 47x - 42x for x. -1 Solve -24q + 31 = 7q for q. 1 Solve 2q + 52 = 62 for q. 5 Solve 3174t = 3170t - 36 for t. -9 Solve -3k + 84 = 108 for k. -8 Solve -21b + 26b + 10 = 0 for b. -2 Solve -3h - 3316 = -3298 for h. -6 Solve 1286a = 1290a - 24 for a. 6 Solve 11 - 14 = i for i. -3 Solve 3w - 15 = -30 for w. -5 Solve -12 = 5t - 2 for t. -2 Solve 9z - 33 = 30 for z. 7 Solve 9i + 1022 = 1049 for i. 3 Solve -3p + 19 = 10 for p. 3 Solve 156m + 18 = 147m for m. -2 Solve -22 + 14 = -2a for a. 4 Solve 22 - 74 = 13s for s. -4 Solve 21s = 9 + 12 for s. 1 Solve -95h + 132 = -83h for h. 11 Solve 0 = 108s + 1275 - 411 for s. -8 Solve -13s = -32s + 152 for s. 8 Solve 0 = v - 10 + 5 for v. 5 Solve -29d - 142 = -287 for d. 5 Solve 7b = 10b for b. 0 Solve -3k + 8k = -25 for k. -5 Solve -32c = -240 + 80 for c. 5 Solve 10p + 6 = -4 for p. -1 Solve -20b + 21b - 10 = 0 for b. 10 Solve -11q = -q - 30 for q. 3 Solve 55a - 58a = 15 for a. -5 Solve -41y - 39 = 84 for y. -3 Solve 91r = -38r - 387 for r. -3 Solve -156f = -153f + 9 for f. -3 Solve 0 = 26k - 42k for k. 0 Solve 0 = 54d - 51d + 6 for d. -2 Solve -82w + 86w + 20 = 0 for w. -5 Solve -65z = -69z - 12 for z. -3 Solve 3z + 8 - 20 = 0 for z. 4 Solve 0 = -12q + 566 - 602 for q. -3 Solve -10 = -19t + 9t for t. 1 Solve 0 = 37m - 30m + 35 for m. -5 Solve 0 = 29z - 44z + 105 for z. 7 Solve -25r = -22r + 12 for r. -4 Solve 0 = m + 2m - 9 for m. 3 Solve 4t + 4 = 20 for t. 4 Solve -70 = -23t + 58t for t. -2 Solve 0l - 5l = 15 for l. -3 Solve 10f + 5 - 35 = 0 for f. 3 Solve 3j + 2j = 15 for j. 3 Solve 0 = -65q + 54q + 66 for q. 6 Solve -7p + 2p + 25 = 0 for p. 5 Solve -11s = -38 - 6 for s. 4 Solve -47m = -36m + 11 for m. -1 Solve -5 = -3c + 8c for c. -1 Solve 2186v - 2191v = -25 for v. 5 Solve 0 = 41l - 61l - 120 for l. -6 Solve -30 = -3w - 39 for w. -3 Solve 0 = m - 13 + 18 for m. -5 Solve 15 - 19 = -2o for o. 2 Solve 130v = 9v + 605 for v. 5 Solve -225 = -41t + 144 for t. 9 Solve 0 = y + 5 - 7 for y. 2 Solve 26 = -9z - 19 for z. -5 Solve 0 = 30v + 12v + 210 for v. -5 Solve -h - 5 = -10 for h. 5 Solve 62i + 640 = 142i for i. 8 Solve 22t + 35 = 101 for t. 3 Solve 5 = 4i + 9 for i. -1 Solve 0 = -m + 57m + 280 for m. -5 Solve 4m = m + 8m for m. 0 Solve 22o - 9o = 13 for o. 1 Solve -100 + 28 = -9o for o. 8 Solve 13y + 2 = -11 for y. -1 Solve -12d + 11d = -2 for d. 2 Solve 1630m = 1627m + 15 for m. 5 Solve 6 = 39d - 42d for d. -2 Solve 204 = 68z - 340 for z. 8 Solve -7 = 58x - 65x for x. 1 Solve -8335v - 54 = -8341v for v. 9 Solve b - 1 = 4 for b. 5 Solve -171r + 174r = 6 for r. 2 Solve 15 = -9p + 4p for p. -3 Solve 8 = 2z + 14 for z. -3 Solve 10q = -0q + 10 for q. 1 Solve 4i - 2i = 0 for i. 0 Solve 1 = 3j + 13 for j. -4 Solve -4 = 12g - 11g for g. -4 Solve -20g - 107 = -27 for g. -4 Solve 0 = 11x - 0x + 66 for x. -6 Solve 0 = f + 13 - 11 for f. -2 Solve -334 + 59 = 25f for f. -11 Solve 2c = -4c - 30 for c. -5 Solve -92r + 95r = 21 for r. 7 Solve 5o + 9 = 29 for o. 4 Solve -31 = s - 38 for s. 7 Solve -347 = 13f - 373 for f. 2 Solve -18l = -21l for l. 0 Solve -28k + 208 = -80k for k. -4 Solve 11n = -1 + 1 for n. 0 Solve 8g + 9g = -3g for g. 0 Solve -12k = 213 - 285 for k. 6 Solve 0 = 7c + 1 + 6 for c. -1 Solve -5p + 15 = -10p for p. -3 Solve 10a + 5 = -15 for a. -2 Solve 0 = 3b - 2b - 2b for b. 0 Solve 3a = a + 2 for a. 1 Solve -18a - 27 = -153 for a. 7 Solve -6k = 3 - 9 for k. 1 Solve 10x - 3x = 35 for x. 5 Solve 2l - 7l + 5 = 0 for l. 1 Solve -29v = -7v for v. 0 Solve -7k - 9k - 64 = 0 for k. -4 Solve 7101p + 24 = 7095	{ "pile_set_name": "DM Mathematics" }
19/4) Simplify (yy/(yy*(-12)y))/(yy/y3)y(-18/5)/(y/(y(-12)y)) assuming y is positive. y(-13/5) Simplify ((h/(hh/h*(-4)hh))/h(2/19))48 assuming h is positive. h(-6480/19) Simplify ((g/((g(-9)gg)/g))/(g/((g(-2/25)/g)/g)))/(ggg/((g(-3/8)/g)/g))(6/5) assuming g is positive. g(-53/100) Simplify ((z/z(-3/4))(-3/34)/(z(3/5)z(-7/3)/z))(1/37) assuming z is positive. z*(5261/75480) Simplify ((nn*(-21))/nnn/n(6/25)n)/((n*(2/43)nn)/n(1/8)) assuming n is positive. n(-173389/8600) Simplify (o(-1/7)o*(-1/26))/((ooo3o)/o7) assuming o is positive. o(149/182) Simplify (a*(-2)a((aaaa/((a/a29)/a))/a)/a)/(a(-15)/((a*(2/9)/aa)/a)) assuming a is positive. a*(398/9) Simplify (kkkk(2/33))/k10k/(k(-2/25)/kk)k9 assuming k is positive. k(2591/825) Simplify ((j(1/2))(-2)/(j(1/3))16)(-35) assuming j is positive. j(665/3) Simplify gg(gg/(gg(-19)g))/ggg*(-3/8)((((g/(g*8ggg))/g)/g)/g)(1/5) assuming g is positive. g(721/40) Simplify c*0cc/c(-12)c(c(-5)/c)/cc(-15) assuming c is positive. c(-7) Simplify p*(-11)p/(p*(-13)/p)p(pp(-2/13))/(p/(p(-4/21)/p)) assuming p is positive. p(998/273) Simplify (g(-17)g24)/((ggg/(g(g*(-2/17)g)/g)g)/gggg(-2/29)) assuming g is positive. g(1455/493) Simplify g*22g/(gg(-1)g)g(((g/g*(-1))/g)/g)/((gg(-24))/g) assuming g is positive. g47 Simplify ((t*(-8/9)t(-13))(2/75))(1/5) assuming t is positive. t(-2/27) Simplify w/w*(-7)(w/w*(1/8))/www/(ww*7)w/(w0/w) assuming w is positive. w(31/8) Simplify (z12/z)/(z/(z/(z/(z/z(4/9)))))(z13)(-4/7) assuming z is positive. z(197/63) Simplify ((ccc(-1/3)cc)/(c6c))/(c/(ccc*1/ccc))13 assuming c is positive. c(107/3) Simplify j3/j11j*15(jjj/j*(2/19)jj)/j assuming j is positive. j(207/19) Simplify ((k(-1/2)kk)(4/7))(-31) assuming k is positive. k(-186/7) Simplify ww/(www*(-1/12)w)www(-22)/w(w/w*(-27)w)/(w/(w/(w*(12/7)w))) assuming w is positive. w(367/84) Simplify t/(t/(t(-5/6)t)t)t((tt14t)/t)/tt(6/7)/(ttt(ttt/(t*(-15)t))/tttt) assuming t is positive. t(-293/42) Simplify (b/(b/(bb/b*16)b))*(-2/35)b*(-22)/(bb/b*23b) assuming b is positive. b(-8/7) Simplify (t(2/13)tt)/t*(-12)t*(-8)t8/t assuming t is positive. t(171/13) Simplify q*(-25)(q*(1/43)q)/qq15q(q/(q/q(9/4)))/q assuming q is positive. q(-1329/172) Simplify d(1/23)/dddd*(-2/5)d(d/(dd*(-1)d))12 assuming d is positive. d(189/115) Simplify (a3)42/((a/(a*(-2/5)a))/a)(2/13) assuming a is positive. a(8196/65) Simplify ((q*(2/7)q(-1/9))/(q(1/4)q(5/2)))4 assuming q is positive. q(-649/63) Simplify (((s/s(-1/2))/(s/(s(s/s(2/7))/s)))/(s(-1/4)/s)(-5/3))(-1/44) assuming s is positive. s(73/3696) Simplify (q(-12)/(q/(q/q(-13))))/(q(-1/28)/qq(-18)) assuming q is positive. q(561/28) Simplify ((o(8/7)/(o(-9)/o))/((o/(oo(6/7)/o))/o4))(-17/2) assuming o is positive. o(-255/2) Simplify ((w*(2/11)/ww7)/((w(-5)/w)/(w/((ww/(ww(-5)))/w))))(-6) assuming w is positive. w*(-540/11) Simplify yyyy*(2/55)(y/y*2)/y(yy/(yy*(1/4)y)y)34 assuming y is positive. y(2919/110) Simplify ((k/(kkk(-1))k10)(-5/2))5 assuming k is positive. k(-125) Simplify (o/((o*(-1/13)/o)/oo)o)/(o/(o(-3/4)/o))(o(-3))(2/63) assuming o is positive. o(253/1092) Simplify (s2s(-6))/(s(1/3)/s(3/13)) assuming s is positive. s(-160/39) Simplify (kk/((kk/k(-1/4)kk)/k))48/(kk5)(6/11) assuming k is positive. k*(-696/11) Simplify (dd15)(-3/10)((d/(d/(d((d/d*(-9)d)/d)/d)))/d)(1/16) assuming d is positive. d(-339/80) Simplify vv(-2/9)vv(-2/21)v(v/(((vv(-25))/v)/v))/v(-2/5) assuming v is positive. v*(9476/315) Simplify (j/(j/((jjj/(jj/(((jj(17/4))/j)/j))j)/j))j)/(j/(j(-4/25)/j))((j/j2)/j)/(j/j(-1/7)) assuming j is positive. j(-37/700) Simplify (((s/s15)/s)/s*28)/(ss12)3 assuming s is positive. s(-82) Simplify ((o/(o(3/8)/oo))/(o1/o))/(o(-2/9)o(-2/7)) assuming o is positive. o(571/504) Simplify ((t*(1/4)tt(2/17))/(tt(-2))(-18))(10/7) assuming t is positive. t(-5655/238) Simplify (c*(-2/61)c(-1/3))/(c(-1/7))(1/30) assuming c is positive. c(-1543/4270) Simplify ((y(-19)/y)/y(-4/7))/(y*(-1/3)y(-35)) assuming y is positive. y(334/21) Simplify ((f/((f/f*(-1/5))/f)ff1)/(f0)(4/5))(-9) assuming f is positive. f(-126/5) Simplify (x(x(x/x1)/x)/xx4)/(x/(x(-9)/x))(1/21) assuming x is positive. x(73/21) Simplify (i/i*(-1/39)i*(-2/5))/(ii*(-18)(i(((i/(i/((i/(i(i/(i(i(2/25)i)/i))/i))/ii)))/i)/i)/i)/i) assuming i is positive. i(19057/975) Simplify (((q/q(-1/4)q)(-6/17))(-2/47))(39/2) assuming q is positive. q(1053/1598) Simplify ((g(-1/5))(-1/13))(12/11) assuming g is positive. g(12/715) Simplify (m/(mm/(mm*0m)))*(1/23)(m/(mmm(mm*(-12)m)/mm))/(m/(mmm(-2/5)m)) assuming m is positive. m(1109/115) Simplify (c(2/141)c32c)/(c(-8)/c(6/23)) assuming c is positive. c(133855/3243) Simplify ((d(-1/3)d)(-5/7)(d/((d/(d3/d))/d))/d(-3/4))(-2/67) assuming d is positive. d(-275/2814) Simplify ((t(t/t(-2/3)t)/t)/t)(-5/9)/((t/t(-1/5))/(t/(t(1/12)/t))) assuming t is positive. t(-113/540) Simplify (((v/v*(2/9)v)/v(-2/7))/(v(-1)v(4/9)))(26/7) assuming v is positive. v(1430/147) Simplify (((uu/u(-12))/u5)/((uu/u(-2/7)u)/(u/u(9/2))))35 assuming u is positive. u(155/2) Simplify (((m(-1/13)m)/m)/(m((m(m(4/3)m)/m)/m)/m))/(m(m/m(-1/4))/m)(-37) assuming m is positive. m(6995/156) Simplify (u(-6))(3/25)/(u17/(u24/u)) assuming u is positive. u(132/25) Simplify n(-5)/n17(n(-6))17 assuming n is positive. n*(-124) Simplify ((g/(ggg25))/(g/((g/((g(g/(g*(-3/16)g))/g)/g)g)/g)))/(g(-6)g(-17)) assuming g is positive. g(-35/16) Simplify (nnnn/(n/(n(-21)n)))/(n/n*(-16))(nn(7/4)n)(3/22) assuming n is positive. n(-2947/88) Simplify ((ll/l(1/4))42l*(5/6)l5)(-41) assuming l is positive. l(-9758/3) Simplify ((b/b(-1)b)(22/3)/((b(-1)b)/b)0)36 assuming b is positive. b792 Simplify ((t(-2/5)/tt)(-38))(1/25) assuming t is positive. t(76/125) Simplify ((t(t*9t)/t(tt*(-10)tt)/tttt)(3/10))(-38) assuming t is positive. t(-57) Simplify (u(7/6)/u)/((u/u*(-3/14))/uu)(u/(u(2/5)/u))/(((((u(-20/9)u)/u)/u)/u)/u) assuming u is positive. u(1819/315) Simplify f(-19)(f(-24)/f)/ff/(f*(-10/7)/ff)ff(11/3) assuming f is positive. f(-796/21) Simplify v16/v(2/63)v18/(((v11/v)/v)/v) assuming v is positive. v(1636/63) Simplify ((w/(www(-4/3)))/(w/w(2/51)))/(w(2/3)www/w(-2/5)) assuming w is positive. w(-399/85) Simplify (((q/q(6/13))/((q(-6/5)/q)/q))(4/7))7 assuming q is positive. q(972/65) Simplify (((n(-33)n)/nn)/(((nnn/n(5/4))/n)/n))/((n/n(-2/9))/n11) assuming n is positive. n(-791/36) Simplify (v3/v)(-16/3)/((vv(-2/23)/v)/(vv(1/13))) assuming v is positive. v(-8524/897) Simplify (m*(-16)m(m/(mm*16))/m)/((mm/m*37mm)/(mm*(-6/11)mmm)) assuming m is positive. m*(49/11) Simplify (kk13)/(k3/k)k/(k(-17/4)k)k26k assuming k is positive. k(173/4) Simplify (s(-2/35)s)(-1)(ss5)(-1/66) assuming s is positive. s(-398/385) Simplify ((d(-7)d9)(6/13))(1/11) assuming d is positive. d(12/143) Simplify ((u0)28/(u*10/(uu(-8))))(-1/28) assuming u is positive. u*(17/28) Simplify jj*5j/(jj12)(j*(-2)j)(-2/33) assuming j is positive. j(-196/33) Simplify (ww16)(-7)w*(4/29)w/(w/(ww(-2/57))) assuming w is positive. w(-194884/1653) Simplify yyy10yy(-13)(yy/y(3/5)y)28 assuming y is positive. y(336/5) Simplify a13/a(-2/9)(a((a/(aa/((a/(a(-2/3)/a))/a)a))/a)/a)(-3/2) assuming a is positive. a(137/9) Simplify r*(5/2)/(r/(rr*(-7)))r/r*(-3)r/(r/(r3/r)) assuming r is positive. r(3/2)	{ "pile_set_name": "DM Mathematics" }
d + r. Is d composite? True Let a(p) = -p*3 - 2p - 3. Let b be a(0). Let g be (2/6)/(1/b) - -5. Let i(d) = 23d3 + 4d*2 + 4d + 7. Is i(g) composite? False Suppose 3h + 17p = 19p + 18519, -h = -3p - 6180. Let j = h - 3976. Is j prime? False Suppose 27 = 9s - 9. Let f(q) = 7693q + 1. Is f(s) a prime number? True Let w(h) = 690h3 - 7h*2 + 27h + 15. Is w(13) prime? False Let c(i) be the third derivative of 985i5/6 - 5i*4/8 - 7i*3/3 + 197i*2. Is c(-1) a prime number? True Let o(r) = -11097r - 391. Is o(-20) composite? False Suppose -2a - 43048 = -3j, 8j = 13j - 5a - 71740. Let n = j - 6983. Is n a composite number? False Suppose -11u + 0u + 11 = 0. Is (1330 + (2 - -5))u prime? False Let f be 23 + -15 + 2 - 15. Suppose fv - 16893 = -n + 48700, 5n = v - 13129. Is v a composite number? True Let v = 1005 - 583. Suppose 4a - v = 2a + 2l, 3a + 2l = 633. Is a composite? False Is (3 + 0)644172/36 a composite number? False Let x(b) = -11b*3 - 16b*2 - 21b - 83. Let r be x(-13). Suppose 4p = -20, 2d - r = -6p + p. Is d composite? True Suppose -3i - 31 = -2b - 2i, b + 4i = -7. Let n(g) = 8g + 8g + 14g + 6 - 44g + 14g*2 + 12g - g*3. Is n(b) a prime number? True Suppose -5u + 23 = -7. Is -182014(4/u - (-224)/(-192)) composite? True Suppose 18 = 3u + 5b - 15, 30 = 4u + 2b. Suppose -i + ui + i = 0. Suppose 0 = -5x + 3a + 4567, 0 = -4x - ix + 3a + 3656. Is x a prime number? True Let t be 4 - (-5 - 770) - 0. Suppose 7h - t = 3799. Let l = 2365 - h. Is l a prime number? False Let a be 36667 - (22/44)/(2/(-4)). Suppose 18x - 17314 - a = 0. Is x a composite number? False Let w = 839 - 329. Suppose q + 4m = 453, -3q + w = -4m - 833. Is q composite? False Let a be 6 + (-1 - -7380 - -6). Let q = a + -3434. Is q a composite number? True Is (-1)/4 + 674631216/1472 a composite number? False Suppose -566a = -565a - 1312. Let i = a + 309. Is i prime? True Suppose 288974 = 4q - 4i - 3498, -q + 73136 = 5i. Is q prime? True Is (8 + -3 - -33428) + -10/3 a prime number? False Let g = -27 - -32. Let v = g + 0. Suppose 2w - 2k + 104 = 676, -k = -vw + 1434. Is w prime? False Suppose 360 + 3726 = -3d. Let o = d - -2141. Is o prime? False Let s(i) = -15i - 31i*2 + 28i - 9i + 108i2 - 5. Is s(-6) a composite number? True Let g(q) be the third derivative of q6/60 - q5/20 + q4/6 - 13q3/6 - 2093q*2. Suppose 2n - 4f + 32 = 6n, -10 = -5f. Is g(n) a prime number? False Let h(t) = -10t*2 - 3t*2 + 6t*2 + 6t + 4t3 - 7. Let b be h(4). Suppose s - b = 90. Is s a composite number? False Let x = -683 - -1340. Let c(k) = 2 + xk + 11 + 8 - 15. Is c(3) composite? True Suppose 8 = -43l + 47l. Suppose 0 = q + o - 4, -lo - 2o - 38 = -5q. Suppose 0 = -4j + 10p - qp + 9628, 0 = -5p + 20. Is j a prime number? True Let s(v) = -v3 - 21v*2 + 16v + 18. Let c be s(-10). Let g = c + 1759. Is g a composite number? True Let b be (-28)/126 - 29023/9. Let o be (2126/5)/(2/(-10)). Let j = o - b. Is j composite? True Let g = 22620 + 48973. Is g a prime number? True Is 10/6 + (-3488)/327 + 212786 a prime number? True Suppose 66x - 17727564 = 20814440 - 13053794. Is x a composite number? True Let p = -62405 + 136716. Is p composite? False Suppose 50f = 32f + 693774. Is f a prime number? True Let t = 206797 + -114060. Is t composite? False Suppose 5l + 509 - 5644 = 0. Suppose -d - 4n + 2919 = 0, -2d - 2n + l = -4817. Is d a prime number? False Suppose 16u + 72u + 743920340 = 428u. Is u a composite number? False Let i = 3 - 2. Let l be 14/(-21) + 22/6 + i. Is 1/((-6376)/19164 + l/12) a prime number? True Let v(b) = -b*3 - 6b*2 - 99b + 67. Is v(-58) a composite number? True Is ((-8)/4)/((-26)/373763) composite? False Let g = -3135 + 9043. Let a(s) = s*2 + 3s - 4. Let q be a(-4). Suppose 18h - 22h + g = q. Is h prime? False Let b(s) = -208s - 31. Let x(m) = 35m + m*2 - 2m*2 - 26m + 13 + 2m2. Let k be x(-6). Is b(k) composite? False Let c(w) = 3w*2 - 27w - 43. Let v(i) = -i*2. Let n(o) = c(o) - 2v(o). Suppose -108 = -193b + 199b. Is n(b) a composite number? False Is 196970 + (-16)/((-160)/(-30)) composite? True Suppose 1321830 - 883129 + 1608239 = 20c. Is c a composite number? True Suppose -26o + 260959 = -117500 - 164499. Is o a composite number? True Let m(b) = 70b3 + 7b*2 + 12b + 27. Let c(z) = -70z3 - 7z*2 - 13z - 28. Let w(x) = 4c(x) + 5m(x). Is w(6) a composite number? False Let g = -37 - -80. Suppose m = -g + 52. Is (-9)/(-6)(-3)/(m/(-1682)) a prime number? False Let i = 574879 + -313908. Is i a prime number? False Let r(i) be the third derivative of -i6/120 - i5/30 - i4/8 - i3/2 + 18i*2. Let t be r(-2). Suppose th - 1431 - 1488 = 0. Is h a composite number? True Let g(f) = 9f2 + 91f - 1429. Is g(96) a prime number? False Let f(s) = s3 + s2 - 8s. Let n be f(-3). Let o(r) = 131r + 1. Is o(n) a prime number? True Let m(b) = b*3 + 3b*2 - 9b + 4. Let i be m(-5). Is 6 + (-4 + i)-271 prime? True Is (1/((-1)/1))/(-27 + 7159804/265178) a composite number? False Suppose 5z - z = 8. Suppose -869 = -3b + zx, b = -b - x + 570. Is b composite? True Let j(x) = -x*3 - 12x*2 + 13. Let u be j(-12). Suppose t = 3g + 4 - u, 0 = 2t + 4g - 12. Suppose 7r - 14r + 18011 = t. Is r a composite number? True Suppose -6o + 3o + 35 = 5w, 2w = -3o + 23. Suppose -ov + 10479 = 3694. Is v prime? False Let g(c) = c*2 + 37c - 53. Let r be g(-40). Suppose 2k = 5k - 438. Let n = k - r. Is n composite? False Let f(o) = -7o - 3o*2 - 2o*2 - 24 - 4o + 4o2. Let u be f(-4). Suppose 6s + 2m - 12616 = 2s, s - um = 3163. Is s a prime number? False Let y(n) be the first derivative of 571n*3/3 + 13n*2/2 - 11n + 156. Is y(-4) prime? False Let m = 55806 - 25826. Let n = m + -14819. Is n prime? True Let w(b) = -b*2 - 10b. Let a be w(-10). Suppose -5l + 0l + 455 = a. Let y = l - -1078. Is y a prime number? False Let u(c) = -13c3 - 31c*2 - 51c - 71. Is u(-26) a composite number? False Let x(j) = -j - 21. Let q be x(-12). Let a = 11 + q. Suppose 1 = 3m + 7, -4l = am - 1456. Is l a composite number? True Suppose 0 = -3m + 6m + n - 10, -2m - 12 = -4n. Suppose -mx = 3s - 7093, -10x + 2s - 14198 = -14x. Is x a composite number? True Let c = -3402 + 6768. Suppose 4z - 2z = -4s - 4766, 4z + 9562 = 2s. Let x = c + z. Is x a prime number? True Let y(p) = 5p - 53. Let g be y(11). Let o(h) = -4h2 + 5h - 8. Let i be o(g). Is 586/((-8)/i63/18) a composite number? False Suppose 4h + 11h = 31h - 2766928. Is h prime? True Let t(w) = w*3 + 10w*2 - 21w + 11. Suppose 24 = -2g - g. Is t(g) prime? True Let u(k) = -78k*2 + 8 - 436k + 194k2 + 454k. Let l be u(-9). Suppose -l = 96c - 98c. Is c a composite number? False Let n = 187954 + -31013. Is n prime? True Let a(l) = l3 - l2 + 3l + 21. Let h be a(0). Suppose z + h = 28. Let q(b) = b3 - 4b*2 - 3b + 1. Is q(z) composite? False Suppose 275h = 160h + 18413265 + 52072420. Is h a composite number? True Suppose -6422 = 27k + 4432. Let j = k - -613. Is j a prime number? True Let q(v) = 5v*2 + 88v + 2. Let n be q(-18). Suppose -ns + 46934 = -7s. Is s prime? False Let m(r) = 17r3 - 27r*2 - 31r - 93. Let v(l) = -5l3 + 9l*2 + 10l + 31. Let d(o) = -2m(o) - 7v(o). Is d(18) a composite number? False Suppose 2v + 0v = 6. Let l(o) = -o*3 + 122o*2 - 913o + 129. Let k be l(114). Suppose -m + 3c + 883 = m, 0 = -vc + k. Is m a prime number? True Let d be (-2)/(-4) + (-489253)/(-82). Suppose d = p + 4h, -11p - h - 17849 = -14p. Is p a prime number? False Let l = -4143 + 45742. Is l a composite number? True Suppose -46k = -52k + 74490. Suppose -4n - k + 3735 = 0. Let m = -1283 - n. Is m a composite number? False Suppose -23k + 310154 + 146557 = 0. Suppose 0 = -57t + 60t - k. Is t composite? False Let t = -6 - -10. Let k = 1904 + -1900. Suppose -tq + kn + 503 = 71, 5n - 364 = -3q. Is q prime? True Suppose 6 = -7f + 27. Let r(j) = 457j - 10. Is r(f) prime? True Let w = 242 + -237. Suppose -36r + 113939 = wr. Is r a composite number? True Suppose -2u - q = 122440, 5u - 10u = 3*q + 306099. Let v = 97018 +	{ "pile_set_name": "DM Mathematics" }
c be ((-12600)/108)/(4/6). Let h = -397 + 274. Let u = h - c. What is the tens digit of u? 5 Let u = -10 - -95. What is the tens digit of u? 8 Suppose 3b + 44 = 1922. What is the tens digit of b? 2 Let t be (-6)/24 + 30/(-8). Let h = -76 + 45. Let z = t - h. What is the tens digit of z? 2 What is the thousands digit of (4 - 4)/(-5) - (-3 + -2617)? 2 Let q be -24(-3)/2410. Suppose -6g = -126 - q. What is the tens digit of g? 2 Let x = 1926 - 485. What is the hundreds digit of x? 4 Let i = 5 + -5. Let h = 0 + i. Let z = 4 - h. What is the units digit of z? 4 Let h(a) = -a*2 - 8a + 6. Let c be h(-8). Let u = -8 - c. Let n = 44 + u. What is the units digit of n? 0 Let y be 1/(3/(-606)-2). Suppose 2r - 63 = -z, -r + 2r = 2z - y. What is the tens digit of z? 5 Let g be 2 + 0 + 1-4. Let k be g/2 - (2 + -33). Suppose -3b + 0b + k = 0. What is the units digit of b? 0 Suppose 12 = 7s - 3s + v, s - 5v - 3 = 0. What is the tens digit of 232 - (0/s)/(-4)? 3 Suppose -3x = -3h - 9 - 6, 4x - 3h = 25. Suppose j - x + 49 = 0. Let c = 62 + j. What is the tens digit of c? 2 Suppose n - 7 = -4. Suppose l = 54 + n. What is the units digit of l? 7 What is the units digit of 1310(66/12 + -5)? 5 Let p = -5 + 10. Suppose -3x - x = -m - 97, px - 5m - 140 = 0. What is the tens digit of x? 2 Let k(r) be the first derivative of 2r2 + 1 - 1/4r*4 - 4/3r*3 - 4r. What is the units digit of k(-5)? 1 Let s = 2117 + -1314. What is the hundreds digit of s? 8 Suppose 3m = 5l - 15947, -l + 3203 = -5m + m. What is the tens digit of l? 8 Let i = 171 - 153. Let x = -14 - -3. Let z = i + x. What is the units digit of z? 7 What is the hundreds digit of 3572/36 + 1 - (-8)/(-36)? 1 What is the units digit of 3/99394? 2 Suppose 4c - 4 = 16. Suppose 4v + 46 = cn, -15 = 4v + 4n + 13. Let a = v + 34. What is the tens digit of a? 2 Suppose 1 = 3w + 10. What is the units digit of 10 + (-4 + 10)/w? 8 Let y(s) = -372s*3 + 2s*2 - 5s - 7. What is the units digit of y(-1)? 2 Suppose 45s - 38s = 16513. What is the units digit of s? 9 Suppose -r = -4b - 958, 0 = r - 26b + 28b - 982. What is the hundreds digit of r? 9 Suppose 0 = 16f - 17519 - 16817. What is the units digit of f? 6 Suppose -11425 = -13w - 2806. What is the hundreds digit of w? 6 Let u(i) = i3 - 5i*2 - 5i - 3. Let l be u(6). Suppose -lr + 5m + 237 = r, 0 = -r + m + 59. What is the units digit of r? 8 Suppose 9v - 441 = 2214. What is the hundreds digit of v? 2 Let v(i) = 10i - 2i - 5i + 1 + 7i. What is the units digit of v(3)? 1 Let x(q) = -q2 - 5q. Let d be x(-6). Let z be d/44/(-3). Suppose zs + 60 = 4s. What is the units digit of s? 0 Let l(v) = -139v + 2. Let r(s) = 93s - 1. Let a(x) = 5l(x) + 7r(x). What is the units digit of a(-1)? 7 Suppose 5h - b = b, 3h + 2b = 0. Suppose m - 34 = -h. Suppose m = 2z + 4. What is the tens digit of z? 1 Let c = 1116 - 1105. Suppose 0 + 25 = 5k. Let l = c + k. What is the tens digit of l? 1 Let l = -148 + 175. What is the tens digit of l? 2 Let d = 165 + -57. Suppose 28s - 27s - d = 0. Suppose -18n = -15n - s. What is the units digit of n? 6 Let w be 9/(-5(-3)/15). What is the units digit of (0 + 70/(-3))(w + -12)? 0 Suppose 3k - 10 = -2k, -2j - 22 = -5k. Let n = 7 + j. What is the tens digit of n - -2 - 462/(-14)? 3 Let x = -8 + 2. Let u be (-5 - -3)/(x/9). Suppose uq + 2s - 25 = -2s, -4q - s + 16 = 0. What is the units digit of q? 3 Let a = 1417 + -868. What is the hundreds digit of a? 5 What is the hundreds digit of (-35 + 34)/(-2 - (-11235)/5619)? 8 Suppose 4v = -3v. Suppose 5i - 60 = -vi. What is the tens digit of i? 1 Suppose 6 = -3g, 3j - 2j + 432 = 3g. What is the tens digit of ((-1)/2)/(3/j)? 7 Let u be (-2)/(-3) - (-11)/(-3). Let b(m) = -16m + 9m + 2m - 17m. What is the tens digit of b(u)? 6 Suppose -5291 = -15v + 2v. What is the hundreds digit of v? 4 Let n(l) be the second derivative of l*4/12 - 2l*2 - l. Suppose 47 = -17p + 22p - 3t, -5p + 51 = -4t. What is the units digit of n(p)? 5 Let w(i) = 3i - 3. Let n be w(7). What is the units digit of n/45 + (-128)/(-5)? 6 Suppose 0 = -j - i + 55, 19 = j - i - 44. What is the tens digit of j? 5 Let n(d) = 14d*2 - 19d + 6. What is the hundreds digit of n(5)? 2 Let t(w) = 9w - 17. Let k be t(4). Suppose 16n + 264 = kn. What is the units digit of n? 8 Suppose -z - 752 = -3w + 4w, -z + 1501 = -2w. Let v = -450 - w. What is the hundreds digit of v? 3 Let t = -19 + 19. Suppose -3x - 3x + 150 = t. What is the units digit of x? 5 Suppose -3s + 8 = 2m - 5, 5s - 4m = 7. Let q(p) = 6p - 190. Let r be q(32). Suppose 4x = -3b + 52, -sx = -0x - rb - 22. What is the units digit of x? 0 What is the tens digit of (10 - (-7 + 20)) + 2101? 9 Let b(x) = 11x - 3. Let w(d) = d + 1. Let a(q) = -b(q) + 4w(q). Let n(u) = -20u + 20. Let t(f) = -11a(f) + 4n(f). What is the units digit of t(-7)? 4 Let k be (1 + 2)(-72 + 5 + -1). Let t = k + 299. What is the tens digit of t? 9 Let o(v) = -v3 - 16v*2 - 14v + 16. Let d be o(-15). What is the units digit of (1 - d)/3 - -20? 0 Let c = -315 + 457. What is the tens digit of c? 4 Let x = 1243 - 878. What is the tens digit of x? 6 Let n be -2(-2 + -1 + 2). Let r be (40 - 7) + n + -2. Let l = r + -15. What is the units digit of l? 8 Let q(r) = -1007r - 341. What is the tens digit of q(-3)? 8 Let l = -547 - -609. Let k(x) = -3x2 - 2x + 1. Let q be k(-2). Let t = q + l. What is the units digit of t? 5 Let f = 543 + -78. What is the units digit of f? 5 Let r = 3424 + -1840. What is the units digit of r? 4 Let q be 7 - (-1)/(4/16). Suppose -qc = -13c + 28. What is the units digit of c? 4 Suppose 0 = -s + 2 - 3, -s - 171 = 5b. Let t be b/221 - (-2)/13. What is the tens digit of (39 + -1 - t) + -4? 3 Let r(o) be the third derivative of -o6/120 + o5/6 + 13o*4/24 + 11o*3/6 + 22o*2. What is the units digit of r(9)? 9 Suppose f + 0f - 5 = 0. Suppose 2h = fn - 19, -n + 3h + 15 = 2n. Let d(q) = 15q + 2. What is the tens digit of d(n)? 4 Let c = 7 + 1. Suppose -4t + 2u = 8, 3u + 20 = 3t + cu. Suppose 2j - 4k - 52 = -16, -3j - 2k + 78 = t. What is the tens digit of j? 2 Let d = 13 - 9. What is the units digit of 9/(-18) + 86/d? 1 Let k(c) = -7c + 4c + 2c + c2 + 7. What is the tens digit of k(-4)? 2 Let y(w) = -w - 3w*2 + 4w + w*3 - 2w*2 + 2w*2 - 1. Let i be y(3). What is the tens digit of (-6)/i(3 + -35)? 2 Let j = -14 - -423. What is the units digit of j? 9 What is the hundreds digit of (-260 + -12)14/(-4)? 9 Suppose -12c = 2420 - 16496. What is the thousands digit of c? 1 Suppose 3z + 11125 = 3b + 2677, -5b - 4z + 14116 = 0. What is the thousands digit of b? 2 Let p(b) = 10b2 + 10b + 245. What is the hundreds digit of p(19)? 0 What is the hundreds digit of 5 - (74/259 - 20402/14)? 4 Let f(x) = 4x - 10. Let p be f(7). Let s = p - 15. Suppose -sb + 5c = -19, b + 4c + c + 7 = 0. What is the units digit of b? 3 Let k(z) = 11 + 13 + 3z - 7z + 3z. Let m be k(10). Suppose 0j - m = -j. What is the units digit of j? 4 Let t = 35 - 35. Suppose t = -5q - 2q + 231. What is the tens digit of q? 3 What is the thousands digit of 10731(1 + 10)/33? 3 Let t = -2 - -5. Suppose 0x + 8 = tq + x, 0 = 5q + 5x. What is the units digit of q? 4 Let c(t) = 4t*2 - t - 1. Let l be c(-1). Suppose -99 = -q + lf, 0 = -f - f - 2. What is the units digit of ((-6)/(-30))/(1/q)? 9 Let d(l) = l*3 - 6l*2 + 2l + 5. Let x be d(5). Let y = 10 - 5. Let f = y - x. What is the tens digit of f? 1 Suppose f = 3g + 2, g - 2g = -3f + 6. Let b(q) = 4q*2 - 2 - 7qf + q + q3 - 1 - 3q2. What is the units digit of b(6)? 3 What is the tens digit of ((-427)/(-14))/(45/600)? 1 Let m be 0/(-5)1/(-2). Let o be (m - -12)/(15/20). Suppose o = -3z + 58. What is the units digit of z? 4 Let a(m) = 5m - 1. Let x be a(1). Suppose -60 = -xy + 24. What is the units digit of y? 1 Let n(t) = -5t + 17. Let y(d) = d. Let w(p) = n(p) + 4y(p). What is the units digit of w(-18)? 5 What is the tens digit of 3/6 - 119/(-2)? 6 Suppose 500 = 2r + 2b, -4b + 1223 = 5r - 8b. What is the tens digit of r? 4 Let y(n) = n2 - 3 + n2 - 3n*2 + 6n*2 + 2n - n**3. Let	{ "pile_set_name": "DM Mathematics" }
hat is prob of picking 2 z when two letters picked without replacement from {c: 3, z: 1, i: 1, w: 2}? 0 Calculate prob of picking 2 j when two letters picked without replacement from {j: 2, f: 16}. 1/153 Calculate prob of picking 3 p when three letters picked without replacement from cgccapmamppbagm. 1/455 What is prob of picking 2 j when two letters picked without replacement from {j: 4, h: 2, s: 1, a: 7, r: 6}? 3/95 Two letters picked without replacement from xbubvbc. What is prob of picking 2 b? 1/7 What is prob of picking 2 g and 2 e when four letters picked without replacement from {g: 3, e: 4}? 18/35 Calculate prob of picking 1 l and 1 j when two letters picked without replacement from djdijddddilj. 1/22 What is prob of picking 2 r when two letters picked without replacement from rrrirrrirrrirrr? 22/35 What is prob of picking 2 r when two letters picked without replacement from krrk? 1/6 Two letters picked without replacement from zzpgpgeppbepgep. Give prob of picking 1 g and 1 e. 3/35 What is prob of picking 1 h and 3 r when four letters picked without replacement from qzzoooohrooloo? 0 Two letters picked without replacement from {e: 1, a: 1, r: 2, d: 4, l: 5, q: 2}. Give prob of picking 2 l. 2/21 Four letters picked without replacement from jjjjjjjjjjjjjjbjjjjj. Give prob of picking 4 j. 4/5 Two letters picked without replacement from ouuuovhuuououvuuouoo. Give prob of picking 1 u and 1 h. 1/19 Two letters picked without replacement from {x: 5, g: 9}. What is prob of picking 2 x? 10/91 What is prob of picking 2 o, 1 s, and 1 v when four letters picked without replacement from {o: 4, s: 3, v: 4}? 12/55 Calculate prob of picking 3 n when three letters picked without replacement from {n: 4, c: 7}. 4/165 Three letters picked without replacement from nvubjnjujbvvv. Give prob of picking 1 b and 2 j. 3/143 Three letters picked without replacement from fanftonofnnon. Give prob of picking 1 o, 1 t, and 1 a. 3/286 What is prob of picking 1 b and 1 o when two letters picked without replacement from bbbbobobbo? 7/15 What is prob of picking 2 f when two letters picked without replacement from mmfzmfzzzzmzfff? 2/21 Four letters picked without replacement from {l: 2, p: 1, f: 4, m: 1, r: 5, y: 2}. What is prob of picking 2 f, 1 r, and 1 m? 2/91 Four letters picked without replacement from {e: 5, v: 3}. What is prob of picking 4 e? 1/14 Four letters picked without replacement from {w: 14, v: 5}. What is prob of picking 4 v? 5/3876 Two letters picked without replacement from ndfolof. What is prob of picking 1 f and 1 o? 4/21 Two letters picked without replacement from {j: 1, t: 1, i: 1, g: 1, q: 4}. Give prob of picking 1 g and 1 t. 1/28 Three letters picked without replacement from {f: 1, v: 1, l: 3, s: 5, k: 2, a: 3}. Give prob of picking 1 v and 2 l. 3/455 What is prob of picking 1 s, 2 b, and 1 a when four letters picked without replacement from baabaabssseaaaaaaau? 33/1292 Three letters picked without replacement from {q: 1, s: 1, a: 1, o: 2, x: 1, h: 1}. Give prob of picking 1 h, 1 q, and 1 s. 1/35 What is prob of picking 1 d and 2 g when three letters picked without replacement from ggdggggdgg? 7/15 Two letters picked without replacement from {j: 1, m: 1, o: 1, i: 2}. What is prob of picking 1 j and 1 m? 1/10 What is prob of picking 2 c, 1 i, and 1 s when four letters picked without replacement from {c: 8, i: 1, s: 2, r: 1, d: 5}? 2/85 Four letters picked without replacement from {l: 1, x: 2, i: 3, c: 1}. Give prob of picking 1 c, 1 x, and 2 i. 6/35 Four letters picked without replacement from {w: 2, t: 2}. What is prob of picking 3 t and 1 w? 0 Calculate prob of picking 1 v and 3 t when four letters picked without replacement from {v: 2, a: 1, t: 1}. 0 Four letters picked without replacement from gzxgxggzsxxxxgssghgx. Give prob of picking 1 h and 3 x. 7/969 Calculate prob of picking 4 i when four letters picked without replacement from xjnininnnnssijdinss. 1/3876 Three letters picked without replacement from qaanntktna. Give prob of picking 1 q, 1 a, and 1 n. 3/40 Three letters picked without replacement from zzzzzzzzvzpzzzzuupz. What is prob of picking 1 p and 2 u? 2/969 Three letters picked without replacement from jhvtrtfjjhrjj. Give prob of picking 2 h and 1 r. 1/143 Three letters picked without replacement from nqyiqvg. Give prob of picking 1 v, 1 i, and 1 n. 1/35 Three letters picked without replacement from vvyvooo. What is prob of picking 3 o? 1/35 Four letters picked without replacement from {y: 1, k: 1, r: 2, g: 1, b: 2}. Give prob of picking 1 k, 1 y, 1 b, and 1 g. 2/35 Four letters picked without replacement from {e: 4, u: 5, w: 5, s: 1, v: 4}. Give prob of picking 3 w and 1 v. 10/969 Four letters picked without replacement from {h: 10, t: 1, i: 7}. Give prob of picking 2 h, 1 t, and 1 i. 7/68 Two letters picked without replacement from hrhhrhhll. What is prob of picking 1 l and 1 h? 5/18 Two letters picked without replacement from okooossosrcj. What is prob of picking 1 r and 1 o? 5/66 Calculate prob of picking 1 g, 2 a, and 1 e when four letters picked without replacement from {g: 2, i: 7, a: 2, e: 7}. 7/1530 What is prob of picking 3 u and 1 p when four letters picked without replacement from {p: 1, u: 14}? 4/15 What is prob of picking 1 s and 1 t when two letters picked without replacement from {s: 7, t: 9}? 21/40 What is prob of picking 1 r, 1 s, and 1 z when three letters picked without replacement from tzzozstotztrsm? 2/91 Calculate prob of picking 1 d and 1 p when two letters picked without replacement from {d: 3, x: 2, j: 6, p: 1, e: 1}. 1/26 Calculate prob of picking 1 z, 2 c, and 1 g when four letters picked without replacement from hgnccppzn. 1/126 What is prob of picking 2 d and 1 i when three letters picked without replacement from {i: 2, d: 3}? 3/5 Calculate prob of picking 4 w when four letters picked without replacement from wwkwwk. 1/15 What is prob of picking 2 p when two letters picked without replacement from {g: 6, p: 7}? 7/26 What is prob of picking 2 k when two letters picked without replacement from nzznzmkkkk? 2/15 Calculate prob of picking 1 k and 1 l when two letters picked without replacement from {k: 1, l: 1, p: 1}. 1/3 What is prob of picking 2 e and 1 v when three letters picked without replacement from {d: 3, v: 1, e: 4}? 3/28 Two letters picked without replacement from ehr. Give prob of picking 1 e and 1 h. 1/3 What is prob of picking 4 f when four letters picked without replacement from {x: 2, w: 1, f: 4, i: 2}? 1/126 Two letters picked without replacement from jmwojpcmmjmccjjj. What is prob of picking 1 o and 1 j? 1/20 Three letters picked without replacement from kzexezpk. What is prob of picking 1 p and 2 e? 1/56 Calculate prob of picking 2 d and 2 g when four letters picked without replacement from {g: 3, d: 5}. 3/7 Three letters picked without replacement from {w: 3, v: 4, o: 4, b: 2, a: 1}. What is prob of picking 2 v and 1 w? 9/182 What is prob of picking 1 c, 1 o, 1 d, and 1 a when four letters picked without replacement from coaxd? 1/5 Calculate prob of picking 2 u and 1 o when three letters picked without replacement from {u: 3, t: 8, o: 2, i: 6}. 2/323 Four letters picked without replacement from {l: 12, s: 2, d: 3}. Give prob of picking 4 l. 99/476 Two letters picked without replacement from iizay. Give prob of picking 1 z and 1 i. 1/5 What is prob of picking 1 v and 1 y when two letters picked without replacement from yvgvvgvvgvgyv? 7/39 Three letters picked without replacement from ioiowwwfoiwiwwg. Give prob of picking 3 i. 4/455 Three letters picked without replacement from {i: 17, f: 2}. What is prob of picking 2 f and 1 i? 1/57 Four letters picked without replacement from wdddddwddddddddddd. Give prob of picking 3 d and 1 w. 56/153 Calculate prob of picking 1 n, 1 a, 1 p, and 1 k when four letters picked without replacement from aaanmjpaknjaajnj. 9/910 Calculate prob of picking 1 n and 1 t when two letters picked without replacement from {n: 2, t: 1, k: 9, f: 2}. 2/91 Three letters picked without replacement from {j: 3, s: 2, o: 5}. Give prob of picking 1 s and 2 j. 1/20 Four letters picked without replacement from {q: 13, s: 1, e: 3}. What is prob of picking 3 e and 1 s? 1/23	{ "pile_set_name": "DM Mathematics" }
ment from bfrbfffzzzz. Give prob of picking 1 b and 1 f. 8/55 What is prob of picking 2 i and 2 q when four letters picked without replacement from iqeeqi? 1/15 Three letters picked without replacement from {v: 6, y: 1, a: 3, w: 3, c: 1}. Give prob of picking 2 v and 1 y. 15/364 Two letters picked without replacement from xqqfqss. Give prob of picking 1 s and 1 q. 2/7 Three letters picked without replacement from seulluullsell. Give prob of picking 2 l and 1 e. 15/143 What is prob of picking 1 j and 2 n when three letters picked without replacement from dataajtjnandandaadda? 1/190 Two letters picked without replacement from {w: 1, s: 1, v: 1, p: 2}. What is prob of picking 1 w and 1 v? 1/10 Calculate prob of picking 1 d and 1 a when two letters picked without replacement from dxlwxxyyxxaaaxwxxw. 1/51 Two letters picked without replacement from xxxxxyvyvy. What is prob of picking 1 v and 1 y? 2/15 Three letters picked without replacement from nnoonooons. What is prob of picking 1 s and 2 o? 1/12 Four letters picked without replacement from nlnnlnzuldzn. Give prob of picking 2 n, 1 l, and 1 z. 4/33 Four letters picked without replacement from wppwwvwvywvwypwwwvvw. Give prob of picking 1 v, 1 y, and 2 p. 2/323 Calculate prob of picking 1 t, 1 g, and 2 d when four letters picked without replacement from {j: 2, t: 1, z: 1, d: 2, n: 1, g: 2}. 1/63 Calculate prob of picking 1 h, 2 k, and 1 a when four letters picked without replacement from flhkklkkfalffff. 2/455 Three letters picked without replacement from {l: 1, k: 2, d: 5, h: 1}. Give prob of picking 2 d and 1 k. 5/21 What is prob of picking 3 y when three letters picked without replacement from yyyyyyyykkykyy? 165/364 What is prob of picking 3 d when three letters picked without replacement from {m: 5, b: 1, l: 1, g: 2, d: 5, j: 1}? 2/91 What is prob of picking 3 s and 1 w when four letters picked without replacement from cswwwswscs? 8/105 Calculate prob of picking 1 q and 1 o when two letters picked without replacement from {o: 1, q: 7}. 1/4 What is prob of picking 1 u and 1 n when two letters picked without replacement from hunuu? 3/10 Three letters picked without replacement from {c: 2, z: 2, b: 4}. Give prob of picking 2 b and 1 c. 3/14 Calculate prob of picking 2 k and 1 y when three letters picked without replacement from yykkl. 1/5 Two letters picked without replacement from {p: 4, r: 2, v: 2, k: 1}. Give prob of picking 1 v and 1 k. 1/18 Two letters picked without replacement from sdsssssisdiqdddiosoo. Give prob of picking 1 q and 1 i. 3/190 What is prob of picking 3 s when three letters picked without replacement from syseuuhxyusxsyu? 4/455 What is prob of picking 1 d, 1 p, and 1 k when three letters picked without replacement from dkdqquqdpukkkgpp? 9/140 Calculate prob of picking 1 k and 3 t when four letters picked without replacement from {k: 2, t: 7}. 5/9 What is prob of picking 2 q when two letters picked without replacement from qcuquccuqcqcqqcqu? 21/136 What is prob of picking 1 m and 1 r when two letters picked without replacement from {m: 3, r: 8}? 24/55 Four letters picked without replacement from {x: 6, p: 1, y: 1, s: 1}. Give prob of picking 1 x, 1 s, 1 y, and 1 p. 1/21 Three letters picked without replacement from {z: 5, j: 1, d: 3, a: 2, x: 8, o: 1}. Give prob of picking 1 z, 1 j, and 1 d. 1/76 What is prob of picking 1 h and 3 u when four letters picked without replacement from suusshhushhs? 4/495 Two letters picked without replacement from fuufuuuuuluflffffl. What is prob of picking 1 u and 1 f? 56/153 Calculate prob of picking 1 z and 1 e when two letters picked without replacement from zzzzzzzzzzzzzzzzzeez. 18/95 Two letters picked without replacement from nqnnnnnnnnqnnqqnnn. Give prob of picking 2 q. 2/51 Calculate prob of picking 2 z when two letters picked without replacement from dzdzzz. 2/5 Two letters picked without replacement from rcccgcrcmcmcfcfgr. Give prob of picking 2 m. 1/136 Two letters picked without replacement from {f: 4, w: 3, s: 2}. Give prob of picking 1 f and 1 w. 1/3 What is prob of picking 2 y when two letters picked without replacement from {q: 2, y: 5, t: 4}? 2/11 Calculate prob of picking 2 k when two letters picked without replacement from kssskjks. 3/28 Three letters picked without replacement from {n: 1, a: 2, z: 1, h: 1}. Give prob of picking 2 a and 1 h. 1/10 Three letters picked without replacement from {e: 11, z: 9}. Give prob of picking 1 e and 2 z. 33/95 Four letters picked without replacement from {c: 5, n: 4, a: 2}. Give prob of picking 2 c and 2 n. 2/11 What is prob of picking 1 b and 1 u when two letters picked without replacement from {l: 2, u: 12, g: 2, b: 2}? 8/51 Four letters picked without replacement from iuuuuuuuuiuu. What is prob of picking 2 i and 2 u? 1/11 Calculate prob of picking 1 v and 2 f when three letters picked without replacement from fffffffvvvf. 28/55 Two letters picked without replacement from tttdddttwtttttt. Give prob of picking 1 d and 1 w. 1/35 Two letters picked without replacement from ududuuuu. Give prob of picking 2 d. 1/28 Two letters picked without replacement from {j: 7, b: 1, y: 8, a: 2, w: 2}. What is prob of picking 1 a and 1 b? 1/95 What is prob of picking 1 r and 1 u when two letters picked without replacement from {i: 1, d: 1, u: 1, r: 1, k: 1}? 1/10 What is prob of picking 1 t and 1 s when two letters picked without replacement from tiiiisistdiispsti? 3/34 Four letters picked without replacement from {c: 3, q: 3, m: 8, y: 3}. What is prob of picking 1 m, 2 q, and 1 c? 18/595 Calculate prob of picking 4 e when four letters picked without replacement from xeeeeeeexeeeexeexeee. 364/969 Four letters picked without replacement from ppttgptgp. Give prob of picking 2 p and 2 g. 1/21 Calculate prob of picking 1 t, 1 s, and 1 c when three letters picked without replacement from {b: 1, t: 1, s: 2, r: 2, c: 1, u: 1}. 1/28 Three letters picked without replacement from oxehl. What is prob of picking 1 x, 1 h, and 1 e? 1/10 Three letters picked without replacement from pkphwkhhwh. Give prob of picking 3 h. 1/30 Three letters picked without replacement from fffkxffefffffk. What is prob of picking 1 x and 2 f? 45/364 Two letters picked without replacement from {a: 4, m: 2, z: 2}. What is prob of picking 2 z? 1/28 What is prob of picking 2 b when two letters picked without replacement from eebzdezezzdbdb? 3/91 Calculate prob of picking 2 i and 1 j when three letters picked without replacement from {a: 2, y: 4, d: 1, h: 4, j: 2, i: 7}. 7/190 Two letters picked without replacement from uuouoruuokrfuk. What is prob of picking 1 k and 1 o? 6/91 What is prob of picking 3 k when three letters picked without replacement from kqkvvqkkkvkkvkkqqqk? 40/323 Three letters picked without replacement from mttttmaaamamtm. Give prob of picking 1 a and 2 m. 10/91 Two letters picked without replacement from {c: 8, h: 2, f: 7, m: 1}. Give prob of picking 1 c and 1 h. 16/153 Three letters picked without replacement from {k: 2, l: 1, n: 3, v: 1}. Give prob of picking 2 n and 1 k. 6/35 What is prob of picking 2 v and 2 c when four letters picked without replacement from vzccnvcvnvccnmv? 20/273 Four letters picked without replacement from dduuuu. Give prob of picking 1 d and 3 u. 8/15 Calculate prob of picking 1 t, 1 s, and 1 m when three letters picked without replacement from {r: 4, m: 1, s: 4, t: 9, j: 2}. 3/95 Two letters picked without replacement from {v: 1, l: 1, o: 1, u: 1, w: 1}. Give prob of picking 1 l and 1 w. 1/10 Two letters picked without replacement from rzzktpzzmmpzzzz. Give prob of picking 1 z and 1 t. 8/105 Three letters picked without replacement from {n: 1, z: 2, x: 1, p: 1, q: 2, o: 1}. What is prob of picking 1 p, 1 n, and 1 z? 1/28 What is prob of picking 1 w and 1 l when two letters picked without replacement from {f: 1, w: 2, l: 3, h: 4}? 2/15 Calculate prob of picking 2 g when two letters picked without replacement from gfgfuuugu. 1/12 Calculate prob of picking 1 k and 2 d when three letters picked without replacement from {d: 4, k: 9, e: 1}. 27/182 Two letters picked without replacement from {s: 11, h: 5}. What is prob of picking 1 s and 1 h? 11/24 Two letters picked without replacement from {a: 3,	{ "pile_set_name": "DM Mathematics" }
28184 What is the t'th term of 745, 784, 841, 910, 985, 1060? -t*3 + 15t*2 + t + 730 What is the i'th term of -55, -200, -373, -520, -587? 9i*3 - 68i*2 - 4i + 8 What is the m'th term of -8201, -16415, -24629, -32843, -41057, -49271? -8214m + 13 What is the k'th term of -1343, -2691, -4035, -5381, -6735, -8103? -k3 + 8k*2 - 1365k + 15 What is the j'th term of -25650, -25658, -25668, -25680, -25694, -25710, -25728? -j*2 - 5j - 25644 What is the t'th term of 25812, 51613, 77414, 103215, 129016? 25801t + 11 What is the b'th term of 8381, 8369, 8349, 8321, 8285, 8241? -4b*2 + 8385 What is the q'th term of -75, -346, -817, -1488? -100q*2 + 29q - 4 What is the w'th term of -181147, -181148, -181151, -181156, -181163? -w*2 + 2w - 181148 What is the o'th term of -228073, -456143, -684213, -912283? -228070o - 3 What is the b'th term of -11501, -23006, -34511, -46016? -11505b + 4 What is the n'th term of 233247, 466491, 699735, 932979? 233244n + 3 What is the w'th term of 5373, 10768, 16163, 21558? 5395w - 22 What is the v'th term of 983, 2144, 3327, 4544, 5807, 7128? 2v3 - v2 + 1150v - 168 What is the p'th term of 92, 119, 174, 263, 392? p*3 + 8p*2 - 4p + 87 What is the j'th term of 382, 662, 942, 1222? 280j + 102 What is the a'th term of 150559, 150482, 150353, 150172, 149939? -26a*2 + a + 150584 What is the a'th term of 2871, 2778, 2685? -93a + 2964 What is the n'th term of 106, 393, 684, 979, 1278, 1581? 2n2 + 281n - 177 What is the n'th term of -4323, -8626, -12905, -17148, -21343, -25478? 2n3 - 4317n - 8 What is the n'th term of 265371, 265370, 265369, 265368? -n + 265372 What is the j'th term of -79243, -79237, -79217, -79177, -79111, -79013, -78877, -78697? j3 + j2 - 4j - 79241 What is the g'th term of -43, -96, -159, -238, -339, -468? -g3 + g2 - 49g + 6 What is the n'th term of -11166, -44662, -100490, -178650, -279142, -401966, -547122? -11166n2 + 2n - 2 What is the s'th term of -1687, -1707, -1739, -1789, -1863? -s*3 - 13s - 1673 What is the y'th term of -190, -29, 406, 1253, 2650, 4735? 23y3 - y2 + 3y - 215 What is the h'th term of -543, -1083, -1597, -2079, -2523, -2923, -3273? h*3 + 7h*2 - 568h + 17 What is the t'th term of 152, 216, 284, 362, 456? t*3 - 4t*2 + 69t + 86 What is the u'th term of 25, 811, 1597, 2383, 3169? 786u - 761 What is the p'th term of -1914, -3824, -5728, -7620, -9494, -11344, -13164, -14948? p3 - 3p*2 - 1908p - 4 What is the q'th term of 1171, 941, 711, 481? -230q + 1401 What is the c'th term of -12940, -51752, -116438, -206998, -323432, -465740? -12937c*2 - c - 2 What is the n'th term of -1942, -3873, -5804? -1931n - 11 What is the h'th term of 8543, 8541, 8539, 8537, 8535? -2h + 8545 What is the u'th term of -311, -610, -901, -1178, -1435, -1666, -1865, -2026? u3 - 2u*2 - 300u - 10 What is the z'th term of -7483, -7318, -7051, -6688, -6235, -5698, -5083, -4396? -z*3 + 57z*2 + z - 7540 What is the x'th term of -1539840, -1539839, -1539838, -1539837, -1539836? x - 1539841 What is the w'th term of 3028, 2331, 1634? -697w + 3725 What is the s'th term of -6484, -6466, -6448, -6424, -6388, -6334? s*3 - 6s*2 + 29s - 6508 What is the s'th term of -1613, -3171, -4727, -6281, -7833, -9383, -10931? s*2 - 1561s - 53 What is the w'th term of -75, -145, -193, -207, -175, -85, 75? 2w3 - w2 - 81w + 5 What is the v'th term of -13995, -13996, -13997, -13998? -v - 13994 What is the t'th term of 12, 51, 106, 177, 264? 8t2 + 15t - 11 What is the v'th term of 164, 554, 1592, 3602, 6908, 11834? 54v3 + 12v + 98 What is the h'th term of -15693, -31370, -47039, -62694, -78329, -93938, -109515, -125054? h*3 - 2h*2 - 15678h - 14 What is the c'th term of -187231, -374461, -561691, -748921, -936151? -187230c - 1 What is the l'th term of -4376, -8854, -13332? -4478l + 102 What is the t'th term of 45, 261, 805, 1833, 3501, 5965? 26t3 + 8t*2 + 10t + 1 What is the i'th term of -531973, -1063939, -1595905, -2127871? -531966i - 7 What is the g'th term of 582, 897, 1226, 1575, 1950? g3 + g2 + 305g + 275 What is the n'th term of -1183, -2362, -3537, -4708, -5875, -7038? 2n2 - 1185n What is the g'th term of 2929, 3209, 3979, 5485, 7973, 11689, 16879, 23789? 41g3 - g2 - 4g + 2893 What is the o'th term of -2465, -2530, -2595, -2660, -2725, -2790? -65o - 2400 What is the k'th term of -112763, -112762, -112761, -112760, -112759? k - 112764 What is the w'th term of 107, 575, 1043, 1511, 1979? 468w - 361 What is the s'th term of 231, 477, 733, 999, 1275, 1561? 5s2 + 231s - 5 What is the p'th term of 5620, 22531, 50716, 90175, 140908, 202915, 276196? 5637p2 - 17 What is the v'th term of -46832, -93704, -140562, -187400, -234212, -280992, -327734, -374432? v3 + v2 - 46882v + 48 What is the m'th term of 6614, 6615, 6618, 6623, 6630, 6639, 6650? m*2 - 2m + 6615 What is the j'th term of -62385, -124753, -187109, -249453? 6j2 - 62386j - 5 What is the l'th term of 94, 59, 24, -11, -46? -35l + 129 What is the g'th term of 6883331, 6883332, 6883333, 6883334, 6883335? g + 6883330 What is the f'th term of 191, 750, 1685, 2996, 4683, 6746, 9185? 188f*2 - 5f + 8 What is the r'th term of -3170, -12782, -28840, -51344, -80294, -115690, -157532? -3223r2 + 57r - 4 What is the h'th term of -2950, -11800, -26550, -47200? -2950h2 What is the j'th term of 147, 366, 655, 1014? 35j*2 + 114j - 2 What is the o'th term of -738, -746, -760, -780, -806, -838, -876? -3o2 + o - 736 What is the m'th term of -731, -762, -783, -788, -771, -726, -647? m3 - m2 - 35m - 696 What is the v'th term of -10, -22, -46, -88, -154, -250, -382? -v*3 - 5v - 4 What is the f'th term of 494, 1907, 4238, 7487, 11654? 459f2 + 36f - 1 What is the s'th term of -3806, -15391, -34700, -61733, -96490, -138971, -189176? -3862s2 + s + 55 What is the q'th term of -21, -99, -223, -393? -23q*2 - 9q + 11 What is the o'th term of 60, 83, 120, 171, 236, 315, 408? 7o2 + 2o + 51 What is the t'th term of -14662, -58634, -131916, -234508, -366410, -527622, -718144? -14655t2 - 7t What is the s'th term of 79, 74, 49, -8, -109, -266, -491? -2s3 + 2s*2 + 3s + 76 What is the p'th term of 29, -109, -525, -1357, -2743, -4821, -7729? -23p3 - p2 + 26p + 27 What is the x'th term of -11, -43, -115, -245, -451, -751? -3x3 - 2x*2 - 5x - 1 What is the o'th term of -14, -86, -158, -230? -72o + 58 What is the s'th term of -27, -111, -277, -567, -1023? -7s3 + s2 - 38s + 17 What is the b'th term of 98, 197, 314, 461, 650? 2b*3 - 3b*2 + 94b + 5 What is the y'th term of -156, -557, -1186, -2031, -3080, -4321, -5742, -7331? 2y3 - 126y*2 - 37y + 5 What is the v'th term of 1368, 2943, 4518, 6093, 7668? 1575v - 207 What is the d'th term of -97, -476, -1231, -2464, -4277, -6772, -10051, -14216? -17d*3 - 86d*2 - 2d + 8 What is the d'th term of 102, -112, -470, -972, -1618, -2408? -72d2 + 2d + 172 What is the d'th term of 6284, 6261, 6200, 6083, 5892, 5609, 5216, 4695? -3d3 - d2 + d + 6287 What is the h'th term of 1666, 3155, 4644, 6133, 7622, 9111? 1489h + 177 What is the m'th term of -120, -433, -938, -1635, -2524, -3605, -4878? -96m2 - 25m + 1 What is the t'th term of 12794, 12805, 12832, 12881, 12958, 13069? t*3 + 2t*2 - 2t + 12793 What is the a'th term of 12897, 25786, 38671, 51558, 64453, 77362, 90291, 103246? a*3 - 8a*2 + 12906a - 2 What is the c'th term of 456, 485, 520, 561, 608, 661? 3c2 + 20c + 433 What is the o'th term of -2435, -4510, -6585, -8660, -10735, -12810? -2075o - 360 What is the b'th term of 690, 2719, 6100, 10833, 16918? 676b*2 + b + 13 What is the n'th term of -22782, -45555, -68328, -91101? -22773n - 9 What is the g'th term of 475, 470, 503, 610, 827? 6g3 - 17g*2 + 4g + 482 What is the g'th term of -824, -267, 290, 847, 1404, 1961? 557g - 1381 What is the i'th term of 380569, 761139, 1141709? 380570i - 1 What is the t'th term of -97309, -194619, -291927, -389233, -486537, -583839, -681139? t*2 - 97313t + 3 What is the x'th term of -44621, -89236, -133847, -178454, -223057, -267656? 2x2 - 44621x - 2 What is the s'th term of -311, -293	{ "pile_set_name": "DM Mathematics" }
o lj2 + hj*4 + i + yj + uj3 and give h. 13 Express -2r - r - r + (4r - 3r + r)(3 - 3 + 1) + (2 - 5 + 0)(-4r + 9r + 4r) in the form tr + k and give t. -29 Express (-2h + 3h - 2h)(h*3 + 2h3 + h3) + (-2h + h - h)(-2h3 + 2h*3 + 2h*3) as i + bh*2 + lh*3 + jh*4 + uh and give j. -8 Rearrange 2w + 4w*3 - 2w + (5w + 0w - 2w)(-2 + 0w2 + 5w*2 - 3w*2) to q + zw*3 + iw*2 + aw and give a. -6 Express -61m + 110m - 19m as x + am and give a. 30 Rearrange 5 - 2 - 55n2 - 2n*4 - n + 58n2 - n3 to the form p + xn2 + bn + cn3 + yn*4 and give p. 3 Rearrange 14z + 29z + 65z - 13z to k + tz and give k. 0 Express -4r2 + 21 + 0r - 8r2 + 10r*2 + r in the form lr*2 + f + qr and give l. -2 Rearrange (o - o - 3o)(-6 + 3 + 1)(-2 + 2 - 3)(o*2 - 4o*2 + 5o*2 - 6o) to the form i + qo + uo*2 + so*3 and give s. -36 Rearrange 39m - 7m - 17m + 2 - 2m - 2 + (2 - 2 + 2)(-3m - m + 2m) to vm + b and give v. 9 Express v - 4v - 2v as lv + y and give y. 0 Rearrange -166f2 - f4 + 0f + 165f2 - 2f to the form af + cf*4 + z + gf*3 + nf*2 and give n. -1 Express 5z + 14z + 15 - 18z in the form gz + a and give a. 15 Express -5 + z2 + 0z*2 - z - 2z*3 + 3z*3 as x + iz*2 + sz*3 + uz and give x. -5 Express 3 - 2n3 - 20 - 2n*4 + 7n*4 - 2n*4 in the form cn*3 + i + qn + ln2 + bn*4 and give i. -17 Rearrange (6 - 3 - 2)(5c2 + 2c*2 + 0c*2) to dc*2 + rc + h and give d. 7 Rearrange (w + 0w - 3w + (1 - 1 + 2)(2w + 0w + 0w) - 4 - 7w + 4)(-2 - 2 + 7)(-3 + 7w + 3) to yw2 + jw + g and give g. 0 Rearrange -4q4 + 7q*4 + 2q*3 - 6q*2 + 5q*2 to rq*4 + nq*3 + a + yq*2 + wq and give w. 0 Express 108 - 108 + 176r as zr + n and give z. 176 Express (-5 + 8 + 19)(-2a*3 + 0a + 0a) as za + da2 + fa*3 + s and give f. -44 Express -2 - 3l*2 + 2 + 0l*2 as o + il*2 + cl and give i. -3 Rearrange (-2y + 1 - 1)(-3y2 + 3y2 + y3) - y*4 - 5y*4 - 2y*4 to ny*3 + fy*2 + oy + w + sy4 and give s. -10 Express ((4i - i - i)(0 + 0 + 2) + 2i - 4 + 4 - 2 + 2 - i - 5i - i + 4i)(14 + 20i - 14) in the form wi + ki*2 + p and give k. 60 Rearrange -10 - 13 + 2t*2 - 21t + 23 to the form yt2 + j + ot and give y. 2 Rearrange b2 - b2 + 21 + 2b2 - 4b*2 to k + wb*2 + hb and give w. -2 Express (1 + 3 - 2)(1 + 3 - 5)(-3l3 + 19l*3 + 19l*3) in the form x + yl + ml2 + tl*3 and give t. -70 Express 12g*2 - 8g*2 + 5 - 3g*3 - 5 - 4g in the form rg2 + x + bg*3 + wg and give x. 0 Rearrange (1 - 4 + 2)(0x + x + 2x) - 3x + 0x + 4x - 2x - 2 - 4x + 4 to vx + z and give z. 2 Express 8 - 9 - 2c - 1 - c*2 + 0c*4 - 2c*4 as o + dc*3 + zc + bc4 + wc*2 and give w. -1 Express 6 - 6f - 6 - 18f in the form pf + s and give s. 0 Express (1 - 1 - 1)(-39 + 39 + 11m*2 + m + (2 + 1 - 1)(0 - m*2 + 0)) as cm + gm2 + n and give g. -9 Rearrange 5t3 - t4 - 2t2 + 5 - 6 + 0t*4 - 1 to the form ut*4 + c + vt + jt3 + ht*2 and give j. 5 Rearrange -1 + 8u - 3u3 + 0u + 5u3 - 3u*4 - 6u to the form ou + gu*4 + mu*3 + ju*2 + w and give j. 0 Express (5 - 4 - 4)(4a - 4a + 3a4) + (2a2 - a2 + 4a2)(-6a2 + 3a*2 + 4a*2) in the form q + na + wa3 + ia*2 + za*4 and give z. -4 Rearrange -3f + 13f + 6f to the form c + gf and give g. 16 Express (-f2 - 2f*2 + 2f*2)(-14f2 + 41f*2 + 0f*2) as gf*3 + r + cf*2 + mf + bf4 and give b. -27 Rearrange (2 - 7 - 6)(13 - 13 - 6d)(4 + d - 4 + 1) to rd2 + bd + f and give r. 66 Rearrange -5y2 + 3y*3 + 5y*2 - 4 + 0y*2 to the form fy + oy3 + hy*2 + p and give p. -4 Express (-4d - 2 + d + d)(4d*3 - 4d*3 + 3d3) + (-d2 + 3d2 + d2)(-3d2 - 3d*2 + 4d*2) as s + md*3 + qd*2 + bd*4 + pd and give m. -6 Express (3r + 0r - r)(2 + 1 + 1) + 3r - 3r - 3r + 0r - 3r + 3 - 5 in the form mr + n and give n. -2 Rearrange (2 - 1 + 1)(b + 4b - 3b) - 2 - 9b + 7b + b to the form ub + r and give r. -2 Rearrange b2 - 8b*3 + 2b*3 + 14b3 + b2 to the form c + hb2 + ab*3 + rb and give h. 2 Express 4 - 12i - 4 in the form s + pi and give p. -12 Rearrange 3a4 + 5 - 5 + (4a + a - 3a)(-a3 - a3 - 3a3) + 2a*4 + 3 - 3 to ma*4 + ja*3 + ha + ca2 + t and give m. -5 Rearrange (-1 - 4 + 6)(-3 - 1 + 3)(0 + 0 + a) to ha + b and give h. -1 Express (4d2 - 5d*2 + 0d*2)(-d + d + 3d)(2d - 5 + 5) in the form jd*3 + qd*2 + t + od*4 + md and give o. -6 Rearrange -12 + 12 - 13i to h + xi and give x. -13 Rearrange (4h2 + 2h*2 - 4h*2)(2h - h + 0h) + 21h + 3h*3 + 3 - 12h - 10h to the form nh*2 + jh*3 + th + k and give j. 5 Express -4i + 2i - 7i + (-2 + 2 - 2i)(1 + 1 + 0) + 3i - 4i + 0i in the form r + ni and give n. -14 Express (30 - 30 - 9o + (-4o + 6o + 0o)(3 - 5 + 1))(-6o + 4o + 3o - 2) in the form ro + mo*2 + n and give r. 22 Rearrange 0t + 3t - 4t + 0t + 2t + 3t + (-4t + 4t + 2t)(1 - 1 + 3) to jt + p and give j. 10 Rearrange (-1 + 5 - 2)(3h*2 - 3h*2 - 9h*4) - 4h*4 + 2h*4 + 6h*4 to xh*4 + j + ch*3 + mh*2 + qh and give x. -14 Rearrange (-n*4 + 0n*3 - 2n*3 + 3n*4)(10 + 27 + 0) to the form z + kn2 + in + vn3 + tn*4 and give v. -74 Rearrange 11i*3 - 3i*2 - 6i*3 - 2i*3 + 3i to ki + di*3 + wi*2 + n and give k. 3 Express 2l*2 - 1 - 135l + 135l as xl + ol2 + s and give s. -1 Rearrange (-p + 0 + 0)(-3p + p2 - p + 2p + 3) to wp3 + kp + n + dp2 and give k. -3 Express -4i*2 + 5i*2 - 2i*2 - 3 as ci + o + bi2 and give b. -1 Express 26z + 8z - 14z as c + jz and give j. 20 Express (-1 + 1 - 1)(x + 0x - 3x) + 2x - 2x + x - 2x + 4x + 0x + 48 - 48 + 9x + 5x - 6x - x as t + px and give p. 12 Express c4 + 11 - 28 + 4 - 2c*2 + 11 as xc*4 + wc + vc2 + fc3 + j and give j. -2 Rearrange (j2 + j - j)(4j - 3j + j) + (4 - 4 + 2j)(5j*2 + 13j2 + j2) to the form nj2 + d + tj*3 + xj and give t. 40 Express r + 230 - 8r2 - 230 as sr*2 + xr + a and give s. -8 Rearrange (-1 - 1 + 3)(0 - 2h + 0 + (-1 + h + 1)(-3 + 5 - 1) - 2h + 4h + 6h) - 2h + 3h - 3h to qh + z and give q. 5 Rearrange -1109k - 2 + 2k*2 - 3k*2 + 1113k - 2k4 to xk + nk4 + qk*3 + b + gk*2 and give x. 4 Express -4w3 + 1 + 1 - w3 + 6w3 - 5w in the form cw2 + tw + sw3 + q and give t. -5 Rearrange -v2 + 5 - 2 + 0 - v + v4 - 5 to the form yv*3 + dv + pv2 + o + tv*4 and give d. -1 Express 5p + 7p - 6p in the form zp + m and give z. 6 Express -3g*3 + 3 + 2g - 1 + g*3 - 6 as dg*3 + wg + ag2 + p and give d. -2 Rearrange (4f*3 - 2f*3 + 0f*3)(-12f + 4f - 17f) to pf*4 + w + cf*2 + hf*3 + bf and give h. 0 Rearrange 41z3 - 36z*3 - 19z*3 + (-2z + 2z + 2z*2)(-z - 3 + 3) to tz3 + jz + iz2 + g and give t. -16 Express -39j + 64j + 48j as c + xj and give x. 73 Express 50 + l2 - 50 + 3l as gl2 + tl + w and give t. 3 Express (-1 + 1 + 7)(-2x + 5x + x) as n + wx and give n. 0 Rearrange (-25 + 25 + 13l2)(2l + 0 + 0)(-2 - 1 + 4) to tl3 + y + gl + xl2 and give t. 26 Express 3a + a + 5a2 - 5a as va + wa*2 + s and give w. 5 Rearrange (-7 - 3 - 8)(-t + 0t + 0t)(-2 - 2 + 2) to bt + w and give b. -36 Express 9i4 - 7i*4 + 4 + 0 - i as ai + bi3 + yi*4 + r + hi*2 and give y. 2 Express -3u - 2u + 3u + (2 + 0 + 0)(2u - 3u + 2u) - 2 + 2u + 2 + 4 - 5u - u + 3u as fu + i and give f. -1 Rearrange 25o + 2 + 0 - 22o + 2 to the form l + uo and give l. 4 Rearrange -3u - 11u2 - 17u*2 - 15u*2 + 44u*2 - 4 + 3u*3 to the form hu*3 + v + fu*2 + xu and give h. 3 Express -80y3 + 78y*3 + 33y + 1 + 5y as sy*3 + ny*2 + q + by and give s. -2 Express 13 - 17f - 13 in the form i + uf and give u. -17 Express t*3 + 4t - t*3 + 5t*3 - 6t*3 in the form wt + xt3 + v + jt*2 and give w. 4 Express (3g - 3g + 2g)(-7g - g + 3g)(0g + 3g - 2g) as mg*3 + hg*2 + b + pg and give m. -10 Express 3	{ "pile_set_name": "DM Mathematics" }
4 + 9 + -1 -4 (-2 - 5 - -3) + 5 1 -14 + -7 + 10 + 8 -3 What is -10 - (9 + (6 - 23))? -2 What is the value of 3 + (9 - 12 - -2)? 2 What is the value of (1 - 2) + (4 + -11 - -9)? 1 What is the value of (3 - (7 - 1)) + 6? 3 Calculate 4 + 0 + -4 + (-7 - -2). -5 What is the value of 5 - ((-33 - -36) + -1 + 0)? 3 Evaluate -1 - 10 - (40 - 47). -4 Calculate (1 - 2) + -3 + 0. -4 What is the value of 12 - (0 + 1) - 12? -1 -2 - (-2 - (-4 + -2)) -6 What is the value of 3 + -3 - -2 - -1? 3 What is 2 - -15 - 4 - 6? 7 What is the value of (-1 - (-1 + 2)) + 6? 4 What is 2 + -2 + 0 + 1 + 2? 3 What is -11 + (18 - -9) - 9? 7 What is -10 + 5 + -2 - (-4 - 9)? 6 (-80 - -77) + -4 + 0 -7 What is the value of 5 - (2 + 8 + -5)? 0 Calculate 3 - -2 - (-1 - -5) - -4. 5 Calculate (24 - 27 - (1 - 9)) + 2. 7 Calculate 0 - -4 - -14 - 9. 9 Calculate -5 + (-2 + 7 - 2). -2 Calculate (-1 - 1) + 3 + -3 + 4. 2 What is 2 + -7 + 8 + -4? -1 What is the value of -17 + 20 - (0 - -1 - 1)? 3 3 - (2 + 3 + 0) -2 Calculate (0 + -1 - 0) + 1 - -2. 2 0 + 3 + 0 + -2 1 Evaluate -12 - ((0 - 5) + 0). -7 -5 - -4 - -8 - 2 5 What is (-11 + 5 - -4) + -1? -3 Evaluate -3 - (-6 + 3 + -5). 5 What is the value of -9 + 8 + 2 + -49 + 43? -5 Calculate 10 - -2 - (9 - 4) - 7. 0 What is (2 - 0) + -5 + 5 + -7? -5 Calculate 5 - (0 + -6 - -8). 3 What is the value of 1 + -8 - (8 - (-9 - -21))? -3 -5 + 6 + -5 + 6 2 What is the value of (2 - -3) + (-29 - -23)? -1 What is the value of -7 + 1 + (19 - 2) + -4? 7 Calculate 3 + -5 - 1 - (-1 - 1). -1 Evaluate 0 + (1 - 1) - 1 - 3. -4 Evaluate 3 + -1 - (2 - 2). 2 What is 22 + (-13 - -4) + -4? 9 Calculate 7 - (-4 + 15) - (0 + -2). -2 Evaluate (0 - (-3 + 1 - 4)) + -3. 3 What is -8 + (0 - -9) + (42 - 50)? -7 (0 + (-1 - -2) - 1) + 1 1 Evaluate -2 - (27 + -30 + -2 + 0). 3 -1 + -9 + 1 + 8 -1 What is the value of 11 + (1 - 9 - -3)? 6 Calculate (3 - 2) + (2 - (-1 + -1)). 5 What is the value of -9 + (-2 - -7) + 8? 4 What is (4 - (-4 + 2 - -1)) + -5? 0 What is the value of 5 + -6 + 1 - 5? -5 Calculate -4 + 3 + (-9 - -5). -5 What is 4 - ((0 - 2 - 2) + 8)? 0 What is the value of -1 + 3 - (4 + 2 + 1)? -5 Calculate -2 + -6 + 5 + 1 + -2. -4 Calculate 6 + 1 + 8 + -6 + -10. -1 Evaluate -3 + -4 + 6 + 2. 1 Calculate 1 - (10 + -11 + (0 - 1)). 3 What is the value of -7 + (-4 + 16 - 6)? -1 What is the value of -3 - (12 + -19 + 7 + 6)? -9 -36 + 42 - (2 + -5 - -3) 6 What is the value of 6 - 6 - (2 + -4)? 2 Calculate 10 + -8 + -1 + 3 + 3. 7 What is the value of -3 - (4 - ((-3 - 3) + 10))? -3 5 + -1 - (6 + 0 - -3) -5 What is the value of 2 - (0 + -3 - -5 - 2)? 2 Evaluate (6 - (4 + -6)) + -5. 3 What is the value of -1 - -6 - (5 + 2 + 0)? -2 Calculate -3 + 2 + (-8 + 1 - -4). -4 What is the value of -12 + 2 - (14 + -18) - -12? 6 What is the value of (0 - 23) + 8 + 7? -8 Evaluate -4 + 3 + -4 + 0. -5 What is the value of 4 + (3 + 1 - 2) - 7? -1 Calculate -1 - -5 - (0 + 15 - 17). 6 -4 + (7 - 3) + (-5 - -2) -3 Evaluate (61 - 57) + (-2 - 0). 2 What is 4 - (-5 - (-6 - 3))? 0 2 + ((2 - 1) + -2 - 1) 0 (4 - (6 - 3 - -1)) + -2 -2 Calculate (-3 - -1) + 5 + -3 + -4. -4 What is -3 - (-4 - -4) - -1? -2 Calculate 5 + -11 + 9 - (3 + -1). 1 Calculate 0 - (-8 - (-10 + 1)). -1 Calculate -5 - ((-54 - -58) + (-2 - 0)). -7 What is 4 + (-4 - -3 - 5) + -3? -5 What is the value of -5 - (3 - 5) - (0 - -3)? -6 -99 + 96 + 0 + 0 -3 Calculate -9 + (-9 - (-14 - 2)). -2 What is the value of -2 + 11 + -7 + -3? -1 -1 + 1 + 7 + 4 + -8 3 Evaluate 7 + -3 - (-2 - (0 - 2)). 4 Evaluate (6 - 14) + 1 + 3. -4 What is (-10 - -2 - -4) + 6 + -3? -1 What is -5 - (2 + -3 + -6)? 2 Calculate -14 + 0 - (209 - 212). -11 Calculate (-3 - 8) + 7 - (-1 + 2). -5 (77 - 76) + -1 + 0 0 (-13 - -6) + 3 + -2 -6 Evaluate (-8 - -7 - 2 - 1) + 6. 2 -61 + 51 - (-3 - 1) -6 Calculate -4 + (-7 + 8 + 6 - 14). -11 Calculate -7 + (-3 + 2 - -6). -2 What is the value of -6 + (14 - 6) + -5? -3 What is the value of 1 + 0 + 1 + -3 + 2? 1 What is 2 + 2 - (-17 - -22)? -1 -5 + (-6 - -3) - -5 -3 Evaluate -10 - (-4 - (-2 - -2)). -6 Evaluate 1 + -27 + 23 + 1 + 2. 0 -9 + 17 + -15 + 5 -2 Evaluate -6 + -2 - (53 + -55). -6 What is -1 - -6 - (4 + -3)? 4 Evaluate 1 + (-18 + 3 - -9). -5 What is the value of 0 - (5 + -7 + 4 - 1)? -1 What is the value of -14 + 1 + 5 - -3? -5 What is the value of 3 + (-10 + 1 + 2 - 1)? -5 Evaluate (6 - 13 - 3) + 8 + 12. 10 What is 4 - ((1 - 2) + 2)? 3 What is 2 - 3 - (10 + -12) - 0? 1 Calculate (2 + (0 - 3) - 0) + -3. -4 What is the value of 8 - 2 - (-5 - (-9 - -4))? 6 What is the value of 11 - ((13 - 9) + 7)? 0 What is the value of 13 - 21 - 2 - -6? -4 What is the value of (-3 - -4 - (5 - 0)) + 3? -1 Calculate (-14 - 5) + (3 - 2) - -8. -10 Evaluate 4 + (1 + -15 - -4). -6 1 + (10 - 3) + -4 4 What is 1 + 0 + 4 - (-35 - -44)? -4 Evaluate 3 + (-2 - (-4 - -7)). -2 What is the value of 5 - (8 - 3 - (-7 + 10))? 3 What is the value of (4 - 5) + -6 + 3? -4 What is 1 - (1 + 0 + 1)? -1 Evaluate -4 - ((5 - 3) + -2). -4 -5 - (9 + -2 + -4) - -3 -5 What is the value of -2 + -5 + 8 - -4? 5 3 + (-6 - -3) - 1 -1 What is 2 + (-2 - 6) + 2? -4 Calculate -3 + (2 - (3 - -1 - 3)). -2 What is the value of -1 + -14 + 5 + 3 + 2? -5 What is -2 - (-1 - (5 + 1 + -1))? 4 -8 + 0 + 8 - 2 -2 -29 - (-52 + 26) - (-1 - -7) -9 What is the value of 3 + -1 + (-2 - (-2 + 1))? 1 Evaluate 16 + -14 + 9 + -5. 6 What is the value of -5 - ((-4 - 2) + 5 + -7)? 3 Evaluate -2 + (3 - 3) - (0 + -5). 3 What is (8 - 4) + 1 + 0 - -2? 7 What is -3 - (3 - 3) - (-1 - -2)? -4 5 + (3 - 6 - (1 - 0)) 1 What is the value of -1 + (2 - -1 - 0 - 2)? 0 What is (4 - (5 - -13)) + 18? 4 -7 + (3 - 4 - -8) 0 What is 9 + (-70 - -63 - (1 - 2))? 3 Evaluate 9 - (15 - (-6 + 13)). 1 Evaluate 2 - (0 - -4) - 0. -2 Evaluate 7 - ((-1 - -8) + -4 - -4). 0 Evaluate (-7 - 4) + 1 + 2 - -3. -5 -1 - ((-8 - 2) + 6) 3 Evaluate 9 - (4 - 6 - -7). 4 Evaluate 3 + 4 + -4 + 0 + 0. 3 What is -5 + 2 + 0 + -1? -4 What is 10 + -9 + 9 - 7? 3 Evaluate 3 - (-4 + (-3 - -6) + 0). 4 Calculate 1 + -5 - (-4 + -5). 5 Calculate (4 - 2) + -6 - -2. -2 What is (9 + -17 - -7) + 3? 2 -2 - -1 - 3 - -5 1 What is 2 + -1 + (2 - 2)? 1 Calculate -21 - -17 - (0 + -1 + -7). 4 What is the value of -13 + 23 + -12 - (3 - 11)? 6 Calculate 17 - 21 - (0 + -5 - -2). -1 Evaluate -91 + 80 - (-7 - 0). -4 Calculate -2 + -1 - (-2 + -1 + 2). -2 4 - (6 - -2 - (0 - -2)) -2 What is the value of (-3 - -8 - 7) + (-2 - -2)? -2 What is the value of (6 - 3 - 6) + (3 - 3)? -3 Evaluate -5 + 4 - (-2 + 7 - 0). -6 What is -4 + 5 + -1 - -1? 1 What is -3 + 9 + (-2 - -3) + -4? 3 Calculate 3 + -4 - (-1 + 3 + -1). -2 Calculate -2 - -8 - (-11 - -15). 2 What is the value of -3 - (-6 - -13 - 13)? 3 1 + -4 + 2 + -3 -4 Calculate 0 - (2 + -4 - (-1 - 2)). -1 What is -7 + 5 + 2 + 3? 3 Evaluate 3 + 0 + -1 + -4 + -1. -3 What is the value of -6 + -11 - -12 - (1 + 2)? -8 What is the value of -7 - -6 - (-9 + 8)? 0 What is the value of (-4 - (-2 - 8)) + 3? 9 -2 + 1 - -4 - -7 10 Evaluate 12 + -5 + (-1 - 5) + 1. 2 Evaluate 0 - (-4 + 5 + 3) - -3. -1 Evaluate 29 + -16 + -16 + (-2 - -5). 0 What is -2 + (-5 - -9) - -2? 4 What is the value of 2 + -10 - -6 - -1? -1 What is the value of 3 - (-4 - (5 - (8 + 5)))? -1 Calculate -2 - -2 - (-2 - 6). 8 What is 6 + 1 + -3 + 20 + -18? 6 What is the value of 1 + 4 + 5 + 6 + -13? 3 11 + 9 + -6 + -5 9 Evaluate (-20 - -15) + 4 + -1. -2 What is 7 + -13 + 13 + -8? -1 (-4 + 11 - 13) + 6 0 Calculate (-8 - (-1 - 3)) + 0. -4 What is (-15 - -4) + (-7 - (-16 - -7))? -9 What is the value of (-6 - -11) + 1 - 7? -1 Evaluate 8 - ((-10 + 4 - -1) + 9). 4 Evaluate (2 - -2) + -4 + 5. 5 What is the value of (3 - -1) + (9 - (-7 - -15))? 5 5 - (7 + -3 + -3) 4 Calculate 9 - 9 - (2 + 3). -5 Evaluate -1 + -1 + 5 - (0 - -7). -4 -48 + 52 - (-1 - -13) -8 Evaluate -4 - 7 - -6 - -8. 3 What is 3 + (-1 - 0) - (9 + -5)? -2 3 + 2 + (1 + 3 - 4) 5 2 + -7 + -9 - -8 -6 Calculate 21 + -21 - (-7 - -1). 6 What is -4 + -6 + 17 + -6? 1 What is (-3 - 1) + (7 - 2)? 1 What is 8 + -14 + 12 + -3? 3 What is the value of 2 - (-10 + 8 + 4)? 0 Calculate (-2 - -3) + (-6 - -1). -4 Calculate (5 - -4) + (6 - 3) + -6. 6 What is the value of (-1 - 1 - (-9 + 5)) + -1? 1 Calculate 4 + -8 + 4 - 5. -5 -4 - (16 + -14 - (0 - 2)) -8 Evaluate 6 + -1 - (-13 + 17). 1 Calculate 0 + 6 + -1 + 1 - 6. 0 -62 + 76 - (2 - -9) 3 What is -1 - (2 - 16) - 5? 8 (7 - (-5 +	{ "pile_set_name": "DM Mathematics" }
c)/cc(-4/7) assuming c is positive. c(79/21) Simplify (f(-6))(-3/23) assuming f is positive. f(18/23) Simplify f(-5)f/f(6/13) assuming f is positive. f(-58/13) Simplify (v*11/(v(v*(-4/3)v)/v))(1/6) assuming v is positive. v(17/9) Simplify (r(-21)/r(9/8))(-1/15) assuming r is positive. r(59/40) Simplify ((((y/y*(-2/11))/y)/y)/y)/(yyy(-1/2)/y)((y*1yy)/y)(3/16) assuming y is positive. y(-171/88) Simplify ((z(-10)z)15)18 assuming z is positive. z(-2430) Simplify (z(-2/49)z)/((z(1/55)zzz)/zz) assuming z is positive. z(-5549/2695) Simplify ll*(1/3)l*(-3)l/(l*0l)l5/l assuming l is positive. l(7/3) Simplify (t/(tt/((t(-1/5)/t)/t)))(-7/2) assuming t is positive. t(56/5) Simplify ((a/((a1a)/a))/aaa)/(aa*(7/6)a) assuming a is positive. a*(-13/6) Simplify (h(h(h(-9/7)h)/h)/hh)/h(-8) assuming h is positive. h(61/7) Simplify w3w*(-5/2)(w*(-4)w)/(w/(ww(-3)/w)ww) assuming w is positive. w(-17/2) Simplify ((s/(ss((s/(s/(((ss*(-4)s)/sss)/s)))/s)/s))/(ss(3/5)s))(2/15) assuming s is positive. s(4/75) Simplify k*(-8)k/k(-1/5) assuming k is positive. k(-34/5) Simplify (d(d14/d)/dd)/ddd(-1/52) assuming d is positive. d(727/52) Simplify i/(iii*(-13))iii6 assuming i is positive. i20 Simplify ((o*5o)/(oo/(o(-3)o)))/(o/o*(3/8)oo(-1)/oo) assuming o is positive. o(11/8) Simplify b0/b11 assuming b is positive. b(-11) Simplify (m/((m/m8)/m))(-1/16) assuming m is positive. m(-9/16) Simplify (x1xxx/(xx(2/7)/x))(-2/77) assuming x is positive. x(-52/539) Simplify (((c/c(-3/4))/c)/cc)/(c/(c(-10)c)) assuming c is positive. c(-37/4) Simplify r(2/13)r(-2) assuming r is positive. r(-24/13) Simplify ((m(-3))39)14 assuming m is positive. m(-1638) Simplify t(-4/9)/(t/(t/(tt*9t))) assuming t is positive. t(-103/9) Simplify (n(20/9)nn)/nn(-6) assuming n is positive. n(-25/9) Simplify g15/g(2/49) assuming g is positive. g(733/49) Simplify (j(-5/2)/j)(-3/19) assuming j is positive. j(21/38) Simplify x(-2/23)x(-1/9) assuming x is positive. x(-41/207) Simplify (h*7h)(-48) assuming h is positive. h(-384) Simplify c*(-1/12)c1 assuming c is positive. c(11/12) Simplify (l*(-2/5)l)(-3/5)/(l(-2/5))(-5/6) assuming l is positive. l(-52/75) Simplify (ii/(i/(i4i))i(-9))4 assuming i is positive. i(-12) Simplify (qq*(-6)q(q/((q(-2/9)q)/q))/qq)(-40) assuming q is positive. q(1000/9) Simplify (t/(t/(t27/t)t))/(tt(-18/11)) assuming t is positive. t(282/11) Simplify ((a/(a/((a/((a(a/a*(1/2))/a)/aa))/aaa)))/(aa3))/((a4a)/(a*7a)) assuming a is positive. sqrt(a) Simplify (h/h(1/5))(1/4) assuming h is positive. h(1/5) Simplify (x(-1/2))(-26)/(x(3/5)x(-4/5)) assuming x is positive. x(66/5) Simplify (tt(-2/7))27/(t(-2/3))15 assuming t is positive. t(205/7) Simplify ((n/(n/n(5/7)))/(n(4/7)/n))(-13) assuming n is positive. n(-104/7) Simplify (x(5/9))39 assuming x is positive. x(65/3) Simplify (((h/(h*10h))/h)/h*(-2/5))/(h/(h/(hh*(3/7))h)h(2/19)) assuming h is positive. h(-7404/665) Simplify (o(1/4))18((oo/((o/o0)/o)o)/o)/(o/(o/(oo(1/6)))) assuming o is positive. o(16/3) Simplify (y/(y(2/5)/y))44/(y/y(-2/5))(5/11) assuming y is positive. y(3837/55) Simplify ((kk(2/9)/k)/(k/(k/k(-3))))/(k(2/7))(4/5) assuming k is positive. k(943/315) Simplify (j/j(-1))*(-49)(jj(1/3))(-14/15) assuming j is positive. j(-4466/45) Simplify i(1/2)i/((i/((i/((i*(2/11)i)/i))/i))/ii)(i/i(-1/4))(-8/9) assuming i is positive. i*(-157/198) Simplify (u/(uu/((u*(-27)uu)/u)uuu)u)/uu(7/4)/u assuming u is positive. u(-117/4) Simplify n*(-25)n/(n*20nn) assuming n is positive. n(-46) Simplify x/(x(-12)/xx)x/(xx6) assuming x is positive. x7 Simplify ((g/(g*0/g)gg)/gg/(g*(-2/3)g)g)/(g(-2/5)g6) assuming g is positive. g(-14/15) Simplify (z8/z)/z(-6/5)z(-2/11)z/(z/z(-1/7)) assuming z is positive. z(3032/385) Simplify ((gg/g(-2)g)/(gg(-11/5)g))(-2/17) assuming g is positive. g(-52/85) Simplify (s(-2)/s)(1/50) assuming s is positive. s(-3/50) Simplify f33f/((f(-2/9)/f)/f) assuming f is positive. f(326/9) Simplify (h0)(-16)/(h(-2/21)hh(2/5)) assuming h is positive. h(-137/105) Simplify (r(-6)r*(-4/11)r)/(r(-1))(21/8) assuming r is positive. r(-241/88) Simplify ((u/(u5uuuu))/u9)/(u(-7)u8) assuming u is positive. u(-18) Simplify ((ccc0cc)/cc/(ccc/(c/c*(-2)))c)/(((c/(c/c*0))/c)/cc/((c6/c)/c)) assuming c is positive. c10 Simplify (g*(-2/11)/gg)/(g*(-2)/g)g*8g(g/(g/(gg*(-4/7)gg)))/g assuming g is positive. g(1020/77) Simplify o/(o/(o/o2))ooo/(o/(o/(oo(-2/37)))) assuming o is positive. o(39/37) Simplify cc(c4/ccc)/cc*(-1/3)(cc(1/3))(-2) assuming c is positive. c3 Simplify ((y/((yy(-1))/y))/(y/y(2/9)))(-49) assuming y is positive. y(-539/9) Simplify (q/((qq43)/q)q)/((q*(-38)/q)/q) assuming q is positive. 1/q Simplify (ii*(-1/6))/(i/(ii*(2/5)ii)) assuming i is positive. i(97/30) Simplify ((u0u)(-49))(-1/33) assuming u is positive. u*(49/33) Simplify gg/g*(4/3)g*(2/15)((g/(g/g*4))/g)/((gg(2/15))/g) assuming g is positive. g(11/3) Simplify (i*(-10)(i/(i/i*(-10))ii)/i)/(ii/(i/(i*2i)))37 assuming i is positive. i(-167) Simplify (fff*(-10)/fff/(f/f(1/16)))(-2/113) assuming f is positive. f(127/904) Simplify (b(3/4)/(bbb/(b/b(-2/3))))/((b/(bbb4b))/(b*6/bb)) assuming b is positive. b(137/12) Simplify (h/(h(-2/3)hh))(-6/25)/(h(-1)h/h(-2/17)) assuming h is positive. h(-16/425) Simplify w21/((ww*(6/5))/www) assuming w is positive. w(89/5) Simplify r1/((rr*(3/2))/r)(rr/r(-1/2))21 assuming r is positive. r52 Simplify (s(-1/4)/((s(-1/2)s)/s))(6/25) assuming s is positive. s(3/50) Simplify (d*2/d)/(dd(-1/10)) assuming d is positive. d(1/10) Simplify d*(3/2)d(4/9) assuming d is positive. d(35/18) Simplify ((i*(-3/10)i)(3/29))(4/3) assuming i is positive. i(14/145) Simplify (d/(d(1/3)d))(3/4)/(dd/(d/(((d/(dd(-1/3)/d))/d)/d)))(-4/3) assuming d is positive. d(7/36) Simplify (x9xx5)/((xx(-5))/((x/(x/x(-4))x)/x)) assuming x is positive. x15 Simplify (v(vv3vv)/vvv(-7))24 assuming v is positive. 1 Simplify (l(3/4)lll(-2/11))49 assuming l is positive. l(5537/44) Simplify (i/((i/(i(-1/3)/i))/i))*(-46)(ii(-2/5))/(i3i) assuming i is positive. i(179/15) Simplify ((p(-2/7)/p)(2/27))28 assuming p is positive. p*(-8/3) Simplify (((oo/o(1/3))/o)(2/3))(-44) assuming o is positive. o(-176/9) Simplify m*0/mm/m26 assuming m is positive. m(-26) Simplify ((ww/w(-2/9))/w)(-24)(w(-2/3))6 assuming w is positive. w(-100/3) Simplify (r(3/7))(-17)/(r9/rr(-2/9)/r) assuming r is positive. r(-886/63) Simplify (a(2/13)a/((aa(-2/9)aa)/a))46 assuming a is positive. a(-3358/117) Simplify (z(-2/23))(5/11) assuming z is positive. z(-10/253) Simplify ((f/((ff*(-1/2)f)/f))/f)*38(ff/f(-6))/f5 assuming f is positive. f(-16) Simplify o(-1/37)o*(-4/3)/oo assuming o is positive. o*(-151/111) Simplify (ss/(s/(ss/s(-1/10))))(-18/11) assuming s is positive. s(-279/55) Simplify ((jj(2/3))23)(9/8) assuming j is positive. j(345/8) Simplify bbbbb*(-1/3)/bb*1(bb(2/3)b)40 assuming b is positive. b(331/3) Simplify o*(14/3)o(-28) assuming o is positive. o(-70/3) Simplify ((sss/(s*(2/5)s)s)(-4/25))(-8/5) assuming s is positive. s(416/625) Simplify (i(-1))6 assuming i is positive. i(-6) Simplify ((y0/y)23)(2/9) assuming y is positive. y(-46/9) Simplify (g(1/9)/g(-12))27 assuming g is positive. g327 Simplify s10s(-7) assuming s is positive. s3 Simplify d15/d(-16/3) assuming d is positive. d*(61/3) Simplify (c(c/(c/(c/(c/(c/c*(2/3)))))cc)/c)13 assuming c is positive. c*(	{ "pile_set_name": "DM Mathematics" }
s w even? False Let n(m) = 2m2 + 2m - 4m + 3m. Does 12 divide n(4)? True Let t(v) = v*2 + v + 1. Let k(i) = -3i*3 - 6i*2 - 6i - 6. Let j(h) = k(h) + 5t(h). Let w be ((-4)/(-6))/((-3)/9). Is j(w) a multiple of 10? False Let y be 26 + 5 + (-5 - -2). Suppose 0n + y = 2n. Is 6 a factor of n? False Let w be (-3 + (-3 - -4))/2. Let r(t) = 44t2 - 1. Is r(w) a multiple of 11? False Let o(c) = c2 + 1. Let g be o(4). Let b be 2/3 + 25/3. Let l = g - b. Is 6 a factor of l? False Let w(i) = 6i + 7. Does 5 divide w(3)? True Let q(y) = -96y*2 + 2y. Let w(s) be the third derivative of -4s5/5 + s4/24 + s2. Let o(g) = -3q(g) + 5w(g). Is o(1) a multiple of 16? False Suppose -468 = -2r - 4r. Does 6 divide r? True Let j(b) = 11b - 7. Suppose -d + 6 = 1. Let v be j(d). Suppose 0n + 4n = v. Does 11 divide n? False Suppose -90 = 4f - 9f. Does 9 divide f? True Let k = -39 - -50. Is k even? False Suppose -4r + 183 = 4x + 23, -159 = -4r - 3x. Is r a multiple of 8? False Let d(f) = -2f2 + 0f - 3 - 2f + f2 - 7f*3 + 2. Does 3 divide d(-1)? False Let o(l) = 3l*2 - l. Is 4 a factor of o(-3)? False Let g(c) = -8c - 1. Is g(-1) a multiple of 2? False Is 22 a factor of (-2034)/(-27) + 2/(-6)? False Let i(a) = a*3 - 9a*2 - 2a + 10. Is i(10) a multiple of 20? False Let l(f) = -f*2 + 10f. Suppose 5j - 46 = -16. Suppose -9 = -3h + j. Is 7 a factor of l(h)? False Let o(h) = h*2 - 3h + 1. Let x be o(3). Is 13 a factor of 154/4 + x/2? True Let q = 1 - -2. Does 2 divide q? False Let y(b) = b*2 - 5b - 7. Let g(u) = u*3 + 5u*2 + 4u + 1. Let v be g(-3). Does 4 divide y(v)? False Suppose -x = 2c - 0x - 9, 3c + 2x = 11. Suppose cy = 2y. Suppose -2z + 47 = 3a, y = -a - a + 2z + 48. Does 15 divide a? False Let i be 8/28 - 303/7. Let m = -4 - i. Does 13 divide m? True Suppose 9l = 14l - 75. Is l a multiple of 5? True Let y(u) = 4u*2 + 5u - 3. Let g = 2 + 1. Is 16 a factor of y(g)? True Let n(v) = -7v + 1. Let i = 7 + -12. Let d(p) = p3 + 5p*2 + p + 4. Let u be d(i). Is n(u) a multiple of 7? False Let s = -273 + 465. Is s a multiple of 24? True Let n = -72 + 108. Is 12 a factor of n? True Suppose 36 = -0j + 3j. Suppose -2z + j = 2q, 0 = 2q + z + 5 - 15. Suppose -2x = 2w - 38, -x + qx + 5w = 63. Is 8 a factor of x? True Let m(g) = 3g - 27. Does 6 divide m(11)? True Let i(p) = 2p*2 - 7p - 9. Let w be i(7). Let m = w + -10. Suppose 3v + 0t - m = 3t, -2 = -t. Is v a multiple of 6? True Suppose -74i = -77i + 24. Does 4 divide i? True Let w(f) = f3 - 11f*2 + 12f - 6. Suppose 6s = 3s + 30. Does 4 divide w(s)? False Suppose d + 30 = 5g, -1 = 4g + d - 16. Does 4 divide g? False Suppose 3w - 3n - 156 = 0, -2n + 0n - 200 = -4w. Does 8 divide w? True Let a(j) = -j + 39. Does 13 divide a(0)? True Let h(w) be the third derivative of -w5/60 + w4/8 - 5w*3/3 + 2w*2. Let x be h(8). Let z = 90 + x. Is z a multiple of 16? False Suppose -2j - 5s + 33 = -47, 20 = -5s. Does 25 divide j? True Let f(m) be the third derivative of 5m4/12 - m3/3 + 3m*2. Let s be f(6). Let t = s - 38. Does 10 divide t? True Let n(o) be the third derivative of -1/120o*6 - 1/24o*4 - 5/6o*3 + 0 - 3o*2 + 0o + 1/10o5. Does 15 divide n(5)? True Let f(t) = t3 - t2 - 2t + 1. Let u be f(-2). Let m = 11 + u. Suppose mr = 37 - 1. Is r a multiple of 8? False Let w be ((-14)/21)/(4/(-30)). Let d(l) = -l3 + 6l*2 - 2l. Is d(w) a multiple of 5? True Suppose -5b - 4h + 15 = 0, -5h + 0 = -3b + 9. Let j = 24 - b. Suppose j = 2c - 3l, 18 = 2c - 3l - l. Is 5 a factor of c? True Suppose -3y + 401 = 4w, -y + 202 = 2w + y. Does 14 divide w? True Let h be 1/2 - (-34)/(-4). Let p = -5 - h. Suppose p = -3q + 36. Is q a multiple of 4? False Let k(q) = -6q + 13. Let n(a) = 5a - 13. Let z(w) = -6k(w) - 7n(w). Let t be (3 - (3 + -4)) + -12. Is z(t) a multiple of 5? True Let h = -13 - -37. Does 6 divide h? True Suppose 0f + 28 = 2f. Is f a multiple of 14? True Let j(p) = -p*3 - 6p*2 + 5p. Does 22 divide j(-8)? True Let m = 113 - 77. Suppose -4h - m + 232 = 0. Suppose -5u + h = -6. Is u a multiple of 11? True Suppose -f = 5x - 29, 4f + 2 - 49 = 3x. Suppose f + 14 = o. Does 28 divide o? True Suppose 4v + 5f + 0f + 7 = 0, v = -f - 3. Let t = 24 + v. Is t a multiple of 16? True Suppose 5w - 3h = 85, w - h - 15 = -0w. Is w a multiple of 14? False Let a be 2 + (-5)/(10/4). Suppose a = -4c + 35 + 41. Suppose c + 16 = 2j - 5y, -3j = 4y + 5. Is 2 a factor of j? False Let q(x) = -x*2 + 23x + 9. Is 8 a factor of q(20)? False Let p = 18 - -14. Let s = 50 - p. Suppose -q - q + s = 0. Is 5 a factor of q? False Let q(o) = o*2 - 7o - 10. Let k be q(8). Is (k + -1)/3-20 a multiple of 20? True Is (-3)/(-24) - (-1195)/40 a multiple of 9? False Let r(p) = 3p - 5. Let m be r(5). Is 20 a factor of m/420/2? False Suppose -5l = 5i - 20, 0 = 5i - 3l + 5 + 7. Suppose i = 9v - 5v - 56. Suppose -10 - v = -2b. Is 7 a factor of b? False Suppose -2l + 8 = 0, 2f - 28 = -f - l. Suppose 0 = fj - 4j - 48. Is 6 a factor of j? True Let l(k) = k. Let d(g) = -2g - 6. Let y(i) = d(i) + 3l(i). Let o be y(9). Suppose -a - 3a = s - 51, 5s - 51 = -oa. Does 12 divide a? True Suppose 4w - 6 = -18, 4m = 4w + 84. Suppose 4v - 14 = -3n - v, -3v = 5n - m. Does 8 divide (-3)/n - 1 - -24? False Suppose 6n = 2n + 28. Suppose -4z = -nz. Suppose 3b + 4i + 6 = 1, -b + 2i + 15 = z. Is 2 a factor of b? False Let t(y) = -y3 + 6y*2 - 5y + 3. Let b be t(5). Let d(j) = 4j + 1. Let g be d(1). Suppose 0 = n - 3r - 25, -2 = -bn - gr + 3. Is 10 a factor of n? True Let x(c) be the third derivative of 0c5 + 0c - c*2 + 1/24c*4 + 0 - 1/30c*6 + 1/6c*3. Is x(-1) a multiple of 4? True Is 2/(-4) - 404/(-8) a multiple of 25? True Does 41 divide -2 + -1 - 174/(-1)? False Let k(o) = 5o - 5o2 + 3 - 2o - 4o - o3. Is 2 a factor of k(-5)? True Suppose -2 = -z + 1. Suppose 7 + 200 = zk. Is 33 a factor of k? False Suppose 2m - 96 = -5g, 2g - m = 3g - 18. Suppose -3w - 5x + g = 0, 0 = 3w - 0x - 3x - 60. Is w a multiple of 5? True Let n(f) = -f3 - f2 + 6. Suppose -3m = -m. Does 2 divide n(m)? True Suppose 3398 = 11r + 538. Does 13 divide r? True Suppose 0 = 4i - u + 4u + 44, 4u = 16. Let y = i + 23. Is 6 a factor of y? False Suppose -8 = -4w + w - 5h, -4h - 1 = -5w. Let u(r) = -r + 1. Let o be u(w). Suppose o = t - 2d - 5 - 3, -4t + 46 = -d. Does 12 divide t? True Let l = 9 - 3. Does 16 divide (116/(-6))/((-2)/l)? False Let d = -42 + 61. Is 6 a factor of d? False Let b = 23 + -7. Is 2 a factor of b? True Suppose -8 - 4 = -3s. Suppose 24 = sk - 8. Suppose -3v = -kv + 100. Does 5 divide v? True Let i(b) = -b*2 + 6b - 6. Let x be i(5). Does 28 divide 27 - 1(-2 - x)? True Suppose -3v = -4y - 185, -3v - 5y + 3y + 173 = 0. Is 6 a factor of (-3)/(-15) + v/5? True Let j(n) = n*3 + 7n*2 - n + 2. Let o be j(-7). Suppose -g + o = 3. Is g a multiple of 6? True Suppose 0 = -8h + 5h - 15. Let z be (0 + h)48/(-10). Let q = z - 15. Is 4 a factor of q? False Suppose 0a + 5a - 195 = 0. Does 10 divide a? False Suppose 7a + 267 = 10a. Suppose 25 - a = -2o. Is 7 a factor of o? False Let q(b) = -3b + 1. Let x be q(-1). Does 9 divide (-2)/4 - (-102)/x? False Let a(x) = x*2 - 3. Let t be a(6). Suppose t = 5u + 8. Is 2 a factor of u? False Let h(g) = 8g - 1. Let x be h(6). Suppose b = -1, 0 - x = -2w - 5b. Let t = -9 + w. Is t a multiple of 13? False Let l = -30 - -58. Let u = 7 + l. Is u a multiple of 24? False Suppose -25 = 3y - 10, 0 = -4c + 4y + 92. Suppose 4g + 4l = 112, 4g + 4l = 5g - c. Does 13 divide g? True Let z(w) = 60w + 1. Let q be 2 - (-3)/6-6. Let b be z(q). Let x = -35 - b. Does 20 divide x? False Let k(u) = u - 4. Is k(15) a multiple of 2? False Suppose 0 = 3o - s - 396, -o - s + 53 = -79. Is o a multiple of 44? True Let b be (-2 - (-6)/3)1. Suppose 5r = -4w + 15, -3w - 4r + 3 + 9 = b. Let t(l) = -l3 + l2 + l + 10. Is t(w) a multiple of 10? True Let k be (-9)/6 - 1/2. Is 26 a factor of 0 - 49(-3 - k)? False Let y be ((-27)/4)/(4/32). Is 50/(-15)y/4 a multiple of 12? False Let g be (-2 - (-1)/1) + 10. Suppose 4m = -4*f	{ "pile_set_name": "DM Mathematics" }
510 What is the least common multiple of 351 and 33? 3861 What is the common denominator of 31/189 and 20/147? 1323 Find the common denominator of 17/2 and 53/26. 26 What is the smallest common multiple of 1792 and 320? 8960 What is the lowest common multiple of 2153 and 2? 4306 What is the common denominator of -53/108 and 119/36? 108 Calculate the smallest common multiple of 130 and 5174. 25870 What is the lowest common multiple of 3 and 41? 123 Calculate the smallest common multiple of 68 and 357. 1428 Calculate the common denominator of 127/54 and 179/1230. 11070 What is the common denominator of 109/154 and -61/99? 1386 Calculate the common denominator of 71/1380 and 91/345. 1380 What is the common denominator of -57/8659 and -57/7? 8659 Calculate the common denominator of 7/20 and 61/118. 1180 What is the common denominator of 23/7 and 22/103? 721 Find the common denominator of 127/3230 and 27/2584. 12920 Calculate the lowest common multiple of 3214 and 12856. 12856 What is the smallest common multiple of 6 and 124? 372 Calculate the common denominator of 13/54 and -139/2442. 21978 Calculate the least common multiple of 21 and 1029. 1029 Find the common denominator of 32/35 and -64/875. 875 Calculate the common denominator of -173/300 and -47/420. 2100 Calculate the least common multiple of 8 and 7935. 63480 What is the least common multiple of 312 and 18? 936 Calculate the least common multiple of 387 and 27. 1161 What is the common denominator of -28/505 and -19/101? 505 What is the smallest common multiple of 5 and 88? 440 What is the least common multiple of 12 and 36? 36 What is the least common multiple of 36 and 102? 612 What is the lowest common multiple of 1638 and 3? 1638 Find the common denominator of -29/28 and -53/48. 336 Calculate the least common multiple of 3 and 803. 2409 What is the smallest common multiple of 165 and 6? 330 Find the common denominator of 47/1890 and 1/22. 20790 What is the lowest common multiple of 128 and 448? 896 Calculate the common denominator of -117/50 and -47/18. 450 What is the lowest common multiple of 114 and 6? 114 What is the common denominator of 17/401 and -5/17? 6817 What is the common denominator of -1/6696 and 125/648? 20088 What is the least common multiple of 1682 and 8? 6728 What is the smallest common multiple of 98 and 10? 490 Calculate the common denominator of -11/16926 and 181/546. 16926 Calculate the common denominator of -33/721 and 38/105. 10815 Calculate the least common multiple of 119 and 136. 952 Find the common denominator of -167/990 and -35/16. 7920 What is the lowest common multiple of 64 and 224? 448 Find the common denominator of 53/70 and -9/3605. 7210 Calculate the common denominator of -71/12540 and -193/4560. 50160 Calculate the common denominator of 93/2 and -151/30. 30 Calculate the least common multiple of 90 and 72. 360 What is the least common multiple of 10 and 30? 30 What is the lowest common multiple of 1112 and 973? 7784 Calculate the lowest common multiple of 70 and 160. 1120 What is the least common multiple of 140 and 76? 2660 Calculate the lowest common multiple of 39 and 6. 78 What is the common denominator of -8/461 and 19/8? 3688 Calculate the common denominator of -137/70 and -65/4. 140 Find the common denominator of 97/14 and -8/7. 14 Find the common denominator of -43/108 and 161/90. 540 What is the common denominator of -47/528 and 55/144? 1584 Calculate the least common multiple of 27 and 831. 7479 Find the common denominator of 5/816 and 163/2244. 8976 What is the common denominator of -29/280 and -63/176? 6160 What is the least common multiple of 1330 and 8? 5320 Calculate the common denominator of -85/22 and 101/234. 2574 Calculate the least common multiple of 114 and 24. 456 What is the least common multiple of 791 and 1017? 7119 What is the smallest common multiple of 2412 and 3618? 7236 Find the common denominator of 87/2 and 49/22. 22 What is the smallest common multiple of 5 and 522? 2610 Calculate the lowest common multiple of 5 and 88. 440 What is the smallest common multiple of 27 and 21? 189 Calculate the common denominator of -1/270 and -47/450. 1350 What is the lowest common multiple of 10 and 76? 380 What is the common denominator of -1/468 and -47/9? 468 What is the smallest common multiple of 7 and 115? 805 Find the common denominator of 52/3 and -65/424. 1272 What is the common denominator of 95/96 and -89/2? 96 Calculate the common denominator of -28/243 and 83/420. 34020 What is the common denominator of -65/56 and 93/224? 224 What is the common denominator of 107/42 and 9/1267? 7602 Calculate the common denominator of 64/15 and -31/5940. 5940 Calculate the least common multiple of 5 and 55. 55 What is the common denominator of -29/8 and 79/88? 88 Calculate the common denominator of 28/657 and 77/438. 1314 What is the least common multiple of 684 and 209? 7524 Calculate the lowest common multiple of 54 and 38. 1026 Find the common denominator of -87/1880 and 67/15980. 31960 Calculate the smallest common multiple of 208 and 377. 6032 Calculate the least common multiple of 8 and 105. 840 What is the least common multiple of 231 and 63? 693 Find the common denominator of 7/582 and -13/2910. 2910 Calculate the common denominator of 34/133 and 41/665. 665 Find the common denominator of 41/72 and -25/774. 3096 What is the common denominator of 29/308 and -23/8? 616 Calculate the lowest common multiple of 312 and 264. 3432 Calculate the common denominator of 123/10 and 103/2158. 10790 What is the common denominator of 53/14 and 81/14? 14 What is the common denominator of -59/1120 and -45/16? 1120 Calculate the least common multiple of 64 and 80. 320 What is the least common multiple of 54 and 1764? 5292 Calculate the least common multiple of 987 and 2303. 6909 Find the common denominator of -1/22 and 7/146. 1606 What is the common denominator of -10/19 and 99/76? 76 What is the least common multiple of 300 and 40? 600 Calculate the smallest common multiple of 183 and 183. 183 Calculate the smallest common multiple of 336 and 462. 3696 What is the lowest common multiple of 1050 and 250? 5250 Calculate the least common multiple of 39 and 258. 3354 Calculate the common denominator of 18/371 and 28/41. 15211 Calculate the least common multiple of 31 and 279. 279 What is the common denominator of 41/660 and 17/30? 660 Calculate the common denominator of -31/880 and -71/600. 13200 What is the smallest common multiple of 1463 and 1254? 8778 What is the least common multiple of 957 and 348? 3828 Calculate the least common multiple of 720 and 264. 7920 What is the least common multiple of 6 and 370? 1110 What is the common denominator of 109/24 and 101/52? 312 Find the common denominator of -27/14 and -27/68. 476 Calculate the lowest common multiple of 22 and 1870. 1870 Calculate the common denominator of 103/306 and -139/36. 612 Calculate the lowest common multiple of 10 and 15. 30 Calculate the lowest common multiple of 92 and 27. 2484 What is the least common multiple of 108 and 2? 108 What is the common denominator of -91/30 and 73/30? 30 What is the least common multiple of 12 and 168? 168 What is the common denominator of -23/150 and -53/200? 600 What is the least common multiple of 705 and 2585? 7755 What is the smallest common multiple of 40 and 100? 200 Calculate the smallest common multiple of 300 and 18. 900 Calculate the common denominator of 127/390 and -29/120. 1560 Calculate the smallest common multiple of 183 and 12. 732 What is the common denominator of -39/137 and 97/4? 548 What is the common denominator of 63/338 and -95/22? 3718 What is the smallest common multiple of 110 and 2? 110 Calculate the lowest common multiple of 12006 and 8. 48024 Calculate the smallest common multiple of 1846 and 8307. 16614 What is the common denominator of 35/54 and 11/1510? 40770 Find the common denominator of 41/18 and 79/2542. 22878 Calculate the common denominator of -119/1818 and 137/1818. 1818 Calculate the least common multiple of 6 and 3. 6 What is the smallest common multiple of 12 and 206? 1236 What is the lowest common multiple of 10 and 3650? 3650 What is the least common multiple of 195 and 3770? 11310 What is the commo	{ "pile_set_name": "DM Mathematics" }
