Datasets:

suolyer
/

pile_dm-mathematics

Dataset card Viewer Files Files and versions Community

Split (2)

validation · 2.01k rows

text stringlengths 8.19k 8.19k	meta dict
-b + 0k = ok - 17, 4b - 2k - 40 = 0. What is the units digit of b? 1 Suppose -5q + 0q + 50 = 0. What is the tens digit of q? 1 Let u(w) = w*2 - 2w + 3. Let r = 8 + -3. What is the units digit of u(r)? 8 Let j = 7 - 3. Suppose 4o = -4s + 20, -jo + 4s + s - 25 = 0. Suppose o = -f + 16 - 5. What is the units digit of f? 1 Suppose -d = q - 166, 0 = -2d - d + 5q + 506. What is the units digit of d? 7 Let i be (-16)/(-24) + (-20)/(-6). Suppose 3o + j - 3j = 32, 4j - 56 = -io. What is the tens digit of o? 1 Suppose 627 = 11y - 8y. What is the hundreds digit of y? 2 Let f be 12/(-3) + 0 - -6. Suppose 2s - 2c = -5c + 19, -3s + 2c = 4. Suppose -sk = q - 27, 2q - 6 = fk - 3k. What is the units digit of k? 6 Let l(i) = -i - 13. Let q be l(-7). Let d be 24/q + (-1 - 0). Let c = d - -6. What is the units digit of c? 1 Let q = 5 + -3. Suppose 4s - q = 10. What is the units digit of s? 3 Suppose s + 4s + 20 = 0. Let u = s + 1. Let m = u + 6. What is the units digit of m? 3 Let l be (-10)/(-30) - (-16)/6. Suppose 5x + 3g - 132 = 0, -lx + 0x + 2g + 64 = 0. What is the units digit of x? 4 Let y(o) = -33o - 8. What is the tens digit of y(-4)? 2 Suppose 76 = 4x - 20. Suppose 0 = -3g + 2p - x, 0 = -3p + 11 - 2. Let b(u) = -u2 - 7u + 2. What is the units digit of b(g)? 8 Let v = 0 + -38. Let t be 3/(-9) + v/(-6). What is the units digit of (3 + -5)/((-4)/t)? 3 What is the units digit of ((-22)/1 + -3)-1? 5 Let a = 63 + 6. What is the units digit of a? 9 Suppose -k = 2g - 42, 3k - 210 = -2k + 5g. What is the units digit of k? 2 What is the units digit of (27/12)/((-9)/(-24))? 6 Let a(h) = -3h + 9. Let x(r) = 6r - 16. Let p(c) = 7a(c) + 4x(c). Suppose 0 + 2 = k. What is the units digit of p(k)? 5 Suppose -32 - 43 = 5z. Let o be -2 + (2 - z)/1. Suppose n + 5 - o = 0. What is the tens digit of n? 1 Suppose 3i = 4 + 11. Suppose -p + 2 = 0, h - p + ip = 23. What is the tens digit of h? 1 Suppose -5h - 8 = -h + s, 0 = 3h - s + 6. Let k = h - -5. Suppose -km - 4b + 0b = -18, 4m - 2b = 46. What is the tens digit of m? 1 Suppose k - 4o = 28, 0o - 4o - 60 = -5k. Let w be -4 + (-1)/(2/(-34)). Let s = w - k. What is the units digit of s? 5 Suppose -4k - 24 = -2c, 5k = -0c - c - 16. Suppose 4y - 1 = t, 4y = ct - 0t + 4. Suppose 3 = p - y. What is the units digit of p? 3 Let f be 2/(-10) + 16/5. Suppose -4 = -fb + 32. What is the units digit of b? 2 Let v = -5 + 11. Let x(w) be the third derivative of -w6/120 + w5/12 + w*4/4 + 4w*3/3 - 2w2. What is the units digit of x(v)? 8 What is the tens digit of (-3 - 2/(2/(-7))) + 50? 5 Let l(o) = o2 - 3o + 2. Let b be l(2). Suppose 17g + 18 = 26g. Suppose -4c - gd + 52 = b, 2c + 0d - 20 = 2d. What is the units digit of c? 2 What is the units digit of (0 - (-1 - -2))(-4 + -2)? 6 Let z be (-21)/3 - (0 - -1). What is the units digit of (84/9)/(z/(-12))? 4 Let h(s) = s2 + 12. Let a be (12/21)/((-4)/(-14)). Let x = 2 - a. What is the units digit of h(x)? 2 Let w = 3 + -3. Let q be (-21)/((-2)/(2 - w)). What is the units digit of q((-3)/(-9))/1? 7 Suppose 0v + 5v - 5 = 0, 3f - 506 = -2v. What is the units digit of f? 8 Let i = 70 - 10. Let n(v) = -8v. Let o be n(-1). What is the units digit of o/(-6)i/(-8)? 0 Let o(c) = -4c - 5. Let f(i) = i. Let r(p) = 6f(p) + o(p). Let s = -3 - -9. What is the units digit of r(s)? 7 Let y be ((-18)/10)/((-10)/50). Let j(k) = 9k - 26. Let r(f) = -3f + 9. Let a(v) = -2j(v) - 7r(v). What is the units digit of a(y)? 6 Let j(q) = -q*3 + 5q*2 - 3q + 2. Let a = -4 + 6. What is the units digit of j(a)? 8 Suppose 9 + 5 = 4k + 2v, -4k + 9 = 3v. Suppose 0 = 5g + 5, 3g - 37 = -2b + kg. Let w = b - 12. What is the units digit of w? 5 Let g(r) = r*2 + 10r + 12. Let y be g(-9). Suppose 3w + 5l - 6 = 0, 5l + 4 = w + w. Suppose 3t = -3, yt + 9 = -k + wk. What is the units digit of k? 6 Let a = 30 + -50. Let j = -3 - a. What is the units digit of j? 7 Let r be 1 + 0 - -3 - 2. Let o(b) = -3b + 0b2 + br + 3b + 6 - 6b. What is the units digit of o(6)? 6 Let j(i) = 7i3 - i2 - i + 1. Let b be j(1). Let p = b + -4. What is the units digit of (1 - -5)/(p - 1)? 6 Let o = -2 + 1. Let f be 7(o - (-5 + 3)). Suppose 7 = m - f. What is the tens digit of m? 1 Let p = 8 + -6. Suppose -2 = pf - 6. What is the units digit of f? 2 Suppose z - 8 = -0z. What is the units digit of z? 8 Let s be (-2)/(-2) + -1 + 2. Suppose -5x + 53 = -s. What is the units digit of 02/(-6) + x? 1 Suppose 4s - 9s = -795. What is the tens digit of s? 5 Let l be 108/(-9)(-1)/3. Suppose -4w - 52 = l. What is the units digit of (-7)/w + (-54)/(-4)? 4 Let b(w) = -w + 1. Let x = 4 + 0. Suppose t - 3t = x. What is the units digit of b(t)? 3 Suppose d - 4 = -1. Let b = 5 - d. What is the units digit of b? 2 Suppose -503 = -5i - 73. Let b = i - 61. Suppose -m - 4v = -0v - b, -25 = -5v. What is the units digit of m? 5 Let s(p) = 2p + 9. Let j be s(0). Suppose 14r - 30 = jr. What is the units digit of r? 6 Let n(w) = w*3 + 7w*2 + 4w + 3. Let g be n(-7). Let l be (-110)/g + 4/(-10). Suppose -5 - l = -3z. What is the units digit of z? 3 Let j = -27 + 44. What is the tens digit of j? 1 Let n be (-14)/(-6) + (-16)/(-24). Suppose -5c + 24 = 2l - l, 24 = 3c + nl. What is the units digit of c? 4 Let h(f) = 7f. Let z be h(1). Let l be 33(-57)/(-54) + 2/12. Suppose -2r + zr - l = 0. What is the units digit of r? 7 Suppose q - 20 = -0q. What is the units digit of q? 0 Let z = -147 + 397. What is the hundreds digit of z? 2 Suppose -5a = -z - 4z + 80, a + 34 = 2z. Suppose 3b + 5g = 44, z = -4g - 2. What is the tens digit of b? 2 Suppose -5y - 13 = 12, 0 = -5v - 3y + 990. What is the units digit of v? 1 Let o = 10 - -30. What is the units digit of o? 0 Let i be (-8 + -1)/((-6)/(-4)). Let z(r) = -r3 - 6r*2 + r + 7. What is the units digit of z(i)? 1 Let a = -3 + 3. Suppose -3p + 65 - 17 = a. What is the tens digit of p? 1 Let h(v) = 22v3 + v2 - v. Let k be h(1). Suppose -2w = -2f + k, 5f - 32 = 2w + f. What is the tens digit of 4/w3 + 24? 2 Suppose -5 = p, 4p = 5b + 5p + 50. Let n = 23 + b. What is the tens digit of n? 1 Let w(r) = -r - 2. Suppose -s - 24 = -5m, -64 = s + 3s - 4m. What is the units digit of w(s)? 2 Let u(z) = z*3 - 12z*2 + 10z - 29. What is the tens digit of u(12)? 9 Let f(h) = 3h - 1. Let t be f(4). What is the tens digit of -1 + 3/(3/t)? 1 Let f(s) = 4s - 3. Let p(j) = -7j + 7. Let t(l) = -5f(l) - 3p(l). What is the units digit of t(7)? 1 What is the units digit of (7/(-14))/(1/(-204))? 2 Let y = 77 + 16. Let u = y + -65. What is the tens digit of u? 2 Let u = 13 - 8. Suppose -um + 11 = -9. Suppose 2t = -2t - mn + 8, 5n = -t + 6. What is the units digit of t? 1 Let b be -3 + 0 + (8 - 3). What is the units digit of ((-21)/b)/((-3)/4)? 4 Let k be (-136)/(-6) - (-12)/(-18). Let j be 2/6 - (-40)/(-3). Let n = k + j. What is the units digit of n? 9 Let f(h) = 9h2 + 12h + 15. Let u(r) = 5r2 + 6r + 8. Suppose -4q = -25 - 19. Let j(b) = qu(b) - 6f(b). What is the units digit of j(7)? 5 Let t(q) = -q2 + 8q - 3. Let y(x) = 7x - 1. Let g be y(1). Let l be t(g). Suppose 0 = -2j + j + l. What is the units digit of j? 9 Let u be ((-6)/(-4))/((-9)/(-156)). Let x = u - 13. What is the units digit of x? 3 Let r(w) = -w*3 - 4w*2 - 5w - 4. Let y be r(-3). Suppose -ya - a + 18 = 0. Suppose 5j - q - 23 = 0, q - a = 2j - 17. What is the units digit of j? 4 What is the tens digit of -2 + 45/1 + 10 + -11? 4 Let o(p) = 5p*2 - 2p + 21. What is the hundreds digit of o(5)? 1 Suppose 3a + z = -2z + 15, -3a - 2z = -13. Let h be a/3 + 1 + -1. Suppose 2 = -c + s - h, -c = 5s - 27. What is the units digit of c? 2 Let z(g) = 2g*2 + 5g - 4. Let b be z(-7). Suppose 3t + h - 41 = 0, 0 = -2t + 7t - 3h - b. What is the units digit of t? 3 Let w(u) = 3u2 - u. Let f(x) = -x. Let p(h) = -5f(h) + w(h). What is the tens digit of p(-3)? 1 Suppose 0g + h = 3g - 261, g + 3h - 97 = 0. What is the tens digit of g? 8 Let c(j) = 5j + 5. What is the tens digit of c(18)? 9 What is the tens digit of 2/(-12) - (1 + 1453/(-6))? 4 Let z be 8/(-28) + (-122)/14. Let	{ "pile_set_name": "DM Mathematics" }
What is the second biggest value in -4/7, 1, b, -2? b Let x = -2.23 - -2.2. Let k = -344.1 - -344. Which is the third biggest value? (a) x (b) k (c) 0.07 b Let h be ((-3)/6)/(3/(-4)). Let l = -138.1 - 2.9. Let q = 141.2 + l. Which is the second smallest value? (a) -1 (b) h (c) q (d) -3 a Let m = -1355767/263 + 5155. What is the fourth smallest value in 0.3, 3, 2/5, 1/5, m? 2/5 Let c be -4 + 6 + (-14)/8. Suppose -6y + 4a = -2y + 28, -y = -5a + 35. What is the biggest value in -1, c, y, 0.3? 0.3 Let f be 5/(-15) - 5/(-33). Let y = -10.89 + 11. Let k = 0.05 - y. Which is the second biggest value? (a) f (b) -2 (c) k a Let l = -3.533 - -0.033. Let t = -6.1 - l. Let p = t + 2.4. Which is the fourth biggest value? (a) 4 (b) p (c) -3 (d) 0 c Suppose -4l - 10 = -0p - 2p, -3p = -l - 15. Let s = 175039/3 - 58346. Which is the smallest value? (a) s (b) 1/34 (c) l c Let p = 1.0694 + -0.8694. What is the biggest value in -0.07, p, 24/5, 2? 24/5 Suppose -41w + 160 = -9w. Let s be (0 - 1)/(1/(-9)-6). What is the biggest value in s, w, -0.9? w Suppose 41 = -11n - 14. Let k = 479.7 + -480. What is the second smallest value in n, k, -2, 0.09? -2 Let l = -1.82 + 1.32. Let y = 16/15 + -2/3. Which is the smallest value? (a) 1 (b) 2 (c) y (d) l d Let u = -0.16 + 2.16. Let k = -259.238 + 0.338. Let f = -259 - k. Which is the third smallest value? (a) 1/7 (b) 1 (c) u (d) f b Let q = -14795 - -73976/5. Which is the fourth smallest value? (a) -2/9 (b) -0.03 (c) 2 (d) q (e) -1/7 d Let j = 4310 + -4320. What is the second smallest value in 197, j, 0.2? 0.2 Let x = -47631.05 + 47631. Which is the second smallest value? (a) x (b) -6 (c) 33 a Let l = -698 + 694. Let o = -1 + 5. Let r = o + -4.3. What is the fourth biggest value in r, -2, -2/5, l? l Let j be (96/8)/6 + (-1 - 1). Suppose -3r + 32 = -jr + 4d, 0 = 5r + d - 42. What is the biggest value in r, 1, 2? r Let u = 69/2 - 106/3. Let w = 0.54718 - 0.04718. What is the third smallest value in 0, u, w? w Let j be (-7)/(252/486) - -12. What is the third smallest value in -1/2, -2/17, -254, 2, j? -1/2 Let o = -55 - 1. Let g = o - -58. Let u = -29 + 204/7. Which is the smallest value? (a) 14 (b) g (c) u c Let q be 4/48168/112. What is the fifth smallest value in -5, 0, q, 4, 0.4? 4 Let y be (2/(-3))/((-154)/(-66)). Which is the second biggest value? (a) y (b) 4 (c) 0.37 c Let q be ((-11)/(-6))/(-1) - -2. Let z = -237 + 233. Let a be -4 + 2((-30)/z - 4). What is the second biggest value in a, q, 16? a Suppose -32x + 4x - 56924 = 0. Let y be x/2140 + (6/8)/3. Which is the third biggest value? (a) 5 (b) y (c) -1 c Let h be (12/10)/((-80)/600) - -7. Let z be (6/(-5))/((-27)/2340). Which is the third smallest value? (a) h (b) z (c) -3/2 b Let v(z) = -z*3 + 5z + 6. Let i be v(-2). Suppose -11 = -ij - 15. Let t be (7 + 1)-15. Which is the smallest value? (a) -1/2 (b) j (c) t c Let k be 1(-2)/(-36)-2. Let p = -4789/45 + 956/9. Which is the second biggest value? (a) -0.6 (b) k (c) p c Let z = 17 - -9. Suppose 4a - z = 2h, -h + 18 = 3a + 1. Let g be (a/(-8) + 0)/(1 + 2). What is the third smallest value in 2, 1/7, 2/3, g? 2/3 Let y = -1794 + 1796. Let b = -2 + -2. Let n = 7 + b. What is the third biggest value in y, n, -2? -2 Let o = 3 - -2. Suppose 2i + 0i + 22 = -4p, p = oi - 33. Let s = -247 + 247. Which is the third smallest value? (a) p (b) -5 (c) s c Let n = -15621 - -15623. What is the biggest value in -3, n, 91/5? 91/5 Let t = -0.43 - -0.33. Let u = t + 28.1. Let q = -23 + u. Which is the smallest value? (a) q (b) -2 (c) -0.2 b Let s = -22 + -4. Let i = 30 + s. Let m = -34 + 36. Which is the smallest value? (a) i (b) -1/8 (c) m b Let x = -726.95 - -727. Suppose -2l + 3v = -22, 2l - 4 = -4v - 10. What is the third biggest value in x, l, 2? x Let l = -111 + 111.1. Let s(t) = -t + 8. Let v be s(7). Which is the second smallest value? (a) -28 (b) v (c) l c Let r = 717 - 721.53. Let f = r + 0.53. What is the third smallest value in f, 5, -7? 5 Let i = -24/19 + 26/19. Let z be (-50)/12 - (-1)/(-2) - (71 + 9825/(-131)). Which is the second biggest value? (a) 38.4 (b) i (c) z b Let y = 0.1 - -1.9. Let v = -7.491 - -7.54. Let s = v - 1.049. What is the smallest value in 1/8, y, s? s Let h = 4.5 - 9.5. What is the fourth biggest value in 2, -6, h, -0.3? -6 Let h = -1611 - -892. Let z = -696 - h. What is the third smallest value in 0.04, 2/9, z? z Let f = -10180 + 91616/9. Which is the fourth biggest value? (a) -2 (b) -0.48 (c) -0.1 (d) -0.04 (e) f b Suppose -9w - 2684 - 5848 = 0. Let i be (-3 - 3458/w) + (-6)/9. Let m = i - 241/3950. What is the biggest value in 0.7, -0.1, m? 0.7 Let s = 70 + -70.4. What is the third smallest value in s, -4/1293, 0, 5? 0 Let w = -367 - -8443/23. What is the second biggest value in -34, w, 0.7, 0.4? 0.4 Let v = -723 + 722.8. Which is the second biggest value? (a) v (b) 2/9 (c) 0 (d) -1/21 c Suppose -t - 10 = 4t. Let d = 7 + -8. Let y = 13.533 - -1.467. Which is the third biggest value? (a) t (b) y (c) d a Let t = -8 - -13. Let d = -75 + 35. Let h = -44 - d. What is the second smallest value in -5, h, t? h Suppose -4b + 3 + 13 = 0. Let n = -0.00215 - 0.99785. What is the biggest value in n, -10, b? b Let j be -3 + 360/(-32)4/(-3). Suppose -jt + 3 = 63. Which is the second biggest value? (a) t (b) -1/13 (c) -0.4 c Let p be (-90)/(-18) - (5 + 5/2). Which is the second smallest value? (a) p (b) 4/3 (c) 3 (d) 3/5 d Let m = -7380 + 7372. What is the second biggest value in -17, -21, m? -17 Let l = -0.753 - -0.253. Let q = 2.7 - 17.7. Let z = -11 - q. What is the fourth biggest value in 1/6, l, -1/5, z? l Let i be (-15 + -11 + 22)/(-20). Let g = -4 - -4.4. Which is the second biggest value? (a) i (b) -1 (c) 0.1 (d) g a Let l = 43/24 - 167/120. Let s = -241 + 1209/5. Let h = -0.2 + -1.8. Which is the third biggest value? (a) s (b) l (c) 1/3 (d) h c Let l(h) = 4h*2 - 68h - 337. Let r be l(21). Let q = 180 + -904/5. Which is the second smallest value? (a) 0.3 (b) -2 (c) q (d) r d Let j = 192.71 + -192. Let c = 0.01 - j. What is the third biggest value in 0.4, c, -2/13? c Let y = 0.0603 + 17.9397. Which is the second biggest value? (a) 0.08 (b) y (c) 4 c Let u = -10811.2 - -10811. What is the second biggest value in -4, u, 4, 0.6, -6/29? 0.6 Suppose 0 = 16y - 1 - 37 - 10. What is the fourth biggest value in 26, y, -2/11, 6, 0.4? 0.4 Let v = 0.01959 + 2.02341. Let z = v - 0.043. Which is the biggest value? (a) z (b) 4/9 (c) -1/3 a Let o be (105/60 - 12/6)(-16)/(-14). Let d = 12 - 10. What is the biggest value in o, 0.7, d? d Let u = -45 - -314/7. Let n = -0.064 + 0.067. Let b = -0.197 - n. What is the fourth smallest value in -3, b, -4, u? u Let n = 2999.02 - 3000. What is the smallest value in 0.4, n, -1? -1 Suppose -4j + 10 = -2y, -14 + 9 = 2j - 3y. What is the second biggest value in -9, 5/3, j, -5? 5/3 Let z = 13012 - 13014. Which is the biggest value? (a) -6 (b) 0.3 (c) 1417 (d) z c Let i = -0.2 - 0. Let v = -33024 + 33025.9999. Let o = v - -0.0001. Which is the third smallest value? (a) 5 (b) o (c) i (d) -2/15 b Let j = -3637 + 3656. Which is the third biggest value? (a) 4 (b) 10/9 (c) j b Let j be (279/(-18))/31(-12)/21. Which is the biggest value? (a) j (b) 1/7 (c) 2/13 (d) -1395 a Let l be -4(2 - 86/44). Let s = -0.3893 - -1.3893. What is the smallest value in 3, s, 0, l? l Let w = 17/3 - 6. Suppose -24 = 14a - 23a + 3. What is the second biggest value in -2/13, -7, a, w? -2/13 Let m be (1760/(-330))/(273/18 + 1/6). What is the biggest value in 5, m, -3? 5 Let r = 71/4 + -193/12. Let j be (27/72)/(3/12). Suppose 6m - 12m = 6. What is the smallest value in j, r, m? m Let y = 7328 - 7328.06. What is the second smallest value in 0.85, y, -0.1? y Let l be (10/(-28))/((-235)/94). Which is the third biggest value? (a) -3 (b) l (c) 245 a Let n = -138259/4 - -34534. Which is the third biggest value? (a) -5 (b) 12 (c) n c Let v = -46.16 - -65.16. What is the biggest value in v, -4, 0.8? v Let h = -329.7 - -350. Let p = h - 13.3. What is the third biggest value in p, 2/3, 0.3, -5? 0.3 Suppose i - 3 = -0. Let t = -0.151 + 5.151. Let b	{ "pile_set_name": "DM Mathematics" }
e third smallest value? (a) 11 (b) 97/5 (c) -52 b Which is the smallest value? (a) -61 (b) 5 (c) 85 a What is the third biggest value in 48830, 4, 5, 0.1, 3/7? 4 Which is the sixth biggest value? (a) 0 (b) -0.9 (c) 3 (d) -2 (e) -1/508 (f) 5 d What is the smallest value in -1/3, 2/11, 1/4, 0, 5/3, -18/23? -18/23 Which is the second biggest value? (a) -7/3 (b) 2/211 (c) -2 (d) 0.2 b What is the second smallest value in 2/85, 0.141, -4, 2? 2/85 Which is the third biggest value? (a) 4/5 (b) 2546 (c) 2.22 (d) 2 d What is the third smallest value in -2, 3, 0.8, 19/5? 3 Which is the biggest value? (a) 0 (b) -19/3 (c) 6 (d) -5/7 c What is the fifth biggest value in -14/3, -5, -2, -0.06, 2, -4? -14/3 Which is the fourth smallest value? (a) -1 (b) 12 (c) -0.42219 (d) 4 b Which is the third biggest value? (a) -0.4 (b) 0.03249 (c) -3/17 a Which is the biggest value? (a) -1 (b) 78 (c) -90 b Which is the fifth biggest value? (a) -11 (b) 3/5 (c) 3 (d) 0.8 (e) -6/29 a Which is the second smallest value? (a) -2/9 (b) -4 (c) 260/97 a What is the fourth smallest value in -4/5, 5, 2, 1/61? 5 Which is the third biggest value? (a) 2/5 (b) -0.17 (c) -0.1 (d) -4133/2 b Which is the smallest value? (a) 3 (b) -12 (c) -7 (d) 6/7 b Which is the third biggest value? (a) -52 (b) -8/11 (c) -5 (d) -0.5 c What is the fourth smallest value in 0.02, -1.6, 2/13, 298? 298 What is the second smallest value in 0.05, -0.15, 687? 0.05 What is the third biggest value in -0.3652, 1/9, 11, -0.2, 2? 1/9 What is the third smallest value in 0.5, 1, -5, -19, -4/5? -4/5 Which is the third biggest value? (a) 1/7 (b) 2/547 (c) 22/5 b Which is the smallest value? (a) 0 (b) -35862 (c) -0.4 (d) 4 b Which is the third smallest value? (a) -1.05 (b) -3 (c) 0.199 (d) -0.3 d Which is the fifth biggest value? (a) 487 (b) 1/6 (c) -3/2 (d) -0.4 (e) -0.3 c Which is the fourth smallest value? (a) 4.3 (b) 62 (c) -3 (d) 2/17 b What is the second smallest value in -1/6, 160/93, -0.2? -1/6 Which is the smallest value? (a) -2/13 (b) -1/10 (c) 18 (d) 4 (e) 1537 a Which is the biggest value? (a) 0.7 (b) -2 (c) 0.1 (d) -33 a Which is the second smallest value? (a) 0.1 (b) -0.4 (c) -2 (d) 709 b Which is the second biggest value? (a) -159.9 (b) 2/387 (c) -3 c What is the fourth smallest value in -2, 0.6, -1201.4, -1? 0.6 What is the third biggest value in -908, 0, 5? -908 Which is the biggest value? (a) -3 (b) 4 (c) -1 (d) -5 (e) -0.618 (f) -0.1 b Which is the sixth biggest value? (a) 0.381 (b) 5 (c) 0.1 (d) 0 (e) -3/2 (f) -4 f What is the smallest value in 2/19, -2, 1/13, -1/46? -2 What is the smallest value in -56/3, -210, -2? -210 Which is the third smallest value? (a) 4 (b) 928 (c) 4/5 (d) 30 d What is the smallest value in -1, 1/4, -2.49, -0.4, -4/5? -2.49 Which is the second biggest value? (a) 3/4 (b) 60227/4 (c) 2 c What is the biggest value in -1/7, 3, -5, 51, -0.28? 51 Which is the biggest value? (a) 1786 (b) -16/3 (c) 1 (d) -4 a What is the third smallest value in 5, 0.1, 0.4, 18/7, -5? 0.4 What is the second smallest value in -2/39, 0.53, -2, 0.5? -2/39 Which is the third smallest value? (a) -0.3 (b) 0.01 (c) 187/2 (d) 3 d What is the biggest value in -1, -5/3, 4392? 4392 What is the smallest value in 1/8, -0.1, -25, 0.018? -25 What is the second smallest value in 5, 0.4, -1/121, 8/7? 0.4 What is the sixth biggest value in -3/4, -7, 0.6, 1/4, -102, -0.1? -102 Which is the third biggest value? (a) 4/9 (b) -870 (c) 0.3 b What is the third biggest value in -0.62, -4, 7.23? -4 What is the second biggest value in 4, -1/2, 3, -8, 624, -1? 4 Which is the second smallest value? (a) 0.8 (b) -0.22 (c) 1/9 (d) 0.1 d What is the smallest value in 0.02, -2/21, -0.2, -128, 0.12, 0.5? -128 What is the third biggest value in 3, 1/3, 17, -1.08, -1, -5? 1/3 Which is the fourth smallest value? (a) 0 (b) -74 (c) 3/8 (d) 77 d Which is the fifth smallest value? (a) -48 (b) -0.2 (c) -794 (d) 4 (e) 3 d What is the second smallest value in -5, 313, 1/5, -0.05, 0.4? -0.05 Which is the second smallest value? (a) -0.4 (b) -195050 (c) -4 (d) 4 c What is the second biggest value in 1/2, 19/7, 1/5, -5/2, -14, -4/9? 1/2 What is the smallest value in -0.21, -0.07, 14/85? -0.21 Which is the fourth smallest value? (a) 60 (b) -4 (c) -1/3 (d) -7 (e) 1/6 e Which is the third smallest value? (a) 5 (b) -3268/11 (c) 0.4 a What is the third smallest value in 5, -0.027, 2/3, 84? 5 What is the biggest value in -1/11, -20/27, 30, 4, 0.1? 30 Which is the smallest value? (a) 2 (b) -1274 (c) -4 (d) 3 (e) 1/39 b What is the smallest value in -1, -2/14919, 2/15? -1 What is the fifth smallest value in 1/2, 22, -1, 3, 3/4, -8/19? 3 What is the second biggest value in -9, 2, 174, -0.8? 2 What is the fourth biggest value in -2, -16, -4, -13? -16 Which is the third biggest value? (a) 27 (b) 11/2 (c) 28 (d) 0.2 b Which is the fourth smallest value? (a) -10 (b) 7 (c) 0.39 (d) -0.1 (e) -0.5 c Which is the third biggest value? (a) -0.4 (b) -4 (c) -4/193 (d) 5 a What is the smallest value in 22, -64, 0.5, -2/5? -64 Which is the third smallest value? (a) 4.757 (b) 0.4 (c) 6 (d) 1 (e) 24 a Which is the second biggest value? (a) -1/1380 (b) -0.3 (c) 0.5 (d) -2 a Which is the sixth biggest value? (a) 1/5 (b) 7 (c) -1.2 (d) -1/7 (e) -1/2 (f) 5 c Which is the third smallest value? (a) -4 (b) 0.3 (c) 35 (d) 31 (e) 0.4 e What is the biggest value in 2, -189, -0.2, 0.2? 2 What is the third biggest value in 2788, 1/4, 0.4, -0.05? 1/4 What is the second biggest value in 5, 14, -4.2? 5 What is the third smallest value in 539796, 5, 2? 539796 Which is the second smallest value? (a) 0 (b) 8 (c) -0.3 (d) -708 (e) 0.3 c Which is the fourth smallest value? (a) -1/3 (b) 16 (c) 272 (d) -3 (e) -2 b What is the fourth smallest value in -2, -3/7, 5, 19.1, 0.4, -3? 0.4 Which is the biggest value? (a) -3 (b) -3/20 (c) 1 (d) 1/7 (e) 0.4 c Which is the biggest value? (a) -56 (b) 15 (c) 0.14 (d) 0.2 b Which is the fifth biggest value? (a) -4 (b) -41 (c) -84 (d) 0.4 (e) 0.3 (f) -0.5 b Which is the fourth biggest value? (a) -0.04 (b) -0.9 (c) 55 (d) -0.4 (e) -8 b Which is the third biggest value? (a) 2 (b) -6/5 (c) 24 (d) -1/7 d What is the third biggest value in 3/217, -0.2, -2.7, 2/17? -0.2 Which is the fourth biggest value? (a) -3/8 (b) 51 (c) -107/3 (d) 4/3 c What is the biggest value in -6, 1/435, -0.153? 1/435 What is the fifth biggest value in 2/13, -3, -0.5, -49/3, 1/5, 5/2? -3 Which is the third smallest value? (a) -76 (b) 0.52 (c) -0.4 b What is the fourth biggest value in -1/2, 266, -28/13, -1/3? -28/13 What is the smallest value in 0.824, 0.5, 133? 0.5 Which is the second smallest value? (a) 3/7 (b) 2 (c) 3 (d) -3/2 (e) -39 (f) 32 d What is the third biggest value in -1/110, -199, -6? -199 Which is the sixth biggest value? (a) 1/4 (b) -0.1 (c) -1 (d) 0.3 (e) -4 (f) -0.43 e Which is the sixth biggest value? (a) -63 (b) 6/47 (c) 0.09 (d) -3 (e) -1 (f) -1/5 a What is the smallest value in 1, 16.1, 1.6? 1 Which is the third smallest value? (a) 234 (b) -169 (c) -3/4 (d) 0.5 d Which is the fifth biggest value? (a) 3 (b) 4 (c) 7 (d) 5/4 (e) 0.1 (f) -0.17 e Which is the third smallest value? (a) -7/3 (b) 37 (c) -1 (d) -0.29 d What is the smallest value in -1/9, -2/3, 5, -70, 33? -70 What is the smallest value in -2/15, 0.2, 3, -0.27, -2/19? -0.27 Which is the fifth smallest value? (a) 4 (b) -1 (c) 0 (d) 11 (e) 0.1 d Which is the biggest value? (a) -0.56 (b) 2 (c) -503 (d) 0.07 b What is the second smallest value in 3, -0.2, 1.103, 0.08? 0.08 What is the second smallest value in 607, 16, 2/5? 16 Which is the second biggest value? (a) 0.3 (b) 0.4 (c) -5 (d) 3 b What is the smallest value in 6, -2.1, 5, -15? -15 Which is the biggest value? (a) -0.3 (b) -4 (c) -0.008 (d) -1 (e) 4 e What is the biggest value in -56/15, -89, -1, 4, 2? 4 Which is the smallest value? (a) 0.1 (b) -3 (c) 3302 b Which is the biggest value? (a) 40 (b) 4 (c) 6204 c Which is the biggest value? (a) -1 (b) 0.2 (c) 12/239 (d) -3/2 b Which	{ "pile_set_name": "DM Mathematics" }
k(d). 44 Calculate the common denominator of (-683791)/1582275 - (-2)/(-75) and 4/18 + (-1574)/36. 170 Suppose 5k = -26 - 19. Let n = 499/21 + -55/14. What is the common denominator of n and (k - -22)/(6/(-11))? 6 Let h = 472/31 - 35833/2046. What is the common denominator of h and -70/99? 198 Let o = -1464 - -2106. Let x be o/55371(4067/(-62) + 3). Let k = x - 1/36914. Calculate the common denominator of k and 1/2. 62 Let x = -27731/39622545 - -4/8055. Calculate the common denominator of x and -83/10. 49190 Suppose v = 20v - 18544. What is the common denominator of 90/150 - v/810 and -145/36? 324 Let w = 4112 + -4082. What is the smallest common multiple of 615 and w? 1230 Let r = -8233/286416 - -9/208. Calculate the common denominator of r and -13/36. 5508 Let f = -11519632 - -2096565895/182. Let v = f + -30/91. Let q = -345/7 + 445/14. Calculate the common denominator of q and v. 2 Suppose -d + 8p - 4p - 10 = 0, 2d + 2 = 2p. Let x(g) = -g2 - 3g + 1. Calculate the smallest common multiple of 19/(-38)(-10)/(2/d) and x(-2). 15 Suppose t - 17z + 15z - 1063 = 211, z = 0. What is the smallest common multiple of t and 28? 2548 Suppose 4g = q - 3, -g + 3g - 5q = -15. Find the common denominator of -91/6 and 1 + g - (-728)/(-429). 66 Let f = 75 + -68. Suppose -264 = -19j + fj. Suppose -23 = -4x + 41. What is the smallest common multiple of x and j? 176 Suppose -6 = 3x - 6x. Suppose 2v - xa = 20, 3v = -a - 3a + 23. Suppose 5n = 4k + 101, 2n - 4k = 34 + 4. What is the least common multiple of n and v? 63 Calculate the common denominator of (-2 + (-115)/(-10) + -13)-9 and -91/2140. 2140 Let r = 342 + -292. Calculate the smallest common multiple of r and 210. 1050 Suppose -2v = 1909 + 871. Find the common denominator of (-6)/(-21) - v/84 and 1((-92)/16)/((-77)/(-88)). 42 Let r = -90169/10 + 9027. Let i be 38861/3327/2. Let p = -15902 + i. What is the common denominator of r and p? 110 Let o be 1683742/(-187074) + (11 - 2). Let x = o + 35014/14769. What is the common denominator of x and -133/78? 702 Find the common denominator of -125/1032 and (4((-4)/8)/(-1))/(48/(-972)). 1032 Calculate the smallest common multiple of 48 and 12/120-136-20. 816 Suppose -b - 50 = -2b. What is the lowest common multiple of (-1015)/(-435) - 1152/(-27) and b? 450 Let g be (-24)/(-1 + 5) - (4 - -5590). Let m = -89641/16 - g. What is the common denominator of m and 9/80? 80 Find the common denominator of 19/8 and 12/(-14) - 1220/1104880-796. 15784 Suppose h - 7 = -c, -3h + 29 = -4c + 1. Suppose 3i - 1 = h. What is the lowest common multiple of 5 and i(-3 + 85/15)? 40 Calculate the common denominator of ((-6)/108)/((1/(-2))/(428/80)) and 125/72. 360 Let f(c) = -c*3 + 14c*2 + 14c + 13. Let v be f(15). Let b be (-2 - (2 + v))/((-2)/5). Suppose 3u - 13 = b. Calculate the least common multiple of 2 and u. 6 Let j(y) = 5y - 37. Let g be j(8). Suppose -4p + 3p - 5l + 27 = 0, -gp = -2l + 4. Find the common denominator of -19/42 and -6 + 179/12 + -5 + p. 84 Suppose 0 = 3q + 36. Let h = 12/211 - -12329/2110. Find the common denominator of ((-273)/216)/(3/q) and h. 90 Let u = 5107 + -8595. Calculate the common denominator of (-8)/(-4) - (-7464)/u and 87/20. 2180 Let s = -233/22 + 41/4. Let q = 1703/220 + s. Calculate the common denominator of q and -133/120. 120 Suppose -89p + 76p - 4836 = 0. Let y = p - -374. Calculate the least common multiple of y and 22. 22 Let c = -2198/3 - -7269/10. What is the common denominator of c and (2(-221)/1170)/((-4)/(-33))? 60 Suppose -3o + j = -300, -4o + j + 376 + 23 = 0. Calculate the least common multiple of 495 and o. 495 Let r = -1100 + 11069/10. Let x be (-2 - -302)4/12. What is the common denominator of (-2)/(-8) - (-885)/x and r? 10 Let g = 13460 + -107701/8. Calculate the common denominator of 43/9083 and g. 72664 Let a be (9 - 5 - -1)/((-1)/(-5)). Suppose -ab + 222 = 72. Calculate the smallest common multiple of 72 and b. 72 Let i = 6682 + -681557/102. What is the common denominator of 11/68 and i? 204 Suppose 9 = -2i + 3, -3l + i + 2685 = 0. Let v be l/4 + 3/(-3). Let y = 2297/10 - v. What is the common denominator of 25/7 and y? 35 Let l = -13 + 28. Let q be 66/18(-102)/l. Let g = 3754/165 + q. Find the common denominator of -61/3 and g. 33 Let i = 18/1187 + -35217/208912. Find the common denominator of i and -53/8. 176 Let f(y) = -y*3 - 6y*2 + 291y + 1717. Find the common denominator of -23/980 and f(-6). 980 Let i(o) = 41o2 - 1. Let t = 83 + -31. Suppose tf - 13 = 195. What is the smallest common multiple of i(-1) and f? 40 Let a = 316 + -131. Let w = a - 184. Calculate the lowest common multiple of 206 and w. 206 Let l be 1206/917502/(-108). Let f = -3709 - l. Calculate the common denominator of f and -49/9. 81 Suppose -168 = -l - 3l. Suppose 0 = -d - 16d - 2771. Let y = 173 + d. Calculate the least common multiple of y and l. 210 Let w(i) = -i*3 - 6i*2 + 13i + 22. Let d be w(-7). Let r be -13 - 0/(d/(-4)). Let z = r - -17. Calculate the least common multiple of z and 2. 4 Let s(c) = -49c + c2 + 22c - 22 + 22c + 21c. Let n be s(-19). Suppose -2a + 21 = z, -4a = -2z - n - 3. What is the least common multiple of a and 20? 20 Suppose -3r + 860k - 863k + 246 = 0, 5r - k = 350. Let t = -75 + 123. What is the least common multiple of r and t? 144 Suppose -26b - 185 = -263. Suppose -3 = 2l - bh, -3 = -21l + 18l + 2h. Suppose 9 + 27 = 2a. What is the least common multiple of a and l? 18 What is the smallest common multiple of 40 and (-39)/(-65)-5 + 913? 3640 Calculate the common denominator of 101/604 and 1 + (2 - -2) - ((-300)/144 - -11). 1812 Let g = 744 + -714. Let l(h) = -h3 - 13h*2 + 12h - 6. Calculate the least common multiple of l(-14) and g. 330 Let q = 112064 + -10085917/90. What is the common denominator of q and -1/21? 630 Let w be (7/(-21))/((-2)/6)-19. Let q = w + 506/27. Calculate the common denominator of -2/5 and q. 135 Let u = 19724 + -16424. What is the least common multiple of u and 3300? 3300 Let z = -4899 - -88223/18. Find the common denominator of z and -137/18. 18 Suppose -9 = 31a - 54 - 17. What is the lowest common multiple of a and 1208? 1208 Let a be 11583/132 - ((-1)/4 - 0). Suppose 18f + a = 20f. What is the smallest common multiple of f and 44? 44 Let h = -26148943/336 + 311295/4. Calculate the common denominator of -19/16 and h. 336 Let d = -36 + -12. Calculate the common denominator of -6 + 1 - (-22)/d and 63/5. 120 What is the common denominator of -18/515 and (-104)/(-2028) - 478/195? 515 Let r = -396411/67340 - 213/1036. Let m = r + 51817/8580. Calculate the common denominator of -85/96 and m. 1056 Suppose -7s + 3s - 4f + 23184 = 0, 0 = -s - 4f + 5814. What is the smallest common multiple of s and 1930? 5790 Let d = -89/128 + 1/128. Suppose -2t = -3t - 10334. Let f = t - -144793/14. Calculate the common denominator of f and d. 112 Let m = 5/687 + -5282/2061. Find the common denominator of m and (71 + 14)/(-61). 18 Let c = 30 + 6. Let a = 99 + -94. Suppose 2m = am - c. What is the lowest common multiple of 6 and m? 12 Let a be 5 - (7/(-21))/((-2)/(-18)). Suppose 1 + a = -j. Let r(v) = -2v*2 - 19v - 7. Calculate the lowest common multiple of r(j) and 10. 10 Let z = 1463/2 + -713. Suppose 20d + 48 = 26d. What is the common denominator of z and d/28 - (24/(-4))/2? 14 Let n be 2/(-7) - (10 + 26920/210). Let j = n + 131161/945. What is the common denominator of 37/165 and j? 1485 Let b(u) = u*2 + 59u - 111. What is the lowest common multiple of b(-61) and 1439? 15829 What is the common denominator of -97/768 and (6/(-1792))/((-4188)/70498)? 5376 Let l = 10475/28 + -2680/7. Calculate the common denominator of (-6)/(-44)3/(27/39) and l. 44 Let i = 1863/520 + 19/65. Let k be (-8)/166 - (-13 - -13). Let b = k - 4553/249. Find the common denominator of b and i. 24 Suppose 4347 + 2187 = 18q. Let p = 551 - q. Calculate the least common multiple of (-56)/6(-3)/2 and p. 1316 Suppose -6n - 5094 = -7n - 3q, 0 = -2n + 4q + 10168. What is the smallest common multiple of n and 12? 5088 Suppose 13t = 38t + 2908 - 13183. What is the smallest common multiple of 11 and t? 4521 What is the common d	{ "pile_set_name": "DM Mathematics" }
w/5 - 4418 = 0. -11045, 1 Factor 55h*3 - 300h*2 + 455h - 150. 5(h - 3)(h - 2)(11h - 5) What is b in -5b4 - 525020b*3 - 13782825030b*2 - 27564075020b - 13781775005 = 0? -52501, -1 Find n such that 9n5/2 + 177n*4/2 - 1641n*3/2 - 39057n*2/2 - 19344n + 247680 = 0. -16, -5, 3, 43/3 Factor -212v2/5 + 10904v + 45408/5. -4(v - 258)(53v + 44)/5 Factor 3k*3 + 247k*2/2 - 1240k - 2950. (k - 10)(k + 2)(6k + 295)/2 Suppose 4l*4 - 244l*3 + 1352l*2 - 1760l = 0. What is l? 0, 2, 4, 55 Factor -29770y2 + 29768y + 2. -2(y - 1)(14885y + 1) Determine g so that 15g*3 - 3760g*2 - 19265g + 23010 = 0. -6, 1, 767/3 Suppose -w*5/10 + 15w*4 - 3682w*3/5 + 12951w*2 - 137295w/2 - 82350 = 0. What is w? -1, 15, 60, 61 Factor x*3 + 72x*2 - 16995x - 1421606. (x - 134)(x + 103)2 Factor -c2/3 - 55c + 2896/3. -(c - 16)(c + 181)/3 Factor -3d*3/2 + 273d*2/2 + 564d + 570. -3(d - 95)(d + 2)*2/2 Factor 2h*3 - 520h*2 + 4064h - 8064. 2(h - 252)(h - 4)*2 Factor 2a*3/3 + 720a*2 + 7150a + 53500/3. 2(a + 5)2(a + 1070)/3 Factor c*2/4 + 1503337c/2 + 2260022135569/4. (c + 1503337)2/4 Factor -g3 + 167g2 + 12826g - 12992. -(g - 224)(g - 1)(g + 58) Factor -2l2/7 + 186552l/7 - 559638/7. -2(l - 93273)(l - 3)/7 Find n such that 4n5 - 88n*4 + 236n*3 - 152n*2 = 0. 0, 1, 2, 19 Determine l so that 4l*3/3 + 816l*2 + 267692l/3 - 90048 = 0. -469, -144, 1 What is r in r*4 - 79151r*3 + 158298r*2 = 0? 0, 2, 79149 Factor 4a*2/11 - 29474a/11 + 14736/11. 2(a - 7368)(2a - 1)/11 Factor t3/3 - 5810t*2/3 - 34888t/3 - 46528/3. (t - 5816)(t + 2)(t + 4)/3 Find u such that -u*2/3 + 1742u = 0. 0, 5226 Solve -5h4 - 195h*3 - 215h*2 + 5595h - 5180 = 0. -37, -7, 1, 4 Solve -2k3/9 - 6392k*2/9 + 38438k/9 + 44828/9 = 0 for k. -3202, -1, 7 Determine m, given that -4m5 + 1544m*3 + 12672m*2 + 11132m = 0. -11, -1, 0, 23 Factor 3r4/4 - 3r*3 - 9r*2/4 + 15r/2 + 6. 3(r - 4)(r - 2)(r + 1)2/4 Find t, given that 5t*5 - 980t*4 + 64290t*3 - 1424800t*2 + 612625t + 16477500 = 0. -3, 4, 65 Suppose -2g4/21 + 2g*3/7 + 986g*2/21 + 498g + 1512 = 0. What is g? -9, -7, 28 Factor 98o4 - 25760o*3 + 22032o*2 - 44032o/7 + 4192/7. 2(o - 262)(7o - 2)3/7 Find a, given that -4a*5/3 + 1680a*4 - 439344a*3 - 58839552a2 = 0. -96, 0, 678 Factor r2/8 - 13302r. r(r - 106416)/8 Suppose -4a4/3 + 3508a*3/3 - 177540a*2 - 36917100a = 0. What is a? -113, 0, 495 Determine v so that -79507v5 - 97645690v*4 - 208575112v*3 - 27836144v*2 - 1275056v - 19616 = 0. -1226, -2, -2/43 Let 3u5/2 + 165u*4/2 - 1095u*3/2 + 255u*2/2 + 2220u + 1464 = 0. What is u? -61, -1, 4 Solve -1392400w4/3 + 4181920w*3/3 - 14164w*2/3 + 4w = 0. 0, 1/590, 3 Factor 2n3/15 + 15002n*2/15 + 1876000n + 1875000. 2(n + 1)(n + 3750)*2/15 Solve 3c*4/4 + 789c*3/2 + 1944c*2 - 10149c/2 + 10941/4 = 0. -521, -7, 1 Factor -2g2/23 - 30872g/23. -2g(g + 15436)/23 Determine b, given that 2b2/7 + 1076b/7 + 5330/7 = 0. -533, -5 Solve 4l2/5 + 548l/5 - 7152/5 = 0 for l. -149, 12 Determine g, given that g*5 + 7733g*4 - 46422g*3 + 92860g*2 - 61912g = 0. -7739, 0, 2 Find a such that -81a3/4 - 5337a*2/2 - 4696a - 2080 = 0. -130, -8/9 Find n such that n*4/3 + 325n*3/3 + 17789n*2/3 + 285107n/3 + 167214 = 0. -261, -31, -2 What is o in -2o4 - 164o*3 - 1610o*2 - 3408o = 0? -71, -8, -3, 0 Factor -a*3/7 + 881a*2/7 - 201312a/7 + 3172608/7. -(a - 432)*2(a - 17)/7 What is b in -2b4/15 - 1108b*3/15 - 153458b*2/15 = 0? -277, 0 Find j such that 3j*2 - 812136j = 0. 0, 270712 Factor -l*4/8 - 141l*3/4 + 9l*2/8 + 1269l/4. -l(l - 3)(l + 3)(l + 282)/8 Find l, given that -l2/6 + 13031l/3 - 169806961/6 = 0. 13031 What is t in -3t3 - 393t*2 + 1200t - 804 = 0? -134, 1, 2 Suppose -5x3 - 1375x*2 + 30530x - 162800 = 0. What is x? -296, 10, 11 Suppose 5l3 - 1890l*2 - 103925l - 294630 = 0. What is l? -46, -3, 427 Let -5r4/3 - 487r*3/6 - 1175r*2/3 - 646r - 348 = 0. What is r? -87/2, -2, -6/5 Factor -5m3 - 2500m*2 - 4985m - 2490. -5(m + 1)2(m + 498) Factor -2b2/15 - 324b/5 - 194/3. -2(b + 1)(b + 485)/15 Let 3z2 - 10590z - 95553 = 0. What is z? -9, 3539 Determine i so that 36i5 - 4805i*4 + 168403i*3 - 535021i*2 + 224705i - 25350 = 0. 2/9, 1/4, 3, 65 Solve 2u2 + 5069668u + 3212691703778 = 0 for u. -1267417 Factor -2o3/3 + 32050o*2 - 385216962o + 1155554738/3. -2(o - 24037)2(o - 1)/3 Solve -10s4/13 + 466524s*3/13 - 1119618s*2/13 + 839704s/13 - 186600/13 = 0. 2/5, 1, 46650 Factor 365k2 + 69725k + 1910. 5(k + 191)(73k + 2) Find u such that -u2/2 + 274u + 13133/2 = 0. -23, 571 Factor 4k3/3 - 733k*2/2 - 3825k/2 - 700/3. (k - 280)(k + 5)(8k + 1)/6 Factor -3d*4 + 15576d*3 - 20155200d*2 - 162240000d. -3d(d - 2600)*2(d + 8) Find m such that m*3 + 5928m*2 - 4m - 23712 = 0. -5928, -2, 2 Find g such that g*2/5 + 1129g/5 + 14508/5 = 0. -1116, -13 Determine v so that 56v4 - 17278v*3 + 1337340v*2 - 712712v + 94864 = 0. 1/4, 2/7, 154 Find l, given that 15l4/4 + 717l*3/4 - 3255l*2/4 + 1191l/4 + 1287 = 0. -52, -1, 11/5, 3 Factor -2z3 - 34388z*2 - 147748018z + 591542408. -2(z - 4)(z + 8599)*2 Suppose -4b*3 - 1525312b*2 - 145411043584b = 0. Calculate b. -190664, 0 Factor 4y2 + 1124y + 68352. 4(y + 89)(y + 192) Factor -5c2 - 24975c + 24980. -5(c - 1)(c + 4996) Factor 2a3/3 - 19231a*2/3 + 9614a/3 + 3205. (a - 9615)(a - 1)(2a + 1)/3 Find r such that 2r*4/7 - 156r*3/7 + 3134r*2/7 - 13956r/7 - 2464 = 0. -1, 8, 22, 49 Factor -5o2 - 1061460o - 56334866580. -5(o + 106146)2 Factor 3g*4 + 3879g*3 - 23346g*2 + 46740g - 31176. 3(g - 2)3(g + 1299) Factor -2c4/23 + 1164c*3/23 - 20520c*2/23 + 122256c/23 - 243648/23. -2(c - 564)(c - 6)*3/23 Factor 3h*4 - 72h*3 + 465h*2 - 900h. 3h(h - 15)(h - 5)(h - 4) Suppose -5a5 - 1560a*4 - 126145a*3 - 677310a*2 + 2019600a + 11236320 = 0. Calculate a. -153, -6, -4, 4 Factor -2t3 + 1192t*2 - 1186t - 2380. -2(t - 595)(t - 2)(t + 1) Suppose -4f*4/3 + 4f*3 + 516f*2 + 2932f/3 - 1496 = 0. What is f? -17, -3, 1, 22 Suppose -2t4 + 24t*3 + 486t*2 - 2916t - 34992 = 0. What is t? -9, 12, 18 Solve 87t4 - 2898t*3 + 25344t*2 - 85920t + 101376 = 0. 96/29, 4, 22 Factor -p*3 - 1618p*2 - 484561p + 145476180. -(p - 180)(p + 899)2 Suppose 15i*4 + 80i*3 - 205i*2 - 170i + 280 = 0. What is i? -7, -4/3, 1, 2 Find v, given that -2v4/3 + 6434v*3/3 + 109774v*2/3 + 196098v + 316932 = 0. -7, -3, 3234 Factor 4w3/3 + 16988w*2/3 - 68096w + 204432. 4(w - 6)2(w + 4259)/3 Let -2t3/13 - 6410t*2/13 + 141746t/13 - 780934/13 = 0. Calculate t. -3227, 11 Factor 29282b3/5 - 1025112b*2/5 + 16941b/10 - 7/2. (b - 35)(242b - 1)*2/10 Let -12v*5 - 42183v*4 - 36672477v*3 + 701953065v*2 - 496634787v - 168603606 = 0. What is v? -1767, -1/4, 1, 18 Let 5i2/3 - 1105i + 19350 = 0. What is i? 18, 645 Determine g so that -g*4 + 268g*3/5 + 4703g*2/5 - 14242g/5 - 6432/5 = 0. -16, -2/5, 3, 67 Solve -k*5/4 + 3k*4/2 + 7k*3/4 - 9k*2 - 9k = 0 for k. -2, -1, 0, 3, 6 Factor -2f2 - 71182f - 71180. -2(f + 1)(f + 35590) Factor -464t3/3 - 75172t*2/3 - 1014984t - 8748. -4(t + 81)2(116t + 1)/3 Solve 3f*4 + 2079f*3 + 56448f*2 + 391020f = 0. -665, -14, 0 What is p in -3p4/4 - 3981p*3/4 - 146697p*2/4 + 321321p/4 + 116010 = 0? -1289, -40, -1, 3 Determine o, given that 21o4 - 3114o*3 - 131412o*2 - 1214136o + 357696 = 0. -18, 2/7, 184 Factor 5f3 - 1135f*2 - 2285f - 1145. 5(f - 229)(f + 1)*2 Find k, given that 4k*3 - 1380k*2 + 147168k - 4518992 = 0. 53, 146 What is k in 3k3/5 - 30k*2 - 6873k/5 = 0? -29, 0, 79 Suppose -h*3/3 - 4624h*2 - 16077567h - 287899974 = 0. Calculate h. -6927, -18 Determine i, given that -18i4/5 - 4846i*3/5 - 48074i*2/5 - 108346i/5 - 21756/5 = 0. -259, -7, -3, -2/9 Find t, given that -3t4 + 1980t*3 - 434079t*2 + 31622562t = 0. 0, 207, 246 Factor 2m2/5 - 14156	{ "pile_set_name": "DM Mathematics" }
ded by 216349. 5 Calculate the remainder when 687697 is divided by 529. 526 What is the remainder when 4604347 is divided by 2302173? 1 Calculate the remainder when 707073 is divided by 168. 129 Calculate the remainder when 117159204 is divided by 16. 4 Calculate the remainder when 285637 is divided by 1195. 32 What is the remainder when 19360 is divided by 1746? 154 Calculate the remainder when 56553 is divided by 4678. 417 What is the remainder when 25055356 is divided by 57204? 4 What is the remainder when 1119550321 is divided by 53? 51 Calculate the remainder when 696876 is divided by 222. 18 What is the remainder when 2001275 is divided by 1041? 473 What is the remainder when 78248 is divided by 19410? 608 Calculate the remainder when 93083 is divided by 585. 68 What is the remainder when 972668 is divided by 81009? 560 What is the remainder when 834488 is divided by 834418? 70 Calculate the remainder when 32329948 is divided by 58. 52 Calculate the remainder when 104223123 is divided by 1619. 1617 What is the remainder when 4334625 is divided by 2167298? 29 Calculate the remainder when 21288 is divided by 6837. 777 Calculate the remainder when 31667028 is divided by 10555673. 9 Calculate the remainder when 71693 is divided by 17830. 373 Calculate the remainder when 392504218 is divided by 90. 88 Calculate the remainder when 12830 is divided by 633. 170 Calculate the remainder when 1237360 is divided by 65039. 1619 Calculate the remainder when 134417 is divided by 1494. 1451 What is the remainder when 2106226 is divided by 27352? 122 What is the remainder when 1345611 is divided by 112134? 3 Calculate the remainder when 18367005 is divided by 528. 525 Calculate the remainder when 15550653 is divided by 444. 441 Calculate the remainder when 175411044 is divided by 139. 133 Calculate the remainder when 40260 is divided by 1434. 108 What is the remainder when 354354168 is divided by 50622023? 7 Calculate the remainder when 2166313 is divided by 189. 184 Calculate the remainder when 21912 is divided by 21904. 8 What is the remainder when 26961 is divided by 3251? 953 Calculate the remainder when 6788268 is divided by 1771. 25 Calculate the remainder when 103018849 is divided by 83. 79 What is the remainder when 32459531 is divided by 24369? 23 Calculate the remainder when 116290963 is divided by 2009. 2007 Calculate the remainder when 1290168 is divided by 216. 0 What is the remainder when 228853837 is divided by 80? 77 What is the remainder when 7503165 is divided by 388? 21 What is the remainder when 294773174 is divided by 115? 114 Calculate the remainder when 33821 is divided by 413. 368 What is the remainder when 916682 is divided by 48244? 46 Calculate the remainder when 309140802 is divided by 953. 944 Calculate the remainder when 143809 is divided by 8950. 609 What is the remainder when 9441594 is divided by 2360398? 2 Calculate the remainder when 21084953 is divided by 96. 89 Calculate the remainder when 212980 is divided by 26606. 132 Calculate the remainder when 3389550 is divided by 472. 118 What is the remainder when 298991 is divided by 1175? 541 Calculate the remainder when 3663539 is divided by 203. 201 What is the remainder when 795760 is divided by 317? 90 Calculate the remainder when 154509 is divided by 15089. 3619 What is the remainder when 103981 is divided by 17? 9 Calculate the remainder when 1503902 is divided by 24. 14 What is the remainder when 5323131 is divided by 2661563? 5 Calculate the remainder when 5542942 is divided by 1164. 1138 Calculate the remainder when 10161 is divided by 974. 421 What is the remainder when 9823 is divided by 9554? 269 What is the remainder when 25836 is divided by 1365? 1266 Calculate the remainder when 5632665 is divided by 148219. 343 What is the remainder when 5034138 is divided by 1626? 42 Calculate the remainder when 18952102 is divided by 510. 502 What is the remainder when 3682260 is divided by 81? 0 What is the remainder when 54444734 is divided by 938702? 18 What is the remainder when 1158873 is divided by 11040? 10713 Calculate the remainder when 79566 is divided by 11356. 74 Calculate the remainder when 523853 is divided by 6951. 2528 Calculate the remainder when 105220 is divided by 8088. 76 What is the remainder when 4722810 is divided by 938? 918 Calculate the remainder when 870964 is divided by 434346. 2272 Calculate the remainder when 49180 is divided by 13244. 9448 What is the remainder when 1184827 is divided by 543? 1 Calculate the remainder when 1567473 is divided by 265. 263 What is the remainder when 5778448 is divided by 39? 13 What is the remainder when 415106 is divided by 605? 76 What is the remainder when 564013 is divided by 112800? 13 Calculate the remainder when 2178314 is divided by 57. 2 What is the remainder when 594433 is divided by 1581? 1558 What is the remainder when 6640748 is divided by 38? 20 Calculate the remainder when 4453471 is divided by 447. 10 What is the remainder when 750371 is divided by 374727? 917 What is the remainder when 297066 is divided by 149? 109 What is the remainder when 113507 is divided by 113158? 349 What is the remainder when 8384561 is divided by 1579? 71 What is the remainder when 10743488 is divided by 10743465? 23 What is the remainder when 207494 is divided by 5183? 174 Calculate the remainder when 132045 is divided by 692. 565 What is the remainder when 256025 is divided by 84047? 3884 What is the remainder when 42115074 is divided by 28? 22 What is the remainder when 48687 is divided by 1417? 509 Calculate the remainder when 45101 is divided by 1192. 997 Calculate the remainder when 4458278 is divided by 24. 14 Calculate the remainder when 58002 is divided by 19283. 153 What is the remainder when 233864 is divided by 589? 31 What is the remainder when 40537 is divided by 8865? 5077 What is the remainder when 739545 is divided by 30793? 513 Calculate the remainder when 372996 is divided by 93209. 160 What is the remainder when 239991 is divided by 13254? 1419 What is the remainder when 598210 is divided by 197548? 5566 Calculate the remainder when 247384 is divided by 123. 31 Calculate the remainder when 30733 is divided by 4499. 3739 Calculate the remainder when 1801671 is divided by 81893. 25 Calculate the remainder when 1467635 is divided by 548. 91 What is the remainder when 19479286 is divided by 342? 334 Calculate the remainder when 7334759 is divided by 2444895. 74 What is the remainder when 91065 is divided by 12989? 142 What is the remainder when 6485043 is divided by 650? 643 What is the remainder when 8113181 is divided by 1212? 53 What is the remainder when 1647030 is divided by 823507? 16 What is the remainder when 7492 is divided by 7048? 444 What is the remainder when 10232578 is divided by 89? 70 Calculate the remainder when 47535 is divided by 9109. 1990 What is the remainder when 122464 is divided by 180? 64 What is the remainder when 1001353 is divided by 123? 10 What is the remainder when 99647 is divided by 1511? 1432 What is the remainder when 163266 is divided by 495? 411 Calculate the remainder when 432456 is divided by 5924. 4 Calculate the remainder when 31323953 is divided by 31323934. 19 What is the remainder when 2211531 is divided by 315832? 707 What is the remainder when 3525677 is divided by 366? 365 Calculate the remainder when 11160284 is divided by 797162. 16 Calculate the remainder when 9230494 is divided by 28845. 94 Calculate the remainder when 2088305 is divided by 1306. 11 Calculate the remainder when 890371 is divided by 222586. 27 Calculate the remainder when 100876 is divided by 155. 126 What is the remainder when 291138 is divided by 710? 38 What is the remainder when 25146826 is divided by 783? 781 What is the remainder when 53606787 is divided by 17868925? 12 Calculate the remainder when 5703018 is divided by 89. 76 What is the remainder when 208327542 is divided by 1151? 1146 Calculate the remainder when 11395866 is divided by 144251. 37 What is the remainder when 33754607 is divided by 29? 28 What is the remainder when 853433 is divided by 315? 98 Calculate the remainder when 1454120 is divided by 1095. 1055 What is the remainder when 94195 is divided by 31258?	{ "pile_set_name": "DM Mathematics" }
qg. What is prob of sequence fq? 1/18 Calculate prob of sequence zasz when four letters picked without replacement from zeazxszxaszssaxzez. 1/204 What is prob of sequence vhyh when four letters picked without replacement from jyuhhyuyvjhuhhj? 1/546 Calculate prob of sequence mpmp when four letters picked without replacement from {d: 4, m: 2, p: 2, c: 1, l: 4, n: 1}. 1/6006 Three letters picked without replacement from {o: 4, r: 10, q: 2, w: 1, u: 2}. Give prob of sequence wuq. 2/2907 What is prob of sequence mpo when three letters picked without replacement from {p: 1, w: 2, m: 1, o: 4}? 1/84 What is prob of sequence vm when two letters picked without replacement from vmmm? 1/4 What is prob of sequence nhny when four letters picked without replacement from {n: 3, h: 1, d: 1, y: 3, l: 2}? 1/280 Calculate prob of sequence oyfd when four letters picked without replacement from {y: 3, g: 4, d: 2, o: 2, f: 7}. 7/6120 Calculate prob of sequence nppz when four letters picked without replacement from pzzzppppn. 5/252 Three letters picked without replacement from vvvzzzvzzvzzzvzv. What is prob of sequence vzv? 9/80 What is prob of sequence mttt when four letters picked without replacement from {m: 3, t: 15}? 91/816 What is prob of sequence cc when two letters picked without replacement from mmhawchhphcmpmwamh? 1/153 Three letters picked without replacement from {i: 2, d: 3, o: 7}. Give prob of sequence dio. 7/220 Four letters picked without replacement from {v: 1, u: 7, y: 12}. Give prob of sequence yuvu. 7/1615 Calculate prob of sequence ohhh when four letters picked without replacement from {h: 5, o: 5}. 5/84 Calculate prob of sequence wwwz when four letters picked without replacement from zzlztzxwtltztwtzw. 3/4760 Four letters picked without replacement from {m: 4, x: 4, j: 1, f: 4, c: 3}. What is prob of sequence jffc? 3/3640 Two letters picked without replacement from qqx. Give prob of sequence xq. 1/3 Three letters picked without replacement from qfxzqqn. What is prob of sequence qfz? 1/70 Calculate prob of sequence gp when two letters picked without replacement from wprgweep. 1/28 Two letters picked without replacement from mcwwcwwmmwmww. Give prob of sequence ww. 7/26 Three letters picked without replacement from idyyppiiiyppypisgysi. Give prob of sequence ipp. 1/57 Two letters picked without replacement from {b: 7, t: 1}. What is prob of sequence bb? 3/4 Two letters picked without replacement from ooqcqaojcjoc. Give prob of sequence qq. 1/66 Calculate prob of sequence llp when three letters picked without replacement from pppllpllppp. 14/165 Four letters picked without replacement from {c: 1, k: 4, o: 3, m: 2, n: 6, y: 4}. Give prob of sequence mckc. 0 Three letters picked without replacement from {z: 1, g: 2, s: 1, u: 5, n: 8}. What is prob of sequence uuz? 1/204 Two letters picked without replacement from {p: 1, y: 4, b: 1, u: 1, k: 2}. What is prob of sequence kp? 1/36 Calculate prob of sequence txxx when four letters picked without replacement from {t: 4, x: 7}. 7/66 Two letters picked without replacement from {p: 1, r: 1, l: 1, f: 1, j: 1}. Give prob of sequence lp. 1/20 What is prob of sequence kklk when four letters picked without replacement from lklklklllk? 1/35 Two letters picked without replacement from {m: 5, k: 5}. What is prob of sequence km? 5/18 Calculate prob of sequence yjl when three letters picked without replacement from {c: 4, y: 5, l: 1, j: 1, k: 4}. 1/546 Three letters picked without replacement from nllppvpplllnppmppp. What is prob of sequence ppp? 7/68 What is prob of sequence gg when two letters picked without replacement from gzlzzzzzzzlzg? 1/78 What is prob of sequence uuu when three letters picked without replacement from uuuuuuu? 1 What is prob of sequence zt when two letters picked without replacement from {y: 1, j: 1, t: 2, z: 1, d: 3, f: 4}? 1/66 Four letters picked without replacement from iidkiiddddkdidtdt. What is prob of sequence tddd? 1/85 Four letters picked without replacement from stsslsssssissrittls. Give prob of sequence tlii. 1/7752 Calculate prob of sequence hcc when three letters picked without replacement from ccyhyyhhhcccycchcy. 35/612 Calculate prob of sequence ddg when three letters picked without replacement from ddidgigdddgygdddddg. 275/2907 Four letters picked without replacement from {l: 3, w: 4, j: 6, c: 1}. Give prob of sequence wcwj. 3/1001 Calculate prob of sequence icqi when four letters picked without replacement from {c: 4, i: 3, q: 4}. 2/165 Four letters picked without replacement from {j: 8, o: 2, z: 2, g: 1, y: 1}. Give prob of sequence gozo. 1/6006 Four letters picked without replacement from {z: 3, n: 1, c: 5}. What is prob of sequence czzc? 5/126 Two letters picked without replacement from {g: 4, z: 1, d: 1, a: 1, i: 1, p: 8}. Give prob of sequence ia. 1/240 Calculate prob of sequence wtt when three letters picked without replacement from wwwttwwttqt. 10/99 Calculate prob of sequence yxyc when four letters picked without replacement from {c: 2, y: 5, x: 2}. 5/189 Three letters picked without replacement from zfvffvvzzvffvzv. Give prob of sequence zvz. 12/455 What is prob of sequence zh when two letters picked without replacement from {h: 3, g: 6, v: 1, z: 2, b: 1}? 1/26 Calculate prob of sequence up when two letters picked without replacement from {e: 1, l: 5, u: 1, s: 2, p: 1}. 1/90 What is prob of sequence dkk when three letters picked without replacement from kkkdkddkkd? 1/6 What is prob of sequence vj when two letters picked without replacement from {v: 4, j: 14}? 28/153 Calculate prob of sequence gdd when three letters picked without replacement from gdgddgggddgdg. 35/286 Four letters picked without replacement from {q: 7, r: 7, p: 2, w: 1}. Give prob of sequence rprw. 1/680 Two letters picked without replacement from rqrff. What is prob of sequence rq? 1/10 Four letters picked without replacement from jjjjjjjmjmajmjjjjmmj. Give prob of sequence ajmm. 7/2907 Four letters picked without replacement from xxpxxpxxxpxxpxxpxx. What is prob of sequence xxxp? 143/1224 Three letters picked without replacement from nbbbbdoobdoboonnbbo. Give prob of sequence nnb. 8/969 What is prob of sequence ht when two letters picked without replacement from {g: 4, h: 2, t: 1, p: 3}? 1/45 Two letters picked without replacement from sobyossoboiyoiybiyo. Give prob of sequence iy. 2/57 Calculate prob of sequence dhdc when four letters picked without replacement from cacjchcddaac. 1/1188 Three letters picked without replacement from duudddugmuamxmgudux. What is prob of sequence dud? 20/969 Calculate prob of sequence gdbb when four letters picked without replacement from gdgbddhhgdb. 1/330 Four letters picked without replacement from dbbbbbjjjbjbj. What is prob of sequence dbbj? 7/572 Four letters picked without replacement from {y: 8, g: 2}. What is prob of sequence yygy? 2/15 Two letters picked without replacement from pdpddpdppppppppppppp. What is prob of sequence pd? 16/95 Two letters picked without replacement from bwjbbjqbmwmw. Give prob of sequence wj. 1/22 Two letters picked without replacement from {m: 3, y: 7}. What is prob of sequence my? 7/30 Two letters picked without replacement from {q: 2, g: 2, s: 1, o: 1, j: 1, b: 1}. What is prob of sequence bg? 1/28 What is prob of sequence ssws when four letters picked without replacement from {p: 12, s: 5, w: 2}? 5/3876 Three letters picked without replacement from wgupu. Give prob of sequence wup. 1/30 Calculate prob of sequence pspn when four letters picked without replacement from {n: 3, s: 2, p: 4}. 1/42 Calculate prob of sequence lyg when three letters picked without replacement from {l: 1, y: 5, u: 3, i: 2, g: 1}. 1/264 Two letters picked without replacement from {c: 7, w: 9}. What is prob of sequence ww? 3/10 Three letters picked without replacement from {b: 2, g: 1, m: 8, x: 5, z: 1}. What is prob of sequence xzb? 1/408 Calculate prob of sequence scsf when four letters picked without replacement from {f: 2, s: 4, c: 3}. 1/42 Two letters picked without replacement from {b: 1, i: 5, t: 2, k: 1, x: 1}. What is prob of sequence tt? 1/45 Three letters picked without replacement from zqjvmqo. Give prob of sequence ojm. 1/210 Four letters p	{ "pile_set_name": "DM Mathematics" }
(f) be the first derivative of 5f2/2 + 4f + 514. Let t(v) be the first derivative of 3v2 + 5v - 1. Calculate -4r(y) + 3t(y). -2y - 1 Let a(v) = -11v*3 - 3v*2 + 3v. Let x(f) = 17f - 122. Let u be x(7). Let p(z) = 10z*3 + 2z*2 - 2z. Determine up(l) - 2a(l). -8l3 Suppose -3n + 0n = 15. Let d(p) = -p2 + 5p - 2. Let v(u) be the first derivative of u*2/2 - u - 141. Determine nv(r) + d(r). -r*2 + 3 Let c(j) = -11j + 9. Let m(w) = 11w - 10. Determine 7c(z) + 6m(z). -11z + 3 Let d(v) = -5v2 + 10v - 11. Let p(h) = 3h2 - 6h + 6. Calculate 4d(c) + 7p(c). c*2 - 2c - 2 Let s(v) = -v*2 - 4v. Let o(y) = -y*2 - 5y. Suppose 2q + 49 - 39 = 0. What is qs(p) + 4o(p)? p2 Let g(t) = 11t*2 + 26t + 6. Let v(s) = 11s2 + 23s + 6. Let a(y) = -6g(y) + 7v(y). Let r(x) = -10x2 - 4x - 5. Give 3a(f) + 4r(f). -7f2 - f - 2 Let g(f) = -296f + 4. Let u(v) = 299v - 3. Calculate 3g(z) + 4u(z). 308z Let o(v) = 1 + 2v - 3v + 4v. Let p(u) = -u. Suppose 736s = 3l + 741s + 6, 2s - 41 = 5l. Give lp(y) - 2o(y). y - 2 Let p(o) = -3o - 3. Let g(c) = c3 - 6c*2 + 4c + 4. Let i be g(5). Let w be -1 + i/(3/(-15)). Let r(v) = -3v - 2 - 3v + 4v. Calculate wr(d) - 3p(d). d + 1 Let w(p) = -p3 + 16p*2 + p. Let y(i) = 3i*2. Suppose -64 = -4q + 4s, -90 = 3q + s - 118. Give qy(v) - 2w(v). 2v3 + v2 - 2v Let p(i) = 911i. Let n(r) = 912r. Give 3n(v) - 4p(v). -908v Let c(h) = -6h. Let p(n) = n*2 - 37n + 1. Let f(g) = 6c(g) - p(g). Let z(r) = -18r*3 - 18r*2 + 18r - 18. Determine -18f(k) + z(k). -18k*3 Let f be (-7)/(-28) - 31/(-4). Let u(r) = -f + 4 + 3. Let g(y) = 4y*2 - 1 + 2y*2 + 2y*2 - 7y*2. Calculate -g(a) + 3u(a). -a2 - 2 Let r(p) be the first derivative of p3/3 + p - 430. Suppose 5a + 0a = 15. Let y(u) = -u*3 - 7 - 6u*2 + 2u3 - u2. Determine ay(n) + 21r(n). 3n3 Let g(s) = 25s*3 - 82s*2 + 11s + 9. Let o(a) = 13a3 - 42a*2 + 6a + 5. Determine 6g(q) - 11o(q). 7q3 - 30q2 - 1 Let a = -42 + 41. Let h(q) = -q3 - q. Let y(s) = 5s3 - s2 + s. Determine ay(i) - 3h(i). -2i3 + i2 + 2i Let y(f) = f + 4. Let n(s) be the third derivative of 0 + 0s - 7/2s3 + 21s*2 - 5/24s*4. Calculate 2n(q) + 11y(q). q + 2 Let q(d) = 4 - 7 - 33017d + 33012d. Let a(l) = 9l + 5. Let p(f) = f*2 - 2f + 1. Suppose -5w + 16 = 1. Let z be p(w). Calculate za(k) + 7q(k). k - 1 Let v(s) = 2s*2 + 3s + 5. Let a(l) = -l*2 - l - 2. Suppose -149t + 155t = 24. What is tv(i) + 10a(i)? -2i*2 + 2i Let i(b) = 75b + 81. Let w(q) = -15q - 16. Let x(o) = -5i(o) - 24w(o). Let a be 14/1(-609)/406. Let z(d) = 3d + 4. Give az(y) - 4x(y). -3y Let o(f) = -6f. Let d = 12 - 7. Let v be 36 + -35 - 5(-1 + 0). Let z(k) = -7k. Let x(b) = 7b. Let q(u) = vx(u) + 7z(u). What is dq(j) - 6o(j)? j Let a(g) = 2g*2 + g + 22. Let q(k) = -2k*2 - k - 23. What is -5a(r) - 4q(r)? -2r*2 - r - 18 Let w(t) = 4t*2 + 439t + 20. Let j(c) = 5c2 + 441c + 23. Calculate 6j(n) - 7w(n). 2n2 - 427n - 2 Let g(b) = -29b - 17. Let z(v) = -19v - 11. Give 5g(c) - 8z(c). 7c + 3 Let b(q) = 5q*2 - 4q. Suppose -2u + 5y = -3, 19 = 4u - y + 4y. Let r(t) = t*3 + 11t*2 - 9t. What is ur(h) - 9b(h)? 4h3 - h2 Let j(s) = 2s*3 - 4s*2 - 7s - 1. Let a(c) be the second derivative of -c5/20 + c4/6 + 2c3/3 + c2/2 + 50c + 1. Calculate 7a(h) + 4j(h). h*3 - 2h*2 + 3 Let r(z) = -7z*2 + 4z - 25. Let y(a) = -9a2 + 5a - 27. Calculate -5r(u) + 4y(u). -u*2 + 17 Let j(k) = -3k + 23. Let v be j(8). Suppose -3g - 24 = a, -4a = -9g + 4g - 57. Let z(c) = c + 1. Let n(t) = -3t2 - 9t - 9. Calculate gz(r) + vn(r). 3r2 Let h(g) = -5g2 + g. Let q(y) be the first derivative of y3/3 - 999. Give 2h(o) + 22q(o). 12o2 + 2o Let u(j) = -4j3 + 3j2. Let s(o) = -o2 + 7o + 4. Let l be s(6). Let c(g) = 7g*3 - 5g*2 - 20g + 43g - 23g. Calculate lu(h) + 6c(h). 2h3 Let k(v) = -v2 - v. Let q(u) = u3 - 3u*2 + 2u - 3. Give -2k(a) + q(a). a3 - a2 + 4a - 3 Let t(r) = -77r2 - 12r + 2. Let w(p) = 231p2 + 33p - 6. Determine 11t(b) + 4w(b). 77b2 - 2 Let z(c) = c - 1. Let d(m) = -9m - 2. Determine d(q) - 4z(q). -13q + 2 Let j(g) = -3g + 2. Let k(q) = -2q + 20. Let r be k(0). Let o(z) = -r + 19 - z - 4z + 6z. Determine 2j(l) + 4o(l). -2l Let m(x) = -34x*3 - 15x + 7. Let v(z) = 18z3 + 6z - 4. Let g(t) = 2m(t) + 5v(t). Let a(k) = k*3 - 1. Give 6a(p) - g(p). -16p3 Let g(k) = -k + 8. Let m(h) = h - 1. Let o(x) = 2g(x) - 4m(x). Let s(y) = -2y*2 + 60y + 261. Let v be s(-4). Let t(j) = 2j - 7. Give vt(f) - 4o(f). 2f - 3 Let u(s) = 29s3 - 5s - 5. Let t be ((-30)/(-12) - 3)/(2/(-20)). Let w(d) = -43d3 + 7d + 7. What is tw(m) + 7u(m)? -12m3 Let i(o) be the second derivative of 7o*3/6 - 7o*2/2 + 35o. Let q(c) = -6c + 6. Give -4i(w) - 5q(w). 2w - 2 Let g(c) = 17c3 + 7c*2 + 9c + 4. Let m(o) = 0o + 4o - 4o3 - 9o*3 + 2 + 21o*3 + 3o*2. Determine 4g(j) - 9m(j). -4j3 + j2 - 2 Let p(k) = -3k + 6. Let r(t) = 1. Suppose 5a + 5 = -0a. Let g be 7/(-14)(-1 - (8 + a)). Give gr(w) - p(w). 3w - 2 Let t(a) = -9a. Let o(z) = -110z. Give 3o(l) - 35t(l). -15l Let f(z) = -5z*2 + 22z - 6. Let u(b) = -2b2 - b - 1. What is -f(y) + 3u(y)? -y*2 - 25y + 3 Let v(z) = -4z2 + 23z - 7. Let d(g) = g*2 + 4g - 1. Let q(w) = -4d(w) + v(w). Let y(r) = -r2 + r - 1. What is -q(o) + 6y(o)? 2o2 - o - 3 Let v = -39 + 44. Let b(u) = -7u + 4. Let m(o) be the first derivative of -3o2/2 + 2o - 10. Give vm(c) - 2b(c). -c + 2 Let u(m) = -m*2 + 3m - 2. Let g be u(2). Let i be 2/5(-10 + g). Let w(c) = -c - 1. Let r(q) = -q2 + 3q + 2. Let z be (-15)/21 - 2/7. Give iw(y) + zr(y). y*2 + y + 2 Let l be ((-15)/18)/1 + (-57)/18. Let d(m) = 1. Let x(y) = -2y + 4. Let k(w) = 2d(w) + x(w). Let u(j) = 5j - 1 - 3j - 6. Determine lk(p) - 3u(p). 2p - 3 Let r(n) = -11n3 + 27n + 6. Let o(l) = l*3 - l - 1. Determine 6o(v) + r(v). -5v3 + 21v Let u(f) = -11f - 18. Let a(q) = 10q + 18. Calculate -3a(m) - 2u(m). -8m - 18 Let b(k) = 5k - 3. Let r(s) = -7s + 4. Let u(c) = 3b(c) + 2r(c). Let y(x) be the first derivative of -x - 1 + 1/2x*2. What is 6u(z) - 5y(z)? z - 1 Let i(d) = -109d*3 - 16d*2 + 8d + 8. Let u(p) = -36p3 - 6p*2 + 3p + 3. Determine 3i(o) - 8u(o). -39o3 Let y be 12 - (12 - 7)-2. Let s(q) = 2q + 1. Let v(t) be the third derivative of 7t*4/24 + 2t*3/3 + 2t*2. Calculate ys(j) - 6v(j). 2j - 2 Let o(f) = f - 3. Let r(n) = -3n - 86. Calculate -5o(d) - r(d). -2d + 101 Let z(u) = -6u*3 + 2u - 43. Let h(n) = 7n3 - 3n + 42. Give 2h(x) + 3z(x). -4x3 - 45 Let i(v) = 1 + 9 + v - 1 + 4. Let r be i(-9). Let y(k) = k3 + r - 58k - 1 + 55k - 3k*2. Let c(d) = -2d*3 + 5d*2 + 5d - 5. Calculate 3c(w) + 5y(w). -w3 Let o(z) be the first derivative of z2/2 - z + 2. Let h(v) = -7v + 7. Suppose -33 + 7 = -2q. Let g = -7 + q. What is go(c) + h(c)? -c + 1 Let c(m) = -3m - 14. Let x(y) = 8y + 29. Give -5c(w) - 2x(w). -w + 12 Suppose 5 = -5i, -50x - 4i - 1 = -49x. Let g(u) = -11u + 4. Let n(w) = -6w + 2. Calculate xg(f) - 5n(f). -3f + 2 Let x(k) = -2k - 19. Let m(a) = -17a*2 - 2a + 1. Let p be m(1). Let l be (9/p)/((-1)/(-12)). Let w(f) = -f - 10. Calculate lx(r) + 11w(r). r + 4 Let r(q) = 1521q - 261. Let j(m) = 152m - 25. Determine -21j(v) + 2r(v). -150v + 3 Let h(z) = -9z*3. Let g(u) = -25u*3 - 55u2 - 55. Let f(j) = -j3 - 2j2 - 2. Let l(k) = -55f(k) + 2g(k). Calculate -2h(v) - 5l(v). -7v*3 Let z(o) = 20o + 614. Let y(m) = -11m - 306. Give -11y(j) - 6z(j). j - 318 Let z(v) = v + 4. Let m(g) = 40g - 10. Give -m(t) - 2z(t). -42t + 2 Let j(k) = k*3 + 4k*2 - 15k. Let x(q) = 3q3 + 7q*2 - 30q. What is -5j(f) + 3x(f)? 4f3 + f2 - 15f Let c(r) be the second derivative of r5/4 + r4/6 - r*2/2 - r - 262. Let n(b) = -21b*3 - 8b*2 + 5. What is -9c(u) - 2n(u)? -3u*3 - 2u*2 - 1 Let z(l) be the second derivative of -13l5/10 + l4/2 + 11l3/6 + l - 5. Let u(n) = 5n3 - n2 - 2*n.	{ "pile_set_name": "DM Mathematics" }
False Is 2848 a multiple of 89? True Is 20262 a multiple of 33? True Is 20200 a multiple of 5? True Is 90 a factor of 990? True Is 15 a factor of 21115? False Does 9 divide 1233? True Is 4 a factor of 4? True Does 42 divide 75699? False Is 13 a factor of 1924? True Is 107 a factor of 5064? False Does 47 divide 14786? False Is 16 a factor of 992? True Does 5 divide 38506? False Is 7076 a multiple of 40? False Is 11 a factor of 440? True Is 2091 a multiple of 41? True Does 7 divide 581? True Is 1439 a multiple of 22? False Is 3474 a multiple of 16? False Is 31 a factor of 8716? False Is 1012 a multiple of 32? False Is 26 a multiple of 26? True Is 8 a factor of 2971? False Is 10248 a multiple of 13? False Is 3564 a multiple of 81? True Is 831 a multiple of 9? False Does 78 divide 44558? False Is 4 a factor of 668? True Does 14 divide 13788? False Is 771 a multiple of 40? False Does 147 divide 2789? False Is 96 a factor of 14976? True Does 16 divide 416? True Is 23 a factor of 1150? True Does 27 divide 56523? False Is 2006 a multiple of 34? True Does 4 divide 204? True Is 1100 a multiple of 22? True Is 6 a factor of 283? False Does 14 divide 50232? True Is 15 a factor of 154? False Is 17 a factor of 3621? True Is 37702 a multiple of 33? False Does 11 divide 241? False Is 193 a multiple of 12? False Is 125 a multiple of 23? False Does 55 divide 5882? False Is 16650 a multiple of 30? True Is 58 a factor of 3190? True Is 12210 a multiple of 10? True Is 312 a multiple of 15? False Is 1312 a multiple of 34? False Does 35 divide 6072? False Does 23 divide 21114? True Does 20 divide 50080? True Is 650 a multiple of 2? True Does 11 divide 24871? True Does 18 divide 26081? False Does 9 divide 13349? False Is 2 a factor of 699? False Is 30 a factor of 806? False Is 17 a factor of 153? True Is 3 a factor of 297? True Is 17852 a multiple of 29? False Is 9 a factor of 56254? False Is 872 a multiple of 36? False Does 23 divide 9673? False Does 16 divide 1184? True Does 380 divide 77900? True Does 56 divide 3080? True Is 271 a factor of 33789? False Is 2765 a multiple of 35? True Does 15 divide 3999? False Is 2499 a multiple of 25? False Does 133 divide 13710? False Is 25 a factor of 11325? True Is 51408 a multiple of 68? True Does 9 divide 117225? True Does 33 divide 297? True Is 739 a multiple of 23? False Is 60368 a multiple of 16? True Does 165 divide 40095? True Is 4176 a multiple of 9? True Is 8 a factor of 235? False Is 726 a multiple of 66? True Is 34 a factor of 1428? True Is 16 a factor of 160? True Does 33 divide 1023? True Does 209 divide 55735? False Does 6 divide 11598? True Is 61444 a multiple of 8? False Does 5 divide 568? False Is 7 a factor of 8610? True Does 8 divide 2560? True Does 43 divide 3479? False Is 1579 a multiple of 42? False Is 1426 a multiple of 45? False Is 7223 a multiple of 31? True Is 1550 a multiple of 62? True Is 9 a factor of 1134? True Is 3573 a multiple of 62? False Is 414 a multiple of 18? True Does 28 divide 727? False Does 11 divide 83? False Is 7536 a multiple of 48? True Is 33504 a multiple of 48? True Is 14 a factor of 277? False Does 21 divide 441? True Is 10472 a multiple of 22? True Does 102 divide 1866? False Is 5 a factor of 3940? True Is 36 a factor of 8551? False Does 5 divide 30? True Is 41175 a multiple of 183? True Is 8 a factor of 2160? True Does 130 divide 13458? False Is 58 a factor of 1450? True Does 17 divide 33099? True Is 65 a factor of 845? True Is 794 a multiple of 14? False Is 6 a factor of 103? False Does 16 divide 1760? True Does 10 divide 20350? True Is 10 a factor of 9364? False Does 13 divide 1521? True Is 159 a multiple of 15? False Is 10 a factor of 5284? False Does 21 divide 4263? True Does 10 divide 4719? False Does 13 divide 18434? True Does 22 divide 1298? True Is 8 a factor of 584? True Is 39078 a multiple of 6? True Does 24 divide 120? True Is 6 a factor of 60? True Is 13 a factor of 715? True Is 11 a factor of 12774? False Does 85 divide 5270? True Is 9612 a multiple of 36? True Is 13 a factor of 19091? False Is 104 a factor of 66133? False Is 64 a factor of 4560? False Is 12 a factor of 2071? False Is 46 a factor of 20654? True Does 27 divide 1728? True Is 4478 a multiple of 15? False Is 15215 a multiple of 85? True Is 14072 a multiple of 91? False Is 126 a multiple of 7? True Is 20568 a multiple of 12? True Does 30 divide 5364? False Does 21 divide 19437? False Does 20 divide 197? False Is 3467 even? False Is 1514 a multiple of 5? False Is 28837 a multiple of 164? False Is 9508 a multiple of 128? False Does 43 divide 387? True Is 348 a multiple of 6? True Is 1116 a multiple of 9? True Does 147 divide 3528? True Is 3 a factor of 485? False Does 224 divide 15680? True Is 137 a multiple of 11? False Is 59 a factor of 11470? False Does 12 divide 259? False Does 2 divide 1388? True Is 15252 a multiple of 41? True Is 4 a factor of 624? True Does 78 divide 2340? True Is 11 a factor of 878? False Does 22 divide 2926? True Is 2033 a multiple of 19? True Is 9 a factor of 181? False Is 83 a factor of 4565? True Does 11 divide 1445? False Is 1020 a multiple of 68? True Does 37 divide 17945? True Is 123 a multiple of 3? True Does 32 divide 64? True Is 2 a factor of 1511? False Does 3 divide 489? True Does 21 divide 19566? False Is 11426 a multiple of 29? True Is 11206 a multiple of 39? False Does 38 divide 5906? False Does 50 divide 2100? True Is 3941 a multiple of 7? True Is 25 a factor of 579? False Is 74 a factor of 222? True Is 5 a factor of 188? False Is 319 a multiple of 12? False Does 8 divide 913? False Is 26776 a multiple of 35? False Does 8 divide 2521? False Is 8 a factor of 30376? True Does 8 divide 136? True Does 80 divide 3440? True Is 8 a factor of 6114? False Is 761 a multiple of 7? False Is 210 a multiple of 15? True Is 74 a factor of 8658? True Is 44 a factor of 792? True Does 7 divide 20845? False Does 41 divide 54735? True Does 65 divide 86060? True Is 16133 a multiple of 22? False Is 984 a multiple of 24? True Does 28 divide 1444? False Is 31827 a multiple of 26? False Is 2169 a multiple of 42? False Does 54 divide 6858? True Does 17 divide 8653? True Is 11 a factor of 88? True Is 4132 a multiple of 78? False Does 53 divide 4611? True Does 7 divide 1036? True Does 9 divide 4781? False Is 67 a factor of 3423? False Is 6 a factor of 1146? True Is 15 a factor of 28115? False Is 30 a factor of 1118? False Is 5333 a multiple of 22? False Is 120 a multiple of 8? True Is 13 a factor of 8118? False Is 8687 a multiple of 24? False Does 16 divide 3089? False Is 4 a factor of 195? False Does 102 divide 1727? False Is 486 a multiple of 18? True Is 13 a factor of 494? True Is 1710 a multiple of 15? True Is 16 a factor of 31872? True Does 38 divide 52934? True Is 1890 a multiple of 42? True Does 63 divide 10017? True Is 24 a factor of 355? False Is 145 a factor of 32915? True Is 110750 a multiple of 25? True Does 13 divide 1560? True Is 1213 a multiple of 3? False Is 83 a multiple of 2? False Does 16 divide 8877? False Does 146 divide 21581? False Does 40 divide 2160? True Does 53 divide 66038? True Is 24 a factor of 236? False Is 71 a multiple of 5? False Does 146 divide 27740? True Is 9 a factor of 156? False Does 35 divide 350? True Is 45990 a multiple of 18? True Is 3160 a multiple of 10? True Does 9 divide 69? False Is 20962 a multiple of 38? False Does 196 divide 3528? True Does 239 divide 9581? False Is 4 a factor of 162? False Does 24 divide 31536? True Does 57 divide 55461? True Does 10 divide 2679? False Does 6 divide 93? False Is 4 a factor of 7660? True Does 15 divide 645? True Does 69 divide 4692? True Is 4 a factor of 135? False Is 46 a multiple of 2? True Does 77 divide 13167? True Is 133 a factor of 2897? False Is 2142 a multiple of 51? True Does 165 divide 15345? True Is 6 a factor of 9393? False Does 23 divide 2967? True Is 1529 a multiple of 11? True Does 10 divide 760? True Does 8 divide 44215? False Is 182198 a multiple of 25? False Is 20 a factor of 2766? False Is 9 a factor of 351? True Does 13 divide 36035? False Does 14 divide 30492? True Does 43 divide 2924? True Is 396 a multiple of 9? True Is 362 a multiple of 22? False Is 7 a factor of 3019? False Is 323	{ "pile_set_name": "DM Mathematics" }
What is the least common multiple of 165536 and 6? 496608 What is the common denominator of -101/48960 and -29/1260? 342720 What is the least common multiple of 30771 and 106515? 1384695 Calculate the smallest common multiple of 298 and 946. 140954 What is the lowest common multiple of 5118 and 36? 30708 What is the smallest common multiple of 140080 and 577830? 4622640 Calculate the common denominator of -11/52124 and -41/4. 52124 What is the least common multiple of 728 and 19656? 19656 What is the lowest common multiple of 3403630 and 64393? 23825410 Calculate the lowest common multiple of 2556 and 1827. 518868 Calculate the least common multiple of 47492 and 71238. 142476 What is the smallest common multiple of 20 and 16640? 16640 Find the common denominator of 27/107848 and -37/3172. 107848 Calculate the common denominator of -74/2439 and -61/91. 221949 Find the common denominator of -13/4760 and -73/8. 4760 Calculate the smallest common multiple of 17001 and 137897. 1241073 Calculate the common denominator of -173/6780 and 32/835. 1132260 Find the common denominator of 107/1030 and -10/1339. 13390 Find the common denominator of -95/156 and 73/27950. 167700 What is the lowest common multiple of 7535 and 375? 565125 What is the least common multiple of 7216 and 1804? 7216 Calculate the smallest common multiple of 113206 and 2140. 1132060 Find the common denominator of -13/1130 and 25/8. 4520 What is the common denominator of 23/20448 and 55/72? 20448 What is the common denominator of 73/4650 and 149/6510? 32550 Calculate the least common multiple of 15129 and 243. 408483 Calculate the least common multiple of 34075 and 13475. 18366425 What is the common denominator of -143/543384 and 85/4? 543384 Calculate the least common multiple of 2 and 1076094. 1076094 Calculate the smallest common multiple of 13451 and 4. 53804 Calculate the common denominator of -57/2380 and -33/970. 230860 Find the common denominator of 31/1056 and 83/2332. 55968 What is the common denominator of -91/170 and -103/75820? 75820 What is the common denominator of 87/31328 and -125/18? 281952 What is the smallest common multiple of 48 and 1155032? 6930192 Calculate the least common multiple of 16560 and 28. 115920 Find the common denominator of -5/432608 and -51/44. 432608 Find the common denominator of -127/48 and -91/294368. 883104 Calculate the lowest common multiple of 33 and 66165. 66165 Calculate the lowest common multiple of 22 and 5945990. 65405890 Calculate the lowest common multiple of 193800 and 516800. 1550400 What is the least common multiple of 8 and 48972? 97944 What is the least common multiple of 832 and 368? 19136 Calculate the lowest common multiple of 9872 and 1360. 839120 Find the common denominator of -47/4694 and 21/32. 75104 What is the common denominator of 49/19 and 31/417905? 417905 What is the lowest common multiple of 273880 and 4100? 1369400 Calculate the common denominator of -131/157320 and -131/162. 1415880 Calculate the common denominator of -25/3472 and 87/224. 6944 Calculate the smallest common multiple of 451440 and 34200. 2257200 What is the common denominator of 37/60 and 11/1471200? 1471200 What is the smallest common multiple of 136043 and 11? 1496473 Calculate the lowest common multiple of 569350 and 284675. 569350 Calculate the least common multiple of 93884 and 26824. 187768 Calculate the common denominator of 47/15 and -91/1181930. 3545790 What is the common denominator of 37/17110 and 7/390? 667290 Calculate the common denominator of -119/8370 and -7/80. 66960 Calculate the common denominator of -86/2865 and 113/10. 5730 What is the common denominator of 42/2365 and -77/20? 9460 Calculate the lowest common multiple of 589125 and 10. 1178250 What is the common denominator of -69/16 and 51/25345? 405520 What is the common denominator of 53/2114 and 45/4? 4228 What is the common denominator of 11/421275 and 77/30825? 1263825 Find the common denominator of 28/1065 and -38/105. 7455 What is the lowest common multiple of 4970 and 180? 89460 Find the common denominator of 139/6 and -1/2380554. 2380554 What is the smallest common multiple of 396 and 81? 3564 Calculate the least common multiple of 35740 and 35740. 35740 Calculate the least common multiple of 295011 and 196674. 590022 What is the smallest common multiple of 402 and 96? 6432 What is the common denominator of -63/4765 and -23/4712? 22452680 Calculate the least common multiple of 23440 and 3516. 70320 Find the common denominator of -64/3261 and -47/6522. 6522 Calculate the lowest common multiple of 42 and 8337. 16674 What is the smallest common multiple of 20790 and 1050? 103950 Calculate the smallest common multiple of 65 and 1755. 1755 What is the smallest common multiple of 107 and 532? 56924 Calculate the smallest common multiple of 433714 and 87915. 6505710 Find the common denominator of -125/1494 and 65/291. 144918 Calculate the least common multiple of 4015 and 28910. 23214730 What is the smallest common multiple of 121094 and 1146? 363282 Calculate the common denominator of -83/38522 and 85/8. 154088 What is the smallest common multiple of 54945 and 1440? 1758240 Calculate the lowest common multiple of 31460 and 10. 31460 What is the common denominator of -89/15246 and -169/19404? 213444 Calculate the common denominator of -64/1617 and 52/59367. 415569 What is the least common multiple of 1625 and 1492725? 7463625 Calculate the common denominator of -97/1134 and -107/27216. 27216 Calculate the smallest common multiple of 84600 and 282. 84600 What is the smallest common multiple of 4 and 800092? 800092 What is the common denominator of -67/101392 and -43/14? 709744 Calculate the common denominator of -29/2 and -12/70327. 140654 What is the common denominator of -7/18526 and -49/1062? 166734 What is the common denominator of 45/448 and -107/7154? 228928 What is the common denominator of 109/39032 and -119/18? 351288 What is the common denominator of -43/168726 and 15/854? 1181082 Calculate the common denominator of 59/51891 and 16/86485. 259455 What is the common denominator of 117/2338 and -99/140? 23380 Calculate the smallest common multiple of 912 and 81. 24624 Calculate the smallest common multiple of 19552 and 24. 58656 Calculate the lowest common multiple of 28 and 10560. 73920 What is the common denominator of -5/2 and -8/76143? 152286 What is the common denominator of -125/4866 and 61/30? 24330 What is the common denominator of 55/1008 and 19/154728? 309456 What is the lowest common multiple of 132 and 3108? 34188 Calculate the least common multiple of 4070 and 1529. 565730 Find the common denominator of -41/3680 and 107/96. 11040 Calculate the least common multiple of 249623 and 90772. 998492 What is the smallest common multiple of 783 and 290? 7830 Calculate the lowest common multiple of 224 and 1092. 8736 What is the smallest common multiple of 1348560 and 337140? 1348560 Calculate the common denominator of 33/5215 and -34/18625. 130375 What is the smallest common multiple of 582 and 1548? 150156 What is the least common multiple of 11 and 35859? 394449 Find the common denominator of -109/41124 and -49/41124. 41124 What is the common denominator of 109/36 and 77/540220? 4861980 Calculate the smallest common multiple of 426 and 63048. 63048 Calculate the common denominator of 23/20568 and 7/30. 102840 What is the common denominator of -37/1244 and 25/52? 16172 Calculate the common denominator of -121/3486 and -17/24983. 149898 Calculate the smallest common multiple of 17208 and 107550. 430200 Find the common denominator of 5/63 and 167/21210. 63630 Calculate the least common multiple of 228 and 2742. 104196 Calculate the smallest common multiple of 63 and 137076. 2878596 What is the common denominator of -63/1054 and 113/434? 7378 Calculate the least common multiple of 46308 and 4994. 509388 What is the lowest common multiple of 400 and 5750? 46000 Calculate the smallest common multiple of 8050 and 8050. 8050 What is the smallest common multiple of 7200 and 306? 122400 Calculate the lowest common multiple of 24 and 29571. 236568 What is the lowest common multiple of 19047 and 87072? 609504 Find the common denominator of -155/4968 and -131/2484. 4968	{ "pile_set_name": "DM Mathematics" }
g(y) = y - 5. Let u(s) = s - 4. Let f(w) = -3g(w) + 4u(w). What is f(c)? 4 Suppose 4y + 24 = 4t, 5t - 6 = 2t - 3y. Let k = 8 + -6. Let w(p) = kp + t - 3p - p. Determine w(5). -6 Let t(j) = -j2 + 5j - 1. Let r be 16/2(-5)/(-10). Give t(r). 3 Suppose -2q = -4q. Let s(n) = n2 + qn*2 - 1 + 0. Let x = -43 + 41. Calculate s(x). 3 Let q = -4 + 9. Suppose -3 = -4a - qw + 11, 14 = a - 4w. Let m(j) = j*2 - 5j - 4. Calculate m(a). 2 Let c(n) = -n*3 - 5n*2 - 2n - 3. Suppose -4k + 8 = -2k. Let j = -4 + k. Suppose j = -2v + 4v + 8. What is c(v)? -11 Let m(k) = -15k3 + 8k*2 + 2k - 17. Let c(g) = -7g3 + 4g*2 + g - 8. Let x(q) = 13c(q) - 6m(q). Suppose -11a = -10a - 4. Calculate x(a). 2 Let h = 19 - 19. Let j(s) = s3 - s + 8. Determine j(h). 8 Let x(d) = -d2 + d - 3 + 0 + 0d. Let l = -36 + 18. Let b = -18 - l. Give x(b). -3 Let s(b) = -b*2 + 5b + 4. Let u(o) = 5o + 6o*2 + 3 - 2o*2 + 1. Let q be u(-3). Suppose 0 = -0f - 5f + q. Give s(f). 4 Suppose -2z = 3z - 5c - 65, -2z + 26 = 2c. Let l(p) = zp - 10p - 4p. Determine l(-5). 5 Let s(k) be the second derivative of k6/720 + k5/20 + k4/6 - k. Let d(v) be the third derivative of s(v). Let o be 1 + -1 - 3 - 1. Give d(o). 2 Let r(t) = t3 - 3t*2 - 5t + 5. Let g be 15/20(18 - -2). Let y(o) = -o + 19. Let a be y(g). What is r(a)? 1 Let n(z) be the second derivative of -z3/3 - z2 + z. Let b(v) = v - 12. Let r be b(6). Let q = r + 8. Give n(q). -6 Suppose 0 = -4m + q + 12, -8 = -0m - m - q. Suppose -r + 5n + 1 = 4, 0 = -4r + mn - 12. Let k(j) = -4j - 11j*2 + 10j*2 - 1 + 0j. Calculate k(r). 2 Let v(n) = -n - 7. Let i be -1(0 - 2-2). Let s(o) = -o*3 - 3o*2 + 5o + 4. Let t be s(i). Calculate v(t). -7 Let z(v) = -v*3 - v + 4. Suppose -f = 5t + f - 33, t = -4f + 21. Suppose 2a = b + 4a, 4b = ta + 13. Let m be (0/(-1b))/(-1). Determine z(m). 4 Let b(t) = t*3 - 7t*2 + 4t. Suppose -434q - 24 = -438q. Give b(q). -12 Let m(j) be the third derivative of -j4/6 - j3/6 + 18j2. Determine m(-1). 3 Let a(l) = -l3 - 3l*2 + 5l - 2. Let d be (-3)/(6/(-1))-2. Let v = d + -3. What is a(v)? -6 Let l(f) = 2 - 3 - 1 - f + f2. What is l(0)? -2 Let i be (-8)/(-1) - (2 - 0). Let b = i + -4. Let u(h) = -3h*2 + 6h*2 - 11h + b - h*3 + 8h. Give u(2). 0 Let w(h) be the second derivative of h*4/12 - 5h*2/2 - 5h. Suppose 5g - 2u - 12 = 0, -2g + 1 = -5u + 13. Determine w(g). 11 Let c(m) be the first derivative of -m*3/3 + 5m*2/2 - 5m + 9. Determine c(6). -11 Let v(j) = -2j2 - 8j + 8. Let b(d) = d*2 + 8d - 8. Let x(t) = 3b(t) + 2v(t). Calculate x(8). -8 Let v(n) = n*3 - 5n*2 + 5n + 10. Let y(h) = -h*3 + 6h*2 - 5h - 10. Let j(t) = 2v(t) + 3y(t). Calculate j(7). 4 Let i = 31 + -22. Let q(t) = -11t3 + 10t*2 + 7t - 13. Let p(g) = -5g3 + 5g*2 + 3g - 6. Let u(n) = ip(n) - 4q(n). Determine u(5). -7 Let b(v) = 3 - v + 0v - v - 40v*2 + 39v*2. Determine b(2). -5 Let t(s) = s - 2. Let w = -31 - -43. Suppose a + 0j + 4 = j, 0 = 4a - 5j + 20. Suppose 4g + 32 - w = a. Determine t(g). -7 Suppose 0 = 3b + 3n + 12, 3b + 10 = 4n - 2. Let s(g) = -g3 - 3g*2 + 7g + 5. What is s(b)? -7 Let l(y) = -2y + 8. Let c(f) = -f2 - 8f - 7. Let z be c(-8). Let r(i) = -4i + 15. Let h(d) = zl(d) + 4r(d). Calculate h(5). -6 Let p(x) = x2 + 7x + 7. Suppose -l = -2i - 16, 5i + 4 = l - 3l. Let o be l1/(-1) + 2. Let d = o - -1. What is p(d)? -3 Let h(n) = -n*2 - 5n + 5. Let v(f) = 53f2 - 1. Let g be v(1). Let t be g/10 + (-4)/20. Suppose -tm - 33 = -3s, 5m = -4s + 4 - 30. Determine h(m). -1 Let r(h) = 0h + 2h - h - 7. Determine r(8). 1 Let s(j) be the first derivative of -2 - 1/2j*2 + 2j. Calculate s(0). 2 Let z(y) be the first derivative of y*2/2 + 2y - 4. Determine z(-2). 0 Let x(z) = z - 4. Let i be x(3). Let v(j) = -8j2 - 5j + 3. Let k(w) = 23w2 + 14w - 8. Let d(c) = 4k(c) + 11v(c). What is d(i)? 4 Let j = -19 - -3. Let w = j - -9. Let h(q) = -7q2 + q - 3. Let b(l) = 8l*2 - 2l + 3. Let n(r) = wh(r) - 6b(r). Determine n(-5). 3 Let d be (-1 + -7)(-3)/(-4). Let j = 47 + -57. Let g be d/j - 14/(-10). Let h(f) = 3f - 2. Give h(g). 4 Let q(h) = 4h2 - 2. Let k be q(-2). Let p be 4/k - 156/(-42). Suppose 3f - 6f + r = 2, -pr - 5 = f. Let v(j) = j. Calculate v(f). -1 Let p(a) be the first derivative of -1/3a3 - 4 + a + a2. Determine p(2). 1 Let k(b) = b2 - b + 2. Let h be k(2). Suppose ho = 3y + 2o + 14, -2y + 5o - 13 = 0. Let c(m) = m*2 - 2m + 2m - 5 + 3m. What is c(y)? -1 Let f(u) = -u + 7. Let j be f(4). Let z(d) = -2 + 0 - 2d + j - 2d*2. Calculate z(-3). -11 Suppose -2d = 3d - 25. Let s(l) = -d - l + 0l + l - l. What is s(-5)? 0 Let u = 5 - 3. Let t be u(6/(-4))/3. Let g(v) = -5v + 1. What is g(t)? 6 Let p(r) = -2r + 0r + 0r - 3. What is p(-4)? 5 Let i = 65 + -70. Let c(g) = -3g + 4. Determine c(i). 19 Let g(x) = 2x + 4. Let q(k) be the third derivative of k4/12 + 5k*3/6 + 2k*2. Let p = -2 - -6. Let j(b) = pg(b) - 3q(b). Determine j(4). 9 Let b(l) = l2 + 5l - 6. Let w be 2 - (-16)/(-6)(4 + -1). Calculate b(w). 0 Suppose -3t = -0t - 18. Let v(k) = -12 - 4k + tk2 - 3k - 6k + 3k3. Let o(w) = w3 + 2w2 - 4w - 4. Let i(l) = -7o(l) + 2v(l). What is i(-3)? 7 Let g(z) = z*2 - 4z + 3z + 1 - 2. Let y be -4(3 - 22/8). Give g(y). 1 Let l(w) = w*2 - 10w - 15. Let c be l(12). Let f(x) = -3x + 4x + 2 + c. What is f(0)? 11 Suppose r = 5m - 24, -5m = r - 5r - 21. Let d(w) = -3w + 1. What is d(r)? -2 Let p be 10/(-1)(-2)/5. Let a(u) = -3u3 - u2 - 2u + 5. Let s(w) = w2 - 3w*2 + 1 + 19w - w*3 + 3w*2 - 20w. Let g(x) = a(x) - 4s(x). Give g(p). -7 Suppose 0 = -4g + 4 + 4. Let d(v) = v - 4v + 9 - vg - 3. What is d(-5)? -4 Let u(a) be the second derivative of -a4/12 + 11a*2/2 - 18a. Let w be (-8 - -11) + (-1 - 2). Determine u(w). 11 Let m(z) be the first derivative of z*2/2 + 4z - 8. What is m(-4)? 0 Let r(h) be the third derivative of h9/60480 - h8/4032 + h7/2520 + h6/144 + h*5/15 - 3h*2. Let n(l) be the third derivative of r(l). What is n(4)? -3 Let b(u) = -u - 4. Let z be (-9)/(-18) - (-15)/2. Suppose -2n + z = -0n. Give b(n). -8 Let f(q) be the second derivative of q5/20 - q4/6 + q3/3 + 6q. What is f(2)? 4 Let s(u) = -u*3 - 2u*2 + 16u + 8. Let g be s(-5). Let r(b) = -5b + 3. What is r(g)? -12 Suppose -3o + 2o - 15 = -5a, 3a = o + 11. Let f(p) = p2. Calculate f(a). 4 Let p(y) be the second derivative of -y3/6 - y2/2 + 7y. Let c(q) = -q*2 - 8q - 3. Let i(n) = c(n) - 2p(n). What is i(-7)? -8 Suppose 6y = 3y + 9. Suppose -ym + 2 = -2m. Let t(u) = 2um - u2 + 5 + 5u + 0u*2. Calculate t(-5). 5 Suppose -10 = -2c - 4a, -2c + 2a = -4c. Let i(g) = -g*3 - 6g*2 - 5g - 2. Calculate i(c). -2 Let d(x) = 5x - 5. Let s(m) = 17m - 14. Let f(j) = 11d(j) - 4s(j). Give f(1). -12 Let j(o) = -o*3 - 2o*2 + 6o + 3. Let g(c) = 3c + 1. Let r be g(-9). Let x = 17 + r. Let p = x + 5. What is j(p)? 11 Let i(p) = 29p*2 - 14p - 6. Let x(z) = z + 1. Let m(w) = i(w) + 6x(w). Let v(u) = -10u*2 + 3u. Let c(k) = -4m(k) - 11v(k). Calculate c(-1). -5 Let q(y) be the second derivative of -y6/120 - y5/60 - 5y3/3 - 2y*2 + 3y. Let c(j) be the first derivative of q(j). Determine c(0). -10 Let o(z) = -z*2 - 14z - 13. Let r be o(-13). Let b(q) = q*3 - 12. Calculate b(r). -12 Let m(c) = 7c*3 - 2c*2 - 10. Let x(g) = -4g3 + g2 + 5. Let s(a) = -3m(a) - 5x(a). Let t = 12 + -8. Suppose -p = -tp. Give s(p). 5 Let y(m) = -10m*2 - m + 1. Let n = -31 + 32. Give y(n). -10 Let u(a) = 7a + 1. Let l(f) = 15f + 3. Let q be 34/6 + (-2)/(-6). Let o(j) = ql(j) - 13u(j). What is o(5)? 0 Let m(i) be the third derivative of i7/2520 + i5/120 - i4/12 - 2i2. Let t(q) be the second derivative of m(q). Give t(2). 5 Let w be (234/(-45))/((-1)/5). Let i be (-2)/(-13) + (-82)/w. Let b(c) = c3 + 2c2 - c. Give b(i). -6 Let r be 0(-2)/((-4)/1). Let j(k) = k + rk - 5 + 0k + 1. Determine j(-5). -9 Let n(g) = g - 6. Let y(p) = -p*3 + 5p*2 - 5p + 2. Let q be y(3). Determine n(q). -1 Let a(s) = s*2 + 9s + 16. Let c be	{ "pile_set_name": "DM Mathematics" }
- 8k = -18. Suppose -5n + 0 = -2p - 491, -kn + 294 = -p. What is the tens digit of n? 9 Let k(v) = 8v2 + 0v3 - v - v3 - 5v2. Let r be k(2). Suppose -rx = -6x + 44. What is the units digit of x? 1 Suppose -11u + 8u + 5y + 5519 = 0, 2u - 3701 = -y. What is the thousands digit of u? 1 Suppose 5j = -5j + 940. Suppose 5y - 616 = j. What is the units digit of y? 2 Let h = 180 + -87. Let d = 28 + h. Suppose 11 - d = -5o. What is the units digit of o? 2 Let c = 669 + -616. What is the units digit of c? 3 Suppose 3v = -4n + 1015, 4n + v + 3v - 1016 = 0. What is the hundreds digit of n? 2 What is the thousands digit of 103650/36 - 4/2169? 2 Suppose 12u - 36 = 9u. Let m = 14 + -9. Suppose 2c = -c - mh + 16, 0 = 2c + 2h - u. What is the units digit of c? 7 Let n(t) = 6t2 - 9 - 8t*2 + t + 3t*2. Let q be n(-4). What is the units digit of (1220/(-30))/((-2)/q)? 1 Suppose -u - 9 = -3. Suppose 0 = -m + 4b + 13, -5m + 0b + 65 = -4b. Let n = u + m. What is the units digit of n? 7 What is the units digit of 9/(-6)13296/(-18)? 8 Let b = -1316 + 1635. What is the units digit of b? 9 Let o(h) = -h*3 - 21h*2 - 21h - 19. What is the units digit of o(-20)? 1 Let m(u) = -u*2 - 21u - 18. Let f be m(-20). Suppose 6v = fv + 184. What is the tens digit of v? 4 What is the tens digit of ((-1)/(-3))/((-11)/(-33)) - -350? 5 Suppose 7g + 2r - 96 = 3g, 0 = 3g + 3r - 72. What is the tens digit of g? 2 Suppose -17966 + 2327 = -3c. What is the thousands digit of c? 5 Let u(l) = l*2 + 29. Let j be u(0). Let a = 26 - j. What is the tens digit of a - (-16 - (-5 + 3))? 1 Suppose 2v = -5t + 100, 0t - t = -v - 27. Let x be 19/5 - 11/(-55). Suppose -4f + xu + 88 = 0, -f + 0u + t = -4u. What is the units digit of f? 2 Let z be 30/165 + (-796)/22. What is the units digit of (-9)/(z/8) - -58? 0 Suppose 0 = 5h - 3g + 6g + 107, 4h + 91 = 3g. Let s = -10 - h. What is the tens digit of s? 1 Suppose -10n - 468 = -4n. Let q = 138 + n. What is the tens digit of q? 6 Let j be 20/30 - (-4)/(-6). Suppose j = y - 19 + 11. What is the units digit of y? 8 Let i(d) = -d3 - 8d*2 + 7. Let s be i(-8). Let o(v) = 11 + 22v - sv + 4 - 4v*3 + 3v*3 + 13v2. What is the tens digit of o(14)? 2 Let l(s) = -s3 + 6s2 + 9s + 13. Let j be l(-6). Suppose -3r - 151 = -j. What is the tens digit of r? 8 Suppose -2t + 8 = 0, -2f - 5t = -2034 - 836. What is the thousands digit of f? 1 Suppose 6u - 9u - 84 = 0. Let n = u + 93. What is the units digit of n? 5 Suppose -195 = -6v + v. Suppose -v + 17 = p. What is the units digit of 4/p - 57/(-11)? 5 Let r = 74 - -25. What is the units digit of r? 9 Suppose -4r - 4 = -8. Let w = r + -1. Suppose 4 = -4d + 5o + 39, 5d + 4o - 13 = w. What is the units digit of d? 5 Suppose -4u + 3w + 1250 = -96, 5u + 3w = 1669. Let s be (-15)/(-2)(-4)/(-5). Suppose -u = -sn - 53. What is the tens digit of n? 4 Suppose -2b - 21 = -5l, l = -2b - b + 11. Let o(a) = 44a - 7. What is the tens digit of o(b)? 8 Let s(f) = f*2 + 5f + 20. Let d = 41 + -52. What is the tens digit of s(d)? 8 Suppose -8i = -13i - 1460. Let o = -45 - i. What is the hundreds digit of o? 2 Let q(b) = -b*2 - 6b - 1. Let g be q(-7). Let f(r) = -9r + 1 + 5 + 14r - 8r. What is the units digit of f(g)? 0 Suppose -4i - 15 = -7i. Suppose -iv = -0v. Suppose 5u + 2f - 94 = 82, v = 3f + 6. What is the tens digit of u? 3 Suppose -3u = -6u + 930. Suppose -4y = y - u. What is the tens digit of y? 6 Let y(a) = a - 9a + 7 + 7a. Let v be y(6). Suppose c = -o + 14, c - 3 = 4o + v. What is the tens digit of c? 1 Let x = -11 + 4. Let r(b) = b + 5. Let j be r(x). What is the units digit of 35 + (j - (3 + -5))? 5 Suppose -64v + 141409 + 165023 = 0. What is the units digit of v? 8 Let x be (-1 + 2)/(3/(-6)). Let i be (-4 - -6)/((-1)/x). Suppose ir - 6r + 4 = 0. What is the units digit of r? 2 Let q(a) = -2a*2 + 16a - 119. Let j be q(6). Let p = -98 - -233. Let o = j + p. What is the tens digit of o? 4 Let x(v) = -v*3 - 4v - 2. Let y be ((-1)/(-2))/((-1)/(-6)). Let q be (-2 + 3)(-9)/y. What is the units digit of x(q)? 7 What is the hundreds digit of -3 + -1 + -2 + 558? 5 Let k(x) = -3x + 20. Suppose 0 = b + b - 4, b - 7 = h. What is the units digit of k(h)? 5 Let n(j) = -23j3 - j2 + 1. Let h be n(-1). Suppose -9r - h = -689. What is the units digit of r? 4 Let g = 807 + -554. What is the units digit of g? 3 Let x be (4/(-2))/((-4)/(-14)). What is the units digit of (-1660)/(-28) - (6/x)/(-3)? 9 Let z = -1031 - -569. Let q = -311 - z. What is the units digit of q? 1 Let f(d) = 2d3 - 2d*2 + 6d - 2. What is the hundreds digit of f(7)? 6 Suppose -71r + 106348 + 35652 = 0. What is the units digit of r? 0 Let s = 9 - -228. What is the tens digit of s? 3 Let l = -6 - -10. Suppose y = 4b - l, 5y + 2 = 2b + 4y. What is the tens digit of (0 - b)/((-2)/20)? 1 What is the thousands digit of 1 - 10622/(-9) - 44/198? 1 Let h be (5/(-6))/((-3)/18). Suppose v + 65 = 2b, 0b - hv - 145 = -4b. What is the units digit of b? 0 Suppose 0l + l = 0. Let s(j) = -j*2 - 4j + 163. Let z be s(-15). What is the units digit of (-17)/z(2 - l)? 7 Suppose 0 = -3j + 2u + 1266, -u + 1699 = 14j - 10j. What is the units digit of j? 4 Let y(f) = 5f*3 - 15f*2 + 3. Let h be y(3). Suppose 0 = -2g - g + 222. Let p = g + h. What is the units digit of p? 7 Let p(l) = -9 - 7l2 + 6l*2 + 13 + 3l + 17l2. Let i be p(-2). Let b = i + -30. What is the tens digit of b? 3 Suppose 4h = 4u - 16, -4u + 7 = 4h - 9. What is the hundreds digit of 6/u2420/33? 1 Suppose -4x - x - 5u + 800 = 0, -5x = -5u - 820. Suppose 2v - x = -l + 4l, -l + 439 = 5v. What is the tens digit of v? 8 Let x(q) = 2q + 16. Let a be (-4 - -4)/(-2 + 1). What is the tens digit of x(a)? 1 Let a be (-2)/2 - 8/(-2). Let c(v) = -5v + 7v*2 + 6v*a + 1 - 4v*3 - 3v*3. What is the units digit of c(6)? 7 Suppose 1172 = 4l - n, -l + 0n + 2n + 286 = 0. Let t = l + -175. What is the units digit of t? 9 Let p = -179 + 254. What is the tens digit of p? 7 Let n(r) = r*2 - 5r + 4. Let c be n(5). Suppose 0 = -j + 3j + cg + 4, -4 = j + 4g. Suppose j = -5q - 74 + 189. What is the tens digit of q? 2 Suppose -3 - 3 = -b. Let l(x) = x - 2x - b - 3x. What is the tens digit of l(-5)? 1 Let k(n) = 8n + 2. Let m(q) = 7q + 2. Let a(u) = 5k(u) - 6m(u). Let c be a(-1). Suppose 5w - 471 = -3i - 51, c = 5i - 25. What is the units digit of w? 1 Let m be (2 + -3 - -151) + -3. Suppose d - z = -4z + m, -5d + 4z + 716 = 0. What is the hundreds digit of d? 1 Let c(o) = 8o2 - 19o + 5. What is the units digit of c(-8)? 9 Let a(f) = 3f2 + 15f + 16. Let k be a(-5). What is the units digit of (-16)/10(-800)/k? 0 What is the hundreds digit of -6 + (1456 + 0)/7? 2 Suppose -7408 = -13i + 9388. What is the tens digit of i? 9 Suppose -2w + w = -5f + 135, 3f - 2w = 74. Let c be (-1)/(2 - 58/f). Suppose 0 = -2y + c + 26. What is the units digit of y? 0 Let t = 8 - 4. Suppose -12 = -2i - th, -3i = 2i + h - 30. Let z = 11 - i. What is the units digit of z? 5 Suppose 2m - 286 = -5u + 577, 0 = -5u - m + 859. Suppose -5k = -n + u, -3n - 23 = -k - 592. What is the units digit of n? 1 Suppose -28o - 2o = -60. Suppose 16 = -0i + 4i. Suppose -oa - 96 = -4a + 2h, ih = a - 45. What is the units digit of a? 9 Let v(a) = 3a + 64. What is the tens digit of v(-5)? 4 Let a(t) = 42t*2 + 8t - 64. What is the units digit of a(8)? 8 Suppose -3d = -5d - 4. Let j(o) = 4o3 - 2o*2 + 1 - 2o*3 - 5o*3 - 3o*3. What is the tens digit of j(d)? 4 Let x = -1525 + 2554. What is the thousands digit of x? 1 Let g be 2 + (-20)/828. Let u = g - -128. What is the units digit of ((-6)/5)/((-9)/u)? 8 Suppose -377 - 323 = 3x + 5q, 4x + 885 = 3q. Let z = -85 - x. What is the tens digit of z? 4 Suppose -d + 4 = -5d. Let n be d/4-1520. Suppose n = 2p + p. What is the units digit of p? 5 Let b(h) = h*3 - 6h*2 - 4h + 3. Let i(t) = 3t2 - 2t - 2. Let o be i(2). Let k be b(o). Let s = 42 + k. What is the units digit of s? 1 Let u(s) = 13s2 + 7s - 11. What is the hundreds digit of u(-7)? 5 Suppose 4*z = -198 + 62. Let p = -16 - z. Wh	{ "pile_set_name": "DM Mathematics" }
