repo_name
stringlengths 6
103
| path
stringlengths 4
209
| copies
stringlengths 1
4
| size
stringlengths 4
7
| content
stringlengths 838
1.04M
| license
stringclasses 15
values |
---|---|---|---|---|---|
pytorch/fairseq | examples/simultaneous_translation/eval/agents/simul_t2t_enja.py | 1 | 7099 | # Copyright (c) Facebook, Inc. and its affiliates.
#
# This source code is licensed under the MIT license found in the
# LICENSE file in the root directory of this source tree.
import os
from fairseq import checkpoint_utils, tasks
import sentencepiece as spm
import torch
try:
from simuleval import READ_ACTION, WRITE_ACTION, DEFAULT_EOS
from simuleval.agents import TextAgent
except ImportError:
print("Please install simuleval 'pip install simuleval'")
BOS_PREFIX = "\u2581"
class SimulTransTextAgentJA(TextAgent):
"""
Simultaneous Translation
Text agent for Japanese
"""
def __init__(self, args):
# Whether use gpu
self.gpu = getattr(args, "gpu", False)
# Max len
self.max_len = args.max_len
# Load Model
self.load_model_vocab(args)
# build word splitter
self.build_word_splitter(args)
self.eos = DEFAULT_EOS
def initialize_states(self, states):
states.incremental_states = dict()
states.incremental_states["online"] = dict()
def to_device(self, tensor):
if self.gpu:
return tensor.cuda()
else:
return tensor.cpu()
def load_model_vocab(self, args):
filename = args.model_path
if not os.path.exists(filename):
raise IOError("Model file not found: {}".format(filename))
state = checkpoint_utils.load_checkpoint_to_cpu(filename)
task_args = state["cfg"]["task"]
task_args.data = args.data_bin
task = tasks.setup_task(task_args)
# build model for ensemble
state["cfg"]["model"].load_pretrained_encoder_from = None
state["cfg"]["model"].load_pretrained_decoder_from = None
self.model = task.build_model(state["cfg"]["model"])
self.model.load_state_dict(state["model"], strict=True)
self.model.eval()
self.model.share_memory()
if self.gpu:
self.model.cuda()
# Set dictionary
self.dict = {}
self.dict["tgt"] = task.target_dictionary
self.dict["src"] = task.source_dictionary
@staticmethod
def add_args(parser):
# fmt: off
parser.add_argument('--model-path', type=str, required=True,
help='path to your pretrained model.')
parser.add_argument("--data-bin", type=str, required=True,
help="Path of data binary")
parser.add_argument("--max-len", type=int, default=100,
help="Max length of translation")
parser.add_argument("--tgt-splitter-type", type=str, default="SentencePiece",
help="Subword splitter type for target text.")
parser.add_argument("--tgt-splitter-path", type=str, default=None,
help="Subword splitter model path for target text.")
parser.add_argument("--src-splitter-type", type=str, default="SentencePiece",
help="Subword splitter type for source text.")
parser.add_argument("--src-splitter-path", type=str, default=None,
help="Subword splitter model path for source text.")
# fmt: on
return parser
def build_word_splitter(self, args):
self.spm = {}
for lang in ['src', 'tgt']:
if getattr(args, f'{lang}_splitter_type', None):
path = getattr(args, f'{lang}_splitter_path', None)
if path:
self.spm[lang] = spm.SentencePieceProcessor()
self.spm[lang].Load(path)
def segment_to_units(self, segment, states):
# Split a full word (segment) into subwords (units)
return self.spm['src'].EncodeAsPieces(segment)
def update_model_encoder(self, states):
if len(states.units.source) == 0:
return
src_indices = [
self.dict['src'].index(x)
for x in states.units.source.value
]
if states.finish_read():
# Append the eos index when the prediction is over
src_indices += [self.dict["tgt"].eos_index]
src_indices = self.to_device(
torch.LongTensor(src_indices).unsqueeze(0)
)
src_lengths = self.to_device(
torch.LongTensor([src_indices.size(1)])
)
states.encoder_states = self.model.encoder(src_indices, src_lengths)
torch.cuda.empty_cache()
def update_states_read(self, states):
# Happens after a read action.
self.update_model_encoder(states)
def units_to_segment(self, units, states):
# Merge sub words (units) to full word (segment).
# For Japanese, we can directly send
# the untokenized token to server except the BOS token
# with following option
# --sacrebleu-tokenizer MeCab
# --eval-latency-unit char
# --no-space
token = units.value.pop()
if (
token == self.dict["tgt"].eos_word
or len(states.segments.target) > self.max_len
):
return DEFAULT_EOS
if BOS_PREFIX == token:
return None
if token[0] == BOS_PREFIX:
return token[1:]
else:
return token
def policy(self, states):
if not getattr(states, "encoder_states", None):
# No encoder states, read a token first
return READ_ACTION
# encode previous predicted target tokens
tgt_indices = self.to_device(
torch.LongTensor(
[self.model.decoder.dictionary.eos()]
+ [
self.dict['tgt'].index(x)
for x in states.units.target.value
if x is not None
]
).unsqueeze(0)
)
# Current steps
states.incremental_states["steps"] = {
"src": states.encoder_states["encoder_out"][0].size(0),
"tgt": 1 + len(states.units.target),
}
# Online only means the reading is not finished
states.incremental_states["online"]["only"] = (
torch.BoolTensor([not states.finish_read()])
)
x, outputs = self.model.decoder.forward(
prev_output_tokens=tgt_indices,
encoder_out=states.encoder_states,
incremental_state=states.incremental_states,
)
states.decoder_out = x
torch.cuda.empty_cache()
if outputs.action == 0:
return READ_ACTION
else:
return WRITE_ACTION
def predict(self, states):
# Predict target token from decoder states
decoder_states = states.decoder_out
lprobs = self.model.get_normalized_probs(
[decoder_states[:, -1:]], log_probs=True
)
index = lprobs.argmax(dim=-1)[0, 0].item()
if index != self.dict['tgt'].eos_index:
token = self.dict['tgt'].string([index])
else:
token = self.dict['tgt'].eos_word
return token
| mit |
pytorch/fairseq | examples/MMPT/mmpt/processors/models/s3dg.py | 1 | 12416 | # This source code is licensed under the MIT license found in the
# LICENSE file in the root directory of this source tree.
"""Contains a PyTorch definition for Gated Separable 3D network (S3D-G)
with a text module for computing joint text-video embedding from raw text
and video input. The following code will enable you to load the HowTo100M
pretrained S3D Text-Video model from:
A. Miech, J.-B. Alayrac, L. Smaira, I. Laptev, J. Sivic and A. Zisserman,
End-to-End Learning of Visual Representations from Uncurated Instructional Videos.
https://arxiv.org/abs/1912.06430.
S3D-G was proposed by:
S. Xie, C. Sun, J. Huang, Z. Tu and K. Murphy,
Rethinking Spatiotemporal Feature Learning For Video Understanding.
https://arxiv.org/abs/1712.04851.
Tensorflow code: https://github.com/tensorflow/models/blob/master/research/slim/nets/s3dg.py
The S3D architecture was slightly modified with a space to depth trick for TPU
optimization.
"""
import torch as th
import torch.nn.functional as F
import torch.nn as nn
import os
import numpy as np
import re
class InceptionBlock(nn.Module):
def __init__(
self,
input_dim,
num_outputs_0_0a,
num_outputs_1_0a,
num_outputs_1_0b,
num_outputs_2_0a,
num_outputs_2_0b,
num_outputs_3_0b,
gating=True,
):
super(InceptionBlock, self).__init__()
self.conv_b0 = STConv3D(input_dim, num_outputs_0_0a, [1, 1, 1])
self.conv_b1_a = STConv3D(input_dim, num_outputs_1_0a, [1, 1, 1])
self.conv_b1_b = STConv3D(
num_outputs_1_0a, num_outputs_1_0b, [3, 3, 3], padding=1, separable=True
)
self.conv_b2_a = STConv3D(input_dim, num_outputs_2_0a, [1, 1, 1])
self.conv_b2_b = STConv3D(
num_outputs_2_0a, num_outputs_2_0b, [3, 3, 3], padding=1, separable=True
)
self.maxpool_b3 = th.nn.MaxPool3d((3, 3, 3), stride=1, padding=1)
self.conv_b3_b = STConv3D(input_dim, num_outputs_3_0b, [1, 1, 1])
self.gating = gating
self.output_dim = (
num_outputs_0_0a + num_outputs_1_0b + num_outputs_2_0b + num_outputs_3_0b
)
if gating:
self.gating_b0 = SelfGating(num_outputs_0_0a)
self.gating_b1 = SelfGating(num_outputs_1_0b)
self.gating_b2 = SelfGating(num_outputs_2_0b)
self.gating_b3 = SelfGating(num_outputs_3_0b)
def forward(self, input):
"""Inception block
"""
b0 = self.conv_b0(input)
b1 = self.conv_b1_a(input)
b1 = self.conv_b1_b(b1)
b2 = self.conv_b2_a(input)
b2 = self.conv_b2_b(b2)
b3 = self.maxpool_b3(input)
b3 = self.conv_b3_b(b3)
if self.gating:
b0 = self.gating_b0(b0)
b1 = self.gating_b1(b1)
b2 = self.gating_b2(b2)
b3 = self.gating_b3(b3)
return th.cat((b0, b1, b2, b3), dim=1)
class SelfGating(nn.Module):
def __init__(self, input_dim):
super(SelfGating, self).__init__()
self.fc = nn.Linear(input_dim, input_dim)
def forward(self, input_tensor):
"""Feature gating as used in S3D-G.