(z). What is the units digit of 0 - -16 - (-3)/a? 5 Let h(z) = -z*3 - 8z*2 - 6z - 28. Let c be h(-8). What is the units digit of 5/c - (-1677)/12? 0 Let l = -484 - -1046. What is the units digit of l? 2 Let l(b) be the second derivative of -b5/20 - b4/6 + b*3 + 3b*2/2 - 2b + 10. Suppose 4u + 0u + 16 = 0. What is the tens digit of l(u)? 1 Let y(m) = m*2 + 2m + 3. Suppose 0k - 4k = -88. Let v = -27 + k. What is the units digit of y(v)? 8 Suppose 5f + 41 = -o + 9, o = 4f + 4. Let i(u) = u*3 + 13u*2 + 3u + 9. What is the tens digit of i(o)? 1 Suppose -4v + 34 = -14. Let m = 4 + v. What is the tens digit of m? 1 Suppose 0j - 2 = 2j + 2f, 3f = 2j + 7. What is the units digit of j/5 - (156/(-15) + 6)? 4 Suppose 225f = 212f + 4173. What is the hundreds digit of f? 3 Let k = -642 - -1204. What is the hundreds digit of k? 5 Let n = -45 + 55. What is the tens digit of -2(-113)/n + 12/(-20)? 2 Let c(r) = 5r*2 - 4r - 2. Let v be c(6). Let h be 21/5 - ((-66)/(-30) - 2). Suppose -v = -hl - 2d, l + d - 157 = -3l. What is the units digit of l? 0 Let p be 10 - 1 - (0 + 4). Suppose 12 + 416 = 3c + pd, -3c - 4d = -430. What is the hundreds digit of c? 1 Let h(v) = -v3 - 6v*2 - 6v - 1. Let a be h(-5). Let p be (-86)/4 - a/(-8). What is the units digit of p/624/(-14)? 6 Let a(d) = -d3 - 6d*2 - 3d + 12. Let h be a(-5). Suppose -hj = -0j - 350. What is the tens digit of j? 7 Let f(w) = -w - 6. Let x be f(-8). Let k(j) = 24 + j*x + 15j - 2j - 7. What is the units digit of k(-12)? 5 Suppose -3l - 5 = -4l. Suppose 0 = 11a - la - 90. What is the tens digit of a? 1 Let f = 11 + -8. Let v(z) = -z - fz + 25z3 + 3z. What is the units digit of v(1)? 4 Let b(k) = -2k + 2. Let o be b(2). Let g = 1 + -1. Let h = g - o. What is the units digit of h? 2 Suppose 518a - 522a = -356. What is the tens digit of a? 8 Suppose -3x + 119 = r - 110, 3x - 3r = 225. What is the tens digit of x? 7 Suppose 4r - 3 = 4u - 7, u - 2r = 0. Suppose 0g = -ug + 4. What is the units digit of -1 + g + 81/3? 8 Let b(p) = -p3 + 27p*2 + 16p - 92. What is the tens digit of b(27)? 4 Suppose 0 = -9i + 7i + 8. Let s(q) = -13 - q*2 - iq - q*3 + 2q*2 + 7q*2. What is the tens digit of s(6)? 3 What is the tens digit of (-2960)/2(12/4 - 4)? 8 Suppose -5s + 23d = 22d - 16336, -4s + 3d + 13060 = 0. What is the units digit of s? 8 Let f(v) = 153v + 2. Let x be f(2). Suppose -x = -4t + 32. What is the units digit of t? 5 Suppose 5l - 10 = -p + 2l, 0 = -p + 5l + 50. Suppose 0 = -3w + 3r - 0r - 18, -5w - 3r = 6. Let u = w + p. What is the tens digit of u? 2 Let m(w) = -69w*2 + w + 1. Let n be m(2). What is the tens digit of (n/(-13))/(0 - (-2)/12)? 2 Suppose -4y + 20 = 0, 0 = 7l - 2l - y + 15. Let c(g) = 37g2 + 1. What is the hundreds digit of c(l)? 1 Suppose 2f = 0, 5f + 228 = 4m + f. Let v = 22 + m. What is the tens digit of v? 7 Suppose -2 = -4c + 10. Let s be 120/(-36)c/(-2). Suppose -5o + 24 = x, 5x - 70 = so + 50. What is the units digit of x? 4 Suppose 2l - 2f = -2l + 2264, f - 4 = 0. What is the tens digit of l? 6 Suppose -86 = 4m + 2n, -5m - 126 = 5n - 6. Let x be m/(-2) + (-27)/18. What is the units digit of (-1576)/(-28) - x/28? 6 Suppose -2t - 2t = -3g - 265, -3t + g + 205 = 0. Suppose 9y - t - 20 = 0. What is the units digit of y? 0 Suppose -4k = -5d - 4 + 37, -2d + 5k + 3 = 0. Suppose -d + 7 = -j. What is the tens digit of 29 + -5 + j - 0? 2 Let b = 25 + -40. Let f = b + 117. What is the units digit of f? 2 Let y = 21 + -7. Let p = y + 2. What is the tens digit of p? 1 Suppose 1192 + 2092 = 2a. What is the thousands digit of a? 1 Let y = -25 - -32. Suppose m - y = -0. Suppose 0 = -ma + 2a + 315. What is the tens digit of a? 6 Let a be (-4)/6(2 + 25/(-2)). Let r(s) = s3 - 5s*2 - 8s + 6. What is the units digit of r(a)? 8 Suppose 4i - 2r - r = 33, -3r + 51 = 3i. Let w be (1 + 7)6/i. Suppose 0 = -2y - wn + 10, -2y + 16 = 2y + 4n. What is the units digit of y? 3 Let u(a) = -a*3 + 6a*2 + 5a - 1. Suppose 14c - 12c = 12. What is the tens digit of u(c)? 2 Suppose 5w + 2r = 174, -4r = -3w - r + 96. Suppose 0y - 2y = -w. Suppose 2h = z - 3z + 4, -h = -2z - y. What is the units digit of h? 7 What is the units digit of (-9)/(-15) - (4 - 10810/25)? 9 Let k(d) = d2 - 4d - 17. Let o(c) = -c*3 + 5c*2 + 8c - 3. Let m be o(6). What is the tens digit of k(m)? 2 Let w = -227 - -239. What is the tens digit of w? 1 Let m(w) = 44w2 - 4. Let z be m(-3). Suppose 38i - 42i + z = 0. What is the units digit of i? 8 Let g(w) = w3 - 4w*2 - w + 8. Let s be g(4). Let t(c) be the first derivative of 5c*2/2 - 5c + 2. What is the units digit of t(s)? 5 What is the tens digit of 75/(-10) - -7 - (-5103)/6? 5 Suppose 2f = -0w + 3w + 16, -4f - 4 = 0. Suppose -s + 12 = 2s. What is the units digit of (-38)/s(w + 4)? 9 Suppose -3t + i + 925 = 5i, 950 = 3t - i. Suppose p - 2j - 17 = 40, -5p + t = 5j. What is the units digit of p? 1 Suppose -3x = -5f + 16, -2x + 0 - 4 = -2f. Suppose 3i = 4i - 5d + x, d = 2i + 15. Let k = 23 - i. What is the tens digit of k? 3 Suppose 467 = 16b - 47325. What is the thousands digit of b? 2 Let n = -3289 + 4715. What is the thousands digit of n? 1 Let f(v) = 3v + 3. Let s be f(0). What is the tens digit of s/(-3)3146/(-6)? 7 Suppose -4z = -98 - 18. Suppose -30o + 337 = -zo. What is the units digit of o? 7 Suppose 0 = -n + 5 - 3. Let j(h) = 3h + 24. Let v be j(-8). Suppose v = m + w - nw - 22, 5m = -w + 86. What is the units digit of m? 8 Let x = -48 + 48. Suppose -6b + 180 + 258 = x. What is the tens digit of b? 7 Let z(n) = -67n + 82. What is the thousands digit of z(-19)? 1 Let n = -15 + 12. Let d = -19 - -7. What is the tens digit of d/826/n? 1 Let i = -2902 - -5074. What is the hundreds digit of i? 1 Let b(i) be the second derivative of -2/3i*4 - 3i*2 - 1/20i*5 + i + 0 + 5/6i*3. What is the units digit of b(-9)? 0 Suppose 2y - 7h - 8 = -6h, 1 = -3y - 5h. Suppose -3f + 291 = -0f - yd, 2d = -f + 109. What is the hundreds digit of f? 1 Let l(v) = 1. Let d(u) = u - 2. Let x(y) = -d(y) - 4l(y). Let p be x(2). What is the tens digit of p/(4/(-41)) + -3? 3 Let m(a) = -3a - 12 + a - 2a + a2. Let i = 132 + -137. What is the units digit of m(i)? 3 Let t = 459 + -400. What is the units digit of t? 9 Let m(f) = f3 - 2f*2 + 22f - 19. What is the hundreds digit of m(10)? 0 Let c be (-6 - -6) + 54/1. Let o = c - 26. Suppose -86 = -5j + 3x, 0j - 3x + o = j. What is the units digit of j? 9 Let h(w) = 2w - 21. Let q be h(9). What is the units digit of (-2 - q) + (-5 - -69)? 5 Let t = 2 - 18. Let o = t + 17. Let b(z) = 39z2 - z + 1. What is the units digit of b(o)? 9 Let u(c) = c3 + 56c2 - 109c + 184. What is the hundreds digit of u(-57)? 1 Suppose -2c = 3c - 35. Let s(b) = -b*2 + 8b - 7. Let d be s(c). Suppose -3y + 2l + 75 = 0, y = -dy - 4l + 39. What is the tens digit of y? 2 Suppose -8i + 32 - 88 = 0. Let u(k) = -k3 - 6k*2 + 3k - 3. What is the units digit of u(i)? 5 Let h(y) = -15y - 1. Let o(c) be the second derivative of c4/12 + c3/3 - c2/2 + 2c. Let x be o(-2). What is the tens digit of h(x)? 1 Suppose -2y - 3h = -581, 7h + 1117 = 4y + 4h. What is the units digit of y? 3 Suppose -4y = 5k + 10, y + 5k - 2k + 6 = 0. Let c be (-43)/(129/180)1-1. Suppose y = -j - 2j + c. What is the units digit of j? 0 Let s(i) = -5i + 13. Let n be s(3). What is the units digit of (-138)/(-3)(-1)/n? 3 Let y = -251 - -372. Suppose 4j = 3w - y, -5w - 3j = -248 + 56. Let f = -7 + w. What is the tens digit of f? 3 Suppose 0 = -3h - 12 + 54. Let i = h - 8. What is the units digit of (-618)/(-18) + 4/i? 5 Let x = 779 - 178. What is the hundreds digit of x? 6 Let m(x) = x3 + x2 - x + 1. Let y be m(0). Let f be 2 + y/(2/(-4)). Suppose 5s + 34 - 179 = f. What is the units digit of s? 9 Let a = -37 + 61. Let z be 2/(-3)a/(-8). Suppose 4n - 36 = -zn. What is the units digit of n? 6 Suppose c + 2v - 256 = 0, -1244 = -5c - 3v + 5v. What is the tens digit of c? 5 Suppose 0 = -f - 9 - 1. Let c be (-3)/15 + (-52)/f. Suppose 2q = -2*a + q + 3, 5	{ "pile_set_name": "DM Mathematics" }
12599 + 12629. Let a = 140 - 27. What is the remainder when a is divided by l? 23 Let u = 12341 + -7087. Calculate the remainder when u is divided by 18. 16 Suppose -3y + 5a = -477, 8 = -4a + 20. What is the remainder when y is divided by 83? 81 Suppose 4o - 304 = 4t, o + 2t - 115 = -30. Suppose -11h + 33 + 209 = 0. What is the remainder when (3 + o)1/2 is divided by h? 19 Let x(m) = m*3 - 6m*2 - 3m + 3. Let d be x(6). Let s be (18 + d)/(6/(-32)). Calculate the remainder when 8 is divided by (-2)/(-2) + (s - -20). 3 Let d(m) = -m*3 + 18m*2 - 2m + 14. Let b = 249 - 181. What is the remainder when d(17) is divided by b? 65 Suppose 2p + 2p - 12 = 0. Let u(d) = 7d2 - 2. Suppose 10 + 22 = m. What is the remainder when u(p) is divided by m? 29 Let g = -134 + 194. What is the remainder when 225 is divided by g? 45 Calculate the remainder when 5541 is divided by (-3260)/(-90)(-90)/(-20). 162 Suppose -2f + 2g - 428 = 732, -3g - 2884 = 5f. Let x = f + 585. Calculate the remainder when 76 is divided by x. 6 Suppose -3z - 2l + 48 = -246, 3z - 2l - 294 = 0. Suppose 92d + 228 = zd. Calculate the remainder when d is divided by 5. 3 Suppose 4s + 24 - 36 = 0. Suppose 0 = 5f, 2a + 2f - 108 = -sf. Let k(m) = 21m - 2. What is the remainder when a is divided by k(1)? 16 Let m(j) = -148j - 4506. Calculate the remainder when 196 is divided by m(-31). 32 Let x = 297 - 263. Let f(o) = -o3 + 35o*2 - 35o + 62. What is the remainder when 88 is divided by f(x)? 4 Let d be ((-24)/(-27))/4 - (-2164)/(-18). Let y = d + 130. What is the remainder when 26 is divided by y? 6 Suppose 5b + 9k + 16 = 5k, -20 = 5k. Suppose b = 2l - 189 - 1. What is the remainder when l is divided by 11? 7 Let u = 13201 + -11856. Calculate the remainder when u is divided by 18. 13 Suppose s + 51 = 5o, 5s = -o + 2o + 9. What is the remainder when ((-59)/3)/(104/(-312)) is divided by o? 4 Suppose -2y - 11168 = -5x, 123x + 5y = 121x + 4502. What is the remainder when x is divided by 20? 16 Let r be (2 + 1)/(11 - 75/6). Calculate the remainder when 30 is divided by 39((-12)/9 - r). 4 Calculate the remainder when 101 is divided by (-3)/(-2 - 752/(-384)). 29 Suppose -4m - 126 = 5z - 819, -z - 357 = -2m. Let a = m - 106. Suppose 4i - 6i = 3g - 51, -3g = -i - 42. What is the remainder when a is divided by g? 11 Let v = 22684 + -22669. Let q = 277 + -57. What is the remainder when q is divided by v? 10 What is the remainder when 36369/513 + (220/(-76) - -3) is divided by 7? 1 Let x(n) = n3 - 20n*2 + 84n + 87. What is the remainder when 1346 is divided by x(15)? 14 Suppose -8u + 9u = 111. Suppose u = 4k + 3b, 5k - 113 = 3b + 46. Calculate the remainder when k + (-6 - -2) - 2/2 is divided by 13. 12 Suppose 23 + 107 = 13f. What is the remainder when (107 + 0)f/5 is divided by 9? 7 Let y(x) = x*3 + 10x*2 + 12x - 7. What is the remainder when 5/(45/(-324))(-9)/2 is divided by y(-7)? 50 Let v = 323 + -322. Let y(b) = 29b + 4. What is the remainder when 77 is divided by y(v)? 11 Suppose 15i = 11i + 8. Suppose -2t + o + 7 = 3t, it - 3o + 5 = 0. Suppose -3k + ty = k - 146, k = y + 34. What is the remainder when k is divided by 14? 11 Let b = 75 - 5. Calculate the remainder when 2 + 1 - (2 + (1 - b)) is divided by 18. 16 Let c = 134 - 28. Let o = c - 85. What is the remainder when o is divided by 4/(-14) - 79/(-7)? 10 Let x(l) = -2l3 - 18l*2 - 36l - 14. What is the remainder when x(-8) is divided by 114? 32 Suppose 3l = -4l + 35. Let p(n) = -n*3 + 30n*2 - 31n + 79. Calculate the remainder when p(29) is divided by l. 1 Calculate the remainder when 1046 is divided by (-11)/3 + (-11)/((-132)/(-16)) + 38. 23 Suppose -32j - 12813 + 14762 = -23299. Calculate the remainder when j is divided by 34. 7 Let t(q) = q + 10. Calculate the remainder when 15448/841 + 2/21 is divided by t(17). 22 Suppose 15t - 10 = 155. Suppose -3i - 48 = -ti. Calculate the remainder when 45 is divided by i. 3 Let s(w) = w3 - 22w*2 + 36w + 56. What is the remainder when s(21) is divided by 39? 20 Let j = 35356 + -35260. What is the remainder when 1915 is divided by j? 91 Suppose -59614 = -99b - 11599. What is the remainder when b is divided by 483? 2 Suppose 2n + 2 = 0, -11 = -p - 3p - n. Suppose pt = -31 + 82. What is the remainder when t is divided by 10? 7 Suppose -6u + 20456 - 19550 = 0. What is the remainder when u is divided by 54? 43 Let p(k) = -k2 + 37k - 202. Suppose 0 = 4b - 17 - 35. What is the remainder when p(8) is divided by b? 4 Let c(k) = k3 + 22k*2 + 51k - 40. What is the remainder when c(-19) is divided by 11? 8 Let x(w) = w*3 - 17w*2 - 60w + 135. Calculate the remainder when 717 is divided by x(20). 42 Suppose 0 = -4x + 4, 3p + 0x - 5x + 5 = 0. Suppose pz - 90 = -5z. Let k = -1596 + 1641. Calculate the remainder when k is divided by z. 9 Suppose 0 = -5v + 5r + 890, 158v - 157v - 2r - 177 = 0. Calculate the remainder when v is divided by 19. 8 Let d = -7 + 18. Suppose 48r - 62r - 270 = -32r. What is the remainder when r is divided by d? 4 Suppose 3y = 4b + 122, 2y + 115b - 110b = 43. What is the remainder when 199 is divided by y? 29 Let c = 8216 - 8189. Suppose 2p - 24 = 5h, -p + h = -0h - 6. Suppose -4q + 170 = pr, -r + 3q + 2q = -50. Calculate the remainder when r is divided by c. 21 Suppose 17 = g + 3l, -3g + 5l - 7l + 86 = 0. Suppose 5q = -3c + 68, -6c + 2c = -q + g. What is the remainder when 91 is divided by q? 11 What is the remainder when (-3 - 0)(-301)/424 is divided by (1/4-25)/((-185)/296)? 6 Let l = 119 + -71. Let c = l + 47. What is the remainder when c is divided by (6/9)/(2 + 14 + 334242/(-20925))? 20 Suppose -5o + 4h = -399, -4o + 4h + 228 = -88. Calculate the remainder when 1153 is divided by o. 74 Suppose 2x + 2x = 44. Let f(u) = 7u - 3. Let l be f(1). Suppose -5h - lo = -65, h + h = 5o - 7. What is the remainder when x is divided by h? 2 Suppose -6f - 140 = -452. Let c be (-26)/(-8) + (-3)/12. Suppose -2q = -6, 6x - cx + 4q - 93 = 0. Calculate the remainder when f is divided by x. 25 Let x(z) = -3z3 - 4z*2 - 3z - 1. Let u(l) = -216l + 6731. What is the remainder when u(31) is divided by x(-2)? 9 Suppose -640w + 628w = -360. Calculate the remainder when 106 is divided by w. 16 Let p be ((-2)/3)/(2/33). Let w(s) = s3 + 10s*2 - 12s - 3. Let i(c) = -648c + 15. What is the remainder when i(0) is divided by w(p)? 7 Suppose 91 + 39 = -13j. Let q be ((-6)/(-4))/((-15)/j1). What is the remainder when 35 is divided by 3/(-36)-39 - q/4? 2 What is the remainder when 301 is divided by 114(6 - (-140)/(-24))? 16 Suppose 2c = 8c - 66. Suppose -2k = 5m - 149, -2k = m + 3m - 154. Let d = k + -68. Calculate the remainder when d is divided by c. 8 What is the remainder when (-2)/((-3784)/539 - -7) is divided by 10? 8 Let s = 344 + -347. Let c(d) = -d3 - 3d*2 + 12. Calculate the remainder when 66 is divided by c(s). 6 Let j(c) = -7c - 35. Let u be j(-8). Suppose 120 = -ug + 834. Calculate the remainder when 164 is divided by g. 28 Let h(x) = 2x*2 - 1528x - 15291. Calculate the remainder when h(-10) is divided by 47 - (0 + -1)1. 45 Suppose 0 = -4w - 2290 + 2510. Calculate the remainder when 998 is divided by w. 8 Let d = -11785 - -11821. Suppose 0t = -7t + 7. What is the remainder when d is divided by t? 0 Let q(s) = 7317s + 58544. Let a = 6 - 3. Calculate the remainder when 1/a(-93)/(-1) is divided by q(-8). 7 Let j be -2(1 + (-2)/1). Suppose 3b - 635 = -5f, 2b = f - jb - 104. Let y(o) = -21o*2 - 750o + 258. What is the remainder when f is divided by y(-36)? 40 Let v be -23 + 0/(2 + 2). Let h be v(20/(-90) - (-16)/18). Let z(r) = -3r - 7. What is the remainder when 42 is divided by z(h)? 2 Let r = -33 + 68. Suppose i + d = 1, 4i + 4d - 1 = i. Suppose -5v = 2u + 2, -48 + 9 = -3u + iv. What is the remainder when r is divided by u? 8 Let m be 27 + (-3 - (-1 + 0)). Suppose mo - 220 = 3o. Let l(q) = 2q*3 - 5q*2 + 4q + 3. What is the remainder when l(4) is divided by o? 7 Suppose 0 = -5l + 3a + 22165, -5l + 11215 = 3a - 10920. What is the remainder when l is divided by 13? 10 Let n = 12 +	{ "pile_set_name": "DM Mathematics" }
+ 10r3 Expand x2 - x2 - x3 + (2x + 3x + 2x)(2x2 - 4 + 4) + x3 - 2x3 + 0x*3. 12x*3 Expand -14i + 2i2 + 1 + 12i + 1 + (27i - 14 + 14)(2i - 3 + 3). 56i*2 - 2i + 2 Expand (-2j2 - 2j*2 + 0j*2)(7j - 70 + 70). -28j*3 Expand (2 - 3 - 2)(3 + 5 - 6 - 7j) + 0j + 0j - j. 20j - 6 Expand (-1 + 2q3 + 1)(2 + 2q2 + 3q*2 - 1). 10q*5 + 2q*3 Expand -2r5 + r5 + 0r5 + (-r + 2r*3 + r)(-7r2 + 3r*2 - 4r*2). -17r*5 Expand ((1 - s - 1)(-2 + 3 + 1) - 2s - 3s + 4s + s - s - 2s - s + 0s + 3s + 3s - 2s + 0s - 4s + 6 - 6)(1 - 3s - 1). 18s2 Expand (-31 - 2t + 31)(-3t*2 + 2t*4 + 3t*2 + (t + 3t - 3t)(2t3 + 3t*3 - 6t*3)). -2t*5 Expand (-3 + 4 + 0)((5c + 3c*3 - 5c)(-5c2 + c - c) - c5 + 4c3 - 4c*3). -16c*5 Expand (-2 + 2 - 2t)(-3 - 1 + 5) + 4t - 2t - 3t. -3t Expand -6k + 6k - k + 2 + 2k - 2 + (1 - 1 - 2)(0k - 2k + k) + 2 + 2k - 2 + (-2k + k + 2k)(-5 + 3 + 1) - 4 + 4 - 3k + 1 - 1 + 2k. 3k Expand (4y2 - 6y2 + y2)(-4y*2 - 16 + 16). 4y*4 Expand (0u - 2u + 0u)(u + 3u - 3u) + 9u*2 + 3u*2 + 4u2 + 1 - u2 - 1. 13u2 Expand ((-1 - 1 + 7)(4s + 0s - 3s) + 0 + 0 - s)(-13s - 1 + 8s + 6s). 4s*2 - 4s Expand g*2 - 35g + 35g - 3 + (-3g + 2 - 2)(2g + 3g - g). -11g*2 - 3 Expand -6k + 4k + 0k - 2k + 6k + 2k + (-1 + 1 + 1)(2k + k - 2k) + 0k + 2k - 4k. 3k Expand 39v - 39v + 3v5 + (0 + 1 - 2)(-v*3 - 3v5 + v3). 6v5 Expand -m5 + 2m5 + m5 + (2m5 + 2m*5 + 2m*5)(3 - 6 + 1) - 3m5 - 3m*5 + 7m*5. -9m*5 Expand (-3s*3 + 4s*3 + 9s*3)(-13 - 12 + 2). -230s3 Expand (-1 - 1 - 1)(3 + w*2 - 1 - 4w*2). 9w*2 - 6 Expand (2r + 0 + 0)(-2 - 1 + 1) + 5r - r - 2r + (1 - 2 + 2)(3r - 10r + 0r). -9r Expand (1 - 1 + 2o)(o - 5o + 0o) - 5o2 + 2o*2 + 5o*2 + o - o + 3o*2. -3o*2 Expand (-j + 2j - 4j)(4j2 - 3j + 0j + 2j). -12j3 + 3j*2 Expand (0g - 2g - g)(0g + 8g + g) + (4g - 3g - 3g)(2g + 4 - 4) + 3 - 2g*2 - 3. -33g*2 Expand (3t + t - 2t)(3 + 5t - 3 + (0 + 4 - 2)(3t - 5t - t)). -2t2 Expand (2 + 2p*2 - 2)((1 - 2 + 3)(-p2 - p2 + 4p*2) + 4 + 2p - 4 + 3p2). 14p*4 + 4p*3 Expand (x - x - x + (2 + 1 - 1)(4 - 4 - 2x) + 5x - 4x + 0x + 4x - 3x + 0x - 3 + x + 3 + 2x - 4x + x)(2x - x - 2x)(3x + 0x + 4x). 21x3 Expand 2b - 2b - b2 + (-6 + 0 + 4)(2b2 + 3b*2 - 2b*2). -7b2 Expand -m3 + m4 - m4 - 4m5 + 0m*3 + 0m3 - m5 + (5m3 - 3m*3 - 3m*3)(-1 + 1 - 2m2) - 4m*5 - 3m*5 + 5m*5. -5m5 - m3 Expand -6k + 3k + k - 3k - 2k - k + (-5k - 2k + 5k)(1 + 2 - 5). -4k Expand (-d - d + 0d + (-3 + 3 + 2d)(0 - 3 - 2))(-4d + 2d + 3d). -12d2 Expand -k + 2k + 2k - k - 4 + 4 + (4 + 1 - 3)(2k - 1 + 1) - 2 + 2 - 2k. 4k Expand 0v2 + v4 + 0v2 + (1 - 1 + 2v*3)(0 + 0 - 2v) - v2 + v4 + v2 - 8v4 + v4 + v*4. -8v*4 Expand (-1 + 0 + 2 + 2p)(-2p*2 - 10 + 10). -4p*3 - 2p*2 Expand (-1 + 0 + 4)(-2t5 + t5 + 3t*5) + 0t*5 - 6t*5 + 4t5 + t5 + 0t5 + 2t*5. 7t*5 Expand (0 + 2 + 2v + 0)(0 + 2 - 4). -4v - 4 Expand (-2o4 + 0o*4 - 2o*4)(2 + 1 - 1)(0o + 4o + 5o). -72o5 Expand (2 - 1 + 1)(-3a5 + 2a*5 - 3a*5) + 3a*5 - 2a5 + a5. -6a5 Expand (-6y2 - y2 - 16y2)(-y + 0 + 0 + y + 1 - 1 - 2y - 5y + 5y + (-4 - 2 + 4)(-y + 0y + 2y) - 2 + y + 2). 69y3 Expand -5b - 4b + 4b + ((2 - 3 + 3)(3b - b + 0b) - b - 4b + 6b + b + 0b + b)(-1 + 2 - 3). -19b Expand (0 + 0 + 2p)((2 + 1 - 4 + (4 - 2 - 3)(2 + 3 - 3))(64 - 64 + 8p2) + 0p*2 + 4p*2 + 0p*2). -40p*3 Expand (-4 + 5 + 2)(56r - 14 + 12 + 4). 168r + 6 Expand (c + 0c + 0c)(-3c3 + c3 + 0c3) - 3c*4 + 1 - 1 + (3 - 3 - 2c*2)(c*2 + 2c*2 - 2c*2). -7c*4 Expand (-5f + 0f + 3f)(-6f + 6f - 4f3) - f4 - 3f4 + 2f*4. 6f*4 Expand (3 - 1 - 4)(-2g2 + 3g*2 + 2g*2)(g + 6g - g). -36g*3 Expand -z + 4z - z + 2 - 2 - z + z + 0z + 0z + (0 - 1 + 3)(0z + 4z - 2z) + 0 + 0 + 2z + 3z + 2z + 7z. 20z Expand ((2q - 2q3 - 2q)(2q*2 + 0 + 0) - 13q + 13q + 13q*5)(0 + 0 + 1). 9q5 Expand (4s - 4 + 4)(83 - 8s - 83). -32s2 Expand (-7m - 3m - 2m)(2m*2 + 3m*2 - 3m2) + m3 + 0m3 - 2m*3 - 4 + 4 - 2m*3. -27m*3 Expand 301v*4 - 289v*4 - 132v*4 + (3v*2 - 2v*2 + 0v*2)(-2v2 - 1 + 1). -122v*4 Expand (-4h*2 - 2h*2 - 3h*2)(-2h3 + 2h3 + h3 + (0h + 0h - 2h2)(2 - 2 + 2h) - 2h*3 + 0h*3 + 4h*3). 9h*5 Expand 2 + p - 2 + (-2 + 4 - 3)(0p + 3p - 2p) + 2 - 2 - p + 3p + 0 + 2 - 5p. -3p + 2 Expand (-n + 1 - 1)(-8 + 12 - n - 6). n2 + 2n Expand (0 + 1 + 4)(2j*4 + 5 - 5) + (4j*2 + 0j*2 - 2j*2)(j*2 + 0j2 + j2). 14j4 Expand (-6 + 4 + 1)(6 + 6g - 6)(4 - 3 - 5). 24g Expand (-2p - 13p + 2p)(-1 - 1 - 1)(5 - 3 - 4). -78p Expand (-6i*2 - i - 2i + 8i2)(3 - i - 3)(3 - 5 - 5). 14i*3 - 21i*2 Expand -4q*4 + 6q - 6q + 3 + 2q*4 - 3 + (2q3 + q3 - 5q3)(3q + 3q - 3q). -8q*4 Expand (-4 - 2y*2 + 4)(-6 + 4y3 + 6). -8y*5 Expand (12p*3 - 3p*3 + 3p*3)(-4p + 5p + p) + 2p4 + 0p*4 + 2p*4. 28p*4 Expand (2r*3 - 3r*2 + 2r*3 - 2r*3)(-3 + 3 - 3). -6r3 + 9r2 Expand (4 - l2 - 4)(0 + 0 - 2l3) + (l2 - l*2 - 3l*2)(-5l3 + 2l*3 + 2l*3). 5l*5 Expand (0 - 1 + 0 - m)(5m3 + 0m*3 - 3m*3). -2m*4 - 2m*3 Expand (8u - 3u - 2u)(2u*3 + 2u*3 - 5u*3 + (-4u*3 + 3u3 - u3)(0 + 1 - 2)). 3u*4 Expand (-3 + 12 - 6)(1 + a - 1)(0 + a + 0). 3a*2 Expand (5n - n - 2n)(1 + 0 + 1 + (1 + 6 - 5)(1 + 4 - 2) + 0 + 1 + 0)(-4n2 + 3n*2 + 3n*2). 36n*3 Expand 0z + z*2 + 0z + (2z + 4 - 4)(4 - 1 - 5)(-3z + z + 0z) + 3z + 5z2 - 3z. 14z2 Expand ((1 + 2 - 4)(-3h + 0h + h) - 5 - h + 5)(0h*2 + 6h*2 + 0h*2). 6h*3 Expand (1 + 16r - 6r - 9r)(0r4 + r4 - 3r4). -2r*5 - 2r*4 Expand -2v - 2v2 + 5v + 0v + (0 + 2 + 8)(-3v + 3v - 2v2). -22v*2 + 3v Expand (0 + 3 + 2)(4y + 0y - 3y)(3y - 4y - y). -10y*2 Expand (2p*3 - 2p*3 + 2p*3)(-3p + 3p - p*2) + 3p*4 - 3p4 + p5 - p*2 + 3p5 + p2. 2p5 Expand (2 - 6 + 1)(-1 + 1 - 2x)(-2x2 - 2 + 2). -12x*3 Expand (-3x + 8x + 4x)(2x*3 + 2x*3 - 3x*3). 9x*4 Expand (-3x - 32 + 32)(2x2 - x2 - 3x2) - 3 + 3 - 2x*3. 4x*3 Expand (-2s - 2s + 2s + (2s + 2s - 6s)(1 - 5 + 5) + 1 + s - 1)(-6s + 0s + 4s). 6s2 Expand 4m*3 + m - m + (-m - m + 0m)(2m*2 - 2m + 2m) - 18m - 16m3 + 18m. -16m3 Expand -x5 + 3x*5 + 0x*5 + (0x*3 - 2x3 - x3)(3x*2 - 6x*2 - 3x*2 + (-x - x + x)(-5x + x + 3x)). 17x5 Expand 3o*5 - 2o*5 - 2o5 - o5 + 6o5 + 0o*5 + (2o*3 - 5o*3 + 5o*3)(o - o + o*2). 6o*5 Expand (5w*2 - 5w*3 - 5w*2)(1 - 3w - 1 + (0 - 2 + 4)(-w + w - 2w) + 0w - w + 0w). 40w*4 Expand (5p - p - 9p)(-2p + p2 + 2p) + 0 + p*3 + 0 + (0p2 + p2 + p*2)(2p - 1 + 1) - 2p*3 - 2p*3 + 3p3. -p3 Expand (0 + 1 - 2)(-364d + 364d - 2d*5 - 1 + 3d*3). 2d*5 - 3d*3 + 1 Expand 2o*2 + 2o*2 - 5o*2 + (0o - 5o + 3o)(-4o + 6o - 3o) + 0o2 + 3o2 - o2 + o - o - 2o2 - 4o*2 + 3o*2 + 4o*2. 4o*2 Expand -2r + 17 - 17 + (0 - 6 + 3)(-r + 0r + 2r) + (1 - 1 - 2r)(-6 + 4 + 0). -r Expand (0h - h + 2h - 3h - h + h + (-h - 1 + 1)(-3 + 1 + 1) + 0 - h + 0)(-2 - 2 + 3). 2h Expand 1 + 2j - 1 + (-3j - 3j + 5j)(5 - 2 - 5). 4j Expand (3 + 2 - 4 + (-1 + 6 - 3)(0 + 2 - 1) - 1 - 2 + 4)(-6 + 1 + 0)(0 + 0 + 2y). -40y Expand (-2m2 - 2m*2 + 3m*2)((-m + 5m - 3m)(0 + 3 - 1) - 3m - 3 + 3) - 4m3 + 4m*3 + 4m*3. 5m3 Expand (d3 + 2d3 + d3)(-5 + 1 + 7d + 2). 28d*4 - 8d*3 Expand (9 + 0 - 3)(4 - 2 - 3)(3n - 2n + n). -12n Expand (1 - 1 + t)(0t - t - 2t) + 0t*2 + 0t2 + t2. -2t2 Expand (-10 - 4o + 10 + (0 + 3 - 4)(-3 + 3 + 2o))(2o - 3o + 2o). -6o2 Expand ((0 + 3 - 4)(0 - 3 + 2) + (4 - 1 - 4)(-1 + 2 + 1) - 3 + 1 - 2)(1	{ "pile_set_name": "DM Mathematics" }
.3 a Which is the smallest value? (a) -3 (b) -1/3 (c) -0.347 (d) 5 a What is the smallest value in -0.0296, -0.8, -2/5, 4, 5? -0.8 What is the second smallest value in 0.4, 4, 356, 12? 4 What is the fourth biggest value in -0.5, 6, 1/6, 1/22? -0.5 What is the second smallest value in -0.7, 0, 0.087? 0 What is the smallest value in 3, -0.1, -7, 1/5? -7 Which is the smallest value? (a) -2/41 (b) 8 (c) 0.5 a Which is the smallest value? (a) 0.52 (b) -6 (c) 0.3 b Which is the biggest value? (a) -1/2 (b) -1/3 (c) 1/62 (d) 4/7 d Which is the third biggest value? (a) 4 (b) 0.51 (c) -0.1 (d) -4 (e) 0.2 e Which is the third smallest value? (a) -11 (b) 4 (c) -5 (d) -0.4 d Which is the fourth smallest value? (a) 7/4 (b) 4 (c) 1 (d) -7 b What is the biggest value in 1.8, 2, -1.7, -2? 2 What is the second biggest value in 2, -1/5, 1? 1 What is the biggest value in 1/4, 36, -71? 36 What is the smallest value in -1/8, 2/35, 1, 2/3? -1/8 What is the biggest value in -2, -0.194, 2? 2 What is the third smallest value in -25, 0.3, -1/6, -3? -1/6 Which is the fourth biggest value? (a) 3 (b) 11 (c) -0.01 (d) -0.3 (e) 1/2 c What is the third smallest value in 0.5, -2, 2, -0.1? 0.5 Which is the second biggest value? (a) 0.1 (b) -4 (c) -17 (d) -1 d What is the biggest value in -3, 0, -3/4, -0.011, -2/3? 0 Which is the smallest value? (a) -11408 (b) 3/2 (c) 5 a What is the smallest value in 0, 3, -2/13, 3/5? -2/13 What is the second smallest value in -18/11, -5/4, -48? -18/11 Which is the second biggest value? (a) -0.2 (b) 4 (c) -6 (d) 6 (e) 5 e Which is the biggest value? (a) -33 (b) -0.3 (c) -1/3 (d) -2/3 b Which is the second smallest value? (a) 5 (b) -0.4 (c) 2 (d) -0.046 d What is the third smallest value in -0.09, 0.15, 1/2? 1/2 Which is the second smallest value? (a) 1 (b) 0.3 (c) 100 (d) -2 b What is the fourth smallest value in 1.43, 0.5, 0, 3, -5? 1.43 What is the third smallest value in -83, -14, 3? 3 Which is the fourth biggest value? (a) -3/2 (b) 5 (c) 0.09 (d) -0.2 (e) 4 d What is the biggest value in 0.77, 1/2, 0.2? 0.77 What is the biggest value in 6, 467/6, -2? 467/6 What is the third biggest value in -123, -1/3, 3? -123 What is the biggest value in 2, 0.3, -33, -2/13? 2 Which is the second biggest value? (a) 0.2 (b) 4 (c) -3/4 (d) 20 (e) 3 b What is the third smallest value in 2/7, 4, -20, 0.3, 1/3? 0.3 Which is the third biggest value? (a) -0.1 (b) -276 (c) -1 b Which is the third biggest value? (a) 0 (b) 2/3 (c) -0.1 (d) -1/57 d What is the third biggest value in 0.4, -1/6, -0.4, 510, -1/7? -1/7 What is the biggest value in -4, -2, -3/320? -3/320 What is the smallest value in 0.3, -1/65, -0.05? -0.05 What is the second biggest value in 1/6, 1.6, 5? 1.6 Which is the smallest value? (a) 0.1 (b) 4/3 (c) 0.2 (d) 3/43 d Which is the fourth smallest value? (a) 3/2 (b) 5 (c) 3 (d) 0 (e) -2/121 c Which is the third biggest value? (a) -2/5 (b) 2/41 (c) 1/13 (d) -2/3 (e) -0.5 a Which is the second biggest value? (a) 7 (b) -2/7 (c) -0.4 b What is the second biggest value in 1/40, 0, -0.3, 0.2? 1/40 Which is the biggest value? (a) 0.4 (b) -1 (c) 87 (d) -8 c Which is the biggest value? (a) 51 (b) 9 (c) -4 (d) -0.4 a What is the smallest value in 5, -1, -11.3, 0? -11.3 What is the second biggest value in 22, -0.2, 1/44, 0.05, 5? 5 Which is the smallest value? (a) -1.8 (b) 4 (c) 0.4 a Which is the second smallest value? (a) 25 (b) -6 (c) 5 (d) -1 d Which is the second biggest value? (a) -85 (b) 5 (c) 2 c What is the smallest value in 0.2, 4, 0.1, -13/4, 1/4? -13/4 Which is the third biggest value? (a) -7 (b) 0.02 (c) 1/4 (d) 4 b What is the second biggest value in -2/7, -1, 0, 5? 0 Which is the fourth biggest value? (a) 0 (b) -8 (c) -1 (d) -5/4 (e) -0.129 d What is the third biggest value in -3/2, 3, 3/2, -0.2, -0.6? -0.2 What is the biggest value in -0.5, -4, -3, -103? -0.5 What is the smallest value in 0.4, 5, 22/7, 0? 0 What is the smallest value in -16, -9, 3, -1? -16 Which is the smallest value? (a) -6/5 (b) -4 (c) -1 (d) 0.2 b Which is the fourth biggest value? (a) 0.03 (b) 0 (c) 0.1 (d) -5 d Which is the third smallest value? (a) -11 (b) -0.02 (c) -0.1 b What is the fourth smallest value in 54, 1/6, 0.06, -1/5? 54 Which is the second biggest value? (a) -18/23 (b) 7/3 (c) 4 b What is the fifth smallest value in 74, -0.5, 7, 0, -0.4? 74 Which is the biggest value? (a) -1/5 (b) 1195 (c) 4/5 b Which is the second smallest value? (a) 0.3 (b) 2 (c) 2/13 a Which is the fifth smallest value? (a) 4 (b) -4 (c) 11 (d) -3/16 (e) -0.4 c What is the biggest value in -0.4, 1002, 3, -1? 1002 Which is the third biggest value? (a) 4/11 (b) 0 (c) -6 c What is the second smallest value in -10/9, 26, 0.5? 0.5 What is the biggest value in 0, -0.4, 2, 65, -2? 65 Which is the second smallest value? (a) 3 (b) -1/3 (c) 6 (d) 0.02 d What is the second biggest value in 4, 2/17, 6.1? 4 Which is the second smallest value? (a) 6 (b) -0.2 (c) -4/7 (d) 10 b Which is the fourth biggest value? (a) -5 (b) 4 (c) -1 (d) -2 a Which is the fourth biggest value? (a) -1 (b) -0.5 (c) -2 (d) 3 c What is the smallest value in 3, 2/7, 0? 0 Which is the second biggest value? (a) -4 (b) 3/2 (c) 0.043 c Which is the biggest value? (a) 0.3 (b) 84 (c) -1 b Which is the third biggest value? (a) 4 (b) 0.0422 (c) 0.2 b What is the smallest value in 1/7, -18/61, 2, -1/3? -1/3 Which is the second biggest value? (a) -6 (b) -1 (c) -2/497 b Which is the biggest value? (a) -0.5 (b) -0.07 (c) 39 c What is the second biggest value in -0.7, 2/3, 10, -2/13? 2/3 Which is the fourth biggest value? (a) 2/15 (b) 2 (c) -2 (d) -294 (e) -5 e Which is the biggest value? (a) 1/6 (b) -1 (c) -1/5 (d) 5/2 (e) -2 d What is the biggest value in -4, 1/4, 19? 19 Which is the second biggest value? (a) 0.314 (b) 2/9 (c) -0.2 (d) 4 a Which is the second smallest value? (a) -2 (b) -22 (c) 1/18 (d) -0.3 (e) 4 a Which is the second biggest value? (a) -3 (b) -23 (c) -5 (d) 3 a What is the biggest value in 0.15, 4, 1? 4 Which is the biggest value? (a) 18 (b) -2/7 (c) -1/4 (d) -4/3 (e) 0.5 a Which is the smallest value? (a) -154 (b) -0.03 (c) -0.01 a Which is the third smallest value? (a) -1 (b) 5 (c) -2 (d) 0 d Which is the smallest value? (a) -9 (b) 0.5 (c) 7 (d) -3 a What is the fifth smallest value in 0.4, -0.1, -5, 1/2, 37? 37 What is the second biggest value in -4, 1, 0.4, 97? 1 What is the third smallest value in 0.1, -4, 19, -3/10? 0.1 Which is the second biggest value? (a) 2/3 (b) 1/4 (c) 2/13 (d) -3/44 (e) 3 a Which is the fourth biggest value? (a) 1/2 (b) -0.18 (c) 2/11 (d) 0.15 (e) 1 d What is the second biggest value in 2/5, 271, -1, -3? 2/5 Which is the biggest value? (a) 2/1037 (b) -0.4 (c) -1/4 a Which is the third smallest value? (a) -2/5 (b) 26.4 (c) 1 b Which is the second smallest value? (a) -42/11 (b) 1 (c) -1 (d) 4 c What is the second biggest value in -3, -0.3, 2, 473? 2 Which is the fifth smallest value? (a) 4 (b) -4 (c) 0.2 (d) 2 (e) 1/51 a What is the third smallest value in 5, -0.7, 1/5, 0? 1/5 What is the third smallest value in -7/3, 1/2, -1? 1/2 Which is the third biggest value? (a) -17 (b) 5 (c) -0.12 (d) 3/5 c What is the biggest value in 0.2, 0, -7/9? 0.2 What is the third biggest value in 9, -0.2, 2/7, 2? 2/7 What is the second smallest value in -3, 2535, 2/5, -1/10? -1/10 What is the fourth biggest value in 0, -0.007, -1/6, 0.01? -1/6 What is the second biggest value in -1/12, -24/11, 2.5? -1/12 Which is the third smallest value? (a) -1/2 (b) -2/9 (c) 51 c What is the third smallest value in 1, -6, -0.5? 1 What is the third smallest value in -0.1, -3.09, 2, -2? -0.1 Which is the fifth smallest value? (a) 1 (b) 2 (c) -22 (d) 1/2 (e) -1 b What is the biggest value in 0.4, 7/5, 4/3, -5? 7/5 Which is the biggest value? (a) -511 (b) -3/7 (c) 2/13 c What is the smallest value in -0.1, -601, -2/9? -601 Which is the biggest value? (a) 5 (b) -3 (c) -1/5 a What is the second biggest value in -1/3, 10, -0.12, -1/5? -0.12 Which is the third biggest value? (a) -4	{ "pile_set_name": "DM Mathematics" }
et b(q) = 5l(q) - 6t(q). Suppose 15 = 3x - 0. Determine b(x). 5 Let v(t) = -12t - 12 - 24t2 + 33t2 + 0 + t3. Calculate v(-10). 8 Let o(n) = -2n - 2. Let j be o(-2). Let y(m) = -4 + 3m - 9m + m + mj. Calculate y(5). -4 Suppose 25 = l - 4c, -l + 6l - 41 = -c. Let i(o) = -2o + 9. Give i(l). -9 Let m(q) = 2q + 12. Let w(s) = -s3 - 22s*2 - 107s - 34. Let x be w(-15). Calculate m(x). 4 Let p(o) = 10o2. Let s(g) = -4g*2 - 31g + 46. Let d be s(-9). Determine p(d). 10 Let t(d) = d - 6. Suppose -2c = 14 - 22. Determine t(c). -2 Let u(t) = 18 - 16 - t - 12 + 2t - 3. Give u(7). -6 Let l = -3 + -1. Let r(n) be the first derivative of -2n2 - 3n - 11. Give r(l). 13 Let w be 18/162 - 490/(-45). Let p(g) = -3g + 25. What is p(w)? -8 Let b(g) = -6 - 4g - g + 8 + 3g. Calculate b(5). -8 Let k(b) = -5b + 4b2 - 3 - b2 - 6b*2. Let t(m) = m - 4 - m - 2m*2 - 5m. Let y(i) = 3k(i) - 4t(i). Calculate y(6). 1 Let f = 137 - 193. Let y be (f/70)/((-1)/(-5)). Let h(p) = p*2 + 4p + 3. Let d be h(y). Let i(l) = 2l2 - 3l - 2. Give i(d). 7 Let z(d) = 2d - 33. Let w(j) = -2j + 34. Let f(o) = -8w(o) - 9z(o). What is f(10)? 5 Let q(n) = -n*3 + 3n*2 + 30n + 2. Let k(h) = h*3 - 4h*2 - 20h - 2. Let u(p) = -3k(p) - 2q(p). Let v be -11 - (-1 - 6). What is u(v)? 2 Suppose 4s - 2s - 2t + 18 = 0, 5t + 5 = 0. Let z = 12 + 0. Let w = s + z. Let f(y) = y3 + y2 + 2y - 1. Give f(w). 15 Let i = -239 + 239. Let a(c) = c + 7. Calculate a(i). 7 Suppose -3m + 24i = 19i + 9, i - 1 = m. Let w(h) = -3h*3 - 2h*2 + 3h - 3. Calculate w(m). -29 Let g = -59 - -29. Let c be (-400)/32(2 - 3)2. Let x = c + g. Let t(p) = -p*2 - 5p - 7. Calculate t(x). -7 Let b(t) = 3t2 + 7t + 12. Let h(q) = 4q2 + 7q + 16. Let u(m) = -3b(m) + 2h(m). Give u(-4). 8 Let c(z) = -z*2 + 3z + 4. Suppose 5h - 26 = 24. Let p(b) = b2 - 12b + 24. Let m be p(h). Determine c(m). 0 Let y(s) = s*3 + s + 12. Let j be 0/(3-1)(28 + -29). What is y(j)? 12 Let o(i) = -6i*2 + i - 1. Suppose 5j - 84 - 46 = 0. Suppose -8m - 5x - 20 = -3m, 5x = m - j. Calculate o(m). -6 Let y(d) = -12d + 36. Let v(l) = -6l + 21. Let h(g) = -5v(g) + 3y(g). What is h(5)? -27 Let o = 453 + -462. Let h(k) = -k*3 - 10k*2 - 9k + 4. Give h(o). 4 Let v be ((-6)/(-9) + 3)/(10/(-30)). Let c(f) = -f*2 - 12f - 9. Calculate c(v). 2 Let d(h) be the first derivative of -3h4/4 + h2 - h - 2. Suppose 2z + 7z = 9. Determine d(z). -2 Let q = 482 - 479. Let x(i) = i3 - 2i*2 - 3. Calculate x(q). 6 Suppose -k - 3h = -20, -15h + 20h - 15 = 0. Let n(w) = w*2 - 9w - 5. Give n(k). 17 Let c(q) = 6q2 - 259q + 252q + 4q*3 - 5q3. What is c(4)? 4 Let r(l) = l2 + 3l - 3. Let p = 3 + -1. Suppose 0 = n - p + 6. Let y be r(n). Let q(t) = 4t*3 + t - 1. Give q(y). 4 Let n(m) = -3m*2 - 17m - 13. Let l(d) = -8d2 - 36d - 27. Let r(s) = 2l(s) - 5n(s). What is r(12)? 23 Let u = 12 - 11. Let c be 203/14 + u/(-2). Suppose -c = 2v - 2. Let k(a) = -a3 - 7a*2 - 7a - 3. Determine k(v). 3 Let y(p) = -7p - 25. Let v(l) = 2l + 9. Let a(h) = -17v(h) - 6y(h). Determine a(2). 13 Let c(q) = -q*2 + 4q + 5. Let b(w) = w*2 + 2w + 3. Let s be b(-4). Suppose -35 = 4k - sk. Determine c(k). 0 Let f = 34 + -21. Suppose r - f = -5u, 3r = 3u - 0 + 3. Let x(l) = -1 + 11 + ul - 5. What is x(4)? 13 Let f = -29 - -22. Let b(d) = 3d3 + 11d*2 - 4d + 21. Let q(t) = -t*3 - 4t*2 + t - 7. Let v(k) = fq(k) - 2b(k). Give v(-6). 1 Let b = -162 - -184. Let f(m) = 2m - 50. Determine f(b). -6 Let s(j) = j*2 - 2j + 3. Let l be (7 - 9) + (4 - 0). Suppose -li - 3 = -7. Give s(i). 3 Let i(h) = -17h + 18h - 7 + 4. Determine i(3). 0 Let i = -1198 + 1201. Let s(f) = 3f - 1. Determine s(i). 8 Let d = 10 - 9. Let g = 3 - d. Let h(j) = -j*3 - 8j*2 + 3j*2 + 4 + 3j*g. Give h(-3). 13 Suppose -2q - 546 = -3x, 0x = -4x - 3q + 711. Let d(l) = 371l - 1 - 180l - xl. What is d(2)? 21 Let n(x) = -x2 + 2x + 4. Let q be (-3)/6-2 - -2. Suppose 0 = p - 3, u - 20 = qp - 4p. Let g = u - 14. Determine n(g). 1 Let t(n) = 2n + 5. Suppose -5o + 35 = -5u, 0 = 2o - 5o - 5u + 13. Let z = -2 - -7. Let h be (o/z)/((-3)/15). What is t(h)? -7 Let f(r) be the first derivative of -r5/10 + r4/6 + 2r3/3 - r2/2 + r - 19. Let q(u) be the first derivative of f(u). Determine q(3). -25 Suppose -152 = -14a + 2. Suppose ao = -26 + 4. Let d(q) = -q3 - q2 - 2. Give d(o). 2 Let m(v) = 18v + 46. Let f be m(-3). Let k(y) = -y3 - 7y*2 + 12y + 2. What is k(f)? -30 Let w(c) = -5c2 + 2c - 3. Let n(o) = 12o2 - 7o + 6. Let d(m) = 3n(m) + 7w(m). Calculate d(7). -3 Let v(x) = -x*3 - 7x*2 + 7x - 9. Let y be v(-8). Let s(k) = -26k - 2. Let h be s(y). Let m be (-6)/(-4) - h/16. Let w(c) = c2 - c - 5. Determine w(m). -5 Let i(t) = t3 - 3t*2 - 4t + 4. Let v be i(4). Suppose -3c - 21 = -6c. Let h(s) = -s*2 - 4 - 3 + vs + c + 1. Give h(5). -4 Let c(u) = u2 - 3. Let j = 425 - 421. Determine c(j). 13 Let i(r) be the second derivative of -r3/3 - 5r2/2 - 156r. Calculate i(-7). 9 Let z(i) = 4i - 1. Let k = 2 - -19. Let h be ((k/2)/(-7))/(6/(-20)). Calculate z(h). 19 Let q(l) = -5l*3 - 5l*2 - 7 + 3l*3 + 3l*3. Determine q(5). -7 Let o(g) be the third derivative of -1/3g*3 + 0 + 1/24g*4 - 8g*2 + 0g. Let x = 1 - -1. What is o(x)? 0 Suppose 0b = 4b. Let v be b + 0 - 4/2. Let a(r) be the second derivative of r*3/3 + 3r*2/2 - 410r. What is a(v)? -1 Let l(j) = 14j + 10. Let k(u) = u + 1. Let b(i) = -10k(i) + l(i). What is b(-3)? -12 Let n(z) = z*2 + 7z - 7. Let d = 90 - 36. Suppose 6g = -0 - d. Determine n(g). 11 Let v(w) = -2w - 2 + 4 - 4 + 5w + w2. What is v(-3)? -2 Let c(s) be the third derivative of s6/120 - s5/10 + s4/4 - 2s*2. Let j(o) = 6o*2 - 31o + 9. Let a be j(5). Determine c(a). -8 Suppose -5m + 2m = -21. Let h(i) be the first derivative of i*2 - 6i + 6. What is h(m)? 8 Suppose -4i + 20 = i - 5q, -4i + 5q = -11. Let c(t) = -1 - 4t + t + it - t. Calculate c(3). 14 Let c(k) = 9 + 4 - 3k + 2 - 13 + 8. Give c(3). 1 Let s = 769/2298 + -1/766. Let m(w) be the third derivative of -3w*2 + 0 + sw*3 + 0w + 1/12w5 + 1/120w*6 - 1/12w4. Give m(-5). 12 Let n(j) = j + 6. Let r be n(-15). Let o(y) = -y2 + 13y + 7. Let c(g) = 6g*2 - 67g - 37. Let a(z) = -2c(z) - 11o(z). Calculate a(r). -3 Suppose -2g = -25 - 5. Let v(m) = -m2 + 16m - 14. Let d be v(g). Let c(o) be the second derivative of -17o3/6 + o2/2 + o. Calculate c(d). -16 Let g(v) = -v + v + v - 9v - 2. Determine g(-4). 30 Let u be (-5)/10 + (-10)/4. Let g(j) = 3j3 - 3j*2 - j + 2. Let v(k) = 6k*3 - 7k*2 - 2k + 5. Let c(t) = uv(t) + 7g(t). Determine c(-1). -3 Suppose -v + 1 = -17. Suppose 0 = -0h + 2h - v. Let t(p) = p + 1 + 2p2 + p + hp*3 - 4p. Determine t(1). 10 Suppose -5b - 6b = -33. Let g(c) = b + c + 8 - 3 + 0. Calculate g(0). 8 Let z(f) = -f*2 + 7f + 3. Let q(g) = 2g2 - 9g - 4. Let y(t) = 2q(t) + 3z(t). What is y(-5)? 11 Let c(m) = m - 3. Let f be (-3)/((-26)/(-9) - 3). Let r = -22 + f. Determine c(r). 2 Let w(p) = -5p - 7 + 1 + 7p - p - 3p2 - 1. Calculate w(5). -77 Let l(t) = -8t + 10 - 14 + 5t3 - 2t*3 - 7t*2 - 4t*3. Determine l(-6). 8 Let g(x) = -x - 4. Let z be g(-7). Suppose i = -zw + 4i + 27, -31 = -3w - i. Let o be (4/w)/((-15)/150). Let t(f) = -f*2 - 3f - 3. Determine t(o). -7 Let y(a) = 21 - 6a2 - 2a - a*3 - 17 + 2a*2. Suppose 3x - 18 = 12. Let k be (-12)/30 - 36/x. Give y(k). 12 Suppose -22 = 25n - 172. Let l(c) = -c2 + 3c + 5. Determine l(n). -13 Let o(k) = -16 + 0k + 12 + k. Let l = -18 + 18. What is o(l)? -4 Let c = -20 + 22. Suppose -d + 4o + c = 1, 0 = 3d + 3o - 18. Let h(j) be the second derivative of -j*3/6 - 3j*2/2 + 3j. Calculate h(d). -8 Let m(x) = -2x2 + 6x. Let a be m(4). Let c(v) = -56v - 3. Let y(p) = 9p - 1. Let r(w) = -c(w) - 6y(w). Determine r(a). -7 Suppose 4 = -13k + 12k. Let g(j) = 5j*3 - 10j2 + j - 8. Let h(c) = -c3 + c*2 + 1. Let u(r) = g(r) + 6h(r). What is u(k)? -6 Let h(f) be the third derivative of -f*4/12 + 4f*3/3 - 51f*2. Determine h(6). -4 Let g(c) = 749c + 7 - 373*c -	{ "pile_set_name": "DM Mathematics" }
9 What is the next term in 241015, 241007, 240997, 240985, 240971, 240955? 240937 What is next in 269, 2235, 7581, 17999, 35181, 60819, 96605, 144231? 205389 What is the next term in -2945, -11778, -26495, -47096? -73581 What is the next term in 5385, 5374, 5341, 5274, 5161, 4990, 4749, 4426? 4009 What is next in 215, -379, -973? -1567 What comes next: 23286, 23287, 23288? 23289 What comes next: -104735, -209470, -314205, -418940, -523675? -628410 What comes next: -93, -160, -327, -642, -1153, -1908, -2955? -4342 What comes next: 9728, 19455, 29182, 38909, 48636? 58363 What is the next term in 1276, 1254, 1212, 1144, 1044? 906 What comes next: -2602, -10308, -23150, -41128, -64242? -92492 What comes next: -1009, -1980, -2903, -3760, -4533, -5204, -5755, -6168? -6425 What comes next: -801, -3130, -7007, -12432, -19405, -27926? -37995 What is next in 1380, 2590, 3800? 5010 What comes next: -22943, -45878, -68813, -91748, -114683, -137618? -160553 What is the next term in 3304, 3301, 3302, 3313, 3340, 3389, 3466, 3577? 3728 What is the next term in 9154, 18296, 27444, 36598? 45758 What is the next term in -35, -379, -1329, -3191, -6271, -10875? -17309 What is next in -377, -378, -379? -380 What comes next: -8411, -16821, -25231? -33641 What is the next term in -5566, -11139, -16712, -22285? -27858 What is the next term in 96, 274, 452? 630 What is the next term in -339, -1318, -2945, -5214, -8119? -11654 What comes next: -4553, -18181, -40897, -72701, -113593, -163573, -222641? -290797 What comes next: -6377, -6362, -6333, -6290? -6233 What is the next term in 1018, 909, 608, 19, -954, -2407, -4436, -7137? -10606 What comes next: -16307, -17437, -18569, -19703, -20839, -21977? -23117 What is the next term in -42228, -42214, -42186, -42138, -42064, -41958, -41814, -41626? -41388 What is the next term in -1377607, -1377610, -1377613, -1377616, -1377619? -1377622 What comes next: -169, -321, -485, -667, -873, -1109, -1381, -1695? -2057 What comes next: -31012, -31017, -31026, -31039? -31056 What is next in -105, 25, 167, 327, 511, 725, 975? 1267 What is next in -313, -1287, -2907, -5167, -8061, -11583? -15727 What comes next: -65, -136, -231, -362, -541, -780, -1091, -1486? -1977 What is the next term in 413008, 413004, 412998, 412990, 412980, 412968, 412954? 412938 What is next in 9752, 9886, 10008, 10112, 10192, 10242? 10256 What comes next: -1295, -1612, -1929, -2246? -2563 What comes next: -433041, -433039, -433035, -433029, -433021? -433011 What is next in 2137, 16899, 56921, 134833, 263265, 454847, 722209, 1077981? 1534793 What is next in -1635, -4708, -9823, -16974, -26155, -37360? -50583 What is next in -7234, -14524, -21920, -29476, -37246? -45284 What comes next: -321, -1885, -6137, -14421, -28081, -48461? -76905 What comes next: -627, -2977, -6891, -12363, -19387, -27957, -38067, -49711? -62883 What comes next: 6039, 12090, 18149, 24222, 30315, 36434? 42585 What is the next term in -469, -4097, -13943, -33115, -64721, -111869? -177667 What is next in -72, -315, -708, -1245, -1920, -2727, -3660, -4713? -5880 What is the next term in -333, -2624, -8815, -20856, -40697? -70288 What is next in 5405, 10834, 16263? 21692 What comes next: 4528, 4493, 4458, 4423, 4388? 4353 What is the next term in 55, 80, -99, -662, -1789? -3660 What is the next term in -1331570, -2663142, -3994714, -5326286? -6657858 What is next in 206, 394, 534, 602, 574? 426 What is the next term in 12277, 24495, 36713? 48931 What comes next: 11, 7, -7, -31, -65? -109 What is the next term in 2052, 2059, 2054, 2025, 1960, 1847? 1674 What comes next: -18139, -36433, -54725, -73015, -91303? -109589 What is the next term in -491, -208, 73, 352, 629, 904? 1177 What is the next term in -436, -463, -532, -667, -892, -1231, -1708? -2347 What is the next term in -7289, -14582, -21875, -29168? -36461 What is next in -1288, -2635, -3982, -5329? -6676 What is next in -2734, -2696, -2602, -2428, -2150, -1744, -1186, -452? 482 What comes next: -19035, -19056, -19077? -19098 What is the next term in -3588, -5558, -7528? -9498 What comes next: -5819, -5799, -5779, -5759? -5739 What comes next: -97884, -195770, -293656, -391542? -489428 What comes next: -29210, -58445, -87692, -116957, -146246, -175565, -204920? -234317 What comes next: 6249, 11963, 17677, 23391, 29105, 34819? 40533 What is next in -116, -242, -412, -626, -884, -1186, -1532? -1922 What is the next term in 40, 85, 156, 265, 424, 645? 940 What comes next: -27328, -54657, -81984, -109309, -136632, -163953? -191272 What comes next: -39886, -40028, -40180, -40348, -40538, -40756, -41008, -41300? -41638 What comes next: -26080, -26088, -26096, -26104, -26112, -26120? -26128 What comes next: -48, -50, -40, -18? 16 What is the next term in -55136, -110363, -165590, -220817? -276044 What is the next term in 11794, 11780, 11762, 11740, 11714, 11684? 11650 What is next in -2217, -2214, -2211, -2208, -2205, -2202? -2199 What comes next: -3370, -4134, -5408, -7192, -9486, -12290, -15604? -19428 What is the next term in 3016, 3026, 3054, 3106, 3188, 3306, 3466, 3674? 3936 What is next in 94612, 189299, 283986, 378673? 473360 What is the next term in 993, 1041, 1091, 1149, 1221? 1313 What is the next term in 64192, 64191, 64190, 64189, 64188? 64187 What comes next: 5040, 9916, 14798, 19692, 24604? 29540 What comes next: -8798, -35186, -79164, -140732, -219890, -316638, -430976? -562904 What is next in 356, 789, 1236, 1697, 2172, 2661, 3164? 3681 What is the next term in -166, 119, 594, 1259? 2114 What comes next: 96, 292, 688, 1332, 2272, 3556, 5232, 7348? 9952 What comes next: 1278, 1161, 1044, 927? 810 What is the next term in -101, -284, -595, -1040, -1625, -2356, -3239, -4280? -5485 What comes next: 4006, 4009, 4012, 4015, 4018? 4021 What comes next: -8124, -16311, -24496, -32679, -40860, -49039, -57216? -65391 What comes next: 2783, 5539, 8281, 11003, 13699, 16363, 18989, 21571? 24103 What is the next term in -856, -1783, -2720, -3673, -4648, -5651, -6688? -7765 What comes next: -25745, -25769, -25793? -25817 What is next in -3203, -3495, -3787? -4079 What is next in -11104, -11093, -11078, -11059, -11036? -11009 What comes next: 1038, 701, -190, -1911, -4738, -8947, -14814, -22615? -32626 What is the next term in 945, 1954, 2977, 4020, 5089, 6190, 7329? 8512 What is the next term in -32464, -64913, -97344, -129757, -162152? -194529 What is the next term in 1051, 948, 783, 562, 291? -24 What is the next term in -351449, -702896, -1054343, -1405790, -1757237, -2108684? -2460131 What is the next term in -161, -190, -253, -362, -529? -766 What is the next term in 2399, 2344, 2275, 2186, 2071, 1924, 1739? 1510 What is the next term in 40701, 40702, 40703, 40704, 40705? 40706 What is next in 1081, 4379, 9893, 17623, 27569? 39731 What is the next term in 49235, 98471, 147707, 196943? 246179 What is the next term in 362, 730, 1098, 1466, 1834? 2202 What comes next: -200, -178, -144, -98, -40, 30, 112? 206 What comes next: -1388, -1421, -1500, -1649, -1892, -2253, -2756, -3425? -4284 What comes next: -694, -1060, -1426, -1792? -2158 What comes next: -784, -869, -1012, -1213, -1472? -1789 What comes next: 2720, 5442, 8164, 10886? 13608 What is next in -387, -576, -563, -348, 69, 688, 1509? 2532 What is next in 52, 248, 606, 1150, 1904, 2892, 4138, 5666? 7500 What is next in -18586, -37164, -55744, -74326? -92910 What is the next term in -460, -1779, -3956, -6985, -10860, -15575, -21124? -27501 What is next in -12538, -25025, -37512? -49999 What is the next term in 211, 270, 367, 502, 675, 886? 1135 What is next in -363, -807, -1337, -1953, -2655, -3443, -4317? -5277 What is next in 396, 365, 320, 267, 212, 161, 120, 95? 92 What is the next term in 45, 287, 779, 1593, 2801? 4475 What is next in -681, -681, -685, -693, -705, -721? -741 What is next in -973861, -1947732, -2921615, -3895516, -4869441, -5843396, -6817387, -7791420? -8765501 What is the next term in 47, 80, 163, 320, 575, 952, 1475, 2168? 3055 What is next in 3006, 2990, 2956, 2898, 2810, 2686, 2520? 2306 What comes next: -49429, -49437, -49445, -49453? -49461 What comes next: 96827, 193655, 290483, 387311, 484139? 580967 What is next in -10, -80, -206, -406, -698, -1100, -163	{ "pile_set_name": "DM Mathematics" }
What is r in -2r3/5 + 24r*2 + 1226r/5 + 1104/5 = 0? -8, -1, 69 Find f, given that -12f5 - 28f*4 + 312f*3 + 768f*2 - 640f = 0. -4, 0, 2/3, 5 Factor 35z2 - 375z - 110. 5(z - 11)(7z + 2) Determine h so that -2h*4 + 60h*3 - 414h*2 + 756h = 0. 0, 3, 6, 21 Factor -p*2 + 70p/3 + 16. -(p - 24)(3p + 2)/3 Determine g so that 78g2/7 - 54g - 60/7 = 0. -2/13, 5 Factor 6650m3 - 3130m*2 + 2336m/19 - 24/19. 2(7m - 3)(95m - 2)*2/19 Factor -2y*5 + 32y*4 - 176y*3 + 384y*2 - 288y. -2y(y - 6)*2(y - 2)*2 Solve -3l*4 + 1362l*3 - 166359l*2 + 2672244l - 11548332 = 0 for l. 9, 218 Factor 7o3/6 - 17o*2/2 + 28o/3 - 2. (o - 6)(o - 1)(7o - 2)/6 Factor 4l*3 + 60l*2 - 1684l - 1740. 4(l - 15)(l + 1)(l + 29) Factor -o5/7 - 24o*4/7 - 66o*3/7 - 64o*2/7 - 3o. -o(o + 1)3(o + 21)/7 Factor 2q3/13 - 22q*2/13 - 2q/13 + 22/13. 2(q - 11)(q - 1)(q + 1)/13 Let -t3/2 - 236t*2 - 941t/2 - 235 = 0. Calculate t. -470, -1 Suppose 2u5/9 + 4u*4 + 116u*3/9 + 16u*2/3 - 118u/9 - 28/3 = 0. What is u? -14, -3, -1, 1 Determine r, given that -6r5 + 15r*4 - 12r*3 + 3r*2 = 0. 0, 1/2, 1 Suppose -3t*4/2 - 1617t*3 + 6477t*2/2 - 1620t = 0. What is t? -1080, 0, 1 Let -36k5 + 674k*4 + 212k*3 - 422k*2 + 76k = 0. What is k? -1, 0, 2/9, 1/2, 19 Factor -3r2/5 + 9r. -3r(r - 15)/5 Determine m, given that -3m2 - 1101m - 1098 = 0. -366, -1 Solve -3p5 - 12p*4 + 156p*3 - 240p*2 = 0 for p. -10, 0, 2, 4 Factor -5c*3 + 90c*2 + 425c + 330. -5(c - 22)(c + 1)(c + 3) Suppose 21s*3/2 - 660s*2 + 1113s/2 + 93 = 0. Calculate s. -1/7, 1, 62 Factor 5s3 - 100s*2 + 585s - 810. 5(s - 9)2(s - 2) Suppose 2t5/5 - 4t*4/5 - 82t*3/5 + 84t2/5 = 0. Calculate t. -6, 0, 1, 7 Factor -t3 + 21t2. -t2(t - 21) Find w, given that 8w4 - 10w*3 - 24w*2 + 46w - 20 = 0. -2, 1, 5/4 Factor 2r4/7 + 16r*3/7 + 10r*2/7 - 4r. 2r(r - 1)(r + 2)(r + 7)/7 Suppose -k*2 + 71k + 72 = 0. Calculate k. -1, 72 Solve 2x3 + 118x*2 - 244x = 0 for x. -61, 0, 2 Factor -x*4/5 + 11x*3/5 - 9x*2/5 - 119x/5 - 98/5. -(x - 7)*2(x + 1)(x + 2)/5 Factor -2m*4 + 164m*3 - 1362m*2 + 3544m - 2920. -2(m - 73)(m - 5)(m - 2)2 Let 5o*5 + 50o*4 + 120o*3 + 110o*2 + 35o = 0. Calculate o. -7, -1, 0 Factor -2p2 - 46p - 84. -2(p + 2)(p + 21) Factor 2l4/3 + 24l*3 + 260l*2 + 1352l/3 - 4394. 2(l - 3)(l + 13)*3/3 Factor 14q*2/5 - 26q/5 + 12/5. 2(q - 1)(7q - 6)/5 Factor -70j*2 - 284j - 16. -2(j + 4)(35j + 2) Determine k so that 5k*4/2 + 55k*3/2 + 60k*2 - 90k = 0. -6, 0, 1 Factor -4m3 - 192m*2 + 396m - 200. -4(m - 1)2(m + 50) Solve o*2 - 73o + 210 = 0 for o. 3, 70 Factor -u*2/4 + 26u - 676. -(u - 52)*2/4 Factor 2k*3/3 - 18k*2 - 126k - 198. 2(k - 33)(k + 3)2/3 Factor m2/6 + 233m/2 + 697/3. (m + 2)(m + 697)/6 Factor m*5 + 11m*4 + 18m*3 - 130m*2 - 275m + 375. (m - 3)(m - 1)(m + 5)*3 Factor 2i*2/3 - 22i/3 - 52/3. 2(i - 13)(i + 2)/3 What is x in 2x4/13 - 32x*3/13 + 126x*2/13 - 184x/13 + 88/13 = 0? 1, 2, 11 Let 6c2/5 - 11c + 9/5 = 0. Calculate c. 1/6, 9 Let 5b3 - 80b*2 + 260b - 240 = 0. Calculate b. 2, 12 Factor 2g3 - 531g*2 - 267g + 266. (g - 266)(g + 1)(2g - 1) Factor -u3/8 + 5u*2/8 - 7u/8 + 3/8. -(u - 3)(u - 1)2/8 Let -h5/7 + 20h*4/7 + 12h*3/7 - 160h*2 - 448h = 0. What is h? -4, 0, 14 Solve 76o3 - 60o*2 - 136o = 0 for o. -1, 0, 34/19 Solve 5x2 - 1610x + 6360 = 0 for x. 4, 318 Factor 19f4 + 880f*3 + 10327f*2 + 3174f. f(f + 23)2(19f + 6) Solve 3j*5/2 + 93j*4/2 + 933j*3/2 + 2931j*2/2 - 468j - 1512 = 0 for j. -12, -7, -1, 1 Solve k*3/4 - 577k*2/2 = 0 for k. 0, 1154 Solve 3o*5/5 + 3o*4/5 - 1527o*3/5 - 14703o*2/5 - 2028o + 26364/5 = 0 for o. -13, -2, 1, 26 Factor 4m4 + 8m*3 - 20m*2 - 24m. 4m(m - 2)(m + 1)(m + 3) Find c such that 5c2 - 240c - 245 = 0. -1, 49 Suppose v*4/5 - 2v*2 + 9/5 = 0. Calculate v. -3, -1, 1, 3 Find z such that -94559612z*3/5 + 988428z*2/5 - 3444z/5 + 4/5 = 0. 1/287 Factor -a*3/8 + 33a*2/4 - 129a/8 + 8. -(a - 64)(a - 1)2/8 What is a in -3a*2 + 213a - 612 = 0? 3, 68 What is y in -y*3/6 - 7y*2/3 + 31y/6 - 8/3 = 0? -16, 1 Factor t*2/3 - 16t - 100/3. (t - 50)(t + 2)/3 Factor 2p*2/5 + 4p/5 - 6/5. 2(p - 1)(p + 3)/5 Factor -4a3 - 2516a*2 - 389276a + 2009780. -4(a - 5)(a + 317)*2 Factor 2l*3/11 - 48l*2/11. 2l*2(l - 24)/11 Suppose 16o5 + 132o*4 + 134o*3 - 50o*2 - 54o + 14 = 0. Calculate o. -7, -1, 1/4, 1/2 Let c4/8 + c3/8 - 33c2/8 + 59c/8 - 7/2 = 0. Calculate c. -7, 1, 4 Let -3z2/2 - 105z - 204 = 0. Calculate z. -68, -2 Factor -i*2/5 - 4862i/5 - 5909761/5. -(i + 2431)*2/5 Let 35j*5 - 235j*4 - 350j*3 + 3700j*2 - 3960j - 1440 = 0. What is j? -4, -2/7, 2, 3, 6 Find l, given that l*5/7 - 153l*4/7 - 90l*3 + 302l*2/7 + 1893l/7 - 1413/7 = 0. -3, 1, 157 Find r, given that r*5/2 + 5r*4/6 - 25r*3/6 + 5r*2/2 + 5r/3 - 4/3 = 0. -4, -2/3, 1 Determine i, given that i*4 + 4i*3 + 5i*2 + 2i = 0. -2, -1, 0 Suppose h*3/7 + 50h*2/7 - 212h/7 + 216/7 = 0. Calculate h. -54, 2 Find t, given that t*3/10 + 7t*2/10 + t = 0. -5, -2, 0 Factor -3l*2 - 171l - 330. -3(l + 2)(l + 55) Let -5q2 + 30q - 40 = 0. What is q? 2, 4 Factor 4p4 + 64p*3 + 248p*2 + 320p + 132. 4(p + 1)2(p + 3)(p + 11) Find n, given that -n3/2 + 37n*2/2 - 231n/2 - 2205/2 = 0. -5, 21 Factor -z*3/2 - 90z2. -z2(z + 180)/2 Factor j4/2 + 7j*3/2 - 3j*2/2 - 23j/2 - 7. (j - 2)(j + 1)2(j + 7)/2 Find z, given that z*2/6 - 7z/3 + 13/6 = 0. 1, 13 Factor -8v5 + 100v*4 + 103v*3/2 + 13v2/2. -v2(v - 13)(4v + 1)2/2 Determine a so that -3a*5 + 521a*4 - 22005a*3 - 53329a*2 - 38544a - 7744 = 0. -1, -1/3, 88 Determine c, given that c*2 - 104c - 212 = 0. -2, 106 Factor -c*4 - 1293c3. -c3(c + 1293) Solve -3a*3 - 6570a*2 - 3603636a - 7181016 = 0. -1094, -2 Factor 3j2 - 120j - 252. 3(j - 42)(j + 2) Factor 3a3/8 + 45a*2/8. 3a*2(a + 15)/8 Solve 3z2 + 36z + 60 = 0 for z. -10, -2 Suppose 6g5 + 23g*4 + 71g*3/3 + 4g*2/3 - 4g = 0. Calculate g. -2, -3/2, -2/3, 0, 1/3 Factor -44z3/3 - 56z*2 + 32z/3. -4z(z + 4)(11z - 2)/3 Factor 2g2/3 + 4g. 2g(g + 6)/3 Determine a, given that -3a4/8 - 4827a*3/8 - 323811a*2 - 58069704a - 57746496 = 0. -536, -1 Suppose 5a4 + 965a*3 - 4910a*2 + 7900a - 3960 = 0. What is a? -198, 1, 2 Factor p*5/5 - 6p*4/5 - 7p3/5. p3(p - 7)(p + 1)/5 Factor 3x4 + 12x*3 - 63x*2. 3x*2(x - 3)(x + 7) Suppose 50j*3 - 3910j*2 - 3152j - 632 = 0. Calculate j. -2/5, 79 Solve 3g4/8 + 531g*3/8 = 0 for g. -177, 0 What is y in 3y*5 - 18y*4 + 12y*3 + 18y*2 - 15y = 0? -1, 0, 1, 5 Find g such that g*4 + 28g*3 + 278g*2 + 1148g + 1617 = 0. -11, -7, -3 Let -3h3/5 - 6h*2/5 + 9h/5 = 0. Calculate h. -3, 0, 1 Determine j so that -5j2 - 60j - 175 = 0. -7, -5 Solve -n*2 + 522n - 68121 = 0. 261 Solve -j3/7 - j2/7 + 4j/7 + 4/7 = 0 for j. -2, -1, 2 Suppose -2g*4 - 10g*3 - 16g*2 - 8g = 0. What is g? -2, -1, 0 Solve 4w5 - 72w*4 + 240w*3 + 800w*2 = 0. -2, 0, 10 Factor -2i*5/5 - 16i*4 - 78i*3/5. -2i*3(i + 1)(i + 39)/5 Factor -2u*2 - 18u + 20. -2(u - 1)(u + 10) Let -m*4/3 + 97m*3/3 + 100m*2/3 - 196m/3 = 0. What is m? -2, 0, 1, 98 Factor 5w4 + 75w*3 - 80w*2. 5w*2(w - 1)(w + 16) Factor 963u*2/4 + 1686u + 21/4. 3(u + 7)(321u + 1)/4 Factor -3x*3 + 237x*2 - 4560x - 4800. -3(x - 40)2(x + 1) Let -m*5/2 + 16m*4 - 109m*3 - 340m*2 + 867m/2 = 0. Calculate m. -3, 0, 1, 17 Solve -2y5/5 - 14y*4/5 - 18y*3/5 + 38y*2/5 + 44y/5 - 48/5 = 0 for y. -4, -3, -2, 1 Factor -2n5/9 - 2n*4/3 - 2n*3/3 - 2n*2/9. -2n*2(n + 1)*3/9 Let 5v*5 + 185v*4 + 2550v*3 + 15500v*2 + 35000v = 0. What is v? -10, -7, 0 Factor -2w5 - 104w*4 - 1928w*3 - 14720w*2 - 38912w - 32768. -2(w + 2)2(w + 16)3 Determine n so that n3 + 6n2 + 8n = 0. -4, -2, 0 Solve 5i5 + 65i*4 + 155i*3 + 35i*	{ "pile_set_name": "DM Mathematics" }
scending order. -18, n, s Let u = 1070.88 - 1114. Let r = u - -38. Let p = r - -0.12. Sort p, 1, -0.5 in ascending order. p, -0.5, 1 Let w = 2.034 - 0.114. Let j = w + -0.92. Sort j, -9, -2 in ascending order. -9, -2, j Let x = -2 - -3. Let h be (-3)/x6/30. Let a = -14.4 - -14. Put h, a, -3/7 in descending order. a, -3/7, h Suppose 11 = -6p + 71. Sort 4, -2, 1, p in ascending order. -2, 1, 4, p Suppose -1937 = 16s - 289. Let x = s - -106. Sort 2, -5, x in descending order. x, 2, -5 Let t = -4 - -4. Let p be 3 + -2 + 2 + t. Suppose u = -2u - pc + 6, 0 = -2c. Put u, -5, 1 in increasing order. -5, 1, u Let g = 202 + -205. Sort -5, 3, g in decreasing order. 3, g, -5 Suppose 225k - 48 = 241k. Let b be (-1)/(-1) + (-6)/4. Sort b, 1/4, k in ascending order. k, b, 1/4 Let u = 0 - -3. Suppose 3b = u + 3. Let o(h) = -h2 + h + 2. Let q be o(b). Sort -4, q, 2 in descending order. 2, q, -4 Let y be (1/2)/(1/10). Suppose 6k + 9 = 9k. Suppose -8x - 5 = -kx. Sort y, x, -5. -5, x, y Let h = -830 + 779.31. Let r = h + 51. Let l = 0.09 + r. Sort 4, l, -0.1 in increasing order. -0.1, l, 4 Suppose 5c + 91q = 92q - 214, 2c + 64 = -5q. Sort 5, c, 1. c, 1, 5 Let b = -22.2 - -27.2. Sort b, 4/17, 2/5 in decreasing order. b, 2/5, 4/17 Let a(m) = m*3 - 22m*2 + 38m + 42. Let q be a(20). Sort -30, q, 5. -30, q, 5 Let u(c) = -7c2 - 3c + 2. Let k(f) = f*2 - 1. Let d(n) = -4k(n) - u(n). Let s be d(-1). Sort 4, -5, s, -3 in descending order. 4, s, -3, -5 Let b = 0.202 + 0.098. Put b, -1/13, -3/2, -0.2 in increasing order. -3/2, -0.2, -1/13, b Let s = 5288 + -5526.1. Let v = s + 228. Let f = -10 - v. Sort f, 4, -1/6 in increasing order. -1/6, f, 4 Let w = 1.99 + 0.01. Suppose -6c + 54 = -0c. Let g be 12/c(-3)/(-18). Sort 4, g, w in increasing order. g, w, 4 Let w be (0 - 4/(-6))-3. Suppose -15 = -4o - 7. Let u = -57 - -56. Put u, w, o in ascending order. w, u, o Let h = 12 - 8.5. Let p = 4 - h. Let a(b) = -b3 + 36b*2 - 9. Let m be a(36). Sort 4, p, m in ascending order. m, p, 4 Let k = -0.4 + 0.46. Put -2, 1, k in descending order. 1, k, -2 Let n be (-17)/(-42) - (-3)/(21/(-4)). Sort 1/2, n, 8, -3/2 in increasing order. -3/2, n, 1/2, 8 Suppose -3y + 3t - 1 - 11 = 0, 0 = 3y + t. Put -3/2, -5, 5, y in decreasing order. 5, y, -3/2, -5 Let s be (-1 + 4)40/(-72)3. Sort s, 1, -1, 2 in increasing order. s, -1, 1, 2 Let p = 41/24 + -13/8. Let h = 403/1020 - -1/204. Sort h, -16, p in descending order. h, p, -16 Let d be ((-44)/(-14))/(-11 + 546/49). Put d, -5, -2 in decreasing order. d, -2, -5 Let w be (3 + 32/(-11))(-1 + 2). Put w, 0.4, -2/9, -0.5 in ascending order. -0.5, -2/9, w, 0.4 Let k = 1.1 + -1. Suppose -3s = 3n + 2s - 114, 3s = -9. Let c = -133/3 + n. Put -2, k, c in descending order. k, c, -2 Let l = 971 - 967. Sort -4, 2, 0, l in descending order. l, 2, 0, -4 Suppose -41j + 64 + 18 = 0. Let m be (-24)/(-14) + (-4)/(-14). Let n be (0/m - 1) + 2. Sort j, n, 0. 0, n, j Let o = -15.2 + 19.2. Sort 23/6, -9, -1, o. -9, -1, 23/6, o Let p = -1/40 + -77/120. Let g = -322 + 201. Let z = g + 117. Put 4, p, z in descending order. 4, p, z Let l(a) = 409a - 401a + a2 + 14 + 4. Let b be l(-6). Sort 0, b, -1 in descending order. b, 0, -1 Let n be 2/((-16)/36 + 213/54). Let j = -3 - -35/11. Put n, -4/5, 0.1, j in ascending order. -4/5, 0.1, j, n Let j = 191 - 195. Put -3, 3, j in descending order. 3, -3, j Let r(p) = -p3 - 3p2 + 6p + 3. Let t be r(-4). Sort 2, -11, t, -4 in ascending order. -11, t, -4, 2 Let t be (-2)/20 + (-5 - 2358/20). Put -1/5, t, 1 in ascending order. t, -1/5, 1 Let p = -1884 - -1883. Put 6, -7, p in increasing order. -7, p, 6 Let b(c) = -8c2 - 9c - 3. Let k be b(3). Let y be (-2 + k/(-52))(-12)/(-39). Sort 2, y, 0.2 in decreasing order. 2, 0.2, y Let f be 2628/54 + 2/6. Sort f, 1, -1, 5 in descending order. f, 5, 1, -1 Let m be 7/4(14 + -16). Let l = 4 + m. Let t be ((-4)/(-6) + -1)-3. Sort 2/13, t, l in increasing order. 2/13, l, t Let k = 3 - 1. Let o = 5.2 - 1.2. Let r be (3 - 5) + 13/6. Put k, r, o in decreasing order. o, k, r Let j(z) = -3z + 41. Let h be j(13). Suppose 4g - 5p = -g - 15, hp = -g. Put g, 5, 3 in ascending order. g, 3, 5 Suppose 2y + 0 - 4 = 0. Suppose -2b = -b + y. Let v = -402 - -405. Put b, -4, v in increasing order. -4, b, v Let g be (-14 - -15)(-1)/432. Let s = -29/301 + g. Sort -5, -3, s in descending order. s, -3, -5 Let o = -0.284 + 0.034. Let l = o + -0.75. Sort l, -17, -3/4. -17, l, -3/4 Let w = 539 + -401. Sort 0.5, 5, w in descending order. w, 5, 0.5 Suppose 4 = -2i - 2q, 0i + 2i = -4q - 12. Sort -0.15, 0.4, i. -0.15, 0.4, i Let q = -16956/301 + 394/7. Sort q, 0.4, 5 in descending order. 5, 0.4, q Let x = -6.98 + 5.98. Put 0, x, 1, 0.02 in increasing order. x, 0, 0.02, 1 Suppose 5h + 27 = -23. Let r be (6 - 7)/((-2)/h). Let q be (5/4)/(8/32). Put 1, q, r in increasing order. r, 1, q Let h(q) = q2 + 6q - 11. Let g be h(-7). Sort g, 4, -1, -2 in descending order. 4, -1, -2, g Let h = -1.96 + 2. Let y = 0.36 + h. Let s = -91.7 + 92. Put y, 1/4, s in descending order. y, s, 1/4 Let f be 76/16 + (-1)/(-4). Suppose -fi = -21 + 6. Let o = 643 + -647. Sort o, i, 1. o, 1, i Suppose 0 = 25f + 5f + 60. Let j = 3 + -2.9. Let m be (-2)/(-8) + (-3)/6. Put j, f, m in descending order. j, m, f Suppose 86 = -12p + 14. Sort 12, -2, 1, p in decreasing order. 12, 1, -2, p Let q be (0 - -4) + (-1 - -2). Let x = -14 - -10. Let f be 2 + -4x/16. Sort -3, q, f in decreasing order. q, f, -3 Let c be 33/((-1377)/(-6)). Let i = -0.989 - -3.989. Sort i, -1, c in ascending order. -1, c, i Suppose 9d = 42d - 132. Put 6, -15, d in descending order. 6, d, -15 Let a = 230.2 + -230. Put a, 0.9, 2/17 in decreasing order. 0.9, a, 2/17 Let l(y) = -y*3 - 3y*2 - 9y + 16. Let c be l(-6). Let n = c - 178. Let i = -2 + 5. Sort i, n, 1. n, 1, i Let t = 1640/13 - 126. Let d = 1.2 + -0.9. Sort d, 2/7, t in ascending order. t, 2/7, d Let i be 2 + ((-24)/10 - (-22)/22). Let n be 5/(-4)(2 + 2). Let v(j) = -j - 1. Let t be v(n). Sort t, 0, i. 0, i, t Let i = 59 + -61. Sort -107, i, 2 in ascending order. -107, i, 2 Let s = -1.38 - -0.98. Let a = -58 - -752/13. Put s, 1.2, a in ascending order. s, a, 1.2 Let w = 518 + -358. Let r = w + -137.1. Let g = -23 + r. Sort -4, 1, g in increasing order. -4, g, 1 Let o = -2020 - -2016. Put 2/9, 1/7, o in ascending order. o, 1/7, 2/9 Let l = -25 + 7. Let x be 4/5 - l/40. Let r = -2 + 3/2. Put x, 0, r in increasing order. r, 0, x Let f = 46 - 44. Suppose -fa - 11 = -g - 1, -a - 8 = -2g. Sort a, 0, 1, -1 in descending order. 1, 0, -1, a Suppose -6g = -2g - 60. Let d be g/30 - (-1)/(-2). Let v = -8 + 17. Put d, 5, v in increasing order. d, 5, v Let l = 41 - 39. Let s = 42 - 41. Sort 0.1, l, s, 1/6 in descending order. l, s, 1/6, 0.1 Let q be 1-2(-88)/16. Let k = 15 - q. Let h(s) = s - 14. Let t be h(12). Put 5, t, k in descending order. 5, k, t Suppose -2y = 17 - 15. Put -4, -13, 2, y in decreasing order. 2, y, -4, -13 Suppose 0u + p = -4u - 25, -4u + 4p = 0. Let v = -31 + 35. Suppose 5 + 0 = 5b - 5a, -3b + va = -1. Sort b, 2, u in descending order. b, 2, u Let z be (10 + 0 + 2)(-3)/(-2). Suppose u - 23 = -z. Put 3/5, 0.3, 1, u in ascending order. 0.3, 3/5, 1, u Suppose 22 = 2w - 5h, h + 2h + 6 = 0. Let d be ((-4)/10)/(3/(-90)). Suppose -9 = 3s - d. Put -4, w, s in ascending order. -4, s, w Let h(o) = -o2 + 34o - 260. Let k be h(12). Put -1, 1, k in descending order. k, 1, -1 Suppose -2h = 3s - 0s - 159, -s = -4h + 353. Let l be 1 - (2 + h/(-60)). Let j = l - -3/10. Put 4, 2, j in decreasing order. 4, 2, j Let y(k) = -2k3 + 6k*2 + 8k. Let u be y(4). Sort -3/8, 3/7, 0.2, u in descending order. 3/7, 0.2, u, -3/8 Let p = -0.15 - -0.04. Let j = -9.89 + p. Let r = -8 - j. Put r, -4, -1 in decreasing order. r, -1, -4 Let m be ((-2)/(-24))/(4(-156)/(-32)). Let n = -199/8190 - m. Put n, 3, 0.3, -2/7 in increasing order. -2/7, n, 0.3, 3 Let j be 15/(-160)2/(-3). Let h = 0.0903 + 4.9097. Sort -2/3, h, j in descending order. h, j, -2/3 Let h = 14.6 - 17. Let l = h + -7.6. Let o = l - -8. Put -3, o, 4 in decreasing order. 4, o, -3 Suppose -2k - 5k - 84 = 0. Let n = 11 + k. Sort 1, 3, n. n, 1, 3 Let a be (-1 - 22/(-4))/((-31)/5	{ "pile_set_name": "DM Mathematics" }
/7 Let u = -0.09 - 1.91. Let c = 2/7 + -20/21. Let s = -0.6 + 3.6. What is the closest to c in 5, u, s? u Let s be 0 - 1 - (-117)/123. Let a = s - 37/82. What is the nearest to a in -1, -0.2, 2? -0.2 Let w = 2.6 - 3. Let q = -4.07 - -0.07. Let k = -3.6 - q. Which is the closest to -1? (a) k (b) w (c) 1 b Let t = 5 - 4. Let p = 0.05 + -0.1. Let x = -0.35 + p. What is the nearest to t in x, 1/3, -0.2? 1/3 Let k = 34 - 38. Which is the closest to 3.8? (a) 1 (b) k (c) -1 a Let j = -6 + 8. Suppose -jz = -z - 1. Which is the nearest to z? (a) -0.4 (b) -1 (c) 2 c Let p = 2.8 + -2.7. Let l = -12 - -7. What is the closest to p in 0.1, 1, l? 0.1 Let d = 4.6 + -5. Let x(o) = o3 - 7o*2 + 6o - 2. Let q be x(6). Suppose -s - 1 = -5. Which is the closest to q? (a) s (b) -2/9 (c) d c Suppose 0q - 2q = -6. Suppose -qf + 0f = -21. Let x be -1 + -2 + 1 + f. What is the closest to 1/4 in -0.5, x, 0.4? 0.4 Let x be (2/(-25))/((-1)/(-5)). Let f be ((-2)/(-7))/((-8)/(-7)). Let n = -0.1 - 0.4. Which is the nearest to f? (a) 4 (b) n (c) x c Let p = 4 + -4. Let v = 5 - 0. Suppose 2g - t + 4 = v, 0 = -4g - 5t - 5. What is the closest to g in p, 2, 5? p Let y = -42 - -37.8. Let u = 11 + -15. Let n = y - u. Which is the nearest to -0.1? (a) 4 (b) n (c) 2 b Let w = 0.37 + 0.03. Let t = -0.6 + 0.1. Let s = -0.5 + t. What is the nearest to s in 0.1, w, -4? 0.1 Let y = -0.3 + 0.4. Let g = y - -0.9. Let z = 0.08 - -0.92. What is the nearest to g in 0, 5, z? z Let c = 2.3 - 1.3. What is the nearest to c in -0.1, 0.2, -2? 0.2 Suppose -4a + 20 = 0, 0a = -u - 2a + 25. Suppose u + 10 = 5f. Let s = -0.05 + 2.05. What is the nearest to 0.1 in f, 3, s? s Let b be 4/(-14) + (-96)/56. Let a be (b/15)/(2/(-3)). What is the nearest to a in -0.2, 2/13, -4? 2/13 Let t be (-14)/8 - (-3 - -1). Let f = 4 - 4. What is the nearest to -2 in -1/6, f, t? -1/6 Let q be 6/(-8)6/(-45). What is the closest to -2/7 in 0, q, 4? 0 Let w = 763/604 - 2/151. Let f = w - 3/4. Which is the closest to f? (a) -4 (b) 0.5 (c) 1/10 b Let c = -148/3 - -49. What is the nearest to c in 0.5, 0.3, 2? 0.3 Let x = 1.92 - -21.18. Let n = x + -23. Which is the closest to n? (a) 1/5 (b) 0.3 (c) 1 a Let v = -7 + 10. Let d = -32.7 - -34. Let a = d - 0.3. What is the closest to a in 0, v, -5? 0 Let v = 71/28 + -16/7. Which is the nearest to v? (a) 1 (b) -4/7 (c) -1 a Let z = -7 - -2. Let v = z - 2. Let h = 7 + v. What is the nearest to h in 3/2, -2, 2/5? 2/5 Let l = -12 + 11. Which is the nearest to l? (a) 1 (b) 0 (c) -10 b Let p = 0.9 - 1. Let x = p + 0.1. Which is the closest to x? (a) -1/3 (b) 2/9 (c) -1 b Let g = -4 + 6. Let t = -66.6 + 67. Which is the nearest to g? (a) 5 (b) 1 (c) t b Let q(s) = -2s - 2. Let m be q(-4). Let i be (-18)/10 - m/(-3). Let n = -4 - -6. What is the nearest to n in i, 2, 0.1? 2 Let b = -18 + 17.6. Let u = -0.08 + 0.1. Let i = u + 2.98. What is the closest to 2 in -0.5, i, b? i Let y = 0.35 - 0.05. Let p = 58 + -55. Let k = 0.4 - 0.1. Which is the nearest to y? (a) -5 (b) k (c) p b Let n be (-36)/(-21) - (5 + -3). What is the nearest to n in -6, -1/5, 0.2? -1/5 Let t = 122 + -121.9. What is the nearest to 0 in t, -0.22, -5? t Let y = -4 - 5. Let m = -13 - y. Let f = -5 - -8. Which is the closest to 0? (a) f (b) 2/3 (c) m b Let x = -1.33 + 1.33. Let i = 13 + -51/4. Let s = -7 - -11. What is the nearest to x in i, s, 0.4? i Suppose -2k = -3k - 1. Let l(g) = g3 + 3g2 + g + 1. Let u be l(-3). Which is the nearest to -0.1? (a) u (b) -2/3 (c) k b Let s = -0.03 - 1.97. What is the closest to 1 in 0, s, 2/15? 2/15 Let h = -0.01 + 1.01. Let z = h + -1. What is the nearest to z in 2, 5, 4? 2 Let i be 3/(-3) - 2537/13. Let x = 196 + i. What is the nearest to -1 in x, -0.2, -1/3? -1/3 Let j = -0.2 + 0.7. Which is the nearest to -5/4? (a) j (b) -4 (c) 1 a Let q = -8.8 - -1.8. Let o = 6.4 + q. Let j = -3.6 - o. Which is the nearest to -2/7? (a) j (b) 5/4 (c) 4/3 b Let o = 0.5 + -0.5. Which is the closest to -2/5? (a) o (b) -0.2 (c) -3 b Let k(d) = d3 - 2d2 - 7d + 1. Let i be k(5). Let o be i/63 + 4/(-18). What is the nearest to 0.2 in o, 0.1, -1? 0.1 Let z = 1.9 - 9.9. Let l = -7.5 - z. Suppose -4j - 2x = -4x + 12, 0 = 3x + 12. What is the closest to -0.1 in j, l, -0.2? -0.2 Let z = -5 - -2. Let p be 3/(6/(-4))-1. Let d = -0.9 + 0.7. What is the nearest to p in -0.3, z, d? d Let w = 532/45 + -58/5. Let x = -0.7 + -0.3. Let d = -245/44 + 75/11. Which is the closest to x? (a) w (b) -1/6 (c) d b Let i = 0.2 + -1.2. Let v = -1.8 - -2.4. Let x = v + i. Which is the closest to -1? (a) -1/2 (b) x (c) -2/3 c Let q = 5 + -9. Let f = -0.31 + -1.59. Let s = 0.9 + f. What is the nearest to s in 5, -3, q? -3 Let s be 8/6 - 8/36078. Which is the nearest to 1? (a) 3 (b) 15 (c) s c Let d = -37 + 36. Let s be (-9)/(-15) - (0 + 1). Which is the nearest to s? (a) d (b) 0.3 (c) -2 a Let b be -933/(3 - 6). Let z be (-4)/b - 2/(-9). What is the closest to -1 in -4, z, -5? z Let q be 1 + (5/(-6) - 0). Let n = 302/51 + -112/17. What is the closest to n in -4, q, 0.2? q Let m = 5 + -3.3. Let v = m + 0.3. Which is the closest to v? (a) 0.2 (b) 2 (c) 1/4 b Suppose -3 - 5 = 4m. Let d be (m/(-6))/(2/18). What is the closest to -2/5 in d, 3/4, -3? 3/4 Suppose 7 = -3n + 16. Which is the closest to -3/4? (a) 3/7 (b) 0.3 (c) n b Let u = 137 - 143.3. Let l = u - -7. Let g = 0.6 - l. Which is the nearest to -0.1? (a) -2 (b) g (c) -3 b Let d be (9/(-90))/((-2)/5). What is the closest to -2 in d, 4/3, -2? -2 Let y = 0.12 + -5.12. Let q = 0.224 + -0.024. What is the nearest to q in y, 1/2, 2? 1/2 Let t = 0.8 + -0.6. Let w = t - 0.2. Let s = 1 + -0.7. Which is the nearest to w? (a) 0.5 (b) s (c) -0.4 b Let c(s) = s2 - 1. Let d be c(-1). Let u = 1.037 + -0.037. What is the closest to -0.1 in d, 4, u? d Let c = -0.6 + 1. Let m = c + -5.4. Let r = -0.1 + 1.1. What is the closest to r in 1/3, m, 3? 1/3 Let p(y) be the third derivative of -y6/120 + y4/24 + 3y*2. Let d be p(1). Suppose dh - 4 = -4h. What is the nearest to h in -0.5, 0.1, 2? 0.1 Let m = -10.3 + 10.5. Which is the closest to 1/8? (a) m (b) 2 (c) 2/25 c Let n(f) = 42f3 + 1. Let a be n(-1). Let s = -202/5 - a. What is the closest to 0.1 in s, -3, -4/7? s Let i = -2.4 - -2.3. Let v = 15.9 + -12. Let f = 4 - v. Which is the nearest to i? (a) f (b) 3 (c) 1/3 a Suppose 8 = -v + 21. Let m be 14/(-49) - v/(-21). Which is the closest to -0.1? (a) m (b) 0.5 (c) -1 a Let k = -3 - -2.9. Let j = 0.7 + -0.4. Let i = k - j. Which is the closest to 0.1? (a) -1 (b) i (c) 2/7 c Let v(u) = -u3 + 6u2 + 7u + 10. Let a be v(7). Let p be (a/(-25))/((-26)/10). What is the nearest to 0 in -0.3, p, -3? p Let q = 0.4 - 0.3. Which is the closest to q? (a) -2/5 (b) -0.01 (c) 1 b Let p be 3 + -2 + 10/14 + -2. Which is the closest to p? (a) -2 (b) 0.5 (c) -25 b Let c be 5 + (0 - 85/20). What is the nearest to -9 in 4, c, -2/13? -2/13 Let t be -1 - (0 + 1 + 1). Let l = -3.2 - 0.8. Let s = -61 - -61.3. What is the nearest to 0.1 in l, t, s? s Let y = -14 - -14. What is the closest to -2 in y, -0.1, 2/9? -0.1 Let l = 6 + -8. Let o be -1 - 0/(4/l). Which is the closest to -1? (a) -3/2 (b) o (c) -3/4 b Suppose 0 = -g - 3 - 0. Let n = -0.8 - -1. Let r = 38.5 + -38.4. What is the nearest to r in n, -2, g? n Let r = -0.09 + -0.01. Which is the nearest to -0.1? (a) 2 (b) r (c) -1 b Suppose 10 = -5s - 2y, 2s - s - y + 2 = 0. Which is the nearest to 15? (a) -2/11 (b) 4 (c) s b Let t be (-6)/(6/10 - 1). Let n be 5/t(-4)/(-3). What is the nearest to -1/2 in 2, 0.3, n? 0.3 Let o = 0.3 + 1.7. Let w be (-3)/6 - 2/12. Which is the nearest to w? (a) o (b) -6 (c) -3 c Let o = 3 + -2.8. Let q = 15.6 + 0.4. Let w = q - 13. Which is the closest to 1? (a) w (b) -5 (c) o c Suppose -9g - 12 = -m - 13g, 3m + 4g = 12. Let f = 0.2 - 0.2. What is the closest to m in -2/13, -1/8, f? f Let s = 0.4 + -5.4. Let l = 1.8 + 6.2. Let x = s + l. Which is the nearest to 1? (a) x (b) 4/7 (c) -0.4 b Suppose -4v - 24 = 5d, -3*v - 1 - 2 = 0. What is the nearest to 1 in d, 2/3, -2? 2/3 Let t = 17 - 38. Let m = t - -187/9. Let b = -0.28 + 0.08. What is the closest to -2 in b, -0	{ "pile_set_name": "DM Mathematics" }
gest value? (a) -1 (b) -1/2 (c) 2/17 (d) -30923 a What is the third smallest value in -97338, 2, 41? 41 Which is the biggest value? (a) 196 (b) 9614 (c) 4 b Which is the fourth smallest value? (a) 55 (b) 140 (c) 39 (d) -2/13 b What is the smallest value in -0.005, 2, -2/11, -0.4, 0.4, 57/4? -0.4 What is the sixth biggest value in -5/2, 2579/4, 5, 3/2, -3, 1, -5? -3 What is the fourth biggest value in -0.23, -3, 1/4, -149813? -149813 What is the sixth smallest value in -718, 3/52, -1, 1/4, 2, -3? 2 Which is the smallest value? (a) -4.9 (b) 1/2 (c) 409 (d) 5/6 (e) -6 e What is the second biggest value in -68244, 2/79, -1/5, 1, 4, -0.1? 1 Which is the fifth biggest value? (a) 0.2 (b) 27 (c) 132 (d) -0.5 (e) -4 e Which is the fifth smallest value? (a) -4 (b) 62.12 (c) -5 (d) -0.15 (e) -3 (f) 2/11 (g) -2/5 d What is the biggest value in -46, -1, -0.34, 7, -16/205? 7 Which is the second biggest value? (a) -0.05 (b) 5 (c) -1/759 (d) -3 c What is the fourth biggest value in -4, 15.46, 9, 4/183, -2/11, -0.1? -0.1 Which is the third biggest value? (a) 96553 (b) 4 (c) -4/7 (d) 0.4 (e) 1/7 d What is the fourth smallest value in -6, -4, 2/7, -1, 3, 2, 43? 2/7 What is the second biggest value in -70, 2800/3, 13? 13 What is the sixth biggest value in -2, 0.5, -4352, -1, -4, 69? -4352 Which is the third biggest value? (a) 5 (b) -0.3 (c) 68 (d) 21 (e) -0.2 (f) 0.14 (g) -2/17 a What is the second smallest value in -0.02, -4, 4, 5, 0.4, -20883? -4 Which is the third biggest value? (a) 90/37417 (b) -4 (c) -1/9 (d) 1 c What is the fifth smallest value in -2/9, 5, -0.22, 28, 1/3? 28 Which is the biggest value? (a) 0.37 (b) -10.455 (c) -0.3 a Which is the fourth biggest value? (a) 25733/12 (b) -3 (c) -0.3 (d) -4 d Which is the sixth smallest value? (a) -41 (b) 1 (c) -1656 (d) -1/7 (e) -4 (f) 1/6 b Which is the biggest value? (a) -3 (b) -5 (c) 3 (d) -0.5 (e) 0.4 (f) -13 (g) -64/5 c Which is the seventh biggest value? (a) -160 (b) -1 (c) -15 (d) 0.57 (e) 4 (f) -2 (g) -1/2 a Which is the third smallest value? (a) -559 (b) -0.05 (c) -1.2 (d) -2 c Which is the second smallest value? (a) 7835 (b) 0.1 (c) -0.02 (d) -1 c What is the third biggest value in 12389/4, 2, -51? -51 Which is the biggest value? (a) 705633 (b) -1.7 (c) 1/11 a What is the smallest value in 7, 0.0463, -2, -2/11, -0.5, 0.027, 5? -2 Which is the sixth biggest value? (a) -58 (b) -47 (c) 31 (d) -73 (e) 0.4 (f) -2/15 d What is the second smallest value in -23.1, -0.4, -5613? -23.1 What is the third smallest value in -24226, 0.007, 5? 5 Which is the third smallest value? (a) 57 (b) 14 (c) 0.1 (d) -9 (e) -0.037 c Which is the third biggest value? (a) 3/2 (b) 1/4 (c) -1/4 (d) -26/15 (e) 0.049 (f) 0.4 b What is the seventh smallest value in -26, -0.1, 0.02, 0.2, 3, 0, 145? 145 What is the third biggest value in 2/7, 1/1854, -0.29, 3? 1/1854 What is the fifth biggest value in -0.4, 6, -1/3, -4, 3/2, -5019? -4 What is the second smallest value in -531/5, -16, 2, -4, 3/7? -16 Which is the fourth smallest value? (a) -0.3 (b) 1 (c) 178 (d) 4/9 (e) 73 (f) -1 (g) -4 d What is the biggest value in -993, -0.203, 2, 1.05? 2 What is the second biggest value in 6, 3, -173, 258? 6 Which is the biggest value? (a) 138 (b) -2 (c) 1209 (d) -1/2 (e) -3 c Which is the fourth biggest value? (a) 3/5 (b) 1/4 (c) 9/2 (d) 3184 (e) 204 a What is the fourth biggest value in -0.2, 27, -37412, 0? -37412 Which is the fifth smallest value? (a) 296/135 (b) -0.1 (c) 1/5 (d) 3/7 (e) -2/5 (f) -2/11 d What is the smallest value in -127.5, 6, 190, -1? -127.5 What is the second smallest value in -17/5, -0.1, 0, 4/3, 1/51826, 3/5? -0.1 Which is the third biggest value? (a) 2/15 (b) -5 (c) -2/8311 (d) -267 (e) 3 c Which is the biggest value? (a) -0.4 (b) -7.7 (c) -2/21 (d) -56.98 (e) 1 e Which is the third biggest value? (a) -3 (b) 4854 (c) 0.3 (d) -0.5 (e) 1/2 (f) -2/11 (g) 68 e Which is the third biggest value? (a) -0.5 (b) -0.4 (c) -9 (d) 0.4 (e) 8 (f) -24/4805 (g) -4 f Which is the fourth smallest value? (a) 4 (b) 1/15 (c) 16/3 (d) 5.21343 c What is the fifth biggest value in 9, -0.0111, 125, -2/11, 1, -2? -2/11 Which is the biggest value? (a) -3777.06 (b) -2 (c) 4 (d) -5 c Which is the sixth biggest value? (a) 0.5 (b) 0 (c) 0.43 (d) 15 (e) -1/4538 (f) -5/2 f What is the second biggest value in 9955415/6, -5/9, 3? 3 Which is the fifth smallest value? (a) -0.07 (b) 1 (c) 0.7 (d) -4 (e) 3 e Which is the sixth biggest value? (a) -0.1 (b) -8 (c) -0.0413 (d) 2/9 (e) 4 (f) 1/3 (g) 0 a What is the fifth biggest value in 2/7, -1/11, 3, -115, 0.3, -2/3? -2/3 What is the fifth smallest value in 55, -1/285, 1/4, 7, 1, -3? 7 What is the smallest value in -0.05, 2/13, -5, -3/4, 0.5, 3, -0.1? -5 What is the fifth smallest value in 1, 14444/7, 109, -4, 5? 14444/7 Which is the third smallest value? (a) 2/3 (b) -4/11 (c) 1635 (d) -1 (e) -2/3 (f) -0.2 (g) -0.1 b What is the sixth biggest value in -10241, 2/7, -0.2, -0.5, -5/364, -4? -10241 What is the third smallest value in 24948, -20/3, 10/13, 4/7? 10/13 What is the sixth smallest value in 0.2, -10, 2489, 5, 4, 11? 2489 Which is the third smallest value? (a) 6961 (b) -581 (c) -0.04 a What is the second smallest value in -2/3, -2.4, 40491? -2/3 What is the fourth biggest value in -0.03, 8, -4, 4, -1/9, 3274? -0.03 What is the biggest value in -8, 83269/4, 0.3, 2/7, 4, 5? 83269/4 What is the second smallest value in -5, 3/17, 23.4, -1117? -5 Which is the fifth biggest value? (a) 0.4 (b) 1168/45 (c) 7/4 (d) 4 (e) -2/23 e Which is the second smallest value? (a) 0 (b) 190 (c) -30.14 (d) -1 (e) -8 e Which is the biggest value? (a) -1/2 (b) 1/6 (c) -0.3 (d) -6 (e) -9.5 (f) -5 (g) 0.011 b Which is the smallest value? (a) -2 (b) -1 (c) 6/41 (d) 8 (e) -192 e Which is the fourth biggest value? (a) -62 (b) -3 (c) 3 (d) -2.691 (e) -1 b What is the third biggest value in 1.03, -734, -262? -734 Which is the second biggest value? (a) -1 (b) 363 (c) -2444 (d) -5 (e) 0 e What is the seventh biggest value in 2/7, -3, -44, -0.2, -31438, -0.5, 2? -31438 What is the biggest value in 0, 56.2795, 3, 46? 56.2795 What is the third biggest value in 2/361, -127, -1, 0.3, 2/7, -0.3? 2/361 What is the second smallest value in -25, 0, 4327.02? 0 Which is the biggest value? (a) -0.059 (b) 6.868 (c) -7 b What is the third biggest value in 81, 0.036, -350? -350 What is the second smallest value in 3, 0.2, 961, -16, -0.6? -0.6 Which is the third smallest value? (a) 5/6 (b) 9/7 (c) -2/5 (d) -2/3755 (e) -0.2 d What is the third smallest value in -35, -3, -44674, -4? -4 What is the fourth smallest value in -1/2831, -0.2, -3053, -3? -1/2831 Which is the fifth smallest value? (a) -0.2 (b) -96 (c) 0.5 (d) 48.35 (e) -5 d Which is the second smallest value? (a) -0.3 (b) -0.5 (c) 1.7 (d) 0.66 (e) 8241 (f) 2/3 a What is the fourth biggest value in -0.0442, -9, -3/2, -1579? -1579 Which is the smallest value? (a) -2 (b) -2/3 (c) -1190 (d) -6 (e) 2 (f) -4 c What is the smallest value in 29/462, 3, -0.34? -0.34 What is the sixth smallest value in -3, -3/4, 10, 4, -1/4, -2? 10 Which is the fifth smallest value? (a) 553 (b) -0.1 (c) -6 (d) -5 (e) -16 (f) 10/19 f Which is the second smallest value? (a) 388 (b) -7 (c) 328/33 c Which is the third biggest value? (a) -43.04 (b) -4.3 (c) -1/10 a What is the second smallest value in -1.1841, 0.1, 0.4, -4/7? -4/7 Which is the biggest value? (a) 124 (b) 95 (c) 0.04 a Which is the second biggest value? (a) 24 (b) 0 (c) -459821 b What is the fifth smallest value in 2/605, -19, 0.02, 2, -3? 2 Which is the third biggest value? (a) -5.02 (b) -13486 (c) 3 b Which is the smallest value? (a) -2/5 (b) 0.3 (c) -0.1 (d) -0.15 (e) -4 (f) -368 f Which is the second smallest value? (a) 13/6 (b) -2150 (c) -2 c Which is the third biggest value? (a) -0.1 (b) 5 (c) 223 (d) 3 (e) 1.1 (f) 0.0359 d What is the fourth biggest value in 6/35, 1/3, 36, 0.184, 1/7, 2/5? 0.184 Which is the second biggest value? (a) 168225.4 (b) -54 (c) -2 c What is the biggest val	{ "pile_set_name": "DM Mathematics" }
76, 37280, 46400, 55542? 64712 What comes next: 2312, 7374, 15688, 27242, 42024, 60022, 81224? 105618 What is the next term in -1142, -4418, -9828, -17330, -26882, -38442, -51968? -67418 What comes next: 13090, 17215, 21340? 25465 What is the next term in -2256985, -4513980, -6770977, -9027976, -11284977, -13541980? -15798985 What is next in 12916, 18209, 23502, 28795, 34088? 39381 What comes next: 1244305386, 1244305387, 1244305388, 1244305389, 1244305390, 1244305391? 1244305392 What is the next term in 4520787, 9041580, 13562373? 18083166 What is the next term in 2440, 2467, 2474, 2449, 2380? 2255 What comes next: -8217, -12150, -16083? -20016 What is the next term in 5317621, 5317625, 5317629, 5317633, 5317637, 5317641? 5317645 What is the next term in -462, -370, -260, -132? 14 What is the next term in 32466, 32566, 32666? 32766 What is the next term in -42166, -42093, -42032, -41989, -41970, -41981, -42028, -42117? -42254 What comes next: 1267, 826, 345, -194, -809, -1518, -2339, -3290? -4389 What comes next: -17204505, -17204500, -17204483, -17204448, -17204389, -17204300? -17204175 What comes next: 7832, 31349, 70566, 125513, 196220, 282717, 385034, 503201? 637248 What comes next: -601, -1553, -3037, -5053, -7601, -10681, -14293? -18437 What is the next term in 8350, 22555, 46226, 79363, 121966? 174035 What comes next: -7066, -6768, -6470, -6172? -5874 What is the next term in -995547, -995608, -995709, -995850, -996031? -996252 What comes next: -166268, -665068, -1496400, -2660264? -4156660 What is the next term in -169, -2125, -7669, -18595, -36697? -63769 What is next in 39598, 39674, 39750, 39826, 39902, 39978? 40054 What is next in 8282, 34075, 77060, 137237? 214606 What is the next term in 3375976, 6751952, 10127926, 13503898, 16879868, 20255836, 23631802? 27007766 What comes next: 118884, 238870, 359954, 482136, 605416, 729794, 855270? 981844 What comes next: -38145, -38241, -38337? -38433 What comes next: -538123, -538085, -538047? -538009 What is the next term in -152768, -152839, -152912, -152987? -153064 What is the next term in -91903, -183935, -275963, -367987, -460007, -552023? -644035 What comes next: 1405072, 2810138, 4215204, 5620270, 7025336, 8430402? 9835468 What is the next term in -2687, -5553, -10323, -16991, -25551, -35997, -48323? -62523 What is the next term in -5396, -5512, -5694, -5936, -6232? -6576 What is next in 487498, 487488, 487478? 487468 What is next in -1709040, -3418087, -5127134, -6836181, -8545228, -10254275? -11963322 What is the next term in 299152, 299454, 299756, 300058, 300360, 300662? 300964 What comes next: 6073, 9827, 13581? 17335 What is next in -44108, -88254, -132474, -176804, -221280, -265938? -310814 What comes next: 2945878, 2945872, 2945866, 2945860, 2945854? 2945848 What comes next: -4796, -9730, -14946, -20444, -26224, -32286, -38630? -45256 What is the next term in -11655865, -23311732, -34967599, -46623466? -58279333 What is next in -10394257, -20788516, -31182775, -41577034, -51971293? -62365552 What comes next: 11288725, 22577446, 33866167, 45154888? 56443609 What is next in -597708543, -597708545, -597708547, -597708549? -597708551 What is the next term in 25148224, 50296474, 75444724, 100592974, 125741224? 150889474 What is the next term in 289357005, 578714008, 868071011, 1157428014, 1446785017? 1736142020 What comes next: -659021, -1317961, -1976901, -2635841? -3294781 What is the next term in -1840052504, -1840052503, -1840052502? -1840052501 What is next in 1255, 2346, 3371, 4318, 5175? 5930 What comes next: 5626, 10643, 15662, 20683? 25706 What comes next: 4786, -1448, -7682? -13916 What is next in 78, -149, -1330, -4119, -9170, -17137? -28674 What is next in -8786, -35312, -79500, -141332, -220790, -317856, -432512, -564740? -714522 What comes next: -273, -478, -701, -942, -1201? -1478 What comes next: 453986, 449023, 440752, 429173, 414286, 396091, 374588? 349777 What is next in 117075, 116505, 115937, 115371, 114807, 114245? 113685 What is the next term in -5927905, -5927904, -5927901, -5927896, -5927889? -5927880 What is next in 35747172, 35747174, 35747176? 35747178 What is next in -436494356, -436494354, -436494352, -436494350, -436494348, -436494346? -436494344 What comes next: -407320, -814510, -1221700, -1628890? -2036080 What is next in -23290, -93089, -209422, -372289? -581690 What is next in -109008, -122097, -135186, -148275, -161364? -174453 What comes next: -16338073, -16338072, -16338073, -16338076, -16338081? -16338088 What comes next: -400443, -804049, -1207655? -1611261 What is next in -1490163, -1490163, -1490165, -1490169, -1490175, -1490183? -1490193 What is the next term in 95197402, 95197397, 95197394, 95197393, 95197394, 95197397, 95197402? 95197409 What is next in 1349, 4568, 9603, 16454, 25121, 35604, 47903? 62018 What comes next: 8853828, 8853848, 8853868, 8853888, 8853908, 8853928? 8853948 What is next in -153166, -307859, -462552, -617245, -771938, -926631? -1081324 What comes next: 103, 583, 1817, 4171, 8011, 13703? 21613 What is next in -1249, -1136, -875, -394, 379, 1516, 3089, 5170? 7831 What comes next: -24983, -24864, -24659, -24362, -23967, -23468, -22859? -22134 What is next in 100873722, 201747452, 302621182, 403494912, 504368642? 605242372 What is the next term in 2070, 4133, 6218, 8331, 10478, 12665, 14898, 17183? 19526 What is next in -165909, -165892, -165891, -165912, -165961, -166044, -166167, -166336? -166557 What is next in -3912, -9280, -16106, -24390, -34132? -45332 What is next in -3549207, -7098430, -10647653, -14196876, -17746099? -21295322 What comes next: 132925, 132914, 132881, 132814, 132701, 132530, 132289, 131966? 131549 What is next in -18951010, -37902089, -56853170, -75804253, -94755338, -113706425, -132657514? -151608605 What is the next term in 9234, 36789, 82684, 146919, 229494, 330409? 449664 What comes next: -23413, -23373, -23303, -23203, -23073, -22913, -22723? -22503 What is the next term in 31978767, 31978769, 31978771, 31978773, 31978775, 31978777? 31978779 What is next in -71, -90, -255, -638, -1311? -2346 What is next in -11400, -45664, -102790, -182778, -285628, -411340? -559914 What is next in -68773, -66381, -62397, -56821, -49653, -40893? -30541 What comes next: 75595, 150793, 225991? 301189 What is next in -48641, -40017, -31389, -22757? -14121 What is next in -104351, -208728, -313105, -417482, -521859, -626236? -730613 What is the next term in 13645831, 13645833, 13645835, 13645837, 13645839? 13645841 What is the next term in -1740162, -1740438, -1740714? -1740990 What is the next term in -88361, -353183, -794557, -1412483, -2206961? -3177991 What comes next: 96, -198, -1022, -2640, -5316, -9314, -14898? -22332 What comes next: 462566, 462573, 462580, 462587, 462594, 462601? 462608 What comes next: 148, 853, 1574, 2311, 3064? 3833 What is next in -16011, -16703, -17823, -19377, -21371, -23811, -26703, -30053? -33867 What is the next term in -559330, -2237327, -5033996, -8949337, -13983350, -20136035, -27407392? -35797421 What is next in -223, -473, -663, -763, -743, -573? -223 What is next in -9224658, -18449310, -27673938, -36898530, -46123074? -55347558 What is next in -1998, -2783, -3950, -5493, -7406, -9683, -12318, -15305? -18638 What is the next term in 791131, 1582538, 2373947, 3165358, 3956771, 4748186? 5539603 What comes next: -2861924, -5723865, -8585808, -11447753? -14309700 What is the next term in 3674, 7355, 11050, 14765, 18506, 22279? 26090 What is the next term in 218548, 219148, 220140, 221518, 223276? 225408 What is the next term in -2978, -12135, -27480, -49013? -76734 What is next in 502, 465, 412, 343, 258, 157? 40 What comes next: 3099652, 3099734, 3099878, 3100090, 3100376, 3100742, 3101194, 3101738? 3102380 What is next in 3970, 3552, 2848, 1858? 582 What is the next term in 3520, 6069, 10306, 16225, 23820, 33085, 44014, 56601? 70840 What comes next: 376901, 377178, 377641, 378290, 379125, 380146? 381353 What is the next term in 927, 937, 991, 1089, 1231, 1417, 1647? 1921 What is the next term in -77160, -310692, -700604, -1246908, -1949616, -2808740? -3824292 What comes next: 1671754, 3343548, 5015352, 6687172, 8359014? 10030884 What is next in -110911, -221626,	{ "pile_set_name": "DM Mathematics" }
t: 673654925, 1347309850, 2020964775? 2694619700 What is next in 10223, 41228, 92929, 165320, 258395? 372148 What comes next: -30091, -60415, -90739, -121063, -151387? -181711 What is the next term in -39529, -156808, -352271, -625918, -977749, -1407764? -1915963 What is next in -7, 131, 197, 203, 161, 83, -19? -133 What is next in 61885937, 123771892, 185657847, 247543802? 309429757 What is next in -1458, -5409, -9360? -13311 What is next in -179909, -359555, -538941, -718067, -896933? -1075539 What is the next term in -9297075, -9297079, -9297083, -9297087? -9297091 What is next in 5595, 5333, 4891, 4269, 3467, 2485? 1323 What is the next term in 769, 3079, 9541, 22237, 43249, 74659? 118549 What comes next: 1750076, 3500119, 5250132, 7000115? 8750068 What is next in -18237502, -18237504, -18237506, -18237508, -18237510, -18237512? -18237514 What is the next term in 2462362, 4924661, 7386960? 9849259 What is next in 1264202, 5056695, 11377510, 20226653, 31604130, 45509947, 61944110, 80906625? 102397498 What comes next: 75106, 74947, 74786, 74623, 74458, 74291, 74122? 73951 What comes next: -8327656, -16655313, -24982972, -33310633, -41638296, -49965961, -58293628? -66621297 What is the next term in -66095, -132183, -198341, -264605, -331011? -397595 What comes next: 1490, 3195, 5128, 7301, 9726? 12415 What comes next: 3393101, 3393102, 3393103, 3393104? 3393105 What is next in -5038, -16790, -35466, -61072, -93614, -133098, -179530, -232916? -293262 What is the next term in 121488, 485980, 1093470, 1943958, 3037444, 4373928, 5953410? 7775890 What is next in -27833217, -27833216, -27833215, -27833214? -27833213 What comes next: -173520, -173599, -173744, -173961, -174256, -174635, -175104, -175669? -176336 What is the next term in -4656, -9670, -14790, -20022, -25372, -30846, -36450, -42190? -48072 What is the next term in 379145, 757879, 1136613? 1515347 What comes next: -1635095, -3270252, -4905409, -6540566, -8175723, -9810880? -11446037 What is next in -1331, -4159, -9999, -20369, -36787? -60771 What is next in 1501, 6485, 14805, 26473, 41501, 59901, 81685, 106865? 135453 What comes next: -704050, -704135, -704384, -704881, -705710, -706955, -708700? -711029 What is the next term in 1285, 2281, 3287, 4309, 5353, 6425, 7531? 8677 What is the next term in 8157829, 16315645, 24473461, 32631277? 40789093 What comes next: -1936209, -3872766, -5809323, -7745880, -9682437, -11618994? -13555551 What is next in -19270, -76720, -172352, -306166? -478162 What is next in -1959408, -3918744, -5878080, -7837416? -9796752 What is the next term in -195638, -1566105, -5285946, -12529847, -24472494, -42288573? -67152770 What is next in 13164, 105082, 354478, 840090, 1640656, 2834914, 4501602? 6719458 What is next in -9556, -11128, -12698, -14266? -15832 What comes next: 4509, 8894, 13273, 17646, 22013? 26374 What is next in 39978, 39739, 39500? 39261 What comes next: 347095950, 347095952, 347095954, 347095956? 347095958 What comes next: 8982055, 17964114, 26946173? 35928232 What comes next: -2700, -7430, -15322, -26382, -40616, -58030, -78630? -102422 What is next in -2270, -4241, -5908, -7271, -8330, -9085? -9536 What is next in 17068, 17098, 17116, 17122, 17116, 17098? 17068 What is the next term in 79968, 78567, 77166, 75765, 74364, 72963? 71562 What is the next term in 22827, 22452, 22077? 21702 What is the next term in 35252, 141049, 317368, 564209? 881572 What comes next: -6745398, -6745412, -6745438, -6745482, -6745550? -6745648 What is the next term in -17611, -114539, -276081, -502231, -792983, -1148331? -1568269 What is the next term in 300042, 1200187, 2700430, 4800771, 7501210, 10801747? 14702382 What is the next term in 2049, 1424, 379, -1086, -2971, -5276, -8001? -11146 What is next in 2856, 5774, 8694, 11616, 14540, 17466? 20394 What is the next term in -577, -1350, -2661, -4528, -6969? -10002 What comes next: 9199175, 9199176, 9199177? 9199178 What is next in -231, -1511, -4915, -11505, -22343, -38491, -61011, -90965? -129415 What is next in -6292, -4108, -1924? 260 What is the next term in -144938, -289858, -434776, -579698, -724630, -869578, -1014548, -1159546? -1304578 What comes next: -12606, -26093, -40456, -55701, -71834, -88861? -106788 What is next in 264, 1606, 4026, 7524, 12100, 17754, 24486? 32296 What comes next: -304915220, -304915219, -304915218? -304915217 What comes next: 41020, 41061, 41102, 41143? 41184 What comes next: 21362, 85431, 192210, 341699, 533898, 768807, 1046426? 1366755 What comes next: -6638, -7154, -8004, -9182, -10682, -12498? -14624 What comes next: -1336, -5309, -14720, -32287, -60728, -102761, -161104? -238475 What comes next: -2303574, -2303556, -2303528, -2303490? -2303442 What is the next term in 149966, 1199888, 4049688, 9599306, 18748682, 32397756? 51446468 What is next in 3147, 7343, 11539, 15735? 19931 What is next in 1269, 2404, 4293, 6936, 10333, 14484, 19389? 25048 What is next in -1088533, -2177078, -3265625, -4354174, -5442725? -6531278 What comes next: 10301, 20554, 30705, 40730, 50605, 60306, 69809, 79090? 88125 What is next in -519414, -519491, -519568, -519645, -519722, -519799? -519876 What is the next term in 90121, 90073, 89935, 89659, 89197, 88501? 87523 What is the next term in -16145037, -32290073, -48435109, -64580145, -80725181, -96870217? -113015253 What comes next: -1394678, -5578698, -12552062, -22314770? -34866822 What comes next: 61076, 122371, 183666, 244961, 306256? 367551 What is the next term in -4129, -8843, -14177, -20131, -26705, -33899, -41713? -50147 What comes next: -35994986, -35994984, -35994982, -35994980, -35994978, -35994976? -35994974 What is next in -2579, -5606, -8695, -11852, -15083? -18394 What is next in -87, -1134, -4017, -9636, -18891, -32682, -51909? -77472 What is the next term in 152155425, 304310829, 456466231, 608621631, 760777029, 912932425? 1065087819 What is next in -4082, -4130, -4182, -4232, -4274, -4302, -4310, -4292? -4242 What comes next: 36348, 72429, 108518, 144615, 180720? 216833 What is next in -5769, -23740, -54981, -100548, -161497, -238884, -333765? -447196 What is the next term in 4083074, 8166165, 12249258, 16332353, 20415450, 24498549, 28581650? 32664753 What is next in 33043, 33045, 33053, 33073, 33111? 33173 What is next in -8355952, -8355987, -8356022, -8356057? -8356092 What is next in 9477, 10518, 11557, 12594? 13629 What comes next: 107908, 107338, 106388, 105058, 103348, 101258, 98788? 95938 What comes next: 33485526, 33485528, 33485530, 33485532? 33485534 What is the next term in -51496, -101135, -150764, -200377, -249968? -299531 What comes next: 450040972, 450040975, 450040978, 450040981? 450040984 What is the next term in -3764, -1606, 552, 2710, 4868, 7026? 9184 What is next in 1144, 2510, 4102, 5920, 7964, 10234, 12730? 15452 What is the next term in -88715, -88758, -88801, -88844, -88887, -88930? -88973 What is the next term in -4405, -3942, -3479? -3016 What is next in -102517, -204917, -307317, -409717, -512117? -614517 What is next in 11265, 12481, 15759, 22131, 32629, 48285? 70131 What comes next: 11560210, 11560206, 11560200, 11560192, 11560182? 11560170 What is the next term in -1213, 2674, 9153, 18224, 29887, 44142, 60989? 80428 What comes next: -29151, -17424, 2115, 29460, 64605, 107544, 158271? 216780 What comes next: 840492, 840510, 840530, 840552, 840576? 840602 What comes next: -227123, -227193, -227263, -227333, -227403? -227473 What comes next: 530198, 530126, 530054, 529982, 529910, 529838? 529766 What is next in -68040, -68490, -69240, -70290, -71640, -73290, -75240? -77490 What is next in 35537169, 35537173, 35537179, 35537187? 35537197 What is the next term in -2782, -18195, -43908, -79927, -126258? -182907 What comes next: -145563, -291124, -436689, -582258? -727831 What is the next term in -171929989, -343859977, -515789965, -687719953, -859649941, -1031579929? -1203509917 What is the next term in 7793, 7805, 7815, 7823, 7829, 7833? 7835 What is the next term in -671, -654, -699, -806? -975 What is next in -1166, -1278, -1394, -1514? -1638 What is next in -1557060, -1557084, -1557108, -1557132, -1557156? -1557180 What is next in -3666603, -7333197, -10999799, -14666415, -18333051? -21999713 Wha	{ "pile_set_name": "DM Mathematics" }