t r = 14 - 14. What is the nearest to r in -2/5, k, u? -2/5 Let n = -58556516/441 + 132781. Let y = 1/147 - n. What is the nearest to y in 1/7, 0, -2/9? 1/7 Suppose 0 = 14x - 11x - 81. Let g = -16 + x. Let v = -10 + g. What is the closest to -1 in 2, -2, v? -2 Let s = -0.0332 + -3.9668. What is the closest to -1/3 in -17, s, 1? 1 Let o be 2(-2)/(-4)-1. Suppose 320w + 33 = 287w. Which is the nearest to w? (a) 1 (b) o (c) -2 b Let c = -94/15 - -18/5. Let k = 4.1 - 4. What is the closest to k in -0.5, -2/13, c? -2/13 Let d = -0.3 - 0.1. Let q = 0.3 + d. Suppose 0 = 5o - 40, 18o = k + 13o + 35. Which is the closest to q? (a) -4 (b) k (c) 4 a Let f = -202.7 + 204. What is the closest to 6 in 1/7, -5, f? f Let i = -112 + 114. Which is the nearest to i? (a) -2/9 (b) 2 (c) 1/6 b Suppose -21v + 15 = -6. What is the closest to v in 2, 2/3, 2/9? 2/3 Suppose 26l - 22l = 2i + 14, -2l + 1 = i. What is the nearest to i in -2/3, 4, -4, 0.2? -4 Suppose 2g - 2 - 2 = 0. Let w(q) = -11q - 16. Let z be w(-8). Let x be 1 - 4 - (6/z + -3). Which is the nearest to 2/7? (a) g (b) -3 (c) x c Let n = 19 - 21. Let j = 156 + -1402/9. What is the nearest to n in j, 3/5, 1/14? 1/14 Suppose 216n - 214n = -5q + 6, -n + 2q - 6 = 0. What is the closest to n in 4, 0.4, 0.09, -0.4? -0.4 Let c be (-8 - 0) + 108/14. What is the nearest to c in 1, 4, 2/9, 8? 2/9 Let o = -1.2 - -1.4. Let l = 287/3 - 96. Which is the nearest to -1? (a) l (b) o (c) -2 a Let r = -833 + 835. Let z be (-8)/4 + (-8)/(-6). Which is the closest to 1/2? (a) 3 (b) r (c) z c Let g be (0 - -1) + (-3)/4. Let b be (-16)/24 - 92/6. Let a = -15 - b. What is the nearest to g in 3, a, 0.2? 0.2 Let b(q) = 4q2 + q + 2. Let o be b(-1). Let d be 4/10 + 56/(-190). Let k = 2/33 - -29/66. What is the nearest to k in d, 1/3, o? 1/3 Let n = 0.13 - -0.49. Let p = n - 0.63. What is the nearest to -1 in 2, 1/6, p? p Let f be ((-9)/27)/((-5)/(-5)). What is the closest to -0.1 in -2, f, 7? f Let m = 414 - 410. Let j = 0.17 + -0.57. What is the nearest to m in 1/7, j, -4? 1/7 Let l = 12.2 + -13.19. Let g = 1.99 + l. Which is the nearest to g? (a) -4 (b) -0.5 (c) 4/9 c Suppose -144i + 168i = 0. Let y(f) = -f3 + 6f*2 + 7f - 1. Let j be y(7). Which is the nearest to j? (a) -1/6 (b) i (c) -4 a Let i = 103/3 - 34. What is the closest to i in -1.2, -2/13, -0.5? -2/13 Let g = 0.06 + -0.06. Let b(i) = 22i - 265. Let v be b(12). What is the nearest to g in v, 2/5, 2? 2/5 Let v = -17.5 - -3.5. Let r = v + 18. Let l = r - 4.01. Which is the closest to 2/3? (a) l (b) 2/5 (c) -1/4 b Let d = 1213.3 + -1213. Let q = -1 + 2. What is the closest to q in 6, d, 2? d Let a = 3.2 + -0.2. Let l = 28 + 9. Let d = 39 - l. What is the closest to 0 in -4, a, d? d Let s = 323.7 - 324. Which is the closest to -1/18? (a) 2 (b) 0.2 (c) -0.1 (d) s c Let h = -109/150 - -3/50. Let r = -0.82 + 0.32. What is the closest to h in r, -5, 2/3? r Suppose 8i + 16 = 4i, -3b = 3i - 57. What is the nearest to 0 in b, -2, -0.1, -1? -0.1 Let f = 0.15 - 7.15. Let s = f + 6.93. Let j = 0.13 - s. Which is the closest to j? (a) -0.4 (b) -1/3 (c) -1 b Suppose -12p = -9p + 27. Let w be (-2 - (-12)/p)/((-4)/6). Which is the closest to -2.4? (a) -2/25 (b) w (c) 0.4 a Let l be ((-84)/39 - -2)/(-1). Let t = l + -43/26. Let n be (2/16)/(2/(-4)). Which is the closest to 1? (a) t (b) 3/5 (c) n b Let i = 12.949 - -0.051. What is the closest to i in -0.5, 0, 0.2? 0.2 Let y = 4.3 - 4. Let j = -1.3 + y. Let f = -0.9 - j. What is the nearest to 2 in f, -1/2, -1? f Let f = -1023 + 1019. What is the nearest to 1/52 in 4, -2/5, f? -2/5 Suppose 226l - 45 = 217l. Let m = -0.5 - -0.3. Let h = m - 0. Which is the nearest to -2? (a) l (b) -5 (c) h c Let p be 2/6 - 59/177. Let q = 0.58 - 0.08. What is the closest to 0 in q, -2, p? p Let z(i) = -i3 - 4i*2 - i + 2. Let f be z(-2). Let x be (-32/15)/(f - -6). Which is the nearest to -2? (a) -0.4 (b) -0.5 (c) x b Let y = -2325.98 - -2326. Which is the nearest to -2/3? (a) y (b) -0.1 (c) -4 (d) 2/35 b Let o be (-40)/12 - -1(4 + -1). What is the closest to o in 2/13, 1/8, 0.09? 0.09 Suppose 0 = -3h - 2v - 5, 4h - 209 = v - 223. Which is the nearest to 0? (a) 21/4 (b) 0.4 (c) h b Let m = -212 + 213. What is the closest to m in -3, 1/5, -4, -2/5? 1/5 Let r = -338 - -338. What is the closest to 1 in -0.4, 3/4, -0.09, r? 3/4 Let n = 49 - 49. What is the nearest to -1/3 in -8, -4, n? n Let p = -182.1 + 182. Which is the closest to -1? (a) -2/3 (b) -5 (c) -7 (d) p a Suppose 4j = -g + 8, 21 + 2 = 5j - 2g. Let h = -0.11 - -0.186. Let y = h - -1.924. Which is the nearest to -4? (a) y (b) j (c) -0.3 c Let o = -63 + 63. Suppose 4 = -6w - 2. Which is the nearest to w? (a) -8 (b) o (c) -1/2 c Suppose 20g - 4v - 23 = 17g, 4g = -4v - 44. Let o(n) = n2 + 3n + 2. Let k be o(-2). Which is the nearest to 1? (a) k (b) g (c) 0.1 c Let o = 197 - 49. Let k = -1040/7 + o. What is the closest to -9/7 in -5, k, 0.2? k Let g = 0 - -3. Let u be (-300)/12511/g. What is the nearest to 0 in -1/4, 2, u? -1/4 Let h = 0.1 - 0. Suppose -10 = -7y + 5y. Let f = -28 + 31. What is the closest to f in h, -3, y? y Let x = 0.0911 + -0.1911. Which is the closest to 2/7? (a) 8 (b) x (c) -1 b Let j = 825 - 824.9. Let s = -2 - 3. Let k = 2/73 + 357/292. Which is the nearest to 0? (a) s (b) j (c) k b Let h be (-20)/25(-20)/8. What is the nearest to -0.3 in -1, h, 1? -1 Let x(i) = i3 + 7i*2 + 3i - 4. Let w be x(-6). Let f be (-4)/w - (-86)/56. Which is the nearest to 0? (a) f (b) 0.12 (c) 3/4 b Let s = 3 - 11. Let f be 2/s(-48)/54. Let v = -28/45 + f. Which is the closest to v? (a) -1/3 (b) 0.3 (c) -0.2 a Let q = -1 + 5/2. What is the nearest to q in -5, 2/5, 3? 2/5 Let s = 14/11 - 104/99. Let i be (3 + -1)((-790)/(-80) - 10). What is the nearest to i in 9, s, 0.4? s Let y = 374.7 - 374. Let n = 5.11 + -0.11. What is the closest to y in -3, n, 6/5? 6/5 Let f = -51 - -31. Let r be (-5)/216/f. Let z = 4 - 4.4. Which is the closest to r? (a) 1/4 (b) z (c) -1/2 a Let d = -0.36 - -1.31. Let k = 1 - d. Let s = 221/4 + -55. Which is the nearest to k? (a) 4 (b) s (c) 1 b Let w be 4760/(-156) + (-5 - -3). Let s = 98/3 + w. Let h = 2 + -6. Which is the nearest to 1? (a) 0 (b) h (c) s c Let g = 1379 - 1262.6. Let k = g + -116. Which is the closest to -0.3? (a) k (b) 0.3 (c) 0 c Let z = -95/3 + 33. Let t be (-6 - -16) + 4/(-2). Let u be t/160 - (-3)/15. What is the nearest to 4/5 in z, 2/9, u? z Let k = -2 + 1. Let h = 0.309 - 0.409. What is the nearest to k in 4, h, 3/5? h Let i = -157 - -155. Which is the nearest to -2/9? (a) -0.2 (b) 0 (c) i a Let k = -0.0697 - 0.0303. Let v(i) = i - 5. Let n be v(7). Let p be 2/7 + (-22)/28. What is the closest to p in n, k, -2/7? -2/7 Let a be 54/182 - 13/91. Let u = 73 + -149/2. What is the nearest to 0.1 in a, -3, u? a Let p = -0.922 - -0.872. What is the nearest to 0 in p, 5, 2/5? p Suppose 219 = 41a - 150. What is the closest to a in -0.3, -3/5, -0.4? -0.3 Let f = -1585 - -1581. What is the nearest to f in 0.5, 2, 3, -2? -2 Let z(x) = 10 + 0 + 6 + x - 7. Let i be z(-12). Which is the nearest to -1? (a) -0.3 (b) i (c) 0.4 a Let t(h) = -h*3 + 12h*2 - 10h - 15. Let m be (-24)/(-2) - ((-1)/1 + 2). Let b be t(m). What is the closest to -1 in 3, b, 1/2? 1/2 Let l = -111 + 2107/19. Let h = -69.1 + 67.1. What is the nearest to h in l, -2/13, 4/3? -2/13 Suppose -72 = g + 3s, -3g = 4s - 0s + 196. Let m be g/48(6/(-10))/3. Which is the closest to m? (a) -3 (b) 2/7 (c) 2/13 b Let r = -37 - -37. What is the closest to r in 2, 14, -1/5? -1/5 Let f = -3 - -6. Let a = -0.05 - -0.05. Let i be 14/61/7. What is the nearest to a in f, i, -2/13? -2/13 Let s = -35 - 15. Let i be 19/76 + s/72. Which is the closest to -1/4? (a) i (b) 0 (c) -2/17 c Let d = -1879 + 1882. What is the nearest to -0.03 in 11, d, 0.1? 0.1 Let t = -122.2 + 122. Which is the nearest to 2? (a) t (b) -3 (c) 6/5 c Let r be (2/5)/(4/(-442)). Let z = -1009/20 - r. Let t = z + 179/28. Which is the nearest to -0.1? (a) 5 (b) -3/7 (c) t c Let t = 4 + -1.8. Let m = t + -2.2. What is the nearest to 1 in -6, -2/3, m? m Let a = 8 - -2. Let p b	{ "pile_set_name": "DM Mathematics" }
actor of 868 and 1343912. 124 What is the highest common divisor of 90 and 125453106? 18 Calculate the greatest common factor of 271891 and 113393. 97 Calculate the highest common divisor of 10205540 and 1420. 1420 What is the greatest common divisor of 107981071 and 1507? 1507 Calculate the highest common factor of 42539 and 2524669. 413 What is the greatest common factor of 22831815 and 59424? 1857 What is the highest common factor of 1539 and 23664717? 81 What is the greatest common factor of 12666890 and 10? 10 What is the highest common divisor of 126 and 4264288? 14 Calculate the greatest common divisor of 38461544 and 121. 121 What is the greatest common divisor of 248 and 504578? 2 What is the greatest common divisor of 549 and 450542523? 183 What is the greatest common factor of 34216266 and 61544? 2198 What is the greatest common divisor of 470 and 1189852? 94 Calculate the highest common divisor of 294126977 and 1829. 1829 What is the greatest common divisor of 256 and 9592928? 32 Calculate the highest common divisor of 2318 and 206707650. 2318 Calculate the highest common factor of 30578392 and 312. 104 Calculate the highest common factor of 1445584 and 32368. 112 Calculate the greatest common factor of 295906 and 144742. 494 Calculate the greatest common divisor of 3460 and 8964514. 346 What is the greatest common divisor of 3119484 and 67116? 564 Calculate the greatest common factor of 163759 and 712253. 1973 Calculate the greatest common divisor of 4110315 and 8265. 435 What is the highest common factor of 3339 and 46683? 63 Calculate the greatest common factor of 25200 and 89314848. 1008 Calculate the greatest common factor of 56 and 122397716. 28 What is the greatest common factor of 2843140 and 940? 20 Calculate the highest common divisor of 33085602 and 330. 66 Calculate the greatest common factor of 132064 and 590161. 4127 What is the highest common factor of 61 and 913667? 1 What is the highest common divisor of 3568327 and 441? 49 Calculate the highest common factor of 600 and 70728. 24 What is the highest common factor of 77035868 and 21917? 217 What is the greatest common factor of 1925019 and 450? 9 Calculate the greatest common divisor of 180 and 86952010. 10 What is the highest common divisor of 875 and 8093750? 875 What is the highest common factor of 468390 and 5160? 30 What is the greatest common divisor of 3432988 and 1070? 214 Calculate the greatest common divisor of 168 and 4724520. 24 Calculate the highest common divisor of 21957 and 1959945. 39 What is the greatest common divisor of 236 and 36018438? 118 What is the greatest common divisor of 8722 and 20457451? 4361 What is the highest common factor of 80 and 30591260? 20 Calculate the highest common factor of 2 and 3607022. 2 What is the greatest common factor of 11748969 and 411752? 4679 What is the greatest common factor of 31983 and 16850472? 4569 What is the greatest common factor of 3611172 and 24? 12 Calculate the highest common factor of 28808 and 13000. 104 Calculate the highest common divisor of 8930 and 7547636. 1786 Calculate the greatest common divisor of 714 and 3603582276. 714 What is the greatest common factor of 266194799 and 26? 13 What is the greatest common factor of 1312822 and 163806? 2374 Calculate the greatest common divisor of 34680725 and 175. 25 Calculate the highest common factor of 12 and 18126642. 6 Calculate the greatest common divisor of 984838572 and 6. 6 Calculate the highest common factor of 96891242 and 14. 14 Calculate the highest common divisor of 275241 and 19945. 3989 Calculate the highest common factor of 6044 and 24923945. 1511 Calculate the highest common divisor of 83969820 and 6435. 495 Calculate the greatest common factor of 579139 and 20102. 19 Calculate the greatest common factor of 6 and 29037418. 2 What is the greatest common divisor of 2201 and 34641539? 2201 What is the highest common divisor of 5461 and 7251827? 127 What is the highest common divisor of 605729000 and 8? 8 Calculate the greatest common divisor of 105617164 and 8. 4 Calculate the highest common factor of 5769608 and 2639. 377 What is the highest common factor of 844 and 135722163? 211 Calculate the highest common factor of 354 and 621138. 6 What is the highest common divisor of 27723 and 1517215103? 9241 What is the highest common divisor of 278779 and 13177453? 1871 What is the highest common divisor of 41 and 2578099229? 41 What is the greatest common divisor of 8 and 39295896? 8 Calculate the greatest common factor of 111188 and 390852. 308 What is the highest common divisor of 2299 and 229575841? 2299 Calculate the highest common divisor of 6063704 and 493439. 5087 Calculate the highest common divisor of 2757 and 125724714. 2757 Calculate the greatest common divisor of 22559391 and 8262. 4131 What is the greatest common factor of 3003 and 294844? 11 What is the greatest common divisor of 35507690 and 23844? 3974 Calculate the greatest common factor of 5 and 10396865. 5 What is the greatest common factor of 2684286176 and 416? 416 What is the greatest common factor of 6048 and 143010? 126 What is the greatest common divisor of 500 and 112434500? 500 Calculate the highest common factor of 210 and 12197955. 105 Calculate the greatest common factor of 6288 and 125148. 12 Calculate the highest common factor of 12826 and 197549. 11 What is the highest common divisor of 949662 and 17108? 14 Calculate the greatest common divisor of 28580086 and 17118. 634 What is the greatest common factor of 812039564 and 2989? 2989 Calculate the highest common factor of 40 and 3329720. 40 What is the greatest common divisor of 41 and 315872? 1 What is the highest common factor of 9230346 and 144? 18 Calculate the highest common factor of 14515465 and 8255. 635 Calculate the greatest common divisor of 1503 and 89383410. 1503 What is the highest common factor of 740396 and 16? 4 Calculate the highest common divisor of 40628984 and 1408. 88 Calculate the highest common factor of 444380 and 10938283. 1307 What is the highest common divisor of 85513137 and 3? 3 Calculate the greatest common divisor of 12948 and 557926. 166 Calculate the highest common divisor of 1260 and 340425. 45 What is the highest common divisor of 48572121 and 390? 39 What is the highest common factor of 52171134 and 2505? 501 What is the greatest common divisor of 1083 and 42360918? 57 What is the highest common factor of 31852478 and 8903? 307 Calculate the greatest common divisor of 11644632 and 108. 36 Calculate the greatest common divisor of 118311 and 246453. 339 What is the greatest common factor of 1656897 and 184? 23 What is the greatest common factor of 109426 and 56? 2 Calculate the greatest common factor of 1 and 4447816. 1 What is the greatest common divisor of 6549 and 102129? 177 What is the highest common factor of 62841469 and 136? 17 Calculate the highest common divisor of 750 and 23487250. 250 Calculate the greatest common divisor of 3580665 and 2640. 165 Calculate the highest common divisor of 935622 and 45666. 1062 What is the highest common factor of 1782624 and 36504? 24 What is the greatest common factor of 48 and 156460128? 48 What is the highest common factor of 3153031 and 233145? 157 Calculate the greatest common divisor of 6816393 and 5913. 81 Calculate the highest common divisor of 3411 and 14794644. 1137 Calculate the greatest common divisor of 13836402 and 2163. 309 What is the highest common factor of 112584 and 168? 24 What is the greatest common divisor of 914 and 8113121? 457 Calculate the highest common factor of 152 and 248912. 8 What is the highest common divisor of 960 and 32989920? 480 Calculate the highest common factor of 101780 and 111440. 140 What is the highest common divisor of 74762838 and 255? 51 Calculate the greatest common factor of 132 and 2559888. 12 What is the greatest common factor of 192322 and 74? 2 What is the greatest common factor of 10602 and 1653057? 171 What is the highest common divisor of 4568 and 66800148? 2284 Calculate the highest common factor of 1924 and 13150696. 52 What is the highest common factor of 5510 and 19386935? 2755 What is the greatest common divisor of 90376790 and 395? 395 Calculate the highest common fac	{ "pile_set_name": "DM Mathematics" }
. Let x = 25 + r. Solve -3b + x + 2 = 0 for b. 5 Let x(b) = b3 + b2 - b. Let v(m) = 2m*3 + 8m*2 - 5m - 2. Let j(o) = -v(o) + 3x(o). Let s be j(5). Suppose -2d + s = 6. Solve -2z = dz for z. 0 Let p = 1131 + -870. Solve 262f + 5 = pf for f. -5 Let g(t) = -t*3 + 5t*2 + 6t - 2. Let n be g(6). Let d be -8(2 + -1)/(n1). Solve s + 10 = -ds for s. -2 Let g = 19 - 19. Let s be ((3 + -3)/(-3))/(-2). Suppose m + sm - 2 = g. Solve b = -mb + 9 for b. 3 Suppose -52j = -23j - 116. Let a be 1/(-1)(-2 + 2). Suppose -4c - 3g = -19, 2c = -ac - jg + 22. Solve h - 3 - c = 0 for h. 4 Let j be 1/(-2) - (-50)/(-4). Let l(p) = -19p - 11. Let k(y) = 9y + 5. Let x(m) = jk(m) - 6l(m). Let z be x(-1). Solve zn - 6 = 10 for n. 4 Let r = -1513 - -1520. Solve -10v = rv for v. 0 Let a = -724 + 855. Solve a = 23c + 16 for c. 5 Suppose d + 0d - 5 = 0. Suppose 17 = -2w + d. Let g be w/1515/(-1). Solve 3q + 9 = gq for q. 3 Let v be 1/10 - ((-3102)/(-220) - 17). Let j = 21 - 15. Solve -3 = vd - jd for d. 1 Let a = -190 - -192. Solve 13 = -5k - a for k. -3 Let r = 15 + -10. Suppose o + 29 = rp + 2, -2p = 5o. Solve 13 - p = 4z for z. 2 Suppose -2l - 5x + 11 = 0, 6l = 2l + 3x + 9. Solve lv - 4v + 5 = 0 for v. 5 Suppose 12 = -0m + 3m. Let n(u) = -u - 8. Suppose 6c = 10c + 80. Let r be n(c). Solve -2z + m = r for z. -4 Let l be (44/(-3))/(-1) + (-8)/(-24). Solve lu = 16u + 5 for u. -5 Suppose 0 = -5z + 9 + 46. Suppose -2y - 28 + 11 = -k, 0 = -k - y + 8. Let c = z - k. Solve cv = 4v + 20 for v. -5 Suppose -4x + 31 + 23 = 2i, 4x = -5i + 147. Let t = -23 - -55. Suppose -ih = -th. Solve 3d = 9 - h for d. 3 Suppose -25 = w + 27. Let k = -50 - w. Solve -n = -kn - 1 for n. -1 Suppose -17w = -5024 - 416. Solve -12 = -wy + 326y for y. -2 Let l be ((-6)/15)/((-49)/245). Let m(c) = c*2 + c. Let p be m(-2). Solve lf + pf - 16 = 0 for f. 4 Let v be -2 - (-4 - 0/5). Suppose -4a = -va - 2. Solve -4 - a = -5x for x. 1 Let r(y) = -y. Let f(x) = -x*3 - 4x*2 - 2x - 5. Let l be f(-4). Suppose 2 = -0n - 2n + 2d, -3n - 15 = ld. Let m be r(n). Solve -v - 20 = mv for v. -5 Suppose 5u + n - 23 = 0, -2n + 12 = 4u - 4. Solve 2p - 5 - u = 0 for p. 5 Let d be 21/14((2 - -1) + -1). Solve di = 2i - 2 for i. -2 Let t = -333 + 338. Solve 0 = -tb + 9 + 6 for b. 3 Let f = -307 - -308. Solve 7x - 1 = -f for x. 0 Let u be 14/35(-195)/(-6). Let b be (6/4)/((-6)/(-16)). Solve 3f - u = -b for f. 3 Let t(f) = 17f + 17. Let o(h) = -9h - 9. Let n(p) = -7o(p) - 4t(p). Let z be n(-2). Solve 0 = 3g - 4g + z for g. 5 Let b(x) be the third derivative of -x5/60 + x4/12 + 5x*3/6 + 8x*2 - 1. Let r be b(2). Solve -2 - 3 = rj for j. -1 Let i(k) = -k*3 + 5k*2 - 8k + 6. Let w be i(2). Solve 0 = wq + 10 - 14 for q. 2 Suppose 4 = 2o, 3b + o - 16 = 5o. Suppose b - 56 = -4h. Solve -3s - s + h = 0 for s. 3 Let n = 57 + -57. Let b = -3 - -15. Solve n = 2w + w + b for w. -4 Let w(a) = -a3 + 6a*2 + a - 3. Let q be w(6). Let g be 44/(-66) + (11/q - 0). Solve 1 = l - g for l. 4 Let m be -4 - -34/12. Let s be (m/1)/(27/(-36)). Solve s = -0o - 4o for o. -1 Let q(v) = v. Let m(d) = d*2 - 2d - 12. Let t be m(5). Let n be q(t). Let w be (-12)/n(-3)/12. Solve 0 = -u - 0u + w for u. 1 Suppose -4n = 11n - 75. Solve nc - 2 = -7 for c. -1 Suppose -2f + 10 = 0, -95 = -2h + h + f. Suppose -4n - n = -h. Solve 4m + n = -m for m. -4 Let p = -3 + 9. Let r = p - 1. Solve -m - r = 4m for m. -1 Suppose 246 = -5r + r - 5f, -285 = 5r - 5f. Let a = r + 64. Solve 10p - ap = 0 for p. 0 Suppose 12 = 4o + 5n, 3o + 0n = 4n + 9. Suppose x = -5v - 12, 3x + o = 3v + 21. Solve xq = 2q - 3 for q. -3 Let t be 6/4 + (-4)/8. Let l be (3 - (4 - t))/2. Solve -b = -lb for b. 0 Suppose -24 = -0k - 6k. Let t(z) = z + 4. Let a be t(-4). Solve a = -0j + kj for j. 0 Let z(u) = 13u - 22. Let o be z(9). Let c be (0 - 1)/((-19)/o). Solve i = c - 0 for i. 5 Suppose x - 10 = -4r, -51x - 19 = -55x + 5r. Solve xo = 4o for o. 0 Suppose 5n = -o + 17, -3o - o + 2n + 46 = 0. Suppose -4v = o + 20. Let u be v + 9 - (-2 + 1). Solve -3q + uq = 2 for q. -2 Let x(r) = r + r*3 + 6r*2 - 5 + 1 - 3r - 3r2. Let n be x(-3). Suppose -g + n = -0g. Solve -v - g = v for v. -1 Let k(d) = -d*3 + 6d*2 + 12d - 22. Let u be k(7). Solve -7t = 8 + u for t. -3 Let t(b) = 43b - 551. Let m be t(13). Solve 2c + mc - 10 = 0 for c. 1 Let a(y) be the first derivative of -y*3/3 + 3y*2 - y + 25. Let m be a(5). Solve 0 = ms - 7 - 5 for s. 3 Let z be 0(-3 + (-40)/(-15)). Let p(d) = d2 - 2d + 6. Let n be p(z). Solve x + 2x = n for x. 2 Suppose -6l = 6 - 24. Suppose lh = -0h. Solve h = -0s + 5s - 15 for s. 3 Let g be (-5 + 64/12)12. Solve -3h = -gh + 4 for h. 4 Suppose 2t - 3 = 3. Let o(n) = -n*2 + 8n + 14. Let c be o(9). Suppose -j - 4 = -3w + 4, -cj + 2 = -w. Solve tu + w = -0 for u. -1 Let j(w) = -7w*2 - w + 2. Let f be j(-2). Let a be f/(-7) + 16/(-14). Solve 0s = -as + 12 for s. 4 Suppose 2j = -0 + 6. Solve -jm = 5m for m. 0 Let g(k) = -k3 - 4k*2 - 2k + 2. Suppose -1 = -r - 0. Let j be (-3)/(-2 - r) + -5. Let v be g(j). Solve 0 = 3n - v - 2 for n. 4 Let q(b) = 3b*2 - 39b - 133. Let k be q(16). Solve -k = -8x - 3 for x. 1 Suppose 4163 = -9r + 4190. Let v = 0 - -2. Solve -w = -rw - v for w. -1 Let y be (-92)/(-20) + (-3)/5. Let x be 4/7 - 20/35. Solve -p + y = -x for p. 4 Suppose 0 - 126 = -6b. Solve -b - 1 = -22z for z. 1 Suppose 18 = 6g - 3g. Suppose gb = 4 + 8. Solve -4m = -5m - b for m. -2 Suppose -w - 3c + 5 = -2c, -w = -5c + 13. Suppose -4654o - 120 = -4694o. Solve wf - f = -o for f. -3 Let j(v) = v - 2. Let h be j(4). Suppose hs - 14 = -6. Let t be (21/(-28))/(2/(-8)). Solve -a = -sa + t for a. 1 Let l(u) = u*2 - 23u + 53. Let j be l(21). Solve -j + 10 = -z for z. 1 Let c = 1153 + -1137. Solve cx - 18x = 0 for x. 0 Suppose 0 = -3s - 4j + 4, -2j + 0 = -2. Solve -3a = 3 - s for a. -1 Suppose 2 = -2o, -5x = -5o - 8 - 7. Let a(z) = -6z*3 - 1 + 3z3 - zx - 2z3 - z + 0. Let h be a(-1). Solve hl = -5 + 17 for l. 3 Let a = 1 + 6. Let i = 16 - a. Let r = i + -4. Solve 0 = -x + rx for x. 0 Let a(q) be the third derivative of 7q4/12 - q3/3 + 38q2. Let g be a(1). Solve 5s = s - g for s. -3 Let t(p) = -4p3 + 6p*2 + 4p. Let f(y) = -y*3 + y - 1. Let r(q) = -5f(q) + t(q). Let u be r(-6). Solve 1 - u = 2s for s. -5 Suppose 4t - 44 = -7t. Suppose 4 = -0y + y - tu, 4y - 5u - 38 = 0. Solve m + 2m + y = 0 for m. -4 Let i = 12 - 7. Let v = -9 - i. Let a = -12 - v. Solve -4 = -0x - ax for x. 2 Let a be (12/10)/((-33)/(-220)). Solve -13g - a - 44 = 0 for g. -4 Suppose -5l - 83 = 102. Let u = 40 + l. Solve -g + ug = -6 for g. -3 Let b(m) = 2m3 - m2 - m - 3. Let n be b(2). Solve 13 = -2r + n for r. -3 Suppose -4a - 4 = -2b, -7 = -4b + 1. Let u be 32/16(a + 2). Suppose -16 = -4y - 4t, -3t = -4y - 4t + 10. Solve -2 = -uj + y for j. 1 Suppose -1 = 6r - 37. Suppose 2x = -0x + r, -4g - 7 = -5x. Suppose -b = -gj - 7, 2b - 5j - 38 = -7j. Solve -b = 5a + 10 for a. -5 Let x = -13 - -17. Suppose m - 30 = -xm. Suppose 0 = 3p - m. Solve pv = v for v. 0 Let a = -29 - -31. Let k be (2/(-3) - (-4)/(-3)) + a. Solve k = 2u - u for u. 0 Suppose 2y + 1479 = 19y. Let u = 99 - y. Solve 0 = -5m - u - 3 for m. -3 Let j be (-12)/273 - (-4)/3. Solve -5i - i + 6 = j for i. 1 Let i(o) = -2o2 - 15o - 4. Let m be i(-7). Suppose -mf = -12 + 3. Solve -fr - 6 = -5r for r. 3 Let k(j) = -j2 + 6j + 3. Let h be k(6). Suppose u - 5 + 8 = 0. Let d be u/((-2)/((-8)/(-4))). Solve 2m = hm + d for m. -3 Let a(b) = -b*3 - 9b*2 - 14b + 8. Let o be a(-7). Suppose 0 = 2p - 0p - 3h - 6, 0 = 5p + 5h + 10. Solve p = -3l + o + 7 for l. 5 Let f be (-2 - -4) + (-5 - -6)-2. Solve 7h - 4 - 3 = f for h. 1 Let t = 2015 - 1988. Solve -37h = -th - 50 for h. 5 Let k = -25 + 28. Suppose kc = -9, -4u + 3c + 8 = 7c. Let j be 10 - u/255. Solve 3b = -3 - j for b. -4 Let h(d) = 8d2 + 1 + 0 - d3 - 7d + 7. Let n be h(7). Suppose -2g - 5w = -n - 12, -3g = 5w - 20. Solve 4 = -b - g for b. -4 Suppose 2s - 5s = 3n - 21, 5s - 2*n	{ "pile_set_name": "DM Mathematics" }
:07 AM? 354 What is 573 minutes before 3:34 AM? 6:01 PM How many minutes are there between 8:15 AM and 9:03 AM? 48 What is 41 minutes before 9:26 AM? 8:45 AM What is 359 minutes before 4:38 AM? 10:39 PM What is 315 minutes after 1:12 PM? 6:27 PM How many minutes are there between 4:51 AM and 12:27 PM? 456 How many minutes are there between 11:35 PM and 5:19 AM? 344 What is 528 minutes before 2:18 AM? 5:30 PM How many minutes are there between 3:43 AM and 9:04 AM? 321 How many minutes are there between 2:20 PM and 2:29 PM? 9 What is 184 minutes after 11:35 AM? 2:39 PM How many minutes are there between 9:12 AM and 9:31 AM? 19 What is 589 minutes before 6:32 AM? 8:43 PM What is 120 minutes after 9:57 AM? 11:57 AM What is 56 minutes after 11:12 AM? 12:08 PM How many minutes are there between 4:49 PM and 5:28 PM? 39 How many minutes are there between 4:23 PM and 1:32 AM? 549 What is 704 minutes before 7:33 PM? 7:49 AM How many minutes are there between 7:27 PM and 8:43 PM? 76 How many minutes are there between 1:22 AM and 8:30 AM? 428 How many minutes are there between 6:47 PM and 6:49 PM? 2 How many minutes are there between 7:55 PM and 11:17 PM? 202 How many minutes are there between 2:42 AM and 8:14 AM? 332 What is 458 minutes before 6:45 AM? 11:07 PM What is 546 minutes before 5:12 AM? 8:06 PM What is 481 minutes before 2:07 PM? 6:06 AM What is 52 minutes before 8:57 PM? 8:05 PM How many minutes are there between 2:47 PM and 10:59 PM? 492 What is 292 minutes before 7:37 PM? 2:45 PM What is 520 minutes before 8:21 AM? 11:41 PM What is 310 minutes before 6:38 PM? 1:28 PM How many minutes are there between 2:42 AM and 7:38 AM? 296 What is 25 minutes before 3:23 PM? 2:58 PM How many minutes are there between 1:43 AM and 7:57 AM? 374 What is 337 minutes before 4:33 PM? 10:56 AM What is 643 minutes after 5:31 AM? 4:14 PM What is 681 minutes after 9:14 AM? 8:35 PM What is 690 minutes before 6:14 AM? 6:44 PM How many minutes are there between 7:36 AM and 4:35 PM? 539 What is 373 minutes after 5:20 PM? 11:33 PM How many minutes are there between 3:13 AM and 7:13 AM? 240 How many minutes are there between 11:58 PM and 10:53 AM? 655 How many minutes are there between 5:47 PM and 8:16 PM? 149 How many minutes are there between 9:45 PM and 4:24 AM? 399 What is 77 minutes before 2:21 PM? 1:04 PM What is 67 minutes after 10:24 PM? 11:31 PM What is 91 minutes before 3:04 AM? 1:33 AM How many minutes are there between 8:18 AM and 1:27 PM? 309 What is 53 minutes after 1:07 AM? 2:00 AM What is 203 minutes before 3:56 PM? 12:33 PM How many minutes are there between 9:45 AM and 8:03 PM? 618 What is 144 minutes before 8:46 AM? 6:22 AM How many minutes are there between 4:41 PM and 7:03 PM? 142 What is 77 minutes before 10:40 PM? 9:23 PM How many minutes are there between 7:47 AM and 9:19 AM? 92 How many minutes are there between 10:34 AM and 6:13 PM? 459 What is 223 minutes before 10:10 AM? 6:27 AM How many minutes are there between 10:17 AM and 11:46 AM? 89 How many minutes are there between 9:55 AM and 3:23 PM? 328 How many minutes are there between 3:26 AM and 10:27 AM? 421 How many minutes are there between 1:28 PM and 6:48 PM? 320 How many minutes are there between 8:24 PM and 6:20 AM? 596 What is 51 minutes after 5:02 AM? 5:53 AM What is 538 minutes before 11:23 PM? 2:25 PM How many minutes are there between 3:35 PM and 2:39 AM? 664 What is 167 minutes after 11:10 AM? 1:57 PM What is 243 minutes before 12:12 AM? 8:09 PM How many minutes are there between 10:56 AM and 1:35 PM? 159 What is 586 minutes before 1:18 AM? 3:32 PM What is 231 minutes after 4:15 AM? 8:06 AM What is 480 minutes after 7:29 PM? 3:29 AM How many minutes are there between 1:38 AM and 3:25 AM? 107 What is 52 minutes after 2:07 PM? 2:59 PM How many minutes are there between 8:33 AM and 6:20 PM? 587 What is 243 minutes after 3:04 AM? 7:07 AM How many minutes are there between 5:18 AM and 4:50 PM? 692 What is 611 minutes before 1:08 PM? 2:57 AM How many minutes are there between 11:40 AM and 1:31 PM? 111 What is 467 minutes after 10:11 AM? 5:58 PM How many minutes are there between 3:13 AM and 5:59 AM? 166 What is 53 minutes after 3:56 AM? 4:49 AM What is 309 minutes before 11:31 AM? 6:22 AM What is 402 minutes before 7:26 AM? 12:44 AM What is 558 minutes after 12:32 PM? 9:50 PM What is 676 minutes before 10:30 AM? 11:14 PM What is 101 minutes before 6:50 AM? 5:09 AM What is 292 minutes before 12:08 AM? 7:16 PM What is 597 minutes before 10:53 PM? 12:56 PM What is 323 minutes before 2:25 AM? 9:02 PM What is 611 minutes after 1:34 PM? 11:45 PM What is 156 minutes after 10:24 PM? 1:00 AM How many minutes are there between 12:02 PM and 9:08 PM? 546 How many minutes are there between 2:48 PM and 6:45 PM? 237 How many minutes are there between 12:05 PM and 2:29 PM? 144 What is 657 minutes after 8:10 PM? 7:07 AM How many minutes are there between 11:11 AM and 10:42 PM? 691 What is 355 minutes before 3:44 AM? 9:49 PM What is 315 minutes before 3:43 AM? 10:28 PM What is 699 minutes after 9:00 PM? 8:39 AM How many minutes are there between 7:37 PM and 2:31 AM? 414 How many minutes are there between 8:07 AM and 3:07 PM? 420 How many minutes are there between 11:54 PM and 3:11 AM? 197 What is 181 minutes after 11:08 AM? 2:09 PM What is 439 minutes before 10:29 AM? 3:10 AM How many minutes are there between 2:41 AM and 6:41 AM? 240 What is 692 minutes after 9:20 PM? 8:52 AM What is 663 minutes after 2:37 PM? 1:40 AM What is 90 minutes after 8:12 PM? 9:42 PM How many minutes are there between 3:33 PM and 2:43 AM? 670 What is 203 minutes after 1:37 PM? 5:00 PM What is 323 minutes before 11:56 AM? 6:33 AM How many minutes are there between 1:42 AM and 12:02 PM? 620 What is 572 minutes before 5:05 PM? 7:33 AM How many minutes are there between 3:19 PM and 12:25 AM? 546 What is 704 minutes after 1:44 PM? 1:28 AM What is 586 minutes before 1:31 AM? 3:45 PM What is 597 minutes after 9:56 PM? 7:53 AM What is 246 minutes before 12:34 AM? 8:28 PM How many minutes are there between 1:40 AM and 5:02 AM? 202 What is 102 minutes after 2:11 AM? 3:53 AM How many minutes are there between 6:54 PM and 11:04 PM? 250 What is 156 minutes before 10:48 AM? 8:12 AM What is 507 minutes after 10:01 PM? 6:28 AM How many minutes are there between 5:35 AM and 8:40 AM? 185 How many minutes are there between 10:53 AM and 12:44 PM? 111 What is 54 minutes after 4:25 PM? 5:19 PM How many minutes are there between 11:01 AM and 7:17 PM? 496 What is 446 minutes after 9:42 AM? 5:08 PM What is 130 minutes before 8:30 PM? 6:20 PM What is 581 minutes after 7:51 AM? 5:32 PM How many minutes are there between 7:42 AM and 8:49 AM? 67 What is 313 minutes before 7:35 AM? 2:22 AM What is 44 minutes before 5:00 PM? 4:16 PM How many minutes are there between 2:17 AM and 12:24 PM? 607 What is 255 minutes before 5:53 PM? 1:38 PM How many minutes are there between 3:18 PM and 5:50 PM? 152 What is 127 minutes after 6:45 AM? 8:52 AM What is 310 minutes before 11:27 AM? 6:17 AM How many minutes are there between 1:10 PM and 2:01 PM? 51 What is 127 minutes before 2:05 PM? 11:58 AM How many minutes are there between 1:36 PM and 6:36 PM? 300 How many minutes are there between 5:30 AM and 12:24 PM? 414 What is 691 minutes after 9:55 AM? 9:26 PM How many minutes are there between 4:13 PM and 8:04 PM? 231 What is 679 minutes before 3:39 AM? 4:20 PM How many minutes are there between 4:16 PM and 9:44 PM? 328 What is 586 minutes after 6:15 PM? 4:01 AM What is 699 minutes after 8:31 PM? 8:10 AM How many minutes are there between 9:20 AM and 1:15 PM? 235 What is 117 minutes after 9:09 AM? 11:06 AM How many minutes are there between 10:11 PM and 9:54 AM? 703 How many minutes are there between 5:45 AM and 3:37 PM? 592 What is 557 minutes after 6:11 PM? 3:28 AM What is 14 minutes before 2:40 PM? 2:26 PM How many minutes are there between 8:01 PM and 3:02 AM? 421 What is 419 minutes before 2:56 PM? 7:57 AM How many minutes are there between 10:12 AM and 5:15 PM? 423 What is 111 minutes after 9:29 AM? 11:20 AM What is 616 minutes after 3:23 PM? 1:39 AM What is 36 minutes after 10:35 AM? 11:11 AM What is 159 minutes before 11:15 PM? 8:36 PM What is 123 minutes after 3:5	{ "pile_set_name": "DM Mathematics" }
9/((-45)/4)). Let m = -4.4 - -0.4. Which is the closest to 0.1? (a) m (b) 5 (c) u c Let t = -1.5 + -13.5. Let o = 11 + t. Which is the nearest to -0.1? (a) -0.3 (b) -0.2 (c) o b Let f(c) = -c*2 + 4c + 6. Let y be f(5). Let g = 11 - 10.6. What is the closest to 2 in -1/6, g, y? y Let r = 128.2 + -129. What is the closest to 0 in -0.4, r, -0.2? -0.2 Let q = -3.07 + 0.07. Let o be (-4)/(48/27) + 2. Let g be (-3)/28/(-42). Which is the nearest to g? (a) o (b) 4 (c) q a Let n = 0.1 - 4.1. Let i = 8 - 2. Let p be ((-1)/6)/(-5 + i). Which is the nearest to 0? (a) p (b) -0.1 (c) n b Let x = -9 - -8.2. Let k = x + 0.3. What is the closest to 1 in 0.3, 1, k? 1 Let x = 8 + -5. Let q = -262 + 260. What is the closest to -1 in -3, x, q? q Let u = 1 - -4. Which is the nearest to -0.1? (a) 4 (b) 1 (c) u b Suppose 0 = 2v - r + 4, 5r - 27 + 7 = -4v. What is the nearest to 2/3 in -5, v, -2/3? v Let t be ((-8)/(-12))/(2(-2)/(-6)). Let o = 0.43 - 0.03. Which is the closest to t? (a) -5 (b) o (c) 2/21 b Let x = -7.7 + 8. Let s = x + -0.2. Let f = -16 + 18. What is the nearest to s in f, 1/5, -3? 1/5 Let x = -62 - -436/7. Let o = x + -13/21. Which is the nearest to 1? (a) 2/3 (b) 3/7 (c) o a Let u = 0.34 - 0.3. Let q = 4.04 - u. Let t = -1/32 - -131/96. What is the closest to -0.1 in t, q, 2/13? 2/13 Let t = -9 + 8. Let o be t(-3)/(-3 + 2). Let v = 0.2 - 0.3. What is the nearest to v in 1, o, -4/7? -4/7 Let j(i) = -i + 8. Let m be j(5). Suppose 5o = mo - 4. What is the closest to 0 in -0.3, o, -3? -0.3 Let j = 5.085 + -0.085. Let m be (-4)/18 - (-6391)/6120. Let u = m - 3/136. Which is the nearest to -0.1? (a) 2/7 (b) j (c) u a Suppose 3w - 2 - 5 = -k, -w + 2k = -14. Which is the closest to 1? (a) 0.12 (b) w (c) -1 a Let o = -26 + 20. What is the closest to 1/3 in -2/21, 5, o? -2/21 Let a = 3 + -3.5. Let p = 2 + -3. Let g be (-2 - (-10)/3) + p. What is the nearest to g in -0.2, a, 4? -0.2 Let t = -5 + 0. Let l(v) = v + 10. Let w be l(-8). What is the nearest to -1/4 in w, 0.3, t? 0.3 Let s = -13.1 + 8.1. Let m = 0.08 - -3.92. Which is the nearest to 0? (a) 1/8 (b) s (c) m a Let v = 5 - 4.6. Let p = 0.48 - 0.28. What is the nearest to 0 in p, -2/7, v? p Let j = -15 + 15. Let k = -0.16 + -0.24. What is the closest to j in -3, k, -2? k Suppose 0m = 3m + j + 16, 4m + 3j + 28 = 0. Let o be m + -34/(-12). Which is the closest to 1/2? (a) -2 (b) o (c) -2/13 c Let d = 390204/119 + -3279. Let i = 205/1309 + d. Which is the closest to 0.2? (a) 4/7 (b) -0.2 (c) i c Let g = -0.08 - 2.42. Let k = g - 0.5. Let z = k + 1. Which is the closest to -1/4? (a) -0.5 (b) z (c) 0.3 a Let c = 1461/19 + -77. Suppose 0 = -4a + m + 467, -2a + 4a = -2m + 226. Let x = a - 810/7. What is the closest to x in c, -1, 1/2? 1/2 Let a = -23 - -18. What is the closest to 2/7 in a, 0.3, 2? 0.3 Let r = 1605/8 - 201. Suppose -10 = -4u - 2. Let m = u - 3. What is the closest to m in r, -0.5, -1? -1 Let n = 1.5 - 1.1. What is the nearest to 0.2 in -1, n, -2? n Let v = 0 + -0.2. Let c = 1.2 - 0.9. What is the closest to 0.1 in -5, c, v? c Let r = 2 - 1.9. Let q be 3/(-261)23. Let t = -33/58 - q. Which is the nearest to t? (a) -0.3 (b) 3 (c) r a Let c = -95/267 + 2/89. What is the nearest to 0 in -4, -0.2, c? -0.2 Let t(u) = u*2 + 6u + 5. Let r be t(-5). Let i = 1.1 + -1. Which is the nearest to 0.3? (a) r (b) 1/3 (c) i b Let g be -1(-85)/(-30) - -3. Which is the closest to 0.1? (a) -5 (b) g (c) 0 b Let c = -11 + 21. Let d be 0(3 - c/4). What is the closest to d in 3, -4, 0.3? 0.3 Let r = -1 - -2. Suppose 15 = -c + 5z, -4z + 13 = -5c + r. What is the closest to c in -1, -0.1, -2? -0.1 Let k be (-1)/28/22. Suppose -2y - 2n - 8 = -0n, 0 = 5n + 15. What is the nearest to -0.1 in 1/3, y, k? k Let p(h) = -h*3 + 5h*2 - 4h + 2. Let s be p(4). Let c be (s/(-27))/(1/(-3)). What is the closest to c in 0.4, -4/5, 1? 0.4 Let p(n) = -n*2 + n. Let v be p(0). Let i = -19/44 + 2/11. Which is the closest to 2? (a) v (b) 5 (c) i a Let h = 5.1 + -0.1. Let o be 1-2 + 208/80. Which is the nearest to 1? (a) 0.1 (b) o (c) h b Suppose m + 21 = 6m - 3h, 2 = 4m + 5h. Suppose m = 5x + 4t - 5t, 15 = 3x - 5t. Let q = -14 - -10. Which is the closest to x? (a) -3 (b) q (c) -1/2 c Let l be 54/(-42) - ((2 - 4) + 1). Let g(n) = -n3 - 4n*2 + 5n + 4. Let i be g(-5). Which is the nearest to 2/7? (a) i (b) l (c) -5 b Suppose b - 2 = 2b. Let v be 1/3 + 2/(-2). What is the nearest to 2 in b, v, -0.1? -0.1 Let p = 5 + -2. Let o = p - 3. Let w = 0.2 - 0.1. What is the closest to o in w, -4, 1? w Let n = 2 + -2. Let f = 2 + n. What is the nearest to -1 in f, 1/3, 3/8? 1/3 Let u = -104 - -726/7. What is the closest to -1 in u, 2, -6? u Let i = -4 - -1. Let w = i + 6. What is the closest to -1 in 2, -3, w? -3 Suppose 0 = 3y - 9, -2 = v - 2y - 0. Suppose vl = 5j - 8, -l - 2 + 1 = -j. What is the closest to -1 in -2, -1/2, j? -1/2 Suppose -8 = -4x - 0. Which is the closest to 1/3? (a) 0.4 (b) x (c) 5 a Let t = 5.7 + -9.7. Let y be (-2)/4 + (-7)/(-6). What is the nearest to y in 3, t, 0.4? 0.4 Suppose -6f - 1 = 29. Which is the closest to 1/6? (a) f (b) 0.3 (c) 0.2 c Let s = 21.06 - 21. What is the nearest to 1 in -0.2, s, 4? s Let i = 15 + -14.97. What is the nearest to -1/4 in -0.2, i, -0.1? -0.2 Let o = -1.7 + 2. Let q = 16 - 16.6. Let n = 2.6 + q. What is the nearest to n in o, -1/12, 1/4? o Let f = -111.9 - -112. Which is the nearest to 2? (a) f (b) 4 (c) -7/4 a Let r be (-2)/(-9) - 8/18. Let n = -3 - -3. Let q = 12 + -12.5. What is the closest to 2/5 in n, q, r? n Let f(u) = 3 - 8u + 4u2 - 3u*2 + 2u. Let s be f(5). Let m = 1019/7 - 145. Which is the nearest to -2? (a) m (b) 1/4 (c) s c Let x be -5(171/30 + -6). What is the nearest to 0 in x, -4, -1? -1 Let p be 40/51/2. Let s = 0.1 - -0.3. Which is the closest to -1/3? (a) p (b) 4/7 (c) s c Let l = 2.69 - -0.01. Let o = l + -0.7. Which is the closest to 0? (a) o (b) -3/2 (c) -4 b Let u = 83 + -87. Let g = 0.1 + -0.1. Which is the closest to g? (a) 0 (b) u (c) -1 a Let r = -0.5 + 0.4. Let s = r - -0.45. Let c = -0.05 + s. What is the closest to 2/7 in -3, c, 1? c Let g = 0.12 + -0.1. Let z = 0.48 + g. Let w = z + -0.9. Which is the nearest to -1? (a) 1/2 (b) -0.1 (c) w c Let n = -2.8 - -0.2. Let k = -3 - n. Let l = -0.3 - -0.2. Which is the closest to l? (a) 5 (b) k (c) 0 c Let w = -1 - 1. Suppose 2f + 2m = -16, 0 = 2f - 4m - 2. Which is the nearest to -1/2? (a) f (b) w (c) -1 c Let r be 9/(-12)-1 - 1. Which is the closest to 0.1? (a) r (b) 5/4 (c) -0.4 a Let h = -55 + 57. What is the closest to -21 in -4, 1, h? -4 Suppose -2k = -7k. What is the closest to 0.1 in 0.5, -3, k? k Let y = -0.2 - -0.2. Suppose 2m - 4g = -3m - 15, g = -4m + 9. Which is the closest to m? (a) 5 (b) y (c) -2/3 b Let y = -0.02 + 0.11. Let p = y - -0.91. Suppose -4l = 7 + 1. Which is the closest to p? (a) -1/5 (b) -3 (c) l a Suppose -5s = -2s + 6. Let d = 4.9 + 0.1. Which is the closest to 0? (a) 0.5 (b) s (c) d a Suppose 4l + 4v + 92 = 0, -3v + 39 = -3l - 0v. Let y = -17 - l. Which is the nearest to 1? (a) 5 (b) y (c) 3/5 b Let r(v) be the second derivative of -7/6v*3 + 0 + v - 1/12v*4 - 9/2v*2. Let i be r(-6). Which is the nearest to 0? (a) 3/2 (b) -0.3 (c) i b Let l = -45 - -45.7. Which is the nearest to l? (a) 3 (b) -2/11 (c) 2/9 c Let a = 3 - 2.9. Let s = 0.2 - -0.3. What is the closest to a in -5, 6/5, s? s Suppose -15 = -r - 13. What is the closest to 1 in -2/9, -1/7, r? r Let r be ((-3)/(-2) - 2)-2. Let w = 56 - 57. Which is the closest to 1? (a) -0.4 (b) w (c) r c Let s = -0.3 + -0.2. Let j = 0.195 - 0.195. Which is the nearest to j? (a) s (b) -3/4 (c) -0.4 c Let t = -1.5 + -3.3. Let o = 5 + t. Let l = o + 0. Which is the nearest to -0.2? (a) l (b) -0.2 (c) -1/2 b Let v = 0.3 + -0.3. Let p = -2 - v. Let r = 0.1 - 0. Which is the closest to r? (a) 3/7 (b) p (c) 1 a Let r = 0.02 - 4.02. What is the nearest to 2/3 in -0.1, 0.1, r? 0.1 Let b(z) = z*3 - 3z*2 - 2z - 4. Let l be b(4). Let h = -31 - -27. Let s be ((-2)/(-28))/(2/(-4)). What is the nearest to 2/7 in s, h, l? s Let l = 95/2 - 46. Let s	{ "pile_set_name": "DM Mathematics" }
- 220l4 + 2l*3 + 5l*2y + 730264y wrt l? 745320l*3y - 5280l + 12 Differentiate 1105060044c + 841461990. 1105060044 What is the third derivative of 3370296p3 - 4459821p*2 - 2 wrt p? 20221776 Find the second derivative of -4t*5 - 2972571t*4 - 4870847t. -80t3 - 35670852t*2 What is the third derivative of -36f*5 + 507824f*4 - 13113289f*2 wrt f? -2160f*2 + 12187776f What is the third derivative of 13x6 - 1125x*4 + 24x*3 + 9281271x*2 wrt x? 1560x*3 - 27000x + 144 What is the third derivative of 17513982m3n*3 + 3m*3n*2y + m*3n + 6169m2y + mn2 + 10n*3y + 36ny - 2 wrt n? 105083892m3 + 60y What is the first derivative of 411116596m3p + 65034m3 - 1654m*2 + 1 wrt p? 411116596m*3 What is the second derivative of -2947816x*2 + 5718202x? -5895632 Find the third derivative of 12bl*5 + 5bl4 + 4782624bl2 - 33415l*3 + 6l*2 wrt l. 720bl2 + 120bl - 200490 What is the third derivative of -28462837n*6 - 27453623n*2? -3415540440n*3 What is the third derivative of 38331857h*5 - 39851990h*2 wrt h? 2299911420h*2 Find the first derivative of 31622131t*2 - 25840266. 63244262t Find the second derivative of -33920dy*3 - 9dy - 16950d - 513y3 + 8y wrt y. -203520dy - 3078y What is the first derivative of -85i*2y - 9057043i2 + 6iy - 145y wrt y? -85i2 + 6i - 145 What is the second derivative of 91g3i*3 - 7g*3i - 4232g3 - 103387gi4 + 68i wrt i? 546g3i - 1240644gi*2 What is the derivative of -239d*2m*2 + 161d*2 - 937d - 181684708m2 wrt d? -478dm2 + 322d - 937 What is the second derivative of 5695422l2q*2 - 4l*2q + 2l2 - 23l - 449q + 3 wrt q? 11390844l*2 Find the second derivative of 3b*3h*2 + 28124b*3h - 172b2h - 12883164h2 wrt h. 6b*3 - 25766328 Find the third derivative of 93798c*4v - 4c4 - 2c*3v + c*2v - 57c2 - 5c + 20 wrt c. 2251152cv - 96c - 12v What is the second derivative of -7382340d2 - 390d + 137? -14764680 Find the second derivative of -4812813t4 + 2059t + 31 wrt t. -57753756t2 What is the third derivative of 9085812y*3 + 677y*2 - 56y + 2? 54514872 Find the second derivative of 8554047b4g*2 - 6b*2g*3 - 87bg3 - 14827g*3 wrt b. 102648564b*2g*2 - 12g*3 What is the third derivative of 2133235m*5 + 815131m*2? 127994100m*2 Find the third derivative of 1714h*6 + 97h*5 + 18h*3 - 61839506h*2 wrt h. 205680h*3 + 5820h2 + 108 What is the first derivative of -v4 - 247132v2 + 4v - 44355861? -4v3 - 494264v + 4 Find the third derivative of 5s5 + 674658s*3 + 2173s*2 + 3s - 531. 300s2 + 4047948 Find the second derivative of 104319i*3 + 2i*2p*3 - 2i*2p + 2ip*3 + 58ip - 2p + 70 wrt i. 625914i + 4p*3 - 4p What is the second derivative of 11o3p*4 - 98629o*3p + 2op - 65962p4 + 1 wrt p? 132o*3p*2 - 791544p*2 What is the first derivative of 2ahk - 60ah + 1211a + 434hk2 + 5h + 46k2 - 1 wrt k? 2ah + 868hk + 92k Find the second derivative of 28869917f2 + 3f + 1965307. 57739834 What is the second derivative of -638338809c5 + 29240120c wrt c? -12766776180c3 What is the third derivative of -9701698j*3 - 21319261j*2 wrt j? -58210188 What is the first derivative of -16955829co - 4067c + 7o + 240 wrt o? -16955829c + 7 Find the first derivative of 405264fiv2 - 19fiv - 6fi + 19fv*2 + 21f - 182v2 + v + 9 wrt i. 405264fv2 - 19fv - 6f Find the second derivative of -4046m3u*2 - 1121m*2u*3 + 50787mu3 + mu2 - m - u2 wrt m. -24276mu*2 - 2242u*3 What is the first derivative of -14538123r*4 - 44058735 wrt r? -58152492r*3 Find the third derivative of 80486k*3l - 77k3 - 3523k*2l + 5161k2 - 2l wrt k. 482916l - 462 Find the first derivative of -4160734o*2 + 2o - 76117685. -8321468o + 2 What is the third derivative of 2b*6 - 4691668b*4 - 3b*2 - 2213b - 665? 240b3 - 112600032b Differentiate -5412u3 + u2 - 113u + 2525508 wrt u. -16236u2 + 2u - 113 Find the third derivative of -2i5 + 3i*4 - 27711i*3 + 273162i*2. -120i*2 + 72i - 166266 Find the second derivative of -24847792n3 - 29946071n wrt n. -149086752n Differentiate 55b*3 + 2b*2 + 1617317b - 609509277 wrt b. 165b2 + 4b + 1617317 Find the third derivative of 16n3u*2 + 19205n*3u + 278n3 + 16n*2u*2 - 393n*2u - 3n2 - 2nu2 - 69u*2 wrt n. 96u*2 + 115230u + 1668 What is the second derivative of 7z4 + 54913z3 + z2 + 18020998z? 84z*2 + 329478z + 2 What is the third derivative of -131193894h4 - 557045690h*2? -3148653456h Find the third derivative of 2f4k - 14468699f4 - 2f*3k*2 - 26f*2 + 3fk2 - 2614fk + k2 + 5 wrt f. 48fk - 347248776f - 12k2 Differentiate -15936003q + 17270223 wrt q. -15936003 Find the third derivative of 323b5g - 101075b3g - 39b2g + 4b2 - 30795 wrt b. 19380b*2g - 606450g Differentiate -195474211y*3 - 182907436. -586422633y*2 What is the second derivative of -301672054b*2s*3 + 145bs3 - 146bs2 - 86b + 4s3 wrt b? -603344108s*3 What is the derivative of -383885958j - 172989350? -383885958 What is the first derivative of -219136665i + 126566988? -219136665 What is the second derivative of -387999923s*2u + 1044595su - 3s wrt s? -775999846u What is the derivative of -62aks - 4ak - 10111as + 28ks - 2k + 27497s wrt a? -62ks - 4k - 10111s Differentiate -8082961z*3 + 3z + 47176993 wrt z. -24248883z2 + 3 Find the second derivative of 121408907k*4 - 9995k - 3071 wrt k. 1456906884k2 What is the third derivative of -57625y*5 + 63y4 - y2 - 185y + 3558 wrt y? -3457500y*2 + 1512y Find the second derivative of 1185118432u2 + 12u + 18200699 wrt u. 2370236864 What is the third derivative of 63528144g6 - 2g*2 + g - 1028032 wrt g? 7623377280g*3 What is the third derivative of 13432r*4 + 494r*3 - 26730935r*2 wrt r? 322368r + 2964 Differentiate 17984963bh*2z + 15bh*2 - 9bh + 12b + 628h2 - 1 with respect to z. 17984963bh2 Find the third derivative of 416lw3 - 79lw2 - 13l + 228608w3 - 5w - 6614 wrt w. 2496l + 1371648 What is the third derivative of 20127875p*3 + 10640152p*2 wrt p? 120767250 Find the second derivative of -28134214g*2 - 60402661g. -56268428 Find the third derivative of 29x4 + 50343x*3 + 431x*2 + 10189x wrt x. 696x + 302058 What is the second derivative of -3905457r*3 + 141110r? -23432742r Find the third derivative of 356734465l*4 - 6731145l*2 + 7l + 1. 8561627160l What is the second derivative of -140m*4 + 239812m*3 - 15m + 2895006 wrt m? -1680m2 + 1438872m Find the second derivative of -152001gj*2 - 20gjw + 312gj - g + 138j2w - 3jw - 3j wrt j. -304002g + 276w Find the third derivative of 53182b*2g*3 + 12058343b*2g*2 + 116bg3 wrt g. 319092b*2 + 696b What is the derivative of 46763786fz - 2536f + 7192 wrt z? 46763786f Find the third derivative of -29472x6 + 7x*4 - 2x*3 - 1947x*2 + 819x wrt x. -3536640x3 + 168x - 12 Differentiate 24843787c4 - 18679495 with respect to c. 99375148c*3 Find the third derivative of -1219445w*6 - 221935w*2 - 9w + 3. -146333400w3 Find the second derivative of 223j*3 + 159852j*2 - 13677395j. 1338j + 319704 What is the third derivative of -33664047h*3 + 276h*2 + 25524? -201984282 Find the third derivative of 2i*6 - 1299818i*4 + 8i*3 + 6i*2 - 15i - 1777 wrt i. 240i3 - 31195632i + 48 What is the second derivative of -f*5 - 688668f*4n - 10277943fn wrt f? -20f3 - 8264016f*2n What is the second derivative of -296421533m2 - 29422m - 18379? -592843066 Find the third derivative of 698q5 + 5q*4 - 4780q*3 + 6q*2 + q + 11576. 41880q*2 + 120q - 28680 Find the second derivative of 3546534a4 + 4a*3 + 369826a - 38. 42558408a2 + 24a Find the third derivative of 952q5 + 5298q*4 - 2q*3 - 19q*2 + 6730q + 32 wrt q. 57120q2 + 127152q - 12 What is the second derivative of -176184058q*	{ "pile_set_name": "DM Mathematics" }
rue Is 22 a factor of 30844? True Is 99 a factor of 5798? False Does 25 divide 10200? True Is 124616 a multiple of 222? False Is 4 a factor of 6615? False Does 75 divide 1923? False Is 63 a factor of 63630? True Does 6 divide 1842? True Is 12 a factor of 30143? False Is 65 a factor of 25545? True Does 49 divide 441? True Is 18 a factor of 668? False Does 7 divide 336? True Is 13586 a multiple of 34? False Does 3 divide 1488? True Is 62 a factor of 9414? False Does 7 divide 1220? False Does 10 divide 14631? False Does 5 divide 1340? True Is 28 a factor of 29365? False Does 19 divide 34124? True Does 25 divide 8700? True Is 1554 a multiple of 7? True Is 12 a factor of 96? True Is 12 a factor of 682? False Is 196 a multiple of 7? True Is 43938 a multiple of 162? False Is 2 even? True Is 42 a factor of 1470? True Is 135 a factor of 14310? True Does 8 divide 129? False Is 38 a factor of 2105? False Does 4 divide 20? True Is 11 a factor of 950? False Is 63 a factor of 397? False Is 68 a factor of 597? False Is 69951 a multiple of 45? False Is 102 a factor of 2048? False Is 24 a factor of 496? False Does 60 divide 180? True Is 34 a factor of 22490? False Is 176 a multiple of 8? True Is 41 a factor of 5500? False Is 56 a factor of 8448? False Does 23 divide 36? False Does 4 divide 67? False Is 9867 a multiple of 47? False Is 111 a factor of 15235? False Is 40 a factor of 3920? True Does 190 divide 11970? True Does 36 divide 14112? True Does 112 divide 15657? False Does 37 divide 32745? True Does 36 divide 14580? True Is 80 a factor of 62800? True Is 9896 a multiple of 32? False Is 18 a factor of 16470? True Does 12 divide 204? True Is 1097 a multiple of 9? False Does 12 divide 813? False Does 143 divide 14872? True Is 891 a multiple of 30? False Does 97 divide 6111? True Does 45 divide 2686? False Is 9 a factor of 10350? True Is 27 a factor of 27027? True Is 9 a factor of 13532? False Is 72581 a multiple of 43? False Does 18 divide 4303? False Is 97 a factor of 18839? False Does 9 divide 5058? True Is 7 a factor of 15787? False Is 15296 a multiple of 239? True Does 17 divide 2805? True Does 65 divide 51025? True Does 133 divide 88578? True Does 3 divide 1747? False Does 3 divide 892? False Does 60 divide 22060? False Does 14 divide 5432? True Is 298 a multiple of 27? False Is 94810 a multiple of 38? True Does 13 divide 14443? True Does 10 divide 5230? True Does 33 divide 201? False Does 12 divide 10652? False Does 38 divide 3135? False Does 15 divide 6240? True Is 67 a factor of 25326? True Is 182 a multiple of 7? True Is 1831 a multiple of 27? False Does 17 divide 1173? True Is 36 a factor of 3205? False Is 7 a factor of 5278? True Is 1962 a multiple of 9? True Is 4669 a multiple of 137? False Is 37214 a multiple of 23? True Is 598 a multiple of 46? True Is 16 a factor of 14064? True Is 49 a factor of 4704? True Does 24 divide 624? True Is 14 a factor of 3986? False Is 12 a factor of 804? True Is 68451 a multiple of 14? False Is 2 a factor of 3885? False Does 45 divide 585? True Is 29 a factor of 729? False Is 10 a factor of 647? False Does 9 divide 612? True Does 152 divide 31312? True Does 20 divide 60? True Is 4 a factor of 636? True Is 1936 a multiple of 11? True Is 1030 a multiple of 10? True Does 65 divide 1235? True Does 29 divide 261? True Does 16 divide 32992? True Does 62 divide 4846? False Is 15 a factor of 1020? True Is 18 a factor of 576? True Does 21 divide 31605? True Does 14 divide 3892? True Is 88 a multiple of 26? False Does 6 divide 3788? False Is 16 a factor of 624? True Is 3 a factor of 3933? True Does 2 divide 399? False Does 7 divide 20990? False Is 2 a factor of 85? False Does 232 divide 61480? True Does 132 divide 7220? False Is 9 a factor of 752? False Does 18 divide 1188? True Is 16 a factor of 663? False Is 57 a factor of 171? True Does 26 divide 21034? True Is 3 a factor of 1438? False Does 470 divide 55600? False Is 15 a factor of 54? False Does 8 divide 4393? False Does 22 divide 2332? True Is 1191 a multiple of 20? False Does 3 divide 54? True Is 159 a factor of 29733? True Does 69 divide 113022? True Does 69 divide 5848? False Is 5038 a multiple of 4? False Is 27 a factor of 2757? False Is 55860 a multiple of 181? False Is 9510 a multiple of 15? True Does 15 divide 532? False Does 42 divide 1092? True Does 77 divide 1957? False Does 194 divide 9465? False Is 57 a factor of 33402? True Does 59 divide 11314? False Is 214 a factor of 71853? False Does 13 divide 3237? True Is 28766 a multiple of 69? False Is 120 a factor of 31080? True Is 2789 a multiple of 24? False Is 32 a factor of 48? False Is 30 a factor of 23002? False Does 37 divide 19018? True Is 301 a multiple of 9? False Does 18 divide 7829? False Is 16 a factor of 26? False Does 48 divide 4896? True Is 79749 a multiple of 9? True Is 411 a multiple of 31? False Is 76124 a multiple of 263? False Is 2 a factor of 3? False Does 10 divide 2240? True Does 118 divide 7188? False Does 71 divide 71? True Does 5 divide 2035? True Does 7 divide 2863? True Is 13156 a multiple of 5? False Is 7 a factor of 302? False Does 29 divide 2281? False Is 32848 a multiple of 8? True Does 12 divide 2496? True Does 27 divide 4628? False Is 611 even? False Is 11 a factor of 91476? True Does 23 divide 11224? True Does 7 divide 304? False Is 142 a multiple of 3? False Does 19 divide 1387? True Does 18 divide 2160? True Is 40 a factor of 520? True Is 2 a factor of 8? True Is 108 a factor of 20775? False Is 28 a factor of 46355? False Is 405 a multiple of 77? False Does 17 divide 30? False Does 18 divide 234? True Is 1485 a multiple of 11? True Does 76 divide 1322? False Is 16830 a multiple of 34? True Is 7898 a multiple of 17? False Does 17 divide 80317? False Is 94 a multiple of 10? False Is 13858 a multiple of 43? False Is 7 a factor of 6567? False Does 7 divide 413? True Is 37 a factor of 2849? True Is 180 a multiple of 15? True Is 4 a factor of 44345? False Is 942 a multiple of 24? False Does 8 divide 20464? True Is 21 a factor of 294? True Is 1863 a multiple of 12? False Is 16 a factor of 3504? True Is 82 a factor of 34420? False Is 8 a factor of 3984? True Is 18 a factor of 666? True Does 97 divide 1064? False Does 8 divide 8103? False Is 2224 a multiple of 16? True Is 1155 even? False Is 30 a factor of 769? False Is 2 a factor of 17? False Is 8150 a multiple of 18? False Is 5 a factor of 4294? False Is 8396 a multiple of 50? False Is 23689 a multiple of 31? False Is 1263 a multiple of 73? False Is 19 a factor of 4004? False Does 27 divide 16902? True Does 188 divide 9776? True Is 2810 a multiple of 13? False Is 10 a factor of 8140? True Is 14 a factor of 4214? True Does 11 divide 39853? True Is 3 a factor of 6281? False Is 1504 a multiple of 75? False Is 13 a factor of 6864? True Is 16 a factor of 20928? True Is 72 a factor of 66744? True Is 154 a multiple of 12? False Is 17 a factor of 30370? False Is 28 a factor of 120? False Is 887 a multiple of 43? False Is 97 a factor of 1067? True Does 29 divide 1796? False Is 46 a factor of 508? False Is 17 a factor of 15236? False Is 8150 a multiple of 163? True Is 3899 a multiple of 44? False Is 55 a multiple of 5? True Does 13 divide 2743? True Is 14 a factor of 6608? True Does 13 divide 1588? False Does 13 divide 1846? True Is 27 a factor of 743? False Is 176 a factor of 8624? True Does 18 divide 118? False Is 11427 a multiple of 74? False Is 44892 a multiple of 261? True Is 64151 a multiple of 452? False Is 13987 a multiple of 197? True Is 5668 a multiple of 5? False Is 5920 a multiple of 10? True Does 69 divide 1449? True Is 17 a factor of 242? False Is 37 a factor of 2760? False Does 7 divide 307? False Does 5 divide 10440? True Does 16 divide 929? False Is 14 a factor of 3401? False Is 48 a multiple of 8? True Is 38152 a multiple of 76? True Is 533 a multiple of 13? True Is 1021 a multiple of 18? False Is 65170 a multiple of 15? False Is 96 a factor of 10656? True Does 17 divide 41474? False Is 122 a factor of 32452? True Does 58 divide 2436? True Is 13 a factor of 3491? False Is 166 a factor of 28866? False Is 783 a multiple of 87? True Is 208 a multiple of 26? True Is 11771 a multiple of 100? False Does 8 divide 8803? False Doe	{ "pile_set_name": "DM Mathematics" }
. Calculate the greatest common divisor of 10 and b. 10 Let p(h) = h*3 + 4h*2 + 4. Let a be p(-4). Suppose 0 = 2z - 40 + a. Let t(w) = -w - 3. Let b be t(-5). Calculate the highest common divisor of b and z. 2 Let o(p) = -p*3 + 7p*2 + 11p - 8. Let l be o(8). Calculate the highest common divisor of 4 and l. 4 Let o(n) be the first derivative of -n*2 + 5n + 5. Let c be o(-7). Calculate the highest common divisor of 19 and c. 19 Suppose -4q - 2 + 22 = 0. Suppose 3k = 6, 3v + qk = v + 42. What is the greatest common divisor of v and 24? 8 Let l(u) = -u3 + u2. Let a(s) = 2s3 - s2 - 4s + 2. Let k(o) = -a(o) - 5l(o). Let t be k(2). Calculate the greatest common factor of 42 and t. 14 Suppose 86 = -5x - 4. Let r be (x/21)/((-1)/42). What is the greatest common divisor of r and 54? 18 Suppose 5l - 3l - 10 = 0. Let u be -3 + (l - 0) + 15. What is the greatest common divisor of 187 and u? 17 Suppose 0 = -5r - 4l + 177, -5r - 6l + 180 = -l. What is the greatest common factor of 22 and r? 11 Suppose 3y = y. Let j = 42 - y. Calculate the highest common divisor of 14 and j. 14 Suppose -764 = -3h - h. Suppose -4k + h = -69. Suppose 5 = -5c + k. What is the greatest common divisor of c and 48? 12 Let h = 208 - 78. What is the greatest common factor of 10 and h? 10 Let d be (-4)/(-8)54 - -3. Suppose -2h - 3h + d = 0. What is the highest common divisor of 15 and h? 3 Let k be ((-1)/2)/((-3)/192). Suppose -25 = -2a - 9. What is the highest common factor of a and k? 8 Suppose 0 = -3w - 0w + 3. Suppose -4l - w = -53. Calculate the greatest common factor of l and 91. 13 Let t(v) = 3v*2 - 8v + 21. Let m be t(-7). Calculate the highest common factor of 28 and m. 28 Let p = 184 - 58. Calculate the highest common factor of p and 18. 18 Let u(h) = 2h + 6. Let q be u(-6). Let f be (-24)/(-2)(-16)/q. Calculate the highest common factor of 4 and f. 4 Let k = 41 + -33. Let j = -4 - -6. Let p = k - j. Calculate the greatest common divisor of 30 and p. 6 Suppose -13 = -z - 0z + 3j, 5j = 2z - 24. What is the greatest common factor of 63 and z? 7 Let i = 5 + -2. Let q(u) = u3 - u2 - 5u + 4. Let w be q(i). What is the greatest common divisor of 7 and w? 7 Let q = 9 - 1. Let a(j) = -j2 + 10j + 4. Let s be a(8). What is the highest common divisor of q and s? 4 Let y(g) = 2g2 + g - 8. Let v be y(-4). Calculate the greatest common factor of 5 and v. 5 Suppose c = -2s + 3, -c - 2c = -2s - 1. Let f be (0 - -9)5/15. Suppose -4d = -3d - f. Calculate the greatest common factor of s and d. 1 Let g be (-1)/(12/220)-6. Calculate the greatest common divisor of g and 10. 10 Suppose -4c + 1 = 4i - 7, -8 = -4i - 3c. Let y be (10/25)/(i/20). Calculate the highest common factor of 28 and y. 4 Suppose 0 = 4r - 66 + 6. Let p be -5(-3)/r4. Suppose -5b = -41 - p. What is the highest common factor of b and 9? 9 Let m = 3 - -63. What is the greatest common divisor of 44 and m? 22 Suppose 0l = -4l + 28. Let u = -53 + 81. Calculate the highest common factor of u and l. 7 Suppose -9 = -4b + 47. Let o(g) = 6g + 1. Let d(n) = -n. Let s(t) = -3d(t) + o(t). Let m be s(3). What is the greatest common factor of b and m? 14 Let k(j) = -4j + 4. Let w = -13 + 8. Let c be k(w). What is the highest common factor of 120 and c? 24 Let t(c) = c*3 + 2c*2 - 6c + 7. Let l be t(5). Calculate the highest common factor of l and 19. 19 Suppose 142 = 3v - 4g, 0 = -2v - 4g + 63 + 65. Calculate the greatest common divisor of 6 and v. 6 Let d = 1 - 0. Let b be (-1 + 3 - d) + 16. What is the greatest common divisor of 119 and b? 17 Let f(q) = q*3 - 4q*2 + 5q - 3. Let m be f(3). Suppose 0c - 5c = -75. Let n = c + 12. What is the greatest common divisor of m and n? 3 Let c(a) = a3 + a2 + a + 8. Let w(n) = -n - 4. Let b be w(-4). Let d be c(b). What is the highest common divisor of d and 16? 8 Let c be (-13)/((-28)/(-10) + -3). What is the greatest common factor of c and 26? 13 Suppose 3g - 142 = -2o, 5g = 2o + o + 205. Suppose -7m + 3m = -g. What is the highest common divisor of m and 55? 11 Let y be 2/(-6)24/(-2). Suppose 54 - 6 = yb. What is the greatest common factor of 18 and b? 6 Let z = -12 + 75. Let a be 2/(-2) - (-2 + -17). Let r = a - 9. Calculate the greatest common factor of z and r. 9 Let t = 10 + -7. Let j(d) = -d + 6. Let m(g) = -g + 5. Let y(v) = tm(v) - 2j(v). Let i be y(-5). What is the highest common divisor of i and 12? 4 Let d(v) = -v*3 - 6v*2 - 6v + 1. Let w be d(-5). Suppose 3h + 2r = 136, -2h - h = r - 131. Calculate the highest common factor of w and h. 6 Suppose -3t + 27 = -4a - 0a, 2t - 18 = -a. Let v = t + -6. Let o = v - -11. Calculate the greatest common factor of 7 and o. 7 Let y be (3/2)/(3/(-8)). Let l be 212/18 - y/18. Calculate the highest common divisor of l and 8. 4 Suppose 2f - 35 = -3f. What is the highest common factor of 1 and f? 1 Let p(a) = a2 + 14. Let b be p(0). Let l = b + -10. Suppose 3q = -5o + 4 + 45, -2q = l. What is the greatest common divisor of o and 11? 11 Let o(n) = -n*3 - 3n*2 - 3n + 1. Let d be o(-3). Let i be (-2)/((-4)/42) - 1. Suppose -5t + i = -0t. Calculate the greatest common factor of t and d. 2 Suppose -2n + v + 1 = 0, -n + 3v - 8 = 4. Suppose -nj + 0 = -3. Calculate the highest common divisor of 5 and j. 1 Suppose -3 - 9 = -4t, x = -3t + 107. Calculate the highest common factor of 14 and x. 14 Let m = 118 - 95. Calculate the highest common divisor of 69 and m. 23 Let w(b) = 3b*2 - 2b - 1. Let r be w(3). Let v(z) = 3z2 - 32z - 44. Let g be v(12). Calculate the greatest common factor of r and g. 4 Let z(n) = -n*3 + 8n*2 + 12n - 6. Let o be (-12)/(-5 + 0 + 3). Suppose t - o = 2. Let x be z(t). Calculate the greatest common divisor of 10 and x. 10 Suppose 1625 = -3i - 2i. Let w be (-2)/(-4) - i/10. What is the highest common factor of 11 and w? 11 Let p(m) = 5m2 - 2m - 1. Let f be p(1). Calculate the highest common divisor of f and 16. 2 Suppose -3f = -0f + 9, -5y - 3f - 39 = 0. Let x be (-38)/y(-6)/(-2). Let o = x - 13. Calculate the greatest common divisor of 15 and o. 3 Let f be ((-32)/3)/(26/(-39)). Suppose 0 = 5k - 4 - f. Calculate the greatest common divisor of 4 and k. 4 Suppose 4b - 21 + 9 = 0. Let w(u) = 2u*2 - 2u - 2. Let d be w(2). Calculate the greatest common factor of b and d. 1 Let y be -2 + 1 + (-330)/3. Let l = y - -201. Suppose p + 4p + 2t = 98, 2p - 16 = 5t. Calculate the greatest common factor of p and l. 18 Let m = 7 + -4. Let q = 125 + -45. Suppose -71 = -5o - 4d + md, -5d = -4o + q. Calculate the highest common factor of 165 and o. 15 Let c = 4 + 12. Suppose -j - 1 = 0, 17 = p + 2j - 5. What is the greatest common factor of p and c? 8 Suppose 0 = -11t + 9t + 32. Calculate the greatest common divisor of t and 16. 16 Let v = 19 + -17. Calculate the highest common factor of 10 and v. 2 Suppose -34 + 7794 = 4n. Let v be 1/(-2) + n/8. Calculate the highest common factor of 22 and v. 22 Let s(v) = -v2 - 5v - 6. Let z be s(-4). Let h be (4/(-6))/(z/186). Let m = h - -1. Calculate the greatest common divisor of 7 and m. 7 Suppose 4f - 3t = -4 - 2, -10 = -5f - 5t. Suppose f = -0o + 2o - 360. Suppose -4r = r - o. What is the highest common factor of r and 24? 12 Let m(s) = 34s + 3. Let x be m(-2). Let k be x/(-4) + 3/(-12). Suppose 0 = -w - w + k. Calculate the greatest common divisor of 24 and w. 8 Suppose 5j = -5, 6r - 3r - 26 = -4j. Let o = 31 + -26. What is the highest common divisor of r and o? 5 Let j(b) = 65b2 + 4b - 3. Let k be j(3). Calculate the greatest common divisor of k and 54. 54 Suppose 0 = -4c - 2c + 30. Suppose cw - 124 + 4 = 0. Calculate the greatest common divisor of w and 12. 12 Let d be -14 + (-156)/(-3). What is the highest common factor of 12 and d? 12 Let w(g) = g*2 + 6g - 9. Let j be w(-7). Let d be 4/j - 55-1. Suppose -4l - d = -5r - 3l, -4r = -l - 43. What is the greatest common factor of r and 100? 10 Suppose -2g - 2j = -5j - 19, g - 4j - 2 = 0. Calculate the highest common factor of 154 and g. 14 Let a = 7 - 24. Let q = 65 + a. Suppose -3l - 3w = -8w - 23, -19 = -3*l + w. What is the highest common factor of q an	{ "pile_set_name": "DM Mathematics" }
se 3) in base 6? 15 3 (base 14) to base 9 3 Convert 25 (base 16) to base 13. 2b Convert -22 (base 3) to base 7. -11 Convert -47 (base 8) to base 9. -43 Convert e (base 16) to base 10. 14 a0 (base 14) to base 10 140 -300 (base 5) to base 9 -83 -a (base 12) to base 9 -11 What is -3 (base 16) in base 8? -3 What is 1314 (base 6) in base 10? 334 2 (base 3) to base 6 2 Convert 101 (base 2) to base 3. 12 Convert 13 (base 7) to base 14. a Convert -11 (base 7) to base 6. -12 What is 2 (base 16) in base 8? 2 Convert 4 (base 7) to base 13. 4 Convert 1031 (base 4) to base 3. 2212 7 (base 8) to base 7 10 Convert 11 (base 16) to base 9. 18 What is -8 (base 11) in base 9? -8 -4 (base 14) to base 7 -4 What is 7 (base 15) in base 10? 7 b (base 16) to base 6 15 Convert 12 (base 6) to base 12. 8 Convert -48 (base 9) to base 5. -134 -ca (base 15) to base 3 -21001 Convert 3 (base 14) to base 8. 3 -202 (base 3) to base 14 -16 Convert -15 (base 8) to base 10. -13 What is -26 (base 8) in base 14? -18 Convert 68 (base 13) to base 2. 1010110 -2 (base 6) to base 10 -2 Convert 13 (base 12) to base 13. 12 57 (base 10) to base 2 111001 1211 (base 3) to base 10 49 What is -2 (base 9) in base 2? -10 What is -14 (base 13) in base 7? -23 Convert b2 (base 14) to base 12. 110 What is -10 (base 12) in base 7? -15 Convert -8 (base 16) to base 7. -11 -4 (base 10) to base 4 -10 What is 27 (base 8) in base 6? 35 100001110 (base 2) to base 5 2040 What is 103 (base 8) in base 7? 124 1 (base 7) to base 5 1 What is -1 (base 13) in base 8? -1 Convert 4 (base 16) to base 10. 4 What is -48 (base 11) in base 10? -52 Convert -1130 (base 4) to base 12. -78 106 (base 11) to base 7 241 12 (base 6) to base 16 8 What is -6 (base 14) in base 4? -12 10 (base 10) to base 5 20 Convert -2 (base 12) to base 3. -2 What is 15 (base 9) in base 5? 24 -10 (base 13) to base 10 -13 4 (base 7) to base 2 100 What is -2 (base 12) in base 6? -2 1043 (base 5) to base 6 404 What is 29 (base 13) in base 14? 27 Convert -2 (base 7) to base 13. -2 -3 (base 5) to base 12 -3 -57 (base 11) to base 14 -46 -13 (base 5) to base 2 -1000 What is 2 (base 13) in base 6? 2 -12 (base 8) to base 6 -14 109 (base 12) to base 11 12a -11 (base 15) to base 6 -24 What is 19 (base 10) in base 16? 13 Convert c (base 15) to base 13. c Convert -2 (base 9) to base 5. -2 What is 0 (base 14) in base 10? 0 Convert -20 (base 9) to base 15. -13 What is 10 (base 2) in base 16? 2 -123 (base 4) to base 8 -33 What is -3 (base 6) in base 16? -3 Convert 1 (base 14) to base 6. 1 What is -14a (base 11) in base 10? -175 Convert 4 (base 7) to base 12. 4 Convert 3 (base 8) to base 16. 3 Convert -2 (base 9) to base 8. -2 What is 12 (base 14) in base 4? 100 Convert -20 (base 9) to base 11. -17 What is -102 (base 4) in base 2? -10010 -59 (base 10) to base 9 -65 Convert -1a (base 12) to base 7. -31 What is 30 (base 12) in base 15? 26 1 (base 4) to base 12 1 -52 (base 8) to base 6 -110 3 (base 12) to base 3 10 -67 (base 10) to base 7 -124 Convert -a (base 11) to base 14. -a Convert 303 (base 4) to base 7. 102 Convert 1220 (base 3) to base 12. 43 Convert 0 (base 12) to base 11. 0 1 (base 7) to base 2 1 Convert -2 (base 12) to base 11. -2 What is -6 (base 13) in base 2? -110 What is 1 (base 12) in base 6? 1 What is -6 (base 13) in base 14? -6 Convert 111 (base 2) to base 14. 7 -112 (base 3) to base 5 -24 Convert -12112 (base 3) to base 16. -95 What is -b (base 15) in base 14? -b Convert -1 (base 12) to base 5. -1 What is 23 (base 7) in base 6? 25 What is 1 (base 12) in base 15? 1 b (base 14) to base 9 12 Convert 13 (base 9) to base 16. c What is 1 (base 2) in base 12? 1 What is 110011 (base 2) in base 8? 63 What is -10 (base 3) in base 12? -3 6 (base 7) to base 16 6 -11221 (base 3) to base 14 -97 What is 2 (base 13) in base 3? 2 10110 (base 3) to base 4 1131 Convert -6 (base 7) to base 5. -11 -2 (base 8) to base 5 -2 What is -8 (base 16) in base 7? -11 What is -e (base 15) in base 7? -20 What is 3 (base 4) in base 2? 11 Convert -1 (base 8) to base 2. -1 What is 27 (base 12) in base 3? 1011 Convert 5 (base 14) to base 7. 5 2 (base 11) to base 10 2 -21 (base 10) to base 4 -111 What is -10 (base 14) in base 9? -15 Convert 32 (base 12) to base 16. 26 What is -14 (base 14) in base 4? -102 2102 (base 4) to base 2 10010010 1 (base 14) to base 3 1 -62 (base 11) to base 6 -152 What is 11a (base 12) in base 4? 2212 What is 1 (base 3) in base 11? 1 17 (base 11) to base 5 33 Convert -2a (base 16) to base 6. -110 Convert -6 (base 10) to base 16. -6 What is -540 (base 6) in base 15? -d9 Convert 8 (base 11) to base 2. 1000 What is 0 (base 9) in base 16? 0 -6 (base 9) to base 10 -6 Convert 37 (base 14) to base 5. 144 154 (base 13) to base 8 356 Convert 4 (base 14) to base 11. 4 Convert -2 (base 14) to base 4. -2 What is 1231 (base 5) in base 10? 191 What is 70 (base 11) in base 12? 65 What is -153 (base 11) in base 8? -263 What is 2b (base 13) in base 12? 31 26 (base 10) to base 12 22 6 (base 12) to base 2 110 Convert -62 (base 8) to base 7. -101 5 (base 12) to base 5 10 What is 3 (base 12) in base 5? 3 -95 (base 11) to base 14 -76 What is -10 (base 16) in base 3? -121 11 (base 16) to base 5 32 21 (base 13) to base 7 36 Convert 2100 (base 3) to base 10. 63 -1 (base 5) to base 12 -1 Convert -5 (base 11) to base 3. -12 What is 2122 (base 4) in base 9? 181 What is 4 (base 12) in base 15? 4 What is -1 (base 3) in base 11? -1 -97 (base 12) to base 13 -8b What is 2202 (base 3) in base 11? 68 -41 (base 13) to base 11 -49 1010 (base 2) to base 5 20 111 (base 3) to base 11 12 104 (base 10) to base 13 80 1 (base 2) to base 4 1 Convert 2 (base 3) to base 8. 2 Convert 3 (base 6) to base 4. 3 -4 (base 10) to base 12 -4 What is -3 (base 9) in base 3? -10 -104 (base 13) to base 8 -255 28 (base 12) to base 13 26 Convert 11 (base 14) to base 7. 21 What is 10 (base 5) in base 16? 5 -104 (base 7) to base 4 -311 Convert 4 (base 13) to base 9. 4 What is 100110 (base 2) in base 16? 26 What is 10 (base 5) in base 13? 5 Convert 3 (base 12) to base 9. 3 Convert 5 (base 13) to base 7. 5 Convert 12 (base 3) to base 10. 5 What is -148 (base 15) in base 4? -10211 -2 (base 4) to base 9 -2 44 (base 10) to base 2 101100 What is 10 (base 4) in base 12? 4 Convert 1 (base 5) to base 7. 1 -2 (base 12) to base 10 -2 Convert 6 (base 7) to base 9. 6 -56 (base 9) to base 5 -201 What is -1 (base 3) in base 14? -1 Convert 0 (base 9) to base 16. 0 What is 13 (base 12) in base 16? f Convert 133 (base 7) to base 16. 49 Convert 8 (base 11) to base 6. 12 Convert 424 (base 8) to base 6. 1140 Convert 2303 (base 4) to base 5. 1204 Convert 5 (base 8) to base 16. 5 -3 (base 14) to base 12 -3 Convert 0 (base 7) to base 5. 0 3 (base 15) to base 5 3 What is 23 (base 9) in base 4? 111 What is 34 (base 9) in base 7? 43 -1212 (base 3) to base 15 -35 What is -7 (base 8) in base 14? -7 -1 (base 8) to base 12 -1 306 (base 11) to base 10 369 What is 0 (base 13) in base 5? 0 Convert -3 (base 11) to base 9. -3 What is -211 (base 4) in base 8? -45 Convert 110 (base 2) to base 6. 10 Convert -20 (base 9) to base 6. -30 -33 (base 14) to base 13 -36 What is 1 (base 13) in base 2? 1 What is -3 (base 8) in base 4? -3 -10 (base 9) to base 6 -13 What is -241 (base 5) in base 12? -5b Convert -3 (base 4) to base 3. -10 Convert -4 (base 6) to base 15. -4 1 (base 13) to base 14 1 -52 (base 7) to base 13 -2b Convert 9b (base 14) to base 2. 10001001 What is 7 (base 15) in base 3? 21 1 (base 15) to base 2 1 Convert c (base 13) to base 11. 11 -2 (base 14) to base 15 -2 110 (base 3) to base 15 c 6 (base 13) to base 6 10 16 (base 15) to base 11 1a What is 20 (base 15) in base 16? 1e Convert -44 (base 10) to base 5. -134 What is -22 (base 4) in base 16? -a What is -4 (base 5) in base 10? -4 -11 (base 15) to base 10 -16 -5 (base 13) to base 6 -5 Convert 7 (base 11) to base 15. 7 What is 25 (base 11) in base 12? 23 Convert -7 (base 8) to base 15. -7 Convert -30 (base 5) to base 12. -13 What is -2 (base 8) in base 9? -2 What is -3 (base 14) in base 5? -3 -3 (base 14) to base 9 -3 111 (base 6) to base 12 37 What is -100 (base 6) in base 11? -33 Convert 3 (base 16) to base 8. 3 What is 1232 (base 4) in base 2? 1101110 -123 (base 4) to base 7 -36 What is -22 (base	{ "pile_set_name": "DM Mathematics" }
he second derivative of h(i). Let s(q) = 2q - 5q + 5q. What is s(u(v))? 78v Let n(x) = 5866080x - 34340. Let f(h) = 1025h - 6. Let l(g) = 34340f(g) - 6n(g). Let q(k) = k. Calculate l(q(m)). 2020m Let f(x) = 11x - 572x2 + 574x*2 - 11x. Let g(i) = -526i. Give f(g(v)). 553352v*2 Let k(l) = 19l. Suppose -48 = -15w + 5d - 13, -3d = -3w + 21. Let r(v) be the second derivative of 0v2 + 0v*3 + w - 1/6v*4 + v. Calculate k(r(h)). -38h*2 Let g(l) = -139l. Let q(k) = 38053k2. What is q(g(j))? 735222013j*2 Let h(b) = -95b2. Let v(l) be the second derivative of l6/360 + l*4/12 - 98l*2 + 39l. Let d(p) be the third derivative of v(p). Give h(d(t)). -380t2 Let r(i) = i2. Let k(l) be the third derivative of -l5/30 + 176l*3/3 + 10l*2 - 1. Give r(k(w)). 4w*4 - 1408w*2 + 123904 Let x(v) = 190v*2 + 211v*2 + 40v*2. Let l(n) = 5n*2. Calculate x(l(b)). 11025b*4 Let k = -178 + 222. Let w(o) = -ko + 13o + 0o. Let u(f) = -2f2. Give u(w(d)). -1922d2 Let t(d) be the first derivative of -d3/3 - 7. Let o(y) = 109y + 8. Let u(w) = 218w + 14. Let f(r) = 7o(r) - 4u(r). Give f(t(z)). 109z2 Let l(t) = 9t + t - 6t - 5t - t. Let g(o) be the third derivative of 0 + 0o3 - 4o*2 + 0o - 1/24o4. Give l(g(f)). 2f Let l(t) = 19655313t - 4. Let d(g) = -2g*2. Give l(d(f)). -39310626f*2 - 4 Let w(b) = 31989b. Let v(d) = -1584d. What is w(v(a))? -50670576a Let b(h) = 6791h2 - 16. Let r(p) = 31p. Give b(r(v)). 6526151v2 - 16 Let p(o) = -12o. Let l(s) = -7074985s2. Give l(p(w)). -1018797840w2 Let t(v) be the first derivative of -v3/3 + 3215. Let i(j) = 280j. Determine i(t(c)). -280c*2 Let a(s) = -47s - 17. Let d(z) = 3z - 46. What is a(d(u))? -141u + 2145 Let s(h) be the second derivative of 14 - 4h + 0h*2 + 331/12h*4 + 0h*3. Let a(o) = -2o*2. Determine a(s(r)). -219122r*4 Let n(m) be the second derivative of -14m*4 + 548m. Let w(h) = -h. Determine n(w(d)). -168d2 Let p(b) = -12b*2. Let u(w) = -2w*2. Let s(o) be the third derivative of -13o*5/60 - 12o*2 + 3o. Let t(d) = -2s(d) + 14u(d). Determine p(t(y)). -48y4 Let z(v) = 81158v. Let g(n) = 232n2. Determine z(g(i)). 18828656i*2 Let l(j) = -58j - 1. Let r(q) = -64q - 44. Let a(i) = 24i + 15. Let p(n) = -11a(n) - 4r(n). Calculate p(l(y)). 464y + 19 Let c(j) = -j2. Let b be (-7 + 3/1)9/(-18). Let n(g) = 374 - 764 - gb + 376. What is c(n(m))? -m4 - 28m2 - 196 Let o(m) = 58m*2 - 10320m. Let c(z) = -2z2. Give o(c(h)). 232h*4 + 20640h*2 Let d(t) = -3t2. Let c(r) = r3 - 26r2 - 18r - 94. Let g be c(27). Let z(l) = gl - 1 - 170l + 1. Calculate z(d(o)). 63o2 Let f(b) = -5b + 100. Let i(o) = -o + 13. Let w(k) = -f(k) + 4i(k). Let s(c) = -2c. Give w(s(d)). -2d - 48 Let v(r) = 396r + 24. Let b(o) = 331o + 20. Let y(c) = -6b(c) + 5v(c). Let f(t) = 0 - 1 + 0. Let k(l) = 3l + 2. Let n(m) = -2f(m) - k(m). Give y(n(d)). 18d Let t(w) = -w*2 - 43w + 682. Let z be t(-55). Let h(f) be the first derivative of 0f2 + z + 0f + 4/3f3. Let n(m) = 2m*2. What is n(h(b))? 32b*4 Let p(h) = 30h*2 - h. Let q(b) = 120600b. What is q(p(k))? 3618000k2 - 120600k Let p(i) = 24i2. Let u(z) be the third derivative of -11z5/30 + z2 + 377z. Give u(p(a)). -12672a4 Let l(z) be the third derivative of -z5/20 - 966z2. Let x(q) = 0 + 0 + 24q. Determine l(x(i)). -1728i2 Let a(w) = -2843w - 70. Let o(r) = -441r2. Give a(o(x)). 1253763x*2 - 70 Let y(c) be the second derivative of 3c*3/2 - 1910c. Let u(k) = 42k2 - 3k. Give y(u(h)). 378h2 - 27h Let q = 1139 + -1137. Let h(d) be the second derivative of 0 + 1/6d3 - 7d + 0dq. Let v(z) = 46z*2. What is h(v(b))? 46b*2 Let m = 29 + -24. Suppose mh = 3j + 6, j + 3 = 5h - 3j. Let r(p) = -hp + 3p2 + 0p + 3p. Let v(w) = -5w. Determine r(v(n)). 75n2 Let o(x) = -276x. Let t(d) be the first derivative of -9d2/2 - 5708. What is t(o(v))? 2484v Let y(i) = -149i - 158i + 302i. Let l(m) = 1 + 3 - 4 + 12m*2. Calculate y(l(p)). -60p*2 Let a(t) = t. Let y(k) be the third derivative of 26/15k*5 + 0 + 0k*4 - 38k*2 + 0k*3 + 0k. Calculate a(y(z)). 104z2 Let q(f) = 6f*2 - 181023f. Let l(g) = 2g. Determine q(l(h)). 24h*2 - 362046h Let x(i) = -7i. Suppose 5m + 435 = 1555. Let l(t) = 1 + mt - 1 - 226t. Give x(l(v)). 14v Let n = 189 - 307. Let d = n + 129. Let g(r) = -26r*2 + 16r*2 + dr*2. Let z(k) = 19k. Give z(g(p)). 19p2 Let q(o) be the first derivative of o2 + 3010. Let x(n) = -14680n*2. Determine x(q(w)). -58720w*2 Let p(v) be the first derivative of 9v*2/2 + 1093. Let r(b) = -8b - 2. Calculate p(r(w)). -72w - 18 Let x(b) = 3b*2. Let c(m) = 19m - 7. Let y(j) = -3j - 3. Let g(r) = c(r) + 2y(r). Give x(g(f)). 507f2 - 1014f + 507 Let w(m) = 5m - 10m + m + 4m + 2m. Let c(l) = 2l - 346. What is c(w(g))? 4g - 346 Let w(o) = -23o. Let z(r) = -375r*2 - 88r - 11. Let n(s) = 188s2 + 48s + 6. Let v(u) = -11n(u) - 6z(u). Calculate v(w(a)). 96278a2 Let s(d) be the third derivative of -107d*5/60 + 98d2. Let n(h) = h2 - 12. Let m(g) = 2g2 - 21. Let i(c) = -4m(c) + 7n(c). Give i(s(o)). -11449o*4 Let a(q) = 127912q*2 - 15399q + 1711. Let g(j) = -897j2 + 108j - 12. Let b(x) = -12a(x) - 1711g(x). Let t(k) = -11k2. Determine t(b(z)). -344619z4 Let c(g) be the third derivative of g5/60 + 2g2. Let y(w) = -3w*2 + 10. Let h(j) = -244j*2 + 610. Let b(a) = h(a) - 61y(a). Calculate b(c(q)). -61q4 Let z(o) be the first derivative of 2o*3/3 - 173. Let w(q) = -1 - q + 9q + 10q. Determine z(w(s)). 648s*2 - 72s + 2 Let d(p) = -43p. Let i(z) = 72z + 1896. Let s(t) = 14t + 395. Let l(m) = 5i(m) - 24s(m). What is d(l(y))? -1032y Let p(x) = -5604x + 1526. Let q(r) = 2r. Determine q(p(h)). -11208h + 3052 Let t(q) = -2 + 2q*2 + 2 - 4q*2. Let v(b) = -b + 302 - 28b - 777 + 475. Give t(v(x)). -1682x2 Let b(l) = 23l*2 - 8l*2 + 8l2. Let i(s) = s2 - 12s. Suppose -30h - 4h + 34 = 0. Let g(z) = -2z. Let v(r) = hi(r) - 6g(r). Calculate b(v(j)). 23j4 Let b be -38/639/(-26). Let o(f) = 2f*2 + 17f - 5f - 7f + bf. Let j(q) = -5q*2. Calculate o(j(p)). 50p*4 - 55p*2 Let l(w) = -2w + 2843. Let x(o) = 1188 + 2o - 2390 + 1202. What is l(x(r))? -4r + 2843 Let w(g) = -17g2. Let o(u) be the first derivative of -164 + 11/3u*3 + 0u + 0u2. Calculate w(o(y)). -2057y*4 Let c(s) be the first derivative of -6s*2 + 1. Let n(q) = 0q + 2q - 13q + 14q - 2q. Give n(c(k)). -12k Let s(a) = 21a. Let n = 865 - 727. Let y(d) = d - 138 + 7d + n. Determine y(s(k)). 168k Let a(q) = -q - 46. Suppose -5t + 63 = 2t. Let g(y) = ty2 - 3y*2 - 11y*2 + 4y2. What is a(g(x))? x2 - 46 Let v(d) = -12d2. Suppose 0o + 16 = 2o. Let y(l) = l3 - 7l*2 - 7l - 6. Let q be y(o). Let z(s) = -2s2 - s2 - sq. Calculate v(z(t)). -192t*4 Let w(f) = -47f*2 + 13f*2 + 36f*2. Let x(p) = 9p - 109. Let n(j) = 8j - 108. Let i(o) = -6n(o) + 5x(o). What is i(w(q))? -6q*2 + 103 Let t(p) = 1 + 5p*2 + 2p - 1. Let j(g) = -3g - 5. Let u(x) = -436 + 875 + 2x - 436. Let d(n) = -3j(n) - 5u(n). Calculate d(t(v)). -5v2 - 2v Suppose 10 = c - 13. Suppose 0 = 194b - 83b - 94b - 34. Let g(j) = bj - 23 + c. Let x(d) = 17d. Determine g(x(z)). 34z Let w(q) = -7q2 - 7q + 2. Let f(b) = 3b - 44. Let p(l) = -2l + 33. Let a(o) = -3f(o) - 4p(o). Determine w(a(d)). -7d2 + 7d + 2 Let t(a) = -2a - 5. Let r(x) be the first derivative of -126 - 10x*2 - 8x*2 - 9x*2 + 24x*2. Give t(r(c)). 12c - 5 Let p(o) = 1550o - 3. Let x(d) = 2d*2 + 1962d + 2050d - 4012d. Calculate x(p(g)). 4805000g2 - 18600g + 18 Let p(t) = 4t - 296. Let d(x) = -6516x. Calculate d(p(v)). -26064v + 1928736 Let c(m) = -277210m*2 + 138618m*2 + 138779m*2. Let w(j) = -10j*2 - 4j. Give w(c(n)). -349690n4 - 748n*2 Let i(j) = 40j + 24. Let b(s) = 7s + 4. Let y(c) = 6b(c) - i(c). Let k(h) be the third derivative of 79h4/24 - h2. Determine y(k(f)). 158f Let h(t) = 453t - 453t + t*2. Let p(o) = -23o**2 - 22. Determine h(p(k))	{ "pile_set_name": "DM Mathematics" }
ere in 1583.885 millilitres? 1.583885 Convert 43360.28ns to seconds. 0.00004336028 How many months are there in 34/5 of a millennium? 81600 How many seconds are there in 1/4 of a hour? 900 Convert 284154.3 microseconds to nanoseconds. 284154300 How many seconds are there in 1/15 of a hour? 240 Convert 0.2030429ug to milligrams. 0.0002030429 Convert 1859.814 decades to millennia. 18.59814 What is 85.00361 millennia in centuries? 850.0361 How many millilitres are there in 27/5 of a litre? 5400 How many nanograms are there in one fifth of a microgram? 200 How many milliseconds are there in 12/25 of a second? 480 What is five quarters of a litre in millilitres? 1250 What is 82793.02ug in tonnes? 0.00000008279302 How many millilitres are there in 0.463525 litres? 463.525 How many micrograms are there in 541340.1ng? 541.3401 What is 43/2 of a kilogram in grams? 21500 How many grams are there in twenty-one quarters of a kilogram? 5250 What is 5.955812 millilitres in litres? 0.005955812 Convert 0.4822512 micrograms to grams. 0.0000004822512 How many months are there in 714386.3 centuries? 857263560 How many minutes are there in 61/3 of a day? 29280 How many millilitres are there in seven quarters of a litre? 1750 Convert 57.74916ng to tonnes. 0.00000000000005774916 How many millilitres are there in twenty-one eighths of a litre? 2625 How many kilometers are there in 176.7502nm? 0.0000000001767502 What is 2531.17 kilograms in nanograms? 2531170000000000 What is 560554.7 kilometers in micrometers? 560554700000000 What is six fifths of a kilometer in meters? 1200 Convert 25564.257 months to millennia. 2.13035475 What is eighteen fifths of a second in milliseconds? 3600 What is 58.63052ug in milligrams? 0.05863052 What is twenty-five quarters of a meter in millimeters? 6250 What is thirteen fifths of a tonne in kilograms? 2600 What is twenty-seven quarters of a millennium in months? 81000 What is 7.349053m in centimeters? 734.9053 How many months are there in 4/15 of a decade? 32 How many grams are there in 7698.512 milligrams? 7.698512 What is fourty-nine fifths of a tonne in kilograms? 9800 How many nanograms are there in 9/25 of a microgram? 360 What is 9/10 of a hour in minutes? 54 What is 52.00832 years in centuries? 0.5200832 What is 0.042988mm in nanometers? 42988 How many millilitres are there in eighteen fifths of a litre? 3600 What is 7435.641 grams in tonnes? 0.007435641 Convert 443.8915 days to hours. 10653.396 What is sixty-seven thirds of a year in months? 268 How many centimeters are there in one fifth of a meter? 20 What is 208113.111s in days? 2.4087165625 How many months are there in 38645.88 millennia? 463750560 How many seconds are there in 568663.2 days? 49132500480 How many micrograms are there in 3/10 of a milligram? 300 How many grams are there in 3/40 of a kilogram? 75 Convert 109566.7t to milligrams. 109566700000000 What is three fifths of a decade in months? 72 Convert 292.0512ng to grams. 0.0000002920512 How many years are there in 7/2 of a century? 350 How many hours are there in 101292.6 days? 2431022.4 What is four thirds of a day in hours? 32 Convert 772034.8ml to litres. 772.0348 How many days are there in 26131420.8ms? 0.302447 How many minutes are there in fifty sevenths of a week? 72000 What is 0.0850979 days in hours? 2.0423496 How many years are there in 6/5 of a decade? 12 What is 480552.4 decades in centuries? 48055.24 What is 41862.08 hours in nanoseconds? 150703488000000000 What is 0.6023399l in millilitres? 602.3399 How many micrograms are there in 46/5 of a milligram? 9200 How many nanometers are there in 1/20 of a micrometer? 50 What is 77.9746 decades in millennia? 0.779746 How many kilometers are there in 0.6765843nm? 0.0000000000006765843 What is 302.1871 years in decades? 30.21871 What is 1.71243m in millimeters? 1712.43 What is 5/4 of a week in hours? 210 What is one sixteenth of a gram in micrograms? 62500 How many millilitres are there in fifty-two fifths of a litre? 10400 What is six fifths of a litre in millilitres? 1200 Convert 5598.648m to centimeters. 559864.8 How many milligrams are there in seven halves of a gram? 3500 How many nanograms are there in 86872.54 grams? 86872540000000 Convert 3.172605ng to grams. 0.000000003172605 What is fifty-two fifths of a minute in seconds? 624 What is 462.9868 minutes in microseconds? 27779208000 What is 1/10 of a micrometer in nanometers? 100 What is 5.325649 litres in millilitres? 5325.649 How many nanograms are there in one twentieth of a milligram? 50000 Convert 0.7448735mg to nanograms. 744873.5 How many micrometers are there in 11/2 of a millimeter? 5500 What is 273.2987 tonnes in kilograms? 273298.7 What is five quarters of a litre in millilitres? 1250 Convert 238.121991 seconds to days. 0.0027560415625 Convert 1.0203243s to minutes. 0.017005405 What is 9/14 of a week in minutes? 6480 What is 9.856712 years in decades? 0.9856712 How many seconds are there in 512.5395 weeks? 309983889.6 How many millilitres are there in 0.8480238 litres? 848.0238 How many millilitres are there in 3.034955 litres? 3034.955 How many millilitres are there in twenty-nine fifths of a litre? 5800 What is 3/40 of a litre in millilitres? 75 How many hours are there in 1/4 of a day? 6 How many nanometers are there in 7.797036 micrometers? 7797.036 Convert 4.9886955us to days. 0.00000000005773953125 How many seconds are there in eleven tenths of a day? 95040 How many litres are there in 7.276483ml? 0.007276483 What is six fifths of a microgram in nanograms? 1200 What is 28.23917 micrograms in milligrams? 0.02823917 How many nanoseconds are there in 3/10 of a microsecond? 300 What is 8.728286 kilograms in milligrams? 8728286 What is 11170.89 hours in seconds? 40215204 Convert 8335.897 grams to nanograms. 8335897000000 What is 0.2070399 centuries in years? 20.70399 How many seconds are there in twenty-nine thirds of a minute? 580 How many meters are there in 421.974 kilometers? 421974 How many seconds are there in 1/24 of a hour? 150 Convert 119.571mm to nanometers. 119571000 How many minutes are there in 32/5 of a day? 9216 What is 84.7379l in millilitres? 84737.9 What is fifty-one halves of a litre in millilitres? 25500 What is 3194.295s in microseconds? 3194295000 What is 1/4 of a litre in millilitres? 250 How many months are there in 1/16 of a century? 75 What is nine tenths of a litre in millilitres? 900 What is 822.4642 micrometers in meters? 0.0008224642 How many minutes are there in thirteen quarters of a hour? 195 How many months are there in 694.1841 years? 8330.2092 How many seconds are there in twenty-three thirds of a hour? 27600 How many millilitres are there in thirty-two fifths of a litre? 6400 Convert 0.2356605ml to litres. 0.0002356605 What is 37/5 of a micrometer in nanometers? 7400 How many centimeters are there in 294.9914 meters? 29499.14 How many millilitres are there in thirteen eighths of a litre? 1625 What is 3/8 of a day in hours? 9 What is one quarter of a litre in millilitres? 250 What is 3.976409us in milliseconds? 0.003976409 How many millimeters are there in fourty-eight fifths of a meter? 9600 How many millimeters are there in thirty-one halves of a meter? 15500 Convert 2003.393kg to micrograms. 2003393000000 What is 13.88265 decades in millennia? 0.1388265 Convert 389.338362 minutes to weeks. 0.0386248375 How many hours are there in 2155.8267 minutes? 35.930445 What is 331.1209ml in litres? 0.3311209 What is 13540.77um in kilometers? 0.00001354077 How many millilitres are there in 61/2 of a litre? 30500 What is 1/20 of a hour in seconds? 180 Convert 210226.35 months to millennia. 17.5188625 What is seven quarters of a gram in milligrams? 1750 How many months are there in 33597.39 decades? 4031686.8 Convert 59055.01 hours to microseconds. 212598036000000 What is 7/2 of a year in months? 42 What is 19026.678 months in decades? 158.55565 Convert 744.0836ng to milligrams. 0.0007440836 What is three fifths of a milligram in micrograms? 600 How many seconds are there in 17/4 of a minute? 255 How many seconds are there in 2/63 of a week? 19200 How many millilitres are there in 6/25 of a litre? 240 What is 0.404562l in millilitres? 404.562 What is 67.585	{ "pile_set_name": "DM Mathematics" }
ose 20a + 285 = 23a. Let k(n) = -2n2 + 23n - 24. Calculate the remainder when a is divided by k(6). 11 Suppose 231 = 104t - 115t. Calculate the remainder when (-11409)/t - (-14)/(-49) is divided by 42. 39 Suppose -16j - 12308 = -84j. Calculate the remainder when j is divided by 115. 66 Let a = -3045 - -3466. Calculate the remainder when 1263 is divided by a. 0 Let a(r) = -99r3 + 12r*2 + 11r - 2. Calculate the remainder when 263 is divided by a(-1). 67 Suppose -4f + 3f + 5 = 0. Suppose -fr = 4p - 20 - 17, -2r = 3p - 26. Calculate the remainder when 27 is divided by (-20)/(p/(-2 + -2)). 7 Let l(u) = -49u2 - 23u - 62. Let p be l(-3). Let i = -414 - p. What is the remainder when 39 is divided by i? 19 Let g = -306 - -336. Calculate the remainder when g is divided by ((-3)/(-2))/(289/238 + -1). 2 Let c(o) = -3o + 2o - 78o2 + 170o2 - o3 + 0o - 80o*2 - 78. Calculate the remainder when c(10) is divided by 35. 7 Let a = 9732 + -9598. What is the remainder when 657 is divided by a? 121 Let l(o) = -12 + o + 2 + 5o + 28o. Calculate the remainder when 231 is divided by l(2). 57 Let p = -1182 + 9346. Calculate the remainder when p is divided by 6. 4 Let j be (8(-2)/(-4))/(14/91). Suppose 0 = -5z + 129 + j. What is the remainder when 556 is divided by z? 29 Calculate the remainder when ((-4 - -6) + 0)(-64719)/(-54) is divided by 30. 27 What is the remainder when 713 + (12 - -52)/16 is divided by 51? 3 Let n(x) = x*3 + 10x*2 - 39x - 19. What is the remainder when n(-12) is divided by 54? 53 Calculate the remainder when 30 is divided by 124/93(17 - -1). 6 Let a(h) = 8h - 56. Let v(z) = 16z - 15. Let p be v(6). Let y = p + -36. Calculate the remainder when y is divided by a(9). 13 Let g(b) = -2b*2 - 23b - 26. Let u(r) be the third derivative of -r4/24 + r3/2 - 7r2. Calculate the remainder when g(-8) is divided by u(-5). 6 Let a = 20404 - 20226. What is the remainder when 1251 is divided by a? 5 Calculate the remainder when 1123 is divided by (827 - -1)/(1/2 - (-9 - -8)). 19 Let i = -2740 + 2890. What is the remainder when 897 is divided by i? 147 Suppose -606g = -645g + 229749. Calculate the remainder when g is divided by 20. 11 Suppose 7 - 2 = 5p - 5v, -9 = -2p - 5v. Suppose 2t - 25 = -pr + r, -4t + 35 = r. Suppose -s - 2s = -126. What is the remainder when s is divided by r? 12 Let d(l) = -15l - 53. Suppose 2t + 4q - 60 = 0, -3t + 4q - 11 = -71. What is the remainder when d(-16) is divided by t? 19 Let i(k) = k*3 - 18k*2 + 7k - 21. Let z be i(18). What is the remainder when 177 is divided by (-598/z)/((-2)/6)? 9 Calculate the remainder when 2305 is divided by (-7)/((4/6)/(-11 - -9)). 16 Calculate the remainder when -14 - -16 - (1 + -635) is divided by 313. 10 Let d be 8 + -8 + (4 - 0). Suppose -69 - 59 = -dt. Suppose -5o + 4w + 645 = -w, 0 = 5w + 15. What is the remainder when o is divided by t? 30 Let l be (455 - 1/(-1))(-10)/20. Let b = l + 231. What is the remainder when 24 is divided by b? 0 Suppose -w - 5d = -41, 2d + 2d - 16 = 0. Suppose -1047t + 1371t = 12312. Calculate the remainder when t is divided by w. 17 Let i = 11568 - 11557. Calculate the remainder when 1032 is divided by i. 9 Suppose -8 = -2z - 2. Suppose -g - 2f - z = 3f, 5g - 39 = 2f. Suppose 5l - 22 + g = 0. What is the remainder when 13 is divided by l? 1 Let f be ((-1)/(-3))/(4/(-168)). Let i be (-1)/(4/3)232. Calculate the remainder when 22 is divided by i/f - 4/(56/6). 10 Let i be 6/(-8) + (-66)/(-24). Suppose -it = 2t - 12. Suppose -5v = w - 23, -115 = -5w - v - tv. What is the remainder when 67 is divided by w? 21 Suppose 0 = -48u + 2726 + 154. Calculate the remainder when 5638 is divided by u. 58 Let p(z) = z + 64. Let h be p(15). Suppose v + 4v = 2w + 148, 0 = -4w + 5v - 296. Let q = w + h. Calculate the remainder when 18 is divided by q. 3 Suppose -558m - t = -560m + 68, 5t + 30 = 0. Calculate the remainder when -3((-61)/3 + -2) is divided by m. 5 Suppose -6g - 36g = -g - 3813. What is the remainder when 154 is divided by g? 61 Suppose 238 = -6b + 7b. Let x(w) = w*3 + 21w2 - w + 19. Calculate the remainder when b is divided by x(-21). 38 Let o(q) = -q3 - 10q2 - 9q - 6. Let j be o(-8). What is the remainder when 137 is divided by (2 - j/(-7))/((-8)/56)? 41 Let q(t) = 2t2 - 239t + 6743. Calculate the remainder when q(45) is divided by (-36)/(-10) + 10/25. 2 What is the remainder when 7 + -7 + -1 + (1 - -3619) is divided by 1203? 10 Let k = -1472 + 1458. Let q = 4 - 7. Calculate the remainder when 62 is divided by 1q + 4(-91)/k. 16 Suppose -1215a = -1391a + 31680. Calculate the remainder when 699 is divided by a. 159 Suppose 2l - 4 = -t, -2l + 13 = 5t - 7. Suppose -5x + 8 - 48 = -5q, 4 = -q + tx. What is the remainder when (-14(-19)/266)/((-1)/(-31)) is divided by q? 7 Let b(p) = p2 + 1. Let d(h) = 7h*2 + 4. Let j(o) = -3b(o) + d(o). Let f be 0 - -6 - (7 - 2). What is the remainder when 24 is divided by j(f)? 4 Let q(y) = 12y2 + 65y + 394. Calculate the remainder when q(-8) is divided by 110. 92 Let c = -8590 - -9175. Calculate the remainder when c is divided by 7. 4 Let k = 132 - 129. Suppose -kj + 47 + 73 = 0. Suppose 0 = 6c - 14 - j. Calculate the remainder when 69 is divided by c. 6 Suppose k = 4k, 3j = 9k - 6k + 198. Calculate the remainder when 194 is divided by j. 62 Let d(l) = -l*3 - 2l*2 - 2l + 3. Let c be -5 - 1(-3 + 1). What is the remainder when 158 is divided by d(c)? 14 Suppose 0 = 2c + 4t + 70, -4 - 22 = c - t. Calculate the remainder when 75 is divided by (17 + c)(-39)/18. 23 Suppose -3480 + 9681 = 3o. Suppose -13i + 0i + o = 0. What is the remainder when i is divided by 20? 19 Suppose -208 = 3f - 5f. Let s = f + -69. Calculate the remainder when s is divided by (0 - -3) + 4 + 2. 8 Let s(h) = -h2 - 48h - 362. What is the remainder when 154 is divided by s(-35)? 61 Suppose 370n = 3k + 367n - 1275, -k = 3n - 449. What is the remainder when k is divided by 37? 24 Suppose -41g = 133g + 38g - 8056. Let o(j) = 2j*2 - 4j - 5. What is the remainder when g is divided by o(-3)? 13 Suppose 4a - 567 = -5f, 3f - 1 = 5a + 354. Suppose -3w = -m + 7, 56 - 2 = 5m + 4w. What is the remainder when f is divided by m? 5 Suppose -2l = -l - 69. Calculate the remainder when (-630)/3(0 - 1) + (0 - 8) is divided by l. 64 Let t be (-3 + 22/5)5. Suppose -tb + 6b = -40. Suppose 5l - 794 = j, -5j = -14l + 16l - 323. Calculate the remainder when l is divided by b. 39 Suppose 6l - l = 270. Suppose -38b = -18b - 440. What is the remainder when l is divided by -4 + b + (-48)/12? 12 Let n(q) = 29q - 2. Let v be n(1). Let u(k) = -14 + v + 7k - 14. Calculate the remainder when u(3) is divided by 11. 9 Suppose -5f + 2f = -2o + 81, 2o = 2f + 78. Let d(v) = 3v3 - 8v*2 + 10v - 8. What is the remainder when o is divided by d(3)? 5 Suppose -8058 = -97i + 1168 + 8331. What is the remainder when i is divided by 95? 86 Suppose -67y + 69y = -256. Let b = -105 - y. Calculate the remainder when 61 is divided by b. 15 Let s = -9071 - -9130. What is the remainder when 249 is divided by s? 13 Let s be (27/18)/((-6)/(-20)). Suppose sl - 168 + 148 = 0. Suppose -33 = -lc + 11. What is the remainder when 43 is divided by c? 10 Let b(h) be the second derivative of 7/20h*5 - 1/6h*4 + 0 + h - 3/2h*2 + 2/3h*3. Calculate the remainder when 17 is divided by b(1). 5 Let f be 8/10 - (-936)/(-20). Let r be 1281/(-33) + (-6)/33. Let z = r - f. Calculate the remainder when 27 is divided by z. 6 Suppose 22y = 17y + 130. Suppose -2a + 110 = 2u, u + 3a - 40 = 25. What is the remainder when u is divided by y? 24 Let l = -1024 + 1083. Calculate the remainder when 464 is divided by l. 51 Let m = -2 - -5. Let n(a) = 2a2 + 60a - 85. Let q(z) = -3z. Let w(p) = -n(p) + q(p). What is the remainder when w(-32) is divided by m? 2 Suppose 0 = -8j + 22 + 2. Let i(y) = 2y2 - 6y + 10. What is the remainder when 57 is divided by i(j)? 7 Let s(d) = -d*3 - 2d**2 + 10. Let o = -45 + 41. Calculate the remainder when 45 is divided by s(o). 3 What is the remainder when (-18516)/(-26) + (3/(-2))/((-3081)/(-316)) is	{ "pile_set_name": "DM Mathematics" }
+ 86 for l. 3 Solve -2t = -d, 5t = 2d + 9 - 10 for d. -2 Solve 9a + 168 = -z + 58, -4a = -5z + 38 for z. -2 Solve 10g = 7g - 3w + 24, -2w + 25 = 5g for g. 3 Solve 0 = 3973s - 3978s + 5y + 45, 20 = 3s - 2y for s. 2 Solve 8 = 2k + n, 4k + 5n = -5 + 15 for k. 5 Solve 0 = 4f + 5m + 17, -3m - 902 = 4f - 895 for f. 2 Solve -4x - 24 = 3j, -8j + 9j + 5 = -3x + 2j for x. -3 Solve 2o = -62d + 57d + 17, 4o + 4d - 4 = 0 for o. -4 Solve 5p + 18w + 36 = 0, 0 = -5p - w + 18 - 20 for p. 0 Solve 4n + 1035d = 1034d + 7, 5d + 5 = 0 for n. 2 Solve -60 = 5a + 5b, -4b - 22 = 3a + 19 for a. -7 Solve -16 = 2s + 3j, -15s + 4j + 3 = -14s for s. -5 Solve -19m + 28m - 31 = -2b, 3b - 9 = -m for b. 2 Solve -2u + 14 = 10n, 18u - 17u - 3n = -9 for u. -3 Solve 1195 = -5r - 5q + 1210, -5r = -q + 3 for r. 0 Solve -49 = -5f - 3v, 4v - 246 = 3f - 229 for f. 5 Solve 0 = -5a + 180 - 170, 4i + 25a - 66 = 0 for i. 4 Solve -33b + 3v = -36b + 27, -5v = -2b + 53 for b. 14 Solve -3c - 44o + 40o = -33, c + 4o - 19 = 0 for c. 7 Solve 5w + 4z = -3, -29z + 3 = -3w - 31z for w. -3 Solve -3i + 3z - 24 = 0, -2z - 41 = 7i - 4z for i. -5 Solve -116v - 6 = 2o - 112v, -2 = v for o. 1 Solve 3l + 50h - 52h + 17 = 0, -3l - 3h = 27 for l. -7 Solve 2t + 10 = -0t, -3w = 26t + 33t + 286 for w. 3 Solve -21b + 16b - 3q = -15, 13b = -2q + 10 for b. 0 Solve n - 4 = z, 77n - 81n + 16 = 0 for z. 0 Solve -14 = 3r - 5q, -4r - 2q = -516 + 526 for r. -3 Solve 4r = -620d + 622d - 28, 5d - 22 = 2r for d. 2 Solve 3w - 9 = 0, -3a + 9w = -a + 4w - 31 for a. 23 Solve 3g - 9 = -3w, -1841g + 4w = -1843g + 4 for g. 4 Solve 0 = -4w + 10z - 12, 7w - 9w + z + 2 = 0 for w. 2 Solve 15 = -4c + 807n - 804n, -4n + 39 = c for c. 3 Solve -3v - a + 440 = 466, 2v + 6 = -12a for v. -9 Solve 3v + 2d = 5, -43v + 7d - 2 = -38v for v. 1 Solve 0 = -5c + 2k - 5, -23k = -129c + 131c - 117 for c. 1 Solve 19 = -4d - 139a + 142a, 3d + 14 = 2a for d. -4 Solve 4y + 3t = -49, -11 + 4 = -y + t for y. -4 Solve 368s - 365s + 11 = -x, x - 1 = 0 for s. -4 Solve -5g = 15, -14 = m + 4g + 6 - 12 for m. 4 Solve 5q + 64 - 15 = -c, -29q + 28q = 9 for c. -4 Solve 4p + 938 - 962 = 5f, 2p = 4f + 12 for f. 0 Solve 0 = z + 4t - 8, -14 = -3z + 8103t - 8110t for z. 0 Solve -a + 3z - 7 = 0, 5a - z - 622 = -629 for a. -1 Solve -f = -2x - 33849 + 33883, -4x = -3f - 66 for x. 18 Solve 149279o - 149276o - 5w + 20 = 0, 0 = -4o - w - 19 for o. -5 Solve -20 = 2m + 4h, -9m = -7m + 3h + 15 for m. 0 Solve 3v - r - 15 = 0, 19v + 4r + 60 = 23v for v. 0 Solve 320u = -a + 321u + 5, a - 4 = 2u for a. 6 Solve 321a - 320a - 4g - 8 = 0, 2g = 5a + 32 for a. -8 Solve 6 = -24o + 23o + 4m, 4m = 2o + 8 for o. -2 Solve 2o - 15 + 19 = 0, -5x - 5o - 10 = 0 for x. 0 Solve u = -2s + 4, -2s = -135u + 131u - 4 for u. 0 Solve -4d = 81 + 74 - 175, 0 = -3n - d - 10 for n. -5 Solve g + 14944 = 4w + 14921, -2g = -5w + 31 for g. -3 Solve -4i + 2a = -40, 0 = i + 5a + 7626 - 7559 for i. 3 Solve 2k + 8 = -6t + 4t, -2k + 4t = -22 for k. 1 Solve -9 = -8213v + 8214v + 4u, 8u + 13 = 3v for v. -1 Solve 9p + 3v - 39 = 0, -37v + 40v + 17 = 5p for p. 4 Solve 52 = 2m - 4f, -409m + 404m = -3f - 102 for m. 18 Solve -11o - 9 = -8o + 3m, 70 = -10m for o. 4 Solve -4l - 32 = -5c - 79, 26c - 56 = -4l + 22c for l. 13 Solve 10 = f + 3d, -3d + 17 = 429f - 427f for f. 7 Solve -n - y + 25 = 22, -y - 2 = 0 for n. 5 Solve -3z + 22939s - 22934s - 15 = 0, -4z = 5s - 50 for z. 5 Solve -q + 7 = 164k - 156k, k - 4q = 5 for k. 1 Solve 4v + 9 = -3n, -2v + 90n - 95n = 29 for v. 3 Solve -46230q + 46232q = 3a, 5a - 22 = -4q for q. 3 Solve 41x - 42x - 4z - 38 = 0, 59 = -3x - z for x. -18 Solve 49x - 51x = 10, 0 = 5w - 3x - 100 for w. 17 Solve 3p + 5z + 126 = 109, 2p = z - 7 for p. -4 Solve 4u = 2i - 36, -u - 15 = 685i - 686i for u. -3 Solve j - s + 1 = 0, 16 = -7j + 5s + 5 for j. -3 Solve -12f + 4 = -2x, f + 4f - 6 = 3x for x. -2 Solve -18 = 4k + r, 15136k + 20 = 15134k + 5r for k. -5 Solve 5p - 2h - 23 = 0, 126p = 125p - h - 1 for p. 3 Solve -31b - 2m = -33b, -4 = -b + 5m for b. -1 Solve 5i = -2h - 13, h + 23 = -i + 21 for h. 1 Solve 9 = 3i - 75a + 76a, -3i + 2a = 9 for i. 1 Solve 7064o + 13 = h + 7060o, -4o = h - 13 for h. 13 Solve -2w - 3b = 13, 23w + 114 = 6b - 5b for w. -5 Solve -3d = -3m + 6, -69d + 63d + 5m - 13 = 0 for d. -3 Solve 0 = -3c - 37a + 105, -2 - 1 = -3c - 3a for c. -2 Solve -2415a - 17 = -2414a + 5n, -5n - 26 = -2a for a. 3 Solve p = d - 8, -1598d + 4 = -3p - 1600d for p. -4 Solve 0 = -129z + 125z + 2i + 10, 5i = -25 for z. 0 Solve -b + 4h - 181 = -183, -h - 4 = 3b - 3h for b. -2 Solve -h = -5, -3t + 6723h - 1 = 6724h for t. -2 Solve -2c = -q - 30, -3q - 216c = -211c - 97 for q. 4 Solve 3f + 4o - 45 = 0, -2f - 8888o = -8891o - 13 for f. 11 Solve -16 = -4k + 2v - 14, -k + 5 = -2v for k. -1 Solve 10j + n = -34, -2n - 48 = -4j - 52 for j. -3 Solve -9q = 3y - 206 + 209, 0 = 3q - 3y - 3 for q. 0 Solve -234w + 236w = 5l - 10, 3 = -w + 2l for w. 5 Solve -3g - 313 = 3h - 331, -g = -h + 2 for g. 2 Solve -2d = 2c + 36, -4d - 2c = -284 + 330 for d. -5 Solve 0 = 140j - 68j - 77j - 10, -22 = -4t + 5j for t. 3 Solve r - 5t + 27 = 0, 17 = -17r + 21r + 5t for r. -2 Solve 3w - 15 = 8w - 40, -4q + 4w = 28 for q. -2 Solve -a = -4s - 20, -s = -2a - 11 + 16 for s. -5 Solve 0 = m + 3f - 11, 2f - 6 = -4m + 8 for m. 2 Solve 4h + 15 = k, 4h + 5k - 102 = -3 for h. 1 Solve 0 = 9u + 36, -2g + 5g - 3g - 2g = 5u + 30 for g. -5 Solve -213g + 59 = -222g - 4y, 5y = 2g - 34 for g. -3 Solve 525n + v + 25 = 529n, 2v + 2 = -4n for n. 4 Solve 37g - 6 = 33g - 3w, -14g - 3w + 36 = 0 for g. 3 Solve b = -3v - 66, -v = -4b + 30v + 725 for b. 3 Solve 0 = 2i - 3k - 5, 0 = 138i - 134i - 4k for i. -5 Solve 3w - 3k - 57 + 30 = 0, 20k - 29 = w for w. 11 Solve u = 4j - 16, -2j + 14 = 48u - 47u for j. 5 Solve 2b + 12 = 2v, 0b = -v - 3b - 2 for v. 4 Solve -4u + 34k + 27 = 31k, k + 25 = 4u for u. 6 Solve 74339k = 2n + 74334k + 18, -5n = -3k + 26 for n. -4 Solve 2i = 22b - 20b + 2, 14b + 5i = -0i - 14 for b. -1 Solve -55j + 27j - 3 = -23j + i, -9j = 3i + 3 for j. -1 Solve -4k - 129c + 23 = -134c, -4c - 16 = -4k for k. -3 Solve 3c - 2j + 1606 - 1632 = 0, -3j - 58 = 5c for c. -2 Solve -3d + 5o = -19, d - 14 = -o - 13 for d. 3 Solve 2x + 22 = 268z - 263z, -4x + 2z - 44 = 0 for x. -11 Solve -3h - 33 = -5s, -2h - 43s = -46s + 21 for h. -6 Solve 2v + 3f = -19, 5v + 343780 - 343743 = -4f for v. -5 Solve 0 = -h + 3o - 13, -4o + 83 = 71 for h. -4 Solve -3s + 925 - 908 = 2y, -4y - s = -9 for y. 1 Solve 3f - 33 = 2z, 2z + 20 = 5f - 31 for f. 9 Solve -6i + 0i = -i, 0 = 4r + 5i + 8 for r. -2 Solve f - 2g - 2g = 0, 4g - 20 = -6f + 2f for f. 4 Solve -5 = -v - 3c, -54 = 5v + 12c - 73 for v. -1 Solve 132b = 142b - 3d + 55, b = -5d - 32 for b. -7 Solve -4l = 116 - 120, -2t - 5l + 13 = 0 for t. 4 Solve 5u = -5i + 5, -6u = -8u + i + 8 for u. 3 Solve 4y - 15m - 45 = -14m, -4m = y - 7 for y. 11 Solve 0 = 2n - 5f + 14, -17n - 4f + 4643 = -12n + 4645 for n. -2 Solve -4x + 44 = -4u, 3u = 3659x - 3662x - 57 for u. -15 Solve -3u - 2z + 2994 = 2974, -2z = -2u - 30 for u. -2 Solve 3p + 6 = -g + 6p, -143g + 4p - 27 = -148g for g. 3 Solve -26c + p = -109, -7p - 3 = -2c - 8p for c. 4 Solve -256p + 254p = 5t - 11, 0 = 4p - 4t - 8 for p. 3 Solve 4h - 39a = -35a - 12, 4h - 16a = -11a - 14 for h. -1 Solve k + j + 36 = 31, -4k - j + 7 = 0 for k. 4 Solve 2l - 1154 + 1159 = 3x, 0 = -l - 4 for x. -1 Solve 0 = -5u + 3j + 4, 26j - 6 = -4u + 27j for u. 2 Solve 0 = -m - 5h - 7, 3h = 14m - 9m - 21 for m. 3 Solve 4k = 5j + 8, -16j = -13j - 3k + 3 for j. -4 Solve t = 2d - 5, 63t - 8 = -4d + 67t for d. 3 Solve -23c + 2f - f - 46 = 0, -3c + f = 6 for c. -2 Solve 4x - 2 = 2h, -293x + 290x - 3h - 30 = 0 for x. -3 Solve 2446a - 2445a - w = 9, 0 = -6*a -	{ "pile_set_name": "DM Mathematics" }