"""
spatiotemporal_average = th.mean(input_tensor, dim=[2, 3, 4])
weights = self.fc(spatiotemporal_average)
weights = th.sigmoid(weights)
return weights[:, :, None, None, None] * input_tensor
class STConv3D(nn.Module):
def __init__(
self, input_dim, output_dim, kernel_size, stride=1, padding=0, separable=False
):
super(STConv3D, self).__init__()
self.separable = separable
self.relu = nn.ReLU(inplace=True)
assert len(kernel_size) == 3
if separable and kernel_size[0] != 1:
spatial_kernel_size = [1, kernel_size[1], kernel_size[2]]
temporal_kernel_size = [kernel_size[0], 1, 1]
if isinstance(stride, list) and len(stride) == 3:
spatial_stride = [1, stride[1], stride[2]]
temporal_stride = [stride[0], 1, 1]
else:
spatial_stride = [1, stride, stride]
temporal_stride = [stride, 1, 1]
if isinstance(padding, list) and len(padding) == 3:
spatial_padding = [0, padding[1], padding[2]]
temporal_padding = [padding[0], 0, 0]
else:
spatial_padding = [0, padding, padding]
temporal_padding = [padding, 0, 0]
if separable:
self.conv1 = nn.Conv3d(
input_dim,
output_dim,
kernel_size=spatial_kernel_size,
stride=spatial_stride,
padding=spatial_padding,
bias=False,
)
self.bn1 = nn.BatchNorm3d(output_dim)
self.conv2 = nn.Conv3d(
output_dim,
output_dim,
kernel_size=temporal_kernel_size,
stride=temporal_stride,
padding=temporal_padding,
bias=False,
)
self.bn2 = nn.BatchNorm3d(output_dim)
else:
self.conv1 = nn.Conv3d(
input_dim,
output_dim,
kernel_size=kernel_size,
stride=stride,
padding=padding,
bias=False,
)
self.bn1 = nn.BatchNorm3d(output_dim)
def forward(self, input):
out = self.relu(self.bn1(self.conv1(input)))
if self.separable:
out = self.relu(self.bn2(self.conv2(out)))
return out
class MaxPool3dTFPadding(th.nn.Module):
def __init__(self, kernel_size, stride=None, padding="SAME"):
super(MaxPool3dTFPadding, self).__init__()
if padding == "SAME":
padding_shape = self._get_padding_shape(kernel_size, stride)
self.padding_shape = padding_shape
self.pad = th.nn.ConstantPad3d(padding_shape, 0)
self.pool = th.nn.MaxPool3d(kernel_size, stride, ceil_mode=True)
def _get_padding_shape(self, filter_shape, stride):
def _pad_top_bottom(filter_dim, stride_val):
pad_along = max(filter_dim - stride_val, 0)
pad_top = pad_along // 2
pad_bottom = pad_along - pad_top
return pad_top, pad_bottom
padding_shape = []
for filter_dim, stride_val in zip(filter_shape, stride):
pad_top, pad_bottom = _pad_top_bottom(filter_dim, stride_val)
padding_shape.append(pad_top)
padding_shape.append(pad_bottom)
depth_top = padding_shape.pop(0)
depth_bottom = padding_shape.pop(0)
padding_shape.append(depth_top)
padding_shape.append(depth_bottom)
return tuple(padding_shape)
def forward(self, inp):
inp = self.pad(inp)
out = self.pool(inp)
return out
class Sentence_Embedding(nn.Module):
def __init__(
self,
embd_dim,
num_embeddings=66250,
word_embedding_dim=300,
token_to_word_path="dict.npy",
max_words=16,
output_dim=2048,
):
super(Sentence_Embedding, self).__init__()
self.word_embd = nn.Embedding(num_embeddings, word_embedding_dim)
self.fc1 = nn.Linear(word_embedding_dim, output_dim)
self.fc2 = nn.Linear(output_dim, embd_dim)
self.word_to_token = {}
self.max_words = max_words
token_to_word = np.load(token_to_word_path)
for i, t in enumerate(token_to_word):
self.word_to_token[t] = i + 1
def _zero_pad_tensor_token(self, tensor, size):
if len(tensor) >= size:
return tensor[:size]
else:
zero = th.zeros(size - len(tensor)).long()
return th.cat((tensor, zero), dim=0)
def _split_text(self, sentence):
w = re.findall(r"[\w']+", str(sentence))
return w
def _words_to_token(self, words):
words = [
self.word_to_token[word] for word in words if word in self.word_to_token
]
if words:
we = self._zero_pad_tensor_token(th.LongTensor(words), self.max_words)
return we
else:
return th.zeros(self.max_words).long()
def _words_to_ids(self, x):
split_x = [self._words_to_token(self._split_text(sent.lower())) for sent in x]
return th.stack(split_x, dim=0)
def forward(self, x):
x = self._words_to_ids(x)
x = self.word_embd(x)
x = F.relu(self.fc1(x))
x = th.max(x, dim=1)[0]
x = self.fc2(x)
return {'text_embedding': x}
class S3D(nn.Module):
def __init__(self, dict_path, num_classes=512, gating=True, space_to_depth=True):
super(S3D, self).__init__()
self.num_classes = num_classes
self.gating = gating
self.space_to_depth = space_to_depth
if space_to_depth:
self.conv1 = STConv3D(
24, 64, [2, 4, 4], stride=1, padding=(1, 2, 2), separable=False
)
else:
self.conv1 = STConv3D(
3, 64, [3, 7, 7], stride=2, padding=(1, 3, 3), separable=False
)
self.conv_2b = STConv3D(64, 64, [1, 1, 1], separable=False)
self.conv_2c = STConv3D(64, 192, [3, 3, 3], padding=1, separable=True)
self.gating = SelfGating(192)
self.maxpool_2a = MaxPool3dTFPadding(
kernel_size=(1, 3, 3), stride=(1, 2, 2), padding="SAME"
)
self.maxpool_3a = MaxPool3dTFPadding(
kernel_size=(1, 3, 3), stride=(1, 2, 2), padding="SAME"
)
self.mixed_3b = InceptionBlock(192, 64, 96, 128, 16, 32, 32)
self.mixed_3c = InceptionBlock(
self.mixed_3b.output_dim, 128, 128, 192, 32, 96, 64
)
self.maxpool_4a = MaxPool3dTFPadding(
kernel_size=(3, 3, 3), stride=(2, 2, 2), padding="SAME"
)
self.mixed_4b = InceptionBlock(
self.mixed_3c.output_dim, 192, 96, 208, 16, 48, 64
)
self.mixed_4c = InceptionBlock(
self.mixed_4b.output_dim, 160, 112, 224, 24, 64, 64
)
self.mixed_4d = InceptionBlock(
self.mixed_4c.output_dim, 128, 128, 256, 24, 64, 64
)
self.mixed_4e = InceptionBlock(
self.mixed_4d.output_dim, 112, 144, 288, 32, 64, 64
)
self.mixed_4f = InceptionBlock(
self.mixed_4e.output_dim, 256, 160, 320, 32, 128, 128
)
self.maxpool_5a = self.maxPool3d_5a_2x2 = MaxPool3dTFPadding(
kernel_size=(2, 2, 2), stride=(2, 2, 2), padding="SAME"
)
self.mixed_5b = InceptionBlock(
self.mixed_4f.output_dim, 256, 160, 320, 32, 128, 128
)
self.mixed_5c = InceptionBlock(
self.mixed_5b.output_dim, 384, 192, 384, 48, 128, 128
)
self.fc = nn.Linear(self.mixed_5c.output_dim, num_classes)
self.text_module = Sentence_Embedding(num_classes,
token_to_word_path=dict_path)
def _space_to_depth(self, input):
"""3D space to depth trick for TPU optimization.
"""
B, C, T, H, W = input.shape
input = input.view(B, C, T // 2, 2, H // 2, 2, W // 2, 2)
input = input.permute(0, 3, 5, 7, 1, 2, 4, 6)
input = input.contiguous().view(B, 8 * C, T // 2, H // 2, W // 2)
return input
def forward(self, inputs):
"""Defines the S3DG base architecture."""
if self.space_to_depth:
inputs = self._space_to_depth(inputs)
net = self.conv1(inputs)
if self.space_to_depth:
# we need to replicate 'SAME' tensorflow padding
net = net[:, :, 1:, 1:, 1:]
net = self.maxpool_2a(net)
net = self.conv_2b(net)
net = self.conv_2c(net)
if self.gating:
net = self.gating(net)
net = self.maxpool_3a(net)
net = self.mixed_3b(net)
net = self.mixed_3c(net)
net = self.maxpool_4a(net)
net = self.mixed_4b(net)
net = self.mixed_4c(net)
net = self.mixed_4d(net)
net = self.mixed_4e(net)
net = self.mixed_4f(net)
net = self.maxpool_5a(net)
net = self.mixed_5b(net)
net = self.mixed_5c(net)
net = th.mean(net, dim=[2, 3, 4])
return {'video_embedding': self.fc(net), 'mixed_5c': net}
| mit |
agartland/utils | hclusterplot.py | 1 | 24750 | import matplotlib as mpl
import matplotlib.pyplot as plt
import matplotlib.gridspec as gridspec
from matplotlib.gridspec import GridSpec
import palettable
import pandas as pd
import scipy.spatial.distance as distance
import scipy.cluster.hierarchy as sch
from sklearn.cluster.bicluster import SpectralBiclustering, SpectralCoclustering
import numpy as np
import itertools
from corrplots import scatterfit
__all__ = ['plotHCluster',
'plotHColCluster',
'plotCorrHeatmap',
'mapColors2Labels',
'computeDMat',
'computeHCluster',
'plotBicluster',
'labeledDendrogram',
'clusterOrder']
def clean_axis(ax):
"""Remove ticks, tick labels, and frame from axis"""
ax.get_xaxis().set_ticks([])
ax.get_yaxis().set_ticks([])
for sp in list(ax.spines.values()):
sp.set_visible(False)
ax.grid(False)
ax.set_facecolor('white')
def mapColors2Labels(labels, setStr='Set3', cmap=None, returnLookup=False):
"""Return pd.Series of colors based on labels"""
if cmap is None:
N = max(3, min(12, len(np.unique(labels))))
cmap = palettable.colorbrewer.get_map(setStr, 'Qualitative', N).mpl_colors
cmapLookup = {k:col for k, col in zip(sorted(np.unique(labels)), itertools.cycle(cmap))}
if returnLookup:
return labels.map(cmapLookup.get), cmapLookup
else:
return labels.map(cmapLookup.get)
def computeDMat(df, metric=None, minN=1, dfunc=None):
if dfunc is None:
if metric in ['spearman', 'pearson']:
"""Anti-correlations are also considered as high similarity and will cluster together"""
"""dmat = 1 - df.corr(method = metric, min_periods = minN).values
dmat[np.isnan(dmat)] = 1
"""
dmat = 1 - df.corr(method = metric, min_periods = minN).values**2
dmat[np.isnan(dmat)] = 1
elif metric in ['spearman-signed', 'pearson-signed']:
"""Anti-correlations are considered as dissimilar and will NOT cluster together"""
dmat = (1 - df.corr(method = metric.replace('-signed', ''), min_periods = minN).values) / 2
dmat[np.isnan(dmat)] = 1
else:
dmat = distance.squareform(distance.pdist(df.T, metric = metric))
else:
ncols = df.shape[1]
dmat = np.zeros((ncols, ncols))
for i in range(ncols):
for j in range(ncols):
"""Assume its symetrical"""
if i<=j:
tmpdf = df.iloc[:, [i, j]]
tmpdf = tmpdf.dropna()
if tmpdf.shape[0] >= minN:
d = dfunc(df.iloc[:, i], df.iloc[:, j])
else:
d = np.nan
dmat[i, j] = d
dmat[j, i] = d
assert dmat.shape[0] == dmat.shape[1]
assert dmat.shape[0] == df.shape[1]
return dmat
def clusterOrder(df, axis=0, metric='correlation', method='complete'):
if axis == 0:
dvec = distance.pdist(df, metric=metric)
else:
dvec = distance.pdist(df.T, metric=metric)
clusters = sch.linkage(dvec, method=method)
den = sch.dendrogram(clusters, color_threshold=np.inf, no_plot=True)
if axis == 0:
order = df.index[den['leaves']].tolist()
else:
order = df.T.index[den['leaves']].tolist()
return order
def computeHCluster(dmat, method='complete'):
"""Compute dmat, clusters and dendrogram of df using
the linkage method and distance metric given"""
if dmat.shape[0] == dmat.shape[1]:
if type(dmat) is pd.DataFrame:
#compressedDmat = dmat.values[np.triu_indices_from(dmat.values)].ravel()
compressedDmat = distance.squareform(dmat.values)
else:
#compressedDmat = dmat[np.triu_indices_from(dmat)].ravel()
compressedDmat = distance.squareform(dmat)
else:
raise
clusters = sch.linkage(compressedDmat, method=method)
den = sch.dendrogram(clusters, color_threshold=np.inf, no_plot=True)
return clusters, den
def testData(rows=50,columns=20):
data = np.random.multivariate_normal(rand(columns), rand(columns, columns), rows)
df = pd.DataFrame(data, columns=[''.join([lett]*9) for lett in 'ABCDEFGHIJKLMNOPQRST'])
rowLabels = pd.Series(rand(rows).round(), index=df.index)
columnLabels = pd.Series(rand(columns).round(), index=df.columns)
return {'df':df,'row_labels':rowLabels,'col_labels':columnLabels}
def addColorbar(fig,cb_ax,data_ax,label='Correlation'):
"""Colorbar"""
cb = fig.colorbar(data_ax, cb_ax) # note that we could pass the norm explicitly with norm=my_norm
cb.set_label(label)
"""Make colorbar labels smaller"""
for t in cb.ax.yaxis.get_ticklabels():
t.set_fontsize('small')
def plotCorrHeatmap(df=None, metric='pearson', rowInd=None, colInd=None, col_labels=None, titleStr=None, vRange=None, tickSz='large', cmap=None, dmat=None, cbLabel='Correlation', minN=1):
"""Plot a heatmap of a column-wise distance matrix defined by metric (can be 'spearman' as well)
Can provide dmat as a pd.DataFrame instead of df.