686px wrt x? 5446p2 What is the second derivative of 36kl3v*2 + 6klv*2 - 3klv - 49kl + 3l3 + 5l*2v*2 wrt l? 216klv*2 + 18l + 10v2 Find the third derivative of 107y*4 - 2y3 - y2 + 20. 2568y - 12 What is the second derivative of -74o*4 + 115o wrt o? -888o2 What is the third derivative of -7au4x + 4au*3 - 2au2x + au2 + au + 10u4x - 278u2 + x wrt u? -168aux + 24a + 240ux Find the second derivative of 28d*3w + 17d3 - 443dw wrt d. 168dw + 102d Differentiate 200qv*3 - 7qv2 + 4v*3 + 3v wrt q. 200v3 - 7v*2 Find the second derivative of 308j*5 - 4j. 6160j3 What is the first derivative of 30f*2q*3u + 8f2q*3 + 4f*2q*2u - 7f2q*2 + fq*2 wrt u? 30f*2q*3 + 4f*2q*2 What is the derivative of -227u*2 + 332? -454u Find the second derivative of -6af*2q*4 - 51af2q - 3af*2 + af + 18aq*4 wrt q. -72af2q*2 + 216aq2 Find the first derivative of -ps*3w + 377ps*3 - 6psw - ps + 209pw - 2p wrt w. -ps3 - 6ps + 209p What is the derivative of 1177p + 930? 1177 Differentiate -583l*2 + 12843 wrt l. -1166l Differentiate 4ab*2uy - 2ab2y + 111ab*2 - 20au + ay + 7b2u - 2b2 + 2 with respect to u. 4ab2y - 20a + 7b*2 What is the third derivative of -1550j*6 + 3006j*2 + 2j? -186000j3 What is the third derivative of 831z*3 + 134z*2 - 1? 4986 What is the first derivative of 52f*2h + 2f2n2 + f2 + 5hn*3 + 2h + 26n3 wrt n? 4f*2n + 15hn*2 + 78n*2 Find the second derivative of 52bt2v*3 + 160bt2v*2x*3 - btv3 - 3bv2x - 2tv*2x*3 - 11v*3x + 13v2x*3 wrt t. 104bv3 + 320bv2x*3 Find the third derivative of -17f*5 - 12f*4 + 2f*3 + 20182f*2. -1020f*2 - 288f + 12 Find the second derivative of -7117m2s*3 - 53ms3 - ms wrt m. -14234s3 Find the second derivative of 6i*5 + 5i*4 - 2i*3 - 12i + 92 wrt i. 120i3 + 60i*2 - 12i Find the third derivative of 3ho*3 - 12ho2 - 10h - 6o4 - 11o*3 wrt o. 18h - 144o - 66 Differentiate 78fr2w*3 - fr*2w*2 - fr - 2r2w + 53r2 - rw*3 with respect to f. 78r*2w3 - r2w2 - r Find the third derivative of 6c*2f*3 - 2c*2f*2 + 8cf - 15f*5 - 11f*2 wrt f. 36c*2 - 900f*2 Differentiate 6iy + 6i + 29y - 60 with respect to y. 6i + 29 Find the third derivative of 77o3p*3z - o*3p*2 + 119op2 + 27p*3z + 39pz wrt p. 462o3z + 162z Find the second derivative of -191i*2k*2 - 17i*2z + 2ik*2z + 2i - 9k*2z - 55k2 - k wrt i. -382k*2 - 34z Find the second derivative of 206a2c*2ru3 - 2a*2c*2u*3 + 3ac2u*3 - ac*2u*2 - 26aru*2 - 5ru3 wrt a. 412c*2ru3 - 4c*2u*3 Find the second derivative of -62d*2j*2p - 2d2j2 - d2jp + 2j2p*3 - j + 23p3 + p2 wrt j. -124d2p - 4d2 + 4p*3 What is the second derivative of 157a*2 - 477a wrt a? 314 Find the third derivative of 1757g4 + 2413g*2 wrt g. 42168g What is the derivative of -y*4 + 25y*2 + 224? -4y*3 + 50y What is the second derivative of 10108p2 + 8593p wrt p? 20216 What is the second derivative of 172k3 + 71k wrt k? 1032k Find the second derivative of -35061z*2 + z - 607. -70122 Find the second derivative of 2g*3t*2 - 2g*3t - 2g3 - 29g*2t*2 - 2gt2 - 10g + 22t wrt t. 4g*3 - 58g*2 - 4g Find the second derivative of -18618r2 + 234r - 25. -37236 Find the third derivative of -b5 + b3w3 - 16b*3w - b*2w3 + w3 - 11w2 wrt b. -60b*2 + 6w*3 - 96w Find the second derivative of -o*2x - 122o2 + 339ox + 2o wrt o. -2x - 244 What is the second derivative of 3m*4 - 44m*3y*2 - 12m*3 + 7227my2 wrt m? 36m*2 - 264my2 - 72m What is the second derivative of -36p2 - 4p + 31 wrt p? -72 Find the second derivative of 4a3p*2 - 200a*3p - 2a3 + 19p*2 - p wrt p. 8a*3 + 38 Differentiate 531g*2h + 3609g2 - gh*2 wrt h. 531g*2 - 2gh Find the second derivative of 1433b*5 - 1683b. 28660b3 Find the first derivative of 8137d - 4301 wrt d. 8137 Find the third derivative of -21568j3s*3y - 16j2s - 2js*3y + 125js*2y wrt j. -129408s3y Differentiate 820c2z - 241c2 wrt z. 820c*2 What is the second derivative of 1289n*2 + 6703n? 2578 What is the derivative of 2992x - 1742? 2992 Find the third derivative of -19h*4i*2 + 31h*4i + h*3i*2 - 2448h*2i*2 wrt h. -456hi2 + 744hi + 6i*2 What is the third derivative of 101y*6 + 2y*5 + 96y*2 - 3 wrt y? 12120y*3 + 120y*2 What is the first derivative of 167sw + 2w + 12 wrt s? 167w What is the third derivative of 4281c*3 + 508c*2 wrt c? 25686 Find the first derivative of -2d*3s + 16d3 + 1946s + 104 wrt s. -2d3 + 1946 What is the second derivative of g2t*3 - 12g*2t*2 - 2g*2t - 367g2 + 41t*4 wrt t? 6g*2t - 24g2 + 492t*2 Find the third derivative of 49g*4n + 2g3n*2 - 2g*3 - 6196g2 - n2 wrt g. 1176gn + 12n2 - 12 What is the third derivative of -5a*2n*4 + 4a*2n*2 + 22a*2n - 11an4 + n4 wrt n? -120a2n - 264an + 24n Differentiate -5a*3o - a*3x - 6ax*2 + 29ox - 3x*2 - 2x with respect to a. -15a2o - 3a2x - 6x2 What is the derivative of -8l*3n + 10l3 - 2n + 7 wrt l? -24l2n + 30l2 Find the second derivative of -98a*2t*2 - 3at + 55t*2 wrt a. -196t*2 Find the third derivative of 49n*6x - 2n5x*2 + 410n*2x*2 + 2x*2 wrt n. 5880n*3x - 120n2x*2 What is the second derivative of 8il4 + il*2 + il + 2i + 27l*5 + 89l wrt l? 96il*2 + 2i + 540l3 What is the derivative of -k3p + 2k3u + 13kpu + 18p - 2u wrt u? 2k*3 + 13kp - 2 Find the first derivative of -1361k + 3962. -1361 Find the second derivative of -3p5 - 42p*4 + 177p - 2. -60p3 - 504p*2 Differentiate 122bp2t + 5b + 27p*2t + 391p2 with respect to t. 122bp2 + 27p*2 What is the second derivative of -209s*2 + 33s - 3 wrt s? -418 Find the first derivative of -35m - 131 wrt m. -35 What is the derivative of -124s*2u*4 + 1329s*2 wrt u? -496s*2u*3 Differentiate -200cm - 320c with respect to m. -200c Find the third derivative of 2kr3 + 11kr2 - k - 74r*5 - 2r*4 + 6r*2 wrt r. 12k - 4440r2 - 48r What is the third derivative of -1009z6 + 3z*5 - 2z*2 + 229z wrt z? -121080z3 + 180z*2 What is the second derivative of 1611i*2s*2 - 2i - 138s2 + 6 wrt i? 3222s*2 Find the third derivative of -24q*3s*3 + 91q*3s*2 - 3q*2s*2 + 2qs - 5s*3 - 280s*2 wrt q. -144s*3 + 546s*2 Differentiate 9a*2d - 29a2 - 2ad + d + 8219 with respect to a. 18ad - 58a - 2d What is the second derivative of -223d*2 - 212d? -446 What is the third derivative of -961i4p*3 - 2i*3m*2p*3 - 2i*2 - 2im2p*3 - 16im2p wrt i? -23064ip*3 - 12m*2p*3 Find the second derivative of -34go2 + g - 5o*4 - o wrt o. -68g - 60o2 What is the second derivative of 639a*2y*3 - 98ay3 wrt a? 1278y*3 Find the second derivative of -2106n*2 + 1651n. -4212 Find the second derivative of -25354r4 + 1651r. -304248r2 Differentiate -16413dp - 15245p with respect to d. -16413p What is the second derivative of -171p*4 - 2p + 62? -2052p2 Find the second derivative of f5 - 105f*4 - 188f wrt f. 20f3 - 1260f*2 What is the second derivative of -63p*2 - 335p wrt p? -126 Find the third derivative of -6177m3 - 17370m*2. -37062 Differentiate 156d*2m*2 - 432d*2 - 2m*2 wrt m. 312d*2m - 4m Differentiate -479vy2 + 5y*2 + 18 with respect to v. -479y*2 What is the third derivative of -1672dl6 - 2dl2 - 4dl + 44d wrt l? -200640dl*3 What is the derivative of 773g*4 + 2683? 3092g*3 Find the second derivative of 2p*3uv2 - 5p*3u + 12p2uv2 + 6pv3 - uv - 5u wrt v. 4p*3u + 24p2u + 36pv Find the third derivative of 1061v6 + 1726v*2. 127320v**3 What is the third de	{ "pile_set_name": "DM Mathematics" }
*4 + 4l*3 - 2l*2 + 1. Let r(x) = 0. Calculate x. 0, 1 Let a(v) = -3v*2 - 21v + 23. Let n(f) = f*2 + 10f - 11. Let o(p) = -2a(p) - 5n(p). Let k be o(7). Let -2/7tk - 2/7 - 4/7t = 0. Calculate t. -1 Let n(b) be the third derivative of -b8/23520 + b7/3528 + b*6/1260 + 3b*5/20 - 5b*2. Let a(l) be the third derivative of n(l). Factor a(w). -2(w - 2)(3w + 1)/7 Let o(y) = y*2 + 1. Let c(s) = -3s*2 - 2. Let d(f) = -6c(f) - 15o(f). Suppose d(l) = 0. Calculate l. -1, 1 Let j(y) be the first derivative of -y8/3920 + y7/490 - y6/168 + y5/140 - 5y*3/3 - 2. Let w(z) be the third derivative of j(z). Factor w(o). -3o(o - 2)(o - 1)*2/7 Let u be 1784/28 + 4/14. Let z = u - 190/3. Solve -4/3 - zf + 2/3f2 = 0. -1, 2 Factor 44u - 26u + 3u*2 - 42u + 21. 3(u - 7)(u - 1) Solve 1 + 459y + 35y*2 - 1 - 5y*3 - 509y = 0 for y. 0, 2, 5 Factor -2/5 - 6/5r2 - 2/5r*3 - 6/5r. -2(r + 1)3/5 Suppose -19 - 1 = -5y. Suppose -2f = 5b - 20, 2f + 2 = 4b + 4. Factor 5uy - 5u*2 + 1 - 5u*2 - u - 2u*3 + 3u*f + 4u*2. (u - 1)(u + 1)*3(3u - 1) Find l, given that 3/2l - 21/4l2 + 21/4l*4 + 0 - 3/2l3 = 0. -1, 0, 2/7, 1 Let j(o) be the first derivative of -o4/6 + 10o3/9 - 8o*2/3 + 8o/3 - 16. Determine d, given that j(d) = 0. 1, 2 Let p(f) = f*3 - 3f*2 + 2f - 4. Let w be p(3). Suppose -3s + 3n - 5 = -w, -2s + 4n - 8 = 0. Let -i*3 - 3/2i*s + 0 + i + 3/2i*4 = 0. What is i? -1, 0, 2/3, 1 Let a = 1542 + -1540. Solve 32/13n*a + 2/13 - 16/13n = 0. 1/4 Let f be 11/14 + -2 + 84/49. Factor fy + 0 + 1/2y*2. y(y + 1)/2 Let g = -15 - -15. Let a(n) be the third derivative of gn - 2n*2 + 0n*3 - 1/240n*5 + 0 - 1/48n*4. Factor a(t). -t(t + 2)/4 Let r(n) be the second derivative of -n10/60480 - n9/30240 + n8/13440 + n7/5040 - n*4/6 + 3n. Let s(q) be the third derivative of r(q). Factor s(o). -o*2(o - 1)(o + 1)2/2 Let l(z) = z3 + 4z*2 - 5z + 2. Let a be l(-5). Factor 4 - 4 - at + t - t2. -t(t + 1) Let u(q) be the third derivative of -q*6/40 + 3q*5/20 - 3q4/8 + q3/2 + 5q2. Factor u(y). -3(y - 1)*3 Let d be ((-24)/5 - -4)/((-4)/10). Let 1/2 + 1/4b - 21/4b2 + db*3 + 7b*4 = 0. Calculate b. -1, -2/7, 1/2 Let o = 41/15 - 272/105. Solve 0 - on*2 + 2/7n = 0. 0, 2 Factor 2/13f2 - 12/13 - 10/13f. 2(f - 6)(f + 1)/13 Let k(l) be the first derivative of -2/25l5 + 2/5l + 1/5l4 + 4 - 2/5l*2 + 0l*3. Find r, given that k(r) = 0. -1, 1 Let n(f) = -f. Let x(j) = 2j*4 - 6j*2 - 10j. Let v(i) = 12n(i) - 2x(i). Factor v(d). -4d(d - 2)(d + 1)2 Let b(n) = -5n*3 - 11n*2 - 11n - 3. Let j(d) be the second derivative of d5/20 + d4/12 + d*3/6 - 2d. Let h(g) = -b(g) - 2j(g). Factor h(v). 3(v + 1)*3 Let u be 0 - 1 - (8 - 16). Let z = 10 - u. Let -2c*2 - 5c*z - 2c*2 + 5c*2 + 4c*4 = 0. Calculate c. 0, 1/4, 1 Let m(w) = -11w*3 + 8w*2 + w - 6. Let d be (4/(-8))/(3/(-48)). Let a(l) = -7l*3 + 5l*2 + l - 4. Let u(z) = da(z) - 5m(z). Solve u(c) = 0 for c. -2, 1 Solve 1/3m + 5/3m3 + 2/3 - 8/3m*2 = 0 for m. -2/5, 1 Suppose 10g = 7g. Let y(v) be the first derivative of 2 + 0v*3 + 0v + 1/15v6 + gv*2 - 4/25v*5 + 1/10v*4. Factor y(t). 2t*3(t - 1)2/5 Let q(p) be the first derivative of -p6/3 - 6p5/5 - p4 + 4p*3/3 + 3p*2 + 2p + 7. Suppose q(v) = 0. What is v? -1, 1 Let b(z) be the third derivative of z5/15 - z4/3 - 16z3/3 + 22z*2. Factor b(t). 4(t - 4)(t + 2) Determine v, given that -19/5v*2 + 0 - 6/5v + 7/5v3 = 0. -2/7, 0, 3 Let d(c) = c2 + 209c + 1729. Let q(n) = -n*2 - 314n - 2593. Let s(t) = 8d(t) + 5q(t). Determine u, given that s(u) = 0. -17 Let b = -197 - -11821/60. Let w(z) be the third derivative of 0 + 0z3 + 0z*4 + 3z*2 - bz*5 - 1/210z*7 + 0z - 1/60z6. Let w(i) = 0. What is i? -1, 0 Let f(o) be the third derivative of o7/455 - o6/195 - 3o*5/130 + 3o*4/26 - 8o*3/39 - 4o*2 - 3. Determine x, given that f(x) = 0. -2, 1, 4/3 Factor -27/5m*3 + 0 - 21/5m*2 - 3/5m*5 - 6/5m - 3m4. -3m(m + 1)3(m + 2)/5 Suppose -t = 1 - 3. Suppose -48w + 47w = 0. Factor 2/3m - 2/3m*t + w. -2m(m - 1)/3 Let v(g) be the first derivative of g7/315 - g6/90 + g5/90 - 3g*2/2 + 2. Let q(f) be the second derivative of v(f). Suppose q(y) = 0. Calculate y. 0, 1 Let m(l) = 3l3 - l2 + 12l + 12. Let i(y) = 2y3 - y2 + 11y + 12. Let r(k) = 4i(k) - 3m(k). What is f in r(f) = 0? -2, 3 Factor 0v*2 + 4v*2 + 6v + 4 + 4v - 2v. 4(v + 1)2 Suppose 0c + 0 + c*2 + 1/2c*5 + 5/2c*3 + 2c*4 = 0. Calculate c. -2, -1, 0 What is a in -15a - 2a4 - 315a*3 - 5a*2 + 10 - 3a*4 + 330a*3 = 0? -1, 1, 2 Let x(z) be the first derivative of 3z*5/4 - 3z*4/2 - 9z*3/4 + 3z*2 + 3z + 45. Suppose x(y) = 0. What is y? -1, -2/5, 1, 2 Let x(d) be the third derivative of d6/360 - d4/24 + d*3/9 - 8d*2. Determine y so that x(y) = 0. -2, 1 Let n(b) be the second derivative of -1/15b*6 - 1/12b*4 + 6b - 1/84b7 + 0b*3 + 0 + 0b*2 - 1/8b*5. Find f such that n(f) = 0. -2, -1, 0 Let c(d) = 8d*4 + 4d*3 - 8d*2 - 9d + 5. Let u(i) = i4 + i3 - i + 1. Suppose -6 = -3p, 3a - 5p = -a - 6. Let r(o) = ac(o) - 5u(o). Factor r(x). x(x - 2)(x + 1)(3x + 2) Suppose 4b + 35 = -149. Let g = -46 - b. Suppose g - 14/13q2 + 4/13q - 4/13q3 + 14/13q*4 = 0. Calculate q. -1, 0, 2/7, 1 Find v such that -2/3v + 2/3v3 + 0 + 0v*2 = 0. -1, 0, 1 Let -2/3q*2 + 0 - q + 1/3q3 = 0. Calculate q. -1, 0, 3 Let j(z) be the third derivative of -z5/40 - z4/8 - z3/4 - 7z2. Factor j(q). -3(q + 1)*2/2 Let v = 175 + -347/2. Factor -3/2i4 + i3 + 1/2 + 1/2i5 + i2 - vi. (i - 1)*4(i + 1)/2 Let q be 4/(-10)30/(-8). Solve -qz*2 + 0z + 3/2 = 0 for z. -1, 1 Factor v + 0 - 1/5v2. -v(v - 5)/5 Suppose -18g + 20g + 2o + 6 = 0, 4o + 12 = g. Suppose 2/9j2 + g + 4/9j = 0. Calculate j. -2, 0 Let i(k) be the third derivative of k6/360 + k5/90 + k*4/72 + 5k2. Find x, given that i(x) = 0. -1, 0 Let s(c) be the second derivative of -c4/48 + c*3/2 - 9c*2/2 - 3c. Solve s(n) = 0. 6 Suppose 34 = 3j + 28. Let y(b) be the second derivative of 2b + 1/6b3 - 1/42b*7 - 1/6b*4 + 0b*5 + 0b*j + 1/15b*6 + 0. Factor y(o). -o(o - 1)*3(o + 1) Let y(p) be the third derivative of p7/105 - p6/30 + p*5/30 + 4p*2. Factor y(b). 2b*2(b - 1)*2 Solve -12/7n*2 + 0 + 0n - 2n3 + 6/7n4 = 0 for n. -2/3, 0, 3 Let w(g) = -g2 + g. Let r(z) = 3z2 - 10z - 5. Let x(q) = r(q) + 4w(q). Factor x(m). -(m + 1)(m + 5) Let b(d) = -4d4 + 8d*3 + d + 5. Let w(h) = -5h*4 + 9h*3 + 2h + 6. Let x(f) = 6b(f) - 5w(f). Determine c, given that x(c) = 0. -2, 0, 1 Let d(h) be the second derivative of -h4/36 + h3/18 + h*2 - 18h. Factor d(k). -(k - 3)(k + 2)/3 Let z(s) be the first derivative of -s6/6 + 3s5/5 - s4/2 - 2s3/3 + 3s2/2 - s - 2. Factor z(y). -(y - 1)4(y + 1) Suppose -4i + 1 = g - 11, 3g + 9 = 3i. What is t in t - 3/2t2 + 0 + 1/2t*i = 0? 0, 1, 2 Let b(a) be the second derivative of -a + 0a*4 + 1/75a*6 + 0 + 0a*2 - 1/50a*5 + 0a*3. Factor b(k). 2k*3(k - 1)/5 Suppose -15n + 233 = 158. What is i in 0i*2 + 0i + 0 + 2/11in - 2/11i*3 + 0i*4 = 0? -1, 0, 1 Suppose -a + 12 = 2a. Factor -2s2 + 3 + as + 3 - 2 - 6. -2(s - 1)2 Let z be (-3)/((-1008)/68) + (-6)/(-8). Let k(g) be the second derivative of 4/7g*2 + 0 - 3g - zg3 + 25/42g*4. Factor k(i). 2(5i - 2)2/7 Let b(g) be the third derivative of -g7/525 + g6/300 + g5/75 + 18g2. Determine m, given that b(m) = 0. -1, 0, 2 Let f(t) be the first derivative of -t6/420 + t*4/84 + 5t*2/2 + 2. Let u(i) be the second derivative of f(i). Factor u(o). -2o(o - 1)(o + 1)/7 Suppose -35 = -5j - 4u, 30 = -0j + 5j + 3u. Suppose 9 + 2a*2 - ja*2 + 0a*2 - 2a*2 + 6a = 0. Calculate a. -1, 3 Factor 2q - 1/2q2 - 2. -(q - 2)2/2 Factor -4/11a + 0 + 2/11a*3 + 2/11a*2. 2a(a - 1)(a + 2)/11 Let u be (-2)/(-2) - (-5)/(-7). Let h = 737 - 734. Factor 24/7c + 16/7 + 12/7c*2 + uc*h. 2(c + 2)**3/7 Let z(q) be the first derivative of -q	{ "pile_set_name": "DM Mathematics" }
398)/(-5929) + (-148)/407. Sort 0.05, 0, t, 0.2, -2/3. -2/3, 0, t, 0.05, 0.2 Let t = 152.97 + -0.97. Let u = 153 - t. Let x = 61 + -61.8. Sort x, u, 0 in descending order. u, 0, x Let p be (255/(-68) + 2/(-1))-4. Suppose p = -2d - d + b, 5d + 3b = -29. Put d, 4, -2 in increasing order. d, -2, 4 Let w be 3 + 93/36 - (-4)/6. Let t = w + -97/20. Put t, -3/2, -1, -1/9 in increasing order. -3/2, -1, -1/9, t Suppose 5h = -2p + 95 + 33, p = -2h + 50. Sort -11/2, h, 0.5 in decreasing order. h, 0.5, -11/2 Let a be 216/270 - ((0 - -1) + -1). Put 4, 0.45, a in descending order. 4, a, 0.45 Suppose 106 = -228q - 201 - 149. Put -1, q, -3, 45 in descending order. 45, -1, q, -3 Suppose 3i + 64 = 4n, -i + 80 = -22n + 27n. Put 0.4, -4, n, -6 in increasing order. -6, -4, 0.4, n Let w = 31 + 25. Let a = -54 + w. Let d = -0.8 + 0.7. Put a, 0.06, d in decreasing order. a, 0.06, d Let h = -734 - -5869/8. Suppose a - 5a + 20 = 0. Sort h, a, -0.3 in increasing order. h, -0.3, a Let q = -20476 - -20408. Sort -8, 0, q in decreasing order. 0, -8, q Suppose 1 = 2b - b - 4g, 4b - 25 = -5g. Suppose 2q + 3 = -3. Let l be 309/20632/(-6). Sort b, l, q in decreasing order. b, q, l Let o = 16.31 + -19.31. Put o, -5, 2, 28/3 in descending order. 28/3, 2, o, -5 Suppose 6h + 165 - 27 = 0. Let g(q) = 3q - 9. Let s be g(-4). Let c = s - h. Put c, 5, -1 in descending order. 5, c, -1 Let z = -12992/3 + 4330. Sort -1/6, 2/85, z, -0.2 in descending order. 2/85, -1/6, -0.2, z Let t(s) = -s - 2. Let j be ((-2)/(-4))/((-1)/8). Let f be t(j). Suppose m = 10, -23l + 26l + 4m - 40 = 0. Sort 3, f, l in increasing order. l, f, 3 Suppose 2t - l - 1333 = 0, -3l = 2t - 6t + 2663. Let v = -673 + t. Sort -1, 4, v, -59. -59, v, -1, 4 Suppose 28t - 23t - 35 = 5l, -4t + 4 = 4l. Let u be (-2 + 1)/(6/2). Sort -3/7, -1/5, u, l in decreasing order. -1/5, u, -3/7, l Let v = 97 - 95. Let q(k) = k2 - 4k + 6. Let i be q(v). Put i, 0.04, -0.1, 5 in decreasing order. 5, i, 0.04, -0.1 Let j = 451/5 + -90. Suppose 26o - 24 = 18o. Sort -5, -20, o, j in descending order. o, j, -5, -20 Let b = 18156 - 18116. Sort -3/2, b, -2/19. -3/2, -2/19, b Let c = 591 + -399. Let a = c - 166. Sort a, -5, -0.5, -4/3 in descending order. a, -0.5, -4/3, -5 Let a be 0 - ((-3)/(-6))/((-297)/108). Sort a, -454, 1 in decreasing order. 1, a, -454 Let h(k) = 26k3 + 19k - 8k2 - 15k*3 + 4 - 10k*3. Let w be h(5). Put -4, w, -2 in descending order. w, -2, -4 Let x = 972 + -968. Let a(m) = 4m*2 + 8m - 5. Let u be (-20)/(-6)(-72)/60. Let y be a(u). Put -2, x, y in descending order. y, x, -2 Let c be (28-2)/(-8) + -1. Suppose 4o + 12o + 16 = 0. Put o, c, -4 in decreasing order. c, o, -4 Let j = -44.6 + 40.4. Let k = 64.8 - 72. Let v = k - j. Put 0, v, -5 in increasing order. -5, v, 0 Suppose -r + 75 = 4f - 10r, 2f - 2r - 50 = 0. Sort f, 1, 47, 4 in descending order. 47, f, 4, 1 Let v be 13/2 + 35/10. Let i = -20.6 - -21. Suppose -3p - 3p = -9p. Sort i, v, p, -2. -2, p, i, v Suppose 0 = 52m + 126 + 30. Let i = -34 - -33. Sort i, -2, 1, m in descending order. 1, i, -2, m Let u = -1141 + 1136. Sort u, 5, -9, 4, -4 in increasing order. -9, u, -4, 4, 5 Let a = -17.54 - 1.76. Let i = 23.3 + a. Put i, 1/5, 11 in descending order. 11, i, 1/5 Let z = -2723 - -2476.8. Let x = z - -255. Sort 0.1, x, 1/7 in descending order. x, 1/7, 0.1 Let h = 2576471/7 + -368696. Let o = -629 - h. Sort 3, 1, o, 9 in descending order. 9, 3, 1, o Let m be 4/(-10) + (-132)/(-30). Suppose -4g = -mk + 12, -4k + 27 = k - g. Let j be (-5 - 24/(-6))/(5/(-5)). Put -1, j, k, -0.5 in ascending order. -1, -0.5, j, k Let x be (-86)/18 + 5 - 0. Sort -1.1, 7, -2/9, 0.1, x in ascending order. -1.1, -2/9, 0.1, x, 7 Suppose 4a + 7 = 35. Suppose -7 = ax + 28. Let b be 7/(28/452)-1. Put b, 2, x in increasing order. b, x, 2 Let f = 2202 - 2191. Let m = 10.92 + -11. Sort -5, m, f in decreasing order. f, m, -5 Let h(a) = -a2 - 6a - 5. Let r be h(-4). Suppose -320u + 4 = 3w - 325u, -67w + 4u = 126. Let g be ((-18)/(-5))/(3/10). Sort g, r, 4, w. w, r, 4, g Let l be (-11)/28 - 4/(-16). Let o = 2.806 - 2.706. Sort o, l, 2 in ascending order. l, o, 2 Let a be ((-82)/42 + (-82)/(-287))(-9)/3. Put -3, a, -1, 56 in ascending order. -3, -1, a, 56 Let c = -9 + 6. Let l = 1.1953 + -1.0953. Put 3, l, c in ascending order. c, l, 3 Suppose 2f - 2 + 0 = 0. Let w be 2(-45)/(-6)36. Suppose -95 = 559c - wc. Put 8, f, c, -4 in ascending order. c, -4, f, 8 Let x = 5574.6 + -5569.6. Let c = -0.5 + 0.4. Let q = 373/4 - 94. Sort q, x, c in descending order. x, c, q Let r(l) = -l3 + 6l*2 - 5l + 3. Let t be r(5). Let g(m) = 2m3 + 38m*2 + 18m - 15. Let s be g(-18). Let k = s - 305. Put t, 13, k in decreasing order. 13, k, t Suppose 5k - 31 + 11 = 0. Let z be (-54)/(-2) - (k + -5). Let d = z + -31. Put 1, d, 4 in ascending order. d, 1, 4 Let i = -0.0026 + 0.4086. Let u = -0.094 - i. Suppose 4a + 7 = -9. Sort a, u, 2/3 in increasing order. a, u, 2/3 Suppose -4b = -0b + 3r + 66, 4b = 5r - 82. Let w be b/(-5) + (-8)/20-1. Sort -7, 2, w, 1 in ascending order. -7, 1, 2, w Let u = -116/141 - -23/47. Let l be 1 + 2/(10/(-15)). Put l, 4, u, 0.1 in descending order. 4, 0.1, u, l Let g be 10 + 80/(4 + -12). Let z = 1 + 11. Let x = -7 + z. Put x, g, 2 in decreasing order. x, 2, g Let x = -0.4 + 0.4. Let t be (32 + (-2420)/75)/(4/(-6)). Sort -50, t, x in ascending order. -50, x, t Let n = -1063/18 + 119/2. Let t = -7.98 - -11.5. Let r = -0.52 + t. Sort n, 2/11, r. 2/11, n, r Let p(h) = -h - 12. Suppose -2t + 10 - 24 = 0. Let r be p(t). Sort -8, r, -4 in descending order. -4, r, -8 Let g = -1105.0545 + 0.0545. Let x = g - -1106. Let o = -7 + 33/5. Put x, o, 0.5, -2 in descending order. x, 0.5, o, -2 Let g = 22229 - 22234. Put -3, 7/3, g, -4, -0.3 in decreasing order. 7/3, -0.3, -3, -4, g Let p = -2700 - -2700.5. Put -98, -4, p, 25 in decreasing order. 25, p, -4, -98 Let o = 14429 + -14430. Sort -5, -612, o in increasing order. -612, -5, o Let i = -9 + 0. Let n = i - -4. Let b = 5435 + -5436. Sort b, n, -3 in decreasing order. b, -3, n Let u = 13643 + -13646. Sort -26, u, -4. -26, -4, u Let y be 96/117 - (5/3 - (-46 + 47)). Sort 213, 2, y in ascending order. y, 2, 213 Let v = -0.1 + -0.9. Let c = 0.04 - -0.46. Let h = -755 + 760. Sort v, -2/9, h, c. v, -2/9, c, h Let k = -167 + 95. Let m = 28875 + -202127/7. Sort k, 2/3, m in descending order. 2/3, m, k Let t = -7.275 - -7.375. Put -3, 1, -2/13, t, 0.05 in ascending order. -3, -2/13, 0.05, t, 1 Let d(t) = 0 - 1 + 2t + 0 + 3. Let l be d(-3). Let h = 371 - 5567/15. Sort h, l, -1/5 in ascending order. l, -1/5, h Let r = -0.874 - 0.026. Let p = 2.9 + r. Let g = -1/7 - 4/21. Put p, g, -2/13, -2 in ascending order. -2, g, -2/13, p Let b = -0.1051 - 261.3949. Let i = 262 + b. Sort 0, -9, 3/2, i in ascending order. -9, 0, i, 3/2 Suppose 0 = 2l + 8, -5l = 2z - 3l + 12. Let x = -5 - 7. Suppose 2s = m - 3s + 10, -3s = -m - 6. Sort -3, z, x, m. x, -3, z, m Let i = 0.02267 + -0.01267. Put -4/3, 8, -2, i, 2 in decreasing order. 8, 2, i, -4/3, -2 Let u = -0.08289 + -4.91711. Put 1/3, -0.4, 1.1, u, -2/45 in increasing order. u, -0.4, -2/45, 1/3, 1.1 Let n = -10.9 - -10. Let v = 5.9 + n. Suppose -75g = -71g + 3y - 1, -y = 5. Put v, 3, g in descending order. v, g, 3 Let i(n) = 2n2 - 32n - 211. Let g be i(-5). Put -2, g, 2, 6 in ascending order. -2, g, 2, 6 Suppose -101q - 5q - 212 = 0. Put q, 37, 2 in decreasing order. 37, 2, q Suppose -9l - 25 = -4l. Let x = -12 - -21. Let d = x + -13. Sort l, 11, d. l, d, 11 Let p = 6 + -5.9. Let l be (-2)/14 + (-8)/(-28). Let s = -2010 - -2010. Sort p, l, 5/6, s. s, p, l, 5/6 Let l = -155 + 152. Let n = -0.2162 + 4.2162. Put l, 0.3, -2/9, n in descending order. n, 0.3, -2/9, l Let z = 643 - 642.6. Let p = -56 + 55. Put p, z, 0 in decreasing order. z, 0, p Suppose 0 = 3b + 4n - 10 + 3, -5n + 15 = 5b. Let u be (2/b)/(16/(-160)). Let a be (8(-5)/10)/(-6). Put a, u, 2, 0.5 in descending order. 2, a, 0.5, u Suppose -5x = 4f - 1 - 11, 0 = -2x - f + 6. Let v(j) = j*2 - 7j + 8. Let g be v(6). Let w be g + 0 + -2*1. Sort w, x, -1, -8 in ascending order. -8, -1, w, x Let t be (12 - (-90)/(-8)) + 30/24. Sort -220, 3, -3, 0, t. -220, -3, 0, t	{ "pile_set_name": "DM Mathematics" }
- 2s4 + 6s*3 + 2s. Factor i(w). 4w(w - 3)*2 Suppose 10p*3 - 3p*2 + 18p*4 - 24p*4 - 2p + p*2 = 0. Calculate p. -1/3, 0, 1 Let r be -11 - (-4 - -1) - 1. Let b be (r/(-9))/((-2)/(-6)). Factor -1/5i*b - 3/5i + 3/5i2 + 1/5. -(i - 1)3/5 Let p(s) = 7s*3 + 11s*2 - 5s - 8. Let t be (10/(-8))/(4/16). Let v(a) = -11a3 - 17a*2 + 8a + 12. Let b(f) = tv(f) - 8p(f). Let b(c) = 0. What is c? -2, 1 Let y(g) be the first derivative of -g4/6 + g3/3 + 2g2 - 2g + 1. Let f(n) be the first derivative of y(n). Factor f(o). -2(o - 2)(o + 1) Suppose 60/11s2 - 50/11s*3 - 18/11s + 0 = 0. What is s? 0, 3/5 Factor 1/3b2 - 1/6b*4 - 1/6 - 1/6b + 1/3b3 - 1/6b5. -(b - 1)2(b + 1)3/6 Let n(j) be the second derivative of -3j*5/5 + 32j*4/3 - 94j*3/3 + 36j*2 - 2j - 12. Factor n(b). -4(b - 9)(b - 1)(3b - 2) Let g(x) be the second derivative of x5/90 + x4/18 - x3/27 - x2/3 - x - 23. Suppose g(o) = 0. What is o? -3, -1, 1 Let p = 55 - 53. Determine o so that 2/3op - 4o + 6 = 0. 3 Suppose -59c = -48c. Solve -4/5f + 0f*3 + c + 2/5f*4 - 6/5f*2 = 0. -1, 0, 2 Let w be 4(-1 + 3)/4. Suppose -c + c + 6c4 + 5c*w + 6c*3 + 2c*5 - 3c2 = 0. What is c? -1, 0 Let v(g) be the first derivative of -g6/2 - 48g5/25 - 51g*4/20 - 6g*3/5 - 8. Suppose v(u) = 0. Calculate u. -6/5, -1, 0 Let k(m) be the third derivative of 3m*8/224 - 13m*7/140 + 19m*6/80 - 11m5/40 + m4/8 + 15m2. Let k(o) = 0. Calculate o. 0, 1/3, 1, 2 Let t(a) be the first derivative of a4 - 8a*3/3 + 2a*2 - 12. Factor t(j). 4j(j - 1)2 Let r(o) be the first derivative of 5o*6/4 - 12o*5/5 - 3o*4/2 + 5o*3 - 3o*2/4 - 3o + 39. Let r(y) = 0. What is y? -1, -2/5, 1 What is j in 9/7j4 + 0j + 0 + 3/7j3 - 6/7j*2 = 0? -1, 0, 2/3 Let j be (-28)/(-6) + (-11)/(-33). Let a(g) be the second derivative of -1/21g*3 + 0g*2 - 1/70g*j + 1/21g*4 - 2g + 0. Suppose a(t) = 0. Calculate t. 0, 1 Suppose 2a - 6 = 2. Suppose -ax - 3f = -17, 8f = 4x + 3f + 7. Suppose 4o4 + 5o - 7o + 0o*4 + 2o*3 - 2o*4 - 2o*x = 0. Calculate o. -1, 0, 1 Solve -18v*4 - 19v*2 - 26v*3 - 3v*5 - 17v*2 - 13v*3 - 12v = 0 for v. -2, -1, 0 Suppose 13 = 4w + 5. Let -35j*5 - 16j - 80jw - 48j*3 - 8 + 8 + 116j*4 = 0. What is j? -2/5, -2/7, 0, 2 Let c = -769/3 + 257. Factor 1/3z*2 - c + 1/3z. (z - 1)(z + 2)/3 Let n = 2 + -5. Let m(k) = -8 - k2 - k3 - k + 8. Let t(z) = 4z*3 + 4z*2 + 2z - 1. Let s(r) = nm(r) - t(r). Find j, given that s(j) = 0. -1, 1 Let y be 143/6 - 4/(-6). Let c = y + -24. Factor 1/2u2 - u + c. (u - 1)2/2 Let q(b) = b*4 - 5b*3 - 10b*2 + 4b + 4. Let z(m) = 6m4 - 36m*3 - 69m*2 + 27m + 27. Let d(h) = -27q(h) + 4z(h). Determine c, given that d(c) = 0. -2, -1, 0 Let d(t) be the first derivative of t6/60 - t5/10 + 5t4/24 - t3/6 + t - 3. Let g(x) be the first derivative of d(x). Factor g(o). o(o - 2)(o - 1)2/2 Let y(q) be the first derivative of q6/16 + q5/4 + 3q4/8 + q3/4 + q*2/16 + 32. Factor y(u). u(u + 1)*3(3u + 1)/8 Suppose i = -2 + 6. Suppose -q + 20 = iq. Determine r, given that 18r2 - 2 + q - 8r*3 - 10r - 2r = 0. 1/4, 1 Let c = -16675/3 + 5480. Let r = 79 + c. Determine g so that -rg + 0 + 0g2 + 2/3g3 = 0. -1, 0, 1 Let y(m) be the second derivative of -m6/180 - m5/30 - m4/12 - m*3/3 + 2m. Let s(d) be the second derivative of y(d). Factor s(h). -2(h + 1)2 Let j(n) = n3 + 2n2 - n. Let x be 1/(10/(-4) - -2). Let g be j(x). Suppose -2 - g - q2 + 7 - 2 = 0. What is q? -1, 1 Let a(h) be the first derivative of h*4/2 - 7h*3/3 + 2h*2 - 3h - 1. Let z(v) be the first derivative of a(v). Factor z(o). 2(o - 2)(3o - 1) Let w(x) be the second derivative of -x5/40 - x4/3 - 7x*3/12 + 16x. Find r, given that w(r) = 0. -7, -1, 0 Let b(d) be the first derivative of d7/210 + d6/90 - 2d3 + 1. Let z(t) be the third derivative of b(t). Find p such that z(p) = 0. -1, 0 Suppose -4b + 10 = -b - 4j, 3j = -4b + 5. Find k, given that -2/9k*3 + 0k*b + 2/9k + 0 = 0. -1, 0, 1 Let s be -2 + 0 + 1 + 6. Determine n, given that 0n3 - n5 + 2ns + n5 - 2n3 = 0. -1, 0, 1 Let f(p) be the second derivative of 0 - 4p - 1/6p4 + 0p*2 + 3/20p*5 + 1/12p*3 - 1/15p*6 + 1/84p*7. Suppose f(q) = 0. What is q? 0, 1 Let m(u) = 48u*3 + 26u*2 - 23u + 3. Let p(i) = -480i3 - 261i*2 + 231i - 30. Let z(o) = -21m(o) - 2p(o). Determine g so that z(g) = 0. -1, 1/4 Let y(r) = -5r5 + 30r*4 - 60r*3 + 34r*2. Let k(g) = -5g*5 + 30g*4 - 60g*3 + 33g*2. Let w(u) = -6k(u) + 7y(u). Let w(m) = 0. What is m? 0, 2 Let c(t) = -3t + 20. Let k be c(5). Let j(u) be the first derivative of 0u - 3 + 6u*4 - 8/3u*3 - 2u*k + 0u2. What is r in j(r) = 0? 0, 2/5, 2 Let l(h) be the first derivative of h4 + 8h3 + 24h*2 + 32h - 18. Factor l(d). 4(d + 2)3 Let u(h) = 5h*2 + 2h + 3. Suppose -2b + 5b = -2s - 2, 0 = -5b - 2s + 2. Let x(o) = o3 - 1. Let g(r) = bu(r) + 6x(r). Factor g(d). 2d(d + 1)(3d + 2) Let o(x) = x2 - 9x - 9. Let q be o(10). Let s be (2/(-8)0)/q. Let s - 1/2m*4 + 0m*3 + 0m*2 + 0m + 1/2m5 = 0. Calculate m. 0, 1 Let r be (-35)/(-14)(-4)/(-5). Suppose -9b2 + 6b*3 + 3b*r - 3b*5 + 17 + 19 - 33 + 3b*4 - 3b = 0. Calculate b. -1, 1 Let q(r) be the third derivative of -1/15r5 + 1/168r*8 + 0 + 0r - 1/30r6 + 1/12r*4 - 3r*2 + 1/105r*7 + 1/3r*3. Solve q(i) = 0. -1, 1 Let t(y) be the second derivative of -1/14y*4 + 3/7y*2 + 0 - 3/14y*3 - 2y. Factor t(a). -3(a + 2)(2a - 1)/7 Factor -3/2k*3 + 0k*2 + 9/2k - 3. -3(k - 1)2(k + 2)/2 Factor 2 - 2s2 - 1/2s*3 + 1/2s. -(s - 1)(s + 1)(s + 4)/2 Let x(l) be the second derivative of -l*6/5 + 3l*5/20 + 9l*4/8 + 11l*3/8 + 3l*2/4 - 15l. Factor x(b). -3(b - 2)(2b + 1)3/4 Factor 4u*3 - 104u*2 + 55u*2 - 4u - 4 + 53u2. 4(u - 1)(u + 1)2 Suppose -4/3u*3 + 4/3u*2 - 4/3u*4 + 4/3u + 0 = 0. What is u? -1, 0, 1 Let h = -28 - -30. Let t(v) be the first derivative of 4/3v + 1/9v*3 + 2/3v*h - 1. Suppose t(x) = 0. Calculate x. -2 Let n = 2437/3065 - -3/613. Factor -n - 2/5f*3 - 2f - 8/5f2. -2(f + 1)*2(f + 2)/5 Let d = -112 + 114. Let z(f) be the first derivative of -2f3 + 1/2f*6 + 9/5f*5 + 3/2f*4 - 9/2f*d - 3 - 3f. Factor z(j). 3(j - 1)(j + 1)*4 Let m = -10 + -6. Let a = m + 18. Factor 2/7i*a + 0i + 0. 2i2/7 Let b(a) be the first derivative of a4/12 + a3/2 + 4a - 3. Let m(c) be the first derivative of b(c). Determine h, given that m(h) = 0. -3, 0 Let x = -12 + 14. Factor 5jx - 45j*3 + 49j*3 - 4j - j*2 - 4. 4(j - 1)(j + 1)2 Let z be ((-104)/65)/(-3(-2)/(-10)). Determine s so that 2/3s2 + 8/3s + z = 0. -2 Let w = -3 - -6. Factor -m + 2mw + 3m - 2m - m2. m2(2m - 1) Let y(d) be the second derivative of -11d*4/30 - 23d*3/15 - 12d*2/5 - 2d + 5. Factor y(m). -2(m + 1)(11m + 12)/5 Let k = 9 - 4. Let o(h) be the first derivative of -8/5hk + h2 - 8/3h3 + 1/3h*6 + 3h*4 + 0h + 1. Solve o(n) = 0 for n. 0, 1 Let n(z) be the first derivative of -4z5/25 - 3z*4/10 - 2z*3/15 + 4. Solve n(o) = 0. -1, -1/2, 0 Let l be ((4 + -1 + -3)/(-3))/(-1). Determine g so that -4/9g + 10/9g2 + l - 8/9g*3 + 2/9g*4 = 0. 0, 1, 2 Let q(v) be the first derivative of 4/7v*2 - 1 + 12/35v*5 + 13/14v*4 + 1/21v*6 + 8/7v*3 + 0v. Factor q(f). 2f(f + 1)*2(f + 2)2/7 Let x(j) = -j4 - j*3 + 8j*2 - 6j - 6. Let i(w) = -w*2 + w + 1. Let k(c) = -6i(c) - x(c). Let k(v) = 0. Calculate v. -2, 0, 1 Let f(a) be the second derivative of a9/6048 - a7/840 + a5/240 - a3/2 - a. Let u(w) be the second derivative of f(w). Factor u(k). k(k - 1)2(k + 1)2/2 Let h(g) = -2 + 4 - 5 - g. Let m be h(-6). Let l2 - 4 + l*m + 4 = 0. What is l? -1, 0 What is r in -2/7r + 0 - 6/7r2 - 4/7r*3 = 0? -1, -1/2, 0 Let v be (1 + (-1)/(-5))1. Let y(l) be the second derivative of 0 + vl3 + 2l - 27/20l4 - 2/5l*2. Factor y(x). -(9x - 2)*2/5 Let k be 24/827. Let y = 27 - k. Determine r, given that -1/3 + 1/3r*2 + yr = 0. -1, 1 L	{ "pile_set_name": "DM Mathematics" }
19 - 22)(14 - 14 + 5g)) to t + ng and give n. 142 Express -17p - 4 + 57p4 + 0p2 + 0 + p2 - 28p4 - 31p*4 as jp + u + wp4 + tp*2 + vp*3 and give w. -2 Express -9y*4 + 2y*2 - 1 - 5y*3 - 84y + 0y2 + 8y*4 - 6y as zy4 + iy + gy3 + j + ly*2 and give z. -1 Express (4 + 11 + 3)(-2v + v + 0v)(19v*2 - 14v*2 + 90v*2) in the form w + mv + cv3 + bv*2 and give w. 0 Express (3 + 0 - 1)(9 - 6 - 1)(-4t + 9t - 12 - 7t)(-3t + t + 0t)(-5t + 6t + 2t) in the form g + zt*2 + pt + ct3 and give c. 48 Rearrange -3z*3 + 21859z*2 + 2 + 207z - 21860z2 + 2z*3 - 2z*4 - 2z*3 to q + xz + cz3 + sz*4 + fz*2 and give x. 207 Rearrange -6792b*3 + 19 + 5b + 3389b3 + 3409b*3 to sb*2 + fb + c + lb3 and give c. 19 Express 43077 - 1820q - 21538 - 21539 in the form uq + g and give u. -1820 Rearrange (v - 3v + 3v)(8553 - 8553 - 5974v2) to the form j + yv*3 + cv*2 + nv and give y. -5974 Rearrange (-79y3 - 35y*4 + 79y*3)(-3 - 21 + 3)(12 - 11 - 6) to the form m + gy + uy3 + ny*4 + oy*2 and give n. -3675 Rearrange 8 - 20 + 2036l - 1 + 1 + 11 to the form x + ql and give x. -1 Express -5h - 399h3 + 50h*2 - 2h*4 + 3h*2 + 4h*4 - 54h*2 as fh*4 + kh + mh3 + vh*2 + d and give f. 2 Rearrange (-5 - 1 - 3 + (-5 + 1 + 3)(0 + 9 - 5) + 6 + 1 + 1)(2r*2 - 2r2 - r2) to fr + a + hr*2 and give h. 5 Rearrange 7y*2 + 3657y*3 - 7324y*3 + 3648y*3 to gy*2 + vy*3 + w + oy and give v. -19 Rearrange 2t - 1244 - 61t*2 + 41t*2 + 1241 to jt + h + lt2 and give h. -3 Express 4a*2 - 4a*3 - 25401a + 5a3 + 33 + 25403a as ba + xa*2 + g + za*3 and give x. 4 Rearrange -16m*3 - 2m + 2 + 21m2 + 5m*4 - 16m*3 - 18m*2 + 10m*3 to wm*2 + km*4 + fm + u + hm3 and give w. 3 Express 22i - 14i - 9i + 17i2 + 31i*2 in the form mi + o + vi2 and give m. -1 Express -31u*2 - 75u*2 - 2u*2 + 2 + (7 + 35u - 7)(0u - 2u + u) as yu + mu2 + k and give k. 2 Rearrange -3d - 3 - d - 13629d3 + 13628d*3 + 49d*2 + 2d to zd2 + t + kd*3 + gd and give z. 49 Rearrange o*3 + 0 + 0 + (0 + 0 + 2o)(4 - o2 - 4) + 19 + 32o*3 + 7o*3 - 22 to io*3 + q + ho*2 + no and give i. 38 Rearrange (7l4 + 8l*4 - 3l*4)(255 - 28 - 221 + 490 + 505) to the form ul3 + bl*4 + zl + ml2 + g and give b. 12012 Rearrange (18u - 6u - 10u)(9 - 9 + 5) - 3u + 5u + 0u to the form b + nu and give b. 0 Rearrange -557h*2 + h + 982h*2 + 1081h*2 + 1232h*2 to uh + z + bh2 and give b. 2738 Express 5d - 2d - 10d + (-3d - d + 5d)(1 + 1 - 1) + 3 - d - 3 + (81 - 63 + 134)(0 + 3 - 2)(-4 + 4 - 3d) in the form wd + i and give w. -463 Rearrange (7n - 3n + 9n)(177n - 19n2 - 177n) + 37n3 + 3887n - 3887n to fn + sn2 + l + an*3 and give a. -210 Rearrange 87 + 11j + 49 - 8j + 7 + j2 to the form p + fj + hj2 and give f. 3 Rearrange -81p + 14p3 + 0p - 7p2 + 30p - 15p3 to the form fp*2 + cp*3 + o + bp and give b. -51 Express 15t2 - 5t*2 + 23t*2 + (-t + 0t - 4t)(-20 + 20 + 2t) + 4t - 4t + 2t*2 as nt*2 + mt + l and give n. 25 Express 3143 + 124u3 + 22u*4 + 3139 + u - 6282 - 43u*3 as j + hu*3 + ku*2 + wu + su4 and give s. 22 Rearrange 35o + 10o4 - 14o*4 - 40o4 + o4 - 25o4 - 3o*2 to the form lo*3 + qo*4 + mo*2 + do + v and give q. -68 Express (-4 - 5 - 9)(-114w*4 - 235w*4 - 304w*4) as pw + m + tw3 + vw*2 + sw*4 and give s. 11754 Rearrange (10g*2 - 9g*2 + 0g*2)(26g + 107g + 155g - 40g - 1) to the form xg2 + kg*3 + jg + d and give x. -1 Express -447i2 + 64 - 64 - 404i*2 as hi*2 + c + oi and give h. -851 Express 0u - 5u - 64 + 2u3 - 54u*4 + 65 + 53u*4 + 7u - 642u2 in the form xu*4 + tu + cu3 + v + nu*2 and give v. 1 Express 115q*2 + 179q*2 - 24q*2 + (3q + 2q - 6q)(-2q - q - q) + (-3q + 3q + q*2)(2 + 1 - 1) in the form jq2 + lq + g and give j. 276 Rearrange 2x4 + 6x*2 + 1507x*3 + 12 - 5x*2 - 1503x*3 to the form sx*2 + jx + mx4 + a + yx*3 and give s. 1 Rearrange (-65x - 52x - 123x)(-43x + 20x + 27x + 1) to tx + cx*2 + k and give t. -240 Express -2z*4 + z + 10z*2 + 36712 + 3z*4 - 36713 in the form bz*4 + jz*2 + tz*3 + oz + n and give j. 10 Rearrange -a + 0a + 3a + (-3 + 1 + 1)(0a + 4a - 6a) + 2a - 9a - 24a + 62a + 24a + 80a to the form h + la and give l. 139 Express -5873771 - 10944i*2 + 5873771 as wi*2 + oi + r and give r. 0 Rearrange -5168k - 7589k + 6229k to ok + x and give o. -6528 Rearrange (-862h2 + 4048h*2 + 2352h*2)(-4 + 3 + 3) to the form jh + oh*2 + a and give o. 11076 Express -7k*2 - 47 + 9k*3 - 20 - 140k*3 - 30 + 128k*3 as z + pk + fk2 + lk3 and give f. -7 Rearrange -t2 + 0t2 + 12t*2 + (-2t + 6t - 3t)(199 - 83t - 199) to mt + vt*2 + h and give h. 0 Rearrange 2858z2 - z4 - 1 - 2 - z*3 + 14z - 2857z2 to the form uz*2 + xz*4 + iz + g + pz3 and give i. 14 Rearrange (27 - 83o + 40 + 13o - 34)(-15 + 7 + 4) to qo + k and give q. 280 Express -4i*2 + 2328i - 2 - 4648i + 2318i + 2i2 + 634i*3 as bi*3 + vi + m + hi2 and give v. -2 Express 53 - 4o + 380 - 896 in the form vo + u and give u. -463 Express 22 - 106 - 2m - 4 as gm + o and give g. -2 Express -o + 31 + 0o - 88o2 + 173o*2 + 0o - 87o2 + 13o4 + o3 in the form ko + jo*3 + xo*2 + ho*4 + l and give l. 31 Rearrange -4b*3 - 4b*3 + 5b*3 + 3b*3 - 5b*3 + 4b3 + (-b3 - 2 + 2)(-553 + 1612 + 238) to wb + nb2 + z + ab*3 and give n. 0 Rearrange -11828d + 11619d2 + 11828d to the form vd2 + i + kd and give v. 11619 Express -347171b + 2b*3 + 347171b + 2b4 + 1084b*2 in the form v + sb*2 + lb*4 + yb + pb3 and give s. 1084 Express -40j*2 + 17j*3 - 12j*4 + 39j*2 - 92j + 91j in the form wj*4 + aj + ij3 + x + tj*2 and give i. 17 Express 253v*3 + v + 249v*3 - 453 - 500v*3 + v as bv + fv3 + o + sv*2 and give f. 2 Rearrange -1367k*2 - 3k - 42k - 282k*2 + 46k - 5k to the form pk + ak2 + g and give a. -1649 Rearrange -3380 + 6764 + 7135o - 3384 + 21812o to the form no + v and give n. 28947 Rearrange 5 + 2f + 0f*2 - 4 - 4f*2 + 180f3 + f2 - 178f3 to the form vf*3 + df*2 + xf + r and give d. -3 Express 1652 + 2r + 885 + 2566 - 1277 - 3r as xr + v and give v. 3826 Express -3z2 - z2 - 2696 - 478 - 329 - z*2 in the form xz + r + vz2 and give v. -5 Rearrange (-21y*2 - 77y*2 - 21y*2)(14 - 17 - 4 - 23y) to gy + cy2 + p + dy*3 and give d. 2737 Rearrange 6w*3 + 4w*3 - 3w*3 + (9w*3 + 31w*3 - 4w*3)(-1 + 3 - 1) to the form jw2 + o + aw + uw3 and give u. 43 Express 208 + 2026m - 409 + 201 as pm + s and give p. 2026 Express -922806n*4 + 78n*2 + 922804n*4 + 3n*3 + 81n*3 as gn*4 + an*3 + un + sn2 + i and give a. 84 Rearrange -147b - 1289b + 235b to the form a + xb and give x. -1201 Express (-m2 - 2m*2 + 5m*2 - m)(-3m + 2418 - 2418) + (52m*2 + 49m*2 - 118m*2)(m - 2 + 0 - 1) in the form im + q + ym*2 + bm*3 and give b. -23 Express 28b - 154 - 122b + 158 - 158b - 300b as lb + q and give q. 4 Rearrange 14u3 - 82503u*2 + 2u + 0 + 0 - u*4 - 12u*3 + 82175u*2 to the form d + ru*4 + tu*2 + hu + ku3 and give r. -1 Express 2m - 69m3 - 2m4 + 72 - 65 + m2 + 0m in the form lm*4 + pm*3 + bm + rm2 + h and give p. -69 Rearrange -3 + 3r*4 + 3 + (-49r + 3r - 56r)(r3 - 4r*3 + 6r*3) to xr*3 + a + wr*4 + cr*2 + qr and give w. -303 Rearrange 22a - 1 + 2 - 1 + a - 3a + 0a + (-2 - 1 - 4)(2a - 7a + 3a) + (0a - a - a)(1 - 1 + 3) to the form z + sa and give s. 28 Express (0 + 0 + 3j)(166 + 126j2 - 115 - 3j - 46) in the form nj3 + h + qj + xj2 and give q. 15 Rearrange (0y*3 + 0y*3 - 6y*4)(11 + 5 - 7)(0 + 0 + 3)(-20 + 5 - 13) to my4 + ny + oy2 + k + py*3 and give m. 4536 Rearrange 11q*2 + 1 + 2q*3 + 16q*2 - 25q2 - q2 - 2q + 17q*2 to the form aq**3 + l	{ "pile_set_name": "DM Mathematics" }
) = 2i2 - 19i + 4. Let o be y(9). Let n(d) = -3d + 4. Calculate op(k) + 2n(k). 4k - 2 Let i(z) = 13z - 1. Let l(m) = 11m - 1. Determine 3i(w) - 4l(w). -5w + 1 Let s(r) = -4r + 4. Let q(g) = -2g - 3. Let j(n) = n + 1. Let t(h) = 5j(h) + 2q(h). Let f be (-32)/5 - 6/(-15). Determine ft(b) - 2s(b). 2b - 2 Let s(y) = y - 10y2 + 19y*2 - 3y - 3y2. Let p(j) = -7j*2 + 3j. What is 2p(i) + 3s(i)? 4i2 Let o(r) = -18. Let d(f) = f - 20. Calculate -2d(m) + 3o(m). -2m - 14 Let l(t) = 8t2 - 106t + 13. Let k(b) = -2b2 + 26b - 3. Calculate -9k(j) - 2l(j). 2j2 - 22j + 1 Let h(d) = 14d + 2 - 18d - d. Suppose -3y = -3 - 3. Let i(m) = 16m - 6. What is yi(n) + 7h(n)? -3n + 2 Let a(h) = -3h*3 + 9h*2 + 2h - 7. Let v(z) be the third derivative of z6/120 - z5/12 - z*4/24 + 2z*3/3 + 149z*2 - z. What is -4a(d) - 7v(d)? 5d3 - d2 - d Let b(l) = -l*3 - 2l*2 + 4l - 2. Let n(m) = -m*3 + m - 1. Let k = -242 + 244. Determine kn(o) - b(o). -o*3 + 2o*2 - 2o Suppose 2x = -4m + 6, -x - 9 = -5m + m. Let t(l) = l + 16 - 16. Let q(p) = 2p - 70. Let h(r) = -r + 29. Let f(k) = -12h(k) - 5q(k). Give xf(g) + 4t(g). 2g - 2 Let d(y) = -3. Let z(g) = 170g - 14. What is 5d(t) - z(t)? -170t - 1 Let d(p) = 60p3 - 27p2 - 27. Let j(i) = i3 - i*2 - 1. Determine -2d(n) + 54j(n). -66n3 Let p(r) be the third derivative of -r4/3 - r*3/3 - 1829r*2. Let b(n) = -6n. Let s(g) = 7g. Let a(k) = -6b(k) - 5s(k). Calculate -5a(c) - p(c). 3c + 2 Suppose 0 = 2t - 6 + 2. Suppose -3o - 2184 = -15o. Let y(x) = 183x + 0 - ox - 1. Let z(p) = 1. Determine ty(k) + z(k). 2k - 1 Let h(t) = -373t2 + 39t - 3. Let l(a) = -371135a2 + 38792a - 2984. Determine -2984h(b) + 3l(b). -373b2 Let r(k) = -12k + 4. Let b(j) = 36j - 12. Give -3b(p) - 8r(p). -12p + 4 Let o(q) = -15q - 13. Let u = -11 - -18. Let b(w) = 1 - 4 - 3 - uw + 0. Let n = 36 + -23. What is nb(s) - 6o(s)? -s Let b = 66 - 62. Let n(c) = -2c2 + 5c + 3. Let x(j) be the second derivative of j3/6 + j2/2 + 5j. Give bx(r) - n(r). 2r2 - r + 1 Let q be (6/7)/(3/(-21)). Let j(n) be the second derivative of -n3/3 + 317n. Let s(l) = 0l + l + l. What is qs(z) - 5j(z)? -2z Let n(l) = -l*2 - 4l + 1. Let x(r) = 12r2 + 21r - 2. What is 6n(y) + x(y)? 6y*2 - 3y + 4 Let w(m) = 3m3 + 4m2 - m + 31. Let q(s) = s3 + 2s2 + s. Give -2q(l) + w(l). l*3 - 3l + 31 Let h(u) = 10u2 + 4u - 1. Let x(i) = -9i2 - 4i + 1. Calculate -5h(n) - 6x(n). 4n2 + 4n - 1 Let x(g) = 41497g2 - 850g - 85. Let l(d) = 1482d2 - 30d - 3. What is 85l(r) - 3x(r)? 1479r2 Let i(q) = q2 - 1. Let z(m) = 2m*3 - 7m*2 + 7. Let k be -2 - (1/(-1 - -2) + -4). What is kz(x) + 5i(x)? 2x*3 - 2x2 + 2 Let z(v) = v3 + v + 1. Suppose -3w + 6w - 9 = -5q, -q = 0. Let b(x) = -x3 - x2 - 3x - 3. Determine wz(a) + b(a). 2a3 - a2 Let g(r) = -2r3 + 2r*2 - 9r + 8. Let o be g(1). Let a(i) = -i*2 + 4i*3 + 0i*2 - 5i*3. Let s(m) = -3m*3 - 6m*2. Determine os(y) + 6a(y). -3y*3 Let w(n) = 4n - 3. Let u(m) = 2m - 2. Let h = -721 + 727. What is hw(q) - 11u(q)? 2q + 4 Let d(s) = -s. Let b = -618 + 619. Let x(z) = -z - 1. What is bx(k) - 3d(k)? 2k - 1 Let y(c) = 7c*2 + 4c - 13. Let x(l) = -26l2 - 6l + 21. Let k(n) = 8n2 + 2n - 7. Let f(a) = 7k(a) + 2x(a). Give 5f(v) - 3y(v). -v*2 - 2v + 4 Let d(q) = 1102q3 - 3. Let p(t) = -t3 - 1. What is d(f) - 3p(f)? 1105f3 Let l(q) = 5q*2 + 6q - 1. Let n(t) = t*2 - 2t. Determine -l(m) - 3n(m). -8m*2 + 1 Suppose -11o + 162 = -2o. Let c(z) = 32 - 18 + z - o. Let t(b) = b - 7. Let r(k) = -2k + 15. Let f(v) = -4r(v) - 9t(v). Calculate 5c(i) + 7f(i). -2i + 1 Let i(r) = 9r + 2r + 2880 - 4r - 2872. Let l(h) = 6h + 7. What is 5i(a) - 6l(a)? -a - 2 Let v(b) = 105b*3 + 20b2. Let h(t) = -t3 + t*2. Give -100h(o) + 5v(o). 625o*3 Let z(m) be the first derivative of -1/3m*3 - 12 + 5/2m*2 - 5m. Let n(o) = -o + 1. Calculate 15n(i) + 3z(i). -3i2 Let v(f) = 4f - 5f + 2f. Let o(j) = 6j - 25. Let c(w) = -5w + 20. Let u(n) = 5c(n) + 4o(n). What is 2u(p) + 6v(p)? 4p Let k(j) = 104 + 116 - 330 + 109. Let i be 2/9 + 28/36. Let x(r) = 2r*2 + r - 1. Let c = -12 + 8. Give ck(g) + ix(g). 2g*2 + g + 3 Let i(x) = -3x + 3. Let v(w) = 4w - 4. Let c(h) = -7i(h) - 5v(h). Let l(s) = 6s - 6s - 6 + 5s + 1 + s. Determine 11c(b) - 2l(b). -b - 1 Let k(r) = r*2 + 1. Let s(u) = -89u3 - u2 + 2u - 2. What is 2k(t) + s(t)? -89t3 + t2 + 2t Let m(w) = -31w2 + 9w*2 + 24w2. Let k(q) = -q2 + q + 1. Give k(g) + m(g). g*2 + g + 1 Let l(k) = -3k*3 - 4k2 - 109. Let q(o) = -o3 - o*2. Determine -l(p) + 4q(p). -p*3 + 109 Let j(c) = -111c - 2. Let z(d) = 2d + 1. Give j(k) + 3z(k). -105k + 1 Let r(j) = -6j*3 + 12j*2 - 8j - 8. Let b be (-27)/3 + 6 + 8/1. Let k(d) = 4d3 - 8d*2 + 5d + 5. What is br(p) + 8k(p)? 2p3 - 4p*2 Let j(h) = -6152h + 0 + 6153h - 4. Let d(t) = 3t + 9. Let x(q) = q + 4. Let v(s) = -2d(s) + 5x(s). Calculate -3j(c) - 5v(c). 2c + 2 Suppose q + 5 = -0. Let y(r) = 8r*3 - 2r*2 - 4r - 6. Let d(k) = 5 - 3k + 10k - 8k3 - 2k*3 + 2k*2 - 4k + 3k3. Calculate qy(w) - 6d(w). 2w*3 - 2w*2 + 2w Let i(g) be the second derivative of g*3/2 + 3g*2 - 16g. Let o(d) be the second derivative of -d*2/2 - 3d. What is i(h) + 5o(h)? 3h + 1 Let b = 339 - 284. Let l(u) = -242u3 - 55u*2 - 55u - 55. Let j(z) = -9z3 - 2z*2 - 2z - 2. What is bj(t) - 2l(t)? -11t3 Let b(z) = z3 - z2 + z. Let n(c) = -c3 - 9c*2 + 6c - 3. Let l(a) = 2a3 + 25a*2 - 17a + 8. Let u(t) = 3l(t) + 8n(t). Calculate -8b(o) - 3u(o). -2o3 - o2 + o Let b(g) = 133g + 56. Let t(u) = 7u + 3. Suppose 112 = 3c + 4a - 68, 68 = c + 4a. What is ct(z) - 3b(z)? -7z Let h(n) be the first derivative of 3n*2 + 2. Let f(r) = 5r + 2r - 2r - 8r + 4r. Determine f(i) - h(i). -5i Let i(n) = -38 + 18 - n - 5n*2 + 24. Let l(v) = -6v*2 - v + 5. Calculate -5i(s) + 4l(s). s2 + s Let g(w) = -2w*2 - 2w - 1. Let q(b) = 2b2 - 8b - 6. Calculate g(s) - q(s). -4s2 + 6s + 5 Let k(t) = -26t + 10. Let j(y) = 5y + 1. Calculate -6j(o) + k(o). -56o + 4 Let x(j) = 306j2 + 153j + 153. Let m(y) = -y*2 - y - 1. Calculate 765m(s) + 5x(s). 765s*2 Let c(m) = 13m + 12. Let g(b) = 16b + 11. What is -4c(w) + 5g(w)? 28w + 7 Let q(u) = -28u - 208. Let y(t) = -13t - 104. What is 6q(l) - 13y(l)? l + 104 Let n(l) = 64l2 + 6l + 5. Let g(q) = 64q2 + 7q + 7. Determine 3g(w) - 4n(w). -64w2 - 3w + 1 Let o(z) = -11z2 - 37z - 70. Let g(w) = -2w2 - 9w - 17. Give -9g(i) + 2o(i). -4i2 + 7i + 13 Let d(g) be the second derivative of -g3/6 - g2/2 + g. Let c(o) = 6o + 3. Let u = -32389 - -32391. Give ud(j) + c(j). 4j + 1 Let h(u) = -9u*3 - 15u2 - u + 1. Let s(k) = k3 - 2k2 + k - 1. Give -h(f) - s(f). 8f*3 + 17f*2 Let l(p) = -9p + 2. Let u(c) = -20c + 7. Let m(y) = -y + 2. Let f(o) = -m(o) + u(o). Determine 4f(x) - 9l(x). 5x + 2 Let c(q) = -q*3 + q + 1. Let d(m) = 68m3 - m2 + 4m + 4. Give -4c(k) + d(k). 72k3 - k2 Suppose 4f + 7f = 22. Suppose 6a + 52 = fa. Let x(y) = y + 2y + 8 - 2y. Let c(i) = -2i - 17. Calculate ax(n) - 6c(n). -n - 2 Let l(x) = x*3 - x - 1. Let t(w) = -6w3 - w2 + 5. Give -2l(c) - t(c). 4c3 + c2 + 2c - 3 Let f(z) = -4z2. Let d be 3 + -6 + (1 - -1). Let p = -10 + 12. Let a(w) = -10 - wp + 10. What is df(y) + 3a(y)? y*2 Let d(b) = -37b + 3. Let f(l) = 10l - 1. What is -6d(j) - 22f(j)? 2j + 4 Let o(w) = 495w + 95. Let k(g) = 124g + 23. Determine -25k(u) + 6o(u). -130u - 5 Let i(a) = 13a*2 + 13a + 9. Let y be (-23)/4 - (-73 + 67). Let x(m) be the second derivative of -m*2 - ym*4 + m + 0 - 1/2m*3. Determine 2i(v) + 9x(v). -v2 - v Let x(u) = 242u + 55. Let o(w) = 232w + 21. Let h(j) = -43j - 4. Let c(z) = 11h(z) + 2o(z). Determine 55c(g) + 2x(g). -11g Let k(r) = 2r*3 + r + 8. Let n(i) = 1. Suppose -90q + 242 + 208 = 0. What is qn(z) - k(z)? -2z*3 - z - 3 Let z(t) = 1. Let s(b) = -4	{ "pile_set_name": "DM Mathematics" }
Let z = 106 - s. What is the highest common factor of z and 30? 6 Let d(f) = f*2 - 6f - 5. Let n be d(7). Let s = 22 - 20. Calculate the highest common divisor of s and n. 2 Let o = 4 + -4. Suppose o = n + 2. Let v be (-69)/(((-4)/n)/(-2)). What is the highest common factor of 23 and v? 23 Let f(p) = -p2 + p - 1. Let j(r) = r3 - r*2 - 2r + 2. Let g(l) = -6f(l) - j(l). Let b be g(4). What is the greatest common factor of 24 and b? 12 Let w = 1151 - 821. What is the highest common factor of 66 and w? 66 Let k = 14 + 18. Let d = -1772 - -1804. What is the greatest common factor of k and d? 32 Suppose 683 = 27m - 721. Calculate the highest common factor of 65 and m. 13 Suppose 875o - 854o - 231 = 0. Calculate the highest common factor of 16 and o. 1 Let d(n) = 39n - 368. Let q be d(10). Let p = 0 + 2. Calculate the highest common divisor of p and q. 2 Suppose -4 = 3b - 10. Suppose -2m - 38 = -4l, bm + m = -3. What is the greatest common factor of l and 72? 9 Let p(a) = a3 + 15a*2 + a + 15. Let g be p(-15). Let f be 60/24(g + 22). What is the highest common factor of f and 11? 11 Suppose 0 = -76w + 218 - 66. Calculate the greatest common divisor of w and 59. 1 Let t = -516 + 533. What is the highest common factor of 51 and t? 17 Let v = 183 + -8. What is the highest common factor of v and 35? 35 Suppose 0 = -5i + 2i - l + 38, -2i + 4l + 16 = 0. Suppose -i = 14j - 15j. Calculate the highest common divisor of j and 204. 12 Let t be (-1)/(33/9 - 4). Suppose 20 = 4z - 3p + p, -tz - 5p - 11 = 0. Calculate the highest common factor of 3 and z. 3 Let n(b) = -7b - 45. Let p be n(-7). Suppose -542 = 6w - 11w + q, -pq + 424 = 4w. Calculate the greatest common divisor of w and 81. 27 Let k be 39/10 + (-1)/(-10). Let j be (1 + k/(-3))-355. Suppose 0 = 6c - c - 55. What is the greatest common divisor of j and c? 11 Let u(z) = 3z - 4. Let n be u(3). Let k(f) = -f*2 + 8f - 10. Let g be k(n). Suppose j - 24 = -g. What is the greatest common factor of 152 and j? 19 Let d(u) = 18u2 - u + 1. Suppose 5k - 23 = -m, 26 = m + m + 5k. Let t be d(m). Calculate the greatest common factor of 40 and t. 40 Let w(j) be the first derivative of 6j4 - j3/3 - j*2/2 + 5. Let v be w(-1). Let a be (-16)/v - (-133)/3. What is the greatest common factor of a and 5? 5 Suppose -72 = 3f - 12f. Calculate the greatest common factor of f and 18. 2 Let r(c) = -c2 - 6c + 1. Suppose -46 = 5i - 16. Let y be r(i). Suppose -54o + 56o - 18 = 0. Calculate the highest common divisor of y and o. 1 Let j(s) = s2 - 3s - 7. Let t be j(5). Suppose -5g - 2x + 38 = -20, tg - 50 = -5x. Let p be (g/3)/(2/27). What is the highest common divisor of 5 and p? 5 Let t be (-18436)/(-242) + 4/(-22). What is the highest common factor of 19 and t? 19 Suppose 3s - 9 - 15 = -3x, 5s + 20 = 0. Let c = 21 - 18. Suppose -5g = o - 2o - 662, -co + 522 = 4g. What is the highest common divisor of g and x? 12 Let o(u) = -7u - 1. Let r be o(2). Let q = r - -27. Let i be 72/((9 + 1)/5). What is the greatest common factor of i and q? 12 Let x be (-2681)/(-35) + -63/30. Calculate the highest common divisor of 190 and x. 38 Suppose 0 = m + 2n - 0n - 26, -3m = 3n - 63. Suppose f = m + 29. Calculate the greatest common factor of f and 5. 5 Let x(y) = 12y*3 - 1 + 13y*3 + 2y + y*2 - 18y*3. Let t be x(3). Suppose 0 = -3n + 283 + t. What is the highest common divisor of 18 and n? 18 Suppose -4d + w = -310, -3d + 0d + 226 = -4w. What is the highest common factor of d and 30? 6 Suppose -2s + 15 = s. Suppose 4i = -n + 30, -3n - si = -42 - 13. Calculate the highest common factor of n and 70. 10 Let t = 52 + -28. Let i be (-80 - 0/((-4)/(-1))) + -2. Let l = -66 - i. What is the highest common divisor of l and t? 8 Suppose 5x = x + 64. Suppose -2 + x = 2q. What is the highest common factor of 35 and q? 7 Suppose -j + 8 = -7. Let s(d) = -d*3 - 8d*2 - 9d + 1. Let c be s(-7). Let g be ((-6)/c)/1-150. Calculate the greatest common divisor of j and g. 15 Let l(u) = 3u*2 + u - 2. Let d be l(1). Suppose 0z - 3z = -4j + 77, dj + 2z - 42 = 0. What is the greatest common divisor of j and 10? 10 Let f be 6(20/3 - 2). What is the greatest common factor of 4 and f? 4 Suppose z + 16i - 390 = 13i, -i = -3z + 1150. Suppose 0q + 48 = q. What is the greatest common divisor of z and q? 48 Suppose -2q + 35 = 3q. Suppose 8z - qz - 18 = 0. What is the greatest common divisor of 54 and z? 18 Let a be (-33 + 30)/((-9)/1716). Calculate the greatest common divisor of a and 44. 44 Suppose 11c = -3c + 8806. What is the highest common factor of 51 and c? 17 Let t be (-96)/(-1) - (8 + 0 - 5). What is the greatest common divisor of 124 and t? 31 Let p be (14/(-3) + 2)-33. Let o(f) = 2f2 + 14f + 22. Let a be o(0). Calculate the highest common divisor of p and a. 22 Suppose 2h - 36 = -4w, w + 0h + 2 = 5h. Suppose 24 = 9u - 6u. Calculate the greatest common divisor of u and w. 8 Let u(n) = -39n - 36. Let c be u(-3). Let r = -9 + 36. What is the greatest common divisor of r and c? 27 Let i be (-5)/12/5. Let c(m) = 4 - 4m2 - 4m*3 - m - 2 + 2m*3. Let p be c(i). Calculate the highest common divisor of 36 and p. 4 Let l(j) = 6j*2 - 32j + 142. Let i be l(4). Calculate the highest common divisor of 10 and i. 10 Suppose 0 = -3q - 4u - 6, -4q + 17 = -u - 2u. Suppose -5 = -qi - y - 6, 3y + 15 = 0. Let b be i/7-9-42. What is the highest common factor of 12 and b? 12 Suppose -72 = -22j + 19j. Let x be 460/6 - -42/j. What is the highest common factor of 11 and x? 11 Let g = 36 - -356. Calculate the greatest common divisor of g and 98. 98 Let s be (6/(-8))/(71565/5112 + -14). Calculate the greatest common factor of s and 71. 71 Suppose -3i + 52 = -5s + 3s, -50 = -5i - 4s. What is the highest common factor of i and 42? 14 Suppose 27 = 4y - 5u, -3y = u - 3 - 3. Let p be (-2)/y + (-3)/((-54)/1794). Calculate the highest common divisor of p and 11. 11 Let w = 23 - 27. Let q = w + 7. Let y be -24q(-4)/36. Calculate the highest common divisor of 88 and y. 8 Let l be 3 + (-62)/(0 + 2). Let k = 34 + l. Suppose 4y - 2 = 14. Calculate the highest common factor of y and k. 2 Let l = -15 - -35. Let a = l + -12. Let s = 21 + -13. What is the greatest common factor of a and s? 8 Suppose 8 = 4u, -5w - 3u - 29 = -165. Suppose 2k = w - 8. Calculate the highest common factor of k and 1. 1 Let q be (175/10 - 2)-8. Let u = q - -133. Calculate the greatest common divisor of 3 and u. 3 Suppose 0 = -8d + d. Suppose -5g + 30 = -5n, d = -4g - 0n - 5n + 69. Let x = -24 + 57. What is the highest common divisor of x and g? 11 Suppose 2v = -2o + 112, -4o + v - 40 + 284 = 0. What is the highest common divisor of 70 and o? 10 Let c(d) = -d*2 + 8d + 2. Let s be c(6). Let n = -33 + 33. Suppose -y - 6y + 784 = n. Calculate the highest common factor of s and y. 14 Suppose 2p - p - 6 = 0. Suppose -b + 180 = pz - z, 5b + z = 828. Suppose 5a - b = -0a. What is the highest common factor of a and 22? 11 Let y be (-18)/15 + (-2104)/(-20). What is the highest common divisor of 416 and y? 104 Let x = 1693 - 1645. What is the greatest common divisor of x and 294? 6 Let a(i) = 39i + 10. Let r be a(10). Calculate the greatest common factor of r and 50. 50 Suppose 4 = 5j - 21. Suppose 3 + 1 = -4i. Let r = j + i. Calculate the highest common divisor of r and 2. 2 Suppose 31k - 461 = 407. What is the greatest common divisor of 294 and k? 14 Let o(y) = -y*3 + 10y*2 + 29y + 3. Let z be o(12). Let s be ((-63)/15)/(3/(-15)). What is the greatest common divisor of z and s? 21 Let s be 629/6 + -12(-4)/288. Suppose -5l + 135 = -0l. Let b = l - 12. What is the highest common divisor of s and b? 15 Let t = 6 + -2. Suppose -t = -v + 3v. Let f be (-2)/(1 + v) - -18. Calculate the greatest common factor of 180 and f. 20 Let a(x) = 925x - 270. Let v be a(4). What is the highest common divisor of v and 10? 10 Let z = 223 - 11. Let x = -77 + z. Calculate the highest common divisor of x and 45. 45 Let k(w) be the third derivative of 0w - 1/24w4 - 4w*2 + 0 + 0w*3 + 89/60w**5. Let t be k(1). What is the greatest common factor of 11 and t? 11 S	{ "pile_set_name": "DM Mathematics" }
se 2r - 2 + 4 = -3i, i = -3r - 3. Suppose 5y = -0y + 125. Suppose 5l - 35 = y. Solve -d - 5q = -26 + 4, 3q - l = i for d. 2 Suppose -4c = g + 61, c = -2g + 5g - 12. Let b be 45/c - (-8 - 1). Solve 3a = 3y + 3, -2a + 2 = -2y - ba for y. -1 Let t(u) = u. Let q be t(2). Suppose 0 = j + 4f + 2, qj + 2 = j - f. Let c be 5/j12/(-15). Solve cg - g - 1 = 0, 3g + 5 = -2h for h. -4 Let a(h) = 2h + 7. Let g be a(-4). Let v = 6 + g. Suppose vx - 5q - 10 = 0, q = -5x - 9 + 31. Solve -10 = 3k - 5z, -k = 4k + xz - 8 for k. 0 Let p(s) = s3 + s2 - s + 1. Let h(z) = -2z3 - 13z*2 + 20z - 9. Let j(f) = h(f) + 3p(f). Let d be j(8). Solve -dv - 19 = u - 4, -25 = 5v for u. -5 Let o be 3 - (-1 + 16/(-2)). Let j be (-16 + o)(-2)/4. Solve -2w - 20 = jw - 2z, 5z = 3w + 22 for w. -4 Suppose -z + 5 = 0, q - 24 - 31 = -4z. Solve q = 5i + 3f, 4i - 5f + 10 - 1 = 0 for i. 4 Let f be -4(-7)/(14/8). Let s be ((-24)/f)/((-3)/(-4)). Let o(k) = -3k - 3. Let q be o(s). Solve x - 2 = -qy + 15, -5x - 15 = -5y for x. 2 Let m(u) = 2u - 18. Let l be m(10). Let o be 27/36 + 117/(-12). Let h be 0/(-4 - (o + 2)). Solve 4v - ld + 0d + 2 = h, 4v = -4d + 28 for v. 2 Suppose 5t - 9 = -z, -4t + 1 = -3t. Suppose -10 = -3q + 4x, zx - 5x - 7 = -3q. Solve 0n + 6 = -n - 5i, 4n = -qi + 12 for n. 4 Suppose -1 = -h + 3. Suppose y = -y + 58. Solve 0g = 4g + 5c - y, -hg - 11 = -3c for g. 1 Let r = -354 - -359. Solve -4l - rf - 30 = 0, 5f + 5 = l - 0f for l. -5 Let p(g) = -g*2 + 6g - 2. Let j be 5/4(5 - 1). Let n be p(j). Solve -3l + 2l + 3m + 1 = 0, 4l + nm = 4 for l. 1 Let k be (0/10)/11 - 2-2. Solve 3r = 6r, 3q + kr - 12 = 0 for q. 4 Suppose 19d - 3 = 17d - 3n, -4n = 4. Solve -dh - 5m - 15 = 0, 3h - 5m + 3m = 6 for h. 0 Suppose 2r - 125 = -3r. Suppose -4b + 3b = o + r, -3o + 2b = 50. Let c = o + 25. Solve -2z + 0z - cp - 20 = 0, -16 = 3z + 4p for z. 0 Let w(h) = -32h - 442. Let y be w(-14). Solve -t = yc - c + 7, -3t = 3c + 9 for c. -1 Let x(r) = -36r + 548. Let q be x(15). Solve -2g + 3i = 4, q = g + 3i + 1 for g. 1 Let j(n) = n3 + 8n*2 - 22n - 20. Let b be j(-10). Solve -2f - 10 = 0, -3o + 2o - 2f - 9 = b for o. 1 Let i(b) = -2b + 35. Let x be i(8). Suppose -15j + xj = 12. Let n be 3/4 + 15/12. Solve -nf = -jo + 5, -3o + 3f = -2o - 4 for o. 1 Let q(v) = -v*3 + 9v*2 + 6v - 51. Let l be q(9). Solve -r - 3t + 10 = 0, 6t - t - 10 = -lr for r. -5 Let p(t) = -2t2 + t2 - 54t + 37t - 26. Let x be p(-15). Solve -f + xh - 27 = -h, -2h + 18 = -4f for f. -2 Suppose 458 = 4r - 294. Suppose -rv = -182v - 30. Solve c = -2c - 2y - 5, 0 = vc - y + 17 for c. -3 Suppose -8 = -2w - 2w. Let f be (1 + -2)/(0 + -1). Solve -ws + 5v + 35 = 0, -f = -3s + v + 19 for s. 5 Suppose 2b + 0 = 10. Suppose -bf + f = -60. Let i be 5/(f/6) - -2. Solve 0 = 4d - n + 16, -id - d - 13 = -3n for d. -5 Let a = 70 - 40. Suppose -a = -5u - 3b + 16, -2b + 44 = 5u. Solve 3g - 2v = u, 0 = 8v - 4v - 8 for g. 4 Let g(p) = 18p + 597. Let n be g(-33). Suppose 2r - 3r - 2f - 2 = 0, -2f = 2. Solve -nv - 5 = 2t, v - 15 = -4t - r for v. -5 Let p be 0(-1 - 12/(-9)). Suppose 2f - 4f - 24 = p. Let v = f + 16. Solve -10 = 2w, -4l + l + vw = -11 for l. -3 Let y = 2 + 8. Let m(p) = p - 7. Let i be m(y). Let h(l) = -27l + 248. Let g be h(9). Solve -3u = 3c + 2c - 3, -ic = -gu + 5 for u. 1 Let r = -99 + 99. Solve r = 2p + 5w + 12, -3 = -5p + 4w + 33 for p. 4 Suppose 0t = -4t + 12. Suppose 10 = 5z - tz. Suppose -19 = x + 5g, -2x - 5 - 3 = 4g. Solve -5q = -2h - 3, -2h + h = zq - x for q. 1 Let f = 9 + -4. Suppose v - fv = 0. Suppose -5g - 20 = 0, -3z + 5g - 4 = -7z. Solve -l - r = z, r + 1 = -vr for l. -5 Let n be 2/6(-9 + -3 + 18). Solve -2p - u - n = 1, -2u = 2 for p. -1 Suppose -v + 5 = -1. Suppose 3l + 30 = -2i, -vi + 3i - 45 = -l. Let k = -13 - i. Solve -kf = 2w + 3f + 29, 15 = -3f for w. -2 Suppose -3y + 51 = -g - 4g, 3y = 2g + 24. Let o = -6 - g. Solve -3x = 5p - o, 1 = -3p - x + 2 for p. 0 Suppose 0i - 4i = -3r - 14, -2i = r - 12. Suppose 0 = p + 4, p + 4 = -0j + 3j. Suppose jg = g - 24. Solve -rf - f + 5s = -g, -5s = 15 for f. 3 Let u be (0 + 0)/(-2)(-7)/21. Let c be 18/9 - (u + -2). Solve -z + 4t + c = -6z, 2z = 3t - 20 for z. -4 Let o = 14 - 14. Let h(s) = 3s + 3. Let a be h(o). Solve 17 = -ag + q, -5q + 5 = 5g - 0q for g. -4 Suppose 4g - 2 = -3w - 3, 22 = -w + 3g. Let h be -2 + (3 - 0) + (-5 - w). Solve -3q + 27 = hf, 5q - 33 - 7 = -4f for f. 5 Let n(g) = -g3 - 4g*2 - 3g + 2. Let t be n(-3). Suppose -4k = 2y - 16, -4k + 5y - 11 + 27 = 0. Solve q = -0m - m, kq - tm + 30 = 0 for q. -5 Suppose 4o + 10 = 18. Suppose 0g + 21 = -t + 3g, -ot - 77 = g. Let l be 80/32t/(-5). Solve -2y + l = 4s - 7s, -4y - s + 8 = 0 for y. 3 Suppose -34 = -5g - 2u, 4u = 4g - 24 - 20. Solve 11j = n + 9j - g, n = -2j - 12 for n. -2 Suppose 4j + j + 25 = 0. Let i(m) = -m + 2. Let w be i(j). Suppose 4 = -0k + 2k + u, 0 = 5k - u - 17. Solve -3o + 9 = kh, 10 = 3h + 5o - w for h. -1 Suppose -205b + 214b = 18. Solve -9 = 3c + br, -3r + 2 = 2c + 8 for c. -3 Let p = 2 + -2. Suppose 2j - 3q = -q + 24, 5j = 3q + 62. Suppose -3a + j = 1. Solve -5v - 16 = w + w, p = 4w - 4v + a for w. -3 Let o(r) = r + 5. Let u(x) = 3x + 10. Let n(f) = -5o(f) + 2u(f). Let l be n(9). Suppose lq = q + 15. Solve 3z - qh + h = 17, -5z = 3h + 20 for z. -1 Let m be 0((-6)/(-18) - 0). Solve mp - 4v = 3p + 11, -4p + 2v = 22 for p. -5 Suppose 0 = -2i + 4o - 1 - 3, 0 = i + 5o + 37. Let w be i/60 + (-42)/(-10). Solve -z = 5a + 15 + 3, -21 = 3z + wa for z. -3 Suppose -11q - 4 = -37. Suppose 76 = qv + 4t, -v + 14 = -t - 9. Solve -2b = -4m - v, -4m + 1 - 21 = -b for b. 4 Let v(d) = d + 8. Let x be v(-3). Let z be (x-1)/((-4)/(-36)-3). Solve m + 4c = z, 5m + 2 - 20 = -c for m. 3 Let h be (-3 + 1)(-5 + 0). Suppose -h = -w - w. Let x(m) = m - 10. Let d be x(12). Solve -5t = da - 22, -13 = t - 3t - wa for t. 4 Suppose 5n + 10 = 0, 17d - 14d - 35 = n. Solve 0 = j + 3w + d, 11 = -3j - 4w + 6w for j. -5 Suppose 0y + 3y + 4f = -5, 0 = 3y - f - 5. Solve -4b + b - 4 = n, 5b = 4n - y for b. -1 Let c(s) = -s - 9. Let d be c(-6). Let g(b) = -b*3 - 3b*2 - b + 1. Let r be g(d). Solve -5 + 17 = rq, -v - 5q = -15 for v. 0 Let m be (1 + -10)(1 + -2). Solve 10 = -4b - b + 2x, -x - m = b for b. -4 Let u(n) = -32n - 158. Let m be u(-5). Solve -mp = -5f + p - 3, -2p - 17 = 3f for f. -3 Let a(n) = -n2 + 3n + 23. Let u be a(0). Suppose -5j - 6 + u = -b, 8 = -4b. Solve 0 = -jz - 3h + 9, z + 3z + 3h = 14 for z. 5 Let j = -1693 - -1695. Solve -4h + 2 = -jt, 2h = -h + 3t - 3 for h. 2 Suppose -5x - 4k + 2k = -15, 5x = -5k. Let f = 562 + -541. Solve -f = -5r + p, xr + p = 6p + 5 for r. 5 Let f = 14 + -10. Suppose -2a + 2q = -a - 8, fq + 12 = a. Solve -i = -3y + 11, 0i = -ay - 3i + 32 for y. 5 Let f = 2144 - 2140. Solve -3r + 15w - 15 = 16w, -5r = -fw + 25 for r. -5 Let y be 2 - 4/(-4)4/(-2). Solve -9 + 29 = 4u - 3v, u - 5v - 22 = y for u. 2 Suppose -315 = -173n + 110n. Let s(l) = l*2 + 2l - 2. Let b be s(-3). Solve -2m = -3m - b, -3j + 11 = -nm for j. 2 Let y = -29 - -65. Suppose -6 + y = 3j. Solve 0 = -c - 3p + j, 2c + c - p - 10 = 0 for c. 4 Let g be 47/4 + (-483)/276. Solve 0 = -2p + g, -3p + 0p + 27 = -3r for r. -4 Let s(u) = u - 5. Let z be s(5). Solve z = 4q + 4a - 0a + 4, -11 = -4q - a for q. 4 Suppose 12y = 4y + 32. Suppose 0 = -yt - 3c + 27, 2t + 5c - 37 = -2t. Solve 0 = r + 2r + 5k + 26, -tr + k = 2 for r. -2 Let h = 557 - 541. Solve 5l + z + 16 - 36 = 0, 4l = -4z + h for l. 4 Let r be 48/80 + 12/5. Solve 0v = -2l - 3v + 8, 4l = -rv + 4 for l. -2 Suppose -p - 3l = -5p + 25, -2l = -4p + 22. Suppose 0t = pt. Suppose 4y + u = 3u + 4, t = -y + u. Solve n - 1 = 0, -s + ys - 5n = -10 for s. -5 Let p be 8-810/(-160). Solve 5c = o + 8, pc - 3o - 14 = -6o for c. 2 Let w(z) = -z2 + 13z + 3. Let y be (3 + 15/(-6))26. Let u be w(y). Suppose 2a - ua = -4. Solve ah - 35 = 3v, 7h	{ "pile_set_name": "DM Mathematics" }
03/128 (c) 5 c What is the sixth smallest value in -95, -5, -4, -0.5, 5642, -3/2? 5642 What is the second biggest value in 9, -199, -675/14? -675/14 What is the third smallest value in 4, -5/2, -716, -0.4, -1, 1? -1 Which is the third smallest value? (a) -1626.143 (b) 1 (c) -2/7 b Which is the fifth smallest value? (a) 4 (b) -1 (c) 47 (d) 0.03 (e) -5/3 (f) -3 (g) -0.05 d What is the fifth biggest value in 2, 7/5, -304, 0.3, -1, -2/5? -1 What is the biggest value in 1/5, -119, -8, 0.1, -9, -1/5, 0? 1/5 What is the third smallest value in -22/7, 17098, -1/4? 17098 What is the fifth biggest value in -1/3, 2, 159074, -4, 7/6? -4 Which is the second smallest value? (a) -0.1 (b) 0.6 (c) -67709 (d) 35 (e) 0.2 a What is the third biggest value in 3/7, 1/2, 474/47, -58, 0.4? 3/7 Which is the fifth smallest value? (a) -129 (b) 17 (c) -0.4 (d) -3 (e) -0.3 (f) 36 (g) 8 g Which is the second biggest value? (a) 0.09 (b) 113.87 (c) 79 c What is the fourth smallest value in -4.934, -0.1, 3/2, -2, -3? -0.1 Which is the third biggest value? (a) -8620049 (b) 0.081 (c) 3 a What is the biggest value in -1/209, -1/7, -1/5, -3, -2? -1/209 Which is the second biggest value? (a) 15 (b) -2/5969 (c) 0.3 (d) 0 (e) 5/32 c Which is the fifth smallest value? (a) 9 (b) -1/5 (c) 0.2 (d) -16 (e) 0 (f) -17 c Which is the fourth smallest value? (a) -8964 (b) 2/55 (c) 0.058 (d) -1 c Which is the second smallest value? (a) 2/5 (b) -4/369 (c) 428614 a What is the fifth smallest value in -2, 3/7, 31, 8, -4, -7, 273? 8 What is the third smallest value in -0.1, 0.2, 0.063, -1/392? 0.063 What is the second biggest value in 0.4, -0.5, 33, -1/3, 1, -14, -25? 1 Which is the smallest value? (a) -509 (b) 0 (c) 526 (d) 1/6 a Which is the second biggest value? (a) -2 (b) -0.09 (c) -0.2 (d) -2/3 (e) -0.21 (f) -107474 c What is the second biggest value in -0.04, -237, 860, -2/3? -0.04 Which is the third biggest value? (a) 2 (b) -5 (c) 59511749 b What is the sixth biggest value in -2, 4/15, 509, -3, -2/3, 53? -3 Which is the smallest value? (a) -2/11 (b) 5/107241 (c) 2/45 a Which is the third biggest value? (a) 0.2 (b) 4 (c) -5/4 (d) -107.05 (e) 5 (f) 1 f What is the second smallest value in -5, -0.2, 1, 1/245, 10291, -0.1? -0.2 Which is the fourth biggest value? (a) -2/21 (b) 15 (c) 7 (d) 55 (e) 1/2 (f) -40 e What is the smallest value in 25, -1/8, -41.2, -4.2, 14? -41.2 What is the second smallest value in 5, 26, -4.8451, 1/17? 1/17 What is the third biggest value in 2/3, 2/1017, 2, -1733? 2/1017 What is the third biggest value in -0.02, 132/7, -2/145, 0, 3/4? 0 What is the smallest value in -43821, 35, 0.15? -43821 Which is the fourth biggest value? (a) 13 (b) -3/142 (c) -313 (d) 0.3 c What is the sixth smallest value in 0.133, 0, -0.4, -5, -47, -4/5, 9? 0.133 What is the sixth smallest value in 3, -0.1, -23.4, 10, 106, 2, 0.4? 10 What is the seventh biggest value in 1/10, -4/3, -2, -0.4, -144.8, 0, -1? -144.8 Which is the seventh biggest value? (a) 5/4 (b) 1/4 (c) 0.3 (d) 0 (e) -5 (f) -4 (g) 22274.1 e What is the second biggest value in 0.04, 0.2, 4, 2308? 4 Which is the fourth biggest value? (a) -5 (b) 3/10 (c) 0.12 (d) -7/17 (e) 3 d Which is the sixth biggest value? (a) -3/8 (b) -4 (c) -0.1 (d) 1 (e) 2 (f) 0.2624 (g) 0.17 a What is the biggest value in 1693, -2/3, -0.3, 51/11, -1? 1693 What is the third smallest value in -7.6798, 26, -2/19? 26 What is the second smallest value in 3, 1/2, -5, -0.4, -239, 2/9? -5 What is the biggest value in -832, 1/5, -36, -1246? 1/5 Which is the sixth smallest value? (a) 1/15174 (b) -4/7 (c) 0.5 (d) -0.5 (e) 0.2 (f) 4 f What is the fourth biggest value in -2, 4/5, -0.4, -2/1819, 1/23, -53? -0.4 Which is the fourth biggest value? (a) -0.1 (b) -5 (c) 2 (d) -2 (e) 0.11 (f) 624 (g) 0 g Which is the smallest value? (a) -4 (b) -0.09 (c) 3325 a Which is the second smallest value? (a) -2/13 (b) 1/4 (c) -23 (d) -2/143 (e) 2/3 (f) -0.4 f What is the third smallest value in -11, 0.3, 3.83, -1, 5.9, -0.4, 5? -0.4 Which is the third smallest value? (a) 183 (b) 3 (c) 4943 (d) 0.05 a What is the third smallest value in 2/3, 5950.7, 3? 5950.7 What is the fourth biggest value in -231, -76, 0, -68, -6, 2/7? -68 Which is the biggest value? (a) -193/7 (b) 3/7 (c) -7/26 (d) -0.1 b What is the second biggest value in 0.3, 0, -10, -1425, -180, -0.1? 0 What is the second biggest value in 2, 1/5, -3607863? 1/5 What is the smallest value in -2/7, 0.1, -1.16, 2/15, -0.5, -0.2, 4? -1.16 What is the third smallest value in -5, -0.21, 4/225, -3/7, 16/3? -0.21 Which is the biggest value? (a) 2 (b) -2/7 (c) -131786 (d) -67/4 a What is the fourth biggest value in 0.9, -24/271, 51, 3? -24/271 What is the third biggest value in -26.33, 33/8, -3, 0.01? -3 Which is the second biggest value? (a) 0.23 (b) -22/5 (c) -4 (d) 4 (e) -3/4 (f) -3 (g) -28 a Which is the smallest value? (a) 777/41 (b) 2/3 (c) -6 (d) -781 d What is the fifth smallest value in -0.3, -36, 563, -2/7, 4/3, 5, 328? 5 Which is the second smallest value? (a) -4 (b) -2/11 (c) 17/6 (d) -0.1 (e) -5 (f) -2125 e Which is the smallest value? (a) -3 (b) 102 (c) -0.1 (d) 111/110 (e) -3/8 a What is the third smallest value in 6/7, 3, 1/97, 1, 0.2, -0.21? 0.2 Which is the fourth smallest value? (a) 1 (b) -18202 (c) -15/8 (d) 5 d What is the biggest value in -3, 10.88, -1.8, -2/17, 7? 10.88 What is the third biggest value in 0.3, 425/4, -1.1, -2/3, -1/2? -1/2 What is the third biggest value in -7.1, -1/7, 2/13, 2/9, -57, -3? -1/7 Which is the third biggest value? (a) -14 (b) 8 (c) -3/2 (d) 2 (e) 0.2 (f) -85 e What is the second smallest value in -0.7, -24691, -35? -35 Which is the second biggest value? (a) -4 (b) 20718/5 (c) -2/57 (d) -1.52 (e) 5 e What is the second biggest value in -2/13, 0.5, -5, 4, -177.4, 137, -0.5? 4 Which is the second biggest value? (a) -7.4 (b) 1/4 (c) -136/59 c Which is the fifth biggest value? (a) 17 (b) 1 (c) -5/101 (d) 5/48 (e) -2/7 (f) -0.4 (g) 0 c Which is the third biggest value? (a) -2/1191 (b) 4 (c) 25 (d) -0.8 (e) -0.2 a Which is the second biggest value? (a) 2/3 (b) -1779 (c) -1 (d) -2/15 (e) -1/59 (f) -1/2 e Which is the smallest value? (a) 0.4 (b) -1/28 (c) 108/625 b What is the third biggest value in -18, -1, -3, -2970, 3, 4, -4? -1 Which is the fourth smallest value? (a) 1/6 (b) -6/5 (c) 2 (d) 3 (e) 5 (f) 304005 (g) -7 c What is the third biggest value in 1/13, 0, -7, 2346, -0.5? 0 What is the third smallest value in 4/7, -0.119, -73, 0.02? 0.02 Which is the second biggest value? (a) -2/4183 (b) 0 (c) 16 (d) 1/15 (e) 3/2 (f) 3 (g) -3 f What is the third smallest value in -2, -368782/25, 1? 1 What is the fourth biggest value in -5, 86/15, 15, 2, -1? -1 Which is the smallest value? (a) 4/77 (b) 205425 (c) 0.2 a What is the second smallest value in 3/2, -0.0242783, -2, 1? -0.0242783 Which is the third smallest value? (a) -35053323 (b) 1/3 (c) 2/9 (d) -0.2 c What is the smallest value in 241594, -11, -0.3? -11 Which is the fourth biggest value? (a) 0.05 (b) -2/5 (c) -1/6 (d) -1/3 (e) -0.2529 (f) 29 e Which is the second biggest value? (a) -0.04703 (b) -112379 (c) -2 c What is the third smallest value in -48.626, 3, 0.1, -1.1, -4, 0.2? -1.1 Which is the biggest value? (a) -2.9 (b) -81 (c) -1 (d) 0.2 (e) -2/7 (f) -0.5 (g) 13 g What is the second biggest value in 829, 2, 4, -262? 4 Which is the second smallest value? (a) -2/9 (b) -73 (c) -1/2 (d) -1/5 c What is the second biggest value in -1/2, 0.5, 82, -1/11, 2, 2/3? 2 Which is the third smallest value? (a) 14271 (b) 459 (c) -4/5 a What is the smallest value in -5, 57.42, 0.3, 2, -21/4? -21/4 What is the third biggest value in 0.1, 586, -117, 2, 85, 1.8? 2 What is the biggest value in 0, 10, 12483628? 12483628 Which is the second biggest value? (a) -4 (b) -13166/9 (c) 13 a What is the third smallest value in 0.1, 1, -1, -2/3, -2, -0.0248, 3/1864? -2/3 Which is the fifth biggest value? (a) 16/65 (b) 108 (c) -12 (d) 0.1 (e) 14 c Which is the fourth smallest value? (a) -2 (b) -12 (c) -2/3 (d) 2/127 (e) 0.03	{ "pile_set_name": "DM Mathematics" }
? b Let m = -4 - -4.1. Let f = -0.3 + m. Are -1 and f nonequal? True Suppose -4t - t = -5. Let g be 2/(t - 7/3). Suppose 0 = -5d - 3 - 2. Which is bigger: g or d? d Let x = 0.2 + 7.3. Let o = x - -1.5. Is o != 0.2? True Let u be (-3)/(-10 - 2)4. Which is bigger: 0 or u? u Let c = -59/2 + 645/22. Which is bigger: 1 or c? 1 Let g be -1 + 4 - 0 - (-7)/(-2). Is -30 > g? False Let k(o) = o2 - 5o + 2. Let d(q) = -q*3 - 9q*2 + 4. Let r = -22 - -13. Let c be d(r). Let j be k(c). Which is bigger: j or -3? j Suppose 13z = 22z + 45. Is 10 greater than or equal to z? True Let q be 12/94/2. Which is greater: q or 3? 3 Let g = 2 - -1. Suppose 3x - 18 = -g. Let c be 2/(((-5)/2)/x). Is c less than or equal to -5? False Suppose 2x + 4 = -2. Let o = -10 + 7. Does o = x? True Suppose 0y = y - 12. Suppose 0 = v - 4k - 9, -5v - k + 2k - y = 0. Is v greater than or equal to -5/2? False Let h = -19 - -7. Are -12 and h non-equal? False Let v(c) = -c - 1. Let r be v(-1). Let d = 1247/7 + -178. Is d <= r? False Suppose 3s + 4 = 3g - 7g, g = 5s - 1. Suppose -4a - 32 = -12. Let q = a - -5. Is q smaller than s? False Let o(j) = -j3 + j + 2. Let s be o(0). Suppose 0 = -4m, 3m + 0 = -sy + 14. Is 6 bigger than y? False Let s = 56.06 + -40. Let g = s - 16. Which is bigger: -0.1 or g? g Let w(g) = -g*2 + 5g. Let m be w(5). Let n(a) = -6a + 3a*3 + 6a*2 + 2 - 4a*3 + 3. Let q be n(5). Is m bigger than q? False Let j be (-20)/(-110) + (-282)/(-22). Is 13 greater than j? False Let l be (-24267)/(-5) - (-3)/5. Let m be l/35 - (-9)/15. Let q = -139 + m. Is q at most 2? True Let b = 24 + -42. Let r be (-12)/b + 7/12. Are 0 and r equal? False Let u(t) = t + 8. Let b be u(-6). Which is greater: b or -1/3? b Let l be 0/(1(-1 - 0)). Let u = l + 1. Are u and 6/5 non-equal? True Let f = -2.88 - -3. Let s = f + 0.08. Which is bigger: s or -1? s Let l be 0(1 + ((-7)/2 - -3)). Do l and -2/135 have the same value? False Suppose 0 = 4q - 2q. Suppose 4t + 48 = 2a, 5t + 3a + 107 - 25 = 0. Let j be (12/t)/(q + 2). Which is bigger: j or 0? 0 Let h = 1.1 - 9.1. Let c = 7.96 + h. Which is smaller: 0 or c? c Let d = 0.5 + -2.5. Let y = -0.03 + 4.03. Let s = d + y. Is s less than or equal to -1? False Suppose -7x = -3x. Suppose 5f - 19 - 6 = x. Suppose 0j = -fj. Which is greater: j or 1/4? 1/4 Let o(a) = a - 3. Let i be o(3). Suppose -3 = x - ix. Let p(n) = n - 14. Let t be p(11). Do x and t have the same value? True Let f = -21 - -20.9. Is 11 smaller than f? False Suppose -3c - 14 = 22. Let y be (-40)/(-18) + c/54. Which is bigger: y or 1/2? y Let j = 82 - 82.1. Is 30 greater than j? True Let h = 3 - 2. Let n = -21/5 + 283/65. Is n at least as big as h? False Suppose -18 + 3 = -5v. Suppose vb = -12 + 3. Is b bigger than -4? True Suppose -5i = -0i - 10. Let h be (1/i)/(2/(-52)). Which is greater: h or 0? 0 Let k = -5.45 + 5.5. Are k and 0.5 unequal? True Let q(h) = h*3 + 2h*2. Let s be q(-2). Suppose 0 = -2w, -2w = 3y - sw. Let z be (-1)/(-2) + 6/(-28). Are y and z nonequal? True Let v = -7/55 + 317/330. Suppose 0 = z - 0z. Which is bigger: v or z? v Suppose 0 = 5t - 30. Let j = t + -9. Which is smaller: -4 or j? -4 Let b be (-3)/5 + 280/175. Do b and -1 have the same value? False Suppose 2n - 8 = -2. Suppose nc + 12 = -c. Which is greater: -2 or c? -2 Let d(h) = -h2 - h - 1. Let q be d(0). Do -5/11 and q have the same value? False Let f be 2((-18)/4 - -1). Let y = -5 - f. Suppose -3n = yn - 15. Which is bigger: n or -2? n Suppose -6s = -5s + 180. Let n = 3/2486 + 2247329/12430. Let w = s + n. Is w greater than or equal to 0? True Let o = 43 - 39. Let k = 6 + -3. Suppose -ob = -t + 1, -2b - 3b - 3 = -kt. Is b at least as big as 3/4? False Let y be 6/(-90)(-1 + 2) - 0. Is y >= 0.2? False Let q = 575 - 22427/39. Let c = 142/273 - q. Which is bigger: 2 or c? 2 Let u(n) = n2 - n - 5. Let y be u(-4). Let h be y/(-10)4/6. Is h greater than or equal to -4/5? False Suppose -2o + 1 + 1 = 0. Suppose 0 = -f + 2r - o - 3, -2f + r - 2 = 0. Suppose 2z - 10 = 5q, -2z + 1 = -9. Is q greater than or equal to f? True Suppose 90 = 4h - 5p, h - 8p - 28 = -4p. Let j be -1(h/(-8))/(-5). Which is bigger: j or 5? 5 Let n be 322/(-207)3(0 + -1). Is n at most 6? True Suppose 0 = -22t + 15t - 343. Do t and -47 have the same value? False Suppose -20 = -4x - 2n, -n = -2 - 2. Is x at least as big as -13? True Suppose -5a = -3z - 69, 1 = -5z - 14. Let o be 11/3 + (-8)/a. Suppose -4 = ox + 2. Does x = -1? False Let y = 11 - 38. Let v be (12/(-14))/((-165)/y). Let q = v + -8/55. Which is bigger: q or -1? q Suppose 5q = 15, -4t = -q + 55 + 264. Is -78 at most t? False Let o = -11 - -18. Let g = o - 7. Let v = g + -0.4. Is 0 < v? False Suppose 0 = 9n - 7n. Are n and 12 equal? False Let h be -25(-1)/2. Suppose -h = -2c + 3c. Let a = -4 - c. Which is greater: a or -2/7? a Let k = -45 - -46. Is k at least as big as 15? False Let a(q) = q + 1. Let g be a(-1). Suppose z = -gz + 1. Is z greater than 3? False Let w be 210(-2)/(-4). Suppose 3h + w = 2h - 2p, -4h + p = -5. Is h != 1/2? True Let o be 2(1 + 17/(-10)). Does 0 = o? False Suppose -2k - 9 - 3 = 0. Let l be (-3)/3 + k/2. Is -4 >= l? True Suppose -15 = -5t - 2q, 4t - 2q = 5t - 11. Let x = 1.57 + 0.13. Let b = -0.3 - x. Which is greater: b or t? t Let v be (4/10)/((-16)/24)5. Is v at least as big as 5? False Let u be (-51955)/119 + (-2)/7. Let m = u + 437. Which is smaller: 0 or m? 0 Let x be (-2)/(-6) + (-26)/6. Let p(h) = h*2 - 8h + 5h3 - 6h*3 + 6h*2 + 8. Let u be p(6). Are u and x equal? True Let x be (-2)/(-2)21. Suppose 4 = -xz - 2z. Is -2 equal to z? False Suppose 0 = 3c - 0c - 9. Suppose cv - 4 = v. Which is bigger: v or 3/2? v Let o(d) = 2d - 3d*2 + d + 1 + 4d*2 + 0. Let y be o(-1). Is y less than or equal to 3? True Suppose 0 = 4l - l + 66. Let m = -8 - l. Suppose 0 = -4x - 3w - 9, -3x = -8x - w - m. Is x at least as big as -4? True Let j be (-21)/28 - (-15)/(-12). Suppose -3t = 6, 2i + 3t = 5i - 3. Which is bigger: i or j? i Suppose 0 = 4a - 0a + s - 3, 0 = 4a + 4s + 12. Suppose 0 = j - 3l - 12, 0 = j + l - al - 2. Do 0.3 and j have the same value? False Suppose 3u = -29 + 83. Which is smaller: 20 or u? u Let h(y) = y2 + 2y + 1. Let u be h(-4). Let n be ((-1)/(-2))/(u/6). Is -0.3 smaller than n? True Suppose -2p + 4p = -60. Let w be (1 - -1)/(8/p). Let k = 73/10 + w. Is 1 bigger than k? True Let o be (-3 + 6)(0 + 1). Suppose -ow - g = -7w + 4, g - 10 = -3w. Suppose -wk = -7k. Is k at most as big as -1? False Let o = 0.07 + 0.96. Let s = 7 - 6.97. Let b = o - s. Which is greater: 5 or b? 5 Let c(a) = -a*2 + 1. Let x be c(1). Suppose 2l - 11 = -1. Suppose 4s + l - 1 = x. Is s at least as big as -1? True Let z = 4 - 0. Suppose z + 0 = -m. Which is smaller: -5 or m? -5 Let a(c) = 17c*2 + 3c - 3. Let b be a(-3). Do b and 142 have the same value? False Let b be ((-2)/(-8))/((-21)/(-12)). Is b != 1? True Let z(j) = 2j - 6. Let k be (-5)/(-4)(1 - -3). Let i be z(k). Let m be i/(-18)9/(-12). Which is smaller: m or 0? 0 Suppose -6c + 0c = 18. Is -3 greater than or equal to c? True Let l(k) = -2k - 5. Let o(u) = -5u - 11. Let n(d) = 9l(d) - 4o(d). Let c be n(2). Let h = 0.22 - 0.12. Is h less than c? True Let m = 20 + -20. Which is greater: m or -1/4? m Let u be 44/84 - 3/(-21). Which is bigger: u or 0? u Let i = 19042/35 + -544. Is 1 != i? True Let t be 9/(-2)8/6. Suppose 3l = 3 - 0. Let v be (4 - l)/((-63)/t). Which is smaller: v or 1? v Let u = 3 + 11. Which is smaller: 0.1 or u? 0.1 Suppose -v - 3d = -0d - 6, -2d - 21 = -v. Suppose z + z = 5r - 10, 2r + v = -3z. Which is smaller: -4 or z? z Let i = 43 + -24. Is 19 at most as big as i? True Let i = -7 + 6. Let t be ((-1 - i) + 4)/14. Let w = 0.2 - 0.2. Which is smaller: w or t? w Suppose 4d = 172 - 4. Let w be (1/(-15))/(3/d). Let t = -3/5 - w. Which is smaller: t or 1? t Let t = -68146438/2789 + 24434. Let v = -103853/153395 - t. Let a = v - -3/11. Is 1 < a? False Let v = -305 - -314.87. Let h = v - -0.23. Let c = 10 - h. Is 6/7 smaller than c? False Let j(l) = l*2 + 4l + 3. Let w be j(-3). Suppose w = -5*q + 2 + 18. Let v(x) = -x - 2	{ "pile_set_name": "DM Mathematics" }
3105o2 + 3105o*2 - 4o - 26o3. -26o*3 - 4o Collect the terms in 4y2 - 18y3 + y3 - 29 + 29 - 3y2. -17y3 + y2 Collect the terms in -3609g - 1 + 1 + 0. -3609g Collect the terms in -273a2 + 23a*3 + 88a*2 + 98a*2 + 87a*2. 23a*3 Collect the terms in 5 - 1864h + 3635h - 5 - 1757h. 14h Collect the terms in -47i + 1 + 52i - 3 + 12i + 40i. 57i - 2 Collect the terms in -86d + 2180d*2 + 156d - 70d. 2180d*2 Collect the terms in 12y*3 + 8y*3 + 12y*3 + 17y*3 + 4y*3 - 54y3. -y3 Collect the terms in 14v2 - 14v*2 + 148v*3 + 80v*3. 228v*3 Collect the terms in -187691g*2 - 187184g*2 + 374878g*2. 3g*2 Collect the terms in 7n*3 - 51n*2 - 46n*2 - 52n*2 + 139n*2. 7n*3 - 10n*2 Collect the terms in -6163o + 2845o + 3312o. -6o Collect the terms in -l - 19l*2 - 11l*2 - 14l*2 + 79l*2 - 30l*2. 5l*2 - l Collect the terms in -34j - 17j + 51j + 1304j3. 1304j*3 Collect the terms in 0i*3 + 1646957i - 1646957i + i3. i3 Collect the terms in -64w*3 - 88w*3 + 182w*3 - 49w*3. -19w*3 Collect the terms in -2r*2 - 58r*3 + 622r*3 + 600r*3. 1164r*3 - 2r*2 Collect the terms in 50 - 191 + 2x + 46 + 95. 2x Collect the terms in -51 + 51 - 5929c + 5936c. 7c Collect the terms in 61w3 + 62249w - 62249w. 61w*3 Collect the terms in 386p*2 + 106p*2 + 1114p*2. 1606p*2 Collect the terms in 9 - 10z*3 - 8z*3 + 18 + 17z3 + 11. -z3 + 38 Collect the terms in -z - 2z + 456 + 64 - 56 + 320. -3z + 784 Collect the terms in -145y + 17y*3 + 258y - 109y. 17y*3 + 4y Collect the terms in -6338397b2 + 6338397b*2 + 27b*3. 27b*3 Collect the terms in -2l - 136912 + 136912. -2l Collect the terms in 4974v + 7533 + 4975v - 9947v - 7533. 2v Collect the terms in 102k*3 - 190k*3 + 130k*3. 42k*3 Collect the terms in -151y + 675y + 351y. 875y Collect the terms in -54d*2 - 34d*3 - 23d*2 + 77d*2. -34d*3 Collect the terms in 25 + 161r + 160r - 26 - 319r + 71. 2r + 70 Collect the terms in -8h*2 + 6335 + 6323 - 12658. -8h*2 Collect the terms in 852g - 1003g - 1821g. -1972g Collect the terms in -178 - 175 + 203w*3 + 353. 203w*3 Collect the terms in 38s*3 + 1347s*3 - 1381s*3. 4s*3 Collect the terms in -13 - x + 25 + 14x - 7 - 4. 13x + 1 Collect the terms in -15h + 2351 + 20h - 627. 5h + 1724 Collect the terms in 1269m - 2532m - 11m2 + 1263m - 18m2. -29m*2 Collect the terms in 174l - 219l - 717l - 21l. -783l Collect the terms in -21h + 46h + 23h3 - 7h + 75h. 23h*3 + 93h Collect the terms in -30s2 - 14726 - s2 + 14726. -31s*2 Collect the terms in 46847m3 - m2 + m*2 - 46845m*3 - 8m*2 + 8m*2. 2m*3 Collect the terms in 18 - 4 - 12 - 1200b*2. -1200b*2 + 2 Collect the terms in -23l + 109l + 5l*3 - 86l. 5l3 Collect the terms in -172s*2 - 172s*2 - 167s*2 + 4s + 510s2 - s. -s2 + 3s Collect the terms in 45f - 66f*2 + 19f*2 - 43f - 2f. -47f*2 Collect the terms in -982d*3 + 1113d*3 + 1494d*3. 1625d*3 Collect the terms in 216j - 253j + 35j + 6j2. 6j*2 - 2j Collect the terms in 19o2 + 28o*2 + 8o*2 - 83o*2 - 2o. -28o2 - 2o Collect the terms in 13s3 - 4s*3 - 1659 - 6s*3 + 1659. 3s*3 Collect the terms in 23f*2 - 23f*2 - 89f*3 + 66f*3 + 31f*3. 8f*3 Collect the terms in -84027t*3 - 84040t*3 + 168066t3. -t3 Collect the terms in -12844r2 + 6504r*2 + 6341r2. r2 Collect the terms in -8186l + 24452l - 8161l - 8158l. -53l Collect the terms in -822q*3 - 823q*3 + 3281q*3 - 821q*3 - 819q*3. -4q*3 Collect the terms in -2318n - 2330n + 4648n - 103n3. -103n*3 Collect the terms in 19q*3 + 7623q*2 - 7625q*2 + 7q*3. 26q*3 - 2q*2 Collect the terms in -131v*3 - 139v*3 + 509v*3 - 130v*3 - 106v*3. 3v*3 Collect the terms in -5n - 4n - 7n + 20n - 2n. 2n Collect the terms in 12c*3 - 13c*3 + 59413c*2 - 29714c*2 - 29718c2. -c3 - 19c2 Collect the terms in -909 + 909 - 1204x + 13453x. 12249x Collect the terms in 2y3 + 27 - 44 + 17 + 11y*3. 13y*3 Collect the terms in 216i*3 - 209i*3 + 58i*2 - 32i*2 - 10i*3 - 26i*2. -3i*3 Collect the terms in -17g*2 + 0g*2 - 37g*2 + 4g*2. -50g*2 Collect the terms in 324650w*2 + 520404w*2 + 495973w*2. 1341027w*2 Collect the terms in 109973849c + 3c2 - 10c*2 - 109973849c. -7c2 Collect the terms in -462 + 274 - 8d*2 + 3d*2. -5d*2 - 188 Collect the terms in 205f + 8 - 8 + 722f - 178f. 749f Collect the terms in 2628 - 1318 - 1310 - 11403j. -11403j Collect the terms in -152r*3 - 223r3 - r2 + 26r3 - 8r*2. -349r*3 - 9r*2 Collect the terms in 47 + 43 + 16z - 90. 16z Collect the terms in 5i*2 - 74i*2 + 26i*2 + 26i*2 + 20i*2. 3i*2 Collect the terms in -8 + 12s - 1 + 4 - 1 - 3s. 9s - 6 Collect the terms in -1576l3 + 802l*3 + 787l*3. 13l*3 Collect the terms in 195b + 190b + 195b - 582b. -2b Collect the terms in 260409n - 520826n + 260418n. n Collect the terms in -23065r*2 + 11533r*2 - 53r*3 + 11532r*2. -53r*3 Collect the terms in -3 + 0 + 0 - 5t + 8t + t. 4t - 3 Collect the terms in 271393 - 271393 - 3l - l2. -l2 - 3l Collect the terms in k2 + 23212319044 - 23212319044. k2 Collect the terms in -2152s2 + 4300s*2 + 13 - 13 - 2155s*2. -7s*2 Collect the terms in -1438f*3 + 16 + 16 - 32. -1438f*3 Collect the terms in -373673005 - 40a*2 + 373673005. -40a*2 Collect the terms in 10 - 20 + 6778b + 10. 6778b Collect the terms in -p3 - 49p*2 + 59p*2 - 10p2. -p3 Collect the terms in 184u + 185u + 3u3 - 15u*3 - 369u. -12u3 Collect the terms in 2 - 3 - 6729a*2 + 6728a2 + 1. -a2 Collect the terms in -4 + 2 + 37b - 2 - 2 + 7. 37b + 1 Collect the terms in 203w3 - 129 - 205w*3 + 136. -2w*3 + 7 Collect the terms in 4d*2 - 99 - 7d + 99 + 21d2. 25d*2 - 7d Collect the terms in -10m + 23m - 25m + 14m + 18m. 20m Collect the terms in -86b + 28 - 26 + 47b. -39b + 2 Collect the terms in 3351l*3 - 12845l*3 - 1466l*3. -10960l*3 Collect the terms in -90i*2 - 221i*2 + 6i*2 - 68i*2. -373i*2 Collect the terms in -24 - 2399p + 2400p + 2 + 1. p - 21 Collect the terms in 2031026g*3 - 4062060g*3 + 2031031g*3. -3g*3 Collect the terms in 38 - 66 + 28 + 150q. 150q Collect the terms in -233p*2 - 357p*2 + 21p - 21p. -590p*2 Collect the terms in 9f + 6f + 46f - 57f + 42f. 46f Collect the terms in -2 + 6644n*2 + 103n - 202n + 97n. 6644n2 - 2n - 2 Collect the terms in -6o + 67o - 18o - 28o - 21o. -6o Collect the terms in 0l2 - 10l*2 + 26779l*3 + 10l*2. 26779l*3 Collect the terms in 7a*2 + 1 + 13915a - 13915a. 7a*2 + 1 Collect the terms in c + 1001c*2 - 422c*2 - 426c*2. 153c*2 + c Collect the terms in 0 + 1882u - 1845u - 1. 37u - 1 Collect the terms in -36u + 72u - 246u - 135u. -345u Collect the terms in -8r*3 - 14r*3 + 47272210r*2 + 25r*3 - 47272210r*2. 3r*3 Collect the terms in 4209w*2 + 4217w*2 - 12634w*2 + 4218w*2. 10w*2 Collect the terms in 88x*2 + 5700x - 5700x - 88x2 + x3 - 2x3. -x3 Collect the terms in 153r*2 - 1 - 470r*2 - 3 + 2. -317r*2 - 2 Collect the terms in -5h*3 + 70 - 70 + 113h. -5h3 + 113h Collect the terms in -4v - 741v*3 + 601v*3 + 5v. -140v3 + v Collect the terms in -2578 - 262k - 505k + 2578. -767k Collect the terms in 12 - 5 - 455g2 - 7 - 246g*2 + 679g*2. -22g*2 Collect the terms in 974q*2 + 10 + 25 + 6 - 7 - 988q*2. -14q*2 + 34 Collect the terms in -17778897f + 17778897f + 5f*3 - 15f*2 + 3f*2. 5f*3 - 12f*2 Collect the terms in 80169 - 160343 - 24z*3 + 80174 + 74z*3. 50z*3 Collect the terms in -4h + 24 + 8h - h. 3h + 24 Collect the terms in -2h2 - h2 + 161h*3 - 127h*3. 34h*3 - 3h*2 Collect the terms in 1878f*3 - 391f*3 - 396f*3 - 1094f*3. -3f*3 Collect the terms in 4 - 1151m - 3m2 + 2296m - 4 - 1139m. -3m*2 + 6m Collect the terms in -6b + 3b + b - 42509 + b. -b - 42509 Co	{ "pile_set_name": "DM Mathematics" }
-l*2 - 9l + 29153. Calculate r(-155). 6523 Let w(o) = -178o - 1954. What is w(-14)? 538 Let l(q) = q3 - 317q*2 + 989q - 14756. Determine l(314). 2 Let z(d) = d*2 + 1013d - 26062. Give z(25). -112 Let f(n) = n*3 - 40n*2 - 1262n - 126. What is f(61)? 1033 Let k(p) = -50p2 - 217p + 6789. Give k(-14). 27 Let p(u) = 2u3 - 1528u*2 + 77893u + 5313. Determine p(55). -22 Let f(s) = -4s2 + 613s + 23721. Calculate f(-32). 9 Let r(l) = 2l3 + 16l*2 - 6l - 1823. Determine r(0). -1823 Let j(g) = -2735g - 1893. Determine j(-1). 842 Let v(a) = -13a*2 - 1879a + 18938. Give v(-154). -4 Let k(v) = -524151v - 2096625. Give k(-4). -21 Let p(o) = o2 - 91889o - 827076. Give p(-9). 6 Let h(d) = 2d3 - 25d*2 - 224d + 145. What is h(16)? -1647 Let h(k) = k*2 - 2969k - 540314. Calculate h(-172). -62 Let q(f) = 133f3 + 33f*2 + 74f + 6. Calculate q(-2). -1074 Let d(c) = -52c3 - 229c*2 + 176c + 108. Determine d(-5). 3 Let n(f) = 7284f + 495323. What is n(-68)? 11 Let y(i) = i2 + 197519i - 23. Calculate y(0). -23 Let c(t) = 5t3 + 5t*2 - 431t - 2451. What is c(-6)? -765 Let g(f) = -284f - 974. What is g(-9)? 1582 Let x(j) = -2700j*2 + 27038j - 421. What is x(10)? -41 Let s(j) = -5446j + 141599. Determine s(26). 3 Let l(b) = b3 - 242b*2 + 2971b + 73. Give l(13). -5 Let l(f) = -141901f - 141943. What is l(-1)? -42 Let c(v) = 2v*3 + 122v*2 + 103v + 733. Give c(-60). 1753 Let h(f) = -f*3 - 13f*2 - 51f - 121. Calculate h(-5). -66 Let k(h) = 34h3 - 8124h*2 - 536h + 13867. Calculate k(239). 5 Let w(r) = 7r2 - 1737r - 4869. Calculate w(251). 151 Let l(r) = -3r3 - 33r*2 + 4r - 193. Calculate l(-9). -715 Let g(u) = 1332025u - 9324181. What is g(7)? -6 Let v(r) = -r3 - 5r*2 + 2648r + 259. Give v(0). 259 Let c(y) = -y*2 + 936395y - 6554715. Calculate c(7). 1 Let q(k) = 2322k + 936273. Calculate q(-403). 507 Let a(o) = 29o*3 - 262o*2 - 80o + 814. Determine a(9). 13 Let q(u) = u*2 + 59301u - 1898649. Calculate q(32). 7 Let w(k) = 654k - 18198. What is w(28)? 114 Let k(a) = 15a*2 - 80a - 11. Give k(-10). 2289 Let x(k) = -5k2 - 725k - 11710. Give x(-17). -830 Let g(z) = -z*2 + 32768z + 229447. Give g(-7). 22 Let w(u) = u*3 - 230u*2 + 1563u - 621. What is w(223)? -175 Let a(l) = 2l2 + 64l + 507. What is a(-18)? 3 Let t(l) = -15l2 - 162l - 93. Calculate t(-12). -309 Let x(g) = -8g2 - 137g + 33. Give x(-17). 50 Let b(a) = -242a + 17332. Calculate b(72). -92 Let c(z) = -3z*3 - 36z*2 - 94z + 49. What is c(-4)? 41 Let g(r) = -665r2 + 131049r - 8690. What is g(197)? -22 Let d(v) = -38v3 - 16v*2 + 28v. Calculate d(2). -312 Let p(d) = -9d2 + 336d + 37. Give p(40). -923 Let c(h) = h*2 - 18833h + 188218. Give c(10). -12 Let k(s) = -10s2 + 1165s - 11604. Determine k(11). 1 Let q(u) = -350798u + 2455580. Give q(7). -6 Let v(f) = 2f*2 - 2012f - 29577. Give v(-15). 1053 Let r(k) = k*2 + 256k + 6152. Determine r(-30). -628 Let v(m) = -11247m - 56181. Give v(-5). 54 Let z(m) = 62m*2 - 2299m + 2413. Determine z(36). 1 Let j(a) = -20715a + 20690. What is j(1)? -25 Let d(k) = -k3 - 33k*2 + 187k + 9164. Give d(-28). 8 Let j(c) = 65448c + 7853753. What is j(-120)? -7 Let r(z) = 16z*3 + 94z*2 - 40z - 288. What is r(-6)? -120 Let r(d) = -1392d + 9732. What is r(7)? -12 Let r(q) = -q3 + 48q*2 + 92q - 243. Determine r(50). -643 Let v(i) = -i*2 - 87i + 4048. Calculate v(-119). 240 Let a(t) = 1909t - 68731. Calculate a(36). -7 Let n(k) = 4k*3 - 157k*2 - 287k - 77. Determine n(41). -77 Let l(v) = v*3 + 638v*2 + 5673v - 381200. Give l(-628). -4 Let v(k) = -8851k2 - 389449k - 208. What is v(-44)? 12 Let x(w) = 2757w + 38642. What is x(-14)? 44 Let p(g) = -15g*2 - 855g - 4608. What is p(-51)? -18 Let d(s) = 14s2 + 922s - 22577. Give d(19). -5 Let o(t) = -272t + 1201. What is o(3)? 385 Let a(m) = 3m*3 + 5m*2 - 12m - 34. What is a(-6)? -430 Let k(h) = -6093h3 - 16h*2 + 3h + 19. What is k(-1)? 6093 Let x(g) = -g*3 + 25g*2 + 1114g - 1461. Determine x(-24). 27 Let p(i) = 6722i + 3414769. What is p(-508)? -7 Let j(x) = -5953x - 41639. Calculate j(-7). 32 Let g(q) = 17q2 - 8899q - 4602. Determine g(524). 114 Let d(s) = -260962s + 3392511. Determine d(13). 5 Let y(q) = -2q*3 + 2q*2 - 3q - 196. Determine y(0). -196 Let q(t) = 2303t - 149728. Calculate q(65). -33 Let y(i) = -359i + 2164. Calculate y(3). 1087 Let z(x) = -x*3 + 12x*2 - 7622x + 30367. What is z(4)? 7 Let q(n) = n*3 - 62n*2 - 1114n - 2742. Determine q(-3). 15 Let f(h) = h*2 + 1240h + 258537. Give f(-265). 162 Let l(t) = -10t2 + 6332t - 13815. Calculate l(631). 67 Let k(x) = 8x2 + 672x - 27356. Give k(-114). 4 Let l(s) = 1514s + 77. Calculate l(2). 3105 Let k(m) = 2m*2 + 139m - 2209. Give k(14). 129 Let n(i) = -14606i + 1066242. Calculate n(73). 4 Let g(p) = -4p*2 - 5266p - 36659. Determine g(-7). 7 Let n(b) = 473b + 88843. Determine n(-188). -81 Let d(x) = 4x*3 - 930x*2 + 419x + 10440. Give d(232). 0 Let v(d) = -6d2 + 16109d + 48389. Determine v(-3). 8 Let i(q) = 6q2 + 354q - 8244. What is i(-77)? 72 Let b(a) = a*3 + 221a*2 + 93a + 20553. What is b(-221)? 0 Let s(y) = 91y3 + 1247y*2 - 44y + 29. Determine s(-14). -4647 Let m(c) = 4c2 + 134725c + 538920. What is m(-4)? 84 Let g(f) = f*3 - 40f*2 - 155f - 11013. Give g(48). -21 Let l(w) = 4316w - 159665. Give l(37). 27 Let o(w) = -526080w - 8943358. Give o(-17). 2 Let o(d) = 7d3 + 10d*2 - 67d - 293. What is o(-4)? -313 Let v(j) = -4j3 - 45j*2 - 121j + 80. What is v(-9)? 440 Let i(h) = -h*2 + 143266h + 4298875. Give i(-30). -5 Let z(m) = -m*2 - 170m + 4025. Calculate z(-191). 14 Let c(r) = -523r2 + 6r + 36. Give c(0). 36 Let t(v) = v*3 + 3v*2 + 52v - 418. What is t(10)? 1402 Let g(x) = -1336x + 28191. Give g(21). 135 Let t(a) = 25a*3 - 1298a*2 - 2693a - 1. Calculate t(-2). -7 Let j(q) = -33q2 - 292q + 677. What is j(2)? -39 Let w(p) = -p*2 + 72p - 1488. Give w(57). -633 Let t(f) = 34497f + 310489. Determine t(-9). 16 Let s(j) = j2 + 573j - 58146. Give s(88). 22 Let s(i) = 13i2 + 15i + 45. Give s(-7). 577 Let y(w) = 19676w - 865734. What is y(44)? 10 Let k(m) = -814m + 786309. Give k(966). -15 Let w(j) = -j*2 + 98j - 2486. Determine w(20). -926 Let y(n) = -4n3 - 3n*2 - 89n - 418. Calculate y(-7). 1430 Let y(d) = 2d2 - 247d + 2375. What is y(10)? 105 Let p(c) = 115c + 823. Give p(-6). 133 Let x(u) = u2 + 7049u - 14094. What is x(2)? 8 Let k(h) = h*3 + 354h*2 + 1451h + 17866. Determine k(-350). 16 Let w(a) = -3694a - 55492. Determine w(-15). -82 Let k(m) = -76m + 11479. Calculate k(151). 3 Let p(r) = 54r - 592. Determine p(25). 758 Let q(y) = -y2 - 33y + 1105. Give q(-44). 621 Let i(r) = 8r3 - 448r*2 - 23r + 959. Determine i(56). -329 Let o(a) = -22578a + 541857. What is o(24)? -15 Let c(k) = -2960k - 290107. Calculate c(-98). -27 Let t(j) = 1135j - 137300. Give t(121). 35 Let f(u) = u3 - 52u*2 - 258u - 1437. Determine f(57). 102 Let s(h) = 13h2 - 128h + 993. Give s(10). 1013 Let x(k) = 2737k + 11177. What is x(-4)? 229 Let h(r) = -10r*2 - 22r + 20. Determine h(-2). 24 Let t(u) = 28u2 - 41u - 2502. Determine t(-9). 135 Let d(k) = 5773k - 404070. Determine d(70). 40 Let k(f) = -79f + 5817. Determine k(72). 129 Let f(k) = 8610k + 490376. Give f(-57). -394 Let y(x) = -1083x - 3446. Determine y(-4). 886 Let z(k) = -k*2 - 201k - 8426. Calculate z(-136). 414 Let w(g) = -g*3 - 9g*2 + 398g + 4925. What is w(-13)? 427 Let u(d) = 4d2 - 70028d - 1121481. Calculate u(-16). -9 Let m(h) = h*3 + 37h*2 + 248h + 56. Determine m(-20). 1896 Let n(q) = -q*3 - 2q*2 - 68q + 748. What is n(0)? 748 Let g(s) = s*3 - 18s*2 - 177s + 1311. What is g(21)? -1083 Let u(b) = 13325b2 - 39997b + 12. Give u(3). -54 Let u(p) = -22627p - 22730. Calculate u(-1). -103 Let n(y) = -139122y + 278245. Give n(2). 1 Let x(s) = -19s2 + 220s - 123. What is x(8)? 421 Let l(j) = -11j2 - 7730j - 106059. Determine l(-14). 5 Let t(y) = 1058y - 5812. What is t(7)? 1594 Let t(c) = 8c*2 + 573c - 3380. Determine t(-77). -69 Le	{ "pile_set_name": "DM Mathematics" }
d + 5350. Round d to the nearest 100. 1100 Let s = 22061 + -21908.976. Let d = s + -0.024. Let t = d + -152.00067. What is t rounded to 4 dps? -0.0007 Let v = 50.41057 + -36.4075. Let p = 39 + -25. Let d = v - p. Round d to 4 dps. 0.0031 Let h = -80.1 - -831.1. Let s = h - 712.2. Round s to the nearest 10. 40 Let q = 25.066 - 14.541. What is q rounded to 0 dps? 11 Let i = 19136262.99829 - 19136453. Let r = 1067 + -1257. Let y = i - r. What is y rounded to four dps? -0.0017 Let t = -40261 + 40193.852. Let q = -374 + 307. Let f = q - t. Round f to one decimal place. 0.1 Let z = 123.5623 - 2.5923. Let y = 122 - z. Let w = y + -1.0382. What is w rounded to three dps? -0.008 Let f = -0.448 + 0.38. Let a = 14.10138031 + -14.03338. Let h = f + a. What is h rounded to 7 dps? 0.0000003 Let n = -182227 + 182047.646. Let y = 181.4 + n. Round y to 1 decimal place. 2 Let w = -1788.13 - -1899.7. What is w rounded to the nearest 100? 100 Suppose 0 = -b + 5y + 2374, b + 0y = 3y + 2364. Let d(f) = 1568f*2 - 2f - 1. Let c be d(-1). Let t = b - c. Round t to the nearest 100. 800 Let w = -2833256389.263 - -2833257889.262996869. Let p = 1500 - w. Round p to 7 dps. 0.0000031 Let o = -221.06 + 652.4. What is o rounded to the nearest ten? 430 Let o = 0.06985 + -0.0698516388. What is o rounded to 7 decimal places? -0.0000016 Let h = -22796 + -28886. Let t be h/(-4) + 56/(-112). What is t rounded to the nearest one thousand? 13000 Let x = -18.344 - -34.953. What is x rounded to one decimal place? 16.6 Let m = -3141 - -1630. Let p = m - -1511.00857. What is p rounded to 4 decimal places? 0.0086 Let n = 12592333 - 17872333. Round n to the nearest 100000. -5300000 Let n(o) = 2782o2 + 2o - 4. Let v be (-10)/45 + 0 + 112/18. Let l(g) = g - 10. Let p be l(v). Let z be n(p). Round z to the nearest one thousand. 45000 Suppose -5g + 28887649 = -74512866. Suppose -34319897 = -2d + g. What is d rounded to the nearest one million? 28000000 Let h = -71425 - -71456.0046. Let x = 29.26 - -1.74. Let p = x - h. What is p rounded to 3 dps? -0.005 Let k = 0.461 - 33.223. What is k rounded to the nearest integer? -33 Let m(t) = -3211t3 - 15t*2 + 19t. Let f be m(14). Let b = 2163658 + f. What is b rounded to the nearest one million? -7000000 Let h = 5.365 - 5.4. Let a = h - -2.835. Let b = a - 2.84. Round b to one dp. 0 Let c = 63.280862240366 + -0.168930562766. Let r = c + -0.1119333576. Let h = r + -63. What is h rounded to six decimal places? -0.000002 Let z = 2676648.90587 - 11.90587. Let k = -2676636.998200463 + z. Let i = k - 0.0018. What is i rounded to seven decimal places? -0.0000005 Let q = -2205916 + 2206211.9554. Let i = -0.0446 - q. Let l = i - -296.000123. Round l to five decimal places. 0.00012 Let f = 11016571139 + -11016571132.740001243. Let n = f + -6.26. What is n rounded to seven dps? -0.0000012 Let o = -275.02315 + 274.9. Let b = 0.12 + o. Round b to four dps. -0.0032 Let u = 17.355 + 1.032. What is u rounded to 1 dp? 18.4 Let r = -1040.2 - -1040.199994337. What is r rounded to 5 decimal places? -0.00001 Let c = 486.9 + -460. Let q = 136.8 - 150.1. Let z = c - q. What is z rounded to the nearest ten? 40 Let y = 16.31 + -882.31. Let s = 865.99999713 + y. Round s to 7 dps. -0.0000029 Let c = 2899 - 2899.281. What is c rounded to one decimal place? -0.3 Let u be (-9 + 1 - (0 + -14)) + 51974. Round u to the nearest one thousand. 52000 Let b(s) = 2468520s + 18. Let w be b(5). Suppose 0 = -14v + 17v - w. Suppose v + 109794 = 11y. What is y rounded to the nearest one hundred thousand? 400000 Let g be (-202853)/(-2) - (34/(-4) + 10). Suppose 3s + 2b - 304210 = 0, 0s - 5b = s - g. Round s to the nearest one thousand. 101000 Let f = -0.34 + -4.76. Let b = -0.27061 - -5.37091. Let r = f + b. Round r to 4 decimal places. 0.0003 Suppose -2a + 10 = 0, -5f - 4a + 4587914 = -462106. Round f to the nearest 100000. 1000000 Let a = -22950 - -23251.21. What is a rounded to zero dps? 301 Let i = -102 - -43. Let c = 44.5 + -98.8. Let p = i - c. Round p to 0 dps. -5 Let a = 1682460 + -1682447.60457. Let h = -1155.01243 + a. Let t = -1142 - h. What is t rounded to 2 dps? 0.62 Let n = 2717.0031 - 2717. What is n rounded to two decimal places? 0 Suppose 0 = 123u + 54u + 13475010. Round u to the nearest 10000. -80000 Let a(o) = -o3 + 9o*2 - 3o - 14. Let y be a(7). Let d be ((y/4)/(-9))/(2/(-40)). Let h = -74 + d. What is h rounded to the nearest 10? -40 Suppose 2i - 4f = 2227228, i - 868642 = -2f + 244944. Round i to the nearest one hundred thousand. 1100000 Let d = -1 - -5. Let b be (-167595)/(-105) + (0 + 1)/(-7). Let l be b/(d + -7) + -2. What is l rounded to the nearest 100? -500 Let u = 10223.0000016507 + -10223. Round u to six decimal places. 0.000002 Let t(h) = -9026917h + 2 + 0 + 2666161h. Let x be t(-1). Let p = -8839242 - x. Round p to the nearest one million. -15000000 Let s = 381917 - 381921.0999296. Let t = s - -4.1. Round t to five decimal places. 0.00007 Let v be (-2245319072)/42 - 62/651. Let g be -2 + v/12 - 2/(-12). What is g rounded to the nearest one hundred thousand? -4500000 Suppose -5f - 154461 = -4s, -595f = 4s - 594f - 154431. What is s rounded to the nearest 10000? 40000 Let s = -363 + 550. Let i = -192.4637 + 2.8937. Let b = i + s. Round b to one dp. -2.6 Let n = 0.43597 + -0.26684. Let c = n - 11.41813. Let l = -11.2 - c. Round l to 2 dps. 0.05 Let f = 24.61 - -185.79. Let h = f - 185. Let c = 5.8 - h. Round c to 0 decimal places. -20 Let x = 359 + -340.1. Let d = x + 256.6. What is d rounded to the nearest one hundred? 300 Let s be 748/(-14) + (-20)/35. Let y be 360/s2195-6. Round y to the nearest 1000. 88000 Let d = -39.113 + 39.11290191. Round d to 5 dps. -0.0001 Let a = 2.593 + 0.007. Let m = a - -95.4. Let n = -97.999973 + m. Round n to 4 decimal places. 0 Suppose 0 = 6b + 9 + 3. Let z be (-3b/4)/(3/14). Let r be z/14 - (-13319997)/6. Round r to the nearest one hundred thousand. 2200000 Let j = -153028.99880459 - -153029. What is j rounded to four decimal places? 0.0012 Suppose 2h - 4m = -168630, 61515 + 191410 = -3h + 10m. Round h to the nearest one hundred. -84300 Let l = 61.7 - 63. Let i = l + 4.7. Let d = i - 6. What is d rounded to the nearest integer? -3 Let x = -1363 + 1412.55. Let g = -44.7 + x. Round g to one decimal place. 4.9 Let i = 3148 + 42821. What is i rounded to the nearest 1000? 46000 Let p = 0.035989 - 0.036029923. Round p to 6 decimal places. -0.000041 Let x = 4520.07 - -521.63. Let j = -4788 + x. Let v = j + -266. Round v to the nearest integer. -12 Let c = 459.9498 + 0.0502. Let w = 460.000000466 - c. Round w to seven dps. 0.0000005 Let k = 6 - 0. Let r be (98 + -1)/(1/(k + -5)). Let x = -61 + r. Round x to the nearest 10. 40 Let v = -1073.278932 - -1073.3. Let w = v - 154.094068. Let s = w + 154. Round s to 2 decimal places. -0.07 Let i = -1.1167 + -3551.7633. Let n = -3603.880019 - i. Let f = n - -51. Round f to five decimal places. -0.00002 Let a = 76 - 77. Let i(t) be the first derivative of 332999t3/3 + t2/2 + 2t - 7. Let w be i(a). Round w to the nearest one hundred thousand. 300000 Let m = 75.862 - 75. Let a = m - -0.198. What is a rounded to the nearest integer? 1 Let k = -3092 + 3077.461. Let d = 0.061 - k. Let o = d + -14.59999907. Round o to 7 decimal places. 0.0000009 Let x = 5750.799 + -3.799. Let k = 6230.2 - x. Round k to the nearest ten. 480 Let m = -69157 - -68879.21. What is m rounded to the nearest ten? -280 Suppose -c + 10 = 13, 4y = -3c - 29. Let n be (-76 + 81)858/y. What is n rounded to the nearest 100? -500 Let w = 440.35 + -5.35. Let u = w + -436.97. Let l = -1.97000273 - u. Round l to 7 dps. -0.0000027 Let b = 126 + -244. Let r = 118.068 + b. Round r to 1 dp. 0.1 Let f = -0.7793 + 0.84436. Round f to three decimal places. 0.065 Let g(b) = -b*3 - 40b*2 - 43b - 152. Let x be g(-39). Suppose -xs = -8k + 4k - 29600, -s = 3k + 22200. Round k to the nearest 100. -7400 Let z(x) = 6383x2 - 3x + 24. Let r be z(9). Round r to the nearest ten thousand. 520000 Let k = -265240642711.999999669 - -265240642229. Let n = 1079 + -596. Let a = k + n. Round a to 7 dps. 0.0000003 Let r(z) be the third derivative of z5/60 + z4/4 + z*3 + 19z**2. Let g b	{ "pile_set_name": "DM Mathematics" }