ut replacement from {q: 1, a: 4, y: 2, v: 2, x: 3}. 1/55 Four letters picked without replacement from llellfllfeeelleeelf. Give prob of sequence eefe. 35/5168 Two letters picked without replacement from mmbbbmmbmmbbm. What is prob of sequence mb? 7/26 Two letters picked without replacement from {q: 5, a: 11}. Give prob of sequence aa. 11/24 Calculate prob of sequence quu when three letters picked without replacement from byuibugyyiggygqgiig. 1/2907 Four letters picked without replacement from yamaccmmcycm. What is prob of sequence cmay? 8/1485 What is prob of sequence zrff when four letters picked without replacement from {z: 2, f: 7, r: 6}? 1/65 What is prob of sequence hqq when three letters picked without replacement from qqjjeshjhhqqhr? 2/91 Two letters picked without replacement from {p: 8, d: 2}. Give prob of sequence pp. 28/45 Three letters picked without replacement from ykkysujskymjmkms. What is prob of sequence sjj? 1/560 What is prob of sequence ufe when three letters picked without replacement from {t: 3, e: 5, f: 5, j: 1, u: 4}? 25/1224 Three letters picked without replacement from {c: 9, t: 1, i: 1}. Give prob of sequence cic. 4/55 Calculate prob of sequence qx when two letters picked without replacement from {v: 4, c: 4, q: 3, x: 1, r: 2}. 3/182 What is prob of sequence ryr when three letters picked without replacement from {y: 1, r: 2}? 1/3 Two letters picked without replacement from mxnxifixfmix. Give prob of sequence fx. 2/33 Calculate prob of sequence ukuu when four letters picked without replacement from {k: 15, u: 3}. 1/816 Four letters picked without replacement from kiikrw. Give prob of sequence wkir. 1/90 Calculate prob of sequence qi when two letters picked without replacement from {q: 1, p: 3, b: 3, g: 1, i: 3, x: 2}. 1/52 Three letters picked without replacement from uikipkzpkppppppkp. Give prob of sequence iuz. 1/2040 Two letters picked without replacement from nmmuuunmumu. What is prob of sequence mn? 4/55 Three letters picked without replacement from {o: 1, m: 1, f: 2, b: 3, r: 1, y: 3}. Give prob of sequence fyr. 1/165 Calculate prob of sequence bbb when three letters picked without replacement from {b: 5, c: 8}. 5/143 What is prob of sequence vkvk when four letters picked without replacement from {k: 2, v: 16}? 1/153 Three letters picked without replacement from {r: 1, c: 1, n: 4, w: 3, q: 8}. Give prob of sequence qnq. 14/255 Calculate prob of sequence pp when two letters picked without replacement from {r: 3, s: 4, p: 8, w: 1, y: 3}. 28/171 Two letters picked without replacement from {b: 2, q: 2, l: 4, v: 3, i: 2}. What is prob of sequence bb? 1/78 Calculate prob of sequence id when two letters picked without replacement from difiifhli. 1/18 Calculate prob of sequence it when two letters picked without replacement from {t: 2, b: 3, n: 4, i: 2, h: 1}. 1/33 Two letters picked without replacement from mtymhpphmhypppw. Give prob of sequence th. 1/70 Calculate prob of sequence nnn when three letters picked without replacement from {x: 5, n: 14}. 364/969 Two letters picked without replacement from {t: 1, s: 8, y: 6, g: 1, r: 1}. What is prob of sequence gt? 1/272 Calculate prob of sequence ee when two letters picked without replacement from ddeevo. 1/15 What is prob of sequence xuui when four letters picked without replacement from viuuxkxuxkiuxxvxxvku? 7/2907 What is prob of sequence tz when two letters picked without replacement from {z: 1, y: 5, t: 6, j: 2, m: 5}? 1/57 Four letters picked without replacement from {q: 5, o: 15}. Give prob of sequence qoqo. 35/969 What is prob of sequence jqq when three letters picked without replacement from jqdqjjjjnqnqqndnnjj? 70/2907 Two letters picked without replacement from mmuuuumummmuu. Give prob of sequence um. 7/26 Calculate prob of sequence yyy when three letters picked without replacement from yyyy. 1 Two letters picked without replacement from {h: 1, w: 2, c: 1, e: 1, j: 1, z: 2}. Give prob of sequence zh. 1/28 Two letters picked without replacement from {p: 1, c: 7, j: 1, g: 7}. Give prob of sequence pg. 7/240 What is prob of sequence qa when two letters picked without replacement from {q: 2, a: 1, p: 1}? 1/6 Calculate prob of sequence pib when three letters picked without replacement from byrpsip. 1/105 What is prob of sequence ppxx when four letters picked without replacement from xxxwxxxppxtptxjxbt? 1/170 Three letters picked without replacement from {o: 2, z: 2, e: 3, t: 6, a: 2}. Give prob of sequence zeo. 2/455 Two letters picked without replacement from {y: 3, s: 1}. What is prob of sequence ys? 1/4 Three letters picked without replacement from {v: 3, k: 5, s: 3, e: 7, u: 2}. What is prob of sequence vek? 7/456 Calculate prob of sequence eede when four letters picked without replacement from {p: 1, l: 6, d: 2, e: 9}. 7/510 What is prob of sequence hbh when three letters picked without replacement from {s: 7, h: 6, b: 1}? 5/364 Calculate prob of sequence nk when two letters picked without replacement from nnnnnnnknnnn. 1/12 Four letters picked without replacement from mvmmmmv. Give prob of sequence mmmv. 1/7 Calculate prob of sequence qn when two letters picked without replacement from qqqqnqqnqtqvvq. 9/91 Two letters picked without replacement from {x: 4}. What is prob of sequence xx? 1 Three letters picked without replacement from {i: 1, p: 1, d: 1, h: 1, s: 1}. Give prob of sequence idh. 1/60 Two letters picked without replacement from {v: 11, f: 1}. What is prob of sequence vf? 1/12 Calculate prob of sequence ppqa when four letters picked without replacement from {a: 6, q: 1, p: 7}. 3/286 What is prob of sequence yifi when four letters picked without replacement from fxihxxixyhxhxii? 1/2730 What is prob of sequence bbnb when four letters picked without replacement from {n: 7, y: 4, b: 6, d: 1}? 7/612 Four letters picked without replacement from {t: 4, g: 2, o: 3, e: 1, q: 4}. Give prob of sequence etqe. 0 Three letters picked without replacement from evdvndrvvrvzrrv. Give prob of sequence rzd. 4/1365 Calculate prob of sequence mf when two letters picked without replacement from {y: 1, f: 11, m: 5}. 55/272 Three letters picked without replacement from {d: 1, w: 7, b: 3, c: 3}. Give prob of sequence cbw. 3/104 What is prob of sequence pvpm when four letters picked without replacement from mvmpmyymavlp? 2/1485 Two letters picked without replacement from sssu. What is prob of sequence su? 1/4 Two letters picked without replacement from hhhhhjjhhh. Give prob of sequence hj. 8/45 Two letters picked without replacement from ggjjlwj. Give prob of sequence jl. 1/14 Calculate prob of sequence ww when two letters picked without replacement from wppwwpwwhbwpyye. 1/7 Two letters picked without replacement from {y: 2, p: 1, h: 1, j: 1}. Give prob of sequence yp. 1/10 Three letters picked without replacement from {a: 3, n: 4, o: 5, l: 5, x: 1}. What is prob of sequence loa? 25/1632 Three letters picked without replacement from {s: 6, a: 1, m: 12}. What is prob of sequence ams? 4/323 What is prob of sequence ooff when four letters picked without replacement from ofoofffofoffoffofooo? 45/646 Calculate prob of sequence dcy when three letters picked without replacement from cyd. 1/6 What is prob of sequence fz when two letters picked without replacement from fzzzzzzzzzzfzfzfff? 4/17 Three letters picked without replacement from fnfabnnnfnannnabb. Give prob of sequence fan. 3/170 What is prob of sequence xokx when four letters picked without replacement from {x: 2, k: 3, o: 15}? 1/1292 What is prob of sequence ww when two letters picked without replacement from {t: 3, o: 1, g: 4, w: 2, v: 1}? 1/55 What is prob of sequence eenb when four letters picked without replacement from jeensbbeuuu? 1/660 Calculate prob of sequence db when two letters picked without replacement from {z: 2, r: 1, b: 2, o: 1, d: 1}. 1/21 Three letters picked without replacement from {b: 1, x: 2, q: 4, d: 1, k: 1}. Give prob of sequence xkb. 1/252 What is prob of sequence hh when two letters picked without replacement from {h: 2, g: 9}? 1/55 Three letters picked without replacement from uryuurrrlu. Give prob of sequence rul. 1/45 Three letters picked without replacement from {n: 4, i: 2, a: 5}. Give pr	{ "pile_set_name": "DM Mathematics" }
27 divided by -330 -9/110 3482 divided by -4 -1741/2 Divide -750 by 5. -150 What is -2398 divided by -22? 109 328 divided by 41 8 -625 divided by -25 25 Divide 192 by -6. -32 4287 divided by -1 -4287 Divide -275 by -2. 275/2 What is -710 divided by -4? 355/2 -52 divided by 52 -1 Divide 2300 by 2. 1150 What is -1 divided by 4? -1/4 -4965 divided by 993 -5 Calculate 896 divided by -2. -448 Calculate -4 divided by -123. 4/123 Divide -486 by -54. 9 -3514 divided by 7 -502 What is -15138 divided by -58? 261 -354 divided by -6 59 What is 777 divided by -21? -37 What is -3 divided by -1496? 3/1496 What is 1905 divided by -381? -5 Calculate -9 divided by 3. -3 Calculate 3 divided by -70. -3/70 What is 50 divided by 5? 10 Calculate -3 divided by 25. -3/25 310 divided by -3 -310/3 What is 984 divided by -246? -4 What is 2906 divided by 2906? 1 Divide 66 by 6. 11 Divide -52 by 4. -13 Calculate -4 divided by -1996. 1/499 Divide -3152 by -6. 1576/3 10 divided by -1 -10 -108 divided by 4 -27 Divide -3894 by -33. 118 Calculate 4 divided by 108. 1/27 Calculate -3 divided by 595. -3/595 Divide -23 by -1028. 23/1028 Divide -275 by 5. -55 16994 divided by -58 -293 Divide -4 by -395. 4/395 -2525 divided by -3 2525/3 -779 divided by -4 779/4 Calculate 0 divided by 2554. 0 522 divided by -2 -261 1096 divided by -274 -4 -4510 divided by 110 -41 What is -930 divided by 186? -5 -8005 divided by 6 -8005/6 What is -52 divided by -24? 13/6 -2924 divided by 4 -731 What is -10578 divided by 2? -5289 -5 divided by -121 5/121 What is 935 divided by -187? -5 -351 divided by 3 -117 Calculate 0 divided by 275. 0 Calculate 628 divided by 4. 157 What is 321 divided by 3? 107 What is 0 divided by -276? 0 -7 divided by 1499 -7/1499 Divide 605 by 6. 605/6 Divide -79 by -131. 79/131 What is -600 divided by 30? -20 Divide -138 by -6. 23 Divide -5 by 237. -5/237 Calculate 282 divided by -47. -6 What is -1357 divided by -19? 1357/19 Divide -1 by 1046. -1/1046 Calculate -388 divided by -4. 97 Calculate 484 divided by -4. -121 What is 235 divided by 1? 235 Divide -216 by 12. -18 What is -4 divided by -1703? 4/1703 What is -6 divided by -2312? 3/1156 -24 divided by 6 -4 -5430 divided by -362 15 What is -29 divided by 81? -29/81 What is -4833 divided by 1611? -3 Calculate 0 divided by -104. 0 Divide 510 by -102. -5 What is 52 divided by 13? 4 Calculate -43 divided by -2. 43/2 Divide 300 by -30. -10 Divide 26 by -1. -26 What is -770 divided by 70? -11 What is 1488 divided by 62? 24 0 divided by -100 0 Divide -19 by 11. -19/11 What is 4772 divided by -4? -1193 162 divided by 162 1 Divide 4 by 4. 1 Calculate -24 divided by 7. -24/7 What is 125 divided by 25? 5 -2010 divided by -6 335 -5 divided by -156 5/156 Divide -2366 by 13. -182 Calculate 14 divided by 4. 7/2 Divide -7 by 88. -7/88 -1918 divided by -7 274 14 divided by -6 -7/3 -6 divided by -2236 3/1118 What is -38 divided by 19? -2 Divide 9444 by 2. 4722 Calculate 9060 divided by 4. 2265 Calculate -175 divided by 1. -175 Calculate -49 divided by 1. -49 Divide -46 by -23. 2 What is -84 divided by -160? 21/40 Calculate 236 divided by -4. -59 What is -238 divided by 2? -119 Calculate 10 divided by 1148. 5/574 What is 22116 divided by -19? -1164 What is 2 divided by 2852? 1/1426 What is -13 divided by -24? 13/24 Calculate -1465 divided by -2. 1465/2 Calculate -29 divided by -29. 1 Calculate -4 divided by -3117. 4/3117 Divide 6 by 98. 3/49 Divide -10152 by 376. -27 Divide -578 by -2. 289 -798 divided by -57 14 Calculate 5 divided by -8. -5/8 Calculate 90 divided by 10. 9 -1402 divided by 701 -2 Calculate -214 divided by 5. -214/5 Calculate 99 divided by 1. 99 What is 52886 divided by -2? -26443 Divide 2778 by -1389. -2 Divide 284 by -71. -4 80 divided by 40 2 Divide -69 by -6. 23/2 Divide -663 by -17. 39 152 divided by 7 152/7 0 divided by -34 0 What is 8325 divided by -5? -1665 Calculate -23 divided by 8. -23/8 Calculate 55 divided by -55. -1 What is -7 divided by 7? -1 Divide 220 by 28. 55/7 Divide 3 by -90. -1/30 Divide -856 by -7. 856/7 What is -748 divided by 374? -2 What is 31 divided by 13? 31/13 Divide -1356 by -4. 339 Divide 715 by -55. -13 Divide -678 by 2. -339 756 divided by -14 -54 Divide -5 by 689. -5/689 Divide 2304 by 48. 48 Calculate -6 divided by -457. 6/457 Calculate 20 divided by -2. -10 -32 divided by 166 -16/83 60 divided by -12 -5 What is 313 divided by 1? 313 -1219 divided by -1 1219 What is 21816 divided by -216? -101 Calculate 10962 divided by -4. -5481/2 Divide 3 by -1959. -1/653 Divide -256 by -6. 128/3 Calculate 144 divided by 2. 72 Calculate -27 divided by -3. 9 Calculate -10 divided by -198. 5/99 What is 208 divided by 8? 26 Calculate -2 divided by -54. 1/27 Divide -246 by 3. -82 2634 divided by 3 878 What is 164 divided by -41? -4 Calculate 93 divided by -2. -93/2 Calculate -7128 divided by -1. 7128 -4 divided by 511 -4/511 Divide -477 by 53. -9 -7 divided by 178 -7/178 Calculate 4 divided by -583. -4/583 -1454 divided by -1 1454 What is -320 divided by -13? 320/13 Calculate 1 divided by 162. 1/162 What is -36 divided by 4? -9 Calculate -1463 divided by -77. 19 Calculate 7592 divided by 26. 292 What is -28716 divided by 2? -14358 -72 divided by -5 72/5 -690 divided by -69 10 Calculate 1 divided by -45. -1/45 Calculate -36 divided by 5. -36/5 -12758 divided by 2 -6379 3 divided by 592 3/592 Calculate 3 divided by 62. 3/62 38310 divided by 1277 30 Divide -2540 by 5. -508 Calculate 544 divided by -12. -136/3 9379 divided by 83 113 What is 340 divided by 64? 85/16 Calculate 1143 divided by -1. -1143 Divide -1 by 65. -1/65 Calculate 432 divided by 144. 3 What is -35 divided by -8? 35/8 What is -103 divided by -13? 103/13 What is -5 divided by -540? 1/108 Calculate 4228 divided by -302. -14 Calculate -3815 divided by 5. -763 558 divided by -3 -186 What is 89 divided by -6? -89/6 What is -153 divided by -6? 51/2 What is -6960 divided by 1740? -4 Calculate -444 divided by 4. -111 What is 789 divided by 263? 3 Calculate -349 divided by 9. -349/9 What is 48 divided by -7? -48/7 Divide 1280 by 128. 10 Calculate 3 divided by -1779. -1/593 -10 divided by -50 1/5 Divide 174 by 58. 3 Divide 10320 by -6. -1720 What is 168 divided by 168? 1 25960 divided by 440 59 What is 1125 divided by -225? -5 Divide -5 by 111. -5/111 Calculate -10152 divided by -3384. 3 -234 divided by -117 2 Divide 40 by -1. -40 Divide -663 by -13. 51 3 divided by -769 -3/769 What is -4 divided by -8958? 2/4479 Divide -874 by 437. -2 Divide -2 by -161. 2/161 -8 divided by -3170 4/1585 Divide -11529 by 27. -427 Calculate 2 divided by -299. -2/299 345 divided by 69 5 -60 divided by 20 -3 -47 divided by 47 -1 What is 1605 divided by -107? -15 Calculate -3 divided by -64. 3/64 -68 divided by -17 4 What is 0 divided by -20? 0 Calculate 2 divided by 130. 1/65 Divide -90 by 1. -90 Divide -12464 by -3116. 4 What is -14 divided by -1175? 14/1175 Calculate 156 divided by 52. 3 What is 2610 divided by -18? -145 Divide -414 by 138. -3 Divide -204 by 6. -34 -1891 divided by -6 1891/6 Divide -1 by -319. 1/319 What is -1052 divided by -4? 263 528 divided by -1 -528 2919 divided by -139 -21 What is -38 divided by 19? -2 Calculate -2712 divided by 2. -1356 0 divided by -130 0 Divide 5 by 412. 5/412 Divide 0 by -71. 0 -547 divided by 547 -1 What is 400 divided by -100? -4 Calculate 2748 divided by 12. 229 304 divided by 76 4 Divide 182 by 124. 91/62 Divide 3989 by -1. -3989 -7 divided by -166 7/166 What is -30 divided by -6? 5 What is -505 divided by -5? 101 What is -5 divided by 5426? -5/5426 What is 3 divided by 21? 1/7 What is 875 divided by 5? 175 Calculate -4 divided by -1451. 4/1451 Divide 155 by -31. -5 Divide 15 by -968. -15/968 Calculate 0 divided by -10. 0 Divide 531 by -5. -531/5 Divide 2 by -31. -2/31 Divide 1 by -53. -1/53 Divide 1 by -3. -1/3 -7 divided by -35 1/5 What is 6052 divided by 6? 3026/3 Divide 30 by 5. 6 What is -20 divided by 15? -4/3 625 divided by 3 625/3 Divide -5034 by 1. -5034 Divide -7638 by 3. -2546 Divide -369 by -123. 3 -234 divided by 78 -3 Calculate -4455 divided by -27. 165 Divide -4970 by 710. -7 Divide -8 by 1095. -8/1095 0 divided by -172 0 -48 divided by -6 8 Calculate -8 divided by 595. -8/595 Calculate -2 divided by -52. 1/26	{ "pile_set_name": "DM Mathematics" }
t - 116. Give p(7). -4 Let b(s) = s + 8. Give b(9). 17 Let g(j) = j - 29. Calculate g(6). -23 Let t(q) = 7q + 44. Determine t(-18). -82 Let q(c) = c3 + 26c*2 + 91c + 37. What is q(-22)? -29 Let x(a) = 23a - 121. Calculate x(9). 86 Let c(b) = -b2 - 3b + 1. Determine c(-3). 1 Let f(l) = -3l + 16. Calculate f(13). -23 Let z(s) = 15s + 7. What is z(3)? 52 Let s(k) = k*2 + 9k - 10. Determine s(-8). -18 Let a(k) = 20k - 6. Give a(-2). -46 Let h(k) = 6k - 297. What is h(54)? 27 Let t(g) = 4g - 18. Calculate t(-2). -26 Let c(g) = -g3 + 4g + 1. Calculate c(0). 1 Let h(x) = 5x3 + 2x*2 + 3x + 1. Calculate h(-1). -5 Let d(c) = c*3 - 7c*2 - 7c + 14. What is d(7)? -35 Let a(d) = -d*2 + 20d + 23. What is a(21)? 2 Let t(d) = -d. What is t(-3)? 3 Let k(p) = -4p3 - 162p*2 - 80p + 1. Give k(-40). 1 Let c(w) = w*2 + 28w + 31. Give c(-27). 4 Let k(b) = -6b3 + 4b*2 - 2b - 2. Calculate k(2). -38 Let m(r) = r*3 + 11r*2 + 3r + 2. Determine m(-11). -31 Let b(v) = v*3 - 12v*2 - 11v - 18. Give b(13). 8 Let m(r) = 2r2 + 8r - 18. Calculate m(-6). 6 Let s(n) = n*3 + 6n*2 - 8n - 6. What is s(-4)? 58 Let r(y) = -y*3 - 11y*2 - 14y - 7. Determine r(-10). 33 Let k(r) = 2r2 + 3r + 1. Determine k(1). 6 Let y(j) = 10j + 82. Determine y(-8). 2 Let x(y) = 2y*3 + 6y*2 - 6y + 2. Calculate x(-5). -68 Let f(n) = -n*2 - 7n + 25. Determine f(-10). -5 Let g(h) = 2h + 66. Calculate g(-27). 12 Let p(l) = l3 - 6l*2 - 2l + 1. Give p(6). -11 Let h(u) = 3u2 - 32u + 6. What is h(10)? -14 Let g(j) = 2j3 + 9j*2 + 3j + 9. Calculate g(-4). 13 Let b(q) = -13q - 293. Calculate b(-22). -7 Let i(a) = -a3 - 4a*2 - 8a - 33. What is i(-4)? -1 Let a(g) = -60g - 10. Calculate a(-3). 170 Let j(l) = 4l - 17. Determine j(9). 19 Let p(t) = 7t - 1. What is p(0)? -1 Let o(y) = 7y3 + 1. Determine o(1). 8 Let q(s) = s3 - 6s2 + 7s + 6. What is q(4)? 2 Let h(v) = v*3 + 8v*2 + 13v - 8. Calculate h(-7). -50 Let k(z) = -11z + 1. Determine k(2). -21 Let v(q) = 13q + 62. Give v(-10). -68 Let y(i) = i*3 + 16i2 + 7. Determine y(-16). 7 Let p(o) = o2 + 8o + 26. What is p(-7)? 19 Let c(t) = 22t + 1. Calculate c(1). 23 Let z(l) = -l3 + l2 - 2l + 13. Calculate z(3). -11 Let f(b) = 2b*2 + 3b - 3. What is f(6)? 87 Let u(z) = -z*3 - 5z*2 + 6z - 4. Determine u(-6). -4 Let w(t) = 40t - 5. Calculate w(1). 35 Let l(r) = -r3 + 4r*2 + 7r + 3. Calculate l(5). 13 Let h(k) = 19k - 34. Calculate h(6). 80 Let l(c) = -3c2 + c + 19. Calculate l(-3). -11 Let t(n) = n2 + 15n - 19. Calculate t(-13). -45 Let y(j) = -12j*3 + 5j*2 + 7j + 5. Determine y(-2). 107 Let z(k) = -k*3 + 19k*2 - 15k - 49. What is z(18)? 5 Let r(z) = z*3 - 6z*2 - 11z + 22. Calculate r(7). -6 Let b(j) = 13j - 3. Give b(2). 23 Let j(q) = -8q + 272. Calculate j(34). 0 Let w(k) = -k*2 - 7k + 1. What is w(-11)? -43 Let z(x) = 9x + 23. Determine z(-6). -31 Let s(n) = n2 - 10n - 12. Calculate s(11). -1 Let t(m) = m*2 - 4. What is t(-5)? 21 Let j(r) = -2r*3 - 38r*2 - 35r + 17. What is j(-18)? -1 Let s(g) = g*3 + 5g*2 + 2. Give s(-5). 2 Let t(h) = 2h*2 - 30h + 6. Determine t(14). -22 Let x(p) = p*2 + 7p + 15. What is x(-6)? 9 Let h(v) = -v*2 + 2v + 8. Determine h(5). -7 Let n(r) = 112r - 456. What is n(4)? -8 Let q(b) = 10b + 106. Calculate q(-11). -4 Let p(m) = m*3 - 12m*2 + 12m - 9. Calculate p(11). 2 Let q(h) = -h*3 + 43h*2 - 46h + 176. Determine q(42). 8 Let f(o) = 25o + 57. Determine f(-2). 7 Let b(y) = y2 - 4y. What is b(4)? 0 Let r(n) = n*2 - 4n - 2. Give r(3). -5 Let t(q) = -q*3 + 7q*2 - 13q + 5. Calculate t(5). -10 Let v(s) = -10s - 17. Determine v(-4). 23 Let o(q) = q3 - 3q*2 + 2q + 1. Give o(3). 7 Let k(h) = h*2 + 11h - 96. Give k(-16). -16 Let n(a) = a*2 - 3a - 5. What is n(3)? -5 Let u(s) = 10s - 2. Give u(-3). -32 Let w(u) = -u2 - 2u + 6. Give w(3). -9 Let r(n) = n*3 + 8n*2 - 9n + 12. Give r(-9). 12 Let i(x) = x*3 + 6x*2 + 8x + 16. What is i(-4)? 16 Let w(h) = h*3 + 11h*2 - 12h - 7. Give w(-12). -7 Let o(d) = -2d2 + 5d - 1. Determine o(4). -13 Let v(i) = -i - 24. Determine v(13). -37 Let u(s) = 2s2 + 7s + 7. Calculate u(-5). 22 Let s(i) = -i*3 + 18i*2 - 30i - 28. Determine s(16). 4 Let s(t) = 4t2 - t. Calculate s(1). 3 Let a(z) = z3 - 15z*2 + 24z - 104. Calculate a(14). 36 Let m(g) = 2g2 - 10g - 6. Calculate m(6). 6 Let a(x) = x*3 - 6x*2 - x - 35. Calculate a(7). 7 Let g(p) = -4p - 3. Calculate g(-3). 9 Let t(y) = y*2 - 31y + 104. Calculate t(27). -4 Let m(n) = -6n - 30. What is m(-5)? 0 Let j(c) = 44c - 351. What is j(8)? 1 Let n(v) = 15v - 448. What is n(27)? -43 Let j(p) = p3 + p - 1. Determine j(2). 9 Let x(o) = -23o*2 + 66o + 9. Give x(3). 0 Let z(v) = v*3 - 2v*2 - 4v. What is z(-2)? -8 Let f(u) = u*3 + 12u*2 - 11u + 50. Determine f(-13). 24 Let s(b) = b - 60. Determine s(0). -60 Let d(o) = -o3 + o2 + o - 25. Give d(0). -25 Let w(f) = 26f - 1490. Give w(57). -8 Let u(t) = 11t - 156. Calculate u(13). -13 Let u(k) = k*3 - 7k*2 - k - 4. Determine u(7). -11 Let d(n) = -2n*2 + 13n - 48. Calculate d(7). -55 Let l(o) = o*2 + 2o + 29. Determine l(0). 29 Let h(b) = -2b2 - 7b + 8. Calculate h(-7). -41 Let k(y) = y*3 - 7y*2 + 6y - 8. Determine k(7). 34 Let v(t) = t*2 - t - 4. Calculate v(3). 2 Let n(a) = -2a*2 - 29a - 7. Give n(-15). -22 Let t(c) = -c*3 + 15c*2 + 18c - 39. Give t(16). -7 Let o(a) = -5a2 - 18a - 5. Determine o(-4). -13 Let h(i) = i*2 - 9i + 1. Give h(8). -7 Let o(v) = -v + 20. Calculate o(21). -1 Let m(r) = -r*3 - 9r*2 + 16r - 73. Calculate m(-11). -7 Let u(j) = -j*3 + 41j*2 + 88j - 73. Give u(43). 13 Let i(l) = 17l - 34. Determine i(7). 85 Let j(a) = a3 + 26a*2 - 29a - 53. Calculate j(-27). 1 Let w(g) = -80g + 393. What is w(5)? -7 Let u(l) = l2 + 31l + 44. Calculate u(-30). 14 Let j(z) = 2z2 + 19z + 29. What is j(-8)? 5 Let d(s) = -s*2 - 5s - 4. Calculate d(-6). -10 Let g(t) = 3t2 + 7t + 33. Calculate g(-5). 73 Let h(f) = -3f - 4. Determine h(2). -10 Let j(s) = s2 - 5s - 7. Calculate j(5). -7 Let s(a) = -4a3 + 3a*2 - 5a + 5. Give s(2). -25 Let p(q) = -q*3 + 2q*2 + 2q + 6. What is p(-4)? 94 Let k(x) = -2x2 + 6x + 17. Give k(-5). -63 Let u(p) = p + 54. Determine u(-20). 34 Let k(j) = j*2 - 7j. Give k(6). -6 Let s(h) = -17h3. Give s(1). -17 Let n(a) = a2 - 7a - 23. What is n(8)? -15 Let o(p) = 12p + 103. Calculate o(-11). -29 Let k(z) = -z3 - 4z*2 - z - 6. Give k(-4). -2 Let y(b) = -b + 30. What is y(36)? -6 Let m(l) = -2l*3 + 8l*2 + 8l - 14. Determine m(5). -24 Let x(l) = -2l2 + 4l - 5. Determine x(2). -5 Let y(o) = -o*3 - 12o*2 - 5o - 60. Determine y(-12). 0 Let c(m) = -6m2 + 93m - 33. Determine c(15). 12 Let p(r) = 6r3 - 3r*2 - 2r + 2. What is p(-2)? -54 Let k(v) = v + 6. Determine k(-20). -14 Let a(j) = j*3 + 3j*2 - 8j + 12. Give a(-5). 2 Let d(o) = o*2 + 5. Give d(-2). 9 Let y(s) = -s. Determine y(-3). 3 Let m(p) = 13p - 7. Calculate m(0). -7 Let p(h) = -2h3 + 17h*2 - 11h + 20. Give p(8). -4 Let z(p) = 7p2 + 132p - 13. Determine z(-19). 6 Let o(g) = 2g3 - 16g*2 + 4g - 10. Calculate o(8). 22 Let n(u) = u*3 - 3u*2 - 3u - 4. What is n(4)? 0 Let p(h) = 5h - 18. What is p(2)? -8 Let w(j) = 2j + 8. What is w(-6)? -4 Let m(i) = -2i. What is m(1)? -2 Let i(u) = u2 - 4u - 12. Determine i(-3). 9 Let h(n) = 3n - 13. What is h(-3)? -22 Let c(d) = -d3 + 5d*2 - 3d - 5. What is c(6)? -59 Let t(h) = 2h - 6. Give t(0). -6 Let p(l) = 17l + 91. Give p(-5). 6 Let o(x) = -x - 14. Give o(-14). 0 Let h(a) = 2a + 8. Give h(-12). -16 Let b(p) = -3p*2 + 33p - 23. What is b(10)? 7 Let t(p) = p*2 + 33p + 271. Determine t(-19). 5 Let h(f) = 2f3 + 4f*2 - 7f + 32. Determine h(-4). -4 Let k(p) = p*2 + 36p + 327. Give k(-16). 7 Let d(r) = -r*2 + 2r - 8. What is d(14)? -176 Let l(d) = -d3 - d2 + 11d + 3. Give l(-4). 7 Let z(n) = 9n + 107. What is z(-9)? 26 Let n(s) = 4s2 - 8s - 10. Give n(5). 50 Let i(f) = 2f + 40. Give i(-21). -2 Let m(r) = -r3 + 10r*2 - 7r + 18. What is m(9)? 36 Let d(f) = -f*2 + 6f - 3. What is d(5)? 2 Let	{ "pile_set_name": "DM Mathematics" }
+ 4c, wc - 9 = -3x + 2c. Let i(f) = 1 - 4f - f - 3f*2 + xf2 - f2. Determine i(-6). -5 Let j(y) be the first derivative of -y*5/60 + 7y*4/24 + 4y*3/3 - 3y*2 - 30. Let b(s) be the second derivative of j(s). What is b(6)? 14 Let q(v) = -6v*3 + 8v2 + v - 8. Let k(i) = -i3 + i*2 - 1. Suppose 10m - 35 = 3m. Let t(f) = mk(f) - q(f). Let s = 7 + -4. Determine t(s). 0 Let m(o) = -19o + 28. Let p(d) = -7d + 14. Let k(f) = 2m(f) - 5p(f). What is k(-7)? 7 Let u(w) = 16w2 + 6w + 56. Let v be -1 - 20/(-5)(-2)/8. Let r(j) = -3j*2 - j - 11. Let x(d) = vu(d) - 11r(d). Give x(0). 9 Suppose 0 = -4n + 149 + 35. Let z(p) = -n + p*2 + 22 - 5p + 16. Suppose -2 = l - 2w, 4 = 3l - l - 2w. What is z(l)? -2 Suppose 17 - 101 = 3b. Let i = b + 20. Let c(t) = 5t2 - 3t + 3. Let k(r) = 2r2 - r + 1. Let m(u) = ik(u) + 3c(u). Calculate m(-4). -11 Let o(b) = -2b + 4. Let m = -1854 - -1862. Determine o(m). -12 Let z(p) = -26p - 36. Let c(j) = -10j - 18. Let i(k) = 5c(k) - 2z(k). Give i(6). -6 Let t(l) be the first derivative of l*4/4 + 4l3/3 - l2 + l - 2. Let k(b) be the first derivative of 3b2/2 + 23b - 9. Let s be k(-9). Give t(s). 9 Let p(n) = n*3 - 10n*2 + 7n + 12. Let q = 216 - 207. What is p(q)? -6 Suppose -5o - 15 = -0o. Let u(w) be the second derivative of -w4/12 - w3/3 + 2w2 + w. Let a be u(o). Let r(h) = 9h + 1. Determine r(a). 10 Let t(i) = i*2 - i - 1. Let q(p) = -2p + 3. Let a be q(-6). Let d(k) = -4k + 3k + ak2 - 13k2 - 2. Let h(y) = -d(y) + t(y). What is h(1)? 0 Let u(g) = g3 + 6g2 + 7g + 5. Let w be u(-5). Let i(q) = -7 + 1767q2 - 1766q*2 + 3q + 2q. What is i(w)? -7 Suppose l - x = -2, -12 = l + 2l - 5x. Let s(v) be the first derivative of -2v*2 - v - 64. Determine s(l). -5 Let w = -1 - 2. Suppose p + 15 = 3y, 3p = -y + 8p - 9. Let u(l) = 0 - 4 + y - l + 3l. Give u(w). -4 Let w(p) = -p3 + 4p*2 + 6p + 1. Let c be w(5). Let h be c(-8 + 3)/5. Let b be 620/(-120) - 1/h. Let n(z) = z - 2. Calculate n(b). -7 Let k(w) be the first derivative of -6w*2 + w + 2. Suppose 0 = -o + 2j + 11, o - 2o + 4j = -21. Calculate k(o). -11 Suppose t + 3f = -9, -27 = 3t - 5t + 3f. Let u(m) = 17m2 - 3m + 13. Let b(d) = -21d2 + 2d - 14. Let l(r) = 4b(r) + 5u(r). What is l(t)? 3 Let h(g) = g*2 + g + 1. Let u(x) = -5x*3 + 3x*3 + 5 + 133x*2 + 7x + 3x3 - 125x*2. Let n(v) = 4h(v) - u(v). Determine n(-3). -1 Let m(v) be the first derivative of v*3/3 - 7v*2/2 + 6v - 772. Let j(a) = -2a2 - 3a - 3. Let i be j(-2). Let y = i + 9. Give m(y). -6 Let t be ((-4)/(-6))/(8/276). Suppose q - 12 = -3q, 4m - t = -5q. Let h(v) = -8 + 9v + 5 - 3v - v3 + 8v*2 - 3vm. Give h(6). -3 Let t = -163 + 169. Let w(m) = m3 - 6m2 - 2m + 9. Give w(t). -3 Let q(a) = 12a2 - 4a + 4. Suppose -5j + 5 = 0, -b - 3j - 1 = -6. Calculate q(b). 44 Let s(l) = l3 - l2 - l + 16. Let n = 307 - 307. Calculate s(n). 16 Let u(x) = x*3 + 7x*2 + x - 7. Let l be (-1 + 72/(-168))/((-2)/(-7)). Calculate u(l). 38 Suppose 0o + 4u + 24 = -4o, -5o = 2u + 27. Let l be ((-11)/15 - 2/o)-3. Let g(c) be the second derivative of 2c5/5 - c2/2 + 5c. What is g(l)? 7 Let o(r) be the first derivative of r3/3 + 8r + 11. Determine o(8). 72 Let b(c) = 4c + 5c2 + c2 - 3c2 - 2c2 + 3. Let p(h) = -h2 + h + 3. Let a be p(3). Determine b(a). 0 Let o(f) = -f*2 + 11f - 3. Let q be ((-148)/9)/(-2) - (-216)/(-972). Determine o(q). 21 Let m(i) = 8i - 3. Let j(o) = -15o + 7. Let b(q) = 6j(q) + 11m(q). Let r(c) = c - 4. Let d(t) = 4b(t) + 9r(t). Calculate d(-7). -7 Let b(l) = -l*2 - 7l + 20. Let h be b(-9). Let r be 12/3 - (-1 + h). Let t(u) = u2 - 3. What is t(r)? 6 Let a(j) = -j3 - 7j2 - 5j + 2. Let r be 6(2/4 - 1)-2. Suppose -r = f + 3c + 2c, 3f + 18 = -2c. What is a(f)? -4 Let k(n) be the first derivative of -4n + 9 - 3/2n*2 - 1/4n*4 - 5/3n3. Suppose -w - 2 = 1. Determine k(w). -13 Let t(p) = p2 + 7p + 5. Let c be t(-5). Let i(b) = -7b - 29. Let s(a) = -4a - 15. Let u(f) = 3i(f) - 5s(f). What is u(c)? -7 Let x(v) = -v - 18. Suppose -3h + 16h + 195 = 0. Let m be x(h). Let j(l) = -l + 3. Calculate j(m). 6 Let m(h) = 13 - 14 - 11 + 6h - 9h. Give m(-9). 15 Let c(y) = 2y*2 - 8y - 14. Let f(t) = t*2 - 9t - 16. Let d(p) = 2c(p) - 3f(p). Determine d(-8). -4 Let s(x) = x*3 - 5x*2 + 4x - 1. Let n = 13 - 20. Let d = -4 - n. Determine s(d). -7 Let d(j) = -j + 6. Suppose -4p = -3p - 5. Let u = p - 2. Calculate d(u). 3 Let d(b) = b - 5. Let j be 1/(1/(-1 - -2)). Let u be (j - 0) + (1 - -1). Suppose -ul - 6 = -4l. What is d(l)? 1 Suppose c + 5 = 1, 3c = -5w - 37. Let x(y) = 3y2 + 2y - 13. Let s(l) = -l*2 - l + 6. Let t(i) = ws(i) - 2x(i). What is t(0)? -4 Let h(j) = -2j - 3. Let o(r) = -3r - 4. Let m(d) = -4h(d) + 3o(d). Calculate m(8). -8 Let n(f) = -f3 + 4f*2 + f. Let y(m) = 3m*3 - 13m*2 - 3m - 3. Let x(s) = 8n(s) + 3y(s). What is x(7)? -16 Let a(j) = -8j - 25. Let w = 2040 + -2044. Give a(w). 7 Let b(g) = -g2 + 11g - 8. Suppose -59x = -158 - 255. What is b(x)? 20 Let t(w) = w3 - w + 3. Let o be t(0). Suppose -3f + 11 = -2j - 8f, f = oj + 8. Let p(r) = -r - 5. Calculate p(j). -2 Let u(p) be the third derivative of -p4/2 + p3/6 + 5p*2 - 14p. Calculate u(-1). 13 Let y(n) be the third derivative of -n*6/120 + 2n*5/15 + 7n4/24 + n3 + 9n2. Calculate y(9). -12 Let o(z) = -4z - 846 + z*2 - 4z*2 + 2z + 847. Give o(1). -4 Let h(v) = v*3 - 5v*2 - v - 7. Suppose 0 = -72s + 64s + 40. Give h(s). -12 Let r be (-7)/(364/(-1396)) + 4/26. Let c = -19 + r. Let k(u) = -u + 18. Determine k(c). 10 Let n(z) = -z3 - 9z*2 - 15z - 15. Let v(u) = u*2 + 97u - 625. Let k be v(6). Give n(k). -8 Let y(p) = -2p2 - 9p. Let w(i) = -3i2 - 13i. Let a(h) = 5w(h) - 8y(h). Let d(b) = 3b - 13. Let o be d(5). Suppose -11 = on - 3. Calculate a(n). -12 Let b be (-6)/42 - (-9788)/14. Let o(a) = -ba2 - a3 + 3 + 701a*2 + 0a*3. Give o(3). -6 Let f(m) = -2m + 5. Let c(q) = q*2 + 6q - 1. Let i be c(-3). Let x = i + 17. Let w = -3 + x. Give f(w). -3 Let m(g) = 2g - 1. Let t(y) = -2y - 36. Suppose -4x = 0, -2f - f = -x + 9. Let p = f + -16. Let w be t(p). Calculate m(w). 3 Let a(s) = s*3 + 4s*2 - 2s - 2. Let g be 6/14 - (-3616)/56. Suppose -5c + 14 = b + g, -5b = -3c - 25. Let u be c/212/15. Calculate a(u). 6 Let y(d) = -3d2 - 6d - 2. Let q(a) = -a*2 + 38a + 78. Let o be q(40). What is y(o)? -2 Let s(f) = 6f + 6. Let d(i) = 7i + 6. Let r(z) = -4d(z) + 5s(z). Calculate r(5). 16 Let x(m) = 17m2 + 11m + 15. Let n(l) = 4l2 + 3l + 4. Let b(k) = 9n(k) - 2x(k). What is b(-4)? 18 Let i be 9(-98)/426/9. Let f(c) be the first derivative of c*3/3 + 7c*2 - 6c - 1. Give f(i). -6 Let s(l) = -l2 + l. Let c(o) = -o3 - 8o2 - 3o + 7. Let p(z) = c(z) - 2s(z). Let w be p(-5). Let h(g) = -g3 + 6g*2 + 7g + 10. Give h(w). 10 Let w be (7 - 4)/(-3) + 4. Suppose -l - 2 = -3k - w, 2k - 3 = -3l. Let g(y) be the second derivative of -y4/6 - y2/2 - y. What is g(l)? -3 Let y(u) = 6u*3 - 2u*2 - 9u + 2. Let i(m) = 5m3 - m2 - 8m + 1. Let o(q) = 7i(q) - 6y(q). Calculate o(4). 3 Let x(r) = -6r2 + 3r - 6. Let t(c) = -6c2 + 7c - 13. Let b(o) = 4t(o) - 9x(o). Determine b(-1). 31 Let i(u) = -167566u - 1 + 3 + 167567u. Suppose -3a + 5a - 6 = 0. Suppose 11 = -ao + 35. Calculate i(o). 10 Let w = -91 + 100. Let g(z) = z3 + z2 + z + 10. Let v(u) = -5u*3 - 5u*2 - 5u - 39. Let k(p) = wg(p) + 2v(p). Give k(0). 12 Suppose 0j - 48 = -4j. Let h(p) = p - 7. What is h(j)? 5 Let a(u) = -u*2 + 2u + 4. Let g be 27 - (0 - (-3 + 4)). Let s = 30 - g. Suppose t + 5h + 24 = st, 0 = -3t - h + 8. Calculate a(t). -4 Let l(n) = n - 9n - 7 + 10n + 7n - 2n2 - 3n. Calculate l(2). -3 Let w = -205 - -207. Let s(r) = -2r3 + 2r*2 - 4r + 3. Determine s(w). -13 Let l(f) = 2f3 - 7f3 + f3 - 5f2 + 1 + 3f*3 + 3f. Determine l(-5). -14 Let v(w) = 7w - 5w*2 - 3w - 67w3 - 3w + 66w3. Give v(-5). -5 Suppose 3c - 42 = -33. Suppose 0 = ck + 5w - 4, 2k + 3w - 6 = -2w. Let h(n) = 4n - 1. Determin	{ "pile_set_name": "DM Mathematics" }
the third derivative of -21688l2z*3 - 232l*2 - 13z*3 - 4z*2 + 320z - 1 wrt z. -130128l2 - 78 What is the third derivative of -19292n*5 + 131n*3 - 27728n*2 - 804n? -1157520n2 + 786 Differentiate 21431042c*3t*3 + 319c*3 - 16092c*2 wrt t. 64293126c*3t*2 What is the second derivative of -4730cv4 + 3cv3 - 93cv2 + 939cv - 23c + 8 wrt v? -56760cv*2 + 18cv - 186c Find the third derivative of -1509ct*4 - ct*3 + 2ct2 - 4ct - 219365c + 9646t4 + 1 wrt t. -36216ct - 6c + 231504t Find the third derivative of 230293k*5 - 5k4 + k3 + k*2 - 186746k - 1 wrt k. 13817580k2 - 120k + 6 What is the derivative of 108c2mr2 - 1404459c*2mr - 553693c*2r - cr2 - 30r*2 wrt m? 108c*2r*2 - 1404459c*2r Find the third derivative of -12649173p6 + 3463644p*2 + 2p - 2. -1517900760p3 What is the derivative of -60550i*3 - 414i*2 - 4i + 1466427089 wrt i? -181650i2 - 828i - 4 What is the second derivative of -600241024h5 - 565292232h? -12004820480h3 What is the second derivative of 35m*3u*2 - 151m*3u + m*2u*2 - 31m*2u + 2m2 - mu*2 + 4856u*2 + 124u - 1 wrt u? 70m3 + 2m*2 - 2m + 9712 What is the second derivative of -7628629s3v - s*2v + 240283sv + v + 13 wrt s? -45771774sv - 2v What is the third derivative of 510z*5 - 1467z*3 - 4z*2 - 927095? 30600z*2 - 8802 What is the second derivative of -22513f*2s*2 - 4f*2s - 2f2 - 2fs + 15f - 890s3 + s2 + 671s - 2 wrt s? -45026f2 - 5340s + 2 What is the second derivative of 1489728f2is2 - 37537f*2is + 3fs + 18is2 wrt s? 2979456f*2i + 36i Differentiate 14946165m*4 - 15776104 wrt m. 59784660m*3 What is the second derivative of -244k*3y*3 + 1530k*2y*2 + 2ky + 182k - y*3 - 31 wrt k? -1464ky3 + 3060y*2 What is the second derivative of -3177g*3j*2 + 138g*2j*3 + 3g - 17j3 - 7879 wrt g? -19062gj2 + 276j*3 Differentiate 182860r*3 + 447r*2 - 674093617 wrt r. 548580r*2 + 894r Find the second derivative of 307632907d5 - 2d - 11774101 wrt d. 6152658140d3 What is the second derivative of 187572095m*2 + 20701m + 4670 wrt m? 375144190 What is the second derivative of 19g3l + 1394g3 + 33g*2l + 5g2 + 1067gl - 3g + 7l - 50 wrt g? 114gl + 8364g + 66l + 10 What is the first derivative of -143254t*4 - 34t - 710382? -573016t3 - 34 Find the second derivative of -8co4 + 33410co2 - 30co + o3 + 56269 wrt o. -96co2 + 66820c + 6o What is the second derivative of 4163223r*3 + 9539137r? 24979338r Differentiate s3 + 13086969s*2 + 45358923 wrt s. 3s*2 + 26173938s What is the second derivative of -4481252o4 + 702507o wrt o? -53775024o2 What is the third derivative of -9a*4q - 159a4 + 39a*3q + 4a2 + 3a - 88q - 99 wrt a? -216aq - 3816a + 234q What is the third derivative of 385109666t*4 + 364193999t*2 wrt t? 9242631984t Find the second derivative of -14768451w2 + 19433w + 212. -29536902 Find the third derivative of 111o6 + 474916o*3 + 363561644o*2 wrt o. 13320o3 + 2849496 Differentiate k3z + 46k*3 - 82701kz + 25341529z with respect to k. 3k2z + 138k2 - 82701z What is the derivative of -2655772d4 + 39234030? -10623088d*3 Find the second derivative of -59471481y*2 - 164029y - 79. -118942962 What is the second derivative of 7b3 - 23748702b*2 - 428330702b wrt b? 42b - 47497404 What is the derivative of 13317520n*2s + 3670454n2 wrt s? 13317520n*2 What is the first derivative of 8k*3 - 896613k + 104547337? 24k2 - 896613 Differentiate -iv*3 + 14iv2 - 2iv - 120281i - 158744300v3 wrt i. -v3 + 14v*2 - 2v - 120281 What is the first derivative of 1412t2 + 993t - 1696003? 2824t + 993 Find the third derivative of 775h*5 + 3h*4 - 2351h*3 - 87h*2 - 19h - 532. 46500h2 + 72h - 14106 Find the first derivative of -30g4 - 23032g*2 + 13118608 wrt g. -120g*3 - 46064g What is the first derivative of -63637v2 - 140v + 210776690 wrt v? -127274v - 140 Find the third derivative of 3g*6 + 88974383g*5 + 1054987616g*2. 360g*3 + 5338462980g*2 Differentiate -67o*2sz - 6o*2s + 3006os*2z - 277556os*2 wrt z. -67o*2s + 3006os*2 Find the second derivative of 115258845p*2 + 18921659p - 2. 230517690 What is the third derivative of 13058285d3 - 9024577d*2? 78349710 Find the second derivative of -6o*3 - 1681136o*2 + 72715o + 212 wrt o. -36o - 3362272 What is the third derivative of 10148772k*3 - 2312767k*2 + 1? 60892632 Differentiate -184grv + 29gr + 1305gv - g + 701529728rv with respect to g. -184rv + 29r + 1305v - 1 What is the first derivative of -19076456h + 25565600 wrt h? -19076456 Find the third derivative of 247549092q*4 + 224225698q*2 wrt q. 5941178208q What is the second derivative of -2483729i2 + 154i - 1067 wrt i? -4967458 What is the second derivative of 4946303p2 + 7764090p wrt p? 9892606 Find the second derivative of -101465b5 - 2b*4 + 19b*2 - 1637b - 41 wrt b. -2029300b3 - 24b*2 + 38 Find the third derivative of 29119226a*2z*3 + 67783a*2z + 148az*2 wrt z. 174715356a*2 Find the first derivative of -143006063t*4 + 111191112. -572024252t*3 What is the second derivative of -105398h*5 + 4h*4 - 2h*3 - 49h - 143603 wrt h? -2107960h3 + 48h*2 - 12h Find the second derivative of 2d4x - 9968933d2xy - 2dxy - 4dx - 4dy - 5656d - 2xy - x - 4y wrt d. 24d2x - 19937866xy Differentiate -5h2 - 33626435h - 801084679 with respect to h. -10h - 33626435 What is the first derivative of 313426788l*4 + 179587428? 1253707152l*3 What is the third derivative of 185325002v*3 - 86v*2 + 161444v? 1111950012 Find the third derivative of -190390y6 + 22y5 - y3 + 94416562y2. -22846800y*3 + 1320y*2 - 6 What is the third derivative of -6155401h*3 + 117009h*2 + 33h? -36932406 Find the third derivative of 15834664r2x*3 - 35622r*2x*2 + 5x*2 wrt x. 95007984r*2 What is the second derivative of -68106056u*5 - 43729u + 421? -1362121120u3 What is the second derivative of -4318is2 + 1694isx*2 - 19ix2 + 2886s*2x*2 + 2s*2x + 125s wrt s? -8636i + 5772x2 + 4x Find the third derivative of 7132703io*3 - 10io2 + 2327io - 10o*2 wrt o. 42796218i Find the second derivative of 30532788d2w3 - d2w - 14dw - 104709d wrt w. 183196728d2w Find the first derivative of 4391688b - 6084744. 4391688 What is the second derivative of 51s*3vw2 - 12s*3vw + 220913s*3w*2 + 51577s*2w wrt w? 102s3v + 441826s3 What is the first derivative of -1090269335m*4 + 701170531 wrt m? -4361077340m*3 What is the second derivative of -207890100x*5 - 115861922x? -4157802000x3 What is the third derivative of -13208571l*3 + 9636115l*2? -79251426 Find the first derivative of 36872617z + 78855220. 36872617 What is the second derivative of 43807083o3 + 17137202o wrt o? 262842498o Find the second derivative of -195910471c*2 - 105172331c wrt c. -391820942 Differentiate 50922295l2y + 102293353l2 wrt y. 50922295l*2 What is the second derivative of -23850115d*2 - 18942787d? -47700230 What is the first derivative of -56o3 - 26511o*2 - 40836815? -168o*2 - 53022o What is the second derivative of -187387913c2j*3 + 1263cj2 + 2cj - 340j*3 - 1 wrt c? -374775826j*3 Find the third derivative of 770953a*4i - 42a3i*3 - 34a*2i - 10886ai*3 + 17ai + 3i*3 wrt a. 18502872ai - 252i*3 What is the derivative of 106217938t + 2714450 wrt t? 106217938 What is the third derivative of 51836644j4 - 2j*3 - 23j*2 + 28j + 38170? 1244079456j - 12 What is the second derivative of 10595l*5 + 1386l*4 - 87352991l? 211900l3 + 16632l*2 Find the first derivative of 10o*3 - 5014o*2s + 543os - 60772s - 610 wrt o. 30o*2 - 10028os + 543s What is the derivative of 1379573419ax*2 + 10a - 11454469 wrt x? 2759146838ax Differentiate 1189ry*4 - 4ry + 84792041r + 1231*y with respect to y	{ "pile_set_name": "DM Mathematics" }
5, -7m + 12m = -5k - 5075025. What is m rounded to the nearest 100000? -1000000 Let d = 131.7 + -20.7. Let g = -110.9999435 + d. What is g rounded to 5 decimal places? 0.00006 Let g = -143.8662461101 + -0.1337756899. Let k = -100 + -44. Let r = k - g. What is r rounded to six decimal places? 0.000022 Let y = 0.34119 + -0.3226. What is y rounded to three dps? 0.019 Let l(r) = -r3 + 4r2 + r - 3. Let y(m) = m2 + 3m - 6. Let z be y(-5). Let c be l(z). Let g be 1033 + 5/c. Round g to the nearest ten. 310 Let k = 1764 + -783. Let y = 980.999999061 - k. What is y rounded to seven dps? -0.0000009 Let s(q) be the first derivative of -225003q2/2 + 3q + 3. Suppose -25 = 2y - 7y, 4y - 24 = -4m. Let o be s(m). Round o to the nearest 10000. -230000 Suppose 2m = 31m - 1189. Suppose -m = 5y + 219. Round y to the nearest 100. -100 Let t = 585 + -452. Let g = t - 133.194. What is g rounded to 0 dps? 0 Let u = -279.483 - -0.483. Let b = -239.2 - u. What is b rounded to the nearest ten? 40 Let i(u) = -59 - 19 + 2889523u + 11 - 158 + 1043302u. Let s be i(-7). Round s to the nearest 1000000. -28000000 Suppose -2n + 21d = 18d - 795, 0 = 3n + 5d - 1164. Let o be n/((-12)/(-28)7). What is o rounded to the nearest ten? 130 Let m = -384.99981214 - -385. What is m rounded to 5 decimal places? 0.00019 Let a = 3715.408 - 3733. Round a to zero decimal places. -18 Let n = -240554561.10000161 - -240554590. Let r = -28.9 + n. What is r rounded to 7 dps? -0.0000016 Suppose 0 = -4s, 458k - 462k + 3s = 1807200. Round k to the nearest 100000. -500000 Let a = 413728.0115 + -413567. Let k = 161 - a. Round k to 2 dps. -0.01 Let p = -708 - -1220. Let l = -511.99792 + p. What is l rounded to four decimal places? 0.0021 Let d = 793 + -1326. Let q = 116328.266121 - 116861.2659. Let t = d - q. Round t to five decimal places. -0.00022 Let c = -126193.3700176 + 126193. Let z = c - -0.37. Round z to five dps. -0.00002 Let y = -3474793788 + 3474793610.2265829. Let d = -83.773427 - y. Let c = d + -94. Round c to 6 dps. -0.00001 Let s = 4210 + -4209.99990215. Round s to five decimal places. 0.0001 Let r = -17932 + 17946.167. What is r rounded to one dp? 14.2 Let x = 1311.3 + -1137. Let r = x + -156. Let h = r - 17. What is h rounded to the nearest integer? 1 Let j = -0.092897217 + 0.159397916. Let f = -0.0665 + j. What is f rounded to 7 decimal places? 0.0000007 Let y = -29498.5829 + 5.5829. Let v = -29493.031682 - y. Let d = v - -0.032. Round d to 4 decimal places. 0.0003 Let f = -3418 + 3388.78. Let s = -22 - f. Round s to zero dps. 7 Let d = -105841.13012 + 106090.14. Let z = d - 249. What is z rounded to three decimal places? 0.01 Let n be (-7048)/(-14) - 16/(-28). What is n rounded to the nearest one thousand? 1000 Let x = 21069738 + -8889738. Suppose 19j + x = 20j. Round j to the nearest one million. 12000000 Let z = -2587.5 - -2585.9051. What is z rounded to 1 decimal place? -1.6 Let n = 2969.7761 - 2970. Round n to 2 dps. -0.22 Let o = -38317.0049566 - -38317. What is o rounded to three decimal places? -0.005 Let a = 2.4674 + 1457.8326. What is a rounded to the nearest ten? 1460 Suppose -6083199 = -128x + 1966721. What is x rounded to the nearest ten thousand? 60000 Let t = 34654136391.999669 - 35356547523. Let j = 702411498 + t. Let z = 367 - j. Round z to 4 dps. 0.0003 Let l = 765 + -1217. Let u = -449.11 - l. Round u to the nearest integer. 3 Suppose -5w + 10 = -0w, x - 4w - 92 = 0. Suppose -109p + xp = 81900000. What is p rounded to the nearest one million? -9000000 Let z = 39129.60016 + -39127. Let v = 715 + -717.6. Let u = z + v. Round u to 4 dps. 0.0002 Let t = -118 - -66. Let b = t - -162. Let p = b - 110.029. Round p to one dp. 0 Let i = -144 - -146. Suppose 0 = 4w - iw - 5f - 1200, 0 = 3w - 4f - 1786. What is w rounded to the nearest one hundred? 600 Let t = 94.1 + -5.1. Let u = -7 + t. Let i = u + -82.0000158. What is i rounded to 6 decimal places? -0.000016 Let o(i) = i*3 - 18i*2 - 3i - 22. Let y be o(-18). Let u = y + 25531. Suppose 5l + g = -u, -l - 3g + 15 = 2792. Round l to the nearest one thousand. -3000 Let r = 36432 - 33938.1. Let x = 2350 - r. Round x to the nearest ten. -140 Let h = 1428113046 + -1428113050.975337672. Let n = 0.024666928 - h. Let p = n + -5. What is p rounded to 6 dps? 0.000005 Let j be ((-984)/36)/(((-20)/(-5472))/(-5)). What is j rounded to the nearest 1000? 37000 Suppose -219k + 214k + u - 73201 = 0, -3k - u - 43919 = 0. What is k rounded to the nearest 1000? -15000 Let u = 1366.9557 - 1367. Round u to 1 decimal place. 0 Let r = 11.14 - -719.86. Let u = -690.9 + r. What is u rounded to 0 decimal places? 40 Let f = -11.411 + 11.410994701. Round f to 6 dps. -0.000005 Let n = -54078.7117 - -54184.8. Let t = n - 106. Round t to three decimal places. 0.088 Let d be 2((-21)/(-6))/7. Let z(y) = -46y3 - 430y*3 - y + 0 + 3y + d - 2y2. Let g be z(1). What is g rounded to the nearest one hundred? -500 Let p = -9120.23421708 + 10187.2342257. Let o = 1067 - p. What is o rounded to 6 dps? -0.000009 Let m = -11275544 - -11275719.99839. Let b = 2546 + -2722. Let l = m + b. What is l rounded to 4 dps? -0.0016 Let c = -10.2825 - -69.6615. Round c to the nearest ten. 60 Let t = 2521 + -2521.0000001591. Round t to seven decimal places. -0.0000002 Suppose 11 = -3x + 5x + 5l, -3l + 1 = 4x. Let a be (x/10)/(14/(-350)). Suppose 83333 - 31833 = ap. Round p to the nearest 10000. 10000 Suppose -5x + x = -39032. Let j be 4/(3/(-9) - x/(-29310)). Round j to the nearest 1000. -10000 Let r = 7 - -41. Let g = r - -48. Let f = -96.0075 + g. What is f rounded to 3 dps? -0.008 Suppose 64k + 2192768 = 68224. Round k to the nearest 10000. -30000 Let a = 33.041 + -0.041. Let n = a - 15. Let z = 18.00000425 - n. What is z rounded to 6 decimal places? 0.000004 Let h(q) = -q3 - 4q*2 + 6q + 13. Let t = -23 - -29. Let l be h(t). Let i = l - -130. Round i to the nearest ten. -180 Let l = -311.4 - -41.4. Let q = 269.98941 + l. Round q to three decimal places. -0.011 Let p = -32320 + 33567.53. Round p to the nearest 10. 1250 Let s = -278.85376022638 - 0.14623983362. Let y = s - -279. Round y to 6 dps. 0 Suppose 2092090625 - 5149013015 = -137u + 24992457610. Round u to the nearest one million. 205000000 Let b = 986448.47 + 7454587.73. Let f = 8440887.2000234 - b. Let v = f + 149. Round v to 6 dps. 0.000023 Let i = 506789.2000285 - 506754.2. Let h = 35 - i. What is h rounded to five dps? -0.00003 Let y = 27122 - 20070.2. Round y to the nearest 1000. 7000 Let j = -52437351446203 + 52437351443820.0000002191. Let v = j - -2383. Round v to 7 dps. 0.0000002 Let n = -2.4 + 1.08. Let i = 17.52 + n. Let j = i + -16.199524. What is j rounded to four dps? 0.0005 Let c = 0.442 + -0.973. Let g = c + 0.932. Let n = g + -0.400999759. What is n rounded to 7 decimal places? 0.0000002 Let p = 1168.711 + -1271.07. Round p to the nearest ten. -100 Let f = -47.01259016 - 2901.98564884. Let z = -2949 - f. What is z rounded to four dps? -0.0018 Let u be (-2 + 1)/(-2(-4)/(-592)). Suppose 24 = 5p + u. Let j be p + 2/2 - 0/(-2). Round j to 0 decimal places. -9 Let s = -1112 + 1112.0000054204. Round s to 6 decimal places. 0.000005 Let q = 1634804.11 - 1634795.50004091. Let x = 8.61 - q. What is x rounded to six dps? 0.000041 Let s be -44430(1 - 4201)/12. What is s rounded to the nearest 1000000? 6000000 Suppose -3p - 15415994 = -5p + 4b, -3p - 3b = -23124009. Let i = 29521999 + p. Round i to the nearest 1000000. 37000000 Let v = -3158870289693555.5999731 + 3158870596740519. Let r = -307046980 + v. Let z = r - -16.6. What is z rounded to 6 decimal places? 0.000027 Let i = 169 - 170.776. Let p = -0.026 - i. Let k = 0.24 - p. Round k to 1 dp. -1.5 Let p = -11756 - -11756.00026178. What is p rounded to 4 dps? 0.0003 Let v = 3.3 - 2. Let s = -21402 - -21400.6961. Let y = s + v. Round y to three dps. -0.004 Let g = -195.5 - 1119. What is g rounded to the nearest one hundred? -1300 Let m = 4.0904 + 2.5751. Let s = m + -6.7. Let k = -0.0004 + s. Round k to 2 decimal places. -0.03 Let m = 438860097658868 - 438860112102284.69999804. Let s = -14443422 - m. Let x = 5.3 + s. Round x to seven decimal places. -0.000002 Let d = 10.77032 + -1	{ "pile_set_name": "DM Mathematics" }
terms in 3j2 - 20j*3 - 8j*2 + 5j*2. -20j*3 Collect the terms in 35m + 34m + 60m - 128m. m Collect the terms in -10n*2 - 270n + 270n. -10n*2 Collect the terms in -2998b*2 + 1129b*2 - 1184b*2. -3053b*2 Collect the terms in 2l + 27739 - 27739. 2l Collect the terms in -10r*3 - 3r*3 + 5r3 - r3. -9r3 Collect the terms in 486341 + f + 486341 - 972682. f Collect the terms in 6n*2 + 482 - 2n + 2n - 482. 6n*2 Collect the terms in -32 - 38 + 70 - 10z. -10z Collect the terms in -4 + 20c - 7 + 23 - 10. 20c + 2 Collect the terms in -10 - 15m + 2 + 8. -15m Collect the terms in 25y + 35y + 32y - 118y + 30y. 4y Collect the terms in -58 - 25 + y + 152 - 54 - 50. y - 35 Collect the terms in 0g*2 - 1752 + 0g2 - g3. -g*3 - 1752 Collect the terms in -11i*3 - 15i*3 - 62i3 + i3. -87i3 Collect the terms in -159g*3 + 460g*3 - 140g*3 - 158g*3. 3g3 Collect the terms in -v2 + 18954 - 18954. -v*2 Collect the terms in -15v*3 - 46v*3 + 3v*3. -58v*3 Collect the terms in v - 18v*2 - 2v*2 - v. -20v*2 Collect the terms in 143f - 45f - 43f - 49f. 6f Collect the terms in 9n - 8n + 6n + 5n. 12n Collect the terms in -2 + 0 - 13m - 1 + 4. -13m + 1 Collect the terms in -2 + 8690o*2 + 2 + 0 - 8691o2. -o2 Collect the terms in 12m - 12m - 60 + 2m2. 2m*2 - 60 Collect the terms in -9p + 120p2 - 9p + 20p. 120p*2 + 2p Collect the terms in 0r3 + 799r*2 - 799r*2 + 4r*3. 4r*3 Collect the terms in 24g - 10g - 30g. -16g Collect the terms in 28 + 33 - 61 + 8o*2 - 2o*2. 6o2 Collect the terms in -b2 - 129 + 129. -b*2 Collect the terms in 165h - 85h + 8h*2 - 80h - 20h2. -12h*2 Collect the terms in 5j*3 - 76j + 76j. 5j*3 Collect the terms in 0 - 7 - 9 + 124d. 124d - 16 Collect the terms in 27o*2 + 26o*2 - 5 - 8o*2. 45o*2 - 5 Collect the terms in -6p + 8p - 4p + 3p. p Collect the terms in 58p*2 + 0p*3 - 58p*2 - 2p*3 - 3p*3. -5p*3 Collect the terms in -7i + 6i + 7i + 6i. 12i Collect the terms in 3j3 - 316j + 316j. 3j*3 Collect the terms in 0g2 - g2 + 8g2 + 5g*2. 12g*2 Collect the terms in -2 + 6a - 23a - 4a - 4a. -25a - 2 Collect the terms in -427r2 + 56 - 56 - 5r*3 + 427r*2. -5r*3 Collect the terms in 2 - 17t*3 + 12t*3 - 2. -5t*3 Collect the terms in 1671 + 2h*3 - 1671. 2h*3 Collect the terms in -2w3 - w3 - 5w3 - 70w. -8w3 - 70w Collect the terms in -62c3 - 205c*3 - 581c*3. -848c*3 Collect the terms in 192c*3 - 22943 - 193c3 + 22943. -c3 Collect the terms in 12f - f + 5f + 8f. 24f Collect the terms in -83z2 - 119z*2 + 17z*2. -185z*2 Collect the terms in 81g*3 - 48g*3 - 43g*3. -10g*3 Collect the terms in -2p*2 + 20p + 4p2 - 20p. 2p2 Collect the terms in -3k + 1729k2 + 3k - 1731k2. -2k*2 Collect the terms in 2j*2 - 5j*2 - 16j*2. -19j*2 Collect the terms in 3z - 97z2 + 125z*2 - 3z. 28z2 Collect the terms in -639 - 2c*2 + 410 + 229. -2c*2 Collect the terms in -97 + 2f + 10 - 38 + 0f. 2f - 125 Collect the terms in 20s2 - 38s + 12s2 + 36s. 32s2 - 2s Collect the terms in o + o*3 + 5o - 4o3. -3o*3 + 6o Collect the terms in -23y3 + 2 - 2 + 35y*3 - 17y*3. -5y*3 Collect the terms in -82r*2 + 4r*3 + 82r*2. 4r*3 Collect the terms in 22c*3 - 10c*3 + 18c*3. 30c*3 Collect the terms in 17o*3 - 8o*3 + 1 - 11o - 1. 9o3 - 11o Collect the terms in 0n2 + 57n - 7 + 7 + n2. n2 + 57n Collect the terms in 12g*2 + 21g - 48g + 27g - 10g2. 2g*2 Collect the terms in -9s + 1 - 1 + 4s. -5s Collect the terms in -6 + 26 + 4c2 - 7 - 14. 4c*2 - 1 Collect the terms in -1 + 6 + 5q - 6q + 8. -q + 13 Collect the terms in -40q*3 + 85q*3 - 41q*3. 4q*3 Collect the terms in 0u2 + u2 + 13 + 3u2 - u2. 3u*2 + 13 Collect the terms in 3x - 7x - 4x - 4x. -12x Collect the terms in -22l2 - 27l*2 + 40l*2. -9l*2 Collect the terms in -1512 + 1512 - k. -k Collect the terms in -30910 + 5g + 30910 - 4g. g Collect the terms in -12b + 7b - 5b. -10b Collect the terms in -146j*2 + 144j*2 - 28 - 4j + 4j. -2j*2 - 28 Collect the terms in 36c - 4c + 0c - 4c + 2c. 30c Collect the terms in -8c*3 - 4c*3 + 6c*3 + 5c*2. -6c*3 + 5c*2 Collect the terms in -2s*3 - 39 + 3 + 36. -2s*3 Collect the terms in -77821738 + w + 77821738. w Collect the terms in 4 + 37c + 1 - 10c - 1. 27c + 4 Collect the terms in -16o2 - 174o + 174o + 18o*2. 2o*2 Collect the terms in 10u*2 - 10u*2 - 2u*3 + 0u*3. -2u*3 Collect the terms in 205o + 4o2 - 2o*2 - 360o. 2o2 - 155o Collect the terms in 1 - 1 + 5l - 10l. -5l Collect the terms in -4a + 10a3 + 0 + 0. 10a*3 - 4a Collect the terms in -71v2 - 42v*2 - 41v*2 - 2v. -154v2 - 2v Collect the terms in 2x2 + 4x*2 - 15x*2 + 7x*2 + 5x*2. 3x*2 Collect the terms in 11c*2 - 69 - 43c*2 + 69. -32c*2 Collect the terms in 0 + 4n*3 - 4 + 4. 4n*3 Collect the terms in 249 - 18t*3 - 249. -18t3 Collect the terms in -211 - 83 + 294 - x3. -x*3 Collect the terms in 26o*3 + 0o*3 - 24o*3 - 7o*3. -5o*3 Collect the terms in 376c + 1 - 2 - 3 + 1. 376c - 3 Collect the terms in -219x + 458x - 231x. 8x Collect the terms in 293o3 + o2 - o*2 + 153o*3. 446o*3 Collect the terms in -2x*2 + 3x*2 - 5x + 5x. x2 Collect the terms in 30 - 2a - 64 + 34. -2a Collect the terms in -4u + 3u + 16u. 15u Collect the terms in -1 + 53b + 22b - 13b. 62b - 1 Collect the terms in 17f + 3f3 + 17f - 34f. 3f*3 Collect the terms in 8w*3 - 41w*3 - 7w*3 - 18w*3. -58w*3 Collect the terms in -11952 + 10i*3 + 11952. 10i*3 Collect the terms in 6b - 5b3 + 6b*3 - 6b. b*3 Collect the terms in -4 + 0 + 4 - 1032c*3. -1032c*3 Collect the terms in -41c2 + c3 - 66c2 - 40c2. c3 - 147c2 Collect the terms in -26 + 6h + 26. 6h Collect the terms in 20p*3 + 7p*3 - 8p*3. 19p*3 Collect the terms in -20 + 9n + 17 + 17n. 26n - 3 Collect the terms in 94h - 45h - 55h. -6h Collect the terms in 4o - 8o + 2o. -2o Collect the terms in -17t + 147 - 52 - 47 - 48. -17t Collect the terms in 11g2 - 6g*2 - 2g*2. 3g*2 Collect the terms in 77y2 + y2 + 211y2 + y2. 290y*2 Collect the terms in 5z - 2z - 6z + 9z. 6z Collect the terms in 3v - 3 - 78 - 42 + 20. 3v - 103 Collect the terms in 143 - 143 + 20n3. 20n*3 Collect the terms in 2 - 1 - 1 + 6u*3. 6u*3 Collect the terms in -3 - 4o + 0 + 3. -4o Collect the terms in -566b*2 - 569b*2 + 1138b*2. 3b*2 Collect the terms in 5b + 6b - 6b - 2b. 3b Collect the terms in 3o3 + 86o*2 - 86o*2. 3o*3 Collect the terms in 6p - 122p - 56p - 38p. -210p Collect the terms in -71b2 + 90b*2 - 16b*2. 3b*2 Collect the terms in -17p - 66p - 406p + 47p. -442p Collect the terms in 3i3 + 2i + 5i - 7i. 3i3 Collect the terms in 0 + 0 - 59g + 78g. 19g Collect the terms in -376u2 + 187u*2 + 189u*2 + 16u*3. 16u*3 Collect the terms in 50w + 145w + 28w. 223w Collect the terms in 5h*2 + 19h*2 + 2 + 6h*2. 30h*2 + 2 Collect the terms in -33g*2 - 3g*2 - 4g*2 - 15g*2. -55g*2 Collect the terms in -459 + 2i + 159 + 151 + 149. 2i Collect the terms in 40p*2 + 39p*2 - 74p*2. 5p*2 Collect the terms in 126o*3 - 39o*3 - 43o*3 - 41o*3. 3o*3 Collect the terms in 0 + 100t - 20t + 3. 80t + 3 Collect the terms in -15d3 + 15d*2 - 15d*2. -15d*3 Collect the terms in 0n + 16n + 5 - 2n. 14n + 5 Collect the terms in -3k*3 - 11k*3 - 2k*3 - 7k*3. -23k*3 Collect the terms in -293t*2 + 293t*2 - 6t*3. -6t*3 Collect the terms in -8i*3 + 29i*3 - 24i*3. -3i*3 Collect the terms in 2 + 76m*2 - 234m*2 + 75m*2 + 73m*2. -10m*2 + 2 Collect the terms in -178z*3 - 2z*2 + 2z*2 + 187z*3. 9z*3 Collect the terms in -71 - 3x*2 + 34 + 37. -3x*2 Collect the terms in -7z2 + z2 + 3z2 + 2z*2 + 2z2. z2 Collect the terms in -14w2 + 29w*2 - 32w*2. -17	{ "pile_set_name": "DM Mathematics" }
32 divided by 476 107 118515 divided by -1 -118515 What is -399 divided by -9? 133/3 Divide 5 by -33087. -5/33087 Calculate -2537 divided by -14. 2537/14 What is 1176213 divided by 3? 392071 38617 divided by 38617 1 What is 1171500 divided by -6? -195250 Divide 126437 by -1. -126437 What is 0 divided by 49221? 0 -45120 divided by 376 -120 Calculate -151500 divided by -15. 10100 Calculate -22229 divided by -4. 22229/4 Calculate 809088 divided by -24. -33712 69633 divided by -2579 -27 Divide 331128 by 1533. 216 What is 66080 divided by -1652? -40 Divide 13 by -3342. -13/3342 1 divided by -120096 -1/120096 What is -1119005 divided by -223801? 5 Calculate -146484 divided by 18. -8138 Divide -1918682 by -461. 4162 Divide 14029 by 14029. 1 Calculate -1767147 divided by -589049. 3 What is -39116 divided by -3556? 11 Calculate 150051 divided by -33. -4547 What is 6282 divided by 7? 6282/7 -17080 divided by -1708 10 Calculate -1252120 divided by 92. -13610 16590 divided by 105 158 What is 602300 divided by 4? 150575 What is 1 divided by -45065? -1/45065 -139472 divided by -69736 2 65 divided by -53 -65/53 -3137 divided by -1344 3137/1344 -247 divided by 95 -13/5 What is 348150 divided by -34815? -10 Divide 3 by 92695. 3/92695 Divide 626 by 3. 626/3 -35215 divided by 1 -35215 What is -730290 divided by 121715? -6 Divide 63152 by -8. -7894 Calculate -17339 divided by -1. 17339 What is 34119 divided by 223? 153 Calculate 51473 divided by 3. 51473/3 What is -50274 divided by -126? 399 Calculate 435949 divided by 4. 435949/4 What is 23898 divided by -3414? -7 What is 2 divided by 9315? 2/9315 What is 11040 divided by -48? -230 Calculate 257 divided by 10806. 257/10806 Divide -482816 by -11776. 41 -4718060 divided by 4 -1179515 0 divided by 34767 0 Calculate 3007 divided by -790. -3007/790 Divide 29326 by 75. 29326/75 56655 divided by -1 -56655 Calculate -11840 divided by -74. 160 -5847948 divided by -23967 244 -2057 divided by -242 17/2 Divide -3677536 by -8. 459692 -13 divided by -1270 13/1270 60510 divided by 6 10085 Calculate -21204 divided by 684. -31 Calculate 498632 divided by 397. 1256 What is 3925680 divided by -220? -17844 Calculate -741240 divided by -24708. 30 Calculate -2691870 divided by -448645. 6 Calculate 1568420 divided by -156842. -10 -2 divided by -20149 2/20149 Divide -39 by 17468. -39/17468 What is -154 divided by -669? 154/669 Divide 582960 by 4164. 140 What is -13 divided by -754? 1/58 116304 divided by -3 -38768 Divide 2388 by 738. 398/123 What is -1793 divided by 10? -1793/10 What is -357 divided by 5? -357/5 Divide 119603 by -83. -1441 1206548 divided by -7 -172364 -20 divided by -451 20/451 Divide 0 by 79525. 0 26700 divided by 5340 5 What is 393 divided by -635? -393/635 What is -155122 divided by 242? -641 Calculate 1896426 divided by -126. -15051 What is -114576 divided by -3? 38192 Divide 101 by -3272. -101/3272 Divide 42 by 602. 3/43 -203752 divided by 8 -25469 132003 divided by -3 -44001 Divide 28434 by -4. -14217/2 What is 6877 divided by -2? -6877/2 Divide 983 by 2308. 983/2308 What is -4 divided by 221885? -4/221885 Divide 4 by -23206. -2/11603 Calculate -1 divided by -2326. 1/2326 -38646 divided by 19323 -2 Calculate -69600 divided by 24. -2900 What is -67021 divided by 4? -67021/4 What is 50364 divided by -6? -8394 Divide -4170255 by -5. 834051 Calculate -24128 divided by 3016. -8 What is 272091 divided by -90697? -3 47264 divided by -5908 -8 Divide -234570 by 10. -23457 Divide 7384 by -330. -3692/165 Calculate 31 divided by -3201. -31/3201 -31 divided by -949 31/949 Divide -308950 by 6. -154475/3 What is -4587501 divided by 3? -1529167 Divide -4 by -99903. 4/99903 Divide 339614 by -718. -473 Calculate -6613 divided by -15. 6613/15 46452 divided by -4 -11613 Divide -2699570 by 10. -269957 What is 26910 divided by -8970? -3 What is -4 divided by -138595? 4/138595 Calculate -495796 divided by 35414. -14 What is -161311 divided by 4? -161311/4 What is -4 divided by -15545? 4/15545 Calculate 63652 divided by -1. -63652 Calculate 9280 divided by 1160. 8 What is 97 divided by 1780? 97/1780 What is -184242 divided by 2? -92121 -111984 divided by -6 18664 Calculate 157147 divided by -5. -157147/5 What is 657104 divided by 4? 164276 Divide 233 by 99. 233/99 What is -3659415 divided by 10607? -345 Calculate 15 divided by 588. 5/196 -12290 divided by 2458 -5 Divide -695520 by 8. -86940 Calculate 1537181 divided by 3. 1537181/3 Calculate -27 divided by -80. 27/80 -224345 divided by -5 44869 Calculate 114 divided by -323. -6/17 Calculate 21814 divided by 3. 21814/3 What is 198 divided by 318? 33/53 699798 divided by 6 116633 -4 divided by -15905 4/15905 What is -282838 divided by 103? -2746 -480344 divided by 120086 -4 134580 divided by 4486 30 Divide -2814 by 5. -2814/5 Divide -72 by -4195. 72/4195 858568 divided by -17 -50504 What is 5748 divided by -21? -1916/7 18007824 divided by -4 -4501956 Calculate -27820 divided by -535. 52 What is -15 divided by -11248? 15/11248 Divide -204066 by 7558. -27 Divide -126930 by 10. -12693 -8241 divided by -6 2747/2 What is 350 divided by -3503? -350/3503 662061 divided by -1 -662061 What is -82234 divided by 2? -41117 What is -4000 divided by -25? 160 Calculate -156 divided by -212. 39/53 Divide -47 by 1789. -47/1789 -4124524 divided by -4 1031131 What is 3 divided by 43363? 3/43363 What is 367 divided by 30? 367/30 37860 divided by -18930 -2 Calculate -337926 divided by -2. 168963 Divide 7909593 by 2. 7909593/2 9730248 divided by -4 -2432562 Divide 2491240 by 122. 20420 4784 divided by -817 -4784/817 What is 5 divided by 28366? 5/28366 Calculate 79101 divided by 799. 99 123500 divided by 24700 5 What is -855 divided by -16? 855/16 -74464 divided by 18616 -4 -4288 divided by 2144 -2 Calculate 41 divided by 67472. 41/67472 Divide -17544 by -1032. 17 What is -214 divided by -775? 214/775 Calculate -24034 divided by 394. -61 Divide -20 by 482. -10/241 Divide -63100 by 4. -15775 Calculate -4347560 divided by -155270. 28 -180026 divided by 8183 -22 What is 113951 divided by 6? 113951/6 Calculate -1 divided by 12009. -1/12009 13224 divided by -2204 -6 What is 2562 divided by -42? -61 Divide 3441720 by -573620. -6 -5 divided by 74233 -5/74233 What is 1707 divided by 42? 569/14 What is -548 divided by 718? -274/359 Divide -1 by -4645. 1/4645 Divide 43134 by 3318. 13 What is 1187085 divided by -1? -1187085 Calculate -2271960 divided by -6. 378660 Calculate 371 divided by 314. 371/314 -8975 divided by 1795 -5 Calculate -65183 divided by -5. 65183/5 Divide 65 by 46357. 65/46357 What is -144203 divided by -3? 144203/3 218418 divided by 218418 1 What is 503884 divided by -251942? -2 Divide 10 by 483149. 10/483149 150354 divided by -5 -150354/5 -2823504 divided by 352938 -8 Divide 0 by -228214. 0 Divide 2593 by -71. -2593/71 Divide -101925 by 30. -6795/2 What is -405396 divided by -135132? 3 What is 1574664 divided by -131222? -12 Divide 2164392 by -94104. -23 What is 1282 divided by 255? 1282/255 What is -7095 divided by 1? -7095 Divide 17695 by 5. 3539 Calculate -117370 divided by 4. -58685/2 81565 divided by -5 -16313 33735 divided by 173 195 Divide -3 by -495056. 3/495056 331578 divided by -4251 -78 Calculate 0 divided by -32574. 0 What is -3206708 divided by -4? 801677 Calculate -61490 divided by 12. -30745/6 What is 937913 divided by -5? -937913/5 Divide 0 by -41609. 0 3 divided by -368582 -3/368582 What is 0 divided by 23336? 0 Divide 340414 by -2. -170207 Calculate 3625020 divided by 548. 6615 What is -16715 divided by 5? -3343 Divide 1 by 474294. 1/474294 Divide 937090 by 5. 187418 What is -7252 divided by 2? -3626 What is 2444 divided by 32? 611/8 Calculate -36390 divided by -7278. 5 Calculate 37 divided by 102. 37/102 Divide 759915 by 3. 253305 Divide -1977 by -13. 1977/13 Calculate -55764 divided by -19. 55764/19 Divide -267984 by -44664. 6 What is 3028 divided by -96? -757/24 What is 5 divided by -1234248? -5/1234248 Divide 0 by -355. 0 Divide 4662 by -1. -4662 Calculate 36150 divided by 5. 7230 Divide 4489190 by -5. -897838 -1925154 divided by -19446 99 Divide -674 by -4. 337/2 What is 8922 divided by -3? -2974 Divide -7936 by -201. 7936/201 What is 1667120 divided by 208? 8015 What is -77	{ "pile_set_name": "DM Mathematics" }
4 + 2f - 12 + 5/2f*2 - 1/5f5 + f3. Factor l(j). -(j - 2)(j + 1)3 Factor 16/5 + 8/5d + 1/5d2. (d + 4)2/5 Let w(x) = 2x*2 + 1. Let c(a) = -10a*2 - 10a - 18. Let o(l) = c(l) + 6w(l). Let o(t) = 0. Calculate t. -1, 6 Suppose 10c - 15c = 30. Let x(u) = 43u*2 + 22u*3 - 8u*2 - 17u + 4u3. Let h(m) = -9m*3 - 12m*2 + 6m. Let r(d) = cx(d) - 17h(d). Factor r(f). -3f2(f + 2) Let f(m) = 30m - 87. Let n be f(3). Let z(s) be the first derivative of -5 + 3s*2 + 1/10s*5 + 3/4s*4 + 2s + 13/6sn. Solve z(b) = 0 for b. -2, -1 Factor -x5 + 263x*2 - 132x*3 - 729 - 4x*4 + 62x*2 + 377x*2 + 31x*4 - 110x*3 + 243x. -(x - 9)*3(x - 1)(x + 1) Let v be -6(6/4 + -2). Let y be (-15)/(-9) + 1/v. Factor -2a4 - 25a*2 + 27a*y + 2a*4 - 2a*4. -2a*2(a - 1)(a + 1) Let f(u) be the second derivative of -16u + 0 + 7/4u3 + 7/8u*4 + 3/20u*5 + 3/2u*2. Let f(g) = 0. What is g? -2, -1, -1/2 Let v be (-36)/(-112)42 + (-13)/1. Factor w - 1/2 - vw2. -(w - 1)2/2 Let b(y) be the second derivative of 37y - 4/9y3 + 0 - 1/36y*4 + 3/2y*2. Suppose b(g) = 0. What is g? -9, 1 Suppose 57 - 49 = 4o. Let v(c) be the second derivative of -1/10c5 + 0 + 1/6c*4 - 1/15c*6 + 0c*o + c + 1/3c*3. Find f, given that v(f) = 0. -1, 0, 1 Let h be (1053/65 + -15)(-1 - -6). Let y(s) be the second derivative of 2s + 0s*3 + 0 + 0s*2 - 1/42s*4 + 0s*5 + 1/105sh. Solve y(i) = 0. -1, 0, 1 Let t(i) be the second derivative of i7/315 - 8i6/75 + 24i*5/25 - 35i. Solve t(a) = 0. 0, 12 Determine h so that 7h2 + 841h - 10h3 + 11h*3 - 842h - 6 - h*4 = 0. -2, -1, 1, 3 Let s be ((-5)/60-1)/(15/45). Factor 0 - sy - 1/4y*3 - 1/2y*2. -y(y + 1)2/4 Let l(g) = g2 - g - 1. Let q(u) = 4u2 - 3u - 4. Let f = -11 - -17. Suppose -fk + 10k = -24. Let d(x) = kl(x) + 2q(x). What is s in d(s) = 0? -1, 1 Let r(m) be the first derivative of -4/11m - 12 + 3/11m*2 + 0m*3 - 1/22m*4. Factor r(o). -2(o - 1)*2(o + 2)/11 Let z be ((-2)/5)/((-18)/(-360)). Let p be 63/12 + (-6)/z. Determine l, given that -2l4 - 6l*2 - 8l + 18l2 + 3l*4 - pl*3 = 0. 0, 2 Let m = 15681 - 15679. Factor -1/2n*m + 2n - 2. -(n - 2)*2/2 Factor 0 + 0k*3 + 8/23k*2 - 2/23k*4 + 0k. -2k2(k - 2)(k + 2)/23 Let w(l) = -l3 - 4l*2 + 3. Suppose 0 = 3y + 4q, 8 = y - q + 5q. Let v be w(y). Factor vj + 4j*3 + 8j*2 - 4j + j. 4j2(j + 2) Let c be (-58 + 58)(-2)/636/48. Factor 0i4 + 2/9i*5 - 2/9i*3 + 0i + 0 + ci2. 2i*3(i - 1)(i + 1)/9 Suppose 4s - 21 = w, -5w + 39 = s + 3s. Let j(l) = l*2 - 6l + 3. Let t be j(6). What is g in -sg2 + g4 + 9g*2 - 4g2 - gt + g*5 = 0? -1, 0, 1 Suppose 1280i - 115/2i4 - 420i*3 + 0 - 800i*2 - 5/2i5 = 0. What is i? -8, 0, 1 Let m(b) = -b4 + 16b + 2 + 3b*3 + 3b*2 - 2b*2 - 19b. Let y(h) = h*4 - 6h3 - h2 + 6h - 5. Let x(z) = 5m(z) + 2y(z). Solve x(u) = 0. -1, 0, 1 Suppose 15r - 18r3 - 272r*5 + 11 + 275r*5 - 2 + 0r*4 - 6r*2 - 3r*4 = 0. Calculate r. -1, 1, 3 Let b = 445/6 + -74. Suppose 0 = -z - 3 + 5. Factor 1/6f + b - 1/6fz - 1/6f*3. -(f - 1)(f + 1)*2/6 Let y(m) be the third derivative of -2/21m*3 + 0 - 2/35m*5 - 11/84m*4 + 6m*2 + 3/140m*6 + 0m. Suppose y(p) = 0. What is p? -1/3, 2 Let t(f) = -10f - 188. Let r be t(-19). Factor -3/2c*r - 9/2c + 0. -3c(c + 3)/2 Let h(i) be the third derivative of i8/33600 - i7/6300 + i6/3600 - i4/2 - 16i2. Let u(v) be the second derivative of h(v). Find w such that u(w) = 0. 0, 1 Let x(h) be the third derivative of -h6/240 + 47h*5/30 - 373h*4/48 + 31h*3/2 + 96h*2. Let x(c) = 0. Calculate c. 1, 186 Let b(s) = -s. Let d(h) = -2h*2 - 19h - 20. Suppose 11c + 7 = 16c - k, -16 = -5c - 2k. Let r(y) = cd(y) - 10b(y). Let r(u) = 0. Calculate u. -5, -2 Let s be 28/70 - (-108)/5. Factor -3k3 + 0k + s - 25 - 9k2 - 2k - 7k. -3(k + 1)3 Let m(l) be the second derivative of -l7/273 - l6/195 + l5/130 + l*4/78 + 71l. Let m(h) = 0. What is h? -1, 0, 1 Let y be (-224)/3 + (8 - (-200)/(-24)). Let p be (1/(-1))/(3 + 237/y). Factor -1/4 - 29/2g2 + pg*5 + 53/2g*3 + 13/4g - 85/4g4. (g - 1)3(5g - 1)2/4 Suppose -5r - 5 = 3j, j = 3r + 10 + 7. Let o(y) = y*2 - 6y + 7. Let g be o(j). Factor 10 + 21d - 12d + 6d + 5d*g. 5(d + 1)(d + 2) Suppose 198 + 201r - 86r3 - 143r*2 - 137r*2 - 3r*4 + 85r*2 - 40r*3 - 75r*3 = 0. What is r? -66, -1, 1 Let i(g) be the first derivative of -5g*6/6 + 16g*5 - 110g*4 + 320g*3 - 360g*2 - 84. Factor i(f). -5f(f - 6)2(f - 2)2 Let w(o) be the first derivative of o5/15 + o*4/3 - 11o*2/2 - 2. Let g(n) be the second derivative of w(n). Let g(u) = 0. Calculate u. -2, 0 Let z = -11 - -13. Find q such that -9q*5 + 7q5 - q2 - 8 + 10q3 - qz + 10q - 26q + 2q*4 = 0. -1, 2 Let l(n) = -3n*5 + 21n*4 - 51n*3 + 36n*2 + 3n. Let q(h) = -9h5 + 64h*4 - 155h*3 + 108h*2 + 8h. Let t(g) = -8l(g) + 3q(g). Solve t(b) = 0. 0, 1, 3, 4 Let z(d) be the second derivative of d6/45 + d5/15 - 5d4/6 + 4d*3/9 + 20d*2/3 - 29d + 2. What is v in z(v) = 0? -5, -1, 2 Let t(y) = -2y3 - 2y*2 + 2. Let n(k) = -11k*3 - 11k*2 + 5k + 7. Let f(s) = n(s) - 5t(s). Find a, given that f(a) = 0. -3, 1 Let x = 11 - 3. Find z such that 2 - xz*2 - 5 + 19z*2 - 14z*2 + 10z = 0. 1/3, 3 Let a(o) be the first derivative of 13 - 4/9o3 - 2o*2 - 8/3o. Factor a(k). -4(k + 1)(k + 2)/3 Factor -2/5p2 + 48/5p + 10. -2(p - 25)(p + 1)/5 Let t(z) be the third derivative of z7/315 + z6/60 - 2z5/9 - 4z*4/3 + 64z*3/9 + 183z*2. Factor t(l). 2(l - 4)(l - 1)(l + 4)*2/3 Let r(g) = 3g - 1. Let b be r(2). Suppose 2i3 - 25i*b + 3i - 4i + 24i5 = 0. What is i? -1, 0, 1 Let m(i) = i3 - 2i2 + i. Let o(x) = -2x*3 - 4x + 8x3 + 3x - 7x3. Let b(n) = -2m(n) - 4o(n). Factor b(k). 2k(k + 1)2 Suppose 80m - 72 - 248 = 0. Factor 8/13b2 + 2/13b*5 + 2/13b + 8/13bm + 0 + 12/13b*3. 2b(b + 1)4/13 Let n(j) = 4j*4 - 111j*3 + 672j*2 + 781j - 3. Let x(g) = -4g4 + 112g*3 - 672g*2 - 780g + 4. Let k(y) = -4n(y) - 3x(y). Factor k(a). -4a(a - 14)*2(a + 1) Let b(j) be the first derivative of -4j3 + 30 + 1/2j*6 + 0j*2 + 0j + 27/4j4 - 18/5j*5. Suppose b(c) = 0. What is c? 0, 1, 4 Let n(k) be the second derivative of 27/14k*2 - 1/98k*7 + 0 + 9/70k*5 - 3k - 3/70k6 - 3/2k*3 + 5/14k*4. Factor n(o). -3(o - 1)*3(o + 3)*2/7 Let o be 0/(0 - (-9)/3). Suppose o = t + 2f + f - 20, 0 = 5t - 4f - 62. Suppose t + x*2 - 39 - 10x - 2x2 = 0. Calculate x. -5 Let d(a) = -10a*5 - 30a*4 - 24a*3 + 16a*2 + 6a - 14. Let u(f) = -2f5 - 6f*4 - 5f*3 + 3f*2 + f - 3. Let q(z) = -6d(z) + 28u(z). Factor q(k). 4k(k - 1)(k + 1)*2(k + 2) Factor -10384 - 66k2 + 10357 + 24k*3 + 88k - 16k - 3k*4. -3(k - 3)*2(k - 1)2 Let c(q) be the third derivative of -q7/21 - 13q6/60 - 3q5/10 + q4/12 + 2q3/3 + 372q*2. What is k in c(k) = 0? -1, 2/5 Let n(w) = -13w - 464. Let o be n(-36). Let y(f) be the third derivative of 0f + 4/3f*3 + 0 + 8f*2 + 1/3f*o + 1/30f*5. Factor y(q). 2(q + 2)*2 Suppose -s - 1 = -5y, 2y + 49 = 4s + 17. Let a = 11 - s. Factor -1 - 2o + 0o*2 + 0o2 - oa. -(o + 1)*2 Suppose -d = x - 3, -5x + 2x = 12. Suppose 2t - 52 = 3s - ds, 0 = -4s + 12. Let 6 + 8l - 8l2 - 3l*3 + tl*2 - 23l = 0. Calculate l. 1, 2 Let l = -5317 - -5320. Find n such that 0n2 + 2/3n*l + 0n + 0 - 5/3n4 = 0. 0, 2/5 Suppose 0 = b + 2n + 1, 6n = 4b + 10n - 4. Let u = 1/30 + 3/10. What is r in 0 - ur + 0r2 + 0r*4 - 1/3r*5 + 2/3r*b = 0? -1, 0, 1 Let a = 19993/24985 + -1/4997. Find d, given that -8/5d*4 + ad*2 + 0 - 2/5d*3 + 6/5d*5 + 0d = 0. -2/3, 0, 1 Let g(z) = -z3 + z2 - 1. Let w(j) = -j*4 - 85j*3 - 2021j*2 - 17576j - 7. Let t(q) = 7g(q) - w(q). Factor t(y). y(y + 26)*3 Solve 12/5 - 46/5g + 68/5g2 + 16/5g*4 - 48/5g*3 - 2/5g*5 = 0 for g. 1, 2, 3 Let s(l) = l - 1. Let x(q) = -8q - 10. Let y(m) = -10s(m) - x(m). Let w be y(9). Solve 4/11	{ "pile_set_name": "DM Mathematics" }
Let u be 4/3(-3)/b. Solve 3c - uw + 13 = -w, kw = -3c - 23 for c. -5 Let n be 10/(-4)-318 + -3. Let y = n - 122. Solve 3w - 4 = 11, y = -r + 2w for r. 0 Let v(f) = -3f*2 - 2f + 24. Let s be v(0). Let d be ((-5)/20)/((-2)/s). Solve -4h + 20 = 0, -3g - dh - 9 = -6h for g. 2 Suppose -7 = -0x + 7x. Let n(v) = v*3 + 1. Let k be n(x). Solve 2q - 1 = 4r - 19, k = 4r + 4q - 12 for r. 4 Suppose 2k = -4b - 12, 0 = -3k - k - 2b. Let d be 1 + 4 + (1 - (k - 3)). Solve -dh + 2h = -3y + 15, 0 = -h for y. 5 Suppose 5r - 98 = -2x - 72, -2r = -4x + 4. Solve 10 = -xq - 5u, -q - 1 - 4 = 2u for q. 5 Let b be 18/5 + (-2 - (-21)/15). Suppose 4z + 4g = 36, -z + g = -bg - 9. Solve 3i + 1 = -3t - 2, -z = 4i + 5t for i. 4 Suppose -5 = -u + w, -5w = -4u - 0w + 23. Let t be 1/u320/32. Solve 22 = 3z + 2g, -3z + tg - 1 = 12 for z. 4 Suppose -c - 4m + 969 = 0, c - 3m - 136 = 805. Solve -5h - d + 22 = 0, -3h - 956d = -cd - 6 for h. 5 Let q = -306 - -77. Let w = q - -232. Suppose 0 = t + 5y - 8, -3y + 86 = 5t - y. Solve -2m - 3u = t, -3m + wu = -m - 6 for m. -3 Let u(r) = 49r + 4024. Let c be u(-82). Solve 0 = -n - b - c + 15, 4b = 3n + 8 for n. 4 Let h be 2/(-8) - 252/(-48). Let g be (h/(-2))/(1/(-4)). Let r = g + -7. Solve -4n = v, -v + 4n = rn for v. 0 Suppose -53 = 3f - 3q + 13, 3q - 24 = f. Let y be (3/(-2))/(f/56). Solve -ys + 4m = 8, -3s + 4m - 8 = -0s for s. 0 Suppose -24p + 16p = -120. Suppose pd = -5u + 12d + 12, 3u = 5d - 20. Solve -3i + 5n - 18 = -2i, -2i + 2n - 4 = u for i. 2 Let v be 3/784 - (-640)/(-104). Let w be (2/4)/(1v/(-12)). Solve 5z = -c + 5, 4c - z = -w + 21 for c. 5 Let r be 0 + (-3)/6 + (-780)/(-24). Let o be 0 - r/24-3. Solve 0 = -5u - 4j + 6, u + oj - 10 = -2u for u. -2 Suppose -197 + 161 = b. Suppose -p + 3p = 82. Let t = p + b. Solve -tj = 5g - 15, -3g - 2g + 15 = 0 for j. 0 Let l = 92 - 89. Suppose -12 = z + lw, 4w + 5 = -4z - z. Let o be 0((-2)/(-12))/(1/z). Solve -5t - 3f = -7f + 7, o = 3f - 9 for t. 1 Suppose 5i = 5z - 8z + 445, 5i = 2z - 280. Let p = 150 - z. Solve -4j = 6g - 5g + 10, p = -3j - 2g for j. -3 Let z(t) = t3 + 8t*2 - 7t - 28. Let s be z(-2). Solve c - 2j = 1, 2c + j - 2 = -s for c. -3 Let i be (-25)/(-10)2 - (-185 + -3). Let s = i + -188. Solve 0 = -3l + sv - 40, 10 = -3v + 25 for l. -5 Suppose 7y = 13y - 1848. Let h = 311 - y. Solve 5a + hp = -11, -2a - 8 = 3a + 4p for a. -4 Let b be (0 - -3) + 1/(-1). Let l = 22 + -18. Suppose 5n = -lo + 25, n + 3o + o - 5 = 0. Solve -2q = 3p - 1, -1 - 2 = -np - bq for p. 1 Suppose 2f - 8u = -3u, 8 = 4u. Suppose -15982b + 15962b + 45 + 55 = 0. Solve fn = -2t - 19, -t - b = -5n - 18 for t. -2 Let h be (-441)/153 + 3 + 49/17 + 2. Solve -3m = -hc, 0 = -76c + 71c for m. 0 Let s(p) = 2p*2 - 1866p - 3730. Let a be s(-2). Suppose -5y - 5g = 10, -2y - 2g = g + 8. Solve a = 5h + 5d, -yh - 1 = 3d - 5 for h. 2 Let r(n) = -28n2 - n - 1. Let s be r(1). Let c be 75/s6/(-5). Suppose -2b + 22 = 10. Solve -ci = -u + b + 8, 22 = -3i + 5u for i. -4 Let l = 214 + -211. Let o be (-1)/(5/(-75)l). Let h be 31/30. Solve hv - 10 = -ov, 2y + v - 4 = 0 for y. 1 Suppose -2t = 3d - 5, -d + 3t + 12 = d. Let j(q) = -12q*2 - 2q + 49. Let y be j(-8). Let c = 703 + y. Solve -dh - 5g = -0h + 10, c = g + 5 for h. 5 Suppose -14 = 4d + 3i, -d - 3i = 7 + 1. Let r be 4524/406 - (4/(-14))/d. Solve -m + 2p = -r, -m - 3m - 2p = -4 for m. 3 Suppose 4g = -8, -4b + g = -0g - 18. Let s be 6/(-5)-5 - (0 - -2). Let h be ((-16)/4)/s - (-3 - 1). Solve -a + 16 = -4z, ha = ba + 4z + 16 for a. 0 Suppose -249 + 254 = j. Suppose 18f + j = 41. Solve 2s - 3t = -s + 9, 19 = -fs - 3t for s. -2 Suppose 0 = -5h - 2b + 18, -3b + 20 = 10h - 6h. Solve -8 = 2w + 4x, -8 = -w - hw - x for w. 4 Let r = 10296 - 10295. Solve 63j - 2u = 64j, -r = -j - u for j. 2 Suppose 37s - 12 = 38s - 4v, -2v = -2s + 6. Let y(p) = -9p + 76. Let h be y(s). Solve m - hu - 3 = -11, 0 = -m - 2u - 2 for m. -4 Let m be 8/(29/(-216)). Let c be (11/2)/((-48)/m). Solve 2z - 5u + c = 3z, -4 = -2z - u for z. 1 Suppose 3t - 4n = -10, 3t + 5 = -2n + 1. Let d be t/(-21)-3 + (-80)/(-35). Suppose -di - 24 = -30. Solve 0 = 6c - 3c - a + i, 0 = 5c - 5a + 5 for c. -1 Suppose 4m - 108 = -8m. Let v be 1 + 2/6m. Solve -3o = a + 7, -va + 3o - 7o - 20 = 0 for a. -4 Let p be (9(-5)/60)/((-4)/16). Solve -3i + 45f - 3 = 40f, 3i - 3f = -p for i. -1 Let v be (-16)/(-6) - 2/(-6). Let h be ((15 - -33) + -16)/4. Solve 2g - 2 + h = vo, -4g = 0 for o. 2 Suppose -38d - 18d = 7d - 252. Solve -2p - 22 = -63k + 58k, 2k = dp + 12 for k. 4 Let s = -32 - -43. Suppose 9r = -16r + 3375. Let c = -132 + r. Solve ck + 6 = k, 5h - s = 2k for h. 1 Let g = 233 + -185. Let s = -28 + g. Solve -s = -x - 4m, 0m = 4x + 2m - 10 for x. 0 Suppose -m = -6 - 5. Let u be (4 - 26/(-10)) + 15/(-25). Let i be (-17)/(17/u) - -8. Solve 5s + 2y + 12 = -y, iy = 3s + m for s. -3 Suppose -833 = -26z - 807. Solve 7 - z = -a + 2h, -3 = -3h for a. -4 Let d be (-7)/((-63)/16) - (-30)/135. Solve -m = -dm + 3, -22 = 5j + m for j. -5 Suppose 19f - 11 = 109 - 44. Solve -2z = -2n, 0 = fz - 21n + 16n + 1 for z. 1 Let p(z) = z*2 + 11z - 90. Let o be p(-17). Let k be (-10)/35 - 38/14 - -15. Solve -a + o = -0a + 4m, -2a + k = 5m for a. -4 Let v = -3783 - -3793. Solve 5d = -j - v, -4d + 15j = 10j - 21 for d. -1 Let x(a) = -a*3 - 31a*2 + 103a + 67. Let h be x(-34). Solve 0 = -3c - hm + 37m + 10, -8 = -3c + 2m for c. 2 Suppose 36 = 4q - 5r, -r - 1 = -2q + 11. Suppose 14 = 2k + k + j, -qk = -5j + 13. Solve b + 2 = z - 0, kz - 16 = -2b for b. 2 Let j be (-11 - (-1 - 0))/(-19 - -18). Let k be (-4)/(22/j - 3). Solve 14 = -ki - 4n, -2i + 4n - 2 = i for i. -2 Suppose 167 = 15o + 92. Solve 0 = -4t + t - 5n - 37, ot = 4n for t. -4 Suppose 15l = -22l + 481. Suppose -li + 39i - 156 = 0. Let g = 6 - 6. Solve 0 = -4y + 2d - 5d + 2, g = -2y - 5d - i for y. 2 Suppose -17n = -3k - 828, 6k = -5n + 11k + 260. Solve -4s - 6 = 2x, x = 5s - n + 52 for x. -1 Let q be (-291)/2(1 - (-1)/3). Let s = q - -196. Solve -m - 4 - 12 = -4o, -14 = -2o + sm for o. 3 Let z(b) = -18b + 151. Let k be z(8). Let j(n) = 50n - 348. Let m be j(k). Solve -2w + m = 2i, -w + 17 = w - 3i for w. 4 Suppose -l - 2 = -2l, l = -r + 2. Let y be (r + 3)/(0 - 1 - -2). Suppose 0 = -6n + 8n - 4o - 6, -n = o - y. Solve 0 = -f + w - n, -15 - 6 = 3f + 3w for f. -5 Let f(m) be the third derivative of -m*4/4 - 223m*3/6 - 7m*2 + 5m. Let a be f(-38). Solve 3i + 5 - 2 = -3v, 2i = av + 26 for i. 3 Let b(r) = r*2 + 2r + r + 10 - 23. Let c(d) = d - 10. Let f be c(4). Let g be b(f). Solve 0t - 23 = -3t - 5a, 3t = ga - 17 for t. 1 Let l(i) = -6i + 159. Let m(h) = -3h + 78. Let s(q) = -6l(q) + 13m(q). Let b be s(19). Solve -bo - 4j + 11 = 0, -5j = 2o - 13 - 6 for o. -3 Suppose 9 = -n - h, 0h - h = 2n + 19. Let g be 12(n + 21). Let u = 24 - g. Solve v + 2f = 4v, -uv + f = 0 for v. 0 Let q(w) = 4w2 - 191w - 192. Let j be q(-1). Solve -i - 22 + 30 = jn, 0 = -2n + i - 3 for n. 1 Let k(t) = 22t + 131 - t2 - 2t*2 + 8t - 121. Let o be k(10). Suppose 9b = 4b + o. Solve 5q + 2c - 9 = 0, -bq + 3c + 21 = 2q for q. 3 Suppose -c + 6 = -0m + m, -5m + 16 = -2c. Suppose -92 = cu - 94. Suppose -w + 6 = 4o, w + 5o - 4 = u. Solve 5i - 20 = 4g + w, 2g = -5i for i. 2 Let r(n) = 5n*2 - 77n + 32. Let w be r(15). Suppose 0 = wi - 5y + 15, 30y = 5i + 34y - 45. Solve 14 = -5l + iz - 1, -4l + 12 = 2z for l. 1 Let w(a) = -2a + 1 - 11 + 41. Let g be w(13). Solve 5i = 2o + 10, 5 + g = -4i - 2o for i. 0 Let o(w) = -8w - 63. Let v be o(-8). Let u be (6 + -4)/(v2/4). Solve uh = l - 16, -2l = 5h - 2h + 1 for h. -3 Suppose 13r - 105 - 142 = 0. Let l be r - 13 - (1 - (1 - 1)). Solve 5v - 12 + 2 = 0, 0 = -lc + 5v + 5 for c. 3 Let q = -147 - -98. Let t be (q/21 + 2)-9. Solve -u + 5m + 9 = -4u, -2u + 13 = -tm for u. 2 Let h be 2/(-11) - (-506)/121. Suppose 0x = 2x - h. Suppose 21g = 32g - 22. Solve q + q = xj	{ "pile_set_name": "DM Mathematics" }
ere between 6:23 PM and 10:57 PM? 274 What is 530 minutes after 6:49 AM? 3:39 PM How many minutes are there between 11:28 AM and 5:54 PM? 386 How many minutes are there between 12:09 AM and 11:57 AM? 708 How many minutes are there between 4:32 PM and 10:03 PM? 331 What is 704 minutes after 3:41 PM? 3:25 AM What is 127 minutes after 11:23 AM? 1:30 PM How many minutes are there between 1:04 AM and 7:15 AM? 371 How many minutes are there between 5:35 AM and 4:02 PM? 627 How many minutes are there between 6:26 PM and 4:35 AM? 609 What is 644 minutes before 5:44 PM? 7:00 AM What is 204 minutes after 1:37 AM? 5:01 AM What is 92 minutes after 5:08 AM? 6:40 AM What is 444 minutes after 9:53 AM? 5:17 PM What is 300 minutes after 1:30 AM? 6:30 AM What is 611 minutes before 9:30 AM? 11:19 PM How many minutes are there between 6:58 AM and 9:33 AM? 155 What is 525 minutes after 10:57 PM? 7:42 AM How many minutes are there between 4:38 AM and 10:02 AM? 324 How many minutes are there between 8:34 AM and 5:24 PM? 530 What is 153 minutes after 5:04 AM? 7:37 AM What is 101 minutes before 8:32 PM? 6:51 PM What is 376 minutes after 10:11 AM? 4:27 PM What is 429 minutes before 1:03 AM? 5:54 PM What is 707 minutes before 11:48 AM? 12:01 AM What is 296 minutes before 2:52 AM? 9:56 PM What is 345 minutes before 4:14 AM? 10:29 PM How many minutes are there between 1:45 AM and 10:54 AM? 549 What is 423 minutes before 7:56 PM? 12:53 PM What is 211 minutes before 5:14 AM? 1:43 AM How many minutes are there between 1:52 PM and 7:34 PM? 342 What is 165 minutes after 11:33 AM? 2:18 PM What is 137 minutes after 7:39 PM? 9:56 PM What is 430 minutes after 9:21 AM? 4:31 PM What is 128 minutes after 12:14 AM? 2:22 AM What is 559 minutes after 2:54 PM? 12:13 AM How many minutes are there between 9:09 PM and 11:12 PM? 123 What is 12 minutes after 7:07 AM? 7:19 AM How many minutes are there between 7:28 PM and 12:52 AM? 324 How many minutes are there between 12:38 PM and 12:48 PM? 10 How many minutes are there between 1:02 AM and 8:30 AM? 448 What is 4 minutes before 2:33 PM? 2:29 PM How many minutes are there between 4:03 PM and 8:42 PM? 279 How many minutes are there between 2:59 AM and 1:11 PM? 612 How many minutes are there between 7:39 PM and 3:25 AM? 466 How many minutes are there between 10:39 PM and 3:42 AM? 303 What is 60 minutes after 3:27 PM? 4:27 PM What is 303 minutes before 10:04 PM? 5:01 PM How many minutes are there between 8:36 AM and 12:13 PM? 217 How many minutes are there between 7:23 AM and 5:57 PM? 634 How many minutes are there between 7:06 AM and 1:22 PM? 376 How many minutes are there between 12:07 AM and 7:16 AM? 429 How many minutes are there between 6:11 AM and 3:43 PM? 572 How many minutes are there between 2:14 AM and 10:35 AM? 501 What is 203 minutes before 7:17 PM? 3:54 PM How many minutes are there between 5:47 PM and 3:36 AM? 589 What is 675 minutes after 12:39 AM? 11:54 AM What is 612 minutes after 12:46 PM? 10:58 PM What is 405 minutes after 5:31 AM? 12:16 PM What is 439 minutes after 12:29 PM? 7:48 PM What is 40 minutes after 6:10 AM? 6:50 AM What is 154 minutes after 11:08 PM? 1:42 AM What is 675 minutes after 1:31 PM? 12:46 AM What is 547 minutes after 3:07 AM? 12:14 PM What is 456 minutes after 8:09 AM? 3:45 PM What is 660 minutes before 9:45 AM? 10:45 PM What is 394 minutes after 11:00 PM? 5:34 AM How many minutes are there between 1:26 PM and 6:21 PM? 295 What is 246 minutes after 10:49 PM? 2:55 AM What is 439 minutes before 1:07 PM? 5:48 AM How many minutes are there between 8:02 AM and 10:09 AM? 127 What is 428 minutes before 9:22 AM? 2:14 AM What is 149 minutes before 8:48 PM? 6:19 PM What is 532 minutes after 1:01 PM? 9:53 PM What is 148 minutes before 2:34 PM? 12:06 PM What is 324 minutes before 5:00 AM? 11:36 PM How many minutes are there between 1:05 PM and 5:31 PM? 266 How many minutes are there between 1:44 AM and 4:55 AM? 191 What is 277 minutes before 12:51 PM? 8:14 AM How many minutes are there between 2:14 AM and 3:30 AM? 76 How many minutes are there between 6:58 AM and 6:29 PM? 691 How many minutes are there between 12:45 PM and 12:56 PM? 11 How many minutes are there between 10:59 AM and 11:11 AM? 12 What is 310 minutes before 6:54 AM? 1:44 AM How many minutes are there between 4:10 AM and 6:11 AM? 121 How many minutes are there between 8:33 PM and 2:27 AM? 354 How many minutes are there between 1:09 PM and 1:51 PM? 42 What is 607 minutes before 8:05 AM? 9:58 PM What is 2 minutes before 2:15 AM? 2:13 AM How many minutes are there between 9:38 AM and 8:03 PM? 625 How many minutes are there between 10:11 AM and 7:58 PM? 587 What is 703 minutes before 7:39 PM? 7:56 AM What is 98 minutes before 5:08 PM? 3:30 PM How many minutes are there between 11:01 AM and 1:35 PM? 154 What is 35 minutes before 3:45 AM? 3:10 AM What is 564 minutes after 11:43 PM? 9:07 AM How many minutes are there between 3:45 PM and 8:50 PM? 305 How many minutes are there between 10:17 AM and 6:39 PM? 502 What is 175 minutes before 6:30 AM? 3:35 AM How many minutes are there between 10:01 AM and 6:24 PM? 503 What is 318 minutes after 11:48 AM? 5:06 PM What is 553 minutes before 10:37 AM? 1:24 AM How many minutes are there between 3:19 PM and 4:50 PM? 91 How many minutes are there between 2:00 AM and 11:38 AM? 578 What is 398 minutes before 12:34 AM? 5:56 PM How many minutes are there between 10:38 AM and 4:00 PM? 322 How many minutes are there between 8:10 AM and 9:19 AM? 69 What is 453 minutes after 6:52 AM? 2:25 PM How many minutes are there between 7:45 PM and 7:10 AM? 685 What is 543 minutes after 7:50 PM? 4:53 AM How many minutes are there between 12:03 AM and 4:15 AM? 252 What is 197 minutes before 11:46 PM? 8:29 PM What is 715 minutes before 9:32 PM? 9:37 AM What is 416 minutes before 4:46 PM? 9:50 AM What is 623 minutes after 10:42 AM? 9:05 PM What is 195 minutes after 3:44 AM? 6:59 AM What is 706 minutes before 6:00 PM? 6:14 AM What is 324 minutes before 11:38 AM? 6:14 AM How many minutes are there between 3:31 PM and 2:46 AM? 675 What is 385 minutes after 3:58 PM? 10:23 PM What is 402 minutes before 7:26 AM? 12:44 AM What is 617 minutes after 5:49 PM? 4:06 AM How many minutes are there between 8:40 AM and 1:31 PM? 291 How many minutes are there between 3:37 AM and 7:14 AM? 217 How many minutes are there between 1:13 PM and 11:49 PM? 636 What is 128 minutes before 11:13 PM? 9:05 PM How many minutes are there between 11:35 AM and 4:18 PM? 283 How many minutes are there between 8:30 PM and 5:42 AM? 552 What is 53 minutes before 11:39 AM? 10:46 AM How many minutes are there between 11:59 AM and 10:59 PM? 660 What is 90 minutes before 4:05 AM? 2:35 AM How many minutes are there between 9:26 AM and 12:18 PM? 172 What is 102 minutes before 10:07 AM? 8:25 AM What is 667 minutes after 4:27 AM? 3:34 PM How many minutes are there between 10:44 AM and 6:22 PM? 458 How many minutes are there between 12:13 PM and 8:03 PM? 470 What is 324 minutes before 2:44 AM? 9:20 PM How many minutes are there between 11:56 PM and 8:30 AM? 514 How many minutes are there between 8:48 AM and 3:04 PM? 376 How many minutes are there between 2:41 PM and 6:36 PM? 235 How many minutes are there between 9:52 PM and 1:19 AM? 207 What is 687 minutes before 3:36 AM? 4:09 PM How many minutes are there between 4:31 PM and 9:29 PM? 298 What is 612 minutes after 3:25 AM? 1:37 PM How many minutes are there between 5:17 PM and 11:45 PM? 388 How many minutes are there between 2:23 AM and 11:09 AM? 526 What is 678 minutes before 8:49 AM? 9:31 PM What is 203 minutes after 8:18 AM? 11:41 AM What is 482 minutes before 11:30 PM? 3:28 PM What is 406 minutes after 8:27 AM? 3:13 PM What is 176 minutes before 10:34 PM? 7:38 PM How many minutes are there between 2:26 AM and 2:38 AM? 12 What is 525 minutes after 9:39 PM? 6:24 AM What is 581 minutes after 4:16 AM? 1:57 PM What is 387 minutes after 12:27 PM? 6:54 PM What is 675 minutes after 11:53 AM? 11:08 PM What is 293 minutes after 3:30 PM? 8:23 PM What is 53 minutes before 11:55 AM? 11:02 AM How many minutes are there between 2:27 AM and 5:58 AM? 211 How many minutes are there between 2:23 PM and 12:35 AM? 612 How many minutes are there between 1:5	{ "pile_set_name": "DM Mathematics" }
t common factor of 404 and 20705? 101 Calculate the highest common factor of 1207233 and 6. 3 Calculate the highest common divisor of 1400 and 6328. 56 Calculate the highest common factor of 1050 and 1694. 14 Calculate the greatest common factor of 1010658 and 6. 6 Calculate the greatest common divisor of 2337 and 478101. 123 What is the greatest common factor of 34934 and 24? 2 What is the highest common factor of 2 and 1994? 2 Calculate the greatest common divisor of 770699 and 3188. 797 What is the highest common divisor of 467 and 2978993? 467 Calculate the greatest common factor of 16 and 61112. 8 Calculate the highest common divisor of 118100 and 10. 10 Calculate the greatest common divisor of 44 and 1095116. 44 Calculate the highest common factor of 52 and 1901497. 13 Calculate the highest common factor of 6768 and 42192. 144 Calculate the greatest common divisor of 20762 and 126. 14 What is the highest common divisor of 1802 and 62222? 106 Calculate the highest common divisor of 649 and 18953. 11 What is the greatest common divisor of 27 and 98616? 3 What is the greatest common factor of 6575 and 825? 25 Calculate the highest common factor of 432 and 415008. 144 Calculate the greatest common divisor of 153444 and 48. 12 Calculate the greatest common divisor of 1106 and 22309. 7 Calculate the highest common factor of 12878784 and 464. 464 What is the greatest common factor of 8991 and 13851? 243 Calculate the greatest common divisor of 23 and 859211. 23 What is the greatest common factor of 59 and 37? 1 What is the highest common factor of 85957 and 86? 43 Calculate the greatest common divisor of 48 and 109698. 6 What is the highest common factor of 1587157 and 242? 121 Calculate the highest common factor of 1243 and 10021. 11 What is the greatest common factor of 22432 and 192? 32 What is the highest common factor of 610 and 41968? 122 Calculate the greatest common factor of 7112 and 9352. 56 What is the greatest common divisor of 754 and 754? 754 Calculate the greatest common divisor of 274 and 69733. 137 Calculate the highest common factor of 9 and 51669. 9 Calculate the highest common divisor of 137 and 419357. 137 Calculate the greatest common factor of 302 and 1386784. 302 What is the highest common divisor of 7831 and 1025? 41 Calculate the greatest common divisor of 720 and 375216. 48 What is the highest common divisor of 840 and 8967? 21 What is the greatest common divisor of 11692 and 790? 158 Calculate the greatest common divisor of 1488 and 78492. 372 Calculate the highest common factor of 19337 and 4121. 317 What is the greatest common factor of 37202 and 10324? 178 Calculate the greatest common divisor of 1876 and 117116. 268 What is the highest common factor of 1247 and 41296? 29 What is the greatest common factor of 113175 and 160? 5 Calculate the greatest common factor of 5790 and 960. 30 Calculate the highest common divisor of 14013 and 417. 3 What is the greatest common factor of 265839 and 21? 21 What is the highest common divisor of 96 and 3504? 48 Calculate the highest common divisor of 3401 and 2470. 19 Calculate the greatest common divisor of 52559 and 338. 169 What is the highest common factor of 105692 and 8? 4 Calculate the greatest common factor of 15265 and 16125. 215 Calculate the highest common divisor of 13053 and 1311. 57 What is the greatest common divisor of 330 and 2089670? 110 What is the highest common factor of 744 and 15996? 372 What is the highest common factor of 4482 and 9504? 54 What is the greatest common divisor of 1074933 and 747? 747 Calculate the greatest common divisor of 472576 and 312. 104 Calculate the greatest common divisor of 3482 and 68. 2 Calculate the highest common factor of 140514 and 84. 6 What is the greatest common factor of 606 and 13137474? 606 What is the highest common divisor of 87 and 24099? 87 Calculate the highest common divisor of 191052 and 696. 348 Calculate the highest common divisor of 702069 and 741. 57 What is the highest common factor of 3242 and 1522? 2 Calculate the highest common divisor of 4395040 and 26. 26 Calculate the greatest common divisor of 8832 and 1242. 138 Calculate the greatest common factor of 1732214 and 110. 22 Calculate the highest common divisor of 8 and 114152. 8 Calculate the greatest common divisor of 147 and 1487542. 49 What is the greatest common factor of 40850 and 50? 50 Calculate the greatest common divisor of 532 and 54376. 28 Calculate the highest common factor of 1137345 and 366. 183 Calculate the highest common divisor of 3745 and 298851. 749 Calculate the greatest common factor of 1782 and 22. 22 Calculate the greatest common factor of 49881 and 351. 39 What is the highest common factor of 2215 and 10? 5 What is the greatest common divisor of 300 and 3583800? 300 What is the greatest common factor of 45746 and 66820? 514 Calculate the highest common divisor of 4950 and 16742. 22 Calculate the greatest common divisor of 5688 and 303676. 316 What is the greatest common divisor of 72098 and 19552? 1222 What is the highest common divisor of 153180 and 3105? 1035 What is the greatest common factor of 87950 and 10? 10 What is the greatest common factor of 69839 and 308? 77 What is the greatest common factor of 76340 and 1265? 55 What is the greatest common factor of 148 and 2528654? 74 Calculate the highest common divisor of 1938432 and 2304. 768 Calculate the highest common factor of 54 and 47808. 18 Calculate the greatest common divisor of 52488 and 144. 72 Calculate the greatest common divisor of 1223650 and 950. 50 Calculate the highest common divisor of 33 and 800415. 33 What is the highest common divisor of 344300 and 440? 220 Calculate the highest common factor of 51 and 62781. 51 Calculate the highest common factor of 1474 and 389873. 737 Calculate the greatest common divisor of 571359 and 2043. 681 What is the greatest common divisor of 45914 and 132? 22 Calculate the greatest common factor of 846156 and 14124. 1284 Calculate the greatest common divisor of 1116 and 158751. 279 Calculate the greatest common divisor of 5797410 and 45. 15 What is the highest common factor of 140540 and 340? 20 What is the greatest common factor of 946 and 4378? 22 What is the highest common divisor of 105 and 1869? 21 Calculate the greatest common divisor of 41 and 173881. 41 Calculate the greatest common factor of 502 and 304714. 502 What is the highest common factor of 36179 and 69? 23 Calculate the greatest common factor of 48815 and 78. 13 Calculate the greatest common divisor of 63610 and 230. 10 What is the highest common divisor of 2064 and 84? 12 Calculate the highest common factor of 189 and 69606. 27 Calculate the greatest common divisor of 490672 and 520. 104 What is the highest common divisor of 752 and 23923? 47 What is the greatest common factor of 201 and 96614? 67 Calculate the highest common factor of 12375 and 297. 99 Calculate the highest common factor of 1036790 and 10. 10 What is the greatest common factor of 329 and 7943? 47 What is the greatest common divisor of 5038810 and 28? 14 What is the greatest common divisor of 1138102 and 2? 2 What is the highest common divisor of 553625 and 1648? 103 Calculate the highest common divisor of 380 and 2274984. 76 What is the highest common divisor of 2596 and 16676? 44 What is the highest common divisor of 413 and 37660? 7 Calculate the greatest common divisor of 481 and 4958. 37 What is the greatest common divisor of 9992 and 888? 8 Calculate the greatest common factor of 9856 and 374. 22 What is the greatest common divisor of 9779 and 781? 11 What is the highest common factor of 36 and 284061? 3 What is the greatest common divisor of 19224 and 672? 24 Calculate the greatest common factor of 100 and 242300. 100 Calculate the highest common factor of 56287 and 4515. 301 What is the greatest common factor of 19123 and 14573? 13 Calculate the greatest common divisor of 12431 and 78997. 401 What is the greatest common factor of 13 and 477971? 13 What is the greatest common divisor of 10528 and 130144? 224 Calculate the greatest common factor of 26588 and 15844. 68 Calculate the highest common divisor of 4278 and 1. 1 What is the greatest common factor of 795 and 1545? 15 What i	{ "pile_set_name": "DM Mathematics" }