Optionally supply a column index colInd to reorder the columns to match a previous clustering
Optionally, col_labels will define a color strip along the yaxis to show groups"""
fig = plt.gcf()
fig.clf()
if dmat is None and df is None:
print('Need to provide df or dmat')
return
elif df is None:
rowLabels = dmat.index
columnLabels = dmat.columns
dmat = dmat.values
elif dmat is None:
dmat = computeDMat(df, metric, minN=minN)
rowLabels = df.columns
columnLabels = df.columns
if cmap is None:
cmap = palettable.colorbrewer.diverging.RdBu_11_r.mpl_colormap
if colInd is None:
colInd = np.arange(dmat.shape[1])
if rowInd is None:
rowInd = colInd
if col_labels is None:
heatmapAX = fig.add_subplot(GridSpec(1, 1, left=0.05, bottom=0.05, right=0.78, top=0.85)[0, 0])
scale_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.87, bottom=0.05, right=0.93, top=0.85)[0, 0])
else:
col_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.05, bottom=0.05, right=0.08, top=0.85)[0, 0])
heatmapAX = fig.add_subplot(GridSpec(1, 1, left=0.11, bottom=0.05, right=0.78, top=0.85)[0, 0])
scale_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.87, bottom=0.05, right=0.93, top=0.85)[0, 0])
if vRange is None:
vmin, vmax = (-1, 1)
#vmin = dmat.flatten().min()
#vmax = dmat.flatten().max()
else:
vmin, vmax = vRange
my_norm = mpl.colors.Normalize(vmin=vmin, vmax=vmax)
"""Column label colorbar but along the rows"""
if not col_labels is None:
col_cbSE = mapColors2Labels(col_labels)
col_axi = col_cbAX.imshow([[x] for x in col_cbSE.iloc[rowInd].values],
interpolation='nearest',
aspect='auto',
origin='lower')
clean_axis(col_cbAX)
"""Heatmap plot"""
axi = heatmapAX.imshow(dmat[rowInd,:][:, colInd],
interpolation='nearest',
aspect='auto',
origin='lower',
norm=my_norm,
cmap=cmap)
clean_axis(heatmapAX)
"""Column tick labels along the rows"""
if tickSz is None:
heatmapAX.set_yticks([])
heatmapAX.set_xticks([])
else:
heatmapAX.set_yticks(np.arange(dmat.shape[1]))
heatmapAX.yaxis.set_ticks_position('right')
heatmapAX.set_yticklabels(rowLabels[colInd], fontsize=tickSz, fontname='Consolas')
"""Column tick labels"""
heatmapAX.set_xticks(np.arange(dmat.shape[1]))
heatmapAX.xaxis.set_ticks_position('top')
xlabelsL = heatmapAX.set_xticklabels(columnLabels[colInd], fontsize=tickSz, rotation=90, fontname='Consolas')
"""Remove the tick lines"""
for l in heatmapAX.get_xticklines() + heatmapAX.get_yticklines():
l.set_markersize(0)
addColorbar(fig, scale_cbAX, axi, label=cbLabel)
"""Add title as xaxis label"""
if not titleStr is None:
heatmapAX.set_xlabel(titleStr, size='x-large')
def plotHColCluster(df=None, col_dmat=None, method='complete', metric='euclidean', col_labels=None, titleStr=None, vRange=None, tickSz='medium', cmap=None, minN=1, K=None, labelCmap=None, noColorBar=False, interactive=False):
"""Perform hierarchical clustering on df columns and plot square heatmap of pairwise distances"""
if col_dmat is None and df is None:
print('Need to provide df or col_dmat')
return
elif df is None:
columnLabels = col_dmat.columns
col_dmat = col_dmat.values
colorbarLabel = ''
col_plot = col_dmat
elif col_dmat is None:
col_dmat = computeDMat(df, metric, minN=minN)
columnLabels = df.columns
if metric in ['spearman', 'pearson', 'spearman-signed', 'pearson-signed']:
"""If it's a correlation metric, plot Rho not the dmat"""
colorbarLabel = 'Correlation coefficient'
if metric in ['spearman-signed', 'pearson-signed']:
col_plot = df.corr(method=metric.replace('-signed', ''), min_periods=minN).values
else:
col_plot = df.corr(method=metric, min_periods=minN).values
else:
colorbarLabel = ''
col_plot = col_dmat
else:
col_plot = col_dmat
columnLabels = df.columns
colorbarLabel = ''
nCols = col_dmat.shape[1]
if cmap is None:
if metric in ['spearman', 'pearson', 'spearman-signed', 'pearson-signed']:
cmap = palettable.colorbrewer.diverging.RdBu_11_r.mpl_colormap
else:
cmap = palettable.colorbrewer.sequential.YlOrRd_9.mpl_colormap
col_clusters, col_den = computeHCluster(col_dmat, method)
if col_labels is None and not K is None:
col_labels = pd.Series(sch.fcluster(col_clusters, K, criterion='maxclust'), index=columnLabels)
if isinstance(col_plot, pd.DataFrame):
col_plot = col_plot.values
if vRange is None:
if metric in ['spearman', 'pearson', 'spearman-signed', 'pearson-signed']:
vmin, vmax = (-1, 1)
else:
vmin = col_plot.min()
vmax = col_plot.max()
else:
vmin, vmax = vRange
my_norm = mpl.colors.Normalize(vmin=vmin, vmax=vmax)
fig = plt.gcf()
fig.clf()
#heatmapGS = gridspec.GridSpec(1,4,wspace=0.0,width_ratios=[0.25,0.01,2,0.15])
if col_labels is None and K is None:
col_denAX = fig.add_subplot(GridSpec(1, 1, left=0.05, bottom=0.05, right=0.15, top=0.85)[0, 0])
heatmapAX = fig.add_subplot(GridSpec(1, 1, left=0.16, bottom=0.05, right=0.75, top=0.85)[0, 0])
if not noColorBar:
scale_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.94, bottom=0.05, right=0.97, top=0.85)[0, 0])
else:
"""TODO: work on row_cbAX so that I can have the data labels on the top and left"""
col_denAX = fig.add_subplot(GridSpec(1, 1, left=0.05, bottom=0.05, right=0.15, top=0.85)[0, 0])
col_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.16, bottom=0.05, right=0.19, top=0.85)[0, 0])
#row_cbAX = fig.add_subplot(GridSpec(1,1,left=0.2,bottom=0.83,right=0.75,top=0.86)[0,0])
heatmapAX = fig.add_subplot(GridSpec(1, 1, left=0.2, bottom=0.05, right=0.75, top=0.85)[0, 0])
if not noColorBar:
scale_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.94, bottom=0.05, right=0.97, top=0.85)[0, 0])
"""Column dendrogaram but along the rows"""
plt.sca(col_denAX)
col_denD = sch.dendrogram(col_clusters, color_threshold=np.inf, orientation='left')
colInd = col_denD['leaves']
clean_axis(col_denAX)
"""Column label colorbar but along the rows"""
if not col_labels is None:
col_cbSE = mapColors2Labels(col_labels, cmap=labelCmap)
col_axi = col_cbAX.imshow([[x] for x in col_cbSE.iloc[colInd].values], interpolation='nearest', aspect='auto', origin='lower')
clean_axis(col_cbAX)
"""Heatmap plot"""
axi = heatmapAX.imshow(col_plot[colInd,:][:, colInd],
interpolation='nearest',
aspect='auto',
origin='lower',
norm=my_norm,
cmap=cmap)
clean_axis(heatmapAX)
"""Column tick labels along the rows"""
if tickSz is None:
heatmapAX.set_yticks(())
heatmapAX.set_xticks(())
else:
heatmapAX.set_yticks(np.arange(nCols))
heatmapAX.yaxis.set_ticks_position('right')
heatmapAX.set_yticklabels(columnLabels[colInd], fontsize=tickSz, fontname='Consolas')
"""Column tick labels"""
heatmapAX.set_xticks(np.arange(nCols))
heatmapAX.xaxis.set_ticks_position('top')
xlabelsL = heatmapAX.set_xticklabels(columnLabels[colInd], fontsize=tickSz, rotation=90, fontname='Consolas')
"""Remove the tick lines"""
for l in heatmapAX.get_xticklines() + heatmapAX.get_yticklines():
l.set_markersize(0)
if not noColorBar:
addColorbar(fig, scale_cbAX, axi, label=colorbarLabel)
"""Add title as xaxis label"""
if not titleStr is None:
heatmapAX.set_xlabel(titleStr, size='x-large')
if interactive and not df is None:
scatterFig = plt.figure(fig.number + 100)
ps = PairScatter(df.iloc[:, colInd], heatmapAX, scatterFig.add_subplot(111), method=metric)
return colInd, ps
return colInd
def plot1DHClust(distDf, hclusters, labels=None, titleStr=None, vRange=None, tickSz='small', cmap=None, colorbarLabel=None, labelCmap=None, noColorBar=False):
"""Plot hierarchical clustering results (no computation)
I'm not even sure this is useful..."""
if cmap is None:
cmap = palettable.colorbrewer.sequential.YlOrRd_9.mpl_colormap
fig = plt.gcf()
fig.clf()
nCols = distDf.shape[0]
if labels is None:
col_denAX = fig.add_subplot(GridSpec(1, 1, left=0.05, bottom=0.05, right=0.15, top=0.85)[0, 0])
heatmapAX = fig.add_subplot(GridSpec(1, 1, left=0.16, bottom=0.05, right=0.78, top=0.85)[0, 0])
if not noColorBar:
scale_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.87, bottom=0.05, right=0.93, top=0.85)[0, 0])
else:
col_denAX = fig.add_subplot(GridSpec(1, 1, left=0.05, bottom=0.05, right=0.15, top=0.85)[0, 0])
col_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.16, bottom=0.05, right=0.19, top=0.85)[0, 0])
heatmapAX = fig.add_subplot(GridSpec(1, 1, left=0.2, bottom=0.05, right=0.78, top=0.85)[0, 0])
if not noColorBar:
scale_cbAX = fig.add_subplot(GridSpec(1, 1, left=0.87, bottom=0.05, right=0.93, top=0.85)[0, 0])
if vRange is None:
vmin = distDf.values.min()
vmax = distDf.vlaues.max()
else:
vmin, vmax = vRange
my_norm = mpl.colors.Normalize(vmin = vmin, vmax = vmax)
"""Column dendrogaram but along the rows"""
plt.axes(col_denAX)
colInd = hclusters['leaves']
clean_axis(col_denAX)
imshowOptions = dict(interpolation = 'nearest', aspect = 'auto', origin = 'lower')
"""Column label colorbar but along the rows"""
if not labels is None:
col_cbSE = mapColors2Labels(labels, cmap = labelCmap)
col_axi = col_cbAX.imshow([[x] for x in col_cbSE.iloc[colInd].values], **imshowOptions)
clean_axis(col_cbAX)
"""Heatmap plot"""
axi = heatmapAX.imshow(distDf.values[colInd,:][:, colInd], norm = my_norm, cmap = cmap, **imshowOptions)
clean_axis(heatmapAX)
"""Column tick labels along the rows"""
if tickSz is None:
heatmapAX.set_yticks(())
heatmapAX.set_xticks(())
else:
heatmapAX.set_yticks(np.arange(nCols))
heatmapAX.yaxis.set_ticks_position('right')
heatmapAX.set_yticklabels(distDf.columns[colInd], fontsize=tickSz, fontname='Consolas')
"""Column tick labels"""
heatmapAX.set_xticks(np.arange(nCols))
heatmapAX.xaxis.set_ticks_position('top')
xlabelsL = heatmapAX.set_xticklabels(distDf.columns[colInd], fontsize=tickSz, rotation=90, fontname='Consolas')
"""Remove the tick lines"""
for l in heatmapAX.get_xticklines() + heatmapAX.get_yticklines():
l.set_markersize(0)
if not noColorBar:
addColorbar(fig, scale_cbAX, axi, label=colorbarLabel)
"""Add title as xaxis label"""
if not titleStr is None:
heatmapAX.set_xlabel(titleStr, size='x-large')
def plotHCluster(df, method='complete', metric='euclidean', clusterBool=[True, True],row_labels=None, col_labels=None, vRange=None,titleStr=None,xTickSz='small',yTickSz='small',cmap=None,minN=1):
"""Perform hierarchical clustering on df data columns (and rows) and plot results as
dendrograms and heatmap.