30423, -98630424, -98630425? -98630426 What is the next term in 3413822, 3413752, 3413682, 3413612? 3413542 What is the next term in 2465, 4541, 6227, 7523, 8429, 8945, 9071? 8807 What comes next: 69937, 280268, 630819, 1121590, 1752581, 2523792? 3435223 What is the next term in -9640, -18782, -27436, -35608, -43304, -50530, -57292? -63596 What is the next term in 5456435, 10912837, 16369239, 21825641? 27282043 What is next in -1087262318, -1087262319, -1087262320, -1087262321? -1087262322 What is next in -53993252, -53993238, -53993224, -53993210? -53993196 What is next in -635, -2300, -5079, -8972? -13979 What is the next term in 116998, 468081, 1053220, 1872415, 2925666? 4212973 What comes next: 414667, 829340, 1244013, 1658686, 2073359, 2488032? 2902705 What is next in 5, -50, -159, -346, -635, -1050, -1615? -2354 What comes next: 10219763, 20439515, 30659259, 40878995, 51098723? 61318443 What comes next: -4175, -6967, -9761, -12557, -15355? -18155 What is the next term in 5597295, 11194595, 16791895? 22389195 What is next in -24167995, -24168013, -24168057, -24168139, -24168271, -24168465, -24168733? -24169087 What is the next term in -252386, -504704, -756968, -1009178? -1261334 What comes next: -5830688, -11661389, -17492104, -23322839, -29153600, -34984393, -40815224? -46646099 What comes next: 1043531, 4173985, 9391409, 16695803? 26087167 What comes next: 85159, 170100, 255043, 339988, 424935, 509884, 594835? 679788 What comes next: 332502282, 665004565, 997506848, 1330009131, 1662511414? 1995013697 What is next in 4634935, 4634939, 4634943, 4634947, 4634951, 4634955? 4634959 What comes next: 271774, 543548, 815330, 1087120, 1358918, 1630724, 1902538? 2174360 What is next in -42168, -84184, -126064, -167820, -209464, -251008, -292464, -333844? -375160 What comes next: -2867, -23333, -79187, -188219, -368219, -636977? -1012283 What is the next term in -239259, -957032, -2153321, -3828126, -5981447? -8613284 What is the next term in -1580, -1700, -1814, -1922, -2024, -2120, -2210? -2294 What comes next: 16923, 33504, 49737, 65622, 81159, 96348, 111189? 125682 What is next in -118107, -118122, -118137, -118152, -118167, -118182? -118197 What is next in -284, -1125, -2674, -4931? -7896 What comes next: -42550, -39165, -35780, -32395, -29010, -25625? -22240 What is the next term in 35183, 35174, 35153, 35114, 35051, 34958? 34829 What is next in 6192, 6564, 6936? 7308 What comes next: 5285346, 5285325, 5285304? 5285283 What comes next: 7067, 7483, 7885, 8267, 8623, 8947, 9233, 9475? 9667 What is the next term in -30052416, -30052394, -30052372, -30052350, -30052328, -30052306? -30052284 What is the next term in -1790281, -1790279, -1790277? -1790275 What is the next term in 181585367, 181585369, 181585371, 181585373, 181585375, 181585377? 181585379 What is the next term in 1053, 838, 493, 18, -587, -1322? -2187 What is the next term in 218337, 437031, 655725, 874419, 1093113? 1311807 What comes next: 94150, 94123, 94082, 94027? 93958 What is the next term in -3625, -14803, -25983, -37165? -48349 What comes next: -138, 717, 2376, 4839, 8106? 12177 What comes next: 1280414, 2560834, 3841254, 5121674, 6402094? 7682514 What comes next: 4615423, 9230798, 13846173, 18461548, 23076923? 27692298 What is next in -2296744, -4593485, -6890192, -9186847, -11483432, -13779929, -16076320, -18372587? -20668712 What is the next term in 57, -357, -879, -1509? -2247 What comes next: -2678897, -10715591, -24110087, -42862391, -66972509? -96440447 What is next in -1208075, -1208021, -1207969, -1207919? -1207871 What is the next term in -169356, -169364, -169374, -169386, -169400, -169416, -169434? -169454 What is next in -2988, -2871, -2588, -2055, -1188, 97? 1884 What comes next: 15426, 19243, 23060, 26877, 30694? 34511 What is the next term in 2749586, 2749581, 2749572, 2749559, 2749542? 2749521 What comes next: 13911415, 13911423, 13911437, 13911457? 13911483 What is next in 1060201218, 1060201220, 1060201222, 1060201224, 1060201226, 1060201228? 1060201230 What comes next: 3178061, 6356119, 9534177, 12712235? 15890293 What is next in 16110, 14868, 13626? 12384 What is next in -6349, -5728, -4693, -3244, -1381, 896? 3587 What is next in 79899, 79920, 79925, 79908, 79863, 79784, 79665, 79500? 79283 What is the next term in -2120, -3545, -4952, -6335, -7688? -9005 What is next in -34318871, -68637746, -102956621, -137275496, -171594371, -205913246? -240232121 What is next in 46432, 46555, 46666, 46759, 46828, 46867, 46870? 46831 What comes next: -49647, -198551, -446719, -794151, -1240847, -1786807? -2432031 What is the next term in 15274, 14916, 14274, 13312, 11994? 10284 What comes next: 787648, 787663, 787678, 787693? 787708 What comes next: -61967579, -61967580, -61967581? -61967582 What is the next term in 295553, 591082, 886611, 1182140, 1477669? 1773198 What is next in -9362, -9177, -8870, -8441, -7890, -7217, -6422? -5505 What comes next: 190, 458, 806, 1234, 1742, 2330, 2998? 3746 What comes next: -162814, -162757, -162700, -162643? -162586 What is the next term in -65214845, -65214851, -65214861, -65214875? -65214893 What comes next: -15364, -60518, -135774, -241132, -376592? -542154 What is the next term in -907498, -907365, -907232, -907099? -906966 What comes next: 12675, 12728, 12829, 12978? 13175 What is next in 580, -192, -952, -1700? -2436 What is the next term in 430, 1044, 1944, 3130, 4602, 6360? 8404 What is next in 16889, 33640, 50427, 67256, 84133? 101064 What is the next term in 62153507, 62153504, 62153501? 62153498 What comes next: 92734040, 92734037, 92734032, 92734025, 92734016? 92734005 What is next in 219107, 218854, 218601, 218348? 218095 What is the next term in 3599, 3497, 3331, 3101, 2807, 2449, 2027? 1541 What is the next term in -4616, -8268, -11920, -15572, -19224, -22876? -26528 What is the next term in -40511, -40530, -40549, -40568, -40587? -40606 What comes next: 262341, 262448, 262555, 262662, 262769? 262876 What is the next term in -4195856, -8391714, -12587572, -16783430? -20979288 What is next in 735, 1626, 2339, 2886, 3279? 3530 What comes next: 335699, 671928, 1008175, 1344446, 1680747, 2017084, 2353463, 2689890? 3026371 What comes next: -1665405, -1665329, -1665289, -1665291, -1665341, -1665445, -1665609? -1665839 What is the next term in 3244, 6488, 9738, 13000, 16280, 19584, 22918, 26288? 29700 What is the next term in -11385, -45502, -102347, -181920, -284221, -409250, -557007? -727492 What comes next: -179, -14481, -53291, -128861, -253443, -439289? -698651 What comes next: 35098, 70165, 105232, 140299, 175366? 210433 What is the next term in -9161, -82013, -282233, -673505, -1319513? -2283941 What is next in -8943, -35740, -80365, -142830, -223147? -321328 What is the next term in -1328, -5496, -12442, -22166, -34668? -49948 What is next in -19751, -39433, -59109, -78779? -98443 What is the next term in 21465535, 42931069, 64396603, 85862137, 107327671? 128793205 What is the next term in 1061, 1690, 2745, 4226? 6133 What comes next: 5315, 8385, 9221, 7823? 4191 What comes next: 24613273, 49226551, 73839829, 98453107, 123066385, 147679663? 172292941 What is next in -55944, -111850, -167706, -223512, -279268, -334974? -390630 What is the next term in -4823790, -4823805, -4823830, -4823865, -4823910, -4823965, -4824030? -4824105 What is next in 2277, 4540, 6767, 8964, 11137? 13292 What is the next term in 855, 181, -567, -1383, -2261, -3195? -4179 What is next in 3223589, 3223585, 3223579, 3223571? 3223561 What is the next term in -1260881, -1260864, -1260847, -1260830, -1260813? -1260796 What is the next term in -7366, -7458, -7612, -7822, -8082? -8386 What is next in 96634, 386289, 868982, 1544659, 2413266, 3474749? 4729054 What comes next: -38, -384, -822, -1256, -1590? -1728 What is next in 23763248, 23763250, 23763252, 23763254? 23763256 What is next in 131150, 524625, 1180424, 2098553, 3279018, 4721825, 6426980? 8394489 What comes next: -150662, -602642, -1355942, -2410562, -3766502, -5423762, -7382342? -9642242 What comes next: 44634, 44432, 44066, 43512, 42746? 41744 What is the next term in -4638, -18601, -41874, -74457? -116350 What is the next term in 6323, 50592, 170841, 405080, 791319, 1367568,	{ "pile_set_name": "DM Mathematics" }
here between 1:06 PM and 8:32 PM? 446 What is 62 minutes before 7:00 PM? 5:58 PM How many minutes are there between 9:36 AM and 5:38 PM? 482 What is 592 minutes before 3:49 PM? 5:57 AM How many minutes are there between 11:16 AM and 10:47 PM? 691 What is 249 minutes after 8:45 PM? 12:54 AM How many minutes are there between 5:45 PM and 3:52 AM? 607 What is 667 minutes before 10:14 PM? 11:07 AM How many minutes are there between 1:38 AM and 12:06 PM? 628 What is 10 minutes after 11:20 PM? 11:30 PM What is 170 minutes before 6:35 AM? 3:45 AM What is 353 minutes after 3:25 PM? 9:18 PM How many minutes are there between 9:31 PM and 6:26 AM? 535 What is 552 minutes before 1:48 PM? 4:36 AM What is 184 minutes before 8:34 PM? 5:30 PM How many minutes are there between 9:23 PM and 10:54 PM? 91 What is 320 minutes after 5:03 PM? 10:23 PM What is 482 minutes before 9:40 AM? 1:38 AM What is 324 minutes before 6:32 AM? 1:08 AM What is 414 minutes before 5:48 PM? 10:54 AM What is 430 minutes before 1:46 PM? 6:36 AM How many minutes are there between 10:27 AM and 11:21 AM? 54 What is 53 minutes before 1:44 PM? 12:51 PM What is 501 minutes before 11:32 PM? 3:11 PM How many minutes are there between 6:16 AM and 4:55 PM? 639 What is 448 minutes after 9:03 AM? 4:31 PM What is 165 minutes after 4:55 PM? 7:40 PM How many minutes are there between 10:31 AM and 3:14 PM? 283 What is 195 minutes before 2:33 AM? 11:18 PM How many minutes are there between 4:34 PM and 8:37 PM? 243 How many minutes are there between 9:33 PM and 7:58 AM? 625 What is 296 minutes after 4:57 AM? 9:53 AM What is 9 minutes after 8:01 AM? 8:10 AM What is 443 minutes after 2:34 PM? 9:57 PM How many minutes are there between 1:50 AM and 1:22 PM? 692 How many minutes are there between 9:44 AM and 4:29 PM? 405 How many minutes are there between 10:19 AM and 10:25 AM? 6 What is 401 minutes after 11:38 PM? 6:19 AM How many minutes are there between 9:08 PM and 9:47 PM? 39 What is 246 minutes after 3:22 PM? 7:28 PM How many minutes are there between 11:46 AM and 1:37 PM? 111 What is 50 minutes before 9:31 AM? 8:41 AM How many minutes are there between 1:48 PM and 11:32 PM? 584 What is 315 minutes after 5:15 AM? 10:30 AM How many minutes are there between 3:22 PM and 2:06 AM? 644 How many minutes are there between 4:34 AM and 9:29 AM? 295 How many minutes are there between 5:00 PM and 5:52 PM? 52 How many minutes are there between 12:21 PM and 8:13 PM? 472 How many minutes are there between 1:10 AM and 8:19 AM? 429 How many minutes are there between 3:35 AM and 2:03 PM? 628 How many minutes are there between 4:37 AM and 8:47 AM? 250 What is 418 minutes before 4:02 AM? 9:04 PM What is 328 minutes after 8:38 PM? 2:06 AM What is 405 minutes after 9:41 PM? 4:26 AM How many minutes are there between 10:30 PM and 7:54 AM? 564 What is 501 minutes before 6:06 AM? 9:45 PM How many minutes are there between 9:06 AM and 2:30 PM? 324 What is 468 minutes before 12:48 PM? 5:00 AM What is 310 minutes after 12:48 AM? 5:58 AM What is 705 minutes before 2:15 PM? 2:30 AM How many minutes are there between 5:44 PM and 11:28 PM? 344 What is 321 minutes before 5:26 AM? 12:05 AM How many minutes are there between 5:51 AM and 11:11 AM? 320 What is 54 minutes before 5:04 AM? 4:10 AM What is 564 minutes after 10:32 PM? 7:56 AM What is 699 minutes before 12:52 PM? 1:13 AM How many minutes are there between 7:02 PM and 4:15 AM? 553 How many minutes are there between 5:39 PM and 8:18 PM? 159 What is 252 minutes after 1:16 AM? 5:28 AM How many minutes are there between 11:15 PM and 5:08 AM? 353 How many minutes are there between 10:30 PM and 5:58 AM? 448 What is 217 minutes after 10:28 AM? 2:05 PM What is 655 minutes before 8:43 AM? 9:48 PM How many minutes are there between 12:15 AM and 11:10 AM? 655 What is 583 minutes after 3:57 PM? 1:40 AM How many minutes are there between 5:48 AM and 11:01 AM? 313 What is 429 minutes before 5:00 PM? 9:51 AM What is 420 minutes after 2:21 PM? 9:21 PM How many minutes are there between 12:44 AM and 8:10 AM? 446 How many minutes are there between 11:02 AM and 10:30 PM? 688 How many minutes are there between 4:24 AM and 6:39 AM? 135 How many minutes are there between 1:13 AM and 9:06 AM? 473 What is 103 minutes after 8:42 AM? 10:25 AM What is 587 minutes after 11:48 AM? 9:35 PM How many minutes are there between 1:37 PM and 3:52 PM? 135 How many minutes are there between 7:41 PM and 6:24 AM? 643 What is 331 minutes after 9:42 AM? 3:13 PM How many minutes are there between 1:21 PM and 6:41 PM? 320 What is 49 minutes after 2:32 AM? 3:21 AM How many minutes are there between 11:49 PM and 10:56 AM? 667 What is 153 minutes before 5:23 PM? 2:50 PM What is 320 minutes before 11:42 PM? 6:22 PM What is 627 minutes before 1:24 PM? 2:57 AM How many minutes are there between 2:47 PM and 12:00 AM? 553 How many minutes are there between 6:58 PM and 12:58 AM? 360 What is 171 minutes after 2:27 PM? 5:18 PM How many minutes are there between 2:29 AM and 12:15 PM? 586 How many minutes are there between 8:19 AM and 1:37 PM? 318 What is 142 minutes after 11:12 AM? 1:34 PM How many minutes are there between 9:39 PM and 8:42 AM? 663 What is 367 minutes before 4:03 PM? 9:56 AM What is 585 minutes before 7:27 PM? 9:42 AM What is 265 minutes before 8:28 PM? 4:03 PM How many minutes are there between 1:10 AM and 9:21 AM? 491 How many minutes are there between 4:40 AM and 12:16 PM? 456 What is 670 minutes after 7:41 AM? 6:51 PM What is 50 minutes after 6:10 PM? 7:00 PM What is 502 minutes before 9:31 PM? 1:09 PM What is 291 minutes after 3:13 PM? 8:04 PM How many minutes are there between 7:42 AM and 11:57 AM? 255 How many minutes are there between 4:03 PM and 7:18 PM? 195 How many minutes are there between 12:37 PM and 10:28 PM? 591 How many minutes are there between 6:54 PM and 4:40 AM? 586 What is 166 minutes before 11:43 AM? 8:57 AM What is 623 minutes before 3:04 AM? 4:41 PM How many minutes are there between 2:56 AM and 8:50 AM? 354 What is 429 minutes after 7:09 AM? 2:18 PM What is 50 minutes before 12:25 AM? 11:35 PM What is 293 minutes before 1:16 PM? 8:23 AM What is 121 minutes before 1:40 PM? 11:39 AM What is 592 minutes before 5:10 PM? 7:18 AM How many minutes are there between 11:33 AM and 6:11 PM? 398 What is 302 minutes after 12:01 PM? 5:03 PM How many minutes are there between 8:43 AM and 7:06 PM? 623 What is 454 minutes before 5:51 PM? 10:17 AM What is 223 minutes after 1:26 AM? 5:09 AM What is 570 minutes after 6:44 PM? 4:14 AM What is 76 minutes after 9:40 AM? 10:56 AM How many minutes are there between 7:00 AM and 12:31 PM? 331 How many minutes are there between 5:47 AM and 1:10 PM? 443 How many minutes are there between 8:06 PM and 8:59 PM? 53 What is 612 minutes before 2:17 AM? 4:05 PM How many minutes are there between 2:56 AM and 11:17 AM? 501 What is 386 minutes after 12:47 AM? 7:13 AM How many minutes are there between 12:38 AM and 1:31 AM? 53 How many minutes are there between 6:05 AM and 7:43 AM? 98 How many minutes are there between 6:22 AM and 9:07 AM? 165 How many minutes are there between 7:37 AM and 5:54 PM? 617 What is 473 minutes before 2:48 PM? 6:55 AM How many minutes are there between 2:04 PM and 4:36 PM? 152 How many minutes are there between 7:30 AM and 5:48 PM? 618 How many minutes are there between 10:20 AM and 8:47 PM? 627 What is 625 minutes before 11:39 AM? 1:14 AM What is 578 minutes before 5:19 AM? 7:41 PM What is 33 minutes after 3:05 PM? 3:38 PM What is 639 minutes before 5:11 AM? 6:32 PM What is 115 minutes after 4:37 AM? 6:32 AM How many minutes are there between 10:31 AM and 7:21 PM? 530 What is 662 minutes after 12:34 AM? 11:36 AM How many minutes are there between 8:19 PM and 10:51 PM? 152 What is 507 minutes after 7:19 PM? 3:46 AM What is 309 minutes before 6:02 AM? 12:53 AM What is 578 minutes before 3:21 AM? 5:43 PM What is 553 minutes after 9:02 AM? 6:15 PM What is 585 minutes after 5:07 PM? 2:52 AM What is 692 minutes before 9:19 PM? 9:47 AM How many minutes are there between 11:57 PM and 12:17 AM? 20 What is 490 minutes after 4:30 AM? 12:40 PM What is 655 minutes after 3:39 PM? 2:34 AM How many minutes are there between 8:12 PM and 5:31 AM? 559 How many minu	{ "pile_set_name": "DM Mathematics" }
e (-3 - -4)/(c/1). Sort 0.3, 0.2, g in increasing order. 0.2, 0.3, g Let g = -24 + 44. Suppose 3f = -2f - g. Put 3, 2, f in decreasing order. 3, 2, f Let s = -12 + 7. Let w(c) = -c*3 + 2c2 - c - 2. Let g be w(2). Put -1, g, s in ascending order. s, g, -1 Let v = 5.5 + -5.1. Let y = -3 - -2.4. Let s = v - y. Put s, 3, 5 in descending order. 5, 3, s Let p = 2.28 + -2.18. Let k = 0.2 + -1.2. Sort k, 5/4, p. k, p, 5/4 Let p(o) = o2 + 6o + 1. Let y be p(-6). Suppose 7c - 2c = -3d + 10, -4d + 23 = -3c. Suppose -3f + u = -d, 3f - 6f - u - 5 = 0. Sort y, f, -1. -1, f, y Suppose 2u + 5a - 10 = 0, -3u + 5a - 3a = 4. Suppose -y - 1 = -u. Let s be (-4)/(-22) - ((-31)/11 + 8). Sort -4, y, s in descending order. y, -4, s Let j = -186/5 + 467/10. Let q = -97/10 + j. Sort 2, q, -1/2. -1/2, q, 2 Let j be (-1)/(-1 + (-376)/(-370)). Let r = -61 - j. Put 0, 0.5, r in descending order. r, 0.5, 0 Let q = 2569 - 20439/8. Let h = q + -14. Sort -2, 2, h in decreasing order. 2, h, -2 Suppose 5z = 2v + 3, -v + 0 = 5z + 9. Let n = 5 + -9. Let p = -0.2 + -0.3. Sort n, p, z. n, z, p Let r = 0.5 - -1. Let c = r + 0.5. Sort c, 3, 2/11 in decreasing order. 3, c, 2/11 Let m be 2/11 + (-240)/594. Sort -2, 0, m in ascending order. -2, m, 0 Let l = 0 + 0. Let x be (-34)/(-51) + 8/6. Put l, x, -5 in ascending order. -5, l, x Let o = 0.2 - -1.8. Let h be (-1)/(-4 - -3) + -12. Let s = h + 6. Sort s, o, -2/3 in descending order. o, -2/3, s Let c = -18/13 - -7/52. Put -5, -1, c in decreasing order. -1, c, -5 Let q = 5 - 7. Let d be 22/6 + (-2)/(-6). Sort 2, q, d. q, 2, d Suppose -3j - 2q = -4j - 15, q = -3j - 45. Let t(i) = -i - 17. Let l be t(j). Put l, -0.3, -5 in increasing order. -5, l, -0.3 Let z = 1/7 - -5/14. Let a = -15 - -27. Let d be -42/a + 2. Sort -2, z, d in descending order. d, z, -2 Let q be 7/(1/((-1)/(-1))). Let f(c) = -c*2 + 7c - 1. Let y be f(q). Let i be (-2)/(-4)y4. Sort i, 2, 5. i, 2, 5 Let f = -58 - -59. Put f, -5, 0, -1 in descending order. f, 0, -1, -5 Suppose t = 2t + 1. Let p be (-8)/t - (-9)/(-3). Suppose 0l + 15 = pl. Sort 4, -5, l in descending order. 4, l, -5 Let r = -13 + 12.5. Put 1, 1/3, r, -0.2 in descending order. 1, 1/3, -0.2, r Let l = 9 - 7. Suppose -5p - 22 = -o, 0 = -2p + p - lo - 11. Let u be ((-4)/10)/(5/25). Sort p, u, -4 in descending order. u, -4, p Let s be (2 + -1)/(-1 + 2). Let b be (-1)/(1/6) + 0. Let u = b - -10. Sort -1, s, u. -1, s, u Let k = 1 + -2. Let q be 20/8(2 - 4). Put q, k, 1 in decreasing order. 1, k, q Suppose -6x + 2x - 6 = -2p, -5p - 37 = 3x. Put x, -3, -2 in ascending order. x, -3, -2 Let i = -0.48 + 0.5. Let t = -0.98 - i. Let n be 0 - (12/7 - 2). Sort n, t, -0.5 in decreasing order. n, -0.5, t Let k = 0.2 - 2.2. Let v = -1.8 + 2. Sort v, -1/2, k in descending order. v, -1/2, k Let q be 2/70 - 39/91. Let r = -13 + 17. Sort q, -0.5, r in descending order. r, q, -0.5 Let s(w) = 2w2 + 2w - 2. Let z be s(-2). Suppose zv = 4v. Put -3, -2, v in decreasing order. v, -2, -3 Suppose -21 = 3r - 6. Put 0, 2, r in increasing order. r, 0, 2 Let f(b) = b + 1. Let u be f(-1). Let y(j) = j2 + 5j + 2. Let t be y(-3). Sort 4, t, u. t, u, 4 Let t(i) = 3i - 38. Let v be t(13). Sort v, 2, -5, -11. -11, -5, v, 2 Let i = -64 - -446/7. Suppose 0 = 5n - 2z + 375, -2z - 2z = -3n - 211. Let k be n/28 - (-6)/8. Sort k, 0, i. k, i, 0 Let z be 4-11/(-2). Let p be (-11)/4 + z/(-8). Put -2, 4, p in descending order. 4, -2, p Let f = -25 - -24.9. Sort f, -1/3, -5 in decreasing order. f, -1/3, -5 Suppose 2d - 5 = -19. Let f = 11 + d. Let b be 42/(-144) + 2/12. Sort 1/4, b, f in ascending order. b, 1/4, f Let k = -17 - -27. Suppose 3l + k = h, 2h + h = -6. Sort -1, 0, l in descending order. 0, -1, l Let v = -21 - -17. Put 1/8, 1, v in ascending order. v, 1/8, 1 Let s be (-2)/84 + -31. Put -2, -1, s in ascending order. s, -2, -1 Let p = 24.378 + -0.478. Let x = p - 23. Let m = x + -0.4. Put 0, m, -4 in decreasing order. m, 0, -4 Suppose 5w = 2 + 3. Let o be -1 + (4 - 6)/w. Put -4, o, 5 in decreasing order. 5, o, -4 Let w(a) = -a*3 - 2a*2 + 2a - 1. Let j be w(-3). Suppose 5u + j = 4v, 2v + 4u - 20 = -2v. Sort v, -4, 4 in ascending order. -4, v, 4 Suppose -m - 3 - 4 = 3i, -4m + 8 = 0. Let j(f) = -f3 + f - 1. Let a(z) = -6z*3 - 4z*2 + 3z - 3. Let d(x) = a(x) - 5j(x). Let u be d(-2). Sort u, i, 2. i, u, 2 Suppose 0 + 3 = 3g. Let s = g + 2. Suppose -sl = -0l - 9. Sort -5, l, -3 in descending order. l, -3, -5 Let g = -28.1 + 28. Let r = -7 + 6.2. Let v = 0.2 - r. Sort v, g, 2. g, v, 2 Let v = -5.2 - -6. Let w = v + -1.7. Let c = w - -3.9. Sort c, 2, 1 in decreasing order. c, 2, 1 Let f = 106 + -113. Put -4, 0, f in decreasing order. 0, -4, f Let h = 125 + -127. Suppose 0u = 5u + 15. Sort u, 15, h in increasing order. u, h, 15 Let c = -96 - -94.94. Let a = c - -0.06. Sort a, 1, 4 in decreasing order. 4, 1, a Let y = 10 - 7. Suppose -o - 4d = -4o + 7, -o + d + 3 = 0. Let t be (-30)/(-72)2/o. Sort y, -5, t. -5, t, y Let f = -78 - -74. Sort f, -2, 1 in decreasing order. 1, -2, f Let i = 0 + 0. Suppose -3q = -iq - 3. Put -2, -4, q in decreasing order. q, -2, -4 Let l = -2.8 - 15.2. Sort 0.3, l, 1/8 in ascending order. l, 1/8, 0.3 Let d be 0/((-1)/(-1) + 0). Suppose -4m - y - 24 = -9, 3y - 20 = m. Put m, d, 3 in descending order. 3, d, m Suppose -k + 4 = 10. Put k, -3, -2 in descending order. -2, -3, k Let h(f) = -f3 - 6f*2 + 8f + 5. Let n be h(-7). Let x be (44/(-77))/(4/(-2)). Put 0, x, n in increasing order. n, 0, x Suppose 5n = -z + 3 - 8, 1 = -n - 2z. Let y = -3 + 2. Let q = 1 + y. Sort n, q, 5. n, q, 5 Let o = -56.2 + 56. Put 0, 1, -3, o in increasing order. -3, o, 0, 1 Suppose 5p + 2x - 6 = 0, 0 = 4p + 2x - 3x - 10. Suppose 0 = 2i + 6. Suppose -4q = -5l - 0q + 19, 2q = -2. Sort p, i, l in descending order. l, p, i Let w = 1.5 - 2. Let q = 1.44 + -1.49. Let g be (-13)/((-1)/(-1)). Put g, w, q in ascending order. g, w, q Let f = 120 + -116. Put f, 1, -2, -4 in decreasing order. f, 1, -2, -4 Let s = -552 - -555.01. Let z = -0.01 + s. Let o = -0.4 + 0.2. Put o, -4, z in decreasing order. z, o, -4 Let v be ((-3)/6)/((-2)/(-28)). Let x = -20 - v. Let j be x/5 + 6/(-15). Put j, 2/11, 0 in descending order. 2/11, 0, j Let x(k) = -k3 - 15k*2 - k - 20. Let c be x(-15). Sort c, 4, -1. c, -1, 4 Let a = 6 - 4. Let t = -0.21 + 0.11. Let y be (-6)/841. Put y, t, a in increasing order. y, t, a Let r = 0 + -4. Let n be (-5 - -4)/(1/7). Let l be (n/28)/((-1)/(-4)). Sort r, l, -3 in increasing order. r, -3, l Let a = -0.1 - 0.1. Put a, 0.4, 0.3 in ascending order. a, 0.3, 0.4 Let q = -2.98 + 3. Let f = 0.02 - q. Sort 2, f, 0.4 in descending order. 2, 0.4, f Let s = -6 + 5. Put 1, -6, s in descending order. 1, s, -6 Suppose -15x = -10x - 20. Sort -0.2, 1/4, -1, x in decreasing order. x, 1/4, -0.2, -1 Suppose s - 16 = -5a, 5s + 33 = -a - 7. Let k be 1 + (-2 - s/3). Let v = -7 - -12. Put 3, v, k in decreasing order. v, 3, k Let d = -58 - -284/5. Sort d, 4/3, -3, 3. -3, d, 4/3, 3 Let d be ((-3)/(-2))/((-11)/(-66)). Sort 2, -4, d, 1 in decreasing order. d, 2, 1, -4 Let q = 11 - 8. Let c = 5 - 7. Put 4, c, q in ascending order. c, q, 4 Let h(i) = -i2 + 10i + 1. Let b be h(10). Sort b, 2, 3. b, 2, 3 Let p be 6/(-4)(-2 + 4). Let i(r) = -r3 + 3r*2 + 2r + 3. Let n be i(4). Sort n, p, 1 in increasing order. n, p, 1 Let x = 10 - 13. Let d = 1.5 - -1.3. Let o = 3 - d. Sort -3/2, o, x in increasing order. x, -3/2, o Let b = 1.9 - 1.2. Let d = b + -0.3. Sort 0.1, -2, d in decreasing order. d, 0.1, -2 Suppose -2c - 4w = 10, 2c = -3w + 6w + 25. Let p(x) = x3 - 5x*2 - 2. Let b be p(c). Put b, -5, 3 in descending order. 3, b, -5 Suppose -3a + 3u + 12 = 0, u + 8 = 2a + 2u. Put -4, a, 0 in decreasing order. a, 0, -4 Suppose 0q + 16 = 2q. Let o be (8/(-5))/((-10)/25). Let f = o - q. Put -5, f, -1 in ascending order. -5, f, -1 Let x = -1.5 + -1.5. Let q(l) = -3l - 1. Let w be q(1). Sort 0.4, x, w in descending order. 0.4, x, w Let m be (-6)/4 + (-2)/4. Let q be (6/(-18))/((5/9)/(-5)). Suppose 9 = 5r - 1. Sort m, q, r in ascending order. m, r, q Let l(b) = b2 + 6b + 4. Suppose g + 5s = -11, -6s = -g - 9*s - 9. Let u be l(g). Let r = u - 3.	{ "pile_set_name": "DM Mathematics" }
o - 10. Which is the nearest to k? (a) -1/4 (b) -2/3 (c) -1 a Let q(m) = -6m3 - m2 - 2. Let j be q(-2). Suppose 2527d = 2501d + 52. Let g be -2 + 10/d + j/(-10). What is the nearest to g in 3, 5, -0.4? -0.4 Let q = 12811 + -12811. Which is the nearest to 0? (a) q (b) -9 (c) 0.6 a Let i = -5642/5 - -1129. Which is the nearest to i? (a) 2/3 (b) -0.4 (c) -1.7 (d) 2 a Let m = -93 + 647. Let k = m - 554. Let x = -78/11 - -568/77. What is the nearest to k in -1, -12, x? x Let i = -43 - -299/7. Let q = 1.28 - 0.08. Let u = -0.2 + q. What is the closest to i in -8, 2/7, u? 2/7 Let c(w) = -w3 + 6w*2 - w + 3. Let j be c(6). Let v be j/12 - (4/48 - 0). Let k = 235/72 + -26/9. What is the closest to -1/3 in k, v, 0.3? v Let i be 2/(-3) + 13/(-3). Let o = -14.1 + 54.1. Let y = -40 + o. What is the closest to y in 1/3, i, 0.1? 0.1 Let d = 128.5 + -129. Let p(n) = 3n - 38. Let f be p(11). Let h = 0.1 + -1.1. Which is the nearest to h? (a) f (b) d (c) 7 b Let b = -20524/5 + 4104. What is the closest to 4 in -5, 5, -2, b? 5 Let s = -0.1239 + 0.1239. Which is the nearest to 4/13? (a) -3 (b) s (c) 5 (d) 4 b Let n = 59 - 44.6. Let g = n + -18.4. Which is the nearest to 2? (a) g (b) -0.3 (c) -2/5 b Suppose -29 + 79 - 39 = -11w. Which is the closest to 0? (a) 7 (b) -5 (c) w (d) 136 c Let y be (-5 + -1)/((-3)/(-2)). Suppose 0 = 65d - 66d + 21. Let u be -18 + d + -31. Which is the closest to u? (a) -8 (b) y (c) 0.5 c Let f = 6682 + -6681.6. Which is the closest to -14? (a) 0.03 (b) 3 (c) -2 (d) f c Let g = 5 - 4.5. Let y = 1.1 - 1.223. Let w = -0.223 - y. What is the nearest to w in 0.3, 3/5, g? 0.3 Suppose 7i + 31i + 37i = -750. Which is the nearest to 2? (a) -4 (b) i (c) -1/8 (d) -1 c Let l be (-6)/4-199 + 60/120. Suppose -16j + 789 + l = 0. Let t = 273/4 - j. Which is the closest to 0.2? (a) 0.4 (b) t (c) 0.3 b Let c be (-5)/25 - (-63)/165. Let u = 3182 + -3177. Let y be (-14)/(-12) + 2/(-4). What is the nearest to y in c, -0.03, u? c Let j = 2 - -2. Suppose -2f = i + 1, 0 = -jf + i - 3 + 4. Suppose 4k = 6k. Which is the nearest to k? (a) -2/9 (b) -5 (c) f c Let h = -12 + 28. Suppose 15f - hf = 2. Let p be (-10)/4f + -10. Which is the nearest to 0.1? (a) -0.5 (b) p (c) -2/3 a Let r = -0.16899 - -3.16899. Which is the nearest to 1/8? (a) r (b) 3/4 (c) 0.057 c Let y = 1.377 - 0.377. Suppose -3i - 2q + 3 = 0, -q + 4 = 2i + 1. Which is the closest to -1? (a) i (b) -11 (c) y c Let q be -18((-110)/33)/(-5). Let s = 0.037 + -5.037. What is the closest to q in s, 4, 0.1? s Suppose 4z = -200 + 220. Let q = -86/3 + 29. Let f = 18 + -18.5. Which is the closest to -3/2? (a) q (b) f (c) z b Let m be 14/(-80)-4. Let x = -46 + 52. Suppose 2v - xv + 17 = k, 2k = 5v - 18. Which is the closest to 0? (a) v (b) 5 (c) m c Let l = 413473 - 5382903/13. Let h = l - -596. Let m = 0.0527 - -0.3473. Which is the closest to h? (a) m (b) -0.3 (c) 1/6 b Let c be 249/(-332) - 1/(-4). Let l = 20 - 35. Let w be (3/9)/(-1)l. What is the closest to c in -2, -0.4, w? -0.4 Suppose -9 = -2p + 3k + 173, -k = 2. Let r be (-11)/(p/32) + (-30)/(-8). Let d = -1 + 4. What is the closest to -0.07 in 2, r, d? r Let j = -1271/7 + 181. Let p = -13/14 + j. Let l = 30.9 - 30.5. Which is the closest to -3/5? (a) p (b) l (c) -2/17 c Let h = 76.2 + -127. Let q = -51 - h. What is the nearest to 1 in q, 0.2, 0.16? 0.2 Let s be (-32)/(-24)(-77)/16. Let u = s + 27/4. Let r = -2173 - -2177. What is the nearest to 1 in -1/5, u, r? u Let d(w) = -50w + 449. Let o be d(9). Let p be -174/18 + 65 + -61. What is the nearest to o in 5/6, 0, p? 0 Let x = -67.19 + -0.81. Let p = x - -67. Let y = 71 - 499/7. What is the closest to y in p, -0.3, 2/7? -0.3 Suppose 41h = 40h + 2. Let k = -68 + 104. Let s = k + -36. Which is the nearest to s? (a) 0.07 (b) 4 (c) h a Suppose 2h + 3k = 20, 0 = 55h - 59h - 4k + 32. Let v be (-3)/18-3(-16)/12. Which is the nearest to v? (a) 5/4 (b) 1/4 (c) -0.06 (d) h c Let s = -2229 + 430. What is the nearest to 2/9 in 3, -0.1, s? -0.1 Let r = 0.02747 - -4.97253. Which is the closest to 0? (a) r (b) 3 (c) 4/5 (d) -168 c Let y = 1656/7 - 236. Let j = -0.04714 - 9.95286. What is the nearest to -1 in -4/9, y, j? -4/9 Let k = 22.6 + -22.4. What is the closest to -2 in 1/3, -10.6, k, 2/5? k Let f = 8127 + -16253/2. Let z = -0.6 + 0.1. What is the closest to -1 in 1/4, z, 0.3, f? z Suppose 97k - 275 = -193k + 15. What is the nearest to 58 in -0.09, 1/2, k? k Let m = -163.03 - -157.03. Which is the nearest to 2/3? (a) -1/4 (b) m (c) -3/4 (d) -1 a Let k = 1484 + -1483. What is the closest to k in -5, 0.3, 3, 2? 0.3 Let t = -6.97 + 7. Let m = -5.03 + t. Let d = 300/59 + -777/118. What is the closest to 0.1 in d, m, 0.2? 0.2 Let k = -0.3 - -0.1. Let p(a) = a*2 - 5a - 8. Let l be p(6). Let s be (48/15 + l)/((-3)/20). What is the closest to -0.1 in k, s, 2? k Let a be 35/75 + ((-36)/(-15))/(-4). Let s = 13 - -23. Let h = -33 + s. What is the nearest to h in a, 0.5, 0.1? 0.5 Let p = 14.7 + 18. Let n = -33 + p. Let t = -340 - -1361/4. Which is the closest to t? (a) n (b) -0.09 (c) -1 b Suppose 3s - 8j - 247 = -9j, -2j - 94 = -s. Let l = -167/2 + s. Which is the closest to 0.4? (a) l (b) 2/7 (c) 4/5 a Let d(p) = -p + 17. Let o be d(21). Let u(y) = -13 + 2 - 2 - 3y. Let f be u(o). What is the nearest to 0 in 4, f, -5? f Let l be (190/1710)/((-2)/18). Suppose 1 + 3 = -4i. What is the nearest to i in -0.06, l, -0.3, 1/2? l Let o = -6 + 8. Suppose 12g = 15g - 9. Let r = 0.62 + 4.38. What is the closest to o in r, -1/2, g? g Suppose -3r + r + 14 = 5q, 3 = -3q - 5r. Let j be (-147)/210 - 4/(-20). What is the nearest to 3 in q, 1, j? q Suppose 0 = -m + 4g + 22 + 2, 0 = 2g + 14. What is the nearest to -1/4 in m, -79, -0.4? -0.4 Let o be 4 - (186/3)/(240/(-33)). Let l = o + -105/8. Which is the closest to l? (a) -3 (b) -1 (c) 2/3 b Let u = 44807 - 134419/3. Which is the nearest to 2/3? (a) 1541 (b) u (c) -2/9 b Let i = 15 - 27. Let s = -16121 - -16106. Let l = i - s. Which is the closest to 0.4? (a) -6/7 (b) l (c) -4 a Let z = 645 + -642. Let y = 230/1463 + -4/77. Which is the nearest to y? (a) -2/11 (b) -0.2 (c) -2/5 (d) z a Let j = 507.33 + -507. Let k = -422.67 - -425. Let t = j - k. Which is the nearest to 0? (a) -3 (b) -2/15 (c) t b Let b = -4.95 - -5. Let h = b - 4.05. Let a = 19/14 + -181/154. What is the closest to a in 5, 2/11, h? 2/11 Let q = -2 + 4. Let i be (1 - -1)1 - (1363/987 - (-40)/140). What is the closest to -1/4 in 2/7, i, -1/4, q? -1/4 Let x = 4.04043 + -0.04043. Which is the closest to -0.3? (a) x (b) 0.3 (c) 0.5 (d) 1 b Let l = -2577.5 + 2578. Which is the nearest to -2/87? (a) -1/8 (b) 0 (c) -0.4 (d) l b Suppose 5i + 40 - 200 = 5u, -31 = -i + 2u. Suppose -37d + 26d - i = 0. Which is the closest to -6? (a) 0.3 (b) -1 (c) d c Let y = -135 - -134. What is the nearest to 16 in 30, 0.4, -5, y? 30 Suppose 0 = 5d - 5 - 20. Let h = 0 - -0.1. Let u = 0.056647 + -1.056647. Which is the closest to u? (a) 4 (b) h (c) d b Let w be 8 + 0 + 12/(-4). Suppose 4v - 1 = wv. Let h = 189 - 187. What is the closest to v in -1/3, 1, h? -1/3 Let n be 1621/(-420)(-55)/(-2). Which is the nearest to -1/2? (a) n (b) 3 (c) 1.7 c Let k = 241 - 136. Let r = k + -100. What is the nearest to 2/3 in -2/53, -0.3, r? -2/53 Let s = -2299.3 - -2404. Let i = s + -105. Let g = 0.39 + 0.01. Which is the nearest to -0.03? (a) i (b) g (c) -1 a Suppose -113s = 32s + 1015. Which is the closest to -0.1? (a) -8 (b) s (c) -2.9 c Let z = 29 + -29.5. Let m = -11.7 - -12. Let l = -1.7 - m. Which is the closest to 0.2? (a) 2/5 (b) l (c) z a Let f(i) = -2i + 6. Let g be f(5). Suppose 557s + 4x + 66 = 555s, 13 = 3s - 2x. Which is the closest to g? (a) 1 (b) 3/7 (c) -0.1 (d) s d Suppose -3 = 14k + 81. Let w be (-34)/(-8) - k/243. Suppose -5y - 1 = -f + w, -5 = -4f + y. Which is the nearest to 1? (a) f (b) 0.2 (c) 5 a Let f = 1084.93 + -1085. Let r = -0.01 + 0.21. What is the closest to f in -0.1, 2, r? -0.1 Let w be (1/45)/((-455)/(-45) + -10). What is the closest to 2/3 in w, 2, 1/4, 11? 1/4 Suppose 21 - 161 = 7y. Let f be y/20*(1	{ "pile_set_name": "DM Mathematics" }
d*2 + 712d + 32 = 0. -2, -1, -2/41, 4 Factor 2n2/21 - 2n/3 - 96/7. 2(n - 16)(n + 9)/21 Suppose -4m4 - 124m*3 - 1092m*2 - 3620m - 3800 = 0. What is m? -19, -5, -2 Determine r so that 4r4/7 + 40r*3/7 - 100r*2/7 - 40r/7 + 96/7 = 0. -12, -1, 1, 2 Suppose 3p4/8 - 21p*3/4 + 195p*2/8 - 93p/2 + 63/2 = 0. Calculate p. 2, 3, 7 Determine j so that -14j4/9 + 178j*3/9 - 368j*2/9 - 40j/3 = 0. -2/7, 0, 3, 10 Factor -j*4 + 33j*3 - 242j2. -j2(j - 22)(j - 11) Determine b, given that -18b3/17 - 14b*2/17 + 40b/17 - 8/17 = 0. -2, 2/9, 1 Solve 42r5/17 + 1090r*4/17 + 3780r*3/17 + 2840r*2/17 + 528r/17 = 0. -22, -3, -2/3, -2/7, 0 Let -4c5/3 + 8c*4/3 + 64c*3/3 - 8c*2/3 - 20c = 0. What is c? -3, -1, 0, 1, 5 Solve 2k2/11 + 12k/11 - 10 = 0. -11, 5 Factor 2k3/7 - 2k*2/7. 2k*2(k - 1)/7 Factor 2c4 - 42c*3 + 250c*2 - 582c + 468. 2(c - 13)(c - 3)*2(c - 2) Find v such that v*2/7 + 15v/7 + 36/7 = 0. -12, -3 Let -2d3 - 58d*2 - 110d - 54 = 0. What is d? -27, -1 Factor -i*3 + 37i*2 - 239i + 203. -(i - 29)(i - 7)(i - 1) Solve 2m3/3 + 86m*2/3 - 178m/3 + 30 = 0. -45, 1 Factor 3d3/5 + 66d*2/5. 3d*2(d + 22)/5 Factor d*2/3 + 145d + 866/3. (d + 2)(d + 433)/3 Factor 2j*2/21 - 22j/21. 2j(j - 11)/21 Factor 7w3/3 + 16w*2/3 + 11w/3 + 2/3. (w + 1)*2(7w + 2)/3 Factor -4z*3/7 - 652z*2/7 + 4z/7 + 652/7. -4(z - 1)(z + 1)(z + 163)/7 Solve 3m*5 + 54m*4 - 195m*3 - 90m*2 + 732m - 504 = 0 for m. -21, -2, 1, 2 Let -2k2/19 + 556k/19 - 38642/19 = 0. What is k? 139 Factor z*3/3 + 29z*2/3 + 104z/3 + 100/3. (z + 2)*2(z + 25)/3 What is r in r*3 + 2r*2 - 11r - 12 = 0? -4, -1, 3 Factor -3a4 + 3a*3 + 21a*2 - 39a + 18. -3(a - 2)(a - 1)*2(a + 3) Factor 189q2 - 2274q + 72. 3(q - 12)(63q - 2) Suppose 3s*2 - 627s + 624 = 0. What is s? 1, 208 Factor d*4/2 - 37d*3 + 2029d*2/2 - 12210d + 54450. (d - 22)*2(d - 15)*2/2 Factor 40l*4 - 175l*3 + 180l*2 - 45l. 5l(l - 3)(l - 1)(8l - 3) Factor -4t*4 + 88t*3 - 272t*2 - 2392t - 2028. -4(t - 13)2(t + 1)(t + 3) Factor -8o*5 + 50o*4 - 84o*3 + 18o*2. -2o*2(o - 3)*2(4o - 1) Determine v so that -2v*5/5 + 48v*4/5 - 82v*3 + 1428v*2/5 - 1568v/5 = 0. 0, 2, 7, 8 Determine q so that 2q4 + 8q*3 - 10q*2 = 0. -5, 0, 1 Factor 45z*5 - 140z*4 + 150z*3 - 60z*2 + 5z. 5z(z - 1)*3(9z - 1) Factor -r5 + 111r*4 + 808r*3 + 2104r*2 + 2352r + 944. -(r - 118)(r + 1)(r + 2)*3 Factor 2v*2/3 + 6064v/3 + 4596512/3. 2(v + 1516)2/3 Factor 3w*3 + 291w*2 + 9288w + 97200. 3(w + 25)(w + 36)*2 Solve -3b*4/4 - 261b*3/2 + 1587b*2/4 - 531b/2 = 0. -177, 0, 1, 2 Factor -2m2/5 - 424m/5 - 168. -2(m + 2)(m + 210)/5 Solve 4f4/5 + 732f*3/5 + 144f*2 - 1456f/5 = 0. -182, -2, 0, 1 Factor -p*3/3 - 106p*2/3 - 703p/3 - 330. -(p + 2)(p + 5)(p + 99)/3 Factor -2h2/3 + 1030h/3 + 1036. -2(h - 518)(h + 3)/3 Factor 9w3 + 492w*2 - 171w - 330. 3(w - 1)(w + 55)(3w + 2) Factor -2m3/3 - 8m*2/3 - 8m/3. -2m(m + 2)2/3 Solve j3/4 + 189j2/4 + 93j/2 - 94 = 0. -188, -2, 1 Solve 5w3 + 190w*2 + 825w = 0. -33, -5, 0 Factor 4f2 + 616f - 5184. 4(f - 8)(f + 162) Factor 15k3/2 - 642k*2 + 27219k/2 + 5547. 3(k - 43)2(5k + 2)/2 Suppose 3f*5/2 + 57f*4 + 111f*3/2 = 0. Calculate f. -37, -1, 0 Let 4w*2 + 12w + 5 = 0. What is w? -5/2, -1/2 Factor a*2 + 17a - 60. (a - 3)(a + 20) What is n in -n5 + 7n*4 - 10n*3 - 2n*2 + 11n - 5 = 0? -1, 1, 5 Find n, given that 2n5/5 + 616n*4/5 - 498n*3 + 376n*2 + 2488n/5 - 2496/5 = 0. -312, -1, 1, 2 Factor -b*3/2 - 9b*2 - 54b - 108. -(b + 6)3/2 Factor z4/4 - z3/4 - z2/4 + z/4. z(z - 1)2(z + 1)/4 Determine j, given that 3j3/5 - 18j2/5 = 0. 0, 6 Factor c2 + 822c + 1640. (c + 2)(c + 820) Let 5y3 - 15y*2 - 80y - 60 = 0. Calculate y. -2, -1, 6 Factor -y*5 - 4y*4 - 3y*3 + 4y*2 + 4y. -y(y - 1)(y + 1)(y + 2)2 Find z such that -4z*2 - 7584z - 3594816 = 0. -948 Suppose 2o5 - 72o*4 + 698o*3 - 1188o*2 + 560o = 0. Calculate o. 0, 1, 14, 20 Factor 3l4 + 984l*3 - 11115l*2 + 24516l + 36612. 3(l - 6)2(l + 1)(l + 339) Determine j, given that -2j*4/3 + 6j*3 - 4j*2/3 - 32j = 0. -2, 0, 3, 8 Solve 2k2/13 + 1088k/13 - 168 = 0. -546, 2 Factor 40d3 + 65d*2 + 25d. 5d(d + 1)(8d + 5) Factor 4l3 + 1296l*2 + 5136l + 5120. 4(l + 2)2(l + 320) Factor 3o4 - 27o*3 + 45o*2 - 21o. 3o(o - 7)(o - 1)2 Suppose -2x*2/9 - 4x/3 + 14/9 = 0. Calculate x. -7, 1 Determine i, given that -2i4 - i3 + 2i*2 + i = 0. -1, -1/2, 0, 1 Solve 100d*4 - 7080d*3 + 128116d*2 - 99120d + 19600 = 0. 2/5, 35 Find r, given that -105r5 + 65r*4 + 95r*3 - 65r*2 + 10r = 0. -1, 0, 2/7, 1/3, 1 Find d, given that -16d3/11 + 232d*2/11 - 113d/11 + 14/11 = 0. 1/4, 14 Let 4n2/3 + 688n/3 + 896 = 0. Calculate n. -168, -4 Let 22k4/19 + 1118k*3/19 + 15636k*2/19 + 35136k/19 - 6912/19 = 0. What is k? -24, -3, 2/11 Factor -2p2 - 9276p - 10755522. -2(p + 2319)2 Factor 5h*5/3 - 95h*4/3 + 710h*3/3 - 870h*2 + 1575h - 1125. 5(h - 5)2(h - 3)*3/3 Factor -9x*3 - 78x*2 - 111x - 42. -3(x + 1)(x + 7)(3x + 2) Suppose -3c2/4 + 1725c/4 - 861/2 = 0. Calculate c. 1, 574 Factor -3d5 + 42d*4 - 216d*3 + 480d*2 - 384d. -3d(d - 4)*3(d - 2) Factor 1225z2 - 35z + 1/4. (70z - 1)2/4 Solve -4c*3/5 - 4c*2/5 + 48c/5 = 0. -4, 0, 3 Factor -2b3 + 20b*2 + 46b + 24. -2(b - 12)(b + 1)*2 Factor 2p*5/9 + 56p*4/9 + 194p*3/9 - 2668p*2/9 + 6392p/9 - 4624/9. 2(p - 2)3(p + 17)*2/9 Determine q, given that -2q*4 - 24q*3 - 20q*2 + 24q + 22 = 0. -11, -1, 1 What is p in -2p2 + 2004p - 2002 = 0? 1, 1001 Suppose 2z2/3 + 48z + 864 = 0. What is z? -36 Factor -n*2/3 + 11n/3 + 14. -(n - 14)(n + 3)/3 Factor t2/8 + 41t/8 - 33/2. (t - 3)(t + 44)/8 Factor i4/5 - 2i*3/5 - 27i*2/5 - 52i/5 - 28/5. (i - 7)(i + 1)(i + 2)2/5 Factor p3/2 - 11p2 - 233p/2 - 105. (p - 30)(p + 1)(p + 7)/2 Factor 5l2 - 30l - 80. 5(l - 8)(l + 2) Let -9a3 + 1419a*2 - 943a + 157 = 0. Calculate a. 1/3, 157 Factor -231u2 + 6u. -3u(77u - 2) Suppose 3x*3/2 - 75x*2/2 + 141x/2 - 69/2 = 0. Calculate x. 1, 23 Determine m, given that -6m5/5 + 56m*4/5 + 112m*3/5 - 1548m*2/5 + 406m/5 + 196 = 0. -5, -2/3, 1, 7 Let -3o4/7 - 2o*3/7 = 0. What is o? -2/3, 0 Solve 5s*3 + 110s*2 - 795s + 1260 = 0. -28, 3 Determine j so that -2j4 - 8j*3 - 12j*2 - 8j - 2 = 0. -1 Factor -g*4 - 30g*3 + 204g*2 + 13294g + 103173. -(g - 21)(g + 17)3 Factor 5q*3 - 585q*2. 5q*2(q - 117) Solve -5c3 - 75c*2 - 180c = 0 for c. -12, -3, 0 Let 242x5/7 - 54120x*4/7 + 3069426x*3/7 - 4841836x*2/7 - 2066376x/7 - 197136/7 = 0. What is x? -2/11, 2, 111 Factor -22t2 + 6032t - 1096. -2(t - 274)(11t - 2) Suppose 2g*2/9 + 10g/9 - 56/3 = 0. What is g? -12, 7 Let 5w5/3 - 32w*4/3 + 37w*3/3 - 10w2/3 = 0. What is w? 0, 2/5, 1, 5 Let z4 + 6z3 - z2 - 30z = 0. Calculate z. -5, -3, 0, 2 Suppose 5w3 + 380w*2 - 395w - 770 = 0. Calculate w. -77, -1, 2 Factor -5h3 - 80h*2 - 315h. -5h(h + 7)(h + 9) Factor -3w*4 - 15w*3 + 39w*2 - 21w. -3w(w - 1)*2(w + 7) Solve -45u4 - 84u*3 + 690u*2 - 84u - 45 = 0. -5, -1/5, 1/3, 3 Factor -28h2 - 16080h - 4592. -4(h + 574)(7h + 2) Factor -4u*2 - 884u - 5992. -4(u + 7)(u + 214) Determine k, given that -14k2 - 204k - 112 = 0. -14, -4/7 Determine t, given that t*5 - 5t*4 - 174t*3 - 968t*2 - 1952t - 1152 = 0. -4, -1, 18 Find n such that 5n4 + 1075n*3 - 15n*2 - 3215n + 2150 = 0. -215, -2, 1 Solve -2w5/5 - 6w*4/5 + 12w*3/5 + 16w*2/5 = 0. -4, -1, 0, 2 Factor 3y*4/2 - 423y*3/2 - 429y*2. 3y*2(y - 143)(y + 2)/2 What is j in -2j*4 - 188j*3/3 - 838j*2/3 - 136j/3 + 520/3 = 0? -26, -5, -1, 2/3 Determine d, given that 3d3 - 30d*2 + 69d - 42 = 0. 1, 2, 7 Suppose -5j5/4 + 395j*4/4 - 7595j*3/4 - 8395j*2/4 + 1900j + 2000 = 0. Calculate j. -1, 1, 40 Solve 5d*2/	{ "pile_set_name": "DM Mathematics" }
divided by c. 1 Suppose 10 = 5v, -4k - 5v + 4v = -2. Suppose -97 = -3g - 2q, g - 4g + 2q + 89 = k. What is the remainder when g is divided by 11? 9 Suppose 0 = -2g - 4x + 280, -g - x = g - 295. Calculate the remainder when 9 is divided by 2/(-13) + g/(-39) - -9. 4 What is the remainder when 4 - (-28)/(-70)(0 - 70) is divided by 19? 13 Suppose 0 = 2w - 0w + 3y + 13, 5y + 21 = -4w. What is the remainder when 28 is divided by w? 0 Suppose 6u = u - 40. Let a = u + 11. Suppose 0w - 8 = -4l + 2w, -5w = -5l + 5. Calculate the remainder when l is divided by a. 0 Suppose 6 = 8w - 18. Suppose 2t = 2h - 52, 3t = -wh + 8t + 74. Calculate the remainder when h is divided by 10. 8 Let a(s) = s*2 + 6s + 6. Let b be a(-4). Suppose 4q - v - 87 = 0, 5q - 3v - 124 = -24. What is the remainder when 1393/21 + b/6 is divided by q? 20 Suppose -z + 3h = -91, 7z - 309 = 3z + h. What is the remainder when -7 + 3 + -3 + z is divided by 18? 15 Let f = -68 + 74. What is the remainder when 12 is divided by f? 0 Let o(w) = -8w - 3. Let n = 59 - 51. Suppose -16 - n = -i. What is the remainder when i is divided by o(-2)? 11 Suppose -5n - 1165 = -10n - 2o, -3o = -4n + 955. Calculate the remainder when n is divided by 78. 1 Let o = -243 - -266. What is the remainder when 65 is divided by o? 19 Suppose -20 = 4j, -16 = w + 4j - 41. What is the remainder when w is divided by 27? 18 Suppose -g + d = -2, 10 = 2g - 0d + d. Suppose 32 = 3u - g. What is the remainder when 142 is divided by u? 10 Let l = -129 + 221. What is the remainder when l is divided by 19? 16 Let m(c) = 0 + 2c*2 - 5c*2 + 0c*2 + 7c - 3. Let a be m(5). Let v = a - -84. What is the remainder when v is divided by 11? 8 Let m be 6 - 1 - 3/1. Suppose -3h - mg = -100, -2h - 2g = -0h - 64. Calculate the remainder when 69 is divided by h. 33 Let r = -770 - -808. What is the remainder when 74 is divided by r? 36 Let w = 650 + -452. Calculate the remainder when w is divided by 41. 34 Suppose b = 7 + 22. Suppose -5u = -u - 336. What is the remainder when u is divided by b? 26 Let x be 8/(-14) + 21219/77. Suppose 5f = 2p - 93, 0p - 4f - x = -5p. Let a = 37 - 22. Calculate the remainder when p is divided by a. 14 Calculate the remainder when 70 is divided by -1 + (30/6 - -2). 4 Let p(j) = 6j*3 + 113j*2 - 21j + 8. What is the remainder when p(-19) is divided by 8? 6 Let h(r) = 5r3 + 21r*2 - 3r. What is the remainder when h(4) is divided by 72? 68 Suppose -2l + g = -7, -4l + 11 + 2 = -g. Suppose -h + 3a - l = 0, 2h - 14 = -a - 3a. What is the remainder when 21 is divided by h? 0 Calculate the remainder when 970 is divided by -1 - (-28)/16 - 897/(-52). 16 Let t(o) = -o3 - 9o*2 - 28o - 11. Calculate the remainder when 193 is divided by t(-6). 46 Let x(k) = -k*3 - 16k*2 - 7k - 6. Suppose -5y = -10y + 155. Let s = y + -4. What is the remainder when x(-16) is divided by s? 25 Suppose -2p - p + 2a + 34 = 0, -2a - 2 = p. Let c = -17 + 25. Suppose -4s = -108 - c. What is the remainder when s is divided by p? 5 Suppose q + 3 = -2. Let t be 6/(-4)10/(-15). Let u = t - q. Calculate the remainder when 23 is divided by u. 5 Let t(f) = f3 + 3f*2 - 3f + 2. Let a = 92 + -60. Calculate the remainder when a is divided by t(-3). 10 Let q = 6 - 5. Let s be (-6)/(q - (-20)/(-8)). Calculate the remainder when (s + -6)(-42)/4 is divided by 6. 3 Let p(x) = -x2 + 13x + 19. What is the remainder when 2/4 - 34/(-4) is divided by p(14)? 4 Suppose -2q + 7q - 345 = 0. Let g = q + -60. Calculate the remainder when 15 is divided by g. 6 Let g(q) = -11q + 36. Calculate the remainder when 101 is divided by g(0). 29 Let v(x) = -134x - 1. What is the remainder when v(-1) is divided by 2/((-602)/(-119) + (1 - 6))? 31 Suppose -n = -j - 6n + 36, 39 = 2j - n. Calculate the remainder when 40 is divided by j. 19 Let b(v) = v*2 + 4v. Let u be b(-9). Let l = 30 + u. What is the remainder when l is divided by 26? 23 Suppose 2m + 4s = 464, -3m - 2m + 5s + 1160 = 0. What is the remainder when m is divided by 59? 55 Let m(u) = -2u + 5 - 4 + u*2 + 3u*3 + 1. What is the remainder when 7 is divided by m(1)? 3 Suppose -8v - 411 = -3539. Calculate the remainder when v is divided by 28. 27 Suppose -198 = -11s + 44. Let u = s - -56. Calculate the remainder when u is divided by 20. 18 Suppose -5z = y - 20, -4z - z + y = -20. Let m be 2/((-45)/(-12) + -4). What is the remainder when 17 is divided by m/(-1) - (z + -1)? 2 Let c(y) = -y - 5y + 1 + 3 - y. Calculate the remainder when 35 is divided by c(-2). 17 Suppose 2t = -3f + 52, -112 = -3t - 3f + 7f. What is the remainder when 254 is divided by t? 30 Suppose c = -c + 40. Suppose -30l - 444 + 2754 = 0. Calculate the remainder when l is divided by c. 17 Suppose u - 5z = -3, -17 = -3u - 5z + 34. Suppose 0 = c - 1, -5f + 24 + 20 = 4c. What is the remainder when u is divided by f? 4 Suppose -2k + 9 = -5k, 0 = -3z - k + 114. Suppose 14 = 3j + 4j. Suppose 9 = -jp + z. What is the remainder when 57 is divided by p? 12 Let u(z) = z2 - 13z - 16. Let l be u(15). Let c = l + 5. Calculate the remainder when c is divided by 7. 5 Let s = -114 - -228. Calculate the remainder when (s/18)/((-2)/(-6)) is divided by 5. 4 Let s = -905 + 918. What is the remainder when 72 is divided by s? 7 Let b = -58 - -58. Suppose 0 = -2x - 6, x = k - 10 - b. What is the remainder when 47 is divided by k? 5 Suppose 0 = -4q + 4p + 176, 2q + 5p - 9 = 51. Suppose -25v + 24v + 7 = 0. Calculate the remainder when q is divided by v. 5 Let o(q) = q2 - 8q + 8. Let m be o(7). Suppose m = -5h + 31. Let k(z) = 2z + 13. Calculate the remainder when k(2) is divided by h. 5 Suppose -3i = 9, 6 = y - i - 3. What is the remainder when 6 is divided by y? 0 Let n(l) = l2 + 14l - 213. Calculate the remainder when n(20) is divided by 89. 22 Suppose -p = 4p + 5q - 10, -q - 4 = 4p. Let t = 89 + -48. Calculate the remainder when t is divided by (p/3)/((-10)/165). 8 What is the remainder when 150 is divided by 5/(15/(-4))(-33)/2? 18 Let s(a) = -7 + 3a - a2 + 6 + 0a*2 + 7a - 8. Let u = 17 + -10. Calculate the remainder when 58 is divided by s(u). 10 What is the remainder when 102 is divided by ((99/2)/(-11))/(2/(-24))? 48 Suppose 5m = -5m + 30. Suppose -5k = 5i - 65, -5k + 72 = mi + 23. Calculate the remainder when i is divided by 4. 0 Let n(a) = -a*3 + 7a*2 + 8a + 11. Let l = 577 + -1597. Calculate the remainder when n(8) is divided by 4/(-14) + l/(-140). 4 Suppose 0 = -29x + 5x + 3048. What is the remainder when x is divided by 8? 7 Let z(i) = i*2 + 2i + 49. What is the remainder when z(-11) is divided by 31? 24 Suppose 2 = -5p + 3p. Calculate the remainder when 2 - p - (-57)/22 is divided by 16. 12 What is the remainder when 139 is divided by 5(-18)/30-13? 22 Let m = 63 + -46. Suppose -mr = -23r + 114. Calculate the remainder when 55 is divided by r. 17 Suppose 2x = 3 - 5. What is the remainder when (2 + x + -2)-33 is divided by 17? 16 Suppose -4 = -o, -3i + 5o = 9o - 1270. Calculate the remainder when i is divided by 20. 18 Suppose -3r + 24 = -6. Let k(h) = -h3 + 6h*2 + 2h + 12. Calculate the remainder when k(5) is divided by r. 7 Let d be 10/35 + 523/7. Let h = d - 62. What is the remainder when 35 is divided by h? 9 Suppose -12 + 45 = -3l. Let f be 82/4 - 9/(-6). Let q = l + f. What is the remainder when 30 is divided by q? 8 Let q(s) = s2 - 3s + 5. Let f be q(-8). Suppose 69 = 3p - f. Suppose 6 = 5o - p. What is the remainder when o is divided by 5? 2 What is the remainder when 211 is divided by (-3)/27172/(-489)? 13 Let m = 459 - 437. Calculate the remainder when 41 is divided by m. 19 Suppose 3l + j + 207 = 0, 3l + 5j - 7j + 198 = 0. Calculate the remainder when 121 is divided by (l/102)/(2/(-93)). 28 Let r(s) = 9s - 67. Suppose -38 = -3q + 4. Calculate the remainder when r(12) is divided by q. 13 Let j = 29 - 14. What is the remainder when 4/(-18) + 16764/594 is divided by j? 13 Suppose -2992 = -38b - 6b. What is the remainder when b is divided by 5? 3 What is the remainder when ((-8)/(-4) - -34) + -8 is divided by 12? 4 Suppose 3v - 3q - 45 = 0, 3v - 30 = v - q	{ "pile_set_name": "DM Mathematics" }
)/(h/(-184892)) a composite number? False Let n(g) be the third derivative of g6/30 - g5/5 + 5g4/6 + g3/2 - 2g*2. Let z = 2629 + -2620. Is n(z) composite? True Is (-1 - (-2040732)/8) + (-73)/(-146) composite? True Let o = 61 - 64. Let g(y) = 6y + 16. Let d be g(o). Is 4/d(-531)/18 composite? False Suppose 8c + c - 68949 = 0. Is c a composite number? True Let a(g) = 13g3 + 3g*2 - 3g + 2. Let f be a(3). Suppose 64 = -w - 0w. Let y = w + f. Is y composite? False Suppose -2 = -83b + 84b. Let h(p) be the third derivative of 73p5/20 + p4/12 - p*3/2 - 16p*2. Is h(b) prime? False Suppose -4v = -3v + 3j - 23154, 3v - 69392 = 5j. Suppose -7689 = -w - 5n, -3w - 28n + 31n + v = 0. Is w composite? True Let p(v) = 224v3 - 6v*2 + 13v - 18. Let n be p(3). Suppose 0 = 10q - 9415 - n. Is q composite? False Let j(a) = -18545a - 6. Let y(f) = -f - 1. Let h(q) = 2j(q) - 4y(q). Is h(-1) a composite number? True Suppose q - 16q = 193560. Let y = -8799 - q. Is y a prime number? False Let u be (-1582)/56 + (-6)/8 + 1. Let q be (u/(-2))/(-7)(-2)/(-4). Let c(j) = 793j2 + 2j. Is c(q) prime? False Let t be ((-20)/(-6) - 2)/(15/45). Suppose -tn + 15834 = -3002. Is n prime? False Let z = 239 + -235. Suppose -zx = -4c - 14444, c = -5x + 2c + 18039. Is x prime? True Let i(s) = 30s*2 - 23s + 90. Let g be i(3). Let y(b) = b*2 + b. Let w be y(-1). Suppose -32c + 31c + g = w. Is c a composite number? True Let t be ((-5)/1 - -5) + -2. Is (3 - -40251)/2 + (-2 - t) prime? False Let f = -39165 + 95558. Is f composite? False Suppose 73b - 69b = 12, 53843 = 2f - 5b. Is f prime? False Suppose -2295b + 7257020 = -2275b. Is b a prime number? True Let y = 67 + -58. Suppose 3x - 3644 = -i, -10x = -yx + i - 1218. Is x prime? True Is (-59439360)/(-69) - (1 + -10) composite? True Suppose -2u + 337899 = -5f, 656606 + 188059 = 5u + 4f. Is u prime? True Let p be -7(145/35 + -4). Let v(o) = -2630o*3 + 3o*2 + 4o + 2. Is v(p) a prime number? False Suppose 14 = -6b + 29 + 15. Let o be 554 - (1 - (-2)/(-2)). Suppose o = ba - 1701. Is a composite? True Suppose 55 = 17h + 4. Is (9/12)/h1804 composite? True Suppose n - 654211 = -g, -3n - 8g + 1038015 = -924628. Is n a prime number? True Is ((-2)/16)/((-21)/504) - 1012-100 composite? False Suppose 71 = 9b + 26. Suppose bg - 9156 - 20029 = 0. Is g a prime number? False Let c(z) be the third derivative of z6/60 - 17z*5/15 + 7z*4/24 + 14z*3/3 + 25z*2 + 3z. Is c(37) composite? False Is ((-12)/6 - (-296 - -2))(-320779)/(-388) a prime number? False Let d(k) = 209k*2 - 7k - 3. Let g(l) = -2l + 22. Let a(t) = t + 13. Let b be a(-4). Let v be g(b). Is d(v) composite? False Let s(g) = -8g*3 + 4g*2 - 3g - 4. Let i(u) = -9u3 + 4u*2 - 4u - 3. Let c(n) = -5i(n) + 6s(n). Let l be c(3). Is (-39088)/l - 4/(-6) composite? True Suppose -194f - 3528 = -202f. Let o = 3 + -5. Is (f - o) + 6/2 a prime number? False Let t(g) = -8g + 39. Let x be t(4). Let w(v) = -48v + 17. Let d(o) = o. Let u(a) = 4d(a) - w(a). Is u(x) a composite number? False Let j be 3555/75 - 5 - (-2)/(-5). Suppose -jr + 23r + 6251 = 0. Is r composite? True Suppose -2b - 2 = 4t, -3 = 5b - 2b. Suppose s - 4g - 137 = t, 2g + 0g = 2. Suppose s = -y + 548. Is y composite? True Suppose 14936 = -10i + 14i. Suppose -10t + 16611 = -3t. Let d = i - t. Is d composite? False Suppose 0h + 4h = 4n - 392428, 5n = 2h + 490517. Is n composite? False Let j = -511974 + 1296103. Is j a prime number? True Suppose -4h = -5k + 15420, 0 = -4k - 4h + 12619 - 319. Let q = 5199 - k. Is q a composite number? True Let v = 88 + -88. Suppose -12y + 4y = v. Suppose y = 5n - 56 - 14. Is n a composite number? True Let k = -164 + 181. Suppose kc = 12c + 5185. Is c composite? True Suppose 5d = 2i - 50, -5d + 178 = 3i + 53. Let y be 355/256/i. Suppose -7m + y + 38 = 0. Is m prime? False Let a = 226 + -208. Is (-55)/66 - (-146643)/a composite? True Let o(k) = -k*2 + 68k + 841. Is o(62) prime? True Suppose -m - 650604 = -5u + 1509973, 4m = 3u - 1296353. Is u a composite number? True Let q(t) = t3 - 5t*2 - 27t + 29. Let b be q(8). Let u(l) = -l*3 + 6l*2 + 3. Let y be u(6). Suppose f + 3f - 5377 = -bd, -yf = -9. Is d composite? True Let t(q) = -18q2 - 2q - 45. Let j(c) = 19c2 + c + 47. Let x(l) = -4j(l) - 5t(l). Is x(21) a composite number? False Suppose 2l = -4, 3k - 8 = -0l + 4l. Suppose 14h - 182610 - 260252 = k. Is h a composite number? True Let w = 85 + -165. Let v be 4/(-18) + w/(-36). Is (-2110)/(-15)(-3)/v-1 prime? True Suppose 0 = -8y + 16136 + 76272. Is y a prime number? True Suppose -4s + 10 = -2s, 3f - 4s = -5. Suppose -fm - 67004 = j, -3m + 0j + 3j - 40206 = 0. Is (-1)/(-4 + 0) - m/12 prime? True Let z = 192 + -176. Let s(h) = h3 - 12h*2 - 25h + 25. Is s(z) composite? True Is (102715830/945)/(((-12)/46)/(-3)) a prime number? False Suppose 6496 = 21d + 7d. Suppose -dq + 228q + 10052 = 0. Is q a prime number? False Let d = -103 - -106. Suppose -dq + 5h = 290, 202 = -2q - 0h - h. Let x = 354 - q. Is x a composite number? True Let y be (-296034)/21 + 96/(-84). Let z = -4421 - y. Is z prime? True Let p = 27282 - -26663. Is p a prime number? False Let o(g) = 8g3 + 9g*2 + 5g - 37. Is o(5) a composite number? False Suppose -a - 321 = -325. Is a(-3)/24-1402 composite? False Suppose -6 = -2z - 298. Let o = 161 - z. Is o composite? False Let r(b) = -2b*3 - 125b*2 + 50b + 3663. Is r(-92) composite? False Let v = 47453 - 27124. Is v prime? False Let n(k) = -25k + 10. Let i be n(-2). Suppose 59g = ig - 11281. Is g composite? True Let k(d) = 69d*3 - 41d*2 - 4d + 289. Is k(21) a prime number? True Let m(t) = -t*2 + 14t - 37. Let s be m(7). Let j be s/(-102) - (-6)/51. Suppose 5y - 2750 - 975 = j. Is y a composite number? True Let k be (16/(-48))/((-1)/12). Suppose -2i + kn + 3398 = 0, -8i + 5i - 4n = -5067. Is i a composite number? False Let j(w) = -w*3 + 5w*2 + 3w - 3. Let r be j(3). Let v(a) = 2a2 - 32a - 5. Is v(r) a prime number? True Let l be 3/3 - 0 - -57. Suppose -6 - 13 = -3q + 2j, -2q + 3j + 21 = 0. Suppose -qh + l = -143. Is h prime? True Let s(y) = -5y*3 + 6y*2 + 15y - 11. Let b = -13 + 7. Let o(x) = -9x3 + 13x*2 + 30x - 22. Let d(g) = bo(g) + 11s(g). Is d(-12) a prime number? True Suppose 2a = -18s + 14s + 225158, 4a - s = 450307. Is a composite? False Suppose 237p - 13p - 19978336 = 0. Is p prime? True Let u = -407 - -412. Suppose 20316 = ug + 7g. Is g prime? True Let m(g) = g*2 + 9g - 19. Let f be m(-11). Suppose -5k - 3h + 78856 = -k, fh = -5k + 98573. Is k a prime number? True Let x(p) be the second derivative of 147p5/20 + 7p3/6 - p2/2 + 27p. Is x(3) prime? True Suppose 5f - 14052 = 30878. Suppose 2m + 1596 = f. Is m a prime number? False Let f = -106 + 106. Suppose 0 = -fb - 2b + 5398. Is b a prime number? True Suppose -15z + z + 429758 = 0. Is z a composite number? False Let f = 235533 + -113516. Is f a composite number? True Suppose -3c - 211 = -5m - 2c, 4m - c - 169 = 0. Is (m/(-12))/7 - 26457/(-6) a prime number? True Suppose 2v - 3m = 1094, -4v + m + 2748 = v. Let z = 1491 - v. Is z composite? False Let b(d) = d3 - 6d*2 - 2d + 10. Let u be b(6). Let q be ((-17471)/u)/((90/12)/15). Suppose 12z - 6205 = q. Is z a composite number? False Let a = -25993 + 82482. Is a a prime number? True Let l = 8619 + -200. Is l a composite number? False Suppose 0 = 3l + d - 148357, -24l + d = -21l - 148349. Is l prime? True Let z(k) = -9k - 5. Let o be z(-1). Suppose 1 = -ox - 3v - 2, -2v = -2x + 2. Suppose x = 2q - 261 - 637. Is q a prime number? True Let x = -48 + 60. Let m(d) = 349d - 61. Is m(x) prime? True Let n = -43488 - -112853. Is n a composite number? True Suppose 5c + 0f - f = -53, 5c = -f - 57. Let t(y) = -51y - 34. Is t(c) a composite number? True Let b(i) = -31i*3 + 11i + 32. Let n be b(-5). Let x = 24294 - 12348. Suppose -x - n = -6s. Is s prime? True Let u = -744848 + 1701613. Is u prime? False Let a = -99 - -102. Suppose 0 = aw + 12. Is (5 - 1) + w + 229 a prime number? False Suppose -5j - 3 = 17.	{ "pile_set_name": "DM Mathematics" }
m, 3, 5 Let i = -2649 - -2675. Sort 2/13, i, 1, -3. -3, 2/13, 1, i Suppose -5l - 51 = -66. Put l, 0, 4 in ascending order. 0, l, 4 Let z = -235 + 234. Put 3, -6/11, z in descending order. 3, -6/11, z Let h(m) = 76m*3 - 1 + 0 + 14m*2 - 73m3 + m2. Let r be h(-5). Sort -6, 0, r in increasing order. -6, r, 0 Let h = -29.1 + 29.4. Let o = -2 - -2. Let b = -0.4 - o. Put h, 4/3, b in descending order. 4/3, h, b Let g(l) = l*2 + 2l - 2. Let t be g(1). Suppose v - 3w - t - 6 = 0, 2 = -2w. Put 2, v, 7 in descending order. 7, v, 2 Let i = 365/2261 + -6/323. Put -3/5, -2/9, i in decreasing order. i, -2/9, -3/5 Suppose 4i - 3o - 1 = -i, -2i - o + 7 = 0. Suppose 4u = m + 3u, -m - 10 = 4u. Let a(w) = w*3 - 13w*2 + 14w - 27. Let f be a(12). Sort m, i, f. f, m, i Let s be ((-8)/(-6))/((-84)/(-63)) + 5. Sort 74, -3, s in descending order. 74, s, -3 Let s(b) = 2b2 - 3b - 4b2 - 10b2. Let y be s(-2). Let q be 2/7 + 12/y. Sort q, -1, -5 in descending order. q, -1, -5 Let f be 0 - (35/4 + (-6)/8). Let q(x) = -x2 - 8x - 2. Let i be q(f). Put 3, i, 9 in increasing order. i, 3, 9 Let i be (-4)/(-7) + 6/14. Let g = -1 + i. Let j be -1 + g + (-45)/(-39). Put -2, j, -4 in descending order. j, -2, -4 Let g = 0.2 - 0.3. Let h = 2912 + -2908. Sort -5, h, g in ascending order. -5, g, h Suppose -5d + 10 = -10. Let g(u) = u + d + 0u + u - u. Let y be g(-3). Sort 7, -4, y. -4, y, 7 Let t = -0.4887 - -0.3887. Let r = -5.6 + 0.6. Sort r, t, -8, 4 in decreasing order. 4, t, r, -8 Suppose -10 + 23 = 13f. Let l(n) = n - 13. Let j be l(9). Sort j, -3, f. j, -3, f Let l = 772 - 771.7. Let w = -28/9 - -718/225. Sort w, -3, -2, l in increasing order. -3, -2, w, l Let c = 1.77 + -1.7. Let k = c - -0.43. Let v = 1116/13 - 86. Sort k, v, 5 in decreasing order. 5, k, v Let m = 30 - 32. Sort -3, m, 0 in decreasing order. 0, m, -3 Let y be 2/(-14) - (-2380)/(-490). Let u = -0.3 + -0.4. Let g = u + 0.4. Sort 6/5, g, y in decreasing order. 6/5, g, y Suppose 4l = p + 253, 4l + 2p = 164 + 74. Sort l, 4, 2 in decreasing order. l, 4, 2 Let x be 2/7 + 24/(-6300)40. Put x, 32, -4, 0.13 in ascending order. -4, 0.13, x, 32 Let o = 0.133 + 0.007. Let q = 13 + -13.4. Put 5, q, o in ascending order. q, o, 5 Let b = 302 - 300. Sort -4, 4, 5, b in ascending order. -4, b, 4, 5 Let v = -1 + 0. Let x = -2 - v. Let o(p) = p*2 - 318p - 640. Let w be o(-2). Sort 4, x, w in ascending order. x, w, 4 Suppose -c - 13d = -10d - 20, -2c - 5d = -35. Put c, 4, 71 in decreasing order. 71, c, 4 Let w = 2 + -2. Let u = -11 + 23. Let n be ((-6)/(-9))/(u/(-54)). Put 2, n, w in decreasing order. 2, w, n Let k = 0.3 - 0.32. Let c = -1.02 - k. Let r = 0.34 + 0.06. Put c, -0.3, r in descending order. r, -0.3, c Suppose -5y - 16 = 5z - 7y, -z - 8 = -2y. Sort 4, 0, -25, z in descending order. 4, 0, z, -25 Let t = -0.2 + 14. Let v = t - 5.7. Let i = 8 - v. Sort 5, 0.2, i. i, 0.2, 5 Let z(h) = h3 - h2 - 3h + 4. Let c be z(2). Let f be (-1)/(c/1)30/12. Sort -2, -3, f, -5. -5, -3, -2, f Let q be 2/(-2)(56/(-21))/(-8). Sort -67, q, 1, -2. -67, -2, q, 1 Suppose -2u + 7u + 2l - 2 = 0, 2l = -8. Suppose -10 = -uw + 4w. Sort w, 26, -4 in decreasing order. 26, -4, w Suppose 75m + 54 = 81m. Sort 2, m, -3 in ascending order. -3, 2, m Let o = 3 - 2.6. Suppose 0 = 2n - 6, -5s + 2n + 2n + 198 = 0. Let w be -2(s/9)/(-7). Put 0, o, w in descending order. w, o, 0 Suppose -7g + 15 = -2g. Let t = 6 + -3. Suppose -x + 8 = -tx. Sort x, g, 0. x, 0, g Suppose -5l - 35 = -3a, a + 4l = -l + 5. Put -1, a, 1 in increasing order. -1, 1, a Suppose 5u - 5s + 81 = -14, 4u + 106 = -2s. Put u, -1, 2 in ascending order. u, -1, 2 Let u = -1/2201 + -4387/33015. Sort 1, 5/6, u, 0 in ascending order. u, 0, 5/6, 1 Let g be (-1)/((-3)/(-18)) - -10 - -4. Put -4, 1, g in increasing order. -4, 1, g Let x be 43/(-215) + (-31)/70. Sort 2/5, -0.5, x, -4 in descending order. 2/5, -0.5, x, -4 Let d = 149 - 150. Let k = -2 + 0. Put d, 0, k in decreasing order. 0, d, k Suppose -4o - 59 - 13 = 0. Let c be (-1 - -1)/((-18)/o). Put 0.6, 4, c in ascending order. c, 0.6, 4 Let n(a) = -a3 + 5a*2 + 5a + 2. Let g be n(6). Suppose 0 = -183k + 182k - 5. Put 3, k, g in descending order. 3, g, k Let j be 21/12 - (-1 + 2). Sort -33, j, 3, -2/3 in descending order. 3, j, -2/3, -33 Let m(z) = -z*2 + z. Let f be m(0). Let v = 1.437 - 0.437. Put -0.17, f, 3, v in decreasing order. 3, v, f, -0.17 Let k = -11.8 - -4.9. Let a = 1.1 - k. Let n = -8 + a. Sort n, 1, 0.1 in decreasing order. 1, 0.1, n Let n = 1368 + -1369. Suppose -2z + 3 - 23 = 0. Sort -4, z, n. z, -4, n Let y = 46 + -97. Let i = -47 - y. Let r be (18/(-15))/(2/(-5)). Sort r, -4, i. -4, r, i Suppose -5h - 2b = 20, -2h + b = 3h + 20. Put 42, h, -2 in ascending order. h, -2, 42 Let p(d) = -d*3 - 45d*2 - 131d - 211. Let k be p(-42). Let x be 3-1 + (-1)/1. Put x, 5, 4, k in ascending order. x, k, 4, 5 Let q be (-260)/6 - 6/9. Let h be 6/(-42) + q/(-14). Let i(y) = -3y - 1. Let m be i(-2). Sort h, m, 4. h, 4, m Let l be (-7)/(84/(-9)) + 12/(-8). Let u = 7.8 + -9. Let o = 1 + u. Put l, -0.1, o in decreasing order. -0.1, o, l Let h be (-2 - (-5)/3)/1. Let b = 0.0865 + -1.0865. Sort b, h, -2. -2, b, h Let q = -2816 - -1459. Let n = q + 17665/13. Let o = n + -2. Sort 3, o, -2/9 in ascending order. -2/9, o, 3 Let p = -1069 - -5343/5. Let q = 6 - 8. Let o = q - -3. Sort p, o, 0.1 in increasing order. p, 0.1, o Suppose 7j - 47 = -33. Put -100, 1, j in increasing order. -100, 1, j Let l = -13 + 1. Let p be -2 + 4 + (-14)/(-2). Let f = p + l. Sort 1, f, -1. f, -1, 1 Let c = -43 - -50. Let l be (-70)/c(-2)/5. Put l, -0.1, -4 in descending order. l, -0.1, -4 Let a = -241947/868 - -1115/4. Sort 1/6, -0.2, a. -0.2, a, 1/6 Let g = -114 - -124. Put g, 1, 0, -1 in increasing order. -1, 0, 1, g Let b be (-1)/3 + 26 + -25. Let w = -0.16 + -0.04. Put -2/9, b, w in increasing order. -2/9, w, b Let n = -584 - -583. Put -61, n, 2 in descending order. 2, n, -61 Let u(b) = b*2 - 26b - 86. Let d be u(29). Let l(j) = -j - 2. Let z be l(-8). Suppose 5m + 2 = zm. Sort -5, m, d in descending order. m, d, -5 Let z(p) = p*3 - 2p*2 - 4p + 5. Let a be z(3). Let u be 0 + a - (2 + -4). Let j be (9/(-12))/(1/u). Sort j, -1, -2 in increasing order. j, -2, -1 Let l be 3/(-4) + -2 + 83/36. Sort -0.5, l, -0.04 in ascending order. -0.5, l, -0.04 Let l = 1247 - 1238. Sort 0.3, 2/23, l, 1 in descending order. l, 1, 0.3, 2/23 Let g = 12 - 10. Suppose 2t = -0t + g. Let r(d) = d + 7. Let h be r(-11). Put h, 5, t in descending order. 5, t, h Let i be (760/1330)/(1/(-7)). Suppose 0 = 4h + 6 + 6. Sort i, h, 1 in descending order. 1, h, i Let b be 124/24 - (-1 - (-14)/12). Put 2/7, 2/13, b, 2/3 in ascending order. 2/13, 2/7, 2/3, b Let h be (((-39)/(-2))/13)/((-1)/(-2)). Let r be (-2)/3 + h/(-9). Suppose -2x + 3f - 6 = 0, 3x + 0f = f - 2. Sort -5, r, x in decreasing order. x, r, -5 Let v be 1(-1 - -6) - 3. Let r = -196 - -191. Sort -2, r, v. r, -2, v Let x = 748 + -745. Let i = -0.2 - 0.2. Sort i, 0.4, 1/2, x in increasing order. i, 0.4, 1/2, x Let x(l) = l*2 + 22l + 112. Let u be x(-9). Sort u, 2, 4, 0 in increasing order. u, 0, 2, 4 Let k = -217/232 - -7/116. Let n = k + 65/56. Sort 0.4, 5, n in decreasing order. 5, 0.4, n Suppose 5412 = 74c - 62c. Sort c, -3, 5 in ascending order. -3, 5, c Suppose -2z + z = 0. Let a(d) = -d - 21. Let h be a(-17). Sort z, h, -5 in descending order. z, h, -5 Let i be (3/15)/(((-21)/6)/7). Sort i, -2, 0 in decreasing order. 0, i, -2 Let x be (-64)/352 + 53/(-11). Let n be x - (-4 - (-1 - 0)). Sort 4, -5, n, 11 in descending order. 11, 4, n, -5 Let q = -18 + 31. Let d = q - 89/7. Sort 4/5, d, -1 in increasing order. -1, d, 4/5 Suppose 3j - 4s = -9s - 30, 5s - 10 = 5j. Let f(x) = 4x3 - 11x*2 + 23x - 9. Let t be f(2). Sort 2, j, t in decreasing order. t, 2, j Let v = 1.5 + -2.5. Let z = 61/2 + -31. Let l = -4 - 0. Sort v, z, l. l, v, z Suppose 3q - 9q = -24. Put -20, -2/5, q in increasing order. -20, -2/5, q Let t = -4/519 + -55/346. Sort -0.17, -2/7, t, 0.6 in descending order. 0.6, t, -0.17, -2/7 Let w be 4/(-6) + (-8)/(-6). Let i = -1.75 - -2.25. Sort i, 4, w. i, w, 4 Suppose 5v - 22 = -2. Let n be (v - 3)(2 - 0). L	{ "pile_set_name": "DM Mathematics" }
6. Let w be 49152/h + 6/(-39). Are w and 631 non-equal? True Let h be 2/9 + 240/(-108). Let y(k) = 9k - 2. Let t be y(h). Suppose 32i - 33i = x + 16, -3i + 3x = 78. Are i and t unequal? True Let h = -8117 + 8275. Which is greater: h or 162? 162 Let b = -495 - -220. Let r = b - -1383/5. Let h(i) = -2i - 5. Let p be h(-4). Is p at least r? True Let x(a) = 141a + 4224. Let i be x(-30). Let k = 1 - -1. Suppose kh = 3p - 3, -3p - 2p - 3h = -24. Which is bigger: i or p? p Let u = 3299.16 - 44.16. Is 0.1 at most as big as u? True Suppose i = -2p + 3p + 1, -3p + 3 = 0. Suppose 0 = iv + 5n - 4n - 107, 0 = v + n - 53. Which is bigger: v or 53? v Suppose 194025 + 135977 = 102s - 11494. Is 3348 less than or equal to s? True Let v be (5/50)/((-25)/30). Which is bigger: -1.7 or v? v Suppose 8u - 114 = -122. Which is smaller: 3823 or u? u Let z = -0.9535 + -0.0465. Which is greater: z or 0.02908? 0.02908 Let k = 12081 + -11618. Is k bigger than 463? False Let w = -171 - -172. Let y = -244.944 + 245. Is w >= y? True Suppose 1 = 2v - 1. Let u = 1519/8 + -190. Let a = 21/104 + u. Are v and a non-equal? True Suppose -3p + 3 = -0, -7 = x - 5p. Let l be (2 + -2)/(3 + 10/x). Which is smaller: l or 1/7? l Let k = 23.764 - 26.464. Do -0.15 and k have different values? True Let w be (-4)/(-4) - -2 - -4. Let o be (w + -7)(-2)/2. Let h = -97525/59 + 1653. Which is smaller: h or o? o Let b = 1743 + -1798. Is -53 less than or equal to b? False Let j be (-412 + 4)/((-3)/2). Let c = 1356/5 - j. Let v be (1/(-3))/((-1392)/(-72) - 19). Is c < v? False Let q = -1106.8 + 1114.8. Is q less than or equal to 0.0534? False Let d = -13 + 9. Let m(f) = -f*3 - 4f*2 - 4f + 5. Let h be m(-4). Let l be d + h + -4 - 2. Which is smaller: l or 8? 8 Suppose 541 + 845 = -18b. Let l = -4544/59 - b. Is -1 at most as big as l? True Let a = 547 - 37195/68. Let s(l) = -43l + 4428. Let m be s(103). Which is bigger: m or a? a Suppose 76q = 262 - 262. Is q greater than 1/1699? False Suppose -l = -0l - 7l. Let z(u) = u3 - 3u*2 + 2u - 4. Let a be z(l). Is -49 < a? True Suppose 5i - 5n = -1035, -5n - 92 + 713 = -3i. Let o = -71 - i. Which is smaller: 273/2 or o? o Let b(t) = 16t2 + 5t + 9. Let u be b(-2). Let n = 25 + u. Let w be 12/(-28)(1 + (-2)/6). Which is greater: w or n? n Suppose 0 = -61b + 59b - 5v - 100, b - 5v = -20. Suppose 0 = -2m + 147 + 57. Let f be m/b + (-40)/(-16). Which is smaller: 0.1 or f? f Suppose 36 = -15r - 54. Let x be r/(-4) + 1256/(-16). Which is smaller: x or -153/2? x Suppose -b + 8 = -4. Let n be 0/(b/(-5) - 28/(-70)). Let i be (-2)/(-9) - (n - 32/18). Is 2 at least i? True Let w = 31 - 14. Let c = 331 + -316. Suppose 0 = cq + 5 - 260. Does q = w? True Let s = -792 - -787. Let d be (-48)/10 - s(13 - 12). Is 0.01 smaller than d? True Suppose -32 = -2o - 376. Suppose 1998a + 4z = 1994a - 708, 0 = -2a + 3z - 324. Which is smaller: o or a? o Let f be -17 - -18 - (-131 + 0/(-2)). Suppose -3h + f = -126. Suppose 0 = v - o - 32, 3v - 4o + 3o - h = 0. Which is smaller: v or 26? 26 Let s = 3 + -3.1. Let u = s - 7.9. Let x = 646 + -646. Is x smaller than u? False Let q = 1.49 - 92.49. Let a = q + 97. Let j = 0.9 + -1.9. Is a < j? False Let j be 3 + 0 + 52/598 + 5422/69. Is j less than -0.02? False Suppose 0 = -3g - 2c + 4c + 10, -4 = -4c. Suppose 4q + 460 = -go, 95 = -q + 3o - 0. Which is smaller: q or -111? -111 Let t be (-2325)/(-175) + 14 + -27. Let k be ((-1)/22)/((-9)/6). Is t not equal to k? True Let n = -651 + 650. Which is smaller: n or 9/200? n Let q = 8/18093 + -4999723/54279. Which is bigger: -93 or q? q Let w be (14/(-44) + 8/(-44))/((-112)/224). Which is smaller: w or 4/245? 4/245 Suppose -z - 3 = -2. Let v be (-45)/4 + 11 + (-780)/(-3376). Which is greater: z or v? v Suppose 5d + 31 = -3u, 2u - 3d - 48 = -56. Let q be 10(6/(-4) - -2). Let i = -1 - q. Is i >= u? True Let r = 7817/6 + -1284. Is -1 != r? True Let w = -4 + 4.3. Let h = w - 0.4. Let j = -23655 - -23654.8. Is j smaller than h? True Suppose 0 = 5x - 84 + 64. Let k = 3 - -2. Suppose 9 = -xm + k. Which is bigger: 1/22 or m? 1/22 Let v = 12218/385 + -1098/35. Let r(t) = t + 3. Let p be r(-4). Which is smaller: v or p? p Let t be ((-1)/2)/((77/(-602))/11). Let o = 136 - 92. Is o greater than or equal to t? True Let c = 8617 + -10629. Are c and -2 nonequal? True Let j(b) = b3 - 16b*2 - 17b + 62. Let h be j(6). Which is greater: -5 or h? -5 Let o = -28 + 66. Let q = o + -30. Suppose 2t - 4 = 10. Are t and q non-equal? True Let n be (6/(-12))/1(-14 - 2474). Is n != 1239? True Suppose 532 - 28 = 8j. Suppose js - 44 = 19s. Is -9/35 >= s? False Let h = -9.39 - -4.79. Let x be (-3)/36 + 1/3. Is h at least as big as x? False Suppose 6194 = j + 3c, -4j + 4c - 3393 = -28089. Suppose 0 = -16i + j - 595. Which is smaller: 350 or i? i Let x(y) = -473y + 3783. Let f be x(8). Is 2/59837 at most as big as f? False Let h = -1082 - -1809. Let x = -727.1 + h. Which is bigger: x or 408? 408 Let t be -4(889/133 - 3). Is t greater than -1? False Let j = -21.99 + 32.99. Is j != -201? True Let x(p) = p2 - 38p - 300. Let d be x(-7). Which is bigger: -7/5 or d? d Suppose -5r = m - 1000, -m = 4r + 4m - 821. Let g = -24 + r. Let c be 2/(-5) + 70/g. Which is bigger: c or -1/7? c Let u = -1953 + 1953.5. Let p = 13.19 - -1.81. Is u > p? False Let g = -1062.91649 + -0.08351. Does 1/4 = g? False Suppose 3t + 272 = -v, 4t - 254 = 3v - 595. Which is greater: t or -5? -5 Let m be 304((-51)/(-459))/((-2)/(-9)). Which is smaller: 10 or m? 10 Let k(p) = -3p - 62. Let t be k(-27). Suppose ts = 12s + 7. Are 2/281 and s non-equal? True Let w = -168 + 119. Let t = w + 50. Do 5 and t have the same value? False Suppose -5a = 4r - 34, 0a - 5a + 22 = 2r. Let k be (-7)/(-63) - (-27699)/27. Let j = 1032 - k. Is r greater than j? False Let u = 9579 + -9756. Which is smaller: u or 12? u Let m be 32189/(-8910) + ((-72)/(-33) - 2). Let z = 5/162 + m. Which is greater: 0 or z? 0 Suppose 0 = -2l + 3u + 5371, -l - 173u = -177u - 2683. Do 0.1 and l have different values? True Let x(o) = o3 + 15o*2 - 35o - 16. Let z be x(-17). Let r be ((z/1)/33)/((-48)/144). Which is bigger: 3 or r? 3 Suppose -7n - 12n = 19. Let y be n(-14 + 8)/6. Is y < 1/412? False Suppose 2n + 2 = 2l + 30, 0 = 2n + 4l + 2. Let p(v) = -57v + 12. Let c be p(n). Let j = -9523/19 - c. Is j < 1? True Let t = -1682 + 1680. Which is smaller: t or 13/4? t Let l = 18706 + -18913. Is l less than or equal to -9? True Let s(k) = k + 14. Let i be s(-8). Let j be -14 + -3 + i. Let t be 6/(-9) - (-7)/24. Which is bigger: t or j? t Suppose -333 = 4x - 85. Let h = -62 - x. Which is smaller: h or 5/48? h Suppose 6x - 214 = -58. Suppose 7 = -25k + xk. Which is greater: 1 or k? k Suppose -2m = -3x - 883, -64m + 2x = -60m - 1754. Is m >= 437? True Let m(g) = g*3 - 13g*2 - g + 13. Let w be m(13). Suppose w = l + 1, 4n + 8l = 7l - 25. Which is greater: n or -7? n Suppose -99i + 91i + 24 = 0. Suppose 2n - 23 = 3n - l, 5l = -in - 45. Do n and -182/9 have the same value? False Let p be (-1872244)/(-19760) + (-45)/(-15). Let q = p + 1/1235. Is q not equal to 99? True Let g = 102 + -99. Suppose -12 = gb + 3l, b + l - 2l = 4. Suppose b = 12m + 7 + 5. Which is bigger: -1/2 or m? -1/2 Let v(r) be the second derivative of r*3/2 + 7r. Let h be v(-2). Let j be 15/h3/(-675). Which is smaller: 0 or j? 0 Let x = 33397 - 33398. Which is bigger: x or -63/388? -63/388 Let a be 1588/(-6) - (-1 + 16/12). Let r = a - -3443/13. Which is greater: r or 5/9? 5/9 Let i = -28 + 76. Let c = -50 + i. Let d(f) = -f3 - 4f*2 - 4f - 1. Let m be d(-1). Which is smaller: c or m? c Let g be (-2)/(-4) - 738/(-12). Let p(o) be the second derivative of -o*4/12 - 11o*3/3 - 25o*2 + 2o + 32. Let y be p(-14). Are y and g unequal? False Suppose 0 = 4p - 7p + 36. Let d = -1240 + 1277. Let a = d - p. Is 25 at most as big as a? True Let u = -256 - -240. Let p(b) = b*2 - 2b - 13. Let f be p(6). Suppose m + 28 = f. Which is smaller: m or u? m Let b be 188122/6168 - -7 - 4/2. Let w = 1/3084 + b. Let u = w + -777/22. Which is smaller: u or 0? 0 Let q = -9.273 - -9.143. Which is bigger: -38 or q?	{ "pile_set_name": "DM Mathematics" }
5d + 6. Let i be n(q). Let iw*2 + 3w*2 + 5w*3 - 2w3 = 0. What is w? -1, 0 Let b(n) = -n3 + 7n2 - 5n - 4. Let j be b(6). Suppose -jh2 + 2/3h*3 + 2h - 2/3 = 0. What is h? 1 Let o(v) be the first derivative of v*6/57 - 12v*5/95 + 13v*4/38 - 8v*3/19 + 4v*2/19 + 77. Factor o(q). 2q(q - 2)2(q - 1)2/19 Let v(p) be the first derivative of -p4/20 - 19p3/15 - 23p*2/2 - 45p + 53. Factor v(y). -(y + 5)*2(y + 9)/5 Let b(m) be the second derivative of -m*4/15 - 4m*3/15 + 16m*2/5 + 3m - 73. Suppose b(y) = 0. What is y? -4, 2 Let 50/7l2 + 2/7l*3 + 726/7 + 374/7l = 0. Calculate l. -11, -3 Factor -16s3 - 92s - 8s - 24 - 8s*2 - 26s*2 - 78s*2. -4(s + 6)(2s + 1)*2 Suppose -3r + x + 8 = 2x, -5r = -2x - 17. Let c(n) be the first derivative of 0n - 1/5n5 + 17/20n*4 + 2/5n*2 - 16/15n*3 + r. Factor c(p). -p(p - 2)(p - 1)(5p - 2)/5 Let t be (43/7)/((-3)/(-6)). Let y = -704/63 + t. Solve 4/9c - yc4 + 8/3c*3 - 2c*2 + 0 = 0. 0, 2/5, 1 Suppose 3h + h = 0. Suppose 0 = -hk - 2k + 12. Factor -3 + x*4 + kx*2 - 5x4 - x4 + 2x4. -3(x - 1)*2(x + 1)*2 Let -64l*2 - 48392l*3 + 44l + 3896 + 48388l3 - 992 = 0. What is l? -11, 6 Factor 0 - 21/2k + 10k2 + 1/2k*3. k(k - 1)(k + 21)/2 Let y(b) be the first derivative of -12b*2 + 21 + 969/4b*4 - 132b*5 - 99b*3 + 12b. Find q, given that y(q) = 0. -2/11, 1/4, 2/5, 1 Let q(x) be the first derivative of x*5/20 + 15x*4/8 + 193x*3/12 - 60x*2 + 64x - 590. Suppose q(f) = 0. Calculate f. -16, 1 Determine l, given that 11l2 + 43l*3 + 15l*2 + 95l + 62l3 - 221l*2 - 5l4 = 0. 0, 1, 19 Let i(p) be the third derivative of -p5/12 + 5p4/8 + 25p*3/3 - 22p*2. Suppose i(r) = 0. What is r? -2, 5 Let f = -16 - -20. Let d(i) = 5 + 11 - fi - 14. Let w(g) = g*3 + g - 1. Let m(u) = -2d(u) - 4w(u). Factor m(o). -4o(o - 1)(o + 1) Let f(i) be the third derivative of -i7/6300 + i6/540 - i5/300 - i4/20 - 3i3 - 3i*2. Let n(h) be the first derivative of f(h). Factor n(r). -2(r - 3)*2(r + 1)/15 Let l(d) be the third derivative of -d*7/210 - 13d*6/120 - 11d*5/60 + 13d*4/24 + 2d*3 - 192d*2. Factor l(f). -(f - 1)(f + 1)*2(f + 12) Let j be ((-46)/(-36) - 1) + 32/144. Let i(x) be the first derivative of -jx - 1/16x*4 + 1/6x*3 - 7 + 1/8x*2. Factor i(t). -(t - 2)(t - 1)(t + 1)/4 Let g be (-4)/(-8) - (-30)/4. Suppose -2s = -w - g, -3w + 8w = s - 22. Factor -6l5 - 2l*3 - 3l*4 - sl*4 + 3l5. -l3(l + 1)(3l + 2) Let d(r) be the first derivative of 17r*4/6 + 110r*3/9 + 46r*2/3 + 16r/3 + 183. Suppose d(f) = 0. What is f? -2, -1, -4/17 Let o(p) be the second derivative of -p7/7560 + p6/3240 + p5/270 - p4/54 - 2p3 - 14p. Let z(g) be the second derivative of o(g). Factor z(i). -(i - 2)(i - 1)(i + 2)/9 Factor 39/7j + 18/7 - 24/7j*2. -3(j - 2)(8j + 3)/7 Let y be (24/(-8) + 3)1. Let u(h) be the second derivative of 1/12h*3 + 4h + 0h2 + y + 1/48h*4. Determine s, given that u(s) = 0. -2, 0 Let b(x) be the first derivative of -1/6x*2 + 1/12x*4 + 0x*3 - 7 + 0x. Find h such that b(h) = 0. -1, 0, 1 Let w = 143 - 138. Suppose -7h - wh - h = 0. Suppose ha3 + 0a*2 - 3/4a*5 + 3/4a*4 + 0a + 0 = 0. What is a? 0, 1 Let q(d) = 4d4 + 8d*3 + 6d*2 + 10d + 8. Let j(x) = x4 + x3 - x*2 + x + 2. Let t(i) = -3j(i) + q(i). Factor t(m). (m + 1)*3(m + 2) Let u(y) be the first derivative of 0y + 3/4y*2 - 15/16y*4 + 3/4y*3 + 7. Find q, given that u(q) = 0. -2/5, 0, 1 Suppose 4q + 3 = 11. Suppose 0j - 257j*2 + 0j + 3j3 - j4 + 255j*q = 0. Calculate j. 0, 1, 2 Let y be 34(-4)/(-16). Let b = y - -1. Determine c so that -3c*2 - 12c - 4c2 - 15 + bc*2 + 3 = 0. -2 Let g(y) be the second derivative of 0 + 1/7y*2 - 1/42y*4 + 12y + 1/42y3 - 1/140y*5. Solve g(m) = 0 for m. -2, -1, 1 Let f be -86(-2 + 2 + -1). Suppose 4j + d + 3d = 320, j = 5d + f. Factor 285 - 3u*2 - 349 - ju*2 + 10u*3 + 192u. 2(u - 4)2(5u - 2) Let l be 15/9 - (-1 + 12/6). Let u(w) be the first derivative of 4 - lw*3 - 2w*2 - 2w. Factor u(j). -2(j + 1)2 Let z(s) be the second derivative of 2s*6/105 - 3s*5/28 + 4s4/21 - s3/14 - s*2/7 + 34s - 4. Factor z(x). (x - 2)(x - 1)2(4x + 1)/7 Let b = -29503/8 - -3688. Factor -br*5 + 0 + 0r + 1/8r3 - 1/8r*2 + 1/8r4. -r2(r - 1)2(r + 1)/8 Determine h so that 10/17h2 - 2/17h*3 - 16/17 - 4/17h = 0. -1, 2, 4 Let k(v) be the first derivative of v6/1980 - v5/660 - v4/66 - v3 + 13. Let t(b) be the third derivative of k(b). Factor t(o). 2(o - 2)(o + 1)/11 Let i be ((-10)/(-105))/(8/16). Let x(k) be the first derivative of -6 - ik3 - 12/7k - 8/7k2. Factor x(t). -4(t + 1)(t + 3)/7 Let t(m) be the first derivative of m7/21 + 4m*6/15 + 3m*5/10 + 3m - 16. Let r(k) be the first derivative of t(k). Factor r(p). 2p3(p + 1)(p + 3) Let b(f) be the third derivative of f5/510 + 7f*4/204 - 8f*3/51 - 2f*2 - 22f. Factor b(l). 2(l - 1)(l + 8)/17 Let s(j) be the third derivative of j*7/105 + 91j*6/240 + 13j*5/24 - 11j*4/24 - 23j*2. Find a, given that s(a) = 0. -22, -1, 0, 1/4 Suppose 7v - 24v = 17. Let z be (-90)/(-72) + v/(-4). Find a, given that -3/2a*4 + 0 + 0a*3 + 0a + za2 = 0. -1, 0, 1 Let o = 23832 + -23830. Find m, given that -1/2m*o + 4 + 7/2m = 0. -1, 8 Let v(q) be the second derivative of q6/60 + q5/40 - 5q4/24 + q3/4 + q - 79. Factor v(r). r(r - 1)*2(r + 3)/2 Let u(s) = 10s4 + 115s*3 + 420s*2 + 645s + 305. Let v(p) = 5p4 + 58p*3 + 210p*2 + 323p + 151. Let x(l) = 3u(l) - 5v(l). Factor x(w). 5(w + 1)(w + 2)(w + 4)2 Let h = -12 - -9. Let z(d) = -d3 - 2d*2 + 2d - 3. Let o be z(h). Suppose -2/5 + 4/5u2 + 0u*3 + ou - 2/5u4 = 0. Calculate u. -1, 1 Let k(s) be the second derivative of s7/21 - 2s*6/45 - 3s*5/10 + 4s*3/9 - 4s - 24. Determine m, given that k(m) = 0. -1, 0, 2/3, 2 Let r(t) = -2t2 - t - 1. Let i(s) = 10s*2 - 8s + 22. Let z(x) = -i(x) - 4r(x). Factor z(g). -2(g - 3)*2 Let x(z) be the third derivative of 0z + 0z3 + 0 + 1/60z*6 + 2/15z*5 - 1/105z*7 - 1/3z*4 + 30z*2. Find b such that x(b) = 0. -2, 0, 1, 2 Let w = -836 + 838. Factor 3/2n*w + 3 + 9/2n. 3(n + 1)(n + 2)/2 Let k(i) be the second derivative of i7/630 + i6/45 - i5/6 + i4/3 - 15i. Let o(m) be the third derivative of k(m). Determine g, given that o(g) = 0. -5, 1 Let d(g) be the first derivative of 16 + 4/9g + 1/18g4 + 5/9g*2 + 8/27g*3. Solve d(l) = 0. -2, -1 Factor -11h*2 - 9h*3 + 29h*3 + 15h*3 - 5h*4 - 64h*2 + 45h. -5h(h - 3)*2(h - 1) Let h(a) = a*2 + 3a + 3. Let q be h(0). Let o(x) be the first derivative of 2x2 - x4 + 2/5x*5 - 2x + 0xq - 8. Factor o(d). 2(d - 1)*3(d + 1) Suppose -32/9d2 - 2/9d*3 + 34/9d + 0 = 0. What is d? -17, 0, 1 Suppose 556/7q3 + 220q*2 + 56 + 1364/7q - 12/7q4 = 0. Calculate q. -1, -2/3, 49 Let i(r) be the first derivative of -4/21r*3 - 8/7r + 6/7r2 - 22. What is d in i(d) = 0? 1, 2 Let g = 78 - -60. Let m = g + -1516/11. Factor -2/11w*5 + 0 - mw + 0w2 + 0w*4 + 4/11w*3. -2w(w - 1)2(w + 1)2/11 Let t(w) be the second derivative of -w6/30 - 3w5/10 - 3w*4/4 - 2w*3/3 + 115w. Factor t(g). -g(g + 1)2(g + 4) Let y(t) = -t*2 - 9t + 2. Let k be y(-8). Let x = -7 + k. Find i, given that i*2 - xi + 3i - 2i = 0. 0, 2 Suppose -6 = -8n + 5n. Let -6v3 - 9v*n + 9v*3 - 6v*3 + 12 = 0. Calculate v. -2, 1 Let h be (84/(-280))/(1/(-20)). Let y(b) be the third derivative of 2/3b*3 + 0b + 16/5b5 + 2b*4 + 0 + 32/15b*6 + hb*2. Factor y(i). 4(4i + 1)3 Let y(l) be the third derivative of -l6/30 + l5/15 + l4/3 + 3l*2 + 53l. Determine z so that y(z) = 0. -1, 0, 2 Let c be 5((-11)/55 - -1). Factor 18/5j*c + 0 + 3/5j*5 + 36/5j*2 + 39/5j*3 + 12/5j. 3j(j + 1)*2(j + 2)2/5 Let u(b) be the third derivative of -b8/168 + 4b7/105 - b6/20 - 2b5/15 + b4/3 - 24b2. Find n such that u(n) = 0. -1, 0, 1, 2 Suppose 3/8v*4 + 3v - 3/4v3 - 3/2v**2 + 0 = 0. What is v? -2, 0,	{ "pile_set_name": "DM Mathematics" }
ple of 268? True Is 161 even? False Does 6 divide 64062? True Does 13 divide 68866? False Does 16 divide 54912? True Does 42 divide 42? True Is 137 a factor of 58910? True Is 5925 a multiple of 75? True Is 9 a factor of 610? False Does 17 divide 41165? False Is 9 a factor of 559? False Is 165 even? False Is 36 a factor of 8620? False Is 43 a factor of 17716? True Is 200 a multiple of 20? True Is 6 a multiple of 6? True Is 22 a factor of 1031? False Is 208 a factor of 6132? False Does 91 divide 1183? True Does 19 divide 1005? False Is 770 a multiple of 35? True Is 145 a factor of 50315? True Does 5 divide 405? True Is 525 a multiple of 6? False Is 2774 a multiple of 48? False Does 7 divide 4396? True Is 13 a factor of 1559? False Does 23 divide 18722? True Is 39 a factor of 6468? False Is 14 a factor of 67599? False Is 23052 a multiple of 17? True Is 2179 a multiple of 5? False Is 149 a factor of 15935? False Is 52 a factor of 5320? False Is 20373 a multiple of 195? False Does 42 divide 336? True Does 20 divide 120778? False Does 23 divide 8280? True Is 1599 a multiple of 13? True Does 22 divide 176? True Does 24 divide 4375? False Is 60 a factor of 3475? False Does 29 divide 667? True Does 4 divide 2449? False Does 120 divide 39840? True Does 32 divide 864? True Is 63 a factor of 12619? False Is 6 a factor of 1840? False Is 80 a multiple of 11? False Is 33125 a multiple of 19? False Is 37 a factor of 946? False Does 10 divide 65? False Is 9219 a multiple of 7? True Is 1109 a multiple of 2? False Does 105 divide 3315? False Is 11 a factor of 672? False Is 47 a factor of 18223? False Is 540 a multiple of 60? True Is 4638 a multiple of 85? False Does 65 divide 6825? True Is 40 a factor of 1388? False Is 16 a factor of 9165? False Does 26 divide 11518? True Is 3918 even? True Is 182 a multiple of 26? True Does 40 divide 4671? False Does 29 divide 1479? True Is 13452 a multiple of 114? True Is 3 a factor of 493? False Is 5 a factor of 9274? False Does 11 divide 264? True Does 8 divide 34944? True Does 3 divide 9? True Does 35 divide 595? True Does 66 divide 12737? False Is 3 a factor of 586? False Is 19625 a multiple of 20? False Is 189 a factor of 27048? False Is 235 a multiple of 12? False Is 283 a factor of 566? True Does 13 divide 9165? True Is 180 a multiple of 45? True Is 1452 a multiple of 33? True Is 2925 a multiple of 9? True Does 14 divide 3136? True Is 290 a multiple of 27? False Is 35 a factor of 1043? False Is 5280 a multiple of 26? False Is 5292 a multiple of 16? False Is 24 a factor of 552? True Does 47 divide 2090? False Does 10 divide 868? False Does 83 divide 61166? False Is 560 a multiple of 28? True Does 9 divide 657? True Is 22 a factor of 396? True Does 44 divide 1012? True Is 11704 a multiple of 88? True Is 8 a factor of 14688? True Does 3 divide 894? True Does 12 divide 12410? False Does 32 divide 725? False Is 28 a factor of 11270? False Is 157 a multiple of 5? False Is 775 a multiple of 18? False Is 5 a factor of 678? False Does 6 divide 3665? False Does 129 divide 36754? False Is 63 a multiple of 21? True Does 16 divide 1791? False Does 16 divide 420? False Is 42 a factor of 3234? True Is 4669 a multiple of 53? False Does 99 divide 675? False Is 20 a factor of 5658? False Does 191 divide 3690? False Is 4776 a multiple of 6? True Is 1504 a multiple of 8? True Does 9 divide 504? True Does 7 divide 1758? False Does 43 divide 250? False Is 6986 a multiple of 31? False Is 21240 a multiple of 70? False Is 13 a factor of 2037? False Is 160530 a multiple of 15? True Is 32 a factor of 56106? False Is 17240 a multiple of 5? True Is 13 a factor of 2145? True Is 8769 a multiple of 111? True Is 15617 a multiple of 22? False Does 13 divide 434? False Is 54493 a multiple of 204? False Is 762 a multiple of 39? False Is 6593 a multiple of 23? False Is 15078 a multiple of 14? True Is 880 a multiple of 3? False Is 25 a factor of 629? False Does 147 divide 23226? True Does 50 divide 13107? False Is 27 a factor of 42012? True Does 115 divide 21275? True Is 15 a factor of 13965? True Is 247 a factor of 65026? False Is 520 a multiple of 40? True Does 10 divide 55? False Does 2 divide 424? True Is 951 a multiple of 11? False Is 26 a factor of 4836? True Is 6 a factor of 2923? False Does 39 divide 411? False Does 3 divide 160? False Is 38 a factor of 2930? False Is 1113 a multiple of 7? True Is 47 a multiple of 9? False Is 116 a factor of 27164? False Does 85 divide 2635? True Does 82 divide 902? True Is 9 a factor of 370? False Does 58 divide 28045? False Is 26 a factor of 7238? False Is 6 a factor of 13? False Is 24 a factor of 684? False Is 27 a factor of 3078? True Does 21 divide 14759? False Is 13 a factor of 6071? True Is 21605 a multiple of 149? True Is 77 a factor of 10318? True Does 25 divide 17009? False Does 47 divide 50935? False Does 15 divide 9420? True Is 15 a factor of 190270? False Is 26 a factor of 2756? True Does 113 divide 1943? False Is 19 a factor of 1045? True Does 8 divide 60704? True Does 85 divide 9095? True Does 43 divide 1376? True Is 1254 a multiple of 40? False Does 30 divide 1860? True Does 46 divide 1777? False Does 14 divide 1554? True Is 11 a multiple of 11? True Does 84 divide 37064? False Is 61 even? False Does 16 divide 14985? False Does 116 divide 42627? False Is 6829 a multiple of 4? False Is 222 even? True Is 1242 a multiple of 54? True Does 34 divide 1360? True Is 25 a factor of 4841? False Is 1243 a multiple of 62? False Does 43 divide 18060? True Is 7142 a multiple of 6? False Does 48 divide 430? False Is 4 a factor of 6330? False Is 51 a factor of 4947? True Does 63 divide 4834? False Is 10105 a multiple of 235? True Does 8 divide 379? False Is 54 a factor of 10152? True Is 13 a factor of 65? True Is 1006 a multiple of 12? False Is 101 a factor of 5457? False Does 213 divide 43658? False Is 2710 a multiple of 102? False Is 3248 a multiple of 8? True Is 44 a factor of 605? False Is 198 a multiple of 22? True Is 2451 a multiple of 57? True Is 6 a factor of 1636? False Does 130 divide 7633? False Does 5 divide 47427? False Is 883 a multiple of 18? False Is 12264 a multiple of 14? True Does 31 divide 732? False Is 7 a factor of 29342? False Is 336 a multiple of 24? True Is 2745 a multiple of 46? False Is 4116 a multiple of 12? True Is 4950 a multiple of 25? True Is 3870 a multiple of 18? True Does 213 divide 34341? False Is 137 a factor of 9727? True Does 9 divide 3439? False Is 17 a factor of 835? False Does 4 divide 812? True Is 1482 a multiple of 37? False Is 3913 a multiple of 43? True Is 390 a multiple of 13? True Is 809 a multiple of 13? False Does 159 divide 27825? True Is 20 a factor of 53? False Is 5972 a multiple of 35? False Is 8 a factor of 977? False Does 238 divide 35224? True Is 710 a multiple of 33? False Does 8 divide 368? True Is 7 a factor of 2381? False Does 107 divide 102613? True Is 47658 a multiple of 47? True Does 74 divide 370? True Is 798 a multiple of 85? False Is 11 a factor of 121? True Is 12174 a multiple of 51? False Is 15302 a multiple of 29? False Is 1001 a multiple of 25? False Is 18 a factor of 918? True Does 175 divide 8575? True Is 11342 a multiple of 56? False Is 5 a factor of 17713? False Is 32 a factor of 6048? True Does 33 divide 51282? True Is 12 a factor of 3276? True Is 1625 a multiple of 25? True Is 8 a factor of 208? True Is 40 a factor of 31040? True Is 5 a factor of 525? True Is 18 a factor of 6012? True Does 5 divide 4202? False Is 2736 a multiple of 4? True Is 11340 a multiple of 10? True Does 26 divide 452? False Does 188 divide 46857? False Is 189 a multiple of 14? False Does 140 divide 13976? False Is 748 a multiple of 4? True Is 232 a multiple of 15? False Does 21 divide 441? True Is 107334 a multiple of 9? True Is 1846 a multiple of 71? True Does 33 divide 540? False Does 42 divide 590? False Is 552 a multiple of 23? True Does 7 divide 20? False Does 12 divide 480? True Is 46 a factor of 5152? True Is 1550 a multiple of 25? True Does 7 divide 240? False Is 4 a factor of 165? False Is 26895 a multiple of 83? False Does 4 divide 827? False Does 3 divide 162? True Is 408 a multiple of 28? False Is 585 a multiple of 13? True Does 9 divide 1175? False I	{ "pile_set_name": "DM Mathematics" }