10? 150 -3 (base 9) to base 8 -3 -3 (base 8) to base 3 -10 -124 (base 6) to base 8 -64 What is -7d (base 16) in base 13? -98 Convert -142 (base 13) to base 14. -11d Convert 102110 (base 3) to base 16. 135 115 (base 6) to base 2 101111 Convert 1b (base 14) to base 7. 34 49 (base 11) to base 13 41 What is 73 (base 11) in base 7? 143 -2 (base 3) to base 8 -2 -7 (base 11) to base 14 -7 -21 (base 9) to base 5 -34 -414 (base 8) to base 4 -10030 Convert -6 (base 13) to base 6. -10 4 (base 10) to base 15 4 What is 1 (base 6) in base 15? 1 Convert 0 (base 16) to base 10. 0 Convert -2 (base 16) to base 12. -2 Convert -1 (base 5) to base 9. -1 What is -317 (base 8) in base 15? -dc What is -3 (base 4) in base 14? -3 Convert -4 (base 9) to base 13. -4 -7 (base 11) to base 12 -7 What is 4 (base 7) in base 8? 4 1 (base 8) to base 11 1 -2 (base 4) to base 6 -2 What is 100101001 (base 2) in base 14? 173 Convert 22 (base 4) to base 2. 1010 2 (base 7) to base 4 2 Convert 5 (base 13) to base 3. 12 What is -1 (base 15) in base 9? -1 What is -15 (base 6) in base 13? -b What is 27 (base 10) in base 5? 102 Convert 23 (base 7) to base 6. 25 6 (base 10) to base 11 6 -23a (base 11) to base 5 -2120 Convert 20 (base 12) to base 6. 40 Convert -221 (base 6) to base 11. -78 What is -40 (base 6) in base 11? -22 What is -110011 (base 2) in base 3? -1220 Convert -13 (base 5) to base 16. -8 What is 5 (base 6) in base 7? 5 What is 84 (base 11) in base 15? 62 What is 101 (base 2) in base 9? 5 3 (base 6) to base 7 3 Convert -3 (base 13) to base 9. -3 What is -17 (base 12) in base 6? -31 aa (base 13) to base 3 12012 7 (base 13) to base 12 7 What is 33 (base 16) in base 10? 51 Convert -11 (base 4) to base 10. -5 145 (base 11) to base 3 20022 111 (base 3) to base 9 14 Convert -65 (base 7) to base 3. -1202 5 (base 10) to base 16 5 What is 1223 (base 5) in base 15? c8 Convert 3 (base 12) to base 13. 3 What is -1101 (base 2) in base 5? -23 -1011 (base 2) to base 14 -b Convert -37 (base 11) to base 14. -2c -24 (base 11) to base 13 -20 What is -2 (base 9) in base 11? -2 Convert -9b (base 16) to base 15. -a5 What is -3 (base 10) in base 13? -3 What is 5 (base 14) in base 7? 5 -54 (base 13) to base 11 -63 What is -2 (base 6) in base 14? -2 Convert 106 (base 10) to base 6. 254 Convert -8 (base 14) to base 9. -8 What is -1 (base 6) in base 12? -1 202 (base 4) to base 10 34 5 (base 7) to base 10 5 What is 1110001 (base 2) in base 12? 95 What is 21 (base 3) in base 12? 7 -22 (base 6) to base 3 -112 Convert -2 (base 15) to base 8. -2 Convert 313 (base 4) to base 14. 3d Convert -101010011 (base 2) to base 8. -523 What is -10100 (base 2) in base 8? -24 What is -10 (base 2) in base 10? -2 Convert 11112 (base 3) to base 14. 8a Convert 1001101 (base 2) to base 8. 115 What is 1 (base 10) in base 16? 1 -62 (base 16) to base 9 -118 -1 (base 3) to base 11 -1 Convert -3 (base 14) to base 7. -3 Convert -4 (base 15) to base 16. -4 What is 72 (base 14) in base 11? 91 What is -2001 (base 3) in base 4? -313 1a (base 15) to base 7 34 Convert -10 (base 14) to base 4. -32 Convert -34 (base 9) to base 3. -1011 Convert -148 (base 9) to base 3. -11122 What is 44 (base 10) in base 13? 35 What is 4 (base 13) in base 14? 4 56 (base 10) to base 12 48 What is -11110 (base 3) in base 8? -170 Convert 1342 (base 5) to base 14. 11c Convert -1010 (base 2) to base 14. -a -21 (base 11) to base 4 -113 Convert -2 (base 7) to base 2. -10 Convert 3 (base 5) to base 13. 3 What is -51 (base 7) in base 9? -40 Convert -1 (base 9) to base 8. -1 What is -6 (base 16) in base 2? -110 Convert 2 (base 6) to base 3. 2 What is 6 (base 9) in base 3? 20 Convert 264 (base 10) to base 7. 525 What is 10 (base 5) in base 9? 5 -2 (base 13) to base 9 -2 What is 0 (base 2) in base 8? 0 Convert -7 (base 15) to base 14. -7 Convert -152 (base 12) to base 9. -248 What is -13 (base 6) in base 14? -9 Convert -6 (base 7) to base 6. -10 Convert -18 (base 12) to base 6. -32 What is 11 (base 2) in base 3? 10 Convert -221 (base 5) to base 3. -2021 Convert 1 (base 11) to base 13. 1 13 (base 8) to base 5 21 Convert -1043 (base 5) to base 8. -224 What is 20 (base 10) in base 5? 40 What is -3 (base 13) in base 15? -3 -10 (base 7) to base 10 -7 -100 (base 3) to base 14 -9 1230 (base 4) to base 10 108 Convert -2 (base 7) to base 9. -2 -43 (base 6) to base 15 -1c Convert 4 (base 14) to base 6. 4 20 (base 5) to base 7 13 Convert 7 (base 8) to base 10. 7 What is 27 (base 13) in base 4? 201 What is 7 (base 14) in base 11? 7 -b1 (base 16) to base 5 -1202 Convert -3 (base 4) to base 6. -3 Convert -7 (base 13) to base 15. -7 3 (base 4) to base 15 3 -1 (base 15) to base 16 -1 23 (base 4) to base 6 15 -10010110 (base 2) to base 14 -aa 8 (base 11) to base 3 22 What is 1 (base 14) in base 7? 1 Convert 90 (base 14) to base 13. 99 0 (base 5) to base 7 0 Convert -28 (base 9) to base 15. -1b Convert -13 (base 5) to base 13. -8 Convert -13 (base 15) to base 7. -24 -1a (base 14) to base 13 -1b Convert 13 (base 10) to base 15. d Convert 49 (base 14) to base 15. 45 4 (base 11) to base 8 4 Convert -104 (base 12) to base 4. -2110 3 (base 16) to base 4 3 -1 (base 15) to base 4 -1 Convert 2 (base 12) to base 3. 2 What is -11 (base 3) in base 4? -10 78 (base 10) to base 8 116 2044 (base 5) to base 16 112 What is -50 (base 8) in base 2? -101000 4 (base 11) to base 13 4 Convert -11 (base 7) to base 8. -10 What is -22111 (base 3) in base 2? -11100101 -18 (base 14) to base 8 -26 What is 14 (base 11) in base 4? 33 What is -10 (base 9) in base 11? -9 Convert 1 (base 5) to base 16. 1 Convert 7 (base 13) to base 11. 7 0 (base 7) to base 11 0 Convert -11 (base 4) to base 10. -5 What is -34 (base 7) in base 3? -221 Convert 1b (base 13) to base 7. 33 Convert 1d (base 16) to base 8. 35 What is -7b (base 12) in base 4? -1133 1 (base 3) to base 14 1 3 (base 12) to base 10 3 Convert 2 (base 6) to base 2. 10 Convert 52 (base 7) to base 10. 37 Convert -10100 (base 3) to base 13. -6c What is 4c (base 15) in base 8? 110 -154 (base 7) to base 13 -6a -233 (base 5) to base 8 -104 Convert 153 (base 10) to base 4. 2121 -5 (base 10) to base 16 -5 Convert -21 (base 5) to base 4. -23 -14 (base 5) to base 6 -13 -2 (base 8) to base 6 -2 Convert -1 (base 16) to base 11. -1 -50 (base 8) to base 6 -104 What is -57 (base 10) in base 9? -63 What is 220 (base 3) in base 8? 30 Convert 4 (base 5) to base 8. 4 -282 (base 9) to base 12 -178 Convert 3 (base 16) to base 3. 10 Convert 2 (base 7) to base 12. 2 Convert -12 (base 5) to base 2. -111 What is 3 (base 7) in base 13? 3 Convert -5 (base 10) to base 11. -5 Convert 0 (base 12) to base 5. 0 Convert -201 (base 8) to base 10. -129 2 (base 6) to base 14 2 -2310 (base 4) to base 6 -500 What is 0 (base 13) in base 4? 0 Convert -5 (base 6) to base 4. -11 What is -3 (base 5) in base 10? -3 Convert 5e (base 15) to base 5. 324 Convert -111 (base 2) to base 5. -12 What is 2 (base 14) in base 15? 2 What is 31 (base 5) in base 10? 16 What is -121 (base 9) in base 12? -84 -53 (base 8) to base 14 -31 Convert 10000 (base 2) to base 7. 22 3 (base 8) to base 9 3 91 (base 11) to base 4 1210 Convert -101 (base 5) to base 12. -22 Convert 10 (base 2) to base 15. 2 Convert -74 (base 12) to base 14. -64 Convert -20 (base 13) to base 5. -101 -10 (base 15) to base 4 -33 What is -9e (base 15) in base 3? -12112 c (base 15) to base 2 1100 What is -100 (base 12) in base 7? -264 Convert -343 (base 6) to base 8. -207 What is 157 (base 10) in base 14? b3 Convert -122 (base 3) to base 15. -12 2 (base 3) to base 14 2 Convert 0 (base 15) to base 9. 0 What is -4 (base 6) in base 4? -10 -1b (base 15) to base 13 -20 Convert 1211 (base 6) to base 12. 207 What is -27 (base 9) in base 3? -221 What is -1 (base 15) in base 5? -1 5 (base 6) to base 11 5 Convert 2 (base 16) to base 14. 2 Convert 15 (base 10) to base 5. 30 What is 10 (base 2) in base 4? 2 23 (base 16) to base 15 25 22 (base 4) to base 11 a What is -6 (base 16) in base 7? -6 138 (base 9) to base 7 224 Convert 210 (base 5) to base 8. 67 Convert 1 (base 4) to base 3. 1 Convert 1e (base 15) to base 9. 32 Convert 133 (base 6) to base 11. 52 Convert -311 (base 4) to base 13. -41 Convert -1100 (base 2) to base 6. -20 -314 (base 6) to base 16 -76 Convert 500 (b	{ "pile_set_name": "DM Mathematics" }
2k2 - 3k*2 to fk*2 + yk + c and give f. 13 Express (-2u + u + 2u)(-1 - 28u + 11u - 14u) as x + ju2 + gu and give j. -31 Rearrange -13g + 6 - 10g + 33g to bg + r and give b. 10 Express 22d + 2d*3 - 23d + d*3 as nd + id3 + cd*2 + y and give n. -1 Rearrange 9a + 11a - 9a + 5a to ia + v and give v. 0 Express (-6o2 + 0 + 0)(-5 + 2o + 5) + (-4o*3 + 4o3 - o3)(3 - 4 - 1) as to*2 + wo + bo3 + k and give w. 0 Express 2w + 19w3 + 2w*4 + 2w - 22w3 as qw*2 + cw*4 + x + kw + mw3 and give k. 4 Rearrange (4h - 6h + 3h)(-4 - 1 - 2)(3 - 1 - 1)(0h + 5h - 4h) to b + ch + lh*2 and give l. -7 Express (0 + 2 + 2)(2w2 + 0w2 - w2)(3w - 3w - 2w) in the form xw3 + cw*2 + t + pw and give x. -8 Rearrange (-1 + 4 - 4)(-a + 5a - 5a) + (13 - 13 + 3a)(10 - 1 - 1) + 2a - 1 + 1 to f + ta and give t. 27 Express -27 + 27 - 9n as hn + u and give h. -9 Express -21s*2 - 33s*2 + 11s*2 - 19s*2 in the form us + is2 + t and give i. -62 Express (-3b - 3b + 7b)(-1 + 1 - 2b*2) + 3b*3 - 15b*2 - 1241 + 1241 - 2b in the form nb + o + mb*3 + rb*2 and give o. 0 Express (-1 - 3 + 1)(0u - 2u + u) + (1 + 0 + 1)(-1 + 1 + 2u) in the form p + bu and give b. 7 Rearrange -23m + 3m - 14m to the form l + vm and give v. -34 Rearrange (-222 + 23s + 222)((3s + 0s - s)(0 - 2 + 1) - s + s - s) to the form u + ds2 + xs and give d. -69 Express (51c - 3c - 13c)(-1 + 2 - 2) in the form y + lc and give l. -35 Express -5d*2 + 5d*2 - 4d*3 + (3d - 5d + 0d)(7d*2 + 0d*2 - 12d*2) in the form x + yd + sd3 + qd*2 and give s. 6 Express (10 - 17 - 20)(d - 3d - 2d) + 4d - 4d + 2d in the form gd + n and give n. 0 Rearrange (-3w - 4w + 5w)(306 + 2w - 306 + (w - 5w + 2w)(4 + 1 - 2)) to the form aw2 + sw + j and give a. 8 Rearrange 5b4 + 2b*4 - 4b*4 + (-4b2 + b2 + 2b2)(3b - 3b - 2b2) to n + ub*3 + jb*2 + qb*4 + mb and give q. 5 Express (36j2 + 295 - 295)(-3j - 2j - 2 + 4j) in the form vj*3 + pj + dj2 + f and give d. -72 Rearrange -6l*2 - 2l + 2l2 - l3 + 2l*3 + 3l4 + l3 to il3 + kl + pl2 + ql*4 + a and give p. -4 Rearrange (-3 + 4 + 1)(-3a + a + 3a)(4a*3 - a + a) to ra*4 + s + ja*2 + ka*3 + ma and give r. 8 Rearrange (-2 + 15 - 5)(5l + 0l + l) - l - 3 + 3 to the form pl + k and give p. 47 Express -2 + 7h3 + 3 - 3h*3 in the form ch*2 + k + ah*3 + wh and give a. 4 Express -w + 17w2 - 32 - 10w*2 - 8w*2 in the form i + vw + kw2 and give v. -1 Express (-2 - 1 + 6)(5 - 5 + 45f2) in the form if + hf2 + t and give h. 135 Rearrange 11f*2 - 13f*2 + 3 + 16f*2 to the form q + of + gf2 and give q. 3 Express 0b - 5b - 2b + (-3 + 4 - 2)(b - 3b + 4b) + 9b + 5 - 11b - 3 in the form lb + g and give l. -11 Rearrange -1 + 11 - 2 + 2l2 - 4l*2 to the form il*2 + b + kl and give b. 8 Express ((0 - t + 0)(-1 - 4 + 4) + 2 - 2 + t)(-97t - 336 + 336) as n + qt*2 + ht and give q. -194 Express (4g - 5g + 2g)(0 + 0 + 2g) - 1 + 2g*2 + 1 + (-2g + 2g - 8g)(2g - 3g - 2g) - 4 - 2g2 + 4 as y + sg*2 + bg and give s. 26 Rearrange ((0 + 1 + 0)(6u + 0u - 2u) + (1 - 1 + 1)(2u - 5u + 4u) - 2u + 2u - 2u)(2u + 0u + 3u) to the form yu*2 + hu + x and give y. 15 Rearrange (31i3 - 392i*2 + 392i*2)(3i - 2 - 4 + 3) to ji*2 + ui + di3 + oi*4 + n and give d. -93 Express -1 - 6v*3 + 5 - v - 3 in the form av + y + nv3 + zv*2 and give y. 1 Rearrange 3 + 4f*3 - 1 - 1 to the form zf*3 + sf*2 + q + df and give q. 1 Express 3 + 0y4 - y4 - 7y + 8y as qy*4 + hy + py3 + oy2 + f and give h. 1 Rearrange -45 - f4 - 86f3 - 84f*3 - f + 169f*3 to df*3 + xf + tf2 + wf*4 + r and give x. -1 Rearrange 4a - 3a2 - 14a - 9a to ja*2 + p + fa and give f. -19 Rearrange -5p - 2p*3 + 11p*3 + 7p - 2p3 + p2 to fp*2 + zp + d + cp3 and give z. 2 Rearrange ((m + 3m - 2m)(2m - 4m + m) + 7m2 + 3m + 2m - 4m)(-2m + 2m - 2m*2) to bm + gm3 + sm*4 + c + qm*2 and give s. -10 Rearrange -w + 11 - 2w - w to iw + a and give i. -4 Rearrange (3 - 6 + 1)(-9m + 3m - 3m) + 3m - 2m - 2 - 2m to f + dm and give f. -2 Express -s3 - 4s + 1 + 4 + 2s - 6 in the form ws*3 + bs*2 + d + ys and give d. -1 Rearrange (-2x + 5x - 2x)(3 - 3 - 3) to ix + z and give i. -3 Rearrange -x + 16 - 7x - 16 to the form vx + f and give v. -8 Rearrange -14 + 4r*2 - 8r*2 + 2r*2 + r to the form zr*2 + v + qr and give z. -2 Rearrange -2a2 - 14 + 7a + 14 to the form ca2 + za + g and give z. 7 Rearrange 25l - 6l + 3l2 - 13l to nl + x + gl*2 and give g. 3 Express (-4c + 4c - 2c*2)((-3 - 1 + 0)(2 - 4 + 4) + 6 - 4 - 3) as nc + u + rc2 and give r. 18 Rearrange (-3l + l*2 + 3l)(0l - 2l + 5l)(5 - 9 + 0)(-3 - 1 + 2) to the form v + il + ql*2 + sl*3 and give s. 24 Rearrange (-i - 4i + 2i)(i*2 + 2i*2 - 2i*2) + (-5i + 5i - 4i)(2i*2 + 2 - 2) + 4 + 2i*3 - 4 to ui*3 + di + r + qi2 and give u. -9 Express (-2h + 5h - h)(5 - 1 + 2) + (2h - h - 3h)(0 + 1 + 1) + 1 - 1 - h in the form b + jh and give j. 7 Express (1 + 5 - 2 + (-3 - 1 + 3)(-1 - 3 + 5) - 4 + 4 - 1)(1 - 4 + 1)(k + 2k - k) as n + yk and give y. -8 Express 5w*2 + 9w*2 + 12w*2 in the form fw*2 + h + bw and give f. 26 Express 0 + 1 + 20 - 5 + 4q2 in the form uq*2 + g + tq and give g. 16 Rearrange 2j3 - j2 + j2 + (4j - 4j - j2)(-3j - 2j + 3j) + 4j*3 + 0j - 2j + 122 - 127 to r + qj*2 + ij*3 + aj and give i. 8 Rearrange (-36z + 345 - 345)(2z - 4z + 2 - z) to r + wz + lz2 and give w. -72 Rearrange r - r2 - 1 + 6r4 - 1 - 49r3 - r4 + 48r3 to the form ir + br3 + cr*2 + gr*4 + a and give c. -1 Rearrange (-3 + 6 - 2)(4b - 3b - 2b)((-b + 3b - 3b)(-3b + 2b + 2b) + 2 - 2 + 2b2) to g + ab*2 + xb + qb3 and give q. -1 Rearrange -1 + 1 - 3i + (-2i + 2i + i)(-9 - 10 - 20)(0 - 1 + 2) to the form fi + w and give f. -42 Rearrange (2o - 1 + 1)(-2o - o + 5o) + (1 + 2 - 4 - 7o)(2o + 2o - 3o) to uo + f + xo*2 and give x. -3 Rearrange 1 - 24 + s + 5 + 10 to a + ms and give m. 1 Rearrange -70k2 + 82k*2 + 63k*2 to the form dk*2 + ok + c and give d. 75 Express 56 + 89 - 34 - 34q + 35q in the form uq + o and give o. 111 Rearrange (-4h + 10 - 10)(2h*2 - 5 + 3 - 4h*2) to the form jh*2 + vh*3 + uh + q and give v. 8 Express (5z - 4z - 2z)(-5 + 2 - 1)(0z*3 + 3z3 - z3) + 2z4 + 4z*2 - 4z*2 in the form jz + qz4 + c + yz*2 + iz*3 and give q. 10 Rearrange 3t*3 - 6t*3 - 1 + 2t*3 + (-2 + 0 + 0)(-2t3 + t3 + 0t*3) + t - t - 3t*3 to at + ot3 + u + wt2 and give u. -1 Express l2 - 3l + l2 - 3l - 4l2 + 2 as fl + c + vl2 and give c. 2 Express 23 - 21x - 45 + 22 in the form yx + v and give y. -21 Rearrange (-10 + 0 - 10)(1 + 0 - 7)(-2t*3 - 2t*2 + 2t*2) to yt + ct3 + j + ut*2 and give c. -240 Rearrange -15z - 38z + 7z to the form cz + g and give c. -46 Rearrange (-o4 + 8o4 - o4)(-5 + 3 - 2) to jo + zo4 + wo*3 + s + qo*2 and give s. 0 Express (3g3 + g3 - 3g3)(-6 - 1 - 11)(g - 3g + 0g) in the form vg*2 + rg*3 + pg*4 + m + bg and give p. 36 Express -6c - 9c*4 + 8c*4 - 4 + 5 + 13c in the form rc3 + t + dc*4 + oc*2 + hc and give h. 7 Express (-4 + 0 - 3)(4l*2 - 3l*2 - 3l*2)(1 - 2 + 2) in the form s + al + ml2 and give m. 14 Rearrange -x2 + 7x2 + 20x*2 to s + wx*2 + px and give w. 26 Express -1 + 1 - 681r + 601r as lr + v and give l. -80 Rearrange 2 + 0a*4 + 3a4 - 1 + a2 - 3 + a to ua3 + ca + ra2 + v + ga*4 and give r. 1 Rearrange 4x - 8x - 13x to v + sx and give s. -17 Express -40f*2 + 57f*2 - 4 + 7 as vf*2 + kf + w and give v. 17 Rearrange -3m + 0 - 2m - 2 - 2m2 + 3m + 2m3 to the form rm*3 + tm*2 + pm + h and give r. 2 Express (2p - 9 + 1 + 11)(-p + 1 - 1) in the form i + wp + lp*2 and give w. -3 Rearrange (1 - 1 + 2 - 2x)(59x - 61*x	{ "pile_set_name": "DM Mathematics" }
Let q = -50.79 - -51.19. Let o = -0.6 + -0.1. Which is the closest to o? (a) q (b) 1/4 (c) 3 b Let q = -0.04 - 0.16. Let i = -41/2 + 21. What is the nearest to -2 in -3, i, q? -3 Let n = 663 - 660. What is the closest to -2/7 in n, -0.1, -3? -0.1 Let x = -0.9 + 1.4. Let w = x + 25.5. Let c = -26.2 + w. What is the nearest to c in 3, -0.4, 4? -0.4 Let h = 556 + -2781/5. Which is the closest to 13? (a) h (b) -3 (c) 0.5 c Let s = 51.77 + -0.77. Let r = s - 54. Let z be 4/2 - (3 + -1). Which is the closest to z? (a) 0 (b) r (c) -0.3 a Suppose -10d = -0d + 6d. Let m = -9/68 - 2/17. Which is the nearest to m? (a) d (b) -2/3 (c) -4 a Let l = 3 - 70. Let q = -67.4 - l. Let k = 0.2 - 0.1. What is the nearest to -2/3 in q, k, -3? q Let m = -288 - -293. What is the closest to -1 in 2/7, -2, m? -2 Let x = 383 + -381. Which is the closest to 0? (a) -0.4 (b) x (c) 3 a Let p be (-9 + 153/18)23. What is the closest to 0.1 in 0.1, p, 0.02? 0.1 Let l = -61 - -37. Let g = l + 23.5. Let d be 3 - (12/(-22) + 3). What is the nearest to 0.2 in -2, g, d? d Suppose -7g - 34 = -6. Let y = -0.497 + -0.303. Which is the nearest to 2/5? (a) g (b) 0.3 (c) y b Let i = -264 + 263.5. Let s = 2.6 + -2.3. Which is the closest to -12? (a) i (b) s (c) 3 a Let f = -12048.1 - -12048. Let r = -2 - -2. Let v = r - -4. Which is the closest to f? (a) -2 (b) v (c) 0.5 c Let m be 253/(-299)(-8)/44. Let q = -0.1 - -0.5. What is the nearest to 1/2 in -10, m, q? q Let a = -1525 + 6101/4. Let v(f) = -f - 4. Let t be v(-5). What is the nearest to -1/4 in a, t, -4? a Let j = -128 + 509/4. Let g = 2495 + -2522. Which is the nearest to -1? (a) j (b) -1/8 (c) g a Let x = -240 + 241. Which is the nearest to 1? (a) -1/2 (b) x (c) 1/4 b Let s = 12 + -9.9. Let f = s + -2. Let x = -265 + 270. Which is the nearest to 0? (a) -2 (b) f (c) x b Let l be ((-6)/12)/(8/(224/49)). What is the closest to 0.04 in -3, l, 5, -1? l Let h = 0.048 - 1.048. Let t = 239/330 - 13/22. What is the closest to -1 in 0.1, t, h? h Let f = 0.77 + -4.07. Let v = -2.8 - f. What is the nearest to 0 in v, -5, 2? v Let m = 37 - 37.2. Let g = 13.5 + -13.4. What is the closest to m in 0.3, -2, g? g Let x = -6 - -45. Let o = x - 38.9. Which is the closest to o? (a) -3 (b) -1 (c) 2/7 c Let s = 85.2 - 85. Which is the nearest to 0? (a) s (b) -0.1 (c) 5 (d) 0.3 b Let x = 8.3 - 8.264. Let p = -0.436 + x. What is the closest to -1 in 0.4, -2/13, p? p Let t be (0 - -1)138/897. What is the nearest to -1 in -0.5, 2/5, t, -1? -1 Let z = -1 + 1. Let j be 140/(-150)(-18)/7. Let m = j - 9/5. What is the closest to -2/3 in m, -4, z? z Let q be 3/(-9) + 1/6. Let l = -9 - -12. Let d = l + -1. Which is the closest to 1? (a) -3 (b) d (c) q b Let i(r) = -r3 - 2r*2 - 7r - 35. Let o be i(-3). Which is the nearest to -3.4? (a) -0.8 (b) -1/11 (c) o (d) -1 c Let h = 605.5 + -606. What is the nearest to 0 in h, -2, 1/5? 1/5 Let j = 344 + -348. Let o = -0.89 - -0.09. Let i = o + 1.8. What is the nearest to -0.1 in 0.3, j, i? 0.3 Let p = -21.7 - -13.8. Let u = p - -8. Which is the nearest to -1/2? (a) u (b) -5 (c) -1 c Let x = 135.15 + -0.15. Let v = 132 - x. Let s be (-3)/(-6)(7 + 1). Which is the closest to v? (a) -2/3 (b) 5 (c) s a Let i(x) = -x3 - 2x*2 + x. Let k be i(-3). Suppose j + 3 = k. Which is the closest to -2? (a) -2/11 (b) j (c) 1 a Let p = 2/99 - 35/99. Let o = -28791/5 - -5758. What is the closest to p in o, 4/7, -3? o Let g = -3 + 2.6. Let f = -0.2 - -0.02. Let o = f + 0.08. What is the closest to g in -3, o, -0.3? -0.3 Let j = 338 - 339. What is the closest to -1/2 in j, 0.2, 0.9? j Let u = 37.15 + 10.75. Let b = u + -48. What is the nearest to 3 in 0, b, -3? 0 Let b = -391.1 + 391. What is the nearest to 0.1 in 1, -0.3, b? b Let l = 327 - 321. Which is the nearest to -12? (a) l (b) 2 (c) -3 c Let i = -3576 - -3589. Let k = -0.2 + 0.1. What is the nearest to k in -1/7, i, -2? -1/7 Let z = 72 - 69. Let t = 4 - -2. Let x be 4/t3/6. What is the nearest to x in 4, z, 1? 1 Suppose -4o + 6o + 3s + 1 = 0, 5s + 10 = -5o. Let w = 23.05 - 23. Let t be -1 + -2(-6)/16. Which is the closest to w? (a) o (b) t (c) 0.3 c Let i = 10.99 + 0.01. Let m = i + -7. Let r = -1 - -0.9. Which is the closest to r? (a) -4 (b) -0.4 (c) m b Let x = 694/3 + -2767/12. Which is the closest to -2? (a) x (b) -1 (c) -5 b Let o = -537 - -542. Which is the nearest to -7? (a) -0.3 (b) o (c) 3/5 a Let l = 113/21 - 26/7. Let u = -81 + 79. Let n = 3 - 3. What is the nearest to n in u, l, -3? l Suppose 4b = 2b + 8. Let m be 10/b(-1 - 1). Let z = 722.6 + -723. What is the closest to 0.1 in z, m, 2? z Let g = -206/2827 - 28/257. Suppose 4m - 4c + 77 = 13, 4m - 5c = -67. What is the closest to 0 in m, -4/9, g? g Let m = -8 - -11. Let n = -5 - -13. Let o = -7.7 + n. What is the nearest to 0 in m, o, 4? o Let k = 16.5 + -25. Let y = 8 + k. Let n = 0.5 + -0.4. Which is the closest to n? (a) y (b) -0.3 (c) 0 c Suppose -2h = 3h + 5. Let m = -53.9 + 70. Let s = -16 + m. What is the closest to 0.3 in h, 3/4, s? s Let p = 0.2 - 0.3. Let w be (75/40)/(18/56). Let t = w - 16/3. Which is the closest to p? (a) -1 (b) t (c) 4 b Let b = 1.3 + -1.68. Let c = -0.18 - b. What is the nearest to c in 2, -2/13, -0.4? -2/13 Let i = -0.25 + 0.18. Let x be (-6)/(-27) - 63/(-81). Which is the nearest to x? (a) -0.3 (b) i (c) 0.2 c Let p = 129 + -130. Let x be p - 4 - (31 + -35). What is the nearest to -4/3 in 0.5, x, 0? x Let r = 53/210 - 3/35. What is the closest to -2/9 in 2, 1/7, -0.4, r? -0.4 Let w be (-34)/72 - (-8)/32. Let u = -0.05 - -1.55. Let s = -0.5 + u. Which is the closest to s? (a) -2 (b) w (c) 1/2 c Let x = -20.3 + 1.3. Let v = x - -20. Let l = 20 - 20.1. Which is the nearest to v? (a) 0.1 (b) l (c) -0.03 a Let w = -87 - -83. Which is the closest to -2/3? (a) -0.5 (b) w (c) 5 a Let u = -3 - -3.2. Let m = -1565 + 1565.4. Let d = -5.2 + 5. What is the closest to 1/3 in u, m, d? m Let i = 6.2 - 6.7. Suppose -5l + 2q = -2q - 6, 3l + 3q - 9 = 0. Which is the closest to -1? (a) i (b) l (c) 1/7 a Let y = -2653/8 + 332. Let f = 1 - 0.5. Which is the nearest to -0.1? (a) f (b) 3 (c) y c Let d(u) = -4u + 26. Let m be d(6). Let b be -3 - 1 - 20/(-4). What is the closest to -0.1 in m, -0.3, b? -0.3 Suppose -3v + 0v + w - 234 = 0, 2v = 3w - 163. Let k = v + 695/9. What is the nearest to -0.1 in k, 0.5, -5? k Suppose -3q + 27 = 3h, 5q - 12 = -4h + 28. Which is the closest to -2/7? (a) -21/2 (b) 3 (c) q (d) -4 b Let y = 2 + -2.4. Let j = y + 0.2. Let k = 655/2268 + -1/324. Which is the nearest to 1? (a) j (b) -3 (c) k c Suppose 0 = -3n - 0n + 3t - 9, n - 2t + 5 = 0. Let f = 7 - 7.3. Which is the closest to n? (a) 4 (b) -0.1 (c) f c Let o = 33 - 22.92. Let y = o + -0.08. Let s = -7 + y. What is the nearest to -1 in 1/9, s, 2/15? 1/9 Let r(w) = w + 23. Let t be r(-11). Suppose 9g - 11g + t = 0. Which is the nearest to g? (a) 3 (b) -5 (c) 5 c Let i be 38/5 - (-4)/10. Let p(s) = -3s - 16. Let u be p(-5). Let d be (5 - 4)/(((-14)/4)/u). Which is the closest to d? (a) 2/5 (b) i (c) -1/4 a Let m = 39.8 + -46. Let h = -6.6 - m. Which is the closest to 1/4? (a) 0.1 (b) 3 (c) h a Let z = -227785/7 - -32426. Let h = 115 + z. Let u be ((-1)/(-12))/(3/9). Which is the closest to h? (a) -1/7 (b) u (c) -2 b Let t = 3700 - 3699.9. Let p = 1 - 1.4. What is the nearest to t in -0.2, -0.5, p? -0.2 Let y = 7 + 1. Let u = 0.11 - -8.89. Let s = u - y. Which is the closest to s? (a) 1/4 (b) -2/3 (c) -1 a Let l = -47 - -45. Let d be l(-3)/(-18) + (-5)/(-6). Which is the closest to -2/5? (a) d (b) -4 (c) 6 a Let k be ((-1)/3)/(-25 + 1128/45). Let f = 0.3 - 1.3. Which is the nearest to 0? (a) k (b) f (c) 4/5 c Let o = 3 + -6. Let y = 3.04 - 0.04. Let z be ((-35)/(-15))/((-2)/6) + 5. What is the nearest to -1 in z, y, o? z Let d(g) = -g - g2 - g3 + 2g*2 + 2g - 6 + 6g2. Let o be d(7). Let m = -0.3 - 0.2. What is the closest to -1 in m, o, 2? m Let d be (6/108-2)/(1/(-6)). Suppose 2t + 12 = -2t. Let y be (75/36 + -2)2. Which is the closest to d? (a) y (b) 2/7 (c) t b Suppose 12 = 2m - 4u, 2m - 3*u - 12 = -3. Which is the closest to -2	{ "pile_set_name": "DM Mathematics" }
e c'th term of -673633, -673635, -673637? -2c - 673631 What is the h'th term of -90929, -181864, -272799, -363734, -454669? -90935h + 6 What is the h'th term of -699, -1381, -2057, -2727, -3391, -4049? 3h2 - 691h - 11 What is the d'th term of 16286, 32518, 48738, 64940, 81118, 97266? -d*3 + 16239d + 48 What is the r'th term of -16488, -16490, -16492, -16494? -2r - 16486 What is the y'th term of 449, 1758, 3925, 6938, 10785? -2y*3 + 441y*2 + 10 What is the k'th term of -52, 6, 96, 218, 372? 16k*2 + 10k - 78 What is the l'th term of -211, -420, -601, -748, -855? l*3 + 8l*2 - 240l + 20 What is the g'th term of -38, -279, -942, -2237, -4374? -35g3 - g2 + 7g - 9 What is the a'th term of -671, -601, -531, -461? 70a - 741 What is the w'th term of 1544, 3113, 4674, 6227? -4w*2 + 1581w - 33 What is the x'th term of -2655, -10628, -23917, -42522? -2658x2 + x + 2 What is the u'th term of 682, 2821, 6430, 11521, 18106? 2u*3 + 723u*2 - 44u + 1 What is the t'th term of -10145, -9949, -9751, -9551, -9349? t*2 + 193t - 10339 What is the p'th term of -515180, -515181, -515182, -515183? -p - 515179 What is the y'th term of 71870, 287474, 646812, 1149884, 1796690, 2587230? 71867y2 + 3y What is the g'th term of -188143, -188141, -188137, -188131, -188123? g2 - g - 188143 What is the c'th term of -2, -2, -14, -44, -98, -182? -c3 + 7c - 8 What is the r'th term of -47, -132, -219, -308, -399, -492? -r2 - 82r + 36 What is the y'th term of -1066, -1057, -1048, -1039, -1030? 9y - 1075 What is the r'th term of 1618, 1836, 2208, 2740, 3438? r3 + 71r*2 - 2r + 1548 What is the n'th term of -645, -2283, -4921, -8559, -13197, -18835? -500n2 - 138n - 7 What is the r'th term of -528, -714, -896, -1074? 2r2 - 192r - 338 What is the k'th term of -447140, -894280, -1341420? -447140k What is the h'th term of 793818, 793815, 793810, 793803, 793794, 793783? -h2 + 793819 What is the r'th term of 765, 865, 965, 1065, 1165, 1265? 100r + 665 What is the y'th term of 5798, 11594, 17404, 23234, 29090, 34978? y3 + y2 + 5786y + 10 What is the l'th term of -501, -459, -417, -375, -333? 42l - 543 What is the h'th term of -125, -342, -667, -1100, -1641? -54h2 - 55h - 16 What is the w'th term of 1126970, 1126967, 1126954, 1126925, 1126874? -w3 + w2 + w + 1126969 What is the j'th term of 418, 426, 436, 448, 462, 478? j*2 + 5j + 412 What is the p'th term of 3616, 14335, 32194, 57187, 89308, 128551, 174910, 228379? -p*3 + 3576p*2 - 2p + 43 What is the d'th term of -306768, -306784, -306824, -306900, -307024, -307208, -307464, -307804? -2d3 - 2d - 306764 What is the i'th term of 2058, 4104, 6146, 8184? -2i2 + 2052i + 8 What is the m'th term of -16852, -33729, -50606, -67483, -84360, -101237? -16877m + 25 What is the f'th term of 564, 1064, 1564, 2064, 2564? 500f + 64 What is the r'th term of 2058, 8217, 18488, 32871, 51366? 2056r2 - 9r + 11 What is the v'th term of -12614, -12924, -13442, -14168, -15102, -16244, -17594? -104v2 + 2v - 12512 What is the i'th term of -78599, -314402, -707407, -1257614? -78601i2 + 2 What is the c'th term of -19990, -39858, -59724, -79588, -99450? c2 - 19871c - 120 What is the b'th term of 19967, 19974, 19981, 19988, 19995? 7b + 19960 What is the k'th term of 798, 1737, 2692, 3669, 4674, 5713, 6792, 7917? k3 + 2k*2 + 926k - 131 What is the d'th term of -2769, -11096, -24977, -44412? -2777d2 + 4d + 4 What is the j'th term of -88825, -88808, -88791, -88774? 17j - 88842 What is the j'th term of -157, -341, -523, -703, -881? j2 - 187j + 29 What is the b'th term of -54, -114, -290, -642, -1230? -10b3 + 2b*2 + 4b - 50 What is the a'th term of 16730, 16724, 16714, 16700, 16682, 16660? -2a2 + 16732 What is the q'th term of -318, -292, -286, -300? -10q*2 + 56q - 364 What is the g'th term of 325, 342, 373, 424, 501, 610, 757? g3 + g2 + 7g + 316 What is the d'th term of -457757, -915515, -1373273, -1831031, -2288789? -457758d + 1 What is the t'th term of 3893, 7759, 11661, 15617, 19645, 23763? 3t3 + 3845t + 45 What is the a'th term of -590, -505, -420, -335, -250, -165? 85a - 675 What is the n'th term of 14, 85, 244, 521, 946, 1549? 5n*3 + 14n*2 - 6n + 1 What is the p'th term of 401743, 401742, 401741, 401740? -p + 401744 What is the m'th term of 576, -109, -804, -1515, -2248, -3009, -3804? -m3 + m2 - 681m + 1257 What is the p'th term of -1328, -1344, -1360? -16p - 1312 What is the s'th term of 211, 420, 647, 898, 1179, 1496, 1855, 2262? s*3 + 3s*2 + 193s + 14 What is the g'th term of -34255, -34236, -34213, -34186, -34155? 2g2 + 13g - 34270 What is the v'th term of 17997042, 17997053, 17997076, 17997117, 17997182? v*3 + 4v + 17997037 What is the y'th term of -7134, -7136, -7138? -2y - 7132 What is the c'th term of 10929, 21736, 32543, 43350, 54157? 10807c + 122 What is the u'th term of 503, 397, 267, 101, -113, -387? -2u3 - 92u + 597 What is the h'th term of -196532, -393058, -589584? -196526h - 6 What is the y'th term of -3, 85, 213, 375, 565, 777? -y3 + 26y*2 + 17y - 45 What is the w'th term of -1167, -1229, -1353, -1569, -1907? -5w3 - w2 - 24w - 1137 What is the v'th term of -1863, -2026, -2189, -2352, -2515? -163v - 1700 What is the a'th term of 4580, 4580, 4582, 4586, 4592? a2 - 3a + 4582 What is the t'th term of -103, 5, 199, 491, 893? 2t3 + 31t*2 + t - 137 What is the d'th term of 855, 895, 1007, 1227, 1591? 6d*3 - 2d + 851 What is the k'th term of -55, -83, -87, -61, 1, 105, 257, 463? k*3 + 6k*2 - 53k - 9 What is the f'th term of -124, -43, 88, 269? 25f2 + 6f - 155 What is the r'th term of 10550087, 10550086, 10550085, 10550084, 10550083? -r + 10550088 What is the x'th term of 2886, 11570, 26052, 46338, 72434, 104346, 142080, 185642? x*3 + 2893x*2 - 2x - 6 What is the g'th term of -401619, -401605, -401567, -401493, -401371, -401189, -400935, -400597? 2g3 - 401621 What is the c'th term of 1551, 1577, 1603? 26c + 1525 What is the t'th term of 378, 733, 1088, 1443, 1798? 355t + 23 What is the l'th term of -3, 62, 245, 606, 1205, 2102? 10l3 - l2 - 2l - 10 What is the g'th term of -1187, -1145, -1075, -965, -803, -577, -275, 115? 2g*3 + 2g*2 + 22g - 1213 What is the g'th term of 77135, 77123, 77089, 77021, 76907, 76735, 76493, 76169? -2g3 + g2 - g + 77137 What is the d'th term of -4124, -8203, -12280, -16355? d2 - 4082d - 43 What is the h'th term of -2046, -868, 320, 1524, 2750, 4004, 5292? h3 - h2 + 1174h - 3220 What is the p'th term of 131, 162, 193, 224? 31p + 100 What is the l'th term of 55812, 55810, 55808, 55806? -2l + 55814 What is the p'th term of -67438, -134877, -202316, -269755, -337194? -67439p + 1 What is the n'th term of -50864, -203319, -457404, -813113, -1270440, -1829379, -2489924? n*3 - 50821n*2 + n - 45 What is the w'th term of -34, -40, -52, -70? -3w*2 + 3w - 34 What is the u'th term of 4510, 4710, 4910, 5110, 5310, 5510? 200u + 4310 What is the k'th term of 737, 777, 839, 923, 1029, 1157, 1307? 11k*2 + 7k + 719 What is the n'th term of 1932, 7411, 16542, 29325, 45760, 65847? 1826n2 + n + 105 What is the t'th term of 2506, 2435, 2364, 2293, 2222? -71t + 2577 What is the a'th term of -42615, -170462, -383539, -681846, -1065383, -1534150? -42615a2 - 2a + 2 What is the d'th term of -227, -411, -721, -1151, -1695? d*3 - 69d*2 + 16d - 175 What is the s'th term of -6, 31, 68, 105, 142, 179? 37s - 43 What is the a'th term of 819, 831, 855, 897, 963? a3 + 5a + 813 What is the b'th term of -28635, -114520, -257663, -458064? -28629b2 + 2b - 8 What is the f'th term of 5415, 21677, 48779, 86721, 135503? 5420f2 + 2f - 7 What is the z'th term of 195, 344, 453, 522, 551, 540? -20z2 + 209z + 6 What is the t'th term of 300812, 601617, 902422? 300805t + 7 What is the s'th term of 180, 234, 284, 330, 372? -2s*2 + 60s + 122 What is the h'th term of -455, -1160, -2115, -3320? -125h2 - 330h What is the f'th term of -1353, -5263, -11779, -20901, -32629, -46963? -1303f2 - f - 49 What is the h'th term of -149, -137, -125, -113, -101, -89? 12h - 161 What is the z'th term of -3037, -6060	{ "pile_set_name": "DM Mathematics" }
t is the second derivative of -214g4 - g + 91 wrt g? -2568g*2 What is the second derivative of 2d*2m*2t*3 - 45d*2m2 - d2m + 66dmt*3 - dt - m*2 + mt*3 wrt d? 4m*2t*3 - 90m*2 - 2m What is the second derivative of -36a3 + 12a*2 + 500a + 1? -216a + 24 Find the first derivative of 3h*2v*2 - 2h*2v + 104h2 - 93v*2 + 150 wrt h. 6hv2 - 4hv + 208h What is the third derivative of 2di*3l*2 + 4di3l + 2di*2l + 18dil + 3i*3l + 8i2l*2 + 2il2 wrt i? 12dl2 + 24dl + 18l What is the derivative of 4512fp*2 - 560p*2 wrt f? 4512p*2 What is the third derivative of 863r*3 - 79r*2 - 3r + 2? 5178 Differentiate -29b4 - b3 + 449. -116b*3 - 3b*2 Find the second derivative of -451l*2 - 1599l. -902 What is the third derivative of -923q3 - 3q*2 - 4q - 9? -5538 What is the first derivative of -265t2 + 4161 wrt t? -530t What is the third derivative of 4c3hy3 - 254c*3hy2 + c2h - 263chy3 - cy*2 + 2y*2 wrt y? 24c*3h - 1578ch What is the first derivative of 583aj*3 - 2ajs - j*3s*2 - 66s*2 wrt s? -2aj - 2j*3s - 132s What is the third derivative of -48r*2z*5 - 45r*2z3 - r2z2 - 11r*2 + 30rz - 1 wrt z? -2880r*2z*2 - 270r*2 What is the third derivative of -70w*5 + 10w*3 + 4w*2 - 60 wrt w? -4200w*2 + 60 Find the first derivative of -11j*4 + 2j*2 + 44. -44j*3 + 4j What is the derivative of -31o4 + 6o*3 - 2o*2 + 14981 wrt o? -124o*3 + 18o*2 - 4o What is the derivative of 1424i - 5253? 1424 What is the second derivative of -2n*3v*2 - 45n*2v*2 - 3nv - 55n + 2v2 wrt n? -12nv2 - 90v*2 What is the first derivative of -354f + 357? -354 What is the derivative of -1352b + 49? -1352 Find the third derivative of -5xz6 + 10xz5 + 17xz2 - 5z*2 wrt z. -600xz3 + 600xz2 What is the derivative of 7ilx*2 - 18ilx - il + 1271i + lx + 2x*2 wrt l? 7ix2 - 18ix - i + x What is the second derivative of -546g*2 + 332g + 2 wrt g? -1092 Differentiate -32b3u - 23b3y*2 + 5buy*2 - 11y*2 with respect to u. -32b*3 + 5by2 What is the derivative of -1414u + 10001 wrt u? -1414 Find the third derivative of 69j3x + 2j3 + 18j*2x + j*2 - 5jx wrt j. 414x + 12 What is the third derivative of -160t5 - 13t*2 - 8 wrt t? -9600t*2 Differentiate -385j - 109 with respect to j. -385 What is the third derivative of 192k3 - 14k2 - 7? 1152 Find the third derivative of k3r3 - 112k*3x3 - k2r2x2 - k2rx*3 + 7kr3x*3 + 4r*3x*2 wrt k. 6r*3 - 672x*3 Find the second derivative of -171m*5q - 5mq - 2m + 6q wrt m. -3420m3q What is the second derivative of -206bq*2z - 2bqz3 + 6bz + 5q*2z*3 - 46qz + q wrt q? -412bz + 10z*3 Find the third derivative of -ow*5 - 566ow4 - 1147ow2 wrt w. -60ow2 - 13584ow What is the second derivative of -33940f*2 + 7422f - 2 wrt f? -67880 What is the derivative of 4l2s*3 + 3l*2s*2 - 30ls3 - 523s*3 wrt l? 8ls3 + 6ls2 - 30s*3 What is the second derivative of -71v*5 + 5v*4z*2 - 46vz2 - 2v wrt v? -1420v3 + 60v*2z*2 Differentiate -201u*2vy + 5u*2y - 2uvy - vy - 607y with respect to u. -402uvy + 10uy - 2vy What is the third derivative of d*3z*3 + 2d*3 + 6d*2z*3 + 22d*2z - 19dz*4 + dz*2 wrt z? 6d*3 + 36d*2 - 456dz Find the second derivative of 10q*3r*2 - 18q*3w - 2qr*2wx - 4qw + 11r*2x*3 - rwx3 + 5rwx*2 - rx*3 + 2x wrt r. 20q3 - 4qwx + 22x3 Find the second derivative of 11h*3 - 5h*2 + 5h + 14 wrt h. 66h - 10 What is the third derivative of -2n*4 + 260n*3r*2 + 14n*3 - 8n*2r2 - n2 + 16nr + 4r wrt n? -48n + 1560r2 + 84 What is the second derivative of fj*2v - 2fjv3 - 115fj + 3fv3 - 135j*2v*3 wrt j? 2fv - 270v*3 What is the third derivative of 5k*2r*4 + 3k*2r*3 - 254k*2r*2 - 2k*2r - kr4 wrt r? 120k*2r + 18k2 - 24kr Find the third derivative of 4966v*3 + 1516v*2 wrt v. 29796 What is the third derivative of 1152d*6 - 1576d*2 wrt d? 138240d*3 What is the third derivative of -13h*6 + 45h*4 - 2358h*2 wrt h? -1560h*3 + 1080h What is the second derivative of 11508d2 + 5d + 8? 23016 Differentiate 40a2t + 2a2 + 3at2 - 342t*2 with respect to a. 80at + 4a + 3t2 Differentiate 9l*3u*3 + 30l*3u2 + u3 + 498u wrt l. 27l*2u*3 + 90l*2u*2 Find the third derivative of 2lu4 + 8lu2 + 4lu + l - 5u5 - u3 wrt u. 48lu - 300u2 - 6 Find the second derivative of 916h*3 - 10h - 14 wrt h. 5496h Differentiate -2p*3 - 13p + 133 wrt p. -6p2 - 13 Find the third derivative of -158a*3l*2z2 + a3z3 + 2a*2l*2z - 2al*2z + 50z3 wrt a. -948l*2z*2 + 6z*3 Differentiate 244b*3 + 243 with respect to b. 732b2 Differentiate p4 + 798p2 - 1145 with respect to p. 4p*3 + 1596p What is the third derivative of 3x6 - 50x*4 - 278x*2? 360x*3 - 1200x What is the third derivative of -dz6 - 8dz5 + dz*3 - 55dz2 - z2 wrt z? -120dz3 - 480dz2 + 6d Find the third derivative of 4331v4y - 7v2y - 2v2 + 234 wrt v. 103944vy What is the third derivative of 2291q*4 - 5337q*2 wrt q? 54984q Find the third derivative of -t*6 + 253t*5 + 727t*2 wrt t. -120t*3 + 15180t*2 Find the third derivative of -1151c*3z*3 - 2c*2z*3 + 536z*3 wrt c. -6906z*3 Find the second derivative of -2t*4 + 102t*2 - 2t + 25 wrt t. -24t2 + 204 Find the second derivative of 17530x*2 - 2x + 291. 35060 What is the first derivative of -a*2 + ad + 108a + 819d wrt a? -2a + d + 108 What is the second derivative of 14g*3w*5 - 39g*3w + 13g2w*5 + 2g*2w wrt w? 280g3w*3 + 260g*2w*3 Find the second derivative of 83b4 + b3 + b*2l - 639bl wrt b. 996b2 + 6b + 2l Find the third derivative of h3m*3 - 23h*3m*2u*3 + 2h*2m*3u*3 - 7h*2m*3 - 3hm3u*3 wrt h. 6m*3 - 138m*2u*3 What is the second derivative of 7o*3q5 + o3 + 2oq*5 + oq - o wrt q? 140o3q*3 + 40oq3 What is the second derivative of 2034m*2w*3 - 85mw3 - 5mw2 + 3mw wrt m? 4068w*3 Find the third derivative of 4iosz2 + 3ioz*3 - 2isz*3 - 2is - 9o*2sz3 + o2sz2 - 2o*2z + 2sz*2 wrt z. 18io - 12is - 54o*2s Find the third derivative of -150m4 + m3 - m2 - 187m. -3600m + 6 Find the third derivative of -762u*4 + 12u*2 - 5. -18288u What is the second derivative of -6331f2 + 51f + 21 wrt f? -12662 Find the first derivative of 622a3 + a2 + a - 6919. 1866a*2 + 2a + 1 What is the second derivative of -37w5 - 2w*4z - 2w3z + 2wz - 199w - z wrt w? -740w*3 - 24w*2z - 12wz Find the second derivative of 69al*3 - 2al2y*2 - 5al2 + aly2 - 5a - 229l wrt l. 414al - 4ay2 - 10a Find the second derivative of 2p2x*2 - 54p*2xz3 + 2px2z*3 - 47pxz*2 + p + xz*3 wrt p. 4x*2 - 108xz3 Find the second derivative of 3f*3m*2s + f*3ms2 + f3m + 18fms - 374m*2s*2 wrt s. 2f*3m - 748m2 Find the first derivative of -643j*4 - 1366. -2572j*3 Find the second derivative of 145w*4 + 3w + 48 wrt w. 1740w2 Find the third derivative of -3z*6 + 116z*3 + 1315z*2. -360z*3 + 696 Find the second derivative of 4j*3m*2 - 7j*3m - 1707j2m*3 - 3j*2 - 23jm + j wrt m. 8j*3 - 10242j*2m Differentiate 267d2k*3 - 257d*2 - 2k*3 with respect to k. 801d*2k*2 - 6k*2 Differentiate -298i*2q*3 - 3i*2 - 2702q*3 + 2 with respect to i. -596iq3 - 6i Find the second derivative of -9c3t - 171c2t + 3ct - 3c + 229 wrt c. -54ct - 342t Find the second derivative of 18903v5 - 2v - 8652 wrt v. 378060v3 Find the third derivative of 3r*4 + 53r*3 - 766r*2. 72r + 318 Differentiate 67sx*3 + 4sx2 - 503x*3 wrt s. 67x*3 + 4x*2 Find the first derivative of 49u + 39. 49 Find the third d	{ "pile_set_name": "DM Mathematics" }
0. -36/85, 1, 4 What is o in 45o5 + 460o*4 - 935o*3 + 310o*2 + 120o = 0? -12, -2/9, 0, 1 Let -10k5/11 - 64k*4/11 + 386k*3/11 + 224k*2/11 - 376k/11 - 160/11 = 0. Calculate k. -10, -1, -2/5, 1, 4 Let -2d4 - 354d*3 + 48550d*2 - 1266846d - 1315748 = 0. What is d? -274, -1, 49 Determine a, given that 2a2/3 + 1773772a/3 + 393283388498/3 = 0. -443443 Determine f so that f*4/5 - 34f*3 - 8768f*2/5 - 16974f + 338031/5 = 0. -23, 3, 213 Suppose 4p2 - 1744p - 38388 = 0. What is p? -21, 457 Factor -20z2/3 + 2064z + 11340. -4(z - 315)(5z + 27)/3 Determine i so that 3i*3/7 - 9i*2/7 - 1794i/7 = 0. -23, 0, 26 Let g*3 - 154g*2 + 7105g - 102900 = 0. Calculate g. 35, 84 Suppose -867o4/2 + 969o*3 + 2181o*2/2 - 294o + 18 = 0. What is o? -1, 2/17, 3 Determine y, given that -y*3 - 13678y*2 - 13671y + 82062 = 0. -13677, -3, 2 Suppose -25c3/3 + 74372c*2/9 + 27775c/9 + 992/9 = 0. What is c? -1/3, -1/25, 992 Suppose -a*5 + 541a*4 + 5486a*3 + 13234a*2 - 5485a - 13775 = 0. Calculate a. -5, -1, 1, 551 What is w in -2w2/11 + 7704w/11 - 7418952/11 = 0? 1926 Suppose -3o2 - 912o - 36864 = 0. What is o? -256, -48 Factor -3n3 + 1266n*2 + 19515n + 65550. -3(n - 437)(n + 5)(n + 10) Find q such that -2q*3/5 + 140186q*2/5 - 280366q/5 + 140182/5 = 0. 1, 70091 Determine i, given that 9i4/7 + 17223i*3 + 80359i*2/7 - 147349i/7 - 53580/7 = 0. -13395, -4/3, -1/3, 1 Find b, given that b*5/4 - 41b*4/4 + 337b*3/4 - 839b*2/4 + 11b/2 + 310 = 0. -1, 2, 4, 5, 31 Find a, given that -2a4 + 1122a*3 + 7936a*2 + 9120a - 18176 = 0. -4, 1, 568 Find k such that k*4/2 - 47k*3/2 - 194k*2 + 262k + 432 = 0. -8, -1, 2, 54 Factor 2v2/7 + 14856v/7 + 27587592/7. 2(v + 3714)2/7 Find p such that 2p*3 - 240072p*2 + 480138p - 240068 = 0. 1, 120034 Solve 3z5 - 129z*4 + 789z*3 - 1203z*2 + 540z = 0 for z. 0, 1, 5, 36 Determine q so that -54q3/11 - 621678q*2/11 - 345364q/11 - 46048/11 = 0. -11512, -1/3, -2/9 Factor -3g4/4 - 570g*3 - 142848g*2 - 11403264g + 100663296. -3(g - 8)(g + 256)*3/4 Let -13813c*3 - 138128c*2 - 331492c + 48 = 0. Calculate c. -6, -4, 2/13813 Determine z, given that 3z3/2 + 216z*2 + 3669z/2 + 1620 = 0. -135, -8, -1 What is a in 4a4/7 + 93a*3/7 - 429a*2/7 - 653a/7 - 135/7 = 0? -27, -1, -1/4, 5 Factor n*3/6 - 88n*2 + 2245n/2 - 10300/3. (n - 515)(n - 8)(n - 5)/6 Determine c so that -c*4/7 + 9c*3 - 1117c*2/7 + 927c - 5434/7 = 0. 1, 11, 13, 38 Factor h*3/2 + 589h*2/2 + 31737h. h(h + 142)(h + 447)/2 Factor 2c2/3 + 434c/3 + 3200. 2(c + 25)(c + 192)/3 Find a such that -1058a2 - 67160a - 1065800 = 0. -730/23 Factor -j*3 - 967j*2 + 3884j. -j(j - 4)(j + 971) Let -99458a3 + 3582272a*2 - 64232a + 288 = 0. What is a? 2/223, 36 Find a such that 5a2/2 + 664959a - 265984 = 0. -265984, 2/5 Suppose -2j2 - 133156j - 133154 = 0. Calculate j. -66577, -1 Solve -s*4/4 - 43s*3 + 3133s*2/4 - 3764s + 3024 = 0 for s. -189, 1, 8 Factor -5j3 + 9155j*2 - 4222560j + 29111040. -5(j - 912)2(j - 7) Factor 5l2/4 + 362340l + 26258055120. 5(l + 144936)2/4 Suppose -3v*4 - 11826v*3 - 15667272v*2 - 7140984654v - 219012267573 = 0. Calculate v. -1303, -33 Determine d so that 3d4/7 + 5583d*3/7 - 16788d*2/7 - 22368d/7 = 0. -1864, -1, 0, 4 Factor o*2 - 72392o + 1310150416. (o - 36196)*2 Solve 4n*5 + 100n*4 - 848n*3 + 1536n*2 = 0. -32, 0, 3, 4 Find u, given that -3u*4/5 - 966u*3/5 + 142281u*2 - 79339404u/5 - 80051772/5 = 0. -709, -1, 194 Factor 2s3/9 + 1354s*2/9 - 1396s/9 - 9040/3. 2(s - 5)(s + 4)(s + 678)/9 Let -159y*5/4 - 317y*4/8 + 1909y*3/8 + 633y*2/4 - 637y/2 + 1 = 0. What is y? -2, 1/318, 1, 2 Factor -3m4 + 206103m*3 - 3539973600m*2 + 3539767500m. -3m(m - 34350)*2(m - 1) Factor -5u2 - 55u + 1380. -5(u - 12)(u + 23) Factor 2d4/19 + 44d*3/19 - 4200d*2/19 - 167500d/19 - 1656250/19. 2(d - 53)(d + 25)*3/19 Solve -2g*5 + 5266g*4 + 6g*3 - 15794g*2 - 10532g = 0. -1, 0, 2, 2633 Factor -3v4 - 219v*3 - 417v*2 + 639v. -3v(v - 1)(v + 3)(v + 71) Suppose 3o3/5 - 327o*2 + 1632o/5 = 0. What is o? 0, 1, 544 Solve -3x4 - 19548x*3 - 31843692x*2 = 0. -3258, 0 Determine l so that -2l*3/9 - 108020l*2/9 + 216046l/9 - 36008/3 = 0. -54012, 1 Solve n*2 - 1592n - 6384 = 0. -4, 1596 Factor -x*2/2 + 218x - 6834. -(x - 402)(x - 34)/2 Find j, given that 4j*5/7 + 4504j*4/7 + 1267860j*3/7 - 18016j*2/7 - 5071504j/7 = 0. -563, -2, 0, 2 Find l such that 2l5/7 - 342l*4/7 - 10l*3/7 + 1710l*2/7 + 8l/7 - 1368/7 = 0. -2, -1, 1, 2, 171 Let -4j4/5 - 62116j*3/5 - 241180897j*2/5 - 241134312j/5 - 60279696/5 = 0. Calculate j. -7764, -1/2 What is u in -2u5 - 154u*4 + 5496u*3 - 40544u*2 - 21952u + 164640 = 0? -105, -2, 2, 14 Find o, given that 1416o3 + 1407o*2 - 2841o + 18 = 0. -2, 3/472, 1 Suppose -142r2 + 1966r + 308 = 0. Calculate r. -11/71, 14 Suppose -2g2 + 32448g = 0. What is g? 0, 16224 Factor -w*2/2 + 395w/8 - 6699/8. -(w - 77)(4w - 87)/8 Suppose 2d3/7 + 17700d*2/7 + 39249600d/7 + 390728000/7 = 0. Calculate d. -4420, -10 Find m, given that -2m2/5 - 228m + 584192/5 = 0. -896, 326 Solve -2i3 - 164842i*2 + 659392i - 659400 = 0. -82425, 2 Factor a*2/6 + 10612a + 63671/6. (a + 1)(a + 63671)/6 Let -16m*3 - 356m*2 - 1232m - 1168 = 0. Calculate m. -73/4, -2 Factor 28y3/5 - 7688y*2/5 + 522192y/5 + 152352. 4(y - 138)2(7y + 10)/5 Determine v, given that -2v*4/11 + 99892v*3/11 + 299688v*2/11 + 299692v/11 + 99898/11 = 0. -1, 49949 Factor -5m3/3 - 425m*2/3 + 15m + 1275. -5(m - 3)(m + 3)(m + 85)/3 Factor -d4 - 97d*3 - 278d*2 + 376d. -d(d - 1)(d + 4)(d + 94) Factor -m4 + 830m*3 + 5023m*2 - 5852m. -m(m - 836)(m - 1)(m + 7) Find z, given that z4 + 277z*3 - 10673z*2 + 78147z + 337896 = 0. -312, -3, 19 Factor t*4/3 + 595t*3/3 - 4t*2 - 7156t/3 - 9520/3. (t - 4)(t + 2)2(t + 595)/3 Let -4l4/5 - 1028l*3/5 - 5008l*2 - 9200l = 0. Calculate l. -230, -25, -2, 0 Let t*2/7 + 4945t/7 + 24700/7 = 0. What is t? -4940, -5 Factor 2h5 + 3188h*4 + 6370h*3 + 3184h*2. 2h*2(h + 1)*2(h + 1592) Suppose -2z4/7 + 62z*3/7 + 614z*2/7 - 16382z/7 + 2244 = 0. What is z? -17, 1, 14, 33 Factor -5b2 - 101500b - 515112500. -5(b + 10150)2 Solve h4 - 7119h*3 - 7120h*2 = 0 for h. -1, 0, 7120 Factor -2b*3/7 - 886b*2/7 - 14570b - 121086. -2(b + 9)(b + 217)2/7 Determine p so that -p3/6 + 10p2/3 + 26p/3 - 88/3 = 0. -4, 2, 22 Suppose -33t5/2 - 360t*4 + 12903t*3/2 - 12777t*2 + 7722t - 1020 = 0. What is t? -34, 2/11, 1, 10 Factor -3y2 + 531y - 17556. -3(y - 133)(y - 44) Suppose -5l2 - 755l - 9590 = 0. Calculate l. -137, -14 Factor 3q3 + 12681q*2 + 14111685q + 1482281775. 3(q + 117)(q + 2055)*2 What is t in 12t*5/7 + 14024t*4/7 + 5456884t*3/7 + 704531880t*2/7 - 947278800t/7 + 237276000/7 = 0? -390, 1/3, 1 Factor 2n3 - 192n*2 + 1246n. 2n(n - 89)(n - 7) Factor b3/5 + 213b*2/5 + 6296b/5 - 13452/5. (b - 2)(b + 38)(b + 177)/5 Let -2c4 - 6960c*3 - 6055198c*2 + 6960c + 6055200 = 0. What is c? -1740, -1, 1 Factor b*3/7 - 4657b*2/7 + 5579008b/7 - 363108084/7. (b - 2294)*2(b - 69)/7 Solve -o*4/4 + 189o*3/4 - 3969o*2/2 = 0. 0, 63, 126 Factor -318n*4 - 20992n*3 - 346566n*2 - 4356n. -2n(n + 33)*2(159n + 2) Find z, given that 35z*5/3 + 15200z*4/3 - 165505z*3/3 + 607730z*2/3 - 853600z/3 + 356000/3 = 0. -445, 5/7, 2, 4 Factor -2v4/5 - 8806v*3/5 - 9854062v*2/5 - 352646186v/5. -2v(v + 37)(v + 2183)2/5 Let 3h*4/2 + 5897h*3/2 + 238795h*2 + 4899846h - 1659924 = 0. Calculate h. -1882, -42, 1/3 Determine s, given that 2s3/3 + 16280s*2/3 + 162650s/3 + 135500 = 0. -8130, -5 Find i such that -8i5/7 - 304i*4/7 + 662i*3/7 + 814i*2/7 - 372i + 1440/7 = 0. -40, -2, 1, 3/2 Factor h*4/5 + 106h*3/5 - 2127h*2/5 + 2564h - 4960. (h - 8)(h - 5)2(h + 124)/5 Factor f*5/4 + 88f*4 + 8549f*3 + 137780f2. f2(f + 20)(f + 166)*2/4 What is f in 2f**2/9 -	{ "pile_set_name": "DM Mathematics" }
oh - 21. Let u(c) = -1 - 5c + 0c + 7c. What is u(h)? 5 Let j be 4/8(0 + -2). Suppose -150z - 4 = -148z. Let x be j(12/3 - z). Let o(f) = f*2 + 9f + 3. Calculate o(x). -15 Let l(a) = a*2 + a + 6. Suppose 21t - 66 + 3 = 0. Let d(f) be the third derivative of -f3/6 + f2. Let b(x) = td(x) - l(x). What is b(0)? -9 Let f(j) = -j2 - 6j + 17. Suppose -3x + 217 - 244 = 0. Determine f(x). -10 Let g be 6/(-4)(-6)/(-3). Let o = -3 - g. Suppose -4n - 3p = o, 3p - p = 4n. Let t(a) = a - 10. What is t(n)? -10 Let k(z) = z*3 + 5z*2 + 3z. Let b(g) = -g*3 + 7g*2 + g - 3. Let t be b(7). Suppose tu + 2 + 6 = 0. Calculate k(u). 6 Let m(y) = y2 + y - 1. Let z(n) = -n3 + n - 1. Let l = -6 + 5. Let g(r) = lz(r) + 2m(r). Determine g(-2). -3 Let m(g) = -7. Let a(p) = p - 46. Let f(x) = 2a(x) - 6m(x). Determine f(26). 2 Let k(b) be the second derivative of -b*4/12 + 5b*3/6 - 3b*2/2 - 12b. Let j(c) = 6c - 5c - 2c. Let a be j(-3). Give k(a). 3 Let n(p) be the first derivative of -1/360p*6 + 0p - 4 + 0p2 - 1/12p*4 + 7/3p*3 + 1/20p*5. Let y(o) be the third derivative of n(o). What is y(4)? 6 Let g(j) = 837432 - 837432 + 5j. What is g(-4)? -20 Let i(d) = 5d3 + 3d*2 - 2d + 5. Let c(r) = -9r3 - 6r*2 + 4r - 9. Let k(j) = -6c(j) - 11i(j). What is k(2)? -1 Let x(k) be the second derivative of k8/6720 + k7/840 + k5/60 - k4/4 - 12k. Let b(w) be the third derivative of x(w). Give b(-3). 2 Let l(g) = -g3 - 3g*2 - 2g + 4. Suppose -b = -3b + 18. Let p = -12 + b. Determine l(p). 10 Let n(v) = v3 + 3v*2 - 5v - 5. Let b be n(-4). Let i(l) = 10l2 - 5l2 + l2 - 3l2 - 2l*2. Give i(b). 1 Suppose -v = 5m - 9, -3v + 9m + 7 = 4m. Let d(f) = -6 - 5f + 11 - v. What is d(2)? -9 Let b be ((-7)/2)/((-2)/4). Let d = b + -27. Let c = d - -18. Let j(z) = -2z + 1. What is j(c)? 5 Let k(d) = -d2 + 5d + 2. Suppose 0 = -4f - 3u + 30, -2f = -f + u - 8. Suppose 3z + f = x, -x + 5 = 2z - 1. Determine k(x). -4 Suppose -y = -3 - 3. Suppose -2o + l + l = -10, l + 21 = 3o. Let i(g) = 0g - g - 8 + o + 5. What is i(y)? -1 Let q(k) be the second derivative of k*4/12 - 29k*3/6 + 50k*2 + 564k. Calculate q(25). 0 Let t(s) = -4s2 - s - 2. Let b(g) = -3g*2 - g - 2. Suppose -9h = -20h + 55. Let l(r) = hb(r) - 4t(r). Calculate l(3). 4 Let y(x) = 2x*3 + 13x*2 + 15x - 32. Let g(a) = -a*3 - 6a*2 - 7a + 16. Suppose l + 7 = 1. Let d(i) = ly(i) - 13g(i). Determine d(0). -16 Let a(q) = 2q3 + q2 + 5. Let x(t) = 3t3 + t2 + 4. Let z(w) = 5a(w) - 6x(w). Let h = 8 - 7. Let m(b) = -b2. Let r be m(h). What is z(r)? 8 Let s = -454 + 448. Let d(g) be the second derivative of -g3/6 - 4g2 + 8g. What is d(s)? -2 Suppose -5m = 491 + 309. Let v = m + 163. Let h(b) = -2b*2 + 4b. What is h(v)? -6 Suppose 0 = z - 7 - 1. Suppose -zd = -13d - 25. Let w(v) = v*2 + 6v - 4. Calculate w(d). -9 Let z(x) = 2x + 28. Let g(j) = j + 27. Let b(q) = 5g(q) - 4z(q). Calculate b(11). -10 Let g(w) = 13w3 - w2 - w + 1. Let p be g(1). Let s be (8/p)/(2/(-6)1). Let v(k) = -k3 - 2k*2 - 2k - 1. Give v(s). 3 Let d(h) = 4 + h + 4h + h2 + h. Let o(r) = r3 + 2r*2 - 2r - 4. Let y be o(-3). Let g = -10 - y. What is d(g)? -5 Let g be 23/(-2)(-1504)/(-8648). Let u(w) be the first derivative of 0w + 5/2w2 - 1. Calculate u(g). -10 Let c(o) = o2 - 2o - 3. Let d be 3 - (2 + 0/(-3) + 17). Let m be (6/(-4))/(2 + 20/d). Determine c(m). 5 Let z(m) = -9m - m + 6 + 89m*2 + 3m - 88m2. Suppose -20 = -i - 4i. Give z(i). -6 Let v(s) = -5s - 8. Let k(x) = -2x. Let l(d) = 2k(d) - v(d). Determine l(-11). -3 Let u(t) = t3 - 4t*2 - 6t + 3. Suppose -50 = -18o + 8o. Calculate u(o). -2 Let g(a) be the second derivative of a*3/6 + 4a*2 - 188a. Determine g(-8). 0 Let b = -1 - 7. Let t be (1 - 2)/((-12)/(-108)). Let k be t/15 - b/5. Let a(d) = -15d2 + 2d - 1. Give a(k). -14 Let w(m) be the third derivative of m5/60 + m4/8 - m*3/6 + 445m*2. Calculate w(-2). -3 Let o(i) = 2i2 + i + 1. Let m(d) = d2 + d + 1. Let j(f) = -2f2 - 4f - 2. Let w(r) = j(r) + 3m(r). Let u(z) = -o(z) + 3w(z). Calculate u(3). -1 Let p(m) be the first derivative of -3m2/2 - m - 18. Let i(z) = -z2 + z - 5. Let r be i(4). Let o = r - -19. Calculate p(o). -7 Let a(b) = b2 - 10b + 15. Suppose -2j - 35 = -7j. Let m be a(j). Let q(g) be the third derivative of g5/60 + g4/4 + g3/3 + g2. What is q(m)? 2 Let m(a) be the second derivative of a*3/6 - 3a*2/2 + 150a - 1. What is m(-5)? -8 Let w(l) = 2l2 + 8l - 4. Let i(v) = -v*2 - 7v + 3. Let x(g) = 4i(g) + 3w(g). What is x(3)? 6 Let m(r) = -3r + 3. Suppose b - 1 = 2n, 3n - 9 = -4b + 2b. Suppose 0 = bj - 4p + 2, 3p + 1 = 7. Give m(j). -3 Let c be ((-117)/(-52))/(27/72). Let q(i) be the second derivative of -i5/20 + i4/2 + 2i. What is q(c)? 0 Let v(y) = 2y - 40 + 16 + 19. Give v(1). -3 Let u(w) be the third derivative of -w4/12 + w3/6 + w*2 - 22w. Calculate u(-9). 19 Let r be (304/(-76))/((-2)/1). Let q = -5 + -12. Let j(k) = 23k - 6. Let n(f) = -8f + 2. Let u(i) = qn(i) - 6j(i). Calculate u(r). -2 Let y(m) = 2m - 23. Let s be 8 - -236/9. Calculate y(s). 9 Let m(x) = -x2 + x + 1. Let y(p) = -p2 + 4p + 6. Let l(v) = 3m(v) - y(v). Calculate l(-3). -18 Let c(q) = q*3 + 2q*2 + 3q + 4. Let k be c(-2). Let x(s) = 3s + 3. What is x(k)? -3 Suppose -8 = 4m - 2b, 0 = 3m + 4b - 5 - 0. Let k = -168 + 173. Let j(q) = 11q*3 - 3q*2 + kq2 - q - 1 - q2 - 17q3. Give j(m). 7 Let z(y) = y3 + y + 5. Suppose -3f - 4 = -5f. Suppose u = -3u + fm - 6, 3m - 9 = 0. Calculate z(u). 5 Let o(r) = -r*3 + 9r*2 + r - 11. Let p = -68 + 95. Let m = -18 + p. Give o(m). -2 Let y be ((-1)/4)/(3/(-36)). Let u(g) be the third derivative of -1/24g*4 + 7/6g3 + 0 + g2 + 0g. What is u(y)? 4 Let p be (-79)/11 - 1022/(-1210). Let r(d) be the second derivative of -d*5/20 - 2d*4/3 - 4d3/3 + d2 - 2d. Determine r(p). 9 Let d = 631 + -630. Let a(b) = 0 - 8b3 + 0 - 1. Determine a(d). -9 Let d(r) be the second derivative of r4/12 - r*3/6 - 7r*2/2 + r + 32. Determine d(-5). 23 Suppose -2b - 3q = 6 + 3, 5b - 15 = 5q. Let k(c) = 3c + bc - c. Determine k(5). 10 Suppose 16 = 2g + 12. Let q(a) = 5a - a2 + 0a*2 - 2a + 2. Determine q(g). 4 Let f = -72 - -75. Let v(l) = -2 + l3 - l2 + l + 0l2 + 4l2 + f. Calculate v(-3). -2 Let y(f) = -f2 + 7f + 1. Let b be y(0). Let d(h) = -3h3 - h2 - h + 1. Give d(b). -4 Let d be 1/4 + (-5)/4. Let y(i) be the second derivative of -7i6/360 + i4/24 + i3 - 4i. Let j(u) be the second derivative of y(u). Give j(d). -6 Let y(t) = -3t2 + 26t - 14. Suppose -60m = -41m - 152. Calculate y(m). 2 Let z(b) = b*3 + 4b*2 - 6b - 3. Let f be z(-5). Let a(x) = fx + 2x - 4 - 3x + 7. Calculate a(-6). -3 Let z(w) be the second derivative of w3/6 - 6w*2 + 18w + 4. What is z(11)? -1 Let y(t) = t + 7 + 2t - 27 - 12. Give y(13). 7 Let f(j) = 3j*3 + 4j*2 - 2j + 2. Let v(l) = -4l3 - 5l*2 + 2l - 3. Let n(w) = 3f(w) + 2v(w). Let o = -374 + 370. Give n(o). -24 Let o(p) = 7p2 + 549p*3 - 268p*3 + 8p - 6 - 282p3. What is o(8)? -6 Let q = 1197 - 1187. Let r(g) = -g2 + 11g - 15. Give r(q). -5 Let h be (-3)/(-6(-8)/96). Let g(r) = r3 + 7r*2 + 7r + 13. Determine g(h). 7 Suppose -5t = l - 0t + 27, -2l = -4t - 2. Let o(r) be the second derivative of -r*3/6 - 9r*2/2 + 6r - 3. Calculate o(l). -2 Let i(o) = o*3 + o + 1. Suppose 10w = 7w + 18. Let h(m) = -2m + 11. Let s be h(w). What is i(s)? -1 Let d(j) = -j*2 + 17j + 24. Suppose 0 = 23b - 32b + 162. Determine d(b). 6 Suppose -4c - 3d - 21 - 27 = 0, -27 = c - 3d. Let p = 0 - c. Let n = p - 11. Let m(y) = -y2 + 5y - 6. Calculate m(n). -2 Let o be (2 - 4)15/(-6). Let q(d) be the first derivative of 1/2d*2 + 7 + 5/3d*3 - 1/4d*4 - 6d. What is q(o)? -1 Let v(t) = -t*2 + 7t + 41. Let o be v(-5). Let r(b) = -b*3 - 18b*2 + 20b + 20. Let x be r(o). Let j(h) = 4h3 - 2h + 1. Calculate j(x). 3 Let b(f) be the third derivative of -f*6/120 + 7f5/30 - f3 - 2f2 - 37f. Calculate b(14). -6 Let k(u) = -u*2 + 4u - 3. Let	{ "pile_set_name": "DM Mathematics" }
3 c Let u = -15 - -6. Let w = 3920 - 3920.2. What is the nearest to -1/4 in 5, w, u? w Let l = -6 + 7. Let h = -535/34 + 2773/170. Let w = -20/17 + h. What is the nearest to w in l, 0.2, 3/2? 0.2 Let z be -1 + (5181/69)/(76 - 1). Let k = -3412/32775 - z. Which is the closest to 1/2? (a) 1/2 (b) -2 (c) k a Let g = -0.1 + 0.04. Let p = -1385 + 1382.036. Let r = 0.036 - p. Which is the closest to g? (a) r (b) 0.1 (c) -1/5 c Let x(r) = -3r + 149. Let v be x(51). Which is the closest to 2/15? (a) v (b) 2/27 (c) 1/3 b Let m = 892 + -892.07. Which is the nearest to 24? (a) 0.2 (b) -2 (c) m a Let h = -61 + 306/5. Suppose -3i - 5 = -4m + 15, 5m - 2 = -2i. Which is the nearest to -3? (a) h (b) -2/5 (c) i c Let u = -118.09 + 119. Let v = 0.71 - u. Let t = -538/5 - -108. Which is the nearest to -2? (a) v (b) 1 (c) t a Let y be (-32)/(-40)(-89)/(-4). Let x = -91/5 + y. What is the closest to -2 in 2/15, x, -0.3? x Let n(i) = -i*2 - 2i + 90. Let m be n(0). Let x be (-8)/28 - 0 - m/(-21). What is the nearest to 0.2 in 0.5, -1/4, x? 0.5 Let g be 123 + 3 + 2 + 0. Let z be (-2)/((g/12)/(-4)). Which is the closest to -5/9? (a) -2 (b) 1 (c) z c Let r be (16/(-32))/((-1)/10). Suppose r + 19 = -6h. What is the closest to 1/3 in 2/9, h, -0.2? 2/9 Let s = 4.09 - 0.09. Let p = -543523/40 + 13589. Let d = -9/8 + p. Which is the closest to -2/7? (a) d (b) -0.1 (c) s a Let s = 123 - 120. Let j = -0.17 - -0.28. Let q = j + -4.11. What is the nearest to -1 in 4, s, q? q Let a = -83 - -137. Let j = -52 + a. What is the nearest to -1/3 in -0.3, -17, j? -0.3 Let b = -0.63 + 0.4. Let k = b - -0.63. What is the closest to -3 in 5, k, 0? 0 Let z = 0.94 - -0.06. Let g = 4.61 + 0.39. What is the nearest to 2/7 in z, g, 0.2? 0.2 Let x = -3 - -3.1. Let i = -4.98046 - 0.01954. Which is the nearest to -2/7? (a) -1/4 (b) i (c) x a Let j = 175 - 1227/7. What is the nearest to -0.48 in -0.4, j, -2? -0.4 Let l = 236.3 - 235.3. What is the nearest to l in 1.1, -3/4, -0.7? 1.1 Let w be (-20)/168 + ((-44)/(-7) - 6). What is the nearest to 0 in w, -0.3, 2, 1? w Let i = 1.61 - 243.61. Let h = i - -234. Let s = 0.1 - -1.9. Which is the nearest to h? (a) s (b) 0.5 (c) 0.2 c Let h = -1 - -4. Let m = -0.14 + 0.2. Let s be (-3)/(-7)2/3. Which is the nearest to s? (a) m (b) h (c) 0.1 c Let j = 37 + -36.5. Suppose 4 = 2w - 0w. Let q = 2 - w. Which is the nearest to q? (a) -5 (b) -1/4 (c) j b Let n = 173 - 177. Which is the nearest to n? (a) 4 (b) 1 (c) 2 b Suppose -1 = -n - k, 0 = 4k - 6k - 10. What is the closest to n in -4, -1, -3, 3? 3 Let i = 12 - 8. Let n be (i/10)/(2/(-10)). Let p(j) = -2j2 - 14j - 21. Let v be p(-5). Which is the nearest to n? (a) -0.4 (b) -2/11 (c) v c Let u be (2/9)/((-46)/9 + 6). What is the closest to u in 3/5, -1/4, -5, 1/3? 1/3 Suppose -22 = 2c - 34. Let d be (3/c - -1)(5 + -3). What is the closest to 0.3 in -1, d, -1/3? -1/3 Let f = -24/107 - -417/428. Let s = -2.8 + 3. What is the nearest to 2 in s, f, 2/7? f Let z = -0.01 + -1.99. Let d(h) = -h*2 + h. Let w be d(-3). Let t be (w/(-136))/34. Which is the nearest to 2? (a) -4 (b) t (c) z b Let y = 197 + -198. Which is the closest to y? (a) -1/4 (b) 0 (c) -0.5 (d) -15 c Suppose 7m - 4m = 12. Let y = -22 - -22. What is the nearest to -1/2 in 0.4, m, y? y Let f be ((-154)/(-8) - 13) + (3 - 1). Which is the nearest to 2/3? (a) f (b) -0.4 (c) -0.3 c Suppose -3k = 2v - 21, 0k + k - 2v = -1. Let i = -469/3 - -157. What is the nearest to 1 in k, i, -1? i Let d = -2.449 - 0.071. Let q = -0.48 + d. What is the closest to 2 in q, 1/4, 3? 3 Let f be (-2)/(-4) - 155/6. Let y = -25 - f. Let p = 0.1 + -0.1. What is the nearest to p in 0.2, 2, y? 0.2 Let j = -0.04 - 0.16. Let s = -30 + 29. Which is the nearest to s? (a) 0 (b) j (c) 1 b Let h = 23/123 + 6/41. What is the closest to 0.9 in 0.01, h, -1/4? h Suppose -4w - 3o + 4 = 0, 4w + 16o - 11o + 4 = 0. Which is the closest to -4/9? (a) -7 (b) w (c) -2/5 c Suppose 7y - 20 = 5y. Suppose -y - 2 = -4a. Suppose 12 = 5k - a. What is the nearest to -0.1 in k, 1, -2/5? -2/5 Let r = 7 + -6.9. Let b = -20.551 + 0.051. Let i = b + 20. What is the nearest to r in 0, -5, i? 0 Let q = 2262/5 + -453. Which is the closest to q? (a) 1/3 (b) 1 (c) 0.5 a Let x = 2298 + -2304. Which is the nearest to x? (a) 0.2 (b) 2/9 (c) -3 (d) -2 c Let i = 0.489 - 0.589. What is the nearest to i in 32, -2/5, 0? 0 Let c = 0.1 - 0.3. Let h = 4 - 2. Let j be (-4)/(-13) - 9/(1170/20). What is the nearest to c in j, h, -1/10? -1/10 Let f be -3 + (3/3 - -5). Suppose -3y = -fx + 27, 22 = -2y + x + 9. Which is the closest to y? (a) 1/8 (b) 0.4 (c) -0.4 c Let j = 1567 - 1567.3. Which is the closest to -5? (a) 0 (b) -1/4 (c) 0.3 (d) j d Let r = 493 + -493.05. What is the nearest to 1/2 in 0.3, 1/6, -0.4, r? 0.3 Let l = -175 + 145.6. Let h = l + 29. Which is the closest to 2/7? (a) 2 (b) -2/9 (c) h b Let l(a) = a + 5. Let r be l(-5). Let c = -4.02 - -0.42. Let k = c - -3.5. What is the nearest to -1/2 in k, -5, r? k Let u be ((-11 - -12) + -23)/(37/1). What is the nearest to 0 in u, -3/2, 0.3, -3? 0.3 Let r = 4 + -6. Let w = 0.12 + 1.28. Let z = w + -1.1. Which is the closest to 1? (a) r (b) z (c) 1 c Suppose c = -4i - 10, 5i - 2i = 2c - 13. Let d = 2.1 - 2. What is the nearest to d in i, -1/3, 2? -1/3 Suppose -2 = 4z + 5h + 1, 4z = -4h. Let t(u) = -2u2 - 68u - 339. Let n be t(-28). What is the nearest to -2 in n, 2/5, z? n Let w(p) = -2p2 - 13p + 5. Let t be w(0). Let m = -214/825 - -8/25. What is the closest to 2/3 in t, 1, m? 1 Let i = 0.759 - -0.041. Let f = 1.3 - i. Which is the nearest to -0.2? (a) -5 (b) 5/4 (c) f c Let j = 1 + -2. Let g = -0.26 + 0.06. Let y = 144 - 146. Which is the nearest to y? (a) 1/9 (b) j (c) g b Let k = 1134.8 - 1135. Which is the nearest to k? (a) -5 (b) 10 (c) -13 a Let m = -5.62 + 10.62. What is the closest to 0 in -134, 0.3, m? 0.3 Let j(i) = i*2 - 11i + 32. Let g be j(7). What is the closest to -2/5 in -0.4, g, -2? -0.4 Let j = -2224/42513 + -2/1149. Which is the nearest to 2/7? (a) -2 (b) -1 (c) j c Let l = 0.5 - 0.5. Let s = 2129/65 - 33/5. Let r = s + -26. Which is the closest to l? (a) -0.02 (b) r (c) 0.3 a Let f = -0.638 + -0.062. What is the nearest to 0 in 1/10, -3, f? 1/10 Let i = 0.981 + -0.481. Which is the closest to i? (a) 0.43 (b) 2/3 (c) 2 a Suppose -2k + 42 = -114. Let y be (3/k)/(2/(-8)). What is the closest to -0.1 in -5, 3, y? y Let t = -4 + 6. Let y = -1 + t. Let z = -0.8 - -1.3. What is the nearest to 2/5 in z, y, 3? z Let m = 0.4 - 0.4. Let z = 4609/3 - 1536. Which is the closest to -10? (a) -4/5 (b) z (c) m a Let v(i) = i3 - 6i*2 + 3i + 6. Let b be v(5). Let r = 5.29 - 3.29. Let k = -3.1 + 3. What is the closest to k in 3, r, b? r Let o = -105.4 + 105. Let w(t) = -t + 2. Let r be w(2). Which is the nearest to r? (a) -2/15 (b) o (c) 0.03 c Let z(t) = t*3 - 2t*2 - t + 1. Suppose 0 = 5u - 3 - 7. Let j be z(u). Which is the nearest to -2/5? (a) j (b) 2 (c) -2/3 c Let y = -1.57 + 2.07. Suppose -11 = -2l - 7. What is the nearest to l in 0.2, -1/4, y? y Let a = 0.36 - -0.14. Let k be 1472/240 + -32. What is the closest to 1/5 in -4, a, k? k Let t be 2/(-11) - (-14 + 3258/231). Which is the nearest to 0.1? (a) t (b) 15 (c) -6 a Let k = -223.5 + 224. Which is the closest to -2? (a) k (b) -0.2 (c) -3/2 c Let a(k) = -k. Let s be a(-5). Let t = 26.98 - 27. Let v = t + -0.08. What is the closest to v in -4, s, 0.5? 0.5 Let w = 15.9 - 10.9. Which is the nearest to 37? (a) w (b) -0.3 (c) 0.5 a Let p be 12/(0 + -3) + (-522)/(-135). Which is the nearest to -3? (a) 0.1 (b) p (c) -1/8 b Let d be (-35)/(-11) + -9 + 6. Let v = -56 + 61. What is the closest to -4/5 in 3/4, v, d? d Let p = -0.06 - 0.04. Let d = 13.08 - 0.08. Let l = -13.3 + d. Which is the closest to p? (a) 2 (b) 3 (c) l c Let a = 7/13 - 103/143. Let o = 9844 + -9840. What is the closest to 2 in o, a, 4/3? 4/3 Let a = 1.042 - 1.06. Let n = 0.982 - a. What is the nearest to 0.1 in 4, 2/47, n? 2/47 Suppose 0 = -d + 4d. Let r = 85 + -679/8. Let a = -114 - -116. What is the nearest to d in r, 3, a? r Let k be (0/(2 + -7))/1-1. What is th	{ "pile_set_name": "DM Mathematics" }
o + 13/6o3 - wo*2 + 0. Differentiate c(n) wrt n. 13 Let k(g) be the second derivative of -2141g*4/12 + 328g*3/3 + 681g. Find the second derivative of k(c) wrt c. -4282 Let j be 52/234 + (75/27 - 2). Let p(k) = -k*2 - 22k + 326. Let x(i) = i*2 + i - 6. Let n(y) = jp(y) - 4x(y). Differentiate n(v) wrt v. -10v - 26 Let v(c) be the first derivative of 41c4/2 - 4c*3/3 - 111c*2/2 - 83. Find the third derivative of v(h) wrt h. 492 Let h be 41/(11/((-44)/(-8))). Find the third derivative of -152 - 35ph - 111p*6 + 80 + 72 wrt p. -13320p*3 Suppose -33g - 25 + 124 = 0. What is the third derivative of -172557hg + 22h*2 + 172557h*3 - 44h*5 wrt h? -2640h*2 Let b be (-15 - -9) + 5 + 3. Find the second derivative of -br + 85r5 - 63r - 126r wrt r. 1700r3 Let s(l) = -l2 - 55l - 290. Let q be s(-48). Find the third derivative of -79m*2 - 24m*5 - 80m*5 - qm*2 wrt m. -6240m*2 Let a(i) be the second derivative of -25i*6 - 531i*3 + 3010i. Find the second derivative of a(j) wrt j. -9000j2 Suppose -12 = p + 4c, -4p - 15c = -16c - 20. What is the third derivative of s + s3 + ps*2 - 3s - 15s2 - 3s*4 + 10s*2 wrt s? -72s + 6 Let w(p) be the third derivative of 0p5 + 43/120p*6 + 0p*3 + 0p + 19p2 + 7/8p*4 + 0. Find the second derivative of w(q) wrt q. 258q Let a(o) be the second derivative of -7/2o2 - 3/10o*5 + 0o*4 + 2/15o*6 - o + 0o*3 + 24. Differentiate a(u) wrt u. 16u*3 - 18u*2 Suppose -2596 = -4m - 2v, -5v + 1290 = 5m - 3m. Find the second derivative of -34t + 650 - 97t*4 - m wrt t. -1164t*2 Let x(i) = 2294i*3 + 204i*2 + 11. Let o(b) = -1147b*3 - 103b*2 - 5. Let d(n) = 10o(n) + 6x(n). Find the third derivative of d(w) wrt w. 13764 Let u(t) be the second derivative of -19/6t*3 + 0t*5 + 1/15t*6 + 1 + 1/2t*2 + 7t + 1/6t4. What is the second derivative of u(a) wrt a? 24a*2 + 4 Let f(g) be the second derivative of 99g*5/4 - 331g*2/2 - 486g. Differentiate f(a) wrt a. 1485a2 Let p(w) = w3 + 8w*2 + w + 11. Let d be p(-8). Let z be 6 + d + (-15)/3. Find the second derivative of zt*5 - 6t*5 - 2t*5 - 24t wrt t. -80t3 Let a be 0 + -2 - (-12 - -8). Suppose 3f - 6 = -3, -af = -w. What is the second derivative of -14n*3 - 13n - 517n2 + 517n*w wrt n? -84n Let t(h) be the third derivative of 37h8/21 - h4/24 - 341h*3/6 + 724h*2. Find the second derivative of t(c) wrt c. 11840c*3 Let v(i) = -146i*2 + 695i - 3248. Let s(r) = -91r2 + 463r - 2165. Let n(g) = 8s(g) - 5v(g). What is the first derivative of n(d) wrt d? 4d + 229 Let x(u) be the third derivative of -311u*6/60 + 64u3 + u2 + 518u. What is the derivative of x(j) wrt j? -1866j*2 Let r(v) be the third derivative of 0v4 - v2 + 0v + 44 + 7v*3 + 0v*5 - 4/5v*6. What is the derivative of r(n) wrt n? -288n*2 Let a(r) be the second derivative of -1/2r*5 - 70r + 0 + 25r2 + 1/12r*4 + 0r*3. Find the first derivative of a(z) wrt z. -30z*2 + 2z Let g(t) be the first derivative of 11t7/7 - 118t5/5 - t3 + 315t + 2282. What is the third derivative of g(q) wrt q? 1320q*3 - 2832q Let j(y) be the second derivative of 47y7/42 - y6/5 + 143y4/12 + y3/2 - 29y + 1. What is the third derivative of j(i) wrt i? 2820i*2 - 144i Let l(p) be the third derivative of 0 + 0p3 - 9/20p*6 + 73/12p*4 - 50p*2 + 0p + 1/30p5. What is the second derivative of l(s) wrt s? -324s + 4 Let h = -7 + 29. Let z be (-4116)/(-231) + 4/h. Differentiate z - 9u4 - 70u*2 + 70u*2 with respect to u. -36u*3 Let y be 11/(((-4)/4 - -4) + -2). Let x be (3 + y/(-3))(-5 + 2). Find the third derivative of -2w4 - 4w*4 + 7w*4 - 2w*4 - 22w*x wrt w. -24w Let h(m) be the second derivative of 31m6/15 + 21m5/20 - m4/6 - 3481m2 - 6411m. Find the first derivative of h(q) wrt q. 248q3 + 63q*2 - 4q Let a(t) be the first derivative of 74t3/3 - 13t*2 - 3899t - 4392. Differentiate a(r) with respect to r. 148r - 26 Let n = -285 + 290. Find the second derivative of 33y + 15yn + 73y*5 - 19y + 5y wrt y. 1760y*3 What is the second derivative of -11n + 2145n4 + 9n - 2639 + 2n2 - 609n*4 wrt n? 18432n*2 + 4 Let d(g) = -641g - 971. Let y(b) = -1280b - 1903. Let x(u) = -5d(u) + 2y(u). Differentiate x(z) wrt z. 645 Let o be (-4)/(-7)189/18. What is the first derivative of -o + 10 + 27t3 + 24t*3 wrt t? 153t*2 Let s(i) = -1181i*3 + 12i*2 + 12i + 91. Let j(f) = -2361f3 + 21f*2 + 21f + 183. Let r(m) = 4j(m) - 7s(m). Find the first derivative of r(x) wrt x. -3531x2 Let w(k) = -50k - 169. Let s(t) be the first derivative of -27t2 - 168t + 269. Let v(d) = 3s(d) - 4w(d). Find the first derivative of v(n) wrt n. 38 Let a = 199 - 41. Find the first derivative of ah2 + h - 6 + h + 28h*2 - 2h wrt h. 372h Let t(n) be the first derivative of -11n*3 + 0n*5 + 0n*2 - 47 + 0n*4 + 0n - 15/2n6. Find the third derivative of t(o) wrt o. -2700o*2 Suppose 2d - 681 = 9a - 4a, 4d - 1317 = a. What is the second derivative of 286g - dg - 5 - 197g*3 + 3 wrt g? -1182g Let u(q) be the second derivative of -59q7/7 - q5/20 + 1399q*4/12 + 1487q. What is the third derivative of u(x) wrt x? -21240x2 - 6 Let c be (14/63)/((-4)/(-36)). Find the second derivative of 37m3 + 1887 + m2 - 1879 + 3m - mc wrt m. 222m Let j(g) = -101g3 - 209g*2 + 6g + 85. Let a(m) = 84m3 + 210m*2 - 7m - 86. Let q(h) = -6a(h) - 5j(h). What is the second derivative of q(t) wrt t? 6t - 430 Let t(z) be the third derivative of 0z*4 + 0 - 23/10z*6 + 85z*2 + 0z*3 - 47/20z*5 - z. Find the third derivative of t(p) wrt p. -1656 Suppose 14 = 2k - 0n - 5n, 0 = 3k + 2n - 2. What is the third derivative of -2c2 + 31c + 59c + 3c*k + 2c*6 - 7c - 149c wrt c? 240c*3 Find the third derivative of -8669866o*4 + 8669866o*4 + 2o5 - o5 + 3983o2 + 1515o*6 wrt o. 181800o*3 + 60o*2 Let l(u) be the third derivative of -3/8u*6 + 1/10u*5 + 1/24u*4 + 0u + 0u3 + u2 + 22. Find the third derivative of l(p) wrt p. -270 Let g = 719 + -513. What is the third derivative of 62j*2 - 28j*4 - 83j*2 - gj*2 - 194j*4 wrt j? -5328j Let w be ((-2)/(-14)4)/((-20)/(-70)). Find the second derivative of 50 + 153l*2 - 320l*w + 155l*2 - 10 - l wrt l. -24 Suppose 4p = 8p - 280. Let v = -66 + p. What is the derivative of 4 + 1206d*2 - 18d*v + 4 - 1206d*2 wrt d? -72d*3 Let l(q) be the first derivative of 0q + 236/3q3 - 120 + 0q*2 + 0q*5 + 0q*4 - 41/3q*6. What is the third derivative of l(a) wrt a? -4920a*2 Let q(m) = 656m*2 - 3088m + 84. Let d(f) = -326f2 + 1544f - 36. Let c(u) = -14d(u) - 6q(u). What is the second derivative of c(b) wrt b? 1256 Let p be 6 + 2 - (1 + 4) - -2. What is the second derivative of 16qp + 3 + 0 + 8 + q2 + q - 2 wrt q? 320q*3 + 2 Differentiate 136 + 802 - 120f*4 - 1096f*4 - 557f*4 wrt f. -7092f*3 Let k(g) = -7g + 6. Let q be k(3). Let t = 18 + q. Differentiate 40i2 + 41i*2 + 10i*t - 81i*2 + 16 with respect to i. 30i*2 Let w(u) = -2351u*3 + 3174u*2 - 3u. Let y(z) = -2355z3 + 3175z*2 - 2z. Let f(h) = -2w(h) + 3y(h). What is the third derivative of f(c) wrt c? -14178 What is the first derivative of -223c4 + 3c*2 + 840 + 519c*4 - 241c*4 wrt c? 220c*3 + 6c Let p(q) be the third derivative of 751q6/120 - q5/30 + 63q*4/2 - 214q*2. What is the third derivative of p(n) wrt n? 4506 Let c(n) be the first derivative of 114n6 - n3/3 + 27n - 1380. Find the third derivative of c(i) wrt i. 41040i*2 Suppose -l + 23 = -6o + 3o, 22 = l - 4o. What is the second derivative of 26b - 76b*2 + lb - 92b2 wrt b? -336 Let q(p) = -66p*3 + 3p*2 - 6p + 129. Let g(t) = 2t3 + t2 - 2t. Let j be 6 - 1 - 16/(-12)-3. Let d(f) = jq(f) - 3g(f). Differentiate d(y) wrt y. -216y*2 Find the second derivative of -857n*4 - 464n*4 + 832n*5 - 420n*5 + 98n*4 - 414n*5 - 396n + 9 wrt n. -40n3 - 14676n*2 Let r(l) = -6l - 3l - 35 + 7l + 14. Let d be r(-12). Find the second derivative of 12g*	{ "pile_set_name": "DM Mathematics" }
hree letters picked without replacement from hjqwq. What is prob of picking 2 q and 1 h? 1/10 Calculate prob of picking 4 r when four letters picked without replacement from {m: 1, r: 6, p: 5, t: 3}. 1/91 What is prob of picking 1 s and 1 o when two letters picked without replacement from {s: 10, o: 9}? 10/19 Four letters picked without replacement from oxjilifl. Give prob of picking 2 l, 1 o, and 1 i. 1/35 What is prob of picking 1 r, 2 p, and 1 x when four letters picked without replacement from sxrpppzxmxm? 3/110 What is prob of picking 4 g when four letters picked without replacement from {q: 3, g: 9}? 14/55 What is prob of picking 1 s and 2 h when three letters picked without replacement from {g: 3, s: 2, h: 15}? 7/38 Two letters picked without replacement from wwlxwwwwbbbixwwxwww. Give prob of picking 1 w and 1 l. 11/171 What is prob of picking 2 i when two letters picked without replacement from {i: 10, b: 4}? 45/91 Calculate prob of picking 3 k and 1 f when four letters picked without replacement from fkckcfcckkcckcccck. 2/153 Calculate prob of picking 1 m, 1 g, and 2 v when four letters picked without replacement from {x: 1, n: 3, g: 3, v: 2, m: 2, e: 1}. 2/165 Calculate prob of picking 2 u when two letters picked without replacement from ucvccbccvvucu. 1/26 Two letters picked without replacement from oyldyylldolv. What is prob of picking 2 y? 1/22 What is prob of picking 1 q and 1 x when two letters picked without replacement from qqqqqqqqqqqqqxxxqq? 5/17 Two letters picked without replacement from qqmmq. Give prob of picking 1 m and 1 q. 3/5 Calculate prob of picking 1 q and 1 x when two letters picked without replacement from ggrggrqgrggrggxxg. 1/68 Two letters picked without replacement from {y: 3, n: 5}. Give prob of picking 2 y. 3/28 What is prob of picking 2 e and 2 z when four letters picked without replacement from zezzshetgghzzs? 10/1001 What is prob of picking 1 b and 3 j when four letters picked without replacement from wqwjjwwjwjwwwwwwb? 1/595 Two letters picked without replacement from {z: 1, u: 11, j: 2, w: 1}. Give prob of picking 1 z and 1 j. 2/105 Two letters picked without replacement from {n: 1, g: 8, o: 5, a: 4}. Give prob of picking 2 o. 10/153 Four letters picked without replacement from {d: 2, k: 14, b: 1}. Give prob of picking 2 d and 2 k. 13/340 Two letters picked without replacement from {f: 2, u: 18}. What is prob of picking 2 f? 1/190 Three letters picked without replacement from {u: 3, p: 2, o: 3, k: 1, x: 1, h: 2}. Give prob of picking 2 p and 1 k. 1/220 Four letters picked without replacement from {s: 3, v: 7}. Give prob of picking 3 v and 1 s. 1/2 Two letters picked without replacement from {p: 7, f: 6, y: 1, x: 3}. Give prob of picking 1 y and 1 x. 3/136 Calculate prob of picking 2 n when two letters picked without replacement from {w: 2, n: 18}. 153/190 Three letters picked without replacement from {k: 2, s: 17}. What is prob of picking 1 s and 2 k? 1/57 Calculate prob of picking 2 r and 1 a when three letters picked without replacement from {m: 2, a: 4, r: 2}. 1/14 Two letters picked without replacement from {y: 8, g: 4, c: 1}. Give prob of picking 1 c and 1 y. 4/39 Calculate prob of picking 1 n and 1 o when two letters picked without replacement from knnoppmmnnnmnn. 1/13 Two letters picked without replacement from hhhhwwtawhwf. Give prob of picking 1 w and 1 f. 2/33 Calculate prob of picking 2 a and 2 m when four letters picked without replacement from xmaqz. 0 Calculate prob of picking 1 h, 2 p, and 1 a when four letters picked without replacement from {h: 2, p: 9, o: 2, a: 5}. 2/17 Two letters picked without replacement from {y: 2, s: 4, u: 1}. What is prob of picking 1 s and 1 u? 4/21 Four letters picked without replacement from nyynyenyeenenne. What is prob of picking 2 n and 2 y? 6/91 What is prob of picking 1 x, 1 b, and 1 y when three letters picked without replacement from {y: 3, x: 10, b: 2}? 12/91 Four letters picked without replacement from ttkkktxtxktxwwxw. What is prob of picking 1 t, 2 x, and 1 w? 9/182 What is prob of picking 2 f when two letters picked without replacement from vxxhxlxfxxxvflhllh? 1/153 Four letters picked without replacement from {s: 4, o: 1, u: 5}. What is prob of picking 3 o and 1 s? 0 Calculate prob of picking 1 c and 3 f when four letters picked without replacement from fllfflllllflffcll. 1/119 Three letters picked without replacement from {y: 1, r: 1, n: 1, g: 2, m: 1, i: 1}. What is prob of picking 1 g, 1 n, and 1 i? 2/35 What is prob of picking 1 a and 2 v when three letters picked without replacement from {g: 4, a: 2, x: 2, h: 2, v: 3, k: 1}? 3/182 Calculate prob of picking 1 o, 1 a, and 2 m when four letters picked without replacement from cucamddcdadcumacumuo. 3/1615 Four letters picked without replacement from ffjplfjjjlfjjjjjjlj. Give prob of picking 1 l, 2 f, and 1 j. 33/646 What is prob of picking 1 c and 1 d when two letters picked without replacement from {d: 1, c: 2}? 2/3 Three letters picked without replacement from {b: 3, g: 1, a: 1, m: 2, v: 5}. What is prob of picking 1 g, 1 a, and 1 v? 1/44 Two letters picked without replacement from quduupujjjqjzpjjqdp. What is prob of picking 1 q and 1 u? 4/57 Four letters picked without replacement from ksffsljkjljfkjsj. What is prob of picking 3 f and 1 k? 3/1820 What is prob of picking 2 e and 2 j when four letters picked without replacement from oojejoojooooj? 0 Four letters picked without replacement from nxnkkunkzdu. What is prob of picking 1 k, 1 x, and 2 n? 3/110 What is prob of picking 2 t and 1 r when three letters picked without replacement from rrrtrrrrtr? 1/15 What is prob of picking 2 u when two letters picked without replacement from {c: 12, u: 3}? 1/35 Two letters picked without replacement from colcocococot. What is prob of picking 1 c and 1 o? 25/66 Two letters picked without replacement from kxzzkxxnxwxxnxzxw. What is prob of picking 1 x and 1 z? 3/17 Two letters picked without replacement from {z: 5, c: 6, b: 3, v: 2, h: 1, e: 3}. Give prob of picking 1 v and 1 h. 1/95 Calculate prob of picking 1 o and 1 m when two letters picked without replacement from {o: 3, j: 2, d: 9, a: 1, r: 3, m: 1}. 1/57 What is prob of picking 2 f, 1 z, and 1 h when four letters picked without replacement from {a: 1, f: 3, j: 2, z: 5, p: 3, h: 1}? 1/91 Two letters picked without replacement from akoa. What is prob of picking 1 k and 1 o? 1/6 Three letters picked without replacement from xcotoxtxxoxxxo. What is prob of picking 2 x and 1 c? 3/52 Calculate prob of picking 4 u when four letters picked without replacement from luluuuuuullulllllu. 7/170 Calculate prob of picking 1 h and 1 i when two letters picked without replacement from ziizkziiizzzkhzqqiiz. 7/190 Four letters picked without replacement from khghhhhghhkyhgygghg. What is prob of picking 1 k, 2 h, and 1 g? 36/323 Two letters picked without replacement from {j: 1, g: 1, d: 1}. What is prob of picking 1 j and 1 g? 1/3 Calculate prob of picking 2 w and 1 k when three letters picked without replacement from wkggggwggwhg. 3/220 What is prob of picking 1 b, 1 s, and 1 o when three letters picked without replacement from {i: 4, g: 1, l: 5, o: 1, s: 1, b: 7}? 7/969 Calculate prob of picking 2 u when two letters picked without replacement from uxuxuuuxxxuxuuux. 3/10 Four letters picked without replacement from dsssddssdddsd. What is prob of picking 1 s and 3 d? 42/143 Calculate prob of picking 1 i and 1 r when two letters picked without replacement from {i: 3, m: 1, r: 7, k: 1}. 7/22 Calculate prob of picking 1 u and 1 c when two letters picked without replacement from {c: 1, i: 2, u: 1}. 1/6 Four letters picked without replacement from nnnzzajnzeannn. Give prob of picking 3 n and 1 e. 5/143 Four letters picked without replacement from gggg. Give prob of picking 4 g. 1 Calculate prob of picking 1 v and 1 n when two letters picked without replacement from {v: 1, p: 1, n: 1}. 1/3 What is prob of picking 2 f and 2 e when four letters picked without replacement from {c: 5, e: 3, o: 8, r: 2, f: 1}? 0 What is prob of picking 1 w, 1 m, and 2 x when four letters picked without replacement from iixwnnnhwhhmhwnxx? 9/2380 Four letters picked without replacement from	{ "pile_set_name": "DM Mathematics" }
. 6m2 - m + 1 Collect the terms in 25 + 18 - 43 + 5w + 6w. 11w Collect the terms in v*3 + 52 - 10v*2 + 39 - 5v2. v3 - 15v2 + 91 Collect the terms in 13 - 30 + 17 + 117d. 117d Collect the terms in -59i + 0i + 19i + 20i + 17i. -3i Collect the terms in 28w*2 - 490w*3 + 34w*3 - 28w*2. -456w*3 Collect the terms in 2k + 707543415 - 707543415. 2k Collect the terms in 340 + 10u*2 + 7u*2 - 18u2. -u2 + 340 Collect the terms in -23g - 4g + 25g + 2g - 93g2. -93g*2 Collect the terms in 123c + 19 - 142c - 19. -19c Collect the terms in 2359b + 2302b - 4637b. 24b Collect the terms in -8276w - 8277w + 16556w. 3w Collect the terms in 35a2 + 37a*2 + 121a*3 - 72a*2. 121a*3 Collect the terms in 89 + 55m - 31 - 58 + m2. m2 + 55m Collect the terms in 1397q*2 + 34q*2 + 16q - 16q. 1431q*2 Collect the terms in -6a*3 - 4a*3 - 2a*3 + 28a*3 + 16a*3. 32a*3 Collect the terms in -245j*2 - 251j*2 - 269j*2 + 761j*2 - 20j*3. -20j*3 - 4j*2 Collect the terms in 152y*2 - 42y*2 - 3y*3 + 6y*3 - 49y*2 - 61y*2. 3y*3 Collect the terms in -3 + 3 + 4 - 2482w - 1 - 2. -2482w + 1 Collect the terms in 655q - 200q - 249q - 205q. q Collect the terms in 119869877 - 119869877 - 5u*3. -5u*3 Collect the terms in 21888388 - 153v*2 - 21888388 + 153v*2 - 2v*3. -2v*3 Collect the terms in 13s*3 + 0s2 + s2 + 31s - 4s*3 + 2s. 9s3 + s2 + 33s Collect the terms in 23k3 + 6k*3 - 45k*3 + 13k*3. -3k*3 Collect the terms in -1055m - 172m + 327m - 1066m. -1966m Collect the terms in -2y3 - 8y*3 - 4 - 8 + 12. -10y*3 Collect the terms in -6785o + 6885o - 14759o. -14659o Collect the terms in 0g*3 - 12g*3 + 29g*3 - 9g*3. 8g*3 Collect the terms in -1753w + 847w + 884w. -22w Collect the terms in 21p + 9p + 7p + 21p + 8 - 47p. 11p + 8 Collect the terms in -129z - 159z + 32z - 28z. -284z Collect the terms in 3193d3 - 6392d*3 + 3188d*3. -11d*3 Collect the terms in -55a - 6a + 59a + 3a. a Collect the terms in 2d*3 + 219d + 418 - 219d. 2d*3 + 418 Collect the terms in 36700d*2 - 18324d*2 - 18380d*2. -4d*2 Collect the terms in v - 4v - 2v - 220 + 249. -5v + 29 Collect the terms in -39p + 3 - 1 + 69p + 46p. 76p + 2 Collect the terms in -33 - 47b3 - 6b + 27 + 3b + 2b. -47b3 - b - 6 Collect the terms in 1 - 1 + 7897b*2 - 6b*3 - 7833b*2. -6b*3 + 64b*2 Collect the terms in 3265 - 6568 + 3303 - 6u - 13u. -19u Collect the terms in -6552w2 - 15474w*2 + 10621w*2 - 14301w*2. -25706w*2 Collect the terms in 92014d*2 + 1 - 92004d*2 - 1. 10d*2 Collect the terms in 124j*2 - 292021j + 292021j. 124j*2 Collect the terms in 60f - 20 - 62f + 19. -2f - 1 Collect the terms in 72x + 5x*3 + 78x - 239x + 89x. 5x3 Collect the terms in -12h - 14h3 - 4h*3 + 8h*3 + 12h. -10h3 Collect the terms in -9k*3 - 2014 - 9k*3 + 1555. -18k*3 - 459 Collect the terms in -10 - 2 + 10 - 964b*2. -964b*2 - 2 Collect the terms in -209w - 311w + 516w. -4w Collect the terms in 106z + 28 - 221z + 115z + 0z2 + z2. z2 + 28 Collect the terms in 9j + 16j - 53j - 10j - 54j. -92j Collect the terms in -30j*2 - 26j*2 - 21j*2 + 42j*2. -35j*2 Collect the terms in 28w*3 + 33w*3 + 18w*2 + 27w*3 - 85w*3 - 77w*2. 3w*3 - 59w*2 Collect the terms in -10 - 15 - 32353k + 25. -32353k Collect the terms in 8f*2 + 39575 + 534f - 7f2 - 534f - 39575. f*2 Collect the terms in 10906o*2 + 42o*3 + 20o*3 + 97o*3 - 10906o*2. 159o*3 Collect the terms in -151n*2 + 5 + 186n*2 - 3 - 2 + 4n*3. 4n*3 + 35n*2 Collect the terms in 3p - 29p + 19p - 2p + 6p + 5p. 2p Collect the terms in -883l + 29611l + 16057l. 44785l Collect the terms in 0r2 + 408250r - 408250r + 0r*2 + 3r*3. 3r*3 Collect the terms in -40 - 220m*3 - 46 + 86 + 221m3. m3 Collect the terms in -398w + 203w + 197w - 198w*2. -198w*2 + 2w Collect the terms in -144d - 147d - 136d + 452d. 25d Collect the terms in -7 - 131u*2 - 2 + 7 + 2. -131u*2 Collect the terms in -42w - 38w + 205w - 119w. 6w Collect the terms in -383r2 + 790r*2 - 410r*2. -3r*2 Collect the terms in -14j + 39j - 41j. -16j Collect the terms in 39a - 10182a2 - 39a. -10182a2 Collect the terms in -61o - 73o - 66o + 266o - 68o. -2o Collect the terms in 2n*3 + 101n - 2529n - 1895n. 2n3 - 4323n Collect the terms in -g*3 + 3g*2 - 505g - 131g - 309g. -g*3 + 3g*2 - 945g Collect the terms in -26 - 94f2 + 83f*2 + 12f2. f2 - 26 Collect the terms in 971 - 478 - 2i2 - 486. -2i*2 + 7 Collect the terms in -51l - 53l - 3 - 3 + 108l + 4. 4l - 2 Collect the terms in 956 - 928 + 2194k*2 - 2192k*2. 2k*2 + 28 Collect the terms in 186k*3 + 6k*3 - 60k*3. 132k*3 Collect the terms in -3t + 0t - 2t - 1191t2 + 5t. -1191t2 Collect the terms in -5j*2 + 9j*2 + 3 + 5 - 13j*2 - 6. -9j*2 + 2 Collect the terms in 2p - 2p + p2 - 371p*3. -371p3 + p2 Collect the terms in -477m3 + 34m - 9m - 25m. -477m3 Collect the terms in -2862d + 955d + 955d + 952d - 65d*2. -65d*2 Collect the terms in 521n*2 + 422n*2 - 349n*2. 594n*2 Collect the terms in 297x*2 - 161x*3 - 895x*2 + 302x*2 + 296x*2. -161x*3 Collect the terms in 3 - 7 + 27537v*2 - 27527v*2. 10v*2 - 4 Collect the terms in -14n*3 + 12n3 + n3 + 297n2. -n3 + 297n*2 Collect the terms in 20 - 36v - 1 - 9 - 6. -36v + 4 Collect the terms in 20749p*2 + 1883p*2 + 29 - 29. 22632p2 Collect the terms in k2 + 10k2 + 2k*2 + 730k - 729k. 13k*2 + k Collect the terms in 44m - 17m + 14m - 13m. 28m Collect the terms in 691 - 326 - 365 + 8i. 8i Collect the terms in 264x3 + 364x*3 - 28x*3 + 118x*3 + 223x*3. 941x*3 Collect the terms in -2459f + 1243f + 1227f. 11f Collect the terms in -2 + 42970o - 42969o - 1 + 3. o Collect the terms in -4260g*3 + 1996g*3 - 3078g*3. -5342g*3 Collect the terms in 2595 - 9919089h - 2595 + 9919088h. -h Collect the terms in 4o*2 - 1468o - 1217o + 2685o. 4o2 Collect the terms in -1260x*3 + 408x*3 + 395x*3 + 396x*3. -61x*3 Collect the terms in 4k*2 + 2 + 3k*3 + 8215k - k*2 - 2k*2. 3k3 + k2 + 8215k + 2 Collect the terms in 217h*2 + 212h*2 - 688h*2 + 222h*2. -37h*2 Collect the terms in 2 - 175r + 340r - 164r - 184r2 - 2. -184r*2 + r Collect the terms in 5l*2 - 6994884 + 6994884. 5l*2 Collect the terms in -6c + 10c - 25c - 11 - 1. -21c - 12 Collect the terms in -3v*2 - 59v - 3 - 190v - 7 + 6. -3v*2 - 249v - 4 Collect the terms in -40l - 71l + 182l - 74l. -3l Collect the terms in -53335 + 75k + 53335 - 2k2. -2k*2 + 75k Collect the terms in 58n + 70n + 61n - 149n + 25n. 65n Collect the terms in 1031d - 538d - 524d. -31d Collect the terms in -3 - 33 + 6r + 13 - 3 + 26. 6r Collect the terms in -1325670j2 + 1325670j*2 - 4j*3 + 7j*3. 3j*3 Collect the terms in 3254p*3 - 3 - 3175p*3 - 2p*2 + 2p*2. 79p*3 - 3 Collect the terms in -198 - 2j - 190 + 583 - 195 + 5j. 3j Collect the terms in 38u3 + 37u*3 + 28u*3 + 43u*3 - 148u*3. -2u*3 Collect the terms in 1602y + 1599y - y2 - 4800y + 1599y. -y2 Collect the terms in -25g + 25g + 21g*3 - 39g*3 + 24g*3. 6g*3 Collect the terms in -31d*3 + 5311d + 5311d - 10622d. -31d3 Collect the terms in -3024a*2 - 2a - 3951a2 + 2a. -6975a2 Collect the terms in 22594r*3 - 11298r*3 - 11298r*3. -2r*3 Collect the terms in 13 - 1 - 7 - 6 + 22z*2 + 47z*2. 69z*2 - 1 Collect the terms in 230m + 289170 - 289170. 230m Collect the terms in 37 + 51 - 100 - 2q*2 + 35. -2q*2 + 23 Collect the terms in 622v + 2v2 - 1269v + 647v. 2v*2 Collect the terms in -1 - 3 - 2653v + 2755v + 3. 102v - 1 Collect the terms in -172x2 + 1096x*2 - 656x*2. 268x*2 Collect the terms in -7 + 100p*2 - 69p*2 + 8 + 99p*2 + 1. 130p*2 + 2 Collect the terms in 310 - 1244 + a - 3a + 4a + 0a. 2*a - 934 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
ivisor of m and j. 4 Suppose -9z + 120 = 3z. What is the highest common divisor of 90 and z? 10 Let q(g) = g*2 - 17g + 98. Let n be q(7). What is the highest common divisor of n and 77? 7 Let b = -4 + 73. Let m = 121 - b. Calculate the greatest common divisor of 78 and m. 26 Let z be (2 - 0)(-75)/(-10). Suppose -5g + z = -0g. Let b be (-3)/((-1)/(56/g)). What is the highest common factor of b and 14? 14 Suppose -3j + 2c = -5j + 12, -c + 26 = 3j. Calculate the highest common factor of 98 and j. 2 Suppose -w = -0w - 3. Suppose wa = 8 + 4. Suppose 116 = 4d + a. Calculate the greatest common factor of 280 and d. 28 Suppose 19v - 89 + 13 = 0. What is the greatest common divisor of 22 and v? 2 Let s(i) = i3 + 10i*2 + 8i - 9. Let o be s(-8). Let r be 187/44 - 15/(-20). Calculate the greatest common factor of o and r. 5 Suppose 0 = -3m + 376 - 76. Let o = m - 28. Calculate the greatest common divisor of o and 48. 24 Suppose -3q + 14 = 2, -q = -5s - 29. Let n(r) = -r3 - 5r*2 - 9r + 11. Let f be n(s). What is the greatest common divisor of 28 and f? 28 Let h = -211 - -137. Let u = h - -102. What is the greatest common divisor of 14 and u? 14 Suppose -4q - 4a = 4, 2a - 7a - 29 = -q. Suppose -64 = -4b - qy, -5b - 3y = -37 - 37. Let p = 17 - b. Calculate the highest common divisor of p and 8. 4 Let k = 35 - 41. Let n(h) = -6h - 12. Let u be n(k). Calculate the greatest common divisor of 84 and u. 12 Let m(c) = 3c + 9. Let i be m(7). Let r(z) = -z*2 + 4. Let o be r(-2). Suppose -h - h + i = o. What is the greatest common divisor of h and 15? 15 Let u = -35 - -44. Let n be 17 - -1 - (-7 + u). What is the greatest common factor of n and 8? 8 Suppose y + 4g - 16 + 12 = 0, 0 = 2y + 4g - 16. Calculate the greatest common factor of 8 and y. 4 Suppose -v = 3y + 284, 5v + 1 + 9 = 0. Let k be (y + -2)10/8. Let u = 296 + k. Calculate the greatest common factor of 16 and u. 16 Let n be (0 - 6)/((-4 - -3) + -1). Suppose -nq + 54 + 15 = p, -5q + 104 = -2p. What is the highest common divisor of 66 and q? 22 Suppose -4w = -8w + 4. Let u be (-2)/(-1) - (-72)/w. Suppose 0 = 4k - u + 14. What is the highest common factor of k and 60? 15 Suppose -2j = 4z - 78, -3j = -0j - 3z - 117. What is the highest common divisor of 26 and j? 13 Let i = 11 - 11. Suppose -k - 31 = -2r, -k = -ir - 5r + 73. Let c = r + -6. Calculate the greatest common divisor of 8 and c. 8 Suppose -3c = -9, -6c + 60 = 4b - 2c. What is the greatest common divisor of b and 84? 12 Suppose 0 = -6d + 333 - 69. Calculate the greatest common factor of d and 22. 22 Suppose 11u + 96 = 13u + j, -5u + 251 = -3j. Calculate the greatest common factor of 7 and u. 7 Suppose 0 = -3r + 6 + 3. Suppose -5t + rz = -z - 330, -132 = -2t + 5z. Calculate the highest common factor of 6 and t. 6 Suppose -14j + 2380 = -0j. What is the greatest common divisor of 51 and j? 17 Let y = 93 - 50. Let z be y/5 - 6/(-15). Calculate the highest common factor of 9 and z. 9 Let n(i) = -4i - 2. Let f be n(-2). Let o be 306/21 + -8(-27)/504. What is the greatest common factor of f and o? 3 Suppose 2k = d + 306, 6d - 10d + 765 = 5k. Calculate the greatest common factor of 119 and k. 17 Let j be 42/(-14)2/3. Let l be ((-3)/(-9))/(j/(-72)). What is the greatest common divisor of 4 and l? 4 Suppose 0 = 5l - 22 - 3. Suppose 0 = -p + 2p. Suppose p = 5b + 116 - 391. Calculate the highest common divisor of b and l. 5 Suppose 0 = 3n + 11 + 19. Let q = n - -19. What is the greatest common factor of q and 72? 9 Let v be (1 - (-1 + 230)) + -1. Let z(w) = -w*3 + 12w*2 - 5w + 20. Let u be z(12). Let j = u - v. What is the greatest common divisor of 21 and j? 21 Suppose -5h = 3y - 167 + 41, 2y + 3h - 84 = 0. Let p = 60 + -32. What is the greatest common divisor of y and p? 14 Suppose -5a - b - 37 = -142, -40 = -3a + 4b. What is the highest common divisor of 5 and a? 5 Let x = -87 + 114. Let z = 3 - 0. Calculate the greatest common divisor of x and z. 3 Suppose 0 = 3h - 0h - 15, 28 = 3i - 4h. Let z be (-12)/(-42) - (-208)/(-532) - 7620/(-190). Calculate the greatest common factor of z and i. 8 Let k = 12 - -2. Let v be k/(-35) - 2/(-5). Suppose -5h + 9h - 736 = v. What is the greatest common divisor of h and 23? 23 Suppose 2j = 1067 + 727. Calculate the greatest common divisor of 39 and j. 39 Let b be (-16 - -16)1/(-2). Suppose -2j = -bj - 96. What is the greatest common divisor of 6 and j? 6 Let i = 145 - 35. Let x be 10((3 - 0) + -2). Calculate the greatest common divisor of x and i. 10 Let v(k) = -k*3 - 7k*2 - 2k - 5. Let n be v(-7). Let a = 972 + -963. What is the greatest common divisor of a and n? 9 Suppose 0 = 5r - 2q - 136, 2r - 4q - 18 = 46. Suppose -9 = 2j + 15. Let f be 345/9 - 8/j. What is the greatest common factor of r and f? 13 Suppose -m - 228 = -3q, -5q + 390 = -9m + 4m. Calculate the greatest common divisor of q and 175. 25 Suppose l + 62 = 121. What is the greatest common factor of 590 and l? 59 Suppose 0 = -5i + 120 + 480. Let p be (-7 - 2)/3 - -41. Let n = p + -8. Calculate the greatest common factor of n and i. 30 Suppose -2h = -7h + 70. Let s(r) = 2r3 + 4r*2 - 2r. Let a be s(2). Calculate the greatest common factor of h and a. 14 Let p(s) = 12s - 265. Let x be p(32). Suppose 3h = 2v - 69, -2h + 0h - 46 = 3v. Let z = 40 + h. Calculate the highest common divisor of x and z. 17 Suppose -5 = -4v + 7. Suppose 941 = 4f - 3o, 2o - vo + 961 = 4f. Let h = f - 162. What is the highest common divisor of h and 11? 11 Let s be (5 + 0)/(-4 - -2 - -3). What is the greatest common factor of s and 530? 5 Let w = -9 - -26. What is the greatest common divisor of w and 119? 17 Let i be ((-6)/12)/(1/4). Let c be 5/i(-4)/5. Let n = 13 - c. What is the highest common factor of 77 and n? 11 Let f be (-3 + 2)/(2/(-12)). Let w(b) = -b3 + 10b*2 + 10b + 13. Let x be w(11). Calculate the highest common factor of f and x. 2 Let u(y) = 3y3 - 3y*2 + 3y + 7. Let v be u(3). Calculate the greatest common factor of v and 42. 14 Suppose b - 66 = 5q - 32, q = 5b - 290. What is the greatest common divisor of b and 3540? 59 Suppose -5h = -20 - 20. Suppose 2r + 2r - h = 0. Suppose ra + 2a = 44. Calculate the highest common factor of 99 and a. 11 Suppose -2t = w - 30, 2w - 5t = -w + 90. Suppose 4i + 68 = 5v, 3v + 38i = 34i + 28. What is the greatest common factor of w and v? 6 Let p = -271 + 1272. Calculate the greatest common divisor of 273 and p. 91 Let b be (5 - 3)/(3/6). Suppose a - 472 = -ba - 4d, 4a = 4d + 392. Calculate the greatest common divisor of a and 24. 24 Let g = -1834 + 3339. Calculate the greatest common factor of g and 70. 35 Suppose -3j - 12 = -6j. Let l = -306 + 354. Suppose -3t + l = -5h, 9t - jt + h - 80 = 0. What is the greatest common factor of t and 128? 16 Let v = -16 + 17. Let f = v + -16. Let m be 18/f(1 - 21). Calculate the highest common factor of 12 and m. 12 Suppose -11 = -v + u, 4v + 10u - 44 = 13u. Let y be 1(45 + 4/2). Let j = -25 + y. Calculate the highest common divisor of j and v. 11 Let d(y) = -2y2 - 21y - 19. Let u be d(-5). Calculate the greatest common factor of 9 and u. 9 Suppose 5u + 26 = 5b - 24, 2b - 30 = -3u. Let h = 8 + 4. What is the greatest common divisor of h and b? 12 Let r(b) = b*3 - 2b*2 - 1746. Let g be r(0). Let w be g/(-27) + (-2)/(-6). What is the greatest common factor of 39 and w? 13 Let c be (-9)/(-6)12 + -3. What is the highest common divisor of c and 40? 5 Let t(l) = -2l2 - 11l - 6. Let f(b) = -3b2 - 17b - 9. Let z(c) = 5f(c) - 8t(c). Let d be z(-5). What is the highest common factor of d and 143? 13 Suppose 3b + 0b - 18 = 0. Let m = 1197 - 1191. Calculate the highest common divisor of m and b. 6 Suppose -27f - 30 = -32f. What is the greatest common divisor of f and 2? 2 Let f(p) = -4p - 19. Let a be f(-5). Let l be ((-60)/16)/(a/(-28)). Calculate the highest common factor of l and 42. 21 Let z(i) = -i2 - 1013i + 8182. Let w be z(8). Let q = 0 + 14. What is the highest common factor of q and w? 14 Let q = 123 - 87. Calculate the greatest common factor of q and 4. 4 Let x(y) = 2*y - 1. Let b be x(8). Let	{ "pile_set_name": "DM Mathematics" }
e the prime factors of 39244819? 157, 249967 What are the prime factors of 37591854? 2, 3, 6265309 List the prime factors of 81982561. 81982561 List the prime factors of 90721647. 3, 3360061 What are the prime factors of 90960507? 3, 11, 918793 What are the prime factors of 32161534? 2, 641, 25087 What are the prime factors of 42081559? 13, 23, 140741 What are the prime factors of 71699958? 2, 3, 11, 19, 6353 List the prime factors of 1214228390. 2, 5, 109, 1113971 List the prime factors of 623330240. 2, 5, 13, 149839 What are the prime factors of 122501680? 2, 5, 7, 23, 9511 List the prime factors of 489276. 2, 3, 13591 List the prime factors of 2290410124. 2, 617, 928043 List the prime factors of 127943108. 2, 61, 181, 2897 List the prime factors of 3491207354. 2, 59, 269, 109987 List the prime factors of 421379111. 47, 8965513 List the prime factors of 97873172. 2, 157, 155849 What are the prime factors of 80205259? 80205259 List the prime factors of 139980343. 139980343 List the prime factors of 80765754. 2, 3, 29, 464171 What are the prime factors of 377535668? 2, 94383917 What are the prime factors of 342991018? 2, 181, 919, 1031 What are the prime factors of 76586667? 3, 241, 105929 What are the prime factors of 118962413? 17, 6997789 List the prime factors of 94080714. 2, 3, 7, 13, 37, 4657 What are the prime factors of 320542290? 2, 3, 5, 3561581 List the prime factors of 47031963. 3, 11, 101, 103, 137 List the prime factors of 1460463912. 2, 3, 6761407 What are the prime factors of 116619875? 5, 29, 53, 607 What are the prime factors of 1038945723? 3, 346315241 What are the prime factors of 277965363? 3, 13, 41, 131, 1327 List the prime factors of 267838795. 5, 7, 23, 313, 1063 What are the prime factors of 1708867261? 1708867261 List the prime factors of 163429936. 2, 41, 249131 List the prime factors of 278925033. 3, 92975011 What are the prime factors of 82109379? 3, 11, 23, 251, 431 What are the prime factors of 253717135? 5, 7, 223, 32507 List the prime factors of 33500475. 3, 5, 148891 List the prime factors of 1046567181. 3, 11, 157, 202001 What are the prime factors of 15302358? 2, 3, 59, 1601 List the prime factors of 200241039. 3, 66747013 What are the prime factors of 3179240770? 2, 5, 823, 386299 List the prime factors of 387539122. 2, 29, 31, 67, 3217 What are the prime factors of 2027740? 2, 5, 11, 13, 709 What are the prime factors of 48976480? 2, 5, 7, 6247 What are the prime factors of 486937821? 3, 162312607 What are the prime factors of 193037747? 7, 27576821 List the prime factors of 58581043. 58581043 What are the prime factors of 675895590? 2, 3, 5, 834439 List the prime factors of 298419884. 2, 7, 2039, 5227 What are the prime factors of 1821891174? 2, 3, 37, 47, 283, 617 List the prime factors of 344313874. 2, 157, 1096541 What are the prime factors of 1522994631? 3, 507664877 List the prime factors of 1399748749. 7, 2203, 12967 What are the prime factors of 8097479? 13, 31, 71, 283 What are the prime factors of 182833469? 7, 13, 233, 8623 List the prime factors of 49379031. 3, 13, 140681 What are the prime factors of 142689287? 13, 10976099 List the prime factors of 6808066. 2, 3404033 List the prime factors of 49330531. 107, 241, 1913 List the prime factors of 3705203653. 23, 103, 1564037 What are the prime factors of 3212774131? 7, 463, 141613 List the prime factors of 134295520. 2, 5, 29, 103, 281 What are the prime factors of 14921430? 2, 3, 5, 43, 269 List the prime factors of 694579860. 2, 3, 5, 13, 43, 59 List the prime factors of 1338019314. 2, 3, 14563, 15313 What are the prime factors of 96643422? 2, 3, 1789693 What are the prime factors of 25320323? 7, 1471, 2459 List the prime factors of 33594521. 33594521 List the prime factors of 3845191395. 3, 5, 256346093 List the prime factors of 6359107. 6359107 List the prime factors of 22307772. 2, 3, 41, 45341 What are the prime factors of 44576819? 7, 909731 What are the prime factors of 317633718? 2, 3, 1597, 33149 List the prime factors of 434939805. 3, 5, 9665329 What are the prime factors of 77957138? 2, 7, 17, 73, 641 List the prime factors of 55768534. 2, 17, 19, 131, 659 What are the prime factors of 33126512? 2, 43, 89, 541 What are the prime factors of 604975519? 9157, 66067 What are the prime factors of 1872092190? 2, 3, 5, 17, 3670769 List the prime factors of 156541150. 2, 5, 3130823 List the prime factors of 273343672. 2, 7, 97, 50321 What are the prime factors of 141539535? 3, 5, 17, 61673 List the prime factors of 373505958. 2, 3, 7, 988111 What are the prime factors of 628722832? 2, 17, 373, 6197 What are the prime factors of 1054193082? 2, 3, 10111, 17377 What are the prime factors of 13431269? 2417, 5557 List the prime factors of 4313812. 2, 107, 10079 List the prime factors of 58530980. 2, 5, 47, 71, 877 List the prime factors of 351284643. 3, 59, 661553 List the prime factors of 1480243580. 2, 5, 83, 499, 1787 What are the prime factors of 184549320? 2, 3, 5, 107, 1597 List the prime factors of 199040213. 109, 241, 7577 What are the prime factors of 636055765? 5, 17, 440177 What are the prime factors of 84238759? 11, 719, 10651 List the prime factors of 2891475970. 2, 5, 199, 1453003 What are the prime factors of 301656583? 11783, 25601 List the prime factors of 3222298. 2, 67, 139, 173 What are the prime factors of 700584603? 3, 17, 37, 139, 2671 What are the prime factors of 57486483? 3, 79, 26951 List the prime factors of 458401058. 2, 47, 4876607 List the prime factors of 1392283489. 1453, 958213 What are the prime factors of 260528022? 2, 3, 41, 117673 What are the prime factors of 413950739? 19, 277, 78653 List the prime factors of 1395369927. 3, 7, 2357, 9397 What are the prime factors of 641744030? 2, 5, 6317, 10159 List the prime factors of 3580822. 2, 7, 61, 599 List the prime factors of 459341320. 2, 5, 419, 27407 What are the prime factors of 32379631? 29, 353, 3163 What are the prime factors of 102719503? 163, 630181 What are the prime factors of 226135574? 2, 7, 16152541 What are the prime factors of 1772024199? 3, 11, 53697703 What are the prime factors of 86451909? 3, 67, 383, 1123 List the prime factors of 284510927. 1123, 253349 What are the prime factors of 106639044? 2, 3, 349, 25463 List the prime factors of 3152660374. 2, 53, 29742079 What are the prime factors of 10432944? 2, 3, 53, 1367 List the prime factors of 38033238. 2, 3, 6338873 List the prime factors of 4319097639. 3, 17, 113, 749453 What are the prime factors of 3750163169? 3750163169 List the prime factors of 35564596. 2, 8891149 List the prime factors of 140910729. 3, 53, 163, 5437 What are the prime factors of 241718344? 2, 7, 4316399 List the prime factors of 836708347. 1423, 587989 List the prime factors of 5875871569. 29, 11987, 16903 What are the prime factors of 186833826? 2, 3, 10379657 List the prime factors of 171862513. 73, 2354281 What are the prime factors of 2337963454? 2, 17, 53, 109, 11903 List the prime factors of 3176405924. 2, 181, 4387301 What are the prime factors of 64039222? 2, 13, 23, 107089 List the prime factors of 333983616. 2, 3, 523, 1663 What are the prime factors of 268571082? 2, 3, 13, 173, 1531 What are the prime factors of 252391502? 2, 11, 11472341 What are the prime factors of 177003955? 5, 31, 103, 11087 List the prime factors of 574665436. 2, 1933, 74323 What are the prime factors of 728707524? 2, 3, 541, 112247 What are the prime factors of 78279603? 3, 23, 1134487 What are the prime factors of 65375965? 5, 17, 877 List the prime factors of 157660644. 2, 3, 277, 47431 What are the prime factors of 79641433? 23, 1447, 2393 List the prime factors of 301237941. 3, 157, 639571 What are the prime factors of 54937439? 233, 235783 List the prime factors of 169280427. 3, 131, 430739 List the prime factors of 100857386. 2, 7, 1029157 List the prime factors of 1311067211. 1311067211 List the prime factors of 3754337138. 2, 43, 43655083 List the prime factors of 76558154. 2, 38279077 List the prime factors of 6611465070. 2, 3, 5, 7, 17, 59, 10463 What are the prime factors of 2513521944? 2, 3, 17, 389, 5279 What are the prime factors of 2921696858? 2, 1483, 985063 What are the prime factors of 1133823191? 607, 1867913	{ "pile_set_name": "DM Mathematics" }