df - pd.DataFrame(), will use index and column labels as tick labels
method and metric - parameters passed to scipy.spatial.distance.pdist and scipy.cluster.hierarchy.linkage
row_labels - pd.Series with index same as df with values indicating groups (optional)
col_labels - pd.Series with index same as columns in df with values indicating groups (optional)
vMinMax - optional scaling, [vmin, vmax] can be derived from data
clusterBool - [row, col] bool indicating whether to cluster along that axis
"""
if cmap is None:
cmap = palettable.colorbrewer.diverging.RdBu_11_r.mpl_colormap
if vRange is None:
vmin = df.min().min()
vmax = df.max().max()
else:
vmin, vmax = vRange
my_norm = mpl.colors.Normalize(vmin, vmax)
fig = plt.gcf()
fig.clf()
if clusterBool[1]:
heatmapGS = gridspec.GridSpec(3, 3, wspace=0.0, hspace=0.0, width_ratios=[0.15, 0.02, 1], height_ratios=[0.15, 0.02, 1])
else:
heatmapGS = gridspec.GridSpec(3, 3, wspace=0.0, hspace=0.0, width_ratios=[0.15, 0.02, 1], height_ratios=[0.001, 0.02, 1])
if clusterBool[0]:
row_dmat = computeDMat(df.T, metric, minN=minN)
row_clusters, row_den = computeHCluster(row_dmat, method)
"""Dendrogarams"""
row_denAX = fig.add_subplot(heatmapGS[2, 0])
row_denD = sch.dendrogram(row_clusters, color_threshold=np.inf, orientation='left')
clean_axis(row_denAX)
rowInd = row_denD['leaves']
else:
rowInd = np.arange(df.shape[0])
"""Row colorbar"""
if not row_labels is None:
"""NOTE: row_labels will not be index aware and must be in identical order as data"""
row_cbSE = mapColors2Labels(row_labels, 'Set1')
row_cbAX = fig.add_subplot(heatmapGS[2, 1])
row_axi = row_cbAX.imshow([[x] for x in row_cbSE.iloc[rowInd].values], interpolation='nearest', aspect='auto', origin='lower')
clean_axis(row_cbAX)
if clusterBool[1]:
col_dmat = computeDMat(df, metric, minN=minN)
col_clusters, col_den = computeHCluster(col_dmat, method)
"""Dendrogarams"""
col_denAX = fig.add_subplot(heatmapGS[0, 2])
col_denD = sch.dendrogram(col_clusters, color_threshold=np.inf)
clean_axis(col_denAX)
colInd = col_denD['leaves']
else:
colInd = np.arange(df.shape[1])
"""Column colorbar"""
if not col_labels is None:
col_cbSE = mapColors2Labels(col_labels)
col_cbAX = fig.add_subplot(heatmapGS[1, 2])
col_axi = col_cbAX.imshow([list(col_cbSE.iloc[colInd])], interpolation='nearest', aspect='auto', origin='lower')
clean_axis(col_cbAX)
"""Heatmap plot"""
heatmapAX = fig.add_subplot(heatmapGS[2, 2])
axi = heatmapAX.imshow(df.iloc[rowInd, colInd], interpolation='nearest', aspect='auto', origin='lower', norm=my_norm, cmap=cmap)
clean_axis(heatmapAX)
heatmapAX.grid(False)
"""Row tick labels"""
heatmapAX.set_yticks(np.arange(df.shape[0]))
ylabelsL = None
if not yTickSz is None:
heatmapAX.yaxis.set_ticks_position('right')
ylabelsL = heatmapAX.set_yticklabels(df.index[rowInd], fontsize=yTickSz, fontname='Consolas')
else:
ylabelsL = heatmapAX.set_yticklabels([])
"""Add title as xaxis label"""
if not titleStr is None:
heatmapAX.set_xlabel(titleStr, size='x-large')
"""Column tick labels"""
heatmapAX.set_xticks(np.arange(df.shape[1]))
xlabelsL = None
if not xTickSz is None:
xlabelsL = heatmapAX.set_xticklabels(df.columns[colInd], fontsize=xTickSz, rotation=90, fontname='Consolas')
"""Remove the tick lines"""
for l in heatmapAX.get_xticklines() + heatmapAX.get_yticklines():
l.set_markersize(0)
"""Colorbar"""
scaleGS = gridspec.GridSpec(10, 15, wspace=0., hspace=0.)
scale_cbAX = fig.add_subplot(scaleGS[:2, 0]) # colorbar for scale in upper left corner
cb = fig.colorbar(axi, scale_cbAX) # note that we could pass the norm explicitly with norm=my_norm
cb.set_label('Measurements')
cb.ax.yaxis.set_ticks_position('left') # move ticks to left side of colorbar to avoid problems with tight_layout
cb.ax.yaxis.set_label_position('left') # move label to left side of colorbar to avoid problems with tight_layout
#cb.outline.set_linewidth(0)
"""Make colorbar labels smaller"""
for t in cb.ax.yaxis.get_ticklabels():
t.set_fontsize('small')
scaleGS.tight_layout(fig, h_pad=0.0, w_pad=0.0)
heatmapGS.tight_layout(fig, h_pad=0.1, w_pad=0.5)
handles = dict(cb=cb, heatmapAX=heatmapAX, fig=fig, xlabelsL=xlabelsL, ylabelsL=ylabelsL, heatmapGS=heatmapGS)
return rowInd, colInd, handles
def plotBicluster(df, n_clusters, col_labels=None):
model = SpectralBiclustering(n_clusters=n_clusters, method='log', random_state=0)
model.fit(df)
fitDf = df.iloc[np.argsort(model.row_labels_),:]
fitDf = fitDf.iloc[:, np.argsort(model.column_labels_)]
plotCorrHeatmap(dmat=fitDf, col_labels=col_labels)
return fitDf
def normalizeAxis(df,axis=0,useMedian=False):
"""Normalize along the specified axis by
subtracting the mean and dividing by the stdev.
Uses df functions that ignore NAs
Parameters
----------
df : pd.DataFrame
axis : int
Normalization along this axis. (e.g. df.mean(axis=axis))
Returns
-------
out : pd.DataFrame"""
tmp = df.copy()
retile = ones(len(df.shape))
retile[axis] = df.shape[axis]
if useMedian:
tmp = tmp - tile(tmp.median(axis=axis).values, retile)
else:
tmp = tmp - tile(tmp.mean(axis=axis).values, retile)
tmp = tmp / tile(tmp.std(axis=axis).values, retile)
return tmp
class PairScatter:
"""Instantiate this class to interactively pair
a heatmap and a pairwise scatterfit plot in a new figure window."""
def __init__(self, df, heatmapAx, scatterAx, method):
self.scatterAx = scatterAx
self.heatmapAx = heatmapAx
self.df = df
self.method = method
self.cid = heatmapAx.figure.canvas.mpl_connect('button_press_event', self)
def __call__(self, event):
if event.inaxes != self.heatmapAx:
return
else:
xind = int(np.floor(event.xdata + 0.5))
yind = int(np.floor(event.ydata + 0.5))
plt.sca(self.scatterAx)
plt.cla()
scatterfit(self.df.iloc[:, xind], self.df.iloc[:, yind], method = self.method, plotLine = True)
self.scatterAx.figure.show()
def labeledDendrogram(dmat, labels, method='complete', cmap=None):
"""Perform hierarchical clustering on df columns and plot square heatmap of pairwise distances"""
"""TODO: add tick labels, with sparsity option"""
Z = sch.linkage(dmat, method=method)
den = sch.dendrogram(Z, color_threshold=np.inf, no_plot=True)
figh = plt.gcf()
figh.clf()
denAX = figh.add_axes([0.32, 0.05, 0.6, 0.9])
cbAX = figh.add_axes([0.25, 0.05, 0.05, 0.9])
plt.sca(denAX)
denD = sch.dendrogram(Z, color_threshold=np.inf, orientation='left')
ind = denD['leaves']
clean_axis(denAX)
cbSE, lookup = mapColors2Labels(labels, cmap=cmap, returnLookup=True)
axi = cbAX.imshow([[x] for x in cbSE.iloc[ind].values],
interpolation='nearest',
aspect='auto',
origin='lower')
clean_axis(cbAX)
colorLegend(list(lookup.values()), list(lookup.keys()), axh=denAX)
| mit |
tlby/mxnet | tests/nightly/estimator/test_sentiment_rnn.py | 5 | 11113 | # Licensed to the Apache Software Foundation (ASF) under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
# "License"); you may not use this file except in compliance
# with the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
# KIND, either express or implied. See the License for the
# specific language governing permissions and limitations
# under the License.
"""Gluon Text Sentiment Classification Example using RNN/CNN
Example modified from below link:
https://github.com/d2l-ai/d2l-en/blob/master/chapter_natural-language-processing/sentiment-analysis-rnn.md
https://github.com/d2l-ai/d2l-en/blob/master/chapter_natural-language-processing/sentiment-analysis-cnn.md"""
import collections
import os
import random
import sys
import tarfile
import mxnet as mx
from mxnet import nd, gluon
from mxnet.contrib import text
from mxnet.gluon import nn, rnn
from mxnet.gluon.contrib.estimator import estimator
import pytest
class TextCNN(nn.Block):
def __init__(self, vocab, embed_size, kernel_sizes, num_channels,
**kwargs):
super(TextCNN, self).__init__(**kwargs)
self.embedding = nn.Embedding(len(vocab), embed_size)
# The embedding layer does not participate in training
self.constant_embedding = nn.Embedding(len(vocab), embed_size)
self.dropout = nn.Dropout(0.5)
self.decoder = nn.Dense(2)
# The max-over-time pooling layer has no weight, so it can share an
# instance
self.pool = nn.GlobalMaxPool1D()
# Create multiple one-dimensional convolutional layers
self.convs = nn.Sequential()
for c, k in zip(num_channels, kernel_sizes):
self.convs.add(nn.Conv1D(c, k, activation='relu'))
def forward(self, inputs):
# Concatenate the output of two embedding layers with shape of
# (batch size, number of words, word vector dimension) by word vector
embeddings = mx.np.concatenate(
[self.embedding(inputs), self.constant_embedding(inputs)], axis=2)
# According to the input format required by Conv1D, the word vector
# dimension, that is, the channel dimension of the one-dimensional
# convolutional layer, is transformed into the previous dimension
embeddings = embeddings.transpose((0, 2, 1))
# For each one-dimensional convolutional layer, after max-over-time
# pooling, an NDArray with the shape of (batch size, channel size, 1)
# can be obtained. Use the flatten function to remove the last
# dimension and then concatenate on the channel dimension
encoding = mx.np.concatenate([mx.npx.batch_flatten(
self.pool(conv(embeddings))) for conv in self.convs], axis=1)
# After applying the dropout method, use a fully connected layer to
# obtain the output
outputs = self.decoder(self.dropout(encoding))
return outputs
class BiRNN(nn.Block):
def __init__(self, vocab, embed_size, num_hiddens, num_layers, **kwargs):
super(BiRNN, self).__init__(**kwargs)
self.embedding = nn.Embedding(len(vocab), embed_size)
# Set Bidirectional to True to get a bidirectional recurrent neural
# network
self.encoder = rnn.LSTM(num_hiddens, num_layers=num_layers,
bidirectional=True, input_size=embed_size)
self.decoder = nn.Dense(2)
def forward(self, inputs):
# The shape of inputs is (batch size, number of words). Because LSTM
# needs to use sequence as the first dimension, the input is
# transformed and the word feature is then extracted. The output shape
# is (number of words, batch size, word vector dimension).
embeddings = self.embedding(inputs.T)