) = -47f + 1. Let t(p) = 4n(p) - 9w(p). Let d(r) = 4r - 4. Determine 3d(a) - 2t(a). 6a - 2 Let q(x) = x3 + x - 1. Let l(z) = 7z*3 + 5z - 2. Let g = -375 - -627. Let i be g/(-228) - 2/(-19). What is il(h) + 5q(h)? -2h3 - 3 Let i(q) = 9q - 45. Let n(v) be the third derivative of -v*3/6 + 3v*2 - 33v. Give i(p) - 45n(p). 9p Let d(f) = 2f2. Let k(o) = 92o*2 - 11o + 2. What is 5d(g) - k(g)? -82g*2 + 11g - 2 Let o(b) = -52b3 + 16b*2 - 4b + 16. Let k(r) = 35r3 - 11r*2 + 3r - 11. Let a(h) = 7k(h) + 5o(h). Let n(m) = m*2 + m + 1. Determine a(g) - 3n(g). -15g3 - 2g Let w(d) = 13d3 + 14d*2 + 7d + 48. Let t(s) = -27s3 - 30s*2 - 15s - 98. Give 6t(j) + 13w(j). 7j3 + 2j*2 + j + 36 Let q(y) = 8y + 1. Let m(f) = 11f - 9. Let j(o) = -m(o) + 2q(o). Let x(h) = -h + 1. Give -j(l) - 2x(l). -3l - 13 Let o(i) = 18i2 - 654i + 4. Let z(n) = 14n2 - 657n + 3. Give 3o(y) - 4z(y). -2y2 + 666y Let g(r) = 14r. Let q(x) = -15x. Let y = 328 - 332. Determine yq(k) - 5g(k). -10k Let y(b) be the first derivative of -2b*3/3 + 5b + 1. Let u(h) = 3 - 3 + 14 + 2h2 - 7h*2. Let g be (-2)/(-6)(-66 + 54). What is gu(m) + 11y(m)? -2m2 - 1 Let l(v) = -7v - 4. Let r(w) = 73w - 296. Let n(j) = 25j - 105. Let z(t) = 17n(t) - 6r(t). Determine 5l(f) - 2z(f). -9f - 2 Let p(o) = -o2 + 5o + 4. Let q(u) = 3u2 - 14u - 11. Let y = -711 - -717. What is yq(z) + 17p(z)? z*2 + z + 2 Let q(n) = -251n - 139. Let v(l) = 252l + 162. Calculate -7q(w) - 6v(w). 245w + 1 Let j(m) = -50m3 - 20m + 20. Let n = 460 - 463. Let a(t) = 7t3 + 3t - 3. Give nj(h) - 20a(h). 10h3 Let r(v) = -15v - 87. Let i(j) = 16j + 51. Calculate -7i(z) - 6r(z). -22z + 165 Let k(c) = -400 + 798 - 397. Suppose -17s + 80 - 29 = 0. Let y(n) = -2n*3 + 4n*2 - 2n + 3. Calculate sk(b) - y(b). 2b*3 - 4b*2 + 2b Let o(c) = -10c + 4. Let i(v) = 5v - 2. Let w(n) = -n*3 + 42n - 39. Let s be w(6). What is so(z) - 5i(z)? 5z - 2 Let v(p) = 1. Suppose 4s - 5d = -15, 4d = 9d + 5. Let t(a) = 25a - 20. Let h(q) = 12q - 9. Let z(w) = sh(w) + 2t(w). What is 5v(b) - z(b)? 10b Let y(x) = 9x. Let t(d) = 1418d2 + 11d + 3. Let w be t(3). Let z(a) = 4a + 12798 - w. Give -2y(c) + 5z(c). 2c Let r(n) = 7n3 - 51n*2 + 2n + 10. Let k(c) = -6c3 + 50c*2 - c - 8. Give 5k(p) + 4r(p). -2p*3 + 46p*2 + 3p Let j(l) = -30l + 90. Let r(u) = -1. Let b = 4073 - 4072. Give bj(q) + 90r(q). -30q Let o(b) = -b3 + b2 + 9b + 10. Let i be o(4). Suppose 64a - 70a - 6 = 0. Let s(h) = -1. Let m(u) = u3 + 2u*2 + 2. What is am(r) + is(r)? -r3 - 2r*2 Let d(t) = -502t - 213. Let n(q) = 169q + 74. What is -6d(p) - 17n(p)? 139p + 20 Let d(c) = -7c + 7. Let f be (-6)/((-2)/43). Let x(s) = -f - 2s - 2s + 8. Let u = 694 + -700. Calculate ud(m) + 11x(m). -2m + 2 Let a(p) = -8p3 - p2 - 7p + 396. Let r(o) = -15o*3 - 2o*2 - 13o + 790. What is -9a(b) + 5r(b)? -3b3 - b2 - 2b + 386 Let z(l) = 12253l - 117. Let c(f) = -18379f + 187. What is 5c(s) + 8z(s)? 6129s - 1 Let g(n) = -6n*2 + 60n + 665. Let t(i) = -2i2 + 17i + 222. Give -2g(x) + 7t(x). -2x2 - x + 224 Let v(i) = -581i*2 + 132i + 12. Let u(y) = -393918y2 + 89474y + 8134. Determine 6u(s) - 4067v(s). -581s2 Let w(y) = -5y + 2. Let g be (2/(-3))/((-8)/12)(395 - 396). Let v(r) = r - 7. Let n(d) = 1. Let x(l) = 6n(l) + v(l). What is gw(b) - 3x(b)? 2b + 1 Let v(q) = -16q*3 + 5q*2 - q - 9. Let m(d) = -376d*3 - 15d*2 + 833d*3 - 417d*3 + 2d + 22 + 3d2. Determine 5m(y) + 12v(y). 8y*3 - 2y + 2 Let d(b) = 474b3 + 17b*2 - 26b. Let s(c) = 158c3 + 6c*2 - 10c. Calculate 3d(t) - 8s(t). 158t3 + 3t*2 + 2t Let i(c) = 335c - 34. Let o(f) = 155f - 17. What is 4i(r) - 9o(r)? -55r + 17 Let p(n) = 7n*2 - 9n + 5. Suppose -3d = -0 + 15. Let k(w) = 10w*2 - 13w + 7. Suppose -a + 17 = 9x - 57, -5x - 4a = -79. What is dk(f) + xp(f)? -f2 + 2f Let z(a) = 1376 + 3a2 - 2758 + 1381 + 6a. Let k(x) = -10x2 - 18x + 3. Give 2k(y) + 7z(y). y*2 + 6y - 1 Let h(m) be the third derivative of -m6/8 + m5/60 - m*4/8 + 36m*2 - m - 2. Let g(x) = -7x*3 - x. What is 5g(a) - 2h(a)? -5a*3 - 2a*2 + a Let n(b) = 1819b*3 + 6b*2 + 12b - 24. Let d(w) = -552975w3 - 1825w*2 - 3650w + 7300. Determine 6d(k) + 1825n(k). 1825k3 Let g(p) = -6p*2 - 2p + 8. Let u(h) = 1. Suppose 4m - 4 = 0, 6r - 3m = 9r - 6. Calculate rg(n) - 6u(n). -6n2 - 2n + 2 Let k(a) = -9a2 - 2941a - 12. Let s(y) = 2y2 + y + 3. Give -k(b) - 4s(b). b*2 + 2937b Let q(w) = w + 45. Let i(k) = -2k - 3306. Calculate -i(s) - 4q(s). -2s + 3126 Let o(p) be the third derivative of -p6/20 + p4/8 - p3/2 + 43p*2 + 2. Let h(x) = 5x - 4 - 4 - 11x3 + 3. Calculate -3h(a) + 5o(a). 3a*3 Let n(i) = -i - 10. Let f be n(-6). Let a(w) = -2w. Let p(k) = -2k + 5. Let d be p(-2). Let b(s) = 16s - 6s - ds. What is fa(t) - 6b(t)? 2t Let s = -348 - -353. Let a(d) = 22d + 22. Let h(x) = 9 - 4x + 7x + 11x - 5x. Calculate sa(r) - 12h(r). 2r + 2 Let l(j) = j3 - 3j*2 + 39j - 3. Let h(d) = d*2. Calculate -3h(t) - l(t). -t*3 - 39t + 3 Let a(g) = 0g - g + 2g. Let i(s) be the second derivative of 0s2 - s3 + 103s + 0 - 1/12s4. Calculate 6a(q) + i(q). -q*2 Let i(c) = c + 4. Let h be (-9)/(-36)-214. Let s(z) = -15z - 5. Let m(f) = -34f - 8. Let x(j) = hs(j) + 3m(j). Determine -11i(t) + 4x(t). t Let y(k) be the first derivative of 12k*2 + 9k + 883. Let o(w) = 8w + 3. Determine 11o(n) - 4y(n). -8n - 3 Let t(r) = -5r2 - 2r - 3. Let s(m) = -6m2 - 2m - 3. Suppose 5l = -2g - 11, -g = 2g + l + 10. What is gs(f) + 4t(f)? -2f*2 - 2f - 3 Let n(j) be the third derivative of -j*3/6 - 3j*2 - 256j. Let a(b) = 2b - 4. Determine a(k) + 8n(k). 2k - 12 Let w(k) = 9k - 3. Let d = 2 - -1. Let p(a) = -145a - 17396. Let r be p(-120). Let f(h) = -8h + 4. Determine df(y) + rw(y). 12y Let j(u) = -2u + 2887. Let n(i) = -8. What is -j(h) - 2n(h)? 2h - 2871 Let j(s) be the first derivative of 3s4/2 - 4s*3/3 + 2s + 7665. Let o(n) = -n3 - n2 + 1. Calculate -j(c) + 3o(c). -9c3 + c2 + 1 Let r(a) = -16 - 22a + 21a + 17. Let i(n) = 105 + 95 - 198 - 2n. What is 2i(y) - 6r(y)? 2y - 2 Let a(k) = 87k3 - 105k*2 - 22k - 22. Let h(x) = -65x3 + 79x*2 + 16x + 16. Calculate -8a(f) - 11h(f). 19f3 - 29f*2 Let z(k) = -379437k*2 - 474k + 474. Let l(n) = 3994n2 + 5n - 5. Give 474l(o) + 5z(o). -4029o2 Let b(g) = 7g*3 + 5g*2 - 5. Let l(i) be the second derivative of -1/5i5 - 5 + i2 + 0i3 - 1/6i*4 + 2i. Calculate 2b(u) + 5l(u). -6u3 Let k = 2025 - 2023. Let b(r) be the first derivative of r3 + 22 - 7/4r*4 + 0r*k - 3r. Let y(f) = 34f3 - 14f*2 + 14. Calculate -14b(d) - 3y(d). -4d*3 Suppose z - 15 = -12. Let d(u) = -z + 14 - 9. Let q(t) = -6t - 7. Let p(n) = 7n + 7. Let a(o) = 5p(o) + 6q(o). Calculate -4a(b) - 14d(b). 4b Let j(c) = 7c2 + 2. Let m(s) = -209s + 1050. Let v be m(5). Let y(a) = 14a2 + 5. Calculate vj(l) - 2y(l). 7l*2 Let r(a) = 2a*3 - 16a*2 - 141a + 8. Let d(z) = -5z3 + 47z*2 + 425z - 22. What is -4d(t) - 11r(t)? -2t3 - 12t*2 - 149t Let x(y) = 10y3 + 5y*2 + 8y - 47. Let l(g) = -2g3 - g2 - g + 9. Give 11l(q) + 2x(q). -2q3 - q2 + 5q + 5 Let c(v) = -v - 3. Let q(y) be the third derivative of 0 + y2 - 18y + 1/24y4 + 0y*3. Determine -c(s) - 3q(s). -2s + 3 Suppose 4y = 3y + 4c + 105, 4c + 396 = 4y. Let j = 98 - y. Let m(v) = v*2 - 1. Let q(n) = 6n*2 + n - 5. What is jq(r) - 5m(r)? r2 + r Let y(z) = -9z*2 - 13z - 1. Let p be 14 - -7(-171)/133. Let f(b) = 4b*2 + 6b + 1. Give pf(w) + 2y(w). 2w2 + 4w + 3 Let b(y) = 24y + 22. Let d(i) = 8i + 7. Let k(p) = 24p2 - 550p - 51. Let o be k(23). Give ob(j) + 16d(j). 8j + 2 Let h(c) = 11c*3 + 5c*2 + 6c. Let b(r) = 10r3 + 4r*2 + 5r. Let t(m) = -189m - 3965. Let w be t(-21). Determine wh(x) - 5b(x). -6x*3 - x Let r(a) = -6a + 28. Let n(l) = -4l + 19. Let k(w) = -4n(w) + 3*r(w).	{ "pile_set_name": "DM Mathematics" }
1. Let h(y) = 5y - 14. Let b(k) = -h(k) + 4q(k). Let z be b(6). Suppose -4m + 104 = -2s, 8m + zs = 3m + 143. Is m a multiple of 12? False Let c be -7 + -448 - -1 - -3. Let s = 753 + c. Is s a multiple of 32? False Let b(c) = -c3 + 4c*2 - 11c + 44. Let a(r) = 3r3 - 13r*2 + 33r - 131. Let u(j) = 4a(j) + 11b(j). Does 16 divide u(8)? True Let o be -95 - (-3 + -3)/(-2). Suppose -600 - 180 = 10b. Let j = b - o. Does 5 divide j? True Let t = 1874 + 7765. Does 21 divide t? True Let a be (2 - -2) + (-9)/((-27)/12). Suppose -7809 = ai - 27i. Is i a multiple of 22? False Let w(a) = 15a + 17. Let i be w(6). Suppose 73 = -2g - i. Let r = 156 + g. Does 33 divide r? True Let j(r) = 2992r*2 - 223r + 221. Is 19 a factor of j(1)? False Let x(t) = t + 2. Let k be x(-2). Suppose ka = p - a - 9, 2p - 4a - 20 = 0. Does 6 divide 22/p - 2 - (-133)/4? False Let l = 37702 - 10906. Does 13 divide l? False Suppose 0 = -456l + 464l + 4144. Let i = l - -599. Is 27 a factor of i? True Let v = 71 - 68. Let l(i) = -i2 + 1. Let q(t) = 3t*2 + 7t - 25. Let z(f) = -4l(f) - q(f). Does 9 divide z(v)? True Let c be 176/84 + (-32)/336. Does 13 divide (-1 + c + -20)/((-11)/176)? False Suppose 541 = 4t - 715. Let q(s) = -22s - 10. Let m be q(9). Let n = t + m. Does 11 divide n? False Suppose -x - 81x - 25x + 107214 = 0. Does 2 divide x? True Suppose -134g = -5y - 137g + 721, -4y - 5g + 595 = 0. Is 4 a factor of y? True Let l = 5807 - 2692. Suppose 34g = 41g - l. Is 23 a factor of g? False Is (-1)/13 + 81942/39 a multiple of 11? True Suppose -12h + 33 = -9h. Let s(w) = 5w3 + 51w*2 - 24w + 49. Let b(d) = d*3 + 10d*2 - 5d + 10. Let v(o) = hb(o) - 2s(o). Does 22 divide v(-7)? True Suppose 3w - 4 = -h, -h + 2h + 2 = 0. Let l(o) = 27o + 4. Is 2 a factor of l(w)? True Let x(r) = 15793r + 229. Is x(2) a multiple of 315? True Let q = -31 + 28. Let g be ((-27)/(-3))/q(-376)/3. Suppose 0 = 12n - 548 - g. Is 11 a factor of n? True Let v(o) = -3o3 + 144o*2 + 99o + 167. Let z(c) = c*3 - 48c*2 - 33c - 56. Let x(k) = 2v(k) + 7z(k). Does 33 divide x(49)? True Let u(b) = -10b - 48. Let t be u(-6). Let z(l) = l2 + 8l - 7. Is 46 a factor of z(t)? False Let b(p) = 20p2 - 169p - 62. Is 40 a factor of b(10)? False Let y = -269 + 384. Suppose 0 = 12g - 749 - y. Is 8 a factor of g? True Let i(s) = 5s*2 + s + 15. Let l(a) = -17a*2 - 6a - 46. Let o(t) = 7i(t) + 2l(t). Is o(-11) even? False Suppose 26a = 200255 - 42799. Is 82 a factor of a? False Let f be -1 + (-47)/(-7) + 40/140. Is (-434)/21f/4-1 a multiple of 20? False Suppose 2v + 5p - 11 = 0, -8 = 4v - 6v - 2p. Suppose 3r - vf + 5 + 13 = 0, r = -f + 2. Is (316/(-20) - -3)15/r a multiple of 8? True Let r(h) = -588h - 443. Does 14 divide r(-5)? False Let m(c) = -c*3 - 7c*2 + 4c + 53. Let i be m(-6). Is 54 a factor of 536 + (3 - 0) + (-7)/i? True Let g = -199 + 651. Suppose -448m = -gm + 2384. Is 13 a factor of m? False Suppose 7t - 222864 = -23819. Does 30 divide t? False Suppose 55p - 56p + 13584 = 2q, 4q - 5p - 27196 = 0. Is q a multiple of 76? False Let f(p) = -124p - 362. Is 22 a factor of f(-54)? False Suppose -6 = 2o + 4z, 5 + 16 = 5o - 2z. Suppose 5h + n - 2906 = 0, on = -17 + 5. Does 23 divide h? False Let u be 6/(-14) - (-7)/((-98)/(-1350)). Suppose -y = 0, -2w = -2y + 424 - u. Let p = w - -299. Does 15 divide p? True Suppose 2a = -2w - 10, 4w + 4 = 2a - 4. Does 16 divide (-14 - 25)(-12)/(0 - a)? False Let o(k) = 301k + 807. Is o(11) a multiple of 17? False Suppose -5k = 42z - 40z - 21310, -2k = 2z - 21322. Is z a multiple of 135? True Is 7624 - 011/44 a multiple of 92? False Let n be (-89)/4 - 5/(-20). Let b be n34(-5)/10. Suppose 4x + 4o = 452, -x - b = -4x + 4o. Is x a multiple of 23? False Let d(i) = -4i - 64. Let b be d(-11). Is b/(-90) + 939/27 a multiple of 7? True Let u = 23 - 29. Let a be 5 + u - (-3 - 2). Suppose -12 - 76 = -ah. Is h a multiple of 3? False Suppose 3n + 216 = 5n. Suppose -15k + n = -14k. Let g = 162 - k. Is g a multiple of 9? True Let t(m) = m3 + 8m*2 - 19m + 13. Let o be t(-10). Suppose 0q + 104 = 5x + 4q, -q = ox - 61. Is 5 a factor of x? True Let u = -752 - -8320. Is u a multiple of 44? True Is 118 a factor of 118(-13)/52-106? False Let n = 286 + -466. Does 8 divide (6 + n/42)(-42)/(-3)? True Let s(f) be the third derivative of -29/6f*3 + 1/4f*5 + 28 + 2f*2 + 0f - 1/120f6 + 5/8f*4. Is s(15) a multiple of 14? True Suppose 0 = -4g + 16, -13i - 3g = -11i - 13374. Is i a multiple of 9? False Suppose 0 = -p - 3x + 344, -5p + x + 1720 = 5x. Suppose 28v + 2250 = -2846. Let r = p + v. Does 11 divide r? False Let d be (-4 - (-1 - 3))/5 - 469. Let a = d - -691. Is 6 a factor of a? True Let i = 42 + -84. Let l = 42 + i. Suppose 2u + 3d - 66 = l, 2d = 7d - 10. Is u a multiple of 3? True Let w be 43121/26 - (2/4 + -1). Is 22 a factor of w/4 + 3 - 11/(-44)? True Suppose 34 - 114 = -16u. Suppose -g + o + 1601 = 2g, uo = g - 543. Is g a multiple of 12? False Suppose 0 = -y + 3f - 5 - 4, 3f = 4y + 9. Suppose -5x - 2p + 87 = 0, y = x + 3x + 2p - 68. Let r = x + -8. Is r a multiple of 2? False Let d = 0 + 3. Suppose dn - 4l = -6, -2l = -0n - 4n + 2. Suppose -5r + c + 128 = -3c, 5r + nc = 146. Does 5 divide r? False Let h(d) = d*3 - 10d*2 + 8d + 9. Let j be h(9). Suppose -10i + 6i + 12 = j. Suppose -5l + u = -u - 804, -il = 5u - 470. Is 32 a factor of l? True Suppose 27z - 177165 - 105399 = -31059. Is 69 a factor of z? True Suppose -5083 = -6n + 14069. Does 12 divide n? True Let a be (-25)/5 - (-30)/3. Suppose -aq = 16 + 29. Let f(c) = 2c + 51. Is f(q) a multiple of 11? True Let n = -383 + 1193. Suppose -2u + n = -q + 4q, -u - 3q = -411. Is u a multiple of 57? True Suppose -4m + 9 = -0y - y, 3y = -5m + 24. Suppose 0 = yj - 2j - 288. Suppose 4t = j - 32. Is 10 a factor of t? False Suppose -5s - 9 - 21 = 0. Let d(y) = -y*3 - 2y*2 - 15y - 18. Let t be d(s). Let m = t - 88. Does 24 divide m? False Suppose 3w = -4x + 16, 9w - 12 = 7w - 2x. Let c(g) = -g + 63. Is c(w) a multiple of 11? True Let g(x) = 2x*3 - 4x*2 + 20x - 7. Let i(j) = 3j3 - 4j*2 + 20j - 7. Let y(m) = -4g(m) + 3i(m). Let t be y(-7). Does 43 divide 285 + t - (-42)/14? False Let o(w) be the second derivative of 56w5/5 - w4/6 + w3/3 - 46w + 2. Is 28 a factor of o(1)? True Let d be 4 + 3 + 1 + -2. Let i be d/(-2)(-2 + 4). Is -28(-8)/((-32)/i) a multiple of 14? True Let k(g) = -582g2 + 9g + 8. Let s be k(-1). Does 10 divide (-2)/(-4) + s/(-2)? False Let w(f) = -11f2 - 4f + 22. Let k be w(0). Suppose -4m + 123 = 371. Let t = k - m. Is t a multiple of 12? True Is (8495775/(-120))/(-15) - (3/(-8))/3 a multiple of 20? True Let x = 13681 - 6646. Does 47 divide x? False Suppose -17q + 7751 = -5305. Does 22 divide 9/(-2 + 1554/q)? False Let k = -9875 - -18821. Is k a multiple of 63? True Suppose 45544 = -45a + 212494. Is 106 a factor of a? True Suppose -y + 208980 = -0y + 17y. Is 137 a factor of y? False Let i(u) = -7u*2 + 8u - 11. Let d(k) = -11k2 + 12k - 16. Let t(w) = -w*2 + 1. Let q be t(-3). Let m(c) = qi(c) + 5d(c). Is m(10) a multiple of 8? False Suppose 3n + z - 1855 = -175, 1112 = 2n - 2z. Is n a multiple of 13? True Suppose -21k - 7131 - 5553 = 0. Let s = k + 1684. Is s a multiple of 30? True Suppose 0 = -5m - 4z + 54170, -876m = -875m + 3z - 10845. Is 10 a factor of m? True Suppose -2x = 2c - 160, -3c + 0c = -12. Suppose x = -3f - 89. Let s = f + 73. Is s a multiple of 18? True Let s = 3276 + -1129. Is s a multiple of 19? True Let z(c) = -3c*2 - 11c - 8. Let o be z(-2). Suppose -h + 12 = -5n, h + n - 12 = 2n. Suppose -hx + ox + 2210 = 0. Is x a multiple of 13? True Suppose 2j - 185486 = -5t, 129383 = 3t - 5j + 18048. Does 106 divide t? True Let y(f) be the second derivative of 5f3/6 - 5f*2/2 + f. Let d(k) = 3k*2 + 7k + 8. Let r be d(-1). Is 5 a factor of y(r)? True Let o be (-2)/(((-15)/6)/5). Suppose -2d - 30 = -2f, -13 - 5 = -2f - od. Suppose fh - 170 = 8h. Is h a multiple of 10? False Let a = -102 + 88. Let r be 90/21 + (-3 - 38/a). Suppose r*l - l + 25	{ "pile_set_name": "DM Mathematics" }
) + (-6270)/2280. Determine rz(v) - 7b(v). 8v - 2 Let p(f) = -f3 - 2f*2 - 7f + 3. Let n(s) = -5s2 + 5 + 6 - 20s + 44s3 - 23s*3 - 24s*3 - 3. Give 4n(l) - 11p(l). -l3 + 2l*2 - 3l - 1 Suppose -162t + 46 = -116. Let q(w) = -w - 1. Let f(c) = -14c + 8. Calculate tf(i) + 6q(i). -20i + 2 Let f(q) = -2576q*2 + 207. Let p(u) be the third derivative of -5u5/12 + u3/3 - 537u2 + 2u. Determine 2f(m) - 207p(m). 23m2 Let g(l) = -6l3 - l2 - 35l - 62. Let q(m) = 5m*3 + 2m*2 + 35m + 93. Calculate -3g(o) - 2q(o). 8o3 - o2 + 35o Let l(s) = 89s + 58. Let k(o) = 27o - 1. Determine -3k(b) + l(b). 8b + 61 Let z(t) = -58t3 + 4t*2 + 2t + 31. Let j(y) = 57y3 - 3y*2 - 2y - 25. What is 5j(n) + 4z(n)? 53n3 + n2 - 2n - 1 Let n(c) = -c*2 - c. Let q(r) = 7r*3 + 21r*2 + 21r. Let f(z) = -z*2 - 25z + 60. Let v be f(-28). Let i = 25 + v. What is iq(h) + 21n(h)? 7h3 Let o(l) = -4l + 1020. Let b(j) = -3j + 1022. Give -5b(x) + 4o(x). -x - 1030 Let p(b) = b2. Let m(j) = -3j + 503j2 - 1051j*2 + 3j + 510j2. What is m(a) + 76p(a)? 38a2 Let y(q) = -q - 2. Let l(w) be the third derivative of -w4/24 + w3/6 - 1528w*2. Give -2l(j) + y(j). j - 4 Suppose 482 + 73 + 411 = -138t. Let z(v) = 4v*3 + 2v*2 + 2v + 3. Let l(s) = 12s3 + 6s*2 + 7s + 9. What is tz(q) + 2l(q)? -4q3 - 2q*2 - 3 Let w(l) = 11l + 581. Let c(m) = -24m - 1164. Calculate 6c(q) + 13w(q). -q + 569 Let h(q) = -11q - 1. Suppose 11w - 22w - 10 - 12 = 0. Let m(x) = -43x - 4. Determine wm(j) + 9h(j). -13j - 1 Let x(o) = -8o3 + 66o*2 + o - 637. Let j(l) = 7l*3 - 44l*2 + 636. Give -3j(m) - 2x(m). -5m*3 - 2m - 634 Let t(g) = -12g2 + 12. Let i(c) = -47c*2 + c + 45. Let d(s) = -6i(s) + 22t(s). Let z(b) = -18b*2 + 5b + 5. Calculate -5d(m) - 6z(m). 18m2 Let q(i) = -153i*3 + 45i*2 + 45i + 45. Let z(k) = -2 - 22k + 7k*3 + 49k - 9k - 2k*2 - 20k. What is -4q(o) - 90z(o)? -18o3 Let z(q) = 386q - 39. Let i(w) = 383w - 35. Determine -8i(b) + 7z(b). -362b + 7 Let b(j) = -32j2 + 6j + 10. Let o(d) = 43d2 - 8d - 14. Determine 9b(m) + 7o(m). 13m2 - 2m - 8 Let s(t) = -2 + t + 2. Let o(g) = g - 1. Let c(i) = i*2 - i - 14. Let v be c(5). Suppose 19a = -v - 13. Calculate ao(y) + 4s(y). 3y + 1 Let r(f) = -353f - 9. Let l(m) = 193m + 5. Let h(k) = 11l(k) + 6r(k). Let i(b) = -6b - 1. Determine -3h(q) - 4i(q). 9q + 1 Suppose -479r + 484r = 3i + 22, 3r - 18 = 3i. Let d(x) = -5x + 3. Let q(u) = -11u + 7. Let m(k) = -6k + 1. Let n be m(1). What is nd(j) + rq(j)? 3j - 1 Let g(w) = -441w2 - 54w - 8. Let o(t) = t*2 + 10t + 1. Calculate -g(y) - 6o(y). 435y*2 - 6y + 2 Let a(o) = 1868o3 + 3o + 1. Let c(p) = 3733p3 + 5p + 1. Calculate 5a(d) - 3c(d). -1859d3 + 2 Let k(m) = 4m - 6. Suppose 14c = 12c - 6. Let u(r) = 2r2 - 3r + 2. Let q(b) = -b*2 + 1. Let w(l) = 3q(l) + u(l). What is ck(p) - 4w(p)? 4p2 - 2 Let u(c) = -c3 + c2 + 10c - 19. Let d be u(2). Let g(m) = -11m3 - 13m*2 - 9m - 4. Let a(p) = -5p3 - 6p*2 - 4p - 2. Give dg(i) + 7a(i). -2i3 - 3i*2 - i - 2 Let g = -3995 + 3994. Let x(k) = -2. Let u(s) = 5. Let b(z) = -3u(z) - 7x(z). Let m(q) = 2q - 7 + 1 + 1. Calculate gm(y) + 4b(y). -2y + 1 Let z be ((10 - 9) + -3)/((-6)/(-21)). Let c(m) = 9m*3 + 7m*2 + 16m - 10. Let v(f) = -6f3 - 5f*2 - 11f + 7. Give zv(o) - 5c(o). -3o3 - 3o + 1 Let r(c) = 3c3 + c + 1. Let t(q) = -q3 - 1. Let m(i) = -i2 + 101i - 1291. Let n be m(15). Determine nr(o) - 6t(o). 3o3 - o + 5 Let d(q) = -3q + 12. Let g(t) = -t + 3. Let l(n) = n*2 + 1056n + 2112. Let j be l(-2). Determine jd(p) - 15g(p). 3p + 3 Let u(v) = 4v - 2. Let b = -131 + 134. Suppose -3m + 30 = bm. Let c(s) = -s - 1. Give mc(r) + u(r). -r - 7 Let j(p) = p2 - 19p - 1. Let c(l) = -2736l2 + 47652l + 2508. Calculate -c(g) - 2508j(g). 228g*2 Let h(u) = 21u*3 - 10u*2 - 6u + 22. Let w(a) = 40a3 - 19a*2 - 10a + 30. What is -5h(o) + 3w(o)? 15o3 - 7o*2 - 20 Let j(z) = 8z3 + z2 + z. Let d(w) = -23720w3 - 2372w*2 - 2372w. Give -d(c) - 2372j(c). 4744c*3 Let x(g) = 2g + 1. Let a = -375 - -367. Let t(w) = -5w - 1. Let j(l) = ax(l) - 3t(l). Let v(u) = 3u + 15. Determine -8j(p) - 3v(p). -p - 5 Let b be ((-26)/(-39))/((-4)/30). Let t(p) = p*2. Let o(a) be the first derivative of -1/4a*4 + 0a - 4/3a3 - a2 - 4. Determine bt(c) - o(c). c3 - c2 + 2c Let x(h) = -h3 + 3h2 + 1. Let s(y) be the first derivative of -y4/2 + 2y3/3 + y2/2 + 2y + 10836. What is 2s(g) - 3x(g)? -g*3 - 5g*2 + 2g + 1 Let d(t) = -40t3 + 6t*2 + 6t + 6. Let j(f) = -f*2 - f - 1. Suppose 50 = -23i + 27. What is id(x) - 6j(x)? 40x3 Let w(l) = -4l*2 - 6l + 43. Let n(x) = -5x2 - 7x + 42. Let o = -26463 - -26457. What is on(i) + 7w(i)? 2i2 + 49 Let f(g) = -g - 4. Let s(o) = 1. Let p be (-4(-3)/36)/((-15)/(-90)). Give ps(a) - f(a). a + 6 Let y(f) = 13f*2 + 4f - 6. Suppose -4w = 8, -36r - w - 12 = -34r. Let j(u) = u2 + u - 1. Determine rj(m) + y(m). 8m2 - m - 1 Let a(l) = -1. Let t(g) = g + 1. Let n be ((-3)/(-9))/(2/102). Let k = -16 + n. Determine kt(p) + 5a(p). p - 4 Let p(o) = -14o*3 - 3o*2 - 30o - 5. Let h(b) = -15b3 - 4b*2 - 29b - 5. What is -3h(g) + 4p(g)? -11g3 - 33g - 5 Let s(p) = -12p3 + 3p*2 + 4p. Let c(h) = 14h3 - 3h*2 - 4h. Determine -5c(d) - 6s(d). 2d3 - 3d*2 - 4d Let d(j) be the second derivative of -j5/20 + j4/3 + 2j2 - j. Suppose 13p + 12421 = 12460. Let b(q) = q*2 + 1. Calculate pb(v) - d(v). v3 - v2 - 1 Let f(t) = 5t2 + 2t. Suppose -5b - 41 = -11. Let l be b/936/(-8). Let p(s) = -4s2 - ls*2 - 3s*2 - 5s. Determine 5f(v) + 2p(v). 5v2 Let y(b) = -b2 + 4b - 2. Let g(u) be the second derivative of -u*4/6 + 5u*3/6 - 3u*2/2 + 5152u. Give 2g(k) - 3y(k). -k*2 - 2k Let d(y) = 2y + 133 - 116 + 0y + y + 9y2 + 6y*2. Let h(i) = -5i*2 - i - 6. Calculate 6d(a) + 17h(a). 5a*2 + a Let m(t) = 4t*2 - 9t + 4. Let b(h) = h*2 + h + 1. Suppose -13z = 188 - 38 - 85. What is zb(u) + m(u)? -u2 - 14u - 1 Let a(b) = 2b + 1. Let v(t) be the first derivative of -t3/3 - t2 - 2t + 5502. Give 6a(f) + 5v(f). -5f2 + 2f - 4 Let l(c) = -668c + 36. Let u(m) = -36m - 1. Determine l(w) - 16u(w). -92w + 52 Let r(j) = 215j3 + 129j*2 + 129j + 258. Let z(g) = -2g3 - g2 - g - 2. What is r(q) + 129z(q)? -43q3 Let w be 310/3(-45)/(-75). Let b(d) = -31d3 - 3d*2 + 3. Let a(q) = -651q*3 - 62q*2 + 62. Determine wb(x) - 3a(x). 31x*3 Let n(t) = -3t*3 - 40t*2 - 2. Let y(x) = -3x*3 - 38x*2 - 2. Calculate 5n(v) - 4y(v). -3v*3 - 48v*2 - 2 Let z(r) = -3r + 12r + 5r + 35 - 3r. Let g(h) = h + 4. Let a(p) = -36g(p) + 4z(p). Let u(j) = -4 - 5 + 23j - 6j. Give 13a(w) - 6u(w). 2w + 2 Let f(z) = -17z. Let h(q) = 13q - 4. Let w(v) = -27v + 9. Let x(j) = 9h(j) + 4w(j). Suppose 0 = -2d + 6d + 28. Let n = 6 + -10. What is dx(s) + nf(s)? 5s Let s(h) = -102h3 - 2h*2 - 13h + 6. Let u(o) = -510o3 - 11o*2 - 71o + 31. What is -11s(l) + 2u(l)? 102l3 + l - 4 Let j(w) = 7w3 + w2 - w + 4. Suppose -5g - 4o - 37 = 0, -293o + 2 = -g - 292o. Let l(u) = -13u3 - 2u*2 + 3u - 7. What is gj(i) - 3l(i)? 4i3 + i2 - 4i + 1 Let i(m) = 3m3 - 4m*2 + 4m + 1. Let l(f) = 2f3 - 3f*2 + 3f. Let u = -12 + 28. Let k = 14 + u. Let q = k + -27. Calculate qi(w) - 4l(w). w*3 + 3 Let v(o) = -17o*2 + 9o - 2. Let p(w) = 8w2 - 4w + 1. Let f be ((-118)/(-4))/((-18)/(-72)). Let k = f + -124. What is kv(r) - 14p(r)? -10r2 + 2r - 2 Let c(t) = t*3 + 3t*2 + 3t - 1. Let w(p) = -3p3 - 13p*2 - 15p + 13. What is 5c(k) + w(k)? 2k*3 + 2k*2 + 8 Let x(f) = -13f*3 + 24f*2 - 5f - 5643. Let t(p) = -8p3 + 15p*2 - 3p - 3763. Determine 8t(g) - 5x(g). g*3 + g - 1889 Let r(u) = -2u*2 + 8u + 2. Let p(j) = -7j2 - 5263j + 5. What is p(c) - 3r(c)? -c2 - 5287c - 1 Let p(s) = -7s2 - 38s - 6. Let i(c) = 15c2 + 84c + 14. Let g(k) = -6i(k) - 13p(k	{ "pile_set_name": "DM Mathematics" }
(r) = 5r2 - 74. Let w(c) = 7c. Determine b(w(q)). 245q2 - 74 Let b(f) = -f. Let q(s) = 121s. What is q(b(d))? -121d Let x(k) = 2k. Suppose 0n + 30 = 5n. Suppose m - n = -1. Let g(l) = -5l2 + ml*2 + 2l*2. Determine g(x(y)). 8y*2 Suppose -l = -2 - 2. Let r(c) = -lc + 2c + c. Let s(j) = -2j. What is s(r(h))? 2h Let a(p) = p2 + 40p. Let x(w) = -26w. Calculate x(a(f)). -26f*2 - 1040f Let p(f) = f. Let z(x) = 71x - 18x + 30 - 27x - 25x. Determine z(p(c)). c + 30 Let u(v) = 0 + v + 0. Let p(z) = -75z - z2 + 75z. Give p(u(s)). -s*2 Let t(b) = 2b*2. Let h(p) be the second derivative of -5p*4/3 + 5p. Give t(h(o)). 800o4 Let v(g) = 3g. Let x(q) = -7q2 - 91. Determine x(v(d)). -63d2 - 91 Let d(k) = k. Let n(i) = i2. Let c(s) = -4s2. Let b(u) = -c(u) - 2n(u). Determine b(d(q)). 2q2 Let n(t) = 28t*2 + 1. Let g(z) = -7z*2. Give g(n(b)). -5488b*4 - 392b2 - 7 Let w(l) = -l2. Let z(o) = -1. Let g(p) = -p + 1. Let k(x) = 13x - 3. Let q(u) = -6g(u) - k(u). Let s(t) = -q(t) + 3z(t). Determine s(w(r)). -7r*2 Let a(q) be the first derivative of -1 - 1/2q*2 + 0q. Let z(h) be the first derivative of h3/3 + 6. Give z(a(i)). i2 Let n(m) = -2m. Let v(b) be the second derivative of 11b*6/720 - 7b*4/12 - 8b. Let g(z) be the third derivative of v(z). What is g(n(o))? -22o Let p(t) = 5t2. Let v(s) be the first derivative of -s2/2 - 5. Calculate v(p(u)). -5u2 Let p(c) = -2c - 5. Let k(y) = -y - 2. Let b(r) = -5k(r) + 2p(r). Let l(i) = 0i - 2i + i. Give b(l(z)). -z Let f(o) = -2o2 - 10o + 10. Let d(u) = u - 1. Let i(c) = -10d(c) - f(c). Let g(b) be the first derivative of -b3 + 2. Calculate g(i(j)). -12j*4 Let q(c) be the first derivative of 2c*3/3 + 14. Let v(f) = 5f. Determine v(q(r)). 10r2 Let q(w) be the second derivative of w5/6 - w2 - 6w. Let h(n) be the first derivative of q(n). Let s(y) = -2y2. Calculate s(h(a)). -200a*4 Let j(f) = 3f2. Let c(o) = -o2 + 6. Let h(i) = 5. Let t(d) = 5c(d) - 6h(d). What is j(t(x))? 75x4 Let y(v) = -v2 + v - v. Let f(g) be the third derivative of g4/12 - 8g*2. Give f(y(c)). -2c*2 Let t(z) = -11z*2 + 9z*2 + 0z*2 + 5z*2. Let f(w) = -3w*2. Determine f(t(p)). -27p*4 Let c(q) = 9q - 17. Let k(y) be the second derivative of y3/6 - y2 - y. Let u(s) = 6c(s) - 51k(s). Let j(z) = 2z2. Determine j(u(a)). 18a*2 Let h(m) = 6653m. Let n(o) = o*2. Give h(n(u)). 6653u2 Let l(o) = o2 + 2o - 2o. Let y(x) be the third derivative of 5x4/24 + 10x*2. Calculate y(l(r)). 5r*2 Let a(p) = -2p*2. Let i(y) = -9y - 17. Determine a(i(n)). -162n2 - 612n - 578 Let x(h) be the first derivative of 0h2 + 2/3h*3 - 1 + 0h. Let r(v) = -6v2. Give r(x(m)). -24m*4 Let g(u) = 2u. Let d(w) = w - 857. Calculate g(d(t)). 2t - 1714 Let j(s) = -10s - 2. Let c(a) = -283a2. Determine c(j(f)). -28300f*2 - 11320f - 1132 Let b(h) = h. Let w(c) be the first derivative of -2c3 + 20. Give b(w(k)). -6k*2 Let m(y) = 2y*2. Let u = 9 + -13. Let c be 0/u(-1)/2. Let j(q) = -4q2 + 0q*2 + cq*2. Calculate j(m(d)). -16d*4 Let w(j) = -21j*2 + 3. Let l(y) = 48y*2. Determine w(l(k)). -48384k*4 + 3 Let c(n) = 3n2 + n2 - 2n2. Let w(a) = -4a. Determine w(c(i)). -8i2 Let t(g) = -g + 0g + 0g. Let d(k) = -1 - 1 + 2 - 2k. Give d(t(i)). 2i Let p(q) = -10q + 4. Let b(l) = 9l - 3. Let r(n) = 4b(n) + 3p(n). Let v(h) = 3h. Determine r(v(f)). 18f Let m(f) = 8f*2. Let z(y) = 7y*2. Let b(c) = -6m(c) + 7z(c). Let x(d) = 2d*2. What is b(x(l))? 4l*4 Let c(w) = -4w*2. Let p(y) = 2y - 2. Let g(x) = x*2 + 3x - 3. Let u = -9 + 6. Let r(f) = up(f) + 2g(f). What is r(c(h))? 32h4 Let g(r) = 2r. Let q(c) = 19c - 72. What is q(g(d))? 38d - 72 Let d(f) = f + 1. Let z(l) = 2l2 - 2l - 2. Let g(r) = 2d(r) + z(r). Let p(v) = 8v. What is p(g(a))? 16a2 Let v(x) = -x. Let b(r) be the first derivative of 1 + 2/3r*3 + 0r*2 + 0r. Determine b(v(q)). 2q2 Let d(o) = 2o*2. Let v be (-2)/(-8) - (-9)/12. Let k(f) = 5f + 6. Let h(q) = q + 1. Let r(u) = vk(u) - 6h(u). Determine r(d(i)). -2i2 Let h(y) = -16y + 2y + 10y. Let m(s) = -7s. Give m(h(w)). 28w Let i(s) = -14s. Let g(u) = u2 + 71. What is g(i(m))? 196m*2 + 71 Let t(d) = -d - 15. Let f(y) = 4y*2. Calculate t(f(z)). -4z2 - 15 Let k(a) = -a2 - 5a2 - 9a*2 + 12a*2. Let d(h) = -3h*2. Calculate k(d(p)). -27p4 Let z(l) be the second derivative of -l3/6 + l. Suppose 3c + 2u = 6 - 0, -3u + 6 = 3c. Let w(y) = y - 2y - 3y + cy. Give w(z(k)). 2k Let x(r) = -2r2. Let f(l) = -4l*2 + 3 - 6 + 3. Determine f(x(p)). -16p*4 Let f(v) = 8v. Let g(k) = 2k + 10. Let u(q) = 1. Suppose 0 = d + 5l - 15, d - 3l + 35 = 2l. Let o(b) = du(b) + g(b). Determine f(o(t)). 16t Let c(i) be the third derivative of -i5/60 - i2. Let a(v) be the second derivative of -7v4/12 - 107v. Determine a(c(t)). -7t4 Let y(z) = z2 - 43. Let u(j) = 7j*2. Calculate u(y(q)). 7q*4 - 602q*2 + 12943 Let q(a) = 7a*2. Let j(h) = 3h. What is q(j(t))? 63t2 Let v(i) = -6i*2. Let p(z) = -7z*2. Let l(q) = -4p(q) + 5v(q). Let s(b) = -9b. Determine s(l(g)). 18g2 Let p(a) be the second derivative of a4/12 - 2a. Suppose 0n - u + 6 = n, -2u = -4n + 30. Let c(k) = nk*2 - 5k*2 + 2k*2. Determine c(p(y)). 4y*4 Let n(h) = -4 + 4 - 40h. Let u(d) = d. Determine n(u(g)). -40g Let l(s) = 4s*2. Let m = 20 + -28. Let f(a) = -a - 6. Let i be f(m). Let h(c) = 2c*2 - 5c*2 + ic*2. Calculate h(l(o)). -16o*4 Let i(k) = -k + 1. Let n(d) = -5d + 6. Let f(v) = -6i(v) + n(v). Let b(r) be the third derivative of -r4/12 + 2r*2. What is b(f(o))? -2o Let r(d) = -d - 72. Let j(t) = -2t2. What is r(j(x))? 2x*2 - 72 Let x(a) = 6a*2 - 9a - 9. Let v(n) = 3n2 - 4n - 4. Let m(o) = -9v(o) + 4x(o). Let y(i) = i*2. Determine y(m(u)). 9u*4 Let f(s) = -2s + 12s + 14s. Let g(z) = 3z2. Determine g(f(m)). 1728m*2 Let c(g) = -g - 10. Let t(n) = -n + 12. What is t(c(p))? p + 22 Let r(n) = -3n. Let g(q) = 163q. Calculate g(r(h)). -489h Let r(i) = i*2. Let z(d) = 7d*2 + 8d*2 - 7d*2. What is z(r(u))? 8u*4 Let s(y) = 4y*2 + 5y - 5. Let q(x) = 2x2 + 2x - 2. Let w(v) = 5q(v) - 2s(v). Let l(z) be the second derivative of z*4/6 - 5z + 13. Give w(l(d)). 8d4 Let h(l) = -l2. Let c = -7 + 7. Let t(w) = c + 0 + 40w*2 - 35w*2. Calculate h(t(s)). -25s4 Let j(v) = v3 + 2v2 - 5v - 3. Let o be j(-3). Suppose -g + 2g = o. Let a(l) = l2 - 3 + g. Let y(k) = -k2. Give y(a(n)). -n4 Let c(g) be the first derivative of -127g + 5 - 2g2 + 127g. Let a(l) = -17l. Let u(y) = 6y. Let m(r) = -4a(r) - 11u(r). Give m(c(z)). -8z Let k(h) = 3h2 - 2. Let i(q) = -q2. Calculate k(i(z)). 3z4 - 2 Let g be (-14)/(-49) - (-12)/7. Let r(w) = w2 - 5w*2 + 3w*g + 3w*2. Let p(m) = 5m*2. What is r(p(i))? 50i*4 Let l(o) = -2o*2. Let d(w) be the second derivative of 1/6w*4 + 0 + 0w*2 + 0w*3 - 2w. Give d(l(n)). 8n4 Let n(a) = -27a*2. Let k(v) = 5v*2. Calculate k(n(o)). 3645o4 Let l(n) = -n2 + 2n. Let a(f) = f2 - 3f. Let h(x) = -4a(x) - 6l(x). Let p(j) = -2j. Calculate h(p(u)). 8u*2 Let p(l) = l. Let b(j) = j. Let g(w) = 3b(w) - 5p(w). Let n(u) = -14u. Calculate g(n(i)). 28i Let c(f) = -2f*2. Let i(h) = -1043 - 8h*2 + 1043. Give i(c(d)). -32d*4 Let s(l) = -5l*2. Let r(m) = 5m*2 - 4m*2 + 0m*2. What is r(s(d))? 25d*4 Let g(y) = 20y - 6. Let t(s) = 21s - 7. Let l(q) = 7g(q) - 6t(q). Let f(u) = u. Give f(l(o)). 14o Let w(r) be the first derivative of -5r3/3 - 6. Let u(d) = -2d. Calculate w(u(p)). -20p2 Let z(o) be the first derivative of 4o*3/3 + 6. Let t(f) = 3f*2. Give t(z(s)). 48s*4 Let s(t) = 21t - 2. Let c(k) = 51k2. Calculate c(s(n)). 22491n*2 - 4284n + 204 Let r(t) = 50t2. Let h(b) = -63b*2. Give h(r(g)). -157500g4 Let u(k) be the second derivative of -k3/3 + 3k. Let z(g) = g. Let r(h) = 3h*2 - 4h. Let v(a) = r(a) + 4z(a). Give v(u(d)). 12d*2 Let q(b) = 3b*2. Let y(m) = 4m*2 - 2m2 + m2 - m*2. What is q(y(a))? 12a**4 Let v	{ "pile_set_name": "DM Mathematics" }
t(80)-1 + sqrt(35)/sqrt(28))-5. 30sqrt(3)/7 Simplify 2 + ((sqrt(567)1 - sqrt(567))6-1)*2 + (sqrt(315)2)/(sqrt(220)/sqrt(11)). 2 + 3sqrt(7) Simplify (-6((((sqrt(288)-2)/sqrt(8))/(-1sqrt(48)) + 1)6 + 3))2. 3888sqrt(3) + 6804 Simplify 6(225(2(-1 + sqrt(605)) + 4))2. 211200sqrt(5) + 5817600 Simplify 2(2 + sqrt(162))1 - 1(sqrt(2) + -3 + 4sqrt(2) + sqrt(2))1. 7 + 12sqrt(2) Simplify 1((sqrt(275)/(sqrt(11)-1))/((sqrt(40)/sqrt(4))/sqrt(2) - sqrt(5) - sqrt(5)) + (sqrt(45)13)/(sqrt(144)-1)). sqrt(5)/4 Simplify (-1(-2sqrt(2430) - -1sqrt(120)/sqrt(4)))/((-1sqrt(2400) - sqrt(24))/(sqrt(576) - (sqrt(576) - 2sqrt(576)))). -408sqrt(5)/11 Simplify ((sqrt(475) + (0 + sqrt(475) - sqrt(475)))4 - ((-4 + 2sqrt(19) - sqrt(19)) + -1))2 - ((-42sqrt(95))/(sqrt(80)5) + -5). 952sqrt(19)/5 + 6889 Simplify (-4 + ((sqrt(21) - -1sqrt(21))2 - -1sqrt(189))/(sqrt(28)/(sqrt(72)/sqrt(2))))5. -20 + 105sqrt(3) Simplify sqrt(136)/sqrt(512) + (sqrt(136)-3 + sqrt(136))/sqrt(8) + 4 - ((2sqrt(136)-4)/(sqrt(1152) - (4sqrt(1152) - sqrt(1152))))*2. -15sqrt(17)/8 + 19/9 Simplify 51(5 + sqrt(684) + -1 - (-3 + sqrt(684) + 3))4. 80 Simplify (2 + 3 + sqrt(1300) + 5 + 2sqrt(1300) + (2sqrt(1053)-4 - sqrt(1053) - sqrt(1053) - (-4 + sqrt(1053) + -3)))*2. -2346sqrt(13) + 62182 Simplify 5((4sqrt(133)4)/sqrt(7) - (-3sqrt(95)/sqrt(5) + -2)). 10 + 95sqrt(19) Simplify (3(5 + (0 + sqrt(2057) + sqrt(2057) - sqrt(2057)) + 2 + sqrt(2057)-2 + -1 + 4 + 3))2-5. -100170 + 12870sqrt(17) Simplify ((((1sqrt(408) - sqrt(408)) + sqrt(408))1)/((sqrt(108) + sqrt(108)-1 - sqrt(108) - sqrt(108) - sqrt(108))/sqrt(9)))/(-2sqrt(162)26). sqrt(17)/648 Simplify (-6((-1 + (4 + 1 + (-2sqrt(1377) - sqrt(1377)) + sqrt(1377))-2)3 + 0))2. -256608sqrt(17) + 7177572 Simplify (sqrt(84)/(-2sqrt(588) + sqrt(12))-2 - (-2 + 2 + sqrt(42)/sqrt(6) + 3))*2. 66sqrt(7)/13 + 2368/169 Simplify sqrt(4032) + -1 + -5 - (-5sqrt(140)/sqrt(5))/(sqrt(4) + 1sqrt(144)). -6 + 173sqrt(7)/7 Simplify ((sqrt(98)-4 + sqrt(2) - sqrt(4)/(sqrt(16)/sqrt(8))) + (sqrt(98)4 - -2sqrt(2)2))2. 32 Simplify 5 + ((-3 + sqrt(1100)-2 - (0 + sqrt(1100) + -1) - (4 + (sqrt(1100) - 4sqrt(1100)1)))4)2. 581 Simplify (sqrt(99))2 + 0 + (sqrt(66)1)/sqrt(6) - (4 + (sqrt(11) + -2sqrt(11) - sqrt(11)) - (sqrt(165)/sqrt(5))/sqrt(3))2. -16 + 25sqrt(11) Simplify (6(sqrt(8) - 3sqrt(8)-3))2 - (-5(sqrt(1568) + -2 - sqrt(1568)))*2. 28700 Simplify -2(4(sqrt(1053)-2)*2 - (3 + sqrt(1053) + -1))5. -168460 + 90sqrt(13) Simplify ((-3(sqrt(3200)1 - sqrt(3200) - sqrt(3200)))/(-2(sqrt(10) + (sqrt(90) + sqrt(90)1 - sqrt(10)))) + -4)2. 16sqrt(5) + 36 Simplify (((-3sqrt(2744) + sqrt(2744))4 - sqrt(2744))-2)/(-4(sqrt(8)-3 + sqrt(8)) + (sqrt(40) - sqrt(40)-2)/sqrt(5)). 126sqrt(7)/11 Simplify ((0 + sqrt(539) + 1 - sqrt(539)) + 4 + 0 + 4 + -3 + 5 + 2 + 1)2. 196 Simplify (((sqrt(80)1)/sqrt(4) - sqrt(40)/(sqrt(16)/sqrt(8)))/(22-3sqrt(1440)))2. 0 Simplify 5((-1 + sqrt(7) + -4 + sqrt(7) + sqrt(140)/sqrt(5))2 + 4 + (sqrt(567) + 1)2 + 2). 130sqrt(7) + 2820 Simplify -2 + (6(4 + sqrt(68) + sqrt(68) + sqrt(68) + sqrt(68) + 4 + sqrt(68)))2 + 1 + 2. 5760sqrt(17) + 63505 Simplify 2((2 + 0 + sqrt(112) + sqrt(112)2 + sqrt(112))*2 + 6(sqrt(112) - (sqrt(112) + (sqrt(112)2)2)) + 3 + sqrt(112)-1 + -1). -1780 + 120sqrt(7) Simplify (-2 + sqrt(1100))2 + 5 + (sqrt(1100) + 0)2 + -4 + (-2(sqrt(1100) + -4sqrt(1100) + -4)-1)*2. 920sqrt(11) + 41869 Simplify ((sqrt(175) + ((sqrt(175) - sqrt(175)-2)4 - sqrt(175) - sqrt(175)))/(sqrt(20) + sqrt(180) - sqrt(5)))/(sqrt(56)/(52sqrt(2))). 55sqrt(5)/7 Simplify 4 + ((sqrt(110) + 2sqrt(110))/sqrt(10) - sqrt(11)) + (sqrt(176)-1-4)*2 - (-6sqrt(1980) + sqrt(55))/(1sqrt(5)-6). -23sqrt(11)/6 + 2820 Simplify -5(-2 + (-5 + 6sqrt(1300)1)6)2 + -1. -8429121 + 115200sqrt(13) Simplify (sqrt(17) + sqrt(187)/sqrt(396) - (-2 + -4sqrt(17))) + 2 + (sqrt(425) + 3 + -2 + sqrt(425))2. 151sqrt(17)/6 + 1705 Simplify (sqrt(238)/(2sqrt(7)) - sqrt(1224)1)/((sqrt(84)/(sqrt(12)/sqrt(2)))/(sqrt(189)/sqrt(3))). -33sqrt(17)/2 Simplify -3((sqrt(114)/(sqrt(6)/sqrt(27)))/(sqrt(108) + sqrt(108) + sqrt(108) + -2sqrt(108)))22. -57/2 Simplify 2((-1 + 0 + 4(sqrt(567) - ((sqrt(567) - sqrt(567)2) + 3 + sqrt(567)))-4 + -1)*2 + -4). -26496sqrt(7) + 294528 Simplify -5((-2sqrt(130)-2)/sqrt(10) + -5(sqrt(1053) + 0) + sqrt(1053))2. 320sqrt(13) Simplify 5(3(sqrt(204) + sqrt(204)1 + sqrt(204)) + sqrt(204) - sqrt(204))/sqrt(12) - (3 + sqrt(612)-2 + (2 + sqrt(17))-4). 5 + 61sqrt(17) Simplify -1 + ((-1sqrt(12)/(sqrt(8)/sqrt(2)))2 + -3 - (5 + (3sqrt(336))/sqrt(7))). -12sqrt(3) - 6 Simplify ((-1sqrt(297))/sqrt(9) - 2sqrt(3993))/((sqrt(1331) + sqrt(1331)-1)-5 + -1sqrt(1331)1). 23sqrt(3)/11 Simplify ((2 + sqrt(171)-1 - sqrt(171)) + -2)2 - ((sqrt(19) + -2sqrt(19))-4 + (5sqrt(38)/sqrt(2) - sqrt(19)))*2. -532 Simplify (sqrt(784)2 - sqrt(49))/(sqrt(847)3) - (((2sqrt(63))/sqrt(9) - (2sqrt(42))/sqrt(6)) + (sqrt(224)/(sqrt(8)-2))*2). -7 + 7sqrt(7)/33 Simplify (-3sqrt(120))/(sqrt(250) - 2sqrt(250)) - ((sqrt(12)/(sqrt(8)/sqrt(2)) - 6sqrt(48)) + 2 + sqrt(108)2)*2. -367 + 226sqrt(3)/5 Simplify 3 + ((sqrt(54)/sqrt(9)5)/(1sqrt(147))-5)2. 1397/49 Simplify (6((sqrt(171) - 5sqrt(171)1) + -11sqrt(171) + sqrt(171)))/((sqrt(225) - (sqrt(225) + sqrt(225) + (sqrt(225) - (sqrt(225) - sqrt(225)5-6))))3). -8sqrt(19)/145 Simplify ((2 + -2sqrt(192) + sqrt(192) + 1 - 2(1sqrt(192) + -4))43)2. -76032sqrt(3) + 266256 Simplify (-1-1sqrt(117) + sqrt(117) - sqrt(117) - (sqrt(117)-2-5 - sqrt(117)))/(sqrt(36)/(sqrt(8)/sqrt(2)) + (sqrt(81) - sqrt(81)-2)) + 2. -4sqrt(13)/5 + 2 Simplify (5sqrt(500) - (sqrt(2880)3 - sqrt(2880)))/(4-1sqrt(90)6). -sqrt(2)/72 Simplify (2sqrt(1078)3 + sqrt(1078) - -4sqrt(1078)-3)/((sqrt(12)/sqrt(2)3)/(sqrt(21)/(sqrt(7)-1))). 35sqrt(11)/3 Simplify (sqrt(25) - sqrt(250)/sqrt(90))/((sqrt(30) - sqrt(750))/sqrt(6)) + (2sqrt(50)/sqrt(5))/(3sqrt(200) + sqrt(200)) + -2. -2 - 7sqrt(5)/60 Simplify -2 + (-2 + sqrt(847))2 + (0 + sqrt(847) + 1)2 + (sqrt(420)/sqrt(250))/(sqrt(36)/sqrt(6)-2). -221sqrt(7)/10 + 1697 Simplify (-64(sqrt(88) - sqrt(88)-1))/(sqrt(40)/(sqrt(20) + -3sqrt(20))). 192sqrt(11) Simplify ((sqrt(50) + sqrt(100)/sqrt(2)-3)/(sqrt(5) - sqrt(25)/sqrt(45)))/((sqrt(2430)1)/((sqrt(180)/sqrt(3))/sqrt(10))). -sqrt(2)/3 Simplify ((6(2sqrt(153)3 + sqrt(153) + (sqrt(153) - (-1 + 0 + sqrt(153)))))2 + 1)5. 7560sqrt(17) + 1349645 Simplify (-1sqrt(153)-6 + (sqrt(153)-22)2)-3 + (-5 + 5 + -2sqrt(153))2 + 5. -6727 - 54sqrt(17) Simplify -4((sqrt(1088) - (1 + sqrt(1088)))-6 + sqrt(1088) - ((sqrt(2057) + 1)*2 + sqrt(17) - ((1 + sqrt(17))3)*2)). -12sqrt(17) + 7560 Simplify (((51sqrt(490))/sqrt(10)-2)/(1(sqrt(7) + sqrt(63)) + (sqrt(7) - (sqrt(567)2 + sqrt(567) - sqrt(567)))))2. 700/169 Simplify (15(sqrt(76) + sqrt(76) + sqrt(76)5-1 + sqrt(76)))/(-1(sqrt(324) - sqrt(324)2) + sqrt(324)-22). 10sqrt(19)/27 Simplify (-5sqrt(70)/sqrt(2) + (sqrt(385) - sqrt(385)3 - sqrt(385))/sqrt(11))/((sqrt(250)/sqrt(5))/sqrt(10) + sqrt(80) + sqrt(80)2). -8sqrt(7)/13 Simplify 54sqrt(363) + (sqrt(363) + 4 + sqrt(363) + 0 + sqrt(363) + sqrt(363))*2 - 5(1 + 1sqrt(363) - sqrt(363) - (-1 + (sqrt(363) + 0 + sqrt(363))2)). 572sqrt(3) + 13074 Simplify 1(0 + (sqrt(175) - (-1 + sqrt(175))-4) + 4 + -3sqrt(175))24. 2800 Simplify (-6(-1 + (sqrt(5) - (2sqrt(5) + sqrt(5)))) - -6(1sqrt(180) + sqrt(180)))*2 - -2(4((sqrt(80)2 - sqrt(80)) + -2))*2. 496sqrt(5) + 38004 Simplify ((5(sqrt(95) - (sqrt(95) + sqrt(95)22)))/(sqrt(180) + 4sqrt(180)-3)2)*2. 7600/1089 Simplify (1sqrt(108) + sqrt(24)/(sqrt(6)/sqrt(3)))/(1sqrt(100)-1 - sqrt(100)-16). 4sqrt(3)/25 Simplify (-6(sqrt(560) - (-2sqrt(560) - sqrt(560)))-6)/((sqrt(55)-1)/sqrt(11) + sqrt(5) + (sqrt(5) + (sqrt(5) - (sqrt(45) - sqrt(5))) + sqrt(5))4) + -4. -4 + 144sqrt(7) Simplify ((-2sqrt(121)6-6-4)/(sqrt(176) + (sqrt(176) - -1sqrt(176)-4 - sqrt(176)) - (sqrt(176) - (sqrt(176) + -3sqrt(176)1))))2. 1584 Simplify ((2sqrt(91) - sqrt(91))1 - (-5(sqrt(91)*-1 - sqrt(91)	{ "pile_set_name": "DM Mathematics" }
creasing order. -6, -4, -3/2, -0.18 Sort 1/7, -1/3, 0.1. -1/3, 0.1, 1/7 Put 3, 3/8, -32 in descending order. 3, 3/8, -32 Put 2/183, 0.2, -1, 0.4, -12 in descending order. 0.4, 0.2, 2/183, -1, -12 Put -3.3, -3/4, 1 in ascending order. -3.3, -3/4, 1 Sort 0.4, 4, 55. 0.4, 4, 55 Put -6, 5, 127 in decreasing order. 127, 5, -6 Sort -5, -54, 4, 1 in descending order. 4, 1, -5, -54 Sort 5, -14, 254 in decreasing order. 254, 5, -14 Sort 4.8, -2/17, -4, -10. -10, -4, -2/17, 4.8 Put -1, -5, 1425, 1, 4 in decreasing order. 1425, 4, 1, -1, -5 Sort -1, 3, 15/2 in decreasing order. 15/2, 3, -1 Put -5, -1.3, -4, 3 in descending order. 3, -1.3, -4, -5 Sort -3/8, 0.3, -24, 2/17, -0.2 in descending order. 0.3, 2/17, -0.2, -3/8, -24 Put 0.134, 0.4, 2/17 in descending order. 0.4, 0.134, 2/17 Sort 115, 0, 2, 1 in ascending order. 0, 1, 2, 115 Put -1, 6, 19.6 in ascending order. -1, 6, 19.6 Put -1/15, 14, -5 in decreasing order. 14, -1/15, -5 Sort 1, -0.4, -2/19, 4. -0.4, -2/19, 1, 4 Sort 3, -2.2, 2/9, -3 in descending order. 3, 2/9, -2.2, -3 Put 2, 5, 381 in decreasing order. 381, 5, 2 Sort 0, 54/11, 0.1. 0, 0.1, 54/11 Sort 49, 1, -3 in ascending order. -3, 1, 49 Sort 10/3, -0.5, -0.4, 4 in ascending order. -0.5, -0.4, 10/3, 4 Sort 3/5, 4, 1, -12, -2 in descending order. 4, 1, 3/5, -2, -12 Sort -57, 8, 3 in increasing order. -57, 3, 8 Sort -2, -3/11, 33. -2, -3/11, 33 Put 2, -17, 0, -3, -8 in decreasing order. 2, 0, -3, -8, -17 Sort 4, 3, -5, 18. -5, 3, 4, 18 Put -14, 1, -5 in decreasing order. 1, -5, -14 Sort 0.36, 0, 2, -24 in descending order. 2, 0.36, 0, -24 Put -102, 2, -3, 3 in descending order. 3, 2, -3, -102 Put -2, 2, 1, -27 in decreasing order. 2, 1, -2, -27 Put -5, 11/2, -1 in increasing order. -5, -1, 11/2 Put -4.4, -0.2, -5, 1 in ascending order. -5, -4.4, -0.2, 1 Sort -4, 1, 5, 10 in ascending order. -4, 1, 5, 10 Put -13, 1/7, 1/4 in descending order. 1/4, 1/7, -13 Put 0.53, 5, 2/13, 1 in increasing order. 2/13, 0.53, 1, 5 Sort 0.05, 1, 4/9, 1/3 in decreasing order. 1, 4/9, 1/3, 0.05 Sort -0.68, 2/5, -4, -3, -0.02 in decreasing order. 2/5, -0.02, -0.68, -3, -4 Sort -4, 3, 23. -4, 3, 23 Sort -4, 3, -8, 2 in descending order. 3, 2, -4, -8 Sort -5, -2, -126 in descending order. -2, -5, -126 Put -184, 5, -4 in descending order. 5, -4, -184 Sort 0, -26, -19.5. -26, -19.5, 0 Put 2, -9, 4, 0 in decreasing order. 4, 2, 0, -9 Put 0.03, -5, 0.017 in increasing order. -5, 0.017, 0.03 Put -1/3, 0.4, 1/5, -20, -2 in ascending order. -20, -2, -1/3, 1/5, 0.4 Put 57, 4, -23, -2 in descending order. 57, 4, -2, -23 Put -2, 202, 0, 1 in decreasing order. 202, 1, 0, -2 Put -3/8, -11, -8 in descending order. -3/8, -8, -11 Put 2, 1, -3 in decreasing order. 2, 1, -3 Sort 4, 2, -4, -3 in ascending order. -4, -3, 2, 4 Put -0.2, -3/2, 7.014 in ascending order. -3/2, -0.2, 7.014 Put 0, -5, -158 in increasing order. -158, -5, 0 Sort -5, 0, 1, -2 in descending order. 1, 0, -2, -5 Sort -162, -4, 2. -162, -4, 2 Sort 17, 8, -4 in ascending order. -4, 8, 17 Put 12, 93, -5 in increasing order. -5, 12, 93 Sort -1, -66, 1, -4 in decreasing order. 1, -1, -4, -66 Sort -20, -4, -5, -2 in decreasing order. -2, -4, -5, -20 Sort -6, 3, 71 in decreasing order. 71, 3, -6 Put -8, 3, -1, 2 in descending order. 3, 2, -1, -8 Sort 1, -3, 23 in descending order. 23, 1, -3 Sort -0.3, 10/113, 1/3, 0.04, 1. -0.3, 0.04, 10/113, 1/3, 1 Sort 5, 0, -2/9, -1/14, 2 in decreasing order. 5, 2, 0, -1/14, -2/9 Sort 3, -9, 2/9, -4. -9, -4, 2/9, 3 Put 126, 0, -7 in ascending order. -7, 0, 126 Sort -4/9, -3/5, -2282. -2282, -3/5, -4/9 Put 1536, -1, -2, -0.3 in decreasing order. 1536, -0.3, -1, -2 Sort -7, -2, -23, 4 in decreasing order. 4, -2, -7, -23 Put 0, -5, 14, 7/8 in descending order. 14, 7/8, 0, -5 Sort -81, -3, -5 in ascending order. -81, -5, -3 Sort -4, -19, -0.34 in increasing order. -19, -4, -0.34 Sort 5, 2/3, -4, 2066 in decreasing order. 2066, 5, 2/3, -4 Sort 99, -3/5, -1/8, -1/2. -3/5, -1/2, -1/8, 99 Sort -8, 27, 3 in ascending order. -8, 3, 27 Put 2, -4, 1228 in descending order. 1228, 2, -4 Put 1/4, -1, -35, -1/2 in decreasing order. 1/4, -1/2, -1, -35 Sort -3, 3/4, -4/21, 1 in descending order. 1, 3/4, -4/21, -3 Put -4, -8, 1, 0 in descending order. 1, 0, -4, -8 Sort -5, 3, 54, 2, -2. -5, -2, 2, 3, 54 Put 5, 38, 22, 0.5 in descending order. 38, 22, 5, 0.5 Sort -14, -7, 1 in descending order. 1, -7, -14 Sort -80, 5, -4 in ascending order. -80, -4, 5 Sort -5, 2, -223. -223, -5, 2 Sort -2, -0.5, 23, 1, -3 in decreasing order. 23, 1, -0.5, -2, -3 Sort -14, 0, -3, 1, 3. -14, -3, 0, 1, 3 Sort -0.1, 2/11, -1.5, 0.5, 44 in increasing order. -1.5, -0.1, 2/11, 0.5, 44 Sort 3/8, -4/3, -1/5 in descending order. 3/8, -1/5, -4/3 Sort -17, -11, -5, -2 in ascending order. -17, -11, -5, -2 Put 1/5, -4, 1, -0.2 in decreasing order. 1, 1/5, -0.2, -4 Sort -0.4, -0.3, 0.4, 0.1, 12 in increasing order. -0.4, -0.3, 0.1, 0.4, 12 Put 4, 16, -2, -5 in ascending order. -5, -2, 4, 16 Sort 5, -330, 4, -3. -330, -3, 4, 5 Put -4, 3, -5, -2, -1 in descending order. 3, -1, -2, -4, -5 Put 82, 9, -5 in descending order. 82, 9, -5 Sort -14, -0.24, -4/7, -2/5 in decreasing order. -0.24, -2/5, -4/7, -14 Sort 4, -1/18, -5, -1 in decreasing order. 4, -1/18, -1, -5 Sort 3, 4/5, 1/5, -52/5 in decreasing order. 3, 4/5, 1/5, -52/5 Sort 39, -0.2, 2/5. -0.2, 2/5, 39 Sort 8/15, -0.2, 1/10, -0.5, 5 in ascending order. -0.5, -0.2, 1/10, 8/15, 5 Sort 2/29, 2, 0.11, 4 in decreasing order. 4, 2, 0.11, 2/29 Sort 104/9, 2, -2.5. -2.5, 2, 104/9 Sort 8, 14, -0.4, -0.1. -0.4, -0.1, 8, 14 Sort -4, 0, 2, -3, 6. -4, -3, 0, 2, 6 Put -5, -259, -7 in decreasing order. -5, -7, -259 Sort 7, 15, -2. -2, 7, 15 Sort -4, -3, -19, -1. -19, -4, -3, -1 Sort 4, 2/7, -9, 2/3 in descending order. 4, 2/3, 2/7, -9 Put -7, -5, -3, -44 in increasing order. -44, -7, -5, -3 Put 2, 15, 3, 5 in descending order. 15, 5, 3, 2 Put -2, -5, 154, 5 in increasing order. -5, -2, 5, 154 Sort 2/175, -0.3, 2/7 in descending order. 2/7, 2/175, -0.3 Sort -4, 2, 113, 0.4, -0.1 in descending order. 113, 2, 0.4, -0.1, -4 Sort 2/11, 3/10, 0.05, -4, 5 in ascending order. -4, 0.05, 2/11, 3/10, 5 Put -6, -3, 5 in increasing order. -6, -3, 5 Put 13, -26, -1 in descending order. 13, -1, -26 Sort -0.1, -2/13, 17 in ascending order. -2/13, -0.1, 17 Put 0, -1078, -2, 2 in descending order. 2, 0, -2, -1078 Put -2, 74, 1 in descending order. 74, 1, -2 Sort -4, 2, 16, -3 in ascending order. -4, -3, 2, 16 Put -3, 4, -10 in decreasing order. 4, -3, -10 Sort -36, 2, 3, 0, -4. -36, -4, 0, 2, 3 Sort -9, 0, -114. -114, -9, 0 Sort -222, 5, 2. -222, 2, 5 Put -5, 5, 4, 8 in descending order. 8, 5, 4, -5 Sort -4, -8, -16, 2 in decreasing order. 2, -4, -8, -16 Put 2, 0, -48 in decreasing order. 2, 0, -48 Sort -5, -10, 20 in ascending order. -10, -5, 20 Put -4, -16, -2, 50 in ascending order. -16, -4, -2, 50 Put 1, -3, 40 in decreasing order. 40, 1, -3 Sort -1, 298, -4 in decreasing order. 298, -1, -4 Sort 11, 3, 7, -0.3. -0.3, 3, 7, 11 Sort 22, -26, -2. -26, -2, 22 Put -7, -4, -2, 90 in ascending order. -7, -4, -2, 90 Put 1, -8, -2 in descending order. 1, -2, -8 Sort 13/4, -3, -1/2 in ascending order. -3, -1/2, 13/4 Sort 3, -2, 280, -1, 2 in descending order. 280, 3, 2, -1, -2 Sort -1, 190, -6. -6, -1, 190 Put 4, 88, 27 in increasing order. 4, 27, 88 Put 0.4, -5, 5, 61, 0.5 in increasing order. -5, 0.4, 0.5, 5, 61 Sort 2, -4, -5, 7 in ascending order. -5, -4, 2, 7 Sort -5, 10, -4, 2, 4 in increasing order. -5, -4, 2, 4, 10 Put 4, -5, 45 in descending order. 45, 4, -5 Sort 1, 3, -5, 8, -14 in ascending order. -14, -5, 1, 3, 8 Sort 4, 1, -11, -3 in descending order. 4, 1, -3, -11 Sort 4, 2, -61, -8 in decreasing order. 4, 2, -8, -61 Put 5, 1, 256, 2/7 in decreasing order. 256, 5, 1, 2/7 Put -4, 3, 1, -1, 105 in increasing order. -4, -1, 1, 3, 105 Put -16, 2, -4/7, 0 in increasing order. -16, -4/7, 0, 2 Put 1, 4, 223 in decreasing order. 223, 4, 1 Sort -4, -15, -12 in descending order. -4, -12, -15 Sort 2/7, 1.1, 0.7, 1/19 in descending order. 1.1, 0.7, 2/7, 1/19 Put -22, -2, -1, 4 in descending order. 4, -1, -2, -22 Sort -5, 3, -3, 9, 5 in increasing order. -5, -3, 3, 5, 9 Sort 4, 21, -2. -2, 4, 21 Sort 1, -3, -11 in decreasing order. 1, -3, -11 Put 1.2, -0.09, 0, 3 in decreasing order. 3, 1.2, 0, -0.09 Put 3, 32/5,	{ "pile_set_name": "DM Mathematics" }
4.8 rounded to the nearest one hundred? -26700 What is -39348440 rounded to the nearest one million? -39000000 What is -28414480 rounded to the nearest one million? -28000000 What is 0.0000610309 rounded to seven decimal places? 0.000061 Round 100900610 to the nearest one hundred thousand. 100900000 What is -0.00003376451 rounded to 7 decimal places? -0.0000338 Round -2.0402193 to 3 dps. -2.04 What is -3099.736 rounded to the nearest ten? -3100 Round -0.00204291 to four dps. -0.002 What is -0.0003722466 rounded to 7 decimal places? -0.0003722 What is -0.0000195653 rounded to 6 decimal places? -0.00002 Round -824.0308 to 1 decimal place. -824 What is 0.0303326 rounded to four dps? 0.0303 Round -26002.592 to the nearest one hundred. -26000 Round 9804.2194 to the nearest ten. 9800 Round -15373.152 to the nearest ten. -15370 Round 449052200 to the nearest one hundred thousand. 449100000 What is -546.84747 rounded to 1 dp? -546.8 Round 0.0000086354 to six dps. 0.000009 What is 3353.5 rounded to the nearest 100? 3400 Round -0.000031739 to five decimal places. -0.00003 Round 5.200724 to three dps. 5.201 What is 6.272994 rounded to 2 decimal places? 6.27 What is -2099.2334 rounded to the nearest 10? -2100 What is 55.6109 rounded to the nearest 10? 60 What is -0.001623228 rounded to 4 decimal places? -0.0016 Round 1347431 to the nearest 1000. 1347000 Round 0.000046754 to 6 decimal places. 0.000047 Round 7845.273 to the nearest 10. 7850 Round 38156900 to the nearest one million. 38000000 Round -842608.53 to the nearest one hundred thousand. -800000 Round -4.70709 to zero dps. -5 Round 0.00015770718 to five decimal places. 0.00016 Round 110258 to the nearest 1000. 110000 What is -0.0000774148 rounded to five decimal places? -0.00008 Round 0.000000378811 to seven decimal places. 0.0000004 What is 315219 rounded to the nearest 1000? 315000 Round 0.000057342412 to six decimal places. 0.000057 Round 0.05530853 to four dps. 0.0553 What is -18761708 rounded to the nearest 100000? -18800000 What is 0.0001584918 rounded to five decimal places? 0.00016 What is 2536490 rounded to the nearest one million? 3000000 Round 0.00053694679 to six decimal places. 0.000537 What is -101522380 rounded to the nearest one hundred thousand? -101500000 What is -1.431482 rounded to 2 dps? -1.43 What is -0.00046412744 rounded to 6 decimal places? -0.000464 What is 12618.65 rounded to the nearest one hundred? 12600 What is 0.0013973949 rounded to five dps? 0.0014 What is -10643.3023 rounded to zero decimal places? -10643 What is -3.9652 rounded to 1 dp? -4 What is 379.03 rounded to the nearest ten? 380 What is 1.271952 rounded to 1 decimal place? 1.3 Round 0.000598414 to six dps. 0.000598 What is 0.000017315 rounded to five dps? 0.00002 Round -0.60025 to one decimal place. -0.6 What is -80552.1 rounded to the nearest ten thousand? -80000 Round 15820.42 to the nearest 1000. 16000 What is -11.30764 rounded to the nearest integer? -11 What is 0.02268221 rounded to 4 decimal places? 0.0227 What is -38322720 rounded to the nearest one million? -38000000 Round -3272.2095 to the nearest one hundred. -3300 Round 8746.45 to the nearest one thousand. 9000 Round 105634.4 to the nearest 1000. 106000 Round -137.961 to 0 decimal places. -138 Round -0.0001620647 to 7 dps. -0.0001621 Round -0.0005633985 to five dps. -0.00056 What is 1317.8153 rounded to one decimal place? 1317.8 Round 29.54534 to zero dps. 30 Round -1342720 to the nearest 10000. -1340000 Round -9.3567333 to the nearest integer. -9 What is -109831000 rounded to the nearest 100000? -109800000 What is -67.285233 rounded to two dps? -67.29 What is -0.00088242 rounded to 4 decimal places? -0.0009 Round -0.287554 to three decimal places. -0.288 Round -0.00015934868 to six dps. -0.000159 What is 13545.628 rounded to the nearest one hundred? 13500 Round 3226.087 to the nearest integer. 3226 Round -93001.6 to the nearest 100. -93000 What is 13318200 rounded to the nearest one million? 13000000 What is 474.0119 rounded to the nearest integer? 474 What is -4124581600 rounded to the nearest 1000000? -4125000000 Round 59842.3 to the nearest one hundred. 59800 What is 1682.668 rounded to the nearest 10? 1680 Round -0.000248664 to 4 dps. -0.0002 What is -14453590 rounded to the nearest ten thousand? -14450000 Round -71.53148 to one decimal place. -71.5 What is 0.0014408025 rounded to 3 decimal places? 0.001 What is -622.57 rounded to zero decimal places? -623 What is 32.08975 rounded to the nearest 10? 30 What is -0.006555 rounded to two dps? -0.01 What is -66558400 rounded to the nearest one million? -67000000 What is 0.000494874 rounded to six decimal places? 0.000495 What is -0.0000003974262 rounded to 7 decimal places? -0.0000004 What is 0.11002766 rounded to three dps? 0.11 What is 340412.19 rounded to the nearest one thousand? 340000 What is -7.246409 rounded to one dp? -7.2 What is 0.0068292 rounded to 5 decimal places? 0.00683 What is -4532.3626 rounded to the nearest one hundred? -4500 Round 0.0334101 to three decimal places. 0.033 Round 46730000 to the nearest one million. 47000000 Round -23727.1 to the nearest ten thousand. -20000 Round 0.000190757 to seven dps. 0.0001908 Round 0.00170689 to 5 dps. 0.00171 What is 0.0001036899 rounded to 6 dps? 0.000104 Round -5143.3628 to the nearest ten. -5140 Round -0.0634284 to four dps. -0.0634 What is -122210 rounded to the nearest one hundred thousand? -100000 Round -23182.6 to the nearest one hundred. -23200 Round 254.1497 to 1 decimal place. 254.1 What is 17296900 rounded to the nearest 1000000? 17000000 Round -40103290 to the nearest ten thousand. -40100000 Round 0.00002801872 to 6 decimal places. 0.000028 What is -80283.5 rounded to the nearest 100? -80300 What is 0.0204499 rounded to two decimal places? 0.02 Round 0.0000933308 to 5 decimal places. 0.00009 What is 0.000016167871 rounded to 6 dps? 0.000016 Round -39132.9 to the nearest one thousand. -39000 Round -430614 to the nearest 1000. -431000 What is -0.00011465715 rounded to 7 decimal places? -0.0001147 Round -58296 to the nearest one hundred. -58300 Round -0.0000030843172 to seven dps. -0.0000031 What is -1949.783 rounded to the nearest 10? -1950 What is -23.540103 rounded to zero dps? -24 What is -11932.56 rounded to the nearest 1000? -12000 Round 0.1023397 to two decimal places. 0.1 What is -23345450 rounded to the nearest one hundred thousand? -23300000 What is -3.16002 rounded to the nearest integer? -3 Round -311198600 to the nearest one million. -311000000 Round 76435 to the nearest ten thousand. 80000 What is 0.000000839699 rounded to 7 decimal places? 0.0000008 Round -246.8 to the nearest 100. -200 Round -57.370414 to the nearest 10. -60 Round -1525850 to the nearest one hundred thousand. -1500000 What is -194817 rounded to the nearest 10000? -190000 What is -1.7732636 rounded to one dp? -1.8 What is -1572346.1 rounded to the nearest one thousand? -1572000 Round -10.89 to the nearest integer. -11 What is -544738 rounded to the nearest 10000? -540000 What is -9409020 rounded to the nearest 1000000? -9000000 Round -0.19425825 to two dps. -0.19 Round -0.0555489 to 2 decimal places. -0.06 What is -0.000006227447 rounded to six dps? -0.000006 What is -0.002611604 rounded to six dps? -0.002612 What is -0.1343639 rounded to four decimal places? -0.1344 What is 0.000080197 rounded to 5 dps? 0.00008 What is -7267.862 rounded to the nearest ten? -7270 What is 7.150679 rounded to 0 dps? 7 Round 58699300 to the nearest 1000000. 59000000 Round -0.2874168 to 3 dps. -0.287 What is 0.0462209 rounded to 4 decimal places? 0.0462 What is -2637341 rounded to the nearest 100000? -2600000 Round -0.00587931 to five decimal places. -0.00588 What is -0.0000150703 rounded to seven decimal places? -0.0000151 Round 19285.036 to the nearest ten. 19290 What is 1789.458 rounded to the nearest integer? 1789 Round 423.4259 to the nearest one hundred. 400 What is 0.00010339904 rounded to 5 decimal places? 0.0001 What is -15.852534 rounded to the nearest integer? -16 Round 16.392364 to zero dps. 16 Round 0.262001 to one decimal place. 0.3 Round -115220400 to the nearest one million. -115000000 What is 18035.684 rounded to the nearest 10? 18040 Round -25335	{ "pile_set_name": "DM Mathematics" }
(a) -2 (b) -232 (c) -5 (d) 2/5 (e) 0.1 e What is the nearest to 9 in 16, 2/27, -5, -4, -1? 16 What is the nearest to 1/16 in 3/5, -3, 1674, 1/5, -0.2? 1/5 Which is the nearest to 2/7? (a) 0 (b) -3/7 (c) -139/5 (d) -0.2 (e) -0.4 a What is the closest to -2/7 in -8.4, 0.3, 3, 4/7, -5? 0.3 Which is the closest to 0.3? (a) -11 (b) -4 (c) 1.7 (d) 2/7 d Which is the nearest to 479? (a) -2 (b) 0.3 (c) 6 (d) -25 (e) 0.5 c Which is the nearest to -2? (a) 1491 (b) 0.06 (c) -2 (d) 1 c Which is the nearest to 2? (a) -448 (b) 5 (c) -7 (d) 2/9 d What is the closest to 90 in -5, 127, 0? 127 What is the closest to 6 in -0.2, 6/29, -0.02, 0.3? 0.3 What is the closest to -807 in 0, 4, 0.04, 3/8? 0 What is the nearest to -2/23 in -53, 2, -0.94? -0.94 What is the closest to 7 in 29/4, -7, -13? 29/4 What is the closest to 2 in -1/9, 10.2, -2.1? -1/9 What is the closest to -10 in -1/4, -2/5, -0.2, 0, 5? -2/5 Which is the closest to 197? (a) 5 (b) 140 (c) 3 b What is the closest to -1/8 in 2/53, -3, -571? 2/53 Which is the nearest to 1/3? (a) -2.068 (b) -5 (c) 4 (d) -4 a Which is the closest to 2/5? (a) 1 (b) -2.1 (c) 5.2 a Which is the nearest to -0.1? (a) -2 (b) 7 (c) 4 (d) -0.24 d What is the nearest to -1 in 145, 147, 5? 5 What is the closest to 4 in 11, 0, -166, 1, -5/6? 1 Which is the nearest to 4? (a) 0.3 (b) 0.2 (c) -12.8 (d) 16 a Which is the nearest to 2/37? (a) 1/2 (b) 6/169 (c) -3 b Which is the closest to 2/7? (a) 0 (b) 2/11 (c) 16641 b What is the nearest to 0 in -15, -29, 3, -2/5? -2/5 What is the closest to 2/11 in 0.7, 0, -26/7? 0 Which is the closest to 927? (a) 2 (b) -0.134 (c) -0.8 a What is the closest to 0 in 5, 0.5, 3, -1125/4? 0.5 What is the closest to 2 in 1, 51, 1.3, -3? 1.3 Which is the closest to 6? (a) -0.063 (b) -2/15 (c) -0.3 (d) -0.2 (e) 4 e What is the closest to -1/7 in 2, 3/4, 39/5, -3? 3/4 What is the closest to -10 in -1033, -1/7, -2/23? -1/7 Which is the closest to -2/5? (a) -5 (b) -0.2 (c) 6739 b What is the closest to -0.1 in 27, 218, -2? -2 What is the nearest to 0.2 in 3549, 0.2, 2/5, 4? 0.2 Which is the nearest to 0? (a) 1 (b) -5/177 (c) -35 b Which is the closest to -43/2? (a) -0.5 (b) -9/7 (c) 3 b Which is the nearest to 2? (a) 8/45 (b) -4/9 (c) 1/4 c What is the closest to -2 in -21.9, -0.4, 4, 0.4, 0? -0.4 What is the closest to 1 in 4, -3/8, 0.5, -4? 0.5 What is the nearest to 0.1 in -0.5, 0.804, 0.3, -1/8? 0.3 What is the nearest to 1/3 in 0, -836.46, 5, -2? 0 Which is the nearest to -1? (a) -23 (b) 2 (c) 0.3 c Which is the closest to -0.1? (a) 3 (b) -1444 (c) 2 (d) 4 c Which is the nearest to 0? (a) -0.02 (b) -0.00533 (c) -1 b Which is the closest to -0.1? (a) -293 (b) 2 (c) -4 (d) 1451 b What is the nearest to 5 in 0.4, 3/2, 3, 471? 3 Which is the nearest to -1/2? (a) 0.2 (b) 25 (c) 2/17 (d) 47 c What is the closest to -0.6 in 5118, 1, -4/3, 0.2? -4/3 What is the nearest to 1/3 in 0, -12948.8, -1/3, 2? 0 Which is the nearest to -2/5? (a) -206 (b) -0.3 (c) 2 (d) -312 b What is the closest to 6 in -0.03, -40, 5? 5 What is the nearest to 1 in 742, 13.3, -0.2? -0.2 Which is the closest to -2/1637? (a) 1 (b) -4 (c) 0.4 c What is the closest to -1 in -4, -3, -0.1, -0.3, -0.5? -0.5 What is the nearest to 1 in -545, 1, -7/5? 1 What is the closest to 1.9 in 5, 39, 1/2? 1/2 Which is the closest to 25? (a) -8/15 (b) 0.3 (c) -1 (d) 3 d What is the nearest to -0.11 in -2/7, 190, -1.4? -2/7 What is the closest to -4 in 0.2, 44565, 0.1, 1/3, 3/7? 0.1 What is the closest to 0 in -0.079, -6, 0.1, 0? 0 What is the nearest to 1743 in 3/2, 4, 3, 2/11? 4 Which is the closest to 5? (a) -4 (b) -4/3 (c) -21.802 b What is the closest to -0.1 in 5, 2, -16, 8.3? 2 What is the nearest to 0 in -0.4, -1/8, 3/7, -4, -0.05? -0.05 Which is the nearest to -0.1? (a) -15547 (b) 4 (c) 1/9 (d) 0.3 (e) 3 c What is the nearest to -92 in -2/3, -1.5, 0.3, 0.2, -0.4? -1.5 Which is the nearest to -0.1? (a) 13 (b) 2/11 (c) 7 (d) 133 b What is the nearest to 1 in -3/4, 0.4, -0.1, -12.31? 0.4 Which is the nearest to -1.3? (a) 0.3 (b) 0.393 (c) -2/11 (d) 7 c What is the nearest to 0 in -1/6, -0.4, 1/9, -2/11? 1/9 Which is the nearest to -0.1? (a) 2 (b) 0.4 (c) -0.41 (d) -1 c What is the closest to 13 in 0, -0.14, 18.7, 3? 18.7 Which is the nearest to 0.11? (a) 900 (b) 15 (c) -2 (d) -3 c What is the closest to 0.1 in -0.4, -0.186, -3, -0.52? -0.186 What is the closest to 0 in 1, -621, -1/35? -1/35 What is the closest to 69 in 0.15, 0, -1.3, 4, -1? 4 What is the nearest to 15 in -7, 19/3, 1/11, 5? 19/3 Which is the closest to 14/13? (a) 0.3 (b) 9 (c) 0.1 a What is the closest to 2/11 in -0.056, 2/15, 0.1, -152? 2/15 Which is the closest to -1/2? (a) -4 (b) 29/966 (c) 5 b Which is the closest to -1? (a) 0.5 (b) 0 (c) -17465 b What is the closest to -7 in -3, -2/3, 7/16466, -1? -3 What is the closest to -1 in -4, 48, 0.2, 63.9? 0.2 What is the closest to 9/5 in 0, 7, -2/15, 1/6, 0.2? 0.2 Which is the nearest to -1/3? (a) 9/7 (b) 5 (c) -0.04715 (d) 4 c Which is the closest to -0.07? (a) 1/10 (b) 1.8 (c) 1/2 (d) -1/5 d What is the closest to 1 in 0.2, 0, 2/9, -1/2, 1/64? 2/9 Which is the closest to -4/11? (a) 3/109 (b) -1 (c) -0.1 c Which is the closest to 0? (a) 2/7 (b) -133 (c) 3 (d) -136 a Which is the nearest to -1/614? (a) 32 (b) -5 (c) 0.3 c Which is the nearest to -1? (a) 2 (b) 3/2 (c) -25/4 b What is the closest to 2 in 5/7, -0.2, -2, 5, -5? 5/7 Which is the closest to 1? (a) -4 (b) -4/723 (c) -0.2 b Which is the closest to 0.7? (a) 4 (b) -2/111 (c) -6 b Which is the nearest to -175? (a) 2/3 (b) -3 (c) -7 (d) 6 (e) -2/5 c What is the closest to -1 in -0.074, 0, -3, -20, 3? -0.074 Which is the closest to -1/4? (a) -0.1 (b) 4.4 (c) 4/9 (d) 11 (e) 0.1 a What is the closest to -33/4 in -6, -1, -3, 1? -6 Which is the closest to -2? (a) 2 (b) 0.01 (c) -5 (d) 2.4 b What is the closest to -2/3 in 1/3, 0, 0.5, -98? 0 Which is the closest to -0.1? (a) 0.5 (b) -273.9 (c) 1 (d) 2 a What is the closest to 1 in 5, 0.25, 3627? 0.25 Which is the nearest to 1? (a) -5 (b) 25/18 (c) 0.1 (d) 3/7 b Which is the nearest to 2/5? (a) 3/5 (b) 1 (c) 4/7 (d) 291/5929 c Which is the closest to 1? (a) 1/2 (b) -40/403 (c) 3/7 (d) 3 a Which is the nearest to 3? (a) -5 (b) -15348 (c) 1 c Which is the nearest to 0.2? (a) 0.5 (b) 3/4 (c) -1.5 (d) 0.09 d What is the nearest to 73/4 in -2/29, -4, 0.2? 0.2 Which is the closest to 1? (a) 206 (b) 2 (c) 0.3 (d) -4/7 c What is the closest to -0.5 in 0.1, 3/2, -1, -2? -1 What is the closest to 0 in 4/5, -2/327, -0.016, 0.4, -3? -2/327 What is the nearest to -2/7 in -0.09, -3, 0.13, 1.1? -0.09 What is the closest to -0.15 in -2/9, -1/23, -1, 11, -1/8? -1/8 What is the closest to -0.02 in -0.3, 2/3, -7? -0.3 What is the closest to -0.33 in 0.6, 6/5, -0.47? -0.47 Which is the nearest to -14693? (a) -0.3 (b) 0.1 (c) 1/3 a Which is the nearest to 1/4? (a) -1 (b) -5 (c) 189 (d) -2/3 (e) -65 d What is the nearest to -1.9 in -11, -2, -5? -2 Which is the nearest to 5? (a) -4 (b) -924/5 (c) 3/7 c Which is the closest to 1.01? (a) -2/7 (b) -4 (c) 4 a What is the closest to 0 in -26, 395, 3/5? 3/5 Which is the nearest to -1/2? (a) 1 (b) 13/15 (c) 5 b What is the nearest to 0 in 2/21, 4/3, -4/5, 2/21155, -1/3? 2/21155 What is the nearest to 1/4 in 0.2, 818/13, -5, 2/13? 0.2 Which is the closest to 0? (a) -6.33 (b) -67 (c) 0.4 c What is the nearest to -0.1 in -8, -2/13, -27, -3? -2/13 Which is the closest to 0.1? (a) -2/7895 (b) 0 (c) 1/3 (d) 0.3 b What is the closest to 0.1 in 5, -20/13, -5, -6? -20/13 What is the nearest to 0 in -0.04, 1/76, -4, 44? 1/76 What is the closest to -51 in -0.4, 0.5, -1/6, -2/3, -7? -7 Which is the nearest to -0.02? (a) 3/2 (b) 0 (c) -127/5 b Which is the closest to -75? (a) 1 (b) 1/7 (c) -1/10 (d) 0.2 (e) -5 e Which is the nearest to -2/7? (a) 3.273 (b) 5 (c) -6 a Which is the nearest to -57? (a) 3/8 (b) -5/3 (c) -2 (d) 10 c What is the closest to -0.1 in -1, -0.2, 12.6, -0.01, 6? -0.01 Which is the closest to -1? (a) 3 (b) 1/6 (c) -0.033 (d) 0.3 c Which is the closest to 1? (a) 0.1 (b) -3	{ "pile_set_name": "DM Mathematics" }
hich is the closest to -0.1? (a) -2 (b) m (c) p c Let s = 27.5 + -22.5. Let d = 0.3 - 0.1. What is the closest to -1 in s, d, 2/5? d Let o = -88 + 76. Let y be (-6)/(-15)((-28)/o)/(-7). What is the closest to -2 in -5, y, -1/6? -1/6 Let v = -658/3 - -219. Which is the closest to -0.1? (a) 1 (b) v (c) -0.5 b Let l = 36.9 + -37. Let p = -2 + -6. Let g = p - -8.1. Which is the nearest to g? (a) -0.4 (b) -5 (c) l c Let o = -48 + 48. What is the nearest to -3/4 in o, -5, 1? o Suppose 4x + 20 = -4m - 0, -5m + 3x - 9 = 0. What is the closest to 1/4 in 7, 2/11, m? 2/11 Let v be (0 + 0)/(-1 + -3). Suppose 4d - 9d + 25 = v. Which is the closest to 2? (a) d (b) -3 (c) -2/7 c Let i = -7 - -6.9. Let x = -9 - -13. Suppose v - 3j = 1, -4v - xj + j - 26 = 0. Which is the nearest to i? (a) 0.3 (b) 5 (c) v a Let l = -0.162 - -0.462. Which is the nearest to 2/3? (a) 0.6 (b) l (c) -0.3 (d) 1/4 a Let v = -77 - -137. Let w = v + -59.8. Let z = -18 + 124/7. Which is the nearest to 2? (a) 0.3 (b) w (c) z a Let o = 920 - 2764/3. Which is the closest to 1/10? (a) 1/3 (b) 1/4 (c) o b Let k = -38 - -41.1. Let r = k + -3. Suppose 0 = 4j - 0j + 5w + 4, 2w = 0. Which is the nearest to 2/7? (a) 1/2 (b) j (c) r c Let p = 598.9 + -599. Which is the closest to p? (a) -3 (b) 5 (c) -1/2 (d) 0.1 d Let v = -540.1 + 540. Let u = -5 + 4. Which is the closest to -2? (a) u (b) -4 (c) v a Let j = 101.3 - 109. Let d = -7.3 - j. Which is the closest to 0? (a) d (b) 0.5 (c) 2 a Suppose 3y - 7p = -3p + 31, -17 = -y + 3p. What is the nearest to -5 in 0.5, 3, y? 0.5 Let z = -106.1 - -106.3. What is the nearest to 1/9 in -0.2, 7, z, 1? z Let i = -10143 - -10138. Let u be (-2)/(-12) + 2/3. Which is the nearest to -1? (a) -2 (b) u (c) i a Suppose -5z - 12 = 3h, -4h - 8 = 58z - 54z. Let k be -3(-8)/841. Which is the nearest to -1/3? (a) 4 (b) k (c) h b Let q = 1/3 - 1/12. Let n = 7.98 + -9.98. Which is the nearest to 2? (a) q (b) 0.4 (c) n b Let a = 14 - 72/5. Let j = 1.7 - 2. Let t be 8/5 + -4 + 2. What is the closest to a in j, -0.1, t? t Let u = -1067/4 + 268. Let z = 500.3 - 500. Which is the nearest to -0.1? (a) -4 (b) z (c) u b Let w be (11/((-220)/12))/(9/2). Let q be (-44)/96 + (-3)/(-24). Which is the closest to -0.07? (a) w (b) q (c) 0.5 a Let m = -3421 + 3419. Let n = -2.6 + -0.4. What is the nearest to 0.3 in m, -0.03, n? -0.03 Let d be 75/35 + 1 + 3 + -7. Suppose 0 = -3h - 0h - 15. What is the closest to -0.1 in h, d, 1? d Let n be (12/(-168))/(2/16). What is the nearest to -3 in 5, 0.06, n? n Let i = -4.209 + 0.209. What is the closest to -2 in -0.1, i, -1/4, 1? -1/4 Let j = -5 - -4. Let g be 10/75 + (-94)/30. What is the nearest to -2/7 in -4, j, g? j Suppose 2s = -3b - 12, 4b - 3s = -6s - 17. Let f(x) = -x*2 - 24x - 95. Let y be f(-19). What is the nearest to b in y, 0.5, -2? -2 Let w = -20.7 - -21. Let p = 2.1 + w. Let q = p - 1.9. What is the nearest to 0.2 in q, 1, -1? q Let g be 105/245 - (-64)/14. Which is the nearest to 1? (a) 1 (b) g (c) -15 a Let r be 2 + ((-9)/(-6) - 2). Let n(x) = x*3 - 6x*2 - 6x - 8. Let l be n(7). Let o be 39/(-18) + 7 + -5. What is the nearest to l in r, 1/6, o? o Let f = -1.6 - -9.6. Let l = 7 - 15. Let m = f + l. What is the closest to -0.2 in -0.5, -1/9, m? -1/9 Let o = -130061/4107 + 2/1369. Let r = 32 + o. Let c = 1068/7 - 152. What is the nearest to r in -2/3, -2/15, c? c Let r = 29.5 + -35.556. Let d = r - -0.056. Which is the nearest to 0? (a) d (b) -4/9 (c) 3/8 c Let p = -31 + 35. What is the nearest to 2/7 in -0.4, 9, p? -0.4 Let l = 2.45 - 2.55. Let r = -3 - -2.8. Which is the closest to r? (a) l (b) -3 (c) -1/4 c Let d = -463/2 + 231. Which is the nearest to d? (a) 1/2 (b) -2/11 (c) 3/2 b Suppose -4y + 5d + 64 = 0, -4y + 10d + 64 = 15d. Suppose -2f - y = 2r, -7 = r + 2f + 4. Which is the closest to -6? (a) -1 (b) r (c) 4 b Let k = 0.0478 - -16.9522. What is the nearest to -1 in 4, k, -1, -5? -1 Let r = -4.6 + 5. Suppose 0 = -5o + 58 - 313. Let s = o + 665/13. Which is the nearest to s? (a) r (b) -1/3 (c) -4 a Let w = -13 + 17. Let t(g) = -g3 - 3g*2 + 10g - 1. Let r be t(-5). What is the nearest to r in 35, w, -2? -2 Let s(f) = -10f - 61. Let c be s(-6). What is the closest to 2/13 in -0.2, c, -0.4? -0.2 Let i = 227/15 - 15. Which is the nearest to 1/3? (a) i (b) 6 (c) 11 a Let r = 801 + -799. Let g = 10 + -7. What is the nearest to r in 1/4, g, -2/3? g Let x = -0.9 + 0.8. Let r = -0.06 + 0.13. Let t = r + -0.07. What is the nearest to t in 2, x, 5? x Let u = 0.67 - -4.23. Let a = u - 5. What is the nearest to a in 5, -2, -4? -2 Let z = -30 - -27. Let b = -7 + 2. Let p = -4.57 - -4.77. What is the nearest to z in p, 1/2, b? b Let q = 0.0097 + 0.4903. What is the nearest to q in -1/6, -1, -32? -1/6 Let b = -22 + 16. Let i be -12/9 + 12(-10)/(-135). What is the closest to -1 in b, -4, i? i Let s = -0.0172 - -4.0172. What is the nearest to -0.1 in -2, 2, s, 0.3? 0.3 Let t = -168 + 169. What is the nearest to -26/15 in -4, t, 4? -4 Let v(r) = r3 - r2 - 5r + 6. Let q be v(3). Which is the closest to -0.4? (a) 2 (b) -5 (c) q a Let o = 2/545 - -1064/7085. Let i = -2/297 + -52/297. What is the nearest to 15 in -0.4, o, i? o Let v be (-7 + 41)/(12). Let z = v - 16. Let l = 0.2 + 0.8. What is the closest to l in 0, z, 3/5? z Let s be ((-45)/(-60))/((-3)/(-2)). Let l be (-5)/(-30) - 10/6. Which is the closest to s? (a) -0.03 (b) l (c) 0.4 c Let z = -15639 + 15640. Let t = -0.25 + -0.05. Let w = -0.02 - -6.02. Which is the nearest to w? (a) z (b) 2 (c) t b Let k = -4.0017 + 0.0017. Let j(a) = -a2 - a + 1. Let g be j(0). Let v = 0 + g. What is the nearest to v in -2/9, k, 5? -2/9 Let g = 93 - 467/5. Let t be ((-20)/15)/((-20)/6). Suppose l = 9l - 24. What is the closest to t in g, 0.2, l? 0.2 Let g = -1622 - -1624. What is the closest to g in 0.2, -0.149, -1/6? 0.2 Let v = -121 - -115. Which is the nearest to v? (a) 23 (b) -1/9 (c) 0.1 b Let p = -0.339 - 0.061. Which is the nearest to 0.2? (a) p (b) -10 (c) 4 (d) -3/5 a Let l = -9.9 - -10. Let i = l - -10.9. Let r = i - 10.5. Which is the closest to 0.1? (a) 3 (b) r (c) 1 b Let a = 329 + -329. Let l = -2 + 3. Let g(x) = -x*3 - 3x*2 - 2x - 4. Let w be g(-3). What is the closest to a in 0.4, w, l? 0.4 Let c = -3.29 + 0.29. What is the nearest to 3/2 in 1/5, 0, c? 1/5 Let o be 2/4(-8)/(-1). Suppose 0v - ox = -5v + 25, 0 = 2v + 5x - 43. Suppose vj = 4j - 5. Which is the nearest to j? (a) 0.3 (b) 0.2 (c) -5 b Let g(u) = -4u - 31. Let s be g(-8). What is the closest to s in -1, 57, -5? -1 Let l = 2 - -1. Suppose 0 = -d - 2y - 5, 3d - 2 = d + 2y. Let v = -0.2 - -0.3. Which is the closest to d? (a) v (b) l (c) -3 a Let b be (9 - 3)2/4 - 7. Suppose 5n - 7n = 2. Suppose -4h + t = 3 + 1, 0 = 2h + 4t + 20. What is the closest to n in h, 0.3, b? h Let f = -0.6 - -4.1. Let x = f + -3.8. What is the closest to -1/4 in -0.4, x, 5? x Let l = 16 - 18. Let c be ((-2)/10)/(40/(-50)). What is the closest to 3 in 0, c, l? c Let u = 162 - 233. Let s = u - -66. What is the closest to 2/3 in -3, s, -0.02? -0.02 Let l = -163/36 - -25/12. Which is the nearest to -1? (a) 1/5 (b) l (c) -0.3 c Let u = -1951 + 1951.07. Which is the closest to 0.2? (a) -0.1 (b) -3 (c) -2 (d) u d Suppose 5r + 10 - 5 = 0. Which is the nearest to r? (a) -0.14 (b) 2/7 (c) 4 a Let j be -2 - -3 - 2 - -2. Suppose 5p + 1 = -2u, 4p - 6u + 12 = -2u. What is the closest to 1 in j, p, 1/2? j Let y = -184.8 + 185. Which is the closest to 1/2? (a) 3 (b) -4 (c) y (d) 4 c Let x = -464.1 - -464. Which is the nearest to -5? (a) x (b) -0.09 (c) 5 a Let l = -32 + 21. Let y = l + 12. Suppose 0 = -0*z - z - y. Which is the nearest to -1? (a) -0.2 (b) z (c) 1 b Let y = -0.8 - 7.2. What is the closest to y in -0.4, 1/12, -1/3? -0.4 Let g be 1 - (5 + -6 - -3). What is the nearest to 0.2 in g, -2/9, 1, -0.3? -2/9 Let u = -1549 + 1549.3. Which is the closest to -1? (a) 4/5 (b) u (c) -77 b Let s = -402 - -401.7. Let h = -1.05 + 0.05. Let c = h - -0.5. What is the closest to 1/4 in -3/8, c, s? s Let o be 2 - (-4 + 114/18). Let p = -4 - -3.2. Let l = -1 - p. Which i	{ "pile_set_name": "DM Mathematics" }
= i. Let v(t) = -t. Let r(z) = 3j(z) + 2v(z). Let f(a) be the second derivative of a*3 + 10a. Calculate f(r(o)). 6o Let o(n) = -2n. Let l(g) = -17g2 - 13. Let d(y) = 8y*2 - 4y*2 + 1 + 2. Let h(q) = 26d(q) + 6l(q). Determine o(h(a)). -4a2 Let z(d) be the first derivative of -d2/2 - 8. Let m(q) = -2q2. What is z(m(s))? 2s*2 Let s(p) = -55p. Let f(y) = 11y2. Determine s(f(d)). -605d*2 Let f(n) = 2n*2 + 0n*2 + 0n2. Let c(b) = b2 - 4b. Let q be c(4). Let j(z) = -3z*2 + 0 + q. Determine f(j(h)). 18h*4 Let q(g) = 3g - g - 4g. Let l(x) = 7x - 3. Let y(h) = -1. Let o(n) = -l(n) + 3y(n). Give q(o(r)). 14r Let u(h) = -28h + 10. Let m(k) = 9k - 3. Let l(b) = 10m(b) + 3u(b). Let g(d) = -16d. Give g(l(r)). -96r Let i(k) = -3k. Let o be 3 - -101/(-2). Let d(f) = -5f. Let x(z) = -z. Let r(p) = od(p) + 9x(p). What is r(i(s))? -3s Let c(d) be the first derivative of d*3/3 - 1. Let g(l) be the first derivative of 2l*3 + 12. Give g(c(s)). 6s*4 Let u(x) = 26x. Let v(g) = 75g2. What is u(v(r))? 1950r*2 Let w(r) = -13r*2. Let g(t) = 109t. Give w(g(b)). -154453b2 Let u(r) = r. Let m(q) = 388q. What is m(u(n))? 388n Let y(m) = 8m*2 - 11. Let s(n) = 5 + 6n*2 - 3n*2 - 9. Let b(o) = 11s(o) - 4y(o). Let x(u) = u2. Give b(x(g)). g4 Let q(i) = -3i*2. Let p(z) be the third derivative of 0 + 0z - 3z2 + 0z*4 - 1/60z*5 + 0z*3. What is p(q(b))? -9b4 Let k(u) be the first derivative of u4/12 - u*2 + 1. Let n(q) be the second derivative of k(q). Let z(j) = -2j. Calculate n(z(i)). -4i Let k(d) be the second derivative of -d4/6 + 4d. Let w(j) = -j. Determine k(w(h)). -2h2 Let a(h) = 2h. Let q(f) = -62f - 3. Determine a(q(k)). -124k - 6 Let r(u) = -3u2. Let i(d) = 2774d. Calculate i(r(j)). -8322j2 Let a(c) = 6c. Let m(r) = -r*2 + 3r*2 + 4 - 4r2 - 1. Let k(w) = -w2 + 1. Let o(y) = 3k(y) - m(y). Determine o(a(u)). -36u*2 Let c(r) = -2r. Let f(q) be the first derivative of 61q2/2 - 4. What is f(c(y))? -122y Let q(z) = 5 - 5 - 3z. Let k(w) = w2 - 57w + 57w. What is q(k(b))? -3b*2 Let d(i) = 4i2. Let y(k) be the second derivative of -k4/3 + 6k. Calculate y(d(m)). -64m*4 Let o(g) = -31g*2. Let s(x) = 9x. What is o(s(d))? -2511d2 Let z(b) = 16b*2 - 4 + 4 - 15b*2. Let t(x) = -26x*2. Calculate t(z(k)). -26k*4 Let o(c) = -2c. Let w(r) = 4r. Let d(j) = -9j. Let y be 5/(35/(-2))-7. Let q be (-27)/(-2) - 1/y. Let a(m) = qw(m) + 6d(m). What is a(o(h))? 4h Suppose 0g = -g. Let n(p) = p + 0p + gp. Let c(o) = o. What is c(n(u))? u Let y(u) = u2. Let h(c) = -11c + c + 2c. Give h(y(i)). -8i*2 Let z(x) = -2x + 4x + 0x. Let t(a) = 13a - 7. Let g(u) = 7u - 4. Let h(k) = 7g(k) - 4t(k). Let j(b) = -b. Let r(n) = 3h(n) - 12j(n). Determine r(z(w)). 6w Let a(v) = 1. Let i(y) = 2y. Let r(z) = -6a(z) + i(z). Let n(t) = -2t*2. What is n(r(q))? -8q*2 + 48q - 72 Let k(i) = 3i. Let t = -17 - -17. Let a(b) be the second derivative of b + 1/6b*3 + tb*2 + 0. Calculate k(a(j)). 3j Let q(t) = 7t. Let j(p) = 2155p*2. Give q(j(h)). 15085h*2 Let m(h) = 2h*2 + 1076. Let i(g) = 3g. Determine m(i(s)). 18s2 + 1076 Let a(c) = -c. Let m(h) = 813h*2. Determine m(a(b)). 813b*2 Let d(z) = -39z + 27. Let j(n) = 3n - 2. Let y(c) = -2d(c) - 27j(c). Let g(o) = -4o. Give y(g(l)). 12l Let x(i) = i2. Let m(d) be the second derivative of d4/3 - 4d. Give m(x(y)). 4y4 Let a(f) = 51f*2. Let t(q) = 0q*2 + 11q*2 - 10q*2. What is t(a(d))? 2601d*4 Let u(q) = -9q + 3. Let f(b) = -b - 1. Let w(r) = -r - 2. Let n(c) = 4f(c) - 2w(c). Calculate u(n(h)). 18h + 3 Let d(a) = -483 + 483 + a. Let m(l) = -37l*2. Give d(m(q)). -37q*2 Suppose -4z = 3s - 15, -2z + 3z = -3s + 15. Suppose 0 = -3m + a + 8, -m + sa - 2 = 0. Let r(i) = 0i - mi + 5i. Let u(w) = w. Give u(r(q)). 2q Let g(p) = p*2 - 3. Let u(j) = 3j*2 - 8. Let s(v) = 8g(v) - 3u(v). Let k(q) = -36q. Calculate s(k(o)). -1296o2 Let c(o) = -3o*2. Let z(n) = -32n*2 - 16n + 32. Let a(t) = -t*2 - t + 2. Let h(b) = -16a(b) + z(b). Calculate c(h(k)). -768k4 Let k(j) = j. Let g(z) = 2z. Let y(i) = -g(i) + 6k(i). Let l(d) = 3d + d*2 - 3d. Calculate y(l(r)). 4r2 Let t(z) = 2z. Let c(p) = 10p - 3. Let s(o) = 41o - 13. Let x(b) = -26c(b) + 6s(b). Give x(t(f)). -28f Let d(l) be the second derivative of -7l*3/6 - 15l. Let m(v) = v. Let w(c) = -2c. Let i(z) = -9m(z) - 4w(z). Give i(d(a)). 7a Let s(x) = 2x. Let g(i) = 9i. Let y(t) = 4 + 32t - 4 - 5t. Let k(o) = -17g(o) + 6y(o). Determine k(s(c)). 18c Let k(w) = -5w2. Let j(a) be the second derivative of -a4/12 - a3/6 - a2/2 + 2a. Let h(p) = -3p*2 - 2p - 2. Let n(t) = h(t) - 2j(t). Give k(n(r)). -5r4 Let a(b) = b. Let j(k) be the second derivative of -k4 + 7k2/2 + k. Let i(n) = -6n*2 + 3. Let m(x) = -7i(x) + 3j(x). Determine a(m(y)). 6y*2 Let y(n) = 29n*2. Let p(a) = -2a. What is y(p(x))? 116x2 Let j(x) = -x. Let m(n) = 6n. Let g(t) = -t*2 - 7t - 4. Let l be g(-7). Let a(s) = -5s. Let z(o) = la(o) - 3m(o). Give z(j(f)). -2f Let h(c) = -850c2 - c. Let k(d) = 2d. What is h(k(j))? -3400j2 - 2j Let l(a) = 22a. Let w(q) = 0q + 11q - 9q. Determine w(l(c)). 44c Let f(h) = -h2 - 12h. Let k(v) = -3v. What is k(f(x))? 3x*2 + 36x Let y(f) = 11f2. Let a(z) = 3z2 - 4. Let w(d) = d2 - 1. Let m(h) = a(h) - 4w(h). Calculate m(y(g)). -121g*4 Let h(c) = -49c*2 + 1. Let o(s) = -4s. Determine o(h(f)). 196f2 - 4 Let z(p) = 9p. Let j(c) = -c2 - c - 1. Let t(u) = u2 + 2u + 2. Let w(d) = -4j(d) - 2t(d). Determine z(w(i)). 18i*2 Let t(y) = 2y + y - 4y. Let j(f) = f3 - 7f*2 + 5f + 8. Let w be j(6). Let n(u) = 4u2 + 2u - wu. Give t(n(c)). -4c*2 Let o(f) = 2f. Let r(t) be the second derivative of -1/24t4 + 0t*3 - 1/2t*2 + 0 - 3t. Let y(l) be the first derivative of r(l). Determine o(y(s)). -2s Let o(d) = 3 + 14d*2 + 6d*2 - 3. Let c(z) = 2z. What is c(o(s))? 40s2 Let g(v) = 0v - 3v - 2v + 7v. Let l(t) = 2t. Calculate g(l(h)). 4h Let o(k) be the second derivative of -10k*3/3 + 5k. Let c(t) = -2t2. Calculate o(c(l)). 40l*2 Let t(m) = m + 3. Let k(y) = -y - 5. Let s(u) = 3k(u) + 5t(u). Let o(b) = 220b*2 - 117b*2 + 0 + 0 - 109b*2. Calculate s(o(w)). -12w*2 Let o(i) = -4 + 7 - 4 - 8i. Let n(y) = y*2. What is n(o(h))? 64h*2 + 16h + 1 Let v(b) = 3b2 + 6b. Let j(g) = 27g2. What is j(v(l))? 243l*4 + 972l*3 + 972l*2 Let v(b) = -82b - 1. Let n(h) = h. Give n(v(q)). -82q - 1 Let h(j) = -2j. Let f(r) = -r - 1. Let u be f(-7). Let m(t) = 3t - 3t - ut. Give m(h(x)). 12x Let j(z) = -z*3 + 9z*2 - 9z - 4. Let x be j(8). Let a = -8 - x. Let v(u) = u + u + au. Let d(q) = q2. Give d(v(g)). 36g*2 Let u(n) = -34n - 29n2 + 19n + 15n. Let h(z) = z2. Calculate u(h(s)). -29s*4 Let n(f) = 4f*2. Let x(q) = 381q. What is x(n(j))? 1524j2 Let u(t) = t2. Let s(z) be the second derivative of 0z*2 + 3z + 0 - 1/6z3. Determine u(s(r)). r2 Let c be (4(-3 + 2))/(-1). Let r(x) = cx2 - 2x*2 + 0x*2. Let n(j) = -6j. Determine r(n(p)). 72p2 Let u(r) = 17r. Let d(o) = o*2. What is d(u(a))? 289a*2 Let s(z) = -z. Let k(o) = -567o*2. Calculate k(s(g)). -567g*2 Let s(l) = -6l*2. Let r(y) = -2y*2 + 3y. Let d(p) = -p*2 + p. Let b(t) = 3d(t) - r(t). Determine s(b(o)). -6o4 Let i(h) = 25h*2. Let a(p) = -14p. What is i(a(y))? 4900y2 Let q(b) = -5b*2 - 7b. Let s(x) = -2x2. Let t(r) = r2. Let n(u) = -3s(u) - 8t(u). Determine q(n(w)). -20w*4 + 14w2 Let m(l) = -l2 + 206l. Let x(v) = v2. Determine m(x(r)). -r4 + 206r*2 Let u(h) = 11h. Let w(g) = -g*2 - g + 1. Let o(d) = -4d*2 - 2d + 2. Let b(p) = -o(p) + 2w(p). Determine b(u(y)). 242y*2 Let y(h) = -18h. Let q(m) = 6m - 2m - 5m. Determine y(q(c)). 18c Suppose 0 = 5v - v - 16. Let a(t) = -vt + 2 - 2 + 2t. Let x(m) = -4m - 2. Let y(u) = 9u + 5. Let b(q) = -5x(q) - 2y(q). Calculate b(a(r)). -4r Let y(m) = 7m. Let i(k) = -447k. Calculate y(i(d)). -3129d Let s(o) = -o - 3o + 2o. Suppose -3c = c - v - 5, 5*c +	{ "pile_set_name": "DM Mathematics" }
o - n = -40 for o. -4 Solve -3n - 26 = -2r, -185r = -173r + 2n + 4 for r. 1 Solve 0 = -v - 2c + 16, 4v - 839 = 7c - 835 for v. 8 Solve 2799x = -4p + 2802x + 28, -5p - 34 = -21x for p. 10 Solve -3q + 24 = 0, -11u - 4q = -7q + 68 for u. -4 Solve 12d + 1 = 3j + 10, 3d + 2 = -0d + 5j for d. 1 Solve 2a = -3074u + 3078u + 20, 5u = -25 for a. 0 Solve -11b + 5s - s = 102, b + 18s + 18 = 14s for b. -10 Solve 195 = -9p + 7v - v, -p = -v + 22 for p. -21 Solve -321949x = -321952x - 4q + 10, x + q = 3 for x. 2 Solve -15p = -3m + 48, 0 = 404m - 382m - p - 134 for m. 6 Solve 0 = 5z - t - 220, 5z - 2469t - 2469t = -4933t + 220 for z. 44 Solve -3n + 3y - 1188169 = -1188037, 2n - 5y + 217 = 0 for n. -1 Solve 3s = 3q - 15, 507934q - 4s = 507931q + 20 for q. 0 Solve j + 4u - 32 = 0, 4u = 10j + 145 - 113 for j. 0 Solve o = 3h + 23, -7 = -3h + 84676o - 84681o for h. -6 Solve -6z - 490s + 133 = -2z - 493s, 3s = 10z - 319 for z. 31 Solve 4 - 13 = s - q + 7, -3q = 6s + 2q - 36 for s. -4 Solve 0 = 4o + k + 102, -113o + 90k + 122 = -118o + 86k for o. -26 Solve -138 = 163h - 185h + 2f - 0f + 2f, 74 = 5h - 7f for h. 5 Solve 2q = -9a + 136, 0 = -4a - q - 88939 + 89000 for a. 14 Solve 10x + 5h + 180 = 0, -936h = -938h - 4 for x. -17 Solve -5n = -2n - 58g - 464, -4n - 1878g + 40 = -1883g for n. 0 Solve 4121v - 4118v - k = 28, -29v + 5k = -280 for v. 10 Solve v + 5l + 3 = 0, 0 = 3v - 5l + 70 - 21 for v. -13 Solve -17 = -3a - 126k + 127k, -5k = -74a + 249 + 249 for a. 7 Solve 4v - 118 + 118 = 0, -146v = 4f + 72 for f. -18 Solve -5580r + 5601r + 5h - 235 = 0, 4r - 5 = 7h for r. 10 Solve g = -3p + p + 12, -6p - 136g + 134g + 18 = 0 for p. -3 Solve 3x + s = -10, -26018641s = -x - 26018637s + 14 for x. -2 Solve -18 = -3m - 0x - x, 0 = 1375517m - 1375515m + 5x - 38 for m. 4 Solve 2476o - 2c + 3c + 28 = 2481o, 0 = -o - 4c - 4 - 3 for o. 5 Solve 6k - 4k + 4q + 6 = 0, 0 = -5k - 2q + q + 2 + 19 for k. 5 Solve 24l - 44l + 21 = -4s - 91, 4s = -3l - 181 for s. -43 Solve 0 = 3s - 11h + 8h + 27, -570h = 4s - 567h - 48 for s. 3 Solve 5l = 5q + 70, 3l + q - 10 + 9 = 41 for l. 14 Solve -v + 20980 = 20974, -2o + 13 = -7o + 3v for o. 1 Solve -16g + 63 = 5p, g + 0g + 22p - 6 = -3g + 24p for g. 3 Solve -z + 20 = -3l - 0z, -19 - 24 = 2z + 20 - 67 for l. -6 Solve -o + 50 + 62 = -5l, 0 = 15l - 6l - 4o + 206 for l. -22 Solve 6271i = 6273i - 15b - 954, 4b = 5i - 241 for i. -3 Solve -5i + 127x - 101x - 1062 = 410, -4x = -4i - 0x - 220 for i. 2 Solve 3104q + 3105q - 85 = -5r + 6204q, -5r - 19 = -47q for r. 15 Solve -861a = -863a - 2h - h - 138, 214 = 2a - 5h for a. -3 Solve -l + k = 269114 - 268994, -k - 348 = 3l for l. -117 Solve 0 = a - 11o - 94, 3o + 0o + 21 = -5a - 31 for a. -5 Solve 3q = -4y + 64, 6q + 129q - 605 = -5y - 0q for y. 13 Solve -42 = -2t + 2t + 2t - 9j, -56j - 57j + 2 = -112j for t. -12 Solve 5i - 4d = -3, 2d + 3d = 27i - 10 - 7 for i. 1 Solve 9g - 4g - 2h + 30 = 0, 5342g + 2h = 5345g + 22 for g. -4 Solve -56 = 2m - 2y, 0 = -21796m + 21792m - 6y + 138 for m. -3 Solve 2v = 6j - 1343666 + 1343688, 5j = 4v - 16 for v. -1 Solve -6j + 3j + 6d - 3 - 3 = 0, -998j + 994j = -6d for j. 6 Solve 3y + 761 = -389r + 1524, -2r - 3y = 11 for r. 2 Solve 5745p + 2g = 5750p - 23, 5p - 29 = -4g for p. 5 Solve -3r - 65q = -67q + 1 + 1, -5r - 2q + 2 = 0 for r. 0 Solve p + 36x - 41x = -32, -2p - 958 = -457x for p. -22 Solve 5c - 7 = -j, 21j = 644c - 640c + 38 for c. 1 Solve -2s + 8 = 2t, 3t + 58 = -41s + 32 for t. 5 Solve 4s - 5r + 3 = 0, s + r - 31 + 62 = -3 + 31 for s. -2 Solve -q = -a + 87, 10697q - 10694q - 2a - 490 - 151 = -10a for q. -5 Solve 4b - 9k + 66 = -26b, -15b + 73 = -10b + 2k - 0k for b. 5 Solve 83 = 12g + 3s + 2s + 257, 82 = 4g - 3s for g. -2 Solve -h - 6f - 13 = 0, -5h + 57691f = 57694f - 16 for h. 5 Solve 3m = 5t + 7, -6t - 7 - 10 = -12t + 10t + 9m for t. -2 Solve -3d - 7d + 132g - 135g + 88 = 0, 6 = -3d - g + 32 for d. 10 Solve 12a - 68 = 3s + 4, -5a + 723 = -4s + 671 for a. 4 Solve 0 = -66t + i - 4, -t - 2i + 2353 - 2345 = 0 for t. 0 Solve y - 4q = -68802 + 68825, -2y + 5q + 43 = 0 for y. 19 Solve 15184915m - 15184914m - 5w + 120 = 0, 3m + 3w + 414 = 0 for m. -135 Solve 5g + 48y - 2215 = -2y, -6g = -5y + 90 + 112 for g. 3 Solve 0 = -17t - 5a - 250, -2t - 6t + 46 = -4t - 2a for t. -5 Solve 748t = 2o + 742t + 70, 22 = 2t for o. -2 Solve -129u - o = -633 - 19, -118 = -2u + 3o - 129 for u. 5 Solve -402g + 15n = -406g - 110, -6g - 10 - 14 = -n - 0n for g. -5 Solve -5u = 5r + 30, 81529u - 81532u - 20 = 4r for r. -2 Solve -13673q + 13662q + 86 = s, -6 = -q - s for q. 8 Solve -c + 23 = -2q, 2493 = 8q - 3c + 2582 for q. -10 Solve 3m + 45 = 3q, -354m - 5662 = 2068q - 2070q for q. -1 Solve -7m + 19 = -205h + 208h, -6m + 9h + 30 = 7h for m. 4 Solve -533i - 526i = 4w - 1058i + 5, -5i + 55 = 0 for w. -4 Solve 4p + 3 = -k, -295k = -317k - 5p + 266 for k. 13 Solve 2p + 1 = -7, -5i = 12p + 3350 - 3212 for i. -18 Solve 0 = 10q + 3g - 8g + 2g + 174, 5q + 98 = -4g for q. -18 Solve -35x + 24x - 93 = 3c - 4c, -222 + 237 = 3c for x. -8 Solve o + 37 = 195d - 198d, d - 6 = -4o for d. -14 Solve 5z - 15 = -2w, z + 23732w = 23733w - 11 for z. -1 Solve -18j + 24 = -c - 24j + 10j, -35 - 34 = 2c - 11j for c. 4 Solve -3b - 6 = -f - 2f, 2961b - 3f = 2959b - 4 for b. -2 Solve -9395 = 242p + 19p + u, 4p = -17u + 13u - 55 - 85 for p. -36 Solve u = 14q - 6, 5q - 9u - 1431 = -690 - 687 for q. 0 Solve 0 = -409085u + 409088u + 2p - 10, p + 28 = 4u for u. 6 Solve 25z + 2 = j + 22z, -3j - z - 22 = 4z for j. -4 Solve -4t - 104 = -2s, -t - 3t + 78 = -7t for s. 0 Solve 0m - 2b + 18 = 3m - 8m - 0m - b, -7b + 126 = 0 for m. 0 Solve -5y - 7415 = -i - 7265, -3y = -178i + 90 for y. -30 Solve 370n = 7a + 738n - 367n - 102, 4a + 19n = 3 for a. 15 Solve 4d - 3q = -52, -4700q + 373 + 659 - 310 = -73d - 4702q for d. -10 Solve 0 = -220v + 247v - 2o + 43, o = 5v + 13 for v. -1 Solve -4o + 5 = -4o + o, i + 19i - 10i = -5o + 55 for i. 3 Solve 5w - 1193q = -1188q - 35, -w = 15q - 73 for w. -2 Solve 4z - 173 = -17g, 5z - g + 108 = -2z + 9z + 29 for z. 39 Solve 5r - 2w - 3w = 3 - 49 + 1, 15 = 3w for r. -4 Solve 4p - 2n = 26, 2p + 2n - 27392 = -27406 for p. 2 Solve -7s = -n - 8, 58n = -2s - 58n + 119n - 2 + 7 for s. 1 Solve f - 17c - 87 = 0, 4428f - c = 4431f - 1 for f. 2 Solve -13p = -2v + 570, -49338p + 49337p = 3v + 47 for p. -44 Solve -5h + 776d = 771d + 39 - 4, 10h - d + 43 = 0 for h. -4 Solve 10i + 7h + 44 = 6i + 5h, -i + 5i + 55h = -256 for i. -9 Solve 0 = -61835v + 61837v + 4c + 36, 0 = -3v - 4c - 40 for v. -4 Solve 0 = 3v - 12, -22288v + 44578v + 7 = -3w + 22288v for w. -5 Solve -150g = -t - 146g + 32, -81 = -4t + 63g for t. 36 Solve 2262p + 40 = 2266p - 5r, 0 = -4p - r - 32 for p. -5 Solve -3q - 38k = 4k - 161 - 134 + 94, 3q - k = 29 for q. 11 Solve -19y = 2i - 24, -5i - 1 = 4y + 26 for i. -7 Solve 1573t - 2i + 44 = 1576t, 5i - 47 = -4t for t. 18 Solve -4y + 13n = -116, 104n - 55 = -5y + 109n for y. 3 Solve 0 = 4m + 3o + 13, -1110m + 554m + 553m + 2o - 31 = 0 for m. -7 Solve -3i + 9 = 0, -7834f - 39 = -7835f - 9i for f. 12 Solve 2k + 0k + 7i - 28 + 35 = 8i, -i + 19 = -4k for k. -6 Solve s = -2s - 6u - 9, 395u - 201u = 28s + 198u + 32 for s. -1 Solve -2z = -6a - 262, -2z = 37a - 35a + 74 for z. 5 Solve 3v - 10 - 17 = -4h - 76 + 12, 0 = -7v - 3h - 61 for v. -7 Solve -8g - 28 = 4b, 34b - 29b = -3 - 2 for g. -3 Solve -54s + 19 = i + 116 + 30 + 86, -i = 5s + 17 for s. -4 Solve 0 = -18310v + 18316v + k + 47, -3v - 23 = k for v. -8 Solve -t + 4q + 103 = 0, 4t - 17q + 37598 = 38037 for t. -5 Solve -5z + 4m - 6 = 0, 3z - 169m = -188m - 25 for z. -2 Solve -3o + 14 = -x + 2x, -o + 4x + 2309 - 2323 = -6o for o. 6 Solve 5l + 4l - l + 4i - 24 = -0l + 3l, 0 = 23l - 4*i - 200 for l. 8 Solve 8	{ "pile_set_name": "DM Mathematics" }
Let i(m) = -4m - 3. Let u(n) = n. Let k be u(-5). Let a(p) = 3p + 4. Let r(f) = ki(f) - 4a(f). Is r(3) a multiple of 18? False Let i = 12 + 9. Suppose 0 = 2z + k - 21, 45 = 5z - 2k - i. Is z a multiple of 6? True Let a be (5 - 166)/(2/2). Let s = -86 - a. Does 25 divide s? True Let a = 10 + -3. Suppose -80 = 2t - at. Suppose -3k + 29 = -t. Is k a multiple of 9? False Suppose 0 = -2c - 8, -2h - 8 = h + 5c. Does 3 divide h? False Let x(p) = 77p + 14. Is x(2) a multiple of 12? True Suppose 5g = h + 353, -5h - 61 = 2g - 3g. Let t = g - 35. Suppose -4a = -t - 76. Does 11 divide a? False Suppose -14a + 18a = 584. Is a a multiple of 27? False Is 10 a factor of (63/(-12))/((-5)/40)? False Let w(o) = -o - 7. Let q be w(-3). Is q((-33)/6 + 2) a multiple of 7? True Let p = 266 + -145. Does 11 divide p? True Suppose -o = -2y - 42, -5o + 186 = -2y - 0y. Is o a multiple of 6? True Let a(u) = -u*3 + 4u*2 + 6u - 3. Let o be a(5). Let s(i) = 9i - 3. Is 15 a factor of s(o)? True Let l be 5(24/(-15) - -2). Let i(j) = lj2 - 3j3 - j2 + 0j2. Is 2 a factor of i(-1)? True Let q be (21)/(1/2). Suppose -2g + f + 5 = -q, -2f - 6 = -g. Suppose ga = 30 + 118. Is 13 a factor of a? False Let u = 3 - -5. Let b be 22/(-10) + u/40. Is 17 a factor of 2((-65)/b + 1)? False Suppose 0 = -2f + 6f. Let z be 128/56 - 4/14. Suppose f = -zd + 4d - 10. Does 5 divide d? True Let r = -105 + 158. Is 10 a factor of r? False Suppose -3h + 2n + 18 = 0, 3h = -0h - n + 9. Is 5 a factor of 32/h - 4/(-2)? True Suppose -5x + 130 + 5 = 0. Does 3 divide x? True Let w be ((-3)/(-2))/((-1)/(-4)). Let g(k) be the second derivative of -k4/12 + 3k*3/2 - 7k*2/2 - 3k. Does 4 divide g(w)? False Does 13 divide (-30)/(-7)35/5? False Is 4/(-10) - (-364)/35 a multiple of 2? True Let q = 0 - 0. Suppose -25 = -o + 5p, -4o + o - p + 123 = q. Is o a multiple of 13? False Suppose -3v + 0w + 171 = w, -4v - 2w + 230 = 0. Suppose 2q - v - 14 = 0. Suppose -u + q = 2. Is 12 a factor of u? False Let v = -87 + 127. Is 10 a factor of v? True Let s be 0/1 - 6/1. Let a = s + 9. Suppose 0n + 48 = 4z + an, -n + 4 = 0. Is 4 a factor of z? False Let j(i) = i2 + 6i + 7. Let m be j(-5). Let f be (-28)/6-3m. Suppose -q + f = -4r, 4q - 5r - 41 = 27. Does 5 divide q? False Let a = -46 - -126. Is a a multiple of 5? True Suppose 421 = 3x - 4y + 5y, -x - 2y + 142 = 0. Suppose 5s + 5w = x, -s + 5w + 60 = 2s. Is s a multiple of 9? False Suppose 30 + 30 = 5t. Suppose -128 = -4b - t. Suppose -4u - 2m + 11 = -b, 44 = 5u + m. Is u a multiple of 4? True Let d(t) = t*2 - 20t - 12. Does 14 divide d(24)? True Let v(q) = -16 + 10q + 3 - q2 + 1. Let x be v(9). Is 2 a factor of 5(0/x + 1)? False Let b(g) = 16g - 4. Is b(7) a multiple of 36? True Is (-984)/(-40) + (-4)/(-10) a multiple of 25? True Suppose 0 = 4q - 61 - 51. Does 14 divide q? True Let c(p) = -2p - 1. Let q be c(-2). Suppose -2f - 62 = -g, 303 = -g + 6g - qf. Is 9 a factor of g? False Let a(p) = -2p + 4. Does 4 divide a(-6)? True Let n(t) = t3 - 5t*2 - 4t - 7. Let o(q) = 2q3 - 3q*2 + q. Let w be o(2). Let g be n(w). Suppose 115 = 5i + gu, 3 - 20 = -i + 2u. Does 7 divide i? True Let q(z) = -28z - 3. Let b be q(-3). Let u = b - 49. Let i = u + -18. Is i a multiple of 14? True Let u = 74 - 22. Let h = u - 33. Is h a multiple of 5? False Let f be (-16)/(4/423). Is (5/(-4))/(2/f) a multiple of 12? False Let f be 9((-7 - -5) + 8). Let t = -1 - -24. Let j = f - t. Does 9 divide j? False Suppose 5a = 2a - 9. Does 11 divide -1 + (a - (-29 - -3))? True Suppose 3s + 5w = 34, -5 - 4 = -s - 4w. Is s a multiple of 13? True Let o(m) = -18m + 16. Does 14 divide o(-3)? True Suppose -7j + 4y = -6j - 22, 2j + 1 = -y. Suppose -6q + 16 = -jq. Does 4 divide q? True Let g(a) = -8a2 - a3 - 4a - 4 + 2a*2 + 0a*2. Is g(-6) a multiple of 10? True Let k = 84 - 29. Suppose -k = -4x + 17. Suppose 0 = -b - 4 + x. Is 14 a factor of b? True Suppose 0 = 2q - q - 57. Is q a multiple of 19? True Let x(g) = -17g + 1. Is 18 a factor of x(-1)? True Let l = 253 + -100. Does 17 divide l? True Let v be 0 + -3 + (-3)/3. Let c = 7 + v. Does 6 divide (-2)/c + 60/9? True Let g = -83 - -139. Is 10 a factor of g? False Let t be -1151/(-3). Suppose 0 = tq - q - 148. Does 22 divide q? False Let y(f) = 2f*3 + 4f*2 + 5f + 8. Is y(4) a multiple of 20? True Suppose -q + 83 = -5k, 0 = -4q + q - 3k + 159. Is q a multiple of 13? False Let d = -26 + 44. Suppose p + 9 = -d. Is 13 a factor of (1 - (p + 0)) + -2? True Let s(f) = -99f - 1. Let u be s(-3). Suppose 3w = 5w + u. Let r = -89 - w. Is r a multiple of 17? False Let p(x) = x - 45. Let i be p(0). Let w(u) = u*2 - 6. Let k be w(0). Does 10 divide (8/k)/(6/i)? True Let n = -4 + -5. Is 11 a factor of (6/n)/2-111? False Let h(t) = -5t2 + 3t + 2. Let f be h(3). Let p = f + 48. Does 10 divide p? False Suppose 0 = s - 8s + 875. Is s a multiple of 35? False Is 17 a factor of (90/12)/((-3)/(-18))? False Is 2 a factor of 9/(-7) + 1 + (-1060)/(-35)? True Let s be 4/(-18) + (-173)/(-9). Suppose -4c + 6 - 3 = -j, 3j = 2c - s. Let x = j - -17. Does 8 divide x? False Suppose 5q - 6 = 9. Suppose -7 = -qp + 5. Is p a multiple of 3? False Let h = 2 + 0. Suppose 5f - hf + 6 = 0. Let m = 5 - f. Does 7 divide m? True Suppose 4c - 4l = 688, 5c - 4l = 569 + 294. Does 25 divide c? True Let o(n) = 24n2 + 3. Let w be o(3). Suppose 201 = 5s - w. Is 28 a factor of s? True Suppose -5m + 5b = 3b + 90, -4m + 2b - 74 = 0. Let n = -2 - m. Is n a multiple of 14? True Suppose 3c - 4c + 3 = 0. Suppose 43 + 77 = ca. Is a a multiple of 14? False Suppose 0 = t - 4 + 2. Let c = 2 - t. Suppose 5a - 150 = -ca. Is 15 a factor of a? True Suppose c - m - 2m + 9 = 0, -32 = -4c - 5m. Suppose cn = -5h + 7, -2n = -3h - 4 - 7. Does 3 divide 1/(n/3 - 1)? True Suppose -15r + 348 = -3r. Is 9 a factor of r? False Let w(j) = 16j3 - j2 - 2j + 1. Let d be w(2). Let f = 73 - d. Let b = f + 68. Is b a multiple of 12? False Suppose -3u - 6 = -39. Let b(h) = 8h - 5. Let a be b(5). Suppose a = 3t + u. Is 4 a factor of t? True Suppose -g + 3g = -3y + 113, -2g = -5y - 89. Suppose 5v - 5 - 10 = 0. Suppose vn + g = 5n. Is n a multiple of 13? True Suppose 3x + 3y + 6 = -0x, -3y = -5x + 6. Suppose 0m - 2m + 90 = 0. Suppose xi + m = 5i. Is i a multiple of 9? True Suppose 8d = 5d + 6, 3a + 4d = 149. Is a a multiple of 9? False Suppose 0 = -11c + 6c + 210. Is c a multiple of 6? True Let p(f) = -9f + 3. Does 15 divide p(-4)? False Suppose -81 = -5h + 69. Is h a multiple of 10? True Suppose -5o - 2 = -7. Let t = o + 29. Is t a multiple of 30? True Let f(x) = -2x + 13. Let u(n) = -n + 4. Let v(k) = -4f(k) + 14u(k). Let j be v(-5). Let g = j - 15. Is 19 a factor of g? True Let s = 5 + -3. Let r(d) = 5d2 - 2d*s + 3 - 8d + 0. Does 14 divide r(5)? False Let a(y) = -y*2 - 7y + 11. Let g be a(-8). Suppose 0 = u - g + 1. Does 2 divide u? True Suppose -5n = -6n + 14. Let l = n - -19. Does 11 divide l? True Suppose 2w + 2z - 67 = z, -5w = 2z - 167. Suppose -m + 9 = -2m. Let g = m + w. Does 12 divide g? True Is 1/1(35 + 2) a multiple of 3? False Let y be -3(-4 + (-20)/(-6)). Is 12 a factor of (y + (3 - 3))21? False Suppose 0 = 4b - 127 - 33. Is b a multiple of 7? False Let r(g) = g2 - g - 1. Let q(j) = -2j*2 - 6j + 7. Let t(n) = q(n) + r(n). Suppose -2y - 12 = -0y. Is t(y) a multiple of 12? True Let h = -3 - -30. Is 13 a factor of h? False Let i be -1 + (0 - -1 - -63). Suppose -u = -4u - i. Does 10 divide u/(-24)104? False Suppose 7o - 51 = 4o. Let x(c) = -c2 + 9c + 16. Let z be x(9). Suppose o = 3q - z. Is 11 a factor of q? True Let k be 1 - (-2 + 3 + -27). Let l = 3 + k. Does 12 divide l? False Let w = 25 - -125. Is w a multiple of 26? False Let y(p) = -p2 - 13p + 7. Suppose 45 = -0l + 5l. Suppose 4u + v = 4v - 43, -u - l = v. Is 16 a factor of y(u)? False Let r be -3((-8)/6)/4. Let z be r4(-156)/(-8). Suppose -z = -2n - n. Is n a multiple of 13? True Suppose 5a - 25 - 305 = 0. Does 33 divide a? True Let t = -32 + 92. Is 24 a factor of t? False Suppose 58 + 89 = 4m - k, 0 = 3*m + k	{ "pile_set_name": "DM Mathematics" }