+ 3) + 9h + 50 - 50 to oh + b and give o. 10 Rearrange -i - i*2 - 10088i*3 - 2 + 10093i3 + i2 + 0i to the form l + pi + ui3 + mi*2 and give l. -2 Express ((1 - 1 - 2i)(i3 + 2i*2 - 2i2) - i2 - 2i4 + i2)(-15 - 119 - 94) in the form u + zi3 + vi*2 + ri + ji4 and give j. 912 Rearrange -5d + 5d - 2777d*2 + 3513d*2 to pd + a + yd2 and give y. 736 Express y + y - y + (3 - 2y - 3)(-2 + 1 + 4) + 0 + 0 + 3y + 79y - 59y + 74y in the form x + ay and give a. 92 Express -5v4 - v + v + 0v + 2v4 + 0v + (5v2 + 4v2 - v2)(v2 - v2 - 5v*2) as f + xv + ov3 + yv*4 + dv*2 and give d. 0 Express -1 - 84817n + 84817n - 2n*2 + 10n*3 as on*2 + yn*3 + p + fn and give y. 10 Express 209d + 5 - 210d - 5 as w + pd and give p. -1 Rearrange 69 + 0q*3 - 185q + 185q - q3 - 2q*3 to vq*3 + kq + pq2 + c and give c. 69 Rearrange -7 - 5 + 14 - 11 - 2f + 9f2 to i + qf*2 + gf and give g. -2 Express -o*4 + 2o - 2 + 13o3 - 4 + 6 - 27o*3 in the form lo*2 + ko*4 + xo + qo3 + z and give q. -14 Rearrange (2z - z - 2z)(-71z + 18z - 30z) + 11z*2 - 7 + 7 to the form jz + o + dz2 and give d. 94 Rearrange 11 - 8 - 2 - 72d*2 + 4 + 24d*2 to the form s + wd*2 + pd and give w. -48 Rearrange -863i + 377i + 204i to the form h + ti and give t. -282 Express k*2 + 9 + 11 - 7 + 2k + 2 in the form hk + yk*2 + g and give y. 1 Rearrange 265 + 111b + b*2 + 116b - 228b to the form xb + i + hb2 and give h. 1 Rearrange 19 - 246g*2 + 248g*2 - 19 to dg*2 + ig + a and give a. 0 Express (h + 0h + 3h + (h - h + 5h)(1 - 35 + 4))(0h*2 + 0h*2 - 2h*3) as vh*2 + j + yh + zh4 + bh*3 and give z. 292 Express (3 + 2 - 4)(-24r + 13r + 34r)(0r - 2r + 18r) as c + xr*2 + br and give c. 0 Rearrange (-1 + 3 - 4)(-4 + 4 + q) + 3q - 3q - q + 105q - 573q + 189q + 89q to wq + x and give w. -193 Express -26l4 + 1555l*3 - 3113l3 - l2 + 2l + 1558l*3 + 2 as c + tl*4 + kl*3 + xl*2 + il and give i. 2 Rearrange -3w2 + 0w*2 - 7w + 18 + 8w + 0w*2 to the form zw*2 + b + hw and give b. 18 Express 13 - 13 - 1728l + 2104l as jl + k and give j. 376 Express -2w + 5w - 5w + (-2 - 2 + 3)(w + w + 0w) + 2w - w + w - 1 - 2w + 1 - 4w - 17 + 17 + (1 - 29 + 8)(-5w - 2w + 4w) as v + mw and give m. 52 Express 2r2 + 104r + 7r2 - 77r - 3r2 - 4r*2 + 4 in the form sr + f + vr2 and give v. 2 Rearrange (-11 + 22 + 23)(-2g - 2g + 6g) + (1 - 2 - 1)(-3 + 3 + g) - 5g + 5 - 5 to m + xg and give x. 61 Rearrange 58y - 170y + 157 + 57y + 52y to the form s + by and give b. -3 Rearrange (-7a*3 + 4a*3 + 2a*3 + 11a*2)(-7a + 18a + 15a) to the form sa + m + oa3 + pa*4 + wa*2 and give p. -26 Rearrange -1 + 2 - 1 - 84u + (-u + 0u + 0u)(2 + 3 - 6) to the form w + tu and give t. -83 Express -7 + 1205546z4 - 2z*2 - 4z + 2z - 1205551z*4 + 2z*3 in the form wz + k + vz2 + oz*4 + az*3 and give a. 2 Express -2k*2 - 4k*2 + 5k*2 + (-45 + 45 + 12k)(2k - k + 0k) as bk + lk2 + q and give l. 11 Rearrange 61q*3 + 2q + 1489q2 - 1489q*2 - 17q*3 to the form bq + gq2 + fq*3 + k and give b. 2 Rearrange -425 - 109f + 425 + 3f2 - 4f*2 to v + df + mf2 and give m. -1 Express (8u + 8u - 12u)(1 + 2 - 1)(-4 + 3 + 6) in the form k + tu and give t. 40 Express 0 - 66 + 66 - 569q as mq + a and give a. 0 Express r2 + 3r*2 - 2r*2 + (6 - 2 - 3)(r*2 - 3r + 3r) + (-2 + 2 + 3r*2)(-5 + 0 - 2) in the form qr2 + zr + h and give q. -18 Express 24 + 24 + 3r3 - 51 + 0r*3 - 2r - 4r2 as wr*2 + g + nr + sr3 and give g. -3 Express 15 - 46 - 6823z + z*3 - 574 + 6823z as hz2 + m + qz + wz3 and give m. -605 Express (-3q + 7q - 3q)(0q*2 - 5q*2 + 4q2) + q2 - 3q2 + 2q*2 - 87q*3 as oq + xq2 + h + sq*3 and give x. 0 Rearrange -128 - 4z - 137 - 8z + 283 to the form bz + w and give w. 18 Express -12g3 - 8973g + 11g2 - 3g*2 + 8972g + (0g2 - 6g*2 - 2g*2)(-5g + 4g + 2g) as zg*2 + kg*3 + b + fg and give z. 8 Rearrange (7k - 2k - 3k)(33k - 5k + 7k) + (-k - 14k + 4k)(-1 + 1 - 2k) to the form wk*2 + sk + c and give w. 92 Express -5m2 - m4 + m + 4m*2 - 8m*3 + 2m - 2 in the form lm2 + cm + h + rm4 + fm*3 and give c. 3 Rearrange -137p + 62p + 53p + 42p to the form hp + d and give h. 20 Rearrange 6b3 - 12b3 - b3 + (293 - 10b - 293)(-3b2 + 0b*2 + 7b*2) to l + rb*3 + mb*2 + db and give r. -47 Rearrange -10 - 572z - 8 + 42 - 13 - 13 to jz + t and give t. -2 Rearrange (4o - 4o + o)(-2577 + 5152 - 394o - 2577) to bo2 + x + lo and give b. -394 Rearrange (0w + 0w + 2w)(2 + 0 - 1) + (-2 - w + 2)(10 + 3 + 15) + w - 2w + 3w + 0 + 0 + w to rw + d and give r. -23 Rearrange (l - 2l + 3l)(23 + 17 - 12) + l - 5l + 2l to the form i + xl and give x. 54 Rearrange 2q2 - 4q2 + q2 + (q - 2q + 0q)(-2 + q + 2) - q2 + 1 - 1 + (2q - 2q + q)(144q - 458q - 1317q) to g + rq*2 + wq and give r. -1634 Rearrange 3s2 - 2 - 33s - 175s3 + 171s*3 + 34s + 5s4 to the form fs*3 + ls*4 + xs + is2 + h and give l. 5 Rearrange 152m - 234 + 234 to j + bm and give j. 0 Rearrange -479a + 317a + 712a to the form d + wa and give w. 550 Express (9c*2 + 4c*2 - 14c*2)(0c2 - 3c*2 - 2c*2)(0 - 4 + 5) in the form g + pc + dc*3 + fc*4 + yc*2 and give g. 0 Rearrange -1328p*2 + 1573p*2 + 619p*2 to the form lp*2 + ap + z and give l. 864 Rearrange -166 + 168 - 179l2 + 169l*2 to the form dl*2 + r + bl and give d. -10 Rearrange -33w - 62w - 73w - 21w to fw + s and give f. -189 Rearrange 2 + 5i*4 - 109i*2 - 3i*4 + 27202i - 27201i to the form zi + li3 + hi*2 + ai*4 + c and give h. -109 Rearrange -4a*2 + 4a*2 - 71 - 7a*2 - 6 to the form wa*2 + qa + d and give w. -7 Express -463 + 3m - 2m4 - m3 + 456 - m3 + m3 as k + dm + im*2 + ym*3 + tm*4 and give t. -2 Rearrange 295 + 5k - 5k + 5k - 154 - 219 to c + hk and give c. -78 Rearrange (-c3 + 5c*3 - 3c*3)(378c - 277 - 275 + 552) + 3c4 - c4 - 3c4 to bc*4 + sc*3 + wc + dc2 + q and give b. 377 Express -14l - l - 12l + 8l - 2 as ol + r and give o. -19 Rearrange (1 + 2 - 1)(2 - 1 - 4)(-346j - 430j - 454j) to the form a + uj and give u. 7380 Express (1 + 21 + 1)(-6w2 + w2 + w2 + (0 - 2 + 3)(6w2 + 1 - 1)) in the form v + jw*2 + sw and give j. 46 Express f*2 - 80 - 6f - 3f3 + 80 in the form sf + xf3 + bf*2 + y and give s. -6 Express -3 + 3 + 3d3 + d2 - d3 - d2 + (42 - 22 - 26)(-29d - 2d3 + 29d) + d - d*3 - 11 + 11 in the form jd*3 + k + id + ad2 and give j. 13 Rearrange 67c*3 - 200c*3 + 3c + 66c3 - 2 - 4c*4 + 2c*2 + 68c*3 to the form jc*4 + ac + pc2 + fc*3 + i and give j. -4 Rearrange -5 - 15 - 20q*2 - 12q*2 + 22 - 5 to the form dq*2 + l + wq and give l. -3 Express (2d3 + 3d*3 - 2d*3)(-3 - 2d + 3) - 889d*4 + 978d*4 - 1422d*4 - 855d*4 in the form qd + f + cd3 + wd*4 + rd*2 and give w. -2194 Express 65p + 65p + 41p as yp + w and give y. 171 Rearrange (85z*3 + 2z*2 - 4z*2 - 28z*3)(z - 3z - 3z) to the form pz3 + jz*4 + h + xz*2 + yz and give p. 10 Express -7r2 - 10r*2 + 21r2 - 23 - r2 - 105 in the form jr + b + pr*2 and give b. -128 Express 2g*3 + 8g - 16g - 18g*2 + 20g*2 in the form k + sg*3 + lg + yg2 and give s. 2 Rearrange 2w*3 + 60w*2 - 61w - 61w2 + 16w*4 - 17w*4 to r + hw*2 + cw + lw3 + yw*4 and give c. -61 Rearrange o - 20 + 812o*3 - o - 820o3 + o2 + 2o to the form d + uo*3 + ao + fo2 and give d. -20 Rearrange (2 - 3 + 2)(4l - l - 33 - 6)(-l + l - 4l) to the form il + xl2 + r and give x. -12 Express (8u + 5u - 7u)(-u - 4u + 4u + (2u - 4 + 4)(0 + 1 + 2)) in the form pu + o + iu2 and give i. 30 Rearrange (0 - 3a*2 + 0)(-105 + 13 - 75 + 15) to the form sa2 + ua + m and give s. 456 Rearrange -21c3 - 5c*3 + 29c*3 - 5c*3 + 9c	{ "pile_set_name": "DM Mathematics" }
+ 1)*2(p + 31)*2/11 Let d(f) be the first derivative of -2f*3/51 - 42f*2/17 - 882f/17 + 253. Factor d(a). -2(a + 21)2/17 Let r(i) = -3i*2 - i. Let t(g) = 27g*2 + 428g + 120. Let b(x) = -2r(x) - t(x). Let b(q) = 0. Calculate q. -20, -2/7 Let f(c) be the second derivative of c5/48 + 5c*4/12 + 10c*3/3 - 7c*2/2 + 4c. Let o(g) be the first derivative of f(g). Solve o(s) = 0 for s. -4 Let l = -94 - -96. Let j(y) be the first derivative of -3/4yl - 3/8y*4 + 4/3y*3 - y + 1. Factor j(w). -(w - 2)(w - 1)(3w + 1)/2 Let y(w) be the third derivative of 0w3 + 0w*4 + 0 - 18w*2 + 1/30w*6 - 1/5w*5 + 0w. Factor y(r). 4r2(r - 3) Let q(l) be the third derivative of 0l3 + 0 + 0l5 + l2 - 1/14l4 + 1/280l*6 + 0l. Find p, given that q(p) = 0. -2, 0, 2 Let j(v) be the second derivative of -v7/147 + v6/35 - v5/35 - v4/21 + v3/7 - v2/7 + 72v. Factor j(i). -2(i - 1)*4(i + 1)/7 Find y, given that 8y - 14 + 71y - 6 - 20y2 + 6y = 0. 1/4, 4 Let t be (-272)/28 + 2/(-7). Let c(o) = 5o + 50. Let q be c(t). Suppose -1/4m*2 + qm + 1/4 = 0. What is m? -1, 1 Let w(n) = n*3 - 6n*2 - 2n + 14. Let o be w(6). Factor -19g2 - 3g*4 - 21g - 12go - 6 + 6g*2 - 15g*3 - 2g*2. -3(g + 1)*3(g + 2) Suppose -2 = -o + 3r - 0, 4r = 0. Solve -20i + 3 + 47 - 6i*o + 5i*2 + 3i*2 = 0 for i. 5 Let m be (-46)/((-1)/(-176)6730). Let p = -2/673 - m. Factor p + 9/5k + 3/5k*2. 3(k + 1)(k + 2)/5 Let i(m) = 2m - 1. Let k(p) = -p3 - p2 + 30p + 9. Let t(z) = 28i(z) - 4k(z). Factor t(h). 4(h - 4)(h + 1)(h + 4) Let f(v) = -3v2 - v + 26. Let y be f(-5). Let p be 2((-228)/y + -5). Find z, given that 0z - pz*2 - 14/11z*3 + 18/11z*4 + 0 = 0. -2/9, 0, 1 Let q be 56 + -61 + 31/6. Let h(g) be the first derivative of 3 + 2g*2 + 1/12g*6 - qg*3 - 2g + 1/10g5 - 5/8g*4. Solve h(c) = 0. -2, 1 Let b(g) be the first derivative of -49 - 27/2g*2 - 6g - 4g3. Factor b(l). -3(l + 2)(4l + 1) Factor 0a + 0 + 2/9a*3 - 2/9a*2. 2a*2(a - 1)/9 Factor z*3 + 18 + 2 + 5z + 10 + 4z3 - 20z*2. 5(z - 3)(z - 2)(z + 1) Let p(o) be the second derivative of -o*7/70 - 9o*6/50 - 18o*5/25 - 4o*4/5 + 2o - 15. Determine j, given that p(j) = 0. -4, -1, 0 Let n be (-4)/28 + (3 - 5986/2100). Let s(p) be the third derivative of -1/60p4 + 0 + 0p + np5 - 2/15p*3 + 5p*2. Factor s(g). 2(g - 2)(g + 1)/5 Let k = 3194/3 + -1062. Let g(i) be the first derivative of 5 + 2/15i*5 + 8/3i*2 - 1/3i*4 - ki - 2/3i3. Factor g(c). 2(c - 2)(c - 1)2(c + 2)/3 Let y(k) be the second derivative of 0k2 + 0k*5 + 7k + 1/3k4 + 0k*3 + 0 - 2/15k*6. Factor y(g). -4g*2(g - 1)(g + 1) Solve -128u*3 - 64u - 24u2 - 112u*2 - 72u*2 - 20u*4 = 0. -4, -2, -2/5, 0 Let z(w) = -6w + 14. Let p be z(-3). Suppose -4o = -40 + p. Factor 2/3 + 7/3r + r*o. (r + 2)(3r + 1)/3 Let -21/8 - 87/8d - 3/2d2 = 0. What is d? -7, -1/4 Let n = 53/675 - 1/225. Let c(m) be the first derivative of -2 + 4/9m*4 - nm*3 - 2/9m*5 - 2/9m*2 + 0m. Suppose c(u) = 0. Calculate u. -2/5, 0, 1 Let z(q) be the first derivative of 3q4/8 + 5q*3/2 + 3q*2/2 - 12q - 177. Let z(x) = 0. What is x? -4, -2, 1 Let y(a) be the second derivative of -a*4/30 - 14a*3/3 - a - 92. Solve y(g) = 0 for g. -70, 0 Let h(q) = 15q*2 - 2q*2 - 58q - 79q - 11. Let z(a) = 5a*2 - 46a - 4. Let y(b) = 4h(b) - 11z(b). Solve y(l) = 0. -14, 0 Let y(q) be the first derivative of -51 + 2/11q + 10/11q*2 + 50/33q*3. Factor y(a). 2(5a + 1)2/11 Let f(y) be the second derivative of -y6/90 - y5/15 - y4/18 + 2y3/9 + y2/2 + 2y - 6. Suppose f(j) = 0. Calculate j. -3, -1, 1 Let g = 5/6 + -5/42. Let x(n) be the first derivative of 54/7n*2 + 6 + 2/35n*5 + 54/7n + gn4 + 24/7n*3. Factor x(j). 2(j + 1)(j + 3)3/7 Let g(o) be the first derivative of -10 + 0o*3 + 0o*2 + 0o - 1/15o5 + 1/12o4. Factor g(a). -a3(a - 1)/3 Suppose 5j - 9 = 3w - 5, 0 = 2w - 4j + 4. Solve -1/9h + 0hw + 0 + 1/9h*3 = 0. -1, 0, 1 Let w(m) be the second derivative of -5m*4/48 + 275m*3/12 - 15125m*2/8 + m - 2. Solve w(g) = 0. 55 Let c(i) be the third derivative of 1/30i*6 - 7/15i*5 + 8i*2 - 1/84i*8 + 0 + 0i*4 + 2/35i*7 + 8/3i*3 + 0i. Solve c(y) = 0. -1, 1, 2 Let d = 1781 + -19583/11. Find k such that 2/11k2 + 26/11k*3 + 4/11 - dk*5 - 6/11k*4 - 18/11k = 0. -2, -1, 1/4, 1 Suppose 0 = 62q - 64q + 20. Suppose q = d + 2s, -4s + 22 + 6 = 4d. What is i in 0 - 2/5i*3 + 0i*2 - 2/5i*5 - 4/5i*d + 0i = 0? -1, 0 Suppose -20i2 - i3 + 5i*5 + 20i*4 - 27i + 12i + 11i*3 = 0. Calculate i. -3, -1, 0, 1 Suppose 5h - 55 = -45. Let z(o) be the first derivative of 0oh - 4/27o*3 + 0o - 4 + 0o4 + 1/15o*5 + 1/54o6. Factor z(a). a2(a - 1)(a + 2)*2/9 Let p be ((-2)/(-5))/(1130/(-300) - -4). Let 6/7 + pg*2 + 0g*3 - 2/7g*4 - 16/7g = 0. Calculate g. -3, 1 Let d(z) = 11z2 + 20z - 81. Let q(s) = -8s2 - 20s + 80. Let m(j) = -2d(j) - 3q(j). Factor m(u). 2(u - 3)(u + 13) Let s(j) be the first derivative of 1/140j5 + 2j*2 - 1/28j*4 + 1/14j*3 - 7 + 0j. Let r(m) be the second derivative of s(m). Factor r(x). 3(x - 1)2/7 Suppose d = -34 + 43. Solve 6o*2 + 2o + 6o3 + o3 - 6 - do*3 = 0 for o. -1, 1, 3 Factor 1060280/11i*2 + 310/11i*4 + 2217280/11i - 1/11i5 - 31825/11i3 + 1124864/11. -(i - 104)3(i + 1)2/11 Let m = -2 - 14. Let y(z) = z3 + 18z*2 + 33z + 20. Let n be y(m). Factor -3/2d5 + 0d*2 + 0d + 0dn + 3/2d*3 + 0. -3d*3(d - 1)(d + 1)/2 Let m(z) be the third derivative of 40z*2 - 11/270z*5 + 0z*4 + 4/27z*3 - 1/180z*6 + 1/504z*8 + 1/135z*7 + 0z + 0. Suppose m(t) = 0. Calculate t. -2, -1, 2/3, 1 Let s(u) be the third derivative of -u7/1050 - u6/600 + 17u5/300 - u4/8 - 221u*2. Factor s(r). -r(r - 3)(r - 1)(r + 5)/5 Factor 2/7 + 48/7d2 - 50/7d. 2(d - 1)(24d - 1)/7 Suppose 27c - 207 = -43c + c. Suppose 1/6x*c + 169/2x - 13/2x2 - 2197/6 = 0. What is x? 13 Let t(r) = 845r + 5917. Let f be t(-7). Factor 2/3l4 - 2l*f - 4/3l + 0l3 + 0. 2l(l - 2)(l + 1)*2/3 Factor 0 - 9p*2 - 245/4p*4 + 0p + 46p3 + 25/4p5. p2(p - 9)(5p - 2)2/4 Suppose 3 = -z + 2z. Suppose t = -zt. Factor t - 2/5l*3 + 2/5l*5 + 0l - 2/5l2 + 2/5l*4. 2l*2(l - 1)(l + 1)2/5 Let r be 22/33(10 + (-4 - 0)). Let g(u) be the third derivative of -1/18u3 - 1/180u*5 + 9u*2 + 0 + 0u - 1/36ur. Determine h, given that g(h) = 0. -1 Let u be (-672)/(-126) - (-15)/(-3). Find o, given that 0 - uo*3 + 2o - 1/3o2 = 0. -3, 0, 2 Suppose 6 = 5k - 9. Suppose 3x - 18 = -k. Factor 0m*5 - 62m*3 + 6m*2 - 6m*4 + 59m*3 + 3m*x. 3m*2(m - 2)(m - 1)(m + 1) Factor 8/3y3 - 8/3y + 2y2 + 2/3y*4 - 8/3. 2(y - 1)(y + 1)(y + 2)*2/3 Let t(q) be the first derivative of 2q*6 - 142q*5/5 + 58q*4 - 122q*3/3 + 10q*2 + 8. Find d, given that t(d) = 0. 0, 1/3, 1/2, 1, 10 Let a be (-4 - 3549/(-963)) + 1. Let z = -2/107 + a. Factor 6s*3 - 10/3s*4 - zs - 2s2 + 0. -2s(s - 1)2(5s + 1)/3 Let l(s) be the first derivative of -2s*6/5 + 3s5/20 + s4 - s*3/2 - 16s - 3. Let p(d) be the first derivative of l(d). Solve p(j) = 0. -1, 0, 1/4, 1 Let z(n) = -137n2 + 88n + 39. Let s(t) = t*2 + t + 3. Let w(x) = -3s(x) + z(x). Factor w(a). -5(4a + 1)(7a - 6) Let t(i) = -4i4 - 142i*3 + 116i*2 + 5i. Let o(g) = -4g4 - 148g*3 + 116g*2 + 6g. Let k(n) = 5o(n) - 6t(n). Find q such that k(q) = 0. -29, 0, 1 Let y(h) be the first derivative of -h*4/20 + 4h3/15 - h2/2 + 2h/5 - 234. Suppose y(b) = 0. What is b? 1, 2 Suppose -1586z + 1587z + 9 = 4c, 0 = -4c + 2z + 10. Suppose -14rc - 2/7 - 4r = 0. Calculate r. -1/7 Let i(q) be the first derivative of q6/24 + q5/20 - 3q4/8 - 370. Factor i(w). w3(w - 2)(w + 3)/4 Let r(j) be the third derivative of 0 + 0j*4 - 8/3j*3 + 1/15j*5 + 0j - 6j2. Factor r(y). 4(y - 2)(y + 2) Suppose 3b + 36 = d, -3d + 170 = 2d - 5b. Factor 4j*2 + 218 + dj - 22j + 69j + 182. 4(j + 10)*2 Suppose 0 = -i - 23 - 157. Let m =	{ "pile_set_name": "DM Mathematics" }
p. 20 Solve -55195 - 9896 = 2564w + 11829 for w. -30 Solve 80w = 12w + 1110 - 498 for w. 9 Solve -5599x + 5127x = 13216 for x. -28 Solve -22559 + 36914 + 137006 = 2378y + 11059 for y. 59 Solve 21209 = -1442c + 87699 + 11378 for c. 54 Solve 161b + 294b + 7670 = -326b + 14b for b. -10 Solve -456n + 179n - 7082 - 27958 = 453n for n. -48 Solve -43u = -2683u + 28462 + 124385 + 87393 for u. 91 Solve -32p + 57p = -371p - 263p - 71831 for p. -109 Solve -426p - 8764 - 7047 = 4637 for p. -48 Solve 465a = 976a + 557a + 50196 for a. -47 Solve -541i + 534i - 52581 = -406i - 632i for i. 51 Solve -513y - 4397 = -5619 - 26993 for y. 55 Solve -1105 = 75n + 95 for n. -16 Solve -40o + 2193 = 43o + 17o - 6507 for o. 87 Solve 392 - 654 = 52d - 574 for d. 6 Solve 0 = 4497931c - 4498273c + 29754 for c. 87 Solve 32668 = 245i + 113i - 5280 for i. 106 Solve 367h - 12367 = -213h - 72h + 7193 for h. 30 Solve -410j + 17666 - 24226 = 0 for j. -16 Solve 88u - 40517 = -1219u for u. 31 Solve -41 + 284 = 18j - 95 - 4 for j. 19 Solve -778f + 3645 - 6261 = -18547 - 20635 for f. 47 Solve 5044m + 84491 + 78779 = -2067m + 28161 for m. -19 Solve -272i = 3i + 1346i + 42146 for i. -26 Solve 775 = 996m - 1027m for m. -25 Solve 9531 = 51n + 9990 for n. -9 Solve -12136s + 12439s = 12120 for s. 40 Solve 17n - 782n - 37104 - 460 = 686 for n. -50 Solve 42407 + 298 = 454a + 483 for a. 93 Solve -3799 = 916o + 781 for o. -5 Solve 887y + 516y = 56526 + 23445 for y. 57 Solve 124c + 61c - 1295 = 150c for c. 37 Solve -289y + 5603 - 3291 = 0 for y. 8 Solve 0 = 299x + 2562x + 1508x - 415x + 15816 for x. -4 Solve 3148i = 231448 - 70900 for i. 51 Solve 54k + 160k = -115k + 329 for k. 1 Solve -1836z = -1779z - 5700 for z. 100 Solve 53i + 936 - 6441 = 420i for i. -15 Solve 86t - 185t + 19 = -476 for t. 5 Solve 1205 - 10001 + 571 = 235k for k. -35 Solve -1531x + 84106 = 4494 for x. 52 Solve -20828 - 50277 + 9849 = 1178f for f. -52 Solve -1208o - 2770o + 676096 = 4918o for o. 76 Solve 14024 + 138743 = 4265u - 56904 - 37699 for u. 58 Solve 125o + 302o = -587o + 35490 for o. 35 Solve 98f + 108 + 1839 + 33 + 78 = 0 for f. -21 Solve 14j = -35j - 147j - 5292 for j. -27 Solve -53a + 165a - 58a + 1242 = 0 for a. -23 Solve 426d - 90d - 1140 = 51d for d. 4 Solve 0 = -1018k + 40049 + 3725 for k. 43 Solve -112f + 2247 = -415f - 11691 for f. -46 Solve -28u = 108u + 1592 + 6840 for u. -62 Solve 312k + 78k + 20210 = -40k for k. -47 Solve 542m + 471m = 785m + 20748 for m. 91 Solve -813o = -11525 + 103394 for o. -113 Solve 66143 + 231609 = 2863t for t. 104 Solve -84h - 147h - 3612 = 97h - 244h for h. -43 Solve -14739r = -14379r + 7920 for r. -22 Solve -464b + 783 = 42b - 479b for b. 29 Solve -399v + 29096926 = 29098921 for v. -5 Solve -75z - 611377 = -609352 for z. -27 Solve 112k + 304 - 637 = 2131 for k. 22 Solve -1497 - 2558 = 125c + 3445 for c. -60 Solve -415i + 9840 - 11933 - 14580 - 14037 = 0 for i. -74 Solve -443s = 30742 - 8149 for s. -51 Solve 1818a - 7000 = 1468a for a. 20 Solve -349t - 242814 = -255378 for t. 36 Solve 3166w + 143616 = 5342w for w. 66 Solve -19432w = -18763w - 5352 for w. 8 Solve 1679 + 2621 = -770o - 1090 for o. -7 Solve -297i - 10069 = -24i + 3286 + 7666 for i. -77 Solve -36b - 47b - 6844 = -63b + 216b for b. -29 Solve 126091a + 2156 = 126168a for a. 28 Solve 6x - 354 = 261 + 316 - 1009 for x. -13 Solve 64147 - 50809 = 351i for i. 38 Solve -6348p + 6380p = 0 for p. 0 Solve 28g - 195 - 73 = 162g for g. -2 Solve 611h - 105h - 25575 = 41h for h. 55 Solve 2050b + 64274 + 30887 = -2024 + 13135 for b. -41 Solve -29605 = -1281l + 326l for l. 31 Solve -14n + 1207 + 1207 = 75n + 723 for n. 19 Solve -216z + 1315 = 1246z - 80557 for z. 56 Solve 387 - 2359 + 519 = -4001y + 2548 for y. 1 Solve 1373x - 6305x + 29592 = 0 for x. 6 Solve -649c + 2616 - 1318 = 0 for c. 2 Solve -705c - 735c = 75c - 25755 for c. 17 Solve 4862 + 62538 = -2696t for t. -25 Solve 15667 + 34283 - 11359 = -1279y - 16406 for y. -43 Solve 4762a + 849a = 370326 for a. 66 Solve 0 = -1287u + 24154 - 62764 for u. -30 Solve -404n = -125n + 100n + 121n - 22000 for n. 44 Solve 477360 = 979402f - 976282f for f. 153 Solve -261x - 232811 + 75959 = -2374x - 2244x for x. 36 Solve -57d - 5970 - 4017 - 5780 = -11777 for d. -70 Solve -9971n + 35529 = 62679 - 153117 - 223018 for n. 35 Solve -194c = -99c - 130c + 70 for c. 2 Solve -1788 + 1920 = -12u for u. -11 Solve 0 = 318p + 118p for p. 0 Solve -175x = 287x + 69x + 28143 for x. -53 Solve -2826 = -946k - 704k + 1820 + 304 for k. 3 Solve 192a + 1111 + 4046 = 165 for a. -26 Solve -4669n = 8024n for n. 0 Solve -22073m + 44147m = 22120m + 2162 for m. -47 Solve 4004 + 148 = -83o - 263o for o. -12 Solve 0 + 0 = 1698r - 1914r for r. 0 Solve 1955 + 18219 = 1441s for s. 14 Solve -2336 + 13536 = 560k for k. 20 Solve 257826a = 257817a + 657 for a. 73 Solve 10977f + 407721 = -327738 for f. -67 Solve -9018k = -248967 - 256041 for k. 56 Solve -10744g = 7370g + 6264g + 1925862 for g. -79 Solve -1080v = -3608v + 154208 for v. 61 Solve -119z + 89z - 1136 = 112z for z. -8 Solve 235t + 587 + 1533 = -30t for t. -8 Solve 676m + 250m - 16903 + 12692 = 49497 for m. 58 Solve 80s + 1072 = -42s + 588 - 980 for s. -12 Solve -412m + 1293m - 4592 = 396m + 403m for m. 56 Solve 0 = -777i - 4682i + 267491 for i. 49 Solve 13467 = 449z + 14365 for z. -2 Solve 0 = -24139f + 16615f - 270864 for f. -36 Solve 2033298 = -184686c + 170367c for c. -142 Solve 4052f - 5630f = 50496 for f. -32 Solve 21i + 55i + 40i + 10i + 7434 = 0 for i. -59 Solve -3095u - 2767u = -7168u + 101868 for u. 78 Solve -1674b + 5332b = -3178b - 42322 - 101234 for b. -21 Solve 165v - 73v = -55v - 211v + 24702 for v. 69 Solve -336r - 177r + 1806r = -1195r - 330904 for r. -133 Solve 4224 = 5443j - 2589j - 2662j for j. 22 Solve 136n + 261056 - 264728 = 0 for n. 27 Solve 0 = -196q + 130139658 - 130121626 for q. 92 Solve -134p + 37534 = 784p - 69p - 83p for p. 49 Solve 1134 + 7300 + 14358 = 259d for d. 88 Solve -15439a - 20250 = -15169a for a. -75 Solve 19034j = -877611 + 2857147 for j. 104 Solve -221a + 4021a + 64466 = -34866 + 8132 for a. -24 Solve 6546 = -1329s + 27810 for s. 16 Solve -6001 - 2038 + 369 + 2006 = 96h for h. -59 Solve -1256x - 4359x = -1675x + 126730 + 50570 for x. -45 Solve -1204a + 2167 = -1230a + 9 for a. -83 Solve -878g + 94564 = 1134g for g. 47 Solve 3o + 13o = -6o - 5o - 783 for o. -29 Solve 302n + 246n - 901n + 292n + 6527 = 0 for n. 107 Solve 4112k + 124209 + 119419 = -4589k for k. -28 Solve 10405 = 526z - 22207 for z. 62 Solve -23221 - 11946 = -4430q + 17993 for q. 12 Solve 0 = -237n - 155n + 9016 for n. 23 Solve -3450a + 103604 + 58546 = 0 for a. 47 Solve 100a + 6622 = -363a - 1229 - 6039 for a. -30 Solve 0 = -15162n + 13699n + 40964 for n. 28 Solve 3612y = 7557y - 3314y - 35967 for y. 57 Solve 405i + 514i - 3474i = 143080 for i. -56 Solve 30504g - 29910g + 29700 = 0 for g. -50 Solve -7647i - 4864 = -7391i for i. -19 Solve -12858 - 1353 = 741g + 784 - 175 for g. -20 Solve -16m = 17m - 56m - 70m + 651 for m. 7 Solve -1214o + 783o + 349248 = 2137o for o. 136 Solve 35g + 11g - 1262 = -39g + 2223 for g. 41 Solve 750q - 183q = 1219q + 1697q + 89262 for q. -38 Solve -1909h = 1260h - 115405 - 27200 for h. 45 Solve 1091h - 6075 = 14654 for h. 19 Solve 1988 = 366v - 7417 - 2307 for v. 32 Solve 39m - 5049 + 11313 - 5445 = 0 for m. -21 Solve -14p - 6p - 14p = 74p + 4752 for p. -44 Solve 98c + 5824 = 8862 for c. 31 Solve -72j = -46j - 14j - 38j + 78 for j. 3 Solve -433q - 23880 + 7426 = 0 for q. -38 Solve 9a = 539 - 620 for a. -9 Solve 100494 = -1542m + 18768 for m. -53 Solve 47o - 942 - 279 = 95 for o. 28 Solve -1344x - 471x + 26998 = 335x - 63302 for x. 42 Solve 47i = -48i + 28i - 1441 - 1909 for i. -50 Solve 152o + 2690 = 50o + 371o for o. 10 Solve -35j + 4j + 252 = -73j for j. -6 Solve 46l + 401l = 6593 - 3223 + 9593 for l. 29 Solve -7610h - 478h + 679392 = 0 for h. 84 Solve -3038q + 569*q + 92955	{ "pile_set_name": "DM Mathematics" }
nding order. -7, -0.3, 2.7, 2820 Sort -0.5, -101/7, 0.07, 2017 in descending order. 2017, 0.07, -0.5, -101/7 Sort 5, -3, -1, -49, -7, 4 in decreasing order. 5, 4, -1, -3, -7, -49 Put 172, 5549, -2, 12 in decreasing order. 5549, 172, 12, -2 Sort 219, 4, -2221, -3 in decreasing order. 219, 4, -3, -2221 Put 5/3, 4/7, -5.76, -1, 1/6, -3 in increasing order. -5.76, -3, -1, 1/6, 4/7, 5/3 Put -7, 3413, -40 in ascending order. -40, -7, 3413 Sort 190, -52, -2, 3, -4. -52, -4, -2, 3, 190 Sort 69096, -66, 1/6, 5, 1 in decreasing order. 69096, 5, 1, 1/6, -66 Sort 1902, -11, 4, -5. -11, -5, 4, 1902 Sort -2/9, -7, 0, 1/3105, 5. -7, -2/9, 0, 1/3105, 5 Sort -4, -7, -135441, 4, 3, 5, -2 in increasing order. -135441, -7, -4, -2, 3, 4, 5 Put -23142, 2, -2, 1, -3, 4 in decreasing order. 4, 2, 1, -2, -3, -23142 Sort -10, -11, -212/37 in ascending order. -11, -10, -212/37 Put -2, -1557, 43, -3, 4 in increasing order. -1557, -3, -2, 4, 43 Sort -5, -2.02477, -14.4. -14.4, -5, -2.02477 Sort -1/2, -1.4, 591, -4, -5 in increasing order. -5, -4, -1.4, -1/2, 591 Sort -78, 239, -1, -3, -11, 0, 1 in decreasing order. 239, 1, 0, -1, -3, -11, -78 Sort 2/9, 417, -15243 in decreasing order. 417, 2/9, -15243 Sort 5, 4/5, -0.5, 0, 140130, 24.8 in decreasing order. 140130, 24.8, 5, 4/5, 0, -0.5 Sort 463886, 3, 1, -4 in increasing order. -4, 1, 3, 463886 Sort 3, 4, 2, -5, 1757 in descending order. 1757, 4, 3, 2, -5 Put -15113, 5, -0.5, -15 in decreasing order. 5, -0.5, -15, -15113 Sort -578053, 9, 0.5. -578053, 0.5, 9 Sort -32, -2, 4, 5, -31, 0, -34 in ascending order. -34, -32, -31, -2, 0, 4, 5 Put 22019, -3, -5, -11, -321 in descending order. 22019, -3, -5, -11, -321 Sort 255, 3, -301762. -301762, 3, 255 Put -1, -6, -59, 2, -8, 21 in decreasing order. 21, 2, -1, -6, -8, -59 Sort -3, -0.26, -9, -1/8, 0.2418 in increasing order. -9, -3, -0.26, -1/8, 0.2418 Sort -2, 5, -39, -1, -0.2426. -39, -2, -1, -0.2426, 5 Sort 43, -1, 4, -4, 2312 in ascending order. -4, -1, 4, 43, 2312 Put -5, 5, 1762929, 9 in decreasing order. 1762929, 9, 5, -5 Sort -9/10, 10197, 0.7 in ascending order. -9/10, 0.7, 10197 Sort 51, 4872, 588 in decreasing order. 4872, 588, 51 Put 3, -0.8179, -4, -6 in decreasing order. 3, -0.8179, -4, -6 Put 0.05, -5/3, -13.6019 in increasing order. -13.6019, -5/3, 0.05 Put 4, -5, 125, -0.5, -453/4, -4 in decreasing order. 125, 4, -0.5, -4, -5, -453/4 Put 286273, 186, 5 in decreasing order. 286273, 186, 5 Sort -798, -2, 113691 in decreasing order. 113691, -2, -798 Sort -13, -298, -3, 9. -298, -13, -3, 9 Put 1937416, 6, -2 in descending order. 1937416, 6, -2 Put 97, 3/8, 0.015, 1/2 in ascending order. 0.015, 3/8, 1/2, 97 Put -0.1, -0.01, 4724920 in descending order. 4724920, -0.01, -0.1 Put 49990, -4, -46 in increasing order. -46, -4, 49990 Sort 8, 10, 3, -2/59 in ascending order. -2/59, 3, 8, 10 Sort -549, 53, -56 in descending order. 53, -56, -549 Sort 6042, 7, 2, -4, 18 in decreasing order. 6042, 18, 7, 2, -4 Sort -5, -3, 14, 4, -193, 5. -193, -5, -3, 4, 5, 14 Sort -648, -97, 25, 6 in ascending order. -648, -97, 6, 25 Sort -2, 5089, 1860 in descending order. 5089, 1860, -2 Sort 0, -1039, 5, -5, -4, -11 in decreasing order. 5, 0, -4, -5, -11, -1039 Put 0.5, 0.47, -1, 31/1521, 1 in descending order. 1, 0.5, 0.47, 31/1521, -1 Sort -78023, -33, 2, -5, 0 in decreasing order. 2, 0, -5, -33, -78023 Put 4, 14, -2, 27, -5, -1 in ascending order. -5, -2, -1, 4, 14, 27 Sort -3, -4, -786, -3/7, -2, 14 in ascending order. -786, -4, -3, -2, -3/7, 14 Put -411, 201, -2 in decreasing order. 201, -2, -411 Put 288, 2/3, -0.5, 303.6 in ascending order. -0.5, 2/3, 288, 303.6 Sort -1, -26, -137, 31, 0 in increasing order. -137, -26, -1, 0, 31 Sort -0.119, -11, -3, -724 in ascending order. -724, -11, -3, -0.119 Sort -1247/124, 0, 0.2, -3/5, -2/13 in decreasing order. 0.2, 0, -2/13, -3/5, -1247/124 Put -0.1, -1045/27197, -0.3 in increasing order. -0.3, -0.1, -1045/27197 Sort -3, -13, 1374, 5, 52, 4 in descending order. 1374, 52, 5, 4, -3, -13 Sort -2, 16, 52, 1, 4, -8 in ascending order. -8, -2, 1, 4, 16, 52 Put -3, -2, -4, -83544, 5, 76, 3 in decreasing order. 76, 5, 3, -2, -3, -4, -83544 Put 6, 8, 563, 35 in increasing order. 6, 8, 35, 563 Sort -4, 717, 7220 in ascending order. -4, 717, 7220 Put 4614307, -2, 5, 3 in ascending order. -2, 3, 5, 4614307 Put -60, 7.9, 1/4 in descending order. 7.9, 1/4, -60 Put -4, 844481, 3, 5 in ascending order. -4, 3, 5, 844481 Sort 10, -99735, 3, -1, 0 in ascending order. -99735, -1, 0, 3, 10 Sort 2/11, -0.2, -10, -8, -2/5, -1 in decreasing order. 2/11, -0.2, -2/5, -1, -8, -10 Sort 21, 367949.3, 0.05 in increasing order. 0.05, 21, 367949.3 Sort 3, 713205, -2. -2, 3, 713205 Sort -42318, 2/15, -0.15 in descending order. 2/15, -0.15, -42318 Sort 1.875, -0.7, 1/13, -29. -29, -0.7, 1/13, 1.875 Sort -7, 0, 222, -3, 3, -4247 in decreasing order. 222, 3, 0, -3, -7, -4247 Sort 99, 599, -206 in descending order. 599, 99, -206 Sort 4, -20, 3, -5, 0, 105. -20, -5, 0, 3, 4, 105 Sort -36, 0, 5, 6, -5, 2, 920 in decreasing order. 920, 6, 5, 2, 0, -5, -36 Put -2/15, 12956603/16, 4 in decreasing order. 12956603/16, 4, -2/15 Sort 1, -32003, 2, 0, -5, 11 in decreasing order. 11, 2, 1, 0, -5, -32003 Sort 1/9, -10, 1/2, 8/5, -2, -3 in descending order. 8/5, 1/2, 1/9, -2, -3, -10 Sort 11, -15, -0.3, 2/5, 10/11. -15, -0.3, 2/5, 10/11, 11 Sort 4, 3, -4, -0.1, -14, 97, -5 in increasing order. -14, -5, -4, -0.1, 3, 4, 97 Put -4.2, 18926, 0.5 in decreasing order. 18926, 0.5, -4.2 Sort 12.1, -4/3, -70, -2 in ascending order. -70, -2, -4/3, 12.1 Put -4, -9863, 2883 in decreasing order. 2883, -4, -9863 Sort -7, -1, -2, 1, 101, -21, 4 in increasing order. -21, -7, -2, -1, 1, 4, 101 Put 41596733, 0, 4 in increasing order. 0, 4, 41596733 Put 115388, -3, 3, -96 in descending order. 115388, 3, -3, -96 Sort -5, -26171, -1, -4, -3. -26171, -5, -4, -3, -1 Sort -10166141, 3, 5 in descending order. 5, 3, -10166141 Sort 5, 21, 2086, 2, -2 in increasing order. -2, 2, 5, 21, 2086 Sort 26, -3, -2, 11314, 5, 4. -3, -2, 4, 5, 26, 11314 Put -5870, 9, 15 in decreasing order. 15, 9, -5870 Sort -0.6, 40/117, -4, -5, 2/9, 1. -5, -4, -0.6, 2/9, 40/117, 1 Put -3, -56, 3/5, 2/9, 4, 72, 0.2 in decreasing order. 72, 4, 3/5, 2/9, 0.2, -3, -56 Sort 31/61, -1/4, -236, 197 in descending order. 197, 31/61, -1/4, -236 Put 32, -335/142, -2 in decreasing order. 32, -2, -335/142 Sort 2, 0, 0.01, 0.1, 4, 132946 in ascending order. 0, 0.01, 0.1, 2, 4, 132946 Put 73, 2, 54, -2, -19 in ascending order. -19, -2, 2, 54, 73 Sort -2652081, 3, 73 in descending order. 73, 3, -2652081 Put 440, -4.8, -184 in descending order. 440, -4.8, -184 Sort 50098, -3, -116 in descending order. 50098, -3, -116 Put 1, 4, -8, -3, -7, -43, 176 in decreasing order. 176, 4, 1, -3, -7, -8, -43 Sort -4, 49, -0.4, -0.1, -1607, 1/5 in decreasing order. 49, 1/5, -0.1, -0.4, -4, -1607 Sort 6, 1, 7, 529, 2, -3 in descending order. 529, 7, 6, 2, 1, -3 Put 3, -2, -5, -1438, 8, 1, -11 in descending order. 8, 3, 1, -2, -5, -11, -1438 Sort -4, 6, -15, 27463, 3 in descending order. 27463, 6, 3, -4, -15 Sort 130, 2/11, 0.1938, 1/29 in increasing order. 1/29, 2/11, 0.1938, 130 Put 34, -15, -2, 3, 23, 140 in decreasing order. 140, 34, 23, 3, -2, -15 Put 127650, -5, -4, -10, 1 in descending order. 127650, 1, -4, -5, -10 Put 1944/11, -0.5, -317 in ascending order. -317, -0.5, 1944/11 Sort -1124, -0.542, 3, -65 in ascending order. -1124, -65, -0.542, 3 Put -3, -78, 9, 28, -1, -2 in descending order. 28, 9, -1, -2, -3, -78 Sort 4, -1, 127765, -3, 6 in ascending order. -3, -1, 4, 6, 127765 Sort 5, 9140, 1007, 3, 4, -4 in increasing order. -4, 3, 4, 5, 1007, 9140 Put -1, 4, 0, 43, -5, -20 in increasing order. -20, -5, -1, 0, 4, 43 Sort 2, -193, -4, -70 in decreasing order. 2, -4, -70, -193 Put 32, -1, -64, -4, -5, -549 in descending order. 32, -1, -4, -5, -64, -549 Sort 7, -0.24, 105, 5, 1/2, 2/9, -1. -1, -0.24, 2/9, 1/2, 5, 7, 105 Sort -4, -0.0066997, -7/36, 2. -4, -7/36, -0.0066997, 2 Sort -5, 225, -3, 7, 4 in descending order. 225, 7, 4, -3, -5 Sort 20, -2, 0.07, -2660, 0 in decreasing order. 20, 0.07, 0, -2, -2660 Sort 0.4, 1/6, -1692, 1/7, 0.08, -2 in ascending order. -1692, -2, 0.08, 1/7, 1/6, 0.4 Put 4, 1660, 1, -4, -46 in increasing order. -46, -4, 1, 4, 1660 Put -0.	{ "pile_set_name": "DM Mathematics" }
value of -9 - (0 + 3) - (77 - (1 + 23 - 4))? -69 Calculate -4 + 3 + (-797 - -819). 21 What is (-2 + -4 - (7 + -38 + 18 + 0)) + -26? -19 Evaluate 24 + (9 - 21 - (0 + -2)) + -4. 10 What is -57 + 106 + -62 + (1 - -26)? 14 What is the value of -20 + (54 - 6) - 11? 17 Evaluate 1 + -31 - ((12 - (-12 + 0)) + -13). -41 Calculate (29 - 51) + (-9 + 0 + 16 - 2 - 16). -33 What is the value of 16 + -8 - (-77 + (2 - 1) - (-99 - -98))? 83 Calculate -8 - (8 + -1 - (-175 - -185)) - (-44 - 1). 40 What is -73 + 0 + -15 + 28 + -36 + 7? -89 Evaluate 119 - (61 - (-1 + 34)). 91 What is the value of -2 + (1 - -45) - (-67 + 32 + 45 + -2)? 36 Evaluate (14 - (-27 - -21 - -14) - -38) + -1. 43 Evaluate 7 + 5 + -4 - 3 - (14 - (-3 - 40)). -52 What is -10 + 20 + -124 + 30? -84 Evaluate (-11 - -1) + (-18 - 13) + 4 + 21 + -20. -36 What is 6 + 22 + 20 + 25 + -30? 43 Evaluate 44 - (-20 + 14 + 1 - (-21 + 13)). 41 What is the value of (10 + 14 - 8) + -9 - (-6 + 18)? -5 85 + (-57 - -168) - 110 86 Evaluate -98 + 16 - -215 - 29. 104 Calculate -32 + (44 - 47) + 81. 46 1 + -3 + 9 - (-4 + 23 + -6) - -32 26 What is -23 - (33 + -48) - (1 - 8) - 5? -6 Evaluate -26 - (-1 + -1 + (-41 - -44 - 3) - -3). -27 What is 110 + (-63 - 151) - -21? -83 Evaluate -436 + 522 - (-2 - -3 - 29). 114 Evaluate 17 + -1 + (80 - 162 - -82) - -15. 31 What is the value of 17 + -1 + (576 - 577) + (-1 - 18)? -4 Evaluate -4 + 37 + -67 - -46. 12 Evaluate -12 - (1 + -4) - (-38 + 37) - 0. -8 What is (16 - 5) + 0 + -1 + (-24 - 30) + 26? -18 What is 136 + -104 + (1 - (-3 + -1) - 4)? 33 What is -4 + (1 + 68 - 87)? -22 What is the value of 1 + -26 + (-17 - -79) + -96? -59 What is 2 - -83 - (1 + -5 - (1198 - 1220))? 67 What is the value of (11 - -16) + (-5 - (-11 - 0)) - -2? 35 What is the value of -12 + -19 - (13 + -24 - 10)? -10 Evaluate (-21 - 99) + 78 - -83. 41 What is 26 + 4 + 6 + -51? -15 Calculate 4 - (-45 - (6 - 52)). 3 Calculate (-12 + -1 - (-138 + 42 - 3)) + 9. 95 What is the value of -33187 + 33176 - ((1 - 2 - -2) + -40)? 28 Evaluate -1 - (-1 + -10 + 19) - 4 - (-18 - 78). 83 Evaluate -54 + (10 - -22) + 92 + 33. 103 -1 + (13 - 19) + 38 31 Calculate (23 - -28) + 9 + -2 + -13. 45 What is the value of -1 - -5 - (43 + -47) - (57 - 67)? 18 What is the value of 13 - (4 + -6) - -7 - 3? 19 What is 72 + 0 + 3 - (-444 + 469)? 50 Evaluate 704 + -655 - (7 - -1). 41 What is the value of -490 - -621 - (97 + -2)? 36 Calculate -17 + 6 + (40 - 18) - -1 - (7 + -76). 81 What is the value of 0 - 46 - (-77 - -19)? 12 Calculate -4 - (21 + -3 - (90 + -30 + 39)). 77 Calculate -18 - 0 - (90 - (166 + -66)) - (103 + -2). -109 70 - (-23 + -46 + 61) 78 What is 11 + (32 - (12 + -23) - 12 - 8)? 34 Calculate (2 - 4) + -16 + (4 - -43) + -18. 11 What is -48 - (9 + -19 - (9 - (15 - 0)))? -44 Evaluate (-15 - -6) + (19 - (-7 - -2)) - -50. 65 Evaluate 54 + -6 - (250 - 247). 45 What is -3493 + 3548 + (-93 - 0)? -38 Evaluate 0 + (-15 - 0) - (-11549 - -11569). -35 Calculate -25 + -1 + (-17 - (-23 - (-18 - (-2 - 1)))). -35 27 - (10 - -10) - (33 + -4 + 0) -22 Calculate -8 + -7 + (-17 - -39) - -89. 96 Evaluate 9 - (24 + -14) - 15 - (21 - 66). 29 What is the value of -27 - ((-17 - 1) + -6) - -41? 38 Calculate (-29 - -56) + (-43 - -119). 103 Evaluate 14 + (-10 - -5) - (-11 - 11 - 5). 36 What is the value of -1 + 75 + -20 + 13 + 8 - (16 + -6)? 65 What is the value of -24 - (5 - ((19 - -22) + 14))? 26 What is the value of 63 - (-69 + -6 + 208)? -70 Calculate (2 - 1) + 1159 + -1147 + -23. -10 0 + (6 - (-8 - (-30 + 18))) 2 22 + (31 - (11 + 10)) - (1 + 7 + 1) 23 Evaluate (15 - 1) + 111 + -104 - 33. -12 (21 - ((39 - 71) + -23)) + (-2 + -5 - -1) 70 (4 + -14 - 9) + (21 - 44) -42 Evaluate (-856 - -965) + (4 - 2 - (3 - (-7 + 2))). 103 Evaluate 39 + -19 + 33 + 13 + (-16 - -2). 52 71 - (24 - (27 - 33)) 41 Calculate (-10 + 38 - 7) + -26 + -3 + -57. -65 Calculate -1 - 6 - (-88 + 70) - (-3 - -17) - 23. -26 What is 50 + 0 - (-16 - ((39 + -16 - 12) + -24))? 53 What is the value of -23 + (43 + -21 - -7) - -29? 35 What is the value of -25 - -3 - ((28 - 37) + 32)? -45 What is 17 + 0 + 44 + -56 + 10? 15 Evaluate -2 + -9 + 14 + -3 - (-4 + 2) - 37. -35 Calculate 33 - (24 + 62) - -49. -4 34 + -44 - (-80 + 23) 47 What is the value of -23 + 41 - (-6 - 2 - (-42 + 34))? 18 What is the value of (1 + -34 + -11 - (2 - 7)) + 13? -26 What is the value of -21 + (33 - 8 - 15) - (3 + 26)? -40 What is 16 + -42 + 49 + -50? -27 What is -16 - (-5 + -12 + (6 - -12))? -17 Calculate (-50 - 1) + ((-17 - -42) + -36 - -20). -42 What is the value of -497 + 468 - (-20 - 0) - 62 - -3? -68 -1 + -79 - -57 - -85 62 What is 12 + (8 - (-19 + 26)) + -33? -20 (-2 - (4 - 35)) + -50 + 67 46 -14 + (12 - 5) + -15 + -7 -29 What is 19 - (-12 + -9 + -14 + 14)? 40 What is the value of -1 + -5 + -1 - (6 - 26 - -77) - -5? -59 Calculate -75 + -137 + 160 + -38. -90 What is the value of 12 + (19 - (-55 - -58))? 28 What is 6 - -45 - -11 - 45? 17 What is the value of (-11 - (3 + -8 - 9)) + (-2 - (-2 - -13))? -10 What is -18 + (-1 - (8 - (-4 - (-1 + 0))) - -7)? -23 Calculate 156 + -73 + (6 + (-7 - -1) - 9). 74 Calculate 10 - -1 - (46 + -22 + 45 + 2). -60 Calculate (-3 - -15) + -116 + 10 + 30 + -17. -81 What is the value of 25 + (17 - (-1 - -32)) + -5 + -12? -6 -1 - (2 - (-33 + 28 + -5)) -13 Calculate 166 + (113 - 210) - -4. 73 49 + (21 - (-33 - -45)) - -44 102 Calculate 54 - 32 - 2 - (0 - -40). -20 Evaluate (38 - (72 - 62)) + -1 + 20. 47 What is (-5 + -5 + 1 - 10) + -11 + -11? -41 1 + (-2 - 24) + (34 + -26 - 17) -34 Calculate -69 - (86 + 1 + -86 + 48). -118 What is (32 - 6 - ((-34 - -22) + 25)) + 23? 36 Evaluate -8 + 3 + -2 - (119 - 116). -10 What is (41 - -6) + 5 - (26 - 12 - 26 - -13)? 51 Evaluate 149 + -44 + -41 - 64. 0 Calculate 85 - (-17 + 62) - -37. 77 Evaluate -66 - (3 - (-2 + 3) - (-34 + 31 - -12)). -59 Evaluate 45 + -1 + (76 - (-84 + 182)). 22 What is (1 + -1 - (-1 - (12 + 9 - 24))) + 7? 5 What is (15 - (8 + (14 - 47) + 17)) + -137? -114 Calculate -6 - (8 + -5) - ((7 - -4) + -7). -13 Evaluate -36 + 8 + -15 + -6 + 14 + -5 + -2. -42 What is -18 - 1 - 2 - (-252 - (-333 + 155))? 53 What is the value of 22 + -22 + (-4 - -15) - (-1 - 0) - 5? 7 What is 69 + -13 + -29 + -26 + 27? 28 (-13 + 21 + -21 - -13) + (1 - 59) + 5 -53 What is the value of 232 + (43 - 274) + (2 - (2 - -77))? -76 Calculate -3 + 13 + 1 + -87 + 63 + -56. -69 What is the value of (76 - 15) + (-2 - (-6 - -6)) + -11 + 2? 50 What is the value of -5 + (2 - (15 + -21 + 46))? -43 What is -9 - (36 - (35 + 38))? 28 What is 133 - (-4 - (6 - -8 - (-6 + 8)) - -1)? 148 Calculate (-61 - 0) + (49 - 92) + 54. -50 Calculate -3346 + 3383 + -1 + -35. 1 Evaluate 15 - (-25 - (-44 + 30)). 26 What is the value of (-89 - (-106 - -35)) + 64 + -2? 44 Calculate 18 - (1 + (11 - -1 - (-72 + -7))). -74 Evaluate (40 - (9 + -4)) + (-44 - -31). 22 What is the value of (3 - 8) + (195 - 184) - (-29 + (1 - 2))? 36 What is 37 + (-6 + (37 - 2) - -5)? 71 Calculate (29 - (-19 - -52)) + (-1 - (7 + -3 - -24)). -33 What is the value of -11 + (10 - (21 + -27)) + -18? -13 Calculate (13 - (-66 - -8)) + 2 - (-13 + 28). 58 Evaluate -5 - 70 - (-593 + 487). 31 -1 - -7 - 3 - 10 - ((-75 - -57) + 64) -53 Evaluate 596 + -673 - (1 - 31) - -26. -21 Calculate -128 - (119 - (26 + 109)). -112 (5 - -47) + 16 - 42 26 Calculate -20 + 43 - (233 + -100). -110 Evaluate 14 + 85 + -82 - (34 + 1). -18 Evaluate 22 - (-5 - -2 - (0 - 0 - -9)). 34 What is 5 - ((-3 - (-5 - (-6 - 16))) + (12 - 22))? 35 What is (-15 - -1) + -1 - (-862 - -896)? -49 What is 7 - 3 - 2 - (-25 - -72)? -45 (14 - 9) + -57 + (4 + 16 - 11) -43 -1 + 10 - (-683 - -704 - (0 - 83) - 12) -83 What is (15 - (-12 - (-47 + 25))) + 1 + -5? 1 What is 5 - 85 - (-978 - -976)? -78 What is -1 + 24 + (52 + -25 - (-9 + 39))? 20 What is -2 - (20 + -72 - 0 - -31)? 19 Calculate (-2079 - -2119) + (6 - (108 - 4)). -58 Evaluate -11 - (5 - (1 - 1) - (-71 - -67)). -20 What is the value of (2 - (22 + 2 + -1 + 2)) + -2? -25 What is (-18 - -34) + -30 - (4 - (106 + 5))? 93 What is 23 - ((-26 - (-33 - -6)) + 49)? -27 What is the value of (-6 - 0) + 15 + (9 - 8) + -52? -42 507 - 521 - (2 - (5 - 0) - (15 - 12)) -8 What is the value of 14 + -103 + (-92 - -55)? -126 What is the value of 51 + -76 + 32 + 25? 32 What is -4390 - -4411 - (-2 - (1 - 3))? 21 (0 - -12) + (-5132 - -5077) -43 Evalua	{ "pile_set_name": "DM Mathematics" }
1 + 29006. 237216l3 Collect the terms in -11r + 632 - 18r - 9r + 22r. -16r + 632 Collect the terms in -6 - 7 - 4381q + 0 + 42 - 27. -4381q + 2 Collect the terms in 184479w2 - 368998w*2 + 184419w*2. -100w*2 Collect the terms in 241 - 2533 + 18x - 98x - 567. -80x - 2859 Collect the terms in -141560412x - 17x*3 + 141560412x. -17x3 Collect the terms in 58498553d - 116997090d + 15d*3 + 58498537d. 15d3 Collect the terms in -184 + 184 + 9825o*3 + 318o*2 - 318o*2. 9825o*3 Collect the terms in 184022 - 184022 - 142540i. -142540i Collect the terms in 3n + 4397n2 - n - 2 - 960n*2. 3437n*2 + 2n - 2 Collect the terms in -5298 + 2674 + 2659 - 63m2. -63m*2 + 35 Collect the terms in 30d*2 + 41558064 - 41558064. 30d*2 Collect the terms in 6g - 7g + 14g + 25g - 98g*2 - 3g. -98g2 + 35g Collect the terms in -134g + 3g - 2 - 214g + 7. -345g + 5 Collect the terms in -1240845w + 331972w + 723 - 723. -908873w Collect the terms in 76546g*3 - 38414g*3 - 38314g*3. -182g*3 Collect the terms in -39455 - 27800 + 16571 + 5z - 7z - 65384. -2z - 116068 Collect the terms in -1204038 - 62y3 + 602017 + 26y*3 + 602021 + 23y*3. -13y*3 Collect the terms in -i + 28i*2 + 28i*2 + 45i*2 - 53i*2 - 11i - 49i2. -i2 - 12i Collect the terms in 58 - 4a3 + 187a - 194a + 87. -4a*3 - 7a + 145 Collect the terms in -308312957t2 + 308312985t*2 + 5t - 5t. 28t*2 Collect the terms in -61 + 47 - 188 - 320t. -320t - 202 Collect the terms in -1208r - 4r2 + 67 - 45 - 22. -4r*2 - 1208r Collect the terms in 431y + 7 - 859y + 435y + 15y*2. 15y*2 + 7y + 7 Collect the terms in -505 + 506 - 30048z + 383718z. 353670z + 1 Collect the terms in -5o*2 + 2o*2 - 19580637o + o*2. -2o*2 - 19580637o Collect the terms in 153 - 458 - 2m3 + 1346240m - 1346240m + 152 + 153. -2m*3 Collect the terms in 4 - 40d*2 + 21d*2 + 23d*2 + 23752d - 23752d. 4d*2 + 4 Collect the terms in -2 + 93v + 8 - 17 + 4 + 7. 93v Collect the terms in -43t*3 + 140616923927t - 140616923927t. -43t*3 Collect the terms in 843l3 + 1172 - 4682 + 1175 + 1165 + 1168 - l2. 843l3 - l2 - 2 Collect the terms in -1 + 1458j + 2 - 5184j - 5. -3726j - 4 Collect the terms in -30 - 36w3 - 28w*3 - 18w*3 + 136 + 138 + 87w*3. 5w*3 + 244 Collect the terms in 3r - r + 509308 - 507086. 2r + 2222 Collect the terms in -8p*2 - 4p + 3p + 688 + 332 - p. -8p*2 - 2p + 1020 Collect the terms in 800140196 - 29z + 327z - 800140196. 298z Collect the terms in -121 - 7l + 78 + 3l + 38l*2 - 4l. 38l2 - 8l - 43 Collect the terms in 5718 - 9c + 14c - 6c + c - 2c*3 + c. -2c*3 + c + 5718 Collect the terms in 4992p + 5687p - 20789p + 6730p. -3380p Collect the terms in -14z2 + 117z*2 - 2z - 304z2 + 12. -201z*2 - 2z + 12 Collect the terms in -32167l3 + 97053l*3 - 32710l*3 - 32175l3. l3 Collect the terms in -65o - 19o*2 - 17o*2 + 78o + 26o2. -10o*2 + 13o Collect the terms in -1 - 1693q2 + q - 2q + 31q2 - 2q - 312q2. -1974q*2 - 3q - 1 Collect the terms in 42 - 85922w - 18 + 85933w - 47 + 4w2 - 186. 4w*2 + 11w - 209 Collect the terms in -21j2 - 17067j - 17590j + 34657j - j3. -j3 - 21j2 Collect the terms in -y - 16899 + 5400 + y + y + 6090 + 5409. y Collect the terms in -149t*3 - 1549414 + 1549414 - 25t*3. -174t*3 Collect the terms in 240v + 44v2 - 23v*2 - 2v*3 + 243v - 483v - 14v*2. -2v*3 + 7v*2 Collect the terms in -113y - 1140y - 376y. -1629y Collect the terms in -3026b*3 + 3022b*3 - 1033 - 3860. -4b*3 - 4893 Collect the terms in 261p*2 - 776p*2 + 514p2. -p2 Collect the terms in -137y2 + 921y*2 - 111y*2 - 232y*2 - 244y*2 + 2y*3. 2y*3 + 197y*2 Collect the terms in 10242z - 161 + 161 - z2. -z2 + 10242z Collect the terms in -7887u - 45160u + 5034u. -48013u Collect the terms in -600 + 600 + 14n*3 + 486994n*2 - 486994n*2. 14n*3 Collect the terms in 85 + 34 - 361791u*3 - 119. -361791u*3 Collect the terms in -96270 + 797x - 123x + 96270. 674x Collect the terms in 244743g2 + 467 + 468 - 935. 244743g*2 Collect the terms in 1990 + 289 + 2611 + 2487 + 12k*3. 12k*3 + 7377 Collect the terms in -16907z + 16907z - 168907z*3. -168907z*3 Collect the terms in 1 - 3 - 37992g*2 + 1 + 37995g*2 + 1. 3g*2 Collect the terms in 23718 - 23766 - 2h*3 + 4h*3. 2h*3 - 48 Collect the terms in -6g - 5009 - 4959 - 5231 + 15202. -6g + 3 Collect the terms in -9222m + 9222m - 223m*2 + 74 - 76. -223m*2 - 2 Collect the terms in -1147d + 3240368 - 3240368. -1147d Collect the terms in -3078 - 1291 - 10d + 7d + 252. -3d - 4117 Collect the terms in 19n - 50 + 16 + 45. 19n + 11 Collect the terms in -82h + 31h + 49h + 400. -2h + 400 Collect the terms in 18n3 + 2105n*2 - 3n + 3n - 2101n*2 - 5n*3. 13n*3 + 4n*2 Collect the terms in -4s*3 + 279485138s*2 - 558967339s*2 + 279482201s*2. -4s*3 Collect the terms in -94m*2 + 3751513419 - 3751513419. -94m*2 Collect the terms in 314t*2 + 753t*2 + 302t*2 - 3t*2. 1366t*2 Collect the terms in 5199p + 907p - 2 - 1281p. 4825p - 2 Collect the terms in -875v + 269v - 4v*2 + 3v*2 - 5v*2. -6v*2 - 606v Collect the terms in 1240f + 35468f + 7427f. 44135f Collect the terms in -3k2 + 14042k*3 - 7010k*3 + 28k*2 - 7026k*3. 6k*3 + 25k*2 Collect the terms in -255739i*2 + 510157i*2 - 254459i*2. -41i*2 Collect the terms in -103499r*2 + 103645r*2 + 38r - 69r + 31r. 146r2 Collect the terms in -94h - 108h - 5361h*3 + 5348h*3 + 202h - 23. -13h3 - 23 Collect the terms in -1102687m - 1768466m + 17920m. -2853233m Collect the terms in -17187 - 1134244k + 1134237k + 8591 + 8596. -7k Collect the terms in 683b + 809b - 60b - 4 + 4. 1432b Collect the terms in 0 - 2 + 1251b3 + 0 - 3191b*3 - 8b*2. -1940b*3 - 8b*2 - 2 Collect the terms in 1223 + 25t + 458 - 317. 25t + 1364 Collect the terms in 1546464n - 3092341n + 1545882n. 5n Collect the terms in 10 - 10 - 2455s + 2438s + 115s*3 - 32s*3. 83s*3 - 17s Collect the terms in 128f2 + 25f*2 + 41f*2 + 1110f*2. 1304f*2 Collect the terms in 87852815z - 43926409z - 43926419z - 3z2 + 5z*2. 2z*2 - 13z Collect the terms in -b + 1695637b2 + 2b - 847929b2 - 848504b*2. -796b*2 + b Collect the terms in -223575430 - 366t*3 + 223575428 + 2t - 5t. -366t*3 - 3t - 2 Collect the terms in -1399a3 - 3101a*3 + 7a + 4506a3 - 2a. 6a3 + 5a Collect the terms in -7279x + 9908x - 6688x - 5071x. -9130x Collect the terms in 49 - 3y - 157 + 34 + 43. -3y - 31 Collect the terms in 739c - 1111c - 502c. -874c Collect the terms in 10217v - 30573v + 10110v + 10128v. -118v Collect the terms in -61c - 73c - 60c - 62c - 63c + 1 + 340c. 21c + 1 Collect the terms in -2c*2 - 48 + 4c*2 + 55 - 2. 2c*2 + 5 Collect the terms in 0w + 0w - 51068w*3 + 129373w*3. 78305w*3 Collect the terms in -29294 + 29296 - 2q + 2q + 176q*2. 176q*2 + 2 Collect the terms in 7382 - 12490l + 18l3 + 12490l - 7382. 18l3 Collect the terms in 3342y + 3214y - 9967y + 3416y. 5y Collect the terms in 8678m - 3253m + 3663m. 9088m Collect the terms in 955k - 478k - 971k3 + 1948k*3 - 477k - 968k3. 9k*3 Collect the terms in -2a - 36800 + 36708 - 34a. -36a - 92 Collect the terms in 8c3 - 150c*3 - 905c*3 + 27c + c*2 - 460c*3. -1507c3 + c2 + 27c Collect the terms in -14364r*2 + 19414r*2 - 5059r*2. -9r2 Collect the terms in -m2 - 98m + 254m - 47m. -m2 + 109m Collect the terms in 1614756n2 - 75n + 75n. 1614756n*2 Collect the terms in 40047c*3 + 38c*2 - 21c*2 - 485183c*3 - 17c*2. -445136c*3 Collect the terms in 1585 - 73w + 49w + 23w + 11677. -w + 13262 Collect the terms in -13641 - 32572 - v - 25831 + 0v. -v - 72044 Collect the terms in 85w*2 + 14w*2 + 4533 - 9064 + 4529. 99w*2 - 2 Collect the terms in 2w*2 + 7 + 0 + 9 - 27 + 9w*2 - 5w*2. 6w*2 - 11 Collect the terms in 20612 - 2l - 20612 + 2*l -	{ "pile_set_name": "DM Mathematics" }
19669 to the nearest integer? 3 What is 781 to the power of 1/2, to the nearest integer? 28 What is the square root of 9660 to the nearest integer? 98 What is the fifth root of 224 to the nearest integer? 3 What is 1242 to the power of 1/10, to the nearest integer? 2 What is the third root of 1424 to the nearest integer? 11 What is 48055 to the power of 1/5, to the nearest integer? 9 What is 37693 to the power of 1/6, to the nearest integer? 6 What is 24 to the power of 1/7, to the nearest integer? 2 What is 18 to the power of 1/2, to the nearest integer? 4 What is 15981 to the power of 1/2, to the nearest integer? 126 What is 5713 to the power of 1/7, to the nearest integer? 3 What is the third root of 1335 to the nearest integer? 11 What is 2691 to the power of 1/8, to the nearest integer? 3 What is 230 to the power of 1/5, to the nearest integer? 3 What is 1067 to the power of 1/8, to the nearest integer? 2 What is the square root of 3217 to the nearest integer? 57 What is 20977 to the power of 1/2, to the nearest integer? 145 What is 165712 to the power of 1/2, to the nearest integer? 407 What is 12622 to the power of 1/2, to the nearest integer? 112 What is the third root of 95065 to the nearest integer? 46 What is the square root of 7150 to the nearest integer? 85 What is 112127 to the power of 1/7, to the nearest integer? 5 What is the eighth root of 21470 to the nearest integer? 3 What is 27715 to the power of 1/2, to the nearest integer? 166 What is the square root of 114248 to the nearest integer? 338 What is the tenth root of 2785 to the nearest integer? 2 What is the tenth root of 14676 to the nearest integer? 3 What is the third root of 51312 to the nearest integer? 37 What is the cube root of 6282 to the nearest integer? 18 What is the third root of 1665 to the nearest integer? 12 What is 4842 to the power of 1/4, to the nearest integer? 8 What is 142578 to the power of 1/3, to the nearest integer? 52 What is the third root of 515 to the nearest integer? 8 What is the third root of 532 to the nearest integer? 8 What is the tenth root of 2088 to the nearest integer? 2 What is the square root of 2788 to the nearest integer? 53 What is the seventh root of 994 to the nearest integer? 3 What is the tenth root of 5158 to the nearest integer? 2 What is 8430 to the power of 1/8, to the nearest integer? 3 What is the square root of 2860 to the nearest integer? 53 What is the eighth root of 49674 to the nearest integer? 4 What is the cube root of 11036 to the nearest integer? 22 What is 5620 to the power of 1/3, to the nearest integer? 18 What is the square root of 18468 to the nearest integer? 136 What is 2181 to the power of 1/7, to the nearest integer? 3 What is the square root of 21776 to the nearest integer? 148 What is 1062 to the power of 1/8, to the nearest integer? 2 What is the third root of 2317 to the nearest integer? 13 What is the seventh root of 3881 to the nearest integer? 3 What is the square root of 36164 to the nearest integer? 190 What is the square root of 60058 to the nearest integer? 245 What is 188 to the power of 1/9, to the nearest integer? 2 What is the square root of 7457 to the nearest integer? 86 What is 64589 to the power of 1/5, to the nearest integer? 9 What is 12916 to the power of 1/6, to the nearest integer? 5 What is the fifth root of 18494 to the nearest integer? 7 What is the cube root of 46561 to the nearest integer? 36 What is 4255 to the power of 1/7, to the nearest integer? 3 What is 40 to the power of 1/2, to the nearest integer? 6 What is 35027 to the power of 1/7, to the nearest integer? 4 What is 46288 to the power of 1/4, to the nearest integer? 15 What is 22937 to the power of 1/4, to the nearest integer? 12 What is the fourth root of 2653 to the nearest integer? 7 What is the square root of 311 to the nearest integer? 18 What is the cube root of 850 to the nearest integer? 9 What is the third root of 2538 to the nearest integer? 14 What is the square root of 16410 to the nearest integer? 128 What is 1421 to the power of 1/2, to the nearest integer? 38 What is 8796 to the power of 1/6, to the nearest integer? 5 What is the ninth root of 1321 to the nearest integer? 2 What is the square root of 22743 to the nearest integer? 151 What is the third root of 1269 to the nearest integer? 11 What is the square root of 13857 to the nearest integer? 118 What is 29967 to the power of 1/3, to the nearest integer? 31 What is the square root of 923 to the nearest integer? 30 What is 71850 to the power of 1/3, to the nearest integer? 42 What is the square root of 485 to the nearest integer? 22 What is the square root of 5890 to the nearest integer? 77 What is the fourth root of 942 to the nearest integer? 6 What is the cube root of 48131 to the nearest integer? 36 What is the square root of 6336 to the nearest integer? 80 What is the cube root of 436 to the nearest integer? 8 What is 43350 to the power of 1/2, to the nearest integer? 208 What is the square root of 83 to the nearest integer? 9 What is 289 to the power of 1/6, to the nearest integer? 3 What is the cube root of 3985 to the nearest integer? 16 What is 30805 to the power of 1/7, to the nearest integer? 4 What is the sixth root of 826 to the nearest integer? 3 What is 991 to the power of 1/2, to the nearest integer? 31 What is the tenth root of 9820 to the nearest integer? 3 What is the square root of 1926 to the nearest integer? 44 What is 491 to the power of 1/2, to the nearest integer? 22 What is 38906 to the power of 1/10, to the nearest integer? 3 What is the ninth root of 96916 to the nearest integer? 4 What is 3142 to the power of 1/4, to the nearest integer? 7 What is 8251 to the power of 1/2, to the nearest integer? 91 What is 15974 to the power of 1/8, to the nearest integer? 3 What is 29109 to the power of 1/2, to the nearest integer? 171 What is the ninth root of 24462 to the nearest integer? 3 What is 11264 to the power of 1/9, to the nearest integer? 3 What is 1150 to the power of 1/3, to the nearest integer? 10 What is the tenth root of 15136 to the nearest integer? 3 What is 6307 to the power of 1/3, to the nearest integer? 18 What is the cube root of 1193 to the nearest integer? 11 What is the fifth root of 2065 to the nearest integer? 5 What is 38776 to the power of 1/4, to the nearest integer? 14 What is 13664 to the power of 1/2, to the nearest integer? 117 What is 1559 to the power of 1/7, to the nearest integer? 3 What is 123054 to the power of 1/2, to the nearest integer? 351 What is the sixth root of 686 to the nearest integer? 3 What is 9972 to the power of 1/3, to the nearest integer? 22 What is 544 to the power of 1/5, to the nearest integer? 4 What is the square root of 11010 to the nearest integer? 105 What is 14484 to the power of 1/3, to the nearest integer? 24 What is the third root of 2187 to the nearest integer? 13 What is the third root of 899 to the nearest integer? 10 What is the cube root of 21832 to the nearest integer? 28 What is 181257 to the power of 1/2, to the nearest integer? 426 What is the fifth root of 3296 to the nearest integer? 5 What is 39424 to the power of 1/2, to the nearest integer? 199 What is the square root of 18797 to the nearest integer? 137 What is 7740 to the power of 1/2, to the nearest integer? 88 What is 30 to the power of 1/2, to the nearest integer? 5 What is 9532 to the power of 1/2, to the nearest integer? 98 What is 30481 to the power of 1/3, to the nearest integer? 31 What is the square root of 39925 to the nearest integer? 200 What is the cube root of 34142 to the nearest integer? 32 What is 3124 to the power of 1/8, to the nearest integer? 3 What is 2700 to the power of 1/3, to the nearest integer? 14 What is the square root of 2644 to the nearest integer? 51 What is the square root of 1790 to the nearest integer? 42 What is the cube root of 2142 to the nearest integer? 13 What is the fifth root of 1587 to the nearest integer? 4 What is the sixth root of 810 to the nearest integer? 3 What is 71903 to the power of 1/2, to the nearest integer? 268 What is the third root of 7847 to the nearest integer? 20 What is the third root of 16313 to the nearest integer? 25 What i	{ "pile_set_name": "DM Mathematics" }
Express 5u2 + 6u - 6u + (1 - 1 + 1)(84u + 185u*2 + 24u - 186u2) as w + au + cu2 and give a. 108 Rearrange 118k + 184k + 123k to the form rk + c and give r. 425 Rearrange 90d - 17d + 47d to the form m + jd and give m. 0 Express (82 - 47b - 82)(5 + 1 - 5)(0 + 1 + 5 + (-2 + 0 + 3)(2 - 1 - 3))(-2 + 1 - 1) in the form ub + n and give u. 376 Express -2 - 1379h + 0 + 1379h - 88h*2 in the form m + ah + sh2 and give s. -88 Express -54w - 2 - 5w2 + 6w*3 + 3w*2 + 54w in the form kw + vw*2 + iw*3 + t and give i. 6 Rearrange -6s*2 - 116502 - 36s*3 + 116502 to m + hs + as2 + ks*3 and give a. -6 Rearrange 22q*2 - 612q*4 + 203q*4 + 203q*4 + 8q + 204q4 to y + sq*3 + kq*4 + fq + hq2 and give k. -2 Express (-11 - v + 11)(-6v + 0v + 4v)(-4v2 - 19v2 - v2) in the form a + dv4 + cv*2 + mv*3 + uv and give d. -48 Express -44k2 - 111k*3 + 123k*2 - 40k*2 - 3k - 42k2 as uk*2 + b + ck*3 + pk and give c. -111 Express (2h2 - 4 + 4)(3h - 2h - 2h) + 4h*3 + 869 - 41h - 869 in the form jh2 + nh*3 + k + ph and give p. -41 Rearrange (3 + 2 - 2)(l2 - 187 + 187) to the form dl*2 + r + hl and give d. 3 Rearrange -88 + 178 - 5l4 - 7l - 87 + 4l4 - 2l*2 to the form fl + b + pl2 + vl*4 + il*3 and give v. -1 Express ((-2 + 2 - 2)(0 + 3 + 0)(-z + 5z - z) + (2 - 1 + 0)(z - 1 + 1))(-z2 - z3 + z*2) in the form gz + pz2 + h + wz*4 + xz*3 and give w. 17 Express (54 + 2j*2 - 4635j + 2321j + 2317j)(3 + 2j*2 - 3) as oj*3 + dj + vj2 + b + fj*4 and give o. 6 Rearrange -2 + 53t - 23t + 12 - 6 to bt + k and give k. 4 Rearrange -z*3 - 2 + 2 - 9z*3 + 16z*3 - 5z*3 + (5z - 5z + 2z*3)(2 + 1 - 1) - 2 + 2 - z3 + 2 - z3 - 2 to uz2 + vz + w + lz3 and give v. 0 Rearrange (0 + 0 + 4868l*2 - 5512l*2)(4l - 5l - l) to j + ml2 + pl + zl3 and give z. 1288 Express (3 + 2m - 3)(-m - m + 3m) + 2m + m2 - 2m + (62 - 62 + 7m)(-1 + 1 - m) + 2m2 + 5 - 5 in the form x + nm*2 + dm and give n. -2 Rearrange (2 - 1 + 2)(-4l + 3l + 2l) - 5l - 4l + 4l - 6l + 226 - 226 to the form dl + k and give d. -8 Express h2 + 26h + 3h4 + 4 - 5 - 35h + 0h2 - 5h*4 in the form ph*3 + v + dh*2 + kh*4 + th and give p. 0 Express -2a4 + 4a*4 - 1 + 7 - 6a*2 + 2a*3 - 3a*4 in the form ha + ya3 + qa*4 + w + la*2 and give l. -6 Express 116s - 139s + 1 + 219s in the form a + zs and give a. 1 Rearrange (h + 0h + 0h)(-4h + 0h + 2h)(-2 + 1 + 4)(8 + 4 + 2)(-7h - 21 + 21) to the form rh + f + ah3 + oh*2 and give a. 588 Express -56v - 37v + 10v - 15v + (0 - 2 - 1)(0v + 2v - 7v) as i + zv and give z. -83 Rearrange (-1 - 3 - 9)(4y - 5y + 0y - 20 + 22) to vy + k and give k. -26 Express 8o4 - o3 - 16 - 56o2 - 6o*4 + 55o*2 as bo + so3 + yo*2 + z + no*4 and give s. -1 Rearrange 41j2 - j3 + 0j + 42j2 + j4 - 85j2 + 2j - 22 to the form m + gj4 + lj*3 + rj + bj2 and give b. -2 Express -51 + 48t*3 + 14t*3 + 48 in the form m + zt*3 + vt + rt2 and give m. -3 Rearrange -4b + 4 + 0 + 3b + (2 - 1 - 3)(-3 + 3 + 2b) + 21b + 31b - 15b to the form x + db and give x. 4 Rearrange 5q - 3q - 5128q*2 + 5081q*2 to m + lq*2 + bq and give b. 2 Express (r - r - r)(-50r - 24r2 + 85r - 15r2) as n + ur*2 + zr*3 + sr and give s. 0 Rearrange (0 - p + 0)(48 - 48 - 3p*3) + (3p4 - p4 + 0p4)(1 - 3 + 1) to the form d + jp + vp*4 + cp*2 + qp*3 and give v. 1 Rearrange 2n*2 - n + n + (-n + 4n - 2n)(166 - 204 - 34n + 75) to xn*2 + z + dn and give d. 37 Rearrange -4c3 + 2c - 2c + ((0c - 5c + 3c)(-c + 2c + 0c) + (-c + 2c - 3c)(71 - 2c - 71))(c + 0c - 2c) to nc2 + d + xc + oc3 and give n. 0 Rearrange 20y - 56y + 35y + 56y3 to b + ay*2 + cy + hy3 and give h. 56 Rearrange (3c - 5c + 0c)(-28 + 19 + 119c + 8) to sc + ac*2 + j and give s. 2 Express (-161 + 76 + 80 + 2f*3)(-3f + 5f - 7f) as v + hf*4 + jf + if2 + xf*3 and give j. 25 Rearrange 5 - 2x*4 + 4x*4 + 3x*2 - 7 - 10x - 3x4 to sx + dx2 + k + jx*3 + tx*4 and give t. -1 Express -939 - 146n + 939 in the form u + on and give o. -146 Express (2j - 12j - 10j + 2)(-2j*2 + 5j*2 + 2j*2) as d + uj*3 + bj + fj2 and give u. -100 Express -406q*2 + 2q*3 - 6q + 406q2 - 16q + 2 as wq + nq*3 + s + iq*2 and give s. 2 Express (-9f + f + 2f)(33 - 18 + 32) in the form lf + v and give l. -282 Express (3x - 2x - 2x)(-221x + 205x + 12 - 1) as g + tx*2 + hx and give t. 16 Rearrange -28i + 9i - 4i - 3 to qi + s and give s. -3 Express 28n - 636 + 637 - n2 + 4n*2 in the form hn + yn2 + w and give y. 3 Express (43 - 13 + 26)(32r3 - 4r*3 + 11r*3) in the form dr + b + yr2 + gr*3 and give g. 2184 Express 78x*2 + 27x*2 + 70x*2 as z + dx + wx2 and give w. 175 Rearrange -4063h + 9 + 8139h - 4067h to the form a + th and give t. 9 Rearrange o - 2o - o + (0o - 3o + 4o)(-1 + 0 - 1) to the form co + a and give c. -4 Express -u + 31u*2 + 28u*2 - 12 - 10u*2 + 17 - 6 in the form t + au + yu2 and give y. 49 Rearrange (-246y*3 - 490y*3 + 126y*3)(2 + 3 - 3)(4y - y - 2y) to s + vy*4 + hy*2 + xy + uy3 and give v. -1220 Express 0f - 16f - 109 + 109 + 4f - 4f + 5f + (-f + 0 + 0)(0 - 2 + 0) in the form zf + v and give z. -9 Rearrange -g*3 + 2g*3 - 2 - 17g - 422g + 3g*3 - 6g*3 to ag + fg3 + jg*2 + p and give a. -439 Rearrange 9922q*2 - 9287q*2 - 7 + 7 to the form c + kq*2 + rq and give k. 635 Express -2 - 13b - b + 9b - 2b2 + 2b as qb + pb*2 + v and give p. -2 Rearrange -36n - 39n2 - 40n*2 + 83n*2 to cn + x + wn2 and give c. -36 Express 61z - 3z3 + 62z + 4z3 + 26z*2 - 124z in the form rz + nz*2 + wz*3 + c and give w. 1 Express -35p + 108p + 205p + 44p - 4p in the form z + op and give o. 318 Express 0k*4 + 16k*3 - 18k*3 + 0k4 + k4 - 6k + k in the form lk + o + tk2 + sk*3 + nk*4 and give s. -2 Rearrange (-2 - 3 + 9)((3t - 4t + 3t)(0 + 3 - 1) - 2t + 2 - 2 + 27t - 25t + 29t) to the form a + vt and give a. 0 Rearrange 302 + r - 3r + 0r - 105 to cr + m and give m. 197 Rearrange (4 + 1 - 4)(0i + 2i - i) + 101i - 9i - 18i to the form yi + s and give y. 75 Express -4f*3 + 2f*3 + 24f*2 - 5f*4 - 48f*2 - 3f + 0f4 + 1 + 22f*2 in the form v + gf*4 + cf + uf3 + xf*2 and give g. -5 Rearrange 17s*2 - 362s*2 + 38s*2 to ls + qs2 + x and give q. -307 Rearrange 0y - 3y + 4y + (-3 - 2y + 3)(38 + 7 + 141) to oy + t and give o. -371 Rearrange 1062f - 52f - 340f to the form pf + g and give p. 670 Express (-7j + 40j - 5j)(0 - 3 + 13 + 2 - 2 - 2 - 5 - 1 + 4 + (-1 + 1 + 1)(-1 + 1 + 2)) in the form qj + i and give i. 0 Rearrange (-1 + 1 - 8d*4)(-8 + 3 - 23) + 3d4 - 3d4 - d4 to the form fd3 + td*4 + qd + h + ad2 and give q. 0 Express 31l - 15l - 13l - 12l + (0 + 0 + l)(-2 + 0 + 1) in the form xl + m and give x. -10 Express -3n*4 + 0n*4 + 2n*4 + (-68n*2 + 54n*2 - 129n*2)(3n2 - 2n + 2n) as vn + un2 + l + qn*3 + tn*4 and give t. -430 Express 2g*2 + 2g + 3051g4 - 4g*2 - 3056g*4 as bg*2 + s + pg*3 + ig + kg4 and give i. 2 Rearrange (3r - r - r + (-39 + 5r + 39)(-1 + 5 - 3))(9 + 6 + 28062r - 28049r) to p + hr*2 + ar and give a. 90 Rearrange 2 - 4 - 36o - 6 - 6 + 1 to the form p + ho and give h. -36 Express (24n - 17 + 17)(57n + 11n + 45n) in the form un*2 + d + yn and give u. 2712 Rearrange -339x3 + 145x*3 - 322x*3 + (-2x*2 + 0 + 0)(-7x + 3x + 3x) - 3x3 - x3 + 5x3 to ox*2 + fx + v + kx3 and give k. -513 Rearrange 2 - 720x - 1 + 720x + 145x*3 to the form nx*2 + ux*3 + bx + d and give d. 1 Express (2 - 2 - 3)(3p - 3p + 2p) + (-11p + 7p - 6p)(0 - 1 - 1) as h + jp and give j. 14 Rearrange -5 - 88l - 6l2 - l4 + 266l - 93l - 90l to the form al4 + pl*3 + kl + ul2 + f and give k. -5 Rearrange 29o - 27o + o	{ "pile_set_name": "DM Mathematics" }
in 5, 0.14, c, 0.5? 0.14 Let y = 3391 + -3379. Which is the fifth biggest value? (a) 1/3 (b) 2/9 (c) y (d) 2/5 (e) -0.1 e Let l = 12 + -61/5. Let y = 0.04 + 0.06. Suppose 4n + 10 = 9n. What is the biggest value in n, l, -2, y? n Let s = 237.9 - 223. Let h = -14.5 + s. What is the fourth smallest value in 1, -3, h, -7/2? 1 Let p = 19980.2 + -19973. What is the third smallest value in p, -6, 5? p Let g = -0.3 + 0.2. Let q = 3923.5 - 3924. Let h = 0.146 + 17.854. Which is the third biggest value? (a) h (b) g (c) q c Let h = 1422.94 + -1423. Let w = 0.13 - -0.11. Let r = w - h. What is the biggest value in -6/5, 3/2, r? 3/2 Suppose 2j + 5 = 31. Suppose 3t - 25 = -j. Suppose 3q = tq. What is the biggest value in q, -2, 4/9? 4/9 Let t = 2469 - 2444. Let l = 61 + -40. Let s = l - t. Which is the second smallest value? (a) 2/7 (b) s (c) -2/5 c Let y = -8041 + 8042. Which is the fourth smallest value? (a) -1/3 (b) 90 (c) -4 (d) y (e) -0.1 d Let t = 13971 + -13975. Let v(g) = 2g + 8 + 2g - 3g. Let m be v(-6). Which is the second smallest value? (a) m (b) 1/3 (c) t (d) 1/6 d Let x = 6.3 + -8.3. Let f = -76.7888 - 0.0112. Let q = f - -77. Which is the biggest value? (a) x (b) -1 (c) q (d) 4 d Let s = 0.013 - -8.777. Let h = s - 6.79. Which is the biggest value? (a) -45 (b) -2 (c) h c Let m = 4 - 14. Let l be (-24)/30(1 + -28 + 2). Let b be 62/l + 2 + 150/(-30). What is the third biggest value in b, m, -0.5? m Let k = 2 + -2. Let n be 3613/78 - (6 - -10). Which is the third smallest value? (a) k (b) n (c) 0.01 c Let a be (-2 - 32/(-15))950/(-760). What is the second biggest value in 0.08, 2/9, a, 2/7? 2/9 Let t = -5.0167 - -0.0167. Which is the smallest value? (a) 0.3 (b) 0.1 (c) t (d) -4 (e) 153 c Let t = -501 + 547.6. Let h = t - 47. Let k = 1 - 0.9. Which is the third smallest value? (a) k (b) h (c) 3/5 c Let x = -0.52 - -0.52. Let d = -12 + 16. Let t be (-26)/(42/d). Which is the third smallest value? (a) t (b) x (c) 4 c Let b(a) = 2a*2 + 17a - 57. Let f be (3(-2)/12)/(3/66). Let p be b(f). What is the fourth smallest value in 2/3, p, 6/5, 0? 6/5 Let o = 9 - 13. Let x be -43(-3)/o. Let y be (-4)/30 + 2904/180 + -14. Which is the fourth biggest value? (a) x (b) y (c) 4 (d) 1 a Suppose 4z + 40 = -4z. Let j = 2.432 + -2.932. Let u = -317/5 - -64. What is the smallest value in j, u, z? z Let z = 655.3 + -655. Let h be (-1 - (-17)/16)(-4 - -6). Which is the third biggest value? (a) -6 (b) -2/7 (c) h (d) z b Let s = 1903 - 1908. Which is the fourth biggest value? (a) s (b) 0.11 (c) 44 (d) -0.5 a Let z = 159 + -179. Let s = -3389/4 - -867. Let v = z + s. What is the second smallest value in -5, 2, -1, v? -1 Let m = 10.1 + -9. Let n be 2057/(-121) - ((1 - 2) + 5). Let z be 3/n - 165/(-175). Which is the second smallest value? (a) z (b) -3/4 (c) m (d) 1 a Let n = 1.1 + -1.1. Let v = 3841 - 26883/7. Which is the fourth smallest value? (a) v (b) -2 (c) n (d) -5 a Let k = -2.7681 - -0.0581. Let l = k - -58.71. What is the biggest value in l, -1/4, 0.2? l Let n be ((-51)/20)/(-3) + 6/(-10). Which is the biggest value? (a) -25 (b) -2 (c) -4 (d) -0.3 (e) n e Let m = 6036.5 + -6044. Let x = -32 - -28. Which is the second biggest value? (a) m (b) -0.2 (c) x c Let v be 8 - (-75)/(-15 + 0). Which is the fourth smallest value? (a) 0.4 (b) v (c) -25 (d) -2/5 b Let l = -1.176 - -811.176. Let a = l + -805. What is the third biggest value in a, 1/4, -220/3? -220/3 Suppose -47 = 40m - 207. Which is the fourth biggest value? (a) m (b) -1/7 (c) -3/8 (d) -1.18 d Let j = -175.71 + 175.71. Let q = -6 + 6.5. Let w = -4 + 3. Which is the third biggest value? (a) q (b) w (c) j b Suppose -12f = 361 + 419. Let k = f - -85. Which is the second smallest value? (a) -5 (b) k (c) -1 (d) 4 c Let u = -0.18 + -0.02. Let c(g) = -19g3 + g2 + g - 1. Let t be c(-1). Suppose -3 = -tw + 21w. What is the fourth biggest value in w, -1/2, 0.4, u? w Let k = -46901/138 + 2039/6. What is the third smallest value in -1/12, 5, 4, k? 4 Let l = -0.1113 - -5.1113. Let q = 0.16 - 0.33. Let a = -11.83 + q. What is the third biggest value in a, l, -5? a Suppose 37t = 42t + 25, -4t = -3u - 16. Let j = 0.04 + -0.02. Which is the second biggest value? (a) -3/5 (b) j (c) u (d) 4 b Let z = 373 - -72. Let w = -444.8 + z. What is the fourth biggest value in 1, w, -5, 3? -5 Suppose -31 - 50 = -3j. Let t = 18 - j. Which is the third smallest value? (a) t (b) 4 (c) 1 b Let n = -0.2106 + 0.866. Let h = 0.0554 - n. What is the third smallest value in 5, h, 2? 5 Let d = -435 - -435.3. Let h = -5.92 + -0.98. Let q = h - -0.9. What is the fourth smallest value in d, 4, q, 10? 10 Let p = 0.02 + -3.02. Let q be 5/((-54)/(-1152)1620/3). What is the fourth smallest value in 1/2, 4, q, p? 4 Let q = -1225 + 1228. What is the second smallest value in -1/6, q, 2/9, 5, 1/172? 1/172 Let q = -99 + 292/3. Let r = -139041/4 - -34759. Which is the second smallest value? (a) r (b) -1 (c) q a Let a = -38.2 + 22. Let q = 16.4 + a. What is the second smallest value in q, 4, -0.03? q Let x = -1.01 - -1.1. Let g = -10513/4 - -2628. Which is the third biggest value? (a) g (b) 2/3 (c) x a Let u(s) = 140s + 2813. Let l be u(-20). Let z = -40.2 + 44. Let p = 4 - z. Which is the third smallest value? (a) l (b) -5 (c) p a Let s = 1.2127 + 0.0873. Which is the smallest value? (a) 1/4 (b) -11 (c) -2 (d) s b Let z = 3.8126 + -3.3126. Suppose 3p - p - 60 = 0. Suppose 6 = 3q + p. Which is the biggest value? (a) z (b) q (c) 1 c Let m be (-56)/(104/13) + 2/1. Let r = 3911/11 + -355. What is the smallest value in r, 17, m? m Let z = -1672.21 + 1672. What is the third biggest value in 7/2, -1, z? -1 Let x = -5523.2 - -5523. Which is the fourth smallest value? (a) x (b) 5 (c) -123 (d) -4 b Let g = 43.91 + -43.41. What is the fourth smallest value in 1/4, g, 2, 27? 27 Let y(k) = 209k - 834. Let m be y(4). Which is the smallest value? (a) m (b) -0.07 (c) -3/2 (d) 4 c Let x = 6869 + -6871. Let n = 7.4 - 7. Which is the second biggest value? (a) -2/5 (b) x (c) n (d) 1/4 d Let h(g) = -g*2 - 2g + 356. Let d be h(-20). What is the second smallest value in -2/21, d, -4/3, -1/3? -4/3 Let q = -19.018 + 19. Let z = -803/5 - -160. Which is the third smallest value? (a) q (b) z (c) 5 c Let q(k) = 5k3 - 2k + 1. Let o be q(1). Let h = -10 + 15. Let x = 3772.3 - 3772.7. What is the biggest value in 2/3, o, x, h? h Suppose -u - 3u = 5u. Let h = -2.14 + 1.7. Let l = 0.14 + h. Which is the third smallest value? (a) -4 (b) l (c) -3 (d) u b Let f = 22472/5 + -4472. Let p = -114/5 + f. What is the second biggest value in p, -0.5, -4/7, -0.09? p Let m be (-264944)/(-59280) + (-4)/30. Let q = 55/13 - m. Which is the biggest value? (a) -5 (b) 5 (c) q b Suppose 5r + 320 = 5p, 9 + 94 = -2r - 3p. Let d = 647/11 + r. Which is the biggest value? (a) 1.1 (b) -4 (c) d a Let f = 0.03606 - 0.10606. Which is the smallest value? (a) -3 (b) 0 (c) f (d) 0.07 (e) -1/11 a Let o = 1633 - 1424.2. Let k = o + -209. Let t be (-28)/18 + 10/45. Which is the fourth biggest value? (a) k (b) t (c) 4/11 (d) 0 b Let l = 1281 - 1281. Which is the fourth biggest value? (a) 1 (b) -1/9 (c) l (d) -1.56 d Let g = 125.3 - 56.5. Let o = g + -68.7. Which is the second biggest value? (a) 0.9 (b) -2/7 (c) o c Let z(w) = -w - 4. Let h be z(-6). Suppose -u = 2r - 0 - h, -u = 0. Let g = 6518.7 - 6522.7. Which is the biggest value? (a) g (b) r (c) -1/4 b Let h = -1333/42 - -193/6. Let v = 6.474 + -0.074. Let b = 6 - v. What is the second biggest value in h, b, 3? h Let r = -32499 - -32499. What is the third smallest value in 4, r, -2.052? 4 Suppose 2g = 2q + 6, -q + 11 = 14. Suppose 0 = -0w + 3w - 15, -2j + w - 7 = g. Which is the fourth smallest value? (a) 0.064 (b) -0.4 (c) 0.3 (d) j c Let x = 775/11 - 3111/44. What is the second smallest value in -2, -1/3, x? -1/3 Suppose -5i + 12u + 20 = 17u, 4u - 12 = 0. Suppose -21 = -18k + 11k. Which is the third smallest value? (a) k (b) 75 (c) i (d) -1/11 a Let n = 2526 - 2523. Let p = -25 - -21. Let r = -8 - -7.7. What is the third biggest value in n, r, p, 1	{ "pile_set_name": "DM Mathematics" }
, 0, -3? a Let w = 0.0653 + 0.9347. Which is the fourth biggest value? (a) w (b) -0.07 (c) 0.2 (d) -11 d Let g be 8/10-4 + 2. Suppose 13m = 17m - 8. Let q be 0 + (m - -1) + 0. Which is the biggest value? (a) g (b) q (c) -0.3 b Let p = -4/13 - -11/78. Let o = -258 - -1286/5. What is the biggest value in p, o, 0.1? 0.1 Let d be ((-3)/(-15))/(1/(-2)). Let m = 7.3 + -6.6. What is the smallest value in -1, m, d? -1 Let n = 0.0042 + -3.0042. What is the third biggest value in 0.5, -0.5, -0.08, n? -0.5 Let i = 4.28 + 4.72. Which is the biggest value? (a) i (b) -5 (c) -15 a Let s = 97 - 98.02. Let d = 0.32 + s. Let b be (-1)/(15/(-3))4. What is the second biggest value in d, b, 1? b Let n = -41.3 - -39. Let s = n - -1.8. Let y = -5/34 + -1/51. Which is the smallest value? (a) y (b) s (c) -4 c Let p = -157 - -57. Let o = -205/2 - p. What is the second biggest value in o, 0.2, -3? o Let o = 16 - 18.6. Let l = o + 0.6. Let s be (-1)/6 + 1643/318. Which is the third smallest value? (a) s (b) l (c) 0.5 a Let n = -42.39 + 42. Let q = n - -27.39. Let s = -29 + q. Which is the smallest value? (a) 2/9 (b) s (c) -0.2 b Let n = 155 + -154.6. What is the second smallest value in -4/9, -3, 10, n? -4/9 Let w be (-7)/(-42) + 58/(-60). Let u = -17.09 + 17. Let q = -0.91 + u. What is the second biggest value in q, w, 1/5? w Suppose -5n + 5q = 0, -3n + 5n + q = 12. Which is the biggest value? (a) 0.1 (b) -8 (c) n c Let r = -731/12 + 243/4. What is the smallest value in r, 1, -2, 3/2? -2 Let m = -1707 + 1703. Which is the fourth smallest value? (a) 3 (b) -3 (c) -0.3 (d) m a Suppose -34 = -5n - 69. Let i(s) = -s2 - 2s + 31. Let o be i(n). Which is the fourth biggest value? (a) 3 (b) -3 (c) -2/3 (d) o d Let h = 54 + -49. Let q = 3.89 + 0.11. Which is the second biggest value? (a) -0.4 (b) q (c) h b Let r be (-13)/(78/4)6/(-20). Suppose -4x + n = 4n + 3, 5x + 30 = 5n. Let g be (-1)/x(5 - 3). Which is the second biggest value? (a) r (b) g (c) -0.3 a Let i(h) = -h - 8. Let p be i(0). Let n = -3362 - -3361.6. What is the third biggest value in n, -2/9, p? p Let g = -11 + 19. Let w = -6 + g. Suppose p = wp - 11. What is the second smallest value in -4, 0, p? 0 Let t(m) = -6m*2 + 24m - 3. Let h be t(4). Let u be 12 - (-15)/(-10). Which is the third smallest value? (a) 4 (b) h (c) u a Let k(j) = 56j*2 - 5j - 4. Let a be k(3). What is the biggest value in -1/6, a, 2? a Let p = -14 + 14. Suppose p = 2z + 6 - 12. Let h = 0.4 + -0.5. What is the third biggest value in h, 5, z? h Let m(l) = l3 + 9l*2 - 6l - 17. Let k be m(-9). Let x = k - 112/3. Let d = 3.2 + -3. What is the third biggest value in x, -6/5, d? -6/5 Suppose 0 = -10o + 13o. Let g = 3.4 + -3. What is the third biggest value in g, -0.3, o, 5? o Let z = 2.5 - 2.33. Let c = -0.33 - z. Let p be (-6)/4 - -1 - 1. What is the third smallest value in -4, c, p? c Let u = -1.24 + 0.84. What is the second biggest value in u, -6, 0.5, -0.1? -0.1 Let t = 0.27 - -0.94. Let v = -0.21 + t. Which is the second smallest value? (a) -0.3 (b) v (c) -2 a Let a be (-23)/4 + 2/(-8). Let t(n) = n + 11. Let q be t(a). Let r = -24 + 21. What is the smallest value in -1/5, r, q? r Let n be (-8)/(-42) - 2/7. Let u = -50.07 - -0.07. Let g = u - -52. Which is the third smallest value? (a) g (b) -2 (c) n a Let f be 357/49 + 4/(-14). Suppose f = 5h - 3. Suppose hx + x = 0. Which is the smallest value? (a) -2/5 (b) x (c) 3 a Let t = -594 - -594. What is the third smallest value in 5, t, -0.1, -1/5? t Suppose 2m - 3m = 610. Let p = m - -14028/23. What is the second biggest value in p, 1, -1/4, 0? 0 Suppose -4n - 26 = -3a, -a - 12 - 11 = 5n. Let d = -364.4 + 364. Let g = -0.7 - 0.3. What is the second smallest value in d, g, n? g Let s be -1(-21)/(-14). Let h(q) = -6q + 7q + 19 + 0q. Let z be h(-20). Which is the third smallest value? (a) 0.1 (b) z (c) s a Let h(l) be the first derivative of l*2/2 - 19l - 9. Let r be h(15). What is the second biggest value in -0.2, -0.1, r? -0.2 Let z be (64/(-8) - -10)/(2/(-8)). Let t = -103/6 + 17. What is the second biggest value in t, 4, z? t Suppose -3m + 11 = -4o, 0 = -4m - o - 13 - 4. Let x = m - 33. Let j be -2 + (-1 - 111/x). Which is the third biggest value? (a) -1/6 (b) j (c) 2/3 a Let t = -2.6 - -0.6. Let l = 967 + -962. What is the biggest value in t, l, -2/5? l Let m = -1108.4 - -1108. Which is the second biggest value? (a) m (b) 1 (c) 925 b Let o = -596 + 595.9. Let r = 3 + 0. What is the third biggest value in o, -5, r? -5 Let y = 56280877/1487096 - 1/114392. Let x = y - 38. Which is the second smallest value? (a) 0.3 (b) x (c) 2 a Let f = -1.591 + 1.411. What is the third smallest value in 1/9, -1, f? 1/9 Let g = -4412/7 + 630. Which is the second biggest value? (a) -0.056 (b) 4 (c) g a Suppose 0 = -6l + 6 + 30. What is the second smallest value in l, -0.3, -4? -0.3 Suppose 2o - 4 = 0, -o = 4f + 2o - 6. Which is the second biggest value? (a) 0.5 (b) f (c) -3 b Let w = -73 - -65. What is the third biggest value in -3, -2/7, w? w Let o = -241/3 + 80. Let s = -183/475 - -7/25. What is the third smallest value in s, o, -0.1? -0.1 Suppose 4x = 4m - 500, 4m + 6x - 512 = 4x. Let q = m + -382/3. Which is the second smallest value? (a) q (b) -3 (c) -7 b Let n be -1 + (-1 - -2) - (-4)/200. What is the second biggest value in -1, n, -4, -2/5? -2/5 Let h = 1.17 + -0.17. Let f = 2 - h. Which is the smallest value? (a) -2/3 (b) f (c) 5 a Let f = 358 + -358. Which is the smallest value? (a) f (b) -19 (c) -3 (d) 5 b Let f = -4.89 - -5.39. Which is the second smallest value? (a) 2/5 (b) f (c) 10 (d) 0.3 a Let d = -3 + 3. Suppose 0 = -3g + 3h + 36, 3g - g - 5h - 24 = 0. Let v be (3 - (-16)/g) + -4. Which is the third biggest value? (a) d (b) v (c) -4/7 c Let r = 575 + -573. What is the smallest value in -3/7, r, -19? -19 Let z be ((-4)/66)/(104/(-39)). Let w = -1655/121 + 772143/55055. Let g = w - 4/65. Which is the second biggest value? (a) -5 (b) z (c) g c Let b = -575 - -573. What is the third smallest value in 2.5, b, -14? 2.5 Let i be ((-25)/(-23) - 1) + 44161/(-2392) + 18. Let z(j) = 2j*2 + 4j - 1. Let d be z(-4). Which is the third biggest value? (a) 1/7 (b) d (c) i c Let x be 12/(-2)11/(-63). Which is the fourth biggest value? (a) x (b) 5 (c) 2 (d) 3 a Let o = -588 + 1765/3. Which is the fourth smallest value? (a) 0.07 (b) o (c) -0.1 (d) -2/13 b Let z = 87 + -432/5. Let w be 2 - 14/((-280)/(-45)). Which is the smallest value? (a) z (b) w (c) -0.1 b Let u = 0.05 - -3.95. Suppose 0 = 2l + 5d + 27, -3l - 9d = -5d + 23. Which is the second biggest value? (a) l (b) -5 (c) u a Let q = 0.1745 + 1.8255. Let b be 1 - (1 - 1) - 0. What is the third smallest value in 15, q, b? 15 Let b = -776 - -774. What is the fourth smallest value in 0.04, 2/19, b, 0? 2/19 Let d be ((-7)/((-49)/35) + 42)/(-1). What is the smallest value in -4, d, 1? d Let s = 39 + -315/8. Let c = -17/24 - s. Let a = -43415 - -43411. What is the third biggest value in -3, a, c? a Let d = 17 + -17.1. Let y be (-6)/3 + (-2)/(-8 + 4). Which is the smallest value? (a) 2/9 (b) d (c) y c Let j = -14419/19 + 759. Let b = -0.8 + -0.2. What is the second biggest value in j, 0.1, 4/3, b? j Let a = -35/2 - -311/18. Let x = -34 - -444/13. Let s = 117 + -113. What is the second smallest value in s, x, a? x Let q = -7 + -3.7. Let g = q + 11.72. Let u = g - 0.02. What is the third biggest value in u, -0.5, 4? -0.5 Let s be 1/3-1-6. Let h be (0 + -2)(0 + s). What is the biggest value in -0.1, h, 1/5, 0.3? 0.3 Let i = -10.9827 - 0.0173. What is the third biggest value in i, -2, -1, -6? -6 Let h = -1220 + 1242.48. Let a = h - -0.52. Let r = 21 - a. What is the third smallest value in r, -0.2, -4? -0.2 Let l = 11.86 - 6.86. What is the third smallest value in -22, -1/7, l? l Let z = 0.001 + -0.018. Let d = z + 2.017. Which is the smallest value? (a) 0.2 (b) 2/11 (c) d b Let s = 7 + -7.32. Let c = -5.6 - -5.68. Let b = c - s. What is the third smallest value in b, -0.2, 3/2? 3/2 Let l = 1.6 - 2. Let z(n) = n*2 - 10n + 46. Let y be z(12). Let v = 74 - y. Which is the smallest value? (a)	{ "pile_set_name": "DM Mathematics" }
+ xh + yh*3 and give o. -10 Rearrange (0s2 - s2 - s*2)(0s + 4s - 5s) + (-1 - 2 - 2)(-4s2 + 4s*2 - 4s*3) to the form us + is2 + r + ts*3 and give t. 22 Express -13s*2 + 19s*2 + 37s*2 in the form c + us + js2 and give c. 0 Express -14 + 17 + 3w + 4w2 - 3w*2 in the form zw*2 + d + uw and give d. 3 Rearrange 3 - 558r3 + 3r + 559r3 + r + 2r*4 to fr*3 + vr*4 + ur*2 + z + xr and give v. 2 Rearrange -2b + 3b - 6b - 3b to tb + h and give t. -8 Rearrange (-12o*2 + 69o - 69o)(-1 - 1 - 2o2 - o2) to q + to*2 + do*4 + ko + so3 and give d. 36 Rearrange j2 - 12j*2 + 0 - 5 - 2j + 9j2 to dj*2 + i + kj and give k. -2 Express f + 2 + f + 1 - 13 as af + h and give a. 2 Express (3 - 3 - 4s*2)(-s + 2 - 2) - 3s - 1 + 3 - s3 - s in the form zs*3 + t + as*2 + gs and give a. 0 Rearrange (-137t + 17t*2 + 137t)(2t - 5t + 5t) to dt + gt*3 + l + rt*2 and give g. 34 Rearrange (1 - 4 + 2)(-7z + 25z - 10z)(0 + 2 - 1)(-4z + z + 4z - 2) to s + jz + oz2 and give o. -8 Rearrange (1 - 5 - 1)(-3g2 + g - g) + (-3g + 5g + 0g)(g - g + 2g) + 0g + 0g + 2g2 to the form yg + v + rg2 and give r. 21 Express (-2m + 1 - 1)(-3m*3 + 37 + 95 - 193) as bm*3 + nm*2 + ym*4 + j + um and give u. 122 Express (-2 + 2c2 + 2)(-3 + 1 + 4)(0 - c + 0 + (c - 2c - 9c)(-5 + 2 + 2)) in the form vc3 + w + nc + jc2 and give v. 36 Express (-2f + 0f + 5f + 2f + 0f + 0f + (0f - f - f)(1 + 1 - 4))(-2f - 8f - 8f) in the form m + tf*2 + jf and give t. -162 Express -2j2 - 45j + 14j + 14j + 12j in the form oj*2 + i + mj and give m. -5 Rearrange ((1 - 2 + 3)(-3 - 5 + 6) + 50 - 10 + 7)(y + 3y - 6y) to p + ty and give t. -86 Rearrange 16 - 2p + 0 + 0p - 5 to the form q + up and give u. -2 Express 3 + 4o4 - o4 - 6o*4 + 2o2 - o2 as m + yo2 + to*3 + ro + wo4 and give y. 1 Express (1 - 1 - 2m)(8m*2 + 12m*2 - 3 - 13m*2) in the form xm*2 + v + nm + tm3 and give t. -14 Rearrange -14y*3 + 30 + y - 2y2 - 30 + y4 to the form zy2 + n + sy*3 + qy + cy4 and give c. 1 Express (22h - 16h - 14h + 114h)(3h - 3h + h) as qh2 + o + lh and give q. 106 Rearrange -5 + 2v - 92v*3 + 93v3 - v2 - v to the form j + zv3 + hv*2 + uv and give z. 1 Rearrange (-2z + 3z + z)(34z + 9z + 66z) to hz2 + c + oz and give h. 218 Rearrange (1 - 5 + 1)(-13z2 - z2 + 4z2) to the form lz*2 + t + mz and give l. 30 Express -6h4 + 40h - 42h - 1 - 4h*4 as gh + ih4 + uh*3 + qh*2 + c and give c. -1 Express 2m*4 - 17 + 17 + (3m2 - m2 + 0m2)(-2m2 + 4m*2 - 5m*2) in the form vm*4 + um + cm3 + rm2 + s and give v. -4 Rearrange 8 - n2 - 5n3 - n - 8 to the form vn*2 + cn + j + in3 and give v. -1 Express -9m - 3m + m in the form tm + s and give s. 0 Express -69 + 69 + 12c2 + (0 + 0 - c)(c - 3c + 3c) in the form vc + gc*2 + l and give l. 0 Express -42 - 5j + 0j + j + 2j in the form z + mj and give m. -2 Express 36i - 3 + 3 + 21i as di + u and give d. 57 Rearrange (l + l - l)(-2l + 5l3 + 4l*3 - 10l*3) to pl*4 + v + wl*3 + cl + il2 and give i. -2 Rearrange (-3 - 1 - i2 + 0)((-2i + 5i + i)(2 + 0 + 0) - 1 + 1 + i + 0 + 0 + 2i) to the form wi3 + qi + s + ui2 and give u. 0 Rearrange -28n*3 - 3n + 60n3 - 30n*3 + 2n*2 to an + pn3 + gn*2 + h and give g. 2 Rearrange (-3 + 3 + l)(30 - 30 + 2l) + (4 - 2l - 4)(4l + 0l + 0l) - 2 + l*2 + 0l*2 + 4 to the form yl + d + jl2 and give d. 2 Express (2 + 0 + 0)(2q - 2q + q + 7q - 3q - 9q + (-3 - 1 + 2)(4 - q - 4)) as h + pq and give p. -4 Express 0r - 5r + 7r + 8r in the form y + or and give o. 10 Express 5k2 + 4k*3 + 0k*2 - 2k*3 as ok + yk2 + j + qk*3 and give q. 2 Express -2 + 6a3 + 1 + a3 - 4a3 in the form xa + na3 + ma*2 + v and give v. -1 Express 39j - 18j + 30j + 26j in the form l + uj and give u. 77 Rearrange (3 - 2 + 1 + (-1 + 4 + 11)(5 + 0 - 3))(6c - 2c - 3c) to oc + k and give o. 30 Rearrange (0 - 4 + 1)(-1 + 2 + 1)(1 - 4 + 4 - 3l) to pl + f and give f. -6 Rearrange (3 + 4 - 4)(0b + 4b + 9b)(1 + 0 + 0) + (-1 + 1 + 2b)(2 + 4 - 4) to vb + n and give v. 43 Rearrange -14o2 - 8o2 - o2 + (-2o + 0o + o)(2 - 2 - 2o) to the form go + mo*2 + w and give m. -21 Express -19i + 6i + 16i as hi + b and give h. 3 Express -i2 - i3 + 9i*3 - 30i + 28i as h + pi*3 + yi + si2 and give y. -2 Express (8w - 3 - 12w + 2w)(4w*2 - 3w*2 - 2w*2) in the form xw*3 + zw*2 + l + uw and give x. 2 Express (0 - 1 - 4)(-2h + h + 3h)(9 - 9 + 9h) + (-2 + 2 - 2h)(h + 0 + 0) in the form q + xh + bh2 and give b. -92 Express -1 + 10b*2 - 1 - 14b*2 + (b + 0 + 0)(-3b + 2b + 2b) as f + ab*2 + vb and give f. -2 Rearrange -n*4 + 2n*3 + 3n*2 + n - 5n*4 + 1 + 8n*4 - 2 to x + on + tn3 + in*4 + hn*2 and give x. -1 Rearrange (-m - m - m)(-3 + 2 - 1)(-13m*2 - 16m + 16m) to the form gm*3 + dm*2 + a + fm and give g. -78 Rearrange (0o2 + 4o*2 - 3o*2)(39 - 4o - 39) to bo*2 + g + po + so3 and give s. -4 Rearrange -121 + y + 243 - 121 to the form p + dy and give p. 1 Express (-1 - 1 + 0 - 2 + 2 - 2 + 2 + 2 - 5 + (4 - 2 - 1)(-5 + 1 + 5) + 3 - 5 + 1 + 6 + 0 - 4)(-2 + 14 - 2)(t + 0 + 0) in the form it + q and give q. 0 Rearrange 23a2 - 10a*2 + 7a - 10a2 to the form w + ba + fa2 and give f. 3 Express j3 + 5 - 5 + (0j + 3j - 5j)(0 + 0 - j2) - 2 + 0j*3 + 6j*3 + 3 + 2j*3 - 5j3 + j3 as qj + fj*3 + x + dj*2 and give f. 7 Rearrange 32t2 + t3 + 4 - 3 - 8t2 to the form bt*3 + vt + ot2 + i and give o. 24 Express 164l*2 - 76l*2 - 78l*2 in the form cl + yl2 + g and give y. 10 Rearrange (2a + 4a + 0a)(-3 + 2a + 3) + (0a - a + 3a)(0 + 0 + a) - 2a*2 + 4a2 + a2 to ka2 + b + la and give k. 17 Rearrange -69x + 61x + 153x + 35x to dx + l and give d. 180 Express -3a*3 - 2a + 5a4 + 4a*3 + 2a2 - a4 as oa + ga*3 + m + ia*4 + ra*2 and give o. -2 Express -4m*2 + 7m*2 + 8m*2 + 8m*2 as dm + k + rm2 and give k. 0 Rearrange -3y*2 - 29y*3 + 13y3 - y4 + 15y3 to dy*2 + w + uy + iy4 + oy*3 and give o. -1 Express (0 - o + 0)(-3 + 0 + 2) + 3o + 5o - 4o + (-1 + 1 + 1)(3o - o + o) in the form yo + k and give y. 8 Express 2x4 + x2 + x + 2x*3 - 3x*2 + 0x4 + x2 as n + ox4 + ux*3 + mx + qx2 and give m. 1 Express -29 + 29 - 17c*2 in the form a + rc*2 + oc and give r. -17 Express -17h2 + 1 + 0 - 1 in the form uh + xh2 + m and give x. -17 Express 11 + 6w*2 - 13 + 3w*2 + 2w3 - w2 in the form mw + bw*3 + d + xw*2 and give m. 0 Express (s - 4s + s)(8 + 17 + 44) in the form zs + r and give z. -138 Express -4 - n*4 + 16n*3 - 3n + 2n - 15n*3 as r + vn + mn4 + ln*2 + bn*3 and give b. 1 Express -5i*2 + 4i*2 + i - 5i + i*3 + 0 + 1 in the form v + ui*2 + zi*3 + ki and give u. -1 Rearrange -36q3 + 1 - 3q - 2q4 + 40q*3 + 0q - q*2 to wq + pq2 + bq*4 + sq*3 + g and give g. 1 Express -9o + 26o + o4 + 2o*3 + 2o*2 - 18o in the form b + co4 + mo*2 + fo + to3 and give c. 1 Rearrange (6 - 2 + 0)(4f2 - 3f*2 - 2f*2) - 3f*2 + 0f - 3f + f to the form if*2 + w + qf and give i. -7 Express -7n3 - 5n*2 + 5n*2 + (n - 3 + 3)(0n2 + 3n*2 - 2n2) + n3 - 5n3 + 2n*3 in the form xn*3 + wn*2 + in + v and give x. -8 Rearrange -10u2 + 4u*2 + 2u*3 + 30u - 28u to the form vu*2 + k + tu*3 + zu and give t. 2 Express -14o + 12o - 18o - 17o as no + i and give n. -37 Rearrange 3t3 - 1 + 2 - 1 + t2 to ut2 + ht*3 + a + qt and give u. 1 Express -10y2 + 4y*2 - 20 + 10 + 8 as oy*2 + r + jy and give r. -2 Rearrange 212t - 214t - t2 - t4 + 0t4 + 4 to the form rt*3 + bt*4 + qt*2 + kt + s and give b. -1 Express (-7p + 2p + 2p)(10 - 10 - 3p)(-p - 4p + 3p) + 3 - 4p3 - 3 as cp*2 + zp + sp3 + y and give s. -22 Rearrange 2z**4 -	{ "pile_set_name": "DM Mathematics" }
d -0.33962. 257.77158 214.36 times 12.35 2647.346 201 * -1.9106 -384.0306 What is -3531 times -69? 243639 30683526-4 -122734104 Calculate -0.3520.69069. -0.24312288 Calculate -4.25262-95. 403.9989 -12.6 -22699 286007.4 330607 * -1308 -432433956 Product of 0.22 and 1.644267. 0.36173874 Multiply 23.62 and 319717. 7551715.54 Product of -12764939 and 1. -12764939 What is the product of -351.58 and -78? 27423.24 What is -175876.5 times 0.4? -70350.6 What is -10213.827 times 2? -20427.654 -50821.7 * 2.473 -125682.0641 1830589 * -0.7 -1281412.3 What is -0.024 times 1.174068? -0.028177632 -0.2 * 0.4767307 -0.09534614 525.430.2 105.086 3 -0.121031563 -0.363094689 Work out 294050250 * -1. -294050250 1.2844702 * -5 -6.422351 Multiply -3 and 767004. -2301012 Work out 2.4 * -80.15997. -192.383928 Calculate -483.6-1.8887. 913.37532 -0.01 times 3238000 -32380 Work out -40.15 2373. -95275.95 -257748-1.8 463946.4 Work out 27599 0.14. 3863.86 0451.0056 0 -0.32 421196 -134782.72 -0.8 times 5332493 -4265994.4 What is the product of -0.3 and 207045103? -62113530.9 Product of -4 and 1715994. -6863976 Work out -51261 * -513. 26296893 108 times -0.23624 -25.51392 Calculate -189141970.3. -5674259.1 Work out -955 -6263. 5981165 717279-0.5 -358639.5 1.30.8073126 1.04950638 Multiply -1 and -3637143. 3637143 0.16274.256 43.88096 1.5 times 4177 6265.5 Product of 63548 and 0.825. 52427.1 31 times 1757919 54495489 0.02 21876799 437535.98 What is 10712 times 18.1? 193887.2 Calculate -313-69537. 21765081 What is 5 times -527598.7? -2637993.5 Multiply -249717 and -2843. 709945431 Work out 7 -240.5118. -1683.5826 0.0515007461 750373.05 1 148149543 148149543 What is 182 times -37918? -6901076 -2300 times -290386 667887800 Multiply 0.2 and -1851081. -370216.2 Product of 1916 and 57.3213. 109827.6108 Work out 0.4 * 172430075. 68972030 Calculate 0.836730.34. 0.2844882 Work out -8943144 -0.07. 626020.08 Multiply 3 and -0.043768. -0.131304 -7342 times 2582 -18957044 Work out 129141927 * -0.2. -25828385.4 Multiply 343798 and -477. -163991646 What is 266331.4 times 0.3? 79899.42 Product of 0.4395 and -3302. -1451.229 Multiply -0.043516994 and -1. 0.043516994 What is the product of 59694.2 and 0.157? 9371.9894 What is the product of -1394206 and 0.05? -69710.3 Multiply 142.1388 and 4. 568.5552 Calculate -1.52323.114. -3484.671 What is the product of 14.74376 and -0.7? -10.320632 Calculate -17.4-46485. 808839 2.4-1098805 -2637132 Calculate 810822-0.17. -137839.74 Work out 3939027 * -11. -43329297 What is the product of 8219 and -1019? -8375161 Calculate 8775-57.109. -501131.475 23-83.6718 -1924.4514 Work out 0.332 * -22652. -7520.464 0.2 times 6960319 1392063.8 108.77-32075 -3488797.75 What is 0.6 times 147.1495? 88.2897 Product of 5573 and 20223. 112702779 -32395711.4 0.5 -16197855.7 824.36 times 4 3297.44 Multiply -0.02338 and 6225. -145.5405 -935588 times 22 -20582936 What is -7130877 times 117? -834312609 Product of 236 and 201900. 47648400 What is -878 times 5.248? -4607.744 What is the product of -1.29 and 694697? -896159.13 0 times -361613505 0 0.471788.418 28715.3672 Multiply -1 and -2.1132763. 2.1132763 Work out -1155830 74. -85531420 Product of 65400 and -1310. -85674000 -251.4204 * -0.09 22.627836 Multiply -2757 and 33873. -93387861 Calculate 1.9856-79. -156.8624 Calculate 0.4200038. 80015.2 421751318 55586650 Multiply -3 and 10871861. -32615583 9643737 3568169 Work out -206564.1 * -5.24. 1082395.884 Product of -235 and 10.7266. -2520.751 Multiply -0.4 and -289919443. 115967777.2 Multiply -12.4029 and -1.19. 14.759451 What is the product of 14 and -158474? -2218636 What is -10 times -1.5042884? 15.042884 Work out 20835191 * 0. 0 0.2 * 7310.754 1462.1508 What is -4 times -7268.7914? 29075.1656 0.2 * 48.77994 9.755988 0.00077-19370.4 -14.915208 49592 -0.085 -4215.32 Multiply -26 and -0.82125. 21.3525 Calculate 6984261-1. -6984261 What is 0.032 times -2.96201? -0.09478432 Work out 139 -9938. -1381382 What is 614 times 0.660858? 405.766812 Work out -1.95278 * -73. 142.55294 What is the product of -26 and 485.692? -12627.992 0.092129413 times 1 0.092129413 Product of -7210 and -3075. 22170750 Calculate -15524188-4. 62096752 -1626.3855 -626.3855 Product of -2546017 and -0.4. 1018406.8 Work out 101200 * 38. 3845600 Calculate -1258355-25. 31458875 -767 times 31580 -24221860 -0.23 times 20766848 -4776375.04 What is 0.338 times -148703? -50261.614 Product of -10984947 and -0.2. 2196989.4 What is 0.1 times -15638309? -1563830.9 -2628 times 978 -2570184 What is -3666 times 0.002? -7.332 Calculate 32337893. 10812576 -30536314 * -0.5 15268157 Product of -3 and -666.45608. 1999.36824 What is the product of 8 and 5097780? 40782240 -6369.9 times -0.232 1477.8168 Multiply -1254 and 87293. -109465422 What is 145.23 times -768? -111536.64 -1 times -221608004 221608004 -0.7154981 * 18 -12.8789658 -4190-0.4109 1721.671 -23.51-1.734 40.76634 Product of -608184 and 549. -333893016 What is the product of 0.06 and -71397? -4283.82 0.04971 times 3.6018 0.179045478 What is 1149227 times 105? 120668835 What is the product of -809346 and -1.29? 1044056.34 What is -0.6 times 0.050136073? -0.0300816438 -2.67684 times -102 273.03768 What is the product of 2.6995 and -0.04695? -0.126741525 What is 20471 times 22.12? 452818.52 2.7-81980 -221346 27 times 40080 1082160 24526 times 0.00176 43.16576 What is the product of 5 and -282.76919? -1413.84595 0.06 -14358456 -861507.36 56362 * 154 8679748 Multiply 40257538 and -2. -80515076 Work out 67993733 * -3. -203981199 Multiply -4.9 and 3789.9. -18570.51 -5101-0.19 969.19 Product of -211556 and 2.26. -478116.56 What is the product of 13793.5886 and -2? -27587.1772 Work out -0.039 4157.5. -162.1425 What is 621.28 times -237? -147243.36 What is the product of -0.08073 and 432.4? -34.907652 Multiply -746 and -701303. 523172038 Multiply -1701131 and -0.03. 51033.93 What is 25522 times -0.1221? -3116.2362 What is -8822 times 2161? -19064342 -1126-0.33 371.58 Multiply 4146 and -45.6. -189057.6 -28.2-5.2687 148.57734 9.085-0.026 -0.23621 Calculate 0.32-0.0074302. -0.002377664 67 * 12694361 850522187 What is 0.1 times 2944.269? 294.4269 -4288.907 times -12 51466.884 -0.066 * -212.996 14.057736 Work out 0.08825 * -427. -37.68275 -5149740 times 10 -51497400 Calculate 3.69-212011. -782320.59 Multiply 280 and -23449. -6565720 What is the product of -1590.93 and -0.1066? 169.593138 2 times 6.4778174 12.9556348 -1.723497.1 -39945.07 -1725 times 15895 -27418875 4 * -4.3677008 -17.4708032 Product of -0.09 and -30.7994. 2.771946 -3004390 times 58 -174254620 Work out -0.5 * 6655167. -3327583.5 -2-6101735 12203470 Work out -40.4 0.016848. -0.6806592 What is the product of 0.2 and 221704135? 44340827 Product of -0.1047664 and -4. 0.4190656 What is the product of -6208800 and 0.1? -620880 What is 0.5 times 6230288? 3115144 -8529876 * 217 -1850983092 8795 times 640.3 5631438.5 Product of -0.04 and -1822.659. 72.90636 Multiply 1148 and 1522. 1747256 Work out 0.59518 * 20. 11.9036 What is -1.858 times -51? 94.758 What is 0.1 times -5223618? -522361.8 -2551 times -9.8903 25230.1553 Work out 80855358 * -6. -485132148 Multiply -834 and -33567. 27994878 What is -56690 times -6.57? 372453.3 -0.37246 * 22005 -8195.9823 What is the product of -0.0953 and 0.09527? -0.009079231 What is 145551 times -0.02425? -3529.61175 Calculate -3541.3-1349. 4777213.7 10359203 times 3 31077609 Product of 0.133634 and 89. 11.893426 Product of 1859 and -17209. -31991531 Calculate -13973.950.036. -503.0622 What is 16.8 times 69.0777? 1160.50536 33 times 2222.397 73339.101 What is 7177800 times 1? 7177800 What is the product of 239.6 and 111491? 26713243.6 -328168177 times 1 -328168177 -0.1 * -6.74036 0.674036 Multiply -1172967 and -16.3. 19119362.1 Calculate -0.182590. -466.2 -0.07 times -20.014628 1.40102396 Calculate -0.14-3968763.1. 555626.834 What is the product of 0.327444176 and 0.3? 0.0982332528 -110.967-1.047 116.182449 Product of 109.194 and 0.416. 45.424704 -166 times 17636 -2927576 What is 907 times -2683? -2433481 What is -0.80744829 times -0.04? 0.0322979316 Work out -3 -1231522. 3694566 Multiply -0.039 and 271410. -10	{ "pile_set_name": "DM Mathematics" }