# The shape of states is (number of words, batch size, 2 * number of
# hidden units).
states = self.encoder(embeddings)
# Concatenate the hidden states of the initial time step and final
# time step to use as the input of the fully connected layer. Its
# shape is (batch size, 4 * number of hidden units)
encoding = mx.np.concatenate([states[0], states[-1]], axis=1)
outputs = self.decoder(encoding)
return outputs
def download_imdb(data_dir='/tmp/data'):
'''
Download and extract the IMDB dataset
'''
# Large Movie Review Dataset from http://ai.stanford.edu/~amaas/data/sentiment/
# Note this dataset is copyright to Andrew Maas and Stanford AI Lab
# @InProceedings{maas-EtAl:2011:ACL-HLT2011,
# author = {Maas, Andrew L. and Daly, Raymond E. and Pham, Peter T. and Huang, Dan and Ng, Andrew Y. and Potts, Christopher},
# title = {Learning Word Vectors for Sentiment Analysis},
# booktitle = {Proceedings of the 49th Annual Meeting of the Association for Computational Linguistics: Human Language Technologies},
# month = {June},
# year = {2011},
# address = {Portland, Oregon, USA},
# publisher = {Association for Computational Linguistics},
# pages = {142--150},
# url = {http://www.aclweb.org/anthology/P11-1015}
# }
url = ('https://aws-ml-platform-datasets.s3.amazonaws.com/imdb/aclImdb_v1.tar.gz')
sha1 = '01ada507287d82875905620988597833ad4e0903'
if not os.path.exists(data_dir):
os.makedirs(data_dir)
file_path = os.path.join(data_dir, 'aclImdb_v1.tar.gz')
if not os.path.isfile(file_path):
file_path = gluon.utils.download(url, data_dir, sha1_hash=sha1)
with tarfile.open(file_path, 'r') as f:
f.extractall(data_dir)
def read_imdb(folder='train'):
'''
Read the IMDB dataset
'''
data = []
for label in ['pos', 'neg']:
folder_name = os.path.join('/tmp/data/aclImdb/', folder, label)
for file in os.listdir(folder_name):
with open(os.path.join(folder_name, file), 'rb') as f:
review = f.read().decode('utf-8').replace('\n', '').lower()
data.append([review, 1 if label == 'pos' else 0])
random.shuffle(data)
return data
def get_tokenized_imdb(data):
'''
Tokenized the words
'''
def tokenizer(text):
return [tok.lower() for tok in text.split(' ')]
return [tokenizer(review) for review, _ in data]
def get_vocab_imdb(data):
'''
Get the indexed tokens
'''
tokenized_data = get_tokenized_imdb(data)
counter = collections.Counter([tk for st in tokenized_data for tk in st])
return text.vocab.Vocabulary(counter, min_freq=5)
def preprocess_imdb(data, vocab):
'''
Make the length of each comment 500 by truncating or adding 0s
'''
max_l = 500
def pad(x):
return x[:max_l] if len(x) > max_l else x + [0] * (max_l - len(x))
tokenized_data = get_tokenized_imdb(data)
features = mx.np.array([pad(vocab.to_indices(x)) for x in tokenized_data])
labels = mx.np.array([score for _, score in data])
return features, labels
def run(net, train_dataloader, test_dataloader, num_epochs, ctx, lr):
'''
Train a test sentiment model
'''
# Define trainer
trainer = mx.gluon.Trainer(net.collect_params(), 'adam', {'learning_rate': lr})
# Define loss and evaluation metrics
loss = gluon.loss.SoftmaxCrossEntropyLoss()
metrics = mx.gluon.metric.CompositeEvalMetric()
acc = mx.gluon.metric.Accuracy()
nested_metrics = mx.gluon.metric.CompositeEvalMetric()
metrics.add([acc, mx.gluon.metric.Loss()])
nested_metrics.add([metrics, mx.gluon.metric.Accuracy()])
# Define estimator
est = estimator.Estimator(net=net, loss=loss, train_metrics=nested_metrics,
trainer=trainer, context=ctx)
# Begin training
est.fit(train_data=train_dataloader, val_data=test_dataloader,
epochs=num_epochs)
return acc
def test_estimator_cpu():
'''
Test estimator by doing one pass over each model with synthetic data
'''
models = ['TextCNN', 'BiRNN']
ctx = mx.cpu()
batch_size = 64
embed_size = 100
lr = 1
num_epochs = 1
train_data = mx.np.random.randint(low=0, high=100, size=(2 * batch_size, 500))
train_label = mx.np.random.randint(low=0, high=2, size=(2 * batch_size,))
val_data = mx.np.random.randint(low=0, high=100, size=(batch_size, 500))
val_label = mx.np.random.randint(low=0, high=2, size=(batch_size,))
train_dataloader = gluon.data.DataLoader(dataset=gluon.data.ArrayDataset(train_data, train_label),
batch_size=batch_size, shuffle=True)
val_dataloader = gluon.data.DataLoader(dataset=gluon.data.ArrayDataset(val_data, val_label),
batch_size=batch_size)
vocab_list = mx.np.zeros(shape=(100,))
# Get the model
for model in models:
if model == 'TextCNN':
kernel_sizes, nums_channels = [3, 4, 5], [100, 100, 100]
net = TextCNN(vocab_list, embed_size, kernel_sizes, nums_channels)
else:
num_hiddens, num_layers = 100, 2
net = BiRNN(vocab_list, embed_size, num_hiddens, num_layers)
net.initialize(mx.init.Xavier(), ctx=ctx)
run(net, train_dataloader, val_dataloader, num_epochs=num_epochs, ctx=ctx, lr=lr)
@pytest.mark.seed(7) # using fixed seed to reduce flakiness in accuracy assertion
@pytest.mark.skipif(mx.device.num_gpus() < 1, reason="skip if no GPU")
def test_estimator_gpu():
'''
Test estimator by training Bidirectional RNN for 5 epochs on the IMDB dataset
and verify accuracy
'''
ctx = mx.gpu(0)
batch_size = 64
num_epochs = 5
embed_size = 100
lr = 0.01
# data
download_imdb()
train_data, test_data = read_imdb('train'), read_imdb('test')
vocab = get_vocab_imdb(train_data)
train_set = gluon.data.ArrayDataset(*preprocess_imdb(train_data, vocab))
test_set = gluon.data.ArrayDataset(*preprocess_imdb(test_data, vocab))
train_dataloader = gluon.data.DataLoader(train_set, batch_size, shuffle=True)
test_dataloader = gluon.data.DataLoader(test_set, batch_size)
# Model
num_hiddens, num_layers = 100, 2
net = BiRNN(vocab, embed_size, num_hiddens, num_layers)
net.initialize(mx.init.Xavier(), ctx=ctx)
net.hybridize()
glove_embedding = text.embedding.create(
'glove', pretrained_file_name='glove.6B.100d.txt', vocabulary=vocab)
net.embedding.weight.set_data(glove_embedding.idx_to_vec)
net.embedding.setattr('grad_req', 'null')
acc = run(net, train_dataloader, test_dataloader, num_epochs=num_epochs, ctx=ctx, lr=lr)
assert acc.get()[1] > 0.70
| apache-2.0 |
PaddlePaddle/models | tutorials/mobilenetv3_prod/Step1-5/torch2paddle.py | 1 | 1070 | import numpy as np
import torch
import paddle
def torch2paddle():
torch_path = "./data/mobilenet_v3_small-047dcff4.pth"
paddle_path = "./data/mv3_small_paddle.pdparams"
torch_state_dict = torch.load(torch_path)
fc_names = ["classifier"]
paddle_state_dict = {}
for k in torch_state_dict:
if "num_batches_tracked" in k:
continue
v = torch_state_dict[k].detach().cpu().numpy()
flag = [i in k for i in fc_names]
if any(flag) and "weight" in k: # ignore bias
new_shape = [1, 0] + list(range(2, v.ndim))
print(
f"name: {k}, ori shape: {v.shape}, new shape: {v.transpose(new_shape).shape}"
)
v = v.transpose(new_shape)
k = k.replace("running_var", "_variance")
k = k.replace("running_mean", "_mean")
# if k not in model_state_dict:
if False:
print(k)
else:
paddle_state_dict[k] = v
paddle.save(paddle_state_dict, paddle_path)
if __name__ == "__main__":
torch2paddle()
| apache-2.0 |
wilsonkichoi/zipline | zipline/utils/events.py | 3 | 21726 | #
# Copyright 2014 Quantopian, Inc.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from abc import ABCMeta, abstractmethod
from collections import namedtuple
import six
import datetime
import pandas as pd
import pytz
from .context_tricks import nop_context
__all__ = [
'EventManager',
'Event',
'EventRule',
'StatelessRule',
'ComposedRule',
'Always',
'Never',
'AfterOpen',
'BeforeClose',
'NotHalfDay',
'NthTradingDayOfWeek',
'NDaysBeforeLastTradingDayOfWeek',
'NthTradingDayOfMonth',
'NDaysBeforeLastTradingDayOfMonth',
'StatefulRule',
'OncePerDay',
# Factory API
'date_rules',
'time_rules',
'make_eventrule',
]
MAX_MONTH_RANGE = 26
MAX_WEEK_RANGE = 5
def naive_to_utc(ts):
"""
Converts a UTC tz-naive timestamp to a tz-aware timestamp.
"""
# Drop the nanoseconds field. warn=False suppresses the warning
# that we are losing the nanoseconds; however, this is intended.
return pd.Timestamp(ts.to_pydatetime(warn=False), tz='UTC')
def ensure_utc(time, tz='UTC'):
"""
Normalize a time. If the time is tz-naive, assume it is UTC.
"""
if not time.tzinfo:
time = time.replace(tzinfo=pytz.timezone(tz))
return time.replace(tzinfo=pytz.utc)
def _coerce_datetime(maybe_dt):
if isinstance(maybe_dt, datetime.datetime):
return maybe_dt
elif isinstance(maybe_dt, datetime.date):
return datetime.datetime(
year=maybe_dt.year,
month=maybe_dt.month,
day=maybe_dt.day,
tzinfo=pytz.utc,
)
elif isinstance(maybe_dt, (tuple, list)) and len(maybe_dt) == 3:
year, month, day = maybe_dt
return datetime.datetime(
year=year,
month=month,
day=day,
tzinfo=pytz.utc,
)
else:
raise TypeError('Cannot coerce %s into a datetime.datetime'
% type(maybe_dt).__name__)
def _out_of_range_error(a, b=None, var='offset'):
start = 0
if b is None:
end = a - 1
else:
start = a
end = b - 1
return ValueError(
'{var} must be in between {start} and {end} inclusive'.format(
var=var,
start=start,
end=end,
)
)
def _td_check(td):
seconds = td.total_seconds()
# 23400 seconds is 6 hours and 30 minutes.
if 60 <= seconds <= 23400:
return td
else:
raise ValueError('offset must be in between 1 minute and 6 hours and'
' 30 minutes inclusive')
def _build_offset(offset, kwargs, default):
"""
Builds the offset argument for event rules.
"""
if offset is None:
if not kwargs:
return default # use the default.
else:
return _td_check(datetime.timedelta(**kwargs))
elif kwargs:
raise ValueError('Cannot pass kwargs and an offset')
elif isinstance(offset, datetime.timedelta):
return _td_check(offset)
else:
raise TypeError("Must pass 'hours' and/or 'minutes' as keywords")
def _build_date(date, kwargs):
"""
Builds the date argument for event rules.
"""
if date is None:
if not kwargs:
raise ValueError('Must pass a date or kwargs')
else:
return datetime.date(**kwargs)
elif kwargs:
raise ValueError('Cannot pass kwargs and a date')
else:
return date
def _build_time(time, kwargs):
"""
Builds the time argument for event rules.
"""
tz = kwargs.pop('tz', 'UTC')
if time:
if kwargs:
raise ValueError('Cannot pass kwargs and a time')
else:
return ensure_utc(time, tz)
elif not kwargs:
raise ValueError('Must pass a time or kwargs')
else:
return datetime.time(**kwargs)
class EventManager(object):
"""Manages a list of Event objects.
This manages the logic for checking the rules and dispatching to the
handle_data function of the Events.
Parameters
----------
create_context : (BarData) -> context manager, optional
An optional callback to produce a context manager to wrap the calls
to handle_data. This will be passed the current BarData.
"""
def __init__(self, create_context=None):
self._events = []
self._create_context = (
create_context
if create_context is not None else
lambda *_: nop_context
)
def add_event(self, event, prepend=False):
"""
Adds an event to the manager.
"""
if prepend:
self._events.insert(0, event)
else:
self._events.append(event)
def handle_data(self, context, data, dt):
with self._create_context(data):
for event in self._events:
event.handle_data(
context,
data,
dt,
context.trading_environment,
)
class Event(namedtuple('Event', ['rule', 'callback'])):
"""
An event is a pairing of an EventRule and a callable that will be invoked
with the current algorithm context, data, and datetime only when the rule
is triggered.