- 1. Suppose 9 = 2o - 5. Suppose 4b = 13 + o. Let j be w(b). Solve -jc - 2 - 14 = 0 for c. -4 Suppose 10 = 2t - 2a, -3a = 4t - 6a - 15. Solve -d + 3 = -td for d. 3 Let y(z) = z3 - 11z*2 + 2z - 9. Let q be y(11). Solve 4d + 5 = q for d. 2 Let w = -28 + 28. Solve w = -0u - 3u - 9 for u. -3 Let m be 40/18 - (-6)/(-27). Let w be ((-2)/5)/(6/(-30)). Suppose -3r - wv + 51 = 0, -v + 33 = 3r - 15. Solve 3c - r = -mc for c. 3 Suppose 2p + 0p = 0. Solve 3b - 2b = p for b. 0 Let i be 1 + (-2)/4 + (-1)/2. Solve q + 3q + 12 = i for q. -3 Suppose k = -2g - 8, 10 + 10 = -k - 5g. Let y = 13 - 7. Solve k = 4j - 2 + y for j. -1 Let q = 52 + -44. Solve b - q = -3b for b. 2 Let d(j) = -2j - 2. Let i be d(-7). Suppose 2l - i = -l. Solve -lk = -k for k. 0 Let u(s) be the first derivative of s*3/3 - 3s*2 + 5s + 1. Let x be u(6). Solve 3z - xz = 8 for z. -4 Suppose -3b + 9 + 12 = -3k, 21 = 3b + 4k. Suppose p + 3o = -13, -bp - o + 3 = -3p. Solve pf = 3f + 2 for f. -2 Let j(b) = b2 + 14b. Let m be j(-14). Let q be m/(2/(4/(-6))). Solve q = 2c + 4 - 6 for c. 1 Let i(b) = -3b - 10. Let f = -23 - -13. Let w be i(f). Solve 4n + n = w for n. 4 Let n be (1 - 0)/(1/3). Let c be (8/14)/(4/14). Suppose 2q = -cq + 28. Solve -nm - q = -4 for m. -1 Suppose -10b + 7b = 0. Solve d + 1 = -b for d. -1 Let a(l) = 3l + 2l*2 - 4l2 - l2 + 4l2. Let b be a(-5). Solve -4w = 2 - b for w. 2 Let u = -38 + 42. Solve -uc + 3 = 7 for c. -1 Let g be (-264)/10 + 8/20. Let c = g + 36. Solve -x = x + c for x. -5 Suppose -4g = 5v - 11, 5g - 4 = -2v + 3g. Solve -12 = -0w - vw for w. 4 Let i(b) = 3b - 8. Let o be i(4). Solve o = -k - 0 for k. -4 Suppose 4i + 34 = 3v, i - 16 = v - 2v. Let j = v - 13. Solve -j = -n - 0 for n. 1 Suppose -2a + 9 = -3a. Let t be 1 - 2/(2/a). Solve -t = -3k - 1 for k. 3 Suppose -6y = -5 - 1. Let t be 96/40 + 4/(-10). Solve 0 = -m + t + y for m. 3 Suppose -48 = 5g + 7j - 3j, -3j = -2g - 10. Let y(z) = -z2 - 8z. Let a be y(g). Solve -t + 5 = -at for t. 5 Suppose 0 = 6l - 5l - 3. Suppose lp - 20 = -2p. Suppose 3d = 4j + 81, 2j - 98 = -4d + 4j. Solve 3 = ps + d for s. -5 Let q(m) = m2 + 2m - 3. Let c be q(2). Suppose cg - 52 = y + 3y, y = 4g - 35. Solve 2j - g = 4j for j. -4 Let s(h) = 0h + h*3 - h + 3 - 3 - 2 + 7h*2. Let y be s(-7). Solve 6 = -yu - 14 for u. -4 Let h(o) = o*3 + 4o*2 - 13o - 4. Let a be 2/5 + (-256)/40. Let k be h(a). Solve v - 3 = k for v. 5 Let v be (-1 - 9/(-6))6. Suppose -vo + 0 + 15 = 0. Solve 5 = oa - 15 for a. 4 Let z be 0/(4 - (-12)/(-4)). Solve 5x + 3 + 7 = z for x. -2 Suppose -3v = -3f + 9, 0 = 3f + 2v + 1 - 5. Solve 2c = -fc + 4 for c. 1 Let l(c) = -c*3 - 7c*2 - 3. Let a be l(-3). Let d be 6/(-4)52/a. Solve -3b = -db + 2 for b. -2 Let y(t) = -2t + 0t2 + t2 - 2t + 3t. Let m be y(2). Solve -4a + m = -2a for a. 1 Let q(a) = a*2 + 5a + 5. Let x be q(-4). Let d = -10 + 11. Solve k = x + d for k. 2 Let v(c) = -c*2 - c + 2. Let i be v(-2). Solve i = -5s - 0s + 5 for s. 1 Let g(f) = f2 + 5f - 3. Let v be g(-3). Let u = 19 + v. Suppose 5b - u - 15 = 4n, -2n - 4b + 20 = 0. Solve nm = -3m + 3 for m. 1 Suppose 2u - 2w - 10 = 0, 3u + 10 = 5u - 3w. Suppose um = 7 + 23. Suppose -3z = -0 - m. Solve 0g = g - z for g. 2 Suppose 53 = -4s + 3a, -12 + 68 = -3s - a. Let u = -6 - s. Solve -5i - 1 = -u for i. 2 Suppose 3 = -2q + 9. Solve 5 + 4 = qt for t. 3 Suppose 0 = 8g - 2 - 22. Solve 0 = 2q + 1 - g for q. 1 Let o(l) = -l3 + l2 - l + 5. Let a be o(0). Let x = 6 + a. Solve -3 = 2y - x for y. 4 Suppose 2t + 0t - 180 = 0. Let k be 4/((-9)/(t/(-8))). Solve 5 - 10 = kd for d. -1 Let a(v) = v*3 + 16v*2 + 12v - 40. Let w be a(-15). Solve w = -4t + 3t for t. -5 Suppose -2i = -3i. Suppose -9 = -j - 2j. Suppose jz = -z. Solve z = -id - d + 1 for d. 1 Let c(x) = 2x - 13. Let d be c(7). Solve 0 = -4b - 3 - d for b. -1 Suppose 2r - 1 = 9. Suppose rf + 8 - 38 = 0. Let i be (f/(-15))/(2/(-40)). Solve 0o = 2o + i for o. -4 Let u(c) = 2c - 1. Let k be u(-1). Let n = k - -5. Solve 3j = n + 1 for j. 1 Let v be (-17)/3 + (-4)/(-6). Let z(w) = -w2 - 5w - 6. Let o be z(v). Let s(b) = -b*3 - 5b*2 + 4b - 7. Let p be s(o). Solve 0n - n - p = 0 for n. -5 Let z be -4(-3)/6 + 3. Suppose zl - 2 = 8. Let d be 2 - 4 - 0 - -4. Solve -dr - l = 8 for r. -5 Let s = 9 - 5. Suppose -2a + 0a - 56 = 0. Let g be 74/8 + (-21)/a. Solve g + 6 = -sf for f. -4 Let r(q) = -4q - 5. Let p(m) = -m*3 - 7m*2 - 7m - 2. Let u be p(-6). Suppose -5t - 25 = 4z + 31, -uz = 16. Let k be r(t). Solve 0 = 5s + k - 2 for s. -5 Suppose 3o = 4n - 10, 2o + 3n + 2 = 1. Let r be (4/5)/(o/15). Let z(p) = p*2 + 7p + 8. Let m be z(r). Solve ms = 4 + 2 for s. 3 Let d(o) = -o + 13. Let g be d(9). Solve 2 - 10 = gk for k. -2 Suppose -5z + 3z + 68 = 0. Suppose -4o = -2o - z. Suppose -4q + 9q = -s + 45, -o = q - 5s. Solve -3v = -v - q for v. 4 Let h(p) be the third derivative of -p4/6 + p3/2 + 2p2. Let g(s) = -s2 - s + 3. Let u be g(-3). Let t be h(u). Solve 0 = -3l + 6l - t for l. 5 Let c be (3/(-3))/((5/(-3))/5). Solve 3 = -cz + 2z for z. -3 Suppose -4d + 2z + 23 = -31, -5d - 5z + 45 = 0. Solve -2v = -6v - d for v. -3 Let p = 13 + -13. Suppose p = 4j + j - 20. Solve -2l - 4 = -jl for l. 2 Suppose 0h + u = h - 17, 3h = 4u + 53. Solve -2z - h = -7z for z. 3 Let i be ((-1)/(-4) + 0)4. Solve 3b - i + 4 = 0 for b. -1 Let a(j) = j3 + 21j*2 + 20j + 1. Let q be a(-20). Solve w = -q - 2 for w. -3 Let u(i) = i*2 - 8i. Let p be u(8). Solve 5o + po = -15 for o. -3 Let t be 56/(-6) + 8/(-12). Let p be (3/(-2))/(1/t). Solve 0 = -0h + 3h - p for h. 5 Suppose -95 = -119u + 114u. Let z = 7 + -3. Solve zh - 7 = -u for h. -3 Let k = 16 - 14. Suppose -k = -u - 0u. Solve ug - 1 = 7 for g. 4 Let f be (-3)/(-2) - 30/(-4). Let l = -3 + f. Solve -h = -3h - l for h. -3 Let n be (2-1 - -2)-1. Let w = n - 4. Let c = 11 + w. Solve c + 3 = -5g for g. -2 Let m = -5 - -2. Let s be 1/(m/((-30)/2)). Solve l + s = 2 for l. -3 Let l(p) = p + 5. Let m be l(-5). Suppose mo = -5o + 80. Solve -2b = 2b + o for b. -4 Let u(r) = r2 + 10r. Let s(l) = -l - 1. Let d(x) = 4s(x) + u(x). Let p be d(-7). Solve -pb + 7b = -16 for b. -4 Let a = 2 - -3. Suppose -y - 5s + 90 = 4y, 0 = 3y + 5s - 58. Solve av = v - y for v. -4 Let m be (-8)/(-16) - (-1)/(-2). Solve 6 + m = 3t for t. 2 Suppose -5n + 4f + 120 = 0, 3n + 0f - 45 = -3f. Solve -t + n = 3t for t. 5 Let c be -2(-4)/55. Suppose -q + 3m = -8, -4q + 2q = -2m - c. Solve 0l - 2 = -ql for l. 1 Let r be -2 + (-12)/(-4) + 3. Solve 3g - rg = 3 for g. -3 Let y = 3 - 1. Let t(k) = 5k + 1. Let d be t(1). Solve -yv - v = -d for v. 2 Let f = -10 + 17. Let l be 2/14 - (-8)/(-56). Suppose -3c + fc - 24 = l. Solve 5a - 5 = ca for a. -5 Suppose -28o + 25 = -23o. Solve -oi - 6 = -3i for i. -3 Let w(c) = 2c*2 + 9c + 6. Let a be w(-6). Let u be (-2)/(-4)(4 + a). Solve u = -5n - 6 for n. -4 Let a(d) = -3d2 + 27d. Let x(w) = w. Let s(f) = -2f + 4. Let m be s(3). Let i(t) = ma(t) + 54x(t). Let l be i(-1). Solve 0q = 2q + l for q. -3 Suppose -3 - 29 = -8v. Let h(s) = s*2 - 4s - 2. Let w be h(5). Let q = -2 + 4. Solve q + v = wx for x. 2 Let p = 3 - 4. Let h be 0 + p + 2 + 1. Suppose 2f = -hf + 8. Solve fy = y for y. 0 Let r be 11(1 - -3)/(-4). Let v(z) = z + 11. Let q be v(r). Solve q = 2x + 3 - 9 for x. 3 Suppose j = f - 2 + 3, 4j + f = -1. Suppose 3o = s - 22, -5s + 140 = -6o + o. Suppose 4b = c + s - 12, -5b - 2c = -14. Solve k - b + 2 = j for k. 2 Suppose 0i = -4i + 24. Suppose -16 = 2o - 3h, -3h = o + 2o - i. Let r = 6 - o. Solve -rp - 20 = -3p for p. -4 Suppose -4a + 14 = -6. Suppose 2q - az + 19 - 4 = 0, -4z = -12. Let x(j) = -j3 + 6j*2 + j - 4. Let u be x(6). Solve uy + 3y - 5 = q for y. 1 Suppose 4j - 14 - 2 = 0. Suppose ji - 6i + 18 = 2l, -3l + i = -15. Solve lv - 2 = 4v for v. 1 Suppose -5y + 63 = -47. Solve -2 = 4o - y for o. 5 Let b = -40 + 43. Solve 2 = 4v - bv for v. 2 Suppose 0 = 2h - 4i + 10, h - 15 = -0h - 3i. Solve 0 = h*g - g for g. 0 Suppose 0 = 2	{ "pile_set_name": "DM Mathematics" }
07 divided by 7? 3007/7 1863432 divided by 6 310572 -165 divided by 186 -55/62 Calculate -56108 divided by 1079. -52 What is -2977 divided by -13? 229 Calculate 16 divided by -14205. -16/14205 What is -401793 divided by -7049? 57 69 divided by -843 -23/281 What is -18888 divided by -3? 6296 What is -5780 divided by -2? 2890 What is 17 divided by -56? -17/56 Divide 11 by 13465. 11/13465 -995472 divided by 41478 -24 Divide 190 by -85. -38/17 What is -392115 divided by 130705? -3 31 divided by 76 31/76 Divide 312 by 169. 24/13 43368 divided by 5421 8 What is -2118044 divided by -17081? 124 What is 55 divided by 314? 55/314 Calculate -43182 divided by -21591. 2 What is 1485 divided by -297? -5 2 divided by -23513 -2/23513 What is 0 divided by -3090? 0 Calculate 1745401 divided by 37. 47173 Divide -351512 by 2. -175756 Calculate -281883 divided by 6. -93961/2 Divide -663195 by 3. -221065 What is 0 divided by 9076? 0 -68054 divided by 9722 -7 What is 1 divided by -1261034? -1/1261034 -110400 divided by -4 27600 -135422 divided by 7 -19346 -143004 divided by -4206 34 2856135 divided by -1 -2856135 Divide -21948 by -7316. 3 Divide 53131 by 4087. 13 Calculate 1 divided by -308986. -1/308986 8823 divided by -17 -519 What is 27875 divided by 223? 125 Divide -10602 by 1. -10602 -503 divided by 761 -503/761 Calculate 35 divided by -11993. -35/11993 Calculate 176583 divided by 2. 176583/2 Divide -1319358 by -118. 11181 Calculate 12615 divided by 29. 435 Calculate 18372 divided by -12. -1531 Divide -282430 by -5. 56486 Calculate -1808826 divided by -6. 301471 What is -1697 divided by -22? 1697/22 9894 divided by -2 -4947 11656 divided by 16 1457/2 Divide -142777 by -2. 142777/2 Calculate 1926 divided by 470. 963/235 -501200 divided by 100 -5012 Calculate -561176 divided by 28. -20042 What is -93 divided by -25961? 93/25961 58570 divided by -58570 -1 Divide -1940 by 38. -970/19 Divide -315 by 3942. -35/438 Divide -3027469 by 1. -3027469 Calculate 81435 divided by 305. 267 -7337 divided by -42 7337/42 Calculate -28 divided by -127530. 14/63765 Calculate 344817 divided by 3. 114939 What is 0 divided by 415492? 0 Divide -794952 by 18. -44164 Calculate -174840 divided by 564. -310 Calculate 2 divided by 80243. 2/80243 -92950 divided by -845 110 1786536 divided by -12 -148878 -559772 divided by 5 -559772/5 Calculate 2345409 divided by -1. -2345409 55210 divided by 4 27605/2 Divide -530048 by 4. -132512 3 divided by 713673 1/237891 207969 divided by -69323 -3 713427 divided by -18293 -39 Divide 4240548 by -6. -706758 -3238972 divided by -809743 4 -4 divided by -104378 2/52189 Calculate -2 divided by 51425. -2/51425 Divide 87885 by -3255. -27 What is 87148 divided by 14? 43574/7 What is 9174 divided by 2? 4587 176700 divided by 100 1767 Calculate -5568 divided by -24. 232 What is -65 divided by -470? 13/94 Divide 3 by 13677. 1/4559 Divide 400296 by -5. -400296/5 Calculate 52080 divided by -210. -248 -72055 divided by -3 72055/3 What is 54718 divided by -27359? -2 What is 880 divided by 33? 80/3 Calculate -50790 divided by -8465. 6 Divide 948 by 316. 3 Divide -222013 by 1. -222013 Divide 0 by 10016. 0 Calculate 2204 divided by -116. -19 Calculate 6236 divided by -16. -1559/4 What is -6400 divided by -200? 32 Calculate 1918798 divided by -16261. -118 Divide 5 by 208706. 5/208706 -2164 divided by -727 2164/727 What is -1006740 divided by -10710? 94 -19934 divided by 64 -9967/32 16 divided by 9399 16/9399 Divide -221445 by -1. 221445 Calculate 561213 divided by 187071. 3 Divide 84132 by -18. -4674 -117120 divided by -61 1920 Calculate -186356 divided by -46589. 4 What is 314 divided by 1178? 157/589 Calculate 901 divided by 2. 901/2 Calculate -344440 divided by 17222. -20 What is -1552551 divided by -329? 4719 What is 1476048 divided by -4? -369012 What is -82539 divided by 5? -82539/5 Calculate -123056 divided by -2. 61528 486984 divided by 24 20291 -168809 divided by 1 -168809 13680 divided by -228 -60 What is 121824 divided by 16? 7614 What is -5773 divided by -22? 5773/22 Calculate -19637 divided by -56. 19637/56 Calculate -65 divided by -28. 65/28 -7530 divided by 3 -2510 -88107 divided by -2049 43 What is 2291176 divided by -2? -1145588 What is 219606 divided by -4? -109803/2 Calculate 0 divided by -17726. 0 Divide -1395 by 595. -279/119 What is 20148 divided by 146? 138 Divide 72 by 2. 36 Calculate -85200 divided by -5680. 15 50308 divided by -10 -25154/5 Divide 113 by -385. -113/385 Calculate -2980560 divided by 3. -993520 -2 divided by 3061 -2/3061 Divide 2145968 by 1072984. 2 Divide 0 by -7847. 0 Divide 136942 by -3. -136942/3 Calculate 23217 divided by 23217. 1 Calculate -1 divided by 180035. -1/180035 Divide -398156 by -4. 99539 What is -628864 divided by -289? 2176 Calculate 776963 divided by 20999. 37 -2618148 divided by 1014 -2582 4676 divided by 668 7 What is -55 divided by -7088? 55/7088 117370 divided by -2 -58685 -231886 divided by -3266 71 27090 divided by 1 27090 1800 divided by 144 25/2 Calculate 26818 divided by -1. -26818 Calculate 0 divided by 85921. 0 Divide -385444 by 3. -385444/3 What is 240 divided by -111? -80/37 Calculate 34 divided by -396. -17/198 Calculate 380640 divided by 6. 63440 Divide 1718520 by 10. 171852 Divide -2635578 by -1317789. 2 Calculate -77170 divided by 9. -77170/9 What is 40563 divided by -4507? -9 27 divided by -121 -27/121 What is -4105710 divided by -35? 117306 -146913 divided by 2 -146913/2 What is 5013 divided by 300? 1671/100 Divide -1405 by -668. 1405/668 Divide -855404 by -19441. 44 What is 4 divided by -9057? -4/9057 What is -10656 divided by -148? 72 -5549 divided by 6 -5549/6 Divide 5 by 12220. 1/2444 Divide -45650 by -913. 50 Divide 323 by -69. -323/69 615498 divided by 205166 3 Calculate -2328752 divided by 145547. -16 Divide 4731 by -169. -4731/169 Divide 11790 by -3. -3930 What is -64 divided by 1910? -32/955 Calculate 0 divided by 768402. 0 What is -25824 divided by -25824? 1 -14700 divided by -1470 10 Divide -6967 by 68. -6967/68 Calculate -56435 divided by -49. 56435/49 What is -15 divided by -892? 15/892 Calculate -131560 divided by -230. 572 Divide 9132902 by 2. 4566451 What is 58674 divided by -5? -58674/5 80 divided by -452 -20/113 -59 divided by -23508 59/23508 Calculate 272406 divided by -1. -272406 Divide -8343812 by 3838. -2174 Calculate 4437678 divided by 233562. 19 -248302 divided by -3706 67 -7671 divided by 6 -2557/2 109824 divided by -27456 -4 What is -11651635 divided by -5? 2330327 -2101648 divided by -2 1050824 -132 divided by 132 -1 Calculate 11 divided by 19161. 11/19161 Divide 2930012 by -2. -1465006 Calculate 482 divided by 3332. 241/1666 What is -10 divided by 205444? -5/102722 Divide -2 by 1064. -1/532 What is 0 divided by 301882? 0 What is -209417 divided by 1? -209417 Calculate -21 divided by 4940. -21/4940 What is -1735710 divided by 6? -289285 Calculate 11 divided by -28742. -11/28742 Divide 1315998 by 9. 146222 Calculate -6256 divided by 6. -3128/3 Divide 2 by 1750. 1/875 Calculate 2510748 divided by -12942. -194 Divide 1022 by 33. 1022/33 Divide -127987 by 1. -127987 Calculate 899262 divided by -1281. -702 Divide 2620266 by 70818. 37 Calculate -5632 divided by -352. 16 1872588 divided by 116 16143 -236188 divided by 1 -236188 Divide 6666 by 38. 3333/19 Divide 4 by 11199. 4/11199 Divide 9220 by -461. -20 963214 divided by -749 -1286 -28291 divided by -13 28291/13 Calculate 0 divided by 134496. 0 24 divided by -3047 -24/3047 Calculate 331815 divided by -30165. -11 Calculate -19550 divided by 782. -25 Divide 104 by -2265. -104/2265 0 divided by 2660 0 What is -105876 divided by -52938? 2 111 divided by -205 -111/205 904158 divided by 2 452079 What is 254388 divided by 51? 4988 Calculate 40 divided by -235. -8/47 Divide 26 by 523. 26/523 7 divided by 533 7/533 What is -4 divided by -56890? 2/28445 Divide 3162 by -20. -1581/10 -106212 divided by 3 -35404 Divide 791268 by 849. 932 Calculate -405 divided by -11. 405/11 What is 2421 divided by 6? 807/2 36315 divided by 7263 5 What is -2001828 divided by -69? 29012 -28698 divided by 6 -4783 Calculate 157836 divided by 78918. 2 Divide 642 by 625. 642/625 Divide -1 by -216121. 1/216121 Calculate 5 divided by -18681. -5/18681 Calcu	{ "pile_set_name": "DM Mathematics" }
38 = -3y. Calculate the greatest common factor of y and 18. 6 Let w be (-7)/21(-230 - -2). What is the highest common divisor of 988 and w? 76 Let f = -395 + 204. Suppose l + 3 = 344. Let v = l + f. Calculate the highest common divisor of 60 and v. 30 Let n = -25 + 19. Let b = n + 34. What is the greatest common factor of 14 and b? 14 Suppose 2h = -3q + 78, -2h = -5q + 117 + 29. Calculate the greatest common factor of 70 and q. 14 Suppose 4r = 3p + 40, -5r - 4p - 23 = -6r. Let o = 24 + -17. What is the greatest common factor of r and o? 7 Let s be 96/(-5)680/(-51). Calculate the highest common factor of s and 32. 32 Let m(d) = 2d + 1. Let u be m(10). Calculate the highest common divisor of u and 147. 21 Suppose 5o = -2w + 394, 2w = -3o - o + 314. Let p(g) = -37g - 8. Let k be p(-4). Let n = k - o. What is the highest common factor of n and 20? 20 Let z(h) = 2h3 - 3h*3 - 6 - 10h + 0h3 + h2 + 11h. Let o be z(-4). Calculate the greatest common divisor of o and 28. 14 Let f(k) = 4k2 + 3k - 4. Let r be f(-2). Suppose j = 49 - 48. Calculate the highest common divisor of j and r. 1 Suppose -4d + 7899 = 2b - 191, -8065 = -4d + 3b. Calculate the highest common divisor of d and 20. 20 Let q be (88/55)/((-6)/(-60)). What is the highest common divisor of q and 2032? 16 Let i = 147 + -87. Let t(y) = 22y2 + 9y + 7. Let z be t(-1). Calculate the highest common divisor of i and z. 20 Let c = -18 - -10. Let i = c + 8. Suppose -g = 5r - 96, -6g + g - 20 = i. What is the greatest common divisor of r and 10? 10 Let h be 5/6 - 4669/(-42). What is the highest common factor of 4 and h? 4 Let u(c) = -20c - 141. Let x be u(-10). What is the greatest common factor of x and 885? 59 Let h(n) = -n - 8. Let a be h(-12). Suppose 4w + 1 = -b - 1, aw = -4b + 52. Let k = 11 + -8. What is the greatest common factor of b and k? 3 Let f be (2109 - 9)20/15. Calculate the highest common factor of 8 and f. 8 Suppose -95 = -6i + i. Let g = i + 131. Suppose 0z + 45 = 3z. Calculate the highest common factor of z and g. 15 Suppose -4n - 2s - s + 71 = 0, s - 33 = -2n. Let y = -9 + n. Suppose 66 + 74 = yu. Calculate the highest common factor of u and 42. 14 Let o = -5 - -4. Let i be o - (-1)/22. Suppose i = -p - 0p + 3. Calculate the highest common divisor of 2 and p. 1 Suppose 8 = -2b - 2, 5w + 3b + 70 = 0. Let p(z) = -6z + 4z + 13 - 2z + 2z. Let d be p(w). What is the greatest common divisor of 245 and d? 35 Let r = 304 + -206. Suppose -41 = -5w + 29. What is the highest common factor of r and w? 14 Let d = 28 - 26. Suppose -dq = -3f - 65, -6q = -2q + f - 123. Let x = q + -11. What is the highest common divisor of x and 40? 20 Let o(m) be the third derivative of m*2 + 1/12m*4 + 0m + 3m3 + 0. Let i be o(6). What is the highest common divisor of 12 and i? 6 Let p(x) = 4x - 24. Let c = 22 - 6. Let f be p(c). Calculate the greatest common factor of 16 and f. 8 Suppose -2u + 17 + 27 = 0. Suppose -u = 3t - 5t. What is the greatest common divisor of 22 and t? 11 Let l(f) = f + 2. Let c be l(-3). Suppose 0 = -83o + 89o + 24. Let w be (1 - c)/(o/(-30)). What is the greatest common divisor of w and 105? 15 Let g(l) = 2l*3 - 9l*2 + 22l. Let n be g(4). Calculate the highest common divisor of n and 360. 72 Let i be (-61)/((-256)/36 + 7). Calculate the highest common divisor of 9 and i. 9 Let c(q) = 2q3 - 64q*2 + 31q - 117. Let t be c(32). What is the greatest common factor of 35 and t? 35 Suppose 3d + 423 - 447 = 0. What is the greatest common divisor of d and 1? 1 Suppose -5f = 3c - 455, -3f = 2f - 20. Let r = c + -65. Suppose 0 = -5n + 3v + 35, 2n - 6 - 9 = v. What is the highest common factor of r and n? 10 Suppose p - 53 = -67. Let k be (-3)/((p/(-14))/((-30)/2)). What is the highest common factor of k and 18? 9 Let d(r) = -4r + 14. Let n be d(0). Calculate the greatest common divisor of n and 147. 7 Suppose 4 = -2w + 2b, -33 + 11 = -5w - 3b. Let h(z) = z3 + 2z*2 + z - 1. Let g be h(w). Calculate the highest common factor of g and 136. 17 Let i be -3 + 1(-4)/(12/(-15)). Suppose -s = is - 60. Calculate the greatest common divisor of s and 10. 10 Suppose 13s - 49 = 341. Let g = 70 + 35. Calculate the greatest common divisor of g and s. 15 Suppose 22a = 37a - 135. Calculate the highest common divisor of a and 39. 3 Suppose 0 = 6h - 7h + 63. Suppose 5p = -2p + h. Let s be (-8)/(-2)p/6. Calculate the greatest common factor of s and 66. 6 Suppose -195 = -9m + 183. Calculate the highest common factor of 147 and m. 21 Let i be (-33 - -4)/1-3. Let b = i + -63. Calculate the highest common divisor of 8 and b. 8 Let v = 2005 + -1987. Calculate the highest common factor of v and 153. 9 Let h = -3 + 3. Suppose -i - w = h, -i + 4w + w = -6. Calculate the greatest common factor of 2 and i. 1 Let f(s) = -15s - 925 - s2 + 905 + 0s*2. Suppose -4a = 24 + 20. Let b be f(a). Calculate the highest common divisor of 264 and b. 24 Let y = 1478 - 318. What is the greatest common factor of 120 and y? 40 Let t be ((-798)/(-171))/(2/42 + 0). Let v = -7 + 8. Let q be (2/1)/(v/7). What is the highest common divisor of q and t? 14 Let u = -24 + 14. Let f(j) = 2j2 - 4j + 8. Let k be f(u). Let i be k/14 - 8/(-28). Calculate the greatest common divisor of i and 198. 18 Let u be (184/(-16))/(1/(-2)). Calculate the greatest common factor of 46 and u. 23 Let h(b) = b*2 - 29b - 18. Let a be h(30). Suppose 5s - 4n + 6n = 25, s - 3n + a = 0. Calculate the highest common divisor of s and 6. 3 Suppose 20x - 3308 = 3172. Calculate the highest common divisor of x and 72. 36 Let c(a) = a3 - 7a*2 - 8a + 5. Let w be c(8). Suppose -j = -wi - 6j + 265, 3j = -4i + 213. Calculate the highest common factor of i and 6. 6 Let l = 42 + -27. Suppose h - 2h - 2m = -83, -2h + 134 = -4m. Calculate the highest common factor of h and l. 15 Let k = 111 + -15. Suppose -t + 4 = 0, i = 5i + 4t - k. Calculate the greatest common divisor of i and 100. 20 Let f = -8 - -8. Let y be (1 - 2) + f + 2. Let q be y/(2/(-4) + 1). What is the highest common divisor of 8 and q? 2 Suppose -2w + 455 + 380 = -q, 3q = -4w + 1695. Calculate the highest common divisor of 28 and w. 28 Let i = -267 - -268. What is the highest common divisor of i and 31? 1 Let a(x) = x2 - 41x - 296. Let o be a(48). Calculate the greatest common divisor of o and 5400. 40 Let j(p) = 257p2 - p + 1. Let l be j(1). Let f = -173 + l. Let u be 12 - (0/(-1))/1. Calculate the highest common divisor of u and f. 12 Suppose -u - 4u + 4d = -54, -3u + 4d = -34. Let b = 17 - u. Suppose -p + 3r + 3 = 0, 0p - b = -2p + 5r. What is the highest common divisor of 18 and p? 6 Let r = -1182 - -1191. Calculate the greatest common factor of 612 and r. 9 Let x(g) = 4g3 + g2 - 3g - 2. Suppose 0 = -8a - 9 + 25. Let s be x(a). What is the greatest common divisor of 70 and s? 14 Suppose 5n - 9w = -7w + 8465, 0 = 4n - 5w - 6789. What is the highest common divisor of n and 19? 19 Let y be (-22)/(-8) - (-12)/(-16). Suppose -a + 528 = ya. Calculate the highest common factor of 16 and a. 16 Let n be (-6)/(-21) + (-215)/(-7). Suppose -3o + 5c + n = o, c = -4o + 13. What is the highest common factor of o and 8? 4 Let s be (4 - 15)8 - 0/3. Let j = -38 - s. Calculate the highest common divisor of 150 and j. 50 Let a = -28 + 23. Let r be 6(a + 1 + 88/16). Calculate the highest common divisor of 3 and r. 3 Suppose r - 5k = 636 - 215, -1247 = -3r - k. Calculate the greatest common factor of r and 52. 52 Let q(v) = -3v + 44. Let h be q(0). Suppose 0 = -0m + 4m - 1584. Calculate the highest common divisor of h and m. 44 Let z(h) be the first derivative of h4/4 - h3/3 + 4h2 + 2. Suppose 0 = 6o - 20 - 4. Let p be z(o). What is the greatest common factor of 16 and p? 16 Let k be -7(234/(-429) + 10/(-22)). Let b be (-3)/(-12) - (-18)/(-8). Let c = 3 + b. Calculate the greatest common divisor of k and c. 1 Let t be (-92)/207 - (-2744)/18. What is the highest common divisor of 114 and t? 38 Let u(j) = -2j + 5. Let o be u(-5). Let z(x) = -x - 5 - 2x + 4x. Let r be z(10). Calculate the highest common divisor of r and o. 5 Suppose 0 = 4*l	{ "pile_set_name": "DM Mathematics" }
-0.127 Let y = -373 - -370. Sort -34, 0.3, y, -0.4. -34, y, -0.4, 0.3 Let z = -31 + 35. Suppose 4w + 9 = 4j + 29, -zj - 20 = -5w. Let c = 0.2 - 0.3. Sort -0.2, c, w. -0.2, c, w Let o be 5 - 1 - 3/3. Suppose 0 = 3y - 3q + 15, 8y = oy - 4q + 20. Put y, -5, -1 in increasing order. -5, -1, y Let o = -1 - -2. Suppose -2h = t - o, 2h - h = 4t - 31. Suppose 2k - l + 5 = 0, -4k + l - 4l = 5. Put t, k, 3 in ascending order. k, 3, t Let u = 2 - 1.48. Let q = u - 0.02. Let k be (-3)/(-7)2/3. Sort q, 0.3, k in increasing order. k, 0.3, q Let y = -33 + 31.85. Let f = y + 1.2. Let n = -0.5 - -1.5. Put n, f, -1/2 in descending order. n, f, -1/2 Let s = 365.5 + -366. Let p = 0.03 - -0.27. Let j = p + -2.3. Put j, -4, s in descending order. s, j, -4 Let f = -12.62 + 0.82. Let j = -0.014 + 12.014. Let i = j + f. Put -1/5, i, -3/4 in decreasing order. i, -1/5, -3/4 Let k(t) = t*3 - 8t*2 - t - 9. Let h be k(4). Let n = h + 79. Suppose 0 = 2l + l. Sort -2, l, n in increasing order. -2, l, n Let i be 1/(4 - 116/28). Let u = i + 3. Put u, -17, 1 in decreasing order. 1, u, -17 Let r = -702/5 - -140. Let j = -159 - -162. Put j, 0.1, r in ascending order. r, 0.1, j Let u = 241 - 1688/7. Sort u, -4, -0.14. -4, u, -0.14 Let l be ((-143)/(-12) + -12)/(1/3). Let m be (0/(-1))/1 + 4. Let z = m + -6. Sort l, z, -0.5. z, -0.5, l Let r = -6 + 6. Let o = r - -4. Suppose 0g = -og - 12. Put -1, 4, g in descending order. 4, -1, g Let p(u) = u. Let s be p(4). Suppose 0 = -3d - 5 - s. Let z be (-21)/14(-20)/(-18). Sort d, -0.4, z in decreasing order. -0.4, z, d Let i = -32 + 10. Let d be 10/(-4)(i - -24). Sort 3, -15, d in decreasing order. 3, d, -15 Let n = 727 + -760. Put n, -0.2, -3 in ascending order. n, -3, -0.2 Let w(d) = d3 - 2d + 3. Let c be w(2). Suppose -ch + 3h - 20 = 5p, -5h = -4p - 16. Let b be (0 - (0 - h))/(-2). Sort -3, b, 19. -3, b, 19 Suppose -5h - 5 = -3u - 2u, 0 = -5u + 2h - 7. Let v = 24 + -21. Put -1, -4, v, u in ascending order. -4, u, -1, v Let f = 1555 + -1551. Sort 1, -0.3, f in decreasing order. f, 1, -0.3 Let g = -9 - -8.9. Let u = -41 - -27. Let s = 10 + u. Put -5, g, s in increasing order. -5, s, g Suppose 1005r - 1037r = 0. Sort -76, r, 8. -76, r, 8 Suppose -4m - 25 + 27 = -3u, 5u = 2m - 8. Sort -8, -34, u in descending order. u, -8, -34 Let q = 93 - 97. Put 1, q, -2, 3 in descending order. 3, 1, -2, q Let w = -9 - -49/5. Let d = 5 + -5.9. Let g = -0.6 - d. Put g, w, 3 in descending order. 3, w, g Let f be 6((-10)/(-9))/(16/12). Let s be f/7 + ((-12)/7)/(-6). Let k = 3 - -1. Put k, s, 3 in decreasing order. k, 3, s Let d = 17 + -12. Sort 6/11, 5/6, d, 10 in decreasing order. 10, d, 5/6, 6/11 Let a = -5 - -8. Suppose -4r + 4 = -4h, -2r + a = 5h + 36. Sort 14, h, -1. h, -1, 14 Suppose -27h + 314 = -4d - 30h, -3d - 229 = -h. Put -2, d, -4 in descending order. -2, -4, d Let t = 106/3 - 104/3. Sort -1/15, -1/6, t, -2 in ascending order. -2, -1/6, -1/15, t Suppose -5r + 546 = 3f, -5r = -0f - 5f - 530. Sort r, 0, -4. -4, 0, r Let b be 24 - -36/9. Put b, -3, -4 in decreasing order. b, -3, -4 Suppose -h + 12 = -5b, 5h + 32 = 2h - 2b. Put 4, h, -3 in descending order. 4, -3, h Let g = -7.67 - -0.37. Let z = -10 - -3. Let p = g - z. Sort 1/8, -3, p in ascending order. -3, p, 1/8 Let u = -92.7 + 93.7. Let d = -0.7 - 0.3. Put 3/11, d, u in ascending order. d, 3/11, u Let z = -0.181 + -0.019. Put -1/2, 2/19, z, 0.4 in decreasing order. 0.4, 2/19, z, -1/2 Let z be -1 + 3/4 + (-51)/(-12). Let k be (2 + (0 - 1))/(1/z). Put k, 8, 2 in decreasing order. 8, k, 2 Let q = -10.4 + 13.4. Put 0.1, q, -2 in decreasing order. q, 0.1, -2 Let y(x) be the second derivative of -x4/12 - 5x*3/2 + 8x*2 + 4x. Let p be y(-16). Put p, 1, -4 in decreasing order. 1, p, -4 Let x = 30 - 15. Let y = x - 11. Suppose -4k = yd + 8, -5k - 1 = -11. Put 0, 7, d in decreasing order. 7, 0, d Let s be -6 + (-2)/(-2) + 1. Let z(i) = i - 2. Let j(w) = w2 - 6w + 9. Let n be j(2). Let v be z(n). Put s, v, 1 in decreasing order. 1, v, s Let m = -33.2 - 6.8. Let s = m - -39.6. Sort s, -1.5, 4/5 in decreasing order. 4/5, s, -1.5 Let q = 5 + -10. Suppose -5z - 36 = j - 16, -2j = 0. Suppose 5w - 7 + 3 = 4o, 0 = -2w. Put o, q, z in ascending order. q, z, o Let a = -1.4 + 1.54. Let p = 0.36 + -0.44. Let n = a + p. Sort 2/5, -3, n in decreasing order. 2/5, n, -3 Let o = -0.81 - -0.11. Let h = -0.62 - o. Let n = h - 0.08. Put -0.3, 1, n in ascending order. -0.3, n, 1 Let t(m) = -6m + 56. Let a be t(9). Suppose -3l + 16 - 4 = 0. Suppose 0 = -lw + 5z + 10, az - 4 = -2w + 4z. Sort -5, w, 3 in decreasing order. 3, w, -5 Suppose 5a + 0a + 15 = 0. Let r be (33-1)/((-405)/90(-1)/3). Sort r, a, -0.2 in decreasing order. -0.2, a, r Suppose -2v = -v + 8. Let g = 10 + v. Let q be (12/(-8))/((-1)/(-2)). Put q, -5, g in increasing order. -5, q, g Suppose -3i - 18 = -2i - 5f, -2i = 4f - 20. Let j(o) = -3o - o3 - 11 + 6 - 5o*i + o. Let a be j(-5). Sort -5, a, 9 in ascending order. -5, a, 9 Let t = 86 - 87. Sort -3, 5, 3, t in increasing order. -3, t, 3, 5 Let k = 1.13 + 3.87. Sort 1, -10/11, k in descending order. k, 1, -10/11 Suppose -z - 6 = 2z. Let q(i) = 12i2 + 1. Let c be q(-1). Let s(x) = 2x - 27. Let t be s(c). Put z, 6, t in decreasing order. 6, t, z Suppose 5x = 3m + 4, -12 = x - 2x - 5m. Let u be (-7 - -1)x/(-22). Suppose r - 7 = 3y - r, y + 4r = -7. Sort y, 3, u in descending order. 3, u, y Suppose 5a + 4o - 16 = 9a, -a = -2o. Sort a, 2, 0, -48 in increasing order. -48, a, 0, 2 Let t = -73/450 + -3/50. Sort 5, -0.028, t. t, -0.028, 5 Let u = 368 - 371. Sort 2, u, 10. u, 2, 10 Let l be ((-7)/21 - -5)2/21. Sort l, 77, -0.1 in ascending order. -0.1, l, 77 Let z = -0.8381 + 0.0381. Put 0.6, z, 0, -4 in decreasing order. 0.6, 0, z, -4 Let j = 3768 + -3770. Suppose 3 - 13 = -5v. Let w = -12 - -6. Sort j, w, v in decreasing order. v, j, w Let x(f) = 2f*2 - 8f - 1. Let l be x(4). Put 2, l, 4 in descending order. 4, 2, l Suppose 2p - 4p - 3j + 15 = 0, -5p + j + 63 = 0. Suppose 6q = -0q + p. Suppose 3w - q + 5 = 0. Sort w, -4, 3 in increasing order. -4, w, 3 Suppose 5l + 14 = 4v + 2, 4v = -5l + 12. Suppose 4q - 11 = -2r + 5, -q - r + 4 = l. Let h = -5 + q. Put 2, h, 4 in decreasing order. 4, 2, h Suppose -2t - 17 = a, 0 = -5t - 3a - 59 + 16. Let q = t - -12. Let f(j) = 6j - 112. Let u be f(19). Put q, -4, u in descending order. q, u, -4 Let r = -1.8 - -3.8. Let p = 9.4 - -0.6. Let i = p + -13. Put 4, i, r in decreasing order. 4, r, i Suppose -12w = -55w. Sort w, 17, 1. w, 1, 17 Suppose -h - 1 = -2b, 5b - 4h = -19 + 14. Put b, -7, 6, -3 in descending order. 6, b, -3, -7 Let z be (-12)/362/8. Let h = z + 32. Sort -2, h, -8 in descending order. h, -2, -8 Let l(x) = x3 - 2x*2 + 4x + 8. Let z be l(2). Sort -36, z, -3. -36, -3, z Let p = -6562 + 6559. Let w be (1 - -2)(-2)/(-8). Put p, -5/4, w, 3 in ascending order. p, -5/4, w, 3 Suppose -6w + 8w = -2, -5p + 16 = 4w. Sort -5, 117, p. -5, p, 117 Suppose -34 = 4u - 5k - 11, 0 = 4k - 12. Let i be ((-48)/(-52) + -1)u. Let b = -1.93 + 0.93. Put i, b, -2 in descending order. i, b, -2 Suppose -t + 6 = 2t. Suppose 3h = 4h - t. Suppose 10 = 6g - 2g - hd, 0 = -2d + 6. Sort 5/3, g, 2. 5/3, 2, g Suppose 4h + 6 = -2. Let n be 2/7 - 259/(-49)-1. Put 2, h, n, 0 in descending order. 2, 0, h, n Let k be ((-21)/(-9))/((-7)/(-6)). Let l = 3 - 3.4. Sort 4, -5, l, k in ascending order. -5, l, k, 4 Let d be 43(-3)/45. Let s = -1 - -0.9. Let u = s + -0.2. Sort u, d, -0.5 in descending order. u, -0.5, d Let x be (-180)/45 - (-46)/12. Let m = -0.26 - 0.14. Put 3, m, x in descending order. 3, x, m Let q = -1 + -4. Suppose 0 = -h - 3, 2h + 0h = 4p - 14. Sort 1/3, p, q in ascending order. q, 1/3, p Suppose 3b + 21 = -3f, -2 = -f - 3. Let i be -9 - (b - -4 - 2). Let c(s) = -s3 + 5s*2 - 4s + 5. Let q be c(4). Put i, 3, q in increasing order. i, 3, q Let r be (-12)/(-108) - (-35)/9. Let d(y) = y*2 + 7y + 8. Let s be d(-6). Sort s, r, -5, 12 in descending order. 12, r, s, -5 Let p = -0.1258 - 21.8742. Sort -3/2, p, -0.3, 1/5 in increasing order. p, -3/2, -0.3, 1/5 Let l be -6 + -164*(-1)/28. Sort -0.4, -5, -2/9, l in descending o	{ "pile_set_name": "DM Mathematics" }
t of 2805 to the nearest integer? 3 What is the third root of 1433 to the nearest integer? 11 What is the square root of 781 to the nearest integer? 28 What is the cube root of 34751 to the nearest integer? 33 What is the fourth root of 92880 to the nearest integer? 17 What is the third root of 70012 to the nearest integer? 41 What is the third root of 82995 to the nearest integer? 44 What is the square root of 16440 to the nearest integer? 128 What is 13749 to the power of 1/3, to the nearest integer? 24 What is the square root of 380 to the nearest integer? 19 What is 2385 to the power of 1/2, to the nearest integer? 49 What is 71248 to the power of 1/3, to the nearest integer? 41 What is 1134 to the power of 1/2, to the nearest integer? 34 What is the cube root of 231 to the nearest integer? 6 What is the third root of 27101 to the nearest integer? 30 What is 122 to the power of 1/2, to the nearest integer? 11 What is 2386 to the power of 1/2, to the nearest integer? 49 What is 7770 to the power of 1/2, to the nearest integer? 88 What is the cube root of 11771 to the nearest integer? 23 What is the seventh root of 23289 to the nearest integer? 4 What is the third root of 3271 to the nearest integer? 15 What is 15848 to the power of 1/2, to the nearest integer? 126 What is 131606 to the power of 1/6, to the nearest integer? 7 What is the third root of 31764 to the nearest integer? 32 What is the cube root of 6720 to the nearest integer? 19 What is 5684 to the power of 1/8, to the nearest integer? 3 What is the square root of 3857 to the nearest integer? 62 What is the ninth root of 1257 to the nearest integer? 2 What is the third root of 24809 to the nearest integer? 29 What is the seventh root of 135 to the nearest integer? 2 What is the sixth root of 12554 to the nearest integer? 5 What is the cube root of 34552 to the nearest integer? 33 What is 5806 to the power of 1/2, to the nearest integer? 76 What is the square root of 17852 to the nearest integer? 134 What is the ninth root of 5492 to the nearest integer? 3 What is the third root of 455 to the nearest integer? 8 What is the cube root of 1074 to the nearest integer? 10 What is the fifth root of 102578 to the nearest integer? 10 What is the cube root of 3383 to the nearest integer? 15 What is 23638 to the power of 1/2, to the nearest integer? 154 What is 4030 to the power of 1/8, to the nearest integer? 3 What is the fifth root of 3789 to the nearest integer? 5 What is the seventh root of 31291 to the nearest integer? 4 What is the square root of 50348 to the nearest integer? 224 What is 191 to the power of 1/6, to the nearest integer? 2 What is the square root of 1363 to the nearest integer? 37 What is 29828 to the power of 1/10, to the nearest integer? 3 What is the third root of 39808 to the nearest integer? 34 What is the fifth root of 733 to the nearest integer? 4 What is 8917 to the power of 1/3, to the nearest integer? 21 What is the ninth root of 2376 to the nearest integer? 2 What is 887 to the power of 1/2, to the nearest integer? 30 What is the third root of 404 to the nearest integer? 7 What is the sixth root of 3370 to the nearest integer? 4 What is 1464 to the power of 1/9, to the nearest integer? 2 What is 2345 to the power of 1/7, to the nearest integer? 3 What is the square root of 26221 to the nearest integer? 162 What is 132552 to the power of 1/2, to the nearest integer? 364 What is 43769 to the power of 1/4, to the nearest integer? 14 What is the square root of 5827 to the nearest integer? 76 What is the square root of 13970 to the nearest integer? 118 What is the square root of 1304 to the nearest integer? 36 What is the square root of 49976 to the nearest integer? 224 What is 2005 to the power of 1/9, to the nearest integer? 2 What is the square root of 18 to the nearest integer? 4 What is 320 to the power of 1/7, to the nearest integer? 2 What is 1830 to the power of 1/10, to the nearest integer? 2 What is the cube root of 9644 to the nearest integer? 21 What is the sixth root of 662 to the nearest integer? 3 What is the cube root of 2108 to the nearest integer? 13 What is the fifth root of 1128 to the nearest integer? 4 What is the square root of 59611 to the nearest integer? 244 What is 633 to the power of 1/3, to the nearest integer? 9 What is 11953 to the power of 1/3, to the nearest integer? 23 What is the eighth root of 2921 to the nearest integer? 3 What is 1413 to the power of 1/3, to the nearest integer? 11 What is the fourth root of 2918 to the nearest integer? 7 What is 706 to the power of 1/7, to the nearest integer? 3 What is the seventh root of 3695 to the nearest integer? 3 What is the fifth root of 4314 to the nearest integer? 5 What is the third root of 2506 to the nearest integer? 14 What is 4949 to the power of 1/3, to the nearest integer? 17 What is 10276 to the power of 1/2, to the nearest integer? 101 What is the sixth root of 5058 to the nearest integer? 4 What is the ninth root of 764 to the nearest integer? 2 What is the third root of 535 to the nearest integer? 8 What is the cube root of 201 to the nearest integer? 6 What is 8968 to the power of 1/6, to the nearest integer? 5 What is the tenth root of 674 to the nearest integer? 2 What is 1941 to the power of 1/2, to the nearest integer? 44 What is 2390 to the power of 1/8, to the nearest integer? 3 What is 10045 to the power of 1/5, to the nearest integer? 6 What is 113101 to the power of 1/3, to the nearest integer? 48 What is the eighth root of 81768 to the nearest integer? 4 What is the eighth root of 1297 to the nearest integer? 2 What is the third root of 114734 to the nearest integer? 49 What is 3042 to the power of 1/4, to the nearest integer? 7 What is the fourth root of 17645 to the nearest integer? 12 What is 46125 to the power of 1/3, to the nearest integer? 36 What is the square root of 1197 to the nearest integer? 35 What is the square root of 1548 to the nearest integer? 39 What is 1025 to the power of 1/3, to the nearest integer? 10 What is the square root of 979 to the nearest integer? 31 What is the ninth root of 24795 to the nearest integer? 3 What is 46459 to the power of 1/2, to the nearest integer? 216 What is 3535 to the power of 1/7, to the nearest integer? 3 What is 898 to the power of 1/8, to the nearest integer? 2 What is 10982 to the power of 1/2, to the nearest integer? 105 What is 8192 to the power of 1/6, to the nearest integer? 4 What is 52845 to the power of 1/3, to the nearest integer? 38 What is the seventh root of 895 to the nearest integer? 3 What is the sixth root of 1441 to the nearest integer? 3 What is 2436 to the power of 1/2, to the nearest integer? 49 What is the sixth root of 2432 to the nearest integer? 4 What is 15290 to the power of 1/3, to the nearest integer? 25 What is the seventh root of 7234 to the nearest integer? 4 What is 1449 to the power of 1/2, to the nearest integer? 38 What is the cube root of 11960 to the nearest integer? 23 What is the third root of 119954 to the nearest integer? 49 What is the cube root of 89793 to the nearest integer? 45 What is 27108 to the power of 1/6, to the nearest integer? 5 What is 11808 to the power of 1/6, to the nearest integer? 5 What is 43450 to the power of 1/2, to the nearest integer? 208 What is the square root of 2269 to the nearest integer? 48 What is 1946 to the power of 1/2, to the nearest integer? 44 What is the third root of 3501 to the nearest integer? 15 What is 17658 to the power of 1/2, to the nearest integer? 133 What is 87980 to the power of 1/5, to the nearest integer? 10 What is 3462 to the power of 1/2, to the nearest integer? 59 What is the third root of 72575 to the nearest integer? 42 What is 1099 to the power of 1/9, to the nearest integer? 2 What is 1435 to the power of 1/2, to the nearest integer? 38 What is the seventh root of 5563 to the nearest integer? 3 What is the sixth root of 122112 to the nearest integer? 7 What is 16081 to the power of 1/7, to the nearest integer? 4 What is the cube root of 323 to the nearest integer? 7 What is the third root of 359 to the nearest integer? 7 What is the sixth root of 5114 to the nearest integer? 4 What is the third root o	{ "pile_set_name": "DM Mathematics" }
)/r(-3)/(-2). Which is bigger: 31/4 or o? 31/4 Let s = 887863/178 - 4988. Let m = 4.9 - 5. Is m bigger than s? False Let q = -1507226112 - -173719867219935/115258. Let m = q - 10/341. Is m less than or equal to 0? True Suppose -2a - 4i - 36 = 0, a - 6 + 38 = 5i. Let k(f) = -23f2 - 14f + 1 - 14f + 29f. Let w be k(-1). Which is smaller: a or w? w Let n = 0 + 0.2. Let q = 0.3 - n. Let x be (-38 + 39)/(1 - 2) - -10. Are q and x non-equal? True Let s(x) = x*3 - 2x*2 - 3x - 1. Let j be s(3). Let g be 9 - ((-513)/(-255) + 12 + -5). Is j at least g? False Let u be (-7 - 2) + 3 + -2. Let z be (u/10)/(38/(-95)). Let n be 6/2 + 36/(-42). Is n at most z? False Suppose 127j = 120j - 350. Let a be (4 + 0)/(-2)(-2448)/(-96). Is a greater than j? False Let w(v) = v3 + 3v*2 + 3v + 3. Let m be w(-2). Suppose -5s + 4s = -m. Let a be -6-6(-8)/(-528). Which is smaller: s or a? a Let y be (-250)/(-4)616/(-35). Let g be (-380)/y140105/(-174). Let h = -1669/6 - g. Which is smaller: h or -1? -1 Let b(h) = -111h + 2551. Let x be b(16). Which is bigger: x or 772? x Let q = -1490 - -1327. Which is greater: -162 or q? -162 Let g be 166 - (-4 - (-4 - 3/1)). Let y = -164 + g. Is -3/115 not equal to y? True Let j = 15585 + -15585. Which is smaller: j or 3/971? j Suppose 32t = 2f + 28t + 16, 3f + 8 = 2t. Suppose 4p + 3z + 47 = f, -2 = p - 4z + 5. Which is smaller: 8/9 or p? p Let m be (-4)/(-74) - (1422/(-79) - (-2407)/37). Suppose -t + 33 = 4d - 2t, 35 = 5d + 5t. Which is greater: m or d? d Suppose 1401a + 12 = 1398a. Let l be (-1263)/(-6)(a - (0 - 2)). Which is bigger: -420 or l? -420 Let p = 487 + -536.5. Let u = p - -49.74. Are -7 and u unequal? True Let n be 16/5(12 + -7). Let d = n + -17. Let o be 156/(-36) - (-1 - 5/(-3)). Which is bigger: d or o? d Let j = 21 + -3. Suppose 0 = 3o + 12 - j. Let m(z) = z3 - z2 - 2z. Let y be m(o). Which is bigger: y or -2? y Let j be 20/36-3(-4)/30. Let b = -309 + 295.1. Which is greater: j or b? j Let n(p) = -4p - 8. Let l be n(-5). Let t be l/(-572)22398/(-27). Let x = 192/11 - t. Which is smaller: x or 0? 0 Let l = 0.017 + 0.783. Is 195 at most as big as l? False Let f = 27.952 + 0.048. Let z = 2351/4 - 608. Let o = -20 - z. Which is bigger: o or f? f Let r be -9((-1)/(-11) + (-8)/1056). Is -718 != r? True Let i = -39.5755 + -0.9145. Which is smaller: i or -0.2? i Let p = 51047 + -18223760/357. Is p bigger than 0? True Let o = 2054 + -1070136/521. Let b = o + 5743/3126. Which is smaller: b or 0.01? 0.01 Suppose r - 3g - 1 = 3r, 2r - 23 = 5g. Let y be -46 - (2 - 0) - (-2 + r). Let t = y + 76. Is t < 26? False Let k(q) = -29q2 - 46q - 156. Let j be k(-5). Which is smaller: j or -1949/3? j Let u(h) = 2h2 - 17h - 15. Let l(t) = -t*2 + 6t + 5. Let d(y) = 8l(y) + 3u(y). Let q be d(-2). Is -8 at most q? True Suppose -4p + 0p = 0. Let x = -0.13156 - -12.20456. Let v = 0.073 - x. Is p < v? False Let c be (-7 - -29)(25/(-790) - 0). Which is greater: 0 or c? 0 Let i = 0.953 + -0.548. Let c = i - 108.405. Is c > -2/9? False Suppose 4i + 138 = -34. Suppose -22 = -10r + 108. Suppose -17 = c + 5l, 2c + r = l - 76. Is c != i? True Suppose -13r + 3009 = r + 3r. Which is greater: r or 181? 181 Let w = -3490 - -342017/98. Let t be (69/(-92))/(66/288) - -5. Which is bigger: w or t? w Let w be -23 - (27 + (-16081)/65). Which is bigger: w or -0.5? w Let l = 122 - 125. Let b(m) = -2m2 + 22. Let n be b(l). Let c = 15 - 22. Is c less than or equal to n? True Let h(i) = -i2 + 14i - 5. Let s be h(9). Let r be 94(-2)/(-6)(-60)/s. Is -48 bigger than r? False Let m(b) be the third derivative of 7b4/24 + 40b*3/3 - 31b*2. Let a be m(-20). Is 0 less than or equal to a? False Let r = -87.92 - 0.08. Let x = -2812 + 2905. Let u = r + x. Which is greater: u or -1? u Let u = -3 + 2. Let c = u - -2. Let b be 40/(-36) - 17422/2529. Is b less than c? True Suppose 9707 = -9y - 14998. Let r = 660/11557 + -31761963/11557. Let z = y - r. Which is smaller: 3 or z? 3 Suppose 50u = -y + 51u - 3303, 3u = 8y + 26454. Is y greater than or equal to -3308? False Let c = 34/67 + -27405/268. Is -101 equal to c? False Let o be 7 + (2 + -3)(3 - 1). Let g be -2(o + 1416/(-282)). Which is bigger: g or 0? g Let f(g) = -3g - 31. Let w(c) = -c. Let i(z) = -f(z) + 5w(z). Let t be i(6). Is 14 <= t? True Let p(s) = -s3 + s2 - 1. Let o be p(-1). Let g be 19 + -4 - o/(-3). Let c = 290 - 276. Which is smaller: g or c? c Let b = 4749 - 4751. Is 4.7 <= b? False Let a = -1 - -15. Suppose -15i + ai + 36 = 0. Suppose -2g + i = 2. Which is greater: 19 or g? 19 Suppose -152 = -28w + 67w - 20w. Suppose 3k + k = -56. Let u be 184/(-28) - (-6)/k. Which is smaller: w or u? w Let y be 579/(-9)(-26)/(-39). Which is bigger: y or -44? y Let c = 115721/4 + -28930. Which is smaller: 26/17 or c? c Let s(g) = g*2 + 33g - 106. Let d be s(3). Suppose -20 + 28 = dp. Is p less than or equal to 43? True Let h = -108191/92 + 1176. Suppose 7g + 3x + 2 = 11g, 8 = -2g - 3x. Which is smaller: g or h? g Suppose 23 = -4g - 5t + 10t, 0 = t - 3. Let z be (-16)/g + 0 + 47. Which is greater: z or 56? 56 Let b(q) = -4q*2 - 38q - 13. Let z be b(-9). Suppose c + 11 = -3i - 241, -zi - c - 422 = 0. Which is smaller: -83 or i? i Let f be 20/12(-4)/42-93. Let b = -11/7 - f. Is -16 < b? False Suppose -2a = -3o + 99, 9o - 6o - 5a - 90 = 0. Let k = o - 52. Is -4 at least as big as k? True Let w(b) = 591b - 50. Let p be w(-5). Let a = 1372 + p. Let k = 44083/27 + a. Which is smaller: 0 or k? k Let u = -4643 - -18227/4. Which is greater: -87 or u? u Let p be (10917/(-15))/((-228)/(-1710)). Is p at most -5458? True Suppose -34q = -23q + 198. Let s be (-9)/(-6)q/27. Which is smaller: s or -9/5? -9/5 Let f be (25/120)/((-4)/540). Does f = -27? False Let z be (-18)/((-9576)/(-98210)) - 4/(-38). Let f = 22780539691/218 + -104497704. Let n = f + z. Is -1 > n? False Suppose 5t - 18 - 17 = 0. Let v be 96/(-10)(2 - t). Suppose -2d - 2c = -v, -d = 2c + 3c - 16. Is 26 less than or equal to d? True Suppose 173q - 178q + 4o = 470, q + 2o + 108 = 0. Which is smaller: q or -165? -165 Suppose 0l + 5k - 140 = -5l, 0 = 5k - 20. Suppose -ld - 22 = -22d. Is -19/2 != d? True Let u be ((-57)/(-18) - 3)(-21 - -156)22. Do u and 495 have different values? False Let i(r) = r3 + 14r*2 - 4r + 122. Let x be i(-15). Which is greater: x or -310/7? x Let u = -0.02723 + 0.02723. Suppose 3g = 3c + 267, 0 = 5g - 3c - 290 - 159. Which is bigger: g or u? g Let h = -495 - -514. Suppose -9p + hp = 8p. Are p and -4/51 equal? False Let n be -1 - 5/(25/84). Let d = n - -2092/115. Is d smaller than 0? False Let r = 3124 + 1444. Let m = 4591.97 - r. Let z = 24 - m. Which is greater: z or 0.02? z Let f = 268 - 270. Let g(y) = -y3 + 7y*2 - 4y - 14. Let z be g(6). Is f >= z? True Suppose 10o + 2d = 5o - 27, -4o = 5d + 25. Let i be (24/240)/((-6)/o). Which is smaller: -13 or i? -13 Let o(b) = 7b - 34b + 4b*2 - 3b2 - 102. Let g be o(30). Let p(a) = a2 + 6a - 5. Let q be p(-5). Which is smaller: q or g? g Let c = -0.03855 + 0.15855. Which is greater: 272/5 or c? 272/5 Let d be (-1625)/((-1)/2). Let z be 41277/33 + 6 + -6. Let q = d - z. Which is bigger: -2 or q? q Let i be ((-7)/(5670/852))/((-2)/10). Is 4 greater than i? False Suppose -11y = -23y. Let q(m) = -2m3 + m2 + 4m. Let x be q(y). Which is smaller: x or 3/47? x Suppose -46356 + 46528 = -43r. Suppose -16 = 3i - 3q - 4, -i + 6 = 4q. Is r bigger than i? False Let s = -270 + 273.24. Let o = s - 0.04. Let b = -0.2 + 0.1. Is b equal to o? False Let p = 2178/19 + -44702/323. Is -23 at least as big as p? True Let p(q) = -7q - 68. Let j be p(-23). Let t = 0.002 + -0.002. Is t less than j? True Let n = -2735.7 + 2737. Are n and -2/23 non-equal? True Suppose 2x + 14x = -12x - 252. Suppose 0 = 2c + 4 + 6. Is c at most x? False Suppose 5p - 10 = -450. Which is smaller: p or -89? -89 Let r = -25329 - -22717. Are r and -2615 unequal? True Let j = 10.3 + -1.3. Let x = j + 2. Let r = -16095 + 16094.9. Is r smaller than x? True Let m be ((-173527410)/(-8208235))/37 - 1/((-14)/(-8)). Which is smaller: m or 1? m Suppose 0 = -45v - 53v + 60	{ "pile_set_name": "DM Mathematics" }
o + 5r for o. -4 Let q = -221 - -385. Let d = q + -153. Solve -3u + 13 = -6o + 2o, -3o + u - d = 0 for o. -4 Let v = -37 - -38. Let q be v/1 - (7 + -20). Solve 4k = -o + 7, -k + 2k = 5o - q for k. 1 Let h = 50 + -46. Suppose 5u = 2b + 11, 0 = -2u - 10b + 6b + 14. Solve -hk + 0j + 11 = uj, 5k - 40 = 5j for k. 5 Let k be -25((-774)/45 + 17). Solve 0 = 4f - 8, o - ko + 2f + 16 = 0 for o. 5 Let c(n) = -7n + 6 - 17 + n2 + 5n + 6. Let t be c(4). Let f = 17 - 12. Solve -tr + 4 + 1 = -2k, 0 = 2k + fr + 13 for k. -4 Suppose -2f = -5f - 4h - 8, 45 = 5f - 5h. Solve 2i - 5o - 22 = i, -5i - 35 = fo for i. -3 Suppose 209h = 203h + 30. Solve hm + 21 = -8q + 11q, -2m - 3q = 0 for m. -3 Suppose -114f + 119 = -34f + 39. Solve -4k - 28 = -4d, -f = 7k - 4k + d for k. -2 Let q = -6734 - -6749. Suppose -6x + 2x + 5 = k, 0 = -k + x. Suppose -3l + 4m - 6 = -k, l + 2m - q = 0. Solve y + lh = 2y + 8, -2y - h - 5 = 0 for y. -3 Suppose 397w = 390w. Suppose 0u - 2u + 26 = 0. Solve w = -3y - 2j, -2y = -j - 2j - u for y. 2 Suppose 60 = 2k + 2k. Suppose 5m - k - 35 = 0. Let p be (-10665)/(-1422) - 10/4. Solve -pf + 4q - 14 = m, 2q = 2 for f. -4 Suppose 103 = 28r - 9. Suppose -d + 0d = -33. Suppose 6p + 3 - d = 0. Solve 15 = g - pv, g + rv + 15 = -v for g. 0 Let a be 1((-27)/(-6))/910. Let g be a/10 - (-1 + 14/(-4)). Solve -10 = 4l - 2r, 0 = -5l + r - 3 - g for l. -1 Let y(l) = -4l2 - 187l + 444. Let c be y(-49). Solve -c = 3h - 3k, 9k = 4h + 13k - 12 for h. 1 Let f be (-5)/(-4)(-5)/(5/(-4)). Solve fc = 10, 4a - 3a - 11 = -4c for a. 3 Let u(p) = 26p - 75. Let b be u(3). Suppose -bc = 6n - 2n - 57, -5c + 72 = -n. Solve -3 = l - 5l - 3i, 0 = -4l + i + c for l. 3 Let y = -400 - -370. Let p be (6/4)/((-15)/y). Solve -2z + 3 = f, -4f - 1 = -pf for z. 2 Suppose 4f = -5x + 11 + 60, -3f - 3x + 57 = 0. Suppose -69 = -9h - f. Solve -hj + 2n = -16, -3j - j + 20 = -4n for j. 2 Let y(d) = -d*2 - 13d - 40. Let b be y(-7). Let c be (5 - (1 + 4))/((-2)/b). Solve 2p - o = -2, 0 = -5p - 2o - co - 5 for p. -1 Let f = 28658 + -28633. Solve -9g - 5k + f = -g, -g = -k + 5 for g. 0 Let j(t) = -5t - 32. Let k be j(-7). Let s be (k - (8 - 3)) + 0 + -102. Let i = 107 + s. Solve -4l = 2w - 15 - i, -5w = 2l - 29 for w. 5 Suppose 120d + 300 = 17d + 815. Solve dn = -3j - 34, j + 174n - 178n = 17 for j. -3 Let u = -51 - -67. Let c be (-26)/(-7) - u/(-56). Suppose v - 6 = -a, cv - 39 = -0v + a. Solve -3p + 6 = p - 5t, -p + v = -5t for p. -1 Let m be 4/18-654/(-12). Let u be 2/m(-13 - 2). Let d(r) = 5r + 27. Let c be d(u). Solve -ch + 2s = 0, 2s + 2s - 5 = 5h for h. -5 Suppose 4o = i - 34, 84o - 11 = 4i + 89o. Solve i = -3k + p, -3k - 18 = -5p - 0p for k. -1 Let b(i) = 5i*2 - 9i - 2. Let r(u) = -6u - 76. Let f be r(-13). Let s be b(f). Solve 3g - 2 - 4 = s, 0 = -o + 2g for o. 4 Suppose -13 = -d + 5f, 19d - 18d + 5 = -4f. Solve 12 = -4n, -5n = do - 26 + 35 for o. 2 Let x be 84/(-182)26/(-4). Solve -3f = -xw + 27, -2w - 4 = -3f - 27 for f. -5 Let f = -3782 + 3790. Solve b = 4y - f - 12, -15 = -3y + 5b for y. 5 Let r = 2336 + -2328. Solve 4p + 4n = -r, 0 = -25p + 23p - 3n - 8 for p. 2 Suppose 92 = -45f + 115 + 67. Solve 13d - 12d - 6 = 5z, d - fz - 3 = 0 for d. 1 Let s be (0 - -3)(-4)/((-36)/(-15)) - -9. Solve -a + r - 6 = 0, -sr = -15 - 1 for a. -2 Suppose -56v = -68v + 60. Solve -2b = 5i - 7, vb - 5i + 34 = -1 for b. -4 Suppose -c + 4 = -2d + 18, 3d = 9. Let x = c - -39. Suppose 3f = 4s - x, -3s - 6f = -3f + 3. Solve 0 = -5n - 4j + 5, 3j = sn - j - 4 for n. 1 Let m(r) = -r2 + r - 24. Let g = -16 + 24. Let j be m(g). Let a be j/(-5) + -5 - 0. Solve 2t + 0 + a = n, 4t = 3n - 23 for n. 1 Let a = -4 - -8. Suppose -4v - 8 = -v + 16, -30 = -2f + 3v. Solve m = -2z - f + 10, m = z + a for m. 5 Let j be (-8216)/(-234) + (-1)/9. Suppose -2x + 5g + 25 = 0, 0 = -11x + 15x - 5g - j. Solve 0 = -xz + l + 30, -2z = l + l for z. 5 Let n be (-44)/(-11) - (-13)/(78/12). Suppose -4u + w - 3w = -10, -4u - 20 = -4w. Solve -2d + ud - n = q, d + 4q + 3 = 0 for d. -3 Suppose -12p + 15p = 27, 5k + p = 14. Solve 0 = h + g - k + 2, 4g = h + 21 for h. -5 Let m(y) = -2y - 6. Let z be m(-5). Solve 3i = -zc - 2 - 2, -c + 18 = -4i for c. 2 Suppose -l = -2l - 3z - 5, 5z - 25 = -5l. Solve -2r = 4k + l, r + r = -k - 1 for k. -3 Let y be (93/6)/(2/4). Let h = y + -27. Suppose 5a - 90 = 5t, -4t = 4a - 0t - 88. Solve 0 = hf + a, -2v + 20 = -7v - f for v. -3 Let z be (-4)/18 - 1079/(-117). Let k be ((-27)/(-12))/z + 78/8. Suppose -6o + k + 2 = 0. Solve -on + f = 2f - 6, 4f = -8 for n. 4 Let m = -166 - -168. Suppose 4i - 27 - 77 = 0. Solve 5o - mo = -5b + 2, 3b - 5o = -i for b. -2 Let v(t) = -1454t3 + 1 - 7t + 0 + 1453t3 + 6t*2. Let d be v(4). Solve -do = 5u - 10 - 15, 5u - 25 = 2o for o. 0 Let a(q) = -357q + 2503. Let z be a(7). Solve 75l - 8 = 71l, -k + zl = 8 for k. 0 Let y be (3 + -4)112. Let j be 3/(y/10)-2. Suppose -i = -ji + 8, 0 = 4b - 2i - 4. Solve -3x + 2a - 14 = 0, -ba - 2 = 3x - a for x. -2 Suppose 5t - 41 = 2a - 3, t + 19 = -a. Let l = 14 + a. Let f(i) = i2 - 25. Let c be f(l). Solve -k - 10 = -cp + 5p, -k = -p - 8 for k. 5 Let u be (-5)/((2/(-2))/1). Suppose 0 = -2749d - 2878d + 5434d + 772. Solve o + 4 = -3h, 3 = do + 4h - u for o. 5 Suppose -326k + 18 = -320k. Suppose -4j - 3y + 43 = 2y, 4y + 40 = kj. Solve -3i + 24 = 3t - 6t, -3i = t - j for i. 5 Let n be (2/2 + 1)13916/49. Let y = n - 567. Solve -2r - 5g - 10 = 0, -5 = 3g + y for r. 0 Let u(p) = -94p2 + 284p + 1. Let r be u(3). Solve 7 = -6h + z - r, -5z + 8 = h for h. -2 Let l be (-3)/(1/2(-1)/((-208)/(-48))). Solve -23 = -3v + 5d, -d + l = 30 for v. 1 Suppose -4d - 299 = b, b - 4d + 307 = -0b. Let a = b - -319. Solve 2c + a = -4x, 3c = -c + 2x + 8 for c. 0 Suppose -7n = 4a - 3n, 0 = 4a + 5n + 3. Suppose -p + 6p + ah = 16, 0 = -3p + h + 18. Solve 3b = v + 2b - p, 0 = -4v - 3b - 15 for v. 0 Let u be 365 + (-1 - (-7 + 5)). Let z = -341 + u. Solve 5v - 3h = 25, -5v - 4h + h = -z for v. 5 Let c(w) = -6w + 21w - 168 - 11w - 6w - 4w. Let g be c(-28). Solve 8 = -3d + t - 2, g = 3d - 2t + 11 for d. -3 Suppose 0 = -i + 3i - 4. Let z(p) = -p2 + 9p - 5. Let s be z(5). Suppose 0 = 4t - t - s. Solve -3b - tj - 20 = 0, -b + ib = -5j - 10 for b. -5 Let t be 1660/2240 - (-9)/(-21). Solve -3m + g - 14 = t, -5m - 2g - 2g = -5 for m. -3 Let w = 296 - 296. Let l(a) = -a3 + a2 + 3a + 1. Let v be l(-2). Solve w = 2f - 3u - v, -4f = -5u - 4 - 9 for f. 2 Let p(r) = r2 - 242r + 273r + 12 + 2r2 + r3 + 8r2. Let u be p(-5). Solve a + 5s - 2s = u, -4s = 2a - 12 for a. 4 Suppose o = -0o - 8. Let k(j) = -8j - 7. Let y be k(o). Suppose -5q - 10 = -s + 19, 5s = 3q + y. Solve h + 15 = -2h - 5z, 2h = -3z - s for h. 0 Let g = -174 - -156. Let b be 1 - (21/(-2) - (-9)/g). Let t = -5 + 8. Solve -3l - 1 = -10, -3q - tl = -b for q. 1 Suppose 7z - 9z = 4p + 160, -3p = -12. Let l = z - -111. Solve -5f + f - 3j = l, 5f + 26 = -j for f. -5 Let l = 198 - 180. Let w(r) = -r*2 + 22r - 72. Let v be w(l). Solve vz - 25 = -2z - 5i, 5z + 5i = 40 for z. 5 Suppose 43m - 38m = 90. Solve -r - 5k + m = 0, 0 = 2r - 7r + 5k for r. 3 Let o(m) = 10m*3 - 4m*2 - 4m - 2. Let l be o(-2). Let v = l - -144. Let n = v + -52. Solve 29 = 4b + 5h, 0 + 12 = 2b + nh for b. 1 Suppose -195 = -82z + 17z. Solve -4o - 4 - 20 = -2l, 3o + zl = -9 for o. -5 Let c(f) = -f*3 + 11f*2 + 175f - 1921. Let i be c(11). Solve 3m + 28 = 6m + is, 4s = -4m + 32 for m. 4 Let m = 5109 - 5104. Solve 2t - 3t = -mq + 21, -1 = t for q. 4 Let m = -926 + 929. Suppose 4x = -b + 3x + 3, b + 3 = 5x. Suppose 0 = q + 4s + 9, -bq - 5s = -ms. Solve 3h + 3i - 9 = 0, 5h - 18 = qi - 3 for h. 3 Let r = 8 + -12. Let l(z) = z + 4. Let p be l(r). Let s be 336/126 - 1/(-3). Solve p = sv + g - 14, -g - 3 - 4 = -4v for v. 3 Let w(u) = -27u - 45. Let h(j) = 78j + 136. Let t(k) = 4h(k) + 11*w(k). Let v be t(-3). Solve n - s = 1,	{ "pile_set_name": "DM Mathematics" }
nding order. 1, -1, z Suppose -4d + 12 = 2d. Put 1, d, 4 in descending order. 4, d, 1 Suppose 5s = -5t - 30, -9 = 3t - 2s - 1. Suppose l - 3i + 0i = 14, 14 = 4l + 2i. Suppose 2a - l = -3a. Put a, 4, t in ascending order. t, a, 4 Let f be (-2)/4 + (-6)/4. Let a be (-10)/14 + f/7. Suppose 28y - 31y = 15. Sort y, 2, a. y, a, 2 Let n = -52 - -54. Sort 0.13, 1, n, 0.1 in increasing order. 0.1, 0.13, 1, n Suppose 5a - 9 = 16. Suppose -5t = -4n + 40, -n + 5t + 12 = -13. Suppose -nu = g + 10, -a - 12 = 4g - 3u. Sort g, 4, -4. g, -4, 4 Suppose -14r - 2r = -32. Sort 0, r, -3, 1 in descending order. r, 1, 0, -3 Let v(m) = -1 + 3m*3 + m - m - 9m*3. Let h be v(1). Let n = h + 8. Put 4, -4, n in decreasing order. 4, n, -4 Let x be (-5)/(-10)(-10)/1. Sort -2, 5, x in decreasing order. 5, -2, x Let a = 9 - 9. Suppose 4y = -2v + 86, 3y - 2v = -0v + 54. Suppose -j - 4j = y. Put 5, j, a in increasing order. j, a, 5 Let o = -1/30 + -3/10. Let v = -0.5265 - -0.0265. Sort v, -4/5, o. -4/5, v, o Suppose 7b - 2b - 50 = 0. Suppose b = -6v + v. Put -1, 2, v in descending order. 2, -1, v Let q(j) = -j3 + 4j*2 - j + 5. Let h be q(4). Let t = 2 - h. Let p be 7t/4 - 2. Sort -1/2, p, 0.1 in descending order. 0.1, p, -1/2 Let b = -18.1 - -19. Put -2/7, -1, b in ascending order. -1, -2/7, b Let i = -234/95 + 24/19. Let s = -726 + 725.5. Sort s, 2, i in decreasing order. 2, s, i Suppose 1227 - 302 = -5m. Let p be (-188)/(-10)118/(-12). Let t = m - p. Put t, -4/7, -1/8 in increasing order. -4/7, t, -1/8 Let u = 1 + 3. Let c = 1982/11 - 180. Sort c, 2, u in increasing order. c, 2, u Let f = -21 + 20. Put -7, f, -3, 0.3 in decreasing order. 0.3, f, -3, -7 Let k be (-6 - 1) + (-1)/(-1). Let n be (0 - -5) + k/2. Suppose -2 = -z - 5c, nc + 3 - 2 = -z. Sort -1, -4, z in descending order. -1, z, -4 Suppose 0v - v = -16. Let l be (-2 - v/(-6))-3. Let w be (-4 - -5)/(l/(-8)). Sort 5, -1, w in descending order. 5, w, -1 Let k = 3.2 - 2.8. Put 2/11, k, -0.2 in decreasing order. k, 2/11, -0.2 Suppose 3f = -5x + 41, -3f = -3x - 10 + 1. Let j = 11 - f. Suppose 3 = 2c - 3c, -jq + 1 = -3c. Put -5, q, 2 in descending order. 2, q, -5 Let b = 6 + -3. Suppose bk - 1 = -w + 1, -3k = -2w - 5. Let d be (10/(-4))/(w/(-2)). Put 5, d, 0.3 in decreasing order. 5, 0.3, d Suppose 3t = -i - 9, -i + 12 = -6i - 4t. Suppose ia = -4a - 8. Let z be -1 + 0 + 0 + 0. Sort a, z, -4 in ascending order. -4, a, z Let v = 24.2 - 24. Sort 2/5, -4/7, v in decreasing order. 2/5, v, -4/7 Suppose 18 = 2k + 6. Suppose c + c = k. Let l = 0 + 4. Put l, c, -2 in ascending order. -2, c, l Let k = 1.7 + 2.3. Sort 4/7, k, 1/5 in descending order. k, 4/7, 1/5 Let t be ((-3)/6)/((-2)/(-4)). Let d(a) = -4a*3 + 3a*2 + 3a + 1. Let u be d(t). Sort 2, u, 4. 2, 4, u Let s be (24/75)/(36/10). Let k = s + 38/585. Let l = -5.1 - -1.1. Put k, l, 0 in descending order. k, 0, l Let p be -4 + 1 + -6 + 10. Put p, 5, 0 in decreasing order. 5, p, 0 Let y = 1.3 + -1.1. Sort 1, 0.5, -1/2, y. -1/2, y, 0.5, 1 Let m(d) = d3 + d2 + d + 5. Suppose 0g - 3g = 0. Let z be m(g). Suppose 0c + 20 = -zc. Sort -2, 4, c in increasing order. c, -2, 4 Let g(c) = c*3 + c - 1. Let j be g(1). Put 0, 2, j in decreasing order. 2, j, 0 Suppose 0 = t - 3t + 28. Let g = t + -9. Suppose 2i + 3i + 10 = 0. Sort 3, g, i in decreasing order. g, 3, i Let t be 60/(-25) - (-9)/(-15). Put 1/3, t, -4 in increasing order. -4, t, 1/3 Let i be (-30)/(-26) + 1 + -2. Let m be (8/10)/(4/2). Sort -2/9, i, m in decreasing order. m, i, -2/9 Let g = -0.05 + 4.05. Put 0.2, g, -8 in decreasing order. g, 0.2, -8 Suppose 4p = -4r - 20, -5r + 2p + 4 = 1. Suppose 2q - 6q = -3c + 14, 2c - 6 = 2q. Let s be (-2)/6(6 + 3). Sort r, s, c in descending order. r, c, s Let g = 2 + -3. Put 1/6, -2, g in descending order. 1/6, g, -2 Let i = 181.8 + -165. Let z = 17 - i. Put -0.5, 0.1, z in decreasing order. z, 0.1, -0.5 Suppose d = 4n + 378 - 73, 5n = -d - 370. Let t = 644 - 1141/2. Let a = n + t. Sort -2/7, a, 0.4 in decreasing order. 0.4, -2/7, a Suppose -2p = p. Let s(q) = q + 1. Let r be s(-5). Put p, -3, r in decreasing order. p, -3, r Let d = -2.6 + 3. Let j = 25 - 22. Put -2, j, d in ascending order. -2, d, j Let t = -15.11 - -15. Let u = -4.89 + t. Let d = u - -9. Sort 3, d, 1/6 in decreasing order. d, 3, 1/6 Suppose -4v + 5b + 28 = 0, 2b = 3b + 4. Let w be (-4)/(-6) + (-6)/9. Suppose 9 = -3f + 3. Put w, f, v in decreasing order. v, w, f Let l = -4 - -6. Suppose 2s - 17 - 1 = -m, -4s - m + 34 = 0. Let x = 5 - s. Sort l, 1, x. x, 1, l Let f = -0.76 + -0.14. Let l = f - -1.3. Put -3, -5, l in descending order. l, -3, -5 Let t = -10.5 + 6.5. Sort -0.09, t, 1, 2. t, -0.09, 1, 2 Let w = -4.9 + -0.1. Sort w, 1/2, 1/6. w, 1/6, 1/2 Let z = -5 - -3. Let g be 1/(1(-2 + 3)). Let s = -12 - -8. Put s, z, g in increasing order. s, z, g Let g = 47 + -52. Sort g, -3, -2. g, -3, -2 Suppose -2g - 6 = -4z + 4, 0 = 5z - g - 8. Put z, -1/6, 0.07 in increasing order. -1/6, 0.07, z Suppose 0 = 27p + 10p + 9p. Suppose -16 = -0k + 2k. Put p, k, -2 in increasing order. k, -2, p Let m = -365/3 + 123. Let y = -0.3 - -0.5. Sort y, m, -0.2 in increasing order. -0.2, y, m Let l = -6 - -11. Let j = 0 + 0. Sort j, -5, l in descending order. l, j, -5 Let j(m) = -m2 - 5m + 6. Let l be j(-6). Let a be -2 + (3/(-2))/(5/(-10)). Sort a, l, -0.3 in descending order. a, l, -0.3 Let a = 16 - 16. Let m = a + 2. Sort -3, m, -1/3 in descending order. m, -1/3, -3 Let x = -127 - -129. Put -10, 5, 3, x in descending order. 5, 3, x, -10 Let p be 108/(-5)(-5)/329. Let x = p + -2/47. Put x, -0.5, -0.05 in increasing order. -0.5, -0.05, x Let i be (0 + 3/6)/1. Let w(h) = h2 + 6h - 8. Let v be w(-8). Let z = 7 - v. Sort z, 1, i in increasing order. z, i, 1 Suppose 5n + t - 11 = 4, 5n - 3t = 15. Suppose -1 = 2x + n. Put 2/5, x, 0.5 in descending order. 0.5, 2/5, x Suppose -8 = 4x + 2h, -5h + 12 - 32 = -2x. Suppose -o - o = x. Let f = 5 - 8. Sort o, f, -5 in descending order. o, f, -5 Let p(v) = 7v - 78. Let h be p(11). Let f = 161 - 647/4. Put h, f, 2/5 in ascending order. h, f, 2/5 Let i = 0 + -4. Sort i, 4, 3. i, 3, 4 Let i = -135.9 + 136. Sort 5, -1, 7, i in decreasing order. 7, 5, i, -1 Let u = -2 + 1.9. Let m = -7.4 - -1.4. Let t = 4 + m. Sort -5, u, t in ascending order. -5, t, u Suppose -5a + 5m = -5, -5 = -a + 3m - 4m. Suppose -1 = -b + a. Sort -5, b, 3. -5, 3, b Let k = 42 + -87/2. Let w be (-62)/25527/(-6). Let h = -5/17 + w. Sort k, 1/4, h in decreasing order. h, 1/4, k Let z(f) = -2f. Let p be z(-1). Let w = 0.01 + -0.41. Sort w, p, -1/7 in decreasing order. p, -1/7, w Let u = 0.08 + -5.08. Let s = u - -5. Sort 3, s, -0.4 in ascending order. -0.4, s, 3 Let a = -0.295 + -0.005. Let n = 5.4 - 0.4. Let o = n + -10. Put o, -2/11, a in ascending order. o, a, -2/11 Let k be 0 + (-2 + 2)/2. Let z = 24 + -31. Let s = z - -12. Put s, k, 0.5 in increasing order. k, 0.5, s Suppose 4a - 3h = 12, a = -h - 0 + 3. Sort 0.1, 0, a in decreasing order. a, 0.1, 0 Let m = 0 + 0. Let f = -3 - -4. Let k = -1 + 0.7. Sort m, k, f in descending order. f, m, k Let w(n) be the second derivative of n4/12 + n3 + 5n*2/2 - n. Let d be w(-5). Sort 5, 2, d in ascending order. d, 2, 5 Suppose -12 = -5r - 32. Let a = r + 7. Sort 4, a, 0 in decreasing order. 4, a, 0 Let j = -24 - -37. Let x = j - 18. Put 4, x, 2 in decreasing order. 4, 2, x Let j = -1.3 + 0.9. Sort -1/4, j, 4 in descending order. 4, -1/4, j Let c be (-9)/(-6)2 - 132/(-2). Put -4, c, 5 in ascending order. -4, 5, c Let y = -2/39 + 5/13. Let v = -7 + 4. Sort 0.4, v, y in increasing order. v, y, 0.4 Let p be (-1)/((-2)/(-4)1). Let n(x) = x*2 - 1 - 2x2 + 3 - x. Let i be n(-3). Sort i, 1, p. i, p, 1 Let g(j) be the second derivative of j3/2 + 2j2 + 2j. Let b be g(-3). Sort 1, -4, b. b, -4, 1 Let i = 335/3 + -112. Sort -4, 0.1, i, -0.1 in decreasing order. 0.1, -0.1, i, -4 Let u = 17 - 12. Let d = 7 + -4. Sort 1/6, d, u. 1/6, d, u Let q = 13.5 + -13. Let u(p) = p - p - 8 - p. Let v be u(-6). Put v, q, -1/5 in decreasing order. q, -1/5, v Let m = 7 - 7.3. Let g(h) = -2*h - 3. Let w be g(-3). Let b = 7 + -8. Sort w, b, m in decreasing order. w, m, b Let c = 0 + -0.1	{ "pile_set_name": "DM Mathematics" }
aller: g or -1? -1 Let o be ((-3)/(-3))/(1/(-7)). Which is greater: -12 or o? o Let q = 3 + -2.7. Let s(v) = v*3 + 8v*2 + 10v + 4. Let y be s(-6). Let a be (-4)/(y/3) + (-7)/(-12). Which is smaller: q or a? a Let k = 0.715 - 2.129. Let g = 0.014 + k. Which is smaller: -0.1 or g? g Let b = -0.029 - -0.053. Which is greater: b or 0? b Let i(z) = z*2 + 4z + 10. Let f be i(-5). Let q be ((-2)/102)/(f/18). Which is smaller: q or 1? q Let z(p) = -p*2 - 28p + 51. Let j be z(-30). Let c be (-8)/(1(1 + 0)). Is c >= j? True Let t = 7.9 + -8. Suppose 678y = 669y - 468. Which is bigger: y or t? t Let y = 5.4 - 6. Let l = -6 - -5.6. Let g = y + l. Which is bigger: g or 0.1? 0.1 Suppose 5b - 13 = -8. Which is bigger: -9/29 or b? b Let p = -1.1 + -0.7. Let o = p + 1.7. Let w = o + 0.1. Which is smaller: w or 1/3? w Let f be (622/(-6) + 7)/((-2)/3). Let a be (-3 - -6) + f/(-49). Let x(m) = m. Let l be x(1). Which is greater: a or l? l Let d(s) = -2s - 29. Let a be d(-17). Suppose -3h - 1 = 4g, ag - 3h = h - 9. Is g at least -1/7? False Suppose 4k - 200 = -176. Are 7 and k non-equal? True Let c = -50/99 - 14699/495. Is c greater than or equal to -31? True Let s be ((-30)/(-8)-1)/(1/4). Which is bigger: -156/11 or s? -156/11 Let q = -15 + 14. Let h = 0.035 - -23.965. Let v = h - 16. Which is greater: v or q? v Suppose -52p + 2006 = 7p. Is p equal to 47? False Suppose 3y - c + 223 = -123, -5c + 476 = -4y. Which is smaller: y or -116? -116 Let m be (24/(-105) + 0)(-10)/4. Let h(c) = -2c - 1. Let s be h(-1). Which is smaller: s or m? m Let j = -435/56 - -57/7. Suppose -6 + 1 = 5z. Which is smaller: z or j? z Let b be (15 - 12) + (-2 - 0). Let f be 0 + (-2 - 1)b. Which is greater: f or -0.02? -0.02 Suppose -h - 558 = 23g - 18g, 2h = -3g - 1109. Is -552 > h? True Let w(c) = -2c2 + 10c + 14. Let z be w(6). Suppose zj - 7 = -5j. Is 1/22 less than j? True Let k be (-40)/(-180) - (-9)/((-243)/(-210)). Which is greater: 45 or k? 45 Let m be (-4)/22 - 2/(-11). Suppose m = -n + s + 908, -5n + 3s + 4536 = -0n. Let w = -6357/7 + n. Do w and -2 have the same value? False Suppose 29 = 3k - 0k + 5s, 4s = 2k + 10. Let f(a) = 2a - 11. Let h be ((-100)/(-40))/(10/24). Let l be f(h). Which is bigger: l or k? k Suppose 5z = -4h - 2, -41h = -45h - 12. Which is greater: z or 83? 83 Let t(l) = -2l*2 + 67l + 70. Let o be t(35). Is o <= -254/7? False Let y = -65 - -61. Let l = -6.1 + 6. Is l at most as big as y? False Let l = -149 - -446/3. Let r = 41.2 + -39. Is l > r? False Suppose -2y = -4d + 12, -3y + 0d - 6 = -2d. Let c be (-105)/14(1 - -5). Let m be (-506)/252 - -2 - 10/c. Is y equal to m? False Let o be (1/18)/((-3)/(-9))2. Is o not equal to -25? True Suppose 4i - 38 = -6. Suppose -i - 24 = 2o. Let u = 5 + o. Which is greater: -9 or u? -9 Let d = -24 + 24. Let v be (1/2)/((-20)/40). Are d and v unequal? True Let b = 20770 - 20823. Let x be 0 - (1 - (-1 - 50)). Which is smaller: x or b? b Let z be (-94)/88/(-2). Let y = 140/3 - z. Suppose -126 = -13f - 8f. Which is greater: f or y? f Let u = -230.46 - -230. Let d be (2/(-10))/((-2)/(-5)). Which is greater: u or d? u Let n be ((-70)/7)/((-2)/(-3)). Let p = n - -19. Suppose -1 = -pb + b + x, -b + 5 = -5x. Which is smaller: 0.1 or b? b Let d = -25225/7 + 3613. Is 9 at most d? True Let r(c) be the second derivative of -c*4/12 - 13c3/6 - c2 - 22c. Let g be r(-6). Is 40 < g? False Suppose 422 - 128 = 7g. Let w = g + -53. Is w equal to -12? False Let q = -15 + 15.01. Let u = -1.99 - q. Let z = 3 + u. Is z greater than -1? True Let u = -2249 + 1278. Is u >= -970? False Let c(v) = v*2 - 8v + 20. Let r be c(5). Let j(w) be the second derivative of -w*5/20 - 7w4/12 + w3 - 11w2/2 + 3w. Let g be j(-8). Is g < r? False Suppose -q - 1086 = -p, -77q - 2172 = -75q + p. Which is greater: -1085 or q? -1085 Let k = -38 + 35. Let l be (-1)/k - (-6)/9. Which is smaller: l or -1/37? -1/37 Let y(x) = 4x3 + x2 - 2x. Let j be y(-2). Let o(z) = z*3 - 2z*2 - 2z + 9. Let s be o(4). Let a = s + j. Are a and 9 unequal? False Let u(k) = 2k2 - 13k + 11. Let f be u(6). Suppose -fq - 109 = 41. Let t be ((-62)/3)/((-2)/(-3)). Do q and t have the same value? False Suppose -4q + 234 = -5h - 174, -3h - 236 = 2q. Which is bigger: -79 or h? -79 Let x be (-2 + 28/11)24/9. Suppose 4 = -4p + 8. Is p less than x? True Let m be 4/(-30)-61. Let k = -142 - -213. Let c = k + -70. Are c and m nonequal? True Suppose -5w = -10w + 80. Suppose 3b = 2a + 53, 62b - 58b + a = 56. Which is smaller: b or w? b Let q = 450 - 229. Which is smaller: -1 or q? -1 Let f = 53 - 32. Suppose -22p = -fp + 46. Is p smaller than -46? False Let a = -15.275 - 0.125. Let f = a + 1.4. Let x = f + 15. Are -7/3 and x non-equal? True Suppose 3x - 2x = 2y + 38, -37 = -x + y. Suppose 8f - 2f - x = 0. Let i be f/(-9) - (-28)/6. Is i bigger than 4? False Let n be (-5 + 4)(-1 + 1). Let l(r) = -11r - 154. Let u be l(-15). Which is smaller: n or u? n Let h = 26276839/4491 + -5851. Is -1 <= h? True Let h = -41 + 21. Let z(f) = 107f - 127. Let j be z(1). Is h > j? False Let f = 844 + -1125. Is -283 <= f? True Let h(x) = -7 - 2x + 1 + 4x - 2. Let k be h(9). Is 10 <= k? True Let l(a) = 13a + 13. Let o be l(-5). Let m = -52 - o. Is m at most 2? True Suppose -1292 = -5h - 14h. Which is greater: h or 271/4? h Suppose 0 = 2a - z - 85 - 268, a + 5z - 171 = 0. Is 176 smaller than a? False Suppose 0 + 25 = -b. Let w = 736.2 + -736. Is w bigger than b? True Suppose 4i + 11 = -5. Suppose 0 = -w - 5u + 3u + 7, 5w = -3u. Is i greater than or equal to w? False Let y be (-4 - 1)((-4)/1 - -3). Suppose 3a + 2q + 54 = -y, 4q + 55 = -3a. Is a > -23? True Let j be (-9 - -5)/(((-40)/5)/2). Which is smaller: -4/797 or j? -4/797 Let j = 2/6373 - -18931/599062. Is j >= 0? True Let b be (-2)/(-8) + 27/20. Let q be ((-1)/(-6))/(11/33). Which is smaller: q or b? q Let x(c) = -71c - 497. Let z be x(-7). Let d = -4 - -6. Suppose -o - 2l = 11, 0 = -3o + do - 4l - 21. Is o less than z? True Suppose -5c = -2z - 13, 5c - c + 3z = 15. Suppose -2i = -3 - c. Suppose -5b + 2p = -25, 2b + p = ip + 4. Is b > -2? True Let u = 25/48 - 659/1296. Which is bigger: 1 or u? 1 Let f = 3 + 35. Let r be (-16)/(-216)18444/16. Which is smaller: f or r? r Let i(n) = -n*2 + 35n + 453. Let j be i(45). Which is bigger: j or 123? 123 Let n(p) = 0p - 3 - 2 - 3p. Let r be n(-3). Let g be (-32)/48(-18)/4. Is r equal to g? False Let i(v) = v2 - 10v - 67. Let j be i(15). Suppose 5a - b = 23 + 2, -5 = 5a + 5b. Suppose -j - a = -3h. Is h at most as big as 6? True Let i = 141/4 - 2963/84. Suppose -3 + 6 = -3k. Which is smaller: i or k? k Let x be 65/10 + (-3)/6. Let w = 28929 - 88757/3. Let s = w + 663. Is s equal to x? False Let u(b) = 4b - 13. Let a be u(6). Let z(y) = -y*2 + 11y - 6. Let n be z(a). Let h(p) = -p*3 - 7p*2 - 10p - 18. Let o be h(n). Is 4 at most as big as o? True Let k = 0.5 + -0.83. Let i = -433 + 434. Which is smaller: k or i? k Let p be (9 - 11)(3 + (-1390)/463). Are p and 0 nonequal? True Let w be 14/3(-2)/(10/(-135)). Let a be (2 + -1 - -4)w/(-35). Which is bigger: a or -19? a Let g = 1.67 - 0.27. Let b = 2.3 - g. Is 0.1 >= b? False Let h = -4893 + 229981/47. Is 0 less than h? True Let h = -17 - -24. Let y = h - -4. Which is bigger: 1 or y? y Suppose 3q = -5h - 13, 0 = -2h - h - q - 7. Let o be 1 + (h - 36/(-4)). Suppose t - o = 3t. Which is bigger: t or -2? -2 Let c = 164 - 164. Let y = 5/13 + -22/91. Are c and y unequal? True Let l = -2513743/17 + 147751. Let r = l - -116. Which is smaller: 0 or r? r Let s be 3 - 13/((-39)/(-36)). Let f be (-254)/9 + (-2)/s. Are f and -28 unequal? False Let r = -72 + 110. Let x be r/14 - (-5 - -26)/7. Which is smaller: x or 11/3? x Let v be -33/5(-2)/26. Let n = 356/715 + v. Which is smaller: n or 1? n Let a = 298 - 311. Is a at least as big as -6? False Let g be 1 - (-1 - (-5)/2). Suppose 0 = -0i - 2i + 2l, -i - 4l - 15 = 0. Let p(n) = -n3 - 2n*2 + 4n + 2. Let v be p(i). Is g at most as big as v? False Let v = 70.9 + -70.801. Are v and -2 nonequal? True Let l(w) = -8 - 2w - 5 - 6 - 3w. Let m be l(-4). Do -11 and m have	{ "pile_set_name": "DM Mathematics" }
of 1 + (-1)/((-5)/(-11)) and (-4)/((-3)/x - 2/(-4))? 5 Suppose -2n + 4n - t - 2 = 0, -2n + 4t = 4. Suppose 4h + 13 = 4r + 1, -nh + 2 = 0. Calculate the lowest common multiple of 8 and r. 8 Suppose d + 4y - 40 = -y, 0 = -5d + 5y + 110. Suppose -767 + 47 = -16c. What is the least common multiple of c and d? 225 Suppose 64 = 2a - 5x - 17, -2x + 159 = 5a. Calculate the lowest common multiple of 54 and a. 594 Suppose -5d + 2f + 108 = -0d, -f + 1 = 0. Let l(s) = 7s2 + 76s - 8. Calculate the lowest common multiple of l(-11) and d. 66 Suppose -4f = 3h - 35, -4f - 10 = -5h - f. Suppose -hn - 4g = g - 270, 4n = 4g + 208. Calculate the lowest common multiple of n and 3. 159 Let k be (-1)/2 + 170/20. Calculate the common denominator of (1 - -12k)(-5)/30 and ((-19)/6)/((-6)/(-4)). 18 Let d(k) = 17k - 20. Let l be d(13). Find the common denominator of 67/10 and (l/(-6))/(2/2). 10 What is the common denominator of (-2)/(-19) - (-1877)/38 and 127/6? 6 Let a(t) = 34t + 1620. Suppose 5i - 5r - 60 = 0, 0 = -r - 2r. Calculate the smallest common multiple of a(-44) and i. 372 What is the smallest common multiple of 13156/364 + (-1)/7 and 72? 72 Let w = 441975/38 + -11629. Find the common denominator of 89/38 and w. 38 Let a = 8 - 5. Suppose -17 + 9 = -4i. Calculate the lowest common multiple of a and i. 6 Let c(u) = 5u + 227. Calculate the smallest common multiple of c(-35) and 8. 104 Suppose -c = -1, -z = z - 5c + 9. Let y = z - 1. What is the smallest common multiple of (-2 + (-2)/y)-3 and 16? 16 Suppose -2 = -4y - 18. Calculate the common denominator of 1(-2)/((-66)/(-93)) and (y/10)/((-16)/(-1780)). 22 Let p = 39 - 37. Let v(b) = -2b + 5. Calculate the least common multiple of 6 and v(p). 6 Let o = 76 - 62. Calculate the smallest common multiple of 572 and o. 4004 Let q be ((3770/360)/(-29))/(2/(-3966)). Let u be 478/(1 + 1)3. Let d = q - u. Calculate the common denominator of 79/12 and d. 12 Suppose 0s - 3s + 4o = -176, 2o = -s + 62. What is the least common multiple of 40 and s? 120 Calculate the lowest common multiple of 40/(-12) + (-16)/(-12) + 146 and 72. 144 Suppose -r - 17 = r - p, 4r = 4p - 36. Calculate the common denominator of r/14 + -3 + (-3845)/(-1155) and 10/51. 561 Find the common denominator of (-1)/4 + ((-295)/100 - 0) and 23/30. 30 Suppose -5s + 8s = 0. Let j be 4/8s + 12. Find the common denominator of -34/11 and j/(-42) - (-422)/56. 44 Let d = -46 - -47. Calculate the common denominator of -2 - ((-564)/64 + d) and 151/60. 240 Let l = -36549/2 - -19325. Let z = -1020 + l. Calculate the common denominator of z and 57/4. 4 Suppose -2j - 149421 + 32601 = 0. Let o be 12/66 + 110357/j. Let l = -4/531 - o. What is the common denominator of l and 37/10? 10 Let g be 1 + -1 - 11138/(-10). Let r = 1122 - g. Let f = r + -527/60. What is the common denominator of 71/20 and f? 60 Let d = 30583/156 - 2580/13. Calculate the common denominator of d and 41/237. 948 Let c be 4/(-24) + (-52)/(-24). Suppose -5w = cn - 50, 25 = -3n + 8n. Calculate the least common multiple of 18 and w. 72 Calculate the common denominator of 17/20 and 694/(-2632) + (-3)/(-7). 940 Let w = -416167/133 - -3129. Let c = -5493/532 - w. Find the common denominator of c and -87/2. 4 Suppose -2k + 44 = 5l, k + 2l - 31 = -11. Let m be (-45)/(7/(56/(-12))). Let v = 42 - m. What is the least common multiple of v and k? 12 Let x = -1 + -2. Let j(a) = a*3 + 3a2 - a + 5. Let b be j(x). Let u(o) = o2 - 4o - 16. Calculate the lowest common multiple of 20 and u(b). 80 What is the smallest common multiple of ((-2)/5)/(5 - (-462)/(-90)) and 18? 18 Suppose 5o = 3d + 73, 6d - 65 = -5o + d. Suppose -k = -3c + k + 29, c + 5 = -3k. What is the lowest common multiple of o and c? 14 Let k be (-18930)/9(-9)/61. Let s = k + -31439/10. What is the common denominator of s and 85/2? 10 Suppose -3f + 6 = -6. Suppose fi + 0i = 16. What is the smallest common multiple of i and (-1 - 0) + (19 - 2)? 16 Suppose 90d = 82d + 80. Suppose 2n = -4z + 414, 4z + n - 100 = 319. Calculate the least common multiple of d and z. 530 Suppose 4 = 3t - 4t. Calculate the common denominator of t/(-10) - (-219)/165 and 15/14 + 6/4. 77 Find the common denominator of -77/78 and (-1)/12-6 - 47/60. 780 Let r = -858 - -10303/12. Calculate the common denominator of -23/9 and r. 36 Suppose 3z + 3c - 8 = -2, -c + 10 = 5z. Suppose 4h = -z - 2. Calculate the least common multiple of h/(-2) + 190/20 and 2. 10 Let b = -641 + 105. What is the common denominator of ((b/(-18))/4)/1 and -79/8? 72 Let c be -6 + 114 - (1 - 4). Let g = c + -71. Calculate the least common multiple of g and 20. 40 Let p = 6 - 2. Let n be (-12)/(-15)(-90)/(-12). Suppose 0 = -ph + n + 14. Calculate the lowest common multiple of h and 4. 20 Let g(w) = 1061w2 - w + 3. Let a be g(-3). Let q = -360142723/18 - -20017491. Let f = q - a. Find the common denominator of f and 53/22. 198 Let g = 346834/3 + -116697. Let m = 1102 + g. Calculate the common denominator of -133/24 and m. 24 Let x(o) = -o2 - 6o + 3. Let h be x(-3). Let f = h + 18. Suppose 5y = -2b + f, 0b = 3y - 5b - 18. Calculate the least common multiple of y and 3. 6 Let u be 9/573/72. Let b = u - 1445/152. Find the common denominator of (-2907)/180 + (-4)/(-10) and b. 4 Let h(u) = 4u + 184. What is the smallest common multiple of 282 and h(-37)? 1692 Let s = 6612 - 85906/13. Calculate the common denominator of 69/44 and s. 572 Suppose -2h - 80 = -4s, 3h = -s - 15 + 42. What is the common denominator of 4 + -3346/108 and 1/s1710/12? 126 Let r = -252775707/34 - -7433901. Let n = 681 + r. Find the common denominator of -59/22 and n. 374 Suppose 0 = -k - 5, -l - 21 = -4l + 3k. Suppose -l = -3m + 46. Calculate the smallest common multiple of m and 12. 48 Suppose 5d - 20 = 0, -h + 3d - 2d = 6. Let w = 1384 + -9735/7. What is the common denominator of 31/(-4) + 6/h and w? 28 What is the common denominator of 51/4 and ((1024/1100)/(-8))/(3/(-30))? 220 Let i = 5084 + -33910/7. Let z = -33049/140 + i. Find the common denominator of z and -31/20. 20 Suppose 4q = -2s + 22 - 8, 0 = 5s - 5q + 10. What is the common denominator of (-4)/(-66)3210/40 and -7(-11)/6 - s? 66 Let k = 3463/1067 - 15/97. Suppose -o + g + 4452 = o, 0 = -2o + 3g + 4452. Let d = 24540/11 - o. Find the common denominator of k and d. 11 What is the common denominator of -29/21 and (-76)/56 + 5 + -2 + -2? 42 Let g = 69 - 62. What is the lowest common multiple of 21 and g? 21 Let l be 0 - (7 - (-1 - 1)). Let b = -2 + l. Calculate the common denominator of -39/22 and (b/(-3))/(2/(-3)). 22 Let k = 8/6925 - 6524/851775. Let l = -1/551267174 + -5941833232499/1356117248040. Let d = l - k. Calculate the common denominator of d and 1/10. 40 Suppose -2y + 6t = 4t + 110, 160 = -3y + 2t. Let l = 56 + y. Calculate the lowest common multiple of 22 and l. 66 Suppose 0 = -4k - 3f + 350, -3f = 5k + f - 438. What is the lowest common multiple of k and 7? 602 Let h = 37829 + -16228648/429. Let i be (-2)/8 + 5734/858. Let m = h + i. What is the common denominator of 45 and m? 12 Suppose -5y + 10 = -d - 0d, 0 = d - 4y + 7. Suppose 2m + 6 = -m. Let n(i) = 3i*2 + i. Calculate the least common multiple of d and n(m). 10 Let r = 39331/18 - 2183. What is the common denominator of 3/8 and r? 72 Let w = 6127 - 36397/6. Let u = -65 + w. What is the common denominator of u and -8(11/14 + 0)? 42 Let v be 15/3 + (-224)/(-4). Suppose vh + 20 = 71h. What is the smallest common multiple of h and (-11)/((-2)/6)? 6 Let y be (-7)/((-7)/(-93)) + -1. Let t = 102 + y. Calculate the least common multiple of t and 18. 72 Let o be (15 - 3)(-9)/(-24)334. Let l = o - 16551/11. Calculate the common denominator of 9/25 and l. 275 Let l be 1 - 8/(-4) - 3. Suppose 3g + 5i = 64, -2g - 6i + 3i + 41 = l. Let b = 21 - g. What is the least common multiple of 2 and b? 8 Let j = -4373 - -52429/12. What is the common denominator of j and 650/(-72)(-1)/5? 36 Find the common denominator of (-5 + (-1132)/(-8))/30 and 892/3640 + (-4)/(-14). 260 Suppose -41n = 11*n - 24544. What is the lowest common multiple of 16 and n? 944 Find the common denominator of -133/110 an	{ "pile_set_name": "DM Mathematics" }
210 Convert 324 (base 7) to base 11. 140 29 (base 10) to base 11 27 1 (base 5) to base 10 1 0 (base 8) to base 9 0 What is 14 (base 10) in base 12? 12 1112 (base 5) to base 2 10011101 11 (base 5) to base 7 6 Convert -1110 (base 3) to base 16. -27 What is 26 (base 16) in base 10? 38 What is 24 (base 14) in base 6? 52 Convert 5d (base 14) to base 2. 1010011 What is 0 (base 11) in base 9? 0 2 (base 11) to base 2 10 -124 (base 14) to base 10 -228 3 (base 14) to base 16 3 Convert -79 (base 12) to base 9. -113 What is 12 (base 9) in base 14? b -5 (base 14) to base 4 -11 -31 (base 4) to base 16 -d 1000 (base 4) to base 3 2101 Convert 1 (base 9) to base 14. 1 Convert -11 (base 13) to base 5. -24 -105 (base 7) to base 11 -4a What is -4 (base 13) in base 8? -4 6 (base 13) to base 4 12 What is 122 (base 4) in base 9? 28 Convert -5 (base 10) to base 7. -5 Convert 4 (base 5) to base 4. 10 Convert 15 (base 9) to base 10. 14 What is -130 (base 6) in base 12? -46 What is 17 (base 11) in base 15? 13 Convert 260 (base 7) to base 5. 1030 2012 (base 5) to base 13 16a What is 5 (base 8) in base 4? 11 -3 (base 4) to base 12 -3 What is 4 (base 10) in base 12? 4 Convert 23 (base 5) to base 9. 14 Convert 12 (base 11) to base 5. 23 What is -7 (base 10) in base 13? -7 -9 (base 14) to base 10 -9 What is -10100111 (base 2) in base 10? -167 What is -21 (base 3) in base 6? -11 Convert -27 (base 14) to base 6. -55 -1000 (base 3) to base 4 -123 51 (base 8) to base 10 41 Convert 46 (base 14) to base 12. 52 -3 (base 7) to base 9 -3 23 (base 5) to base 10 13 Convert -6 (base 10) to base 15. -6 141 (base 6) to base 8 75 Convert 14 (base 11) to base 15. 10 -25 (base 6) to base 16 -11 Convert -66 (base 9) to base 13. -48 -146 (base 14) to base 12 -196 What is 121 (base 4) in base 15? 1a -3 (base 9) to base 10 -3 What is 176 (base 8) in base 15? 86 0 (base 15) to base 2 0 Convert 4 (base 16) to base 8. 4 Convert 2 (base 9) to base 6. 2 10 (base 3) to base 2 11 Convert -8 (base 13) to base 6. -12 Convert -14 (base 7) to base 5. -21 Convert 40 (base 5) to base 7. 26 4 (base 16) to base 3 11 Convert -27 (base 9) to base 13. -1c Convert -312 (base 5) to base 12. -6a What is 1 (base 9) in base 13? 1 4 (base 7) to base 15 4 101010 (base 2) to base 10 42 Convert -111 (base 2) to base 15. -7 Convert -6 (base 9) to base 14. -6 -2 (base 9) to base 12 -2 What is -1 (base 4) in base 5? -1 Convert 6 (base 7) to base 11. 6 Convert 4 (base 10) to base 16. 4 Convert -1 (base 11) to base 15. -1 Convert -73 (base 11) to base 7. -143 21 (base 12) to base 11 23 What is 35 (base 7) in base 13? 20 Convert -303 (base 5) to base 9. -86 What is 201 (base 7) in base 12? 83 Convert 0 (base 9) to base 14. 0 Convert -ba (base 16) to base 4. -2322 Convert 16 (base 14) to base 9. 22 What is 111011 (base 2) in base 11? 54 2 (base 16) to base 12 2 Convert -10 (base 4) to base 14. -4 Convert -81 (base 15) to base 7. -232 10 (base 2) to base 11 2 Convert 40 (base 16) to base 11. 59 110110 (base 2) to base 5 204 Convert 0 (base 6) to base 4. 0 What is 10 (base 4) in base 15? 4 Convert 0 (base 8) to base 2. 0 -33 (base 6) to base 13 -18 -1120 (base 4) to base 3 -10021 40 (base 10) to base 14 2c Convert 24 (base 5) to base 2. 1110 What is -20220 (base 3) in base 7? -354 0 (base 5) to base 6 0 What is 4 (base 12) in base 6? 4 23 (base 13) to base 11 27 What is -120 (base 15) in base 10? -255 What is 22 (base 11) in base 10? 24 0 (base 2) to base 12 0 -11 (base 3) to base 12 -4 What is 224 (base 5) in base 8? 100 20 (base 16) to base 12 28 Convert b (base 12) to base 8. 13 0 (base 10) to base 3 0 Convert -232 (base 5) to base 8. -103 What is 20 (base 16) in base 5? 112 Convert -2a (base 15) to base 11. -37 Convert 4 (base 5) to base 10. 4 0 (base 10) to base 9 0 Convert 3 (base 6) to base 5. 3 What is 14 (base 14) in base 6? 30 What is 24 (base 6) in base 9? 17 82 (base 12) to base 10 98 68 (base 16) to base 4 1220 What is 8 (base 11) in base 4? 20 -1 (base 8) to base 5 -1 What is 3 (base 14) in base 13? 3 56 (base 16) to base 7 152 -2 (base 15) to base 4 -2 Convert 11 (base 3) to base 11. 4 15 (base 15) to base 3 202 What is -6 (base 14) in base 7? -6 What is -113 (base 5) in base 10? -33 -111 (base 8) to base 14 -53 1 (base 15) to base 12 1 Convert -1122 (base 5) to base 16. -a2 31 (base 4) to base 10 13 Convert 24 (base 11) to base 7. 35 Convert 15 (base 9) to base 11. 13 Convert 12 (base 5) to base 10. 7 What is -20 (base 3) in base 9? -6 Convert 74 (base 9) to base 2. 1000011 Convert 0 (base 16) to base 4. 0 What is 8 (base 16) in base 12? 8 What is 356 (base 7) in base 12? 138 Convert 65 (base 12) to base 14. 57 Convert 3 (base 7) to base 11. 3 What is 8 (base 9) in base 7? 11 -11 (base 4) to base 11 -5 Convert -2 (base 16) to base 11. -2 What is 8 (base 14) in base 9? 8 What is -130 (base 5) in base 2? -101000 Convert 5 (base 15) to base 11. 5 What is 4 (base 13) in base 9? 4 Convert 1 (base 11) to base 3. 1 -a (base 12) to base 10 -10 What is 21 (base 10) in base 4? 111 What is 37 (base 10) in base 13? 2b -1022 (base 3) to base 13 -29 Convert -5 (base 13) to base 14. -5 -45 (base 6) to base 7 -41 What is 0 (base 5) in base 8? 0 What is -245 (base 6) in base 14? -73 Convert -2 (base 6) to base 9. -2 What is -91 (base 11) in base 3? -10201 -14 (base 8) to base 12 -10 71 (base 13) to base 7 161 0 (base 6) to base 13 0 What is -6a (base 13) in base 11? -80 Convert -7 (base 9) to base 14. -7 What is 34 (base 6) in base 10? 22 Convert 2020 (base 3) to base 6. 140 What is 111 (base 2) in base 13? 7 -50 (base 8) to base 14 -2c Convert 16 (base 8) to base 9. 15 What is 54 (base 15) in base 7? 142 -10011 (base 2) to base 6 -31 Convert 7 (base 16) to base 12. 7 What is -35 (base 15) in base 6? -122 Convert -6 (base 10) to base 2. -110 What is -16 (base 11) in base 6? -25 What is -1 (base 3) in base 4? -1 -16 (base 12) to base 14 -14 Convert 5 (base 13) to base 12. 5 1d (base 16) to base 13 23 Convert 21 (base 6) to base 14. d Convert -2 (base 6) to base 2. -10 What is -4 (base 16) in base 15? -4 Convert -a (base 11) to base 14. -a What is 37 (base 11) in base 3? 1111 Convert 100 (base 14) to base 7. 400 Convert -10 (base 3) to base 2. -11 What is 9 (base 11) in base 4? 21 -31 (base 7) to base 6 -34 -c (base 13) to base 9 -13 -1111110 (base 2) to base 16 -7e Convert -8 (base 11) to base 6. -12 -5 (base 6) to base 10 -5 What is 7 (base 10) in base 3? 21 1 (base 5) to base 7 1 -b2 (base 13) to base 3 -12101 What is -1 (base 16) in base 5? -1 91 (base 11) to base 12 84 What is -1 (base 3) in base 4? -1 45 (base 6) to base 16 1d What is -63 (base 11) in base 12? -59 What is 0 (base 13) in base 2? 0 11 (base 9) to base 7 13 What is 4 (base 7) in base 9? 4 What is 2112 (base 4) in base 5? 1100 -47 (base 11) to base 7 -102 Convert -1 (base 3) to base 12. -1 What is -5 (base 11) in base 5? -10 131 (base 8) to base 4 1121 11 (base 5) to base 4 12 Convert -2 (base 9) to base 11. -2 173 (base 10) to base 7 335 Convert -a6 (base 16) to base 13. -ca -1 (base 15) to base 2 -1 37 (base 10) to base 13 2b 2 (base 5) to base 8 2 What is -100101 (base 2) in base 9? -41 What is 64 (base 9) in base 11? 53 Convert 49 (base 11) to base 5. 203 -454 (base 7) to base 6 -1031 What is 2c (base 16) in base 15? 2e What is -10a (base 11) in base 3? -11212 Convert -114 (base 6) to base 10. -46 What is 3 (base 11) in base 14? 3 6 (base 11) to base 2 110 -10 (base 4) to base 2 -100 -1 (base 3) to base 2 -1 Convert 2 (base 16) to base 14. 2 Convert -2 (base 16) to base 9. -2 3 (base 6) to base 2 11 9 (base 12) to base 2 1001 What is 10 (base 2) in base 12? 2 Convert 232 (base 10) to base 8. 350 Convert 18 (base 9) to base 3. 122 What is -12 (base 4) in base 9? -6 a (base 15) to base 3 101 What is 111 (base 2) in base 4? 13 Convert -201 (base 4) to base 6. -53 What is 10 (base 2) in base 14? 2 Convert 2 (base 7) to base 5. 2 What is 11100 (base 2) in base 5? 103 83 (base 11) to base 16 5b What is 245 (base 11) in base 10? 291 What is -1 (base 13) in base 15? -1 What is 6 (base 15) in base 16? 6 Convert 102 (base 6) to base 11. 35 What is 120 (base 4) in base 10? 24 What is -5 (base 12) in base 3? -12 Convert -7 (base 10) to base 11. -7 Convert 2 (base 14)	{ "pile_set_name": "DM Mathematics" }
- 2t wrt m. 53c*3t - 6c3 - ct Find the second derivative of -3741h2q2 - h2 + hq + 2q*2 + 3q + 74 wrt q. -7482h2 + 4 Find the third derivative of -138810a*2l*3 - 6567a*2l*2 + 2a*2 + al*3 + 2a wrt l. -832860a2 + 6a What is the third derivative of -z6 + z5 - 28504z4 + 4z*2 + 3z + 4289? -120z3 + 60z*2 - 684096z Find the second derivative of -2f3i*2z - 7f2i*2 - 44f*2z - 11440fiz - 2i*2 wrt f. -12fi2z - 14i2 - 88z What is the first derivative of -2o4 - 23952o*3 + 59479 wrt o? -8o*3 - 71856o*2 What is the third derivative of 4n*4o*2 + 25386n*3o*2 - 414n*2o*2 - 23n2 + o2 wrt n? 96no*2 + 152316o*2 Differentiate -101j*2v*2 - 21j*2 + j + 452v*4 - 310 with respect to v. -202j*2v + 1808v3 Find the second derivative of 945w*4 - 7w*3 + 2w*2 + 248w + 2115. 11340w2 - 42w + 4 What is the second derivative of -61300u2 + 31295u? -122600 What is the first derivative of 412167x + 1076008? 412167 Find the second derivative of 3f*3i - 750726f2i*2 - 73fi + 2298i*2 wrt f. 18fi - 1501452i*2 Find the third derivative of 8a5 + a4 - 3458a3 + 44a*2 - 2a - 5 wrt a. 480a2 + 24a - 20748 What is the second derivative of 1464132l2 + 67778l wrt l? 2928264 What is the first derivative of -286209m3 + 2322? -858627m2 Find the first derivative of v3w + 128vw2 + 111v - 2274w2 + 3 wrt v. 3v*2w + 128w2 + 111 What is the derivative of 222717z + 138481? 222717 Find the third derivative of -163602h5 + 2h*4j*2 - 7029h*2j*2 - 223j*2 wrt h. -9816120h*2 + 48hj2 Find the first derivative of 31rw3 - 1262rw2 - 69683w*3 - 4 wrt r. 31w*3 - 1262w*2 What is the third derivative of 61883r*3 + 2r*2 - 5994 wrt r? 371298 Find the second derivative of -42109y*2 + 785y. -84218 What is the second derivative of k*4 + 14571k*2 + 9k + 732? 12k2 + 29142 What is the third derivative of -38v*3z*3 + 1333v*3z*2 + 8v*2z - 21525vz*3 wrt v? -228z*3 + 7998z2 What is the first derivative of -q2 + 36851q + 32132 wrt q? -2q + 36851 Differentiate -7b3o - b*3t*2 - 13b*3t - 2b2o + b*2t + 343bot2 - 123 wrt o. -7b*3 - 2b*2 + 343bt2 Find the third derivative of 37233p*4 + 26912p*2 wrt p. 893592p What is the derivative of -7q4 + 189217q*2 + 3131816? -28q*3 + 378434q Find the second derivative of -3672h3 + 12h*2 + 5838h wrt h. -22032h + 24 What is the second derivative of 53g*3r*3 + 11g*3r*2 + 2g*3r - 11802g2r - 4r4 wrt r? 318g*3r + 22g3 - 48r*2 What is the first derivative of -81430b*4 - 591475? -325720b*3 Find the second derivative of -8o*4 - 11547o*3 - 244921o. -96o2 - 69282o What is the third derivative of -11i4w*2 + 240i*4w + 8i4 + 9i*2w2 - i2w - 21iw2 - 2i wrt i? -264iw*2 + 5760iw + 192i What is the derivative of -15198b4 - 36456 wrt b? -60792b*3 Find the third derivative of 74035rw4 - 12rw3 - rw*2 + 283836rw wrt w. 1776840rw - 72r Differentiate -53l3ov - 3l*3o + 34l2o*2 - 272lo2 + 173o*2v wrt v. -53l3o + 173o2 Find the first derivative of 144k*3z*4 + 10k*3z + 17943k3 wrt z. 576k*3z*3 + 10k*3 What is the second derivative of 61594n*2w*2 - 34nw - 2n + 33w2 + 4w wrt n? 123188w2 What is the third derivative of 302c*6 + 254c5 - c3 + 2c2 - 53478 wrt c? 36240c*3 + 15240c*2 - 6 Find the third derivative of 26055u*6 - 27849u*2. 3126600u*3 Differentiate 1108g3 + g2 - 159g - 5070840 with respect to g. 3324g*2 + 2g - 159 What is the first derivative of 67l2 + 208l + 1123946? 134l + 208 What is the second derivative of 160l*2qx2 + 442l*2x*2 - 2lq + lx*2 + 42219q wrt l? 320qx*2 + 884x*2 Find the third derivative of -34208i*6 + 2i*2 + 9i - 414. -4104960i3 What is the third derivative of -31540v*2w*3 - 2v*2w + 16vw*2 - 39v + 4w3 wrt w? -189240v*2 + 24 What is the first derivative of 190595r*3 - 2279239 wrt r? 571785r*2 What is the third derivative of -3069m*3t*2 + 12m*3x - m*2x + 494t2x - 8tx + 2x wrt m? -18414t*2 + 72x What is the third derivative of 4q3w*2 + 5537q*3 - 5704q*2 + 4qw2 wrt q? 24w*2 + 33222 Differentiate -2iu - 674260i - 13153u wrt u. -2i - 13153 What is the second derivative of 64923c3 - 57385c? 389538c What is the first derivative of 35g*3 + 704g*2 + 2g - 1474242 wrt g? 105g2 + 1408g + 2 What is the third derivative of -57864a5 - 2a*4 - 2a*3 + 282541a*2? -3471840a*2 - 48a - 12 What is the third derivative of 3k3r*4 - 41k*3r*3 + 12106k*3r*2 - 2k*3r + 2r3 wrt r? 72k*3r - 246k3 + 12 What is the first derivative of -11554p + 5819? -11554 What is the second derivative of -33068i2 + 9891i + 2? -66136 What is the third derivative of -1656827o5 - 2o*3 + 149o*2 - 3o - 57 wrt o? -99409620o2 - 12 What is the third derivative of -13716i*3r*3 - 302i*3r*2 - 136i*2r*2 + 10r*5 wrt r? -82296i*3 + 600r*2 Differentiate 105433h*2ru - 2h*2 + 12328r wrt u. 105433h2r Find the third derivative of 2bi*3 + 3bi2r*2 - 9bi - 2937i*3r*2 + 5i*3 - 2i*2r*2 - 135ir2 - 2ir wrt i. 12b - 17622r2 + 30 Find the first derivative of -16b*4 + 270b + 28932 wrt b. -64b3 + 270 What is the second derivative of -18v*2z*2 - 2v*2z - 6vz*2 + 10139vz - 2z3 + z2 - 6z wrt z? -36v*2 - 12v - 12z + 2 Find the second derivative of -91125tv2 - 6tv + t + 2v - 90 wrt v. -182250t What is the first derivative of -33k*2p*2 - 4k*2p + 2k2 - 29p*2 - 86p - 1 wrt k? -66kp*2 - 8kp + 4k Find the third derivative of 1703475l5s2 + l3s3 - 19l*2s2 + l2s - 170ls3 + l + 10s*3 wrt l. 102208500l*2s*2 + 6s*3 What is the second derivative of -6k*4 + 4618k*3 - 2k + 45340? -72k2 + 27708k Find the second derivative of 3l4 - 10778l*3 + 2l*2 + 2l + 17999. 36l2 - 64668l + 4 Differentiate 161351o2 - 70774 with respect to o. 322702o Find the second derivative of 9p5t - 765p5 - 2pt + 2p + 49964 wrt p. 180p3t - 15300p3 Find the third derivative of 8o*6 + 804o*5 + 18o*4 + 129o*2 + o + 285. 960o*3 + 48240o*2 + 432o What is the first derivative of -1155615j + 5123285 wrt j? -1155615 What is the second derivative of -1247i*2mx - 2i*2m - 5i2x - 48imx - 55i + 2mx wrt i? -2494mx - 4m - 10x Find the second derivative of -168570bp*3 + 600bp + 15b wrt p. -1011420bp Find the second derivative of 389k2m*2 + 183k*2 + 24km - k + m2 + 302m wrt k. 778m2 + 366 What is the second derivative of 17499f*5 + 3f*2q*2 - 2fq - 119q*2 + 96 wrt f? 349980f*3 + 6q*2 What is the second derivative of -mp*2v + 9908mpv + 4mv - p4 + 9676p*3v - 4p wrt p? -2mv - 12p*2 + 58056pv What is the second derivative of 27p*4t - 4879p4 - 2p*2 - 3443pt + 148t wrt p? 324p2t - 58548p2 - 4 Differentiate -500u*3 - 45u*2 - 2u - 131784 wrt u. -1500u2 - 90u - 2 What is the second derivative of -42379u2x - 66516ux wrt u? -84758x What is the third derivative of 45qw3 - 3qw2 + qw + 2q + 33w*3 - 793w*2 wrt w? 270q + 198 What is the first derivative of -438w3 - 26w - 115795? -1314w2 - 26 What is the third derivative of 642256k*3 + 289910k*2? 3853536 Differentiate -12cj2 + 20cj - 21992c + 8j2 - j with respect to j. -24cj + 20c + 16j - 1 Find the third derivative of -221r*4 + 1627r*3 - 384r*2 - 173r + 11. -5304r + 9762 Find the third derivative of 51d*4p*2 + 998d*3p*3 + 648d*2p*2 - 47dp3 wrt d. 1224dp2 + 5988p3 What is the third derivative of -g3l4 + g3l + 22g2l*2 + 7548gl4 - 2l*3 + 15l*2 wrt l? -24g*3l + 181152gl - 12 What is the third derivative of -163741cf*3 - 35cf2 - 43cf - c + 3 wrt f? -982446c What is the second derivative of 29df*4 + df - 6323d + 1847f*2 + 2f wrt f? 348df**2 + 3694 What is	{ "pile_set_name": "DM Mathematics" }