n 0.5, q, 4/3, d? q Let k = -0.7 - -1.7. Let w = 0.16 - 0.3. Let z = -5.86 + w. Which is the second biggest value? (a) -0.4 (b) k (c) z a Let k = -6 - -6.5. Suppose 0 = 12z + 2 - 2. Which is the second smallest value? (a) z (b) 4/7 (c) k c Let r = 1669.6 + -1673. Let x = -16 + 19.4. Let g = x + r. Which is the smallest value? (a) g (b) -2/3 (c) -0.05 b Let f = -2.43 - -2.93. What is the third biggest value in f, 25, 5, 12? 5 Let m = 0.1602 + -0.1602. Which is the third biggest value? (a) -0.55 (b) 4 (c) m a Let v = 1.3 - 0.6. Let c = v - -0.3. Let y = 21/2305 - -6768/16135. What is the second smallest value in y, 0.5, c? 0.5 Let v = 74 + -41. Let j = v + -30. What is the smallest value in -2/13, 4, -11, j? -11 Let r = 26 + -32. Let y = 3.7 - 0.7. Which is the second biggest value? (a) r (b) y (c) -5 c Let h(s) = s3 + 2s*2 - 7s - 12. Let q be h(-2). Which is the second smallest value? (a) 0.4 (b) 4 (c) 7 (d) q d Let p be 2/(-10)(-10)/8. Let i = 37915/14 - 5417/2. Which is the fourth biggest value? (a) 11/2 (b) -0.4 (c) p (d) i b Let t = -2 + 1.5. Let v = -938.004 + 936. Let l = -0.004 - v. What is the smallest value in 4, t, l? t Let z be (72/(-16) + 3)/(6/16). Which is the smallest value? (a) 6/7 (b) 3/2 (c) z c Let s(u) be the first derivative of -u4/4 - 11u3/3 + u2/2 + 9u + 2. Let m be s(-11). Which is the third smallest value? (a) 4 (b) -0.1 (c) 5 (d) m a Let j = 2058 + -2058.8. Which is the second smallest value? (a) 2/11 (b) 2 (c) j (d) 4/9 a Let v = -74.25 + 74. Let y = v - 2.75. Which is the smallest value? (a) y (b) -0.2 (c) -1 a Let x = -71 + 71.4. Which is the third biggest value? (a) x (b) 0.1 (c) 0 c Let t be ((-33)/44)/(3/2421). What is the third smallest value in -59, t, -2, -0.5? -0.5 Let u = 15.2 - -0.8. Let f = -1.39 - -16.39. Let o = u - f. What is the biggest value in 2, 5, o? 5 Let x be 5/4-4 + 5. Let g = -5 + 2. What is the second biggest value in 10, g, x? x Let s = 0.2 - 0. Let y = 0 + s. Let o = -0.168 - 4.832. Which is the second smallest value? (a) o (b) y (c) -2/7 c Let f = -4.12 - 0.88. Which is the fourth biggest value? (a) 1 (b) f (c) 0.15 (d) -1 b Let h = 199 + -198. Which is the third biggest value? (a) 2 (b) -6 (c) -5 (d) h c Suppose 0 = -3o - o + 2184. Suppose -o = -x + 4x. Let d = x + 914/5. What is the third biggest value in 3, d, 2? d Let h = -6/179 - -794/2327. Let s = 10566 - 10569. What is the third biggest value in 2, s, h, -4? s Let v = -55 - -22. Let r = -51 - v. Let d = r + 17.93. Which is the third biggest value? (a) -0.3 (b) d (c) 0.4 a Let p = 14.4 - 12. Let h = p - -2.6. Which is the second biggest value? (a) -1/3 (b) h (c) 2/7 c Let f(x) = -11x + 9. Let d be f(-3). Suppose 6h - d = -6. Let u be h/(-18) + 11/(-3). What is the third smallest value in u, -4/3, -0.5? -0.5 Let o be 6/(-4)12/(-18). Suppose -w + 3q = -2, -3w + 5q - q = -o. Which is the smallest value? (a) 3/5 (b) w (c) 0.1 b Let t = 41 + 27. Suppose -3q + 34 = m, -6 = q - m - 3m. Let p be 4/q - t/20. Which is the smallest value? (a) -0.4 (b) 0 (c) p c Let l = -1/192206 + -35969971/1729854. Let r = -144/7 - l. Let i = 2 + -1.6. What is the second smallest value in 4, i, r? i Let u = 70.5 - 71. Let b = 5 - 5.9. Let t = u - b. What is the biggest value in 3, -1, t? 3 Let o = 721 - 731. What is the third smallest value in 2/11, -2/11, -0.3, o? -2/11 Let u = -767 - -767.5. What is the second biggest value in 2/29, -1.5, u? 2/29 Let p = -9 + 12. Suppose -5f - 25 = 0, pf + 27 = -0w + 2w. Suppose -w = d - 9. Which is the third biggest value? (a) 2/3 (b) 5/3 (c) d a Let z = 821 - 820.94. Which is the second biggest value? (a) z (b) 4 (c) -0.3 a Let w = -10.3 - -13.3. What is the second biggest value in 4/3, 1/2, -2/5, w? 4/3 Let r(j) = 26j + 915. Let n be r(-35). Suppose 0 = 3d + 22 - 4. Which is the second biggest value? (a) 2 (b) d (c) n a Let c be (-12)/(-20) + -5 - -5. What is the fourth smallest value in -3, -10, -0.2, c? c Let o = -15.8 + 13.77. Let r = 0.03 + o. Which is the smallest value? (a) -5/4 (b) 0.2 (c) r c Let d = 4.12 + -0.11. Let h = -9 + 13. Let w = d - h. Which is the smallest value? (a) -1/3 (b) w (c) 1/3 a Let t be ((-4)/3)/((-1760)/(-240)). Which is the third smallest value? (a) -20 (b) t (c) -5 b Let i be ((-10)/(-20))/(4/(-6)). What is the fourth biggest value in i, 2/5, -45, -3? -45 Let b = -165 + 96. Let y = b - -69. What is the third biggest value in -1/3, y, -6? -6 Let x = 1.7 - 1.56. Let q be (174/(-4959))/((-1)/(-3)). What is the second biggest value in q, 3, -0.4, x? x Let s be ((-9)/(-36))/((-1)/(-284)). Let w = s - 69. Which is the smallest value? (a) 0.1 (b) w (c) -5 c Let a be 1/(-3)(-3)/(-3). Let d = -0.066 + -4.934. What is the fourth smallest value in a, 3, d, -0.2? 3 Let i(b) = b*3 + 7b*2 + 6b + 5. Let k be i(-6). Suppose 0j + 9 = -3j, -3j = kf + 9. What is the biggest value in -5, f, 0.3? 0.3 Let h = -16 - -12.2. Let z = 4.2 + -5. Let u = h - z. Which is the smallest value? (a) -2 (b) 1/2 (c) u c Let t = 88.8 + -88.6. Suppose z + 2z = 18. Suppose 0 = -5l - 2b - 10, -5l = -2b + z + 24. What is the smallest value in 4, t, l? l Let y = -110.8 + 109.5. What is the second smallest value in 0.2, 0.7, y, -1? -1 Let q = -14 - -1. Let b(c) = c3 + 13c*2 + c - 19. Let f be b(q). Let y = f + 35. What is the second biggest value in y, 5, -3? y Let t = 19 - 19. Let j be 306/144 - (t + 2). Let v be 1 + 1/((-14)/18). What is the biggest value in j, v, -0.5? j Let d(f) = -4f + 6. Let o be d(-4). Let l be 1((-9)/(-15) + 9/(-15)). Which is the third biggest value? (a) 3 (b) o (c) l c Let l = 5 - 5. Let o = -0.1 - l. Let h = -2.1 - o. Which is the biggest value? (a) 0.3 (b) -0.5 (c) h a Let z = -93 + 93.1. Let s = -5.1 + 5. What is the smallest value in s, z, -1/3? -1/3 Suppose 2p + j - 8 = -j, -10 = -5j. Let q = -0.92 - -22.62. Let v = -22 + q. What is the third smallest value in 5/3, p, v? p Let d be (-459)/(-270) - 2/10. What is the fourth biggest value in 0, -37, d, 0.4? -37 Let x be (-8)/30 - (-2)/3. Let y be 2/12 - 11021/10836. Which is the smallest value? (a) y (b) 1/4 (c) x a Let q be ((-17)/(-51))/((-16)/18)4. Let k(f) = -2f - 14. Let l be k(-7). Which is the second smallest value? (a) -5 (b) q (c) l (d) 0.3 b Let q = 25.9 + -5.9. Let y = q - 19. Let f = 0 + 0. What is the third smallest value in 3, f, y? 3 Let h = -0.0167 - -3.0167. What is the third biggest value in 0.02, 3/8, h? 0.02 Let t(s) = 3s - 16. Let k be t(7). Suppose 4z = 2n - 11 - 17, -2n + 14 = -2z. Let p be 3/z + 5/28. Which is the third biggest value? (a) k (b) p (c) 1/9 b Suppose 0 = -8h + 5h + 3f + 66, 2f - 118 = -4h. Suppose 39 = -3v + h. Which is the third biggest value? (a) -2/5 (b) v (c) -2 b Let i be ((-42)/(-35)5)/(-2). Which is the second biggest value? (a) i (b) -7/3 (c) -0.07 b Let m = 1130 + -1129.95. Which is the second biggest value? (a) 3/7 (b) m (c) -0.4 (d) -2 b Let g = 40.04 - 27.5. Let x = g - 13. Let b = 0.04 - x. What is the biggest value in 0, b, -1/7? b Let t = -37 - -77/2. Let h = -0.3 + 0.2. Suppose 41 - 1 = -20g. Which is the third smallest value? (a) g (b) h (c) t c Let r be 1(20/8)/(-5). Let h = 14/5 + -61/20. Which is the biggest value? (a) r (b) h (c) 0 (d) 1 d Let d(u) = 3u2 + 1. Let x be d(-1). Suppose -20 = xg - 8. Which is the biggest value? (a) g (b) -5 (c) 1/4 c Let y = 5.5 + -4.5. Suppose -n + t = -3, 2n + 0 = -5t - 1. Suppose -4c - 18 = nf, 5c = -5f - 26 + 1. What is the smallest value in 2/7, y, f? f Let n = 43 + -44. Let l = 0.21 - -0.09. What is the third smallest value in l, n, 4? 4 Let n be ((-6)/8)/((-12720)/(-101512)). Let i = 15/424 + n. Let r = i - -31/5. Which is the biggest value? (a) -4 (b) -6 (c) r c Let w be 21/2(-4)/(-22). Let z = w + -61/55. Let p = -136.04 - -136. Which is the third smallest value? (a) 0 (b) p (c) z c Let j = -391 + 394. Suppose 3k - 25 = 5. Let t = k - 15. Which is the second biggest value? (a) j (b) t (c) 4 a Let q = -750 + 747. Which is the fourth smallest value? (a) 1/2 (b) -5 (c) q (d) -0.1 a Let x(d) = -d*3 + 25d*2 - 45d - 18. Let s be x(23). Which	{ "pile_set_name": "DM Mathematics" }
late the greatest common factor of 3 and y. 3 Suppose -4m - 4r + 12 = 0, 2r + 4 = 2m - 2. Suppose 4o + 89 = 3n, -n + 13 = -mo - 15. Calculate the greatest common factor of n and 62. 31 Let o = 2 - -1. Let q(f) = -f2 - f - 7. Let w be q(-5). Let y be 6/w + (-29)/(-9). What is the highest common divisor of y and o? 3 Let u(p) = -p + 20. Let n be u(0). Suppose -5k - 3 = 4g, -2g - 15 = -5k - 6. Let c be 15-20g/12. What is the highest common divisor of c and n? 10 Suppose 6 = 3l - 6. Suppose lg = 4c + 52, 0 = 3g - g - 4c - 36. Let t be (34/g)/((-2)/(-40)). What is the greatest common divisor of 17 and t? 17 Let a be ((-2)/(-2))/((-1)/(-7)). Let z = 11 - 21. Let b = z - -11. Calculate the greatest common factor of b and a. 1 Let s = -1 + 12. Let z be (1/(-2) - -1)0. Suppose -7f + 2f + 5 = z. Calculate the greatest common divisor of f and s. 1 Suppose -3n + 2 = -4n. Let t be -3(n + (-12)/(-9)). Calculate the highest common divisor of t and 16. 2 Let l = -4 - -24. What is the highest common factor of l and 10? 10 Suppose 2h - 26 = 3n, 5h - 4n - 23 = 4h. Let c = -8 + 15. Calculate the greatest common factor of c and h. 7 Suppose -29 = -3n + d, -9 = -2d - 7. Let p be 10 + (0 - 0) + 0. Calculate the greatest common divisor of n and p. 10 Let a(s) = 3s - 5. Let v be a(12). Let o = 51 - v. Let h(p) = 5p2 - p + 2. Let g be h(-3). Calculate the highest common factor of o and g. 10 Let u = 56 - 30. What is the greatest common divisor of 78 and u? 26 Let a(o) = -o2 - 6o - 1. Let k be a(-5). Suppose g + z = 6z - 7, 11 = g + z. Let y = 12 - g. What is the greatest common factor of k and y? 4 Suppose -v = 2v - 15. Let h be 10/(-4)(-1 - v). Suppose 3y - 4p - 3 = 35, 3y = -p + 13. What is the greatest common factor of y and h? 3 Suppose -17t + 8t + 54 = 0. Let r = -40 - -82. Calculate the greatest common factor of t and r. 6 Suppose -3a + 24 = z, 7a - 8 = z + 2a. Let n = 31 - z. Calculate the greatest common divisor of 95 and n. 19 Let j = 6 + -3. Suppose -k - 6 = -4k - 3u, 4 = -jk - u. Let d be k/(-4) - 37/(-4). Calculate the highest common factor of 70 and d. 10 Let x = 629 + -524. Let z = -14 - -35. What is the highest common factor of z and x? 21 Suppose 0 = p - z - 39 - 41, 0 = 2p - 4z - 158. Let n = p - 3. What is the highest common divisor of n and 26? 26 Suppose -5h - 5 = 10. Let w(o) = -6o. Let l be w(h). What is the greatest common factor of l and 18? 18 Suppose -5z + 93 + 57 = 0. Let i(c) = -c + 2. Let p be i(0). Suppose -pw = -35 + 11. What is the highest common factor of w and z? 6 Let w(d) = d*3 + 5d*2 + 4d + 3. Let b be w(-4). Let s be (-12)/(-8)(2 + 0 + 0). What is the greatest common divisor of b and s? 3 Let z be (8 + 2)(105/6 + -2). What is the highest common factor of 31 and z? 31 Let g be 1/4 + 0 + 537/12. Calculate the greatest common divisor of 30 and g. 15 Suppose 2k - 3 = 3d - 1, -2d + 4 = 0. Let c = k - 2. Suppose -cf - i = -21, 3 = 2f + 4i - 9. Calculate the greatest common divisor of 12 and f. 12 Let m be (2/(-4))/(3/(-168)). Let d(p) = p*3 + 6p*2 + p + 4. Let j be d(-6). Let i = 2 - j. Calculate the greatest common divisor of i and m. 4 Suppose -8 = 5q - 18. Suppose 0 = -h - 0 + q. Suppose n - 3 = 3v - 9, 3v + n - 6 = 0. What is the highest common factor of h and v? 2 Let k(s) = -2s - 8. Let l(q) = q3 + 1. Let a be l(0). Let j be 22/(-4) + a/(-2). Let z be k(j). What is the highest common factor of 32 and z? 4 Let a be (-87)/(-12) + 1/(-4). Calculate the highest common divisor of 7 and a. 7 Let p be (-268)/6 - (-12)/18. Let k = 84 + p. What is the greatest common factor of 60 and k? 20 Suppose 6m - m - 220 = 0. Suppose 0 = -r - 4n + 6, 0 = 4r - 0n + 2n + 4. Let i be 8 - (-2 + (-3 - r)). What is the greatest common divisor of m and i? 11 Let r(c) = 12c2 + c - 2. Let i be r(-3). Let a be ((-19)/38)/(1/98). Let z = a + i. What is the highest common divisor of z and 18? 18 Suppose 2i - 32 - 18 = 2u, 3u = -4i + 100. Calculate the greatest common factor of i and 10. 5 Let n = 16 + -16. Suppose -3v - v + z + 18 = 0, 2v - 5z = n. Calculate the greatest common divisor of v and 2. 1 Let f = 122 + -77. What is the greatest common factor of f and 225? 45 Let y = 5 - 12. Let k be 5 - y/(28/8). What is the greatest common divisor of 28 and k? 7 Suppose 2y = -5o - 121, 2y + 0o = -o - 101. Let g be (3/(-2))/(y/2560). Calculate the greatest common divisor of 10 and g. 10 Suppose 3n + 75 = 8n. Calculate the greatest common factor of 15 and n. 15 Let g(y) = 3y - 4. Let h be g(14). Suppose -h = 2t - 182. Let o(f) = 3f2 + 5f - 4. Let d be o(-4). What is the highest common divisor of t and d? 24 Suppose x = -4 - 15. Let f = 44 + x. Let y be 41 - (2 - 3). What is the greatest common factor of f and y? 5 Let d = -23 + 24. Calculate the highest common divisor of 1 and d. 1 Let y be (1 + 1 - -12)2. Let v be 10/(-55) - (-4)/22. Let r = 7 - v. Calculate the highest common divisor of y and r. 7 Let n = 56 - 2. Calculate the greatest common factor of n and 36. 18 Suppose 3z = -0c - 4c - 56, 0 = z - 5c + 25. Let o = -19 - z. Calculate the highest common divisor of 8 and o. 1 Suppose -2s + 0s - v - 1 = 0, 5v + 17 = -4s. Suppose 2 = -3p + 4f, -f + sf + 1 = p. Calculate the highest common divisor of 6 and p. 6 Let b(o) = 23o*2. Let u be b(1). Calculate the greatest common factor of u and 115. 23 Let j(m) = 81m*3 - 2m + 1. Let l be ((-4)/8)/(1/(-2)). Let b be j(l). Calculate the greatest common factor of b and 10. 10 Let z(j) = 5j2 + 5j - 3. Let q be z(3). Let g = -18 + q. Let y be g - ((-2 - -3) + -2). What is the greatest common divisor of y and 5? 5 Let k be (-32)/(-2) + 1. Suppose -ka - 4y + 105 = -5y, 82 = 3a - 4y. What is the highest common divisor of a and 182? 26 Let j = 4 + 35. Suppose 4b - j = -2k + 3k, -4k = -5b + 46. Let l(a) = -16a + 2. Let i be l(-3). Calculate the greatest common factor of i and b. 10 Suppose y = -2y, 0 = t - 2y - 4. Calculate the greatest common divisor of 10 and t. 2 Suppose -84 = -9v + 2v. What is the highest common divisor of v and 6? 6 Let f(k) = k3 - k + 20. Let a = -6 - -6. Let z be f(a). Calculate the greatest common factor of 160 and z. 20 Let h(a) = -a3 + 7a2 - 5a - 2. Suppose 3c + 4k + 2 = 0, 2c - 33 = -c + 3k. Let w be h(c). What is the greatest common divisor of 40 and w? 4 Suppose -3g + 8g - 300 = 0. Calculate the highest common factor of 15 and g. 15 Let a(w) = -w*3 + 6w*2 - 3w - 3. Let r be a(5). Suppose -435 = -2f + 7f. Let z = -52 - f. Calculate the greatest common factor of z and r. 7 Let p = -129 + 217. Calculate the highest common divisor of 11 and p. 11 Suppose 91 = 3f + 22. Let t = f - 16. What is the highest common divisor of t and 63? 7 Let u = -32 + 45. Calculate the greatest common factor of 91 and u. 13 Let g(f) = -f3 - 4f*2 + 2f - 3. Let l(k) = k. Let t(m) = -g(m) + 5l(m). Let v be t(-2). Calculate the highest common factor of v and 40. 5 Suppose -2c + 32 = 4. Suppose -6r + 7r - 7 = 0. What is the greatest common factor of c and r? 7 Let n be 642/8 - (-1)/(-4). What is the highest common factor of n and 10? 10 Let r(p) = -8p - 16. Let y be r(-3). What is the highest common factor of y and 8? 8 Let q(n) = n2 - 3n + 9. Let f be q(6). Calculate the greatest common factor of f and 1. 1 Suppose -2h + 3i = -74 - 37, -58 = -h + 2i. Calculate the greatest common divisor of 32 and h. 16 Suppose 0 = 4h - 16, -5h + 42 = 5f - 3. Calculate the highest common divisor of 5 and f. 5 Let c = -14 + 41. Let p = 29 + -20. Calculate the highest common divisor of c and p. 9 Let s(z) = -5z + 21. Let t be s(4). What is the greatest common divisor of t and 13? 1 Suppose 0 = -2g + 14 + 16. Suppose 2n = g + 21. Let f = 137 + -92. What is the highest common factor of f and n? 9 Let u = -10 - -37. What is the highest common divisor of u and 27? 27 Let y be 10/35 + 26/7. Suppose 123 = 5s + b, 0 = -s + ys - b - 69. Calculate the highest common divisor of s and 36. 12 Let n(j) = 2j*2 + 15j + 25. Let z be n(-10). What is the greatest common divisor of 30 and z? 15 Suppose -2v + 0v - 4 = 0, 3i = v + 17. Suppose -3a + 41 - i = 0. What is the grea	{ "pile_set_name": "DM Mathematics" }
(c) -12/1529 (d) -4/9 c What is the seventh biggest value in -1/6, 2/5, -9, 0.2, -4/95, -0.9, -1.71? -9 Which is the seventh biggest value? (a) -2 (b) 202 (c) 341 (d) -1/2 (e) 18 (f) 0.4 (g) -0.3 a What is the smallest value in 2, 0.5, -2372, -15, 0.02? -2372 Which is the second smallest value? (a) 40 (b) 25350 (c) -0.21 a Which is the third biggest value? (a) -4.599044 (b) 0.2 (c) 2/27 (d) 2/5 (e) -2/13 c What is the third biggest value in -0.02, 38, -26977? -26977 Which is the second smallest value? (a) 15 (b) 2/9 (c) -4 (d) -0.6 (e) -17 (f) -143 e What is the fourth smallest value in -2/5, 6377, 3/4, 0.4, -0.34? 3/4 What is the smallest value in -0.1, -97, -3712, 0.3, 3/5? -3712 What is the fifth biggest value in -110, -6/7, -0.003, -2, 0.1, 0.4, 21? -6/7 Which is the fifth biggest value? (a) 26 (b) -2/9 (c) -1 (d) 16 (e) -2 (f) -514 e Which is the second biggest value? (a) -2/35 (b) -0.0177 (c) 0.004 (d) -1/7 (e) 1/6 c Which is the third smallest value? (a) -3 (b) 2/9 (c) -4/5 (d) -7 (e) 464 c What is the third biggest value in 13, 116, 2/15, 351/8, 2/11? 13 Which is the fourth biggest value? (a) -2/5 (b) -187803 (c) 1.3 (d) -2 b Which is the third smallest value? (a) 872 (b) 11 (c) 10.987 a What is the second smallest value in 0, 3, 5, 4, 2/6385, -3.8? 0 What is the sixth biggest value in 0.3, -0.5, 4.92, -1, -129, -2/15? -129 What is the fifth biggest value in 3, -0.6, -115, 9, 2/5, -1, -6? -1 What is the fourth biggest value in 5/3, 6/73, 3, 0.03997? 0.03997 Which is the fifth biggest value? (a) 33 (b) 2 (c) -4 (d) -2 (e) -9/10 c What is the second biggest value in -3, 291, 1/3, 0.39, -2, 15? 15 Which is the third smallest value? (a) 7/11 (b) -9643 (c) 2 c Which is the third smallest value? (a) 2/157 (b) -4/7 (c) 17921 c Which is the biggest value? (a) 30746.6 (b) 1/2 (c) 0 a Which is the second smallest value? (a) 1 (b) -108 (c) -304.758 b What is the third biggest value in 26, 12, 1518856? 12 Which is the smallest value? (a) 1/10 (b) -2 (c) 5 (d) 1 (e) 0.03 (f) 0.04216 b What is the second biggest value in 5/14, 8/3, 15, -2, 19/14? 8/3 What is the fourth smallest value in -216, -0.2, 0, 3, 98, -0.5? 0 What is the smallest value in -0.5, -35/3, -18777? -18777 What is the second biggest value in -2/903, -0.2, -0.27, -1/2, -0.18? -0.18 What is the second smallest value in 352, 0.09, 394? 352 What is the fourth biggest value in -11, -9, 328, -485? -485 What is the third biggest value in 1, -1846910, -1? -1846910 What is the third biggest value in -3, -10, -2/15, 13/10, -0.2, 950? -2/15 Which is the third biggest value? (a) 2/5 (b) 0.5 (c) -5 (d) 429 (e) 3 b Which is the fourth smallest value? (a) 2/16825 (b) -16 (c) 0.5 (d) 6 (e) -0.5 c What is the fifth biggest value in -1/3, -0.33, 0.05, 0.1, -4/9, 31, -1/10? -0.33 What is the third biggest value in -1/2, 5/3, -0.024, 4, 44869? 5/3 Which is the fourth smallest value? (a) -0.5 (b) -1/3 (c) 2/53 (d) 1116 (e) 3/4 (f) 5/4 e Which is the fourth biggest value? (a) -42 (b) -1/4 (c) 20 (d) 52 (e) 3 b What is the third smallest value in -0.3, -2, -26, 128473? -0.3 What is the fourth biggest value in 5/2, -30, 234/7, -28? -30 Which is the third biggest value? (a) -2/11 (b) 14 (c) 5 (d) -46 (e) 16/7 (f) 1/2 (g) -2 e What is the third smallest value in 1.9, -187/5, -66, 5/3? 5/3 Which is the fourth biggest value? (a) 4 (b) -2 (c) -0.2 (d) -3 (e) 15 (f) 0.313 (g) -0.5 c Which is the fifth biggest value? (a) -0.5 (b) -244 (c) 811 (d) 5 (e) 2 (f) -5 f Which is the fourth biggest value? (a) 0.2 (b) -2/5 (c) 924740 (d) -1 d What is the smallest value in -77389, -0.3, 0.02, 0.2? -77389 What is the sixth smallest value in -8.7, 2, -2, 1.6, -1/2, 4? 4 Which is the fourth smallest value? (a) 0 (b) -1 (c) 13413/8 (d) 0.02 c Which is the second biggest value? (a) -49.835 (b) -0.00005 (c) -2/9 c Which is the biggest value? (a) 0.1 (b) 6/7 (c) -42 (d) 865 d Which is the smallest value? (a) -9268 (b) -172 (c) 0.7 a What is the third biggest value in 0, 1326, -1, 6, 4, 292/7? 6 Which is the third smallest value? (a) -0.5 (b) -73.69 (c) -49 (d) -3 d What is the fourth biggest value in -3/7, -1/8, 4, -2.5, 79, 1? -1/8 What is the third biggest value in 0.5, 1, 4/3, -85/9, -5, 55, -6/31? 1 Which is the biggest value? (a) 13/3 (b) 750/13 (c) 0.42 b What is the second smallest value in 2.784, -2/3, 1, -0.5, 2/7? -0.5 What is the third smallest value in -7/17, -130/21, -1/3, -5, -0.6? -0.6 Which is the fourth biggest value? (a) 5/11 (b) -84.931 (c) -0.4 (d) 1 b Which is the fourth biggest value? (a) 0.1 (b) -1358631 (c) -1.4 (d) -0.03 b What is the smallest value in -3/7, 65/3, 21, 5, -4, -17? -17 Which is the sixth biggest value? (a) -2/85 (b) 3 (c) 1/9 (d) -279 (e) 2/7 (f) -0.5 d Which is the smallest value? (a) -1/8 (b) 2/11 (c) 1 (d) -2/15 (e) -2/5 (f) 3 (g) 54943 e Which is the second smallest value? (a) -575 (b) -0.901 (c) 0.5 (d) 4 (e) 0.4 b Which is the biggest value? (a) -2 (b) 12 (c) 4 (d) -1 (e) 1/20 (f) -108 (g) 3/2 b Which is the second smallest value? (a) 871/27 (b) -0.4 (c) 0 (d) -26 b Which is the fifth smallest value? (a) 5/4 (b) 4/5 (c) -214.8 (d) -1/4 (e) 3 (f) 2/3 a What is the third biggest value in -216, 0, -4, -8, -18711? -8 Which is the biggest value? (a) -0.11 (b) -0.07 (c) 2/15 (d) -2 (e) -0.053 (f) -33 (g) -4 c Which is the third smallest value? (a) -2.56 (b) 4/3157 (c) 8 c Which is the fourth smallest value? (a) -8249 (b) -0.7 (c) 2/119 (d) 0.3 (e) -0.1 c What is the second biggest value in -5, -92979, -98? -98 Which is the smallest value? (a) -1/4 (b) -2 (c) 3 (d) -2/7 (e) 0.1 (f) 0.3 b What is the third smallest value in 15.3, -245, -19, -9? -9 What is the sixth biggest value in -84, -5/3, 2, -64, -1/7, -1, 4? -64 Which is the sixth smallest value? (a) 0.37805 (b) 1 (c) -1/23 (d) 4/5 (e) -2/5 (f) -4 b What is the biggest value in 0.4, -25/3, -425, -2, 0.0913, -3? 0.4 What is the smallest value in -3, 1184, 3, 425? -3 What is the second smallest value in -1/9, -2/7, -22, -2.4, 2/29, 0.16? -2.4 What is the smallest value in -0.2, 1892, -1, -29354? -29354 What is the fifth smallest value in 0.3, 2, -2/5, 4, 1/4, -54, 1/3? 1/3 What is the fourth smallest value in 2/26983, -2/41, -1/4, 13, -3? 2/26983 Which is the biggest value? (a) 3/7 (b) 13 (c) 1/6 (d) -341 (e) -16.6 b What is the smallest value in -8819, 0.5, 0.077? -8819 Which is the fifth biggest value? (a) 2 (b) 54355 (c) 9.7 (d) -3 (e) 5 (f) 0 f What is the second biggest value in -2/21, 2484, -0.17? -2/21 What is the third smallest value in -0.1, 65753, 0.2, -2/11? 0.2 Which is the biggest value? (a) 5 (b) 0.5 (c) 2 (d) 40 (e) 1/7 (f) 4.25 d Which is the sixth biggest value? (a) -4 (b) -1/5 (c) -4/93 (d) -2 (e) 60 (f) 1 (g) -0.037 d Which is the sixth biggest value? (a) -2/9 (b) -5/4 (c) 3.7 (d) -11.3 (e) 1/11 (f) 0.2 d Which is the fifth biggest value? (a) 0.2 (b) -5 (c) 2/103 (d) -2/5 (e) -0.7 (f) -30/11 (g) 2/7 e What is the third smallest value in -3/8, 7/27, 4, -0.216? 7/27 What is the biggest value in -7, -0.01, 3, -16/9, 0.16? 3 What is the biggest value in 0.138, -489/25, 4? 4 What is the smallest value in -5450, 2, -2/17, 0? -5450 What is the biggest value in 61, -0.0375, -0.01, -3, 0.4? 61 Which is the sixth biggest value? (a) -3 (b) -1 (c) -1/2 (d) -288/41 (e) -0.2 (f) -38 f What is the fifth smallest value in -0.18, -1/3, 0.2, -5, 0.5? 0.5 What is the smallest value in -11/25, 7/20, 13, -1/10, -0.5, 0.4? -0.5 Which is the biggest value? (a) -5/3 (b) 2/897 (c) 0.1 (d) -948/23 (e) -17 c What is the fourth smallest value in -4, -20, -3, -9, 98? -3 Which is the smallest value? (a) 14 (b) -1313 (c) 71 (d) 0.2 b What is the smallest value in -14/13, -1/5, 1239? -14/13 Which is the sixth biggest value? (a) -5 (b) -22 (c) -0.0693 (d) -0.3 (e) 4 (f) 0.2 b What is the fifth biggest value in -1/3, -0.5, 3216, 1/3, -0.2, -2, 0? -1/3 Which is the second smallest value? (a) 4 (b) -257 (c) -13/6 (d) -1/453 c What is the fourth biggest value in 1.8407, 1/12, 7, -7? -7 Wha	{ "pile_set_name": "DM Mathematics" }
f 0v + 19/2v*3 + 7/30v*6 + 0v*5 + 0v*4 + 90v*2 + 0. Differentiate j(f) with respect to f. 84f*2 What is the second derivative of 306s*4 + 1872s + s*3 + 2878s + 5700s + 2s*2 - 2287s*4 wrt s? -23772s*2 + 6s + 4 Let h(j) = 50j4 - 5j*3 + 3. Let x(l) = 1 + 6l*4 - 28l*3 - 7l*4 + 27l*3. Let g(n) = h(n) - 5x(n). What is the derivative of g(q) wrt q? 220q3 Let v be (-220)/15(19/(-4) - -4). Differentiate vo + 5o - 16o - 101 - 141 + 247o*2 wrt o. 494o Let u be (-200)/900 - 4/(-18)73. Suppose x + q - 65 = -14, -x = 4q - 54. Find the second derivative of 50 - uy + 5y*3 - x wrt y. 30y Let b(z) = 7z + 1. Let g(p) = 487p + 1219. Let d(f) = -13b(f) - g(f). What is the derivative of d(m) wrt m? -578 What is the derivative of 629139 + 2174f*3 - 633727 + 938f*3 wrt f? 9336f*2 Suppose -57r + 2444 = -2230. What is the third derivative of -ri2 - 1 + 7 + 54i*6 + 3 - 9 - i wrt i? 6480i*3 Find the third derivative of 1 - 3t*2 + 1 - 3t*2 - 95785t*6 + 95314t*6 wrt t. -56520t*3 Let v(r) be the third derivative of -1367r*9/252 + 1421r*5/30 + 662r*2 + r - 2. Find the third derivative of v(c) wrt c. -328080c*3 Suppose -47t + 52t = -3h + 169, t - 43 = 4h. What is the second derivative of 10p*4 + tp + 42p - 61p*4 + 12p wrt p? -612p2 Let c(o) = o3 - 5o*2 + 7o - 7. Let w be c(4). What is the second derivative of 5t + 8tw + t2 + 114 - 112 - 7t2 wrt t? 160t*3 - 12 Let t(f) = 2f2 + 24 + 55 - 10 - f2 + 20f. Let k(g) = -22g - 68. Let s(i) = -3k(i) - 2t(i). What is the derivative of s(p) wrt p? -4p + 26 Let w(v) = -76v*3 - 11v*2 + 3396v + 2. Let j(a) = 380a3 + 57a*2 - 17006a - 11. Let z(d) = 4j(d) + 22w(d). Find the second derivative of z(q) wrt q. -912q - 28 Let l(w) = -565w*3 - 19w*2 + 5w - 465. Let k(x) = 574x3 + 13x*2 - 5x + 464. Let m(s) = -4k(s) - 3l(s). Find the second derivative of m(d) wrt d. -3606d + 10 Suppose -5p + 4p = -3x + 169, 0 = -5x - p + 295. Find the third derivative of -3 + xn*5 - 15n*2 + 8n*2 + 5n*2 - 4 wrt n. 3480n*2 Suppose 0n = 7n - 182. What is the second derivative of -35m - 8m3 + nm*3 + 2m*3 + 18m*3 wrt m? 228m Suppose 6r - 169 = 29. What is the derivative of 116i - 16 + r - 22 wrt i? 116 What is the third derivative of 2 + 3272d2 + 352d*6 + 127d*6 - 128994d*4 + 128996d*4 - 3d*3 + 4d*3 wrt d? 57480d*3 + 48d + 6 Let d(y) be the first derivative of -3327y4/4 + 2y*3/3 + 123y + 10580. What is the third derivative of d(c) wrt c? -19962 Let o(s) be the third derivative of -37s2 + 0s + 0s3 + 1/210s*7 + 0 - 17/120s*6 - 211/24s*4 + 0s*5. What is the second derivative of o(h) wrt h? 12h*2 - 102h Let n = 1 - -4. Suppose 2o + 26 = 10 + 34. Find the second derivative of -3s + os5 + 15s*n - s - 8s*5 wrt s. 320s*3 Find the first derivative of 833w*2 - 3w + 1075 + 566w2 + 679w*2 - 1022w*2 wrt w. 2112w - 3 Let r(a) = 24072a3 + 572a*2 + 16a + 119. Let g(t) = 8026t3 + 191t*2 + 5t + 37. Let k(n) = 16g(n) - 5r(n). Find the third derivative of k(j) wrt j. 48336 Let n(s) = -s*3 + 11s*2 - 20s + 20. Let j be n(9). Find the third derivative of 9g2 + 81g*6 - 2 + 6g*j - 97g*6 wrt g. -1920g*3 Let x(s) be the second derivative of -689s*6/10 - 325s*3/3 + 3s + 55. What is the second derivative of x(i) wrt i? -24804i2 What is the third derivative of -1071t*2 - 59t*5 - 7t*4 + 2t*3 + 2688605t - 2688610t + t4 wrt t? -3540t*2 - 144t + 12 Suppose 0 = -7g - 63 - 217. Let f = -32 - g. Differentiate -fm*4 + 4 + 3 - 12m*4 wrt m. -80m*3 Let k(s) = 180s*4 - 3s*3 - 18s*2 + 4s + 44. Let u(z) = -z*3 - 6z*2 + 2z. Let i(f) = k(f) - 3u(f). Differentiate i(t) wrt t. 720t3 - 2 Let g(u) be the third derivative of -u5/20 + 145u4/24 - 529u*3/3 + 1185u*2. What is the first derivative of g(j) wrt j? -6j + 145 Let a = 378 - 375. Differentiate -2q2 - 11q*a - 37q*3 - 169 + 12q*3 with respect to q. -108q*2 - 4q Suppose 2a + 9 = -3h, 0 = 5a + 11h - 6h + 10. What is the second derivative of -12d*a - 16 + 20 - d + 0d*3 wrt d? -72d Suppose -36z - 33 = 147. Let f(l) = -168l + 152. Let y(h) = h + 2. Let u(o) = zy(o) + f(o). Differentiate u(i) wrt i. -173 Suppose 22r = 21r + 17. Differentiate 0d*3 + 24 + rd4 - d3 + 9 + 24 - 4 with respect to d. 68d3 - 3d*2 Find the second derivative of 1175243 + 980a*4 + 764a*4 - 1175243 - 274a*4 - 1345a wrt a. 17640a2 Let c(t) be the third derivative of -9t*5/10 + 37t*4/12 + 17t*3 - 6t*2 - 6. Let u(f) be the first derivative of c(f). Differentiate u(g) wrt g. -108 Let r = 24 + -6. Let s be 144/54r/4. Find the second derivative of -12c2 + 19 - 31 - 2c + s wrt c. -24 Let s(n) be the second derivative of -2n7/21 - 7n6/6 + n3/6 - 5465n2/2 + 1938n. What is the second derivative of s(h) wrt h? -80h3 - 420h*2 Let q(t) be the third derivative of -131t6/60 + t5/30 + 185t3/3 + 2263t*2. Find the first derivative of q(c) wrt c. -786c*2 + 4c Let t(d) be the third derivative of d7/105 + d6/30 + 11d5/60 - 4003d*4/24 + 95d*2. Find the second derivative of t(f) wrt f. 24f*2 + 24f + 22 What is the third derivative of -388p6 - 847p3 - p2 + 846p3 - 256p*6 + 2p*2 + 393p + 2p4 wrt p? -77280p*3 + 48p - 6 Let y(b) = -50b2 - 8b - 164. Let x = 36 + -37. Let p(r) = -r*2 - r + 1. Let j(v) = xy(v) + 5p(v). Differentiate j(h) with respect to h. 90h + 3 Let l be 7 + -2(-4 - -6). What is the first derivative of 4f*2 - 5 + 65f*l + 4 + 55 + 65f*3 - 143f*3 wrt f? -39f*2 + 8f Let q(y) = -75 + 9y + 28 - 63y*3 + 40 + 9y. Let s(w) = -125w3 + 38w - 16. Let l(k) = 13q(k) - 6s(k). What is the second derivative of l(u) wrt u? -414u Let l = -123 - -115. Let w be (-18804)/l(-6)/(-9). Find the third derivative of 1567u + 14u*2 - wu + 11u5 wrt u. 660u*2 Let n(y) = 171y*5 + 2616y*2 - 2y - 2. Let o(a) = -513a5 - 7848a*2 + 7a + 7. Let l(v) = 7n(v) + 2o(v). What is the third derivative of l(f) wrt f? 10260f2 Let s = -73 + 77. Find the third derivative of -8d*2 + d + 31d*s + 30d*4 - 3d*3 - 5d*2 - 44d*4 wrt d. 408d - 18 Let s(y) = -237 - 38y + 5y + 13y + 6y + 6y. Let z(g) = -4g - 2. Let r(w) = -s(w) - 3z(w). Differentiate r(j) wrt j. 20 Let d(n) be the third derivative of 284n*6/5 + 1237n*3/6 - 3n*2 - 100n + 1. Differentiate d(w) wrt w. 20448w2 Let y(o) be the first derivative of -18o*7/7 - 51o5/5 - o4/4 + 8o3/3 + 3199. Find the third derivative of y(j) wrt j. -2160j*3 - 1224j - 6 Let c(k) = 2521k2 - 96k - 6. Let n(g) = 2521g2 - 97g - 10. Let v(b) = 3c(b) - 2n(b). What is the second derivative of v(q) wrt q? 5042 Let c(f) = -754f3 + 32f*2 - 3f - 5. Let o(n) = 2261n3 - 98n*2 + 10n + 17. Let r(l) = -10c(l) - 3o(l). What is the third derivative of r(h) wrt h? 4542 Let l(p) be the third derivative of -3/10p7 + 2 - 1/60p*6 + 5p*2 - 1/6p*3 + 0p + 0p5 - 11/12p*4. Find the second derivative of l(g) wrt g. -756g*2 - 12g What is the third derivative of 107z2 + 107z*2 + 111z*2 - 27z + 110z2 + 1268z*3 - 428z*2 wrt z? 7608 Suppose 4c + 4z - 16 = 0, -2z = -3c - 3z + 10. What is the second derivative of 3s2 - 6s*2 + 67s - 2s3 - 2s*3 + 27s*c wrt s? 138s - 6 What is the second derivative of 29384951z2 - 29380463z*2 + 7z + 26z + 1 wrt z? 8976 Differentiate -891t + 199 - 64 - 26 with respect to t. -891 Let k(s) be the third derivative of -2488s7/105 + 9871s*3/6 + 3118s*2. Find the first derivative of k(x) wrt x. -19904x3 Let c(x) be the third derivative of -x8/336 + 116x7/105 + 6043x*4/24 + 6x*2 + x - 2. Find the second derivative of c(j) wrt j. -20j*3 + 2784j*2 Find the third derivative of -466z*6 - 2 + 577z*6 - 603z*6 + 4 - 1795z*6 + 5165z*2 wrt z. -274440z*3 What is the second derivative of 1121b + 2083b2 - 1364b + 1780b wrt b? 4166 Let h(a) = a3 + a2 + a - 2. Let f(o) = -2o*4 + 1097o*3 + 6823o*2 - 2o + 4. Let m(t) = f(t) + 2*h(t). Find the third derivative of m(u)	{ "pile_set_name": "DM Mathematics" }
2d - 3f = -24. Does 4 divide x(d)? True Let n(m) = 104m + 2206. Is n(61) a multiple of 10? True Suppose -10 = -3k + 8. Suppose -14 = -2w - 2m, 2w + km - 16 = 2m. Suppose -wy - 39 = -7y. Is y a multiple of 12? False Is 4/(-22) - (1829850/121)/(-15) a multiple of 16? True Let p be 36/(-10)-3 + 4/20. Suppose 3029 - 730 = pw. Does 11 divide w? True Let n = -93 + 93. Does 102 divide (-2095 - n - -1)126/(-252)? False Does 43 divide 36/162 - 397044/(-81)? True Suppose -27u - 12405 + 579 = 0. Let n = 449 + u. Is n a multiple of 3? False Let k be 484/(-110) + 4/10. Let p be 2386/(-10) + (-16)/40 - k. Let c = p - -501. Is 50 a factor of c? False Let h(x) = 151 - 9x*2 - 22 + 12x*2. Is 7 a factor of h(0)? False Let s(i) = 54i + 4 - 55i + 2 + i3. Let u be s(-4). Does 7 divide (-4 + 3)-1 - u? False Let k(p) = 3p2 - 45p - 107. Does 11 divide k(63)? True Does 14 divide 70/(-50)(10 - 2)600/(-5)? True Let v = 2441 - 1589. Does 12 divide v? True Let g(d) be the third derivative of 13d4/24 - 7d*3 + 2d*2. Suppose 4z + 8y + 16 = 0, -7 = 2z + 5y + 6. Is 9 a factor of g(z)? True Let q = 678 + -1616. Let m = q - -1391. Is 12 a factor of m? False Suppose -t - 147 = -4x + 275, 3t + 6 = 0. Suppose -4d - 29 = v - 3d, 5v = 5d - x. Let c = -19 - v. Is 3 a factor of c? True Does 20 divide (5/(-2))/(15/30) + 12765/1? True Let u(m) = 272m. Let a be u(1). Let t = 460 - a. Suppose 0 = -j + 1, -2g + 96 + t = -4j. Does 34 divide g? False Let h(j) = -11j3 + 18j*2 - 35j + 56. Does 38 divide h(-10)? False Let g = -76 + -67. Let n = g - -594. Is 49 a factor of n? False Let p be -23063/6 - -4. Let s = -704 - p. Does 48 divide s? False Let q be (-441)/984/(-6). Suppose -45 - 52 = -qz + 5b, -4z - 4b + 140 = 0. Is z a multiple of 34? True Let x = -1 + 121. Suppose 0 = 122v - xv - 6. Suppose vy - 521 = -5f, 0y + 5f + 571 = 3y. Is y a multiple of 47? False Let h(v) = -9v*2 - 6v + 32. Let f(t) = 9t2 + 7t - 32. Let p(x) = -6f(x) - 7h(x). Does 8 divide p(-4)? True Let b(o) = -15o - 20. Let d be b(-2). Suppose 33 = -9w + dw. Is 9 a factor of w? False Suppose l - 3p + 5p - 386 = 0, -3l + 1154 = 4p. Let x = -248 + l. Is 14 a factor of x? False Suppose 3v - 14 = 4. Suppose f = z - vz + 352, 4f - 8 = 0. Does 14 divide (1(-24)/10)/((-3)/z)? True Let t = 2041 - 438. Let d = -936 + t. Is 23 a factor of d? True Suppose 6j - 8j + 5400 = 16j. Is j a multiple of 25? True Let b = -13147 + 20389. Does 51 divide b? True Let k = -271 - -146. Let t = k - -132. Suppose -tj + 184 + 124 = 0. Is j a multiple of 22? True Let k(i) = -16848i - 254. Is 242 a factor of k(-3)? False Let p(y) = -950y - 1225. Is p(-6) a multiple of 18? False Suppose 4t - 27185 + 7258 = 3g, 3t = -5g + 14938. Is t a multiple of 17? True Let c(i) = -i3 + 10i*2 + 11i - 11. Let m = 145 + -150. Is 9 a factor of c(m)? False Let z(c) = 52c2 + 16c - 44. Does 154 divide z(9)? True Suppose 2t = -3q + 28, -4t = -2q - 2t + 2. Is 318/(-4)(-8)/q a multiple of 106? True Let u = 134 + -140. Is 2 a factor of ((-40)/15)/(u/63)? True Suppose 0 = 3k - 10k + 203. Suppose -24d - 15 = -kd. Suppose -df + 66 = -54. Does 25 divide f? False Let t = 59 - 5. Let g = -6 + t. Suppose -j + 2a + g = 0, -4a + 122 = 3j + a. Does 11 divide j? True Let h = 36277 - 1429. Is h a multiple of 72? True Suppose -15 + 6 = -3m - 4q, 5q = -m + 3. Suppose m = -11j + 58. Suppose -d - jy + 31 = -35, 369 = 4d - y. Is d a multiple of 52? False Let x be -18 - (-5 + (-9)/(-3)). Let j be x/(-4 - 72/(-20)). Let z = 72 - j. Does 8 divide z? True Let h(c) = -103c - 7320. Is 20 a factor of h(-80)? True Suppose 48b - 16523 + 5435 = 0. Is 7 a factor of b? True Suppose 4x - 16w - 43456 = -11w, 0 = 6x + 4w - 65092. Is x a multiple of 15? False Let n(u) be the second derivative of 13u*4/12 - 13u*3/6 - 19u*2/2 - 97u - 1. Is 41 a factor of n(-5)? False Suppose 3h - 3 = 3, -5n - 2h = -3744. Suppose -3v = -5o - 0o - n, 736 = 3v + o. Let b = v - 175. Is b a multiple of 25? False Does 11 divide (22/(-6))/(((-1)/(-18))/((-6696)/48))? True Suppose -2a + 4t + 93832 = 0, 3a + 284t - 286t = 140756. Is 184 a factor of a? True Suppose 33 = 5a - 3l, -3l + l = -a + 8. Let b(p) = -8p - 176. Let m be b(-30). Suppose -h = -2y - m, h + 4y = ah - 338. Does 15 divide h? False Is 70 a factor of (-22 - 430/(-20))/(2/(-788))? False Let d(w) = -89w + 14 + 9 + 42w2 + 96w. Is 19 a factor of d(-3)? True Let t = -1953 - -4215. Is t a multiple of 58? True Let m(n) = -2n2 - 2n + 2. Let z be m(1). Is 2 a factor of 35/(4 + z + -1)? False Suppose -2a + 406 = -2k, 121 - 336 = k + 2a. Let l = -624 - k. Let s = -297 - l. Is s a multiple of 30? True Suppose 5r - 453 = -118. Suppose -8g = 427 - r. Let l = g + 66. Is l a multiple of 7? True Suppose -97953 - 12297 = -49x. Is 125 a factor of x? True Let r(x) = 41x2 - 8x - 223. Does 4 divide r(13)? False Suppose y + 3659 - 3174 = 0. Let n = y - -736. Is 15 a factor of n? False Let i(g) = -2g3 - 16g*2 + g + 11. Let u be i(-8). Suppose -j - 4 = -5j, -2c + uj = 31. Does 21 divide (-56)/(-6)((-175)/c + -8)? True Let f be (5/2)/((-3)/(-18)). Let p be 50/(-3)18/f. Is 14 a factor of ((-378)/30)/(3/p)? True Suppose 0 = -a - 5m + 238, a - 117 = 3m + 81. Let q be 31 - (-3 + 7 - 6). Let l = a - q. Is 13 a factor of l? False Let s be 21/2(1 - (-5)/15). Suppose -3l + 3 = 5n - s, -l + 1 = -3n. Suppose -4j - f = -548, l = f - 0. Is j a multiple of 34? True Let t = -464 + 491. Suppose 21o + 168 = to. Is o a multiple of 8? False Suppose 222g = 245g. Suppose g = 27x - 4542 - 12549. Is x a multiple of 11? False Let a be 345510/(-405) - 1/(-9). Let w = a + 1805. Is w a multiple of 56? True Suppose -b + 12767 = 2k, -3b + 8b + 5 = 0. Does 14 divide k? True Let n(o) = -9o + 237. Let f be n(26). Let i(v) = 45v - 79. Is i(f) a multiple of 56? True Suppose 4i - 16 = 4p + 384, 276 = -3p - 5i. Let y = 881 + p. Is 24 a factor of y? False Suppose 0i - 140 = -5i. Let l = i - 14. Is ((-22)/(-10))/(l/140) a multiple of 11? True Suppose -x + 0x = -a - 2, 5x - 8 = 3a. Let z = -1 + x. Suppose 4l + 472 = 3k, z = k + 4k - 4l - 776. Is k a multiple of 8? True Let n be (5/(-30)-9)/(4/2592). Suppose -19z + n = -3892. Is 32 a factor of z? True Let p(g) be the first derivative of -3g2/2 + 13g + 14. Let r be p(8). Let c = 25 - r. Does 6 divide c? True Let l(t) be the second derivative of -t5/4 - t4/3 - 7t3/2 - 6t*2 + t + 11. Is 30 a factor of l(-6)? True Suppose 5a = 15, -k - 2k - 4a - 108 = 0. Let u = 80 + k. Does 8 divide u? True Let w(n) = 7n2 - 2n + 1. Let b be w(1). Suppose 884 = bo + 164. Suppose 4a + o = 2p, -2p - 102 = -4p - 2a. Is p a multiple of 6? True Let n be 1 + 358 + (-12)/4. Suppose -9i = n - 1364. Suppose 2t - t = 2f - i, t - 50 = -f. Is f a multiple of 6? True Let o(i) = i2 - 10i + 454. Does 48 divide o(99)? False Let x(u) = -u*2 + 17u - 10. Let o be x(12). Let f = o + -48. Suppose 68 = fs + 2s. Does 3 divide s? False Let k(f) = 47f - 180. Let y be k(4). Does 10 divide 736 + (y - 13 - 1)? True Let t be (1 - (-10)/25) + 864/(-60). Suppose -4 = p + 5. Is (184/(1 + p))/(1/t) a multiple of 45? False Let p = -202 - -232. Does 18 divide p(-3)/(-30)48? True Suppose 3 = 7q - 32. Suppose 2 - 1 = 2a - i, i = -a + q. Does 3 divide -4(18/(-4) - (a - 4))? False Suppose -154t - 93t = -6t - 5946193. Is 81 a factor of t? False Suppose -189 = 12n + 315. Does 23 divide 1/(-3) + (-7742)/n? True Does 168 divide ((589/(-57) - -15) + -18)6351/(-4)? False Let l(k) = 67 - 8k2 + k3 - 35 - 31 + 13k. Let p be l(6). Suppose 0 = 3s - p + 10, -89 = -2z + 3s. Is 3 a factor of z? False Suppose 16050 = 18f - 3f. Let z = f - 806. Does 11 divide z? True Let i(k) = 215k2 + 106k + 1039. Is i(-9) a multiple of 28? True Let f(x) = 6x3 - 30x*2 + 83x - 103. Is f(14) a multiple of 121? False Suppose -38t = -1315028 + 12008. Is t a multiple of 27? True Let k(b) = 2b*2 + 16b - 224. Is k(-24) a multiple of 4? True Suppose 10f + 5n = 6f + 9353, 0 = 4n - 20. Is f a multiple of 18? False Is (234/(-312))/((2/(-226932))/((-4)/(-9))) a multiple of 83? False Let k = 22 - 2	{ "pile_set_name": "DM Mathematics" }
2400 = 0. -5, 10, 24 Factor -s*2/8 - 1201s/8 - 1797/4. -(s + 3)(s + 1198)/8 Factor 3f*3/2 + 846657f*2/2 + 29866778136f - 149344474080. 3(f - 5)(f + 141112)*2/2 Factor 2u*3/13 + 392u*2/13 - 4920u/13 + 1152. 2(u - 6)2(u + 208)/13 What is z in -10z4/3 + 32782z*3/3 - 26804086z*2/3 - 34118578z + 7181016 = 0? -4, 1/5, 1641 Suppose 81y5 - 303714y*4 + 284630629y*3 + 126547500y*2 + 14062500y = 0. What is y? -2/9, 0, 1875 Find m, given that -24m4/5 + 4m*3/5 + 116m*2/5 - 16m/5 - 16 = 0. -2, -5/6, 1, 2 Let -3n4 - 114n*3 - 1011n*2 - 900n = 0. Calculate n. -25, -12, -1, 0 What is j in -j*4/6 - 177j*3/2 + 6481j*2/6 - 6335j/2 = 0? -543, 0, 5, 7 Let 2v3/5 + 428v*2/5 - 20622v/5 + 225792/5 = 0. Calculate v. -256, 21 Factor b*4/5 - 369b*3 + 226935b*2 - 46521675b. b(b - 615)3/5 Factor -4r*2 + 246840r - 3808124100. -4(r - 30855)2 Let -5x*2 + 7499240x - 2811930028880 = 0. What is x? 749924 Determine h, given that 40h5 + 52580h*4 - 52795h*3/2 - 128255h*2 - 111785h/2 - 6575 = 0. -1315, -1, -1/4, 2 Find g, given that 2g2/3 + 128g/3 - 2400 = 0. -100, 36 Find v such that 2v2 + 526v + 32204 = 0. -166, -97 Find v such that v*3 + 29v*2 - 202v + 280 = 0. -35, 2, 4 Factor 5t2 + 3440t + 588035. 5(t + 317)(t + 371) Solve -d*5/7 - 2165d*4/7 - 1190055d*3/7 - 19744335d*2/7 - 72495000d/7 + 93431556/7 = 0. -1074, -9, 1 Factor 2o2/11 - 4014396o/11 + 2014421905602/11. 2(o - 1003599)2/11 Solve 45586297352q*2/11 - 603896q/11 + 2/11 = 0. 1/150974 Determine o, given that 4o2 + 50484o + 50480 = 0. -12620, -1 Find t, given that -t*2 - 259904t - 16887522304 = 0. -129952 Factor -i*2/3 + 50i/3. -i(i - 50)/3 Find k, given that -88k*2 - 3076k/5 + 28/5 = 0. -7, 1/110 Factor 3l2 - 43963l - 29310. (l - 14655)(3l + 2) Find t, given that 9t5 + 168t*4 + 951t*3 + 1392t*2 - 576t = 0. -8, -3, 0, 1/3 Factor 9b3/4 - 143b*2/4 - 4b. b(b - 16)(9b + 1)/4 Suppose -2l*2/9 + 18036l - 365959458 = 0. What is l? 40581 Find i such that i*5/4 + 23i*4/4 - 485i*3 - 5701i*2 - 4220i + 10400 = 0. -52, -10, -2, 1, 40 Factor 3w3/2 - 261w*2/2 + 1641w - 1512. 3(w - 72)(w - 14)(w - 1)/2 Suppose 2c*5 + 850c*4 + 2538c*3 + 2534c*2 + 844c = 0. Calculate c. -422, -1, 0 Factor 1568o2/15 - 336o/5 + 54/5. 2(28o - 9)2/15 Solve -y4/5 + 37y3/5 - 427y*2/5 + 1371y/5 + 1836/5 = 0 for y. -1, 9, 12, 17 Find x, given that -x*4 + 8990x*3 + 135000x*2 + 675250x + 1125625 = 0. -5, 9005 Find b such that b*2 - 74957b - 374810 = 0. -5, 74962 Factor a*4/5 + 1884a*3/5 - 5658a*2/5 + 1132a - 1887/5. (a - 1)*3(a + 1887)/5 Factor 5n3 - 1780n*2 - 13305n + 217800. 5(n - 363)(n - 8)(n + 15) Find b, given that -4b*2 + 328b + 5376 = 0. -14, 96 Factor 484p3/5 + 1716p*2/5 - 864p - 15552/5. 4(p - 3)(11p + 36)2/5 Factor -3q*2 + 3759q - 649566. -3(q - 1046)(q - 207) Factor c*2 + 502c - 15399. (c - 29)(c + 531) Factor -n3 - 1063n*2 - 18842n - 33440. -(n + 2)(n + 16)(n + 1045) Factor -j*4 + 2057j*3 + 8244j2. -j2(j - 2061)(j + 4) Find q, given that -5q4 + 500q*3 - 12945q*2 + 20090q + 96040 = 0. -2, 4, 49 Find h, given that -2h2/11 + 34926h = 0. 0, 192093 Solve -3c4/2 + 17784c*3 - 71118c*2 + 71112c = 0. 0, 2, 11852 Factor 3m3 + 507m*2 - 33003m - 33507. 3(m - 51)(m + 1)(m + 219) Let -3t*2/4 - 17502t - 102106668 = 0. What is t? -11668 Suppose -18u4 + 264723u*3 - 485277u*2 + 176457u + 44115 = 0. Calculate u. -1/6, 1, 14705 Factor -2n2/7 + 60126n/7 - 120244/7. -2(n - 30061)(n - 2)/7 Factor 2r2/7 - 604r/7 + 9152/7. 2(r - 286)(r - 16)/7 Find o, given that -4o3 + 256o*2 + 10196o + 9936 = 0. -27, -1, 92 Solve 18q3/7 - 17058q*2/7 + 11366q/7 - 1894/7 = 0 for q. 1/3, 947 Let -2a2 - 47064a - 276877512 = 0. Calculate a. -11766 Factor -c*5/6 + 487c*4/6 - 19845c*3/2 + 19683c2/2. -c2(c - 243)2(c - 1)/6 Factor n*5 + 127n*4 + 251n*3 + 125n2. n2(n + 1)2(n + 125) Let 5c3 + 76220c*2 + 152420c = 0. Calculate c. -15242, -2, 0 Factor 3k4 - 801k*3 + 3954k*2 - 6300k + 3144. 3(k - 262)(k - 2)*2(k - 1) Factor -d*4/3 - 127d*3/3 - 390d2. -d2(d + 10)(d + 117)/3 Determine v, given that -2v4/3 + 704v*3 - 555452v*2/3 - 372416v - 559682/3 = 0. -1, 529 Factor 2p2 - 65100p + 529751250. 2(p - 16275)2 Factor 9g*3 + 16536g*2 - 210539g + 667850. (g + 1850)(3g - 19)2 Factor -i2 + 916i. -i(i - 916) Determine b so that -b*3/5 + 16656b2/5 + b/5 - 16656/5 = 0. -1, 1, 16656 Let u2 + 57u - 670 = 0. What is u? -67, 10 Factor 2h*3 - 490h*2 - 3002h - 2510. 2(h - 251)(h + 1)(h + 5) Factor -g3/5 - 8g*2 + 1651g/5 + 338. -(g - 26)(g + 1)(g + 65)/5 Solve 2r4/9 + 117412r*3/9 + 574477342r*2/3 + 6892319224r/9 + 6891849608/9 = 0 for r. -29351, -2 Factor 3m3 + 16893m*2 + 67536m + 67524. 3(m + 2)2(m + 5627) Suppose t*4/2 + 17919t*3/4 + 40149751t*2/4 + 60139533t/4 - 100307205/4 = 0. What is t? -4479, -5/2, 1 Find v, given that -v*4/6 - 187v*3/6 - 807v*2/2 + 187v/6 + 1211/3 = 0. -173, -14, -1, 1 Solve -5n3 + 327008n*2 + 457819n + 130806 = 0. -1, -2/5, 65403 Suppose -20b3 + 8928b*2 + 23372b - 10776 = 0. What is b? -3, 2/5, 449 Let 2j2 - 9608j + 9606 = 0. What is j? 1, 4803 Determine a, given that -2a2/5 + 2028a/5 - 389098/5 = 0. 257, 757 Solve 3j4 - 14055j*3 + 16299024j*2 + 382689780j - 398974752 = 0. -24, 1, 2354 Suppose c*3 + 48c*2 - 12649c = 0. What is c? -139, 0, 91 Determine l so that -87l5 - 59319l*4/2 - 171321l*3/2 + 7953l*2 + 117594l - 10140 = 0. -338, -2, 5/58, 1 Let -5p3/7 - 618647p*2/7 + 989852p/7 + 494924/7 = 0. What is p? -123731, -2/5, 2 Let 268t4 + 280t*3 - 524t*2 - 24t = 0. What is t? -2, -3/67, 0, 1 Find a, given that 3a2 + 193884a + 3132583788 = 0. -32314 Factor 2m2/5 - 10588m/5. 2m(m - 5294)/5 Determine d, given that -4d2 + 184500d + 922600 = 0. -5, 46130 Factor 9z3 - 7224z*2 - 9648z. 3z(z - 804)(3z + 4) Factor 3v3 - 28707v*2 + 68659965v + 68688675. 3(v - 4785)2(v + 1) Solve -4d5/3 - 620d*4/3 - 15605d*3/3 + 17330d*2/3 + 9575d + 2706 = 0 for d. -123, -33, -1/2, 2 Factor 5s4 - 490s*3 - 4745s*2 - 7490s. 5s(s - 107)(s + 2)(s + 7) Find y, given that y*4/3 + 22y*3/3 + 27y*2 - 412y/3 + 308/3 = 0. -14, -11, 1, 2 Factor 3t2/4 + 44895t/4 + 11223. 3(t + 1)(t + 14964)/4 Determine z, given that 5z2 - 8640z - 78165 = 0. -9, 1737 Factor 3g4 + 591g*3 + 38043g*2 + 817905g + 780450. 3(g + 1)(g + 55)*2(g + 86) Factor -k*2 + 20981k - 20980. -(k - 20980)(k - 1) Let -4i*3/7 - 68i*2 + 10176i/7 - 43056/7 = 0. What is i? -138, 6, 13 Find w such that -w*4/6 + 66981w*3 - 13459363083w2/2 = 0. 0, 200943 Suppose -f3 - 14f2 + 735f = 0. Calculate f. -35, 0, 21 What is v in 2025v4/7 + 77670v*3/7 + 102349v*2/7 + 29072v/7 + 2368/7 = 0? -37, -1, -8/45 Find f, given that 2f3 - 106f*2 + 328f + 3136 = 0. -4, 8, 49 Solve -4c3 + 8c*2 + 12028c + 246016 = 0 for c. -31, 64 Suppose 2u3/9 - 10150u*2/9 - 1128u = 0. Calculate u. -1, 0, 5076 Solve 3l4/4 + 149l*3/2 - 1127l*2/4 + 309l/2 = 0 for l. -103, 0, 2/3, 3 Factor d*2/6 - 80d/3 - 1003/2. (d - 177)(d + 17)/6 Factor 2r*2/11 + 366r/11 + 14884/11. 2(r + 61)(r + 122)/11 Suppose 2d2/21 - 844d/7 + 98080/21 = 0. Calculate d. 40, 1226 Let o*5 - 3513o*4 + 7023o*3 - 3511o*2 = 0. What is o? 0, 1, 3511 Factor -3v*2 + 1812v - 38412. -3(v - 582)(v - 22) Suppose -3s3 - 3378s*2 + 20352s - 27168 = 0. What is s? -1132, 2, 4 Factor 3w3/4 - 7861w*2/4 + 10457w + 7845. (w - 2615)(w - 6)(3w + 2)/4 Let -4w*3/7 + 4630w*2 - 6944w + 16202/7 = 0. Calculate w. 1/2, 1, 8101 Let -5r2 - 1065r - 10150 = 0. What is r? -203, -10 What is c in 51c5 - 183c*4 + 192c*3 - 60c*2 = 0? 0, 10/17, 1, 2 Factor 2n*3 + 1106n*2 - 2n - 1106. 2(n - 1)(n + 1)(n + 553) Factor -10q*4/3 - 60942q*3 - 278562834q*2 - 167115762q. -2q(q + 9141)*2(5q + 3)/3 Suppose 15z*3 + 6325z*2/3 + 1160z - 2800/3 = 0. What is z? -140, -1,	{ "pile_set_name": "DM Mathematics" }
pose -3v + 3 = 0, 4z = -v + 4v + 1. Let j = 1 - z. Suppose j = g - 6g. Solve g - 2 = b for b. -2 Let l = 8 + -4. Suppose 7 = 2t + 25. Let q be 27/t - (-23 + 0). Solve -v - lv = -q for v. 4 Let a = 10 + -6. Suppose -4d + 2 = -6d - aq, 0 = 4d + 3q - 1. Let p be (-28)/(-8) + d/(-2). Solve 7 = 2l - p for l. 5 Let f = -24 + 40. Let n be (0/(1/(-1)))/2. Suppose 4b - b + 2q = 17, 4b - 4q - 56 = n. Solve -b = -5g + f for g. 5 Let c(u) = 2u - 23. Let l be c(13). Solve -4 = -g + lg for g. -2 Let v = 14 - 9. Suppose 3n - 26 + v = 0. Solve 3i - 1 = -n for i. -2 Let l be 0/((-6)/(0 + 3)). Suppose x - 3 = -lx. Solve xa = -1 - 11 for a. -4 Let t(c) = 2c + 16. Let n be t(-7). Solve -p = np for p. 0 Let s = 18 + -14. Solve -6n - 2 = -sn for n. -1 Let g be (-14)/56 - 2/(-8). Solve c - 7 + 4 = g for c. 3 Suppose -4k - 1 - 1 = -5h, 2h + k - 6 = 0. Solve hr + 20 = -2r for r. -5 Let n(j) = j - 1. Let y be n(4). Solve 7 = -yp - 2 for p. -3 Let l be (20/2)/(2 - 0). Suppose -8i + 5i + 27 = 0. Solve lt = -i - 1 for t. -2 Let t be -3(8/(-6))/(-1). Let a(s) = s3 + 5s*2 + 4s + 1. Let y be a(t). Solve 2 + y = -3f for f. -1 Let s(o) = 14o3 + o2 - o. Let j be s(1). Suppose -x - j = -3r, -7 = -r + x - 1. Solve rb - 2b + 4 = 0 for b. -2 Let b = 0 - -3. Suppose 6y - 18 = -2k + by, 5y - 20 = 0. Solve kc = -21 + 6 for c. -5 Suppose 0 = v + 5x - 47, -v + 4x + 5 = -15. Suppose 6s = 10s - v. Solve -z - s + 3 = 0 for z. -5 Suppose 5q - 4g - 6 - 15 = 0, 0 = -5g - 20. Suppose -8j + 57 = -5j. Suppose 11 = -2h + j. Solve ho - q = 7 for o. 2 Suppose 3 = 3d + 5m, 5m + 4 = -2d + 11. Let x(i) = 0 - 2i - 2 - 1 - 2. Let t be x(d). Solve 0 = -to + 7o for o. 0 Suppose -5z = 5f - 50, 2 = 2z - f - 3. Solve m + z = 4 for m. -1 Suppose 5d - 8 = 17. Solve -11 = -dy + 14 for y. 5 Suppose 0q - 45 = -3q. Solve -5 = -4y + q for y. 5 Suppose -z - 24 = -7z. Solve zs = 3s + 4 for s. 4 Suppose 5v = 6 - 16. Let u = -2 - v. Solve u = y - 6y + 15 for y. 3 Let r be (3 - 4)(-3 - 0). Solve rd = 2d - 1 for d. -1 Let p be (-1)/(-2) - 145/(-10). Let h = -6 + p. Solve -m + 4m = h for m. 3 Let w(j) = 3j - 1. Let c be (-2)/(-5) + (-9)/(-15). Let i be w(c). Solve 0o - io = 8 for o. -4 Let c be (3 - 3)1 - 6. Let u = c - -14. Solve 3r = 5 - u for r. -1 Suppose -h + 3 = -3. Let a(s) = s*2 + 4s - 2. Let v(f) = -6f2 - 19f + 11. Let t(y) = 11a(y) + 2v(y). Let b be t(h). Solve b = -5o + 19 - 4 for o. 3 Let h = -8 - -16. Suppose -3m = -hm, k - m - 15 = 0. Solve 5x + 0x - k = 0 for x. 3 Let p = 6 + -6. Suppose 76 = 4k - 2m, 2m - 6m = p. Solve -4b - 1 - k = 0 for b. -5 Suppose 0 = -2b + 5 + 1. Suppose bh - 16 = -h. Solve -2 = -hz + 2 for z. 1 Suppose x - 3h - 1 = 0, 3x - 6x + 2h = -3. Let q(l) = -l2 + 1. Let u be q(x). Solve u - 2 = d for d. -2 Let g(a) = a2 + a + 17. Suppose -2m = 5u - u + 4, u + 4m + 8 = 0. Let y be g(u). Suppose 3w = 4j - 23, 3j + 4w - 11 = -0w. Solve y - 2 = -js for s. -3 Let k = -69 - -73. Let h(p) = -p*2 - 4p - 5. Let x be h(-6). Let d = -10 - x. Solve d = -ky - 9 for y. -4 Let d be (1 - -2) + -4 - 1. Let x be (-3)/d(1 - -1). Solve xb + 2 - 5 = 0 for b. 1 Let h be 0(3 + -12). Suppose c + hc = 0. Suppose 4i - 4u - 12 = c, -5i = -2i + 4u + 12. Solve i = -m - 4m + 10 for m. 2 Suppose -5c + 17c = 8c. Let g(u) = u + 7. Let n be g(-5). Solve -5a + na + 15 = c for a. 5 Let g(q) = -2q*2 - 2q + 1. Let c(m) = 3m2 + 4m - 2. Let j(k) = -4c(k) - 7g(k). Let l be j(2). Let o = 8 + -5. Solve -4a = -oa - l for a. 5 Let u(b) = b*2 + 14b + 14. Let s be u(-12). Let n be 7 - (-5)/(s/(-6)). Solve -2x - 3x - n = 0 for x. -2 Let m = 3 - 0. Suppose -3 = mf - 15. Solve 0 = fk + 10 + 6 for k. -4 Let b = 8 - 8. Solve d = -bd for d. 0 Let m be (-5 + 13)(-1)/(-4). Suppose 6f - mf - 16 = 0. Solve q = fq for q. 0 Let i(p) = -p3 + 5p*2 + 12p + 16. Let z be i(7). Solve 2m + zm = 20 for m. 5 Suppose -3u = -4u + 2. Let t(k) = k*2 - 2. Let q be t(-4). Suppose ui + q = 3i. Solve -5n - 11 - i = 0 for n. -5 Suppose -5i + f + 43 = 0, 0 = -2i + i + 3f + 17. Suppose -5y + 75 = -0y. Suppose 0 = 2n + 7 - y. Solve 2c - nc = -i for c. 4 Let f be (8/6)/(160/(-24) + 7). Let q = 2 + -2. Solve -12 = fd - qd for d. -3 Let n = 24 - 19. Solve 3r - n - 1 = 0 for r. 2 Let a(r) = -r2 + 10r - 6. Let b(p) = -p*2 + 9p - 5. Let u(j) = -3a(j) + 4b(j). Let z be u(4). Solve 3t = -0t - z for t. -2 Suppose 0o - 4o + 12 = 0. Solve or + 2r = -5 for r. -1 Suppose -3i + 8i = 15. Suppose 2f + m - 9 = 0, im = -5f - 0f + 23. Suppose 8 = 11g - 7g. Solve q = g - f for q. -2 Suppose -20 = 3f + 4a, -2a - 14 = -4f - 4. Let p(l) = 2l2 + 4l + 5. Let k be p(-3). Solve f = -2b - k + 3 for b. -4 Let f = -43 - -80. Let g = -17 + f. Solve -4x + 0 = -g for x. 5 Let k(s) = s*3 + 12s*2 + 10s - 6. Let u be k(-11). Solve -u = -2h + 1 for h. 3 Suppose -2n + 0n = 0. Let k = n - -5. Suppose k = x + 2. Solve -x = -s + 4s for s. -1 Let d be (-1)/(-3) - 5/(-3). Suppose -4h = -6 - d. Suppose 0 = 7v - 3v - 20. Solve -vi = -8 - h for i. 2 Suppose 3m - 2m = -2u - 1, -11 = m + 4u. Let q = -37 + 62. Solve -4k - q = -mk for k. 5 Let q be 3/(-2)(-4)/6. Let x = q - 1. Let j = 4 - x. Solve -1 = -l + j for l. 5 Let t be 15/(-10)4/(-3). Let q = 5 - 3. Solve 4c - q = tc for c. 1 Suppose 4l + 1 = 3j + 31, 5l - 35 = 5j. Let m = l - -3. Solve -3n = n + m for n. -3 Let l = -33 + 45. Solve -3o = o + l for o. -3 Let m be -2 - 3/((-3)/11). Let z = 15 - m. Let r = z + -2. Solve rj - 10 = -j for j. 2 Suppose -5c + 3 = -12. Let r be (-6)/c + 25. Solve 5v + r = v for v. -2 Let r(x) = 5x - 10. Let g be r(4). Suppose 5 = 5d - g. Solve -i + di = 0 for i. 0 Suppose 0 = m + 4m. Suppose mn - 3n + 30 = 0. Solve -n = f + f for f. -5 Let p(z) = -z*2 - 2z + 21. Let t be p(0). Suppose -5o = -3v, v - t + 1 = -5o. Solve -3k + o = -3 for k. 2 Suppose 2p - p - 5w - 10 = 0, -3 = 3w. Suppose pf + 15 = 0, 0 = -n + 2f - 2 + 12. Solve 3l - n = 8 for l. 4 Suppose 3g = -g. Suppose -n + 4n = 0. Let b = g - n. Solve 2h - 2 = -b for h. 1 Let g be 48/((-6)/(-2)) + (3 - 0). Solve 3o = -g + 4 for o. -5 Let p(q) = -6q2. Let u(r) = -r2. Let w(c) = -6p(c) + 34u(c). Suppose -5j = 2b - 0b + 4, 6 = -3b - 5j. Let y be w(b). Solve -s - s - y = 0 for s. -4 Let f(c) = c3 - c2 - c - 8. Let n be f(0). Let b be 3 + (3 - n/(-2)). Solve 0 = -5q - 22 + b for q. -4 Let y be ((-14)/21)/(1/(-3)). Suppose 4t = yt + 6. Solve -tg = -g for g. 0 Suppose 4c + 0j = -3j - 43, -4c - 8 = -4j. Let y = c + 7. Suppose 3u = -yu. Solve u = 3d + 7 - 4 for d. -1 Suppose -2l - 20 = -3l. Solve -4f = -0f - l for f. 5 Suppose 0o - 4o = 4r - 96, 3o = 3r + 48. Solve 0 = 4w - o for w. 5 Let p = 25 + -6. Let l = -18 + p. Solve m - 4 = l for m. 5 Suppose 3i + 5g = -16, 3i - 5g - 31 = i. Suppose -a + 2 = -2r, 4r = 2a + ir - 7. Let t be (a/(-6))/(4/(-6)). Solve n + t = 2 for n. 1 Let z be 14/6 + (-3)/9. Let q be 35/z - (-3)/(-2). Solve q = 4f - 0f for f. 4 Let m = 55 - 53. Solve -2 = -mu - 0 for u. 1 Let o be ((-3)/(-12))/144. Let v(y) = y + 1. Let q be v(o). Solve 0 = -3r - r - q for r. -3 Let a = 84 + -82. Solve 0 = -as + 1 + 1 for s. 1 Suppose -k + t - 11 = 0, 2k - 4t - 46 = 7k. Let z be k/15 - 10/(-6). Let u be z4 + (1 - 0). Solve 0p + u = -p for p. -5 Let m = 6 - 3. Suppose -my + 17 = 5. Solve 5c - 3c = -y for c. -2 Let a be -2 - (-21 - (3 - 0)). Let q be 1008/22 + 4/a. Let o be q/3(-9)/(-6). Solve -4m + 7 - o = 0 for m. -4 Suppose 2 = 2u - 2p, -5u - 2p + 28 = -u. Suppose 2v = -3v + u. Solve k = v - 3 for k. -2 Let t be (-1)/(1 - (-4)/(-3)). Suppose -tz + 7 = -5. Solve zj = -j for j. 0 Let c = -26 - -36. Solve -6j = -j - c for j. 2 Let v be 68/(-17) - (0 + -4). Solve -3m + 14 - 2 = v for m. 4 Suppose 2a - 13 = -5. Let c be a - (0 + 2/(-2)). Solve -10 - 5 = cl for l. -3 Let m = -25 - -40. Solve -3d - m = 2d for d. -3 Suppose -3q - t - 7 = -0q, 9 = -3q - 3t. Let o be -2(0 - q/(-4)). Let k(j) = j3 + 3j*2 - j - 1. Let z be k(-2). Solve -z = -2n - o for n. 2 Let v(l) = 3l. Let k be v(1). Suppose -3a + 5a - 20 = 4n, -a = k*n. Su	{ "pile_set_name": "DM Mathematics" }
. Suppose 7g = -4t + 2g + 46, -23 = -3t + ug. Solve ta = 4a for a. 0 Let p(w) = -w3 + 5w*2 + 8w - 12. Let i be p(6). Solve ij + 3j = 0 for j. 0 Let q(g) = g + 1. Let y be q(-4). Let l be 5/4 + y/12. Let d be l2 - (-11)/1. Solve d = -3p - 2 for p. -5 Let f(i) = -i*2 + 17i - 24. Let q be f(15). Solve v - 1 + q = 0 for v. -5 Let d(c) be the first derivative of -c*4/4 + 5c3/3 + c2 - 5c + 3. Let j be d(5). Solve 0 = jv + 3 + 17 for v. -4 Suppose 0 = 5k - 3k - 8. Let n be (-11)/(-4) + (-3)/k. Solve nd + 2 = d for d. -2 Let c(d) = -2d + 12. Let f be c(14). Let i = f + 19. Solve -ia - 2 = -a for a. -1 Let n(z) = -z2 - 16z - 8. Let s be n(-16). Let j be (s - 2)/(-2 + 0). Suppose 0 = -3m - m. Solve d - jd = m for d. 0 Let h be -2 + (-4)/(-2) - -7. Let i(o) = o - 7. Let s be i(h). Solve -4w + s - 8 = 0 for w. -2 Let b(v) be the third derivative of v4/24 + 11v3/6 - v2. Let s be b(-8). Let x = 1 + s. Solve p = x - 6 for p. -2 Suppose 2p + 3o + o = -14, 3o = p - 18. Solve r = -pr + 12 for r. 3 Let j be -1 + 0 + 3 + 1. Suppose v = -2v - jp + 12, 14 = 4v + 3p. Solve -w = -vw - 3 for w. -3 Let b(y) be the third derivative of -y6/720 + y5/20 + y4/6 + 3y*2. Let h(l) be the second derivative of b(l). Let z be h(5). Solve -2m - 3 = -z for m. -1 Suppose 2z - 12 = 6. Suppose -5m + z + 6 = 0. Suppose 3p = -9, 5b + 5p - 4 = 1. Solve -j - m = -b for j. 1 Suppose v - 5b = 2, 12 = -4v + b + 1. Let x be (2 + v)/(2/(-8)). Solve xr + 8 = 2r for r. -4 Let n = 33 + -18. Suppose z = q + q - 3, 4q = -5z - n. Solve qf + 5f = -5 for f. -1 Let v be (-5 + 2)/(-4 - -3). Solve 2u + 15 = -vu for u. -3 Suppose 0 = l + 1 - 3. Solve s + s = -l for s. -1 Suppose 4d + 3r - 18 = 0, -2r + 21 = 5d + 2. Let p = -5 - -13. Let v be 10/p - (-3)/(-12). Solve v = -t + d for t. 2 Let h(p) = -p3 + 5p*2 + 5p + 8. Let t be h(6). Suppose -1 = -tm + 1. Suppose 1 + m = k + x, 0 = 5k - x + 2. Solve -6 = -kr - 2r for r. 3 Let q = 4 + 1. Let d = -3 + q. Solve du - 6 = -0 for u. 3 Let a = 6 - 2. Suppose 0 = 4p - 3b - 20, -b + 20 = 4p + 3b. Suppose -l = k - p, -4k - l + 2l = -35. Solve x - a + k = 0 for x. -4 Let y be 8/(-6) - (-6)/(-9). Let x be 1 - (y + 2 + -3). Solve 3f + x = -8 for f. -4 Let w = 6 + -6. Solve w = -u + 4u + 12 for u. -4 Let m(x) = -x3 - 5x*2 - 4x. Let t be m(-4). Solve -2a = -ta for a. 0 Let n(k) = -k*2 - 4k + 4. Let g be n(-4). Let q = -3 + 4. Let v = -1 + q. Solve gw + 27 - 7 = v for w. -5 Let z(q) = q2. Let j be z(0). Suppose -x - 9 + 4 = j. Let p(i) = i3 + 5i*2 + 2. Let f be p(x). Solve 1 = -3g - f for g. -1 Suppose 0 = 6z - 42 - 0. Suppose zn = n. Solve -4f = -nf for f. 0 Suppose 2g = 5m - 8, 2g - 2 = -0g. Solve -7 - m = -3d for d. 3 Let i(q) = -q3 + 7q*2 + q - 10. Let y be i(7). Let v be (1 - -11) + (y - -3). Solve 0 = 3d - 3 - v for d. 5 Suppose -r + 7 = -1. Let b(z) = -z*3 + 8z*2 - z + 7. Let q be b(r). Let d = -1 - q. Solve d = -4j - 0j - 12 for j. -3 Suppose 2o - 6 = -0. Suppose -o + 0 = -3f. Solve c - f = 4 for c. 5 Let r(x) = 10x*2 - x. Let k be r(-1). Solve -3u + 2 - k = 0 for u. -3 Let a be 54 - (-13)/(-3). Suppose d = -2w + a, d + d + 83 = 3w. Solve -2 = -5m - w for m. -5 Let c be (-1 - -5)/(18/153). Suppose -10 = -b - 4g + 2, 0 = -4b - 2g + c. Solve y + 3 = b for y. 5 Suppose 0l - 3l + 9 = 0. Suppose 4y + 12 = 4m, 3y + lm = -0y + 21. Solve -20 = -yw + 6w for w. -5 Let m be (-3)/(-2) + (-6)/4. Solve -2 = r - mr for r. -2 Suppose 3b + 2 = 4b. Solve 4k = bk for k. 0 Let v(y) = 6y - 41. Let r be v(10). Solve -5q + 6 + r = 0 for q. 5 Let z = -36 - -39. Solve -r = -2r - z for r. -3 Suppose -2i - 25 = -7i. Solve ix - 22 = -7 for x. 3 Suppose 18 - 2 = -m. Let c be 4/(-6) + m/3. Let a be 36/10 + c/(-15). Solve -d + ad = 12 for d. 4 Let r be (-44)/(-3) - 6/(-18). Suppose -r = -2p - 3p. Solve p - 4 = -o for o. 1 Suppose -o = -6o. Let c = -2 - -4. Suppose 0p = -cp. Solve -d + pd = o for d. 0 Let r = -13 - -3. Suppose 2g = g - 15. Let b = r - g. Solve bi + 5 - 20 = 0 for i. 3 Let x(m) = m*3 + 7m*2 - 6m + 8. Let q be x(-6). Suppose 0z = -4z + q. Solve -5k - z = -0 for k. -4 Let p be 4/8 - (-1)/(6/(-3)). Solve 0 = -t - pt + 4 for t. 4 Let m(r) be the third derivative of r6/720 - r5/120 - r*4/24 + 2r2. Let z(l) be the second derivative of m(l). Let x be z(4). Solve -p = -2 + x for p. -1 Let x(b) = -b2 + 3b + 2. Let k be x(3). Suppose u - ku - 6 = 0. Let p(q) = -q*3 - 7q*2 - 6q + 4. Let y be p(u). Solve yj + 0j - 8 = 0 for j. 2 Let o(z) = 5z2 - 3z. Let t be o(2). Let x = -5 + t. Let m = 9 - x. Solve -3b + m = -15 for b. 5 Suppose 0a - j + 6 = a, -2a + 21 = 5j. Let b be a/2(12 - 10). Solve -5 - 1 = -bd for d. 2 Let a be (-2)/(-11) - 540/(-297). Solve 25 = ak + 3k for k. 5 Let m(d) = -d*3 + 25d*2 - 25d + 28. Let j be m(24). Suppose 16 = 4b - 2b. Solve -4o - j + b = 0 for o. 1 Suppose 0 = -p - 20 - 12. Let j be 8/p - (-34)/8. Solve -jq = -0 + 8 for q. -2 Let t(y) = y*3 + 6y*2 + 6y + 5. Let b be t(-5). Solve l + 2l = b for l. 0 Suppose 20 = -4q + 5u + 65, q = 3u + 20. Let h = 13 - 8. Let r be (-3)/h - 252/(-20). Solve r = z - qz for z. -3 Let i = 101 - 101. Solve iy + 6 = -3y for y. -2 Let r(d) = d - 5. Let o be r(8). Let l(y) = y. Let k be l(o). Suppose 0c = -kc + 30. Solve -a = a - c for a. 5 Let d(u) = -2u + 10. Suppose -3h - 11 = -4j, 0 = 3j - 0j + h - 18. Let m be d(j). Solve -10 = -2z - m for z. 5 Let m be (-1 - -2)/((-3)/(-6)). Suppose 0 = mn + 3n - 10. Solve -v - 7 = -n for v. -5 Let w(d) be the second derivative of d4/12 + d3/3 - d2 - d. Let l be w(2). Suppose -lu = -u. Solve ui - 2 = 2i for i. -1 Let t = 7 + -4. Let u be 51-1(2 - 1). Let n be 4/(-10) - u/15. Solve 0i + t = ni for i. 1 Suppose 20i = 271 + 69. Suppose -6 = 2h - 5h. Let d be h/(-1(-2)/4). Solve -5 + i = -dm for m. -3 Let n = 6 + 4. Let a(l) = -l + 10. Let i be a(n). Solve i = -m - 4m for m. 0 Let n(q) = -2q3 + 4q + 3. Let d be n(-2). Suppose x - 1 = -d. Let s be -4 - x - (0 - -2). Solve 2t + 2 = st for t. 1 Let g(s) = s*3 + 3s*2 - 7s - 6. Let h be g(-4). Let i = 3 + 4. Let z(l) = l*3 - 7l*2 + l - 5. Let x be z(i). Solve -xj = 4 + h for j. -5 Suppose 2m - 9 - 1 = 0. Suppose -23 = -z - ma - 1, -4z = 4a - 24. Solve -5k = -zk + 3 for k. -1 Let l be (-2)/(-3) - 30/(-9). Solve -lt + 9 + 3 = 0 for t. 3 Suppose -14 = -5a + 16. Solve -x - x + a = 0 for x. 3 Let j be ((-4)/(-10))/(1/5). Let b(g) = -8g + 1. Suppose 0 = -4m - 9 - 3. Let u be b(m). Solve 0 = jl + 3l + u for l. -5 Suppose 0 = 2r - 0r + 2t - 10, -r + 5t = 1. Solve -rv = -3v for v. 0 Suppose -28 + 13 = -3u. Solve s = us + 8 for s. -2 Let h be 1/(-2)12/(-6). Let i be (-1)/(-1)6/2. Suppose 3o + 3 = -in, -5o + 11 + 8 = -3n. Solve ol + 7 = -h for l. -4 Suppose -3b - 1 + 4 = 0. Solve -s = -2 - b for s. 3 Let h be 2 - ((-14)/(-2) + 3). Let g be (h/7)/(4/(-14)). Solve l - 7 = -g for l. 3 Let k(b) = -b*3 + 6b*2 + 2b - 8. Let r be k(6). Suppose rn + n = 0. Suppose -3j + 15 = -nj. Solve t + 0 = j for t. 5 Suppose -5p = -10p + 50. Let u(r) be the second derivative of -r3/6 + 9r*2/2 + r. Let f be u(7). Solve 0m = fm + p for m. -5 Let z be 5 + 0 + (-2 - -5). Suppose 0 = g - 3g + 36. Suppose 30 = 3q - 5a, 5q + 4a = g - 5. Solve 3 = qn + z for n. -1 Suppose 6 = x + 2c - 7, 0 = -c - 4. Let z = 0 - 0. Suppose z = -5v + 20, w + 0v + 5 = 2v. Solve -ws + 6 = x for s. -5 Let u(d) = -d - 13. Let i be u(-13). Solve -2x = -i - 2 for x. 1 Let a(z) = -2z - 6. Let g be a(-4). Suppose -gy + 4f = -10 - 16, 3y - f - 14 = 0. Solve 2 + y = m for m. 5 Let p = 11 + -10. Solve p - 2 = -y for y. 1 Let n be 3(-2 + 8/6). Let g = n + 2. Solve g = 4s + 22 - 2 for s. -5 Suppose 5q - 37 = 43. Suppose 0 = 3j, 5j - 2 = d - 0. Let b be 1d-21. Solve 0 = -0r + br - q for r. 4 Suppose -5i = -20, 4i + 1 = -5o + 32. Solve -ob - 2b = 25 for b. -5 Let w = 5 + 15. Solve 5v + 0v = w for v. 4 Suppose -2c = 4g - 30, 2c - g = -8 + 28. Suppose 0 = -5q + 11 - 1. Suppose -33w - 11w = -132. Solve -w + c = qi for i. 4 Let d = -2 + 4. Suppose 0 = 3s + 4w + 29, 0 = 2s + d*w	{ "pile_set_name": "DM Mathematics" }
2, 2? 1/5 Which is the closest to 0? (a) 2/67 (b) 2.8 (c) 5 a What is the nearest to -0.1 in 11/2, -1, 2, -3/2, -1/4? -1/4 What is the nearest to 1/30 in -2, 3, -1/2, -1.2? -1/2 What is the nearest to 28/17 in -1/8, 1/5, -2/15, 2/7, 7? 2/7 Which is the nearest to 8? (a) -1/4 (b) 2 (c) -10 b Which is the closest to 0? (a) 3 (b) -9/10 (c) -31.1 (d) 2/9 d What is the nearest to 1/2 in 30/11, 0.1, -2/31? 0.1 What is the closest to 1/2 in -2/9, 0.04, 119, -2/7, 2? 0.04 What is the nearest to 1 in -14, -1.17, 3? 3 What is the nearest to 0.2 in 4, 1/3, -1938, -2/5? 1/3 What is the closest to 1 in 3, -7.1, 1.224, 4? 1.224 Which is the nearest to 14643? (a) 1 (b) 1/6 (c) 3/2 (d) 0.1 c What is the closest to -1/4 in 0.3, -5, -52? 0.3 What is the closest to 0 in 0.052, 2/93, -73? 2/93 What is the closest to -2 in -1/4, -2/21, 89, 2/29? -1/4 What is the nearest to -2/3 in -3946, 0, -4, 3? 0 What is the nearest to 12 in 1, 0.05, 44, -1/7, 1/3? 1 What is the nearest to 46 in 0.442, 5, 1? 5 What is the closest to 0.2 in 4, -0.04, -8, 12? -0.04 Which is the closest to -0.07? (a) 3/4 (b) 4819 (c) 0.2 c What is the closest to -1 in -0.1, -2/9, 3/5, 0.75, -1/3? -1/3 Which is the nearest to 19? (a) -2/17 (b) -0.4 (c) -16/5 (d) -1/5 a What is the closest to 1/13 in 0.2, 1, 4, 1039? 0.2 What is the nearest to -0.05 in 0.116, -0.11, 5, -0.4? -0.11 Which is the closest to 1/2? (a) -4 (b) 0.3 (c) -0.006 (d) 2 (e) -14/13 b What is the closest to 0.4 in -2, -0.2, 0.04? 0.04 Which is the closest to 0.3? (a) 5 (b) 56/11 (c) -14 a What is the nearest to 0.05 in 28/15, -5/3, 0.08, 0.1, 3? 0.08 Which is the closest to -44? (a) 2 (b) 3 (c) -2 c What is the nearest to 0 in -0.4, -3, -73, -16, 1/3? 1/3 What is the closest to -296 in -5, 0.33, -1? -5 Which is the nearest to 1? (a) -3/8 (b) -1 (c) 470/7 a Which is the closest to -1? (a) -0.59 (b) 1/7 (c) 3/4 (d) 1 a What is the nearest to -8 in -1/4, -8.2, 2/5, -1? -8.2 Which is the nearest to -5/7? (a) -1/7 (b) -51 (c) 1/4 (d) 2/15 (e) 1/6 a Which is the nearest to -0.69? (a) -544 (b) -2 (c) 3 b What is the nearest to -0.06 in -1, -4/9, -0.00292, -3? -0.00292 Which is the nearest to -0.2? (a) -3 (b) 1 (c) -0.4 (d) -91 (e) -22 c What is the closest to 1/6 in 3/20, 0.1, -2/11, -0.4, 18/77? 3/20 What is the nearest to 0.1 in 4256, 2/9, -0.2? 2/9 What is the nearest to 0 in 175, -0.3, -43? -0.3 What is the nearest to -14 in -2/7, 5, -5, 50, 2? -5 Which is the closest to 0.02? (a) 2 (b) -4/5 (c) 0.3 (d) 7327 c What is the closest to 0 in 1/2, 2, -19.5, -32? 1/2 What is the nearest to -38 in 0.4, -5, 3/8, 27, -0.2? -5 What is the closest to -21 in -130, -1/6, 2/7? -1/6 What is the closest to 0.2 in 6, 20/11, -3, 93, 5? 20/11 Which is the closest to 0? (a) 12 (b) 0.3 (c) 3 (d) 4.5 b Which is the closest to -1/2? (a) 161 (b) 8/7 (c) -2/5 c What is the closest to -43 in -3/8, -4.7, 1/4? -4.7 Which is the nearest to 0.3? (a) 6 (b) -1/2 (c) -1.3 (d) -2 b Which is the nearest to -3? (a) -0.6 (b) -0.09 (c) -1 (d) 6 c Which is the nearest to 2? (a) -28 (b) -4 (c) -35 b What is the nearest to -0.2 in 6/49, -2/13, -4, -2/7? -2/13 What is the closest to 1/4 in 2/5, 672, -163? 2/5 What is the nearest to -0.1 in 1640, -2/5, 0.1? 0.1 What is the closest to 3/2 in 3, -43, -0.1, 1/9, -3? 1/9 Which is the nearest to -2/7? (a) -1/394 (b) 1/5 (c) -4/11 (d) -2/19 c Which is the closest to 0.02? (a) 5 (b) 3 (c) -3/7 (d) 1425 (e) -1/6 e What is the nearest to -2/3 in 0.2, -0.3, -37, 0.6, -4? -0.3 What is the nearest to 0 in 1, 37, -57? 1 Which is the closest to 0.7? (a) -3.2 (b) 5 (c) 6 a Which is the closest to 1/7? (a) 4 (b) 3/4 (c) -975 b What is the nearest to 654 in 8, -5, 2, 0.1, 2/31? 8 What is the closest to 13 in -5, 2/5, 733/4, -0.2? 2/5 What is the closest to 2/49 in 1/4, -7, 0, 0.2? 0 What is the closest to 1/44 in 1.41, 0, -0.1? 0 What is the nearest to -1.25 in -0.2, -2, -8, -16? -2 What is the closest to 0.3 in 2/5, -4, -79, 2/15? 2/5 What is the closest to 2/9 in -0.5, -7, 1/2, 1/25? 1/25 Which is the closest to -66? (a) 217 (b) 1.2 (c) 1/5 c What is the closest to 6 in 0.5, 6/13, 0.1, -0.1? 0.5 Which is the closest to 0? (a) -91 (b) 0.1 (c) -1/7 (d) 186 b What is the nearest to -5 in 2, -0.3, -7539, 1/5? -0.3 Which is the closest to -12.5? (a) -12.6 (b) -0.3 (c) -1/6 (d) -4 a What is the nearest to 40 in 5, -3/8, 0.3, -1/2? 5 What is the closest to -2/3 in -2, -4, -1/3, -5, -0.095? -1/3 Which is the nearest to -0.06? (a) 2/323 (b) 0.4 (c) -1 (d) -3/7 a What is the closest to -2 in -2/19, -3, 0.3, 75? -3 Which is the nearest to 6? (a) 1 (b) 9 (c) -1/23 b Which is the closest to -1/4? (a) -4 (b) 0.3 (c) 0.1 (d) 13/6 c What is the nearest to 856 in 3/4, -1/4, -4, 3/7? 3/4 What is the closest to 62 in -1/6, -2/5, 74.8? 74.8 Which is the nearest to 3? (a) -40 (b) 208 (c) 4 c Which is the closest to 665? (a) -0.5 (b) 0.3 (c) -3 (d) -0.06 b What is the nearest to 1/6 in -38, 0.3, 222? 0.3 Which is the closest to 2/19? (a) 0.232 (b) 4 (c) -4 (d) 1/3 (e) -1/6 a Which is the nearest to 0.2? (a) 0 (b) -0.2 (c) -0.17 (d) -4/5 (e) -135 a What is the closest to -5/4 in -9, 12.9, -3? -3 What is the closest to 951706 in -2, 0.2, -0.2? 0.2 What is the closest to 1 in -4/3, -4, 2/29, 0.0313, 4? 2/29 Which is the closest to 8? (a) -0.06 (b) 2 (c) 0.014 b Which is the closest to 1? (a) 2 (b) 0.08 (c) 5/11 c Which is the closest to 2? (a) -1/12 (b) 218 (c) -0.2 (d) -41 a What is the closest to 4 in -0.245, -5, -0.9, -4? -0.245 Which is the closest to 0.2? (a) 2/5 (b) 3 (c) 71 (d) 1/3 (e) 1/6 e Which is the closest to -2/17? (a) -3/4 (b) -3/5 (c) 0.02 (d) -2.3 (e) 1/5 c Which is the nearest to -7/2? (a) 24.5 (b) -0.4 (c) -2/39 b What is the closest to 0.1 in 4/7, -3897, -4/5, 3, -2/3? 4/7 Which is the nearest to 0.23? (a) 3/5 (b) 5 (c) -3.51 (d) -4 a What is the nearest to 1.131 in -23/4, -0.2, -2? -0.2 What is the closest to -2/5 in -0.3, -11, -4, -2, -29? -0.3 Which is the closest to 202? (a) 5 (b) 0 (c) 1 (d) -3/2 a What is the closest to 0.094 in -0.1, 1/2, 3/4, 0.1? 0.1 Which is the nearest to -1/14? (a) -1 (b) 3 (c) 2/25 (d) -0.4 (e) -4 c What is the closest to 0 in 0.5, -51, 0.1, 2, 1/43? 1/43 Which is the closest to -1/4? (a) -7/5 (b) -4/175 (c) 7 (d) -5 b Which is the nearest to -1? (a) 2 (b) 0.5 (c) 112 (d) 4 (e) 1.8 b Which is the closest to -94/7? (a) -3 (b) -0.5 (c) 1/3 (d) 2/113 (e) 2 a What is the closest to -2 in 0.2, 1/8, 8, 5? 1/8 Which is the nearest to -0.2? (a) -3/2 (b) -27 (c) -1/10 (d) 0.08 (e) 0.03 c Which is the closest to -0.7? (a) -0.1 (b) 47.562 (c) -4 a What is the closest to 515 in 15, 16, -2? 16 Which is the nearest to 1/17? (a) 1 (b) 0.4 (c) -194 (d) -1/3 b Which is the closest to -2? (a) 0.2 (b) -1/6 (c) -35 (d) 2/7 (e) 2 b What is the nearest to 0.07 in 0.7, 2/13, -8, -5? 2/13 What is the nearest to -1/4 in -529, 0.05, 4, -1/4? -1/4 What is the closest to 2/7 in -5, 0.2713, 0? 0.2713 Which is the closest to -2? (a) -115 (b) -1 (c) 0 (d) 1/12 b What is the closest to 3494 in -2, 3, -5, 1? 3 Which is the nearest to 0.1? (a) -174.1 (b) 0.3 (c) 0.5 (d) -2.67 b Which is the nearest to -39? (a) -0.65 (b) 0.2 (c) -2/5 (d) -6 (e) -2 d What is the nearest to -5 in -2/5, -0.63, -0.011, -4? -4 Which is the nearest to 12? (a) 5 (b) -5/2 (c) 0.01 (d) -3 (e) 73 a What is the closest to -0.1 in 0.1, 28, 4, -0.02? -0.02 What is the nearest to 5 in -13, 26, -14, -1/5? -1/5 What is the closest to 556 in 10, 0.1, -2? 10 What is the closest to -8 in -5, -0.3, 0.8, -1, 1? -5 What is the nearest to -0.10065 in 1, -0.4, 0, 2/9, 4/3? 0 What is the closest to 105 in -6, -0.072, -0.3, -2? -0.072 Which is the closest to -42? (a) -2 (b) -0.4 (c) 55 (d) 1 a Which is the nearest to -284? (a) 5 (b) 13/3 (c) -4 c Which is the nearest to -21? (a) -1 (b) -1/3 (c) 807/5 a What is the nearest to 0 in 314, 0.5, -0.01, -2/7, 0? 0 Which is the nearest to 2/3? (a) 1/3 (b) 1003 (c) -2/5 a What is the nearest to 9 in 6/5, -5, -3/4, 2? 2 Which is the nearest to -2921? (a) -2/5 (b) 0 (c) -0.06 (d) -4 d What is the nearest to -43 in -2/7, -2	{ "pile_set_name": "DM Mathematics" }
e million. -6000000 Round -2.83869897 to 4 dps. -2.8387 What is -0.027035268 rounded to 6 decimal places? -0.027035 What is -22024171.2 rounded to the nearest one million? -22000000 What is 0.014347771 rounded to 4 decimal places? 0.0143 Round -29649057 to the nearest 100000. -29600000 What is -0.0001832516267 rounded to six dps? -0.000183 Round 749189464 to the nearest one hundred thousand. 749200000 Round -1.47157449 to four dps. -1.4716 Round -123.36942626 to 1 dp. -123.4 Round -22810577600 to the nearest 1000000. -22811000000 Round -1178821.72 to the nearest 1000. -1179000 Round -6267809575 to the nearest 1000000. -6268000000 What is 90761.316 rounded to the nearest 10000? 90000 Round -28692.23867 to the nearest 10. -28690 Round -192.870133 to the nearest ten. -190 What is -0.0432757106 rounded to 3 dps? -0.043 Round -0.0009691952682 to 6 decimal places. -0.000969 Round 168482903 to the nearest ten thousand. 168480000 Round 129.124156 to one dp. 129.1 Round 0.000150775758 to seven dps. 0.0001508 Round 50781.1227 to the nearest integer. 50781 What is -0.0000259515413 rounded to seven decimal places? -0.000026 What is -17182488.4 rounded to the nearest 100000? -17200000 What is 0.002328300824 rounded to 7 decimal places? 0.0023283 What is 44.168833 rounded to two decimal places? 44.17 What is -1828.92126 rounded to 0 decimal places? -1829 Round -2.04420815 to 4 dps. -2.0442 What is 51499541.6 rounded to the nearest 100000? 51500000 What is 60.4191435 rounded to the nearest ten? 60 What is -5393798.044 rounded to the nearest ten thousand? -5390000 What is 0.000056631466 rounded to seven dps? 0.0000566 Round -86103730.4 to the nearest 100000. -86100000 What is -0.02570966161 rounded to 6 dps? -0.02571 What is -0.0022040141519 rounded to 4 decimal places? -0.0022 What is 87377766.6 rounded to the nearest ten thousand? 87380000 What is 933984.1 rounded to the nearest 100000? 900000 Round 0.4203295601 to two dps. 0.42 What is 1308045.508 rounded to the nearest 100000? 1300000 What is -2.4116312 rounded to 2 decimal places? -2.41 What is -174422023.5 rounded to the nearest ten thousand? -174420000 Round -4938648.676 to the nearest one thousand. -4939000 Round 0.00000161799412 to 7 decimal places. 0.0000016 Round -0.1684137945 to 2 decimal places. -0.17 What is -385430742 rounded to the nearest 10000? -385430000 What is 404329.39 rounded to the nearest one hundred? 404300 Round 4240.526876 to the nearest one hundred. 4200 What is -8.3550979 rounded to 1 decimal place? -8.4 What is -6562.2187 rounded to the nearest one thousand? -7000 Round -0.89223859 to 4 decimal places. -0.8922 Round -134304.34 to the nearest 100000. -100000 Round 37699.02528 to the nearest integer. 37699 What is 0.24199258 rounded to two decimal places? 0.24 Round -30014.15124 to 0 dps. -30014 What is 4316.636665 rounded to the nearest ten? 4320 Round 691579.6108 to the nearest one hundred. 691600 Round -0.0102748868 to 3 decimal places. -0.01 What is 0.00169568835 rounded to five decimal places? 0.0017 What is -10394481200 rounded to the nearest one million? -10394000000 What is -1251485.138 rounded to the nearest 100? -1251500 Round 2458409.53 to the nearest 100000. 2500000 What is 10761326.4 rounded to the nearest one million? 11000000 Round -678280944 to the nearest one million. -678000000 Round 6.68509835 to 4 decimal places. 6.6851 Round 61688.5508 to the nearest ten thousand. 60000 What is 20.09560036 rounded to 1 dp? 20.1 Round -0.000098909221 to 6 decimal places. -0.000099 What is 12050.261343 rounded to the nearest 1000? 12000 What is -287269768.9 rounded to the nearest 100000? -287300000 Round -0.000018062036 to 7 dps. -0.0000181 What is -1954.937559 rounded to the nearest one hundred? -2000 What is 81.8314011 rounded to 3 dps? 81.831 What is -425035336.2 rounded to the nearest one hundred thousand? -425000000 What is -706028.115 rounded to the nearest 1000? -706000 Round -0.000195689092 to seven dps. -0.0001957 Round -3.8350205 to 1 decimal place. -3.8 What is -0.03846877825 rounded to three decimal places? -0.038 Round -10.814443904 to 2 decimal places. -10.81 Round 318.786354 to the nearest ten. 320 Round -5.941467029 to two decimal places. -5.94 Round -0.0077195878 to 5 decimal places. -0.00772 What is -0.0000977367967 rounded to 6 decimal places? -0.000098 What is -0.000333259326 rounded to 5 decimal places? -0.00033 What is 64.23129041 rounded to the nearest ten? 60 What is 0.000062936682 rounded to seven decimal places? 0.0000629 Round 689949.95 to the nearest one thousand. 690000 What is 0.0001686583014 rounded to four decimal places? 0.0002 What is 47092.982 rounded to the nearest one hundred? 47100 Round -706.6112 to 1 dp. -706.6 Round 2427620.82 to the nearest ten thousand. 2430000 Round -5.605662206 to one dp. -5.6 What is 333115.7129 rounded to the nearest 100? 333100 Round -21.9261988 to three dps. -21.926 What is -0.000001736025 rounded to seven dps? -0.0000017 Round -0.146438414 to four dps. -0.1464 Round -25626378020 to the nearest 1000000. -25626000000 Round -142328.62 to the nearest one thousand. -142000 What is -16018.0755 rounded to the nearest ten? -16020 What is -26461125.3 rounded to the nearest 1000000? -26000000 What is 31808833.9 rounded to the nearest one million? 32000000 Round 25623576.4 to the nearest 10000. 25620000 What is -5.5910882 rounded to two dps? -5.59 Round 2013.22598 to the nearest one hundred. 2000 Round -44657.14155 to the nearest one thousand. -45000 Round -0.0415563829 to 4 decimal places. -0.0416 What is -6.581703 rounded to one dp? -6.6 What is 183943.8204 rounded to the nearest 1000? 184000 What is -169.463135 rounded to the nearest ten? -170 Round 7114.20179 to the nearest one thousand. 7000 What is -142.427487 rounded to one dp? -142.4 Round 116.251045 to 0 dps. 116 Round -21477.048 to the nearest 100. -21500 What is 0.025543702977 rounded to three dps? 0.026 What is -0.0000247916371 rounded to six decimal places? -0.000025 Round 0.00006538133546 to 7 dps. 0.0000654 What is 0.662048458 rounded to 3 dps? 0.662 Round -0.349492631 to three decimal places. -0.349 Round 3896392340 to the nearest one million. 3896000000 What is 28.8551727 rounded to the nearest integer? 29 What is -1935.83147 rounded to the nearest 10? -1940 What is -0.0008680951 rounded to six decimal places? -0.000868 Round -0.50185467 to 3 dps. -0.502 Round 11564211 to the nearest 10000. 11560000 What is -391.98297 rounded to 1 dp? -392 What is -86063677.6 rounded to the nearest one thousand? -86064000 What is -61338437 rounded to the nearest 1000000? -61000000 Round 3932.86589 to 1 decimal place. 3932.9 Round -18299213000 to the nearest one million. -18299000000 Round -1404951.861 to the nearest ten thousand. -1400000 What is 25656261020 rounded to the nearest one million? 25656000000 What is 1944599.888 rounded to the nearest 100? 1944600 Round -3364.31474 to the nearest ten. -3360 What is 27636009700 rounded to the nearest 1000000? 27636000000 What is 0.001552605734 rounded to five decimal places? 0.00155 What is 0.0013092545 rounded to four dps? 0.0013 Round -2900220900 to the nearest 1000000. -2900000000 What is 0.1786211282 rounded to 2 decimal places? 0.18 Round -0.000110487317 to six decimal places. -0.00011 Round -0.01289923245 to seven decimal places. -0.0128992 Round 10.102663726 to 3 dps. 10.103 Round -418.451374 to 1 decimal place. -418.5 Round -0.80592159 to 3 dps. -0.806 Round -0.006028788204 to 3 decimal places. -0.006 Round -2778.5659162 to the nearest one hundred. -2800 Round -0.000233489946 to seven decimal places. -0.0002335 What is -0.097698978 rounded to five dps? -0.0977 What is 1.01368655 rounded to 2 dps? 1.01 Round -18.0591552 to zero decimal places. -18 Round 0.0002428114787 to 5 decimal places. 0.00024 Round 457398.14 to the nearest one hundred thousand. 500000 Round -0.03512631196 to 3 decimal places. -0.035 What is -0.000008847329 rounded to seven dps? -0.0000088 Round 0.002892447582 to five decimal places. 0.00289 What is -2284.3795 rounded to 0 decimal places? -2284 What is 28.71950251 rounded to 2 decimal places? 28.72 Round 0.000119935541 to 5 decimal places. 0.00012 Round -0.003691859 to seven decimal places. -0.00	{ "pile_set_name": "DM Mathematics" }
21t3 - 2 Expand -o + 72 - 29 + 9o*2 - 45 + (4o + 2o - 4o)(4o + 2o - 5o) + 5 + o*2 - 5. 12o*2 - o - 2 Expand 3x*2 + 5 - 2x*2 + x - 2x + 0x - 2x*2 + 0x + (-3x + 3x - x)(3 - 3 + 2x). -3x2 - x + 5 Expand (968 + 99c - 968 + 2c + 1 - 1 + (-1 + 1 - c)(0 + 1 + 0))(4 - 2 + 0). 200c Expand -3c + 2c*2 + 3c + (4 - 3 - 4)(0c*2 - 3c*2 + 2c*2) - 2c2 - c2 + 5c2. 7c*2 Expand (5r*2 - 2r*2 - 2r*2)(8 - 6 + 2 + (1 + 2 - 2)(0 + 3 - 5)). 2r*2 Expand (-5a2 + a2 - 2a2)(-6a3 - 10a*3 + 3a*3) - 2a*5 + 7a*5 - 3a*5. 80a*5 Expand (-2u3 + u3 - 3u2 - u3)(-1511 + 666 + 575) + u - u - u*3. 539u*3 + 810u2 Expand (-z2 - 2z2 + 7z*2 + (-2z + 3 - 3)(2z + 0 + 0) - 3z + 2z*2 + 3z + z*2 - 1 + 1 - 7z*2 - 2z + 2z)(3 + 2 - 1). -16z2 Expand (-5t + 2t + 5t)(2t*2 - 4t*2 + 0t*2) + 13t - 43t + t3 - 43 + 38. -3t*3 - 30t - 5 Expand (44 + 41 - 5)(-d - 3 + 3) + (1 - 5 + 2)(0d + d - 2d). -78d Expand (12o + 38 - 38)(-2o - 17o3 - 1 + 3o + 28o3). 132o*4 + 12o*2 - 12o Expand (-3g2 - 3g*2 - 23g*2)(-g*2 + 12g - 12g) + (0g + 3g - g2 - g)(g*2 - 1 + 1). 28g*4 + 2g*3 Expand (-2n + 4n + 2n)(-3n + 4n + 0n) + n2 - n2 + n*2 + 5n*2 + 0 + 0 + (-4n + 0n + 5n)(4n - 5n - n). 8n*2 Expand (-3q*3 + 4q*3 - 2q*3)(5 - 5 - 2q) + 3q*2 - 3q*2 + 2q*4 + 17080q*4 - 17078q*4 + 464q*2 + 70q*2. 6q*4 + 534q*2 Expand (-9c*3 + 8c*3 + 5c*3)((-2c2 + 5c*2 - 2c*2)(0 + 1 + 0) + 2c2 - 4c*2 + 3c*2 + 2c2 + c2 - 2c2 - c + c - 6c*2). -12c*5 Expand (3u + u - 3u)(7u - 3u + u) + 2u - 2u*2 - 2u - 8u2 - 9u*2 - 5u*2. -19u*2 Expand (-2k - k + k - 5 + (-2k + 5k - k)(-5 + 4 - 3))(-k + 3 - 3). 10k2 + 5k Expand (-h + 2h + 0h)(1 - 2h*2 - 1) + 4h*3 + 0h3 - h3 + (-16h2 + 78 - 78)(0h - 2h - h). 49h3 Expand (-4w*2 + 5w*2 + 5w*2)(-2w2 + w2 + 3w2) + (w4 - 2w4 - 2w*4)(5 + 2 - 1). -6w4 Expand 4d*4 - 15d*4 - 6d*4 + (-3d*2 - 3d2 + d2)(2d*2 + 3d*2 - 6d*2). -12d*4 Expand (-3j2 - j2 + 6j2)(-70j3 + 101j*3 + 121j*3). 304j*5 Expand -1683 + 1683 - 15x*2 - 2x*2 - 3x + 3x + (x - 4x + 2x)(2x + x - 2x). -18x2 Expand (10k - 26k - 121 + 120)(-7 + 3 + 0). 64k + 4 Expand -2 + u + 2 + u - 8u - 4u + (0 + 3u + 0)(8 - 2 + 3). 17u Expand (-27k4 + 42k*3 - 42k*3)(-1 + 1 - 4). 108k4 Expand (38 + 3u - 38)(4 + 4 - 1) + (0 - 3 + 4)(-2 + 2 - 2u) + (1 - 1 + u)(0 - 1 + 0) + 5u - 3u - 4u. 16u Expand (-7 - 18 + 4)(2 - 3 - 1)((6k2 + 11k - 11k)(0k + 2k*2 + 0k) + 0k4 - 5k*4 + 3k*4). 420k*4 Expand (-9 + 9 + 4p)(0p - 3p - p). -16p*2 Expand (-17p - 25p - 31p)(2p + 2p - 6p) - 2p2 + 5p2 - p2 + (3 + p - 3)(-6p + 2p + 3p). 147p2 Expand (1 + 2 + 4s + 2)(-s2 + 9s*2 + 3s*2 - 1). 44s*3 + 55s*2 - 4s - 5 Expand ((2b + 1 - 1)(3 + 0 - 1) + b + b - 3b - 4b + 4b + 21b)(-b2 - 4b*2 + 6b*2). 24b*3 Expand (2j + 0 + 0)(2j4 - j2 + j*2) + 0j*5 + 5j*5 - 4j*5 - 84j*2 + 92j*2 - 17j*5 + 5j*5. -7j*5 + 8j*2 Expand (2r + 0 + 0)(0 + 3 - 4) + 354 - 354 - 272r. -274r Expand (b2 + 7b*4 - 3b2 + b2)(-9b - 3b + 0b). -84b5 + 12b*3 Expand -2w*2 + 2w2 - w5 - 26w2 + 26w*2 + 16w*5 + (3w*4 + 4w - 4w)(4w - 5w + 0w) - w5 + 6w*5 - 4w*5. 13w*5 Expand 7k - 7k + 12k*3 + (0k*3 + 0k3 - k3)(2 + 4 - 4) + 3k - 3k - 3k*3. 7k*3 Expand (0 - 3 + 5)(-t + t + t*2)(826 - 421 - 430). -50t2 Expand (-1 - 2 + 4)(0i + 7i - 5i)(-2i + 2i + i + i + i - 3i + (6i - i - 3i)(-1 - 4 + 3) + i - 5i - 3i + 1 + 2i - 1). -18i*2 Expand (-3 - 2 + 2)(3t4 - 3t4 + t4) - 26t4 + 42t*4 + 23t*4. 36t*4 Expand -2d2 + d4 + 2d2 + (3d3 + d3 - 5d3)(4 - 4 - 1)(-5d - 3d - 21d). -28d4 Expand (-11a - 9a + 7a)((-1 + 3 + 0)(a - 2 + 2) + (3 + 4a - 3)(-3 - 3 + 2)). 182a2 Expand (7 + i - 7)(-12i2 + 4i*2 + 5i*2 + 4i). -3i3 + 4i2 Expand i3 - 4i3 + 5i*3 + (-3 + 14 + 2)(114i2 - 114i*2 - 6i*3) + 0i - 2i3 + i + 0i*3. -78i*3 + i Expand (-2 + 2 - 3)(-4 + 5 - 3)(0 - 1 + 2)((3 - 3 - 2j)(-3 + 0 + 4) - 2j + 3j - 3j - 7j + 4 - 4). -66j Expand (16 - 16 + 7s)(-10 + 0 - 2) + 2s - s - 2s + (-2s + 5s - s)(-4 - 3 + 6) + 1 - 2s - 1 + 2s + 0s - s. -88s Expand -129a + 5a*3 + 103a - 10a3 + (a + 0a + a)(0a*2 - 4a*2 + 5a*2). -3a*3 - 26a Expand 12t + 3t + 3t + (-3 + 1 + 1)(-t + 0t + 2t) + (t + 0 + 0)(0 + 3 - 2) - 17t - t + 6t. 6t Expand (12b + 22b + 8b)(-b + 2b2 + b)(3b - 3b - 4b)(1 + 2b - 1). -672b*5 Expand (-2m + m - 2m)(12m + 47 + 129 - 13m). 3m2 - 528m Expand -12a3 + 84a*2 - 84a*2 + 19a*2 - 19a*2 + 5a*3 - 2a*3 - 2a*3 + 5a3 + a2 - a2 - a3 + (3a - a + 0a)(0 + 0 + a2). -5a*3 Expand (2a*2 - 3a*2 - 3a*2)((-a + 2 - 2)(4a - 3a - 5a + (4 - 2 - 4)(2a + a - 6a)) + 3a*2 - 5a*2 + 0a*2). 16a*4 Expand (-9t + 9t + 5t*5)((-5 - 1 + 4)(3 - 2 - 2) - 3 - 8 + 3). -30t*5 Expand (-131 - 15z + 131)(-3z*3 - 4z*3 + 5z*3 - 2z*3 + 5z*3 - 2z*3 + (1 - 1 - 2)(3z2 - 3z2 + z3))(6z - 3z - 4z). -45z5 Expand (-149t - 15695 + 15695)(t + 2t - t + (2 + 0 - 4)(-3t + 2t + 0t)). -596t2 Expand (-2v - 7v - 6v - 2)(3 - 3 - 1). 15v + 2 Expand (t*2 - 5t3 - t2)((1 + 4 - 2)(0 + 2 - 3) + 5 + 3 - 3). -10t3 Expand (2c + c - c)(c2 - 4c2 + c2) + 94c3 - 173c*3 - 36c*3. -119c3 Expand (w4 - 1 + 1)(3 + 2 - 4) - 3w*4 + 0w + 0w + (-2w - w + 2w)(-1 + 1 - 2w3) + 0w*4 - 6w4 + w4 + 11w4 - 64w*3 + 64w*3. 6w*4 Expand (-71 + 10r + 71)(-r2 + 3 - 3) + (0r*2 + 3r*2 - 4r*2)(-7r + 3r + r). -7r3 Expand (44 + 41 - 120 + 2g)(-g + g + 3g). 6g2 - 105g Expand (117o3 + 126o*3 - 228o*3)(2o - 2 + 2). 30o*4 Expand -6p - 5p + 18p + (-4 + 2 - 1)(10 - 10 + 38p). -107p Expand (10a*3 - 6 + 6)(-a + 0a + 0a) + (-3a3 + 3a*3 + 2a*3)(-5a + 3a + 0a) - 7a*2 + 7a2 - a4. -15a4 Expand (3 - 2 - 3)(t + 0t - 2t)(-278t*4 + 3t*3 + 447t*4 - 229t*4). -120t*5 + 6t*4 Expand (-9q*2 - 16q*2 + 9q*2)(0q3 + 9q*3 - 4q*3) + (0q*2 - 4q2 - q2)(-3q3 - q3 + 2q3). -70q*5 Expand (-9i*3 - 2i*3 + 17i*3)(4i - i - 5i) + (-2 + 9 - 3)(-2i*2 + 0 + 0)(3 - 3 + i*2). -20i*4 Expand (-1 + 9 - 1)(2u - 2u + 2u2) + 53u*2 + 92u*2 - 228u*2. -69u*2 Expand (283w - 5w3 - 576w + 273w)(0 + 2 - 4). 10w3 + 40w Expand -3l5 + 4l5 + l5 + 2l5 - 2l5 - l5 + (-2l + 3l + l)(2l*4 - 4l*3 + 4l*3) - 143l*5 + 5l*2 - 18l*5 - 5l*2. -156l*5 Expand (-3 - 5q + 1 + 3q + (2 + 0 - 1)(3q - 2q + 0q) + 0q + 4q - 2q)(7 + 2 - 7). 2q - 4 Expand (-27z2 - 24z*2 + 10z*2)(10 - 10 + 2z). -82z*3 Expand -6r*4 + 2r*4 + 0r4 + r4 - 4r4 + r4 + (3r + 2r - 3r)(-2r3 - r3 + 2r3) - 18r*2 + 18r*2 + 15r*4. 7r*4 Expand (2f + f - 2f)(8 - 3 - 29) - 1 + f + 1. -23f Expand (n3 + 4n*2 - 4n*2)(-1 + 2 - 2) - 2n3 - 2n*3 + 6n*3 - 6n*2 + 6n2 + n3 - 3n3 - 4n*3 + 12n*3. 7n*3 Expand (-4z + 5z - 3z)(-2537 - 235z + 2537)(z - 4z + 2z). -470z*3 Expand 3 + 52g*3 - 3 + (0g - 2g2 + 0g)(3g - 9g - 3g). 70g3 Expand (54k*2 + 14k*2 - 6k*2)(-3 + 1 + 0) + 1 + 2k2 - 1. -122k*2 Expand (4k + 14k - 8k)(-6k*2 + 3k*2 + 0k*2)(-4 + 3 - 3). 120k3 Expand (n + 3n - 5n)(27n3 - 842n*3 - 126n*3). 941n*4 Expand (448k*2 - 275k*2 - 293k*2)(3k - 1 - 3k - k)(-k2 + 4k*2 - 4k*2). -120k*5 - 120k*4 Expand (0 - s + 0 + (s + 3s - 6s)(5 + 1 - 4) + 185s - 123s + 320s + 0 + 2s + 0)(2s - s - 3s). -758s*2 Expand 6o - 3o + 2o + (0 + 3 - 4)(-2o + 6o - 6o) + 2o - o - 3o. 5o Expand (3v*2 - 6v*2 + 4v*2 + (-2 + v + 2)(v - 3v + v) + 2v2 + 1 - 1 + v2 - v*2 - 3v*2)(0 - 2 + 5)(-3 + 1 - 1). 9v*2 Expand -2i + i*4 + 2i + (i4 - i4 - 2*	{ "pile_set_name": "DM Mathematics" }
nn0)/n)43 assuming n is positive. n(8320/9) Simplify (((g(1/2)g)/gg(-1/2)/gg)/(g/(g*(-2/33)g)gg/g2))4 assuming g is positive. g*(-8/33) Simplify (xx/x*(7/8)x((x/x(3/20)x)/xx)/x(x/(x/x(-9/2)))(-9/4))45 assuming x is positive. x(1179/2) Simplify ((z*(-2/13)z*7)/(zz/z*(-2/21)z/(zzz/(z/((zzz(2/25))/z)))))(2/31) assuming z is positive. z(93242/211575) Simplify (h/h0)*(-33)h*(2/11)/(h/(h(h/h*(-1/3))/h))(h*(5/2)h/(h/h*(-7)h))(6/13) assuming h is positive. h(-15025/429) Simplify ((uu/u(-1/6))/u3)(2/15)(((u/(u*(-6)u))/u)/u(-8))(-43) assuming u is positive. u*(-5032/9) Simplify (q/(q(((qq/q(-3/11))/qqq)/qq)/q)q(-8))(-2/163)/(q(-1/3)q(-5/3))(2/97) assuming q is positive. q(29094/173921) Simplify (y(-4/9)y(-2/13))(-2/31)/(y/(yy*(-4))y7)(4/5) assuming y is positive. y(-158888/18135) Simplify (f/f(2/5)f0f2/(f(-1/7)/ff))/(f(-3)f6)(-14) assuming f is positive. f(1566/35) Simplify (c(-19)/c)(1/24)/((c(-25)/c)/(cc(-4/13))) assuming c is positive. c(2017/78) Simplify ((t/t(-13)tt/(tt/t(-2/11)))/(t(-13)(t(-3)/t)/t))26 assuming t is positive. t(9100/11) Simplify (c(-7)/cc*(-1/2)/c(ccc/(cc/(c(-1/2)/c)c)c)13)/((c(2/5))(3/5))(2/9) assuming c is positive. c(-1204/75) Simplify (((o(-2/5)/o)/(oo*(-1/6)))/(o/(o(o/((o/o*(-2/7))/o))/oooo)o)(-1/7))/(o(1/3)o*(-4/9)(o(-2/5))(-50)) assuming o is positive. o*(-98639/4410) Simplify ((mmm/m(-2))/m(-7)mm(4/7)m*(-7/4))/(mm*(2/13)/mm*(-4)m(2/13)/(m(-7/2)/m)) assuming m is positive. m(4009/364) Simplify (f(-2/3))(-2/31)/(f(-6)/(ff(2/11)f))((f3)(5/11))(-2/9) assuming f is positive. f(8104/1023) Simplify ((t0)31ttt/(t*6tt)ttt*(1/5)/t)/((t/(tt/t*(-1/4)tt)t)(-4/5))24 assuming t is positive. t(-47) Simplify ((j/j(-1))*16/(jj*0jj/((j((j(-5/3)/j)/j)/j)/j)))/((j4/j*(1/7))/((jj*5j)/(jj/j5))) assuming j is positive. j(640/21) Simplify ((l(-6/13)/ll)*(-3)/((ll/l22)/(l/l(6/13))))22 assuming l is positive. l(6270/13) Simplify (h*(1/2)h(-6))12(h/(h/h1h))*(-10/13)h*2h1 assuming h is positive. h(-63) Simplify (((v/v6)/(v3v)v*4/vv(-2/5))20)26 assuming v is positive. v(-3328) Simplify (a*17/a(a/((a/(a/a*18))/a))/aa*3a18)(2/59) assuming a is positive. a*(40/59) Simplify (aa/(a*(5/4)/a)a/(aaa(aa*(-1/7))/aa)a/(aa/(a(a(a*16/a)/a)/a))aa/(a/(aa/(((a*(-3)a)/aaa)/a))))(-22) assuming a is positive. a(-5511/14) Simplify ((t/t(1/2))(1/36)/((tt(9/5))/t(-18)))35 assuming t is positive. t(-52381/72) Simplify l/(l(-1/14)l)ll*18ll40l0 assuming l is positive. l(841/14) Simplify (((q/(qq(3/13)))/(q(1/2)q))/(q(1/10))11)(-42) assuming q is positive. q(7728/65) Simplify (i2/i(3/4))*31/((i/(ii/(i*(-10)i)))/i0)22 assuming i is positive. i(1035/4) Simplify ((o(-2/5))*32/((oo/o(1/6))/o)(-7/2))(-2/75) assuming o is positive. o(593/2250) Simplify ((i*1i)/(i(-1/2)/i))(-3/16)((ii*3)/ii/(i/i*(1/8))i)/(ii(-2)/ii/i(-5)) assuming i is positive. i(-17/32) Simplify (((f*(1/3)ff(2/31))/(f/f(-2/7)ff8))(3/4))(-19/5) assuming f is positive. f(54967/2170) Simplify (o4(oo/o(1/9))/oo)/(o*(-1/2)o)*27((oo0o)/(o(-4)/o))28 assuming o is positive. o(3391/18) Simplify (g(-3)g(gg/(g/g2))/g((g*2g)/g)(-1/2))32 assuming g is positive. g(-32) Simplify ((m(-2/5)/m)/m)*(13/7)(m1)(-4/3)(m(-2/9)/(m/(m/m(2/9))))/((m/m3)/(m2m)) assuming m is positive. m(-389/315) Simplify (((((n/n(-1))/n)/n)/n*4)/((n/(nn(1/7)/n))/n(-5/3)))/((n*(2/11)/nn)/n*(3/2)nnn*6nn/(n/n7)) assuming n is positive. n(-9797/462) Simplify ((i(-1))(12/11)(i1)2)/((i*(2/5)/iii)(-45)/(i(-2)ii6)) assuming i is positive. i(758/11) Simplify (((o/((o/(ooo(1/3)o))/o))*47/((oo(o/o(2/5))/o)/o)(7/5))(-2/23))(-40) assuming o is positive. o(243392/345) Simplify (y(1/15)y*(2/9)y(yyy1yy)/yyyy*(-3/2))/((yy*(1/5)y(1/4))/((y6y)/y(-3/4))) assuming y is positive. y(544/45) Simplify a(-2/127)aa(-2/63)aaa/(a*31/a)a*(-2/21)aa assuming a is positive. a(-193166/8001) Simplify ((i(1/3))(-43))(-1/24)i/(i*(4/7)i)((i/i(-2))/ii)/ii6ii/(i(-2/27)i) assuming i is positive. i*(13759/1512) Simplify (aaa(-12/7)a/a*(-10)(a*2/aa)/(aa(-3)))(-37) assuming a is positive. a(-3959/7) Simplify (k2/kk(-2))/((k/(k4k))/(kk*(-8/5)k))((k/k(1/3))/k)/kk*(-3/5)k*(-2/5)kk/k(-4/3) assuming k is positive. k(22/5) Simplify ((k(-1/10)k(4/13))/(k19/k5))(-25/6) assuming k is positive. k(8965/156) Simplify (((u/u(-1/2))/u*(-3)((u/(u*(1/3)/u))/uu)/u(1/8))(-6/13))(-1) assuming u is positive. u(145/52) Simplify k*(-1/4)kk(1/3)kkk*(-1/8)kk1kk((kk/(kk*(-5/6)/k))/kkkk(1/2))/(k(2/13)/(k/(kk(-3)))) assuming k is positive. k(4411/312) Simplify (((vv(-1))(-3/7)v(-10)((((v(-16)/v)/v)/v)/v)/v)(7/3))(1/7) assuming v is positive. v(-31/3) Simplify ((q(1/4))(-9))*(8/5)(qqq0)(-2/101)/((q/q*(-7))/(qq/q(2/5))) assuming q is positive. q(-1014/101) Simplify (k1)(-5/8)/(k(-1))(-3/23)(k(-2/7))(-4)k(-4/7)/k(-1) assuming k is positive. k*(1051/1288) Simplify (((l/(ll*(2/21)/l))/ll)/l*(2/77)((ll13/l)/l)5)(18/5) assuming l is positive. l(12054/55) Simplify (c(-2/7))(-4/13)c/c*(-1)(((cc(1/6))/c)/c)/c(c/c(-1))30/(cc(1/2)cc(-1/8)) assuming c is positive. c(126409/2184) Simplify (((x/((x/(xxx(2/15)))/x)x/(xx/(xxx(3/7))x))(-5))20)(-1/7) assuming x is positive. x(7480/147) Simplify ((o/o10)/o(-1/17)o7/((o/o(2/5))/o))25 assuming o is positive. o(-655/17) Simplify ((((pppp(-22)/p)/p)/p)/p)36(p(-20))(8/15) assuming p is positive. p(-2516/3) Simplify ((j25j/(j*(2/9)j))/((j/(j/((jj(-2/35))/j)))/(j/((jj(-10))/j))))(-4/5) assuming j is positive. j(-45152/1575) Simplify (l(-9)/(l*(3/2)l))*6(l(1/3))(-22)l/(ll/((l*6/l)/l))l(1/5) assuming l is positive. l(-1097/15) Simplify (((n/n*4n*(1/9)n)(-45))43)(-22/7) assuming n is positive. n(-80410/7) Simplify (u(-1/3))(12/7)/(u1/(((u(1/5)u)/u)/u))(uu(2/11)uu(-1/3)u)14 assuming u is positive. u(43321/1155) Simplify (i*(-13/6)/(ii*(-16))i(ii*(-3/11)ii)/ii/((i/i(-13))/i))46 assuming i is positive. i(5405/33) Simplify ((s/(s/s(1/4)))/(s/s(2/3)))/((s/s4s)/((s(-2/11)/ss)/s))((ss4/s)/s)/s(3/2)((s(-1)s)/s)28 assuming s is positive. s(-3401/132) Simplify ((x(3/2))(-10)(x1)(-37))(1/15) assuming x is positive. x(-52/15) Simplify ((ttttt(-2/67)ttt)/(t/(t/t*(2/33))ttttt))/(t/(tt29)t*(3/4)t) assuming t is positive. t(257887/8844) Simplify ((c(-6)(c(-3/5)c)/c)/(c*7cc/(c(4/9)c)))/((c(1/4))(-2/31))(10/7) assuming c is positive. c(-138004/9765) Simplify ((oo(2/9))(2/27)o(-1/5)/o(-2/15))/((o/(ooo(o(o/(o/(oo(-3)/o)))/oo)/o))/o(-7))(-4/25) assuming o is positive. o(7921/6075) Simplify (p/p(-1)pp*(10/3)p*(-12)ppppp(-2/11))(-22) assuming p is positive. p*(122/3) Simplify ((ff*(-2/21))/(ff(1/3)))(-36/11)(f(-2/15)/(f(-1/3)/ff))(4/19) assuming f is positive. f(10568/7315) Simplify (((cc/((c/(cc/(cc(-28)c)))/c)c(cc(1/3)c)/c)(2/163))(2/95))(-28) assuming c is positive. c(-10864/46455) Simplify ((v*(1/3)v)/((vv5)/v))(9/7)/(v1/v(2/15))(1/48) assuming v is positive. v(-23851/5040) Simplify (t15/t(-15))(-44)(t(-1/4))(-12)/(t(1/4))(9/5) assuming t is positive. t(-26349/20) Simplify ((s/(s/(s/(s(1/13)/s)))(s(-3/5)s)/s(s(-2/3)s)(-47))(-6))30 assuming s is positive. s(33564/13) Simplify (z/(z/(z*1z)))*(-38)z*(-7)/(zz*(1/8)/zz)((z/(z/(z/(z(-1/4)z))))/(z*(1/3)/zz))/(z*(4/7)/(zz0)) assuming z is positive. z(-14075/168) Simplify ((r/(r/((	{ "pile_set_name": "DM Mathematics" }
pose -4k - k - 4c + 2869 = 0, 5k - 2c = 2893. Suppose 3a + k = 124. Let q = -72 - a. What is the units digit of q? 9 Let l(g) = -60g + 218. What is the tens digit of l(-7)? 3 What is the units digit of (1205/5)/((-902)/(-1716) - 1/2)? 9 Suppose -2 = -i + 10. Let r = i + 254. What is the hundreds digit of r? 2 Let n be 7 + (-48 + -6)/(-6). Suppose 0 = 2o - n - 1212. What is the tens digit of o? 1 Suppose -5b + 3g = -20, 2b - 2g - 8 = -4g. What is the tens digit of 1015 + b + 40/(-8)? 1 Let i(r) = 6r2 - 7r - 4. Let f(w) = -4w2 + 7w + 3. Let c(y) = 5f(y) + 4i(y). What is the tens digit of c(-8)? 9 Let a(m) = 3321m2 - 9m - 13. What is the tens digit of a(-1)? 1 Let p = -41697 + 69067. What is the ten thousands digit of p? 2 Suppose 0 = 47s - 43s - 1220. Suppose s = 3b - 2491. What is the units digit of b? 2 Let a(i) = 7i*3 - 19i*2 - 42i + 91. What is the thousands digit of a(15)? 8 Let j = -274 + 268. Let r(o) = -2o3 - 7o*2 - 20o - 5. What is the hundreds digit of r(j)? 2 Let s(c) = -72c + 5. Let y be 15/(-3)(-2 + 1). Let v(r) = -36r + 2. Let m(p) = yv(p) - 3s(p). What is the tens digit of m(2)? 6 Let h = -5447 - -3034. Let a = 4069 + h. Suppose j = -8j + a. What is the units digit of j? 4 Let y be (14/(-28))/((-1)/18). What is the hundreds digit of (308 + -2)y/6? 4 Let b be (-1)/((-3)/(-51)-1). Suppose 16x - bx + 16 = 0. Suppose -136 = -2v - 4p, -4p = -0 + x. What is the tens digit of v? 7 Let l(x) = x2 - 12x - 17. Let k be l(15). Suppose 7w = -k - 14. Let a(t) = t3 + 9t*2 + 15t + 2. What is the units digit of a(w)? 0 Suppose -8 = -u + 2u - 3n, 5u - 30 = n. What is the units digit of (498/(-5))/(u/(-35))? 8 Suppose -65c + 60c - 3j = -7064, -3j = -5c + 7076. What is the tens digit of c? 1 Suppose d = -4l - 25953 + 135375, 54718 = 2l - 3d. What is the tens digit of l? 5 Let j(c) = 5c*3 - 153c*2 + 35c + 165. What is the tens digit of j(31)? 7 Let m(u) = -907u - 63. What is the units digit of m(-1)? 4 Suppose -4v - s + 20224 = 3s, -5v + 25282 = 4s. Suppose 8b - v = -b. What is the tens digit of b? 6 Let l = 277 + -481. What is the tens digit of l/(-1224) - ((-718)/(-12))/(-1)? 6 Let g(a) = 2a + 12. Let h be g(-5). Suppose 0 = -hr - 0o + o + 11, -4 = 2r + 4o. Suppose -rv = -5v + 79. What is the tens digit of v? 7 Suppose -13z + 209956 + 91553 = 0. What is the thousands digit of z? 3 Let k(x) be the second derivative of 92x - x3 - 77x + 6x2 - 5x*3. What is the tens digit of k(-2)? 8 Suppose -r + 6946 = 17v - 15v, 0 = -5v - 25. What is the thousands digit of r? 6 Let o = -69 + 78. Suppose om + 7 = 16m. What is the units digit of (-3 - (-68)/(-6))/(m/(-3))? 3 Let b(t) be the third derivative of t6/60 - t5/5 - 17t4/24 + 29t*3/3 + 2t*2 + 10t. What is the tens digit of b(7)? 3 Let h(p) = 1. Let j = 44 - 41. Let u(l) = -21l - 2. Let w(c) = jh(c) + u(c). What is the hundreds digit of w(-6)? 1 Let t(f) = 96f + 141. Let d be t(7). Let x = -377 + d. What is the tens digit of x? 3 Let q = -1 - -405. Suppose 8 = -2k, -5l + 5k + 1241 + q = 0. What is the tens digit of l? 2 Let s(a) = -3a + 41. Let f be s(15). Let d(k) = -k + 7. Let o be d(f). Suppose -og = -6g - 480. What is the units digit of g? 6 Let c(x) = -x3 + 76x*2 + 70x - 3978. What is the hundreds digit of c(68)? 7 Let x(z) = z*3 + 14z*2 + 12z - 9. Let i be x(-13). Suppose 3k + 5 = 11, iv - 556 = -2k. Suppose -vp + 141p = 348. What is the units digit of p? 6 Suppose -3f - 1275 = -3z, 4z - 3z - 422 = 2f. Suppose y - i - z = -54, -4i + 16 = 0. Let q = y + -261. What is the tens digit of q? 1 Suppose -2r = -8r + 408. Suppose u = 4u, 4o + r = -u. Let i = o + 107. What is the units digit of i? 0 Let b be 8868/(-10 - -4)(-3)/6. Suppose 3i - 191 = b. Suppose -15x - i = -17x. What is the hundreds digit of x? 1 Suppose 3i + 2h - 25 = 0, 2i + h = -2i + 40. Let s(w) = -w2 + 12w + 10. Let r be s(i). What is the units digit of -1 + r - (17 + -19)? 2 Let u = -35730 - -63662. What is the ten thousands digit of u? 2 Suppose -577495 - 973114 = -19p. What is the tens digit of p? 1 Suppose 0 = -27j + 225849 - 3259 + 220642. What is the ten thousands digit of j? 1 Suppose -5i - 23 = -48. Suppose -5r + 9 = 4y, -i - 3 = 2y. What is the hundreds digit of (-3)/(-15) + 774/r? 1 Let s(c) = 16c - 8. Let h be s(1). Suppose q - 19 = -6p + p, -4p = -q - h. Suppose m = 3d - 263, qd + d - 3m - 445 = 0. What is the units digit of d? 6 Let p be (5/(-10))/((-3)/(-786)). Let q = -60 - p. What is the tens digit of q? 7 Let x(d) = 46d + 21. Let v(a) = -a3 + 13a*2 + 12a + 32. Let w be v(14). Let s be x(w). Suppose -58 + s = 3i. What is the tens digit of i? 4 What is the units digit of (-3)/5 - (15 + (-50214)/15)? 2 Let s = 14206 + -5857. What is the hundreds digit of s? 3 Let l(z) = -3z*3 - 2z*2 - z. Let g be l(-1). Suppose -gu + 88 = -2d + 2u, u = 2. Let q = d - -49. What is the units digit of q? 9 Let n(i) = 523i3 - 18i*2 + 25i - 14. What is the hundreds digit of n(2)? 1 Let j be 503 + (-4 + 39)/7. Let f = -247 + j. What is the hundreds digit of f? 2 Suppose d - 1866 = 4i, -4i - 1 + 21 = 0. Let s = d + -984. What is the units digit of s? 2 Suppose -5i + 4j = -7584 - 62018, -3i + 4j = -41766. What is the thousands digit of i? 3 What is the units digit of 1(1864/(-6) - 11/33)-47? 7 Let l = 24435 - 20860. What is the tens digit of l? 7 Let r(s) = 4s3 - 65s*2 + 14s + 38. Let y be r(16). What is the hundreds digit of y(-4 - (-436)/8)? 3 Let m be (3/(-18)0)/(4 + -2). Let r be (-1 - (m - 1))11/(-33). Suppose 9 = 2s + s, g + 3s - 89 = r. What is the units digit of g? 0 Suppose -11x - 16x = -44x + 674305. What is the hundreds digit of x? 6 Let u be 58 - (-20)/23/5. Let v be -2 - (-1 + -1 - 44). Let x = u - v. What is the units digit of x? 0 Suppose 101g + 96 = 107g. Suppose -gl + 6633 = -5l. What is the units digit of l? 3 Let f = 345 - 104. Let q be (12/(-30)55)/(-4)-112. Let h = q + f. What is the tens digit of h? 2 Let f = 17708 + -6326. What is the tens digit of f? 8 Let l(c) = 2c3 + 18c*2 - 17c + 55. Let k be l(11). Suppose 996 = -16r + k. What is the units digit of r? 2 Let k(w) = -7w*3 + 6w*2 + 5w + 8. Suppose -26v + 24 = -32v. What is the hundreds digit of k(v)? 5 Let q be 9/117 - (-932)/52. Let w be -3 + 2/(6/(-315)). What is the hundreds digit of 2440/q + (-48)/w? 1 Suppose 5w = -255r + 253r + 85413, -3w - 3r + 51246 = 0. What is the ten thousands digit of w? 1 What is the units digit of 2/23 - 4905901/(-253)? 1 Suppose 1228 = 4r - 3104. Let o = r - 633. What is the hundreds digit of o? 4 Let a = -113893 + 193491. What is the thousands digit of a? 9 Let v(b) = 20b + 57. Suppose -103 + 39 = -4c. What is the hundreds digit of v(c)? 3 Suppose -17 = 5u - 92. Let x(l) = -l3 + 25l*2 - 33l + 10. What is the units digit of x(u)? 5 Suppose w = -0w + 7. Suppose 0 = 23v - 2v + 97 - 3100. Let r = v - w. What is the hundreds digit of r? 1 Suppose -p + 2b + 6389 = 2p, 5p + 4b = 10641. Suppose 0 = 3q - 8q - x + 2121, -5q + p = -x. What is the hundreds digit of q? 4 Suppose 5s = -0s + 10. Suppose 2n - 34 = -r, -sn + 3n = -r + 29. What is the units digit of r? 4 Suppose -z + 217 + 143 = p, -351 = -p + 2z. What is the hundreds digit of p? 3 Let s(t) = t*2 - 39t + 776. What is the hundreds digit of s(84)? 5 Suppose 47n - 152905 = 33n + 269741. What is the thousands digit of n? 0 Suppose -o + 62772 = 2i, -98i + 345267 = -87i - 5o. What is the units digit of i? 7 Let z(i) = 220 - 224 - 2i2 - 5i + 3i2. Let c be z(7). What is the tens digit of (64/c)/(2/20)? 6 Suppose 78703 = 4p + 2h - 20965, 5h - 10 = 0. Suppose 6134 = 18u - p. What is the units digit of u? 5 Let y = 720 - 718. Let i = 99 + -723. What is the hundreds digit of ((-23)/46)/(y/i)? 1 Let i(d) = -330d + 1. Let r = 27 - 28. What is the units digit of i(r)? 1 Let w(f) = 618f2 + 22f - 111. What is the units digit of w(4)? 5 Let u be (0 + 0)/(((-42)/(-6))/(-7)). Suppose 6g + 29 - 5 = u. What is the tens digit of (-158/g)/((-1)/(-10))? 4 Let v(j) = -96*j - 1. Let l be v(1). Let c = 17 - l. What is the tens digit of	{ "pile_set_name": "DM Mathematics" }