"""
def __new__(cls, rule=None, callback=None):
callback = callback or (lambda *args, **kwargs: None)
return super(cls, cls).__new__(cls, rule=rule, callback=callback)
def handle_data(self, context, data, dt, env):
"""
Calls the callable only when the rule is triggered.
"""
if self.rule.should_trigger(dt, env):
self.callback(context, data)
class EventRule(six.with_metaclass(ABCMeta)):
@abstractmethod
def should_trigger(self, dt, env):
"""
Checks if the rule should trigger with its current state.
This method should be pure and NOT mutate any state on the object.
"""
raise NotImplementedError('should_trigger')
class StatelessRule(EventRule):
"""
A stateless rule has no observable side effects.
This is reentrant and will always give the same result for the
same datetime.
Because these are pure, they can be composed to create new rules.
"""
def and_(self, rule):
"""
Logical and of two rules, triggers only when both rules trigger.
This follows the short circuiting rules for normal and.
"""
return ComposedRule(self, rule, ComposedRule.lazy_and)
__and__ = and_
class ComposedRule(StatelessRule):
"""
A rule that composes the results of two rules with some composing function.
The composing function should be a binary function that accepts the results
first(dt) and second(dt) as positional arguments.
For example, operator.and_.
If lazy=True, then the lazy composer is used instead. The lazy composer
expects a function that takes the two should_trigger functions and the
datetime. This is useful of you don't always want to call should_trigger
for one of the rules. For example, this is used to implement the & and |
operators so that they will have the same short circuit logic that is
expected.
"""
def __init__(self, first, second, composer):
if not (isinstance(first, StatelessRule) and
isinstance(second, StatelessRule)):
raise ValueError('Only two StatelessRules can be composed')
self.first = first
self.second = second
self.composer = composer
def should_trigger(self, dt, env):
"""
Composes the two rules with a lazy composer.
"""
return self.composer(
self.first.should_trigger,
self.second.should_trigger,
dt,
env
)
@staticmethod
def lazy_and(first_should_trigger, second_should_trigger, dt, env):
"""
Lazily ands the two rules. This will NOT call the should_trigger of the
second rule if the first one returns False.
"""
return first_should_trigger(dt, env) and second_should_trigger(dt, env)
class Always(StatelessRule):
"""
A rule that always triggers.
"""
@staticmethod
def always_trigger(dt, env):
"""
A should_trigger implementation that will always trigger.
"""
return True
should_trigger = always_trigger
class Never(StatelessRule):
"""
A rule that never triggers.
"""
@staticmethod
def never_trigger(dt, env):
"""
A should_trigger implementation that will never trigger.
"""
return False
should_trigger = never_trigger
class AfterOpen(StatelessRule):
"""
A rule that triggers for some offset after the market opens.
Example that triggers after 30 minutes of the market opening:
>>> AfterOpen(minutes=30)
"""
def __init__(self, offset=None, **kwargs):
self.offset = _build_offset(
offset,
kwargs,
datetime.timedelta(minutes=1), # Defaults to the first minute.
)
self._period_start = None
self._period_end = None
self._period_close = None
self._one_minute = datetime.timedelta(minutes=1)
def calculate_dates(self, dt, env):
# given a dt, find that day's open and period end (open + offset)
self._period_start, self._period_close = env.get_open_and_close(dt)
self._period_end = \
self._period_start + self.offset - self._one_minute
def should_trigger(self, dt, env):
# There are two reasons why we might want to recalculate the dates.
# One is the first time we ever call should_trigger, when
# self._period_start is none. The second is when we're on a new day,
# and need to recalculate the dates. For performance reasons, we rely
# on the fact that our clock only ever ticks forward, since it's
# cheaper to do dt1 <= dt2 than dt1.date() != dt2.date(). This means
# that we will NOT correctly recognize a new date if we go backwards
# in time(which should never happen in a simulation, or in a live
# trading environment)
if (
self._period_start is None or
self._period_close <= dt
):
self.calculate_dates(dt, env)
return dt == self._period_end
class BeforeClose(StatelessRule):
"""
A rule that triggers for some offset time before the market closes.
Example that triggers for the last 30 minutes every day:
>>> BeforeClose(minutes=30)
"""
def __init__(self, offset=None, **kwargs):
self.offset = _build_offset(
offset,
kwargs,
datetime.timedelta(minutes=1), # Defaults to the last minute.
)
self._period_start = None
self._period_end = None
self._one_minute = datetime.timedelta(minutes=1)
def calculate_dates(self, dt, env):
# given a dt, find that day's close and period start (close - offset)
self._period_end = env.get_open_and_close(dt)[1]
self._period_start = \
self._period_end - self.offset
self._period_close = self._period_end
def should_trigger(self, dt, env):
# There are two reasons why we might want to recalculate the dates.
# One is the first time we ever call should_trigger, when
# self._period_start is none. The second is when we're on a new day,
# and need to recalculate the dates. For performance reasons, we rely
# on the fact that our clock only ever ticks forward, since it's
# cheaper to do dt1 <= dt2 than dt1.date() != dt2.date(). This means
# that we will NOT correctly recognize a new date if we go backwards
# in time(which should never happen in a simulation, or in a live
# trading environment)
if (
self._period_start is None or
self._period_close <= dt
):
self.calculate_dates(dt, env)
return self._period_start == dt
class NotHalfDay(StatelessRule):
"""
A rule that only triggers when it is not a half day.
"""
def should_trigger(self, dt, env):
return dt.date() not in env.early_closes
class TradingDayOfWeekRule(six.with_metaclass(ABCMeta, StatelessRule)):
def __init__(self, n=0):
if not 0 <= abs(n) < MAX_WEEK_RANGE:
raise _out_of_range_error(MAX_WEEK_RANGE)
self.td_delta = n
self.next_date_start = None
self.next_date_end = None
self.next_midnight_timestamp = None
@abstractmethod
def date_func(self, dt, env):
raise NotImplementedError
def calculate_start_and_end(self, dt, env):
next_trading_day = _coerce_datetime(
env.add_trading_days(
self.td_delta,
self.date_func(dt, env),
)
)
# If after applying the offset to the start/end day of the week, we get
# day in a different week, skip this week and go on to the next
while next_trading_day.isocalendar()[1] != dt.isocalendar()[1]:
dt += datetime.timedelta(days=7)
next_trading_day = _coerce_datetime(
env.add_trading_days(
self.td_delta,
self.date_func(dt, env),
)
)
next_open, next_close = env.get_open_and_close(next_trading_day)
self.next_date_start = next_open
self.next_date_end = next_close
self.next_midnight_timestamp = next_trading_day
def should_trigger(self, dt, env):
if self.next_date_start is None:
# First time this method has been called. Calculate the midnight,
# open, and close for the first trigger, which occurs on the week
# of the simulation start
self.calculate_start_and_end(dt, env)
# If we've passed the trigger, calculate the next one
if dt > self.next_date_end:
self.calculate_start_and_end(self.next_date_end +
datetime.timedelta(days=7),
env)
# if the given dt is within the next matching day, return true.
if self.next_date_start <= dt <= self.next_date_end or \
dt == self.next_midnight_timestamp:
return True
return False
class NthTradingDayOfWeek(TradingDayOfWeekRule):
"""
A rule that triggers on the nth trading day of the week.
This is zero-indexed, n=0 is the first trading day of the week.
"""
@staticmethod
def get_first_trading_day_of_week(dt, env):
prev = dt
dt = env.previous_trading_day(dt)
# If we're on the first trading day of the TradingEnvironment,
# calling previous_trading_day on it will return None, which
# will blow up when we try and call .date() on it. The first
# trading day of the env is also the first trading day of the
# week(in the TradingEnvironment, at least), so just return
# that date.
if dt is None:
return prev
while dt.date().weekday() < prev.date().weekday():
prev = dt
dt = env.previous_trading_day(dt)
if dt is None:
return prev
if env.is_trading_day(prev):
return prev.date()
else:
return env.next_trading_day(prev).date()
date_func = get_first_trading_day_of_week
class NDaysBeforeLastTradingDayOfWeek(TradingDayOfWeekRule):
"""
A rule that triggers n days before the last trading day of the week.
"""
def __init__(self, n):
super(NDaysBeforeLastTradingDayOfWeek, self).__init__(-n)
@staticmethod
def get_last_trading_day_of_week(dt, env):
prev = dt
dt = env.next_trading_day(dt)
# Traverse forward until we hit a week border, then jump back to the
# previous trading day.
while dt.date().weekday() > prev.date().weekday():
prev = dt
dt = env.next_trading_day(dt)
if env.is_trading_day(prev):
return prev.date()
else:
return env.previous_trading_day(prev).date()
date_func = get_last_trading_day_of_week
class NthTradingDayOfMonth(StatelessRule):
"""
A rule that triggers on the nth trading day of the month.
This is zero-indexed, n=0 is the first trading day of the month.
"""
def __init__(self, n=0):
if not 0 <= n < MAX_MONTH_RANGE:
raise _out_of_range_error(MAX_MONTH_RANGE)
self.td_delta = n
self.month = None
self.day = None
def should_trigger(self, dt, env):
return self.get_nth_trading_day_of_month(dt, env) == dt.date()
def get_nth_trading_day_of_month(self, dt, env):
if self.month == dt.month:
# We already computed the day for this month.
return self.day
if not self.td_delta:
self.day = self.get_first_trading_day_of_month(dt, env)
else:
self.day = env.add_trading_days(
self.td_delta,
self.get_first_trading_day_of_month(dt, env),
).date()
return self.day
def get_first_trading_day_of_month(self, dt, env):
self.month = dt.month
dt = dt.replace(day=1)
self.first_day = (dt if env.is_trading_day(dt)
else env.next_trading_day(dt)).date()
return self.first_day
class NDaysBeforeLastTradingDayOfMonth(StatelessRule):
"""
A rule that triggers n days before the last trading day of the month.
"""
def __init__(self, n=0):
if not 0 <= n < MAX_MONTH_RANGE:
raise _out_of_range_error(MAX_MONTH_RANGE)
self.td_delta = -n
self.month = None
self.day = None
def should_trigger(self, dt, env):
return self.get_nth_to_last_trading_day_of_month(dt, env) == dt.date()
def get_nth_to_last_trading_day_of_month(self, dt, env):
if self.month == dt.month:
# We already computed the last day for this month.
return self.day
if not self.td_delta:
self.day = self.get_last_trading_day_of_month(dt, env)
else:
self.day = env.add_trading_days(
self.td_delta,
self.get_last_trading_day_of_month(dt, env),
).date()
return self.day
def get_last_trading_day_of_month(self, dt, env):
self.month = dt.month
if dt.month == 12:
# Roll the year forward and start in January.
year = dt.year + 1
month = 1
else:
# Increment the month in the same year.
year = dt.year
month = dt.month + 1
self.last_day = env.previous_trading_day(
dt.replace(year=year, month=month, day=1)
).date()
return self.last_day
# Stateful rules
class StatefulRule(EventRule):
"""
A stateful rule has state.
This rule will give different results for the same datetimes depending
on the internal state that this holds.
StatefulRules wrap other rules as state transformers.
"""
def __init__(self, rule=None):
self.rule = rule or Always()
def new_should_trigger(self, callable_):
"""
Replace the should trigger implementation for the current rule.
"""
self.should_trigger = callable_
class OncePerDay(StatefulRule):
def __init__(self, rule=None):
self.triggered = False
self.date = None
self.next_date = None
super(OncePerDay, self).__init__(rule)
def should_trigger(self, dt, env):
if self.date is None or dt >= self.next_date:
# initialize or reset for new date
self.triggered = False
self.date = dt
# record the timestamp for the next day, so that we can use it
# to know if we've moved to the next day
self.next_date = dt + pd.Timedelta(1, unit="d")
if not self.triggered and self.rule.should_trigger(dt, env):
self.triggered = True
return True
# Factory API
class date_rules(object):
every_day = Always
@staticmethod
def month_start(days_offset=0):
return NthTradingDayOfMonth(n=days_offset)
@staticmethod
def month_end(days_offset=0):
return NDaysBeforeLastTradingDayOfMonth(n=days_offset)
@staticmethod
def week_start(days_offset=0):
return NthTradingDayOfWeek(n=days_offset)
@staticmethod
def week_end(days_offset=0):
return NDaysBeforeLastTradingDayOfWeek(n=days_offset)
class time_rules(object):
market_open = AfterOpen
market_close = BeforeClose
def make_eventrule(date_rule, time_rule, half_days=True):
"""
Constructs an event rule from the factory api.