to 3 decimal places? -0.002 Round -0.00003496 to seven decimal places. -0.000035 What is -0.000092874 rounded to 6 dps? -0.000093 Round 0.000596 to 5 dps. 0.0006 What is 0.00072658 rounded to four dps? 0.0007 What is -179650 rounded to the nearest one hundred thousand? -200000 Round -44.602 to one dp. -44.6 Round -321970 to the nearest ten thousand. -320000 Round 1326 to the nearest 10. 1330 Round -7572000 to the nearest one hundred thousand. -7600000 What is -1237 rounded to the nearest one hundred? -1200 Round -0.056131 to 2 decimal places. -0.06 What is -1.462 rounded to one decimal place? -1.5 Round -0.33531 to 2 decimal places. -0.34 Round -0.099 to one dp. -0.1 What is -1319.61 rounded to the nearest one hundred? -1300 What is 0.0000008141 rounded to seven dps? 0.0000008 What is 0.011314 rounded to 3 dps? 0.011 What is -0.0002133 rounded to five dps? -0.00021 What is 41.49 rounded to the nearest integer? 41 What is -782500 rounded to the nearest 100000? -800000 What is -0.02822 rounded to 3 decimal places? -0.028 Round -128090 to the nearest ten thousand. -130000 What is 24854 rounded to the nearest ten thousand? 20000 Round 4.311 to the nearest integer. 4 Round -3.448 to the nearest integer. -3 What is 0.000033 rounded to 6 dps? 0.000033 Round -0.000055667 to 5 dps. -0.00006 What is -0.036012 rounded to 4 dps? -0.036 What is -0.0267985 rounded to three dps? -0.027 Round -32300000 to the nearest 1000000. -32000000 Round -16500000 to the nearest 1000000. -17000000 What is -0.00046578 rounded to 5 dps? -0.00047 What is 0.00155052 rounded to 5 dps? 0.00155 What is 233430 rounded to the nearest one thousand? 233000 Round 0.000000148 to seven decimal places. 0.0000001 What is -1.211 rounded to one decimal place? -1.2 Round 0.000005994 to six decimal places. 0.000006 What is -22.29 rounded to 0 decimal places? -22 Round 0.00003072 to six decimal places. 0.000031 What is -0.01686 rounded to 3 dps? -0.017 Round 1010 to the nearest one hundred. 1000 Round -161000 to the nearest 10000. -160000 Round 0.0002674 to 3 dps. 0 Round -63767 to the nearest ten thousand. -60000 What is 63700000 rounded to the nearest 1000000? 64000000 What is -0.00371 rounded to two dps? 0 Round -2.4616 to 1 decimal place. -2.5 What is 0.0000362 rounded to 5 dps? 0.00004 What is -0.0313 rounded to 2 dps? -0.03 What is -0.00000951 rounded to 5 decimal places? -0.00001 Round 0.000011364 to seven dps. 0.0000114 What is -3560 rounded to the nearest 100? -3600 What is 233.02 rounded to 0 dps? 233 Round 23340000 to the nearest one million. 23000000 Round 4.642 to the nearest integer. 5 What is 0.5925 rounded to 2 decimal places? 0.59 Round -0.000855 to 4 decimal places. -0.0009 What is 1065140 rounded to the nearest 100000? 1100000 Round 15698 to the nearest 1000. 16000 Round -32695200 to the nearest one million. -33000000 Round -336000 to the nearest ten thousand. -340000 Round 86841000 to the nearest 100000. 86800000 What is -1361100 rounded to the nearest one hundred thousand? -1400000 Round -0.1781 to three decimal places. -0.178 Round 10028 to the nearest one hundred. 10000 What is -398700 rounded to the nearest 100000? -400000 What is -0.3235 rounded to 2 decimal places? -0.32 What is 91943000 rounded to the nearest 1000000? 92000000 What is 0.000041219 rounded to six dps? 0.000041 Round 1279 to the nearest 10. 1280 Round -206.7 to the nearest 10. -210 What is -0.0001283 rounded to five dps? -0.00013 Round -0.105273 to two decimal places. -0.11 Round -0.0000119568 to six dps. -0.000012 What is -0.00008445 rounded to 6 decimal places? -0.000084 Round 0.00059371 to five decimal places. 0.00059 What is -8005 rounded to the nearest 100? -8000 Round -0.003238 to 4 dps. -0.0032 Round 0.00000398147 to six decimal places. 0.000004 Round 1197.65 to the nearest 100. 1200 What is -22093 rounded to the nearest 100? -22100 Round -0.0008695 to 4 decimal places. -0.0009 Round 141.7 to the nearest ten. 140 What is -58.37 rounded to the nearest 10? -60 What is 2575000 rounded to the nearest 100000? 2600000 What is 0.3145 rounded to 2 decimal places? 0.31 Round 0.0001125 to six dps. 0.000113 What is 0.08605 rounded to 1 dp? 0.1 Round 10887 to the nearest 1000. 11000 Round -0.000019108 to six decimal places. -0.000019 Round 639700 to the nearest 100000. 600000 Round -727400 to the nearest one hundred thousand. -700000 What is 7530000 rounded to the nearest one hundred thousand? 7500000 Round 137 to the nearest 100. 100 What is 5101100 rounded to the nearest one hundred thousand? 5100000 Round -0.23324 to 1 dp. -0.2 Round 0.0000009426 to 6 decimal places. 0.000001 What is 20692.6 rounded to the nearest one hundred? 20700 Round -0.28158 to one decimal place. -0.3 What is -56455 rounded to the nearest ten thousand? -60000 Round 18706.9 to the nearest 1000. 19000 What is 131210 rounded to the nearest 10000? 130000 Round 0.0000147413 to six decimal places. 0.000015 Round 13851 to the nearest one thousand. 14000 What is 0.0001623 rounded to 3 dps? 0 What is -0.10984 rounded to two decimal places? -0.11 What is -77.29 rounded to the nearest integer? -77 What is -5.4193 rounded to 1 dp? -5.4 What is -0.015083 rounded to 3 dps? -0.015 Round -0.00041129 to 5 dps. -0.00041 What is 550.4 rounded to the nearest ten? 550 What is 95508 rounded to the nearest ten thousand? 100000 Round -0.00008516 to 6 decimal places. -0.000085 Round -0.19559 to 3 dps. -0.196 What is 0.00000020525 rounded to 7 decimal places? 0.0000002 Round 0.0066818 to four dps. 0.0067 Round 1631100 to the nearest 100000. 1600000 Round 3229 to the nearest 1000. 3000 What is -0.00006868 rounded to 5 decimal places? -0.00007 What is -1220 rounded to the nearest one hundred? -1200 What is -15130000 rounded to the nearest 1000000? -15000000 What is 0.00282167 rounded to five dps? 0.00282 What is -49.25 rounded to the nearest 10? -50 What is 20.41 rounded to 0 decimal places? 20 What is 0.0024163 rounded to 3 dps? 0.002 Round 0.00034 to 5 dps. 0.00034 What is 0.50192 rounded to three dps? 0.502 Round 0.030507 to 2 dps. 0.03 Round 0.00035812 to 5 decimal places. 0.00036 What is 0.20654 rounded to two dps? 0.21 What is -3499.6 rounded to the nearest 10? -3500 What is 0.0000731 rounded to 5 decimal places? 0.00007 What is 0.000684989 rounded to four dps? 0.0007 What is -0.0000215 rounded to 6 dps? -0.000022 What is -270590 rounded to the nearest 1000? -271000 Round 0.168 to the nearest integer. 0 Round -0.0000052029 to six decimal places. -0.000005 What is 11705000 rounded to the nearest one million? 12000000 Round -0.00004901 to six decimal places. -0.000049 What is 19790900 rounded to the nearest one hundred thousand? 19800000 Round 61840 to the nearest 1000. 62000 What is 26200 rounded to the nearest one hundred thousand? 0 What is -0.00003396 rounded to six dps? -0.000034 What is 991000 rounded to the nearest 100000? 1000000 Round -10.02 to one decimal place. -10 What is 126528 rounded to the nearest ten thousand? 130000 Round -0.000001145 to six decimal places. -0.000001 Round -43.7 to the nearest one hundred. 0 Round 0.0000471 to 5 decimal places. 0.00005 Round -0.000017275 to six decimal places. -0.000017 Round -1268000 to the nearest 10000. -1270000 Round -2438600 to the nearest 100000. -2400000 Round 112791 to the nearest one hundred. 112800 What is -45218000 rounded to the nearest 100000? -45200000 What is 72240000 rounded to the nearest one million? 72000000 Round 35643000 to the nearest one million. 36000000 What is -0.000000156 rounded to 6 decimal places? 0 What is 279.25 rounded to the nearest one hundred? 300 Round -161910000 to the nearest one million. -162000000 What is 12.93 rounded to the nearest integer? 13 What is 13.079 rounded to the nearest integer? 13 What is 214.5 rounded to the nearest 10? 210 What is 6592 rounded to the nearest one thousand? 7000 What is 12370 rounded to the nearest 1000? 12000 What is 3734700 rounded to the nearest 10000? 3730000 Round -1.9311 to zero decimal places. -2 Round -88490 to the nearest 10000. -90000 What is -20570 rounded to the nearest ten thousand? -20000 Round 50266900 to the nearest one hundred thousand. 50300000 What is -8.165 rounded to zero dps? -8 What is -24.357 rounded to t	{ "pile_set_name": "DM Mathematics" }
. Is -32/14 - j/21 composite? False Let m be (-5 - -9) + (1 - -1). Suppose -2j - 8 = -mj. Suppose -5g + 1585 = jf + 3f, -4f = 3g - 1270. Is f a prime number? False Let o = 168 - 88. Suppose 2d = 1010 + o. Is d a prime number? False Let q(j) = 88j + 13841. Is q(0) a prime number? True Is 40551/1410/62 a composite number? True Suppose -4d = -l - 3l - 4, 4d = 4. Let c(x) = -x3 + 3. Let q be c(l). Suppose -4b = -5z + 831, 205 = qz - 2b - 292. Is z prime? True Suppose 0 = 11j - 4487 - 7866. Is j a composite number? False Let w(i) = -2i - 2. Let f be w(-3). Let q(d) = 27d*3 - 3d*2 + 7d - 7. Let c be q(4). Suppose fk - 3l - c = -627, 2k - 3l = 540. Is k prime? False Let z(c) = 3 - 9c - 4 + 60c2 - 16. Is z(-4) a prime number? False Let c(r) = r3 + 6r2 - 10r - 5. Let z be c(-6). Suppose w + 12 = -o + 4w, 0 = -3o + 4w - 11. Suppose 2t + k = ok + 28, -4t + z = -5k. Is t prime? False Let t(q) = 313q*2 + 13q - 21. Is t(4) a prime number? True Let w be (-1 - 8/(-4)-1)/(-1). Is (-6)/(-4) - w/(18/(-3237)) a prime number? True Let t(v) = -v3 - 2v*2 - 53v - 57. Is t(-23) a composite number? True Let d be -50((-2)/3 + (-16)/30). Suppose 572 = 2c - 5x - d, 3c + 3x - 990 = 0. Is c a composite number? True Let x = -689 + 1440. Is x a composite number? False Suppose t = 4t. Let q(m) = -m3 - m2 + 67. Is q(t) a prime number? True Suppose 7840 = 14a - 4242. Is a prime? True Let a be 3 + (1 + 0)/(-1). Suppose 523 = 4h + o, -4h + 265 = -ah - 3o. Is h composite? False Suppose 0 = -5m + 1 + 54. Suppose 9f - mf = -502. Is f a prime number? True Suppose -2v + 2197 = n + v, -5v + 6599 = 3n. Is n a prime number? True Let w be -1538(5 - (-1 - -5)). Is (-75)/(-15) - (w + 0) composite? False Let b be (-128)/(-40)(1 - -4). Let w be (-53)/(-11) + b/88. Suppose wx - 1015 = 750. Is x a composite number? False Suppose 0 = y - 932 - 302. Let u = y + 43. Is u a prime number? True Let y = 54 + -291. Let p = y - -540. Is p a prime number? False Let m = 284 - 643. Let n = -673 - m. Is (n/(-3))/(4/6) composite? False Let d(g) = 898g2 + 1. Is d(-4) composite? False Suppose 4s - 1452 - 768 = 0. Suppose 2d + s = 7d. Is d composite? True Let p(k) = -2k2 - 2k + 2. Let q be p(-3). Let x = q - -10. Is x + 2/(8/4348) a prime number? True Suppose 0 = -3i + 4i + 18. Let o be 2 + (i/(-2))/(-3). Is (-1)/(o + (-26)/(-28)) a prime number? False Let g(l) = 9l3 + 4l + 4. Let k be 3/(-60)-4 - (-14)/5. Is g(k) composite? True Let k = 15769 - 4271. Is k prime? False Suppose 2u - 1 = 5p + 3u, 5u + 5 = -5p. Let n(r) = 5r + 2407. Is n(p) composite? True Let p = -2266 + 9553. Suppose 0o = 7o - p. Is o a composite number? True Let m be (-1 + (-4)/(-8))-10. Suppose -u = 5j + 4u - 5, 2j = -5u + m. Suppose -2k + 3k - 85 = j. Is k composite? True Suppose -3f + 1164 = 2t, 0 = -f + t - 0t + 388. Suppose 154 = 2b - f. Is b a prime number? True Let x be 286448/(-80) + (-4)/10. Let d = x + 6586. Is d a composite number? True Let b = 6 + -2. Suppose -5y = 2j - 0j - 112, -y = bj - 206. Is j a prime number? False Let c(p) = -101p - 30. Let h(u) = 11u + 4. Let f be h(-1). Is c(f) composite? False Is ((-2892936)/(-60)5)/2 composite? False Suppose -10 = -0w - 5w. Suppose 3 - 9 = -3m. Is 211 - (w/m - 1) composite? False Suppose -648 = -a - v, -3 + 7 = -4v. Suppose 10s - 61 - a = 0. Is s composite? False Is 32434/((-60)/(-6) - 8) a composite number? False Suppose -21b = -18b - 9. Let d be (0 - -70) + 2/(-2). Suppose 4t - b + 13 = 2n, -t + d = 5n. Is n a composite number? False Suppose -3p = -3u - 3, 2u = -0u. Let m(g) = g3 - p - 42g*2 - 9g + 48g2 + 2g*3. Is m(5) a prime number? True Suppose 2l + 2n - 542 = 0, -3l + 1080 = l + 5n. Suppose 0 = -p + 3q + 431, 3p - 2q + l = 1540. Is p prime? True Let p = 4 - 8. Let t(r) = 7r2 + 9r + 6. Let i be t(p). Is i/2 + 8/(-2) a composite number? False Let m(y) = 16y2. Let w be m(1). Suppose 15 = 3q + 3k, q + 3q - w = -2k. Suppose -qu + 6u = -2o + 325, 0 = 2u - 3o - 221. Is u composite? False Suppose 3m + 4411 = 4m. Is m composite? True Is (-3)/((-18)/9614) - (-148)/222 a prime number? False Suppose 5664 = 5a - 181. Is a composite? True Let l = -97 - -5876. Is l a prime number? True Suppose 8f - 32848 = -8f. Is f a prime number? True Suppose 3r - 5v + 1054 = 2r, 0 = 4r - 4v + 4264. Let y = -620 - r. Is y composite? False Let q = -75 + 54. Let i(u) = 2u2 + 26u - 29. Is i(q) a composite number? False Let i(m) = -7m - 1. Let j be i(-1). Is (-426)/4(-28)/j a prime number? False Suppose -10 = -4r - 2f, -5r + 6 = f - 2. Suppose 4b + r + 3 = 0. Is ((-33)/2)/(b/2) prime? False Let l be ((-4)/(-3))/((-6)/(-27)). Let g be (-588)/(-20) - l/15. Let a = 29 + g. Is a a composite number? True Let c = 6897 + 22469. Is c a composite number? True Let h(r) = -2r - 15. Let w be h(-10). Suppose 636 = wn - n. Is n composite? True Suppose -10909 = -3v + 4i, i - 1 = 4. Is v prime? True Is (-2)/15 + (-17202)/(-90) composite? False Let c(g) be the third derivative of -g4/8 - g3/3 - 4g2. Let q be c(-15). Is q + 2 - (-7 + 5) a prime number? True Let l = 1 - 1. Suppose 0 = c + 5v + 17, lc - v - 13 = -3c. Suppose 200 + c = o. Is o a prime number? False Suppose b + 2s - 4s - 9 = 0, 0 = 3b + 4s - 7. Suppose -bf + 117 = -2f. Is -3 + 2 + f - 1 prime? True Let g be (-3)/(-1) + (4 - -18). Suppose 0d = 5d - g. Suppose -di + 1257 = -2i. Is i prime? True Let d(u) = 84u2 + u. Suppose -5 = -3c + 2f, 25 = -3c + 4c + 4f. Suppose s = -4 + c. Is d(s) composite? True Suppose -4b = 13 - 121. Let d = b - -15. Let j = 73 - d. Is j prime? True Let z(a) = -a3 - 4a*2 + 6a - 5. Let c be z(-5). Let x = c - -13. Is -3 - (1 - 44) - x prime? True Let b(j) = -j*3 + 6j*2 + 8j + 5. Let a be b(7). Suppose a = -4k - 5z, 0 = -7z + 3z - 16. Is (-4 - -3) + 190k a composite number? False Let b = -2828 - -4251. Is b a composite number? False Suppose 17g - 21g + 16 = 0. Suppose go = -2a + 418, o = 4a + 4o - 841. Is a composite? False Let f = -65 - -175. Let i(q) = fq + 118q - 5 - 53q + 1. Is i(3) prime? True Is ((-12)/(-24))/(2/(-16)) - -2207 a composite number? False Let f(z) = -22z + 153. Is f(-7) composite? False Let k = 11974 - -17469. Is k composite? False Let h be -2 + 2 + (-3)/3. Let t be 10 + h + -2 - -3. Suppose 2f - 384 = -t. Is f prime? False Suppose -972 = -11g + 6860. Suppose 3r = -n + g, -2n + 0r + 1445 = -r. Is n composite? True Suppose 0 = 5u - 9 - 56. Suppose u = -0m - m. Is (-1)/((-2)/m)-6 composite? True Suppose -2w - 4n = 0, w - 4n = n. Suppose w = -2f + 3566 + 540. Is f composite? False Let i be 8/(-60)-56. Suppose 2z = 5g - 6389, -8z = -3g - iz + 3839. Is g prime? True Let m(q) = 508q2 - 24q - 53. Is m(-7) prime? False Let d(t) = 136t2 - 17t - 56. Is d(-9) a composite number? False Let f(s) = -95s3 + 6s*2 + 7s + 2. Let b be f(-3). Let c be b/8 - (2 + 1). Let g = -159 + c. Is g a prime number? True Let m(n) = -2n2 + 2n - 6. Let i be m(12). Let k = 721 + i. Is k a composite number? True Let m(j) = 63j2 - j - 11. Is m(-7) prime? True Let l(o) = 29o*2 + 4o - 132. Is l(-13) composite? True Let z = 9 - 3. Let r be (1 + 6)z/21. Suppose -3a + 42 = ra - 4s, -s - 28 = -3a. Is a a composite number? True Suppose 0n = 3n - 54. Let p = n + -14. Is 23/p(34 - 14) composite? True Suppose -2v + 5h = -4562, 2832 = v - 3h + 553. Is v a composite number? True Suppose -5j - 29581 - 25509 = -5k, 3k = -4j + 33047. Is k composite? True Let j = -4767 - -10178. Is j composite? True Let i(m) = -m2 + 17m + 4. Let n be i(16). Let k be 4985/n + 12/16. Suppose 0 = -2w + 2c + 244, 4c + k - 8 = 2w. Is w composite? True Suppose 23w - 713106 + 236017 = 0. Is w a composite number? False Let n be (-1)/6 - 102/36. Let z = 6 + n. Is z composite? False Let x(v) = -5v + 2v + 2v + v*3 + 34 + 3v*2. Is x(7) prime? False Let p(z) = 830z + 55. Is p(26) a prime number? False Suppose 8 = -4o + 6o. Suppose -oy = y - 5215. Is y a prime number? False Let w = 16 + -12. Let y = w + 27. Is y a prime number? True Suppose -9c = -11c. Suppose c = 2y, -3x = 2y - 6*y - 1	{ "pile_set_name": "DM Mathematics" }
mmon divisor of y and m? 20 Let a(b) = 670b + 2. Let m be a(1). Suppose -12c + m = -4c. What is the greatest common divisor of 21 and c? 21 Suppose -71400 = 27s - 78s. Calculate the greatest common factor of s and 56. 56 Let h(w) = w3 - 15w*2 - 33w - 7. Let f be h(17). Let j = -6 - -26. What is the greatest common factor of j and f? 10 Let y(o) = 3o - 6. Let j be y(7). Suppose -148 = -6d - 88. Calculate the greatest common divisor of j and d. 5 Let a(z) = -z - 17. Let j be a(-20). What is the highest common divisor of 28 and j? 1 Let b be 4/(8/(-42))(3 + -6). Suppose 0 = -s + 16 + 5. What is the greatest common factor of b and s? 21 Let i = 2 + -1. Let t be 13 - i/1 - 1. Let j = -25137 - -25258. Calculate the highest common divisor of t and j. 11 Let l be -5((-45)/1)/5. Suppose -3t - 2t = -l. Let w(j) = -j*3 + 8j*2 - 6j. Let b be w(6). What is the greatest common divisor of b and t? 9 Let p be (1611)/(3/6). Suppose -99 - 195 = -3n. Let c = n + -66. Calculate the highest common factor of p and c. 32 Suppose -t - 222 = 3j, -3j + 5j = -5t - 1045. Let i be (-2)/(-4) - t/2. What is the highest common factor of i and 8? 8 Let j(v) = 24v2 + v + 1. Suppose -5k - 16 = -5o + 24, 3o + 12 = -k. Let l = 8 + k. Let c be j(l). What is the highest common divisor of 48 and c? 24 Let y be 506/(-110) + (-3)/(-5) - 0. Let p = 2 + -4. Let z be 22 + y(-3 - p). What is the greatest common factor of 182 and z? 26 Let z(x) = -17x*3 - 3x*2 - 4x. Suppose 5s = 3s + 2q, -q = -3s - 4. Let n be z(s). Calculate the highest common factor of n and 12. 12 Let d be -1 + 9/5 - (-22)/10. Suppose 5y = -4k + 71, 2k + 4y = -k + 52. What is the greatest common divisor of k and d? 3 Let p(l) = 3l2 + l + 3. Let h be p(-3). What is the greatest common divisor of h and 153? 9 Let t(y) = y2 + 6y - 12. Let p be t(12). Let g(i) = 5i - 3. Let d be g(3). Calculate the greatest common factor of d and p. 12 Let x = 104 - 77. Suppose l + 4b = 4 - 7, l - 4 = 3b. Suppose -4n + 37 = l. What is the greatest common divisor of x and n? 9 Suppose 8c = 3c - 20, -2a = -3c - 68. Let z be -3 + ((-144)/(-1) - 1). What is the highest common divisor of z and a? 28 Let u(c) = 3c3 - 23c*2 - 37c + 20. Let j be u(9). What is the highest common factor of 22 and j? 11 Suppose 3i = -4m + 524, 14i - 3m + 888 = 19i. What is the highest common divisor of i and 144? 36 Let a(d) = 5d - 11. Let h be a(-5). Let l = 39 + h. Suppose q + 6 = 3v, 0 = q + 2q - 2v - 17. Calculate the highest common divisor of l and q. 3 Let c be (-826)/(-35)-1-60. What is the highest common divisor of 24 and c? 24 Suppose 48 = -27o + 31o. Calculate the greatest common factor of 126 and o. 6 Let i = -30 - -42. Let m(y) = 2y*2 - 8y - 2. Let f be m(i). Suppose 19t - f = 17t. Calculate the highest common divisor of 19 and t. 19 Suppose 14h = 19h - 4g - 207, 4h - 159 = g. What is the greatest common factor of h and 1131? 39 Suppose 0 = 127i - 136i + 1449. Calculate the greatest common divisor of 437 and i. 23 Let f(y) = y3 + y2 - 5y - 3. Let v be f(-2). Suppose 213 = -vj + 6j. Suppose -8r - j + 775 = 0. What is the highest common divisor of 11 and r? 11 Suppose l - 1 = -5c, c + 0c + 19 = -5l. Let i be 37/4 + c/(-4). Let v = -37 - -73. What is the greatest common factor of i and v? 9 Suppose -4d + 5r + 5 = d, 5 = -3d - 5r. Let g(c) = c + 159. Let j be g(d). Suppose -4o + 93 + j = 0. Calculate the highest common divisor of o and 21. 21 Suppose -3x - 5q + 235 = 0, 4q = -3x + 77 + 159. Calculate the highest common divisor of x and 40. 40 Let j(z) = z*2 + 11z + 15. Let r(c) = -c*2 + 7c + 8. Let b be r(9). Let v be j(b). What is the greatest common factor of 20 and v? 5 Let u = 1532 - 1457. Calculate the greatest common divisor of u and 6. 3 Let f = 67 + -31. Suppose 6y = 3y + 90. Let t = y + -26. What is the highest common divisor of f and t? 4 Let c = -187 - -330. What is the highest common factor of c and 13? 13 Let x = 17 + -12. Suppose xi + 2 + 3 = 5t, t - 7 = -i. What is the highest common factor of i and 3? 3 Suppose 0 = 2p + 3f + 3 - 32, -5p + 3f + 62 = 0. Let r = 0 - 4. Let m be (-1)/((-2)/(-52))r. What is the greatest common divisor of p and m? 13 Suppose -16g = -25g + 90. Calculate the highest common factor of 810 and g. 10 Suppose -506 - 2510 = -8u. What is the highest common divisor of u and 13? 13 Let w be (-3 + (-21)/(-6))4. Suppose 0a = wk + 2a + 6, 2k - 2a = 14. Let l be 0/(0 + k) - -8. What is the highest common divisor of l and 8? 8 Let m = 395 - 187. What is the greatest common divisor of m and 48? 16 Suppose -26 = -6x + 5x. What is the greatest common divisor of x and 13? 13 Let o be 4/(-26) - (-164)/52. Let u be (-4 - (0 + 6)) + -4. Let a(b) = -2b - 4. Let d be a(u). What is the highest common factor of o and d? 3 Suppose -3r = 4y - 2r - 228, 2r = 3y - 160. Let s = 126 - y. Calculate the greatest common factor of s and 14. 14 Suppose -v = -4r - 34, 3r + 2v + 6 + 14 = 0. Let s = -6 - r. What is the greatest common factor of 2 and s? 2 Let j(r) = -r3 - 16r*2 - 29r + 1. Let l be j(-14). Calculate the greatest common factor of 195 and l. 15 Let w(l) = -77l + 6. Let y be w(-1). Suppose -4t + 2t - 106 = 0. Let n = y + t. Calculate the highest common factor of 12 and n. 6 Let f = -58 - -52. Let k be (-814)/f - 4/6. Calculate the highest common divisor of k and 54. 27 Let p(b) = b + 1. Let g be p(4). Suppose -2d + 35 = -gf, 41 = -2d + 4d + f. What is the highest common factor of 220 and d? 20 Suppose -35h = -42h + 28. Suppose -4d + h = -l, 7l + 2d - 38 = 3l. What is the highest common factor of l and 8? 8 Let t be (-2)/15 - 5528/(-60). Suppose -t = -2n - 2n + 5r, -3r - 16 = -n. What is the highest common divisor of 112 and n? 28 Suppose 44x - 5x - 2145 = 0. What is the greatest common factor of 55 and x? 55 Let z(d) = 2d - 9 + 15d2 - 14d2 + d + d. Let c = -10 + 3. Let y be z(c). What is the highest common divisor of 48 and y? 12 Let v(j) = -j3 + 29j2 - 27j + 48. Let h be v(28). Calculate the greatest common divisor of h and 4. 4 Let w be 101(-3)/(-12)4. Let r = -43 + w. Let a = r + 67. What is the highest common factor of 50 and a? 25 Suppose -5m = 5k - 135, m - 2k = 15 + 27. What is the greatest common factor of m and 56? 8 Suppose m - 4p = 1105, 7m - 4476 = 3m + 2p. Calculate the highest common divisor of m and 118. 59 Suppose -3i + 4i - 543 = -5m, 5i - 447 = -4m. Let r = -1453 + 1465. What is the greatest common factor of r and m? 12 Let i = -23 - -31. Let d be 7 - 7 - i/2. Let h be (-2 - -4)(-18)/d. What is the greatest common divisor of 45 and h? 9 Suppose -9u + 119 = -1411. Calculate the highest common factor of 30 and u. 10 Let q(z) = -z + 13. Let v be q(7). Suppose 5f + 764 = -556. Let l be (-2 - 1/4)f/9. Calculate the highest common factor of l and v. 6 Let y(d) = -d*3 + 19 - 7 - 2d + 3d. Let v be y(0). Suppose -47a - 768 = -55a. What is the greatest common divisor of a and v? 12 Suppose 0 = 19c - 2645 - 1630. What is the highest common factor of 315 and c? 45 Let r(s) = -s*2 - 4s + 1. Let w be r(-3). Let z(c) = 8c - 1. Let t be z(w). Calculate the highest common factor of 217 and t. 31 Let d = 2869 + -1311. What is the highest common factor of d and 38? 38 Let h be 21 - ((-16)/(-4) + -6). Suppose -4x + 0x + 644 = 0. Calculate the highest common divisor of x and h. 23 Let k = -5 - -43. Let u = k - -74. Let n(x) = x2 - 3x + 4. Let o be n(5). Calculate the highest common factor of u and o. 14 Suppose -5a + 20a - 45 = 0. Calculate the highest common divisor of a and 6. 3 Let x(n) = 2n + 22. Let a be x(-6). Suppose -a = -j + 3. Calculate the highest common divisor of j and 117. 13 Suppose -735 = 3r - 8r. Suppose -j + 53 = 5c - 130, j - r = -4c. Calculate the highest common factor of c and 12. 12 Let z(f) = f2 + 7f - 23. Let i be z(-10). Let x = -7 - -5. Let a(o) = -o*2 - 2o + 1. Let b be a(x). Calculate the greatest common factor of i and b. 1 Let p = -879 + 893. What is the highest common factor of 1022 and p? 14 Let d = -135 + 232. Suppose 264 = 101c - dc. What is the highest common divisor of c and 165? 33 Le	{ "pile_set_name": "DM Mathematics" }
-5 + (sqrt(3) - -2sqrt(3))1 + -1 - (sqrt(45)/sqrt(12))/sqrt(5)-3. -6 + 9sqrt(3)/2 Simplify -2(-1sqrt(162) + 1 + (sqrt(162) - 4(4 + sqrt(162) - sqrt(162))) + -5 + 3)2. -578 Simplify (3(sqrt(1872) + 1))*22-3 - (-3 + sqrt(1872)-1 + 2-2sqrt(1872))-5. -101157 - 1596sqrt(13) Simplify (-6(sqrt(77) - (sqrt(77) + 3sqrt(77))) + -1sqrt(77)5)/(sqrt(70)/(-2sqrt(10)) - sqrt(112)/sqrt(4)). -26sqrt(11)/5 Simplify (2sqrt(176)4 + 0 - (-2((sqrt(176) - -1sqrt(176)) + sqrt(176) - sqrt(176)) + sqrt(176) + 5))*22. -880sqrt(11) + 42642 Simplify (-2 + sqrt(1088)25 - ((2sqrt(1088)5)2 + sqrt(1088) + ((sqrt(1088) - ((2sqrt(1088) - sqrt(1088)) + sqrt(1088)))1)2)) + -1. -109891 + 72sqrt(17) Simplify (0 + ((4 + sqrt(17))-5 - (2 + sqrt(136)/sqrt(8)))-1)*2 + -5. 264sqrt(17) + 1091 Simplify 4 + -2 + ((sqrt(6) - (sqrt(6) - (sqrt(240)/sqrt(4))/sqrt(10)) - sqrt(6))/(sqrt(9)/sqrt(3)1))2 + 4. 6 Simplify -2 + (3(sqrt(153)15 + sqrt(153)))/(44sqrt(9)4) + 3. 1 + 9sqrt(17)/32 Simplify (5 + (sqrt(3)-1 + 1)3 + (sqrt(243) - (4 + sqrt(243) + -1)) + -4)2. -6sqrt(3) + 2 Simplify ((sqrt(24)/(sqrt(8)-1))2 + (sqrt(3) - (sqrt(6)/sqrt(2) - sqrt(3))4) - (2 + (sqrt(3) + 1 + -3 - (-2 + sqrt(3) + -1 + sqrt(3))*2)))3. -36sqrt(3) + 72 Simplify (((2sqrt(108) + sqrt(108))/sqrt(6))/(12sqrt(6)) + 44(sqrt(243) + sqrt(243) + 6(sqrt(243) + 0 + sqrt(243))))2. 48843675/4 Simplify ((sqrt(8) + 1sqrt(128) + (-2sqrt(128) - sqrt(128)))/((sqrt(1944)1 + sqrt(1944) + sqrt(1944))/(2sqrt(24)))5)*2. 39200/729 Simplify (4(sqrt(117)-2 + -2) + sqrt(130)/sqrt(90) + sqrt(208) + -5)2. 1534sqrt(13)/3 + 46774/9 Simplify -1 + (-5(sqrt(612)-2)*2-6 - (2sqrt(102)-6 + sqrt(102))/(sqrt(6) + -4sqrt(12)/sqrt(2))). -11sqrt(17)/3 + 73439 Simplify ((sqrt(60)/(sqrt(10) + -2sqrt(10)) - sqrt(36)/(-1sqrt(6)))/((sqrt(108) + -2sqrt(108))-1)4)2. 0 Simplify (-5(1 + 4((43sqrt(832) - sqrt(832)) + (1 + sqrt(832) + -3 - sqrt(832)))))2. -123200sqrt(13) + 40270025 Simplify ((-4 + -631sqrt(1216) + (2 + sqrt(1216) + -3 - ((sqrt(1216) - (2 + sqrt(1216) + 2)) + sqrt(1216))))1)*2. 288sqrt(19) + 393985 Simplify (-3 + (sqrt(931) - sqrt(931)3) + 1sqrt(931)4 - ((-3sqrt(931) - sqrt(931))5 - (sqrt(931) + sqrt(931) + -3 + -4)))2. -3360sqrt(19) + 536356 Simplify 5(((sqrt(1200) - ((sqrt(1200) - (sqrt(1200) + 0)) + 5)) + sqrt(1200))-5 - (-2 + -1 + sqrt(1200) + -2))*2. -66000sqrt(3) + 730500 Simplify 6(5 + ((sqrt(114) - sqrt(114)-2)-6 + sqrt(114))/(sqrt(432)/sqrt(8)) + ((sqrt(133)-2 - sqrt(133))-4)/(-6sqrt(7)-1)). -22sqrt(19) + 30 Simplify (2sqrt(3024) + sqrt(21)13)/((-6sqrt(3)2 - sqrt(15)/(sqrt(10)/sqrt(2)))-3). 9sqrt(7)/13 Simplify (-5(1 + sqrt(612) + 5))*2 + -2(0 + 1sqrt(612)) + -4. 1788sqrt(17) + 16196 Simplify 2 + ((-6((sqrt(65) - (sqrt(65) + -4sqrt(65)-1)) + -2(sqrt(65) + -1sqrt(65))))/(2(sqrt(5) - 3sqrt(5)) + sqrt(20)/(sqrt(4)2)))*2. 30050/49 Simplify ((2(-2sqrt(304) - sqrt(304)) + -5)1 + (-1 + sqrt(304))3 + 2 + sqrt(304)-1 + -3)6. -96sqrt(19) - 54 Simplify -4(sqrt(90)/(-1(sqrt(6) - -2sqrt(6))))/(sqrt(9)/((sqrt(27)/sqrt(3))/sqrt(3)))-2. -8sqrt(5)/3 Simplify (1 + 1((2sqrt(18)6)/sqrt(6) - (sqrt(3) + 1 + sqrt(363) + sqrt(9)/sqrt(3) + 1))6)2. 132sqrt(3) + 229 Simplify 3-3-4((2 + sqrt(245)2)*2 + (sqrt(245)2 + sqrt(245))*2 + -2) + 5. 2016sqrt(5) + 114737 Simplify (3((6(sqrt(931) + 1) + -3 + sqrt(931)-2)-3 - (-1 + ((sqrt(931) - sqrt(931)-1)2 + sqrt(931) - (2 + sqrt(931) + sqrt(931) + -2sqrt(931))))))2. 12852sqrt(19) + 2421855 Simplify 6-1(sqrt(432) + 1 + 2)*2 - (1 + (sqrt(1089)2 - sqrt(1089) - sqrt(1089))/(-3sqrt(3)1)). -2647 - 432sqrt(3) Simplify (46(sqrt(95) - -13sqrt(95)))/(-4(sqrt(180) - ((sqrt(180) - (sqrt(180) - sqrt(180)1)-3) + sqrt(180)))). 4sqrt(19) Simplify (sqrt(154)/(sqrt(7)-3) + -2sqrt(22)4)/(5((sqrt(704) - sqrt(11)) + 2sqrt(11)5)). -5sqrt(2)/51 Simplify 2(-2(1 + (5 + 2sqrt(700) - (-4 + (sqrt(700) + 0 - sqrt(700)))))-4)*2. 51200sqrt(7) + 371200 Simplify -1(-6(5 + sqrt(28) + 2) + 0 + sqrt(2268) + sqrt(280)/(sqrt(40) - sqrt(10))). -8sqrt(7) + 42 Simplify (sqrt(78)/(sqrt(2)-1))/(sqrt(3) - sqrt(12)/sqrt(4)-2) + -3((-2 + sqrt(468)-2)2 - sqrt(468)). -5628 - 379sqrt(13)/3 Simplify ((15(sqrt(1872) + -4 + 1 + 1)4)2 + 1)3. -57600sqrt(13) + 2251203 Simplify (1(2sqrt(1872) + -4)2)*2 - 4(-3(sqrt(143) + sqrt(143)1))/(sqrt(88)/(2sqrt(8))). -720sqrt(13) + 30016 Simplify -1((((0 + sqrt(891) + 5)1)2 - (sqrt(891) + ((sqrt(891) + 1 + sqrt(891) - sqrt(891)) + -2)2 + -3))-2 + -4). 58 + 198sqrt(11) Simplify (sqrt(95)2-2)/(sqrt(20)1) - (5 + (sqrt(1539) - ((sqrt(1539) + -2sqrt(1539))*2 + 0))). -11sqrt(19) + 1534 Simplify ((sqrt(95) + sqrt(95) + sqrt(95) + sqrt(95) + (sqrt(95) + sqrt(95)-2 - sqrt(95))-2 + sqrt(95)2-4)1)/(4(-1sqrt(320) - sqrt(320))-1). 0 Simplify (1 + 0 + (sqrt(4860) + -2sqrt(4860) + sqrt(4860) + 1sqrt(960))/((sqrt(12) - -2sqrt(48)) + sqrt(588)-1 + sqrt(588)) + 3)*2. 32sqrt(5)/5 + 96/5 Simplify -2-4((sqrt(567) + (sqrt(567) + sqrt(567) + -4)*2 - sqrt(567)) + -3 - (-3-4sqrt(567))2) + 2. -634934 - 1152sqrt(7) Simplify sqrt(144)/sqrt(3) + -3 + sqrt(528)/sqrt(176) + sqrt(48) + -5 - 1-1sqrt(192)/sqrt(4)-2. -8 + sqrt(3) Simplify (2 + ((sqrt(612) - sqrt(612)1) + sqrt(612))1 + -1 - (4 + 1sqrt(612) + -5 + 0))*2. 4 Simplify (5sqrt(637))*2 + sqrt(117)/sqrt(900) + 4(sqrt(13) + -1sqrt(1573) + sqrt(13) + -3sqrt(13)-2)2. sqrt(13)/10 + 16393 Simplify ((sqrt(60)/(1(sqrt(9)/sqrt(3) + sqrt(3)) - sqrt(3)) - (-2 + (sqrt(5) + -5sqrt(10)/sqrt(2) - sqrt(10)/sqrt(8)))) + 0)2. 26sqrt(5) + 861/4 Simplify (-4 + 4 + (sqrt(147) + sqrt(147)-2 - sqrt(147)) + -3 + 1(2 + sqrt(3))-3)2 + -4. 306sqrt(3) + 944 Simplify ((-2sqrt(68) + -1 + sqrt(68)1-3)2 + (-4 + sqrt(68) + sqrt(68) + -1 + sqrt(68))-3)-5 + 5. -8575 - 10sqrt(17) Simplify (-3((sqrt(108)/(sqrt(150) + sqrt(6))-2)/(sqrt(18)/sqrt(32) + sqrt(729)-1) + 1))2. 24sqrt(2)/35 + 11057/1225 Simplify ((sqrt(84)/(sqrt(12) + sqrt(12)-3) + -5)-5 + 5(sqrt(567) + 0)5)*2. 11375sqrt(7) + 1451675/4 Simplify -3 + (-4-4(sqrt(242) + (sqrt(242) - 1sqrt(242))3)-2)2. 247805 Simplify 4(-3 + (sqrt(68)/sqrt(4))2 - (0 + sqrt(1700) - sqrt(1700))2) + -2 - ((sqrt(2448) + 52sqrt(2448))6-1)*2. -10663434 Simplify ((-4sqrt(1782) + sqrt(88)3)/(-6(sqrt(242)-1 + sqrt(242) - sqrt(24)/(sqrt(192) + sqrt(12)))))2. 6875 Simplify -5(sqrt(539) + sqrt(539) + ((-2 + sqrt(539) + sqrt(539))-6 + sqrt(539))2 + (-1 + sqrt(44) + -3)2 + -4) + -3. -327098 + 9250sqrt(11) Simplify -1(sqrt(2187) + -2sqrt(2187))/sqrt(9) + (sqrt(243)-3 + 3 + -2)2. -45sqrt(3) + 2188 Simplify 2((1sqrt(3146) + sqrt(3146) - sqrt(3146)) + sqrt(3146))/sqrt(512)-62. -33sqrt(13) Simplify -2(4 + ((sqrt(156) - (sqrt(156) - (sqrt(156) - (sqrt(156) + sqrt(156)2))-1 - sqrt(156)))2)/(-2sqrt(1728) - sqrt(24)/sqrt(32))). -8 + 48sqrt(13)/97 Simplify ((2sqrt(204)-3)/(-1sqrt(108)))*2 + (2 + sqrt(612)-2 + 1(sqrt(612) + sqrt(612) + sqrt(612) + (sqrt(612) - (sqrt(612) + 1))))2 + 5. 12sqrt(17) + 686 Simplify (sqrt(91) + 3sqrt(91) + sqrt(91))/sqrt(7) + sqrt(13) - sqrt(13)2-6 - (-3 + (sqrt(104)/(1sqrt(8)) - -2sqrt(468))2). -2194 + 18sqrt(13) Simplify -6(-5 + (-6(sqrt(190)-1 - sqrt(190))4)/(-2(-1sqrt(250) - sqrt(250))) + 4)*2. -16566/25 + 144sqrt(19)/5 Simplify (2((sqrt(65) - -2sqrt(65)) + sqrt(65)) + (sqrt(65) + -1sqrt(65))5)/(5(sqrt(5) + sqrt(500)-5)). -8sqrt(13)/245 Simplify (4(2sqrt(325) + sqrt(325)) + sqrt(325) + -2 + 1)2 + (sqrt(1872) + 0 - (sqrt(156) - sqrt(156)2)/sqrt(12)). -117sqrt(13) + 54926 Simplify 1 + ((6sqrt(4617)2)/((sqrt(3) - sqrt(9)/sqrt(3) - sqrt(3))-2 - (sqrt(3) - sqrt(3)1)-2) + 2)*2. 216sqrt(19) + 55409 Simplify sqrt(40)/((2sqrt(8) - sqrt(8))-5) + -1 + (sqrt(20)/(sqrt(4) + sqrt(4)16) + -4)*2. -47sqrt(5)/35 + 740/49 Simplify (((-2sqrt(243))2 + sqrt(243))-2-3 - (2 + sqrt(12) + (sqrt(12)/sqrt(4) + -5)2 + 0))5. 310sqrt(3) + 29010 Simplify -2(0 + sqrt(13)) - (-3 + (1 + sqrt(13))*2) - 2(-2 + sqrt(13) + -1) - (-1sqrt(52)/(sqrt(16)/sqrt(4)) + 0 + sqrt(208) + -5). -9sqrt(13) Simplify (sqrt(931) + 4 +	{ "pile_set_name": "DM Mathematics" }
sitive. g(32/15) Simplify (t(-1/3))(8/9)/(t4t/t(1/4)t) assuming t is positive. t(-653/108) Simplify (t(3/4))(-12)/((t/(t(-4/7)/t))/(((t*(-10)t)/t)/t)) assuming t is positive. t(-158/7) Simplify ((g(-5))(-3/49))16 assuming g is positive. g*(240/49) Simplify (ii(iiii(ii*(-13))/ii)/i)*(-17/6)i*1ii4/i assuming i is positive. i(149/6) Simplify ((s(2/75))(-25))(-39) assuming s is positive. s26 Simplify i(4/9)/(i/i4)i*(2/5)ii(i/i4)/i assuming i is positive. i(83/45) Simplify (j/(j(7/3)/j))(-16)j20j(14/5) assuming j is positive. j(422/15) Simplify ((vv/(v/v(-11))v)/(((v/(v/(v/(vv(-11)v))v)vv)/v)/v)v*(-3)v10/v)(13/5) assuming v is positive. v(-156/5) Simplify ((v1)*24v/v*(-6)v(-7))20 assuming v is positive. v480 Simplify ((n(16/9)/n)/n)/((nn(-14))/n)(n(2/13))(-13) assuming n is positive. n(106/9) Simplify ((o(1/3)/ooo*(1/4)oo)/(o/((o/o(-2/5))/o))(-2))(-18) assuming o is positive. o(-681/10) Simplify a(1/4)/aaa(-3/4)/aa(-1)/(a/a5) assuming a is positive. a(3/2) Simplify a/a(1/2)a/(a(-3/8)/a)a*(-10)/aaa(aa(8/7)aa)/a assuming a is positive. a(-167/56) Simplify (q30/(q(qq/(q/(q/(qq(qq*(-24)q)/qq))))/q))(-7/12) assuming q is positive. q(-14/3) Simplify (t(-5)/t(-2))16 assuming t is positive. t(-48) Simplify (z(-2/19)/z)/((zz/z*0)/z)zzz*0z(z/(z/z10z))/zzz assuming z is positive. z*(207/19) Simplify ((bb*9)/(bb/(b*(-20)/b)))/((bb/((b*(-4/3)b)/b)bb)/bbb(-2)) assuming b is positive. b(-49/3) Simplify p*8p*(-2/11)p(p/(pp/(((pp(2/5))/pp)/pp)))/(ppp(-10)p) assuming p is positive. p(892/55) Simplify w(-8/7)ww/(w/w*7)(w*(-4)w)/wwwww((www/(ww*(-11)w))/w)/w assuming w is positive. w(118/7) Simplify ((f10f/f(-8))/((f(-7/6)f)/(fff/(f/f(2/7)))))(-14/3) assuming f is positive. f*(-901/9) Simplify (((jj/(jj(-25)j))/j)/j)/jjjjj*12j(-2/3)/(j/j(-3/17)) assuming j is positive. j(1793/51) Simplify ((i(1/3)/(ii0/ii))(-10/13))(-31) assuming i is positive. i(-620/39) Simplify (d(-2/11)d)/d(-14)(d(-2))(-47) assuming d is positive. d(1197/11) Simplify (p/((p(-3/8)/ppp)/pppp)p)(-1/3)/(p(-1/24)p/((p(ppp*24/p)/pppp)/p)) assuming p is positive. p(105/4) Simplify (t/t(2/21)t/(tt*(-1/2))(tt(1/2)/tt)45)(-6/7) assuming t is positive. t*(-2894/49) Simplify (dd*11)/dd*(-18)d*(1/5)d(27/5) assuming d is positive. d(-7/5) Simplify (d(-1/2))(-1)/(((d/d*(1/30)d)/d)/(d13/d)) assuming d is positive. d(173/15) Simplify ((cc(-1/4)/c)/((c/(c(13/6)c))/c))(3/46) assuming c is positive. c(35/184) Simplify ((((nn/(n/(((n/n(-1/18))/nn)/n)))/nn)/n(3/2))(11/6))(-46) assuming n is positive. n(1012/27) Simplify i(8/9)/(i(2/53)ii)((i/i*(-6))/ii)/(ii(18/11)) assuming i is positive. i(16868/5247) Simplify ((((a(-7)/a)/a)/a(6/7))(3/5))(-2/69) assuming a is positive. a(6/35) Simplify (u(uuuu(11/3)/uuu)/u)/((u/(u/u(-14/3))uu)/u)u(2/25)/u(5/4) assuming u is positive. u(3049/300) Simplify i(-25)/i*(-17)(i(-6/11))(4/11) assuming i is positive. i*(-992/121) Simplify ((mm(-10/9))/(m2/m))/((((mm(1/21)m)/m)/mmm)/(m*11/mm)) assuming m is positive. m(494/63) Simplify q(-4/3)/q*(-15)q*(-14)q*(-2/27)q assuming q is positive. q(16/27) Simplify (((q(-2/33)/qq)/q)/qqq(-7/4))/(q(-1/9))(3/20) assuming q is positive. q(-461/165) Simplify ((h(h*(1/4)h)/hh)/h)(-6/13)/(hhh/(h/(hh/(hh(-6)hhh))h)h(h/h(1/6))/h) assuming h is positive. h(-250/39) Simplify (ii*16iiii29)/(ii*11ii)(-8/7) assuming i is positive. i65 Simplify (((d/d(-1/2))/d(-2))/(d/d2)(-48))(23/2) assuming d is positive. d(-2047/4) Simplify (a/(a/(a/a(-1/34)a))a(-13)a)/(a*(6/5)aa(-4/23)) assuming a is positive. a(-46907/3910) Simplify (y/(y2y)y)46(y0)24 assuming y is positive. y*(-46) Simplify (f(f/(f/(ff/(f(-6/7)f)ff)))/f)/ff(10/3)f*(-5/7)/((fff(1/32)f)/ff) assuming f is positive. f(1643/672) Simplify (j/(j(3/5)/j)j)*(-1/8)j/(jj(2/19)/jj)j(((j/((jj(1/13))/j))/j)/j)/j assuming j is positive. j(-3661/2470) Simplify (((z(-3/2)/z)/z)(-24))(-22) assuming z is positive. z(-1848) Simplify ((n(5/6)/nnn)/(n/(nn/n*(-5)n))(n/(nn(-2/5)))(-24/7))(4/3) assuming n is positive. n(3134/315) Simplify (r7/((r(-23)/r)/r))(1/74) assuming r is positive. r(16/37) Simplify ((c/(c/(cc/c(-1/2))))(2/39)c(cc/c*0)/c(c*7c)/c)(4/3) assuming c is positive. c(1424/117) Simplify q*(-16)q/((q(qq*4/q)/q)/q)qqq/(qq(-3/10))qq(-10) assuming q is positive. q(-247/10) Simplify (((z1/z)/(z/(zzz4)z))(-3/11))(-21) assuming z is positive. z*(252/11) Simplify (yy4)(7/11)/(yy(1/7)yy(-6/7)y) assuming y is positive. y(69/77) Simplify (((f(1/2)/ff)/ff)*(-2/5)f*(-1/6)f*11f)(-1) assuming f is positive. f(-349/30) Simplify (b(-33)/b(-13))/(b*(6/11)b(24/11)) assuming b is positive. b(-250/11) Simplify r/r*(-3/10)rr3(rrrr(-1/3))/rr(3/5) assuming r is positive. r(227/30) Simplify ((oo/(oo/((oo(2/23)o)/o))o)14)(2/9) assuming o is positive. o(448/69) Simplify (s(-4/7)s(-15/2))(7/2) assuming s is positive. s(-113/4) Simplify ((m(2/13)/m)/m)/m*(3/7)(((m/(m*(1/4)/m))/m)/mm)(-21) assuming m is positive. m(-6561/364) Simplify m(-1/37)/(m(-1)m)m*(2/49)(m(mm*(3/11)m)/m)/m assuming m is positive. m(25657/19943) Simplify ((n2)*39n(-13)/(n4n))(-4) assuming n is positive. n(-240) Simplify (((aaaa2/a)(2/79))(-19))40 assuming a is positive. a*(-6080/79) Simplify uuuu*(4/11)u/(uu/(u/(u/u(-2/25))))(u/u6)(-41) assuming u is positive. u*(57003/275) Simplify (yy/((y((y(2/3)/y)/y)/y)/y))(-4/5)y*(-5)y(1/16) assuming y is positive. y(-2017/240) Simplify (i13/i(-10/7))/(i/(i/i(4/5)))36 assuming i is positive. i*(-503/35) Simplify ((aaa(-10)a)/(a/(aa(-11)a)))/(a*(1/18)a(-2)) assuming a is positive. a(-271/18) Simplify (r/(r*(-4)/rr))/rrr*(-9)r*0/(((rr*(-1/18))/rr)/r) assuming r is positive. r(-71/18) Simplify w(-1/8)(w(-2/11)/w)/ww(w/w(2/5))/wwww(-6) assuming w is positive. w(-2511/440) Simplify (zzz2/z)36(z/(z/(z(-3)zz)))/z(7/4) assuming z is positive. z(421/4) Simplify (t/(tt*(-4)tt))0t/(t*(-1)t)ttt/(t/t(2/7))tt assuming t is positive. t(37/7) Simplify (((u/u(-9))/u)/(u/(u(-1/8)/uu)u))/(u(-2/15)u/(u/((uu/u(1/22)u)/u))) assuming u is positive. u(6671/1320) Simplify (k(-2/19)kk9)/(k12/k(-12)) assuming k is positive. k(-268/19) Simplify (l(-1/2))(-30)l(-18)ll(1/3) assuming l is positive. l(-5/3) Simplify d7/dddd*(-10)/dd((d(1/5)d)/dd)(-26) assuming d is positive. d(-166/5) Simplify (v(-1/8))(-7/13)(v(-1/2))(-46) assuming v is positive. v*(2399/104) Simplify ((jj(jjjj*(-4/3)/jjj)/jj)/(j*(-6/7)/j)(j(2/5)/j)(4/9))20 assuming j is positive. j(876/7) Simplify o(2/35)/o(-1/5)(o/((o5o)/o))(-10/3) assuming o is positive. o(1427/105) Simplify p*7pp14(p1/p)(-2/29) assuming p is positive. p22 Simplify (r27rr/(r*(-3/2)r))/(r(-15))(-28) assuming r is positive. r(-781/2) Simplify (((w/w0w)(15/7))(-1/27))29 assuming w is positive. w(-290/63) Simplify (o(-2))21/(o(-1/14)/o5) assuming o is positive. o(-517/14) Simplify (((((v/(v/(v(v*(-4/3)/v)/v)))/v)/v)/v)/(v/(vvv23)))(6/7) assuming v is positive. v16 Simplify (r(-2/11))(1/6)(r1)(-10) assuming r is positive. r(-331/33) Simplify b(-3/2)/(bb(-3))(b/b*(-2/33))/(b(bbb/(b/b(5/6)))/b) assuming b is positive. b(-14/11) Simplify (y/y(2/11))/(y/(y/y(-13)))((y/(yyyy*2y))/y)46 assuming y is positive. y(-2884/11) Simplify ((yy/(y/(yyy(2/13))))/yy/(yyy/y*12yyy))/(y/y(2/11))(1/37) assuming y is positive. y**(48316/5291) Simplify	{ "pile_set_name": "DM Mathematics" }
. -14405 - 240sqrt(5) Simplify 1((sqrt(1539) + -1)6 + 5) + (5sqrt(76) - (2 + sqrt(19) + 2 + sqrt(19)))3. -13 + 78sqrt(19) Simplify (5(sqrt(132) + (-6(sqrt(132) + sqrt(132) + (sqrt(132) - (sqrt(132)-1 - sqrt(132)))) - sqrt(132)) - -2sqrt(132)-5))/(-4(sqrt(2352)2 - sqrt(48))). 25sqrt(11)/13 Simplify ((2(4(sqrt(42)/sqrt(3) + sqrt(14)))/sqrt(7) + 4 + (-4sqrt(162) + 3 - sqrt(162)))4)*2. -6496sqrt(2) + 27696 Simplify 3((sqrt(133) - (sqrt(133) + sqrt(133)-1)5 - sqrt(133))3)/(((sqrt(56) + sqrt(56)4 + sqrt(56))/sqrt(2))/sqrt(4)). 0 Simplify -5(3 + sqrt(55)/(sqrt(11) + (sqrt(132)/sqrt(3))/sqrt(4)) + (sqrt(300)/(2sqrt(5)))/(sqrt(588) + sqrt(588)1)). -15 - 75sqrt(5)/28 Simplify ((((0 + sqrt(125))-1 - (sqrt(125) - (sqrt(125) + -5 + -1 + sqrt(125) + sqrt(125)))) + sqrt(125) + -1 + 5 + sqrt(125)3 + 2)3)*2. 28125 Simplify 0 + (-2 + sqrt(75))-2 + 6((-5-1sqrt(15))/sqrt(5))2 + 4. -10sqrt(3) + 458 Simplify -4 + -6(sqrt(98)/(-61sqrt(7)))/(sqrt(28)/sqrt(4)-2 - (-2sqrt(700) + sqrt(7))). -4 + sqrt(2)/17 Simplify ((-3(2(sqrt(1694) + sqrt(1694)-2) + sqrt(1694)))/((2sqrt(7)-5 + (sqrt(168)/sqrt(3))/sqrt(8))3))2. 242/81 Simplify (((2sqrt(99) + sqrt(99))/sqrt(3) - 2sqrt(825))/(sqrt(363)3 + (sqrt(12) - sqrt(48))/sqrt(4)))*2. 539/1024 Simplify (2 + (sqrt(96) - sqrt(96)2 - sqrt(192)/(1sqrt(8)))/(sqrt(84)/(6(sqrt(7) + sqrt(21)/sqrt(3)))))*2. -144sqrt(2) + 2596 Simplify (1 + sqrt(6)/sqrt(98) + 4)*2 + ((sqrt(144)-2 + sqrt(144))/sqrt(6))/(sqrt(32)/(sqrt(8)/sqrt(2))). 3sqrt(3)/7 + 1228/49 Simplify -3-1(0 + -4 + -2sqrt(1620) + 0)*2. 864sqrt(5) + 19488 Simplify (-21(sqrt(65) + -2sqrt(65))6)/(2((sqrt(75)2 + sqrt(75))/sqrt(5) - sqrt(15))/sqrt(3)). 3sqrt(13) Simplify ((-2 + 3 + (sqrt(1100) + 0)6 + -4)-3-5)*2. -81000sqrt(11) + 8912025 Simplify ((-2(-1sqrt(187)-2 - sqrt(187)))/(sqrt(1331)-3-2) + 4)-1. -4 + sqrt(17)/33 Simplify (-2sqrt(1296) - sqrt(1296) - (sqrt(400) + (sqrt(400)3 - sqrt(400))))/(sqrt(88)/sqrt(99) - sqrt(64)/(sqrt(24)/sqrt(3)))-4. -252sqrt(2) Simplify ((-1(sqrt(14) + sqrt(42)/sqrt(3)))/(sqrt(8) - -3sqrt(8)) + (5sqrt(7)-5 - sqrt(63)/(sqrt(9)2)))-3. 309sqrt(7)/4 Simplify (sqrt(187)22 + sqrt(187) + 2sqrt(187)2)/(-1(sqrt(704)-2 - sqrt(704))). 3sqrt(17)/8 Simplify -4(-2 + 5 + ((sqrt(605)-2 + -1)2 + (sqrt(605) - (sqrt(605) + 0)2) + -2 - -4((sqrt(605) + -2sqrt(605))-2)2)). -45988 - 220sqrt(5) Simplify 1(5 + 4(-5 + (((sqrt(68) + sqrt(68)2)2)*2 - sqrt(68)) - (-1 + sqrt(68) + -1 - (sqrt(68) + 0)-1)) + -2). -24sqrt(17) + 9783 Simplify 3(53(sqrt(85) + (sqrt(85) - (sqrt(85)1 - sqrt(85))) + sqrt(85)))/(sqrt(60)/(((sqrt(132)4 - sqrt(132)) + sqrt(132))/sqrt(11))). 540sqrt(17) Simplify (6(1 + (6(6(sqrt(34) - sqrt(34)1) + sqrt(34)))/(6sqrt(6)/sqrt(27))))*2. 216sqrt(17) + 5544 Simplify (sqrt(77)/(sqrt(56)/(sqrt(32)/sqrt(4))) - (5(sqrt(11) - sqrt(22)/sqrt(2))-4)*2) + (-2(sqrt(891) + 0 + sqrt(891) + 0 + 5))*2. 721sqrt(11) + 14356 Simplify 4 + (-4(-6-5sqrt(77)3)/(-4sqrt(7)2 + (sqrt(56)/sqrt(2))/sqrt(4)))*2. 1425796/49 Simplify (4 + 5 + (1sqrt(539)-6 - (1 + (sqrt(539) - sqrt(539)-2)) - (1sqrt(539)2 - (-1 + sqrt(539))2)))2 + 4. -756sqrt(11) + 43699 Simplify (5-1sqrt(108)-2)/(4(sqrt(900) + 4sqrt(900)-1)). -sqrt(3)/6 Simplify (-3sqrt(66)/((3sqrt(99))/sqrt(9)))/((sqrt(1400)/sqrt(4))/(sqrt(847)-1)). 11sqrt(3)/5 Simplify (-5 + (sqrt(136)/(sqrt(24)/sqrt(3)) + (3 + sqrt(833))*2 + 4)1)-2. -1682 - 86sqrt(17) Simplify 4(((sqrt(68) + sqrt(68) + 1)-1)*2 + 5 + sqrt(68)-1 - (-1sqrt(68) + 5 + ((sqrt(68) + 2)1)*2)). 804 Simplify -1 + (sqrt(847) + -4sqrt(847) + 2)*2 - (-1 + (1 + sqrt(7) + 0 - (sqrt(7) + -2 + -4))). -132sqrt(7) + 7620 Simplify 2(-5(3 + sqrt(75) + 1 - -3(-1 + sqrt(75) - sqrt(75)))2 - (-1 + sqrt(75) + 1 + 0 + 0)2). -910 - 100sqrt(3) Simplify (-5-1sqrt(136)5)/(-6(sqrt(800) + (sqrt(800) - sqrt(800)3 - sqrt(800)))). 5sqrt(17)/24 Simplify 5 + 1 + (sqrt(280) - (3(sqrt(280) - -6sqrt(280)) - sqrt(280) - sqrt(280)))/(sqrt(10) + sqrt(4840) - sqrt(10)). -18sqrt(7)/11 + 6 Simplify (-1(sqrt(40)/((sqrt(96) - (sqrt(96) + sqrt(96)-1))/sqrt(12) + sqrt(8)) - sqrt(55)/(sqrt(44)/sqrt(4)4)) + 4)-5. -20 + 5sqrt(5)/4 Simplify 5(((sqrt(363)/(-2sqrt(11)) - (2sqrt(2673) + sqrt(33) + sqrt(33)))/((sqrt(1584)-1 + sqrt(1584) - sqrt(1584))-5))2 + -3). -12719/960 Simplify (-2 + 2((sqrt(242) - ((sqrt(242) - 4sqrt(242)) + -5) - sqrt(242))5 + -4 + -2))*2. 23760sqrt(2) + 219096 Simplify ((4(2 + 4 + sqrt(1331) + 1) + -3)3)*2. 19800sqrt(11) + 197289 Simplify (((-1 + sqrt(252) - sqrt(252)) + sqrt(252) + 1 - (3 + 0 + sqrt(252))) + (4-1sqrt(847) + sqrt(847))-1)2. -198sqrt(7) + 7632 Simplify ((sqrt(500)/sqrt(2) + sqrt(10) - (1sqrt(10)2 - sqrt(10)))-6)/(-2sqrt(5)-4-6-2). -5sqrt(2)/16 Simplify ((-2 + sqrt(112) + sqrt(112))-2 - (3 + sqrt(112) + 0) - (34sqrt(567) + -1))2. -512sqrt(7) + 114692 Simplify ((sqrt(1331) - (sqrt(1331) + 1 + sqrt(1331) + sqrt(1331) + 5)) + 3 + sqrt(1331) + -1 + sqrt(1331) + 2 + -4 + 4 + (sqrt(1331) - 4sqrt(1331)) + -5)2. 462sqrt(11) + 12028 Simplify (-4 + (((sqrt(684) - sqrt(684)2) + 2 - (sqrt(684) + -2sqrt(684)-6)) + -1(sqrt(684) + -2 + -1 + sqrt(684)))-5-5)*2. -580800sqrt(19) + 109454641 Simplify (sqrt(11) + sqrt(275) + sqrt(275) + -2 - (sqrt(539)-1 + sqrt(539)))2 + ((-11sqrt(121))/(21sqrt(11)))2. -44sqrt(11) + 5351/4 Simplify (4sqrt(468)-1-2)/((3(sqrt(40) + sqrt(160)))/(sqrt(1000)-2 + sqrt(1000)))-4. 320sqrt(13)/3 Simplify 4 + (-5 + (sqrt(1700) + sqrt(1700)3 - sqrt(1700) - sqrt(1700))-5)2 + (-2sqrt(1700) + 3 - (sqrt(1700)-1-1)*2)-6. 1120sqrt(17) + 180211 Simplify (-2(sqrt(152) + 5((sqrt(152) - (sqrt(152)4 - sqrt(152) - sqrt(152)) - sqrt(152)) + sqrt(152)) - sqrt(152)))/(sqrt(24)/(5sqrt(3))-1). -50sqrt(19) Simplify ((sqrt(108)-1-5 + 11sqrt(108))/((sqrt(12) - (-2sqrt(48))/sqrt(4) - sqrt(12))/(5sqrt(2)-1)))2. 4050 Simplify (sqrt(1539) + 3)2 - (-2 + sqrt(19) + 3) - ((2sqrt(228) + sqrt(228))-2)/((1sqrt(36))/sqrt(3)). 59sqrt(19) + 1547 Simplify -6(((sqrt(91) + 2sqrt(91))6 - -5sqrt(91)2)/(2-4sqrt(112)))2. -1911/32 Simplify (-6(3sqrt(114)-1 - ((sqrt(114) - sqrt(114)-1)2 - sqrt(114))))/(sqrt(24)/(sqrt(484)1)2). 198sqrt(19) Simplify ((sqrt(18) + sqrt(18) + sqrt(72) + -4)2 - (-2sqrt(2178) - sqrt(2178)))-3 + ((sqrt(192)/(sqrt(24)/sqrt(2)))/sqrt(8))2 + -3(-1 + sqrt(2) + 3). -916 - 12sqrt(2) Simplify -4 + sqrt(425) + 1 + sqrt(425) + (sqrt(425) - (-2 + sqrt(425))) + ((-2 + -1 + sqrt(425) + sqrt(425))-1)*2 + 2. -50sqrt(17) + 1710 Simplify ((-1(sqrt(189)-1)/sqrt(9))/(sqrt(28)/(sqrt(16)/sqrt(4))-1))2-3 + -4. -13 Simplify (sqrt(96)-2 - sqrt(42)/(sqrt(7)-2))/(sqrt(27) + (sqrt(108)/(sqrt(4)-4) - sqrt(27)))1. 10sqrt(2) Simplify 4(((sqrt(120)2)/sqrt(6) - (0 + sqrt(405) - sqrt(60)/((sqrt(48) - sqrt(12)) + sqrt(12))))2-3 + 5). -1195 Simplify 5((1 + (sqrt(200) - (-3 + sqrt(200) - sqrt(200)) - sqrt(200)))22 - (4 + sqrt(200)1 + ((sqrt(200) + 1sqrt(200))*2 - sqrt(200))5)). -19860 + 200sqrt(2) Simplify -4 + -1sqrt(176) - 2-1sqrt(176) - 2((2sqrt(176)4)2 - ((sqrt(176) - sqrt(176)-2) + -1)). -22534 + 28sqrt(11) Simplify -5(((sqrt(64) - (-2sqrt(64)2 + sqrt(64)))/(sqrt(18) - sqrt(162)))*2 - ((sqrt(32) + sqrt(32) + 1 + sqrt(64)/sqrt(2))-5-6)2). 108000sqrt(2) + 11703860/9 Simplify (6-2(sqrt(88) + sqrt(88) + (sqrt(88)-2 - sqrt(88))6))/(sqrt(8) - 3(sqrt(8) + sqrt(32)/sqrt(4)) - (sqrt(8) + (sqrt(72) - sqrt(8)))6). -192sqrt(11)/23 Simplify (-2sqrt(224)-2-4)/((-6(-2sqrt(2) - sqrt(2)) + -1sqrt(6)/sqrt(3))4). -16sqrt(7)/17 Simplify (5 + ((sqrt(352)1 + sqrt(352))/sqrt(11) - (sqrt(96)/sqrt(2))/sqrt(6)))*2 + 2. 60sqrt(2) + 99 Simplify (((4(sqrt(684)-1 + 0) - ((sqrt(152)/sqrt(4))/sqrt(2) + sqrt(19) + (sqrt(2299) + -1 - sqrt(19)))) + -5)4)2. 4608sqrt(19) + 394240 Simplify (3(2 + sqrt(28))6 + 4 - 5(sqrt(112) + -6(-1 + sqrt(112))))*2. 2720sqrt(7) + 129572 Simplify 1(-5 + (32-2sqrt(272) - (3 + (sqrt(272) + 0 - sqrt(272)) + 3)))*2. 1056sqrt(17) + 39289 Simplify (-2(0 + sqrt(13))6)*2 + 5 + 5 + (1 + 4-2sqrt(1573))2. -176sqrt(13) + 1884 Simplify (5(-2 +	{ "pile_set_name": "DM Mathematics" }
+ 724 Simplify (-4 + -4 + ((sqrt(171) - sqrt(171)-1) + sqrt(171) + 2)3)*2. -108sqrt(19) + 13855 Simplify (3(4sqrt(121) - sqrt(121)))/((2sqrt(132))/sqrt(12)). 9sqrt(11)/2 Simplify 2(sqrt(196) - (sqrt(196) + sqrt(196) + sqrt(196)2)1)/(sqrt(567)-2 + sqrt(42)/sqrt(96)). 48sqrt(7)/71 Simplify 4((sqrt(245) + -3 + sqrt(245) + -2 + sqrt(245) + sqrt(245))*2 + -1 + (sqrt(245) - (sqrt(245) + 1))). -1120sqrt(5) + 15772 Simplify (sqrt(171)/(sqrt(324) + (sqrt(324) - -2sqrt(324))))2 - (2(sqrt(1216) + sqrt(1216) + 1 + sqrt(1216) - sqrt(1216)))*2. -11208941/576 - 128sqrt(19) Simplify (-5 + (sqrt(243) + -1 + sqrt(3)2 + 1)-2)*2. 220sqrt(3) + 1477 Simplify (-2sqrt(70)1)/(6(sqrt(10) - sqrt(10)2)) - 4sqrt(6300)-1. 361sqrt(7)/3 Simplify ((-1 + -3 + sqrt(117) + sqrt(117) - sqrt(117)) + (sqrt(117) - (sqrt(117) + -1sqrt(117))-1))21. -48sqrt(13) + 484 Simplify 2 + (5(sqrt(300) + 1 + 0) + 5)*2. 1000sqrt(3) + 7602 Simplify (sqrt(3) + 1sqrt(3) + 1 + (sqrt(21) + sqrt(525))/sqrt(7))2 - (3 + -6(sqrt(3) + 2))*2. -92sqrt(3) + 4 Simplify ((sqrt(35) - sqrt(875)1 - 22sqrt(35))/(21sqrt(7) - 4sqrt(14)/sqrt(2)))2. 80 Simplify ((-2 + sqrt(75) + 5)2 + 4 + (sqrt(12) - sqrt(48)/sqrt(4)))1. 30sqrt(3) + 88 Simplify ((3sqrt(5)-2)2 - sqrt(45)/(sqrt(63)/sqrt(7) + sqrt(9))) + (-4 + 2 + -2 + sqrt(20))2. -33sqrt(5)/2 + 216 Simplify (sqrt(735) + (sqrt(735) - (sqrt(735) - (sqrt(735) + (sqrt(735)-1 - sqrt(735))))))/(-2sqrt(75)). 0 Simplify ((sqrt(100) - sqrt(100)2 - sqrt(100))/sqrt(10)-4)/((sqrt(4500)2)/sqrt(9)). 2sqrt(2)/5 Simplify -5((32sqrt(108)-3)2 + 3). -174975 Simplify (-4sqrt(12)/sqrt(4) + sqrt(3) - ((sqrt(3) - sqrt(48)) + -1))4 + 3. 7 Simplify 4(45(sqrt(171) + 2) + 2)2. 336 + 480sqrt(19) Simplify (3(1sqrt(1200) + sqrt(1200) - sqrt(1200) - sqrt(12)))/(sqrt(600) - (sqrt(600) - sqrt(600)-1)3 - sqrt(600)). -9sqrt(2)/20 Simplify 4 + (2((sqrt(637) + -1sqrt(637) - sqrt(637)) + 4 + -3)6)*2. -2016sqrt(13) + 91876 Simplify (2 + (-5sqrt(108)/sqrt(4))/(sqrt(45)/sqrt(125)))2. -100sqrt(3) + 1879 Simplify 3 + sqrt(891)-4 - (-1 + sqrt(539)6)*2. -19402 + 48sqrt(11) Simplify -4 + (1-6sqrt(77)1)/(-3(1sqrt(539) + sqrt(539))). -4 + sqrt(7)/7 Simplify (-1 + sqrt(432) + sqrt(432) + sqrt(432) + 1 + sqrt(432) + (sqrt(432)2 + sqrt(432))3 + sqrt(432))2 + -5. 84667 Simplify sqrt(567) + 1 - (sqrt(7) - (sqrt(847)2 + sqrt(847) + sqrt(7)))*2 - ((4 + sqrt(21)/sqrt(3))-6)*2. -8450 - 279sqrt(7) Simplify -1sqrt(16)/sqrt(32)-1 - ((sqrt(216) - (sqrt(216) + 1(sqrt(216)-1 - sqrt(216) - sqrt(216)) + sqrt(216)))/sqrt(12))*2. -72 + sqrt(2)/2 Simplify ((sqrt(35) + sqrt(2240)1)/(sqrt(847)-2))2 + 4(-1 + sqrt(245)) + 0. -1531/484 + 28sqrt(5) Simplify ((-5(sqrt(78)/sqrt(3) - sqrt(26))-2)/((-2sqrt(128))/sqrt(4)))*2. 0 Simplify 1 + sqrt(2)12 + -4sqrt(250)/sqrt(5). -18sqrt(2) + 1 Simplify 5 + 3 + (sqrt(30) - (sqrt(30) + 2sqrt(3630)))/(-3-1sqrt(10)). -22sqrt(3)/3 + 8 Simplify ((sqrt(5616) - (sqrt(5616)3 + sqrt(5616)) - sqrt(5616) - sqrt(5616)) + sqrt(5616))/(1sqrt(18)/sqrt(6)) + -1. -48sqrt(13) - 1 Simplify (-1sqrt(245))2 + sqrt(245) + (sqrt(5) + (sqrt(30) + sqrt(210)/sqrt(7))/sqrt(6))2 + -4 + ((-1 + sqrt(405))2)*2. -65sqrt(5) + 1910 Simplify 3 + -4 + -2sqrt(3) + (-5 + (0 + sqrt(432) - sqrt(432)))2. -2sqrt(3) + 24 Simplify (sqrt(54)/(sqrt(12)/sqrt(4)) - (sqrt(18) + 1sqrt(882)))/((sqrt(162)1)/sqrt(2)). -7sqrt(2)/3 Simplify (((sqrt(272) - (3 + -1 + sqrt(272))) + sqrt(272) + sqrt(272) - 2sqrt(272)4) + -5)1. -24sqrt(17) - 7 Simplify (3-3((sqrt(76) - (sqrt(76) + (-3(sqrt(76)-5 + sqrt(76)) - sqrt(76)))) + sqrt(76))-2)*2. 2462400 Simplify ((sqrt(1372) + -2sqrt(1372) - sqrt(1372))-1)/(sqrt(24)/(2(sqrt(6)-2 + sqrt(6)) - sqrt(6))). -42sqrt(7) Simplify (4 + (sqrt(2736) - (4 + (sqrt(2736) - (sqrt(2736) + sqrt(2736) + 0)))) + -4)*2. -192sqrt(19) + 10960 Simplify (sqrt(252) - (sqrt(252) + 2) - sqrt(252))*2 - sqrt(252) - (sqrt(567) + 2 + -2). 9sqrt(7) + 256 Simplify (((sqrt(75) - (sqrt(75) + -1 + sqrt(75))) + sqrt(75))*2 - sqrt(12)/(sqrt(196) + sqrt(4))) + 4. -sqrt(3)/8 + 5 Simplify (sqrt(5) + 0)4 + -2sqrt(5) + -4 - (2(sqrt(5) + 2)-3)2. -328 - 142sqrt(5) Simplify (3sqrt(208) - (-5 + sqrt(13)-3)) + -5. 15sqrt(13) Simplify 1((sqrt(1620)4)/(sqrt(36)1))*2 + -3. 717 Simplify -5 + 3 + (sqrt(2057)2 + 3 + sqrt(2057) + sqrt(2057) + -5(sqrt(2057) + 2))2. 154sqrt(17) + 2104 Simplify (((sqrt(130)-2 - sqrt(130))/sqrt(10))2 - (2sqrt(1300) + sqrt(13))*2) + 1 + sqrt(1053)-16. -5615 - 54sqrt(13) Simplify (sqrt(209)/(sqrt(176) + sqrt(11)) - sqrt(475)3 - (sqrt(114) + (4(sqrt(114)-1 - sqrt(114)) - sqrt(114)))/(sqrt(726)1))*2. 11382444/3025 Simplify (6(sqrt(8)/sqrt(4)6 + sqrt(2) + (sqrt(2) - (sqrt(8) - sqrt(2)))3))*2 + -3. 3525 Simplify 2-2(-5 + sqrt(39)/sqrt(3) + (3sqrt(1872))*2). -67372 - 4sqrt(13) Simplify (2-41sqrt(1539))25 + 3. 492483 Simplify (0 + (sqrt(140) - (sqrt(140) + (sqrt(140) - (sqrt(140) - -2(sqrt(140) - (sqrt(140)-2 - sqrt(140))))) + sqrt(140)))/sqrt(5))*2. 1372 Simplify (-2sqrt(70)-1 + -1sqrt(70)1)/((sqrt(10) - (sqrt(10) - sqrt(40)/sqrt(4))-2) + sqrt(1000)-1). -sqrt(7)/9 Simplify (sqrt(3) - (2sqrt(3) + -4)) + (sqrt(3) - -1sqrt(3)-5)*2 - sqrt(108)/(sqrt(4) + sqrt(16) - sqrt(4)). -5sqrt(3)/2 + 52 Simplify (sqrt(112) + (sqrt(112)-1 + sqrt(112))1)/(2-4sqrt(36)). -sqrt(7)/12 Simplify (sqrt(1584) + 1 + 3)-5 + 5. -60sqrt(11) - 15 Simplify sqrt(12)/(sqrt(48)/sqrt(8)-2)-1-5. -5sqrt(2)/2 Simplify sqrt(252) + (sqrt(252)-15 - sqrt(252))*2 - (sqrt(343) + 1 + sqrt(343) - (sqrt(21) - sqrt(84) - sqrt(21))/sqrt(3)). -10sqrt(7) + 9071 Simplify (1 + -5 + -1-2sqrt(833) + sqrt(119)/sqrt(63) + -1 + (sqrt(17) - sqrt(17)-1))2. -490sqrt(17)/3 + 41042/9 Simplify 3 + ((sqrt(76) + -1)*2 - sqrt(76)) + sqrt(76) + 4 - -5(sqrt(76) - (sqrt(76) + sqrt(76)2)2)1. -3336 + 6sqrt(19) Simplify 1 + (-4 + (sqrt(112) + 2 + sqrt(112) + 5)-1)*26. 1056sqrt(7) + 3415 Simplify (sqrt(2736) - -1sqrt(2736)-4) + (sqrt(95)/(sqrt(60)/sqrt(192)))2. -36sqrt(19) + 304 Simplify (-2 + (2sqrt(65))/sqrt(5))1 + ((sqrt(13) + -1 + sqrt(13))2 - ((sqrt(13) + 0 - sqrt(13)) + 2 + sqrt(13)))-6. -16sqrt(13) + 22 Simplify (((1sqrt(154) + sqrt(154))4)/sqrt(11))/((sqrt(972)-1 - sqrt(972))/sqrt(6)). -4sqrt(7)/9 Simplify 5(1 + -3 + sqrt(2) + (3sqrt(2))2-2). -190 + 5sqrt(2) Simplify -2 + 4 + 0 + sqrt(1377) + sqrt(1377) + (sqrt(833) + sqrt(833)2)*2-6 + -2. -44982 + 18sqrt(17) Simplify (-1sqrt(1470))/sqrt(6) + (sqrt(245) + 2 + sqrt(245) + 4)*2. 161sqrt(5) + 1016 Simplify ((1sqrt(36) + sqrt(36))/sqrt(12) - sqrt(3))1 + ((sqrt(90)/sqrt(24))/sqrt(5))*2. 3/4 + sqrt(3) Simplify (sqrt(68)-1-5 + ((sqrt(68)-2 + sqrt(68))-3 - sqrt(68)))/((-3sqrt(484) - sqrt(484) - sqrt(484))-3 - sqrt(484)). sqrt(17)/22 Simplify -3(0 + sqrt(1331) + sqrt(1331)) - (-1 + sqrt(275))-2. -56sqrt(11) - 2 Simplify ((5sqrt(190) + sqrt(190))-2)/(sqrt(40)/(-5sqrt(4))). 60sqrt(19) Simplify (-4 + sqrt(242) + 1 + -4)*2 + -3. -154sqrt(2) + 288 Simplify (3(-2sqrt(104) + sqrt(104)) + -6-2sqrt(104))/(sqrt(64)/(sqrt(72)3 + sqrt(8))). 90sqrt(13) Simplify 4(sqrt(432) + (-1sqrt(432) - sqrt(432)))/(6(sqrt(6) + sqrt(12)/sqrt(2))). -2sqrt(2) Simplify sqrt(2)-1 + -3 - sqrt(2) - -2sqrt(4)/sqrt(2) - (1 + sqrt(128) + (sqrt(128) - (sqrt(128) + (sqrt(128) + -4 + sqrt(128))*2))). -136sqrt(2) + 524 Simplify ((sqrt(15) + 6sqrt(60))/(sqrt(125)-1))*2 - -6(2 + -2sqrt(243))2. -432sqrt(3) + 146907/25 Simplify (5(sqrt(2736) + sqrt(2736)-1)*2 + 3)2 + -4. 2 Simplify (sqrt(110)-2-4 - sqrt(110))/(sqrt(250) + sqrt(250)-1 + sqrt(250) + sqrt(250)). 7sqrt(11)/10 Simplify -4-2sqrt(605) - 35sqrt(605). -77sqrt(5) Simplify ((-51sqrt(7) - sqrt(7))1 - 6sqrt(112)-3)*2. 30492 Simplify ((-3-6sqrt(136))/(6sqrt(968)) + 4)*2. 24sqrt(17)/11 + 2089/121 Simplify (((sqrt(144)/sqrt(4) - sqrt(36)) + sqrt(36))/sqrt(2)-6)2 - (-4 + (sqrt(2) - 12sqrt(2))2 + -5). 655 Simplify ((6sqrt(102)1)/sqrt(6) - ((sqrt(136) - (-3sqrt(136) - sqrt(136)))/sqrt(8) + -4))*2. 8sqrt(17) + 33 Simplify (sqrt(14)/sqrt(2) + 0 + (sqrt(168)/sqrt(3))/sqrt(8) + -3(1 + sqrt(7))5 + -1)**	{ "pile_set_name": "DM Mathematics" }
-2.1 Round -6940930 to the nearest one hundred thousand. -6900000 What is 0.00010370467273 rounded to 6 decimal places? 0.000104 What is -0.0009530479649 rounded to 5 dps? -0.00095 What is -0.0970050596 rounded to 6 dps? -0.097005 Round -199497.0198 to the nearest one thousand. -199000 What is 0.0000670497411 rounded to five dps? 0.00007 What is 42378.603 rounded to the nearest ten? 42380 What is -54.116948 rounded to 1 decimal place? -54.1 What is 0.001827376611 rounded to five decimal places? 0.00183 What is 6659246.7 rounded to the nearest 100000? 6700000 What is 2765998000 rounded to the nearest one million? 2766000000 What is -552731290 rounded to the nearest one million? -553000000 Round 21374832 to the nearest 1000000. 21000000 Round 0.0913710112 to 3 dps. 0.091 Round -5208680.43 to the nearest 100. -5208700 What is 0.203540613 rounded to 5 dps? 0.20354 What is 0.003814752066 rounded to 4 dps? 0.0038 What is 2016881.193 rounded to the nearest 100000? 2000000 Round -0.000015831511 to 6 decimal places. -0.000016 What is -15356.0042 rounded to the nearest 1000? -15000 Round 0.0233424821 to four dps. 0.0233 Round 0.146127904 to one dp. 0.1 Round 0.0001746719603 to 4 dps. 0.0002 What is 52314655.6 rounded to the nearest one million? 52000000 Round -0.000709554457 to six decimal places. -0.00071 What is 679119.8 rounded to the nearest ten thousand? 680000 What is -0.00353331425 rounded to 6 decimal places? -0.003533 Round 0.0005597295 to three dps. 0.001 What is 0.00002551069376 rounded to seven dps? 0.0000255 What is 0.000469167628 rounded to seven decimal places? 0.0004692 Round -10.02149026 to zero decimal places. -10 Round 0.14477740408 to two dps. 0.14 What is -1848.93908 rounded to the nearest 10? -1850 Round -0.196044934 to 1 decimal place. -0.2 What is -7351.83695 rounded to the nearest ten? -7350 What is -101168.46 rounded to the nearest one thousand? -101000 Round 0.004970586772 to 5 dps. 0.00497 What is -747186608 rounded to the nearest 10000? -747190000 What is -3221532.1351 rounded to the nearest 100? -3221500 What is 6.5387579 rounded to three dps? 6.539 Round 137796912 to the nearest 1000000. 138000000 Round -0.000018829826143 to 7 dps. -0.0000188 What is 1.0694813 rounded to 1 dp? 1.1 What is -834.608131 rounded to the nearest integer? -835 What is 69358.2304 rounded to the nearest one thousand? 69000 Round 548.302374 to the nearest ten. 550 What is 0.0000240257888 rounded to 7 decimal places? 0.000024 What is 0.0000120977241 rounded to 5 dps? 0.00001 Round -230467555.6 to the nearest 100000. -230500000 Round -13.7362194 to three decimal places. -13.736 What is 4553813377 rounded to the nearest one million? 4554000000 Round -0.0003488225307 to 7 decimal places. -0.0003488 Round 139773776.1 to the nearest 1000000. 140000000 Round 4396733.331 to the nearest one hundred. 4396700 What is -1661743200 rounded to the nearest 1000000? -1662000000 What is -0.01592376108 rounded to 5 dps? -0.01592 What is -0.00393987661 rounded to seven dps? -0.0039399 What is -2524651.152 rounded to the nearest one million? -3000000 What is 8597.6439 rounded to the nearest ten? 8600 Round 0.147816313 to two decimal places. 0.15 What is 17.07782138 rounded to 2 decimal places? 17.08 What is 2.49524353 rounded to the nearest integer? 2 Round -835.686825 to the nearest ten. -840 Round 3129121.547 to the nearest 100. 3129100 Round 104329.9888 to the nearest ten thousand. 100000 Round -83.96212052 to three decimal places. -83.962 What is 28685.053 rounded to the nearest 1000? 29000 Round -0.0000003544128434 to seven dps. -0.0000004 What is -0.1092404688 rounded to two decimal places? -0.11 What is -0.91233784 rounded to zero dps? -1 Round -43671.8422 to the nearest one hundred. -43700 Round -473.2744473 to 0 decimal places. -473 What is 32168.4622 rounded to the nearest ten? 32170 Round -416288.0524 to the nearest 100. -416300 What is 50288566.62 rounded to the nearest one thousand? 50289000 Round -0.000100524297 to seven decimal places. -0.0001005 Round 253435.6151 to the nearest one hundred. 253400 What is -3394.3187 rounded to the nearest 1000? -3000 Round 1.3457131 to two decimal places. 1.35 What is -160.071577 rounded to 0 dps? -160 Round 0.00883156105 to 5 dps. 0.00883 Round -89296874 to the nearest one hundred thousand. -89300000 What is 0.0015330671 rounded to 4 dps? 0.0015 Round 0.0004522913372 to six decimal places. 0.000452 Round 805529680 to the nearest 1000000. 806000000 What is 47777717 rounded to the nearest one million? 48000000 What is -0.0000101543358 rounded to seven dps? -0.0000102 Round 4490.830596 to the nearest 1000. 4000 What is 0.00008963786 rounded to 3 decimal places? 0 What is -1.5916647 rounded to 3 decimal places? -1.592 What is -0.004538313138 rounded to four decimal places? -0.0045 Round 897286.226 to the nearest one thousand. 897000 Round -0.00113568429 to 6 dps. -0.001136 Round 376.495357 to two decimal places. 376.5 Round 52440699 to the nearest 100000. 52400000 What is 23349777.3 rounded to the nearest ten thousand? 23350000 Round 31.5544938 to 1 decimal place. 31.6 What is -8722972.4 rounded to the nearest 1000000? -9000000 What is 0.0012699081046 rounded to five dps? 0.00127 Round 0.00125937497 to 4 dps. 0.0013 What is 0.0001145980922 rounded to 5 dps? 0.00011 What is -0.1984407945 rounded to three dps? -0.198 Round 34550678.5 to the nearest one thousand. 34551000 Round -17939733.546 to the nearest one million. -18000000 What is 45359798.9 rounded to the nearest ten thousand? 45360000 What is 8227808500 rounded to the nearest 1000000? 8228000000 Round -0.0000003593132202 to seven decimal places. -0.0000004 Round -2.22919107 to three dps. -2.229 Round -14.62531778 to 2 dps. -14.63 Round 94056.7679 to the nearest one hundred. 94100 Round 0.00104424121 to 7 decimal places. 0.0010442 What is -164014278.05 rounded to the nearest 1000000? -164000000 What is -7469819832 rounded to the nearest one million? -7470000000 What is -3772379.5 rounded to the nearest one million? -4000000 Round 7141.974024 to the nearest one hundred. 7100 Round -807114850 to the nearest one million. -807000000 Round 561091610 to the nearest 100000. 561100000 What is 37.342044 rounded to 0 dps? 37 What is -63.768393 rounded to the nearest one hundred? -100 Round -3658325420 to the nearest 100000. -3658300000 Round -1182799.912 to the nearest 100. -1182800 Round -322463.301 to the nearest 10000. -320000 What is -2.6695671 rounded to one decimal place? -2.7 Round -244.3261598 to the nearest integer. -244 What is 0.00646715043 rounded to 3 decimal places? 0.006 What is -7583.7114 rounded to the nearest one hundred? -7600 What is 240885866 rounded to the nearest 100000? 240900000 Round 65366.3063 to the nearest 10000. 70000 Round 902216.17 to the nearest one thousand. 902000 What is -3580620.1 rounded to the nearest 100000? -3600000 Round 0.0000341161547 to 6 dps. 0.000034 What is 47188.78516 rounded to the nearest ten? 47190 Round 1.24028106 to the nearest integer. 1 What is -690.78504 rounded to the nearest 10? -690 What is -3872.68878 rounded to zero dps? -3873 Round -61539.58212 to the nearest 1000. -62000 What is 192461.46 rounded to the nearest ten thousand? 190000 Round -36.7546929 to 2 dps. -36.75 Round 0.00004537608 to four dps. 0 What is 4556327.49 rounded to the nearest one million? 5000000 What is 2889313.171 rounded to the nearest 10000? 2890000 What is 0.00000335438675 rounded to 7 dps? 0.0000034 Round -311284.94 to the nearest one thousand. -311000 What is -0.0000838306784 rounded to five dps? -0.00008 Round -638310.4214 to the nearest one hundred thousand. -600000 What is -7.13340353 rounded to 3 dps? -7.133 What is 80435912.95 rounded to the nearest 10000? 80440000 What is -118997.804 rounded to the nearest one thousand? -119000 Round 0.00005121620248 to 5 decimal places. 0.00005 Round 0.000000044550321 to seven decimal places. 0 What is -50191.4062 rounded to 0 decimal places? -50191 What is 0.1137298305 rounded to four dps? 0.1137 What is 8838413.52 rounded to the nearest one thousand? 8838000 Round -4823355.82 to the nearest 100. -4823400 Round 531.43172 to 1 decimal place. 531.4 Round 0.00000190595148 to seven decimal places. 0.00	{ "pile_set_name": "DM Mathematics" }
x = 34 - -12. Calculate the remainder when x is divided by 16. 14 Let z be -25 + (1 - -4 - 4). Calculate the remainder when 55 is divided by (-200)/(-14) + z/84. 13 Suppose 2l + 0 + 2 = 0. Let y be (-8)/2 + 1 + l. What is the remainder when 26 is divided by ((-14)/(-3))/(y/(-12))? 12 Let g = 4 - 0. Suppose 3v - 62 = 5a, -ga = -5v + 41 + 45. What is the remainder when v is divided by 4? 2 Let n(r) = 41r*2 - 2r - 2. Let l be n(2). Suppose x + x = l. What is the remainder when x is divided by 27? 25 Let r(y) = y*3 + 22y*2 + 20y + 10. Calculate the remainder when r(-21) is divided by 17. 14 Let z = -14 - -27. Suppose n = 6 - 1, -n - z = -2k. Let q = 22 - -13. Calculate the remainder when q is divided by k. 8 Let h = 5 + -3. Suppose 0k = -hk + 8. Suppose -kz + 71 = 4o - 9z, 4z - 4 = 0. What is the remainder when o is divided by 11? 8 Let l(r) = r3 - 2r*3 + 5r*2 - 2 + 6. Let k be l(5). Suppose -kp - p + 60 = 0. What is the remainder when 23 is divided by p? 11 Let t = -6 + 41. Let o(y) = y*2 + 17. Let n be o(0). Let g = n + -5. Calculate the remainder when t is divided by g. 11 Suppose 28 + 0 = 4c. What is the remainder when 25 is divided by c? 4 What is the remainder when 4(67/2 + 2) is divided by 9? 7 Let w(h) = 5h - 3. Let z(d) = d - 1. Let p(c) = -w(c) + 6z(c). What is the remainder when 11 is divided by p(9)? 5 Let c = -19 + 54. Calculate the remainder when 172 is divided by c. 32 Suppose 5i - 48 = 2i. Calculate the remainder when 41 is divided by i. 9 Let f(d) = -2d*2 - 6d + 4. Suppose -65 = -2x - 3x. Calculate the remainder when x is divided by f(-3). 1 Let h = 6 + 36. Suppose 0i - i = -11. What is the remainder when h is divided by i? 9 Suppose -2c + v = 3v - 336, 4c - 668 = -3v. Suppose -2q = 4u - 106, 0 = 5q - q - 4u - c. Calculate the remainder when q is divided by 23. 22 Suppose 4v = 3i - 36 + 7, -3i - 4v = -13. Let q be (2 + 8/(-6))6. Suppose -q = -2k + 2. Calculate the remainder when i is divided by k. 1 Calculate the remainder when 2 is divided by (1 + -3)1/(-2). 0 Suppose 0 = 3z - 4a - 5, -3z = -2z + 2a - 5. Let v(m) = -zm - 6 + 3m + 5m + 2m2. What is the remainder when v(-5) is divided by 7? 5 Let p be ((-235)/(-1))/(2/(-8)). What is the remainder when (-2)/(-5) - p/25 is divided by 20? 18 Let t = -2 + 4. Suppose 6 = 2j - 2l, -3j - 4l + 15 = 2j. Calculate the remainder when j is divided by t. 1 Suppose v + 2v = 15. Suppose -x = -vx + 76. What is the remainder when x is divided by 7? 5 Let z(k) be the first derivative of 3k2/2 - 2k + 1. Let n(w) = -w*3 - 9w*2 - 11w - 4. What is the remainder when n(-8) is divided by z(3)? 6 Let a = -13 + 8. Let g = a - -6. What is the remainder when 3 is divided by g? 0 Let p(a) = -7a3 + a + 4. Let b be p(-2). Suppose -x - 3 + 0 = -3g, -2g + b = 4x. Let d = 41 - 7. What is the remainder when d is divided by x? 10 Let k be (-6 + 4)(0 - 7). Let p(c) = -c3 + 22c*2 - 2c + 57. What is the remainder when (k/2)/(3/21) is divided by p(22)? 10 Let z(x) = -5x + 1. Let y be z(-1). Let t be 12/24/y. Suppose -tr + 37 = -3. Calculate the remainder when 29 is divided by r. 9 Suppose -3k + 3n = -0k - 27, -5k + 63 = n. What is the remainder when 35 is divided by k? 11 Let n(g) = g + 7. Let p(v) = 1. Let w(k) = -3n(k) + 21p(k). What is the remainder when 29 is divided by w(-5)? 14 Let r = -8 - -8. Suppose r = 2p + p - 3, 3p = -2x + 65. Suppose -5q + 137 = 3w, w - 4w - x = -q. Calculate the remainder when q is divided by 10. 8 Suppose -5s - 4 - 16 = 5o, 4s = 4. Let u(j) = -j - 2. Calculate the remainder when 8 is divided by u(o). 2 Suppose -3r + 114 = -60. Calculate the remainder when r is divided by 30. 28 Suppose 5h - 237 + 99 = -2u, -5h = 20. Calculate the remainder when u is divided by 8. 7 Suppose -t - 4q + 9 = -1, -4t + 2q = -94. Calculate the remainder when (20/(-8))/((-2)/52) is divided by t. 21 Suppose -3p = p - 72. Let w = -13 + p. Calculate the remainder when w is divided by 3. 2 Suppose -3h + 3i = -2i - 123, -h + 5i = -31. Calculate the remainder when h is divided by 16. 14 Suppose 4f = f + 78. Let t = 5 - -9. Calculate the remainder when f is divided by 132/14 + (-6)/t. 8 Suppose -55 = -2o - 1. What is the remainder when o is divided by 14? 13 Suppose 0 = -h + 2h - 14. Let o be (-30)/96/5. Calculate the remainder when (o/10)/(2/(-130)) is divided by h. 12 What is the remainder when 214 is divided by (1 + -55)(-25)/50? 25 Let b(l) = 0l - 4l - 5l*2 + 3l - l2. Let d be b(-1). Let t = 39 + d. Calculate the remainder when t is divided by 12. 10 Let w(b) = -b - 1. Let x be w(-6). Let o(g) = g3 - 5g2 + g + 12. What is the remainder when o(x) is divided by 1 + 0/1 - -5? 5 Suppose 8n + 272 = 16n. Calculate the remainder when 132 is divided by n. 30 Let g = -6 + 13. Let l = 14 + g. What is the remainder when 82 is divided by l? 19 Let t(s) = -s - 3. Let r be t(-3). Suppose -z = -3z + 2p + 10, r = -2z + 5p + 13. Calculate the remainder when 14/(1(-4)/(-2)) is divided by z. 3 Let s = 62 + -110. Let o = 70 + s. Calculate the remainder when 63/64/1 is divided by o. 20 Suppose 2i + 30 = 5i. Let k = 3 + 0. Suppose -6w + kw + 54 = 0. Calculate the remainder when w is divided by i. 8 Let m(b) = 8b + 49. What is the remainder when 30 is divided by m(-5)? 3 Suppose -3u - 61 = -4m + 42, 50 = 2m - 2u. What is the remainder when m is divided by -4 + -2 + 20 + 2? 12 Suppose 4b - 36 = -8. Let k = 24 + -11. What is the remainder when k is divided by b? 6 Suppose -5i + 0i + 165 = 0. Let t = i - 18. What is the remainder when 59 is divided by t? 14 Suppose -5a = -a + 3m - 60, -4a = 2m - 56. What is the remainder when a is divided by 6? 0 Suppose -7p = -2p - 40. Calculate the remainder when 14 is divided by p. 6 Let c(n) = -4n. Let j be c(-1). Suppose -3i + 73 = -0h - jh, -h = i - 15. Calculate the remainder when i is divided by 10. 9 Suppose 4y = 3d + 2y - 295, 5y + 495 = 5d. Suppose -d = -3r - 1. What is the remainder when r is divided by 17? 15 What is the remainder when ((-4)/(-1))/(18/153) is divided by 9? 7 Let w(p) = -p3 - 4p*2 - 4p + 4. Calculate the remainder when w(-4) is divided by 6. 2 Let v = -42 + 77. Suppose -5k + 5z + v = 0, -19 = -5k - z + 34. Calculate the remainder when 29 is divided by k. 9 Let k(s) = -3s + 4 - 2s + 2s. Let i be k(3). Let q = 2 - i. Calculate the remainder when q is divided by 4. 3 Suppose 235 + 80 = 3m. Suppose -2w + m = w. Calculate the remainder when w + 1 - (1 - 3) is divided by 10. 8 Let c(l) = 8l - 20. What is the remainder when 82 is divided by c(4)? 10 Suppose 71 = 4z - 9. Calculate the remainder when 116 is divided by z. 16 Let u(z) = z*3 - 11z*2 + 13z - 22. Suppose 5l - 21 = -4m, -2l = -3m + 10 - 0. What is the remainder when (-84)/9(-6)/m is divided by u(10)? 6 Let i = -55 + 184. What is the remainder when i is divided by 26? 25 Suppose 3i + i - 132 = 0. Let d = 9 + i. What is the remainder when d is divided by 15? 12 Suppose y - 18 = 4w, -3w - 2 = 3y + 4. Calculate the remainder when w/((-16)/68)5 is divided by 22. 19 Suppose 2z - 2 - 18 = 0. Calculate the remainder when z is divided by 3. 1 Suppose t = -3t + 212. Suppose 56 = -i + 5i. What is the remainder when t is divided by i? 11 Let v(p) be the second derivative of p5/10 + p4/2 - p3/3 + 2p*2 - 2p. Let i be v(-5). Calculate the remainder when 34 is divided by 6/(-21) + i/(-7). 10 Suppose -11t = -17t + 480. Calculate the remainder when t is divided by 29. 22 Let z = 155 - 88. Calculate the remainder when z is divided by 17. 16 Suppose -k + 19 = -3s, 0k + k + s = 7. Let i(c) = 4c. What is the remainder when k is divided by i(1)? 2 Suppose 2q + 0q + 4s - 68 = 0, q + 5s - 31 = 0. Calculate the remainder when q is divided by 13. 10 Suppose -44 = -4y - 0. What is the remainder when 43 is divided by y? 10 Calculate the remainder when 43 is divided by 11/(-3 - 4/(-1)). 10 Let w = -1 + 3. Suppose -wh - 18 = -5h. What is the remainder when 1 is divided by (2/h)/(1/3)? 0 Suppose 5t - 4b = 0, t - b + 1 = -0t. Let o be 66 + (2 - 0)/1. Suppose 0 = -ta + 8*a - o. Calculate the remainder when a is divided by 9. 8 Ca	{ "pile_set_name": "DM Mathematics" }
s (894/(-10))/37955/(-1406444) + (-4)/26? 1/68 Evaluate ((-38)/570)/(57/684). -4/5 (-15/10)/(259675/4810 + -54) 37 Calculate ((-7940)/5955)/((-8)/(-402)). -67 Calculate 49-1(-1)/(-117) + (860/(-90) - -10). 1/39 Evaluate (1 + (-117)/90)/((-28)/2240). 24 (20/(-120))/((-10320)/(-774)) -1/80 What is (52/(-54))/((-195)/5265)? 26 ((-5)/(-6))/((-8967)/26901) -5/2 What is ((-10 - (-493)/34)/(10/8))/(2/(-10))? -18 Calculate 834/12 - (0 + (-216)/(-112) + 20/(-14)). 69 What is the value of 322/(-22) + (-5369)/(-413)? -18/11 Evaluate 441/84((-77)/21 + 4) - 282/152. -2/19 (26545/(-53090))/(471/(-4)) 2/47 Calculate (2 + -24)710/(-781) - 32. -12 What is (-7)/(-196)-6 + (-154628)/(-2408)? 64 93 + (-800)/50 - 57 20 Calculate 273/(-105) + 144/(((-1125)/(-20))/(-15)). -41 Evaluate ((-35937)/(-484) + -75)(4/(-13))/(-1). -3/13 What is the value of (2612/27426)/(20/(-14))? -1/15 (-482139)/7653 + 29/1 -34 Calculate (106 - 154 - 185/(-5)) + -73 + 1. -83 What is the value of ((-12)/9)/(33 - 11910/360)1? 16 Evaluate ((-22)/3)/((-8530)/(-4265)). -11/3 Calculate -11 + 2/(-1) - (51 - 37 - -5). -32 What is (((-20)/5)/(-1380))/((-69 - -42)/135)? -1/69 Evaluate 10(315/30 - 11). -5 Calculate (-1 - -14) + -23 + (100793/594)/17. -1/54 What is (732412/(-3772) + 194)(-4)/14? 2/41 What is the value of (1 + 1)/((72/96)/((-9)/24))? -1 Calculate (6 - (-663)/(-143))110/10 + -168. -153 (-705)/(-20)(-3760)/(-1410) - -30 124 What is 555(-15)/(-540)((-19)/(-152) + 84/(-160))? -37/6 What is the value of ((-2484)/(-162) - 15)(-36)/8? -3/2 2 + (-7)/3 - (-98 - (-6363)/189) 64 (903/55 - 392/49)5 + 23/(-253) 42 Calculate ((-35)/15 + 4)(-3)/(7 + 16/(-3)). -3 Calculate (-2)/6 + (-4)/(-17) + (-3204824)/(-29534712). 2/191 What is (-109)/(-3597) + -3(-293)/396? 9/4 Calculate ((-588)/154 + (-6)/33)(-7)/2. 14 What is the value of (-2)/22 - ((-1042)/88 - -13)? -5/4 Evaluate 833/((-139)/(10286/(-629))). 98 What is the value of -11 - (-143)/86967? 2/79 (414/12)/(4344/3258) 7/2 10260/35055(6 - (-175)/(-30)) 2/41 Evaluate (-2224)/(-48) - (-130)/(-39). 43 2061/(-458)(-44)/9 22 What is the value of (136/(-14) + -100 + 110)(3 + 70/(-24))? 1/42 What is (-76)/133((-8)/((-16)/(-6)) + -25)? 16 What is the value of ((-35)/56)/(1050/9660)? -23/4 (-32)/10-144526/(-1768) -68 Calculate 1824/76608 - (-836)/(-21000). -2/125 Evaluate ((-7)/((-294)/7) - 2/(-4))(-24948)/(-504). 33 Calculate ((-152)/(-90) - 472/(-4248))/(4/(-180)). -81 Calculate (40/((-3440)/(-5289)))/(6/(-4)). -41 Evaluate (-4 - -10) + -5 + -30(-2)/20. 4 What is the value of (105/6 + (-281 - -256))/(-15)? 1/2 What is the value of (-176)/(-2112)(-4 + 22) + (-31)/8? -19/8 What is the value of 728/(-676) - 14784/(-546)? 26 What is the value of (-500)/140798/95? -30 Evaluate (-8 - (-287)/(-7)1) + (12 - 1) + -4. -42 What is the value of 680/26180 + 8553/(-231)? -37 What is (-4)/(480/18)(-336)/(-504)? -1/10 Calculate 46 - -8016(-32)/1536. -121 -68/(-26664)71/((-497)/(-154)) 4/101 What is (-78)/651615/(-306)-6? -38 What is (644/(-828))/(((-115)/495)/23)? 77 Calculate 32/288(-9 - -72). 7 960/480(-4)/12-129 86 ((-45)/5 + (-583)/(-106))/((-1)/14) 49 What is -516((-3514)/(-84) - 42)? 86 (-14177/70210)/((4 + -1)/(-15)) 3/17 (-1 + 1 - -3)/(-32 + 33) + (-16)/(-12) 13/3 46/(32200/(-2060)) + 6 + -3 2/35 Calculate (-71)/426 + ((-3)/(-12))/((-210)/(-1940)). 15/7 (7/42)/(-1(-208)/(-156)) -1/8 What is ((-3291351)/3420)/113 - 2/24? -43/5 ((-3240)/(-144))/(513/38) 5/3 Calculate ((-3)/9)/((25 - (-1001)/(-39))4/(-48)). -6 Evaluate (27/90)/((-48)/32). -1/5 Calculate 1/(-4)98348/549927. -2/129 Calculate (146/57 - 2) + ((-414)/38 - 6017/(-547)). 2/3 Calculate (-2952)/(-40296) + 2110/(-2415). -1/73 Evaluate 111 + (18 + (0 - 5))/(551/(-493)). -12/19 What is ((-501872)/(-542201))/((-28)/(-264))? 96/11 (213/(-1136))/(6435/3120) -1/11 Evaluate (-1)/((-2994)/1044 - (-8)/(-144)3 - -3). 29 Evaluate 619444/464583(93/(-4) + (0 - 0)). -31 Evaluate (239/478)/(11/(-66) + 41/264). -44 What is the value of 8/(125/(-63375)104)? -39 Evaluate (-1090)/(-26) + (-12625)/(-164125). 42 (5 + 57/(-12) - (-105)/84)(-11 + 5) -9 What is the value of (-3)/10 - (5386/(-360) + (-2355)/(-157))-2? -2/9 What is 1 + 15 + 6 + 13 + (-44)/11? 31 What is -5067 - -4976 - (-40947)/450? -1/150 4914/7938189/24 39/8 Calculate (-536)/21574(-777)/(-222). -2/23 Calculate 94 - (62 - 17375/(-550)). 9/22 Calculate 312/(-1144) - (-408)/44. 9 What is 2821/(-806) - -1292/(-8)? -40 What is ((-4)/19)/(162/(-90) - (-1378)/1060)? 8/19 Evaluate (1 - (-85)/(-25))(20 + -25) - 13. -1 What is (-86633)/(-4226) + (-3510)/172? 4/43 Calculate 324/(-1458) + 1(-62)/(-522). -3/29 ((624/56)/(-3) + 6)/(55/77) 16/5 (398 - 560)(((-55)/10)/(-11))/(-1) 81 (3 + -2)(0 + -11 - -668/(-51)) -19 What is the value of (14 + 15)/(-957)(12 + 0 + 0)? -4/11 What is 64/(-176) + 16 + 973/(-77) + -43? -40 What is the value of (-43)/129 + (5856/(-864))/(2/12)? -41 (25895/(-370) - (-2 - 26)) + 27 - 30/(-2) 1/74 What is the value of ((-1473)/19640)/((-2)/(-2) + 0)? -3/40 What is -2 + 13 + ((-108)/(-90) - (-1334)/(-110))? 4/55 What is the value of (-19206)/3927 + (-24)/(-136) - -7? 16/7 (166/(-14) + 1)/((-2318)/133 + 16) 38/5 What is the value of (-988)/(-54834) - (-20997)/(-999) - (-675)/32? 3/32 32214/(-1976) - 30/(-2) - 5/(-4) -1/19 Calculate (-1722)/(-2460) + 278/(-340). -2/17 Calculate (-957)/11484-1448. 56 What is ((-28)/(-28))/(2/(-2))? -1 Evaluate (13 - (6 - 8))/((-1)/31). -45 1414/21-18(-33)/(-396) -101 What is (-1290)/(-16 - -59) - 416/(-14)? -2/7 What is (-14)/18(-117 + 55760/476)? -1/9 Evaluate ((-13)/((-195)/27))/(-21 + (-6919)/(-330)). -54 What is the value of (456/133)/(-4) + (-7)/(-735)6? -4/5 What is 3/((-12)/8) + -87 + 85 - (0 + 61)? -65 Evaluate 10 + (-352)/(-22) - (29 + -4). 1 Evaluate (388/12)/(1 - (8/(48/50) - 7)). -97 Calculate (-24)/(-63)43785/(-45870). -4/11 392/28 + 1645/(-35) -33 What is (84/(-84))/(112/80 + 885/(-650))? -26 What is 20 - (240/144)/((-5)/6(-39)/(-117))? 26 Calculate -13 - ((-6303)/99 + 49). 5/3 Calculate 6/8 - (23 - ((-11529)/(-532) - -1)). 8/19 What is the value of (2/(-9))/(214/(-19260)) - 57? -37 What is ((-5712)/(-14280))/((-9)/480)? -64/3 Evaluate 69750/175950 + 12/(-34). 1/23 (-9)/84(60 + 3400/(-60)) -5/14 (343/266 - (-44)/209)(-1)/(-3) 1/2 What is the value of (14 - 0) + -11 + 1403/(-1495) + -2? 4/65 What is the value of (1/(-1074))/(115/55256/70)? -1/179 Evaluate 80/24 + 18469/(-8760) + (204/(-40) - -5). 9/8 (354/20)/((-26)/((-8710)/(-201))) + 21/(-6) -33 What is ((-1672)/(-55) - 12)((-315)/(-18) - 15)? 46 Calculate 12/92(-285)/(-855). 1/23 Evaluate (-5 + (-105)/(-20))(-50 - -65 - -389). 101 Calculate ((-33)/(-12))/(10302303/(-26664)). -2/281 What is ((-94)/(-517))/((-35)/(-55))? 2/7 Calculate (-155)/((-35340)/(-2128)) - (4 + -18). 14/3 What is (11/5724)/(240/312)? 1/10 What is the value of 1/15(-652 + 608)/(24/15)? -11/6 Calculate (9/75 + 546/11700)/(-3). -1/18 Evaluate 283426/12870 - (11 - -2) - 9. 1/45 (-230806)/(-110519) - 7/(-21)-6 - 12/174 2/103 (64484/(-3087))/(50/(-15) - -6) -47/6 Evaluate (-33)/(-1122)3413 + (-23)/2. 3/2 (-4(-3)/(-14))/(-1742486/16632 - -26) 108 What is (-208)/(-174) + (-508)/(-3683)? 4/3 Calculate ((-1132461)/6642)/((-11)/(-4)). -62 Calculate (-3)/(6/94) - (-35)/(315/72). -39 Calculate (-1)/(-47)(-4)/(1152/(-143)). 1/47 Evaluate (-154)/(-21)206/824. 11/6 Evaluate (4610/33192)/((-1)/28) - (-3 + 1). -17/9 ((-820)/(-60) + -11)108/48 - -53 59 Evaluate (60435/36261)/(1/425). 14 What is -22 + (-14 - (-4 - -8) - -14)/(-4)? -21 Evaluate (-98)/112(1653/(-133) - -12). 3/8 Calculate -8(10 + -10 + 943/(-184)). 41 (-1725)/(-135) - (-39)/(-3) -2/9 (-12)/(-14)7658/16415/(-6) -10/3 Evaluate ((-12)/56)/((-2990)/182 + 17). -3/8 (22/((-8448)/(-3360)))/((-5)/(-44)) 77 Evaluate 2475/330(3 + (-11)/(-3)). 50 Evaluate 220/(-108)(-139)/(-278)(-6 - 0) - 5. 10/9 What is -285(-196)/(-1190) + 10/(-170)? -47 What is the value of (-3)/(-7)2016/64(-748)/(-198)? 51 6/99 - (-146)/(-12045)-1975 24 Evaluate (-51546)/10366 + (11/22)/(-1(-1)/10). 2/73 What is (-28)/4(-18 - (-20 + (-272)/(-119)))6? 12 Evaluate 261/19 - ((-411)/(-27) + 40/(-180)). -24/19 What is the value of -4(-25256)/(-2706)24/(-7)? 128 What is 180/(-33)*(34	{ "pile_set_name": "DM Mathematics" }
0 for c. 2 Solve -28f = 48f + 684 for f. -9 Solve -35h + 30h + 30 = 0 for h. 6 Solve 0 = -28d + 89 + 51 for d. 5 Solve 37m - 39m = -2 for m. 1 Solve -873q = -892q + 133 for q. 7 Solve -18b - 81 - 9 = 0 for b. -5 Solve -4x + 1661 = 1693 for x. -8 Solve -313f = -286f - 189 for f. 7 Solve 7p - 26 + 5 = 0 for p. 3 Solve -876w + 6 = -873w for w. 2 Solve 68 = 214f - 231f for f. -4 Solve 0 = f - 7f + 12 for f. 2 Solve -92w + 160 - 436 = 0 for w. -3 Solve 56 = -526x + 518x for x. -7 Solve 0 = -15o - 7o - 44 for o. -2 Solve 80 = -22b - 8 for b. -4 Solve -8v + 28 = 4 for v. 3 Solve 79n + 396 = 13n for n. -6 Solve -66v = -74v - 48 for v. -6 Solve 0 = 50m - 158 - 142 for m. 6 Solve -86w + 77w + 27 = 0 for w. 3 Solve 87 = -45w - 138 for w. -5 Solve 0 = 16o - 7 - 73 for o. 5 Solve -6k - 23 = -5 for k. -3 Solve 0 = -4s + 40 - 20 for s. 5 Solve 12t + 74 = 14 for t. -5 Solve -a - 152 + 154 = 0 for a. 2 Solve 62r + 55 = 51r for r. -5 Solve -8t = 3t + 33 for t. -3 Solve 71a - 15 = 76a for a. -3 Solve -302 = 23q - 118 for q. -8 Solve -134r = -96r + 76 for r. -2 Solve 5r - 8r = 3 for r. -1 Solve 0 = 34p - 23p for p. 0 Solve -38m - 57 + 399 = 0 for m. 9 Solve 0 = 11b - 8b + 3 for b. -1 Solve -6z + 39 = 69 for z. -5 Solve -8k + 231 = 287 for k. -7 Solve -2s - s = 0 for s. 0 Solve 16c - 10c = -77c for c. 0 Solve -14l + 561 = 505 for l. 4 Solve -3x - 1 - 2 = 0 for x. -1 Solve 21w + 90 - 27 = 0 for w. -3 Solve 25 = -471g + 466g for g. -5 Solve 172p + 134 = 105p for p. -2 Solve 43v - 41v - 8 = 0 for v. 4 Solve -108 = 24c - 6c for c. -6 Solve 0 = 5m + 26 + 4 for m. -6 Solve -441 + 435 = 3i for i. -2 Solve 15y - 1 = 14y for y. 1 Solve -16d + 42d - 104 = 0 for d. 4 Solve -7b - 6 = -b for b. -1 Solve 0 = -7f - 10 + 3 for f. -1 Solve -65 = 15g - 140 for g. 5 Solve -98f - 78 = -72f for f. -3 Solve -129 = -5o - 89 for o. 8 Solve -59s - 300 - 54 = 0 for s. -6 Solve -3f = -202 + 205 for f. -1 Solve -25x = -33x - 8 for x. -1 Solve 0 = 4c + 8 - 20 for c. 3 Solve 0 = 4h + 197 - 213 for h. 4 Solve -56j + 61j = -20 for j. -4 Solve 0 = -2n - 4 + 10 for n. 3 Solve -19x = -28x - 27 for x. -3 Solve l = 3l - 7l for l. 0 Solve 18g - 16g - 6 = 0 for g. 3 Solve -52o = -8 + 216 for o. -4 Solve 15w = 14w - 4 for w. -4 Solve 0 = g + 6g - 14 for g. 2 Solve 46 = -3i + 43 for i. -1 Solve -25 = -x - 29 for x. -4 Solve -9f - 14 = -2f for f. -2 Solve -46g - 83 = 101 for g. -4 Solve 88h = 204 + 412 for h. 7 Solve -4m = m + 3m for m. 0 Solve -2v - 3v + 25 = 0 for v. 5 Solve -376 = -7f - 348 for f. 4 Solve 20 = -5d - 0 for d. -4 Solve 0 = -2m + 1096 - 1100 for m. -2 Solve 39 = w + 44 for w. -5 Solve 0 = -3i + 22i + 152 for i. -8 Solve -459o = -451o + 32 for o. -4 Solve 0 = 4f + 2 - 18 for f. 4 Solve 741 - 729 = -4x for x. -3 Solve -3 = -6h + 9h for h. -1 Solve 72v = 73v - 6 for v. 6 Solve -11t = -19t + 48 for t. 6 Solve 7 = -7a + 21 for a. 2 Solve -101s + 94s = 0 for s. 0 Solve 10 = -19x + 17x for x. -5 Solve 22k - 6k = 9k for k. 0 Solve -84 = 20v - 164 for v. 4 Solve -16 + 17 = -n for n. -1 Solve 77q - 81q = 0 for q. 0 Solve -9u + 29 - 20 = 0 for u. 1 Solve 82 = 5b + 77 for b. 1 Solve -2z - 11 = -1 for z. -5 Solve 14z - 16 - 68 = 0 for z. 6 Solve -941 = o - 946 for o. 5 Solve 0 = 28k + 12k for k. 0 Solve 5a + a = -24 for a. -4 Solve 3f + 5 = 14 for f. 3 Solve 0 = -94b + 107b - 65 for b. 5 Solve 0 = 4v - 12v + 24 for v. 3 Solve 0 = 3g + 12g - 45 for g. 3 Solve 4 - 4 = -13r for r. 0 Solve -4k - 4k = 8 for k. -1 Solve 14t = -t - 30 for t. -2 Solve -2y = 18 - 14 for y. -2 Solve 0 = 20n - 40n + 20 for n. 1 Solve 90 = 92f + 274 for f. -2 Solve 312 = 5u + 322 for u. -2 Solve 37v - 10 + 121 = 0 for v. -3 Solve -161 - 7 = 42p for p. -4 Solve -12z = -15 - 33 for z. 4 Solve -4j + 851 = 827 for j. 6 Solve -112y - 14 = -105y for y. -2 Solve 1990q - 1983q = 14 for q. 2 Solve 6k = 18k - 72 for k. 6 Solve 0 = -2i - 4i + 24 for i. 4 Solve -3v = 7v - 10 for v. 1 Solve -16 + 40 = -4s for s. -6 Solve 29 + 9 = -19g for g. -2 Solve -49 = -4q - 57 for q. -2 Solve -75n = -60n + 120 for n. -8 Solve 8g - 20 = -4 for g. 2 Solve -277 + 394 = -13v for v. -9 Solve -19o + 11o = -8 for o. 1 Solve -32b - 45 = 19 for b. -2 Solve 8u = 2u + u for u. 0 Solve 0 = -18u + 6u + 36 for u. 3 Solve -16r - 20 = -6r for r. -2 Solve -633 + 545 = 22b for b. -4 Solve 8 = 33d - 25d for d. 1 Solve 17u - 2u = 0 for u. 0 Solve 0 = 5t - 4t - 2 for t. 2 Solve 48a = 61a for a. 0 Solve 304b - 12 = 316b for b. -1 Solve -17l + 10 = -7l for l. 1 Solve 0 = -4g - 2 + 22 for g. 5 Solve -48h + 59 = -325 for h. 8 Solve 0 = -32l + 582 - 422 for l. 5 Solve -53 = -8r - 85 for r. -4 Solve -11 + 9 = -2i for i. 1 Solve -7q - 3 - 4 = 0 for q. -1 Solve -49 = -12b - 169 for b. -10 Solve 23r - 5 = 22r for r. 5 Solve -369o - 70 = -355o for o. -5 Solve -2f - 8f = 50 for f. -5 Solve 109c + 36 = 118c for c. 4 Solve -2b - 4b = 36 for b. -6 Solve -28 + 8 = -5d for d. 4 Solve 39 - 179 = -20l for l. 7 Solve -6 - 12 = 18z for z. -1 Solve 3f = -0 - 6 for f. -2 Solve 3a = -6a for a. 0 Solve 0 = 223q - 214q for q. 0 Solve 11h - h + 30 = 0 for h. -3 Solve 100j = 111j + 77 for j. -7 Solve -8l + 13l = 5 for l. 1 Solve 22 = 15d - 38 for d. 4 Solve -8c + 3c = -25 for c. 5 Solve 25 = 6m + 55 for m. -5 Solve 0a + 11a = -55 for a. -5 Solve 53c = 61c + 16 for c. -2 Solve -22 + 70 = 6x for x. 8 Solve 5x - 2x + 12 = 0 for x. -4 Solve -11p = -8p for p. 0 Solve 3z + 433 - 418 = 0 for z. -5 Solve 0 = 6d - 8d + 10 for d. 5 Solve -5u = 4 + 16 for u. -4 Solve 0 = 5v - 27 + 47 for v. -4 Solve 3v + 31 - 22 = 0 for v. -3 Solve -69k + 60k + 18 = 0 for k. 2 Solve 2 = -5g + 12 for g. 2 Solve 0 = -z - 88 + 92 for z. 4 Solve -288w + 282w = 12 for w. -2 Solve -26s + 20 = -16s for s. 2 Solve -27n = -28n for n. 0 Solve 0 = -56y + 24 + 88 for y. 2 Solve 7a = -35 - 7 for a. -6 Solve -29z = -31z + 8 for z. 4 Solve 6k - 7k = -11k for k. 0 Solve -21u = -26u + 5 for u. 1 Solve 17 - 17 = -5y for y. 0 Solve -2w - 3 = w for w. -1 Solve 163t = 157t - 24 for t. -4 Solve 19 - 74 = 11v for v. -5 Solve 0 = 28h - 35h - 14 for h. -2 Solve -t = -0t - 4t for t. 0 Solve -5 + 21 = 16q for q. 1 Solve 117l - 105 = 132l for l. -7 Solve 4r - 134 = -114 for r. 5 Solve -13m + 10m = -12 for m. 4 Solve 0 = 2r + 22 - 16 for r. -3 Solve 30h - 27 + 57 = 0 for h. -1 Solve -105 = -8k - 13k for k. 5 Solve -2 = -3y - 8 for y. -2 Solve 34f - 19f = -75 for f. -5 Solve 0 = 17r + 281 - 332 for r. 3 Solve 4z - 17 = -13 for z. 1 Solve -1988w + 1995w = 14 for w. 2 Solve 5j - 7j - 6 = 0 for j. -3 Solve 6n - 43 + 19 = 0 for n. 4 Solve 3t - 12 + 27 = 0 for t. -5 Solve -54l + 73 = -143 for l. 4 Solve 0 = 42s - 40s + 12 for s. -6 Solve 36 = -31p + 25p for p. -6 Solve -59z + 5 = -60z for z. -5 Solve -37t - 10 = -39t for t. 5 Solve -3g - 12 - 6 = 0 for g. -6 Solve 11 = 27p + 200 for p. -7 Solve 112 = -758v + 730v for v. -4 Solve 33i = -28i + 366 for i. 6 Solve 62 = -97t + 35t for t. -1 Solve -4i - 10 - 6 = 0 for i. -4 Solve 7h + 21 = 35 for h. 2 Solve -63 = -11t - 10t for t. 3 Solve 66 - 45 = -7c for c. -3 Solve 25 = -5x - 0 for x. -5 Solve 18 = 14q + 4 for q. 1 Solve -79q - 26q + 420 = 0 for q. 4 Solve -4 = 113l - 112l for l. -4 Solve 0 = 7h + 21 - 7 for h. -2 Solve -255a = -257a - 10 for a. -5 Solve 0 = 52c - 126 - 186 for c. 6 Solve 3t - 14 = 17t for t. -1 Solve 5 = -44s + 39s for s. -1 Solve 23o + 316 = -135o for o. -2 Solve 367o - 363o - 16 = 0 for o. 4 Solve 0 = 9o + 27 - 63 for o. 4 Solve -29s = -31s for s. 0 Solve 14y = 9y + 25 for y. 5 Solve -89 = w - 88 for w. -1 Solve 0 = -12s - 78s - 180 for s. -2 Solve 119r = 14 - 14 for r. 0 Solve 14w + 25 - 53 = 0 for w. 2 Solve 19h - 10 = 21h for h. -5 Solve 0 = 174p - 44p - 1040 for p. 8 Solve 10s - 314 = -354 for s. -4 Solve -5 = -6v + 19 for v. 4 Solve -1355f + 76 = -1374f for f. -4 Solve -3594 = 13c - 3555 for c. -3 Solve 12g = -28g + 200 for g. 5 Solve -29c + 32 + 171 = 0 for c. 7 Solve -53 = 36g + 91 for g. -4 Solve 0 = 26*k - 41 - 63 for k. 4 Solv	{ "pile_set_name": "DM Mathematics" }
3474803 and -35. 236543474768 Total of -35222.08 and -94262115. -94297337.08 Work out -1582319 - -0.1654926. -1582318.8345074 Calculate 5 - -217.13038517262. 222.13038517262 What is the distance between -254927 and -26183772? 25928845 What is -0.04304 - 460156528.8? -460156528.84304 Add -538076233 and 3554. -538072679 -19092072957 - 3.8 -19092072960.8 -2058579 + 4257060 2198481 Subtract -221843478339 from -0.2. 221843478338.8 What is 345336.8 take away -64.947? 345401.747 Calculate -2449064492 - -120805. -2448943687 Add -53983 and -12.587177. -53995.587177 What is 161923 - -15201525? 15363448 What is 3265.36259793 less than 573? -2692.36259793 What is -74579736.8 minus -1.15? -74579735.65 -10022.278+70023422 70013399.722 What is the distance between -0.558556334 and 0.1? 0.658556334 What is 41897563752 less than -2.2? -41897563754.2 Calculate 235.54 - 7932874818. -7932874582.46 What is -19830108.4 plus -53.6? -19830162 Add 0 and 243295160409. 243295160409 Calculate 89 + -225.464392238. -136.464392238 What is 7707565585463 plus -2? 7707565585461 1104587+0.25394 1104587.25394 What is the difference between -4362694 and -1039797? 3322897 Work out -2225745 + -153.57966. -2225898.57966 Calculate 68664525984936 + 0.04. 68664525984936.04 Subtract 13.04893408149 from -1. -14.04893408149 Add together 2.43 and -0.053351580283. 2.376648419717 293080 - 109567 183513 -7.95173193837 - 0.3 -8.25173193837 Subtract -13970098310 from -355. 13970097955 What is 5613970029157 take away 0.4? 5613970029156.6 Work out -1742719.336 - -2. -1742717.336 Calculate -513620699328 - 0.2. -513620699328.2 What is 660197859540 take away -88? 660197859628 Sum -0.117 and 9823991386. 9823991385.883 What is 1480 less than -0.43120201? -1480.43120201 136659316 - -46760 136706076 What is 317 - 756663.0678? -756346.0678 What is -9.473741168 - 9305? -9314.473741168 Add together 6067344449 and 3.9. 6067344452.9 Calculate 1.401 - 5651042109.2. -5651042107.799 What is -965959.94 - 0.13597? -965960.07597 28271400 + 32.801 28271432.801 What is 12133181.2 - 48456? 12084725.2 Subtract 11015 from 30093931. 30082916 What is 9116567804 + -6? 9116567798 Put together 11 and -69587054692. -69587054681 What is 256107272 + -224.3525? 256107047.6475 What is -398 take away 1585622850? -1585623248 -11403.39 - 1906198.4 -1917601.79 What is -0.3510413 minus 2728605? -2728605.3510413 Subtract 128491 from -30053.06. -158544.06 Add together -2704 and -42952233.5. -42954937.5 What is -621.40871286 minus 0.31? -621.71871286 What is the difference between 5 and 195539.212389? 195534.212389 Add together -143406171240887 and -0.4. -143406171240887.4 Put together 0.0409758 and 421123. 421123.0409758 Total of 12951 and -4499392.36. -4486441.36 What is -52 - -850670979061? 850670979009 Sum -0.2 and 2457622096984. 2457622096983.8 Add -20812 and 0.4540147337. -20811.5459852663 Put together -24190 and 7160437. 7136247 What is 46791186 minus -6837.46? 46798023.46 Work out -16461856566 - -4. -16461856562 Total of 0.4 and 22378815692. 22378815692.4 What is -0.0466860239481214 + 2? 1.9533139760518786 What is -45740899.4 minus -0.07148? -45740899.32852 -891030 + -143.92006 -891173.92006 Work out -251409339 - 1514892. -252924231 What is 4530.56 less than -7.870137? -4538.430137 Sum -3 and -6108063544233. -6108063544236 Add -526.3 and 369565637. 369565110.7 Work out -16859 - -0.96609213. -16858.03390787 Add together -0.025365579 and 9.6025. 9.577134421 Add together -0.3 and -162150933.7184. -162150934.0184 What is -130233 take away -124155? -6078 What is the distance between -4386524941 and 0.11? 4386524941.11 Add together 55289504 and -176. 55289328 What is -1948 less than -78440273? -78438325 Calculate 23991488975291 - -0.2. 23991488975291.2 Put together 4669122800 and 0.06479. 4669122800.06479 What is 7848.8 minus 862042672? -862034823.2 What is the distance between -561 and -7326491957? 7326491396 Subtract -17 from -7675760917339. -7675760917322 Total of 396733 and 0.082054. 396733.082054 Work out 12.8745 + 3.0292818. 15.9037818 -339302018783+-0.1 -339302018783.1 What is -0.1475 - -102411094526? 102411094525.8525 Calculate 345.4 + 22775.84079. 23121.24079 -166366893+0.5385 -166366892.4615 What is -116.456896 minus 242.33? -358.786896 232814 + 1174.4082 233988.4082 What is 0.151817 minus 0.02536868? 0.12644832 Calculate 18429.268 + 1.582. 18430.85 What is the difference between 0.84 and 46475263870? 46475263869.16 What is 92238790373 plus 193? 92238790566 Work out 276729813646 + 3. 276729813649 12.752729662 + 67052 67064.752729662 Work out 1999 - 135539569646. -135539567647 Add together -235.2 and -131794796. -131795031.2 Work out -359041150 + 12. -359041138 Put together 37726575714567 and 0.3. 37726575714567.3 Work out 214842871 - 246491. 214596380 What is the distance between 16443 and -6387075912? 6387092355 2023 + 22060.3614 24083.3614 5.7448477+-12741.96 -12736.2151523 Total of 0.221761 and -5495260. -5495259.778239 What is the difference between -0.3 and -1548.3585181162? 1548.0585181162 Work out -740.355 + -607737418. -607738158.355 What is the distance between 0.1815507 and 570031? 570030.8184493 What is -12.19 plus -22032610962? -22032610974.19 Work out -2006 - 320.924625. -2326.924625 Work out 3138050 + -22420503. -19282453 Work out -1937 - 2044384193. -2044386130 What is the distance between 73830.8 and 25832025? 25758194.2 -11571897.97 - 0.152 -11571898.122 -0.0315838 - 0.01953666 -0.05112046 Calculate 65.997872 - 242489. -242423.002128 What is 0.151 + 2590806.12506? 2590806.27606 Subtract 31334 from -1881594. -1912928 Sum -3626 and 11081724.205. 11078098.205 4+-49920.155962 -49916.155962 Work out -55673064 - -24398. -55648666 -25713427880+40 -25713427840 What is -6 - -939891673969? 939891673963 What is 34 plus 29062781298914? 29062781298948 -110.41 + -100269.98 -100380.39 Calculate -121342 + 0.060058547. -121341.939941453 Put together 2 and -50.00479872242. -48.00479872242 Add together 0.138727119 and 0.060704. 0.199431119 Add together 1029298.516 and -1.514. 1029297.002 Calculate 23019.68737 + -821. 22198.68737 What is 0.12312421934 - 50.9? -50.77687578066 Subtract 870569 from -325293. -1195862 Subtract -943545614 from -126. 943545488 Work out -4.509 - -50696241267. 50696241262.491 Put together 3129834 and -11.75. 3129822.25 -11979604740538+14 -11979604740524 161 - 658954855 -658954694 Add 114920.96 and -2232430. -2117509.04 11355.7+-433631.3053 -422275.6053 Put together 3668.5991 and -615. 3053.5991 What is 1.63811663 less than -0.6093? -2.24741663 Put together -0.02870233 and 537874. 537873.97129767 Work out -722.9764419302 + -9. -731.9764419302 -1085301142095 + 11 -1085301142084 Calculate -0.083926612243 + 4. 3.916073387757 Work out -87 - 3161188.873499. -3161275.873499 Work out 0.064460406 - -830991. 830991.064460406 Calculate 706 + -212791758781. -212791758075 What is -4 minus 167431967553? -167431967557 What is the distance between 1311911929 and 118? 1311911811 Total of 0.44629785838 and 0.86. 1.30629785838 What is the difference between -1442.02 and -0.24749909? 1441.77250091 What is -923578748 plus 0.37024? -923578747.62976 What is 15874.35276952 plus 0.4? 15874.75276952 Calculate 0.7478496 - 0.04125082. 0.70659878 Put together 1.893251359 and -102. -100.106748641 What is 0.3 take away -0.0423073234903? 0.3423073234903 Work out -0.7964 + -2508707771. -2508707771.7964 What is -16465.5425 take away -4.2973? -16461.2452 What is 259099770.63 + -1987? 259097783.63 What is -0.2 - 9054156.87102? -9054157.07102 What is -8 minus -338730.8315? 338722.8315 0.1422 + -19457521144 -19457521143.8578 5 + -16142492793363 -16142492793358 What is -7.21 - -7100095928? 7100095920.79 What is the difference between 85200988287 and 51? 85200988236 What is -0.387455 plus 4261.90834? 4261.520885 What is -1467518 minus -19.24213? -1467498.75787 Calculate -66116 + -14896862.29. -14962978.29 -11676.6 + 404358 392681.4 What is -1.7 + 0.00377520079? -1.69622479921 What is -52002354 take away -1426? -52000928 -0.097816443126 + -239 -239.097816443126 Add together -342 and 118559002765. 118559002423 Calculate 5270085.6 - 597283. 4672802.6 What is -2965464911 minus 2361? -2965467272 Subtract -201.460029 from -575. -373.539971 Wha	{ "pile_set_name": "DM Mathematics" }