00)/(-26) - (-24)/156. Let c = m + -252. Let -2 - 4/3x - 2/9x*c = 0. Calculate x. -3 Let o(i) be the second derivative of -44521i*4/102 - 844i*3/51 - 4i*2/17 - 2i - 1623. Solve o(u) = 0. -2/211 Let z(q) = 10q3 + 110q*2 + 30q - 985. Let t(o) = -7o3 - 110o*2 - 33o + 986. Let d(g) = -5t(g) - 4z(g). What is c in d(c) = 0? -3, 3, 22 Let p be ((-14)/12 - 2009/(-1722))1. Let y be (-1 - 4/(-8))-4. Let 32/11t + 2/11t*3 + 16/11t*y + p = 0. Calculate t. -4, 0 Let w = 4147085/806379 - -1/115197. Factor 81/7p*2 - wp + 4/7. (9p - 2)2/7 Let m(r) be the first derivative of -r5/150 + r4/60 + 2r*3/15 - 34r*2 - 145. Let b(w) be the second derivative of m(w). Factor b(k). -2(k - 2)(k + 1)/5 Let g(l) = 10l*2 - 2. Let s(j) = -141j*2 + 87j + 168. Let o(m) = -15g(m) - s(m). Determine i, given that o(i) = 0. -23/3, -2 Let f(d) = -2d*2 - 87d - 416. Let i be f(-38). Let g(b) be the first derivative of 1/3b3 + 9 + 1/2b*i + 0b. Determine n so that g(n) = 0. -1, 0 Let l = 8115 + -97379/12. Let f(v) be the first derivative of 1/3v3 + lv*6 + 0v*4 + 0v - 1/5v5 + 35 - 1/4v*2. Solve f(d) = 0. -1, 0, 1 Suppose 362q + 1334 = 1029q. Determine u so that -8/5 - 12/5u*q + 2/5u*3 + 18/5u = 0. 1, 4 Factor -72c3 + 4000 - 6223c*2 - 1600c - 105c3 + 4033c*2 - 28c*3 - 5c*4. -5(c - 1)(c + 2)(c + 20)*2 Suppose 2q - 9 = -t, -7 = -q - 6t + 3t. Suppose k - 18 = -qk + 3y, 1 = k + 2y. Suppose -ks*2 + 4s + 9s - 7s - 3 = 0. What is s? 1 Let b = 110906 - 443623/4. Factor 1/4i2 + 0 + bi*4 + 3/2i - i*3. i(i - 3)(i - 2)(i + 1)/4 Let o(x) = -x*3 + 6x*2 - 591x + 4188. Let h be o(7). Factor 0 + 0k - 13/7k*h - 1/7k3. -k2(k + 13)/7 Let o(k) be the third derivative of -k8/53760 + k7/3360 + 7k6/5760 + k4/3 + k3/6 - k2 + 5. Let i(b) be the second derivative of o(b). Factor i(a). -a(a - 7)(a + 1)/8 Let h(b) be the first derivative of 4b3/3 - 32b*2 + 4897. Determine g so that h(g) = 0. 0, 16 Let k be 1990/4 + (-14 - (-350)/28). Let n = k - 493. Suppose 2/17o*4 + 0 + 18/17o + 6/17o2 - 10/17on = 0. What is o? -1, 0, 3 Let l(p) be the second derivative of p5/70 + 19p4/42 + 83p*3/21 + 65p*2/7 - 11p - 66. Suppose l(f) = 0. What is f? -13, -5, -1 Let x(g) be the first derivative of -8g5/25 - 609g*4/10 - 296g*3/15 + 609g*2/5 + 304g/5 + 3471. Determine f, given that x(f) = 0. -152, -1, -1/4, 1 Let z = -55415 + 55417. Factor 2/3c3 + 256/3 - 28/3c*z + 64/3c. 2(c - 8)2(c + 2)/3 Let l(m) be the third derivative of -1/60m6 + 10/3m*4 + 179m*2 + 7/30m*5 + 0m + 44/3m3 + 0. Solve l(o) = 0. -2, 11 Let v(p) be the second derivative of -p5/90 + 13p*4/54 + 560p*3/27 + 1100p2/3 + p - 5590. Determine f so that v(f) = 0. -10, 33 Let g(n) = -n3 + 16n2 - 16n + 17. Let p be g(15). Suppose -15 + 11 = j + ps, -4s - 8 = 3j. Factor j - 5/4l*2 + 1/4l*3 + l. l(l - 4)(l - 1)/4 Solve -6/11c*3 - 468/11 + 468/11c*2 + 6/11c = 0. -1, 1, 78 Let s be (12/21)/(20/70). Let m be (-18)/510/(-3). Factor -21b + mb - 29b - b*3 - 11b - 14bs. -b(b + 7)*2 Find j, given that -3/4j*4 - 171/4j*2 - 61/4j*3 - 11/4j + 51/2 = 0. -17, -3, -1, 2/3 Let a = -86 + 82. Let m(f) = 2f2 + 7f - 1. Let h be m(a). What is r in -6r - 14r - 10r2 - rh - 17r + 12r = 0? -5, 0 Let u(v) be the third derivative of -v8/504 - 8v*7/315 + 17v*6/180 + 34v*5/15 + 5v*4 - 1933v*2. Let u(z) = 0. What is z? -6, -1, 0, 5 Find y, given that -5/2y*2 + 250y + 0 = 0. 0, 100 Let m be (3/(-2))/(1/(-2)). Suppose 53g - 62g = -711. Factor 3p + mp + gp3 - 31p*3 + 33p*2 + 21p*4. 3p(p + 1)2(7p + 2) Let j be (-3686)/8 - ((-1311)/(-76) + -17). Let v be (j/1844)/(((-1)/(-12))/(-1)). Solve -2/13g*v - 4/13g*2 + 4/13 + 2/13g = 0. -2, -1, 1 Let f(d) = 63d2 - 540d - 555. Let x(a) = -73a2 + 539a + 556. Let j(q) = -7f(q) - 6x(q). What is v in j(v) = 0? -1, 183 Let y(f) be the third derivative of 1/60f6 + 0f + 3/10f5 + 7/3f*3 + 2f*2 + 5/4f*4 - 5. Factor y(m). 2(m + 1)*2(m + 7) Factor 32/3q + 0 + 2/9q*2. 2q(q + 48)/9 Let j(c) be the second derivative of -2c*2 - 14/3c*3 + 0 - 57c + 8/3c4. Suppose j(g) = 0. Calculate g. -1/8, 1 Let w(a) be the second derivative of 3/4a*3 - 2 - 68a + 11/2a2 + 1/40a*5 - 1/2a*4. Factor w(z). (z - 11)(z - 2)(z + 1)/2 Let f(k) = -5k*4 - 6k*3 + 5k*2 - 18k - 4. Let x(l) = -l*4 - 2l3 - l2 - 1. Let c(m) = f(m) - 4x(m). Factor c(u). -u(u - 3)(u - 2)(u + 3) Let u(b) = -7b + 70. Let y be u(11). Let t be (y - (-242)/33)(-3)/(-5). Determine o so that 0o + 4/5 + to*3 - 3/5o2 = 0. -1, 2 Let m(q) = q3 + 7q2 - 15. Let r be m(-7). Let k(h) = -h3 - 14h*2 + 15h + 3. Let o be k(r). Factor -68 - od2 + 60 - 42d - 139. -3(d + 7)2 Find s, given that -436/9s*2 + 0 - 80/9s*3 - 4/9s*4 - 40s = 0. -10, -9, -1, 0 Let v(k) be the third derivative of 13 + 0k + 3k*2 - 1/504k*8 + 0k*3 - 40/9k*5 - 22/9k*6 - 41/315k*7 + 0k*4. Determine d so that v(d) = 0. -20, -1, 0 Let c(m) = 2m*2 - 11m - 52. Suppose 5o + 8 = 9o. Let d(s) = 19so + 27s*2 - 45s*2 - 51 - 12s. Let t(a) = -4c(a) + 6d(a). Factor t(u). -2(u + 7)2 Let k = 115461/144370 - -7/28874. Factor -2/5n*3 - kn*2 - 2/5n + 0. -2n(n + 1)*2/5 Suppose 4p - 712 = 3m, 3p + 7m - 9m = 535. Let -14t3 + 0t*3 - 217t*2 + 2t*3 - 20t + 4t4 + pt*2 = 0. What is t? -1, 0, 5 Let j = -3/33346 - -25011/16673. Solve 24 - jq*4 + 0q*2 + 15/2q*3 - 30q = 0 for q. -2, 1, 2, 4 Let o(j) = -4176j + 58466. Let w be o(14). Factor 0 - 92/9a - 2/9aw. -2a(a + 46)/9 Suppose 6124g = 6123g + 2s, 3g - 4 = 4s. Solve 14/17i5 + 142/17i*2 - 40/17i - 38/17ig - 24/17 - 54/17i*3 = 0 for i. -2, -2/7, 1, 3 Let v be 0((-12654)/(-148))/(-171). Let vw - 112/17w*2 - 2/17w3 + 0 = 0. Calculate w. -56, 0 Let n(i) = i4 + i3 - i2 - 1. Let u(j) = 120j3 + 120j*2 - 26487j + 26247. Let c(f) = 3n(f) + u(f). Factor c(a). 3(a - 12)(a - 1)(a + 27)*2 Let c(x) = -143x*2 - 3879x - 472374. Let s(m) = 32m2 + 970m + 118094. Let z(g) = 4c(g) + 18s(g). Factor z(v). 4(v + 243)2 Suppose -97 = -3u - 88. Suppose -4q4 + 1075 - 1075 - uq*5 - 3q*5 + 8q*3 + 2q5 = 0. What is q? -2, 0, 1 Let g(n) be the third derivative of n7/1260 + n6/360 + n4/24 - n*3/2 - 4n*2. Let h(y) be the second derivative of g(y). Suppose h(r) = 0. What is r? -1, 0 Suppose 24s - 20s = 0. Let i = -743/5 + 149. Find c, given that 2/5c*3 + sc*2 - ic + 0 = 0. -1, 0, 1 Let p(y) be the first derivative of y3/3 + y2/2 - 132y + 93. Let c be p(-12). Factor c - 2/13w + 2/13w4 - 2/13w*2 + 2/13w*3. 2w(w - 1)(w + 1)*2/13 Let s be 3444/(-1845)(-30)/42. Factor 2/3t + 0 + st*3 - 3t*2. t(t - 2)(4t - 1)/3 Let t(c) be the second derivative of c*4/24 - 37c*3/6 + 102c*2 + 1443c + 2. Factor t(l). (l - 68)(l - 6)/2 Let n be ((-1745)/30 - -59) + 2/3. What is g in 0g*3 - ng*4 + 0 + 6g*2 + 0g = 0? -2, 0, 2 Let h(a) be the third derivative of a*7/630 + 7a*6/180 + 5a5/36 + a4/6 - 7957a2. Factor h(n). n(n + 1)*2(n + 12)/3 Factor 0 - 11/3s + 10/3s*2. s(10s - 11)/3 Let p(z) be the first derivative of -z7/756 + 4z6/135 + z5/27 + 8z3 + z + 7. Let q(f) be the third derivative of p(f). Factor q(o). -2o(o - 10)(5o + 2)/9 Let f = -3146293/15 - -209753. Let -32/15p - 128/15 - fp2 = 0. What is p? -8 Let q(l) be the first derivative of 3l*5/5 + 21l4/4 - l3 - 21l2/2 - 179. Factor q(a). 3a(a - 1)(a + 1)(a + 7) Let s(k) be the first derivative of -3/19k*2 + 0k - 125 + 2/57k3. Determine z, given that s(z) = 0. 0, 3 Let h = -52 - -53. Let i(f) = 11f*2 + 4f - 3. Let j be i(h). What is l in -5l - 5l*5 + 15l*2 + 10l*3 - jl*2 - 3l*2 = 0? -1, 0, 1 Let a(u) be the third derivative of -6/7u*3 + 3/70u*5 + 1/280u*6 + 5/56u*4 + 34u*2 - 2u + 0. Solve a(g) = 0 for g. -4, -3, 1 Let w(u) be the third derivative of -u*5/15 + 88u*4/3 - 15488u*3/3 + 70u*2 + 1. Let w(b) = 0. Calculate b. 88 Let x be (5/(-10))/(119/28 + -4). Let m be (-2)/(8/6)x. Determine n so that	{ "pile_set_name": "DM Mathematics" }
e of 15s4/2 + 1301s. What is g(v(j))? -40500j4 Let u(y) be the third derivative of -y5/10 + 871y*2. Let o(f) = 5f - 35. What is o(u(m))? -30m2 - 35 Let q(n) = 3n*2. Let a be 9/2(-70)/(-15). Let z be (8/(-6))/((-14)/a). Let g(m) = 7m2 + m2 + 2m*z. What is q(g(t))? 300t*4 Let q(p) = -151p. Let m(g) = 78672g. Let s(a) = 2m(a) + 1043q(a). Let w(o) = -40o - o*2 + 40o. Give w(s(z)). -22201z2 Let z(k) = 617k. Let f(p) = 542718p. What is f(z(i))? 334857006i Let t(o) = -8o2 + 33o*2 + 4o*2. Let z(k) = -194k + 16. Let a(v) = -12v + 1. Let i(l) = -16a(l) + z(l). Determine t(i(y)). 116y2 Let f(y) be the second derivative of -y4/4 - 1810y. Let n(r) = -17r. Determine f(n(u)). -867u*2 Let i(s) = -3s. Let k(f) = -f*2 + 2231788f. Calculate i(k(n)). 3n2 - 6695364n Let d(m) = -403m2. Let g(f) = 46036f*2. Calculate d(g(o)). -854083258288o*4 Let p(u) = -7u*2 + 26u - 21. Let j(i) = 87i. What is p(j(r))? -52983r*2 + 2262r - 21 Let d(m) = -84m + 175m - 90m. Let i(v) = 0 + 30v - 4 + 4. Give i(d(k)). 30k Let k(u) = 68u + 30. Let h(t) = 109t + 48. Let y(f) = 5h(f) - 8k(f). Let q(b) = 26b*2 + 29b*2 + 38b*2. Determine y(q(m)). 93m*2 Let h(r) = -11r*2 - 2r - 118. Let k(s) = 256s. Calculate k(h(m)). -2816m*2 - 512m - 30208 Let f(v) be the first derivative of -v*2/2 + 11198. Let t = 11 + 28. Let o(j) = -4j*2 + 5j2 - t + 8. Give o(f(c)). c2 - 31 Let c(r) = 1485r2. Let w(d) be the second derivative of -d3/3 - 4846d. Give c(w(k)). 5940k2 Let l(j) = -191j + 63j + 125j. Let g(u) = 51u. Determine l(g(z)). -153z Let x(b) = -3b - 2b + b + 5b. Let u be (-477)/(-27) - (2 - 14/6). Let a(g) = 3g*2 - ug*2 + 6g*2. Calculate x(a(n)). -9n*2 Let i(b) = 79b*2 - 4b + 1961. Let o(c) = c*2. Determine i(o(j)). 79j*4 - 4j*2 + 1961 Let l(k) = -k. Let f(b) = -262876174b. Calculate l(f(z)). 262876174z Let u(r) be the third derivative of 3r4/2 - r2. Let c(s) = 31766s + 31774s - 63538s. Give u(c(y)). 72y Let q(a) = 16889246a2 - 337425a - 67485. Let s(w) = 4505w2 - 90w - 18. Let g(x) = 6q(x) - 22495s(x). Let l(r) = -2r. Determine g(l(n)). -17996n*2 Let j(y) = 12y. Let m(s) = -3053 + 1016 + 17s + 1015 + 1024. Calculate m(j(o)). 204o + 2 Let j(l) = -12l2 - 10l + 35. Let x(g) = -7g2 - 6g + 21. Let d(p) = -3j(p) + 5x(p). Let h(c) = -128c2. Determine h(d(s)). -128s*4 Let f(h) = 3h. Suppose 4j + 5r + 576 = 2073, -5r + 363 = j. Let q = -213 + j. Let z(l) = 81l - ql + 80l. Determine z(f(o)). -12o Let g(l) = 3l - 15. Let z(o) = -16o + 84. Let n(p) = 28g(p) + 5z(p). Let v(c) = -17c*2 + 40 - 40. Calculate v(n(h)). -272h2 Let w(c) be the second derivative of -c4/12 - 83c3/2 + c2 - 61c - 10. Let d(k) = -2k2. What is w(d(b))? -4b*4 + 498b*2 + 2 Let r(j) = -j - 4j + 5j - 4j*2. Suppose -27 = -2a + 45. Let h(v) = -34v - av + 77v. Give r(h(p)). -196p*2 Let s(z) = 245z - 4. Let r(k) = 2576k - 42. Let o(l) = -2r(l) + 21s(l). Let i(x) = -132x. Let j(w) = w. Let c(q) = -i(q) - 165j(q). Calculate o(c(u)). 231u Let m(q) = -1278q. Let f(z) = 4415z. Determine f(m(v)). -5642370v Let y(r) = 13r. Let u(q) = 3469q + 118. Give u(y(n)). 45097n + 118 Let m(i) be the third derivative of 0i - 7 + 7/2i*4 - 6i*2 + 0i*3. Let k(a) = -3a. Determine m(k(u)). -252u Let q(d) = d2. Let u = 20736 + -20734. Let f(x) be the second derivative of 0x*3 + 1/6x*4 - 28x + 0 - 5xu. What is f(q(r))? 2r*4 - 10 Let x(n) = 21n. Suppose -12h = -23 - 25. Let c(l) = 4l*2 - 7l. Let q(d) = -d*2 + 2d. Let t(k) = hc(k) + 14q(k). Determine x(t(o)). 42o2 Let q(g) = -2g. Let v = 3427 - 2394. Let u(b) = 1 - 1 - 954b + vb - b*2. Calculate u(q(f)). -4f*2 - 158f Let n(x) = 3408646x2. Let q(v) = v + 7. What is q(n(h))? 3408646h*2 + 7 Let j(s) = -65s + 165. Let h(k) = -17k + 44. Let i(f) = -15h(f) + 4j(f). Let c(p) = 289p. Determine i(c(y)). -1445y Let f(u) = 1194u*2. Let d(m) = -49649m. Calculate f(d(g)). 2943237701994g2 Let a(b) = b. Let s(t) = -44t*2 - 75t*2 - 9t*2 - 31t*2 - 287t*2. Give s(a(v)). -446v*2 Let h(p) = 2p - 1. Let x(c) = c + 3. Let r(l) = -3h(l) - x(l). Let d(n) = -2n*2 - 5n*2 + 3n*2. Give r(d(v)). 28v2 Let i(x) = -x. Let q(f) be the first derivative of f5/5 + f*4/12 + 139f*2/2 - 123. Let s(c) be the second derivative of q(c). Give i(s(d)). -12d*2 - 2d Let h(y) be the second derivative of -y*4/6 + 34980y + 1. Let a(t) = -32t - 12. Let u(v) = -11v - 4. Let g(b) = -3a(b) + 8u(b). Determine h(g(r)). -128r2 - 128r - 32 Let y(m) = -48m - 2. Let c(d) = 46d*2 - 5d. Let a(r) = -55r2 + 6r. Let v(t) = -5a(t) - 6c(t). Give y(v(l)). 48l2 - 2 Let d be -3(2 - (-4 + 7)) + 127. Suppose -2s = 6, -4s + 46 = -4k + d. Let o(c) = -kc*2 + 40c*2 - 21c*2. Let n(p) = -4p*2 - 2p. What is o(n(u))? 16u4 + 16u*3 + 4u*2 Let i(c) = -7c - 215. Let k be i(-38). Let h(t) = -16 - 64 + t - 47 + 72 - k. Let y(x) = 2x. Determine y(h(l)). 2l - 212 Let z(s) = -4s2. Let n be -4(-42)/7 + -4. Suppose -2h = -5x + h + 119, -5x - 4h + 98 = 0. Let m(k) = -nk + 44k - xk. Determine z(m(a)). -16a*2 Let n = 158 - 107. Let h(s) = ns*2 - 8s*2 - 20s*2. Let y(r) = -3r + 5. Let p(w) = 5w - 8. Let d(o) = 5p(o) + 8y(o). Determine d(h(b)). 23b*2 Let p(v) = 362507v*2 + 4v - 4v - 362508v*2. Let f(x) = 162x + 4. What is f(p(n))? -162n2 + 4 Let i(s) be the second derivative of s3/6 - 757s. Let h(z) = -9266z. Give h(i(v)). -9266v Let q(b) = 1 - 120b - 4 + 119b + 3. Let g(m) = m*2 - 1049m. Give g(q(l)). l*2 + 1049l Let w(u) = -477u. Let y(t) = 556t. Let d(b) = 7w(b) + 6y(b). Let o(x) = 5x + 245. Give o(d(p)). -15p + 245 Let g(r) = -8r2 - 6r. Let v(z) = -3z2 - 341z - 3z2 + 336z. Let d(t) = -5g(t) + 6v(t). Let f(w) = 9w2. Give f(d(y)). 144y*4 Let i(a) = 55572 - 2a*2 - 55572. Let n(v) = 2v - 2790. What is n(i(q))? -4q2 - 2790 Let j(v) = -8783013v. Let x(m) = m. What is j(x(b))? -8783013b Let n(u) = 2u - 11. Let l(q) be the third derivative of -q*5/20 + 63q*2 - q. Determine l(n(t)). -12t*2 + 132t - 363 Let k(t) = -2t. Let b(f) be the second derivative of 1445f*3/6 + 3781f. What is k(b(w))? -2890w Let m(w) = -w - 12. Let y(f) = 3. Let q(j) = m(j) + 4y(j). Let a be 51 - (-4)/(-2). Let x(t) = -10t - 9t + at. Calculate x(q(r)). 16r Let v(n) = -2n + 666n2 - 3499 + 3499. Let f(r) = -r. What is f(v(l))? -666l*2 + 2l Let c(d) = d. Let q(u) = -57u2 + 5u + 32. Let t(k) = -2k2 + 8. Let a(z) = q(z) - 4t(z). What is a(c(b))? -49b2 + 5b Let k(u) = 1320u2. Let b(v) = 7057v*2 - 2. Determine b(k(z)). 12296116800z*4 - 2 Let k(f) = -2f. Let y(j) be the second derivative of 71j3/6 - 2j*2 + 779j. Determine y(k(o)). -142o - 4 Let d(m) = -610m + 1. Let b(f) = -8f2 + 192f + 24. Let g(c) = -c*2 + 16c + 2. Let a(h) = -b(h) + 12g(h). Calculate d(a(r)). 2440r*2 + 1 Let j(d) be the third derivative of 7d*4/24 + 1075d*2. Let u(z) = -5z + 9. Determine u(j(f)). -35f + 9 Let v(l) be the first derivative of -30 + 5l*2 + 0l*2 - 191. Let k(y) = 16y. Determine v(k(f)). 160f Let z(n) = -27n2. Let p(w) = -w2 + 23w + 113. Let v be p(27). Let a(t) = -3 - vt + 3. Give a(z(c)). 135c2 Let x(n) be the third derivative of 13n*5/20 + 76n*2 + 3. Let p be (-6)/10 + (-231)/(-35). Let o(l) = -pl*2 + 4l*2 + 0l + 0l. Calculate o(x(y)). -3042y*4 Let i(y) = -2y*2. Let v = 54 + -62. Let k be (-96)/(-36)(-6)/v. Let s(r) = -16r2 - 20r - r*k + 20r. Determine s(i(z)). -68z4 Let h(u) = 2u. Let d(o) = -99o - 24315. Determine d(h(x)). -198x - 24315 Let s(o) = -2o. Let z(k) = -10745845k + 2. What is s(z(n))? 21491690n - 4 Let i(n) = -8n*2. Let r(u) = u - 171866. Determine r(i(w)). -8w*2 - 171866 Let j(m) = -m + 67. Suppose 127h = 125h + 4. Let u(t) = -34761 + ht + 34761. What is u(j(z))? -2z + 134 Let g(v) = 12v. Let j(d) be the second derivative of -d*4/4 + 3d*2/2 + 183d. Calculate j(g(f)). -432f2 + 3 Let m(s) = -14s*2. Let j(b) = b - 7. Let n be j(9). Suppose -ny = 5h - 46, 0 = h - 4y - y - 20. Let z(x) =	{ "pile_set_name": "DM Mathematics" }
ermine m, given that m*2 - 30535m - 4849494 = 0. -158, 30693 Factor 4b4 + 16b*3 - 516b*2 - 3024b. 4b(b - 12)(b + 7)(b + 9) Factor 2x2/5 + 9494x/5 + 225700. 2(x + 122)(x + 4625)/5 Factor 5b2 - 508370b + 95396840. 5(b - 101486)(b - 188) Factor -2i3/7 - 202922i*2/7 - 5145848014i/7 + 66930322394/7. -2(i - 13)(i + 50737)*2/7 Factor 5z*2 + 1115000z + 22298000. 5(z + 20)(z + 222980) Find m, given that -m*5/6 - 35m*4/6 - 71m*3/6 + 4247m*2/6 + 12m - 702 = 0. -26, -18, -1, 1, 9 Factor -4n5 - 9712n*4 + 19440n*3. -4n*3(n - 2)(n + 2430) Let -21s*5/8 - 5655s*4/4 - 602475s*3/4 + 10672125s*2 - 1261678125s/8 + 815859375/4 = 0. What is s? -295, 10/7, 25 Factor -3i3/5 + 4374i*2/5 + 69084i + 6645288/5. -3(i - 1534)(i + 38)*2/5 Solve -5z*2 - 289990z + 115620120 = 0. -58394, 396 Let -14y5/13 + 2729554y*4/13 - 3119460y*3/13 - 2339620y*2/13 + 3119474y/13 - 389934/13 = 0. What is y? -1, 1/7, 1, 194967 Factor -3m2 - 100050m + 9330597. -3(m - 93)(m + 33443) Factor -r*5/5 - 1494r*4/5 - 5605r3. -r3(r + 19)(r + 1475)/5 Factor m*5/2 + 1139m*4/2 + 202807m*3/2 + 9898197m2/2. m2(m + 103)2(m + 933)/2 Find l such that -2l2/9 - 35266l/3 - 3277816/9 = 0. -52868, -31 Suppose 2m4/5 + 371206m*3/5 - 4825936m*2/5 + 14849208m/5 - 13364352/5 = 0. Calculate m. -185616, 2, 9 Suppose 4y4/5 + 144914824y*3/5 + 289829636y*2/5 + 144914816y/5 = 0. Calculate y. -36228704, -1, 0 Let 2f3/15 + 694f*2/15 - 204820f = 0. What is f? -1425, 0, 1078 Factor 2z3/5 + 912z*2/5 + 25074z + 1084860. 2(z + 105)2(z + 246)/5 Solve -b*4/7 - 5721b*3/7 - 395895b*2/7 - 1836575b/7 = 0 for b. -5651, -65, -5, 0 Determine t, given that -t*2 + 2793319t - 30726388 = 0. 11, 2793308 Suppose 6u5/7 + 16150u*4/7 + 10848724u*3/7 - 25439436u*2/7 - 25385562u/7 + 10886454/7 = 0. Calculate u. -1347, -1, 1/3, 3 Let -64g5 + 70386720g*4 + 35193436g*3 - 65987544g*2 - 39592548g = 0. What is g? -3/4, 0, 1, 1099793 Find j such that 4j2/9 + 312416j/3 - 4686340/9 = 0. -234317, 5 Find c such that -2c4 - 75340c*3 - 9012238c*2 - 8936900c = 0. -37550, -119, -1, 0 Determine a so that a*3/7 + 1034244a*2/7 + 4136963a/7 + 3102720/7 = 0. -1034240, -3, -1 Solve -2z3 - 34z*2 + 201468z = 0 for z. -326, 0, 309 Find k such that -2k2/9 + 757808k/9 + 5304754/9 = 0. -7, 378911 Find m such that 5m3 + 810m*2 - 39005m + 281790 = 0. -202, 9, 31 Factor -3d2 + 2921139d - 37974300. -3(d - 973700)(d - 13) Determine a so that -a*3/2 + 344873a*2/2 - 689743a/2 + 344871/2 = 0. 1, 344871 Factor 3g3 + 17862g*2 + 426885g - 444750. 3(g - 1)(g + 25)(g + 5930) Factor 3d*2 - 160738860d + 2153081759508300. 3(d - 26789810)2 Solve -3531313q*2 - 3531311q + 2 = 0 for q. -1, 2/3531313 Factor -3l3 - 15210l*2 - 3284232l. -3l(l + 226)(l + 4844) Factor -3l*2 + 5688816l + 5688819. -3(l - 1896273)(l + 1) Determine u so that -533u2/3 + 2737u/3 + 1090 = 0. -1, 3270/533 Suppose 4s3/7 - 129496s*2/7 - 4s/7 + 129496/7 = 0. Calculate s. -1, 1, 32374 Determine o so that 2o2/9 - 3430o/9 - 94484/3 = 0. -79, 1794 Determine i, given that -2i4/13 - 9150i*3/13 - 11384478i*2/13 - 2081969514i/13 - 60620162184/13 = 0. -2181, -177, -36 Find f, given that 32732f4 + 98188f*3 - 294612f*2 - 883692f + 216 = 0. -3, 2/8183, 3 Factor -2j2 + 2748j + 774720. -2(j - 1614)(j + 240) Solve -2o3 - 218o*2 + 149464o - 1034880 = 0 for o. -336, 7, 220 Factor 2t2/11 - 3593034t/11 - 17965220/11. 2(t - 1796522)(t + 5)/11 Solve 4f5 + 76836f*4 + 369177672f*3 + 1843507184f*2 - 2212761696f = 0 for f. -9602, -6, 0, 1 Let -5f2 - 15946735f = 0. What is f? -3189347, 0 Solve -2a2 + 19642020a - 19642018 = 0 for a. 1, 9821009 Find d such that -23214d2/11 - 629448d/11 + 34560/11 = 0. -1440/53, 4/73 Let 2l2 - 1996l - 59566 = 0. What is l? -29, 1027 Solve 5c2/4 - 8086075c/4 + 4043035/2 = 0 for c. 1, 1617214 Factor -2k2 + 18910k - 56712. -2(k - 9452)(k - 3) Suppose 5j4/2 + 1733j*3/2 + 37843j*2/2 - 87917j/2 - 62016 = 0. What is j? -323, -128/5, -1, 3 Let -5b4 + 86645260b*3 - 375369967378110b*2 - 750740194692020b - 375370140668645 = 0. What is b? -1, 8664527 Suppose s*2/6 + 154943s/6 - 103298 = 0. Calculate s. -154947, 4 Find i such that -2i3 + 361632i*2 - 50949778i - 103346100 = 0. -2, 143, 180675 Suppose 2f4 + 400f*3 - 44210f*2 - 233080f + 276888 = 0. What is f? -278, -6, 1, 83 Factor 4q3 - 3831452q*2 + 11494328q - 7662880. 4(q - 957860)(q - 2)(q - 1) Factor -3m*2/7 - 741333288m/7 - 45797920324740912/7. -3(m + 123555548)2/7 Factor -p5/8 + 571p*4/4 - 60435p*3 + 11208836p*2 - 765196528p. -p(p - 316)3(p - 194)/8 What is c in -c*3/7 + 18925c*2/7 + 40588c - 303040/7 = 0? -16, 1, 18940 Suppose -2k3/9 + 226k*2/9 + 312620k/9 + 1557200/9 = 0. Calculate k. -340, -5, 458 Determine v, given that -31v3 + 10v*2 + 611v + 570 = 0. -114/31, -1, 5 Solve 2940q5 - 24184q*4 - 203460q*3 + 276720q*2 - 49520q - 2496 = 0. -6, -2/49, 4/15, 1, 13 Find t such that 2t5/5 + 1364t*4/5 + 48438t*3/5 - 324908t*2/5 + 615136t/5 - 340032/5 = 0. -644, -44, 1, 2, 3 Solve -2p5/7 - 34p*4 + 18342p*3/7 - 62018p*2/7 - 70828p - 415200/7 = 0. -173, -3, -1, 8, 50 Let j*2 + 196j - 22437 = 0. Calculate j. -277, 81 Let 26685d5 + 8660130d*4 + 5764525d*3 + 960260d*2 = 0. Calculate d. -192052/593, -1/3, 0 Factor -3y*2 + 1759272y - 14073984. -3(y - 586416)(y - 8) Factor 3y3 - 15777267y*2 + 20743489166520y + 62230609495044. 3(y - 2629546)2(y + 3) Find j, given that -j*2 + 19949j - 2497698 = 0. 126, 19823 Factor -4o2/3 + 2468o/3 - 368368/3. -4(o - 364)(o - 253)/3 Factor -4a3/7 + 788a*2/7 + 24122340a/7 - 24460355700/7. -4(a - 1485)2(a + 2773)/7 Factor 2o3 + 21344o*2 + 75723112o + 89280348064. 2(o + 3188)(o + 3742)*2 Factor -2t*3/3 + 10462t*2 + 61615536t + 235201231520/3. -2(t - 20485)(t + 2396)2/3 Find k, given that -k5/9 + 40k4/3 + 1631k*3/9 - 2482k*2 - 327592k/9 - 293440/3 = 0. -14, -8, -4, 15, 131 Let -48n2 - 35653156n - 2971096 = 0. What is n? -742774, -1/12 Determine r so that -28r5/3 + 55372r*4 - 328932236r*3/3 + 218231788300r*2/3 - 554419235000r - 493039000000/3 = 0. -2/7, 8, 1975 Find q, given that q*3/3 - 3766q*2/3 - 15566207q/3 - 5187480 = 0. -2488, -1, 6255 Factor -2d3 - 161168d*2 + 9352790d - 135639844. -2(d - 29)2(d + 80642) Factor -2a3 - 76398a*2 + 5508432a - 99198432. -2(a - 36)2(a + 38271) Suppose 7o4/6 - 724o*3/3 - 75463o*2/6 - 4754o/3 + 10750 = 0. What is o? -43, -1, 6/7, 250 Determine j, given that 2j3 + 11684j*2 - 35330j - 1519700 = 0. -5845, -10, 13 Factor -2m3/5 + 601424m*2/5 - 45224075946m/5 + 1536923414628/5. -2(m - 150339)2(m - 34)/5 Factor l*3/4 + 503529l*2/2 + 2014104l + 4028200. (l + 4)*2(l + 1007050)/4 Suppose 2f4/7 + 77964f*3/7 - 15121552f*2/7 - 77964f/7 + 15121550/7 = 0. Calculate f. -39175, -1, 1, 193 Factor -2u2 + 69500u/9 + 131342/9. -2(u - 3863)(9u + 17)/9 Factor -3q*2/5 - 161682q/5 + 59977053. -3(q - 1795)(q + 55689)/5 Let 5v3 - 1746765v*2 - 6987165v + 8733925 = 0. What is v? -5, 1, 349357 Determine x so that -x*3/12 + 1118x*2/3 + 781915x/12 + 16769225/6 = 0. -85, 4642 Factor 4f2 - 69776912f + 304301090515984. 4(f - 8722114)2 Suppose -f3/5 - 108539f*2/5 - 1519399f/5 - 1063545 = 0. What is f? -108525, -7 Determine t so that -t*2/3 + 25619t - 76856/3 = 0. 1, 76856 Determine l so that 963605l3/2 - 1292198695l*2 + 11773990l - 26820 = 0. 2/439, 2682 Factor -8l2 - 50131396l + 25065700. -4(l + 6266425)(2l - 1) Solve -8c*5/3 - 3796c*4/3 - 1087633c*3/6 - 17432047c*2/3 + 1657458935c/6 - 6545954800/3 = 0. -224, -139, 55/4 Solve 4z2 + 114480z - 457984 = 0 for z. -28624, 4 Suppose -3y4/4 + 476808y*3 - 303124010589y*2/4 - 303141652659y + 1591441108047 = 0. What is y? -7, 3, 317874 Factor -3s2 + 858711s + 79886070. -3(s - 286330)(s + 93) Factor 3m3 - 28645197m*2 + 68378813693832m + 615411643507632. 3*(m - 4774	{ "pile_set_name": "DM Mathematics" }
Simplify (ss(-2/5))/(((((((s/s(10/17))/s)/s)/s)/s)/s)/ss) assuming s is positive. s(441/85) Simplify (j(-3)j/(j/(j/(jj*(-2/17))j)))/(j*0j(-2)) assuming j is positive. j(2/17) Simplify (g/(g/(gg(-1)/g))g)*49(g(-2/5))8 assuming g is positive. g(-16/5) Simplify h(-2/25)h(12/7) assuming h is positive. h(286/175) Simplify y28/(y18/y) assuming y is positive. y11 Simplify (z(1/3)/z)(-14/5)/(z/z(-1/5)z((z(2/9)/z)/z)/z) assuming z is positive. z(22/9) Simplify j(-2/11)/j(-17) assuming j is positive. j(185/11) Simplify a(-1/3)a*(-1)/a(a/((a(2/7)/a)/a))46 assuming a is positive. a(2573/21) Simplify (k0)*(25/4) assuming k is positive. 1 Simplify (bb/(b/(b*(-2)/b))b)*(6/23)((b/b(-1))/b)/b(-5) assuming b is positive. b(132/23) Simplify (c0/c)*(-46)(cc(-6))/cc*(-7)/cc assuming c is positive. c33 Simplify v4(((vv/(vv(-2/13)))/v)/v)/vv assuming v is positive. v(41/13) Simplify b(2/3)bbbb/(bb2)b(b/b(-1))(5/6) assuming b is positive. b(13/3) Simplify ((w/w(-5/7))/www2)/(w(-8)/w(1/7)) assuming w is positive. w(83/7) Simplify (u(-1/3)u)*(-26)u4/u5 assuming u is positive. u*(-55/3) Simplify ((uu0/u)(-36))*24 assuming u is positive. 1 Simplify ((q/(qq*(-1/4)q))(3/8))1 assuming q is positive. q(-9/32) Simplify t(-5/8)tt17 assuming t is positive. t(139/8) Simplify ((r/r(-2/7))2)(8/3) assuming r is positive. r(48/7) Simplify k(-43)/k38 assuming k is positive. k*(-81) Simplify (oooo/o*(-1/3)o)(10/19)/(o(3/2))(2/53) assuming o is positive. o(8309/3021) Simplify c*4/(cc*(3/4)c)c((c/(c/c*(-2)))/c)/cc(2/7) assuming c is positive. c(-41/28) Simplify ((w/(w/(w/w(2/9))))/(w/(w0w)))/(w/(ww*(-2/9)w)w/((ww0)/w)) assuming w is positive. w(5/9) Simplify a*14a/((a*(-2/51)a)/a) assuming a is positive. a*(767/51) Simplify mm*(-3/5)mmmmm/(m*(-1/5)m)(mm(-1))12 assuming m is positive. m(23/5) Simplify (c47)(2/15) assuming c is positive. c(94/15) Simplify q/q*(2/11)qqq/(q*10q) assuming q is positive. q*(-79/11) Simplify (ff/((f*(-26)/f)/ff))/ff(-32)ff assuming f is positive. f(-2) Simplify ((aa/(a*(1/6)a))(-8))33 assuming a is positive. a(-220) Simplify (r1)28/((r(2/13)/r)/r(-2/3)) assuming r is positive. r(1099/39) Simplify (u5)34 assuming u is positive. u*170 Simplify ww*1ww/(www8)(w/(ww/(ww*(-2))w)www)(-5/7) assuming w is positive. w(-6) Simplify k(-2/15)k/k15 assuming k is positive. k(-212/15) Simplify (d/(d/(dd/(d/d(-14)))))/d1 assuming d is positive. d(-14) Simplify ((zz/(z/(z/(z0/z))))/z4)(3/26) assuming z is positive. z(-3/26) Simplify ((ii/i(-3/8))/(i/i15i))(-15) assuming i is positive. i(-1845/8) Simplify a/(aa/(a/((a/(a/(a/(aa/a*(-37))))a)/a))aaa)a(1/15) assuming a is positive. a(526/15) Simplify (hh12)/hhh(h/h(-2))/h assuming h is positive. h16 Simplify yy17y/((y/((yyy*(-13))/y)y)/y)y assuming y is positive. y7 Simplify (y7y*9)/((yy/(y/y*(2/5)))/yy(-8)) assuming y is positive. y(118/5) Simplify ((z7)(-3))(-6) assuming z is positive. z126 Simplify (t(-3/5)/(t/(t(-2/7)t)t))10 assuming t is positive. t(-132/7) Simplify f/(f/f*(1/17))ff22 assuming f is positive. f(392/17) Simplify (kk/(kk(-7))kk/(k/k(4/9))kk)/(k(2/7))11 assuming k is positive. k(523/63) Simplify d(4/3)/(d/(d(-1/7)d)) assuming d is positive. d*(25/21) Simplify ((t((t/(tt/(t/t4)))/t)/t)/ttt/((t(tt(3/2))/t)/t))47 assuming t is positive. t(-517/2) Simplify j(4/7)jj(-9)jjjj0j/j(-1/4) assuming j is positive. j(-89/28) Simplify (y/y*(4/9)y/y*(-1))/(yy(1/3))(-1/13) assuming y is positive. y(311/117) Simplify ((s(1/11)/ss)/s(-4))(1/41) assuming s is positive. s(45/451) Simplify (kk*(-3/7))/((kk*(-6))/k)(k*2/kkk)/k(-3/2) assuming k is positive. k(155/14) Simplify ((p(p/p(-2))/p)/p(3/8))/(p/(ppp/p*(5/7)pp)p/p4) assuming p is positive. p(499/56) Simplify ((ll(-7))/ll)/((((l/l*(-13/2))/lll)/l)/ll) assuming l is positive. l*(-27/2) Simplify (hh(1/2))0/(((h/(h*(2/5)/h))/h)/(hh(-1/8))) assuming h is positive. h(11/40) Simplify (m*(-3/2)/(m/(mm(2/13))))/(m2/(m(m/(mm(m(-3)m)/m))/m)) assuming m is positive. m(-35/26) Simplify (x/(x/(x/x(-2))x)xx(3/5)x)/(x(3/5)/x(1/10)) assuming x is positive. x(41/10) Simplify (m/(m/(m/(((m/(m/(m/(m(2/11)m))))/m)/m))))/mm(2/5) assuming m is positive. m(142/55) Simplify (k(1/3)/((k/(k4/kk))/k))/((k(1/3)/kk)/k(-4/3)) assuming k is positive. k(8/3) Simplify ((b(b(-6)/b)/b)/(b4/b))42 assuming b is positive. b(-420) Simplify q34/q(-2/21) assuming q is positive. q(716/21) Simplify ((((g(2/3)g)/gg)/g)/g(-10))30 assuming g is positive. g320 Simplify (s4/ssss(s(ss(2/5)s)/ssss)/sss)/(s(-5)s(ss(-2/3))/s) assuming s is positive. s(256/15) Simplify (((r(r/r(-3))/r)/r)/r)/(rrr(-2/13)rrrrr)r(1/2)/r(-4) assuming r is positive. r(-9/26) Simplify w/(w/(ww/(ww(1/10))))w44 assuming w is positive. w(449/10) Simplify j*(-8)/((jj*6)/j)(j(-2/3))(2/21) assuming j is positive. j(-886/63) Simplify p4/(p/((pp/p(3/2))/p))(ppp*(2/3)/p)/((((pp/p3)/p)/p)/p) assuming p is positive. p(49/6) Simplify (m(-6)/m)(-22) assuming m is positive. m154 Simplify (i(-6)i5)/(ii*(1/11)i(-1/8)/i) assuming i is positive. i(-85/88) Simplify xx(-3/7)xxxx23/x assuming x is positive. x(179/7) Simplify (a1)(-1/25)a(1/6)/(a/(a(1/9)/a)) assuming a is positive. a(-793/450) Simplify q(-4/15)/((q*24q)/q) assuming q is positive. q*(-364/15) Simplify (p(p*(8/9)p)/p)/(p*(-9)p) assuming p is positive. p(89/9) Simplify (z(-5)z(1/2))(-1/5) assuming z is positive. z(9/10) Simplify ((n/(n(3/5)n))/n)(2/13) assuming n is positive. n(-16/65) Simplify a(-1/9)/a(-1/4)a7/(a/a(-1/2)) assuming a is positive. a(203/36) Simplify ((ll28)/l)(3/2) assuming l is positive. l42 Simplify (x(1/8)/x)(-6) assuming x is positive. x(21/4) Simplify (z/(z(-3/7)/z))21 assuming z is positive. z51 Simplify (f/(f1/f))*(-33)/(ff*(-2/7)fff(-2/5)) assuming f is positive. f(-1236/35) Simplify (rr/(r2/r)(rrr/(r/((r/((rr(-17))/r)rr)/r)))/r)(-1/49) assuming r is positive. r(-3/7) Simplify (i/(ii(-1/3)))(8/11)/(ii(-4/5)ii(-6)) assuming i is positive. i(832/165) Simplify ((n(1/2))(10/17))(4/3) assuming n is positive. n(20/51) Simplify k/(k(-9)/k)k*(2/5)(kkk/(k2/k))(-10/9) assuming k is positive. k*(413/45) Simplify (vv/(v*(-1/5)/vv)v)/(((vv*(-4/3)v)/v)/v) assuming v is positive. v(68/15) Simplify (a/(a16/a))/(a/(aaa(-7/4))) assuming a is positive. a(-59/4) Simplify l*4l/l(4/9) assuming l is positive. l(41/9) Simplify (c*(-4/3)c/c(1/7))/(c1/c)(-9) assuming c is positive. c(-10/21) Simplify (dd/d(1/4))(-2/15)((dd/(d/((d/(dd*(-7)dd))/d)))/dd)/d5 assuming d is positive. d(-7/30) Simplify rr/(r21/rr)r/(r/(r/(r/(rr*(-2/27)/r)))rr) assuming r is positive. r(-569/27) Simplify (l/(ll/(l*(-2/5)/l)l))24 assuming l is positive. l(-408/5) Simplify ((hhh*(-2)h)/hh/(hh1))/(h/h6hh/(((h*(2/13)h)/hhhh)/h)h) assuming h is positive. h(41/13) Simplify v(-4/25)/vv(-27/4) assuming v is positive. v(-791/100) Simplify ((aa*7a)/(a*(-1/2)/a))/((a/(aa/(aa2)a)a)/a)(-1/23) assuming a is positive. a(485/46) Simplify ((d(d(d(35/4)/d)/d)/ddd)/ddd)/d(-27) assuming d is positive. d(151/4) Simplify (x/(x0x))*(-1/26)(x(-1/4))(34/7) assuming x is positive. x*(-17/14) Simplify (uu*(-2)u)(2/5)/((u8uu)/uu(2/39)) assuming u is positive. u(-353/39) Simplify (j(-12))(2/75) assuming j is positive. j(-8/25) Simplify (rr/r(-4/7))/((r/(r/(r(-5)r)))/r)(r(-2))(-1/32) assuming r is positive. r(855/112) Simplify (y(-3)yy((y/(y3/yy))/yyy)/y)/(((yy*5)/	{ "pile_set_name": "DM Mathematics" }
econd derivative of 3823j7/42 + 11j*4/12 + 59j*2 + 152j - 10. Find the third derivative of f(y) wrt y. 229380y2 Suppose 4u - 1 = 7. Suppose 631 - u = 17s. What is the derivative of -21 - 15 - 16 - 6c*3 + s wrt c? -18c*2 Let z(o) be the first derivative of -2/3o*3 + 0o*2 + 49o + 7/4o4 - 48. Differentiate z(t) with respect to t. 21t*2 - 4t Let x(r) be the third derivative of 223r4/6 + 791r*3/3 - 2r2 - 95. What is the derivative of x(g) wrt g? 892 Let h(k) be the third derivative of -k5/5 - 13k4/24 - 53k*3/2 + 1529k*2. What is the derivative of h(l) wrt l? -24l - 13 Let b(j) = -j3 + j2 + 1. Let t be b(0). Suppose -4o = 4f - 28, 3o - 7f = -3f - 7. Differentiate t - 14 - 2x*3 + 2xo + x4 with respect to x. 4x3 Let b(q) be the second derivative of -376q*4/3 - 55q*2/2 - 1318q. What is the first derivative of b(y) wrt y? -3008y Let l(v) be the first derivative of -78 + 0v*2 + 110v - 38/3v3. What is the first derivative of l(t) wrt t? -76t Find the first derivative of 11859o2 + 67 - 189o*4 - 23730o*2 + 11879o*2 + 270 wrt o. -756o*3 + 16o Let w(v) = -v*3 - v + 1. Let c(l) = -139l*3 + 62l - 1. Suppose 8 - 1 = 7z. Let a(f) = zw(f) + c(f). Find the second derivative of a(y) wrt y. -840y Let h(o) be the first derivative of -27/2o*2 - 12o*3 + 50 + 0o. Find the second derivative of h(f) wrt f. -72 Let n(i) = 13i2 - 12i + 68. Let l(q) = -1 + 2q2 + 0 + 22q - 24q. Let w(s) = -3l(s) + n(s). What is the derivative of w(g) wrt g? 14g - 6 Differentiate -2438 + 1984n + 7728n - 6110n + 3171n - 1146 with respect to n. 6773 Let u = 125 + -122. Find the second derivative of 84f*3 - 171f*3 + 36 + 4f - uf + f - 3 wrt f. -522f Let r(o) = -225o3 + 24o*2 + 8o - 642. Let u(i) = 673i3 - 66i*2 - 22i + 1926. Let t(j) = 11r(j) + 4u(j). What is the derivative of t(f) wrt f? 651f2 Let t(w) = w3 - w + 48. Let m be t(0). Suppose -4g + 3k = -m, 4k - 4 = -2g - 2. Differentiate -a4 + 2 + ga4 + 10 + a4 wrt a. 36a3 Suppose 6r - 1761 = -1743. Let s = 0 - -3. What is the second derivative of 82f - 114f + 0fr + 26f*s wrt f? 156f Find the second derivative of 1789p + 4p*3 - 220p*4 + 7765p + 4p3 - p3 wrt p. -2640p*2 + 42p Suppose 0b = z - 5b + 54, 2z + 5b + 168 = 0. Let j = 78 + z. What is the first derivative of 4v4 - 8v4 + v4 - 23 - 2vj wrt v? -20v*3 Let a(v) be the first derivative of 0v*4 + 0v*2 - 21/5v*5 + 32v - 72 + 0v3. Differentiate a(d) wrt d. -84d*3 Let d(t) be the first derivative of -23t*4/24 + 97t*3/6 + 128t*2 + 183. Let p(f) be the second derivative of d(f). What is the derivative of p(q) wrt q? -23 Let i = 21645 - 21643. Let l(s) be the third derivative of 0s*3 + 0s + 0 + 0s4 + 1/2s5 + si - 1/5s6. Find the third derivative of l(j) wrt j. -144 Let r = -5 + 25. Find the third derivative of -14 - h2 + rh*4 + 0h*2 + 17 wrt h. 480h Let j be (-25)/(-10)4/5. Suppose -11 = 3v - 4y, 2y - 23 = -v - jy. What is the second derivative of -7d*v + 10d*3 + 30d*3 + 32d + d*3 wrt d? 204d Let u(h) be the third derivative of 379h5/15 + 53h4/24 - h3/3 - 737h2. Find the second derivative of u(w) wrt w. 3032 Let z(w) be the second derivative of -w4/2 - 143w*3/6 - 847w*2 - w + 160. What is the first derivative of z(g) wrt g? -12g - 143 Suppose 49t = 115 + 81. Differentiate 101 + 85b*4 + 23 + 117b*t with respect to b. 808b*3 Let p(u) = -1048u*2 + 10u + 2511. Let s(h) = 2093h2 - 23h - 5021. Let w(i) = 9p(i) + 4s(i). What is the first derivative of w(n) wrt n? -2120n - 2 Let d = -246 - -427. Differentiate 16 - 375f*2 + 262f*2 + df*2 wrt f. 136f What is the second derivative of 692p - 7999 + 482p*2 + 194p*2 + 495p*2 + 15991 - 7993 wrt p? 2342 Suppose 18 = -2g - 4c, -4c = g + 5 + 12. Let j be 4/(-4) + g + 5. What is the second derivative of 57rj + 47r + 56r3 - 206r*3 + 59r*3 wrt r? -204r Let p be 63/13 - -21/13. Let l(r) be the second derivative of 0 - 3/4r*4 + 0r*3 + 0r*2 + 1/20r*p - 9r. What is the third derivative of l(d) wrt d? 6 Let s(k) be the third derivative of -27/40k6 - 63 + 0k + 0k3 + k2 - 1/3k*4 - 2/15k*5. What is the third derivative of s(q) wrt q? -486 Differentiate 21 - 62f*3 - 40 + 130 + 698f*3 with respect to f. 1908f*2 Let t(u) = 2u*2 + u - 2. Let h be t(-2). Let p = -425 + 428. What is the second derivative of -pk + 5kh + 2k*4 + 5k*4 wrt k? 144k*2 Suppose -7f - 6455 = -6476. Let s(i) be the second derivative of 15i + 0 + 47/20i*5 + 0i*2 - 1/6i*f + 0i*4. Find the second derivative of s(c) wrt c. 282c Let l be 12/(792/1397) - 10/(-12). Find the first derivative of -22o + lo - 50 + 68o2 - 2o wrt o. 136o - 2 Let c(w) be the second derivative of 0w*2 + 0w*5 + 67/6w*3 - 1/12w*4 + 3w - 10/3w7 + 0w*6 - 41. What is the third derivative of c(l) wrt l? -8400l*2 Let j be 96/4846/4. Find the second derivative of -211z2 + 3z - 13z2 + j + 4 + 21 wrt z. -448 Let j(w) = 14w*4 + 7w*3 - 1677w - 5. Let b(g) = -13g4 - 7g*3 + 1673g + 6. Let d(u) = -5b(u) - 6j(u). Find the second derivative of d(o) wrt o. -228o2 - 42o Suppose -15 = -5c, c + 4c = -j + 38. What is the third derivative of 0 + jq2 + 0 - 9324q*3 + 9323q*3 + 2q wrt q? -6 Suppose -5a = -17a. Suppose 0 = -w - a + 2. Find the first derivative of -6 + 4 + 3 + 0 + 24ow wrt o. 48o Let v be (-6)/9-3(7 - 5). Suppose vr + 0r = -4, 2r - 7 = -3o. Find the third derivative of 0f + 0f - 3fo - 5f*2 wrt f. -18 Let s(a) be the second derivative of -1/3a*6 + 0a*4 + 2a + 1/5a5 - 1/3a*3 + 12 - 21/2a*2. What is the second derivative of s(o) wrt o? -120o*2 + 24o Find the second derivative of 38104366 - 38104366 + 6871b - 11904b*3 wrt b. -71424b Let b = 39 + -27. What is the second derivative of -s*2 + 19s + 61s2 + bs - 9s wrt s? 120 Let w(n) be the first derivative of -269n*4/4 + 4n*3/3 + 1245n*2/2 - 159. Find the second derivative of w(t) wrt t. -1614t + 8 Let u(x) = x*2 - x - 21. Let p be u(6). What is the derivative of -40j*4 - p + 139j*4 - 39j*4 - 32j*4 wrt j? 112j3 Let v(a) = a2 - 8a + 20. Let z be v(3). What is the second derivative of -zu*2 - 2u*2 - 33u + 10u2 + u3 - 2 wrt u? 6u + 6 Let x(b) be the second derivative of -53b7/210 + b3/6 - 23b*2 + 16b. Let k(h) be the first derivative of x(h). Find the first derivative of k(l) wrt l. -212l3 Let v(p) = p2 - 3p + 4. Let z be v(3). Let d = -905 + 939. What is the third derivative of -7yz + 4y*2 + dy3 - y4 - 34y3 wrt y? -192y Let d(w) = 144w2 - 857w + 16228. Let b(u) = 45u2 - 285u + 5409. Let c(k) = -13b(k) + 4d(k). Differentiate c(y) wrt y. -18y + 277 Suppose -5q + 124 = -4m, -4m + 4q - 2 = 126. Let o = m - -38. Find the second derivative of -238h*2 - 8h + 242ho - 4h wrt h. 8 Let f(h) be the first derivative of 1891h5/5 - 170h*2 - h + 2990. Find the second derivative of f(p) wrt p. 22692p*2 Let x(s) be the first derivative of 0s*6 + 29/7s*7 + 0s + 0s2 + 0s5 + s3 + 98 + 0s4. Find the third derivative of x(c) wrt c. 3480c3 Let j(y) = y2 + 8y + 4. Let v be j(-8). Let z(r) = -r2 + 6r + 6. Let b be z(6). What is the derivative of -11 + b - 9av + 15 wrt a? -36a*3 Let o(u) = 1779u*2 + 185u + 11. Let p(r) = -3557r2 - 389r - 21. Let n(m) = 9o(m) + 4p(m). What is the second derivative of n(t) wrt t? 3566 Suppose -5x + 18 = 13. Let l(r) = -r. Let g(j) = 1 - 12j*2 - 6j*2 - 5j + 4j + 0. Let y(i) = xg(i) - l(i). Differentiate y(c) wrt c. -36c What is the second derivative of -279 + 534p*3 + 279 - 1293p - 2487p3 wrt p? -11718p Find the second derivative of -553q + 97 - 311q*3 - 574q*3 + 3 + 29 + 552q wrt q. -5310q Let b(t) = -2t*3 - 26t*2 + 27t - 12. Let d be b(-14). Find the third derivative of -5k5 + k3 - 10k*d - 83k*2 + 5k*5 - 68k*6 - 31k*2 wrt k. -8160k*3 + 6 Find the second derivative of -25334r*3 + 25335r*3 - 1730r*4 - 513r - 3227r4 + 2627r wrt r. -59484r2 + 6r Let s be 16/(-32)*	{ "pile_set_name": "DM Mathematics" }
0))4))). sqrt(5)/48 Simplify -6-3((3sqrt(320) + sqrt(320) + 2)-6 + 5(1 + -5 + sqrt(320) - sqrt(320))*2). -3456sqrt(5) + 1224 Simplify (5(sqrt(7) + 0) + -6(-4 + sqrt(7)) + 5(sqrt(693)-2)/sqrt(11))*2. -1488sqrt(7) + 7303 Simplify (2-5(-2sqrt(4536) - sqrt(4536) - sqrt(4536)))/((sqrt(200)-2 + sqrt(200) + sqrt(200) - sqrt(200)) + sqrt(200) - sqrt(8)-1-2). -180sqrt(7) Simplify (sqrt(972)-1)/(-2sqrt(900)) + (sqrt(45)/(-1sqrt(5) - sqrt(5)))/(-1(sqrt(3) + 2sqrt(3))). 7sqrt(3)/15 Simplify ((-4 + (sqrt(288) + 3 - sqrt(288)))2 - sqrt(288) - sqrt(24)/(3sqrt(300) - sqrt(12)))4-3. -12 + 1014sqrt(2)/7 Simplify (sqrt(208)/((sqrt(8) - sqrt(128))-4)2)/((sqrt(18)/sqrt(3))/sqrt(3)63). sqrt(13)/108 Simplify -4 + (-3 + sqrt(468) + (sqrt(468) + -1)-6 + (-3 + -1 + sqrt(468) - (sqrt(468) + -4 + (sqrt(468) + 1 - sqrt(468)) + sqrt(468))))*2. -144sqrt(13) + 16848 Simplify (sqrt(1250)-4-2)/(sqrt(90)-2 - 1sqrt(160)). -4sqrt(5) Simplify 1 + (sqrt(80)2 + sqrt(80) - -4sqrt(40)/sqrt(2))/(sqrt(90)/(sqrt(18)/(sqrt(4)/sqrt(2)))). 1 + 10sqrt(2) Simplify (1((-4 + sqrt(200) + (4-3sqrt(200) - sqrt(200)))2 + -1 + 1))*2. 3840sqrt(2) + 115264 Simplify (-3((sqrt(77) - (sqrt(77) + (sqrt(77)5 - sqrt(77)))) + sqrt(77))5)/(1(sqrt(1331) + sqrt(1331)2)). 15sqrt(7)/11 Simplify (sqrt(36)/(sqrt(12) + sqrt(60)/sqrt(5)-5))2 + 4 + ((0 + sqrt(108))-1 - (sqrt(108) - 3sqrt(108)2))*2. 27715/16 Simplify ((sqrt(51) - (sqrt(6171) - (4sqrt(6171) + sqrt(6171))))-2)/(-3sqrt(363)-4 + sqrt(363) + sqrt(363)) + -2. -45sqrt(17)/77 - 2 Simplify ((-5sqrt(396))21 + -5 - (sqrt(275) + 5 + sqrt(99)/(-4sqrt(9)))) + -5. -19sqrt(11)/4 + 9885 Simplify (-2 + (sqrt(1900) + 2 + sqrt(1900))-6 + 2 - 3((6(0 + sqrt(475)) - sqrt(475)) + sqrt(475) - -1(sqrt(475) - (-1 + sqrt(475)))))*2. 6300sqrt(19) + 838125 Simplify -1 + (sqrt(297)/(sqrt(36)1)3)/((sqrt(30) - (sqrt(180)1 + sqrt(180))/sqrt(6))/sqrt(10)-2). -1 + 3sqrt(11)/4 Simplify 3((sqrt(125) + ((-6sqrt(125)-2 - sqrt(125)) + sqrt(125) - sqrt(125)))2 - (sqrt(125) + 1 + sqrt(125))24 - (-1 + -3sqrt(125)-3)). -375sqrt(5) + 47991 Simplify (sqrt(912)24 + -6sqrt(57)-16)/(-4(2(-2sqrt(363) - sqrt(363)) + sqrt(363) - sqrt(363))-5). -17sqrt(19)/330 Simplify (6((3 + (sqrt(448) - (sqrt(448) + 1)) - sqrt(448)) + sqrt(448)) + -4 - 1(sqrt(175) - 1sqrt(175)3)-5)2. -800sqrt(7) + 17564 Simplify (-1 + sqrt(80)1 + 4 + -6(-1 + sqrt(80))-6 + 4)2 + 0. -8584sqrt(5) + 110361 Simplify 0 + (-2(4 + (-2 + sqrt(405) + -1 - 2(sqrt(405) + -1)) + -2)6)2. -2592sqrt(5) + 58464 Simplify -5((-3(sqrt(396) + 0))*25 + -4-5(sqrt(55)/(sqrt(20)/sqrt(4)))*2). -90200 Simplify 5 + 1 + ((-1 + sqrt(1216) + sqrt(1216))3 + sqrt(1216) + 3 + 2)*2. 224sqrt(19) + 59594 Simplify ((sqrt(38) + 1sqrt(38)-1)-5-4)/((-2sqrt(648))/(sqrt(100) + sqrt(100)2 + sqrt(100))). 0 Simplify (2 + (6(-4 + -3 + sqrt(343)) + 4)-6 + -5)*2-3. -1485459 + 340200sqrt(7) Simplify (-5sqrt(9)2 - (sqrt(9) - sqrt(81)/(sqrt(90)/sqrt(10))))/((sqrt(147) - (sqrt(147)-1 - sqrt(147)))-5-4). -sqrt(3)/42 Simplify ((-1sqrt(700) - sqrt(280)/(sqrt(50)/sqrt(5) + sqrt(10))) + -2(2 + -3sqrt(28) + 4))2. -24sqrt(7) + 151 Simplify (sqrt(63) + 1sqrt(63))/sqrt(9) + (sqrt(252))2 + sqrt(28) - (-1sqrt(2268))*2 - (-4 + 4 + -3sqrt(7) + -3 + sqrt(7) + sqrt(56)/sqrt(8)). -2013 + 5sqrt(7) Simplify (-3((sqrt(300) + (sqrt(300) + 0 - sqrt(300)))44 + -3)-5)26. -1296000sqrt(3) + 103692150 Simplify ((sqrt(10) - -5sqrt(40))/(sqrt(245)-4))2 + ((sqrt(36)/(sqrt(18)/sqrt(2)))/(sqrt(242)-2))*2-6. 13465/47432 Simplify -6(5 + (-6(sqrt(1331) - 4(0 + sqrt(1331) + sqrt(1331))) - (-3 + (sqrt(1331) - (sqrt(1331) + -1 + sqrt(1331) + sqrt(1331)-2 + sqrt(1331)))))*2). -14087358 - 11088sqrt(11) Simplify -3 + (-4sqrt(1275)-5)/(sqrt(48) + 3sqrt(48) + sqrt(48) + -1sqrt(9)/sqrt(3)). -3 + 100sqrt(17)/19 Simplify ((55(sqrt(405) + -2) + -6(sqrt(405) + -1) + (sqrt(405) - (sqrt(405) + 1 + sqrt(405) + 1) - sqrt(405)))-2 + 2)2. -57528sqrt(5) + 477016 Simplify (53sqrt(66) + (-1sqrt(66) + sqrt(66) + sqrt(66))5)/(6-2sqrt(600) - (sqrt(600)-2 + sqrt(600))-6). -sqrt(11)/9 Simplify (2(5 + 1 + 3 + (-1 + sqrt(272))-1 + (1 + sqrt(272) + -3 - sqrt(272))))*2. -256sqrt(17) + 1344 Simplify ((-2sqrt(500) - (-3sqrt(5) + 4)) + 4(-3sqrt(320) + sqrt(320)) + 4)*2. 32805 Simplify (-1 + ((sqrt(684)-3 + sqrt(684))2 + -2 + (sqrt(684) - (sqrt(684) + sqrt(684) + 3)) - (sqrt(684) - (-2 + sqrt(684) + 0))-3-2))2. 1080sqrt(19) + 17424 Simplify 4 + -5(-2sqrt(143)-4)/((1sqrt(33))/sqrt(3)) + -4. -40sqrt(13) Simplify (2((1sqrt(162) + sqrt(162) + 0 - -3sqrt(162)2) + 0 + -5 + sqrt(162)-2)-3)2. -19440sqrt(2) + 210852 Simplify -3 + (0 + 0 + sqrt(363) + -2 + 1sqrt(363) + sqrt(363) - -6(4 + sqrt(363) + 0 + -2))*2. 1980sqrt(3) + 29500 Simplify (1sqrt(1782)2-6)/(1sqrt(176)2 + (sqrt(176) + (sqrt(176) - (sqrt(176) + (-1sqrt(176) - sqrt(176)))))-3). 27sqrt(2)/7 Simplify (-3(-2sqrt(209)2 + sqrt(209) - ((sqrt(209)-1 - sqrt(209) - sqrt(209))3 + sqrt(209))))/((sqrt(1408) + -2sqrt(1408))/(sqrt(24)/(1sqrt(12)))). 15sqrt(19)/8 Simplify ((sqrt(90) - 1sqrt(90))/sqrt(5)6)/((sqrt(36) + sqrt(324)3 + sqrt(324))/sqrt(6)). 0 Simplify ((-4 + sqrt(162)-1 + 0)*2 + (-5sqrt(288)-2-5)*2)-3. -2160534 - 216sqrt(2) Simplify 2(sqrt(99) + 1) + (sqrt(99)-3)2 + -2 + (sqrt(99) - (1 + sqrt(99) + -5)2) + ((-2 + sqrt(99))2 + 5 - sqrt(99)). 18sqrt(11) + 884 Simplify (2 + 1(-3 + (sqrt(2057) + 2)4 + (sqrt(2057) - 3(sqrt(2057) + -1)) + -4 + sqrt(2057)1))*2. 396sqrt(17) + 18549 Simplify ((2(sqrt(84)-1 + sqrt(84))-1)/(-4(sqrt(972) - (sqrt(972) - sqrt(972)-2) - sqrt(972))))2-1. 0 Simplify -1 + -1((sqrt(196)/(sqrt(63)/sqrt(9)))/(sqrt(4) + (sqrt(4)-5 - sqrt(4))4))2-3. -508/529 Simplify (-4 + sqrt(95)/(sqrt(10)/sqrt(2)) - (62sqrt(684) + sqrt(684))*2) + (sqrt(152) - 1-1sqrt(152))/((sqrt(32)/sqrt(4) + sqrt(8))-2 - sqrt(8)). -115600 + 3sqrt(19)/5 Simplify (5sqrt(1700)2 + (sqrt(1700) - (sqrt(1700) - (sqrt(1700)1 - sqrt(1700))))-1)2 + 1 - -6((sqrt(2448) - 1sqrt(2448) - sqrt(2448)) + 1 + -4). -72sqrt(17) + 169983 Simplify -1 + (((sqrt(32) - -4sqrt(128))/sqrt(4)6)/((sqrt(400) - ((1sqrt(400) - sqrt(400)) + sqrt(400)) - sqrt(12)/sqrt(3)-2)-4))2. 721/8 Simplify ((-1sqrt(34)-4)/(-1sqrt(8)) + -2 + 3sqrt(102)/sqrt(6)-2)*2-6. -6552 - 192sqrt(17) Simplify (46(-5 + (sqrt(112)1 + 0 - -5(sqrt(112) + 1)))-6)*2. 83607552 Simplify (4(-5 + (2 + sqrt(275)3)4-5) + -2)2. 436800sqrt(11) + 15873124 Simplify ((-2 + (sqrt(45) + sqrt(45) + -2 + sqrt(45) + -4 - -1(sqrt(45) + 4 - sqrt(45))))4)*2. -1152sqrt(5) + 6736 Simplify (-1(-2sqrt(152)3 + sqrt(152) - (sqrt(152) + -4(sqrt(152)-1 - sqrt(152)) + sqrt(152) + sqrt(152))))/(2sqrt(512)2-1). -sqrt(19)/2 Simplify (-3sqrt(17)3 - sqrt(17)) + sqrt(17) + (sqrt(17) + 0 + sqrt(68))2 + (-5 + (sqrt(272)/sqrt(8))/sqrt(2) + -1)2. -21sqrt(17) + 206 Simplify (sqrt(416) - -4(sqrt(416)-2 + sqrt(416)) - sqrt(416) - ((sqrt(416) - (sqrt(416)1 - sqrt(416))-6) + sqrt(416)))/(4-2sqrt(1152)). sqrt(13)/8 Simplify 5(3(-1sqrt(85)-5 + sqrt(85))/sqrt(5) - (sqrt(153)/(sqrt(36)/sqrt(4)) - (sqrt(17) - (sqrt(34)/sqrt(2) + 2)))2)2. -210 + 140sqrt(17) Simplify -6(-5sqrt(3)-5 + 4)*2 - ((-3(sqrt(147)-5 - sqrt(147)))2 + 1). -58975 - 1200sqrt(3) Simplify -3 + -1(3 + sqrt(1216)-3-5 + -6(sqrt(1216) - (sqrt(1216) + 3)))*2. -274044 - 5040sqrt(19) Simplify -23(-2(sqrt(98)-2)*2 + 5 + -2) + 4. 4690 Simplify (-5(sqrt(847) + 0 - (-1 + sqrt(112))) - ((sqrt(7) + 4)-6 + sqrt(7) + (sqrt(77)-6 + sqrt(77) - sqrt(77))/sqrt(11)))*2. -912sqrt(7) + 4393 Simplify 1 + (-4((sqrt(19) - sqrt(76)/(sqrt(4) + sqrt(64)) - ((sqrt(19) - (sqrt(19) + -1)) + 5)) + 5 + sqrt(1539)-1) + -3)*2. 328sqrt(19)/5 + 511074/25 Simplify (sqrt(425) + -1)*2-3 + -5 + -1 + sqrt(2057)-1 + (sqrt(2057)-2 + -1 + sqrt(2057))*2. 41sqrt(17) + 774 Simplify ((sqrt(88)-24 - 1(sqrt(88) + sqrt(88)-2))-4)/((3sqrt(200)-5 + sqrt(200) - sqrt(200))-6). 14sqrt(11)/225 Simplify -4(-3 + 0 + -3 + sqrt(272) + (sqrt(272) + (sqrt(272) - (4 + -3sqrt(272)))*2 - sqrt(272)) + -2 + 1). -174	{ "pile_set_name": "DM Mathematics" }
, a, 5, 0? 0 Let m = 104035 - 935147/9. Let d = -130 + m. Let c = -522 - -521.5. What is the second biggest value in d, c, 3? d Let q(j) = -j*3 + 4j*2 + 5j - 5. Let v be q(5). Let s = -15.97 + 17.97. What is the biggest value in s, v, 2/25? s Suppose 5m - 15 = 0, -5s + 3m - 2m - 3 = 0. Let j = -165 - -165.2. Which is the second smallest value? (a) j (b) s (c) 1 a Let g = 185 + -185.5. Which is the third smallest value? (a) g (b) -4 (c) 1/15 (d) 1 c Let f = 1.3 + -1.28. Let o = f + -0.1. Let y = -0.12 + o. Which is the third smallest value? (a) 5 (b) y (c) -4 a Let y(d) = d*2 - 5d - 10. Let m be y(6). Which is the smallest value? (a) m (b) 2 (c) 7 a Let t = 15.1411 + -0.0511. Let n = -15 + t. Let s = n - -0.21. Which is the second biggest value? (a) -0.1 (b) s (c) 2/13 c Let b = -4.98 - 0.02. Let c = -129 + 128. Let i = -1 + 0.9. What is the second smallest value in c, i, b? c Let f = 82 + -81.5. What is the third smallest value in 0, 6/7, f? 6/7 Let t be ((-36)/9)/20(-20)/12. Which is the third biggest value? (a) 2 (b) -1/16 (c) t (d) 1/4 d Let a = -3/1996 + -250489/5988. Let i = a - -71/2. Let h = 7 + i. What is the third biggest value in h, 0.3, 0.2? 0.2 Let t = -14 + 29/2. Let s = -26 + 26.4. Which is the smallest value? (a) s (b) 0.2 (c) t b Let s = -0.18 + -0.02. Let t be 4/34 + 201/(-408). Let b = -0.3 - -0.6. What is the smallest value in t, b, s? t Let p = 4 - -86. Let b be (-4)/(-10) - 171/p. What is the smallest value in 1, b, -2/15, 0.2? b Let o be (6/24)/(9/(-12)). Let s be (3/(-42))/((-2)/(-8)). What is the biggest value in o, -28, s? s Suppose 0 = y - 2n - 2, 4n + 10 = 5y + 6n. What is the smallest value in 3, y, -4? -4 Let p be 6/(-9) + 8/(-54)-3. Let l = -163 - -493/3. Let j = -0.03 + 1.03. What is the biggest value in p, j, l? l Let f = 168.9 + -169. Which is the fourth biggest value? (a) -0.3 (b) 6 (c) -3 (d) f c Let a = -0.11937 - 6.88063. Let z = -7 - -4. What is the biggest value in 4, z, -5, a? 4 Suppose 4v = -4w + 12, 5w + v + 20 = 3v. Let x be 7/(441/(-12))(-3)/w. Which is the third biggest value? (a) 1 (b) x (c) -3 c Suppose -3f = -4j + 1, -5 = 5f + 2j + 14. Which is the third biggest value? (a) f (b) -0.1 (c) 6 a Let n = -1270.2 - -1270. What is the third smallest value in n, -2/9, -3/4, 191? n Let y = 579 + -2321/4. What is the third biggest value in y, 0.04, 1/3? y Let l(z) = 5z + 7. Let r be l(12). Let h = -135/2 + r. Which is the third smallest value? (a) h (b) 2/5 (c) 3 (d) 5 c Let p = 6 - 3. Which is the smallest value? (a) -5/4 (b) 4 (c) 0 (d) p a Let h = 853 - 853. Which is the second biggest value? (a) -2/5 (b) h (c) -9.4 a Let u be (-1 - -9) + (-1098)/135. Let s = -12 + 17. Suppose -k - 14 = -4z, -4z - k + 22 = 4. Which is the smallest value? (a) s (b) z (c) u c Let o = 127 - 509/4. Which is the second biggest value? (a) o (b) 2/3 (c) -1/8 c Let a be ((-8)/10)/(-9 - (-23)/5). What is the smallest value in -0.2, 0.6, a, -0.3? -0.3 Suppose 0 = -37j - 11j + 48. What is the third smallest value in j, -34, 0.4, -1? 0.4 Suppose -16x + 14x - 20 = -4n, 2x = 0. Let h be (-1)/(-2 - 24). Which is the fourth smallest value? (a) 1/15 (b) 2/17 (c) n (d) h c Let l be 0/(-8) + (-1 - (-727)/5). Let i = l - 145. Which is the biggest value? (a) 3 (b) i (c) -2 a Let n = 0.3 - 0.1. Let p = -49706621/68592540 + -4/217065. Let t = -2/79 + p. Which is the second smallest value? (a) 2 (b) n (c) t b Let p(l) = l - 3. Let g be p(1). Let v be (-2(-2)/(-24))/(1/g). Let n be ((-12)/165)/(2/5). Which is the second smallest value? (a) v (b) 1/9 (c) n b Let j(b) = 229b - 2290. Let g be j(10). Let l = -2 - -1. What is the third smallest value in g, l, -0.5? g Let p = -23/15 + 11/15. Let j be (-4 + 2)/(1 + 1). Which is the smallest value? (a) 0 (b) -0.4 (c) j (d) p c Let z = -11 + 9. Let g = -5 + 9. Which is the third smallest value? (a) 0.4 (b) g (c) z b Suppose 31d + 33 = 188. Suppose 0 = -5f - 5, -4f + 1 = -2w - 1. Let p = 2 - 7. What is the smallest value in d, p, w? p Let d = 198.5 + -198. Which is the second smallest value? (a) d (b) -21 (c) -0.5 c Let p = -14 + 18. Let q = p - 2. What is the third smallest value in -3/2, q, -6? q Let c = 2 - 2.01. What is the second biggest value in 0, c, -0.2, -1? c Let k = 0.63 + -0.53. What is the smallest value in -48, 3, 0.3, k? -48 Let g = -3 - 0. Suppose 0 = -11h + 12h + 5. Let z be 10/76/(-15). Which is the second smallest value? (a) z (b) g (c) h b Let q = 0.02 - 0.12. Let u(i) = -4i + 24. Let w be u(13). Let z = w - -30. What is the biggest value in 4, q, z? 4 Let p = 295 - 294.6. What is the biggest value in 4, 2/7, 0.5, p? 4 Let o = 0.021 + -2.321. Let i = -2.4 - o. Let b be (-4)/10(-10)/(-6). What is the third biggest value in 5, i, b? b Let g = -0.294 + 0.164. What is the second biggest value in g, 3, 5, 2/21? 3 Let m = -85/4 - -417/20. Which is the second biggest value? (a) -0.05 (b) m (c) 2 (d) -2 a Let x = -429/862 - 1/431. Which is the third biggest value? (a) 1/13 (b) x (c) -0.3 b Let k = -2716/55 - -246/5. Which is the third smallest value? (a) -31 (b) k (c) -2 b Suppose 25 = 5z + 6b - 3b, -2b + 6 = -2z. What is the third smallest value in -0.5, -2/5, z, 1? 1 Let d = 7 - 12. Let y = 34 + -44. Let h = y + 14. What is the second biggest value in -2/21, h, d? -2/21 Let s = 0.016 - 0.516. Let d(r) be the second derivative of -r3/6 + r2/2 + 2r. Let m be d(3). Which is the third biggest value? (a) -4 (b) s (c) m a Let b = 6 + -4.6. Let i = -1.7 + b. Let r = -4.1 - -2.1. What is the biggest value in i, 1, r? 1 Suppose 3n = -g - 9, -4 = -g - 3g - 4n. Suppose gz - 7z + 4 = 0. Let q = -73/21 + 22/7. What is the biggest value in 0.2, z, q? z Let x be (0 - -2) + -19 + 9. Let d = -12 - x. What is the third smallest value in 2, d, 1? 2 Let d = -6.1 + 2.6. Let r = 20.5 + d. Let y = 13 - r. Which is the third smallest value? (a) -1 (b) 1/3 (c) y b Suppose 0k = 14k - 28. Suppose kx - 2 = -0x. Which is the third biggest value? (a) 2/9 (b) -2/7 (c) -0.2 (d) x c Let x = 0.04 - -0.36. Let y = 58 - 57.543. Let j = 0.057 - y. Which is the third smallest value? (a) j (b) 2/3 (c) x b Let q = -746 - -745.661. Let l = 0.061 - q. What is the biggest value in 6, 0.5, l? 6 Let j = 1.2 - 1.6. Let b = -23.962 + -0.038. Let x = 29 + b. What is the second smallest value in x, j, 2.6? 2.6 Let v(t) = -t3 + 18t*2 + 23t - 72. Let k be v(19). Which is the biggest value? (a) k (b) 2/3 (c) 0 (d) -0.4 a Let a be 62/8 + (64 - 72). Let z = 0.08 - 4.08. What is the smallest value in 0, a, z, -1? z Let y = -504 + 2512/5. Let q = -144.52 - -149. Let w = q + 0.52. Which is the second biggest value? (a) y (b) 2 (c) w b Let t be (-56)/(-182) - (1 - -1 - 2). Which is the third biggest value? (a) 4/7 (b) t (c) 1/2 (d) -3 b Let g be (-8)/(-28) - 3931342/154. Let m = g - -25457. Let w = 71 + m. What is the biggest value in w, -1, 0.5? 0.5 Let f = 0.3 - 0.2. Let u = -13262 - -13261. Let s be 2/86-2. Which is the third biggest value? (a) s (b) u (c) f a Suppose 9 = 3z, g + 8z - 15 = 4z. Suppose 4b = 2b - 16. Let f = -6 - b. What is the biggest value in g, -1/6, f? g Let w = -2448 + 2451. What is the second biggest value in w, -3, 2/67, -0.2? 2/67 Let n = 3.7 + 0.3. Let w(x) = 7x*2 + 3x - 3. Let o be w(1). Let v be (25/50)/(o/2). What is the third biggest value in n, v, -3? -3 Let m = -0.9704 - 0.0296. Which is the third biggest value? (a) -22 (b) m (c) 1/9 a Let g be 14/84 - (-26)/(-12). Let s be (4/14)/(g/4). Suppose 0y = 4y - 32. What is the third smallest value in y, s, 0.5? y Let k = -3.9107 - 0.0893. What is the third smallest value in 40, -3/5, k, 4? 4 Suppose -2z + y = 6, 24 - 22 = -5z - 4y. What is the third biggest value in 13, -4, z? -4 Let x be 1/2(624/36 - 17). What is the third smallest value in 0.6, 4, x? 4 Let s be (7 + -5 - -12) + 2. Suppose -17k - s = -21k. What is the smallest value in -2/9, -4, 0.5, k? -4 Let j be (-32)/(-112) + (-38)/(-14). Suppose -2p + 1 = -j. Suppose -2 = -pu + 8. Which is the smallest value? (a) -6 (b) u (c) 0.5 a Let s = 139 - 139.5. What is the fourth biggest value in s, -2/7, 1/2, -5?	{ "pile_set_name": "DM Mathematics" }
nd 10087. 131 What is the highest common factor of 3840922 and 894? 298 What is the highest common factor of 23 and 8303? 23 Calculate the highest common divisor of 390 and 156. 78 What is the greatest common divisor of 30743 and 2272? 71 What is the greatest common factor of 130143 and 182? 13 Calculate the greatest common factor of 3102 and 1254. 66 What is the greatest common divisor of 69 and 7316277? 69 What is the highest common divisor of 88 and 305668? 44 Calculate the highest common factor of 726912 and 24. 24 Calculate the highest common divisor of 932 and 556. 4 What is the greatest common factor of 174 and 1484829? 87 Calculate the greatest common factor of 9912 and 340784. 472 What is the greatest common divisor of 145 and 140795? 145 What is the greatest common factor of 751821 and 21? 21 What is the greatest common factor of 76 and 3660? 4 What is the highest common divisor of 912 and 1083? 57 Calculate the highest common divisor of 1938 and 2550. 102 Calculate the highest common factor of 2268 and 149364. 324 Calculate the highest common factor of 22 and 1092817. 11 What is the greatest common divisor of 51 and 67863? 3 Calculate the greatest common factor of 2835 and 55485. 405 Calculate the greatest common factor of 820560 and 286. 26 Calculate the greatest common divisor of 1136 and 546558. 142 Calculate the highest common factor of 4710 and 670. 10 What is the greatest common divisor of 1406854 and 699? 233 What is the highest common divisor of 950156 and 406? 58 Calculate the highest common divisor of 26419 and 1073. 29 What is the highest common divisor of 112574 and 12642? 602 Calculate the greatest common factor of 1719 and 598594. 191 Calculate the greatest common divisor of 19200 and 9400. 200 What is the greatest common divisor of 126 and 12404? 14 Calculate the greatest common factor of 2124 and 4968. 36 Calculate the highest common divisor of 3749 and 92. 23 What is the greatest common factor of 231 and 2849? 77 What is the greatest common factor of 62 and 765173? 31 What is the greatest common factor of 728327 and 95? 19 Calculate the highest common factor of 1166989 and 58. 29 Calculate the highest common factor of 1819896 and 38. 38 Calculate the highest common divisor of 412060 and 495. 55 What is the greatest common factor of 1518 and 9790? 22 What is the highest common factor of 336 and 9051? 21 Calculate the greatest common factor of 48737 and 2944. 23 What is the highest common factor of 1290 and 830? 10 What is the greatest common divisor of 3728 and 3275980? 932 What is the greatest common divisor of 21455 and 26215? 35 What is the greatest common factor of 165 and 474540? 165 What is the greatest common divisor of 258 and 1606308? 258 What is the highest common factor of 23275 and 38? 19 Calculate the highest common factor of 20 and 69940. 20 What is the highest common factor of 74800 and 1166? 22 Calculate the highest common factor of 4324 and 5405. 1081 What is the greatest common factor of 1377 and 61727? 17 Calculate the greatest common factor of 2033 and 589. 19 What is the greatest common factor of 156013 and 4364? 1091 What is the highest common factor of 165223 and 85? 17 Calculate the highest common factor of 987846 and 2147. 113 Calculate the greatest common factor of 101787 and 518. 259 Calculate the greatest common divisor of 656 and 2. 2 What is the highest common factor of 37629 and 888? 111 Calculate the greatest common factor of 156951 and 405. 27 Calculate the highest common factor of 43593 and 165. 33 Calculate the greatest common factor of 3979975 and 25. 25 Calculate the highest common divisor of 558 and 159606. 18 Calculate the highest common factor of 158 and 67387. 79 What is the greatest common factor of 23 and 1418801? 23 What is the highest common divisor of 81627 and 138? 69 What is the highest common factor of 26845 and 280? 35 Calculate the greatest common factor of 912 and 18. 6 What is the highest common divisor of 10170 and 360? 90 What is the highest common factor of 32581 and 131375? 1051 What is the greatest common factor of 4598 and 132297? 209 Calculate the highest common divisor of 176810 and 10. 10 What is the greatest common divisor of 126 and 110061? 63 What is the highest common factor of 326710 and 170? 10 What is the greatest common factor of 413 and 187103? 7 What is the highest common factor of 96524 and 8732? 236 Calculate the greatest common factor of 254 and 59182. 254 Calculate the greatest common divisor of 134 and 39. 1 What is the greatest common factor of 1105 and 48815? 65 What is the greatest common divisor of 231 and 11354? 7 What is the greatest common divisor of 612 and 206754? 102 What is the greatest common divisor of 512 and 3904? 64 Calculate the greatest common divisor of 300 and 21990. 30 What is the greatest common divisor of 196 and 655312? 28 What is the greatest common divisor of 7383 and 529? 23 What is the greatest common factor of 219 and 262070? 73 What is the highest common divisor of 364 and 109648? 28 Calculate the greatest common divisor of 480 and 120. 120 Calculate the highest common divisor of 17445 and 1. 1 What is the highest common divisor of 225 and 49475? 25 Calculate the highest common divisor of 77 and 1337721. 77 What is the greatest common divisor of 44 and 163614? 22 What is the greatest common divisor of 500 and 6220? 20 Calculate the highest common divisor of 51019 and 2608. 163 What is the highest common factor of 879373 and 11? 11 What is the greatest common factor of 1212 and 672? 12 What is the greatest common factor of 40 and 415490? 10 Calculate the greatest common divisor of 2 and 302782. 2 What is the greatest common divisor of 5 and 521380? 5 Calculate the highest common factor of 691476 and 1044. 348 Calculate the greatest common divisor of 10 and 232475. 5 What is the greatest common divisor of 43788 and 5412? 492 What is the highest common factor of 3462 and 987824? 1154 Calculate the highest common factor of 858 and 5538. 78 What is the highest common divisor of 52 and 276445? 13 Calculate the greatest common factor of 144774 and 20034. 378 Calculate the greatest common factor of 42 and 11851707. 21 What is the greatest common factor of 400 and 49480? 40 Calculate the highest common divisor of 653581 and 5873. 839 Calculate the greatest common factor of 35 and 94955. 35 Calculate the highest common divisor of 417609 and 81. 27 Calculate the highest common divisor of 1033 and 63013. 1033 Calculate the greatest common divisor of 594301 and 7657. 589 What is the greatest common factor of 1921908 and 180? 12 Calculate the greatest common divisor of 62 and 8545832. 62 Calculate the highest common divisor of 115431 and 9. 3 Calculate the greatest common factor of 6737152 and 256. 256 What is the highest common factor of 35981 and 132? 11 Calculate the greatest common divisor of 2378 and 522. 58 What is the greatest common divisor of 4506432 and 12? 12 Calculate the highest common factor of 93114 and 1638. 126 Calculate the greatest common divisor of 770 and 1447710. 110 What is the greatest common factor of 50 and 899425? 25 Calculate the greatest common divisor of 22842 and 186. 6 Calculate the highest common divisor of 70029 and 6324. 93 What is the highest common factor of 64206 and 34278? 174 Calculate the highest common divisor of 690 and 1470. 30 Calculate the greatest common divisor of 20700 and 12820. 20 What is the greatest common divisor of 1841607 and 36? 9 Calculate the greatest common factor of 66 and 48114. 66 Calculate the highest common factor of 640 and 3575360. 320 Calculate the highest common factor of 7548 and 60. 12 What is the greatest common divisor of 511218 and 54? 54 Calculate the highest common factor of 3048 and 906. 6 Calculate the greatest common divisor of 504651 and 84. 21 What is the greatest common divisor of 60280 and 60? 20 Calculate the highest common factor of 408 and 13656. 24 Calculate the highest common divisor of 2720 and 1375640. 680 Calculate the highest common divisor of 1859792 and 264. 88 Calculate the greatest common divisor of 18446 and 2024. 46 What is the greatest common factor of 48 and 98988? 12 What is the highest common factor of 460 and 1514665? 1	{ "pile_set_name": "DM Mathematics" }
. Suppose 0 = 4a + s - 10, -a - 2a = 4s - r. Calculate the remainder when (10/(-15))/(a/(-393)) is divided by 33. 32 Let d = 71 + -69. Suppose f - d = 25. Calculate the remainder when f is divided by 19. 8 Let q = -12 - -14. Let g(l) = l2 - 5l + 5. Let u be g(7). Suppose -2p + u = -3k, p - 2k - 2 = -3k. Calculate the remainder when p is divided by q. 1 Suppose -6y = 5y - 44. Suppose -yd - 32 = -4j, -d + 4 = 2j - 12. What is the remainder when 20 is divided by j? 4 Suppose -2s = -0o + 2o - 46, 2s - 84 = -4o. Let t = -141 - -152. Calculate the remainder when o is divided by t. 8 Suppose 0 - 15 = -5x. Let d be ((-9)/2)/(x/(-6)). Calculate the remainder when (-2)/d + 573/27 is divided by 8. 5 Suppose 5k + 365 = 5s, -329 + 19 = -4s - 5k. What is the remainder when 91 is divided by s? 16 Let x be 0((-30)/(-9) - 3). Suppose -f + 0f + 129 = x. Calculate the remainder when f is divided by 33. 30 Let y(g) be the first derivative of -8g*2 - 2g + 14. Calculate the remainder when y(-8) is divided by 32. 30 Suppose 0 = v, -6w + 3w + v = -33. Suppose -b - 2u - 3 = w, 5u = -b - 11. Let c = b + 27. What is the remainder when 41 is divided by c? 8 Let n(w) = w*3 + 9w*2 - 17w + 6. What is the remainder when n(-7) is divided by 32? 31 Suppose -4n + 2i = -346, -2n - 3i + 96 = -89. Let h = -1 + 6. Calculate the remainder when n is divided by h. 3 Calculate the remainder when 44 is divided by ((-3)/4)/(3 + (-26)/8). 2 Calculate the remainder when 46 is divided by (-66)/(-72)3(2 - -2). 2 Let a(i) = 2i + 3 - 1 - i. Let z = -13 + 19. What is the remainder when a(z) is divided by 3? 2 Suppose l - 3l + 12 = 0. Let w = -1215 - -1222. What is the remainder when w is divided by l? 1 Calculate the remainder when 471 is divided by 396/14 + 4(-3)/42. 23 Calculate the remainder when 33 is divided by 158/6 + (-32)/(-12) + -1. 5 Let l(v) = -31v3 - v. Let z = -8868 + 8879. What is the remainder when l(-1) is divided by z? 10 Let o(a) = a3 + 4a2 - 5a + 7. Let c be o(-5). Let b(s) = s + 2. Calculate the remainder when b(c) is divided by 4. 1 Calculate the remainder when (-1 - (-64)/10)/(129/430) is divided by -1 + (-296)/(-56) - 4/14. 2 Let f = 107 - 81. Suppose a - 4t - 25 = -4a, f = 4a - 2t. What is the remainder when 34 is divided by a? 7 Let x = 2 - -2. Let z = x + -3. Suppose 3l + 2t = 12 - 5, -2l = -t - 7. What is the remainder when l is divided by z? 0 Let w = 401 - 381. What is the remainder when 259 is divided by w? 19 Let p(d) = -87d - 26. Calculate the remainder when p(-1) is divided by 9. 7 Let z(p) = p3 + p2 + p + 1. Let i be z(-1). Let s = 46 - 8. Suppose 28t - 26t - s = i. What is the remainder when t is divided by 5? 4 Suppose 0 = -4x + 75 - 15. Let v = -32 - -71. What is the remainder when v is divided by x? 9 Suppose -48y + 54y = -24. Let z(u) = u3 + 6u*2 - 2u + 7. What is the remainder when z(-5) is divided by -3(y + (-2)/(-6))? 9 Let d(i) be the first derivative of 5i*2/2 - 6i - 11. Let t(y) = 4y + 1. Let s be t(1). What is the remainder when d(s) is divided by 10? 9 Let p be 4/6 - (-26)/6. Suppose 5i + 3x - 27 = -0x, 0 = -pi - x + 29. What is the remainder when (-4)/(-18) - -11435/63 is divided by i? 5 Let d = -88 + 98. Calculate the remainder when 77 is divided by d. 7 Let c(t) = 96t2 + 2t. What is the remainder when c(1) is divided by 50? 48 Suppose -155 + 932 = -7l. Let i = -67 - l. What is the remainder when 130 is divided by i? 42 Suppose -t = -z - 28, -74 + 2 = -4t - 4z. Calculate the remainder when 81 is divided by t. 12 Let o(l) = -9l - 2. Let j be -23/(6/4). Let h(v) = -2v*2 - 71v - 23. What is the remainder when o(j) is divided by h(-35)? 10 Let r be 21/14(2 - 0). Suppose -4b = -rx - 0b + 58, 3b - 69 = -4x. Suppose -8c + 5c + 153 = 0. What is the remainder when c is divided by x? 15 Let x(o) = -o*2 + 8o + 3. Let k be x(6). Suppose -5q + 5s = -186 + 46, -5s = 2q - 63. What is the remainder when (610/k - (-9)/(-3))3 is divided by q? 26 Suppose 0 = -16q + 10q + 156. Let w(c) = 102c. Let p be w(2). Suppose p = -0i + 2i. What is the remainder when i is divided by q? 24 Let p be (-2)/(-6) - (-190)/(-30). Let r = p + 7. Let s = r + 28. Calculate the remainder when s is divided by 16. 13 Let n = -4 + -22. Let m = n + 44. What is the remainder when 41 is divided by (m/(-3))/(4/(-14))? 20 Let k = 204 + -199. Calculate the remainder when 303 is divided by k. 3 Let f be ((-15)/(-4))/((-1)/(-4)). What is the remainder when 29 is divided by f + (0/4)/(-2)? 14 Let m = -33 - -88. Let o = m - -9. Calculate the remainder when o is divided by 33. 31 Suppose 3l + 4 - 9 = t, -2t + 3l - 4 = 0. Suppose 0v + t = v. What is the remainder when 38 is divided by -3 + v + 0 + 12? 8 Suppose 6b - 24 = -0b. Suppose -6 = -2o - 2x + 2, o - bx - 14 = 0. Suppose j - 5j = -140. Calculate the remainder when j is divided by o. 5 Suppose 65q = 4217 + 4623. Calculate the remainder when q is divided by 11. 4 Let p(y) = y3 + 3y + 8. Let j be p(0). Suppose -3n - 2n = -15. Suppose -j = -nx - f, -3x + 11 = -f - 5. What is the remainder when 8 is divided by x? 0 Suppose 4k - 542 = -2v, 63v - 65v + 3k = -563. What is the remainder when 555 is divided by v? 1 Suppose 15l - 320 = 115. Calculate the remainder when 254 is divided by l. 22 Let i = 10 + -11. Let b be (1 - i) + -2 - -1. Suppose -b - 6 = -v. Calculate the remainder when 26 is divided by v. 5 Let o(a) = a*3 - 2a*2 - 7a + 1. Let x be o(4). Suppose -84 = -xk - n + 59, -2n + 25 = k. What is the remainder when 113 is divided by k? 26 Suppose 4z = 6z - 52. Suppose -73 + 13 = -4n. Let f = n + 86. Calculate the remainder when f is divided by z. 23 Suppose 0 = -13v + 929 + 215. What is the remainder when v is divided by 48? 40 Let u(w) = -w*2 + 77. Suppose 9k = 52 + 92. Calculate the remainder when u(0) is divided by k. 13 Suppose -9q = -2q - 651. Let p(h) = h3 + h2 - 4h + 4. What is the remainder when q is divided by p(2)? 5 Let u(n) = 28n - 14. What is the remainder when 431 is divided by u(1)? 11 Let p(r) = r*3 - 5r*2 + 5r. Let w be p(4). Suppose -3g = t + 38 + 40, -5g - 277 = wt. Let j = -10 - t. What is the remainder when j is divided by 14? 11 Let o(r) = -3r + 1. Let l be (6/(-15))/(1/5). What is the remainder when 3220/175 + 2/(-5) + (2 - 2) is divided by o(l)? 4 Calculate the remainder when 975/9 + 5/(-15) is divided by 10. 8 Let q = -72 - -125. Calculate the remainder when q is divided by 45. 8 Let c(m) = m*3 + 6m*2 - 10m + 6. Let f be c(-8). What is the remainder when 55 is divided by (-2)/(0/1 + 6/f)? 13 Let g(s) = -s*3 + 12s*2 - 10s - 13. Suppose -v + 11 = -0v. Let k be g(v). Calculate the remainder when 43 is divided by 18 - 3/k-2. 13 What is the remainder when 17/(((-40)/152)/(-5)) is divided by 4? 3 Let q = -96 - -153. What is the remainder when q is divided by 15? 12 Let c(x) = x*2. Let q(p) = 13 - 6p*2 + 2p*2 + 0p + p*3 - 7p - 3p. What is the remainder when q(6) is divided by c(3)? 7 Suppose -60r + 18r + 10332 = 0. Calculate the remainder when r is divided by 42. 36 Let b(x) = -14x*3 + 1. Let a be (-105)/(-14)4/(-3). Let t(m) = -m*3 - 11m*2 - 12m - 21. Let u be t(a). Calculate the remainder when b(u) is divided by 8. 7 Suppose 6w + 240 = 10w. Suppose w - 53 = f. What is the remainder when 16 is divided by f? 2 Suppose 25 = -2w + 7w. Suppose -m = -3b + 25, 0b + wb - 41 = 2m. Suppose b = u - 4. What is the remainder when 23 is divided by u? 10 Let j = 407 - 306. What is the remainder when 1615 is divided by j? 100 Let p be 5/((-10)/18) - 1. Let y = 43 - p. Calculate the remainder when y is divided by 18. 17 Let f(b) = 2b2 - b. Let q(j) = 3j*2 - 2j + 1. Let n(r) = -4f(r) + 3q(r). Let v = -1303 + 1322. Calculate the remainder when v is divided by n(4). 8 What is the remainder when (-335)/(-1) - -5 - 1 is divided by 38? 35 Let h = 498 - 201. Calculate the remainder when h is divided by 12. 9 Let g(d) be the third derivative of -d6/40 - d5/30 + d4/12 + d3/3 - 8d2. What is the remainder when g(-3) is divided by 2/4 + 366/12? 28 Let g be 1/(2 - (-633)/(-315)). Let f be (g/(-28))/((-3)/(-156)). Suppose 0 = 24p -	{ "pile_set_name": "DM Mathematics" }
e -n = -5c + 3 for c. 5 Let r(w) = -w - 7. Let q be r(-5). Let y = q + 7. Solve 11 = -yb - 14 for b. -5 Let d be (0 - 1/(-3)) + 1/(-3). Solve dj - 10 = -2j for j. 5 Let g be (-2)/(0 - (-4)/(-4)). Solve 3p = -4 - g for p. -2 Let u = -3 + 6. Suppose 2k + 3m = 8m + 24, uk - 5m - 26 = 0. Solve 5r - 13 = k for r. 3 Suppose 0 = -3w + 6 - 3. Suppose -3h + 7 = w. Solve -s = -hs + 1 for s. 1 Suppose l = 2l + 2. Let q(u) = -u2 - u + 2. Let t be q(l). Solve -4 + t = k for k. -4 Suppose 4a + 16 = 0, -x - 3a = -4a - 6. Solve i = 3i - x for i. 1 Let j(q) = -3q - 3. Let y be j(-2). Solve 0 = -c - 2c + y for c. 1 Let v be (3/(-2))/(-1(-4)/(-8)). Solve -8j - 15 = -vj for j. -3 Let h be 6 - 2 - (6 + 22). Let a be 0(1 - 2) + 138. Let d be 2/8 - a/h. Solve -c = -dc for c. 0 Let i(y) = -5y - 3. Let t(k) = -14k - 10. Let c(j) = 20i(j) - 6t(j). Let q be c(-1). Let m = 20 - 11. Solve -5z - m = q for z. -5 Suppose -2 = -2j - 10. Let l(v) = -v*2 + v + 1. Let d(u) = -4u*2 - 2u + 2. Let q(x) = d(x) - 3l(x). Let s be q(j). Solve -5 = -2r - s for r. 1 Let i(g) = g*3 - 3g*2 - 2g + 1. Let m(f) = f*3 - 8f*2 - 8f - 5. Let d be m(9). Let y be i(d). Solve 4h = y + 7 for h. 4 Suppose -3 = -2u + 3. Solve ul = 4 - 13 for l. -3 Let j(p) = -p3 + 7p*2 - p + 9. Let c be j(7). Solve cn + 2n = 0 for n. 0 Suppose 5o = 6o + 4i - 18, 3o + 3i - 18 = 0. Solve 2z = -0z + o for z. 1 Suppose 0 = 5i - i - 24. Suppose -2z + i = -0z. Suppose zd - 2 + 6 = 4n, 0 = 4d. Solve 0u = u + n for u. -1 Suppose -7g + 8g = 3. Solve 4u - u - g = 0 for u. 1 Suppose u - 3u = -3x + 12, 5u = -5x + 20. Solve 0 = xo + 25 - 9 for o. -4 Let f = 51 - 49. Solve -d = fd - 3 for d. 1 Let s be (3/9)/(2/18). Let r(l) = l*3 + 5l2 - l + 1. Let i be r(-5). Let c(x) = x2 - 3x - 3. Let j be c(6). Solve j = -sn + in for n. 5 Let l be 22/66 - 46/(-6). Solve -2 = -5k + l for k. 2 Let o be ((-50)/15 - -1)/((-3)/18). Solve -o = -4i - 2 for i. 3 Let f be (3/4)/(24/64). Solve ft = 4t for t. 0 Let h(y) = y + 3. Let g be h(-8). Let z be ((-4)/g)/((-2)/(-10)). Suppose -zj - 20 = -9j. Solve -6 = -jd + d for d. 2 Suppose -19 = -5j - u + 2, -3u = 12. Solve -js + 0s = -25 for s. 5 Let x = -1 + 1. Suppose 4 = -d + b - 3, -20 = 2d + b. Let h be (-12)/560/d. Solve 0l - 4l + h = x for l. 4 Suppose -5w + 0w - 4v + 15 = 0, 3v + 36 = 3w. Let t be (-6)/(-4) + 2/4. Let c(r) = r2 - 9r + 21. Let j be c(6). Solve th - j = w for h. 5 Let g(j) be the first derivative of j3/3 + 3j*2 + 6j - 2. Let q be g(-6). Suppose 0l + 16 = 4l. Solve lp - p = q for p. 2 Suppose -2g + 2y + 18 = -3y, -3g - y + 10 = 0. Let o(d) = d3 - 4d*2 + 4d - 4. Let k be o(g). Let x be k/7 + (-6)/(-21). Solve -xv + 5 = -v for v. 5 Let q = -33 + 40. Solve 5p - 22 = -q for p. 3 Let k(y) = 2y - 3. Let m be k(6). Solve -4f - m = -f for f. -3 Suppose 5k - 5v = 60, 0v = k + 3v. Let z(b) = b*2 - 8b - 7. Let t be z(k). Let g be -1 + 4 - (-2)/t. Solve 0 = gx + x - 20 for x. 4 Suppose 2r = 2n + 14, -3r + n = -2 - 15. Let y(a) = 2a - 7. Let t be y(6). Suppose -w = -5l - 0w + 58, tl + 5w = 70. Solve -o + l = -ro for o. -3 Let h be -8(1/(-2))/(-1). Let p = 7 + h. Solve -4b + 1 = -p for b. 1 Let h be 12 + (-2)/(-4)-4. Solve h = 8y - 3y for y. 2 Let d(s) = s + 8. Let t be d(-6). Let n(o) = o2 + 1 + 5o - o*3 + to*2 + 0o*3. Let r be n(4). Solve 0 = -l + r - 0 for l. 5 Suppose -j + 3j - 4 = 2m, 2 = 2m + j. Solve mo = -3o for o. 0 Let i be (-6 - (2 - 4))(-5)/4. Solve -15 + i = -5f for f. 2 Suppose -2v + 1 = 4g + 17, -g = -4v - 23. Let b = 12 + v. Suppose 0a - a = -8. Solve -4w + bw = -a for w. -4 Let b = 47 - 47. Solve b = -5l - 0l for l. 0 Let g be 4((-3)/(-2))/3. Suppose -gu = -4 - 2. Suppose v - 3 = u. Solve b - v = -2 for b. 4 Let q(g) = g*2 - 11g + 6. Let f be q(10). Let y be -2 - f/(-6)-6. Solve -15 = yh - 5h for h. 5 Let c be -1 - -4 - (-1 - -2). Suppose -c = 4p - 6. Solve 0 = 2v - 5 + p for v. 2 Let d(q) = 6q3 - q2. Let m be d(1). Let n(p) = 1 + p - 3 - 1. Let v be n(m). Solve 0 = -0u - vu for u. 0 Suppose -3s - 2f - 1 = 3, -4s = -f - 13. Solve 0l - 6 = sl for l. -3 Let s = -12 + 5. Let t(y) = -2y - 10. Let c be t(s). Suppose -cb + 11 = 3. Solve bm - m = 3 for m. 3 Suppose 0 = -x - 1 + 3. Suppose t - 1 = 2t, -xi + t = 7. Let y = 6 + i. Solve -yj = -3j - 4 for j. -4 Let k be (-27)/(-9)(-8)/3. Let b = k - -9. Solve b = m - 2m for m. -1 Let u(t) = t - 13. Let v be u(13). Solve 4w + v = -20 for w. -5 Let t = 43 + -43. Solve t = 7k - 3k for k. 0 Let m(f) = -4f - 31. Let t be m(-8). Solve 3u - t = -4 for u. -1 Let d(n) = -n2 + 13n + 14. Let g be d(14). Solve -3r - 2r + 5 = g for r. 1 Suppose -9 = -0x - 3x. Suppose -k = -5, -3u + 0 = xk - 15. Solve 0 = -uq - 4q + 8 for q. 2 Let t(h) = -h*2 - 11h + 12. Let s be t(-12). Solve -a - a - 2 = s for a. -1 Suppose 5f + 21 - 66 = 3y, -4f - 2y + 14 = 0. Suppose f = -3c + 5c. Let v be 5/(-20) - 5/(-4). Solve 0 = -2o - v - c for o. -2 Let v(d) = -2d - 16. Let x be v(-8). Solve x + 6 = 3g for g. 2 Let k(o) be the second derivative of o4/12 - o3/2 - o2/2 + 5o. Suppose -4g + 5n = 6n - 14, g = -2n. Let t be k(g). Solve t = 5c - 2 for c. 1 Let q be (-1)/(-2)(-1 + 1). Let n = 1 + 3. Suppose 0 = -k - q + n. Solve -k = -5c + c for c. 1 Suppose 0 = 3p - 7 + 1. Let j be 0 + -4 + p - -4. Solve -j = -3r - 17 for r. -5 Let g(t) = t2 + 15t + 17. Let o be g(-14). Solve 0 = -a - oa for a. 0 Let g = 104 + -70. Suppose -w + 12 = -0w. Let k = -7 + w. Solve g = kb + 9 for b. 5 Let i(c) be the second derivative of -c3/3 + 2c. Let r be i(-1). Suppose -2t = -3j - 7, -3t + t + rj + 8 = 0. Solve 0 = -0s - ts + 10 for s. 2 Let t be 1/(2 - (-26)/(-14)). Let o be (1/2)/(4/(-40)). Let g = o + t. Solve 0 = l + g for l. -2 Let g(r) = -2r2 - 15r - 14. Let u be g(-6). Solve -9 = um - 1 for m. -2 Let c(u) = -u + 10. Suppose 2t + t = 18. Let m be c(t). Let a be -111(-3 - -2). Solve m = 5s - a for s. 3 Suppose 0n = -3n - 4p + 1, -4p = 5n - 7. Solve -nc + 4 = -2c for c. 4 Let u be 66/8 - (-16)/(-64). Solve -u = -5i + 9i for i. -2 Let r = -25 - -25. Let s(f) = f*2 - 1. Let j be s(-1). Let u = j + 0. Solve u = w - 3 - r for w. 3 Suppose -1 = 4z - 5z. Let a be z + -1 + 24/6. Solve -3s = 1 - a for s. 1 Let r(s) = -s*2 - 7s - 8. Suppose 0y - 18 = 3y. Let n be r(y). Let i be (-10)/n - 4/2. Solve 4j - ij = -3 for j. -3 Let u = -7 + 8. Solve -s + u = 2 for s. -1 Suppose 11s - 10s - 3x + 12 = 0, -4s + 4x - 8 = 0. Solve -6 = 3a + s for a. -3 Let q(d) = -d*2 - 12d + 18. Let j be q(-13). Solve 1 = -jv - 9 for v. -2 Let u(y) = -y2 - 3y + 8. Let r be u(-4). Solve -r = d - 3 for d. -1 Let b(y) = y*2 - 11y + 6. Let m be b(11). Let l(h) = h*2 + 7. Let i be l(0). Let j = i - m. Solve -4o = -5o - j for o. -1 Let j = 0 - -8. Suppose -4 = d - j. Let u be d/(-10) - (-2)/5. Solve ur = 2r - 4 for r. 2 Let u be 70/(-25) - 2/10. Let y be u1/(-3) - -3. Solve -4c = -5c - y for c. -4 Suppose -2t + 3 = -9. Solve y = -y - t for y. -3 Let l(y) = y + 9. Let d be l(-7). Suppose 4b - 2b = 0. Solve d = -2j - b for j. -1 Suppose 3 + 9 = 3u. Let s = 6 - u. Let x = -1 - -3. Solve -s = -c + x for c. 4 Let t be (-1)/(-9) - (-220)/45. Suppose -10 = -9z + 4z. Solve -tj + 4j = z for j. -2 Let h be (-10)/25-5(-15)/(-6). Solve -3a + 2 = -ha for a. -1 Suppose t - 50 = -t. Let y be (-10)/6 - (-2)/(-6). Let p = 5 + y. Solve pu + t = -2u for u. -5 Let a = -1 + 6. Suppose -8 - 7 = -an. Solve 2u = -5 - n for u. -4 Suppose 5c - 3v = 18, 3c - 4c = 2v - 14. Let s = c + -2. Suppose 4z + 4 = -4a + 2a, -5z - 3a = 7. Solve -5y + s = -z for y. 1 Suppose -3g + 3r + 0r + 9 = 0, g + 2r = 0. Let j(c) = 2c2 - 3c + 2. Let a be j(g). Solve 0 = -4m - 0m + a for m. 1 Let s be 16 - 1/(3 - 4). Suppose -n - 3h = -19, 6n + h = 3n + s. Solve 5q - nq = 0 for q. 0 Let s(t) = -t3 + 2t*2 + 3t + 6. Let g be s(3). Solve 0b - 2b - g = 0 for b. -3 Let h(b) = 4b + 13. Let d be h(-3). Solve l - 2 = d for l. 3 Let d = -6 - -8. Suppose -3f - f = -y - 41, 5y + f = -100. Let i be ((-36)/y)/((-3)/(-21)). Solve i = dn + 2 fo	{ "pile_set_name": "DM Mathematics" }
replacement from capppapucfpacaupuap. 5/2584 What is prob of sequence yqqy when four letters picked without replacement from {y: 17, q: 3}? 4/285 What is prob of sequence ppe when three letters picked without replacement from prpe? 1/12 Three letters picked without replacement from izzgglz. Give prob of sequence izl. 1/70 Calculate prob of sequence sn when two letters picked without replacement from {n: 18, s: 2}. 9/95 What is prob of sequence vvbc when four letters picked without replacement from bbbbvvvbbbbbbcbbbbbb? 4/4845 Four letters picked without replacement from nnnnn. Give prob of sequence nnnn. 1 Calculate prob of sequence vqkd when four letters picked without replacement from {k: 1, d: 6, z: 7, q: 1, v: 2, f: 2}. 1/7752 Calculate prob of sequence ps when two letters picked without replacement from ppkpkskp. 1/14 What is prob of sequence kdd when three letters picked without replacement from {k: 1, d: 12}? 1/13 Two letters picked without replacement from {d: 3, l: 2}. What is prob of sequence ll? 1/10 Four letters picked without replacement from {h: 3, v: 3, s: 7, d: 7}. Give prob of sequence vhvd. 7/6460 Two letters picked without replacement from {m: 2, g: 2, s: 1, b: 1, j: 1}. Give prob of sequence bs. 1/42 Three letters picked without replacement from {p: 1, d: 1, r: 1, q: 5, w: 1}. Give prob of sequence qpd. 5/504 Calculate prob of sequence jc when two letters picked without replacement from {a: 2, m: 2, c: 1, o: 1, y: 2, j: 1}. 1/72 Calculate prob of sequence oo when two letters picked without replacement from {v: 2, o: 2, t: 2, l: 1, a: 1, r: 1}. 1/36 Calculate prob of sequence jf when two letters picked without replacement from {f: 2, j: 2, k: 1, s: 2, o: 1}. 1/14 Three letters picked without replacement from iiqqq. Give prob of sequence qqq. 1/10 Four letters picked without replacement from uqmunqqumqnquuquqmq. What is prob of sequence uuqu? 10/969 Calculate prob of sequence hehh when four letters picked without replacement from shseshoeheshoososs. 1/1020 Three letters picked without replacement from {f: 1, n: 3, j: 1, t: 10}. Give prob of sequence ftn. 1/91 Four letters picked without replacement from {l: 3, d: 4, u: 13}. Give prob of sequence ldlu. 13/4845 Two letters picked without replacement from {e: 1, r: 1, v: 2, l: 1}. Give prob of sequence er. 1/20 Calculate prob of sequence kl when two letters picked without replacement from lgekel. 1/15 Calculate prob of sequence ep when two letters picked without replacement from fpkfvvfevvvvf. 1/156 Two letters picked without replacement from fkkkkikikkkkkk. What is prob of sequence ik? 11/91 Two letters picked without replacement from {x: 15, v: 4}. What is prob of sequence vv? 2/57 Three letters picked without replacement from {t: 2, d: 7, p: 3, n: 3, w: 4}. What is prob of sequence dww? 14/969 Four letters picked without replacement from {k: 2, g: 2, j: 7}. What is prob of sequence kjjg? 7/330 What is prob of sequence okv when three letters picked without replacement from {k: 1, c: 6, v: 2, o: 1, n: 3}? 1/858 Calculate prob of sequence crx when three letters picked without replacement from xxrrxxrxprxcrqrrqxxx. 7/760 Calculate prob of sequence mj when two letters picked without replacement from {m: 9, j: 9}. 9/34 Calculate prob of sequence ikjj when four letters picked without replacement from {i: 1, m: 4, e: 1, q: 7, k: 2, j: 2}. 1/14280 Four letters picked without replacement from {d: 3, i: 1, w: 4, m: 2, z: 1}. Give prob of sequence dizw. 1/660 What is prob of sequence wiww when four letters picked without replacement from {x: 4, i: 7, u: 4, m: 1, w: 3}? 7/15504 Four letters picked without replacement from {f: 5, c: 1, s: 3, i: 5, t: 1}. Give prob of sequence ssii. 1/273 Two letters picked without replacement from {o: 1, c: 3, d: 5, z: 9}. What is prob of sequence zd? 5/34 Two letters picked without replacement from uuhsosububuhbouhhhuu. Give prob of sequence us. 4/95 What is prob of sequence mh when two letters picked without replacement from mimhyi? 1/15 Calculate prob of sequence hhe when three letters picked without replacement from {h: 7, e: 4}. 28/165 What is prob of sequence ba when two letters picked without replacement from {a: 1, j: 5, m: 3, o: 4, b: 5}? 5/306 Three letters picked without replacement from sjjsjj. What is prob of sequence jss? 1/15 Four letters picked without replacement from ijjjf. Give prob of sequence jjfj. 1/20 What is prob of sequence gsgj when four letters picked without replacement from {g: 6, j: 1, c: 3, e: 4, u: 4, s: 1}? 5/15504 Calculate prob of sequence laal when four letters picked without replacement from {l: 4, m: 6, a: 4, d: 1}. 2/455 What is prob of sequence llpp when four letters picked without replacement from pplppppplppl? 2/55 Three letters picked without replacement from okczczzsbckcbzk. Give prob of sequence zks. 2/455 Three letters picked without replacement from jjjjjjjjjjjjjjssjjj. Give prob of sequence jsj. 16/171 Three letters picked without replacement from {w: 5, x: 7, s: 1}. Give prob of sequence xwx. 35/286 Three letters picked without replacement from {o: 2, d: 6}. What is prob of sequence odo? 1/28 What is prob of sequence nk when two letters picked without replacement from knkknnnnnnnknknn? 11/48 What is prob of sequence ty when two letters picked without replacement from qrtthtztttttthy? 3/70 Calculate prob of sequence hf when two letters picked without replacement from hhafahhhzhhzhhhhzfz. 11/171 Calculate prob of sequence jvj when three letters picked without replacement from jvjvvvjxvjjjjjvo. 1/10 Four letters picked without replacement from ffffffmffmm. Give prob of sequence mmff. 7/165 Two letters picked without replacement from {f: 2, g: 10}. Give prob of sequence gg. 15/22 Two letters picked without replacement from {l: 4, x: 15}. What is prob of sequence ll? 2/57 Calculate prob of sequence bfix when four letters picked without replacement from ffbxbbbbbbfbifibbbb. 1/969 What is prob of sequence xu when two letters picked without replacement from {x: 2, w: 1, l: 2, m: 1, q: 1, u: 1}? 1/28 Calculate prob of sequence lwlx when four letters picked without replacement from {d: 1, y: 3, n: 1, x: 5, w: 1, l: 3}. 5/4004 What is prob of sequence se when two letters picked without replacement from {b: 1, e: 1, g: 1, i: 2, t: 1, s: 1}? 1/42 What is prob of sequence kmkk when four letters picked without replacement from kxkkkkkxkxmkkkkzkxkx? 143/9690 Calculate prob of sequence gg when two letters picked without replacement from {v: 7, p: 1, r: 1, g: 3}. 1/22 What is prob of sequence weo when three letters picked without replacement from ewtowewteeeeeewe? 3/280 Calculate prob of sequence jz when two letters picked without replacement from {l: 2, j: 1, p: 1, r: 1, i: 2, z: 1}. 1/56 What is prob of sequence xmm when three letters picked without replacement from {m: 15, x: 3}? 35/272 Calculate prob of sequence tt when two letters picked without replacement from {t: 3}. 1 Three letters picked without replacement from {x: 14, h: 5}. Give prob of sequence hxx. 455/2907 What is prob of sequence arz when three letters picked without replacement from eeerraaraaz? 2/165 What is prob of sequence yv when two letters picked without replacement from {y: 4, v: 3, p: 2, t: 8}? 3/68 What is prob of sequence kk when two letters picked without replacement from {k: 3, l: 4, y: 1, e: 2}? 1/15 Four letters picked without replacement from {z: 7, x: 7, c: 2, g: 2}. Give prob of sequence xgcg. 7/18360 Calculate prob of sequence tt when two letters picked without replacement from tttxtxqtttq. 21/55 What is prob of sequence mqt when three letters picked without replacement from tmmtqqqmqqttt? 25/572 What is prob of sequence xl when two letters picked without replacement from {a: 1, l: 1, p: 1, x: 1, e: 1}? 1/20 Three letters picked without replacement from kkebekkeiekeibiibveb. What is prob of sequence iki? 1/114 Four letters picked without replacement from jmlml. Give prob of sequence mjmm. 0 Four letters picked without replacement from {o: 3, j: 4, u: 1, f: 4, e: 6, r: 2}. Give prob of sequence rruo. 1/19380 Three letters picked without replacement from {n: 10, x: 2, v: 4}. What is prob of sequence nnn? 3/14 Four letters picked without	{ "pile_set_name": "DM Mathematics" }
osest to x? (a) -0.4 (b) 0.2 (c) m b Let r be (-12)/(-15)(-10 - (-75)/10). What is the nearest to 4 in -3, 0.5, r? 0.5 Let r = 2987 - 2991. Let h = 2 - 1.9. What is the nearest to -0.1 in 16, r, h? h Let n = 4602.8 - 4603. What is the nearest to 4 in -1, n, 49.5? n Let i be 6/7(-6)/(-12)(-826)/1829. What is the nearest to 2 in -0.38, -1, i? i Let p = 3886/11569 + 6/503. Which is the closest to p? (a) 0.03 (b) 3 (c) -3 a Let r = 4606 + -50678/11. What is the closest to 1 in 1/5, -0.2, r, -6/25? 1/5 Let g be 837/(-2835) + 9/21. What is the nearest to -0.037 in 0, g, -4? 0 Suppose -25 = -5s, 2230 = -3i + 2s + 186. Let l be i/(-2079) - (-4)/(-18). Let x = l - -3/77. Which is the nearest to -1? (a) -2/13 (b) x (c) -1/6 c Suppose x + 41x - 42 = 0. Which is the nearest to 1/8? (a) -2/5 (b) x (c) 8 a Let v = 0.062 + 6.538. Let g = v + -2.6. What is the closest to 0.1 in -9, g, 0.2? 0.2 Suppose -2i = -3o + 79, -7o + i = -4o - 77. Suppose -ov - 51 = -8v. Which is the closest to v? (a) -4 (b) -9 (c) 0.5 (d) -2/9 a Suppose -2p - 15 = 5t, 5t - 39p + 175 = -57p. Let q be 1 - 0 - (-1)/1. Which is the nearest to -2/27? (a) -1/3 (b) q (c) t a Let y = -10 - -9.8. Let f = 0.4 - 3.4. Let g(m) = -m - 4. Let d be g(-4). Which is the closest to d? (a) -4 (b) y (c) f b Let l = -1206 + 729. Let s = l + 473. Let h = 0 + 0.1. Which is the closest to h? (a) -2 (b) s (c) 1 c Let x = 15 + -12. Let k = 2.5 - x. Suppose 104a = 98a - 12. What is the closest to a in 0.5, k, -2/9? k Let w = -8 + 6. Let g = -55/31 + 106/217. What is the closest to g in -3, -5, w? w Let o = 4 + -6. Let j(q) = 10q2 + 3q + 1. Let w be j(-1). Suppose 4g + 4 = -d - 2d, -3g = 5d - w. What is the closest to -2/9 in o, -1, g? -1 Suppose -5j - 66 = -91. Suppose -p = d, 3 = 4d - 4p - j. Suppose -2m = m. What is the nearest to m in 5, d, 0? 0 Let n be (-20)/(-9) - 0 - 2. Let w be (((-48)/18)/2)/(2/(-189)). Let f be ((-6)/(-32))/(w/(-84)). What is the closest to -1 in f, n, 2? f Let c be (8/(-14))/((-190)/(-133)) - (-627)/4180. Let w = -0.71 - 0.19. Let o = -0.1 + w. What is the nearest to c in 5, 6, o? o Let l be ((7/(-6))/7)/((-30)/45). Let d = 96 - 191/2. What is the closest to 0.2 in l, -4, d? l Let u = 48.416 - 44.8. Let q = u + -3.6. Let r = q + -5.016. What is the nearest to -1 in r, 0, 5/6? 0 Suppose -5i + 13 = r, 5r + 5i - 3i - 19 = 0. What is the closest to -46 in 0, r, -2/11? -2/11 Let n = -5650/9 - -62288/99. Which is the closest to n? (a) 4 (b) 0.1 (c) -0.5 b Let p be (-6)/7(-42)/(-6). Let t = -1636 + 1641. Let j = -3 - -1. What is the nearest to j in p, t, -0.1? -0.1 Let h = -2029.9 + 2034.9. Which is the nearest to h? (a) 3 (b) 5 (c) 3/4 b Let p = -8570/3 + 2857. Let q be 1-1 + 10/(-4). Let j = q - -19/6. Which is the nearest to -2? (a) p (b) -0.2 (c) j c Let v(q) = -q*2 - q + 18. Let o be v(0). Let r = -21 + o. Let u be 15/(-6) + r/2. What is the closest to -0.3 in 0, -3, u? 0 Let s = 16575 + -16567. What is the nearest to -20 in 5/3, s, 2/9, 0? 0 Let q = -228.68 - -217.68. Which is the nearest to -0.1? (a) q (b) 0.1 (c) -6.4 b Let k be (-63)/(-105) - (-2)/(-10). Let m = -14054/7 + 2008. Which is the closest to m? (a) 2/39 (b) k (c) 1 b Let y be ((-70)/(-112))/((-564)/24). Which is the nearest to y? (a) -3 (b) 2/3 (c) -5 b Let j = 0.185 - -1.815. What is the nearest to 0.1 in j, -2/53, -30, 1/4? -2/53 Let w = 0.31632 - 2.31632. Which is the closest to 27? (a) 3 (b) w (c) 2/7 (d) -0.1 a Let z = -0.63 + -0.37. Let n = -0.3 + 0.8. Let r = 1483.4 - 1483. Which is the nearest to -5? (a) z (b) r (c) n a Let z = -258 - -196. Let y = 58 + z. What is the nearest to 2 in 4, 0.08, y? 0.08 Let j = 140 + -976/7. Suppose -3l - 11 = x, 5l + 8 = x - 5. Let k be (-4)/24-3l/(-1). What is the nearest to 0.1 in 1, k, j? j Let t be (-9)/1612/(-9). Let q(h) = -h3 - h2 - 3h + 6. Let n be q(0). Let d be 2/n6/(-7). Which is the closest to d? (a) 2 (b) t (c) 1/2 c Let k = 11399 + -11403. Which is the closest to 13? (a) 0.6 (b) -0.05 (c) k a Let f = 38.95 - 39.05. What is the nearest to -3/5 in -0.03, -0.12, f? -0.12 Let o = -3280 - -3278. Which is the nearest to -0.1? (a) 0.1 (b) o (c) 34 (d) 2 a Let t = 1480.4 + -1412.17. Let x = t + -0.23. Let j = x + -68.03. Which is the closest to 0.2? (a) j (b) 1 (c) 4/5 a Let c be -2((-1)/(-28))/((-25)/(-300)). What is the closest to -180 in 2/3, 2/9, c? c Let x = 64.398 - 0.398. Which is the nearest to 0.2? (a) -0.05 (b) x (c) -0.3 a Let t = -82 - -81.5. Let b(z) = z + 10. Let y be b(-7). Let w be ((-41)/(-8) - 4)/(6/4). What is the nearest to t in w, -4/9, y? -4/9 Let j = -21459 + 1502177/70. Let k = -15/14 + j. Let o = 5 + -6. Which is the nearest to -0.03? (a) o (b) -1/10 (c) k b Let k = -19760 - -158081/8. What is the nearest to 75 in k, -12, 3/4? 3/4 Let s = 2051 + -2051.5. What is the closest to 1/2 in -0.165, -1/7, -1/4, s? -1/7 Let i be (66/15 + -4)/3. Let z = 19/14 - 3/2. Which is the closest to -0.5? (a) i (b) z (c) -1/8 b Let g be -1 - (-6)/10 - -1. Let s = -13 + 10. Let q = -265 - -263. Which is the closest to -3? (a) g (b) q (c) s c Let n = -2721 + 2721.3. Which is the nearest to -2/5? (a) -0.3 (b) 0.4 (c) n (d) -0.064 a Suppose 0 = 2058v - 2104v + 39 + 7. Which is the nearest to -0.2? (a) v (b) -9 (c) -122 a Let q = 0.71 - 1.5. Let f = 0.99 + q. Which is the nearest to f? (a) 0 (b) 0.6 (c) -2/7 a Let s = 5817 + -5816.99. What is the closest to 0 in -0.3, s, -0.2, -0.4? s Let p be (-5175)/(-585) + (-5 - (134/(-26))/1). Let q = -0.3 + 0.2. What is the closest to 0.2 in 4/5, q, p, 6? q Let k = 62 + 117. Let y = k - 179. Which is the closest to 1? (a) -0.3 (b) -2 (c) y c Let i = -0.8 - 0.2. Let l = 0.066 + -0.01. Let q = 1.944 + l. Which is the closest to i? (a) -4/3 (b) -0.2 (c) q a Let f be (2223/26 + -85)/(0 - 1/2). What is the nearest to f in -6/5, 34, -1, 10? -1 Let s(o) = -o - 6. Let q be s(-2). Let u be 55/(-66) + 2/q-1. Let l = 0.01 - 2.01. Which is the closest to u? (a) l (b) 1/5 (c) -1 b Let j be ((-4)/(-3))/(13019/2493). Which is the closest to 0.2? (a) -0.1 (b) j (c) 2 (d) -2/5 b Let t(w) = -2w3 - 23w*2 - 21w + 10. Let q be t(-10). Let s be (-45)/q(-16)/(-12). Which is the closest to -0.2? (a) 0.5 (b) -0.07 (c) 5 (d) s b Let t = 8 + -6. Let c = -478 + 403. Let y = c + 72. What is the closest to -2 in -1/2, t, y? y Let c be 6(-4)/(-12) + (-790)/12. Let f = -64 - c. What is the nearest to -0.2 in f, -6/5, 0.25? f Suppose -4r - 3b + 228 = 0, 5r - 184 = 2r + b. Let a be (-6)/(-15)(-50)/r. Let u = 8 + -8. What is the closest to a in 1/3, u, 0.1? u Let z = 0.2 + -0.6. Let k = 0 + 0. Suppose h = 635g - 634g, -2h + g = 0. What is the closest to k in z, 0.5, h? h Let z = -6 + -607. Let p = -608 - z. What is the nearest to -2 in -1, p, -0.4? -1 Let n = -5.04 + 0.74. Let l = n - -13. Let a = 8 - l. What is the nearest to -0.1 in -5, 0, a? 0 Let z(k) = 15k - k + k2 + 191 - 148. Let q be z(-10). Suppose -3 = -4n + 5n. Which is the nearest to 1/2? (a) q (b) n (c) -4 a Let l = 72/29 - 878/377. Which is the nearest to -0.116? (a) 2 (b) l (c) -5 b Suppose -29w - 6w = 420. Which is the nearest to 2? (a) w (b) -1 (c) -0.5 (d) -5 c Let u = 56 - 135. Let n = u - -78.8. Which is the nearest to 1/4? (a) 3/2 (b) n (c) 4 b Let q be (-9 - (-68)/8)(-1 + 889). Let w = 1330/3 + q. Which is the nearest to -1/4? (a) -2 (b) -0.3 (c) -16 (d) w b Let n = 4.5241 + 1.4759. Which is the nearest to 0? (a) -5 (b) -10 (c) n (d) 1/4 d Let v = 28.3 + -31. Let x = v + 2.7. Let z = 18 + -87/5. What is the nearest to 0.4 in x, z, 3/4? z Let p = 1.04431 - 1.14431. Let z = -43/2 - -21. Which is the closest to z? (a) 2/3 (b) 0 (c) p c Let n = 49 + -44. Suppose -3g = g - 12, 42 = -3i - 2g. Which is the closest to 0? (a) -3/7 (b) i (c) n a Let x = 1366 + -1363. Which is the closest to x? (a) 5 (b) 0.04 (c) 2.8 c Let d = -15 - -13. Let p = 4 + d. Let k = 4278.1 - 4278. Which is the closest to k? (a) 12 (b) p (c) -2 b Let y = -8.9114 + 8.068. Let j = -0.1566 + y. Let u = -0.8 + -0.2. What is the nearest to u in 2, j, -22? j Suppose 0 = -2p - 3*p. Let c be (((-2)/(-3))/((-76)/171))/(5/2).	{ "pile_set_name": "DM Mathematics" }
9m - 3m + 8m + (4 - 1 - 4)(2m + 3m - 6m))(m*2 + 2m*2 - 5m*2) as rm + ym2 + c + wm*3 and give w. 6 Rearrange ((2 + 1 - 4)(2 + p - 2) - p + 5p - 5p + (4p + 2p - 5p)(0 + 4 + 0))(p - p - 2p) to the form k + gp2 + hp and give g. -4 Express (-202i2 + 30i*4 + 202i*2)(1 - 2 - 2) as ui2 + fi*3 + w + ai*4 + ji and give a. -90 Rearrange (2o - 2o - 2o2)(-19 - 17 - 8) to the form j + lo2 + vo and give l. 88 Express (2m - m - 2m)(-13m + 6 - 6) as pm + n + vm*2 and give v. 13 Rearrange 0 + 4 + 0a3 - a2 - 3 - a*3 to the form r + wa*3 + sa + qa2 and give w. -1 Express 4v*3 + 53v*2 + 0v*3 - 52v*2 + 2v as t + cv3 + gv + jv2 and give g. 2 Express (-4x*3 + 4x*3 - 3x*3)(2 + 21 - 2x - x) in the form nx*3 + yx*4 + ux + f + ix2 and give n. -69 Express -2r*3 + 2r + 15r2 + 2r3 - r3 as sr + q + ur*2 + kr*3 and give k. -1 Rearrange (0 + 2i*2 + 0)(3 + 3 + 0) + (2i2 + 0i + 0i)(1 - 1 + 2) + 1 - 1 - i*2 to the form gi + n + si2 and give s. 15 Express -2 + d2 + 0d2 + d4 + d4 + d4 in the form i + sd + xd*2 + rd*3 + ld*4 and give i. -2 Rearrange 2j*2 - 2 - 2j*4 - 10j + 20j - 10j + 5j3 to y + pj*4 + fj + gj2 + hj*3 and give y. -2 Rearrange (2u + 3u - 4u)(-1 + 0 + 3) - 2u - 2u - u to the form y + ju and give j. -3 Rearrange r - 15r3 + 11r*3 + 11r + (-3 + 5 - 3)(r3 - 2r*3 + 2r*3) to the form gr*2 + m + hr + ir3 and give m. 0 Rearrange 4w*2 - 5w - 7w2 + 5w to k + cw + dw*2 and give c. 0 Rearrange (1 - l + 27l - l)(2 - 1 + 1) to the form j + rl and give j. 2 Express 9 + 0 - 16m + 8m as am + t and give t. 9 Express -68p - 53p - 20p as jp + l and give j. -141 Rearrange (-2v + 1 - 1)(10 - 42 - 10)(0v2 - 3v*2 + 2v*2) to the form fv + bv3 + wv*2 + x and give w. 0 Rearrange 7w + 5w + 0w to d + rw and give r. 12 Express ((-4 - 1 + 3)(-2 - 1 + 1) + 3 - 1 - 1)(y2 - y4 - y2) as wy*4 + iy*3 + hy + my2 + o and give w. -5 Express -2 + 28g*2 + 1 - 21g*2 as lg + k + yg2 and give y. 7 Express -3u*3 - 3u*2 + 3u - 2u3 - 2u as ku3 + a + gu*2 + hu and give h. 1 Rearrange 0x3 - x3 + 0x*3 + (-5x + 0x - 3x)((-2x + 1 - 1)(-3 + 3 + x) + x2 + 0x*2 + 0x*2) to the form w + cx*3 + fx*2 + ix and give c. 7 Rearrange 33 - 33 - 20h2 to o + fh + rh2 and give r. -20 Express (2 - 1 - 2)(-3n + n + n)(-2 + 615n - n2 + 3n*2 - 707n) as cn2 + k + dn + hn3 and give d. -2 Express -679k*2 + 680k2 + k3 - 3k4 - k + 0k*3 + 1 as xk*3 + mk*4 + ak*2 + u + fk and give a. 1 Express -3v4 - 2v*3 - 104v - 5v4 + 0v*3 + 105v + 2 - v*2 in the form qv*3 + s + av*4 + tv + bv2 and give s. 2 Express (-y + 1 + 2 - y)(-4y + 2y + 0y)(2 - 3 + 0)(2y2 - y2 - 2y2) as jy*2 + hy + oy4 + iy*3 + l and give o. 4 Express 391w + 4w2 - 388w - 3 - 2w2 in the form xw*2 + mw + o and give o. -3 Rearrange (1 - 3 + 1)(-2 + 0 + 1 + (1 + 2 - 1)(1 + 0 - 3) + 0 - 1 - 1 - 2 + 2 - 5)(-u + 4u - 7u) to pu + o and give p. -48 Rearrange -o - 6o3 + o3 + o - 3o*2 + 2 to a + zo + po3 + qo*2 and give p. -5 Rearrange (0 - 4 + 2)(-2 + 2 + 8c)(1 - 3 + 1) to wc + q and give w. 16 Express (20 + 89 - 14 - 5)(2f - 7 + 7) as qf + u and give q. 180 Express (3c - 3c + 2c2)(8 - 2 + 11) in the form uc2 + s + gc and give u. 34 Rearrange -p + 0p + p - 16p to sp + t and give s. -16 Express (6 - 1 - 4)(2f - 2f + f) - 2f + 0 + 0 - 5f + 0f - 2f in the form xf + g and give x. -8 Rearrange -8 + 8 - 12 + 2d*2 to the form v + rd*2 + bd and give v. -12 Rearrange -2f3 - 2 - f4 + 2f*2 + 0f*4 + 3 + 3f*3 to the form jf*3 + y + af*2 + tf*4 + wf and give a. 2 Rearrange 20o2 - 21 + 44 + 15o*2 - 25 to the form po + w + ao2 and give a. 35 Express -10y + 1 + 6y + 30y as ty + h and give h. 1 Express -2 - 38l - 3l3 + 45l + 2l2 + 6l*3 in the form gl*2 + dl + jl3 + i and give d. 7 Express 2k*4 - 6k2 + k2 - k*2 - 2 + 4k*2 as ok*4 + rk + bk3 + j + tk*2 and give t. -2 Express (4o4 - o4 - 2o4)(-218 + 397 - 281 + (0 + 2 - 1)(-6 + 1 + 4) + 3 - 6 + 4) in the form so + bo2 + q + mo*4 + zo*3 and give m. -102 Express 3 + 5k*2 - 5 + 61k*3 - 63k*3 as q + pk*2 + ak + ok3 and give o. -2 Rearrange (2 - 2q - 2)(-2 + 3 + 2) to o + wq and give w. -6 Rearrange -221 + 224 + j*2 + j - 11j*2 to vj*2 + y + aj and give a. 1 Express -1 + p + 7 - 6 + 1 as q + cp and give c. 1 Rearrange -86l*2 + 485l - 485l to the form ql*2 + i + gl and give q. -86 Rearrange (18 + 17k2 - 18)(1 - k + 2k + 2k) to the form ok2 + bk*3 + sk + y and give b. 51 Rearrange 5 - 5 - w*4 + (-2w*3 + 4w3 - w3)(7w + 17 - 17) to the form uw4 + s + mw*2 + fw*3 + yw and give u. 6 Rearrange 6z + 4z - 5z + z2 to the form gz*2 + cz + d and give g. 1 Rearrange -9o2 + 7o - 7o to ko*2 + q + bo and give k. -9 Express 7v4 + 43 - 43 + (-3v - 2v + 2v)(2v2 + v3 - 2v3 + 0v*2) as rv + zv3 + ov*4 + p + sv2 and give o. 10 Rearrange -l3 + l*3 - 9l*2 - 2l*3 - 3l*2 to bl*2 + c + dl + kl3 and give k. -2 Express 61x*3 - 2 - 2x - x - 64x3 + 0x + 2x2 as s + nx + ax2 + jx*3 and give j. -3 Rearrange -1 - 2o*4 + 1 + (-2 + 4 - 4)(-5o4 - 3o*4 + 6o4) + o4 + 0o4 + 0o*4 to the form u + zo + so3 + yo*4 + fo*2 and give y. 3 Rearrange (-2f - 3f + 4f + (-2 + 2f + 2)(-5 + 5 + 3))(-9f*2 + 0f2 + f2) to bf + sf*2 + n + zf*3 and give z. -40 Express 3u + 3 - 12 + 3 + 0 in the form zu + o and give z. 3 Express -u - 3 + 3u - 1 - 2 in the form o + pu and give p. 2 Rearrange (-9 - 19h + 9)(0 + 2 - 3)(-h - h + 0h) to i + dh*2 + yh and give d. -38 Express -179b2 + 87b*2 + 94b*2 - 49 as nb + vb2 + k and give k. -49 Express (4a*2 - 3a*2 - 7a*2)(1 - 4 + 2) - 8a2 + 2a*2 - 7a*2 as x + ua + ha2 and give h. -7 Rearrange -9u*3 + 4u*3 + 2u*3 + (0u*3 - 2u*3 + 3u*3)(0 + 1 - 3) to g + ou3 + ju + vu2 and give o. -5 Rearrange -m4 - 2m*4 - 5m4 + (m2 - 1 + 1)(-3m*2 - 4m*2 + 4m*2) to the form im*3 + sm*2 + n + om + fm4 and give f. -11 Rearrange 28p + 5 + 4 - 9 to the form dp + f and give d. 28 Express (2w*2 + 0 + 0)(-w - w - 2w)(0w + w + w) in the form k + qw*2 + ow + jw4 + pw*3 and give j. -16 Express -134p - 446 + 446 as wp + x and give w. -134 Rearrange 0p*3 - 6p*3 + 121 - 122 to yp*3 + vp*2 + np + a and give a. -1 Express -16l + 12l + 8l + 7l as ml + a and give m. 11 Express -10l*2 + 30l*2 - 11 + 11 in the form f + pl + xl2 and give x. 20 Express (0o*2 - 4o*2 - 3o*2)(3o + o + 0o) - 4o3 + 2o*3 + 3o*3 in the form bo*2 + fo*3 + jo + d and give f. -27 Express 2p + 7p*2 - 13p*2 + 7p*2 - 2 in the form lp*2 + yp + g and give l. 1 Rearrange -4r - 4 - 2r*4 + 2r + 82r2 - r3 - 84r*2 to the form nr*3 + ar*2 + hr + w + cr4 and give w. -4 Rearrange (3 - 3 + m)(0 - 5 + 2) + (-5 + 3 + 1)(-2m + 2m - 2m) to im + o and give i. -1 Rearrange 1 - 2 + 4t*2 - 4t*2 - 4t*2 to the form nt*2 + mt + k and give n. -4 Rearrange v + 2v4 + 20v2 - v3 - 2v3 - 21v*2 - 3v*4 to zv + fv2 + jv*4 + ov*3 + i and give j. -1 Express (-18 + 2 - 11)(-2i + i + 0i) in the form k + fi and give f. 27 Express 127 + g - 127 + 3g*2 as c + fg*2 + vg and give v. 1 Express (-15 + 12 - 23)(6h + 0h - 2h) in the form th + v and give t. -104 Rearrange 10m2 - m2 + 3m2 + 3m*2 to f + nm + gm2 and give g. 15 Express -3x + 23x - x as fx + w and give f. 19 Express -6 + 4j - 2j*3 + 3 + 3 in the form xj*2 + g + cj*3 + uj and give u. 4 Express (2 + 2 - 1)(6k + k + 10k)(-1 - 2 + 2)(-k + 3 - 3) as qk*2 + p + nk and give q. 51 Express -g - g*2 - 14g + 5g in the form k + jg + tg2 and give t. -1 Express -19k*2 + 19k2 + k3 + (-k*2 + 0k*2 + 2k*2)((4 - 3 + 0)(-k - k + 4k) - 12 + 12 + 7k) in the form r + lk + wk2 + dk**3 and g	{ "pile_set_name": "DM Mathematics" }