"""
if half_days:
inner_rule = date_rule & time_rule
else:
inner_rule = date_rule & time_rule & NotHalfDay()
return OncePerDay(rule=inner_rule)
| apache-2.0 |
arizona-phonological-imaging-lab/Autotrace | under-development/a3/lib.py | 1 | 5947 | #!/usr/bin/env python3
import os
import logging
from glob import glob
import fnmatch
import h5py
from PIL import Image
import numpy as np
from .roi import ROI
def get_from_files(d,path,roi,scale=1,n_points=32,buff=512,blacklist=[]):
"""Create an hdf5 dataset from a folder of images and traces
Tries to match names of traces with names of images.
Args:
d (str): The path of a folder.
The folder is recursively searched.
path (str): Where to save the dataset
Any existing file will be overwritten without warning
roi (ROI): The partof each image to extract.
scale (numeric, optional):
A factor by which to scale the images.
Defaults to 1 (no scaling). A better setting might be 0.1
n_points (int, optional): The number of points in each trace
Defaults to 32
buff (int, optional): Number of images to buffer before writing
Defaults to 512
blacklist (container): Set of image filenames to ignore
This is particularly useful for making disjoint training /
testing datasets
Defaults to the empty list (i.e. nothing excluded)
"""
images = []
traces = []
names = []
roi = ROI(roi)
roi_s = roi.scale(scale)
if os.path.exists(path):
os.remove(path)
hp = h5py.File(path,'w')
hp.create_dataset('image',
(0,1) + roi_s.shape,
maxshape = (None,1) + roi_s.shape,
chunks = (buff,1) + roi_s.shape, compression='gzip')
hp.create_dataset('trace',
(0,n_points,1,1),
maxshape = (None,n_points,1,1),
chunks = (buff,n_points,1,1), compression='gzip')
try:
unicode
except NameError:
unicode = str
hp.create_dataset('name',
(0,),
maxshape = (None,),
chunks = (buff,),
dtype=h5py.special_dtype(vlen=unicode), compression='gzip')
# traverse d
for root,__,filenames in os.walk(d):
# look for hand-traced traces
for filename in fnmatch.filter(filenames,'*.ghp.traced.txt'):
# because it matched the above fnmatch, we can assume it
# ends with '.ghp.traced.txt' and remove that ending.
# the rest is our target
base = filename[:-len('.ghp.traced.txt')]
# look for our target
f = None
if os.path.isfile(os.path.join(root,base)):
f = os.path.join(root,base)
else:
g = glob(os.path.join(root,'..','[sS]ubject*','IMAGES',base))
if g:
f = g[0]
# if we found it, then put it and our trace in the list
if f:
if os.path.basename(f) not in blacklist:
image = image_from_file(f,roi,scale)
trace = trace_from_file(os.path.join(root,filename),
roi,n_points)
try:
if image.any() and trace.any():
images.append(image)
traces.append(trace)
names.append( os.path.basename(f) )
except AttributeError:
logging.error("%s %s" % (image, trace))
raise
else:
logging.debug("excluding file %s" % (os.path.basename(f)))
if len(images) >= buff:
s = hp['image'].shape[0]
images_add = np.array(images[:buff],dtype='float32')
traces_add = np.array(traces[:buff],dtype='float32')
hp['image'].resize(s+buff,0)
hp['image'][s:] = images_add
hp['trace'].resize(s+buff,0)
hp['trace'][s:] = traces_add
hp['name'].resize(s+buff,0)
hp['name'][s:] = names[:buff]
images = images[buff:]
traces = traces[buff:]
names = names[buff:]
logging.info( "image: %s trace: %s name %s" %
(hp['image'].shape, hp['trace'].shape, hp['name'].shape))
logging.info( "image: %s trace: %s name %s" %
(hp['image'].shape, hp['trace'].shape, hp['name'].shape))
hp.close()
def image_from_file(f,roi,scale=.01):
"""Extract a porperly scaled section of an image
Args:
f (str): The path to an image
roi (ROI): The part of the image to extract
scale
"""
roi = ROI(roi)
roi_scale = roi.scale(scale)
img = Image.open(f)
img = img.convert('L')
img.thumbnail((img.size[0] * scale, img.size[1] * scale))
img = np.array(img,dtype='float32')
img = img / 255
img = np.array(img[roi_scale.slice],dtype='float32')
img = img.reshape(1,img.shape[0],img.shape[1])
return img
def trace_from_file(fname,roi,n_points):
"""Extract a trace from a trace file
Uses a linear interpolation of the trace to extract evenly-spaced points
Args:
fname (str): The path to a trace file.
roi (ROI): The space accross which to evenly space the points
n_points (int): The nuber of points to extract
"""
roi = ROI(roi)
gold_xs = []
gold_ys = []
with open(fname) as f:
for l in f:
l = l.split()
if int(l[0]) > 0:
gold_xs.append(float(l[1]))
gold_ys.append(float(l[2]))
gold_xs = np.array(gold_xs,dtype='float32')
gold_ys = np.array(gold_ys,dtype='float32')
if len(gold_xs) > 0:
trace = np.interp(roi.domain(n_points),gold_xs,gold_ys,left=0,right=0)
trace = trace.reshape((n_points,1,1))
trace[trace==0] = roi.offset[0]
trace = (trace - roi.offset[0]) / (roi.height)
else:
return np.array(0)
if trace.sum() > 0 :
return trace
else:
return np.array(0)
| mit |
florian-f/sklearn | sklearn/datasets/mldata.py | 3 | 6872 | """Automatically download MLdata datasets."""
# Copyright (c) 2011 Pietro Berkes
# License: Simplified BSD
import os
from os.path import join, exists
import re
import numbers
try:
# Python 2
from urllib2 import HTTPError
from urllib2 import quote
from urllib2 import urlopen
except ImportError:
# Python 3+
from urllib.error import HTTPError
from urllib.parse import quote
from urllib.request import urlopen
import scipy as sp
from scipy import io
from shutil import copyfileobj
from .base import get_data_home, Bunch
MLDATA_BASE_URL = "http://mldata.org/repository/data/download/matlab/%s"
def mldata_filename(dataname):
"""Convert a raw name for a data set in a mldata.org filename."""
dataname = dataname.lower().replace(' ', '-')
return re.sub(r'[().]', '', dataname)
def fetch_mldata(dataname, target_name='label', data_name='data',
transpose_data=True, data_home=None):
"""Fetch an mldata.org data set
If the file does not exist yet, it is downloaded from mldata.org .
mldata.org does not have an enforced convention for storing data or
naming the columns in a data set. The default behavior of this function
works well with the most common cases:
1) data values are stored in the column 'data', and target values in the
column 'label'
2) alternatively, the first column stores target values, and the second
data values
3) the data array is stored as `n_features x n_samples` , and thus needs
to be transposed to match the `sklearn` standard
Keyword arguments allow to adapt these defaults to specific data sets
(see parameters `target_name`, `data_name`, `transpose_data`, and
the examples below).
mldata.org data sets may have multiple columns, which are stored in the
Bunch object with their original name.
Parameters
----------
dataname:
Name of the data set on mldata.org,
e.g.: "leukemia", "Whistler Daily Snowfall", etc.
The raw name is automatically converted to a mldata.org URL .
target_name: optional, default: 'label'
Name or index of the column containing the target values.
data_name: optional, default: 'data'
Name or index of the column containing the data.
transpose_data: optional, default: True
If True, transpose the downloaded data array.
data_home: optional, default: None
Specify another download and cache folder for the data sets. By default
all scikit learn data is stored in '~/scikit_learn_data' subfolders.
Returns
-------
data : Bunch
Dictionary-like object, the interesting attributes are:
'data', the data to learn, 'target', the classification labels,
'DESCR', the full description of the dataset, and
'COL_NAMES', the original names of the dataset columns.
Examples
--------
Load the 'iris' dataset from mldata.org:
>>> from sklearn.datasets.mldata import fetch_mldata
>>> iris = fetch_mldata('iris')
>>> iris.target[0]
1
>>> print(iris.data[0])
[-0.555556 0.25 -0.864407 -0.916667]
Load the 'leukemia' dataset from mldata.org, which needs to be transposed
to respects the sklearn axes convention:
>>> leuk = fetch_mldata('leukemia', transpose_data=True)
>>> print(leuk.data.shape[0])
72
Load an alternative 'iris' dataset, which has different names for the
columns:
>>> iris2 = fetch_mldata('datasets-UCI iris', target_name=1,
... data_name=0)
>>> iris3 = fetch_mldata('datasets-UCI iris',
... target_name='class', data_name='double0')
"""
# normalize dataset name
dataname = mldata_filename(dataname)
# check if this data set has been already downloaded
data_home = get_data_home(data_home=data_home)
data_home = join(data_home, 'mldata')
if not exists(data_home):
os.makedirs(data_home)
matlab_name = dataname + '.mat'
filename = join(data_home, matlab_name)
# if the file does not exist, download it
if not exists(filename):
urlname = MLDATA_BASE_URL % quote(dataname)
try:
mldata_url = urlopen(urlname)
except HTTPError as e:
if e.code == 404:
e.msg = "Dataset '%s' not found on mldata.org." % dataname
raise
# store Matlab file
try:
with open(filename, 'w+b') as matlab_file:
copyfileobj(mldata_url, matlab_file)
except:
os.remove(filename)
raise
mldata_url.close()
# load dataset matlab file
with open(filename, 'rb') as matlab_file:
matlab_dict = io.loadmat(matlab_file, struct_as_record=True)
# -- extract data from matlab_dict
# flatten column names
col_names = [str(descr[0])
for descr in matlab_dict['mldata_descr_ordering'][0]]
# if target or data names are indices, transform then into names
if isinstance(target_name, numbers.Integral):
target_name = col_names[target_name]
if isinstance(data_name, numbers.Integral):
data_name = col_names[data_name]
# rules for making sense of the mldata.org data format
# (earlier ones have priority):
# 1) there is only one array => it is "data"
# 2) there are multiple arrays
# a) copy all columns in the bunch, using their column name
# b) if there is a column called `target_name`, set "target" to it,
# otherwise set "target" to first column
# c) if there is a column called `data_name`, set "data" to it,
# otherwise set "data" to second column
dataset = {'DESCR': 'mldata.org dataset: %s' % dataname,
'COL_NAMES': col_names}
# 1) there is only one array => it is considered data
if len(col_names) == 1:
data_name = col_names[0]
dataset['data'] = matlab_dict[data_name]
# 2) there are multiple arrays
else:
for name in col_names:
dataset[name] = matlab_dict[name]
if target_name in col_names:
del dataset[target_name]
dataset['target'] = matlab_dict[target_name]
else:
del dataset[col_names[0]]
dataset['target'] = matlab_dict[col_names[0]]
if data_name in col_names:
del dataset[data_name]
dataset['data'] = matlab_dict[data_name]
else:
del dataset[col_names[1]]
dataset['data'] = matlab_dict[col_names[1]]
# set axes to sklearn conventions
if transpose_data:
dataset['data'] = dataset['data'].T
if 'target' in dataset:
if not sp.sparse.issparse(dataset['target']):
dataset['target'] = dataset['target'].squeeze()
return Bunch(**dataset)
| bsd-3-clause |
anntzer/scikit-learn | examples/cluster/plot_dbscan.py | 6 | 2608 | # -*- coding: utf-8 -*-
"""
===================================
Demo of DBSCAN clustering algorithm
===================================
DBSCAN (Density-Based Spatial Clustering of Applications with Noise)
finds core samples of high density and expands clusters from them.
This algorithm is good for data which contains clusters of similar density.