-2x + x = -52. Suppose 2z + 10 = x. Suppose 0 = -4w + z + 11. Calculate the remainder when 38 is divided by w. 6 What is the remainder when ((-27)/(-5))/(906/1510) is divided by 1? 0 Suppose -4c + 432 = -15k + 19k, -3k = -5c + 540. Let s(u) = -u*2 - 21u - 29. Calculate the remainder when c is divided by s(-16). 6 Let c(w) = w*3 - 20w*2 + 5w - 9. Calculate the remainder when 512 is divided by c(20). 57 Let z(h) = -2h2 - 27h + 138. Calculate the remainder when 152 is divided by z(-17). 0 Let m(w) be the second derivative of w5/5 + w4/12 + 7w3/6 - 27w*2/2 - 84w. Calculate the remainder when m(3) is divided by 38. 35 What is the remainder when ((-8)/50)/2 - (-36885)/125 is divided by 8? 7 Suppose 0 = -4i - 4x + x + 58, -4x = 8. What is the remainder when 909 is divided by i? 13 Let g(z) = z3 + z2 + 1. Let a(f) = 2f*3 - 5f*2 - 20f - 8. Let n(x) = a(x) - 3g(x). What is the remainder when n(-7) is divided by 45? 35 Let m(h) = -402h - 3408. What is the remainder when m(-11) is divided by 11? 2 Let u be ((-4)/(-6) + -1)/(10/60). Let f be (2 + -2)/(2 + u/2). Suppose -k + fk + 80 = 5x, k = 3x - 40. Calculate the remainder when 87 is divided by x. 12 Suppose -14 = 5y - 59. Let z(v) = v*2 + 2v - 5. Let m be z(-3). Calculate the remainder when y is divided by ((-40)/(-25))/(m/(-10)). 1 Suppose 0 = 9f + 81340 - 81412. What is the remainder when (-4)/14 + 410/14 is divided by f? 5 Suppose -82 = 3j + l, j + 3l = -18 - 20. Let v = j + 51. Calculate the remainder when 138 is divided by v/2 + 21/14. 12 Let d be 4/(-2) - (1 + 0). Let a = 46423 - 46417. What is the remainder when 82/d(2 + -5) is divided by a? 4 Suppose 3r - 5r + 32 = 0. Let c = 82 - 72. What is the remainder when 1 + (285/c - 2/(-4)) is divided by r? 14 Let z = 8081 + -6777. Calculate the remainder when z is divided by 87. 86 Suppose -65 = -6x - 683. Let a = x + 115. Calculate the remainder when 35 is divided by a. 11 Suppose -68r = 71r - 164r + 34600. What is the remainder when r is divided by 688? 8 Let b(u) = 35836u3 - 35835u*3 - 15 + 43 - 8u. What is the remainder when b(6) is divided by 101? 95 What is the remainder when 15181 is divided by 5375/344 + 6/(-32)(-6 + 4)? 13 Let l(s) = s2 - s + 35. What is the remainder when l(15) is divided by 50? 45 Let k = 977 - 530. What is the remainder when k is divided by 90? 87 Let w be -4 - -6 - (-6)/1. Suppose -140 = -wl + 3l. Suppose -3p - 7s + 82 = 0, -13p - 20 = -18p + 5s. Calculate the remainder when l is divided by p. 6 Let g = 18709 + -15866. What is the remainder when g is divided by 931? 50 Let n = -240852 - -240897. Suppose -3s = 2s - 1105. What is the remainder when s is divided by n? 41 Let h(f) be the third derivative of -7f4/24 + 43f*3/6 - 141f*2. Calculate the remainder when 71 is divided by h(4). 11 Suppose 3a - 6a = 5q - 1096, 0 = 2q - a - 434. Suppose 4m - q = -3t - 24, 58 = m - 4t. Calculate the remainder when m is divided by 18. 14 Let m = 242 + -193. Suppose 54j = mj + 95. What is the remainder when 130 is divided by j? 16 Let b(f) = f*2 - 2f + 16. Let s be 30/8 + 10/8. What is the remainder when 59 is divided by b(s)? 28 Let r(b) = 172 + 46b - 74 + 7b*2 - 81. What is the remainder when r(-8) is divided by 11? 9 Suppose 0 = -s - 5w - 9, -5w - 17 = 4s - s. Let v be (1 + 2)/((-6)/s). Calculate the remainder when -5 + v + -3 + (-96)/(-2) is divided by 11. 9 Let y(q) = q - 31. Let f(b) = 1. Let s(t) = -4f(t) - y(t). Calculate the remainder when 76 is divided by s(7). 16 Let p be -5 + 6 + 5/(-5). Suppose pb - 3b - 1357 = -5s, -4s - 4b = -1060. What is the remainder when s is divided by 45? 44 What is the remainder when 1573 is divided by (795/20 + 6)(-28)/(-21)? 48 Suppose -s + 4s + 573 = 0. Let h = -423 - s. What is the remainder when 109 is divided by 108/(-162) + (-1 - h/6)? 35 Suppose -9d + 7235 + 127 = 0. What is the remainder when d is divided by 21? 20 Let y(i) = -2074i - 12643. What is the remainder when y(-13) is divided by 80? 79 Suppose -2f - i = -252, f - 119 = 2i + i. Suppose -22t + 21t = -3b + 86, 0 = -5b - 2t + f. Calculate the remainder when 296 is divided by b. 26 Let o = 107 + -261. Let z = o - -207. Calculate the remainder when z is divided by 27. 26 Suppose 2051 - 583 + 1268 = 171a. Calculate the remainder when 5163 is divided by a. 11 Let d be 612(-1 - 0). Suppose -7n - 503 = -195. Let z = n - d. What is the remainder when 110 is divided by z? 26 Suppose -143m + 415918 = -42m. Calculate the remainder when m is divided by 13. 10 Let l = 349 + -205. Let j = l - 86. Suppose -m = -o - 0m + 19, 3o + 5m = 73. Calculate the remainder when j is divided by o. 16 Let o(j) = -j*2 + 19j - 35. Let l(t) = 4t2 + 21t - 4. Let c be l(-6). Let y(k) = -4k - 7. Calculate the remainder when o(c) is divided by y(-5). 9 Let i(q) = q2 + 15q - 1503. What is the remainder when i(34) is divided by 108? 55 Let i(j) = 9j + 27. Let a be i(-3). Suppose 5g + 146 = 3q - 696, 5g - 25 = a. Let d = -178 + q. Calculate the remainder when d is divided by 16. 15 Let w be 2/(-3) - 700/(-42). Suppose w = 4y - 36. Calculate the remainder when y is divided by 9. 4 Let o(y) = -25y - 70. Let r(v) = -2v - 2. Let c(j) = -2o(j) + 30r(j). Calculate the remainder when 172 is divided by c(6). 12 Let s be 20-24/(-8). Suppose -s = -4o + 44. Suppose 6r = 677 + 73. Calculate the remainder when r is divided by o. 13 Suppose -11k - 150 = -8k. Let l = -93 + 66. Let d = l - k. What is the remainder when d is divided by 12? 11 Let a = -17136 - -17169. What is the remainder when 6136 is divided by a? 31 Let a(i) = -i3 - 11i*2 - 5i - 53. Let n be a(-11). Let p = 17 + 5. What is the remainder when ((-654)/(-42))/((n/(-2))/(-7)) is divided by p? 21 Suppose -2p + 489 = h, 32p + 2h - 484 = 30p. Suppose 3o - 385 + p = 0. What is the remainder when 177 is divided by o? 39 Let i = 1 + 11. Let g = -54 - -72. Suppose -2m + 74 = -g. What is the remainder when m is divided by i? 10 Suppose -n - 40 = -5k, -4n - 4k - 12 - 124 = 0. Let z = n + 39. Suppose 2p - 1 = 3p + zj, 53 = 4p - 3j. What is the remainder when 32 is divided by p? 10 Suppose 0 = -46h + 20h + 11596. What is the remainder when h is divided by 51? 38 Suppose 0 = -3672z + 3677z - 105. Calculate the remainder when 260 is divided by z. 8 Let a = 1361 + -1338. Suppose -z - 3i = -62, 5i = -0z + 3z - 144. Calculate the remainder when z is divided by a. 7 Let z = -173 + 161. What is the remainder when (-2 + (-6)/z)/(1/(-8)) is divided by 4? 0 Calculate the remainder when 586 is divided by (-135)/(412/(-32)). 46 Calculate the remainder when (-33)/(-22)1/((-6)/(-1988)) is divided by 242. 13 Let b(r) = r*3 - 6r*2 + 13r - 5. Let j = 486 + -481. What is the remainder when b(j) is divided by 13? 9 Suppose 3o - 13 = 932. Suppose 5j + 3g = 526, -3j + 7g + o = 9g. What is the remainder when j is divided by 10? 7 Let h = 50 - -53. Let p(o) = -2o3 - 173o*2 - 91o + 185. What is the remainder when p(-86) is divided by h? 100 Suppose 5t = o - 256, 2o + 2t - 33 = 443. Let m(s) = -s3 - 35s*2 + s + 62. What is the remainder when o is divided by m(-35)? 25 Suppose -5p - 5r + 15 = 0, -5p - 4r + 17 = 2. Let x be 1p/(3/10). What is the remainder when 1142/x + (-4)/20 is divided by 29? 27 Let j(f) = -f*2 + 7f - 3. Let o be j(6). Let c(w) = -5301w + 10w*2 - 3 + 2652w - 1 + 2650w. What is the remainder when c(o) is divided by 31? 27 Calculate the remainder when 2246 is divided by (-6 + (-900)/54)/(2/(-66)). 2 Suppose 3y + 5f = 342, 2y + 2y = f + 433. Let h = 249 + -173. Let v = y - h. Calculate the remainder when 96 is divided by v. 30 Suppose 0 = 2x + 23 - 9. Calculate the remainder when 9 is divided by (-1)/((-2 - x/4)2). 1 Suppose 14163 = -30k + 106473. Calculate the remainder when k is divided by 54. 53 Suppose -3v + 44 = -2o - 13, 3v + o - 66 = 0. Suppose -5f = -2t - 3341, 4t + 23 - 11 = 0. Let s = -563 + f. What is the remainder when s is divided by v? 20 Let f be 64/34 - 42/(-357). Let y(h) = 11h2 - 11h + 23. What is the remainder when 134 is divided by y(f)? 44 Suppose 12 = -3q, -4t + 190 = -3q + 126. Let k(d) = 4	{ "pile_set_name": "DM Mathematics" }
(-192) Simplify h*(-7)/(hh*(-5))h*8hhh/(hh/((hh(-19))/h)) assuming h is positive. h(-13) Simplify (a*(3/8)a)*(-1/31)(a/(a((aa*(7/6)/aa)/a)/aa)a)/a33 assuming a is positive. a(-24709/744) Simplify (v/(vv(v/v(-2))/v))(30/13)/(((v/v*0v)/v)/v)(-7/10) assuming v is positive. v(-90/13) Simplify ((a*(-12)a)6)(-38) assuming a is positive. a*2508 Simplify (yyyy*(-1/48)yy(-24))(-30) assuming y is positive. y(4805/8) Simplify (qq*11)/qqq7q(q(-6/5)/q)/qqq(-5) assuming q is positive. q(64/5) Simplify (v/(vv*(1/4)vv))(-2/47)/(v(3/5))1 assuming v is positive. v(-237/470) Simplify (dd*(-4)dd/(d(-12)/d))/(d(-9)/d(-6)) assuming d is positive. d15 Simplify (rr*(17/3)rr8)/(r/r(-10))10 assuming r is positive. r(-283/3) Simplify (vv(2/7))(-3/50)v(-1/4)/v(-2) assuming v is positive. v(1171/700) Simplify (t(-29)/tt(-34)/t)/(t(-3/5))15 assuming t is positive. t(-56) Simplify l*19/((l/(l/(ll*(-4))))/l)(l/(ll(17/3)))/((ll(l5l)/ll)/l) assuming l is positive. l(31/3) Simplify ((o(-3))(-22))(1/11) assuming o is positive. o6 Simplify (tt(-1/16))(-3)/(t(-5/8)/t)1 assuming t is positive. t(-19/16) Simplify (p(-8)/((p*(-11)p)/p))/((pp(-15)p)/pp(-4)) assuming p is positive. p21 Simplify ((x(3/10)/((xx/x(-1))/x))(-44))(2/35) assuming x is positive. x(748/175) Simplify u*(-8)/(u(u/(u*(-6)u))/u)(uu/(u/u*8))/uu(-10) assuming u is positive. u(-16) Simplify ((h*0h/(h/(h/((hh(-3))/h))))/(h3hh(2/15)))(-2) assuming h is positive. h(4/15) Simplify r9/(rr*(2/9))(r/(rrr*(-2/3)rr))(-5/8) assuming r is positive. r(665/72) Simplify b23(b/(bb(-2/71)))/b(b(-1/10))(4/31) assuming b is positive. b(242278/11005) Simplify y(-10)yy/((yy(-5))/y)((y/(y*4/y))/y)/yy/y(-1) assuming y is positive. y(-5) Simplify (o((oo/(oo3o))/o)/oooo(3/2)(o/(oo(1/5)o))(-1))26 assuming o is positive. o(91/5) Simplify (h/(h/h(-2)))32/(h/(h3h)hh8) assuming h is positive. h(-70) Simplify (kk11)35(kk*(-23))/(kk(3/7)) assuming k is positive. k(2776/7) Simplify (f(-6)/((f(2/29)f)/f))/((f/f(1/3))/(f/f(-2/5))) assuming f is positive. f(-2321/435) Simplify (q(-1/7)/(qq*(-6/11)/qq))/(q7)(-43) assuming q is positive. q*(23131/77) Simplify ((k/((kkk(-7/2))/k))/(k/(k(-12/7)k)))/(k/k*(2/3)(k/(kk(2/11)k)k)/k) assuming k is positive. k(1217/462) Simplify (hh(-9)/h)/(h(-17)/h)(h/(h/(h/(h(-1/5)h))))(2/29) assuming h is positive. h(1307/145) Simplify (g(-1/3))(-8/5)g(2/9)g10 assuming g is positive. g(484/45) Simplify ((rr(-5))/rr)(-4/17)/(r(-4)r)(-7/3) assuming r is positive. r(-103/17) Simplify ((h(-3/10)/h)/h(-5/3))/((h(4/7)h)/hhhh)(-21/5) assuming h is positive. h(461/30) Simplify ((w(-27)/w)/(w/(ww27)))(-3/28) assuming w is positive. w(3/28) Simplify p(-2)/p*(1/3)p/(ppp*(-5/7))p(-4) assuming p is positive. p(-139/21) Simplify (g*(1/10)g)/(g*(-3/16)g)g2/(g(-1/7)/g) assuming g is positive. g(1921/560) Simplify ((j(-7)j)(-31))(-3/11) assuming j is positive. j(-558/11) Simplify ((j(-3/5)(j(-3)/j)/j)/(j5/j(-1/5)))47 assuming j is positive. j(-2538/5) Simplify ((((y(-10)/y)/yy)/y)/y)/(y*(-4/5)/y)y*6/((y(y(y/y(1/3))/y)/y)/y) assuming y is positive. y(-73/15) Simplify (b14)21b(-26)/b(-1/4) assuming b is positive. b(1073/4) Simplify (p(-5)/p)*(-14)/(((pp/p*(-5/3)p)/p)/(p/(pp(-12/11)/p))) assuming p is positive. p(2720/33) Simplify ((((j(-2/15)j)/j)/(j*(5/2)j))/(j/j(-2))42)49 assuming j is positive. j(-190561/30) Simplify (((h4)(6/7))(-4/5))(-9/11) assuming h is positive. h(864/385) Simplify o0/o(o/(o(-4/3)o)o)/o(o/o*(-3/7))/(oo*(3/2)oo) assuming o is positive. o(-115/42) Simplify (q(-23)qq/q(-2/39)q)(-14/9) assuming q is positive. q(10892/351) Simplify q(-3/13)/q(-6)qqqq/(q/((qq(-20)q)/q))q(-13) assuming q is positive. q(-302/13) Simplify kk*28k*(-8)(k/(((kk(-14)k)/k)/k))/k(-26) assuming k is positive. k62 Simplify (((c(-1/4))2)(4/33))48 assuming c is positive. c(-32/11) Simplify (y(2/57)/y)/(y/((yy(-5/4)y)/y))(y(-22)y)38 assuming y is positive. y(-182449/228) Simplify ((rr(2/67))/r)/(r/r(2/9))r/(rr(-24)r)r/(r/r(-2/3)r) assuming r is positive. r(12413/603) Simplify (y(-2))*(-14/15)/((yy(-1/3)/y)/y14) assuming y is positive. y*(81/5) Simplify (((k/(kkk(-12)kk))/k)/k)1/((k/(k/(k1kk)k))/kkkkk)(-7/5) assuming k is positive. k14 Simplify n(-7)/n12(n(5/2)/n)(-1/10) assuming n is positive. n(-383/20) Simplify (s(8/11)/(s(-15)s))(-2/49) assuming s is positive. s(-324/539) Simplify (((kk0k)2)26)(3/7) assuming k is positive. k(312/7) Simplify (u*(2/29)u)/uu2(u/u(-2/5))(-43) assuming u is positive. u(-8429/145) Simplify ((w(11/4)w)/(((w/(((ww*(3/7)w)/w)/w)w)/w)/w))/(w(-5)ww(w/w*(1/23))/www) assuming w is positive. w(3363/644) Simplify (q(-2/3))(-45)(q/((qqq*5)/q))/(q/(qqq(-4/5))) assuming q is positive. q(126/5) Simplify (u4uu(-4)/uu*(-1/4)/((uu(((u1/uu)/u)/u)/u)/u))(-11) assuming u is positive. u(-33/4) Simplify (pp(-1/4)p*(-15))/(p/(pp1))(4/11) assuming p is positive. p(-611/44) Simplify (d(2/13)d21)/(d(-2/3)d(d/d(2/47))/dddd) assuming d is positive. d*(32743/1833) Simplify (((ggg(-2/5)/gg)/g)/((g/((gg/(g(gg8)/g))/g))/g))/(g(-2/17)g/g(-3/4)) assuming g is positive. g(-3071/340) Simplify ((j(-2)/j1)/(j*(-1/3)/(jj5)))3 assuming j is positive. j*10 Simplify (jj/(jj7j)j(j/j*(1/13))/jjj(2/5)/(j/(j(-4/9)/j)))30 assuming j is positive. j(-8332/39) Simplify (w/w(1/31))/w(6/5)w*20w(1/15) assuming w is positive. w(9223/465) Simplify ((oo/o(-1/16))/o(-32))(34/3) assuming o is positive. o(9265/24) Simplify ((hhh(-2/51))/(h/h(1/4)))/(h14/(h/(h/(h(-3/2)/h)))) assuming h is positive. h(-3119/204) Simplify (j/j(-13))37(j(jj/(j/j*(-17)j)j)/jj)/(j/((jjjj5j)/j)) assuming j is positive. j510 Simplify ((x(-1/2)xx/(x*(-10)xx))(-3/7))(-9/5) assuming x is positive. x(513/70) Simplify ((q2/(q(-6/11)q))(1/25))(4/5) assuming q is positive. q*(68/1375) Simplify s/(sss(-2)s)(ss*(2/9))/ss((ss(-6))/s)(-38) assuming s is positive. s*(2063/9) Simplify ((zz*(9/4)/zz/z(-1/5))(2/11))(-3/8) assuming z is positive. z(-207/880) Simplify (q(-14/5)/(q/(q/(((q(1/11)/q)/q)/q))))(-2) assuming q is positive. q(-12/55) Simplify ((d/((d/(d(-7)/d))/d))/((d/d(2/13))/d)dd*(-3)dddd0)(-2) assuming d is positive. d(152/13) Simplify (z25z*16z)/(((z/z(-11/2))/z)/z(4/3)) assuming z is positive. z(227/6) Simplify (h(-1/23)h)/((h(2/25)hhh)/hh)(h/(hh/(h/((((h(-1/11)hhh)/h)/h)/h))))/(hh(-26)) assuming h is positive. h(145269/6325) Simplify (k(4/3)k(1/4))(-11) assuming k is positive. k(-209/12) Simplify (v/(v/(v/v(-5))))43/(((v8v)/v)/vvv((v/(v*11v))/v)/v) assuming v is positive. v*262 Simplify (((b/(bb/((b*(2/7)/b)/b))b)/b(b(b/(b/(b/b*(-1/8))))/bbb)/b)/(b(1/4))(-13/5))(-26/7) assuming b is positive. b(-221/980) Simplify (l(-1))(-49)(l(5/4))21 assuming l is positive. l(301/4) Simplify ((b/(b/b1))*10/(bb*(1/14)bbb/(b(b(-2/41)/b)/b)))(38/3) assuming b is positive. b(53219/861) Simplify (j(-5)/j(-10))/(j(1/3)/j17) assuming j is positive. j(65/3) Simplify ((v/v(-5)v)/v)/(v/(v(vvvv/(v/(v*(-1/7)/v)))/vv))(v/(vv/(vvv(-2))))(-3/7) assuming v is positive. v(58/7) Simplify (t/(t(-2/5)/t))*25/((t/(t/(tt(2/5))))/(t/t(-2/43))) assuming t is positive. t*(12824/215) Simplify ((cc(-1)/c)9c(-1/14)c(-2)/c)(-10/3) assuming c is positive. c(845/21) Simplify ((t(-23)/t)/ttt*(-16))/(tt*(-27)t(ttt(-9))/tt) assuming t is positive. t*(-8) Simplify (ww*(1/5))/(ww*w	{ "pile_set_name": "DM Mathematics" }
/(-7)(-24)/3-7. -16 Calculate (2/198-9)/(-1). 1/11 Evaluate (-12)/72(-5)/(-5)-30. 5 (-175)/(-70)48/41 30 Calculate ((-14)/(-70))/((-11)/(-55)). 1 What is 1/(126/4)(-6)/((-84)/98)? 2/9 What is 7541/(-15082)(2/(-4))/(1/8)? 2 (2/2(0/13)/7)/(-4) 0 (11/((-792)/60))/((-3)/(-4)-5) 2/9 What is the value of (9/(-486)-9)/(6(-2)/(-80))? 10/9 Evaluate 3249/(2254/(-115)). -15 Evaluate (-3)/1311/6(-1928)/(-5302). -2/13 Calculate 13/(1820/460)-7. -23 (44/(-10))/((-140)/350) 11 ((15/(-50))/((-128)/(-240)))/(15/140) -21/4 Evaluate 30((-4)/(-15))/(48/(-144)). -24 Evaluate 2016/528(-2)/(-7). 12/11 165/(-132)3/(-6) 5/8 What is (-21)/(504/(-32))12/32? 1/2 (228/(-19))/(((-726)/(-3))/11) -6/11 Calculate ((-26)/(-3)57/190)/((-2)/5). -13/2 (202/(-303))/(28/(-3)) 1/8 What is the value of (28/2311)/((-3)/9)? -4/11 Evaluate (-6(-6)/(-45))/(49/((-245)/34)). 2/17 (-16)/(-252)(-63)/(-54) 2/27 1(-63)/42-2 3 Evaluate (-1025)/123(-9)/15. 5 Calculate (-17)/((-68)/24)(-12)/(-6). 12 What is the value of (67/(-402))/((14/54)/7)? -9/2 What is the value of -129/(-135)10? 8 (3(-13)/(-156))/(-1) -1/4 What is the value of ((-41)/(-164))/(((-14)/160)/(-7))? 20 (((-6)/(-84))/((55/50)/11))/(-1) -5/7 What is ((-81)/(-12))/(((-1242)/(-72))/23)? 9 Evaluate 66/(-77)(-2821)/(-62). -39 (2/(60/26))/((-386)/(-1930)) 13/3 What is the value of (-1617)/63(-24)/56? 11 Calculate (-4(-2)/6605)/(33/121). 2/9 Calculate ((-32)/16)/(-2)1-3. -3 Calculate (-1)/10-530/(-9). -5/3 Evaluate (-3024)/324(-36)/(-21). -16 What is the value of ((-232)/522)/((-60)/(-54))? -2/5 Evaluate ((-1)/34/2)/((-104)/(-468)). -3 What is the value of 270/3556/(-24)? -18 Calculate (18/4)/(((-10152)/(-240))/(-141)). -15 (-144)/(-120)-1(-10)/14 6/7 Calculate (-3)/((-64/48)/((-2)/(-150))). 2/25 732/(-6222)2/4 -1/17 Calculate ((36/(-24))/(9/(-6)))/((-3)/3). -1 30/(-25)(-6)/(-12) -3/5 What is 944/(-3304)(-119)/2? 17 What is the value of ((-9)/(-126))/((-16)/64)? -2/7 Evaluate (2/(-3))/((-26)/(-195)). -5 What is (2/4)/(((-21)/14)/(133))? -13 Evaluate ((-11)/((-4147)/(-39)))/((60/(-8))/5). 2/29 What is the value of (-1)/5-5190/707? 19 What is the value of (-54)/4505(-1)/1? 3/5 Evaluate (1/2)/(4(-23)/2024). -11 Calculate 19/(950/15)30/3. 3 Calculate (6/(-5))/(((-48)/84)/(16/56)). 3/5 What is 10/(-2)1079/4316? 0 Calculate (128/576)/((-40)/36). -1/5 Evaluate ((-90)/(-4))/((-3695)/(-4434)). 27 Evaluate (-203/(-15))/((-20)/(-3)). 3/5 Calculate 38/7612/(-3). -2 Calculate 3/((-23)/((-322)/(-6))). -7 What is the value of (260/182)/(9/(-63))? -10 What is (-14)/1518/2120/(-64)? 1/4 (-4)/(((-132)/11)/(-36)4)9 -27 What is the value of (3740/30)/(-17)9/6? -11 Evaluate (-7)/(231/(-44))(-6)/68. -2/17 What is 1/(((-336)/(-35))/8)-6? -5 Evaluate ((-11)/(-176))/(1/(-2))(-980)/70. 7/4 (-3)/(6/10)56/(-1680)18 3 What is 33/(-55)5/93? -1/31 (-6)/4(-2346)/207 17 What is the value of ((-35)/(-4))/(-145(-26)/12064)? 28 What is (-21)/(-4)9880/(-1482)? -35 What is the value of 1132/226401-2? -1/10 Calculate ((-12)/922/(-88))/((-38)/2850). -25 Evaluate ((-17690)/(-191052))/((-5)/12). -2/9 Evaluate (-7)/22/5. -7/5 What is the value of (-42)/(-7)(-7)/(-28)? 3/2 What is 49/141(-6)/(-9)? 7/3 What is the value of ((9/3)/6)/(117/(-2106))? -9 (11/((-55)/6))/((-9)/(-60)) -8 Evaluate (57/532)/((-13)/(52/15)). -1/35 What is the value of ((-1)/3(0/4)/14)/(-1)? 0 Evaluate (-2(-2)/36)/((-79)/(-13509)). 19 What is the value of (-5)/(((-12)/(-30))/(8/(-10)))? 10 (3/3)/((-23)/184) -8 What is 8/20(-63)/(-28)25/15? 3/2 Calculate 2745/(-183)(-1)/21. 5/7 What is ((-3)/10)/(552/1840-27)? 1/14 What is (-6)/4179/(-537)? 1/2 Evaluate 13(-25)/5002/(-13). 1/10 Evaluate 18/(29/(319/22)). 9 What is ((-3)/(-9))/(-81/(-4))-10? -5/3 Calculate (2/(-11))/((-368)/(-552)). -3/11 What is the value of ((-3)/(-4)10/(-15))/(3/6)? -1 What is (-15)/(1/((-5)/1)-5)? -15 ((-1092)/(-17836))/(1/7) 3/7 What is 2/(-1)1/(-2)(-5)/(-15)? 1/3 Evaluate 4/15(432/16)/(-108). -1/15 (-1972)/14799/(-4) 3 (5/((-10)/(-4)))/(8/640-10) -16 Evaluate -7(-4)/7876/(-1168). -3 What is ((-15)/(-1))/((-3935)/787)? -3 What is the value of 24/(-38)6707/(-706)? 6 What is the value of ((-8)/204)/(4/24-2)? 2/17 What is (-1)/(33/209)3? -19 What is (-720)/(-1980)11/90? 2/45 Evaluate (-18)/36(93)/((-9)/12). 18 -35((-27)/45)/3280/98 20 Calculate ((-657)/(-730))/((-3)/2). -3/5 (-4893)/69919/7 -19 What is the value of 1-1((-3179)/374)/((-2)/(-4))? 17 Evaluate (-162)/9(-1)/122. 3 Calculate (-2(-3)/4)/(21/(-280)-5). 4 What is the value of ((-55)/(-9))/(400/(-160))? -22/9 What is the value of ((-192)/(-320))/((-3)/2)? -2/5 What is ((-8)/100)/((-9)/120-8)? -2/15 What is ((-16)/221)/((-1456)/8008)? 4 Calculate -227/213/2. -11 (-1)/((-10)/6(-26)/((-9360)/(-918))) -4/17 What is ((-7)/(-12)(-15)/(-5))/((-234)/(-3744))? 28 Evaluate (414/(-84))/(50/30). -2/5 What is (3/(-3)(-200)/120)/((-2)/6)? -5 1/2((-100)/(-5))/((-4)/(-2)) 5 What is -4115/(-18)(-30)/140? -5/7 (-9(-2)/78)/(99/1053) 3 ((3420/210)/(-19))/(-3) 2/7 What is the value of 0/(2/(-10)(-40)/(-8))? 0 Calculate (-140)/84(-24)/(-20)(-15)/(-3). -10 What is -6(-744)/558(-2)/(-28)? 4/7 What is ((132/9)/(-1))/(11/(231/(-14)))? 22 Calculate 256/(-24)9/6. -16 What is the value of ((-1)/6)/(685/28770)? -7 Calculate (6/22)/((-73)/(-803)). 3 What is the value of (((-40)/(-30))/(2/3))/(4-3)? -1/6 ((6/(-1))/(2/5))/((-6)/4) 10 Calculate (-46)/598(-8)/(-2). -4/13 What is (-148)/37(-16)/(-4)? -16 (618/12)/((-3)/((-3)/(-1))) -9 What is (-2600)/(-300)(-6)/4? -13 What is (-49)/(-392)64/40? 1/5 What is the value of ((-2)/(42/(-5)))/((-24)/(2448/(-85)))? 2/7 What is (3978/(-408))/((3/(-12))/(3/9))? 13 (-4)/2((-37)/555)/((-1)/(-5)) 2/3 Evaluate (((-192)/12)/240)/(6/9). -1/10 Evaluate ((-4)/(-6)21/(-49))/((-615)/(-287)). -2/15 What is (3/(-12))/((-1855)/(-1590))? -3/14 ((-170)/34)/(5/3) -3 What is 9/30(-10)/784? -2/13 Evaluate 23/((-1035)/(-110))18/4. 11 Calculate 27/(-3)(-40)/24. 15 Calculate (15/(-2))/((-2)/12). 15 Calculate 160/60135/(-12)-1. 30 What is -1(-21)/68865/(-4137)? -15/2 What is 28/(-18)1308/(-872)? 7/3 Calculate (240/(-27))/(-4)1071/(-238). -10 (-42)/(-7)3910/90 26 What is the value of 2268/(-864)(-16)/2? 21 Evaluate ((-319)/(-2))/112. 29 What is 2/639-282? -16 Calculate ((-24)/(-26))/1((-4)/(-1))/(-16). -3/13 What is the value of (1134/(-36))/211/(-9)? 1/6 (4(-6)/(-9))/(23/(621/(-198))) -4/11 Evaluate (-12)/792-2-6. -2/11 Calculate ((-11253)/(-66))/112. 31 Evaluate 51(-4)/((-70)/73). 2/3 Evaluate (-4)/(-144)4-254/10. -10/9 (3/(-4))/(((-13)/(-52))/1) -3 What is the value of ((20/(-15))/(-4))/(((-78)/144)/(-13))? 8 ((-2)/1(-8)/(-220))/((-31)/(-310)) -8/11 What is the value of 7056/(-19656)12/(-14)? 4/13 What is (933/(-4665))/((-4)/(120/(-34)))? -3/17 Calculate (1288/5796)/((-2)/(-6)). 2/3 ((-272)/112222)/((-10)/6) 16/5 Evaluate (-5)/12((-432)/45)/(-24). -1/6 What is (12/26477)/((1/2)/(-1))? -7 Calculate (-105)/(-45)15/28-1. -5/4 What is the value of 6/(468/65)(-30)/5? -5 Calculate (193)/(-25(-48)/400). 19 Calculate (((-660)/75)/(-22))/(14/5). 1/7 What is ((-1200)/128)/(-25)24/(-3)? -3 Evaluate ((-303)/202)/(1/(-4)). 6 What is 330/1983/5-7? -7 ((-75)/(-50))/(-1(-1)/(-6)) -9 Evaluate (104/(-26))/(((-2)/(-15))/(2/4)). -15 What is 175/1302616/(-14)? -40 Calculate (((-54)/(-2580))/(30/(-25)))/((-9)/24). 2/43 What is the value of (-12)/633(-30)/180? 2/21 What is the value of (0((-5)/(-2))/(-5))/(316/(-79))? 0 What is the value of 20(-3)/4(-4)/(-5)? -12 ((-1)/(((-308)/(-16))/11))/(1/(-7)) 4 Calculate 1(-55)/((-8360)/16). 2/19 Evaluate 600/50025/(-3). -10 Evaluate ((-1)/3)/((-360)/(-14040)). -13 Calculate (((-4)/1)/(-1))/(6/(-15)-2). 5 What is 6/(-7)(833/68)/7? -3/2 Calculate (-9)/30(-335)/(-2211). -1/22 Calculate 56/1190(-50)/(-40). 1/17 What is the value of ((-16)/(-10))/4((-9500)/57)/(-20)? 10/3 Calculate 242/(-33)138/759. -4/3 What is the value of ((-676)/156)/(39/(-9))? 1 What is (-35)/14/10? -14 What is the value of (-28)/364132/14? -1/7 What is 63(-62)/8376/4? -7 (154/(-15))/(((-2816)/(-55))/(-16)) 9/8 What is the value of 150/125400/(-840)? -4/7 Evaluate (20/70*(-7)/(-8))/((-43)/(-172)). 1	{ "pile_set_name": "DM Mathematics" }
ive. m(1474/1953) Simplify j(-2/47)/(j/j(-6/11)) assuming j is positive. j(-821/517) Simplify (b*(3/2)bbbb/(b/(b(-2)/b))bb)/(bb*(-4/9)bbb(-2/3)) assuming b is positive. b(29/18) Simplify (i3)(-7/2)/(ii1)19 assuming i is positive. i(-97/2) Simplify ((oo/o(2/3))/o)(-17)/(o*4o/o(3/4)) assuming o is positive. o(-119/12) Simplify g*0/(g(g*4ggg)/gg)(g/(g/g*1)g)/gg(-1/11) assuming g is positive. g(-78/11) Simplify (f12)(7/4) assuming f is positive. f21 Simplify (((l(-1/3)/l)/l)/l)41(l/(l/l*(-4)))/(ll/(l/l*(-1/4)l)) assuming l is positive. l*(-1685/12) Simplify bb*(-9/7)b(-20) assuming b is positive. b(-142/7) Simplify (r(2/111))(28/9) assuming r is positive. r(56/999) Simplify c(-7/9)/(c/(c*(-32)c)cc) assuming c is positive. c(-313/9) Simplify z(-4)/zz1 assuming z is positive. z(-4) Simplify ((r(r*(-4)r)/r)/r)(3/14) assuming r is positive. r(-6/7) Simplify q*(-4/5)/(q/(qq(1/2)/q)) assuming q is positive. q(-13/10) Simplify (r*(-25)r)/rrr(3/14)/r assuming r is positive. r(-347/14) Simplify q*(-3/4)q(-8) assuming q is positive. q(-35/4) Simplify (((o*(-6)/o)/o)/ooooo)(6/5) assuming o is positive. o(-6) Simplify ((u/(u/(u(21/4)u)))/u)/uu/(u(-16)u)u assuming u is positive. u(85/4) Simplify w(-1/2)ww(-1/36) assuming w is positive. w(17/36) Simplify (cc*(-5))/(cc*(-4))(c/c(1/4))/c(-1/12) assuming c is positive. c(-1/6) Simplify ((q/q(-2/19))/qq(q/(q/((q/(q/(qq(-1/10)))q)/q)))/q)0 assuming q is positive. 1 Simplify (n(-10)(nn(nn*(-4)n)/n)/n)/((n*9/nnn)/(n6n)) assuming n is positive. n(-15) Simplify (n(-3))2 assuming n is positive. n(-6) Simplify (ll/(((l/((l/l(-4))/l))/l)/l)l*(4/5))/(lll(-2/7)/l)19 assuming l is positive. l(-202/35) Simplify (k5k/k3)/(k(-1/4)/k)5 assuming k is positive. k(37/4) Simplify (cc(3/8)/cc/(c/c(1/4)))(-2/71) assuming c is positive. c(-5/284) Simplify m(1/33)mm18 assuming m is positive. m(628/33) Simplify (l(-2/13)/(l/((l8/ll)/l)))/(((l/(l/l(3/4)))/l)/l7) assuming l is positive. l(681/52) Simplify d(-1/22)d/(d(d/d(2/35))/d) assuming d is positive. d(9/770) Simplify (h(-1/9)hh)/(((hh/h(2/83))/h)/h) assuming h is positive. h(1429/747) Simplify l(-19/2)/(l/(l/l0l)) assuming l is positive. l(-17/2) Simplify s(7/2)/(((s(ss/(ss(-21)))/s)/s)/s) assuming s is positive. s(-33/2) Simplify ((hh(1/13)/h)/(h/h(-2/9)))(2/5) assuming h is positive. h(-268/585) Simplify ((g(-1))(-40))(2/9) assuming g is positive. g(80/9) Simplify (t5/t)(1/35) assuming t is positive. t(4/35) Simplify (jj/(j/(j/(j/(j*(-5/2)/j)))j)jj)(31/5) assuming j is positive. j(-93/10) Simplify (r1)23/((((((r/(r/((r*(-1)rr)/r)))/r)/r)/r)/r)/r)(-1/7) assuming r is positive. r(156/7) Simplify (i/(ii*(4/7)/i)iii(-2/17))/(i5/ii/i9) assuming i is positive. i(751/119) Simplify (i/i20)/(i43/i) assuming i is positive. i(-61) Simplify (t/(t(1/12)/t)t)41 assuming t is positive. t(1435/12) Simplify (q(-2/9)/q)22/(q(1/3))(-23/6) assuming q is positive. q*(-461/18) Simplify (pp/(p*(2/11)p)(p(-7)/p)/pp)(3/22) assuming p is positive. p(-237/242) Simplify (a/(a(-3)/a))(14/11)a(1/21)a(1/5) assuming a is positive. a(7636/1155) Simplify ((d*(6/11)/d)/(dd(d/(d/(d((d/((d*(-6)/d)/d)d)/d)/dd)))/ddd))(-4/5) assuming d is positive. d(592/55) Simplify (j/(j/(jjj9)))/(jjj(-7/5)jj)(jj/j8j)/j((j/(jj(3/10)))/j)/j assuming j is positive. j(1/10) Simplify v2/((v18v)/v) assuming v is positive. v(-16) Simplify s/(ss/(s/s*(1/7)))s/((s/s*(4/3))/s)s(-1/12)/(s/s(-1/8)) assuming s is positive. s*(55/56) Simplify (nn*(-7))/nnn(3/7) assuming n is positive. n(-39/7) Simplify (y2)19 assuming y is positive. y38 Simplify (((f(3/2)/f)/f)(-3/29))(-11/2) assuming f is positive. f(-33/116) Simplify (o10/oo(-6))17 assuming o is positive. o51 Simplify (n/(n(-1/3)n)(n(3/17)/n)/n)(-1/8) assuming n is positive. n*(19/102) Simplify ((ss*(-14/9))/s)/ss/(s*(2/59)/ss) assuming s is positive. s*(-844/531) Simplify ((ll*2)/ll(-2/5))/(l(-1))(-9/10) assuming l is positive. l(7/10) Simplify (c(2/3)/c)(1/14) assuming c is positive. c(-1/42) Simplify l(2/3)/(ll(-2)/l)((lll(-4))/l)/(l5l) assuming l is positive. l(-19/3) Simplify (q(-1/4))(-14/9)((q(qq1/q)/q)/q)/(q1/q) assuming q is positive. q(7/18) Simplify (q(4/9)(qq(-1/4))/q)47 assuming q is positive. q*(329/36) Simplify (w/(w/(ww((w/w(-9/5))/w)/www)))/w(7/2) assuming w is positive. w(13/10) Simplify (p14pp/p(-4/7))(14/13) assuming p is positive. p(232/13) Simplify (h/h(-6)h)/h5 assuming h is positive. h3 Simplify (k/((k(-27)/k)/k))(-23) assuming k is positive. k*(-690) Simplify (((r/((rr*6)/r)rr)/r)/rr*(-13)r)(-17/4) assuming r is positive. r(289/4) Simplify (rr7r)/(r/(r/r*(-3)))r*1r(-7) assuming r is positive. r6 Simplify (v*(-1/4)(v/v*2)/vv)/(v*(-2/7)v(-7)) assuming v is positive. v(169/28) Simplify (n/n10)/n(-6)(nn(1/2))(2/21) assuming n is positive. n*(-20/7) Simplify ll*10lll(-21/8) assuming l is positive. l(83/8) Simplify u(4/9)/(u13u) assuming u is positive. u(-122/9) Simplify c/(c/(cc/c*(5/3)))c(-2/19) assuming c is positive. c(13/57) Simplify p(-2/13)/(p(-9/4)p) assuming p is positive. p(57/52) Simplify o/o8oo(5/3)ooo*(6/11)/((oo*3)/oo) assuming o is positive. o(-191/33) Simplify l(5/4)/l*2l(-1/2)/l(5/3) assuming l is positive. l(-35/12) Simplify (k7)41 assuming k is positive. k287 Simplify v*(2/15)vvvv/((v(-1/3)/v)/v)vv(1/2)/((v(-6)/v)/v) assuming v is positive. v(479/30) Simplify (a/(a(4/11)/a))/((aaa(-2/21)aa)/a)(a*(-2)/a)/aa*(1/4)aa assuming a is positive. a(-2789/924) Simplify (g(-3/2)/(gg(-3)))(-4/3) assuming g is positive. g(-2/3) Simplify (n8n)/((n/n(2/57)n)/n) assuming n is positive. n(458/57) Simplify (p/((p(1/13)/p)/p))/p(2/75) assuming p is positive. p(2824/975) Simplify (d(-1/2)/(d(-1/4)/d))27 assuming d is positive. d(81/4) Simplify a*6a/((a/(a*(-1/5)/a))/aa)aa/a*1aaaa(-2/5) assuming a is positive. a(42/5) Simplify (r(1/4))34/(r(-3/2)/(r/(rrr2r))) assuming r is positive. r*6 Simplify (cc*(1/12)c)/cc(1/41) assuming c is positive. c(545/492) Simplify z/(z20/z)z(-10) assuming z is positive. z(-28) Simplify (o/(oo/o(1/3)))(2/65)/((o/(((o/(o/(o/(oo*6/o))))/o)/o)oo)/o(-3/5)) assuming o is positive. o(-2071/195) Simplify o(-20)/(o/(o/o(1/19)o)) assuming o is positive. o(-362/19) Simplify (c(-7/2)/(cc(-5)))/(c(1/2)cc/c3) assuming c is positive. c Simplify cc/c*(-1/4)cc((c(-28/5)/c)/c)/c assuming c is positive. c(-87/20) Simplify ((f/(ff2))/f)/(f/(ffff*3))(f(-2/7)/f)(28/3) assuming f is positive. f(-10) Simplify ((m(-7)/m)/mm(-4/7))(-1/11) assuming m is positive. m(67/77) Simplify ((f(f*(-2/9)f)/f)/ff/((f/f(-1))/f))/(f(2/9))0 assuming f is positive. f(-2/9) Simplify (w/(w(-18)/w))/ww(3/2) assuming w is positive. w(41/2) Simplify aaaa/(aa/(aa(-20)a))aa(-8) assuming a is positive. a(-23) Simplify (g*(-37)/gg)/ggg(-9) assuming g is positive. g(-46) Simplify l*(-2)/ll(-5) assuming l is positive. l(-8) Simplify (t(-8/5))(-25) assuming t is positive. t40 Simplify (c(1/3))*29c/(((ccc*(-1/5)c)/c)/c)c/c(-2/9) assuming c is positive. c(499/45) Simplify (h(-23)/h)/hhhh(hh/h*(-1/3)h)/h assuming h is positive. h(-59/3) Simplify (j0/j)*2/(jj1/j)(-12) assuming j is positive. j10 Simplify x5/x(x/x0)/x(x(-2/5))(-1/29) assuming x is positive. x(582/145) Simplify s9s(3/11) assuming s is positive. s(102/11) Simplify (rr*21)/(((r(rrr*(-11/3)rr)/r)/r)/r) assuming r is positive. r(71/3) Simplify (g(-4/13))43 assuming g is positive. g*(-172/13) S	{ "pile_set_name": "DM Mathematics" }
+ (1/((-6)/36) - -16). Let f = 4 - 4.5. Sort f, m, -5 in ascending order. -5, f, m Let d(y) = y*3 - 2y*2 - 3y - 3. Let x be d(3). Suppose k = 3k - a + 2, 12 = -3k - 3a. Let b = -6 - k. Sort b, 5, x. b, x, 5 Let y(d) = d3 - 27d*2 + 93d - 19. Let x be y(23). Sort x, 5, -251 in decreasing order. 5, x, -251 Suppose -2n + 3n = 1. Let i(o) = o*2 + 45o + 264. Let x be i(-38). Put -5, n, x in decreasing order. n, x, -5 Let y = -628.6 - -627. Put -5, y, -0.4 in ascending order. -5, y, -0.4 Let n(i) = -6i - 145. Let l be n(-25). Suppose -4s - 9 = -5. Suppose -h = 5w - 2h + 14, 5w + 2h = -17. Sort l, s, w. w, s, l Let b = -6 - -5. Let a = b + 0.6. Let r = -0.05 + -4.95. Sort a, 3, r. r, a, 3 Let s = 10.96 - -2.04. Sort s, -4, 2/7 in ascending order. -4, 2/7, s Let m(o) = -o*2 - 6o - 7. Let z be m(-5). Let g be 26/(-6) + 6/(-9). Let l = g + 0. Sort 4, z, l in increasing order. l, z, 4 Let h = 0.16 - 0.32. Let c = -0.16 - h. Let o = 0.29 - 0.4. Sort o, c, -3/4 in ascending order. -3/4, o, c Let n = -32 + 39. Suppose -3f - 3 = 3s, 0f + f = -3s + n. Suppose 5 = h - 2y - 3, 5h - s = y. Put 2, -1, h in increasing order. -1, h, 2 Let q = 1/5 + 13/10. Let m = 10.7 - -0.3. Let s = m + -10.8. Sort q, s, 1/3 in decreasing order. q, 1/3, s Let z = 1.4 - -0.6. Suppose -4u - 2q = -2, -5u + 4q = -u - 20. Suppose -2b = -4b + u. Sort b, z, -1/4 in ascending order. -1/4, b, z Let i be (480/(-600))/(3 + 17/(-5) + 0). Let x = -3/112 - 197/1008. Put x, -1/3, 3, i in descending order. 3, i, x, -1/3 Let i = -11.369 + 11.3. Let h = -0.069 - i. Put h, 2, 5, -5/2 in increasing order. -5/2, h, 2, 5 Let m(q) = q - 5. Let y be m(4). Let t be 4 - -6 - (y - -1). Suppose -3i + 4 = t. Sort -1, 5, i in descending order. 5, -1, i Let a = -381 + 389. Sort -4, a, 0, -1 in descending order. a, 0, -1, -4 Let a be 13/((-715)/33)(-1 + (-3)/(-9)). Let v = -2 - -3. Put -6, v, a in decreasing order. v, a, -6 Let a = -33 + 30. Let y be (0 + 5/5)a/1. Put 31, -2, y, 0 in decreasing order. 31, 0, -2, y Let s = -28 + 32. Suppose 16h - 2 = 30. Suppose -5 - 10 = -5j. Put j, h, s in descending order. s, j, h Let b be 6/(-10) + 1022/70. Let i be (10/15 - b/(-15)) + -2. Put i, 2/7, -0.6 in decreasing order. 2/7, i, -0.6 Let t = -72.71 + 73. Sort -0.3, 3/7, t in decreasing order. 3/7, t, -0.3 Suppose 69 = -12q + 9. Put -3, 4, q in descending order. 4, -3, q Let n be 3000/144 - 2/(-12). Let c = n + -33. Sort 3, c, -5 in increasing order. c, -5, 3 Suppose c + 8 = -2t, -3c = 5 + 7. Let d be 0 + (-2 - -2 - 0). Sort t, d, -1 in decreasing order. d, -1, t Suppose -13 + 3 = 5j. Let k be (j/3)/((-1)/3). Suppose -9 = -m - km. Put -3, 0, m in ascending order. -3, 0, m Let i(g) = g + 5. Let l be i(3). Suppose -3r = -l - 10. Suppose 0 = -s, 9 = -3b + rb - 3s. Sort -5, -2, b. -5, -2, b Let q(p) = p*2 + 6p + 2. Let c be q(-8). Let j be (-4)/c + 6/27. Sort -5, 9, j in descending order. 9, j, -5 Let i = -1 - 3. Let k(q) be the second derivative of q*3/6 + 5q*2/2 - 8q. Let u be k(-7). Sort u, i, -5 in increasing order. -5, i, u Let t = -33 - -88.2. Let q = -54 + t. Sort 0.4, q, 5. 0.4, q, 5 Let t be 33/18 + 6/36. Let g = -1 + 1. Put 3, t, g in ascending order. g, t, 3 Let s be 4/6 - (-64)/(-78). Let m = -0.065 - -1.085. Let p = m - 3.02. Put -3, s, p in ascending order. -3, p, s Let c = -77/155 - -3/31. Put 6/11, -2, c, 1 in descending order. 1, 6/11, c, -2 Suppose 2p - p + 21 = 0. Let a = p + 35. Put a, 2/3, -2 in ascending order. -2, 2/3, a Suppose 0 = -17n + 46 - 12. Put -1, 4, n, 14 in decreasing order. 14, 4, n, -1 Let n(f) = -23f + 200. Let m be n(10). Put -3, m, 39 in decreasing order. 39, -3, m Suppose -491 = -13c - 426. Sort c, -8, -9 in descending order. c, -8, -9 Let d = -15 - -27. Let f = -31 - -17. Let b = f + d. Put 5, 1/2, b in ascending order. b, 1/2, 5 Let g = 498 + -500.3. Sort 0.5, 2, g, 0.2 in decreasing order. 2, 0.5, 0.2, g Let a = 119 + -121. Put 0.02, a, 3 in ascending order. a, 0.02, 3 Let q be 99/(-132)40/(-6). Let k(v) = v3 - 6v*2 - v + 5. Let u be k(6). Put 2, u, 1, q in increasing order. u, 1, 2, q Let h = -209 - -216. Sort h, 1, 0, 4 in decreasing order. h, 4, 1, 0 Let q = -27.2 - -26.8. Let o = -18.1 - -24. Let n = o - 6. Sort n, 2, q in decreasing order. 2, n, q Let g be 0 - (-2 - (7 + -4)). Let k be ((-1)/g)/(12/24). Sort 4, -16, k in descending order. 4, k, -16 Let v = -3.7 + 3.6. Sort v, -6, 0.3, -2/7. -6, -2/7, v, 0.3 Let g be 5/30(-72)/16. Sort -0.2, g, -39/4. -39/4, g, -0.2 Let z = 1 - 3. Let a be (-5 + 2)z/(-3). Let v = -105 + 105. Put v, 2/11, a in ascending order. a, v, 2/11 Suppose 8 = 2c, -2n - 2c = 3n - 13. Suppose 0 = 2h - x - 2 + 3, -x - n = -4h. Sort h, 5, -1. -1, h, 5 Suppose -16 = 2d - 3b, 4d + 8 + 4 = b. Let o be 12/(-4)d. Let g be -1 - 3 - (-3)/o. Sort g, 4, -5 in decreasing order. 4, g, -5 Let x = -5 + 3. Let i = x + -1. Sort 2/5, i, 0.3, -8/5. i, -8/5, 0.3, 2/5 Let y = -3059/8200 - 2/1025. Let t = -4 - -9. Put -0.4, y, t in increasing order. -0.4, y, t Let c = 617 + -616.8. Sort c, 2.3, -5 in ascending order. -5, c, 2.3 Let x(c) = -c*2 + 6c - 3. Let d be x(4). Suppose 3g - 6g + 21 = 0. Suppose -gh - d = -2h. Put -2, h, -3 in descending order. h, -2, -3 Let n = 2.48 - 2.68. Sort n, 0.2, -4/13 in decreasing order. 0.2, n, -4/13 Suppose -5n + 64 + 36 = 0. Let b be (-3)/n - (-3)/(-12). Let v(f) = f2 - 3f + 1. Let h be v(2). Sort h, 1/2, b in decreasing order. 1/2, b, h Let c = -1 + 6. Suppose cu = -2 + 7. Suppose 5w - u - 34 = 5g, -2g - 3w - 4 = 0. Put 6, 2, g in decreasing order. 6, 2, g Let f(n) = 2n*2 - 18n + 8. Let d be f(11). Let s = -52 + d. Sort s, 22, -3. -3, s, 22 Let r be -16 + 3132/36. Let n be (0 - -3)/(6/(-4)). Suppose -2c - c = -15. Put c, n, r in ascending order. r, n, c Suppose 4t + 22 + 12 = -5p, -2p = -t - 2. Sort 2, 1, t. t, 1, 2 Let c = 9 + -17/2. Let d be (6/9)/2-31. Sort c, -0.5, d, 0.2. d, -0.5, 0.2, c Suppose -2f - 5i + 38 = 0, i + 14 = 2f - 0i. Suppose 0 = -5m - 56 + 11. Let c = m + f. Put -4, -2, c in decreasing order. c, -2, -4 Let b = -2408 + 2412. Let r be (2/3)/((-28)/18). Let a = -3.1 - -3. Sort a, b, r. r, a, b Let w(h) = h*3 - 4h*2 + 3h + 3. Let k be w(4). Let t = -1507 - -1511. Sort t, -2/9, k in decreasing order. k, t, -2/9 Let g be ((-5)/10)/((-1)/12). Let m be 139/g(-3)/11. Let c = m + 42/11. Put c, -5, -0.5 in ascending order. -5, c, -0.5 Let g be (17 - 19)/(-11). Suppose -3q + x - 17 = 0, -14 = -4q - 5x - 5. Let j be -2 - -3 - (-6)/(-1). Put j, q, g in decreasing order. g, q, j Let b(x) = x + 3. Let s be b(3). Suppose sq = -0q. Sort 3, q, -2, -3/2 in descending order. 3, q, -3/2, -2 Let h(j) = -4j. Let k be h(1). Let c(n) = -3n2 - 213n - 211. Let b be c(-70). Sort 12, 4, k, b in decreasing order. 12, 4, b, k Suppose -2b - s = 4, -25s - 16 = -29s. Sort -5, -8, -2, b in ascending order. -8, -5, b, -2 Let g(x) = -x3 - 11x*2 + 11x - 9. Let w be g(-12). Suppose 2y + 4 = 0, o + 5y + 2 = -wo. Sort 3, 1, o in descending order. 3, o, 1 Let o = -0.02 + 4.02. Let n be ((-8)/10 + 1)710/(-639). Sort 1/9, n, o, -2 in decreasing order. o, 1/9, n, -2 Let w = 7 + -2. Let r = 216/541 + 2/2705. Let h = 0.8 + -4.8. Put w, h, r in decreasing order. w, r, h Let w = 0.005 - 0.505. Put 2/9, w, -11, -0.3 in decreasing order. 2/9, -0.3, w, -11 Let m(l) = l*2 + 6l - 21. Let n be m(-9). Suppose -k - 7 = -n. Sort -2/23, 2/3, k, 2/7 in ascending order. k, -2/23, 2/7, 2/3 Let c be -8 + 965/105 + 1/(-3). Put -5, c, -0.1 in ascending order. -5, -0.1, c Suppose -b - 4q - 28 = 0, 7b = 3b - 4q - 76. Let j(o) = 2o + 35. Let u be j(b). Sort -4, u, 1 in descending order. u, 1, -4 Let i(y) = 4y*2 - 63y - 21. Let k be i(16). Let t = 61 - 54.3. Let f = -7 + t. Sort 0.2, f, k in decreasing order. 0.2, f, k Let g = -16 - -16.7. Let m = 4.3 + g. Sort 2/9, m, 5/7 in increasing order. 2/9, 5/7, m Let d = -26 - -30. Let y(m) = 2m - m + 5 - 4. Let t be y(-5). Put 3, t, d in descending order. d, 3, t Let s = 8 - 3. Let o = -7.25 + 0.25. Let p = o + 2. Put s, p, 3 in increasing order. p, 3, s Let l = 24.2 + -27. Let z = l + -3.2. Let n(u) = u2 - 8u + 4. Let h be n(7). Put z, 3/8, h in descending order. 3/8, h, z Suppose -4t - 12 = -4	{ "pile_set_name": "DM Mathematics" }
208 Simplify sqrt(125)1 + -4 + 3. -1 + 5sqrt(5) Simplify (-4 + sqrt(2352))4. -16 + 112sqrt(3) Simplify (((sqrt(448) - (sqrt(448) + -5(-4 + sqrt(448)))) + sqrt(448))-3)*2. -17280sqrt(7) + 148752 Simplify 4 + (sqrt(1573) - sqrt(1573)-2). 4 + 33sqrt(13) Simplify ((-2 + sqrt(192))-64 + 0)*2. -18432sqrt(3) + 112896 Simplify ((sqrt(7) - (-2 + sqrt(7))) + 0)2. 4 Simplify (-5 + sqrt(108) + 2 + sqrt(108))2 + (sqrt(108) - ((sqrt(108) + 2)5 + sqrt(108)))*2. 528sqrt(3) + 3241 Simplify (-6(sqrt(51) + sqrt(153)/sqrt(3)))/(sqrt(3) - sqrt(288)/sqrt(6)). 4sqrt(17) Simplify (sqrt(288)-1)2-4. -1152 Simplify (sqrt(9) + 3(sqrt(27)/sqrt(3) - sqrt(9)))/((sqrt(3) - (sqrt(108) - sqrt(27))) + sqrt(3)). -sqrt(3) Simplify (5(sqrt(99) + sqrt(99) + -2sqrt(99) + sqrt(99) + sqrt(99)))/((sqrt(252)/sqrt(7))/sqrt(4)). 10sqrt(11) Simplify (sqrt(1216) + -5)5. -25 + 40sqrt(19) Simplify sqrt(88)/(sqrt(16)/sqrt(98)). 7sqrt(11) Simplify (2 + sqrt(800))2. 80sqrt(2) + 804 Simplify 1(-1 + sqrt(272)). -1 + 4sqrt(17) Simplify ((sqrt(24) - sqrt(120)/sqrt(5))/sqrt(12))*2 + (sqrt(56) - sqrt(14))/sqrt(7). sqrt(2) Simplify (-1sqrt(176))*2 + 3. 179 Simplify (1 + (2sqrt(30))/sqrt(6) + 0)*2. 4sqrt(5) + 21 Simplify (sqrt(11) + sqrt(55)/sqrt(5))*2 + 1 - ((sqrt(44)/(-1sqrt(4)))*2 + sqrt(11)). -sqrt(11) + 34 Simplify (1sqrt(17))*2 + -3 - sqrt(68)/(sqrt(4)4). -sqrt(17)/4 + 14 Simplify ((sqrt(125) + -2)*2 + sqrt(125))-4. -516 + 60sqrt(5) Simplify sqrt(85)/(sqrt(250)/sqrt(2) - sqrt(5)). sqrt(17)/4 Simplify sqrt(343) + 3 - (sqrt(70)/sqrt(10) + 0). 3 + 6sqrt(7) Simplify ((sqrt(204) + (sqrt(204)1-6 - sqrt(204)) + sqrt(204))/(-4sqrt(12)-2))*2. 425/64 Simplify sqrt(49)/(sqrt(7) - (sqrt(7) + (sqrt(49)4)/sqrt(7))). -sqrt(7)/4 Simplify -2sqrt(57)/(-2sqrt(147) - sqrt(147)) + 4. 2sqrt(19)/21 + 4 Simplify 2 + sqrt(11) + (-4 + sqrt(704))2 + -3. -63sqrt(11) + 719 Simplify 2 + -5(sqrt(11) + sqrt(396))1. -35sqrt(11) + 2 Simplify (1sqrt(78)1)/(-5(sqrt(6) - (sqrt(6) - 1sqrt(6)))). -sqrt(13)/5 Simplify ((sqrt(26)-2 + sqrt(26))-1)/(2sqrt(288)). sqrt(13)/24 Simplify -1 + sqrt(539)2-2. -28sqrt(11) - 1 Simplify (5sqrt(931) + sqrt(475) + -1)*2. -80sqrt(19) + 30401 Simplify (2 + 1sqrt(425))2. 20sqrt(17) + 429 Simplify 1(sqrt(320) + sqrt(20)). 10sqrt(5) Simplify (sqrt(936) + (sqrt(936) - 4sqrt(936)))/sqrt(2). -12sqrt(13) Simplify (2 + (-1sqrt(128))2)-2. -260 Simplify ((((sqrt(385) - sqrt(385)-2) + sqrt(385) + sqrt(385) - sqrt(385) - sqrt(385)) + sqrt(385))/sqrt(7))/((-1sqrt(77))/sqrt(7)). -4sqrt(5) Simplify (sqrt(13) + ((sqrt(208) - -1sqrt(208) - sqrt(208)) + sqrt(13) - sqrt(13)) + (sqrt(52) - sqrt(208))/sqrt(4))*2. 208 Simplify (2sqrt(209)-1)/(sqrt(11) + 1sqrt(1331)). -sqrt(19)/6 Simplify 5(sqrt(5) + (-2 + sqrt(5)2)*2). -35sqrt(5) + 120 Simplify -1 + sqrt(1900) + -3. -4 + 10sqrt(19) Simplify (sqrt(171)-16)/sqrt(9) + (1sqrt(6897) + sqrt(6897))/sqrt(3). 16sqrt(19) Simplify -2 + (-3sqrt(27)-2)/sqrt(9). -2 + 6sqrt(3) Simplify (sqrt(637) - sqrt(13)) + sqrt(13) + -2 + (-4sqrt(104) + sqrt(104))/sqrt(8) + sqrt(13). -2 + 5sqrt(13) Simplify sqrt(20) + 3 + -3(sqrt(5) - (sqrt(5) - sqrt(50)/sqrt(10))). -sqrt(5) + 3 Simplify (sqrt(66)23 - sqrt(66))/sqrt(6). 5sqrt(11) Simplify -3 + (1 + sqrt(700) - sqrt(700)) - (sqrt(7) + sqrt(112) + (-2sqrt(112))2 + sqrt(112) - (sqrt(567) - (sqrt(567) + 0))). -450 - 9sqrt(7) Simplify (sqrt(2) - ((sqrt(2450) - sqrt(50)) + sqrt(2)))2 + 0 + sqrt(2) + 4 + -5. sqrt(2) + 1799 Simplify (0 + sqrt(396) + -1)2 + -5. -12sqrt(11) + 392 Simplify (((sqrt(385)/sqrt(11))/sqrt(7) + -4)4)*2. -128sqrt(5) + 336 Simplify 4(sqrt(1216)-1 + -2). -32sqrt(19) - 8 Simplify ((sqrt(44)/(sqrt(8)/sqrt(2)))2 - sqrt(11)) + sqrt(11) + (sqrt(132)/sqrt(108))2. 110/9 Simplify sqrt(20)/sqrt(4)4 + -3. -3 + 4sqrt(5) Simplify ((sqrt(468) + 0 + sqrt(468) + sqrt(468))1)*2 + 5sqrt(117)3. 45sqrt(13) + 4212 Simplify (sqrt(76)/(-1sqrt(484) - sqrt(484) - sqrt(484)))22. 38/1089 Simplify (sqrt(1216) + 0 + 2)*2 + sqrt(1216). 40sqrt(19) + 1220 Simplify ((sqrt(4) - 2sqrt(36)) + sqrt(4))/(6(sqrt(50) + sqrt(2)) + sqrt(2)). -4sqrt(2)/37 Simplify sqrt(8) + -1 + (-2sqrt(14))/sqrt(7). -1 Simplify 4(1 + sqrt(45) - sqrt(5)). 4 + 8sqrt(5) Simplify (sqrt(540)/sqrt(48))/(sqrt(108)/(sqrt(192) + sqrt(12)) - sqrt(9)). -5sqrt(5)/8 Simplify (1-3sqrt(209))/sqrt(11). -3sqrt(19) Simplify ((-2sqrt(1300) + 4)-3)*2. -1440sqrt(13) + 46944 Simplify 2sqrt(612) - (sqrt(17) + 2sqrt(17)1). 9sqrt(17) Simplify 0 + (sqrt(432) + -1)-3. -36sqrt(3) + 3 Simplify (((sqrt(12)-3)/sqrt(6))2 - ((-1sqrt(10))/sqrt(5))*2) + 4. 20 Simplify 5((-2sqrt(931))2 - sqrt(304)5). -100sqrt(19) + 18620 Simplify ((sqrt(66) + sqrt(66)2)-6)/(sqrt(24)/sqrt(4)-2). 9sqrt(11) Simplify sqrt(144)/sqrt(8) - (1 + 3sqrt(2) + sqrt(2)). -sqrt(2) - 1 Simplify (sqrt(11)44 - -4sqrt(1331))2. 39600 Simplify ((sqrt(156)/sqrt(4) - sqrt(39))/sqrt(3))2 + -3 + sqrt(208). -3 + 4sqrt(13) Simplify -13(sqrt(19) + 1). -3sqrt(19) - 3 Simplify -5(sqrt(3) + 4)-4. 20sqrt(3) + 80 Simplify (sqrt(1700) + sqrt(1700) + 1)*2 + (sqrt(17) + -2)1 + sqrt(17). 42sqrt(17) + 6799 Simplify (sqrt(132) - (sqrt(132) - (5sqrt(132)-1 + sqrt(132))))/(sqrt(72)/sqrt(6)-6). 2sqrt(11)/3 Simplify (sqrt(14)/sqrt(2) + -3)2 + -5. -6sqrt(7) + 11 Simplify (5-2sqrt(320)-3)2. 288000 Simplify (sqrt(171) + sqrt(171) + sqrt(171)-3-3 + sqrt(171))/(-3sqrt(225)). -4sqrt(19)/5 Simplify (3 + sqrt(18) + sqrt(2) + -3sqrt(2)-4)2. 96sqrt(2) + 521 Simplify -4 + (sqrt(294) - ((sqrt(294)2 + sqrt(294) + sqrt(294) - sqrt(294)) + sqrt(294) - sqrt(294)))/sqrt(2). -14sqrt(3) - 4 Simplify ((5sqrt(38)/sqrt(2)1)*2 + -4)-4. -1884 Simplify ((sqrt(153)2-3)/sqrt(9)-6 + 0)2. 22032 Simplify -4-2sqrt(19)5. 40sqrt(19) Simplify -6(sqrt(112) + -2). -24sqrt(7) + 12 Simplify (((sqrt(66)-2 - sqrt(66))-3)/((sqrt(66) + 2sqrt(66))/sqrt(11)))*2. 99 Simplify sqrt(275) + sqrt(275) + (sqrt(275) + (sqrt(275)2)*2)-1 + 4. -1096 + 5sqrt(11) Simplify (-1 + sqrt(152)/(sqrt(16)/sqrt(2)) + 3)2. 4sqrt(19) + 23 Simplify (2sqrt(768))/(sqrt(12)/sqrt(8) + sqrt(6)). 32sqrt(2)/3 Simplify 3(3 + (sqrt(19) - (sqrt(304) + -4 + sqrt(19))))2 + -1. -168sqrt(19) + 1058 Simplify (sqrt(28)/sqrt(4) + 5 - (sqrt(112) + -3))*2. -48sqrt(7) + 127 Simplify (-21sqrt(931))*2 - (sqrt(931) + (sqrt(931) - 2sqrt(931)-6)). -98sqrt(19) + 3724 Simplify (((1 + sqrt(13))-6 - sqrt(13)) + 0)24. 336sqrt(13) + 2692 Simplify -1sqrt(5)1 - (-5 + -4sqrt(5)). 5 + 3sqrt(5) Simplify 4sqrt(45)55 + -4. -4 + 300sqrt(5) Simplify ((sqrt(200)/sqrt(10))2 + (0 + sqrt(15)/sqrt(3))2)5. 125 Simplify (1 + sqrt(5))*2-2 + sqrt(500)-1. -14sqrt(5) - 12 Simplify ((sqrt(605)-1)2 - sqrt(605))6 - (sqrt(605) - (2 + sqrt(605)-2)). -99sqrt(5) + 3632 Simplify ((-2sqrt(33)1)/(sqrt(3) + 2sqrt(75)))2. 4/11 Simplify (sqrt(17) + -5sqrt(51)/sqrt(3) + 5 + sqrt(272) + sqrt(17))*2. 10sqrt(17) + 42 Simplify -4((1 + sqrt(2736)-1)*2 - (0 + (sqrt(2736)1)*2 + sqrt(2736))). -4 + 144sqrt(19) Simplify -4 + (sqrt(3) - (sqrt(3)1 + 4)2). -23 - 7sqrt(3) Simplify -5 + (-2(0 + sqrt(432)))2 + -3. 1720 Simplify ((sqrt(80) + sqrt(20))/sqrt(4) + 4sqrt(10)/sqrt(2))*2-4. -980 Simplify (-5 + (sqrt(117)-5 - sqrt(26)/(sqrt(2)-1)))*2. 140sqrt(13) + 2573 Simplify sqrt(1331) - ((sqrt(1331) + (sqrt(1331) + 1 - sqrt(1331)) + sqrt(1331))-6)2. -191700 - 1573sqrt(11) Simplify (-1sqrt(66))/sqrt(6)-5. 5sqrt(11) Simplify (sqrt(104)/sqrt(128))24. 13/4 Simplify 3 + (sqrt(25)3)/sqrt(5) + sqrt(5) + 3. 6 + 4sqrt(5) Simplify (sqrt(13) - -2sqrt(1053))54. 380sqrt(13) Simplify -5(sqrt(2) + (sqrt(2) + -3 + sqrt(2))-4). -60 + 35sqrt(2) Simplify sqrt(24)/(2sqrt(8)) - (-1sqrt(3) + 0). 3sqrt(3)/2 Simplify (-2sqrt(65)-1 + sqrt(65))/(-4sqrt(80)). -3sqrt(13)/16 Simplify (sqrt(55) + -3(sqrt(55) + sqrt(165)/sqrt(3)))/(sqrt(5) - (sqrt(10) + sqrt(10) + (sqrt(10)-2 - sqrt(10)))/sqrt(2)). -5sqrt(11)/2 Simplify (sqrt(2) + 1 + -5)4. -16 + 4sqrt(2) Simplify ((-3sqrt(1008))/((sqrt(90)3)/sqrt(10) + sqrt(9) - sqrt(9)))2. 112 Simplify -1 + sqrt(19) + -1 + 1 + sqrt(684). -1 + 7sqrt(19) Simplify (sqrt(360) + (	{ "pile_set_name": "DM Mathematics" }
64) - sqrt(64)) + sqrt(64))3. -9sqrt(3) Simplify 26(-5 + (-1 + (sqrt(144)/sqrt(4))/sqrt(12))1-33). -108sqrt(3) + 48 Simplify ((0 + (sqrt(242) - (-1 + sqrt(242))) - sqrt(242)) + sqrt(242) - -2((-1 + sqrt(242))2 - sqrt(242))) + 2 - (1 + 6(3(sqrt(242) + 2) + sqrt(242)))2. -140272 - 19602sqrt(2) Simplify 2 + ((sqrt(13) + sqrt(13)1 + 0 - (sqrt(637) + 0) - (-2 + 1 + sqrt(208) + 2))4)*2. 288sqrt(13) + 16866 Simplify (2 + (-1 + sqrt(800))-2)2 + 4(3 + (sqrt(1800)2 + sqrt(1800) - sqrt(1800)) + sqrt(1800) + sqrt(1800)). 160sqrt(2) + 3228 Simplify (((-1(sqrt(180)-1 + sqrt(180)) - sqrt(180))/sqrt(4))/(24sqrt(81)/sqrt(9)))*2. 5/64 Simplify (-2sqrt(1368) + (sqrt(380) - sqrt(380)-2)/sqrt(10) + (sqrt(342) + (sqrt(342) - 1sqrt(342) - sqrt(342)))-2)/((sqrt(16)-2-1)/(sqrt(24)/sqrt(3))). -9sqrt(19)/2 Simplify (sqrt(1377)-25)*2 + -2 + -4 + ((0 + sqrt(1377)3 - sqrt(1377))2 - sqrt(1377) - (0 + (sqrt(1377) - (sqrt(1377) + -3)) + sqrt(1377))2) + 4. -63sqrt(17) + 141820 Simplify (-5((sqrt(720)-1-1 + -4 - -4(sqrt(720) + (sqrt(720) - (-3 + sqrt(720) + sqrt(720) + -2 + sqrt(720))))) + -1 + -3))2. -21600sqrt(5) + 165600 Simplify (4(sqrt(1331) + 3)4 + -1sqrt(55)/sqrt(5) + 1 + sqrt(11) + -5)2. 15488sqrt(11) + 342672 Simplify -3(3 + sqrt(1100) + 1 + sqrt(1100))2 + (sqrt(77)/(sqrt(21)/sqrt(3)) + -4 - (sqrt(1100) + sqrt(1100) + 0 + sqrt(1100) + -2sqrt(176)))2. 48sqrt(11) + 4843 Simplify (121sqrt(95))/((-2sqrt(25))/sqrt(5) + -2sqrt(20)/sqrt(4)). -sqrt(19)/2 Simplify (-5 + (4sqrt(187)2)/sqrt(11) + 0 + ((sqrt(833) - (1 + sqrt(833))) + sqrt(833))6 + sqrt(85)/(sqrt(560)/sqrt(7)))*2. -2211sqrt(17)/2 + 688753/16 Simplify ((-1sqrt(833) + sqrt(833) + -3)-4 + (1 + 1 + sqrt(1088))-2)2. -256sqrt(17) + 4416 Simplify ((sqrt(378)/sqrt(7) + sqrt(6))/(sqrt(36)/(sqrt(24)/sqrt(2))) + ((2sqrt(140))/sqrt(7))/(2sqrt(10)5))-4. -84sqrt(2)/5 Simplify (-1 + sqrt(9)/(sqrt(3)-2) + (sqrt(3) - (sqrt(3) + sqrt(3)1-2)))*2 - (((4sqrt(24))/sqrt(8))*2 - -1sqrt(3)-2). -161/4 - sqrt(3) Simplify (sqrt(170) - sqrt(170)-1-6)/(sqrt(640)2)6 + (-3sqrt(68)4 + sqrt(68))/(sqrt(4) + sqrt(8)/sqrt(50)). -265sqrt(17)/24 Simplify (-3((sqrt(891) + sqrt(891) + (sqrt(891) - (sqrt(891) - (2 + sqrt(891)-1))*2) - sqrt(891)) + -2) + 2)-6. -64272 + 1620sqrt(11) Simplify ((sqrt(119) - -2(sqrt(119) - sqrt(119)-2) - sqrt(119) - (sqrt(119)-1-6 - sqrt(119) - sqrt(119)))/(1sqrt(1008) + -3sqrt(7)1) + -4)-3. -2sqrt(17)/3 + 12 Simplify ((-2((sqrt(91) - sqrt(91)-6) + sqrt(91))22)/(-1(sqrt(700) + (sqrt(700) + (1sqrt(700) - sqrt(700)))3)))2. 832/25 Simplify (-6(sqrt(1053) + -2(1 + sqrt(1053))) + -4 - (2sqrt(1053)-2-4 + -2))*2. -1800sqrt(13) + 105400 Simplify (1-5sqrt(5)2 + 4)2 - (-4 + (sqrt(60)/sqrt(12)-6)*2 + -3). -80sqrt(5) + 343 Simplify ((0 + 2 + sqrt(700) - (-2sqrt(700) + 2)) + (0 + -1 + sqrt(700) - (sqrt(700) + 4sqrt(700))2))2. 120sqrt(7) + 25201 Simplify -5 + ((-4 + sqrt(2736) + 1 + sqrt(2736))*2 + sqrt(2736)-2 + sqrt(2736) + -3 - ((2 + -3sqrt(2736))2 - ((sqrt(2736)-2 + sqrt(2736))-1)2)). -10947 - 12sqrt(19) Simplify -5-3-1sqrt(147)-1 + (3-2(sqrt(147) + sqrt(147) + 2 + 5 - sqrt(147)))*2 + 2. 3633sqrt(3) + 7058 Simplify (-3sqrt(832) + sqrt(832) + 5)22 - (-1 + -3 + sqrt(52)/sqrt(4) + (-2sqrt(156))/sqrt(12)). -319sqrt(13) + 6710 Simplify -5 + ((-1sqrt(66)-5 - sqrt(66)) + sqrt(66) + (sqrt(66) + 1sqrt(66))-3)/(-6(sqrt(6) - (sqrt(24) + sqrt(24)3))). -5 - sqrt(11)/42 Simplify -4 + (sqrt(10)/(sqrt(20)/(sqrt(40)/sqrt(4))) + -5)*2 + sqrt(180)/sqrt(144) + sqrt(20) + (sqrt(20) - sqrt(80)-6). 26 + 37sqrt(5)/2 Simplify -5 + ((-5 + (sqrt(99) - sqrt(99)-1) + 2 + (sqrt(99) - (sqrt(99) + -1 + sqrt(99)))6)2 - (5 + (sqrt(99) + (sqrt(99) - -1sqrt(99))3)-3)*2). -42096 + 558sqrt(11) Simplify (sqrt(4900) - (sqrt(4900) + sqrt(4900)3-4 + sqrt(4900)))/((-42sqrt(84))/sqrt(12))-2. 55sqrt(7)/2 Simplify -2(((-1(sqrt(200) - 2sqrt(200)))/sqrt(10))/(6(sqrt(800) - sqrt(50) - sqrt(50))/sqrt(5)))*2. -1/36 Simplify ((sqrt(1368) + sqrt(1368) + 1sqrt(1368)-4)/(51sqrt(18)))2-5-3. 912/5 Simplify (5((5(sqrt(605) + 1 - sqrt(605)) - 6(sqrt(605) - -1sqrt(605) - sqrt(605)) - (sqrt(605) + -4(sqrt(605) + 1) + -1)) + 2))*2. -19800sqrt(5) + 139725 Simplify (6((sqrt(360) - (2sqrt(360)5 + sqrt(360))) + sqrt(360) + sqrt(360)))/(2sqrt(968) + sqrt(8) + sqrt(32)/sqrt(64)). -192sqrt(5)/31 Simplify (5(sqrt(66) + -1sqrt(66)))/(sqrt(66)/(sqrt(11) + sqrt(176))) - (((sqrt(11) - sqrt(539))6 + sqrt(11) - sqrt(11)) + 1 + -4)*2. -14265 - 216sqrt(11) Simplify ((4 + (sqrt(396)/(-5sqrt(9)))/sqrt(4) + (sqrt(5324)-2)/sqrt(4))3)2. -7992sqrt(11)/5 + 1223379/25 Simplify (((sqrt(162) - (sqrt(162) + 3 + 3 + sqrt(162)))1 + (sqrt(162) + -4sqrt(162))-4 + -4 + -5)-1)*2. -2970sqrt(2) + 19827 Simplify 3 + (-4 + -1sqrt(1100)-3 + (sqrt(1100) + -2sqrt(1100))-5)*21 + -2. -640sqrt(11) + 70417 Simplify ((sqrt(216)/((sqrt(48) + sqrt(3888))/sqrt(4)))/(sqrt(270)/sqrt(5)4))*2. 1/4800 Simplify (4-2sqrt(2904) + (sqrt(2904) - -1sqrt(2904)4))/(sqrt(8) + sqrt(8) + 3sqrt(288) + sqrt(80)/(-3sqrt(10) - sqrt(10)) + sqrt(8)). -132sqrt(3)/83 Simplify ((4sqrt(875))/((2sqrt(125) - sqrt(125)) + sqrt(125) + sqrt(125))4)2-2. -3584/9 Simplify sqrt(288)-55 + (4 + 5 + (sqrt(8) - sqrt(8)2))2. -336sqrt(2) + 89 Simplify (sqrt(4752) + sqrt(4752)4 - sqrt(231)/(sqrt(21)/sqrt(3)))/(2sqrt(891)2 + 1sqrt(891)6). 59sqrt(3)/90 Simplify 5((sqrt(66) + (sqrt(66)-1 - sqrt(66)))-5 + sqrt(66) + sqrt(66) + sqrt(66) + sqrt(66)-23)/(sqrt(24)/((sqrt(120)/sqrt(3) + sqrt(40))/sqrt(10))). 20sqrt(11) Simplify (-2-4sqrt(88) - (sqrt(88) - (sqrt(88) + sqrt(88) + (-4sqrt(88) - sqrt(88)))6))/((1sqrt(576) + sqrt(576))/(sqrt(2) - (-1sqrt(72) + sqrt(72)))). -11sqrt(11)/12 Simplify ((-1sqrt(72)-1 - sqrt(72)-2-1)2 + -5 + (4(0 + sqrt(72)) - (sqrt(72) + (sqrt(72) - (4 + sqrt(72) + -1)))))2. -24sqrt(2) + 76 Simplify ((4sqrt(280)/sqrt(112)4)/(-5(sqrt(32) + 1sqrt(3872))))*2. 1/180 Simplify -2 + (sqrt(196)/(3sqrt(7)) + sqrt(700) + sqrt(700)-3)/(sqrt(40)/(-1sqrt(10)) - ((sqrt(32) - (sqrt(32) - sqrt(32)-1))/sqrt(8) + sqrt(4))). -2 + 29sqrt(7)/3 Simplify (-21sqrt(78) + (sqrt(78) + (sqrt(78) - -2sqrt(78)) - sqrt(78))-1)/(sqrt(150)3-21). sqrt(13)/6 Simplify (sqrt(56)/sqrt(2) + sqrt(7) - (sqrt(7) + ((sqrt(252))24 - sqrt(7)))) + (-5 + -3sqrt(63)/sqrt(9))1. -1013 Simplify ((sqrt(84)5)/sqrt(6)6)/(sqrt(7) + sqrt(56)/sqrt(72) - sqrt(14)/(1sqrt(2))). 90sqrt(2) Simplify ((-2(((0 + sqrt(1584))-5 - (sqrt(1584) + 4 + -1 + sqrt(1584))) + 1))*2 + 5)1. 1344sqrt(11) + 310485 Simplify 5(sqrt(2178) + 1sqrt(2178) + sqrt(2178) + sqrt(2178) + (-4sqrt(1800) - sqrt(1800)))/(sqrt(225)3 + (sqrt(9) + sqrt(27)/sqrt(3))6). -10sqrt(2)/9 Simplify -1 + (-2 + -6-6(sqrt(425) + -4))21. -52560sqrt(17) + 572115 Simplify (((sqrt(405) - sqrt(405)41) + sqrt(405))-4)/(sqrt(18)/(sqrt(10)/sqrt(500))). 12sqrt(5)/5 Simplify (-6(2(3sqrt(187) - sqrt(187)) + sqrt(187))/(sqrt(11) + sqrt(396)2)-5)*2. 382500/169 Simplify -3sqrt(684)-6 + -1 + (4 + 5 + (sqrt(1539) - (sqrt(1539) + 0)))2. 80 + 108sqrt(19) Simplify (0 + (-1(sqrt(114)-1 - sqrt(114)) + sqrt(114) + -6sqrt(114)1 + sqrt(114))/((sqrt(486) - (sqrt(486) + -2sqrt(486)))5 - 2sqrt(486)2))*2. 19/729 Simplify 515(sqrt(209)/(sqrt(11)-3) - (sqrt(19) - 5(-2 + sqrt(19))))*22. -11000sqrt(19)/3 + 159950/9 Simplify 2 + (2(sqrt(84) + sqrt(84)-2-4))/((sqrt(72) + -6sqrt(72)1)/sqrt(6)). -18sqrt(7)/5 + 2 Simplify (sqrt(330)/sqrt(864) - sqrt(495)/sqrt(1089))/(6(sqrt(5) - sqrt(40)/sqrt(8)) + sqrt(30)/sqrt(6)-1). sqrt(11)/132 Simplify ((sqrt(1053) - (sqrt(1053)1 + 2)) + sqrt(1053) - (sqrt(1053)1 + 2) - 1(-5 + -2sqrt(468)3))*2. 72sqrt(13) + 16849 Simplify (-1 + ((-1 + sqrt(3) + sqrt(3))-1 + sqrt(3) - (-1 + sqrt(3)2)*2) + -4(sqrt(3) + sqrt(24)/(sqrt(32)/sqrt(4)))-4)-1. -35sqrt(3) + 13 Simplify ((sqrt(11) + -5 + sqrt(44) + 3)2 - 6(-2 + 2sqrt(11))) + ((2sqrt(99)-3)/((-3sqrt(108) + sqrt(108))/sqrt(12) - sqrt(9)))*2. -24sqrt(11) + 159 Simplify (((sqrt(114) + -2sqrt(114))2 - sqrt(114))/((-1*sqrt(72))/sqrt(12) - sqrt(6) -	{ "pile_set_name": "DM Mathematics" }
*3. 84m*3 Collect the terms in -400z*3 - 2 - 1249z*3 - 574z*3 + 2. -2223z*3 Collect the terms in 1774g*3 + 1768g*3 + 1614g*3 - 5272g*3. -116g*3 Collect the terms in -11799q + 43467q + 164825q. 196493q Collect the terms in -41859f*3 - 328f*3 - 6131f*3. -48318f*3 Collect the terms in -1382q*3 - 28889q - q*2 + 28893q - 259q3. -1641q3 - q2 + 4q Collect the terms in -6t + 48478t2 - 11t*3 - 11 - 48478t*2 + 11. -11t*3 - 6t Collect the terms in 393z - 251z + 20864140 - 20864140. 142z Collect the terms in 59 + 2f*2 + 59 - 278 + 68 + 62. 2f2 - 30 Collect the terms in -1293 + g2 + 9872g + 1293. g2 + 9872g Collect the terms in 49v - 2387537 + 4772138 - v3 - 2384601. -v3 + 49v Collect the terms in 1724251 - 4z2 - 3448460 + 1724209. -4z*2 Collect the terms in -3763a*2 + 17a + 15a - 3736a*2 + 7561a*2 - 32a. 62a2 Collect the terms in 5c*3 - 123c*3 - 69c*3 + 13c3 - c3 - 67c3. -242c*3 Collect the terms in -14425t*3 - 7256t*3 + 1906t*3. -19775t*3 Collect the terms in -272f*2 - 266f*2 + 38f*3 + 538f*2 + 222f - 39f3. -f3 + 222f Collect the terms in -9258i + 3072i + 3119i + 3070i. 3i Collect the terms in -5828h + 46224h - 8685h. 31711h Collect the terms in 128o - o*3 - 17o*2 - 80o - 68o. -o3 - 17o*2 - 20o Collect the terms in -1843713g3 - 20g*2 - 10g*2 + 1843716g*3. 3g*3 - 30g*2 Collect the terms in -51877c*3 - 6169c*3 - 17278c*3. -75324c*3 Collect the terms in 4354b - 879b + 769b + 1871b + 600b. 6715b Collect the terms in -2106576x + 4076183x - 1969606x. x Collect the terms in -3m + 2198143 + 2m + m + 3m - 2198207. 3m - 64 Collect the terms in -7j2 + 42249j*3 + 7j*2 + 2j - 42267j3. -18j*3 + 2j Collect the terms in 12k3 + 6 - 1124k*2 + 41551k*2 - 4 - 10k*3. 2k*3 + 40427k*2 + 2 Collect the terms in -73890 + 1782837b + 73890. 1782837b Collect the terms in 15w*2 + 0w*2 + 15w*2 + 4w*2 + 10w*2 + 17w*2 - 38w*2. 23w*2 Collect the terms in -47 + 22 + 12101x*2 - 2x*3 + 20. -2x*3 + 12101x*2 - 5 Collect the terms in 15948t*2 - 8000t*2 + 16399t - 16399t - 7973t*2. -25t*2 Collect the terms in -168s + 76s + 414 + 35 + 91s. -s + 449 Collect the terms in 17494 - 52534 - 2604r + 17524 + 17516. -2604r Collect the terms in 1 + 31n2 - 29n*2 - 29 + 13n - 13n. 2n*2 - 28 Collect the terms in -15n + 784622n3 + 18n - 783310n3. 1312n*3 + 3n Collect the terms in -1077 - 38f + 1077 + 49f - 7f - 25f. -21f Collect the terms in -895b + 1612b - 948b + 80 + 1443b + 1723b. 2935b + 80 Collect the terms in -141 - 828901k*3 + 1657793k*3 - 828888k*3. 4k*3 - 141 Collect the terms in 37q*3 - 255q*3 + 117q*2 + 25q*2 + 33q*2 + 17q*2. -218q*3 + 192q2 Collect the terms in -t3 - 29905018 + 9t2 + 10t3 + 29905018 - t2. 9t3 + 8t*2 Collect the terms in 158j + 723j + 1125j + 813j + 167j. 2986j Collect the terms in 11309633o*3 - 3 + 3 - 11309735o*3. -102o*3 Collect the terms in -105 - 113 - 156 - 108 + f + 465. f - 17 Collect the terms in 7596273 + 7596266 - 15192532 - 2m. -2m + 7 Collect the terms in -42z*3 + 2925z*3 + 267594z - 267594z. 2883z*3 Collect the terms in -16n + 0n + 11n + 11958 + 3n. -2n + 11958 Collect the terms in -6151r2 + 12620r*2 - 6482r*2. -13r*2 Collect the terms in 2071 + 2073 - 6244 + m + 2102. m + 2 Collect the terms in -162252s + 2s2 + 324582s - 5s2 + 4s*2 - 162330s. s*2 Collect the terms in -697s - 6 - 2 + 201s - 222s + 2. -718s - 6 Collect the terms in -5416s*3 + 1522s*3 + 2320s*3 + 1529s*3. -45s*3 Collect the terms in -1870v*3 - 1160v*3 - 2156v*3. -5186v*3 Collect the terms in -10871q + 3586q + 7255q. -30q Collect the terms in 88j*3 + 1786j*2 + 29j*3 + 1776j*2 - 3510j*2. 117j*3 + 52j*2 Collect the terms in -2531650o - 2531682o + 17o*3 + 5063332o. 17o3 Collect the terms in -69b*3 - 153b*3 - 156b*3. -378b*3 Collect the terms in 0 + 87i*3 + 18543i - 18552i - 5. 87i*3 - 9i - 5 Collect the terms in -2191691 + 1095844 + 1113o - 1144o + 1095845. -31o - 2 Collect the terms in -13396o*3 + 13452o*3 + 58o*2 - 122o*2 - 2 + 64o*2. 56o*3 - 2 Collect the terms in 4050y - 91 + 192 - 101. 4050y Collect the terms in 99y*3 + 5335 - 2666 - 2671 + 13y*3. 112y*3 - 2 Collect the terms in 7m - 11m + 17m + 2057m2 - 13m. 2057m2 Collect the terms in 53r*2 + 18r*2 + 82r*2 + 5r*2 - 298r*2 + 6r*2. -134r2 Collect the terms in -634 + 151 - g2 - 10g2 + 147 + 190 + 152. -11g*2 + 6 Collect the terms in -196u*3 - 653 + 1306 - 653 - 824u*3. -1020u*3 Collect the terms in 377k*2 - 1774k*2 + 367k*2 + 359k*2 + 182k*2 + 187k*2. -302k*2 Collect the terms in 1678 + 0a*2 + 2a*2 + 14267 - 17624 + 1679. 2a*2 Collect the terms in -22126r*2 - 40743r*2 - 3166r*2. -66035r*2 Collect the terms in 7t*3 + 7557 - 3743 - 3809. 7t*3 + 5 Collect the terms in 3990325x - 7406065x - 13253888x. -16669628x Collect the terms in -34v + 1776v2 - 35v - 31v + 132v - 32v. 1776v*2 Collect the terms in -26s*3 - 114s*3 + 142s*3 - 92s*2. 2s*3 - 92s*2 Collect the terms in 103431y - 103431y - 8032y*3. -8032y*3 Collect the terms in -508y*2 + 5y*3 + 1611y*2 + 6534y*2. 5y*3 + 7637y*2 Collect the terms in -7p*3 + 6p*3 - 18p*3 + 4699p - 2294p - 2405p. -19p3 Collect the terms in 1 + 17h*2 - 186h*2 + 40h*2 + 61h*2 + 1 - 3. -68h*2 - 1 Collect the terms in 17495 - 2935 - 2h + 32033 + 30600 - 7706. -2h + 69487 Collect the terms in 872d*2 - 1348d*2 - 6420d*2. -6896d*2 Collect the terms in -1045886 + 1045886 - 9g*2 + 12g*2. 3g*2 Collect the terms in 86838j*2 + 85633j*2 + 30058j*2 - 60316j*2. 142213j*2 Collect the terms in 5k - 8k + 7k + 58k2 + 8k*2 - 59k*2. 7k*2 + 4k Collect the terms in 6y3 - 672140y*2 + 672133y*2 + 26y*3. 32y*3 - 7y*2 Collect the terms in -35w - 42w - 36w - 35w - 38w - 33w + 204w. -15w Collect the terms in 18t - 14t + t + 10t - 19t - 5t. -9t Collect the terms in 53486 - 26l + 53433 + 53477 - 160394. -26l + 2 Collect the terms in -669 - 143 - d2 + 707. -d2 - 105 Collect the terms in 114180z*3 + z + 2z*2 + 96116z*3 - 3z. 210296z3 + 2z*2 - 2z Collect the terms in -394b2 + 16942b*2 + 1375b*2. 17923b*2 Collect the terms in -17m - 56 + 30m + 113 - 47 - 49 + 39. 13m Collect the terms in -9a2 + 133415311788 - 133415311788. -9a*2 Collect the terms in 12959v - 9v3 + 5v*3 - 6485v - 6486v - 6v*3. -10v*3 - 12v Collect the terms in -8145t3 - 7742t*3 - 642t + 15888t3. t3 - 642t Collect the terms in -9663c2 - 8271c*2 - 26183c*2. -44117c*2 Collect the terms in -11 + 1 - 15 - 2 + 494503i. 494503i - 27 Collect the terms in -1562 + 8354l - 1514 + 3076. 8354l Collect the terms in 38w3 - w2 + 33710w - 33710w - 85w3 + 76w*3. 29w3 - w2 Collect the terms in 11040 - 3j + j - 11049 + j - 3j. -4j - 9 Collect the terms in 1430 - 1422 - 71941b - 41163b + 14368b. -98736b + 8 Collect the terms in -98 - 19942w + 9984w + 9911w. -47w - 98 Collect the terms in 227x + 245x - 802x + 292x. -38x Collect the terms in -290321520a2 + 8a + 0a + 145160773a*2 + 145160751a*2 - 8a. 4a2 Collect the terms in -79b + 18b + 20b + 22b + 28b - 10b + 77. -b + 77 Collect the terms in 20704p*2 + 3p + 53945p2 - 142097p*2 - 3p. -67448p2 Collect the terms in -222409 - 291v*2 + 222409 + 292v2. v2 Collect the terms in -552 - 551 - 487 - 12d2 + 1590. -12d*2 Collect the terms in 2389p + 2720p + 2388p - 7551p. -54p Collect the terms in -14a + 154a*2 - 43 + 13 + 30 - 312a*2 + 159a2. a2 - 14a Collect the terms in 7 - 12v - 2 + 5v + 6v + 57 + 23. -v + 85 Collect the terms in 10201w - 4507w - 4854w. 840w Collect the terms in -2733b + 5313b - 2553b. 27b Collect the terms in -512891125917l + 20l*3 + 512891125917l - 7l3. 13l**3 Collect the terms in 7761 - 374 - i - 7398. -i - 11 Collect the	{ "pile_set_name": "DM Mathematics" }
xpand (5l3 - l3 - 3l*3)(-3l2 + 4l*2 + 0l2) + l5 - l*5 - 2l*5 - 2l*2 + 2l*2 - 2l*5 + (2l + 0l - 4l)(4l*4 - 4l*4 - 2l4). l5 Expand (-1 - 3 + 1)(x + 4x*3 + 5x*3 - 4x*3). -15x*3 - 3x Expand (-2u2 + 3u*2 - 2u*2)(-14 + 46 + 42). -74u2 Expand (0a*2 + 0a*2 - 2a*2)(5a3 - 22 + 22) + (2a - a + 0a)(a4 - a4 - a*4) + 3a*5 - 5a*5 + 0a*5. -13a*5 Expand (-11f*3 - 14f + 14f)(-2f2 + 0 + 0) - f5 - 1 + 2f*5 + 0f*5. 23f*5 - 1 Expand (2z + z + 0z)(4 - 2 - 6)(-z3 - z3 - z3). 36z*4 Expand (0 + 2 + 0)(0d + 6d - 3d)(0d4 - 5d*4 + 2d*4). -18d*5 Expand 11i*3 - 5i + 5i3 - 20i3 + (i2 + 2i2 - i2)(-2i + 2i - 2i). -8i*3 - 5i Expand (0j + 0j + j)(3 + 7 + 1 + 0). 11j Expand (-12c - c + c)(0 + 4 - 2) + (2c - 2c + 2c)(-1 + 2 + 1). -20c Expand (2 - 2 - 6u*2 + u)(-5 + 4 + 5). -24u2 + 4u Expand (0f + 0f - 2f)(-4f2 - f3 + 4f*2) + (2 - 2 - 2f)(-3f*3 + 4f*3 - 2f*3) - 4f*4 + 7f4 + f4. 8f4 Expand (10n*4 + 3n*3 - 12n*4 + 4n*3)(0 + 4 - 1). -6n4 + 21n*3 Expand (i - 4 - 5i + 3i)(i*3 - 5i*2 + 5i*2) - 2i*3 + 2i*3 - 9i*4. -10i*4 - 4i*3 Expand -23 + 23 - 3k*5 - 4k - 2k5 + 4k + (4k3 + k3 - 2k*3)(0k + 0k - 2k2). -11k*5 Expand (-4l*3 + 2l3 - l3)(-3l*2 + 3l2 - l2) - 2l4 + 2l*5 - 2l*4 - 3l*5. 2l*5 - 4l*4 Expand (-4u + 3 + 6u + 0u)(-4 + 1 + 0). -6u - 9 Expand (-5 + 5 - 7a)(a + 2a + a). -28a*2 Expand (-7 + 21 - 8)(2b + 2 - 2)(3 - 2 + 2). 36b Expand (-2d + d - 5 + 3)((4d - 2d - 3d)(-2 + 1 + 3) + 2d + 0d - d + d + d + 0d + 2d - 1 - 5d - 1). 2d2 + 6d + 4 Expand (-1 + 3 + 0)(-3 + 5 + 2)(-3q - q + q). -24q Expand ((-6m3 + m3 + 3m*3)(3 - 1 - 1) + m2 - m2 - 2m3)(22m - 7m - 6m). -36m*4 Expand (2p - p + p)(-1 + 1 + p) + (-11p + 3p + 0p)(2p - 4p + 3p) + 1 - 1 + p*2. -5p*2 Expand (2 + 2x - 2)(0 + 4 - 6)(-11x - 9x + 6x). 56x*2 Expand (4 - 4 - 5)(t*3 - 2t + 2t)(0t + 3t + 0t). -15t*4 Expand -20 + 20 + 5a*4 + (0a*2 + 0a2 - a3)(3a - a - a) - 2a + 2a + 2a4 - 4a4 - a4 + 3a4. 4a*4 Expand (0w*3 + 3w*3 - 2w*3)(5w - 5w - 3w2)(-4 + 2 + 1). 3w5 Expand (l2 + 2l3 - l2)(-5 + 2 - 2) - 2l3 + l3 - l*3. -12l*3 Expand (4q4 - q4 - 5q4)(1 - q - 1) + (-2q3 - 4 + 4)(-q*2 + 0q2 - q2). 6q5 Expand (-3w*2 - 2w + 2w)(-5w2 + 4w*2 + 6w2) + w4 - w4 + w4. -14w4 Expand (q3 - q3 + 2q*3)(2q + 0q + 4q) + (q2 - 4q*2 + 2q*2)(0q + 0q + 2q2). 10q*4 Expand (0u - 2u + 4u)(-2 - 3 + 3) + 2u - u - 2u - 3u + u + u + (6u + u + 0u)(-2 + 2 - 2). -20u Expand (1 - 3 + 5)(2l - 3l2 - 2l). -9l2 Expand (-2t + 4t - t + (1 + 1 + 0)(-3 + 3 - t) - 3t - t + 6t)(0 - 3 + 2). -t Expand (5 - 5 - 1)(-4 + 4 + 2a)(a + 2a - 5a)(-a + 14a - 8a). 20a*3 Expand (5n + 2 - 5n + 16n)(-3 + 3 - n). -16n*2 - 2n Expand (2g2 + 0g*2 + 0g*2)(-5g + 0g + g + 3g2). 6g*4 - 8g*3 Expand (-2b*2 - 3 + 3)(2b + b - b) - b3 - 2b + 2b. -5b*3 Expand (-8 - 1 + 7)(-y*5 + 3y*5 + 0y*5). -4y*5 Expand 0i*5 + 0i5 - i5 - i4 + i5 - 5i5 + 2i*5 + (0 + 0 - 2i*5)(-2 + 4 - 1). -5i5 - i4 Expand (-6 + 2 + 3)(4p - 2p + 0p) + 2p - 3p + 4p - 6p + 4p + 3p. 2p Expand -141h + 300h + 3 - 146h + (-3 + 3 - 2)(h + 3h - 3h) - h + 4h - 5h - 1 + 2h + 1. 11h + 3 Expand (3 + 0 - 1)(-2d + 2d + 5d + (-1 + 3 - 1)(0d + 0d - d) + 3d + 0d - d). 12d Expand (-2u - u + u)(-4u - 2u + 7u). -2u*2 Expand (0x + 2x - 3x)(26 - 49 + 9). 14x Expand -c + c - c*2 + (-1 + c + 1)(-4c + c + c) - 2c*2 + 4c*2 + 0c*2 + 2c*2 + 1 - c - 8c + 8c. c2 - c + 1 Expand 2d*3 + 3d*3 - 3d*3 + (0d + 0d - 2d*2)(0 + 0 + 2d) - 2d*3 - 3d + 3d - 3d*3 + 0d3 + d3 + (4d2 - 4d*2 + 2d*3)(-11 + 4 - 3). -26d3 Expand -5k*2 - k + 0k - k + 1 + k*2 - 2k2 - k2 + (-3 + k + 3)(-3k + k + k). -8k2 - 2k + 1 Expand (-2 + 1 + 2)(-5r + 2r + 4r) - 2r + 3r - 4r - 7 + 3r + 7. r Expand (1 + 1 - 17)(0 + 0 - 3)(0 + j + 0). 45j Expand (-5b*2 + 3b*2 + 3b*2)(2b - 4b + 5b)(-2 - 2b2 + 2) + b5 - 2b*5 + 0b*5. -7b*5 Expand 2p*3 - 3p*3 + 3p*3 + (5p*2 - 3p2 - p2)(0p + 3p + 0p). 5p3 Expand 0x*2 + 5x2 + x2 + (-2 + x*2 + 2)(-3 + 0 + 1) + (-4 + 6 - 3)(-2x*2 + 2x2 - x2) - x*2 - 6x*2 + 5x*2. 3x*2 Expand (-7g + 7g + 3g)(-2g - 3g + 6g)(-2g*3 - 2g*3 + 6g*3). 6g*5 Expand 4351 - 4351 - 5r + 5 - 2r - 5 + (-2r - 2 + 2)(1 - 4 + 4). -9r Expand (10 + 0 - 1 + (-2 + 2 + 1)(1 - 2 + 0))(-4f2 + 3f2 - f2). -16f2 Expand 0n*2 + 5n*2 - 3n*2 + 2n*2 + 4n*2 - 4n*2 + (-4 + 5 + 1)(0n2 - n2 - n2) - 1 + 1 + n2 - 7n*2 + 8n*2 + 18n*2. 20n2 Expand (-u3 - 5u3 + 5u*3)(-216 - 6u + 216) + 0u*3 + 0u3 + u4. 7u4 Expand 23 + 207r - 3 - 206r + (0 - 1 - 1)(5r - r - 3r) - 2 - 2r + 2. -3r + 20 Expand (-1 + 6 - 3)(1 - 1 + 3p)(-p + 8 - 8). -6p*2 Expand (2r - 4r + 4r)(0r*2 - 13r*2 + 3r*2)(-2 + 2r + 2). -40r*4 Expand (3a*3 + a + a + 0a)(0a + 5a - 3a)(2 - 2 - 1). -6a*4 - 4a*2 Expand (6q + 4q - 6q)(q + 0 + 0)(-q - 3q + 2q). -8q3 Expand (3i4 - i4 + i*4)(0 + 0 + 2i + (-2 - 4 + 4)(-i + 1 - 1)). 12i5 Expand (v + 5v - 2v)(5 + 2 - 1)(-2 + 2 - 1)(v + 3v - 2v). -48v2 Expand (3b - 2b - 2b)(2 + 3 + 3)(5b - 2b - 5b). 16b*2 Expand (1 - 7p - 2p + 4p)(0p*3 - 4p*3 + 3p*3). 5p4 - p3 Expand (w + 2w - w)(4 - 4 - 1) - 2 + 2 - 2w + 0w + 2w - w + (4w + 0w - 2w)(-2 + 5 - 2). -w Expand 3 + 2z - 1 - 4z + (-3z + z + z)(-3 + 8 + 3). -10z + 2 Expand (-2w + 0w + 0w)(16 + 4w2 - 16) - w3 - w3 + 4w*3 + 4w*3 + 0w*3 - 2w*3. -4w*3 Expand (j + 2j - 4j)(j - 27 + 66 + 42). -j*2 - 81j Expand 2 - 104q2 - 104q*2 + 210q*2 + 12q + (2 + 0 - 3)(-2q*2 - 3q*2 + 3q*2). 4q*2 + 12q + 2 Expand (6 - 5 - 2)(t + 0t - 2t) - t + 5t - 2t. 3t Expand (0g - 3g + 0g)(3g + 5g*2 + 3g*3 - 5g*2). -9g*4 - 9g*2 Expand (4 - 6 + 1)(4 + z - 4)(-z2 + 3z*2 - 3z2). z3 Expand (7q4 - 3q*4 - 3q*4)(-4q + 2q - 4q). -6q*5 Expand (-1 + 4 - 3 + 273c)(2 + 0 + 0). 546c Expand -4w5 - w5 + 9w*5 + (-4w*3 + 3w3 - w3)(4w*2 - 3w*2 - 2w*2). 6w*5 Expand (3 + 0 + 0)(-x + 0x + 2x) - 4x + x + x. x Expand ((2 - 2 + 1)(0s + 0s + s*2) + 98 + 40s*2 - 98)(-s + 4 - 4). -41s3 Expand -3y + 4y - 2y + (-1 + 7 - 4)((0 + 3 - 1)(3 + 1 - 5) + 40 - 1 - 4)(2 - 2y - 2). -133y Expand (43 - 35 - 24)(-7o + o + 3o). 48o Expand 12 + 3c*5 - 13 - 5c*5 + (c + 0c + c)(-2c*4 + 0c*3 + 0c3) + c5 - 2c5 - 2c*5. -9c*5 - 1 Expand (1 + 3r*2 - 1)(3r + 10r + 2 - 17r). -12r*3 + 6r*2 Expand -13j*3 - 4j*2 + 4j*2 + 4j*2 - 2j*3 - 4j2 + (-j2 - 2j2 + 4j*2)(1 - 1 + j) + (3j + 2 - 2)(j + j*2 - j). -11j*3 Expand (-2u*3 + 6u*3 - 3u*3)(5 + 1 - 4)(3 - 5 + 7). 10u*3 Expand 3 - 7 - 3z + z + (3 - 3 - 2z)(5 - 1 + 0) - 2z + 4 - 4. -12z - 4 Expand (-2d + 0 + 0)(-3d + 2 - 2) + d2 - 2d + 2d + d2 + d - d + 4d*2 - 3d*2 - 3d*2 + (-2d + 2d + d2)(-2 + 0 + 6) + d*2 - 4 + 4. 11d*2 Expand (-1 - 2j + 1)(10j*2 + 4j - 4j) + 3j*3 + 0j*3 + 6j*3. -11j3 Expand n3 - 2n3 + 3n*3 + (0n3 - n3 + 4n3)(-2 + 5 - 2) - 1 - 6n3 + 0 + 25n*3. 24n*3 - 1 Expand (-2 + 3 + j + 3j)(3 - 4 + 2). 4j + 1 Expand -14r2 - 14r - 19 + 12r2 + 17 + (5r - 5r - 2r)(2r + 0r + 0r) + 0 + 0 - 2r2 + 2r + 2r2 - 2r. -6r2 - 14r - 2 Expand (5z - 3z - 3z)(-3z + 4z + 0z) + z2 - 2z2 - z2 + (2z + 8z - 3z)(1 - z - 1) + 8 - 6z2 - 8. -16z*2 Expand (-3a*3 + 2a*3 + 6a*3)(-4 + 4 - 4 + 2a). 10a*4 - 20a*3 Expand (5 - 5 - 5k)(0k*2 + 2k2 - k2)(3 - 2k - 3 + (1 - 1 - 2)(2k + 2k - 2k) + k + 1 - 1 + 3k + 3k - 5k). 20k*4 Expand (-1 - j + 1)(-20 - 4 - 5). 29j Expand (-2n + 4 - 4)*(-	{ "pile_set_name": "DM Mathematics" }
(40). 9sqrt(5)/2 Simplify sqrt(34)/sqrt(800)-1. -sqrt(17)/20 Simplify ((0 + (sqrt(448) - (sqrt(448) - ((sqrt(448) - (sqrt(448) - (sqrt(448) + 1) - sqrt(448) - sqrt(448) - sqrt(448))) + sqrt(448)))) + 3)-1)2. 320sqrt(7) + 11216 Simplify (-4(sqrt(152) + (-2sqrt(152) - sqrt(152) - sqrt(152)) + sqrt(152)))/((1sqrt(64))/sqrt(8)). 8sqrt(19) Simplify (sqrt(20) - sqrt(40)/sqrt(2))/sqrt(10) + sqrt(2) - (sqrt(8) + 5). -5 - sqrt(2) Simplify (3(sqrt(20) + (sqrt(20) + sqrt(20)-1 - sqrt(20)) - sqrt(20)))/(sqrt(4)-2-3). -sqrt(5)/2 Simplify (sqrt(1458) + 0)*2 + 4. 1462 Simplify 2(4 + sqrt(2)) + 5sqrt(8). 8 + 12sqrt(2) Simplify 6sqrt(5)-2 - (sqrt(5) - (sqrt(5) - (sqrt(245) + 0))*2). -13sqrt(5) + 180 Simplify (-22sqrt(78))/(sqrt(60)/(sqrt(10)3)). -12sqrt(13) Simplify (sqrt(96)/(sqrt(88)/sqrt(11)))/sqrt(4). sqrt(3) Simplify ((-1sqrt(832) + -1)-2 + -1)*2. 32sqrt(13) + 3329 Simplify (5(sqrt(1053) + 2)1)*2. 900sqrt(13) + 26425 Simplify -4sqrt(44)1. -8sqrt(11) Simplify sqrt(50)-21-3. 30sqrt(2) Simplify (sqrt(68) - -2sqrt(68)3)/(sqrt(108)/sqrt(3)). 7sqrt(17)/3 Simplify -2((2sqrt(15)/sqrt(3))*2 - (((sqrt(5) + 2sqrt(5) + sqrt(5))5)2 - sqrt(5))). -2sqrt(5) + 3960 Simplify 5 + sqrt(99)-22 + 4. -12sqrt(11) + 9 Simplify 5(0 + sqrt(272)). 20sqrt(17) Simplify sqrt(45)/(-5sqrt(144)). -sqrt(5)/20 Simplify (sqrt(128) + 0 + 2 + sqrt(128) + (-1 + sqrt(128))2)2. 2048 Simplify (5sqrt(170)-3)/sqrt(10). -15sqrt(17) Simplify 2 + sqrt(125) + -3. -1 + 5sqrt(5) Simplify (5 + -1sqrt(11))2 + ((sqrt(110)-2)/sqrt(10) + sqrt(11)-25)*2. -2sqrt(11) + 1594 Simplify (2 + (((sqrt(7) - sqrt(14)/sqrt(2)-3) + sqrt(7))2 - sqrt(7)))6. -6sqrt(7) + 1062 Simplify (sqrt(540)/sqrt(6))/(sqrt(160)/sqrt(2)). 3sqrt(2)/4 Simplify (6(sqrt(1573) + -4))2. -3168sqrt(13) + 57204 Simplify -4 + 2 + 0 + (sqrt(18)/sqrt(6))*2. 1 Simplify (sqrt(704) + (sqrt(704) - (sqrt(704) + -2)-1))*2 + 0. -96sqrt(11) + 6340 Simplify sqrt(209)/(-4(sqrt(44)/sqrt(4) + sqrt(11))). -sqrt(19)/8 Simplify (sqrt(84)2 - sqrt(84) - sqrt(21))/(sqrt(363)-1). -sqrt(7)/11 Simplify sqrt(700) + ((sqrt(700) - (sqrt(700) + 2) - sqrt(700))2 - sqrt(700)) - sqrt(84)/(sqrt(12)-1 - sqrt(12) - sqrt(12)). 121sqrt(7)/3 + 704 Simplify sqrt(176)-3-1. 12sqrt(11) Simplify ((2sqrt(52))/sqrt(2))/(2sqrt(32)). sqrt(13)/4 Simplify sqrt(1088)-1 + -5 + sqrt(1088) - sqrt(153)/(sqrt(9) - (sqrt(99)/(sqrt(22)/sqrt(2)) - sqrt(9))). -5 - sqrt(17) Simplify (sqrt(35)/(2sqrt(112)))*2. 5/64 Simplify (sqrt(931) + -3 + 1sqrt(931) - (sqrt(931) + 0)-3)2. -210sqrt(19) + 23284 Simplify ((sqrt(1300) + sqrt(1300) + 3)-3)2. 1080sqrt(13) + 46881 Simplify (4 + (-2sqrt(50))/sqrt(10))2. -4sqrt(5) + 8 Simplify (-2 + 2sqrt(3))-2. -4sqrt(3) + 4 Simplify (-3 + -4 + sqrt(24)/(sqrt(12) - (sqrt(12) + sqrt(12) + sqrt(84)/sqrt(7))))*2. 7sqrt(2) + 99/2 Simplify (sqrt(228) + -4-2sqrt(228))/(sqrt(12) - sqrt(12)-26). 9sqrt(19)/13 Simplify -4(1 + sqrt(405) + 2)*2. -1656 - 216sqrt(5) Simplify (6(sqrt(70) - -1sqrt(70)) - sqrt(70))/(sqrt(40)-6 - sqrt(10)). -11sqrt(7)/13 Simplify sqrt(171) + -3 + 1 + 1. -1 + 3sqrt(19) Simplify (4sqrt(14)/sqrt(7) + sqrt(2))*2 + 4. 54 Simplify (-1((-1sqrt(136) - sqrt(136)) + sqrt(136)))/(sqrt(80)/(sqrt(30)/sqrt(3))). sqrt(17) Simplify ((sqrt(1100) + 1)2-3 - sqrt(1100)) + sqrt(1100). -3303 - 60sqrt(11) Simplify 0 + sqrt(637)-5 + 3. -35sqrt(13) + 3 Simplify -6(0 + sqrt(847) + sqrt(847) - sqrt(847))-5. 330sqrt(7) Simplify ((sqrt(11) - sqrt(22)/sqrt(2)) + 5)2 - (-2 + sqrt(1100))2. -1079 + 40sqrt(11) Simplify -66(-1 + sqrt(7)). -36sqrt(7) + 36 Simplify -5 + -5 + sqrt(39)/sqrt(3) + 5 + (sqrt(52))*2. sqrt(13) + 47 Simplify 5(-1sqrt(19) + -2 + -1). -5sqrt(19) - 15 Simplify 0 + sqrt(6)/(sqrt(8)/sqrt(4)) + (sqrt(3) + -1)*2 + 2. -sqrt(3) + 6 Simplify sqrt(15)/sqrt(243) + -2. -2 + sqrt(5)/9 Simplify (3sqrt(720))/(-6sqrt(18)/sqrt(2)). -2sqrt(5) Simplify ((3 + 0 + sqrt(19) - sqrt(19)) + (sqrt(38) + sqrt(38)1)/sqrt(2))2. 12sqrt(19) + 85 Simplify (-1 + sqrt(17) + sqrt(68) + -1)*2. -12sqrt(17) + 157 Simplify ((sqrt(2695)1)/(-3sqrt(45) + sqrt(5)))*2. 539/64 Simplify -4 + (sqrt(152) - sqrt(38))/sqrt(2) + 4 + 2. 2 + sqrt(19) Simplify sqrt(33)/(sqrt(11) + (sqrt(44) - sqrt(11))) - (1((sqrt(75) - sqrt(3)) + sqrt(3)))*2. -75 + sqrt(3)/2 Simplify sqrt(24)/(sqrt(8) - (sqrt(32) + sqrt(8))) + sqrt(450)/sqrt(6). 9sqrt(3)/2 Simplify -5(((-2sqrt(44) - sqrt(44))/sqrt(4))2 + 1). -500 Simplify (-2 + sqrt(13))25 + -5. -20sqrt(13) + 80 Simplify (2 + sqrt(1584))*2 - (sqrt(396)1)*2. 48sqrt(11) + 1192 Simplify (3 + (-1 + -2sqrt(75) + sqrt(75) - sqrt(75))-3)*2. 360sqrt(3) + 2736 Simplify (-51sqrt(20))/sqrt(10). -5sqrt(2) Simplify -5sqrt(12)2. -20sqrt(3) Simplify (-1(((sqrt(84) + -1sqrt(84))6)/sqrt(12) + -5))2. 25 Simplify (5 + 1sqrt(114)/sqrt(6)-1)2. -10sqrt(19) + 44 Simplify ((1sqrt(136)-4)/(sqrt(16)/sqrt(2)-4))2 + -5. 12 Simplify (sqrt(77) - (sqrt(77) - (sqrt(77) + (sqrt(77) + sqrt(77) + (sqrt(77) - sqrt(77)32) + sqrt(77) - sqrt(77))) - sqrt(77)) - sqrt(77))/(sqrt(891)1). -2sqrt(7)/9 Simplify -2 + (-4 + sqrt(10)/sqrt(2))5. -22 + 5sqrt(5) Simplify ((5(sqrt(468) - (0 + sqrt(468))) - sqrt(468))4)2. 7488 Simplify (2sqrt(119)/(sqrt(14)/sqrt(2)))*2 + -3. 65 Simplify 2sqrt(350)/(sqrt(189)/sqrt(3)). 10sqrt(2)/3 Simplify 3 + (-5 + (sqrt(700) - (0 + sqrt(700)) - sqrt(700)))2 + -1. 100sqrt(7) + 727 Simplify (sqrt(539) - (2 + sqrt(539))5)-1. 10 + 28sqrt(11) Simplify (3 + sqrt(448) + -1 + sqrt(448) + sqrt(448) + sqrt(448))2. 128sqrt(7) + 7172 Simplify ((sqrt(231) - -2sqrt(231))/sqrt(11))/(sqrt(3) - ((sqrt(300)2 - sqrt(300)) + sqrt(3))). -3sqrt(7)/10 Simplify sqrt(833) - ((sqrt(833) - ((sqrt(833) + sqrt(833) + 1)2 + sqrt(833))) + 3). 35sqrt(17) + 3330 Simplify -4(4sqrt(272) + sqrt(17))-3. 204sqrt(17) Simplify ((sqrt(1764) - -2sqrt(1764)) + sqrt(1764) - sqrt(1764) - sqrt(36))/(-3sqrt(48)/sqrt(4))-5. 100sqrt(3)/3 Simplify -1-2(sqrt(13) + 3 + -1)*2. 8sqrt(13) + 34 Simplify -5(0 + sqrt(11)) + 5. -5sqrt(11) + 5 Simplify (-6(2sqrt(30) + sqrt(30)))/((sqrt(66) - (sqrt(66) - 3sqrt(66)))/sqrt(11)). -6sqrt(5) Simplify -1 + (-3sqrt(475) + sqrt(19))2. 3723 Simplify (sqrt(153) + sqrt(153)-1 + sqrt(153))*2 - (sqrt(425) - sqrt(17))-4. 16sqrt(17) + 153 Simplify ((sqrt(228)1 + sqrt(228))4)/((sqrt(144) - (sqrt(144) + -2sqrt(144) + sqrt(144)))/sqrt(12))-6. -48sqrt(19) Simplify -1 + 2sqrt(112). -1 + 8sqrt(7) Simplify -5((sqrt(11) + -1)6 + 1 + sqrt(55)/sqrt(5))*2. -2820 + 350sqrt(11) Simplify (sqrt(243) - sqrt(243)2-2)*2. 6075 Simplify ((-3sqrt(126))/sqrt(2))/(5sqrt(27)/sqrt(3)). -3sqrt(7)/5 Simplify -4sqrt(22)/sqrt(2) + 1 - 2sqrt(99)-6. 1 + 32sqrt(11) Simplify ((0 + sqrt(180) - sqrt(180)) + 3)*2. 9 Simplify (-4(sqrt(170) + -2sqrt(170)) - sqrt(170))/(sqrt(250)-1). -3sqrt(17)/5 Simplify (sqrt(312)/(sqrt(12)2))/(sqrt(72)-2). -sqrt(13)/24 Simplify 1(6(sqrt(3)-1)2 - (sqrt(27) + -2)2). -13 + 12sqrt(3) Simplify 5(sqrt(468) - (-2 + sqrt(468)))3. 30 Simplify (sqrt(500) + sqrt(500) + sqrt(500) + (sqrt(500) - ((sqrt(500) - sqrt(500)2) + sqrt(500) + 4 - sqrt(500))) - (3 + sqrt(500)1))2. -560sqrt(5) + 8049 Simplify sqrt(119)/(-1sqrt(252)). -sqrt(17)/6 Simplify ((5sqrt(99)-2)/(sqrt(9) + sqrt(36)/sqrt(144)))2. 39600/49 Simplify sqrt(19) + -1 + -3 - (sqrt(2299) - 3sqrt(2299)). -4 + 23sqrt(19) Simplify (sqrt(1900) - -3(sqrt(1900) + (sqrt(1900) + sqrt(1900) + sqrt(1900) + 1 - sqrt(1900))))*2 + -6(sqrt(19) + (sqrt(19) - sqrt(38)/(1sqrt(2)))). 594sqrt(19) + 190009 Simplify sqrt(95)/(-51sqrt(5)). -sqrt(19)/5 Simplify (sqrt(121) - 3-1sqrt(121))/(sqrt(825)/sqrt(3)). 4sqrt(11)/5 Simplify 2(-5 + (sqrt(1331) + (-5 + sqrt(1331) + -2 - sqrt(1331) - sqrt(1331)))*2). 88 Simplify sqrt(114)/(sqrt(48)/sqrt(8) + sqrt(6)) + sqrt(152)/sqrt(8)-6. -11sqrt(19)/2 Simplify ((-2 + sqrt(468) + 1)3)*2 + 2. -108sqrt(13) + 4223 Simplify 1 + (sqrt(60)/sqrt(5))*2. 13 Simplify ((-2 + (2sqrt(114))/sqrt(6) + 0)-6)2. -288sqrt(19) + 2880 Simplify (-2(0 + sqrt(125) - sqrt(125)) - (1 + sqrt(125) + -2))2. -10sqrt(5) + 126 Simplify (-1*(sqrt(704) - (sqrt(704) + (sqrt(704)	{ "pile_set_name": "DM Mathematics" }
z). (z - 1)(z + 1)(4z + 1)/6 Let u be (1 - -9)/((-12)/(-18)). What is m in 5m*3 + 7m*4 + 9m*3 - 3m*2 - 4m - um2 + 11m*4 - 10m*5 = 0? -1, -1/5, 0, 1, 2 Let g = -17212 + 17214. Let b be (-5)/(-15) + (-2 - -2). Factor 0 + 2/3f + 4/3f3 - 5/3f*g - bf*4. -f(f - 2)(f - 1)2/3 Let k be (-618)/(-8) + (-2)/(-16)-2. Let s = -39 + k. Let -36o - 9o*3 + 13o + so2 - 21o - 4 + 12 = 0. What is o? 2/9, 2 Determine v so that -17v + 1481 + 22v*3 + 319v - 164v2 - 4v*4 + 1264 - 2397 - 144v*3 = 0. -29, -2, -1, 3/2 Let b(n) be the first derivative of 2704n*5/5 + 728n*4 + 212n*3/3 + 2n*2 + 6576. Determine f so that b(f) = 0. -1, -1/26, 0 Let t = -334 - -338. Suppose 4 = tg - 4h, -h + 2 = 3g - 5h. Factor 4/7j - 10/7jg + 6/7j*3 + 0 - 2/7j*5 + 2/7j*4. -2j(j - 1)3(j + 2)/7 Find m, given that 323m - 20m*4 + 392m*2 - 751 + 159m + 88m - 723 - 44m*3 + 2m*5 + 574 = 0. -3, 1, 5, 10 Suppose -33f*2 + 290/3f + 1/3f3 - 64 = 0. What is f? 1, 2, 96 Suppose -14/9w*5 + 22w + 4 + 284/9w2 - 32/9w*4 + 104/9w*3 = 0. What is w? -3, -1, -2/7, 3 Suppose 3v + 3i - 153 = 0, 0 = 5v + i - 6i - 265. Let t be 1(3 - v/16)-1. Factor -1/4n*4 + 0 + 5/4n*2 + tn*5 - 3/4n*3 - 1/2n. n(n - 1)3(n + 2)/4 Let m be ((-546)/52 - -7)/(14/(-8)). Let 4 + 11s + 5/2sm = 0. What is s? -4, -2/5 Let m(h) be the third derivative of -h6/180 + 13h5/90 - 10h*4/9 - 314h*2. Solve m(v) = 0. 0, 5, 8 Suppose -90x = -70x - 100. Suppose 4 = 4u - 4a + a, -4u + 36 = xa. Factor 4/5z - 2/5zu + 2/5 - 4/5z*3 + 0z*2. -2(z - 1)(z + 1)3/5 Factor 0 - 158/19v*2 + 156/19v + 2/19v3. 2v(v - 78)(v - 1)/19 Suppose 360 = 5o + 10o. What is u in 64 - 37 - 63 - o - 50u2 + 5u*3 - 115u = 0? -1, 12 Let s be 5390/9240(-16)/(-14). Let 0 - 4x + sx2 + 2/3x*3 = 0. Calculate x. -3, 0, 2 Suppose 0 = -5t - 4p - 473, 467 = -5t - 3p + 2p. Let g = -89 - t. Factor g - b*5 - b + 4b*4 + 8b3 - b5 - 8b2 - 3b - 2b5. -4(b - 1)*3(b + 1)*2 Suppose -2v - 5x = -544, -5v - 2x + 1360 = -x. Let n = 273 - v. Suppose 1/4k3 - n + k2 - 1/4k = 0. Calculate k. -4, -1, 1 Determine z, given that -2 + 4z*4 - 388z*3 - 188z + 76z3 - 7z*5 - 10 + 59z*5 - 440z*2 = 0. -1, -1/13, 3 Let w(v) be the third derivative of -1/40v*6 + 0 - 1/4v*5 - 3/8v*4 + 0v + 9/2v3 - 55v*2. Factor w(l). -3(l - 1)(l + 3)2 Factor -83905438 + 3606266c - 2c4 - 7c*4 - 7810146c*2 + 14523c*3 + 1483719475c - 88442889c + 551068054. -3(c - 538)*3(3c + 1) Suppose -22o - 80 = -2o. Let u(m) = 10m*2 + 57m + 62. Let j(s) = 12s2 + 56s + 64. Let q(l) = ou(l) + 3j(l). Suppose q(b) = 0. What is b? -14, -1 Let z = 209 - 3341/16. Let r = 119/48 + z. What is u in -4/3u5 + ru*3 + 0u*2 + 0u + 4/3u4 + 0 = 0? -1, 0, 2 Let o = 15847/282 - 7430/141. Factor 1/2z*5 + 0z - 2z2 - oz3 - z4 + 0. z*2(z - 4)(z + 1)2/2 Suppose 12 = -3k - 3h, -7k - 5h = 44 - 34. Let n(v) be the second derivative of -1/10v*k + 42v + 5v3 + 8v2 + v4 + 0. Factor n(d). -2(d - 8)(d + 1)*2 Suppose 9 = 5a - 21, -v - 6 = -a. Let d(z) be the first derivative of -4 + 1/5z5 - 4/3z*3 + 2z*2 - 1/4z*4 + vz. Factor d(g). g(g - 2)(g - 1)(g + 2) Let y(j) = 11j*2 - 3572j + 1065644. Let q(b) = -90b2 + 28575b - 8525151. Let x(v) = -4q(v) - 33y(v). Factor x(c). -3(c - 596)2 Let y(d) be the second derivative of -7/102d*4 - 1/34d*5 - 2/51d*3 + 36d + 0 + 0d2. Find a such that y(a) = 0. -1, -2/5, 0 Let j(t) be the second derivative of t6/36 + 34t*5/45 + 217t*4/36 - 98t*3/9 - 57t*2/2 - 60t. Let x(f) be the first derivative of j(f). Factor x(m). 2(m + 7)2(5m - 2)/3 Let o(m) be the first derivative of 17m*4/6 + 40m3/9 + m2 - 2058. What is a in o(a) = 0? -1, -3/17, 0 Let k be 10/5010 + (0 - 0). Factor 8636j*k - 12j - 20 - 8641j2 - 8j. -5(j + 2)2 Let r = 791 - 783. Let s be (25/30)/(1 + 2/r). Factor -8/3b*3 - 8/3b + 4b2 + s + 2/3b*4. 2(b - 1)4/3 Let w(l) be the second derivative of -l4/21 + 776l3/3 - 526904l*2 - 18l + 27. Factor w(i). -4(i - 1358)2/7 Suppose -x + 48 = -36. Let z = 87 - x. Find t, given that -1/5t*4 + 4/5t + 3/5t2 - 4/5 - 2/5t*z = 0. -2, 1 Let w(o) be the first derivative of 60o + 4/5o5 + 0o*3 - 6o*4 - 158 + 44o*2. Factor w(g). 4(g - 5)(g - 3)(g + 1)2 Let q(k) be the second derivative of k4/108 + 4k3 + 648k*2 - 34k - 16. Find r such that q(r) = 0. -108 Let q(p) be the third derivative of -p*6/1500 - 11p*5/375 + 79p*4/300 + 4p*3/3 - 3077p*2. Factor q(r). -2(r - 4)(r + 1)(r + 25)/25 Solve -10512 + 1070173z2 - 1071317z*2 + 2193z + 4z3 - 9165z = 0 for z. -3, 292 Let j(n) be the second derivative of 5n4/12 - 5n*3/3 - 560n*2 - 55n + 14. Solve j(v) = 0. -14, 16 Suppose -60 = -14q + 8q. Let n be 11/4 + q/40. Factor 2/3j2 + 0 - 1/3j*n + 0j. -j*2(j - 2)/3 Let n be 68/6 + 69/(-207). Factor 0l2 + 0l*2 - 12l*2 + 3l*2 + 2l + nl2. 2l(l + 1) Let r(m) be the third derivative of 0m*7 - 1/504m*8 + 0m*3 - 1/36m*4 + 0m*5 + 1/90m*6 + 0m + 0 - 76m2. Factor r(k). -2k(k - 1)2(k + 1)*2/3 Suppose h - 15 = -3i, 5h - 15 = -i + 6i. Suppose 0 = -c - 2y - h, -5y - 41 = c - 5c. Factor 30z*3 + 623z*c + 1 - 618z*4 - 1 + 45z*2. 5z*2(z + 3)*2 Find v, given that 3v*2 - 15v*2 + 8v + 0 + 507v4 - 255v*4 + 10 - 8v*3 - 250v*4 = 0. -1, 1, 5 Find y such that -48/23y*2 + 0 - 2/23y*3 - 126/23y = 0. -21, -3, 0 Let x = 211 + 29. Suppose 9u = x + 39. Let 1 + 30h*5 + 17h*2 + uh*2 - 57h*4 - 12h - 27h3 - 1 = 0. Calculate h. -1, 0, 2/5, 1/2, 2 Let s(g) be the first derivative of -g5/5 + g4/4 + g3/3 + g - 72. Let u(z) = -z4 + 4z*3 - 5z*2 - 2. Let q(h) = -2s(h) - u(h). Factor q(a). 3a2(a - 1)*2 Suppose 708 + 102g*2 - 1617/2g - 3/2g3 = 0. What is g? 1, 8, 59 Let p = -553 + 557. Let x = -44 - -685. What is y in 36y*3 - 14y*4 - py + 609y5 + 8y*2 - xy*5 + 6y*4 = 0? -1, -1/2, 0, 1/4, 1 Let w(x) be the third derivative of 1/21x*7 + 35/24x*4 + 0 + 19/48x*6 + 0x*3 - 2x - 85x2 - 61/24x*5. Suppose w(n) = 0. What is n? -7, 0, 1/4, 2 Let l = 6/319 + -35421/638. Let d = 225/4 + l. Factor -15/4s*2 + 0 - 3/2s - ds4 - 3s*3. -3s(s + 1)2(s + 2)/4 Factor -90k3 + 0 + 1/2k*5 + 0k - 31/2k4 + 0k2. k3(k - 36)(k + 5)/2 Suppose -212/3l + 80/3 + 14l*3 + 110/3l*2 = 0. What is l? -4, 2/3, 5/7 Let r = 913 - 897. Let k be (-15)/(-14 - r) + 2/(-20). Factor 0 + 4/5j + 6/5j3 - 2/5j*4 - kj*5 + 2j*2. -2j(j - 2)(j + 1)3/5 Let n(h) be the third derivative of h7/504 + h*6/144 - 5h*5/4 + 49h*4/12 - 2h*2 + 38. Let i(z) be the second derivative of n(z). Factor i(d). 5(d - 5)(d + 6) Let p(d) be the third derivative of d7/1050 - 3d6/200 + d5/30 + 3d4/10 - 28d*3/15 - 68d*2 + 4d - 1. Find a such that p(a) = 0. -2, 2, 7 Let v(k) be the third derivative of 2k7/105 - k6/15 - 4k*5/5 + 3k*4 + 18k*3 + 7k*2 + 83k. What is i in v(i) = 0? -3, -1, 3 Let -50/11b4 + 4698/11b*2 + 4112/11b + 1720/11b3 + 1184/11 = 0. Calculate b. -1, -4/5, 37 Suppose 22d = 53d. Suppose d = a + 3h + 13, -4h + 2 = -4a - 6h. Factor 4/3u + 4/3ua + 0. 4u(u + 1)/3 Determine u so that 32/3 - 908/3u*2 - 272/3u*3 + 44u*4 - 472/3u = 0. -1, 2/33, 4 Let l(r) = 7r3 + 73r*2 + 76r - 4. Let k(a) = -190a3 - 1970a*2 - 2055a + 110. Let x(i) = -2k(i) - 55l(i). Find m such that x(m) = 0. -14, -1, 0 Factor 539b3 - 522b*3 + 7b*2 - 1881b*3 - 1396b3 + b2. -4b2(815b - 2) Let m be ((-1)/7)/(792/(-924))4 + 0. Solve 38/3d - 40/3d*2 + md*3 + 0 = 0. 0, 1, 19 Let q(v) = -8v - 4. Let l be q(-13). Suppose -b - 4b + l = 0. Factor -32 - bn + 25n2 + 60 - 24. (5n - 2)2 Let r(l) be the third derivative of l7/1260 - l6/30 - l5/120 + 35l4/72 + 4l*3/3 + 23l*2 - 5l + 2. Factor r(q). (q - 24)(q - 2)(q + 1)*2/6 Let h = -260840 + 260842. Determine m, given that -3/4m - 1/4m3 - mh + 0 = 0. -3, -1, 0 Let r(u) = u4 - 18u*3 + 24u*2 + 13u - 45. Let j(z) = z**4 - 17	{ "pile_set_name": "DM Mathematics" }
b*2 + 138751b - 500 What is the g'th term of -38839568, -38839573, -38839578, -38839583, -38839588, -38839593? -5g - 38839563 What is the j'th term of 1463, 12016, 40687, 96530, 188599, 325948, 517631, 772702? 1509j*3 + 5j*2 - 25j - 26 What is the r'th term of -669720, -668968, -668216, -667464? 752r - 670472 What is the m'th term of -1211215, -4844847, -10900901, -19379377? -1211211m*2 + m - 5 What is the m'th term of 21383, 42424, 63127, 83492, 103519, 123208, 142559? -169m*2 + 21548m + 4 What is the x'th term of 3446535, 6893065, 10339595, 13786125, 17232655, 20679185? 3446530x + 5 What is the r'th term of 4864, 10252, 15640, 21028? 5388r - 524 What is the s'th term of 2843, 5388, 7703, 9782, 11619, 13208, 14543, 15618? -s*3 - 109s*2 + 2879s + 74 What is the j'th term of -114045984, -228091971, -342137958, -456183945? -114045987j + 3 What is the s'th term of 72672, 145349, 218026, 290703? 72677s - 5 What is the u'th term of -58, -410, -1236, -2764, -5222, -8838? -38u3 - 9u*2 - 59u + 48 What is the d'th term of -89679, -179246, -268701, -358044, -447275? 56d2 - 89735d What is the f'th term of 2133804, 4267517, 6401230? 2133713f + 91 What is the o'th term of -1603665, -6414663, -14432993, -25658655, -40091649? -1603666o*2 + 1 What is the d'th term of -138463444, -276926899, -415390354? -138463455d + 11 What is the m'th term of 389522, 779130, 1168738, 1558346, 1947954? 389608m - 86 What is the l'th term of -127193, -254270, -381347, -508424? -127077l - 116 What is the o'th term of -42991, -172064, -387185, -688354, -1075571, -1548836, -2108149? -43024o2 - o + 34 What is the t'th term of -3174838, -3174831, -3174824? 7t - 3174845 What is the n'th term of 454, 689, 738, 595, 254? -n*3 - 87n*2 + 503n + 39 What is the z'th term of 2647, 4308, 5967, 7624, 9279? -z*2 + 1664z + 984 What is the d'th term of -21269, -42473, -63675, -84875, -106073? d*2 - 21207d - 63 What is the h'th term of 371886, 743678, 1115470? 371792h + 94 What is the y'th term of -392, -1030, -1892, -2978? -112y*2 - 302y + 22 What is the l'th term of 41666, 43069, 44472, 45875? 1403l + 40263 What is the j'th term of -335552, -1342213, -3019982, -5368859, -8388844, -12079937, -16442138? -335554j*2 + j + 1 What is the k'th term of -97192, -98305, -99418, -100531, -101644, -102757? -1113k - 96079 What is the r'th term of -10192010, -10192035, -10192076, -10192133, -10192206, -10192295? -8r2 - r - 10192001 What is the c'th term of 52543, 105164, 157785? 52621c - 78 What is the m'th term of -5334, -20690, -36044, -51396, -66746, -82094, -97440? m*2 - 15359m + 10024 What is the h'th term of -6232252, -12464504, -18696756, -24929008? -6232252h What is the w'th term of -36702, -73148, -109594? -36446w - 256 What is the h'th term of 2795568, 2795573, 2795578, 2795583? 5h + 2795563 What is the i'th term of -1244343, -1244163, -1243983, -1243803? 180i - 1244523 What is the r'th term of 15301, 15327, 15353? 26r + 15275 What is the c'th term of -46289, -80598, -114907, -149216, -183525, -217834? -34309c - 11980 What is the i'th term of -72875892, -72875896, -72875902, -72875910? -i*2 - i - 72875890 What is the u'th term of 5196, 41223, 139014, 329451, 643416? 5147u*3 - 2u + 51 What is the t'th term of 10527297, 21054602, 31581907, 42109212? 10527305t - 8 What is the g'th term of -265509, -530856, -796203, -1061550, -1326897, -1592244? -265347g - 162 What is the k'th term of 244042, 244094, 244146, 244198, 244250, 244302? 52k + 243990 What is the x'th term of -2010, -1690, -1386, -1098? -8x*2 + 344x - 2346 What is the a'th term of -2628, -4839, -7084, -9363, -11676, -14023? -17a2 - 2160a - 451 What is the i'th term of -69314, -73368, -77422, -81476, -85530, -89584? -4054i - 65260 What is the m'th term of 36588275, 36588272, 36588269, 36588266? -3m + 36588278 What is the a'th term of 2520937, 5041862, 7562787, 10083712, 12604637, 15125562? 2520925a + 12 What is the o'th term of 442279, 442217, 442155? -62o + 442341 What is the p'th term of 1696339, 3392393, 5088433, 6784453, 8480447, 10176409, 11872333? -p3 - p2 + 1696064p + 277 What is the q'th term of -34365, -34579, -34935, -35433? -71q*2 - q - 34293 What is the q'th term of 2363, 2616, 3133, 3992, 5271, 7048, 9401, 12408? 13q*3 + 54q*2 + 2296 What is the l'th term of -54204, -108376, -162486, -216498, -270376, -324084? 6l*3 - 5l*2 - 54199l - 6 What is the f'th term of -162, -1217, -2994, -5499, -8738, -12717? -f*3 - 355f*2 + 17f + 177 What is the w'th term of -726841, -1453697, -2180553, -2907409, -3634265? -726856w + 15 What is the i'th term of 340, 1394, 3146, 5602, 8768, 12650, 17254? i3 + 343i*2 + 18i - 22 What is the p'th term of -345, 222, 1135, 2394, 3999, 5950, 8247? 173p2 + 48p - 566 What is the g'th term of -219831757, -439663514, -659495271, -879327028, -1099158785? -219831757g What is the k'th term of -23746, -47969, -72194, -96421, -120650, -144881? -k2 - 24220k + 475 What is the y'th term of -446, -883, -1302, -1703, -2086, -2451, -2798? 9y2 - 464y + 9 What is the i'th term of 2033683, 2033666, 2033625, 2033548, 2033423, 2033238? -2i3 - 3i + 2033688 What is the p'th term of -454395, -908932, -1363471, -1818012, -2272555, -2727100? -p*2 - 454534p + 140 What is the o'th term of 483322, 966110, 1448898, 1931686, 2414474? 482788o + 534 What is the n'th term of 19026298, 38052593, 57078888, 76105183, 95131478, 114157773? 19026295n + 3 What is the h'th term of 1365482, 2730827, 4096172, 5461517? 1365345h + 137 What is the g'th term of -267787, -267857, -267941, -268045, -268175, -268337, -268537? -g3 - g2 - 60g - 267725 What is the y'th term of 540, -98, -3112, -9690, -21020? -198y3 + 748y - 10 What is the i'th term of -149953, -149988, -150045, -150130, -150249, -150408, -150613, -150870? -i*3 - 5i*2 - 13i - 149934 What is the u'th term of -22832, -91256, -205302, -364970, -570260, -821172? -22811u2 + 9u - 30 What is the s'th term of 67448, 59625, 51802, 43979, 36156? -7823s + 75271 What is the u'th term of 5063315, 10126221, 15189125, 20252027, 25314927, 30377825, 35440721? -u2 + 5062909u + 407 What is the j'th term of 180786, 180809, 180832, 180855, 180878? 23j + 180763 What is the h'th term of 7658, -1646, -10950, -20254? -9304h + 16962 What is the r'th term of 450299, 450297, 450289, 450275, 450255, 450229? -3r2 + 7r + 450295 What is the o'th term of -124, -911, -2302, -4297? -302o2 + 119o + 59 What is the t'th term of 11829553, 23659098, 35488643, 47318188, 59147733, 70977278? 11829545t + 8 What is the d'th term of 80607568, 80607566, 80607564, 80607562? -2d + 80607570 What is the l'th term of -310249, -310248, -310245, -310240? l*2 - 2l - 310248 What is the y'th term of -19074858, -19074856, -19074854? 2y - 19074860 What is the y'th term of 162652, 317125, 471598? 154473y + 8179 What is the f'th term of -13482959, -13482969, -13483001, -13483067, -13483179, -13483349, -13483589, -13483911? -2f3 + f2 + f - 13482959 What is the t'th term of 6204180, 6204160, 6204140, 6204120, 6204100, 6204080? -20t + 6204200 What is the h'th term of -154102, -154083, -154064, -154045? 19h - 154121 What is the i'th term of -72, -677, -2500, -6207, -12464, -21937, -35292? -111i*3 + 57i*2 + i - 19 What is the h'th term of 12807100, 51228411, 115263928, 204913651, 320177580? 12807103h*2 + 2h - 5 What is the q'th term of 1690142, 1690210, 1690294, 1690400, 1690534, 1690702, 1690910, 1691164? q*3 + 2q*2 + 55q + 1690084 What is the f'th term of -6001, -1738, 2531, 6806, 11087, 15374? 3f2 + 4254f - 10258 What is the r'th term of 13816778, 27634036, 41451306, 55268594, 69085906, 82903248, 96720626? r*3 + 13817251r - 474 What is the q'th term of -10178, -20982, -32398, -44426, -57066, -70318, -84182? -306q2 - 9886q + 14 What is the j'th term of -229, -124, 81, 398, 839, 1416? 2j3 + 38j*2 - 23j - 246 What is the a'th term of -35353180, -35353194, -35353208, -35353222? -14a - 35353166 What is the j'th term of 2012, 1498, 810, 86, -536? 23j*3 - 225j*2 + 2214 What is the f'th term of 2635757, 10543029, 23721809, 42172091, 65893869, 94887137? -f	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.