9 Let y(g) = -g*3 - 6g*2 - 20g - 6. Calculate the remainder when y(-4) is divided by 18. 6 Let v = -981 + 994. Let g = 15 + 88. Calculate the remainder when g is divided by v. 12 Suppose 0 = -2k + 2i - 1 + 35, -4k - i = -43. Suppose -4b - s = -274, -18s = -20s - 4. What is the remainder when b is divided by k? 9 Suppose 4t - 398 = 662. Calculate the remainder when t is divided by 10. 5 Let f(k) = -k2 + 9k + 29. What is the remainder when f(7) is divided by 24? 19 Let u = 109 - 19. Suppose -u = -4b - 474. Let y = b + 152. Calculate the remainder when y is divided by 15. 11 Suppose -568r + 567r + 16 = -5h, 4h = 2r - 62. Suppose -2q + 6 = 5t, -4t + 34 = 4q + 10. What is the remainder when r is divided by q? 1 What is the remainder when 131 is divided by ((10 - 3) + -4)22/3? 21 Let y = 31 - 26. Let i = 34 - 17. What is the remainder when i is divided by y? 2 Suppose 11x + 4 = -7. Let f = 17 + x. What is the remainder when 43 is divided by f? 11 Calculate the remainder when -7(60/(-28) + 1) is divided by 1. 0 Suppose 5k - 200 = 4g, -58 - 22 = -2k - 5g. Calculate the remainder when 121 is divided by 205/k6 - 1/(-4). 28 Let o(l) = 4l2 - 3l - 1. Suppose 6j - 8 = 34. Suppose 135 = 2m + jm. What is the remainder when o(-3) is divided by m? 14 Calculate the remainder when (-14)/(-7)60 - 6 is divided by 32. 18 Suppose 151i = 181i - 3150. Calculate the remainder when 728 is divided by i. 98 Suppose 0 = -97q + 94q + 654. Calculate the remainder when q is divided by 37. 33 Let k = 309 - 289. Suppose -2u + 790 = 3u - 5r, -r + 158 = u. What is the remainder when u is divided by k? 18 Let g be -2 + (2/2 - -3). What is the remainder when (0 + 2/g)55 is divided by 19? 17 Let c = 15 - 13. Let n = 9 + -4. Suppose -5m - 7 + 32 = -nx, 0 = cm + 5x - 24. Calculate the remainder when m is divided by 3. 1 Let c(t) = -t + t - t + 0. Let i be c(3). Calculate the remainder when 74(i/6 + 1) is divided by 20. 17 Suppose 0 = -5s + 26 + 29. Suppose s = 3b - 28. Calculate the remainder when 23 is divided by b. 10 Let d = 97 - 203. Let f = d + 208. Calculate the remainder when f is divided by 26. 24 Calculate the remainder when 94 is divided by (4 + -11)/(2 + 10/(-4)). 10 Let p be ((-2)/(-2))/((-1)/(-10)). Calculate the remainder when ((-690)/(-4))/5 - 5/p is divided by 12. 10 Let j(z) = z2 - 6z - 5. Let b be j(7). Suppose -7 = -bt - 1. Let k = -27 - -32. Calculate the remainder when k is divided by t. 2 Suppose -2o + 15 - 1 = 0. Suppose l = -28 + 25. Let q = l - -15. Calculate the remainder when q is divided by o. 5 Let b(z) = -20z + 878. What is the remainder when b(37) is divided by 132? 6 Let r(v) = -2v - 9. Let s be r(-6). Let b = -89 + 156. Suppose -3h + 2a = -b, -a + 1 = s. What is the remainder when 81 is divided by h? 18 Calculate the remainder when 197 is divided by ((-2)/(-4))/(26/1300). 22 What is the remainder when 16/(-88) + (-17067)/(-33) is divided by 26? 23 Let i(a) = a*2 + 2a - 1. Suppose d - 2y - 64 = 0, -7d + 5y = -5d - 133. What is the remainder when d is divided by i(3)? 12 Let d(l) = 2l2 + 21l + 16. What is the remainder when d(-15) is divided by 19? 18 Let f = -15 + 36. Let h(k) = -k - 7. Let i be h(-10). Suppose 0 = -im + 5g + 43, 2m - g - 26 = g. Calculate the remainder when f is divided by m. 10 Suppose 4v - 303 = -6t + 3t, -3v = -3t - 222. Let n(c) = 4c2 - 3c - 3. Calculate the remainder when v is divided by n(-2). 18 Let i(z) = z*3 + 4z*2 - z + 12. Let b = 62 + -54. Calculate the remainder when i(-4) is divided by b. 0 Let m = -639 - -722. What is the remainder when m is divided by 141(2 - 0)? 27 Suppose -3p = -4m - 18, p - 2m + 6m - 6 = 0. Calculate the remainder when p/(-2 - (-16)/7) is divided by (6/(-10) + 1)20. 5 Suppose 5b + 11 = 241. Let y = -36 + b. What is the remainder when 37 is divided by y? 7 Let n(z) = -z2 - 2z + 7. Let o be n(-4). Let k(t) = 7t2 + 3t + 2. What is the remainder when k(o) is divided by 4? 2 Let w(z) = -2z - 6. Let u(a) = a + 4. Suppose -32 = 4q - 2q - 3r, -q = -4r + 26. Let m be u(q). Calculate the remainder when 11 is divided by w(m). 5 What is the remainder when 81 + (-5)/((-30)/(-42)) is divided by 28? 18 Suppose -2o + 3l + 14 = 0, 3o = 4l + 12 + 8. Let f(z) = z + 20. Calculate the remainder when f(-12) is divided by o. 0 Suppose 13x - 360 = -7x. What is the remainder when 101 is divided by x? 11 Let q(o) be the second derivative of o4/4 + o3/3 - 5o*2 - 8o - 9. Let a(i) = i - 2. Let x be a(5). Calculate the remainder when q(x) is divided by 12. 11 Let q = 3 - 3. Suppose 3j + y - 416 = -qy, -2y = 2j - 280. What is the remainder when 91 is divided by (j/(-9))/((-4)/6)? 22 Suppose -z - 3p + 123 = 0, -19z + p - 337 = -22z. What is the remainder when z is divided by 13? 7 Let y(t) = t3 - 5t*2 + 4t - 11. Suppose -5u - 1 = -21. What is the remainder when y(5) is divided by u? 1 Let z(b) = 6b*2 - 17b - 21b + 5 + 37b - 2. Suppose -6g + g = -105. Calculate the remainder when z(-3) is divided by g. 18 Let w(r) = 2r*2 - 7r + 6. Let t = -7 + 1. Let s = 10 + t. What is the remainder when w(4) is divided by s? 2 Let r = -131 - -187. Let o = 63 - r. What is the remainder when 26 is divided by o? 5 Let s(v) = -3v + 33. Calculate the remainder when 116 is divided by s(6). 11 Suppose -105v = -86v - 247. What is the remainder when 100 is divided by v? 9 Suppose 2c - 42 = -5t - 8, t + 46 = 2c. Calculate the remainder when 29 is divided by c. 7 Let b = 386 + -338. Calculate the remainder when 476 is divided by b. 44 Suppose 0 = -2l - 3g + 14, 3l + 1 = 2g + 9. Calculate the remainder when (-4)/(-3) - 116/(-12) is divided by l. 3 Let i = -32 - -28. Let z(b) = -6b - 15. What is the remainder when 14 is divided by z(i)? 5 Suppose -18o - 119 = -35o. Suppose 4j = 3 - 11, -3j - 2 = 2y. Calculate the remainder when o is divided by y. 1 Let k = -15 - -18. Suppose -6q + 128 = -2q + 4u, q = ku + 20. What is the remainder when 55 is divided by q? 26 Let c(s) = s*3 + 3s*2 - 3s + 4. Let g be c(-4). Suppose -3i + 14 - 5 = g. Calculate the remainder when 11 is divided by i. 2 Suppose -5f - a = -295, 2f - 3 - 127 = 2a. Calculate the remainder when 317 is divided by f. 17 Suppose 17l - 20l + 54 = i, -5i = 5l - 80. Calculate the remainder when 470 is divided by l. 14 Let h(c) = -c*3 + 14c*2 - 10c - 19. Let d(g) = g*2 - 2g + 13. Let r be d(0). What is the remainder when h(r) is divided by 8? 4 Suppose 1055 = 5c + 5u, 425 = 2c - 12u + 11u. What is the remainder when c is divided by 44? 36 Let y(d) = -d2 + 42. Suppose -c = -2c, -5c - 15 = -3b. Suppose 0 = bw + 25, 2w + 57 - 14 = 3a. What is the remainder when y(0) is divided by a? 9 Let j(l) = -4l - 6. Suppose 2 = -n + 3a, -a = 5n - 5a + 21. What is the remainder when (39 - 0)/(12/8) is divided by j(n)? 12 Let f(r) be the third derivative of -3r*4/8 - 7r3/3 - r2 - 11r. What is the remainder when f(-11) is divided by 29? 27 Let o = 258 + -235. What is the remainder when o is divided by 14? 9 Calculate the remainder when 33 is divided by 18 - 5 - (1 + 5). 5 Let t(c) = 2c*2 - 64c - 409. What is the remainder when t(-7) is divided by 66? 5 Let m(p) = p*2 - 9p - 10. Let o = -9 - -18. Let f be m(o). Let a = 18 + f. Calculate the remainder when 29 is divided by a. 5 Suppose -18y + 4424 = -994. Calculate the remainder when y is divided by 54. 31 Let m = 194 + -65. Suppose -5y = -4k + 137, -y - 2y = 4k - m. What is the remainder when k is divided by 9? 6 Let g = 0 - 1. Let k = 9 + g. Calculate the remainder when (-100)/30(-132)/20 is divided by k. 6 Let j = -14 + 22. Suppose -j - 1 = -3n. Suppose ny + 0 = 42. What is the remainder when y is divided by 5? 4 Let z(r) = -19r - 6. What is the remainder when 349 is divided by z(-1)? 11 Suppose 3 + 35 = 2u. Let o = 0 - 0. Suppose 4b = -ob + 292. Calculate the remainder when b is divided by u. 16 Let s(b) = 32b2 - b + 1. Suppose 3r - 6r = -3. What is the remainder when s(r) is divided by (3 + 0)(-17)/(-3)? 15 Suppose -90 = -2a - 2w, -67 = -a + w - 28. Calculate the remainder when 67 is divided by a/832/12. 11 Suppose 0 = 3h - v - 5, 4h - 5v	{ "pile_set_name": "DM Mathematics" }
o(1). 7 Let p(s) = -5s - 41. Give p(-11). 14 Let a(y) = 67y + 305. Determine a(-4). 37 Let f(r) = r*3 - 15r*2 - 251r - 8. Give f(-10). 2 Let g(d) = 2d2 - 3d + 4. What is g(3)? 13 Let l(k) = -k*3 - 18k*2 + 20k + 17. Calculate l(-19). -2 Let l(h) = 5h2 - 12h - 3. Calculate l(3). 6 Let m(g) = -2g - 26. Calculate m(16). -58 Let r(u) = -u3 - 4u*2 + 7u + 4. Calculate r(-5). -6 Let k(n) = n*2 - 6n - 19. Calculate k(9). 8 Let i(c) = -c*2 + 9c + 1. What is i(9)? 1 Let o(b) = -b*2 + 12b + 9. Determine o(12). 9 Let i(w) = -2w3 - 42w*2 + 42w - 48. Determine i(-22). -4 Let h(n) = 3n2 + 44n + 145. Give h(-6). -11 Let d(n) = -n*3 - 33n*2 + 2n + 75. Determine d(-33). 9 Let i(q) = 2q2 + 20q + 32. Give i(-2). 0 Let c(i) = i*2 - i - 1. Give c(5). 19 Let b(o) = 5o. What is b(1)? 5 Let c(t) = -t*3 + 11t*2 - 20t + 8. What is c(9)? -10 Let y(p) = -6p - 9. Calculate y(-11). 57 Let j(x) = -x + 1. Determine j(-4). 5 Let r(n) = n2 - 11n - 11. What is r(11)? -11 Let u(d) = d*2 + 10d - 38. Calculate u(-13). 1 Let q(b) = -b*2 + 2b - 2. What is q(3)? -5 Let v(s) = 2s - 6. Calculate v(12). 18 Let j(u) = 2u*3 + 13u*2 - 6u - 7. Calculate j(-8). -151 Let l(v) = v*3 - 5v*2 - v - 4. Determine l(3). -25 Let x(a) = 3a*3 + 5a*2 - 2a - 7. What is x(-2)? -7 Let p(l) = l*2 + 11l + 20. Determine p(-11). 20 Let l(c) = -10c + 27. Calculate l(3). -3 Let z(i) = -i2 - i + 63. Calculate z(0). 63 Let n(h) = -h2 - 18h + 9. What is n(-14)? 65 Let s(l) = 3l. Calculate s(-1). -3 Let a(b) = -b3 - 8b*2 - 6b - 2. Give a(-7). -9 Let b(x) = -x*3 - 5x*2 + 4x + 39. What is b(-4)? 7 Let m(q) = -q*3 - 16q*2 + 19q + 40. Determine m(-17). 6 Let z(a) = -a*2 - 4a + 9. Calculate z(-7). -12 Let v(d) = 2d - 63. Determine v(23). -17 Let q(g) = g + 6. Determine q(2). 8 Let a(t) = -10t*2 + 81t + 1. Give a(8). 9 Let m(b) = -b*2 - 24b + 3. Determine m(-24). 3 Let l(i) = 3i + 40. Determine l(-14). -2 Let c(k) = -k2 - 17k - 25. Give c(-15). 5 Let a(v) = v*3 + 17v*2 - 24v + 6. Give a(-18). 114 Let v(b) = -b2 + 38. Calculate v(0). 38 Let n(t) = t2 + 17t - 61. Determine n(-19). -23 Let z(l) = 2l*2 - 5l - 8. Give z(6). 34 Let f(r) = -r*3 + 13r2 + r - 6. Determine f(13). 7 Let a(z) = z3 - 10z2 + 5z + 12. Calculate a(9). -24 Let v(z) = -5z + 2. Calculate v(11). -53 Let d(l) = l3 + 12l*2 + 20l + 8. What is d(-10)? 8 Let v(n) = n*2 + 15n + 43. Give v(-12). 7 Let n(x) = -4x - 19. Determine n(-7). 9 Let w(z) = -5z*2 - 3z - 15. Give w(4). -107 Let p(j) = -4j3 + 67j*2 + 17j + 14. What is p(17)? 14 Let x(i) = -i3 - i2 + 9. What is x(0)? 9 Let k(g) = -g + 104. What is k(16)? 88 Let c(m) = -m*3 - 5m2 - 3. Give c(-3). -21 Let d(u) = -u2 + 9u - 4. Give d(8). 4 Let z(j) = 2j - 18. Calculate z(12). 6 Let h(m) = -2m - 4. Determine h(-5). 6 Let u(m) = -2m*2 - 7m + 6. Determine u(2). -16 Let j(s) = -s*2 + 14s - 22. Determine j(3). 11 Let t(z) = 3z2 - 10z - 28. What is t(-2)? 4 Let b(y) = -51y + 729. Determine b(14). 15 Let q(s) = -s2 + 3s + 25. Give q(6). 7 Let m(t) = -t*2 + 12t - 43. Determine m(8). -11 Let h(p) = -2p - 25. Give h(-12). -1 Let a(u) = 11u - 50. Determine a(25). 225 Let t(c) = c + 3. What is t(1)? 4 Let f(q) = -29q + 292. Determine f(10). 2 Let v(c) = -3c + 34. What is v(12)? -2 Let q(p) = p*3 + 8p*2 + 14p + 13. Calculate q(-6). 1 Let i(y) = 3y + 10. Give i(-4). -2 Let f(z) = -z2 + 3. Determine f(-4). -13 Let g(v) = -v3 - 9v*2 - 12v + 14. Calculate g(-7). 0 Let b(j) = -j*3 - 8j*2 + 2j - 8. Determine b(-8). -24 Let x(n) = -n - 22. Determine x(-15). -7 Let p(h) = 2h2 + 7h + 1. Calculate p(-3). -2 Let w(n) = 5n2 - 6n + 7. Determine w(2). 15 Let u(f) = f*3 - 6f*2 - 4f - 4. Calculate u(4). -52 Let v(o) = -o*3 - 16o*2 - 17o - 19. What is v(-15)? 11 Let z(i) = 2i3 - 19i*2 - 6i + 13. Determine z(10). 53 Let r(i) = -i*3 + 10i*2 - 22i + 28. Determine r(8). -20 Let n(d) = -d*3 + 7d*2 - 7d + 5. What is n(7)? -44 Let w(o) = -o*3 + 2o*2 - 2o + 30. Determine w(4). -10 Let o(r) = 3r + 5. Determine o(-6). -13 Let m(k) = -9k3 - k2 - 2k - 1. Calculate m(-1). 9 Let g(a) = -2a*2 - 7a - 4. Determine g(-6). -34 Let d(i) = -2i3 - 2i*2 + 5i + 4. What is d(-3)? 25 Let x(k) = -k*3 - 12k*2 + 11k - 9. Calculate x(-13). 17 Let l(q) = -4q - 84. Calculate l(-18). -12 Let x(k) = -19k + 81. Determine x(5). -14 Let o(t) = 2t2 + 17t - 5. Calculate o(-7). -26 Let k(b) = 26b3 + b2 + 5b + 4. Determine k(-1). -26 Let s(q) = q*3 - 9q*2 + 11q - 42. Give s(8). -18 Let j(y) = y*3 - 7y*2 + 8y - 12. What is j(6)? 0 Let g(u) = -u*2 + 2u + 6. Give g(-3). -9 Let s(a) = -44a3 - 3a2 + a + 2. Calculate s(1). -44 Let t(x) = -x2 + 12x + 49. What is t(17)? -36 Let m(q) = -2q*3 - 17q*2 + 8q + 1. What is m(-9)? 10 Let z(s) = -s - 2. What is z(1)? -3 Let h(w) = w*3 + 3w*2 - 8w - 7. What is h(-5)? -17 Let f(m) = 10m - 4. Determine f(1). 6 Let p(s) = 12s. What is p(-2)? -24 Let a(f) = -3f - 11. Give a(-4). 1 Let v(j) = -j3 - 3j*2 + 3j + 5. Determine v(3). -40 Let v(y) = -y - 27. What is v(-22)? -5 Let m(k) = -k*2 + 5k + 6. Determine m(-5). -44 Let r(y) = -4y3 + 3y2 - y - 1. Calculate r(2). -23 Let o(j) = -j3 - j*2 + 4j + 4. What is o(-3)? 10 Let m(g) = g*2 - 8g - 4. Determine m(9). 5 Let t(n) = -4n2 - 2n. Give t(-5). -90 Let p(t) = 3t + 6. Give p(5). 21 Let k(f) = f + 15. What is k(6)? 21 Let t(v) = -v3 + 7v*2 - 29v + 44. What is t(4)? -24 Let s(b) = b*3 - 4b*2 + 4b + 3. What is s(3)? 6 Let b(c) = -16c + 4. Calculate b(-6). 100 Let c(z) = z2 - 12z - 33. Calculate c(-2). -5 Let k(u) = -10u2 + 4u - 4. What is k(1)? -10 Let o(v) = 77v3 - v2 - 7v - 7. What is o(-1)? -78 Let y(n) = -8n - 1. Calculate y(5). -41 Let f(z) = -z2 - 16z - 47. Calculate f(-4). 1 Let b(q) = q*2 - 2q - 78. Give b(10). 2 Let n(o) = -4o + 21. Give n(6). -3 Let s(u) = -2u*3 - 71u*2 - 32u + 99. Calculate s(-35). -6 Let q(s) = -11s - 30. Give q(3). -63 Let g(x) = 2x*2 - 34x + 18. What is g(19)? 94 Let u(r) = r - 29. Give u(7). -22 Let m(v) = -9v3 - v2 + 2v + 2. Give m(1). -6 Let z(m) = 79m - 468. Give z(6). 6 Let k(z) = 23z2. Give k(1). 23 Let t(p) = p3 + 14p2 - 11p + 58. Calculate t(-15). -2 Let o(r) = 3r2 + 9r - 3. Calculate o(-5). 27 Let c(u) = u*3 + 8u*2 - 28u - 73. Calculate c(-10). 7 Let h(c) = -c - 1. What is h(-3)? 2 Let w(f) = -f*3 + 6f*2 + 9f - 57. Calculate w(6). -3 Let t(o) = 2o2 - 21o - 10. What is t(11)? 1 Let y(z) = -2z2 - z + 24. Give y(0). 24 Let r(h) = -h3 - 5h*2 + 3h + 7. Determine r(-5). -8 Let g(x) = 2x - 8. Give g(-6). -20 Let c(d) = -d2 + 8d - 7. Calculate c(11). -40 Let k(c) = c*2 - 36c + 70. Give k(28). -154 Let h(f) = -21f + 4. Determine h(1). -17 Let q(b) = -2b*2 + 113b - 157. Determine q(55). 8 Let u(i) = -13i3 - 2i2 + 1. Give u(1). -14 Let w(j) = j3 - 8j2 - 5j - 5. What is w(8)? -45 Let a(c) = c*2 - 9c - 16. Calculate a(10). -6 Let r(x) = -x*2 + 25x + 102. Determine r(29). -14 Let x(n) = -n*3 + 9n*2 - 16n + 2. Calculate x(7). -12 Let t(o) = -o*2 + 2o + 52. What is t(7)? 17 Let r(o) = o*2 - 13o + 13. Determine r(11). -9 Let m(x) = -x*2 + 5x + 15. What is m(7)? 1 Let m(o) = 107o2 - 3o + 2. Give m(1). 106 Let h(x) = 24x - 268. Determine h(11). -4 Let l(g) = -5g + 59. Determine l(11). 4 Let n(r) = -2r2 + 11r - 10. Determine n(9). -73 Let s(t) = t*2 + 22t - 23. Give s(-23). 0 Let c(n) = 2n2 + 7n - 7. What is c(-3)? -10 Let p(n) = 2n3 - 10n*2 - 5n + 29. What is p(5)? 4 Let a(k) = 3k - 7. Give a(4). 5 Let s(r) = 4r + 9. Calculate s(-5). -11 Let p(i) = i*2 - 3i - 5. Determine p(9). 49 Let n(o) = o*3 + 7o*2 + 10o + 4. Give n(-5). 4 Let u(m) = 2m + 85. What is u(-17)? 51 Let h(g) = -g2 - 11g + 9. Determine h(-12). -3 Let k(y) = y*3 + 4y*2 + 3y + 1. Determine k(-4). -11 Let w(t) = -9t + 93. Give w(10). 3 Let n(r) = -r3 - 6r*2 - 4r - 12. Calculate n(-5). -17 Let f(w) = -6w - 1. Calculate f(6). -37 Let t(q) = q3 + q2 - 2q + 4. Give t(-3). -8 Let v(n) = -5n2 + 4n + 38. What is v(-4)? -58 Let h(a) = a*3 - 17a*2 - 19a +	{ "pile_set_name": "DM Mathematics" }
(x) = 32057x2 + 5x - 50. Let n be f(5). What is n rounded to the nearest ten thousand? 800000 Let u = 68.69998325 - 68.7. What is u rounded to 6 decimal places? -0.000017 Let n = -6.932 - -8.03. What is n rounded to 2 decimal places? 1.1 Let w be ((-1115225)/(-62))/((-4)/(-960)). Round w to the nearest 100000. 4300000 Let a = 85.61 - 2.11. Round a to the nearest integer. 84 Let r = 2834 - 5218. Let b = r - -1194. Round b to the nearest one hundred. -1200 Let t(r) = 10r - 4. Let y be t(0). Let k be 802(4 + 36)50/y. What is k rounded to the nearest ten thousand? -400000 Suppose 9n - 350592 = 5t + 13n, 4n - 280488 = 4t. Round t to the nearest 10000. -70000 Let y be (13 - 169) + (2 - -3). What is y rounded to the nearest 10? -150 Let b be 10 + -12 + -8986317. Let i = 167673 + b. What is i rounded to the nearest 100000? -1400000 Suppose -4g + 2 = -4u - 10, -2u - 4g + 24 = 0. Suppose -4a - 100 = 3m + 88, 0 = -3m + ua - 212. What is m rounded to the nearest 10? -70 Let r = 9181 - 10486.4. Round r to the nearest 10. -1310 Let r = 6.03 + -6.0299545. What is r rounded to five decimal places? 0.00005 Let k = -162196 + 274776. Let z = k - 260580. Round z to the nearest 10000. -150000 Suppose 3y = -11y + 285600. Round y to the nearest one thousand. 20000 Let k be ((-5)/1)/(-1) + -1. Let o be (-707 - 10)/(3/(-8)). Suppose ki - y + 3796 = 0, -4y - o = 2i - y. Round i to the nearest one hundred. -1000 Let t = 68503 - 68503.0770075. Let y = -0.077 - t. What is y rounded to six dps? 0.000008 Let l(q) = -45q2 + 3q - 12. Let i be l(9). What is i rounded to the nearest one hundred? -3600 Suppose 5f = -8788 - 11212. What is f rounded to the nearest 10000? 0 Let s(q) = -28010q*2 + q - 138. Let k be s(-22). What is k rounded to the nearest 100000? -13600000 Let y = -176.1 + 176.1001843. Round y to five decimal places. 0.00018 Let b = 39748 + 24052. Suppose 5x - b = -6x. Round x to the nearest one thousand. 6000 Suppose 3t + 54243 = -2f, -6538 - 47687 = 2f - 3t. Let l = 55917 + f. What is l rounded to the nearest 1000? 29000 Let k(q) = q3 + 6q*2 - 9q - 7. Let n be k(-7). Suppose -5h + nh - 92160 = 0. Let u be (1 - -124)/(8/h). What is u rounded to the nearest 100000? 700000 Let c = -700 - -380. What is c rounded to the nearest 10? -320 Let z = -203.834 + 199.8. Let h = 65 + -61. Let j = z + h. What is j rounded to two dps? -0.03 Let t be -2943949 - 45 - 61. What is t rounded to the nearest one hundred thousand? -2900000 Let h = -24079 + 24078.886696. Let v = 0.04952 + h. Let u = 0.064 + v. What is u rounded to 5 dps? 0.00022 Let o = 25604.09918 + -25607. Let s = o - -2.9. What is s rounded to 4 decimal places? -0.0008 Let d = -66380801 + 66380744.000323. Let a = 57 + d. What is a rounded to 5 decimal places? 0.00032 Suppose 0 = -4o - 8, -2h - 26 = -5h - 5o. Let l(j) = -j3 + 10j*2 + 7j - 14. Let b be l(h). Let y = -142 + b. What is y rounded to the nearest 100? -400 Let p = -2.76 - -2.75999808. Round p to seven dps. -0.0000019 Let u = 874.036 - 879. Let x = 0.13 + 4.87. Let o = u + x. What is o rounded to 2 decimal places? 0.04 Let j = 0.163 + -0.1553. Round j to 3 decimal places. 0.008 Let r be (-350)/(-30) + 4/(-6). Let w(l) = -5l2 + 8l - 13. Let a be w(r). Round a to the nearest 100. -500 Suppose 3x = 5f + 28109990, 3x - 13042824 = -f + 15067178. What is x rounded to the nearest 1000000? 9000000 Let j = 7916922 - 1116922. Suppose 0 = -5k - 3g + 39 - 14, -4g = 2k - 24. Suppose 6n - kn + j = 0. What is n rounded to the nearest 1000000? -2000000 Suppose 5q - 3t = 98949988, 108796966 - 29636978 = 4q - 3t. What is q rounded to the nearest one million? 20000000 Let s(q) = 21430q - 20. Suppose -42 = 23d - 26d. Let u be s(d). What is u rounded to the nearest one hundred thousand? 300000 Let u = -14 + 18. Suppose 3i = uq + 45615, 0q = q + 3. Suppose -11403 = 3v - 0v + 3o, -4v = o + i. Round v to the nearest 1000. -4000 Suppose -51c - 48184894 = -480052894. What is c rounded to the nearest one million? 8000000 Let c(p) = 632340p + 30. Let b be c(7). Suppose b = 5y - 3373590. What is y rounded to the nearest one hundred thousand? 1600000 Let q = 31 - 25. Let d = -5.975 + q. Round d to 2 dps. 0.03 Let d = -2.22 - 9.48. Let s = d - -4.8. Round s to the nearest integer. -7 Let q = 45 - 64.8. Let a = 19.897 + q. What is a rounded to 2 decimal places? 0.1 Let v = 29.4 - 2.4. Let o = -16 + v. Let a = o - 11.00125. Round a to 4 dps. -0.0013 Let z = 100 + 64. Let k = z - 170.35. Round k to 0 decimal places. -6 Let z = -28 + 87. Let u = z - 58.9999555. What is u rounded to 6 decimal places? 0.000045 Let x = -114.1 + 81.2. Let d = x - -38.86. Round d to 0 decimal places. 6 Let s = 1063.2200002 - 1063.2. Let v = 31.98 - 32. Let a = s + v. Round a to seven dps. 0.0000002 Let b = -9 - -27. Let j = 18.092 - b. Round j to two dps. 0.09 Suppose -3n = -2n - 23. Suppose 3w = -5v - n, -3w + 0v - 16 = -2v. Let a(z) = 745z*2 + 2z - 8. Let f be a(w). Round f to the nearest one thousand. 27000 Let a = 0.732 - 0.7319057. Round a to five dps. 0.00009 Let p = -115.3387 - -115.4. Let l = -8 + 8.06. Let o = l - p. Round o to four dps. -0.0013 Let a(i) = 3i3 - 3i*2 + 10i + 4. Let l be a(-5). Let h = l + 866. Round h to the nearest 100. 400 Let c = -10737219.9834608115 + 0.0334608115. Let g = 10737119.9500067 + c. Let b = g + 100. Round b to 6 dps. 0.000007 Let r = 115.919 + 0.081. Let k = r - 116.0129. Round k to three decimal places. -0.013 Let u = 0.1 + -0.212. Let p = -0.11303 - u. Round p to 4 decimal places. -0.001 Let x = 3048149 - -8551851. What is x rounded to the nearest one million? 12000000 Let j = -409.96 - -433. Let d = j - -3.16. What is d rounded to zero decimal places? 26 Let r = -0.07 - 0.44. Let b = 0.5121 + r. Round b to 3 decimal places. 0.002 Let l = 93 - -108. Let b be 1 + l39801/1. Suppose -c - 3g + 895558 = -704448, -5c + b = g. Round c to the nearest one million. 2000000 Let y = -34535.001 - -34517. Let f = y - -18.1. Round f to 2 decimal places. 0.1 Let w = 1370.98163 - 1371. Round w to three decimal places. -0.018 Let x = -2151.00000861 + 2151. What is x rounded to five decimal places? -0.00001 Let a = 1.55364 + -1.559. What is a rounded to three dps? -0.005 Suppose 0 = -5z + 2z + 45. Let y be (-112000)/z(1 - 751). What is y rounded to the nearest one million? 6000000 Let p = 0.378 - 0.709. Round p to 2 decimal places. -0.33 Let b = 4368 + -4367.9997523. Round b to 5 decimal places. 0.00025 Let v = 52 - 86. Let t = -18 - v. Let h = t + -16.000032. What is h rounded to five decimal places? -0.00003 Let o = -332.998892 + 333. What is o rounded to 4 dps? 0.0011 Let i(w) = w*2 - 12w + 4. Let s be i(12). Suppose 0 = sl - 2l + 4. Let y be 600/28112000/l. Round y to the nearest 1000000. -1000000 Let u = -300 - -299.999999488. Round u to 7 decimal places. -0.0000005 Let f = -0.045402 - -0.0454. Round f to five decimal places. 0 Let m = 1.6 - 4. Let l = m - -2.4000073. What is l rounded to 6 decimal places? 0.000007 Let s = -376.2 + 331. Let b = -10.4 - s. Round b to the nearest ten. 30 Let d = 17.9 - 20. Let g = d + 2.2. Round g to the nearest integer. 0 Let w(p) = 337p*3 - 7p*2 + 18p - 23. Let k(b) = -506b3 + 10b*2 - 27b + 35. Let u(y) = -5k(y) - 8w(y). Let o be u(9). Round o to the nearest 10000. -120000 Let v = -0.24 + -2.16. Let u = v + 2.71. Let b = u + -0.17. What is b rounded to 2 decimal places? 0.14 Let x = -23.1 - -23.09999662. Round x to six decimal places. -0.000003 Let t = -82.1 + 4.1. Let r = -2587 + 2664.14. Let f = r + t. What is f rounded to 1 decimal place? -0.9 Let c(p) = 1722p2 - 2p + 8. Let l = -72 + 75. Let q be c(l). Round q to the nearest 1000. 16000 Let u = -4.16 - -4.2. Let k = 0.03928 - u. Round k to five decimal places. -0.00072 Suppose -2m + 4445887 = -888113. Round m to the nearest one hundred thousand. 2700000 Let x = 1.602787 + -1.601. What is x rounded to 4 decimal places? 0.0018 Let f(c) = c2 - 10c + 2. Let b be f(10). Let w = b + 16. Suppose 0 = 5m + 15, 0m - w = 3*u - m. Round u to the nearest integer. -7 Let o = 6402 - -28204. Let h = o - -53394. What is h rounded to the nearest 10000? 90000 Let s = 337.00079 +	{ "pile_set_name": "DM Mathematics" }
is the nearest to 6 in n, -4, 0.3? 0.3 Suppose -8z = -10z + 24. Suppose -4r + z = 0, 0 = 5p - 0p - 3r + 19. Which is the closest to -1? (a) 1/7 (b) p (c) 0.4 (d) 3/11 b Let t = 25 - 17. Let v be (t/(-14))/(-4 + (-162)/(-42)). Let z = 0.18 - 0.18. What is the nearest to z in -0.2, v, -0.3? -0.2 Let z(t) = t*3 - 63t*2 + 114t + 485. Let w be z(61). What is the closest to -3 in 2, w, 2/11, 4? w Let w be (-2)/2 - 8/(-6). Let l = -6197 + 6200. Let u = 0.15 - -0.15. What is the nearest to w in u, l, -5? u Let r = 1.94 + 75.06. Let b = -81 + r. Let d = -0.2 - 0.8. What is the closest to d in b, -5, -0.5? -0.5 Let v = 0.9 - -0.1. Let t = -2.4 + 0.2. Let w = t + 2.5. Which is the closest to -5? (a) v (b) -0.5 (c) w b Let z = -119.4 - -77.4. What is the closest to -2 in z, -2/15, 3/2? -2/15 Let j be (-56)/168(0 + 3). Let g = 0.2 + 0.4. What is the closest to 2/7 in 3, j, g? g Let v = 104.3 + -99. Let j = v - -6.7. Which is the nearest to j? (a) 4 (b) -2/11 (c) -0.1 a Let a be (-22)/(-176) - (-78)/(-240). What is the nearest to -1 in 3, 1/5, 0.5, a? a Let d = 1.86 + 7.14. Let x = -98 + 94. Which is the closest to d? (a) x (b) 2 (c) 0.2 b Let n = 98.2 - 97.2. Which is the closest to 0.7? (a) n (b) -3 (c) 0.2 a Let s be 8/(-36)(-2)/4. Let b = s - 0. Let j be (-1 + (-2)/(-4))-2. What is the nearest to j in -2/11, 0.4, b? 0.4 Let m be 1159/2945 - 2/10 - 0. Let t = m + -116/279. Let o = 10 + -14. Which is the closest to -2/39? (a) o (b) 0.2 (c) t c Let a = 76 + -14. Let v = 1870 + -1937. Let m = a + v. What is the closest to 1/4 in -0.06, m, 0? 0 Let q = 75.505 - 75.905. Let k = -18 - -35/2. Which is the nearest to k? (a) q (b) -4 (c) -5 a Let m = 22300 - 22300. What is the nearest to -2 in 2/7, 5, m, 17? m Let x be ((-155)/(-62))/((-2)/(-4)). Let t = 0.1968 - -0.0032. Which is the nearest to t? (a) 0.6 (b) x (c) -5 a Let j = -6.831 - -2.831. Which is the closest to -1? (a) -0.2 (b) 5 (c) j (d) 19 a Let l = -5.06 + 0.06. Let s = 9129 - 9131. Let g be -2 + 22/363. What is the nearest to 0 in g, s, l? g Let a = -84977 + 594836/7. Let r = -3.4 - -3. What is the nearest to r in a, 0, 1? a Let w = -1.455 - -1.6. Let k = 5.855 + w. Which is the nearest to 0.1? (a) k (b) 1/2 (c) 5 b Let x be (-67 + 66)/(154/16) + (-6)/33. What is the closest to x in -1, -37, 4? -1 Let g = -1691 + 997. Let t = g + 694. Let q = -0.11 - 3.89. Which is the nearest to 2? (a) q (b) t (c) 0.2 c Suppose -4h + 7s - 4s + 38 = 0, 0 = -5h + 5s + 45. What is the closest to 0 in -2/13, 0.06, h? 0.06 Let v = -2.93 - -5.93. Let h = -7 + 6.9. Which is the nearest to h? (a) 7 (b) -2/3 (c) v b Let k(i) = 7i*3 - 7i*2 + i + 3. Let z be k(2). Let n be z/(-10) + -1(-12)/15. Which is the nearest to 1/3? (a) n (b) 0.3 (c) -0.5 (d) -0.1 b Let p be (4/(-26))/(-1) - (-252)/(-2821). Which is the nearest to p? (a) 0.3 (b) -4 (c) 2.3 a Suppose -164 = 16o - 52. Let t = o - -41. Let x be -1 + 1 + 4/t. What is the nearest to -0.05 in x, -0.5, 0? 0 Let w = 0.33 - 0.03. Let t = 21 - 18.33. Let g = t - 4.67. What is the nearest to g in 0.4, w, 4? w Let m = 17.1 + -17. Let q = 119 + -359/3. Let x = 0.34 - -0.06. What is the closest to q in 2/17, x, m? m Let f = 379 - 905. Let h = -525.7 - f. What is the closest to 10 in h, 2, -1, 0? 2 Let v = -488 + 487.71. Let q = 0.51 + -0.22. Let w = v + q. What is the nearest to w in 0, -1, 1/9? 0 Let d = 9676 - 9676.17. What is the closest to -4/3 in d, 0.3, -1/4? -1/4 Suppose -5t - 255 = -3n - n, 4n = -5t + 265. Let r = -57 + n. Suppose 24q - 20q + r = 0. Which is the closest to q? (a) -1/3 (b) -2 (c) -15 b Let r be 1478/(-12) - (-805)/690. What is the nearest to 0.1 in 8, r, -2? -2 Let x = 217.9 + -217.6. Let h = -236 + 143. What is the closest to 1 in -5, h, 0.5, x? 0.5 Let v = -6487 + 51899/8. Which is the closest to 0? (a) 4/7 (b) v (c) -0.1 (d) 4 c Let t = -59.92 - 490.98. Let z = t - -551. Which is the nearest to -0.9? (a) z (b) -1 (c) 3 (d) -0.4 b Let m be -1 + (-454)/(-57) + -7. Let x = 78 + -78.4. Which is the nearest to 1? (a) 0.4 (b) m (c) x a Let f = 0.1 - -0.1. Let x be (-20290)/(-47180) + 21/(-49). Let r = 683/6066 - x. What is the closest to -1 in r, -1, f? -1 Let s = -1 + 1. Let r = -89553.5 - -89554. Let l = -0.07 + -2.93. What is the nearest to s in -2, l, r? r Let m be (-20)/(-21) - (-2)/(-7). Let r = 13465 + -13465. Which is the nearest to 1? (a) r (b) -0.03 (c) m c Let b = -1.6 - -1.5. Let a = 1.9 - b. Let c be 30/(-16) + 34/17. What is the closest to -3 in a, -3, c? -3 Let u = -64.8 - -64.96. Suppose 0 = 5f + 5k - 9k + 5, -2f - 2 = k. Which is the closest to f? (a) u (b) -5 (c) -2 c Let z(h) = h3 + 65h*2 + 355h + 64. Let p be z(-59). Let x = 421.7 + -423. Let t = 0 - 1. Which is the closest to -1? (a) t (b) x (c) p a Let r be (-2)/(-9) + ((-220797)/(-405) - -4). Let w = -549 + r. Which is the closest to -0.1? (a) -4 (b) 2/3 (c) 2 (d) w d Let f be -1 + (-2 + 2 - 4(-7)/20). Which is the nearest to -1/4? (a) -2 (b) f (c) -6 b Suppose 4 = -2l - 2. Let j = -0.498 - -2.508. Let u = 1.91 - j. What is the nearest to u in -4, l, 1? 1 Let q = 149/60 - -1/60. Which is the closest to 1? (a) q (b) -4/5 (c) -0.4 (d) 1/4 d Let h be -21/5-1. Suppose 15 = -5n - 4t, n - 9 + 28 = -4t. Let s be (n - -1) + (8 - 6). Which is the closest to h? (a) 12 (b) 0.1 (c) s b Let p = -0.27086 - 0.02914. Let n = -3 - -2.8. Which is the nearest to -1/3? (a) 0.04 (b) -0.4 (c) p (d) n c Let o = 5538.2 + -5538. What is the closest to 4 in -0.15, -1/6, -0.4, o? o Let h be (-33)/(-3) - 4819/427. Let l = -0.6 + -0.4. Let j = 0.2 - l. Which is the nearest to 1/4? (a) j (b) h (c) -4 b Let a = -3.24 - -209.24. Let p = a - 209. Let b be 6/(-15) - (-12)/5. What is the nearest to 0 in 0.1, p, b? 0.1 Let r = -32 + 47. Let i = 1439.8 - 1455. Let j = r + i. Which is the closest to 13? (a) 0 (b) -1/2 (c) j a Let t = -0.34 - -27.34. Let f = 564.9 - 592. Let d = f + t. Which is the closest to 1? (a) -0.5 (b) -2/3 (c) d c Let f = 5005/9 - 557. Let r = f - -13/45. Let g = 16 + -12. What is the closest to r in -0.1, 1/7, g? -0.1 Let y = 62 + -15. Let j = 595 + -548.5. Let l = j - y. Which is the nearest to 1/2? (a) 0 (b) l (c) -5 a Let f be (-14)/4 + 6 + -15 + 12. What is the nearest to f in 4/7, -37, -17? 4/7 Let m = 0.3 - 0.4. Let n = -28/55 + 9/22. Let a = n + -13/70. What is the closest to -3 in m, a, 1/7? a Let h be (-4)/3 + -3 + 930/198. Let f = -759 - -757. Which is the closest to f? (a) h (b) 3 (c) 1 a Suppose 66 = c - 4c. Let p = -28 - c. Let h = 2.9 - 3. What is the closest to -1 in -2, p, h? h Let o = -27 - -80/3. Let v be 2 - (2 + (-1)/9). Let g = 1.80591 - 4.80591. Which is the closest to g? (a) v (b) o (c) 0.04 b Suppose -18h = -21h + 21. Suppose 0 = -hq + 13q. Let l be ((9/2)/3)/(q + -6). Which is the nearest to -1/4? (a) -1 (b) -5 (c) l c Let p be 16/33 + 414/88. Let u = 17.07 - 17. Let b = -0.23 - u. What is the closest to b in p, 5, 4? p Let w = -341 + 151. Let j = w - -167. Let h = -0.5 + -4.5. Which is the closest to 0.1? (a) h (b) 2 (c) j b Let d = -97 - -95. Let c be d/428/(-63). What is the nearest to -5 in -0.01, 1/5, c? -0.01 Let d = 40 + -198/5. Let t = 1112933 + -1112932.9. Which is the nearest to d? (a) -69 (b) 0.4 (c) t b Let q = 5.4 + -6. Let w = 1.2 - -13.5. Let h = 9.7 - w. What is the nearest to -1 in q, h, -0.1? q Let u = -22904 - -22899. Which is the nearest to 1? (a) 0 (b) -88 (c) u (d) 2/9 d Let d be (3 + -5 + -2)(696/(-144))/(-29). Which is the nearest to -1? (a) d (b) 3.6 (c) -0.24 a Let q = 0.21 + -0.11. Let h = -574306/21 - -27348. What is the nearest to q in 4.8, 0, h? h Let x be (2/(-4))/((-4)/8). Suppose 408q = 409q - x. Which is the nearest to -2? (a) q (b) -1/7 (c) 6 b Suppose -56 = -8o + 16. Let t(b) = -ob*2 - 4b*2 + 12b*2 - 40 + 19b. Let m be t(16). What is the nearest to 1/4 in 2/9, m, 0.2? 2/9 Suppose 73m = 75m + 4, -2m - 30 = 2s. Let d = -17 - -35/2. What is the closest to d in s, 1, -1/4? 1 Let b = -3619 - -3632. What is the closest to -72 in 1/4, b, 0? 0 Let v = -7.33 + 10.33. Which is the closest to v? (a) -0.4 (b) -1 (c) 3 (d) 1/8 c Let m = 577.209 + -0.209. Let	{ "pile_set_name": "DM Mathematics" }
t replacement from oorooororroro. Give prob of picking 4 r. 1/143 Three letters picked without replacement from nvnvvvesnxevvnvvvv. Give prob of picking 3 n. 1/204 What is prob of picking 2 q when two letters picked without replacement from qqqrmmi? 1/7 What is prob of picking 1 h and 2 f when three letters picked without replacement from {h: 1, s: 4, f: 3, c: 2}? 1/40 Four letters picked without replacement from hcchchwwh. Give prob of picking 4 h. 1/126 What is prob of picking 3 r when three letters picked without replacement from {r: 11, o: 1}? 3/4 What is prob of picking 1 a and 1 l when two letters picked without replacement from {a: 1, l: 12}? 2/13 What is prob of picking 2 m when two letters picked without replacement from {a: 4, x: 7, m: 6, q: 1}? 5/51 What is prob of picking 2 y when two letters picked without replacement from yjyjyyjyjyjjj? 5/26 Calculate prob of picking 1 x and 2 f when three letters picked without replacement from ffjnfxdnfdnj. 3/110 Calculate prob of picking 1 y and 1 x when two letters picked without replacement from {y: 1, x: 5, w: 5, z: 2, b: 5, g: 1}. 5/171 Three letters picked without replacement from {x: 2, t: 3, y: 4, o: 1}. Give prob of picking 1 y and 2 t. 1/10 Calculate prob of picking 1 g and 1 s when two letters picked without replacement from {g: 2, s: 2}. 2/3 Calculate prob of picking 3 s when three letters picked without replacement from svssssssssss. 3/4 Calculate prob of picking 2 m when two letters picked without replacement from rmrmrrrmrmrrrmrrrr. 10/153 What is prob of picking 1 d and 1 o when two letters picked without replacement from dvzozcvo? 1/14 Two letters picked without replacement from aaaf. What is prob of picking 2 a? 1/2 Calculate prob of picking 1 p, 1 o, and 2 z when four letters picked without replacement from zppommpzzmgpppzpoozp. 16/323 What is prob of picking 1 t and 1 f when two letters picked without replacement from {d: 2, t: 1, f: 2}? 1/5 What is prob of picking 4 c when four letters picked without replacement from tcxxtctttxtttxctcct? 5/3876 What is prob of picking 3 p when three letters picked without replacement from pgppgppgpggg? 1/11 Two letters picked without replacement from ozoozooszzzzozz. What is prob of picking 1 z and 1 o? 16/35 What is prob of picking 1 i, 1 k, and 1 c when three letters picked without replacement from {i: 2, k: 1, c: 1}? 1/2 Two letters picked without replacement from gkgbpgbbughg. Give prob of picking 1 p and 1 u. 1/66 What is prob of picking 1 x and 2 i when three letters picked without replacement from {x: 3, h: 5, i: 5}? 15/143 What is prob of picking 1 h and 2 l when three letters picked without replacement from lhnl? 1/4 Calculate prob of picking 2 g when two letters picked without replacement from {k: 1, w: 11, g: 2}. 1/91 Two letters picked without replacement from yereyyryyyy. Give prob of picking 2 e. 1/55 Calculate prob of picking 1 u and 2 k when three letters picked without replacement from luluulluluklukuluuuu. 11/1140 Calculate prob of picking 1 d and 1 o when two letters picked without replacement from hddyvoha. 1/14 Calculate prob of picking 2 y when two letters picked without replacement from vcwvaavayy. 1/45 Calculate prob of picking 1 v and 1 o when two letters picked without replacement from ovov. 2/3 What is prob of picking 1 o and 3 t when four letters picked without replacement from {t: 9, o: 1, q: 3, v: 1}? 12/143 Calculate prob of picking 1 c and 1 v when two letters picked without replacement from ccnnnccvncn. 1/11 Two letters picked without replacement from ubcccbucubbc. Give prob of picking 2 c. 5/33 What is prob of picking 1 e, 1 k, and 1 w when three letters picked without replacement from wwwwwkwkewe? 28/165 What is prob of picking 2 f and 1 e when three letters picked without replacement from {f: 2, e: 5}? 1/7 Four letters picked without replacement from {t: 4, g: 15}. What is prob of picking 3 g and 1 t? 455/969 Four letters picked without replacement from {n: 7, m: 12}. What is prob of picking 4 n? 35/3876 What is prob of picking 2 h and 1 m when three letters picked without replacement from {h: 1, m: 1, p: 2, n: 1}? 0 Calculate prob of picking 1 r and 1 l when two letters picked without replacement from {r: 1, c: 4, l: 2, b: 4}. 2/55 Four letters picked without replacement from yyyyuyyuyuyuuy. What is prob of picking 2 y and 2 u? 360/1001 Three letters picked without replacement from {d: 2, n: 1, f: 4, z: 1}. Give prob of picking 1 z and 2 f. 3/28 Calculate prob of picking 1 i and 2 j when three letters picked without replacement from {y: 2, i: 4, j: 9, s: 1}. 9/35 Three letters picked without replacement from mmmmmmmmmmmmmmmmrmm. Give prob of picking 3 m. 16/19 Four letters picked without replacement from ebbbbjbbbbbebb. Give prob of picking 2 b and 2 e. 5/91 Calculate prob of picking 2 c when two letters picked without replacement from {c: 4}. 1 What is prob of picking 1 c, 1 a, and 1 f when three letters picked without replacement from clfiaii? 1/35 What is prob of picking 1 x, 1 k, and 2 q when four letters picked without replacement from xqnxqxqkxkh? 4/55 Four letters picked without replacement from uuuuuuucuuc. What is prob of picking 1 c and 3 u? 28/55 Calculate prob of picking 3 l and 1 j when four letters picked without replacement from lljlj. 2/5 Three letters picked without replacement from {i: 6, n: 8, p: 3, e: 2}. Give prob of picking 2 e and 1 i. 2/323 Two letters picked without replacement from {p: 2, b: 1, r: 5, e: 2, q: 5, y: 2}. Give prob of picking 1 r and 1 q. 25/136 Calculate prob of picking 2 c, 1 z, and 1 a when four letters picked without replacement from xxznxccnnxa. 1/330 Three letters picked without replacement from {o: 2, s: 4, y: 7, k: 1}. What is prob of picking 2 s and 1 k? 3/182 What is prob of picking 2 h when two letters picked without replacement from {d: 1, i: 3, o: 4, g: 1, h: 2}? 1/55 Four letters picked without replacement from {p: 7, x: 7}. What is prob of picking 4 x? 5/143 Calculate prob of picking 1 f and 1 d when two letters picked without replacement from {d: 2, f: 1, t: 1, m: 1}. 1/5 Two letters picked without replacement from {w: 4}. Give prob of picking 2 w. 1 Calculate prob of picking 3 v and 1 j when four letters picked without replacement from jjvjjjjvjjvjvj. 40/1001 Four letters picked without replacement from {z: 4, x: 10}. Give prob of picking 1 z and 3 x. 480/1001 Calculate prob of picking 1 w, 2 i, and 1 x when four letters picked without replacement from {w: 7, v: 4, x: 1, i: 2, e: 4}. 7/3060 Calculate prob of picking 1 m and 1 p when two letters picked without replacement from mmmpmmmmppmmpmmmmmmm. 32/95 Four letters picked without replacement from adayyxlx. Give prob of picking 2 y, 1 d, and 1 a. 1/35 Two letters picked without replacement from {a: 2, q: 3, g: 2, r: 5}. Give prob of picking 2 g. 1/66 Calculate prob of picking 2 q and 2 z when four letters picked without replacement from {q: 4, z: 7}. 21/55 Two letters picked without replacement from {z: 1, m: 1, s: 2, r: 3}. Give prob of picking 2 r. 1/7 What is prob of picking 2 c and 2 e when four letters picked without replacement from {e: 3, c: 2, n: 13}? 1/1020 Calculate prob of picking 2 s and 1 r when three letters picked without replacement from {s: 2, r: 16}. 1/51 Two letters picked without replacement from lllkdlllklldkllllddl. Give prob of picking 1 k and 1 d. 6/95 Two letters picked without replacement from {o: 3, b: 6, y: 2, s: 2}. Give prob of picking 1 s and 1 y. 2/39 Three letters picked without replacement from fxcxrc. What is prob of picking 1 c, 1 f, and 1 x? 1/5 Two letters picked without replacement from qzqqqqqq. Give prob of picking 2 z. 0 Three letters picked without replacement from kkkvvyhhvsvv. What is prob of picking 1 y, 1 k, and 1 v? 3/44 Two letters picked without replacement from jfoof. What is prob of picking 2 o? 1/10 Two letters picked without replacement from {i: 4, n: 1, j: 5, s: 1, u: 3}. What is prob of picking 1 s and 1 u? 3/91 Four letters picked without replacement from qxgqqgxxggq. What is prob of picking 2 q and 2 x? 3/55 Three letters picked without replacement from {j: 1, q: 1, r: 1, m: 1, s: 1}. Give prob of picking 1 r, 1 m, and 1 q. 1/10 Two let	{ "pile_set_name": "DM Mathematics" }
567? p*2 - 890p - 23 What is the n'th term of -2487, -2476, -2465, -2454, -2443? 11n - 2498 What is the b'th term of 3670, 7360, 11054, 14752? 2b*2 + 3684b - 16 What is the a'th term of 280, 779, 1494, 2425? 108a2 + 175a - 3 What is the x'th term of 1193, 1184, 1175, 1166, 1157, 1148? -9x + 1202 What is the h'th term of -2118, -4647, -7958, -12441, -18486, -26483, -36822, -49893? -65h3 - h2 - 2071h + 19 What is the j'th term of -919, -7703, -26115, -61969, -121079, -209259, -332323, -496085? -969j*3 - j + 51 What is the s'th term of -3245, -6273, -9301, -12329? -3028s - 217 What is the q'th term of 222, 437, 652? 215q + 7 What is the k'th term of 115, -120, -507, -1046, -1737, -2580, -3575? -76k*2 - 7k + 198 What is the w'th term of -192753, -192751, -192747, -192741, -192733, -192723, -192711? w*2 - w - 192753 What is the z'th term of 590, 633, 760, 1013, 1434, 2065? 7z*3 - 6z + 589 What is the i'th term of 8804, 17540, 26276, 35012, 43748? 8736i + 68 What is the f'th term of -79803, -79805, -79807? -2f - 79801 What is the v'th term of 20680, 20684, 20686, 20686, 20684, 20680? -v*2 + 7v + 20674 What is the y'th term of 9268, 9236, 9204? -32y + 9300 What is the c'th term of 7636, 15294, 22952? 7658c - 22 What is the d'th term of 847, 568, 103, -548? -93d2 + 940 What is the r'th term of 65, 4, -169, -508, -1067, -1900, -3061, -4604? -9r*3 - 2r*2 + 8r + 68 What is the g'th term of -612, -1224, -1840, -2460? -2g2 - 606g - 4 What is the t'th term of 19194, 38393, 57592, 76791, 95990? 19199t - 5 What is the u'th term of -8485, -16972, -25459, -33946, -42433, -50920? -8487u + 2 What is the c'th term of -246, -682, -1108, -1518, -1906? c3 - c2 - 440c + 194 What is the j'th term of -2972, -5955, -8942, -11933, -14928, -17927? -2j*2 - 2977j + 7 What is the v'th term of 3001, 3204, 3411, 3622, 3837, 4056? 2v2 + 197v + 2802 What is the t'th term of 180, 175, 186, 219, 280? t*3 + 2t*2 - 18t + 195 What is the l'th term of 287, 343, 349, 281, 115, -173, -607, -1211? -4l3 - l2 + 87l + 205 What is the f'th term of -40, -29, -22, -19, -20, -25, -34? -2f2 + 17f - 55 What is the x'th term of -3955, -6691, -9427, -12163, -14899, -17635? -2736x - 1219 What is the f'th term of 142126, 142124, 142122? -2f + 142128 What is the z'th term of 320, 298, 276? -22z + 342 What is the n'th term of -42, -134, -224, -312, -398, -482? n2 - 95n + 52 What is the j'th term of -47, -131, -313, -593? -49j2 + 63j - 61 What is the w'th term of 19, 25, 23, 19, 19, 29, 55, 103? w*3 - 10w*2 + 29w - 1 What is the x'th term of 2291, 2227, 2163, 2099? -64x + 2355 What is the b'th term of 217, 624, 1231, 2038, 3045, 4252, 5659? 100b*2 + 107b + 10 What is the b'th term of 6676, 6671, 6662, 6649, 6632, 6611, 6586? -2b2 + b + 6677 What is the t'th term of 432, 868, 1308, 1752? 2t*2 + 430t What is the l'th term of 125832, 251678, 377538, 503418, 629324, 755262, 881238? l3 + l2 + 125836l - 6 What is the m'th term of -630416, -1260830, -1891244? -630414m - 2 What is the t'th term of -502, -552, -696, -982, -1458? -8t3 + t2 + 3t - 498 What is the k'th term of 112, 109, 110, 121, 148? k*3 - 4k*2 + 2k + 113 What is the d'th term of -197, -117, 105, 541, 1263, 2343, 3853? 12d3 - d2 - d - 207 What is the p'th term of 2655, 10647, 23961, 42591, 66531, 95775? -p3 + 2667p*2 - 2p - 9 What is the j'th term of 157, 101, 7, -119, -271? j*3 - 25j*2 + 12j + 169 What is the m'th term of -368, -920, -1620, -2468? -74m2 - 330m + 36 What is the y'th term of -7701, -15394, -23087, -30780, -38473, -46166? -7693y - 8 What is the h'th term of -4100, -3889, -3678, -3467? 211h - 4311 What is the t'th term of -161, -651, -1469, -2615, -4089, -5891, -8021? -164t2 + 2t + 1 What is the k'th term of 347, 336, 319, 296, 267, 232? -3k2 - 2k + 352 What is the h'th term of 188, 417, 688, 1001, 1356? 21h2 + 166h + 1 What is the j'th term of 596, 651, 742, 869, 1032? 18j2 + j + 577 What is the v'th term of -123, -206, -289, -372, -455, -538? -83v - 40 What is the l'th term of -2403223, -2403224, -2403227, -2403232? -l*2 + 2l - 2403224 What is the r'th term of 139, 270, 413, 574, 759, 974, 1225, 1518? r*3 + 124r + 14 What is the p'th term of -46912, -93848, -140784? -46936p + 24 What is the h'th term of -104, -400, -696? -296h + 192 What is the f'th term of -18991, -19002, -19019, -19042, -19071? -3f2 - 2f - 18986 What is the k'th term of -330, -662, -994, -1326, -1658? -332k + 2 What is the i'th term of 3443, 3390, 3305, 3188, 3039? -16i*2 - 5i + 3464 What is the d'th term of -759, -1388, -2007, -2622, -3239, -3864, -4503? -d*3 + 11d*2 - 655d - 114 What is the j'th term of 36358, 36354, 36348, 36340, 36330, 36318, 36304? -j*2 - j + 36360 What is the c'th term of -66, -356, -646? -290c + 224 What is the j'th term of -97, -125, -11, 317, 931, 1903, 3305? 12j3 - j2 - 109j + 1 What is the y'th term of -308396, -616778, -925160? -308382y - 14 What is the b'th term of -6065, -12128, -18191, -24254, -30317, -36380? -6063b - 2 What is the x'th term of -172, -452, -924, -1594, -2468, -3552, -4852, -6374? -x*3 - 90x*2 - 3x - 78 What is the k'th term of -1835, -2128, -2421? -293k - 1542 What is the v'th term of -568, -2006, -4388, -7714, -11984? -472v*2 - 22v - 74 What is the j'th term of 428, 862, 1306, 1760, 2224, 2698? 5j2 + 419j + 4 What is the f'th term of 56, 62, 72, 86, 104, 126? 2f2 + 54 What is the l'th term of -518337, -2073344, -4665023, -8293374, -12958397? -518336l*2 + l - 2 What is the g'th term of -140160, -280311, -420462? -140151g - 9 What is the w'th term of 1266, 2576, 3886, 5196, 6506? 1310w - 44 What is the m'th term of -2866, -11634, -26240, -46678, -72942? m3 - 2925m*2 + 58 What is the c'th term of 2057, 3560, 5063, 6566? 1503c + 554 What is the j'th term of -3261, -3267, -3275, -3285? -j*2 - 3j - 3257 What is the o'th term of -2587, -10416, -23459, -41710, -65163, -93812, -127651? o*3 - 2613o*2 + 3o + 22 What is the a'th term of -9013, -9021, -9033, -9049, -9069? -2a2 - 2a - 9009 What is the l'th term of 941, 886, 831, 776? -55l + 996 What is the i'th term of -29732, -29725, -29716, -29705, -29692, -29677, -29660? i2 + 4i - 29737 What is the y'th term of -223, -463, -705, -949, -1195, -1443? -y*2 - 237y + 15 What is the c'th term of -35073, -35075, -35093, -35133, -35201, -35303? -c*3 - 2c*2 + 11c - 35081 What is the x'th term of -656540, -656539, -656538, -656537? x - 656541 What is the g'th term of 209, 595, 993, 1409, 1849, 2319, 2825? g*3 + 379g - 171 What is the o'th term of 19583, 19620, 19657, 19694, 19731, 19768? 37o + 19546 What is the k'th term of -2873, -5396, -7919, -10442? -2523k - 350 What is the n'th term of 2452, 9822, 22104, 39298, 61404, 88422? 2456n2 + 2n - 6 What is the q'th term of -218, -696, -1492, -2606, -4038? -159q2 - q - 58 What is the t'th term of 23955, 47821, 71687, 95553? 23866t + 89 What is the b'th term of 2997, 2989, 2973, 2949? -4b2 + 4b + 2997 What is the u'th term of 265, 243, 201, 133, 33, -105, -287? -u*3 - 4u*2 - 3u + 273 What is the y'th term of -27680, -55368, -83056, -110744, -138432, -166120? -27688y + 8 What is the i'th term of 650, 2592, 5822, 10340, 16146? 644i*2 + 10i - 4 What is the g'th term of 15, -47, -335, -963, -2045, -3695, -6027? -19g3 + g2 + 68g - 35 What is the v'th term of 27843, 55691, 83539, 111387? 27848v - 5 What is the c'th term of 6642, 13289, 19936, 26583? 6647c - 5 What is the n'th term of 4480, 4499, 4516, 4531, 4544? -n*2 + 22n + 4459 What is the i'th term of -31727, -31681, -31613, -31517, -31387? i*3 + 5i*2 + 24i - 31757 What is the u'th term of -19, -719, -1887, -3523? -234u2 + 2u + 213 What is the l'th term of 1274, 1691, 2098, 2495, 2882, 3259, 3626? -5l2 + 432l + 847 What is the r'th term of 19258, 77029, 173316, 308119, 481438, 693273, 943624? 19258r2 - 3r + 3 What is the d'th term of -88, -178, -280, -400, -544? -d*3 - 83d - 4 What is the f'th term of 12, 215, 758, 1809, 3536, 6107, 9690, 14453? 28f3 + 2f**2 + f - 19 What is the h'th term of -44048, -44053, -44058?	{ "pile_set_name": "DM Mathematics" }
1.4 + 1101.4. Is 0 bigger than c? False Suppose -2j - 3j = 5r + 130, 0 = 4j - 2r + 104. Suppose -d - 2g = -0d + 15, 12 = -d + g. Let t be 13/j + d/2. Which is smaller: -9 or t? -9 Let w be (3 + (-7 - -4))/(5 - (1 + 3)). Is w >= 18/173? False Let o = -39 + 36.64. Let t = o - 100.64. Let r = 115 + t. Which is bigger: r or 4/5? r Let r = 2669 + -2639. Which is bigger: -0.7 or r? r Let c = -1/56900 + 12695813/28450. Let b = c + -443. Which is greater: b or -1? b Suppose 2u + 2 = h, u + 4 = -5h + 4u. Let p be (51/2(-24)/(-18))/h. Let x = 285/17 + p. Which is smaller: x or -0.1? x Let a be 1 + (4/2 - 3). Let w = -2/2545 - -8597024/17815. Let q = 483 - w. Which is smaller: q or a? a Suppose 0 = -5l + 3i - 1136 + 1235, -2i = -3l + 58. Suppose -3h + 87 = 3w, w - 2h - 17 = 3h. Do w and l have different values? True Suppose 5n = 11k - 6k + 75, 3n = 4k + 44. Let l = n - 17. Is -4/39 greater than l? True Let t be -18 + -38 + 7 + 8. Let f(q) = -2q2 + 3q + 2. Let o be f(-4). Which is smaller: t or o? o Suppose 0 = -3a + a + 4. Let g be a/(-164)24/8. Is g not equal to -1? True Let b(w) = -w*3 - 6w*2 - 3w + 13. Let c be b(-7). Let p = c - 82. Let u be p/(-3) - 779/(-627). Which is smaller: 1 or u? u Let z = 0 - -1. Let x be (3 - 27)/(5 + 20/(-5)). Let d be (-1)/12(x + 14). Which is greater: z or d? z Let d be (-6 - -20)3/126. Is -7306 at least as big as d? False Let u = -3 - -6. Suppose 5h = -ul + 216 - 31, -4h = -5l - 185. Let a be h/15(-10 + 0 + 1). Is -25 > a? False Let g be 12 + -4 + (6 - (15 + -4)). Let p be 30/4(-2)/(-3). Suppose -1 + 4 = -d + t, 11 = -pd + gt. Is d >= -1/5? False Suppose -4j - 15972 = -5c + 2342, -2j = -5c + 18322. Let n = 51285/14 - c. Do n and -4 have the same value? False Let a(j) = -4j - 5. Let c be a(-4). Suppose -cs + 15s - 432 = 0. Suppose 0 = -11x + 17x + s. Which is smaller: -17 or x? x Let i = 4823 - 4717. Is i < 119? True Suppose 0 = -29u + 7101 - 7130. Which is smaller: u or 3953? u Suppose -x - 13b = 283, 4x + 50b = 54b - 1076. Is x at most -276? False Let q be ((-2706)/(-55))/(15/125). Let l = -577 + q. Is l at least 0.1? False Let l be (-2)/(-6) - 2/6. Let z be (-85 - 0) + 4(-3)/(-12). Let k be 0 + (1/17)/(42/z). Which is smaller: l or k? k Let m(k) = -k3 + 3k*2 - 4k - 3. Let a be m(-4). Let p = -8397 - -8521. Is p greater than or equal to a? False Let r = -128931/14 + 9209. Is r != 0.1? True Let l = -668.42 - -667.8. Which is smaller: 73 or l? l Let o(g) = 2g - 33. Let u be o(18). Let n(c) = -21 - 14 + 56c + u - 54c. Let f be n(18). Which is greater: f or 1? f Let t = 2334 - 2333. Is -74 less than t? True Suppose 20476 + 9468 = 19o - 38o. Which is smaller: -1572 or o? o Let j = -829 + 1274. Suppose -4y + j = y. Which is smaller: y or 91? y Let r be -4 - (935/(-10) + 6). Let g = r - 83. Which is smaller: g or 18? g Let r = 7 + -58. Let m = -54 - r. Let f be ((-470)/144 - 0) + 177/472. Is m bigger than f? False Let r = -16.441 + 17.06. Which is greater: 0 or r? r Suppose -16t - 37t - 59 = 6t. Is t less than or equal to 3/2177? True Let y = -59 + 59. Suppose n = -5q + 24, -3q + yq + 13 = 2n. Let b be 155/20 - n/4. Do b and 9 have the same value? False Let j(u) = -u2 - 15u - 34. Let x be j(-8). Suppose xl + 17 = 21l + 3c, 2l - 4c + 40 = 0. Is l < 1/3? True Let l = -22912 + 22874. Is -106 greater than l? False Suppose 331 = 3h + 313, 0 = -l - 3h - 7. Which is bigger: -243/10 or l? -243/10 Suppose -18 = 5n - 18. Suppose n = -3h + h. Suppose 4 = i - 4f - h, 5f = -i - 5. Is 0.01 greater than i? True Let z = 15580 - 171575/11. Let t be 69/276 + (1 - (-4183)/(-220)). Let v = z - t. Which is bigger: v or -1? v Let o(w) be the second derivative of w5/20 + 3w*4/4 + 3w3/2 - w2/2 + 28w. Let p be o(-8). Let i(d) = -2d + 19. Let a be i(p). Is 38 <= a? False Let m(y) = 5y - 35. Let h(n) = -3n + 18. Let r(i) = 5h(i) + 2m(i). Let b be r(3). Suppose -p + 2c = -8, 3p - 2c - b = 3. Is p != 1/45? True Let v(c) = -4c + 198. Let f be v(46). Which is greater: 134 or f? 134 Let x(b) = 3b + 7. Let f be x(5). Let r be f + (0 - 0)/(-1). Let g be (6/3 - (-2 + 16 - -11))/(-1). Which is smaller: r or g? r Suppose 3v + 0v = 54. Let z = v + -8. Let h be 76/z + (-15)/25. Is h greater than or equal to 6? True Let v = -12407 + 8211. Which is greater: -8389/2 or v? -8389/2 Let g(d) = 4d*2 - 5d - 1. Let r be g(4). Suppose z - r + 18 = t, 0 = -4z - 3t + 79. Let c = -167163 - -167185. Is z <= c? True Let q = -2.375 + 2.375. Which is greater: q or 863/12? 863/12 Let q be (-27)/1262/(-3). Let v = q - 46. Let f = -1.7 + 4.7. Is v less than or equal to f? True Suppose -4 = -j - 0j. Suppose 2x = -0x, -jb + 88 = -3x. Let u be 322/77 + -4 - 26/b. Which is smaller: 1/25 or u? u Let o be (-2)/1929/(-6). Let l(g) = 140g + 6860. Let v be l(-49). Which is bigger: v or o? o Let m = -2096/19 - -59644/551. Which is bigger: m or -3? m Let i = -7.108 - 0.092. Let t = i - 2.8. Let r = -10 + 11. Which is smaller: r or t? t Let k(l) = 2l2 - 5l - 4l - 6 - 3l - 37 - 6l. Let y be k(11). Which is greater: -1/52 or y? y Let x = 11316 - 11315. Which is bigger: -1.1507 or x? x Suppose -21z = -3z + 36. Let y be (-408)/170z/(-20). Which is smaller: y or 1? y Let j = 1.045 + -53.325. Let g = j + 0.28. Let m = g + 52. Which is bigger: m or -58? m Let k = -465/91 + 54807/12649. Which is greater: -2/9 or k? -2/9 Let c(r) = -6r3 + 3r*2 - 2r - 2. Let u be c(-1). Let s be (-10)/(-15) - (-10)/3. Suppose 0 = sy - y - 15. Is u < y? False Let o = -2/2557 + 202009/7671. Are 27 and o equal? False Let c = 7963367/128590 - 867/14. Which is smaller: 0 or c? c Suppose 4l + 20 = 0, 13l - 8l = -2j + 55. Are j and 784/19 equal? False Suppose 6 = 9t - 6t. Suppose n = -3m + 682, tm + 5n - 307 = 139. Suppose m = -5y + 3. Is y equal to -1/2? False Let s(b) = 460b*2 - 9b + 9. Let f be s(1). Let i be (-353)/f - 11/(-132)9. Suppose 0 = -5t - 2z + 9, -4 + 13 = 3t + 3z. Which is greater: t or i? t Let g(m) = m2 + 56m + 404. Let a be g(-34). Is -342 at most a? False Let x(d) = 24d + 55. Let r(v) = -26v - 54. Let i(z) = 6r(z) + 7x(z). Let g be i(-5). Is 1/29 <= g? True Let u(x) = 3x2 - 2x + 1. Let c be u(1). Suppose co = 3h - 75, 5o = 12 + 3. Let g = h + -41. Is g != -16? True Let f = -2173.44 - -2173. Do -11 and f have different values? True Let k be (-3)/2120/(-15). Suppose -7s - 9s + 176 = 0. Which is greater: k or s? s Let v = -63 + 45. Let h be -5 - ((-68)/(-5) + 2/5). Is v smaller than h? False Let s(p) = -p2 + 5p + 3. Let b be s(4). Let u be (b/((-2632)/(-6)))/(3/96). Which is smaller: u or 0? 0 Let b = 1032158252 - 189917893189/184. Let t = 4211 + b. Which is smaller: 1 or t? t Let b(o) = -o + 4. Let f = 167 + -131. Suppose -28d + 48 = -fd. Let s be b(d). Which is greater: s or 12? 12 Suppose -5v + 4n + 6543 = 489, 4v - 4842 = 3n. Is v <= 1205? False Let y(q) = q*2 + 6q - 3. Let g be y(3). Let v be (g/(-18) - 30/(-9)) + -1. Is 2/53 not equal to v? True Let j be ((-54)/(-1431))/((-6)/(-429)). Which is bigger: 3 or j? 3 Let r be 7387/1079 - (-4)/26 - 7. Is r at least as big as 1/29523? False Let j(m) = m*3 - 12m*2 + 16m - 58. Let k = -411 - -422. Let h be j(k). Is -1.8 != h? True Suppose -2y + y - 20 = 2b, 0 = -4y - 5b - 65. Let f(l) = 3l2 + 91l + 16. Let j be f(-30). Which is smaller: j or y? j Let p = 162.93 - 163. Let t be ((-35)/(-21) + -3)-2. Which is smaller: p or t? p Let d(l) = 64l*3 - 11l*2 + 22l - 10. Let c be d(2). Which is smaller: c or -2? -2 Suppose 0 = 2x + 73 - 31. Let u be x/(-42) - (-374)/36. Which is greater: u or 10? u Let w = 303 - 302. Let s = 4 + -8. Let r be s/(2 - w)-1. Is 4 less than r? False Let a(s) = s*2 + 8s - 3. Let m be a(7). Let t be (0 + 1)m7/14. Which is bigger: t or 50? t Let j = 694/205 - 24/41. Let s be (-176)/(-220) + 16/5. Is s at most as big as j? False Suppose 4l = 2l - 14l. Let n(y) = -2y*2 + 3y - 3. Let p be n(2). Which is smaller: l or p? p Let v = 1 - 2. Suppose -2t + 4y + 16 = -y, 4t = -y - 12. Let f be ((-51)/11067)/(-1t/(-4)). Which is smaller: v or f? v Suppose 20i + 8i = 28. Let p = 908 + -107145/118. Is p less than or equal to i? True Let	{ "pile_set_name": "DM Mathematics" }
b of sequence ava when three letters picked without replacement from ava. 1/3 Calculate prob of sequence mm when two letters picked without replacement from {m: 6, s: 2}. 15/28 What is prob of sequence scs when three letters picked without replacement from ccszszsczccszzcccs? 5/153 What is prob of sequence uxux when four letters picked without replacement from xxxuxuxxx? 1/36 Two letters picked without replacement from {s: 5, t: 1, p: 2, n: 5, j: 1, k: 1}. What is prob of sequence js? 1/42 Calculate prob of sequence wqwc when four letters picked without replacement from {w: 2, c: 13, q: 3}. 13/12240 Calculate prob of sequence zc when two letters picked without replacement from {w: 3, c: 3, f: 5, z: 2, e: 2}. 1/35 Calculate prob of sequence zry when three letters picked without replacement from {r: 10, w: 1, y: 1, z: 2, h: 3}. 1/204 Two letters picked without replacement from gqekkeeeekgggkq. What is prob of sequence kg? 8/105 Three letters picked without replacement from ppbzbhbpzzpkpbp. Give prob of sequence zhp. 3/455 Two letters picked without replacement from oooooolooookkol. Give prob of sequence lo. 11/105 Calculate prob of sequence pcpc when four letters picked without replacement from {p: 5, c: 7}. 7/99 Calculate prob of sequence je when two letters picked without replacement from {j: 6, h: 4, l: 2, e: 1}. 1/26 Calculate prob of sequence igp when three letters picked without replacement from {p: 5, g: 4, e: 1, i: 1}. 2/99 What is prob of sequence ss when two letters picked without replacement from {f: 2, x: 2, s: 7}? 21/55 Calculate prob of sequence fff when three letters picked without replacement from dddfdddddddddddffd. 1/816 What is prob of sequence yyy when three letters picked without replacement from iyfaqfyqafahfhyh? 1/560 Two letters picked without replacement from {d: 1, r: 5, c: 1, i: 2, v: 3}. Give prob of sequence di. 1/66 What is prob of sequence zyhy when four letters picked without replacement from yzyzzzzzyhzhyz? 8/1001 Four letters picked without replacement from mlllbmllblcblllbmc. Give prob of sequence lcmm. 1/680 Calculate prob of sequence iav when three letters picked without replacement from uuhuaauivahahhah. 1/672 Calculate prob of sequence fj when two letters picked without replacement from lhqjhhhlhqjcf. 1/78 Three letters picked without replacement from {u: 3, l: 1, s: 2, t: 4, h: 1}. Give prob of sequence tht. 2/165 Calculate prob of sequence eyfp when four letters picked without replacement from {f: 3, l: 1, y: 2, p: 2, e: 1, g: 3}. 1/990 Four letters picked without replacement from ggggomgmm. Give prob of sequence mgmm. 5/504 Three letters picked without replacement from {m: 1, n: 8, b: 6}. Give prob of sequence bmn. 8/455 Two letters picked without replacement from uliiliuhihhuuhuqu. Give prob of sequence qu. 3/136 What is prob of sequence ps when two letters picked without replacement from ssppp? 3/10 What is prob of sequence hv when two letters picked without replacement from {h: 2, v: 2}? 1/3 Calculate prob of sequence oo when two letters picked without replacement from ommommm. 1/21 Two letters picked without replacement from {t: 3, b: 1, s: 1, g: 1, x: 1, d: 5}. What is prob of sequence db? 5/132 Four letters picked without replacement from saos. What is prob of sequence saso? 1/12 What is prob of sequence pnn when three letters picked without replacement from nnpnpn? 1/5 Three letters picked without replacement from ggggmgmggmmmgggg. Give prob of sequence mgg. 55/336 Three letters picked without replacement from {k: 1, w: 2, m: 9, r: 7}. Give prob of sequence mrm. 28/323 Calculate prob of sequence oitt when four letters picked without replacement from {o: 8, i: 1, t: 9, c: 2}. 8/1615 Two letters picked without replacement from vvvyyyyvyy. Give prob of sequence yv. 4/15 Three letters picked without replacement from ysfsybjfi. Give prob of sequence yss. 1/126 What is prob of sequence ykfi when four letters picked without replacement from {f: 1, y: 1, i: 3, s: 1, k: 1}? 1/280 What is prob of sequence jjjj when four letters picked without replacement from jjjjjjjjj? 1 Four letters picked without replacement from {a: 5, o: 4, p: 1, h: 3, y: 1, c: 4}. What is prob of sequence hcyc? 1/2040 What is prob of sequence xur when three letters picked without replacement from rxuux? 1/15 Two letters picked without replacement from {d: 4, w: 1, c: 1, x: 5, u: 5}. What is prob of sequence ux? 5/48 Two letters picked without replacement from tjgcptg. What is prob of sequence gt? 2/21 What is prob of sequence uru when three letters picked without replacement from uuururrruuru? 7/44 What is prob of sequence wuue when four letters picked without replacement from {l: 4, u: 3, w: 2, e: 6}? 1/455 Calculate prob of sequence ww when two letters picked without replacement from exxxewx. 0 Four letters picked without replacement from ftdfgaddtdftd. What is prob of sequence tgat? 1/2860 Three letters picked without replacement from {q: 4, h: 2, x: 4}. What is prob of sequence qxq? 1/15 Calculate prob of sequence tb when two letters picked without replacement from {o: 2, l: 2, t: 1, b: 1}. 1/30 Calculate prob of sequence mhz when three letters picked without replacement from zmnhmnv. 1/105 Calculate prob of sequence kks when three letters picked without replacement from ssussskuusususksssss. 13/3420 Calculate prob of sequence ye when two letters picked without replacement from shmhmhyhyhsyyen. 2/105 Calculate prob of sequence dq when two letters picked without replacement from {e: 1, i: 5, d: 2, o: 1, q: 2, v: 5}. 1/60 Four letters picked without replacement from xjjxhqxxjqqjjqqjhj. Give prob of sequence hqhq. 1/1836 What is prob of sequence lllu when four letters picked without replacement from lllluu? 2/15 What is prob of sequence qwoq when four letters picked without replacement from {o: 1, b: 6, y: 2, v: 1, w: 2, q: 7}? 7/7752 Four letters picked without replacement from ddwwwrdrdrrwrwdrrwd. What is prob of sequence ddwr? 35/2584 Two letters picked without replacement from iriflrxsifxs. Give prob of sequence xl. 1/66 What is prob of sequence dr when two letters picked without replacement from {v: 1, d: 1, w: 1, r: 1, g: 1}? 1/20 Calculate prob of sequence eddn when four letters picked without replacement from deeddneleed. 1/132 Calculate prob of sequence ww when two letters picked without replacement from {n: 1, w: 2}. 1/3 What is prob of sequence nh when two letters picked without replacement from {h: 2, z: 1, n: 2, f: 1, t: 1}? 2/21 Three letters picked without replacement from mbbbbmbmbmmm. Give prob of sequence bmb. 3/22 Calculate prob of sequence qjwq when four letters picked without replacement from {q: 2, y: 2, j: 7, w: 1}. 7/5940 Four letters picked without replacement from nxnjnnxjjp. What is prob of sequence pjxx? 1/840 Three letters picked without replacement from {z: 3, o: 3, r: 1, s: 1, y: 3}. What is prob of sequence yso? 1/110 Two letters picked without replacement from {u: 2, t: 1, i: 3, c: 1, e: 5}. Give prob of sequence tc. 1/132 What is prob of sequence lc when two letters picked without replacement from {j: 7, l: 1, f: 4, r: 3, c: 1}? 1/240 Two letters picked without replacement from {v: 4, p: 7}. Give prob of sequence vv. 6/55 Three letters picked without replacement from zbiibizzbvi. What is prob of sequence ivb? 2/165 Three letters picked without replacement from {b: 2, y: 2, q: 2, l: 1, h: 3, u: 4}. What is prob of sequence hbu? 1/91 Three letters picked without replacement from {p: 3, j: 7, s: 3, m: 2, u: 3, q: 1}. Give prob of sequence mpu. 1/323 What is prob of sequence ka when two letters picked without replacement from {n: 4, k: 2, o: 3, a: 1}? 1/45 Two letters picked without replacement from {i: 1, v: 5, u: 7}. What is prob of sequence vi? 5/156 Calculate prob of sequence bv when two letters picked without replacement from vmmtmbmvmmmmmv. 3/182 Two letters picked without replacement from {j: 8, r: 1, a: 2, w: 4}. Give prob of sequence jr. 4/105 Four letters picked without replacement from qddvqbqqbbqc. What is prob of sequence dqvc? 1/1188 Four letters picked without replacement from {e: 1, t: 1, r: 3, z: 5, u: 6, g: 1}. Give prob of sequence tgue. 1/9520 What is prob of sequence nx when two	{ "pile_set_name": "DM Mathematics" }
et c = 0.5 - 0.8. Let a = c - -0.1. What is the biggest value in -0.4, -0.05, a? -0.05 Let a = -0.24 - -0.74. What is the third smallest value in 0.4, a, 3/5? 3/5 Let z = -11.85 - 0.15. Let v = z - -8. Let k be 11/15 + (-13)/39. Which is the second biggest value? (a) 2 (b) v (c) k c Let w = -0.1 + 0.4. Let p = -14 + 12. Let j be p - (-2)/((-6)/(-7)). What is the smallest value in w, j, -2/13? -2/13 Let x be (30/9 - 3)(-4 - -3). What is the second smallest value in -2, x, 3/2? x Let i = 19.6 + -20. Which is the second smallest value? (a) 2/15 (b) i (c) -3/2 b Let l = -151 + 150.9. What is the biggest value in 3, l, -2/5, 4? 4 Let h = 0.3 + -5.3. Let w = 1.7 + -3.7. What is the second smallest value in 5, h, w? w Let y = -2 + -2. Let d = y - -2. Let c = -0.7 - -0.5. What is the third smallest value in d, -3/4, c? c Let f be 94/88 - (-14)/77. Which is the third smallest value? (a) 2 (b) 1 (c) f a Let g be 5/(-2) + (4 - 2). What is the second smallest value in -0.3, 0.1, g? -0.3 Let o = -117.5 + 118. Let m = -0.1 - 0.1. Which is the biggest value? (a) 0.3 (b) o (c) m b Let j = -1057/5 - -211. Let d be 68/(-48) - 4/(-6). Which is the third smallest value? (a) -0.1 (b) d (c) j a Let a = -12 + 12.5. What is the third biggest value in -5, a, -1? -5 Let k = -29 + 29.1. Which is the smallest value? (a) k (b) 0.04 (c) 0.4 b Let k = 1 + 0. Let t = -34.9 - -35. What is the biggest value in k, t, 2? 2 Let u = -0.33 + 0.3. Let o = -150 - -149.03. Let i = o + u. Which is the third smallest value? (a) -0.4 (b) i (c) 0.1 c Let s be (-100)/(-110) + (0 - 1). What is the second biggest value in s, -2/5, 16? s Let r(v) = -2v + 6. Let a(k) = k*2 + 3k - 5. Let z be a(-5). Let j be r(z). What is the smallest value in -3, j, 0.5? j Let z = -6 + 10. Let w = -4 + 3.9. Let m = 0.1 + w. What is the third biggest value in -2, m, z? -2 Let q be 3/((-15)/13) - -2. Suppose 0 = -2l + 10 - 2. Suppose 0 = 3r - 13 + l. Which is the biggest value? (a) r (b) q (c) 1 a Let k be ((-3)/(-8))/((-6)/12). Which is the third smallest value? (a) -6 (b) k (c) -5 b Let b = 0.3 - -2.7. Let f = 35 + -39. What is the third smallest value in b, -0.05, f? b Let x = 71/14 + -18/7. Let b = -6 + 3. What is the smallest value in x, -3/4, b? b Let d = -256/393 - 2/131. Let w = 5011 + -35587/7. Let k = 73 + w. What is the second smallest value in 0.1, d, k? 0.1 Suppose 15n - 11n - 20 = 0. Which is the smallest value? (a) 2/3 (b) 6/5 (c) 0.3 (d) n c Let y(i) = -2i - 5. Let h be y(-4). Which is the second smallest value? (a) 0.02 (b) h (c) 0.2 c Let a = -16 - -17. What is the biggest value in 0.2, a, -1/6? a Let n = 4.1 + -3.7. Which is the fourth biggest value? (a) 0 (b) 2 (c) -4/7 (d) n c Let h = 12 + -7. Suppose -5d + 35 + 0 = hu, -5d = -5u + 5. Suppose 0j = uj. Which is the biggest value? (a) 1/4 (b) -3 (c) j a Let g = -0.5 - -3.5. Let h be 375/(-35) - 2/7. Let n = h + 8. Which is the smallest value? (a) n (b) g (c) -0.5 a Let s = 0 + 2.4. Let l = 5 - 7. Let i = l + s. What is the biggest value in -4, i, 1/5? i Let o(p) = -p3 + 4p + 1. Let z be o(0). What is the smallest value in 2, z, 0.09? 0.09 Let t be (-42)/(-10)2/18. Let i = -3/10 + t. Which is the smallest value? (a) i (b) 0.5 (c) -1/2 c Let u = 9/8 + 3/8. What is the third smallest value in -3, 1/11, u, -1? 1/11 Suppose -5l - 28 = 17. Let t = l - -7. Suppose 8 = -3y - 1. What is the third smallest value in y, t, 0? 0 Let q = -6.85 - -7. Let c = q + 0.05. What is the smallest value in c, 4/9, -2? -2 Let w = -3.88 - -0.88. Which is the smallest value? (a) 1 (b) 13/3 (c) w c Suppose -3u + 10 = -4s, 2s + 3u + 8 = -6. Which is the second smallest value? (a) -0.07 (b) s (c) -2/3 (d) -1 d Let w = 31/12 - 13/4. Let d = -3.71 - 0.29. Which is the smallest value? (a) 0.2 (b) w (c) d c Let s be (2/(-9))/(5/15). Let d = -0.2 + 0.7. Which is the smallest value? (a) d (b) -5 (c) s b Let p be 2/(-3) - ((-64)/(-12))/(-2). Suppose -3f = -2f. What is the third smallest value in p, f, -5? p Let x = 5.4 + -5.1. Which is the second biggest value? (a) 2 (b) 6 (c) x a Let l = -0.33 + 0.03. What is the second smallest value in -3, -1/7, l? l Let z = 4 - 7. Let u = 0.26 - -0.24. Which is the third smallest value? (a) u (b) z (c) -2/9 a Let g be 2 + (1(-3)/3 - -2). What is the fourth biggest value in 5, -0.2, -0.4, g? -0.4 Suppose 5z - 5 = 5d, -3z - 2z + 5 = 5d. Which is the third biggest value? (a) -0.8 (b) d (c) -0.4 a Let j = 682/5 - 136. What is the biggest value in -2, j, 5? 5 Let l = -4.4 + 4.77. Let n = 0.15 - 0.12. Let s = n + l. What is the smallest value in s, 5, -0.2? -0.2 Let w = 29 + -29.17. Let m = 0.23 - w. What is the third biggest value in m, -0.4, 5? -0.4 Let c = -235 + 3759/16. Let g = c - 39/16. What is the second smallest value in 2, 0.3, g? 0.3 Let v be (4/(-12))/(55/(-30)). Which is the third smallest value? (a) v (b) -0.2 (c) 0 a Let q = -4 + 4.4. Let h = 9 - 1. Let w = 11 - h. What is the biggest value in 1/4, w, q? w Let n = -331/5 + 66. What is the third biggest value in -2/5, 6, n? -2/5 Let w be (16/(-15))/(-4) + 6/15. Which is the fourth smallest value? (a) w (b) -3/7 (c) 1/4 (d) -2.4 a Suppose -3d + 5 = -2y + 25, -4d = -5y + 36. Suppose -y = -4w + 6w. Let x be 13/(-11) + w/(-2). What is the second smallest value in 1/6, -3/2, x? x Let g = 0.8 - -2.2. Which is the third biggest value? (a) g (b) 13 (c) -2/3 c Let s be ((41 + 4)/5)/(3/2). Which is the second smallest value? (a) s (b) 0.5 (c) -2/11 b Let g = 21 - 29. Which is the third smallest value? (a) 2 (b) 0.4 (c) g a Let d be 1(2 + 5/(-3)). Let n be (-910)/(-4)5/50. Let h = 23 - n. Which is the biggest value? (a) h (b) d (c) 0.1 b Let k = 0.1 + -1.3. Let x = k - -1.4. Which is the smallest value? (a) 2 (b) -5 (c) x b Let f = -27 - -31. Let r be (-361)/(-95) - f1. Let m = -4 - -2. Which is the second smallest value? (a) r (b) m (c) -1/6 a Let o be 13/(-15)19/69. Let v = o + -1/45. Let w = v + 13/138. Which is the second smallest value? (a) -0.4 (b) w (c) -2/11 c Let y = 6.3 + -6. Let d = 0.4 - y. What is the smallest value in d, 1/3, 2? d Let s = -0.6 + 0.1. Let y be (-4)/18 - 4306/630. Let g = -48/7 - y. Which is the third biggest value? (a) 3 (b) g (c) s c Let k be (-5 + 6)/(-1 - 0). Let o be (-20)/(-4) + 1k. Which is the second biggest value? (a) -0.3 (b) o (c) 1 c Let h be (-1 - (-2)/(-6))20/120. What is the smallest value in -1/8, h, 10? h Let t be (2/3 - 1)-1. What is the third smallest value in 4, 5, t? 5 Suppose -3 - 1 = -d. Suppose 3r + 2 = r - f, 0 = 3r + 3f + 3. Let t be ((-2)/(-5))/((-6)/10). Which is the second smallest value? (a) r (b) t (c) d b Suppose -2v = -3v + 24. Let u be ((-1)/46)/((-6)/v). Which is the biggest value? (a) 4 (b) u (c) 3 a Let u = 6 - 0. Let j = -5.92 + u. Let v = 0.08 - j. Which is the third smallest value? (a) v (b) 2/9 (c) -1/10 b Let u be -1-31/(-21). What is the fourth biggest value in 1/3, u, 0, -13? -13 Let f = 7.4 - 7. Let o = 6.14 - 0.14. Let w = 5.7 - o. Which is the biggest value? (a) -3 (b) f (c) w b Let i = -0.61 - -0.6. Let l = i - -0.31. Which is the third biggest value? (a) -1 (b) l (c) 3 a Let m be (-28)/(-245)(2/4 + 2). What is the second biggest value in 1/2, -0.2, m? m Let u = -7.03 - -0.03. Let o = u - -6.96. Which is the biggest value? (a) 0.3 (b) o (c) 5 c Let q = -246/217 + -337811/434. Let y = -794 - q. Let h = y - -14. What is the smallest value in -4, h, -1? -4 Let s be (-36)/(-234) - 10/(-104). Let h = 100 - 999/10. Which is the third biggest value? (a) h (b) 2/11 (c) s a Let r = -13 - -4. Let j = -13 - r. Which is the third smallest value? (a) j (b) -1 (c) -0.4 c Let q = -1055/7 - -151. Which is the smallest value? (a) 0.5 (b) 0.2 (c) q b Let m = -0.2 + -0.8. Suppose -2u + 5 = 3a - 4, 5u + 3a - 27 = 0. Let c be 10/(-4)u/10. What is the smallest value in c, -0.3, m? c Let y = -1.2 + 1.25. Which is the second smallest value? (a) y (b) -2/11 (c) 2 a Let n = -0.984 - -0.184. Let j be 4/(-14)(-1)/(-2). What is the third biggest value in n, j, -0.5? n Suppose 26 = 4*k - 30. Let g = -9 + k. What is the second biggest value in -1/7, g, -2?	{ "pile_set_name": "DM Mathematics" }
0.6, 0? 0.6 Which is the nearest to 1? (a) 2/3 (b) -411/161 (c) 620 a What is the closest to 1/3 in 0.042489, 0.4, -318? 0.4 What is the nearest to 1/7 in -3, 2/9, 96715? 2/9 What is the nearest to -2 in 506, -1.2, 54/7? -1.2 Which is the nearest to -0.5? (a) -0.071 (b) 1/4 (c) -2709/79 a Which is the closest to 3? (a) 2/3 (b) 5 (c) 90 (d) -0.5 (e) -0.069 (f) -539 b Which is the closest to 11? (a) 544 (b) -1.3 (c) 2/5 (d) 5 (e) -0.3 d Which is the nearest to -1/2? (a) 25890 (b) 152 (c) -16 c What is the nearest to -2/5245 in 4, -0.009, -1/2? -0.009 Which is the nearest to -12? (a) 230050 (b) -5 (c) 3/7 (d) -2 b Which is the nearest to 171? (a) 20 (b) -0.6 (c) 1 (d) -6 a What is the nearest to -5/4 in 0, 4, -0.05, 0.1, 1087? -0.05 Which is the closest to -64/9? (a) -435 (b) -2/3 (c) -1/5 (d) -2/5 b Which is the closest to -0.2? (a) 1 (b) -0.2 (c) 4/25 (d) -515 b Which is the closest to -1? (a) -2904 (b) 0 (c) -5 (d) -2/11 (e) 0.16 d What is the closest to 3/4 in -2, -0.61, 0, -19, 0.7? 0.7 What is the nearest to -1 in -8, -1, -5/4, -50453, -5/2, -0.01? -1 Which is the nearest to 1? (a) 5 (b) -635833 (c) -4 a Which is the nearest to 28/69? (a) -2/13 (b) -1/2 (c) 0.1 (d) 0.21 d What is the nearest to 1.1 in -1, 13, 1143? -1 What is the nearest to 7173 in 0.2, 2, 172? 172 What is the closest to 2/45 in -72428, -11/9, 1? 1 What is the nearest to -4.1 in -8351, -2, 2/11, -1/7? -2 Which is the nearest to 1/2? (a) -4 (b) -2/47 (c) 0.1 (d) -0.2 (e) 340 c What is the nearest to -0.4 in 298, -925, 5? 5 Which is the nearest to 192? (a) -0.2 (b) -1 (c) -2 (d) -1015 a Which is the closest to -0.013637? (a) 38 (b) -5 (c) 5 b What is the nearest to -2.5 in -12/3211, -1.5, -2/5? -1.5 What is the nearest to 2/3 in -3/5, -0.1, 0.2, 20228, 69? 0.2 What is the nearest to 19 in 4, -21694, -18, -1, 3, 0? 4 Which is the nearest to -1? (a) 3 (b) -910 (c) -0.11 (d) 1312 (e) 0 c Which is the closest to 1? (a) 37.86 (b) -25 (c) -2/27 c Which is the nearest to -3? (a) 5 (b) -0.4 (c) -1/7 (d) -1/526 (e) 68 (f) 0.3 b What is the nearest to -95 in 1/5, -0.066, -17/4, -27? -27 Which is the nearest to 0? (a) -2 (b) 5 (c) -340 (d) -2/5 (e) 2/2171 e Which is the nearest to -0.3? (a) 0.1 (b) 259 (c) 50/9 (d) -60 a Which is the closest to 1? (a) 0.05 (b) -7.069 (c) -0.1 (d) 41 (e) -3 a Which is the closest to -1/4? (a) 5 (b) -6 (c) 1/4 (d) -2 (e) -58 c What is the nearest to 4.8 in 1/6, -3, 1/11, 0.2, 0.7, 0.048? 0.7 What is the closest to 1 in 5, -45, 0, -25, 50.4? 0 What is the nearest to -1/2 in -2/3, 321, 2, 479, 7/6? -2/3 Which is the closest to -1/2? (a) -4 (b) -4/11 (c) 0 (d) 49/10 b Which is the closest to 3/5? (a) -0.426 (b) 1.3354 (c) -3 b Which is the closest to -10? (a) -3201 (b) -1 (c) 2/11 (d) 2/5 (e) 0.1 (f) -0.1 b What is the closest to 71.2 in 0.237, 242, 1/7? 0.237 Which is the nearest to -24? (a) -1 (b) -15/4 (c) -10 (d) -8 (e) 0.3 c What is the nearest to -226 in -2/3, -865, 0.4? -2/3 Which is the closest to 27382? (a) 3 (b) 2/63 (c) 1/4 (d) 2/5 (e) -0.5 a Which is the closest to 0.2? (a) -13 (b) 513 (c) 0.7 (d) -14 (e) -1 c What is the closest to -1/2 in -85, 0.13, -3, -1/5, -176? -1/5 Which is the nearest to 0.07? (a) -2/1721 (b) 36 (c) 0.4 a Which is the closest to -7891? (a) 657.2 (b) 3 (c) -0.1 c What is the closest to 0.3 in 0.06, -2523, 26/5, -1? 0.06 What is the nearest to 1 in -1/5, -156631, 2? 2 What is the nearest to 0 in -0.2, -168.1, 2/3, 5, -1? -0.2 What is the nearest to 1/3 in -2, 889/33, 2/5? 2/5 What is the closest to 2/5 in -91, 0, -2/5, 4, -2? 0 What is the nearest to -0.1 in -0.4, -0.3, -3338280, -2/3? -0.3 Which is the closest to -6.691? (a) -1.2 (b) -8 (c) 0.1 (d) -2 b Which is the closest to -36/163? (a) -2/7 (b) 1 (c) 1.6 a Which is the closest to 284? (a) -2/89 (b) -2 (c) 3.75 c What is the nearest to 3029 in 27, 2, 7? 27 What is the closest to 2 in -3/7, 8.75935, 5? -3/7 What is the closest to -30 in -0.5, -4, 2, -0.044, 35? -4 Which is the closest to -2/3? (a) 2/5 (b) 0 (c) -17 (d) 0.0770548 (e) -4 b What is the nearest to 2 in -0.09, 67, 0.3, 1, -2/7, 0.5? 1 Which is the closest to 10162? (a) 4/3 (b) -5 (c) 0.008 a Which is the nearest to 0.136? (a) 0.04 (b) 300 (c) 0.3 (d) -5 a Which is the closest to -2/3? (a) -0.7771 (b) 3 (c) -11 (d) 7/6 a Which is the nearest to 3? (a) 5 (b) 1.35 (c) 1/3 (d) -13 (e) -2/197 b What is the nearest to 1/3 in 39, 3/2, 0, 0.1, 181? 0.1 What is the nearest to -158 in 0.59, -0.9, -0.1? -0.9 Which is the nearest to 26? (a) -21 (b) 2 (c) 5 (d) -4 (e) 1/52 c What is the closest to 8251 in -1, 8, 1? 8 What is the closest to -2/3 in 16, 2/5, -3, -2/5, 8399? -2/5 What is the closest to -6 in -20/41, 0.209, 1/3? -20/41 Which is the nearest to 4/9? (a) -2/69 (b) -7 (c) 72 (d) 0.6 d What is the closest to -2/13 in -0.4, 2, -1986, 0.3? -0.4 What is the nearest to -343.4575 in -0.4, -21, 3? -21 What is the nearest to 7459 in -2/7, 1/40, 2? 2 What is the closest to 2/283 in -28, -1, -5, 104.1? -1 What is the nearest to 0 in 5, -12, 3/7, -3538, -4? 3/7 Which is the closest to 2? (a) -631 (b) -2/17 (c) 11 (d) 0 (e) -1 (f) -1.05 d What is the closest to 0.1 in 0.5, 3/2, 107/26982? 107/26982 What is the closest to -0.7 in 22, 0.146, -433? 0.146 Which is the closest to 2/5? (a) -37 (b) -0.3 (c) 0.1 (d) -86 (e) -1/8 c Which is the closest to -1.42? (a) 162 (b) 15/7 (c) -3 c What is the nearest to -7 in -1/2, -1/381, 4/5, 9, -0.4? -1/2 Which is the closest to 82? (a) 25 (b) -1 (c) -39 a Which is the closest to 2? (a) 4.5 (b) -0.4 (c) 46 (d) -1/9 (e) 1 e Which is the nearest to 2447? (a) 2 (b) -20/3 (c) -6/11 a What is the nearest to -7/8 in 581, -4/7, 2/7, 14, 1? -4/7 Which is the closest to 0.1? (a) 4/7 (b) 0.3 (c) -0.5 (d) -44/13 (e) -3/53 (f) -0.02 f Which is the nearest to -2/9? (a) 594 (b) -0.027 (c) -0.1 (d) -3 c What is the nearest to 0.2 in 4, 0, 16, 0.2, 0.58253? 0.2 What is the nearest to 19 in 966, 10/209, 0.2? 0.2 Which is the nearest to -609/8? (a) -217 (b) 1.6 (c) -2/11 (d) 0.1 c Which is the closest to 0.1? (a) -13 (b) 1 (c) -19/22 b Which is the closest to -3? (a) -0.7 (b) 4 (c) -5 (d) 0 (e) -518 (f) 0.03 c Which is the closest to -2/3? (a) -1.2 (b) 231730 (c) -1/4 (d) -5 c What is the nearest to -7 in 18, -0.5, 0.14, 1, 222? -0.5 Which is the nearest to -163? (a) -5 (b) 4/5 (c) 2 a Which is the nearest to 2? (a) -30/11 (b) 1335 (c) 10/23 c What is the nearest to 34127 in -7, -1/4, -3/2? -1/4 What is the closest to 7 in -5, -4, 0.1, 3/7, 377/2, -0.043? 3/7 What is the nearest to 2 in -22, -1/14748, -5, 0? 0 What is the closest to -0.1 in 468, -0.2, 0.3, 0.11, 0.2? -0.2 Which is the nearest to -1/6? (a) 56 (b) 3 (c) -1 (d) -738 (e) -31 c What is the nearest to -36 in 0.4, 1.4, -0.1, -1.26658? -1.26658 Which is the closest to 0? (a) 0.5 (b) 21/2 (c) 22.1 a What is the nearest to -0.31 in -7/3, -4/11, 3, -0.5, -3/13? -4/11 Which is the closest to 3/320? (a) -6 (b) 4 (c) 1 (d) -3 c What is the nearest to -1 in -1/328367, -0.2, -3, 8/5? -0.2 What is the closest to -132 in -2/271, 1/4, -3, 2/11, -4/3? -3 Which is the closest to -0.59? (a) -0.02 (b) 1 (c) -0.2 (d) 12 (e) 2 c Which is the nearest to 8? (a) -2/5 (b) -1/11 (c) -25 (d) 7.348 d What is the nearest to -5901/2 in 5, -0.5, -0.1? -0.5 Which is the nearest to -18/19? (a) -2/3 (b) -0.3 (c) 151 (d) -0.5 a Which is the closest to 3/7? (a) 4.1049 (b) 1/10 (c) 0.129 c What is the nearest to 3/2 in -1, 0.3, 75241, -0.08? 0.3 Which is the nearest to 2/9? (a) 48 (b) 5 (c) -3/5212 (d) 1 c Which is the closest to 1.22? (a) 5 (b) 1 (c) -2/5 (d) -0.5 (e) -69 b What is the closest to 0.01 in -0.11, -2/1873, 0.3, -2? -2/1873 Which is the closest to -2/5? (a) 0.0668 (b) -2/3 (c) 1117 b What is the nearest to 53 in -2/3, -0.4, -5, -0.1, 0.4, -12? 0.4 What is the nearest to -18/7 in 2.456, 50, 2/7? 2/7 What is the nearest to -0.1 in -0.3, -50152, -6, -0.1? -0.1 What is the nearest to 1150 in -4, -1/12, 122? 122 What is the closest to 2/3 in 1129, 1/6, 3/35, 2/5, -345? 2/5 Which is the closest to 0.2? (a)	{ "pile_set_name": "DM Mathematics" }
What is the z'th term of 5, -48, -141, -280, -471, -720, -1033? -z*3 - 14z*2 - 4z + 24 What is the k'th term of 96, 203, 322, 459, 620, 811, 1038? k*3 + 100k - 5 What is the f'th term of -154, -175, -196, -217? -21f - 133 What is the i'th term of 58, 67, 70, 61, 34, -17? -i3 + 3i*2 + 7i + 49 What is the l'th term of 227, 452, 677? 225l + 2 What is the b'th term of -199, -189, -177, -163, -147, -129, -109? b2 + 7b - 207 What is the a'th term of 40, 43, 48, 55, 64? a2 + 39 What is the c'th term of 7, 18, 21, 10, -21? -c3 + 2c2 + 12c - 6 What is the v'th term of 229, 218, 193, 148, 77, -26, -167, -352? -v3 - v2 - v + 232 What is the t'th term of -6, 8, 34, 72, 122, 184? 6t2 - 4t - 8 What is the g'th term of -139, -109, -67, -7, 77, 191, 341, 533? g*3 + 23g - 163 What is the t'th term of 45, 76, 95, 102, 97, 80? -6t2 + 49t + 2 What is the a'th term of -2198, -2199, -2200, -2201, -2202? -a - 2197 What is the b'th term of 23, 37, 51? 14b + 9 What is the h'th term of 24, 70, 116? 46h - 22 What is the d'th term of 18, 47, 98, 171, 266? 11d2 - 4d + 11 What is the w'th term of 139, 136, 133? -3w + 142 What is the o'th term of 22, 58, 114, 196, 310, 462, 658, 904? o3 + 4o*2 + 17o What is the k'th term of -17, 79, 175, 271, 367? 96k - 113 What is the o'th term of -16236, -16237, -16238? -o - 16235 What is the y'th term of 93, 72, 51, 30, 9, -12? -21y + 114 What is the g'th term of -10, -32, -64, -106, -158, -220? -5g2 - 7g + 2 What is the i'th term of -40, -56, -74, -100, -140? -i*3 + 5i*2 - 24i - 20 What is the g'th term of 14, 9, 4? -5g + 19 What is the c'th term of -64, -99, -166, -271, -420, -619? -c3 - 10c*2 + 2c - 55 What is the k'th term of 167, 124, 75, 14, -65? -k*3 + 3k*2 - 45k + 210 What is the q'th term of 68, 75, 86, 101, 120? 2q2 + q + 65 What is the m'th term of 832, 1666, 2500, 3334, 4168, 5002? 834m - 2 What is the p'th term of -842, -840, -838? 2p - 844 What is the q'th term of -39, -124, -271, -486, -775, -1144, -1599? -q3 - 25q*2 - 3q - 10 What is the d'th term of 952, 1912, 2872, 3832, 4792, 5752? 960d - 8 What is the f'th term of 7732, 7733, 7734, 7735, 7736, 7737? f + 7731 What is the j'th term of -22, -33, -50, -73, -102? -3j*2 - 2j - 17 What is the k'th term of 248, 977, 2182, 3857, 5996? -k*3 + 244k*2 + 4k + 1 What is the h'th term of -37, -77, -117, -157, -197, -237? -40h + 3 What is the p'th term of 82, 164, 244, 322, 398? -p2 + 85p - 2 What is the j'th term of 212, 393, 574? 181j + 31 What is the k'th term of -5, 2, 15, 34, 59, 90? 3k*2 - 2k - 6 What is the f'th term of -3, -18, -43, -78, -123, -178, -243? -5f2 + 2 What is the z'th term of -97, -146, -231, -352? -18z*2 + 5z - 84 What is the z'th term of 64, 117, 172, 235, 312, 409, 532, 687? z*3 - 5z*2 + 61z + 7 What is the t'th term of -12, -16, -30, -60, -112, -192, -306, -460? -t3 + t2 - 12 What is the s'th term of 462, 1843, 4146, 7371? 461s2 - 2s + 3 What is the v'th term of 42, 108, 176, 246? v*2 + 63v - 22 What is the o'th term of -10, -13, -10, 5, 38, 95, 182? o*3 - 3o*2 - o - 7 What is the h'th term of -95, -69, -13, 85, 237? 2h*3 + 3h*2 + 3h - 103 What is the a'th term of -8, -39, -90, -161, -252, -363, -494? -10a2 - a + 3 What is the c'th term of 143, 150, 167, 200, 255, 338, 455? c3 - c2 + 3c + 140 What is the w'th term of 42, 49, 66, 99, 154, 237? w3 - w2 + 3w + 39 What is the c'th term of -11, 12, 35, 58, 81? 23c - 34 What is the i'th term of -21, -59, -97, -135, -173? -38i + 17 What is the x'th term of 7, 7, 13, 31, 67? x3 - 3x*2 + 2x + 7 What is the k'th term of 67, 84, 121, 184, 279, 412? k*3 + 4k*2 - 2k + 64 What is the s'th term of -1065, -1075, -1097, -1137, -1201? -s*3 - 3s - 1061 What is the v'th term of 1, -96, -363, -884, -1743, -3024? -14v3 - v2 + 4v + 12 What is the v'th term of -2645, -5290, -7935, -10580, -13225? -2645v What is the w'th term of 10, 22, 34, 46? 12w - 2 What is the f'th term of -29, -40, -67, -116, -193, -304? -f*3 - 2f*2 + 2f - 28 What is the t'th term of -174, -171, -154, -117, -54, 41, 174, 351? t3 + t2 - 7t - 169 What is the a'th term of 347, 422, 499, 578? a2 + 72a + 274 What is the t'th term of 74, 62, 50, 44, 50, 74? t*3 - 6t2 - t + 80 What is the j'th term of 31, 58, 87, 118? j2 + 24j + 6 What is the p'th term of 461, 463, 465, 467, 469? 2p + 459 What is the n'th term of -149, -144, -137, -128? n*2 + 2n - 152 What is the a'th term of -6, -5, 8, 39, 94, 179, 300? a*3 - 6a - 1 What is the h'th term of 299, 314, 329, 344, 359? 15h + 284 What is the g'th term of 101, 353, 767, 1337, 2057, 2921, 3923, 5057? -g3 + 87g*2 - 2g + 17 What is the s'th term of 215, 425, 633, 839? -s*2 + 213s + 3 What is the r'th term of 790, 799, 820, 859, 922, 1015, 1144, 1315? r*3 + 2r + 787 What is the k'th term of 16, 30, 44, 58, 72, 86? 14k + 2 What is the q'th term of 74, 35, -30, -121, -238? -13q*2 + 87 What is the s'th term of 7, 18, 37, 64? 4s2 - s + 4 What is the p'th term of -102, -182, -260, -336? p2 - 83p - 20 What is the d'th term of 202, 199, 192, 181, 166, 147? -2d*2 + 3d + 201 What is the w'th term of -97, -169, -289, -457, -673, -937? -24w2 - 73 What is the v'th term of -91, -184, -275, -364, -451, -536? v2 - 96v + 4 What is the d'th term of -5, -14, -43, -104, -209, -370, -599, -908? -2d3 + 2d*2 - d - 4 What is the l'th term of 52, 48, 40, 28, 12? -2l*2 + 2l + 52 What is the u'th term of 44, 94, 144, 194? 50u - 6 What is the m'th term of 4093, 4089, 4085, 4081? -4m + 4097 What is the x'th term of 56, 230, 528, 956, 1520? x*3 + 56x*2 - x What is the w'th term of -9, -15, -17, -15, -9, 1? 2w*2 - 12w + 1 What is the u'th term of -27, -41, -51, -57, -59? 2u2 - 20u - 9 What is the s'th term of 205, 205, 193, 163, 109, 25, -95, -257? -s*3 + 7s + 199 What is the d'th term of -12, -43, -88, -141, -196, -247, -288, -313? d*3 - 13d*2 + d - 1 What is the o'th term of -28, -37, -54, -79, -112, -153, -202? -4o*2 + 3o - 27 What is the t'th term of 48, 61, 84, 123, 184, 273, 396? t3 - t2 + 9t + 39 What is the x'th term of -1782, -1784, -1788, -1794, -1802, -1812, -1824? -x2 + x - 1782 What is the l'th term of 5, 15, 47, 113, 225, 395? 2l3 - l2 - l + 5 What is the b'th term of 831, 1663, 2495, 3327, 4159, 4991? 832b - 1 What is the v'th term of 2, 8, 18, 32, 50, 72? 2v*2 What is the k'th term of -6, -72, -248, -588, -1146, -1976, -3132? -9k3 - k2 + 4 What is the b'th term of -16, -12, -8? 4b - 20 What is the m'th term of 75, 149, 223, 297? 74m + 1 What is the n'th term of -37, -77, -135, -217, -329? -n*3 - 3n*2 - 24n - 9 What is the w'th term of -22311, -44620, -66929? -22309w - 2 What is the v'th term of -116, -229, -350, -485, -640? -v3 + 2v*2 - 112v - 5 What is the b'th term of 48, 47, 46, 45, 44? -b + 49 What is the i'th term of -6, 10, 32, 60, 94? 3i2 + 7i - 16 What is the z'th term of -7500, -7495, -7488, -7479, -7468? z*2 + 2z - 7503 What is the r'th term of -7638, -15277, -22926, -30591, -38278? -r3 + r2 - 7635r - 3 What is the m'th term of -833, -830, -827? 3m - 836 What is the y'th term of 14, 39, 78, 131, 198? 7y2 + 4y + 3 What is the h'th term of -19, 56, 311, 836, 1721? 15h3 - 30h - 4 What is the t'th term of 2694, 2692, 2690, 2688? -2t + 2696 What is the k'th term of 31, 41, 51, 61, 71, 81? 10k + 21 What is the q'th term of 18, 7, 0, -3? 2q2 - 17q + 33 What is the z'th term of -1, 10, 29, 56, 91, 134? 4z2 - z - 4 What is the q'th term of -74, -31, 12, 55, 98? 43q - 117 What is the c'th term of -4, -32, -72, -124, -188, -264? -6c2 - 10c + 12 What is the g'th term of 301, 309, 321, 337, 357, 381? 2g2 + 2g + 297 What is the c'th term of 36, 143, 318, 561, 872, 1251? 34c2 + 5c - 3 What is the q'th term of -67, -68, -69, -70, -71? -q - 66 What is the q'th term of -1171, -2350, -3529? -1179q + 8 What is the u'th term of -37, -161, -367, -655, -1025, -1477, -2011? -41u*2 - u + 5 What is the g'th term of -58, -129, -200, -271, -342, -413? -71g + 13 What is the t'th term of 376, 391, 406, 421, 436? 15*t + 361 What is the l'th term o	{ "pile_set_name": "DM Mathematics" }
= n*3 - 4n + 4. Let i(a) = 3h(a) + 4s(a). Solve i(l) = 0. -16, 0 Let i(u) be the first derivative of u7/1680 - u6/360 - u*5/80 + 68u*3/3 - 89. Let b(m) be the third derivative of i(m). Determine f, given that b(f) = 0. -1, 0, 3 Suppose 174j - 791 = 79. Let y(d) be the first derivative of -1/15dj - 24 + 4/9d*3 + 1/12d*4 + 0d - 2/3d2. Suppose y(v) = 0. Calculate v. -2, 0, 1, 2 Let u(t) be the third derivative of -t7/525 - 23t*6/60 + 58t*5/75 + 915t*2. Determine l, given that u(l) = 0. -116, 0, 1 Let y(o) = 17o - 88. Let w be y(7). Solve -14g - 6 - 13g*2 + 58g*2 + 4g + wg = 0 for g. -2/3, 1/5 What is u in 3u*4 - 5979u*3 + 12u2 + u4 + 5995u3 = 0? -3, -1, 0 Let s(d) = -3d3 + d2 + 2. Let n(o) = -2o3 + o2 + 1. Let g(q) = -8n(q) + 5s(q). Let k be g(3). Factor c2 + 3c + 0ck + 38 - 19 - 17. (c + 1)(c + 2) Let c(a) be the third derivative of -a*6/60 + 4a*5/15 - 7a*4/12 + 1138a*2. Factor c(b). -2b(b - 7)(b - 1) Let z = 422 - 410. Let r be (-265)/318 - (-34)/z. Factor 2/17qr - 2/17q - 4/17. 2(q - 2)(q + 1)/17 Let z(c) be the third derivative of 13c6/12 - 127c*5/12 - 1895c*4/24 - 35c*3 - 3c*2 + 124c + 3. Factor z(q). 5(q - 7)(q + 2)(26q + 3) Let 47375/2x - 15625 + 253/2x*3 - 1/2x*4 - 16377/2x*2 = 0. Calculate x. 1, 2, 125 Solve -40804/3i - 54540i2 - 539i*3 - 4/3i*4 + 0 = 0 for i. -202, -1/4, 0 Suppose 4t - 5k + 10 = 0, k = -4t + 19 + 7. Suppose 0 + 38/5y4 - 6/5y*t - 8/5y*2 - 56/5y*3 + 32/5y = 0. What is y? -2/3, 0, 1, 2, 4 Suppose 9s + 5 = 275. Suppose -61p - s = -66p. Solve 3162g - 3192g + pg*2 + 19g2 = 0. 0, 6/5 Let m(p) be the first derivative of p7/168 - p5/16 + p3/6 - 106p + 32. Let z(f) be the first derivative of m(f). Find l, given that z(l) = 0. -2, -1, 0, 1, 2 Let q(u) be the second derivative of u6/120 - 3u5/40 - u4/16 + 2u3/3 + 3u*2/2 - 4936u. Suppose q(s) = 0. Calculate s. -1, 2, 6 Let -330/7 + 2973/7t - 27/7t*2 = 0. Calculate t. 1/9, 110 Let n = 832013 - 10816113/13. Factor n - 2/13a*2 - 54/13a. -2(a - 1)(a + 28)/13 Let m(p) = -p*3 - 11p*2 - 11p + 8. Let s be m(-10). Suppose -3n = 3n - s. Factor -nu2 + u + 2u*2 - 11u - 25. -(u + 5)2 Let f(s) be the second derivative of -s6/10 - 9s5/20 + 11s*4/2 + 12s*3 - 210s. Suppose f(z) = 0. What is z? -6, -1, 0, 4 Suppose -5k - 7 = z, 5z = -2k - 2k + 7. Factor -8t2 + t2 + zt*2 - 4 - 12t - 4t2. -4(t + 1)(2t + 1) Let k(w) = -w*2 - w. Let u(j) = -j - 2j + 5j + j + 1 + 5j*2. Let y(b) = -9k(b) - 2u(b). Factor y(i). -(i - 2)(i - 1) Let n be (12/10)/((-770)/(-2200)). Find r, given that 1/7r*2 + 3/7r - n = 0. -4, 1 Let l = -160822 - -160824. What is t in 4 + 4t3 - 21/5t*l - 3/5t*4 - 24/5t = 0? -1, 2/3, 2, 5 Let s(x) be the third derivative of -x7/1365 - x6/780 + x*5/39 - 2x*4/39 - 830x*2. Suppose s(v) = 0. Calculate v. -4, 0, 1, 2 Let i be (-5)/(-45) + (-466)/(-18). Suppose 10a + 6 = i. Factor q*4 - 6q*3 + 32q*a - 32q*2 + 2q*4. 3q*3(q - 2) Let g(y) be the first derivative of -y*6/33 + 32y*5/55 - 47y*4/22 - 32y*3/33 + 48y*2/11 + 14322. Let g(a) = 0. Calculate a. -1, 0, 1, 4, 12 Let z be 8/(-28)-2 + 112/(-196). Let c = -423/8 - -53. Factor z + 1/8k4 + ck*2 + 0k - 1/4k3. k2(k - 1)*2/8 Suppose -x = -2x + 2. Factor 2i4 - 5i*2 - x - 3i + 10 - i*2 - 5i + 4i3. 2(i - 1)*2(i + 2)*2 Factor -1/5n*2 - 5299204/5 - 4604/5n. -(n + 2302)*2/5 Determine x so that -40443816 - 509796x + 3x3 - 2142x*2 - 10x*3 + 4x*3 = 0. -238 Factor 2o*3 - 9399 + 9431 - 21o + 13o - 8o*2. 2(o - 4)(o - 2)(o + 2) Let n be (250/(-6))/(28/(-1092)). Let 41t - n + 167t - 4t2 - 1079 = 0. What is t? 26 Let a be 6/(742/(-368) + 2). Let q = a - -370. Factor -2/3w - 1/3wq + 0. -w(w + 2)/3 Factor 1/7p2 + 0 - 1/7p*4 - 39p + 39p3. -p(p - 273)(p - 1)(p + 1)/7 Let m(x) = 3x2 + 11826x + 11619074. Let n(u) = 9u2 + 35487u + 34857223. Let d(p) = 7m(p) - 2n(p). Factor d(y). 3(y + 1968)2 Let v(y) be the third derivative of 1/3y*4 + 0y + 11/720y6 - 1/9y*5 - 1/1260y*7 + 0 + 161y*2 + 0y3. Solve v(g) = 0. 0, 3, 4 Let l(i) = -i2 + i - 1. Suppose 0d = 5d + 5. Let j = 11 + d. Let u(v) = -19v2 - 7v + 7. Let s(g) = jl(g) + 2u(g). Factor s(k). -4(3k + 1)(4k - 1) Factor 439w - 6015 + 3844 + 23w*2 - 39w*2 - 4390 + 209w. -(4w - 81)2 Let w(j) be the first derivative of j4/4 - 20j3/3 - j2/2 + 20j + 1438. Factor w(a). (a - 20)(a - 1)(a + 1) Let y(x) be the second derivative of -x7/28 + x6/10 + 9x*5/8 - 5x4 - x3 + 36x2 - 2527x. Determine g, given that y(g) = 0. -4, -1, 2, 3 Let c be 36/19 - (-70)/665. Solve 3oc + 70 - 31o*3 - 61 + 53 + 95o + 2o4 - 3o*4 = 0 for o. -31, -1, 2 Let k be ((-64)/(-2080))/((-24)/(-266)). Let j = k - 11/78. Solve -jy*2 - 1/5y*3 - 3/5 + y = 0 for y. -3, 1 Factor -48a - 3/4a2 - 621. -3(a + 18)(a + 46)/4 Let j(g) be the first derivative of -g4/4 + 28g*3/3 - 27g*2/2 + 478. Determine a, given that j(a) = 0. 0, 1, 27 Let w(j) = 5j*4 + 8j*3 - 3j*2 - 10j - 7. Let q(g) = 3g4 + 7g*3 - 4g*2 - 8g - 2. Let s(v) = 3q(v) - 2w(v). Determine f, given that s(f) = 0. -1, 2 Suppose 12 = -4y + 24. Let u(n) = -n3 + 8n*2 - 2n + 19. Let b be u(8). Solve -h*b - yh3 - h3 + 3h3 - 2h - 4h2 = 0. -1, 0 Let g = -971 + 219. Let u = -3759/5 - g. Let 1/5a*3 + 0 + ua*2 - 2/5a = 0. What is a? -2, 0, 1 What is m in 0m + 7/4m*5 + 0 - 87m*3 + 69/2m*4 + 22m2 = 0? -22, 0, 2/7, 2 Let n(o) = o3 - 3o2 - o + 6. Let z be n(3). Factor -8v*2 + 133v + 50v2 - 213v + 15v4 + 20 + 73v*2 - 70v*z. 5(v - 2)(v - 1)2(3v - 2) Suppose 0b = 6b - 306. Suppose 5u - 61 = -b. Factor 17a4 - a2 + 2a*3 + 2a*2 + 2a*u - 18a4. -a2(a - 3)(a + 1) Let g(k) = 4k3 + 60k*2 - 208k + 156. Let v(d) = -12d3 - 180d*2 + 624d - 465. Let j(o) = -11g(o) - 4v(o). Solve j(r) = 0 for r. -18, 1, 2 Let o(j) be the first derivative of -46j3/27 - 3j*2 - 8j/9 + 8400. Determine i, given that o(i) = 0. -1, -4/23 Factor -26s2 - 438 - 58s*2 + 291s + 15 + 31s2 + s3. (s - 47)(s - 3)2 Let c(n) be the third derivative of -n6/60 - 7n5/15 + 233n*2 + n. Factor c(p). -2p*2(p + 14) Let o(v) be the first derivative of 2v5/65 + 5v*4/13 - 8v*3/13 - 10v*2/13 + 22v/13 - 83. Solve o(q) = 0 for q. -11, -1, 1 Let w(u) be the third derivative of u*6/720 - 7u*5/36 - 49u*4/48 + 6u*3 - 4791u*2. Factor w(p). (p - 72)(p - 1)(p + 3)/6 Let y(l) be the third derivative of l5/15 + 4l*4/3 + 8l3 + l2 - 2l + 30. Factor y(a). 4(a + 2)(a + 6) Let l(d) be the second derivative of 4d*5/5 - 13d*4/2 + 5d*3 + 62d*2 - 3159d - 1. Factor l(r). 2(r - 2)(r + 1)(8r - 31) Suppose -61k2 + 12k + 28k2 + 551 + 318k + 220k + 32k*2 = 0. What is k? -1, 551 Let r(q) be the second derivative of 7q*5/10 - 38q*4/3 + 272q*3/3 - 320q*2 - 3q + 37. Factor r(w). 2(w - 4)2(7w - 20) Let o(s) = s2 + 464s - 5709. Let x be o(12). Let -2/5t5 - 2/5t*4 - 2/5 + 4/5t*2 - 2/5t + 4/5tx = 0. What is t? -1, 1 Let d(a) be the first derivative of a4/15 + 8a*3/15 + 6a*2/5 - 9a + 115. Let n(z) be the first derivative of d(z). Factor n(o). 4(o + 1)(o + 3)/5 Suppose -1540y = -1720y - 2267y - 2038y + 8970. Determine r, given that 1/7r - 1 - 1/7r3 + ry = 0. -1, 1, 7 Suppose 0 = 5n + 3 - 93. Suppose b = w, -3 + n = 3b + 2w. Factor -70o*3 + 151o - 115o - 168o*2 + 193o*3 + 73o*b. 4o(7o - 3)2 Let q(r) = r2 + 2r - 19. Let m be q(9). Let 175i*5 - 6i*2 - mi*4 + 10i*2 + 275i*5 - 22i*3 = 0. What is i? -2/9, 0, 1/5 Factor 705q + 71q2 + 326 + 75q*2 + 63 - 151q*2 + 321. -5(q - 142)(q + 1) Let b = -18 - -18. Suppose b = -15u + 2u + 39. Solve 1/3n + 0 - 1/3nu + 0n*2 = 0. -1, 0, 1 Let h be 3/(-30)4 + (-54)/15. Let o be 15/6 + h/8. What is u in 3u3 + 9u - 102uo + 90u*2 - 4 + 4 = 0? 0, 1, 3 Let q(x) be the second derivative of -65x*4/24 - 151x3/72 + x2/12 - 3x + 28. Factor q(o). -(5o + 2)(78o - 1)/12 Let n(a) be	{ "pile_set_name": "DM Mathematics" }