"""
import numpy as np
from sklearn.cluster import DBSCAN
from sklearn import metrics
from sklearn.datasets import make_blobs
from sklearn.preprocessing import StandardScaler
# %%
# Generate sample data
# --------------------
centers = [[1, 1], [-1, -1], [1, -1]]
X, labels_true = make_blobs(
n_samples=750, centers=centers, cluster_std=0.4, random_state=0
)
X = StandardScaler().fit_transform(X)
# %%
# Compute DBSCAN
# --------------
db = DBSCAN(eps=0.3, min_samples=10).fit(X)
core_samples_mask = np.zeros_like(db.labels_, dtype=bool)
core_samples_mask[db.core_sample_indices_] = True
labels = db.labels_
# Number of clusters in labels, ignoring noise if present.
n_clusters_ = len(set(labels)) - (1 if -1 in labels else 0)
n_noise_ = list(labels).count(-1)
print("Estimated number of clusters: %d" % n_clusters_)
print("Estimated number of noise points: %d" % n_noise_)
print("Homogeneity: %0.3f" % metrics.homogeneity_score(labels_true, labels))
print("Completeness: %0.3f" % metrics.completeness_score(labels_true, labels))
print("V-measure: %0.3f" % metrics.v_measure_score(labels_true, labels))
print("Adjusted Rand Index: %0.3f" % metrics.adjusted_rand_score(labels_true, labels))
print(
"Adjusted Mutual Information: %0.3f"
% metrics.adjusted_mutual_info_score(labels_true, labels)
)
print("Silhouette Coefficient: %0.3f" % metrics.silhouette_score(X, labels))
# %%
# Plot result
# -----------
import matplotlib.pyplot as plt
# Black removed and is used for noise instead.
unique_labels = set(labels)
colors = [plt.cm.Spectral(each) for each in np.linspace(0, 1, len(unique_labels))]
for k, col in zip(unique_labels, colors):
if k == -1:
# Black used for noise.
col = [0, 0, 0, 1]
class_member_mask = labels == k
xy = X[class_member_mask & core_samples_mask]
plt.plot(
xy[:, 0],
xy[:, 1],
"o",
markerfacecolor=tuple(col),
markeredgecolor="k",
markersize=14,
)
xy = X[class_member_mask & ~core_samples_mask]
plt.plot(
xy[:, 0],
xy[:, 1],
"o",
markerfacecolor=tuple(col),
markeredgecolor="k",
markersize=6,
)
plt.title("Estimated number of clusters: %d" % n_clusters_)
plt.show()
| bsd-3-clause |
anntzer/scikit-learn | sklearn/metrics/_plot/precision_recall_curve.py | 8 | 13487 | from sklearn.base import is_classifier
from .base import _get_response
from .. import average_precision_score
from .. import precision_recall_curve
from .._base import _check_pos_label_consistency
from .._classification import check_consistent_length
from ...utils import check_matplotlib_support
class PrecisionRecallDisplay:
"""Precision Recall visualization.
It is recommend to use
:func:`~sklearn.metrics.PrecisionRecallDisplay.from_estimator` or
:func:`~sklearn.metrics.PrecisionRecallDisplay.from_predictions` to create
a :class:`~sklearn.metrics.PredictionRecallDisplay`. All parameters are
stored as attributes.
Read more in the :ref:`User Guide <visualizations>`.
Parameters
----------
precision : ndarray
Precision values.
recall : ndarray
Recall values.
average_precision : float, default=None
Average precision. If None, the average precision is not shown.
estimator_name : str, default=None
Name of estimator. If None, then the estimator name is not shown.
pos_label : str or int, default=None
The class considered as the positive class. If None, the class will not
be shown in the legend.
.. versionadded:: 0.24
Attributes
----------
line_ : matplotlib Artist
Precision recall curve.
ax_ : matplotlib Axes
Axes with precision recall curve.
figure_ : matplotlib Figure
Figure containing the curve.
See Also
--------
precision_recall_curve : Compute precision-recall pairs for different
probability thresholds.
PrecisionRecallDisplay.from_estimator : Plot Precision Recall Curve given
a binary classifier.
PrecisionRecallDisplay.from_predictions : Plot Precision Recall Curve
using predictions from a binary classifier.
Notes
-----
The average precision (cf. :func:`~sklearn.metrics.average_precision`) in
scikit-learn is computed without any interpolation. To be consistent with
this metric, the precision-recall curve is plotted without any
interpolation as well (step-wise style).
You can change this style by passing the keyword argument
`drawstyle="default"` in :meth:`plot`, :meth:`from_estimator`, or
:meth:`from_predictions`. However, the curve will not be strictly
consistent with the reported average precision.
Examples
--------
>>> import matplotlib.pyplot as plt
>>> from sklearn.datasets import make_classification
>>> from sklearn.metrics import (precision_recall_curve,
... PrecisionRecallDisplay)
>>> from sklearn.model_selection import train_test_split
>>> from sklearn.svm import SVC
>>> X, y = make_classification(random_state=0)
>>> X_train, X_test, y_train, y_test = train_test_split(X, y,
... random_state=0)
>>> clf = SVC(random_state=0)
>>> clf.fit(X_train, y_train)
SVC(random_state=0)
>>> predictions = clf.predict(X_test)
>>> precision, recall, _ = precision_recall_curve(y_test, predictions)
>>> disp = PrecisionRecallDisplay(precision=precision, recall=recall)
>>> disp.plot()
<...>
>>> plt.show()
"""
def __init__(
self,
precision,
recall,
*,
average_precision=None,
estimator_name=None,
pos_label=None,
):
self.estimator_name = estimator_name
self.precision = precision
self.recall = recall
self.average_precision = average_precision
self.pos_label = pos_label
def plot(self, ax=None, *, name=None, **kwargs):
"""Plot visualization.
Extra keyword arguments will be passed to matplotlib's `plot`.
Parameters
----------
ax : Matplotlib Axes, default=None
Axes object to plot on. If `None`, a new figure and axes is
created.
name : str, default=None
Name of precision recall curve for labeling. If `None`, use
`estimator_name` if not `None`, otherwise no labeling is shown.
**kwargs : dict
Keyword arguments to be passed to matplotlib's `plot`.
Returns
-------
display : :class:`~sklearn.metrics.PrecisionRecallDisplay`
Object that stores computed values.
Notes
-----
The average precision (cf. :func:`~sklearn.metrics.average_precision`)
in scikit-learn is computed without any interpolation. To be consistent
with this metric, the precision-recall curve is plotted without any
interpolation as well (step-wise style).
You can change this style by passing the keyword argument
`drawstyle="default"`. However, the curve will not be strictly
consistent with the reported average precision.
"""
check_matplotlib_support("PrecisionRecallDisplay.plot")
name = self.estimator_name if name is None else name
line_kwargs = {"drawstyle": "steps-post"}
if self.average_precision is not None and name is not None:
line_kwargs["label"] = f"{name} (AP = {self.average_precision:0.2f})"
elif self.average_precision is not None:
line_kwargs["label"] = f"AP = {self.average_precision:0.2f}"
elif name is not None:
line_kwargs["label"] = name
line_kwargs.update(**kwargs)
import matplotlib.pyplot as plt
if ax is None:
fig, ax = plt.subplots()
(self.line_,) = ax.plot(self.recall, self.precision, **line_kwargs)
info_pos_label = (
f" (Positive label: {self.pos_label})" if self.pos_label is not None else ""
)
xlabel = "Recall" + info_pos_label
ylabel = "Precision" + info_pos_label
ax.set(xlabel=xlabel, ylabel=ylabel)
if "label" in line_kwargs:
ax.legend(loc="lower left")
self.ax_ = ax
self.figure_ = ax.figure
return self
@classmethod
def from_estimator(
cls,
estimator,
X,
y,
*,
sample_weight=None,
pos_label=None,
response_method="auto",
name=None,
ax=None,
**kwargs,
):
"""Plot precision-recall curve given an estimator and some data.
Parameters
----------
estimator : estimator instance
Fitted classifier or a fitted :class:`~sklearn.pipeline.Pipeline`
in which the last estimator is a classifier.
X : {array-like, sparse matrix} of shape (n_samples, n_features)
Input values.
y : array-like of shape (n_samples,)
Target values.
sample_weight : array-like of shape (n_samples,), default=None
Sample weights.
pos_label : str or int, default=None
The class considered as the positive class when computing the
precision and recall metrics. By default, `estimators.classes_[1]`
is considered as the positive class.
response_method : {'predict_proba', 'decision_function', 'auto'}, \
default='auto'
Specifies whether to use :term:`predict_proba` or
:term:`decision_function` as the target response. If set to 'auto',
:term:`predict_proba` is tried first and if it does not exist
:term:`decision_function` is tried next.
name : str, default=None
Name for labeling curve. If `None`, no name is used.
ax : matplotlib axes, default=None
Axes object to plot on. If `None`, a new figure and axes is created.
**kwargs : dict
Keyword arguments to be passed to matplotlib's `plot`.
Returns
-------
display : :class:`~sklearn.metrics.PrecisionRecallDisplay`
See Also
--------
PrecisionRecallDisplay.from_predictions : Plot precision-recall curve
using estimated probabilities or output of decision function.
Notes
-----
The average precision (cf. :func:`~sklearn.metrics.average_precision`)
in scikit-learn is computed without any interpolation. To be consistent
with this metric, the precision-recall curve is plotted without any
interpolation as well (step-wise style).
You can change this style by passing the keyword argument
`drawstyle="default"`. However, the curve will not be strictly
consistent with the reported average precision.
Examples
--------
>>> import matplotlib.pyplot as plt
>>> from sklearn.datasets import make_classification
>>> from sklearn.metrics import PrecisionRecallDisplay
>>> from sklearn.model_selection import train_test_split
>>> from sklearn.linear_model import LogisticRegression
>>> X, y = make_classification(random_state=0)
>>> X_train, X_test, y_train, y_test = train_test_split(
... X, y, random_state=0)
>>> clf = LogisticRegression()
>>> clf.fit(X_train, y_train)
LogisticRegression()
>>> PrecisionRecallDisplay.from_estimator(
... clf, X_test, y_test)
<...>
>>> plt.show()
"""
method_name = f"{cls.__name__}.from_estimator"
check_matplotlib_support(method_name)
if not is_classifier(estimator):
raise ValueError(f"{method_name} only supports classifiers")
y_pred, pos_label = _get_response(
X,
estimator,
response_method,
pos_label=pos_label,
)
name = name if name is not None else estimator.__class__.__name__
return cls.from_predictions(
y,
y_pred,
sample_weight=sample_weight,
name=name,
pos_label=pos_label,
ax=ax,
**kwargs,
)
@classmethod
def from_predictions(
cls,
y_true,
y_pred,
*,
sample_weight=None,
pos_label=None,
name=None,
ax=None,
**kwargs,
):
"""Plot precision-recall curve given binary class predictions.
Parameters
----------
y_true : array-like of shape (n_samples,)
True binary labels.
y_pred : array-like of shape (n_samples,)
Estimated probabilities or output of decision function.
sample_weight : array-like of shape (n_samples,), default=None
Sample weights.
pos_label : str or int, default=None
The class considered as the positive class when computing the
precision and recall metrics.
name : str, default=None
Name for labeling curve. If `None`, name will be set to
`"Classifier"`.
ax : matplotlib axes, default=None
Axes object to plot on. If `None`, a new figure and axes is created.
**kwargs : dict
Keyword arguments to be passed to matplotlib's `plot`.
Returns
-------
display : :class:`~sklearn.metrics.PrecisionRecallDisplay`
See Also
--------
PrecisionRecallDisplay.from_estimator : Plot precision-recall curve
using an estimator.
Notes
-----
The average precision (cf. :func:`~sklearn.metrics.average_precision`)
in scikit-learn is computed without any interpolation. To be consistent
with this metric, the precision-recall curve is plotted without any
interpolation as well (step-wise style).
You can change this style by passing the keyword argument
`drawstyle="default"`. However, the curve will not be strictly
consistent with the reported average precision.
Examples
--------
>>> import matplotlib.pyplot as plt
>>> from sklearn.datasets import make_classification
>>> from sklearn.metrics import PrecisionRecallDisplay
>>> from sklearn.model_selection import train_test_split
>>> from sklearn.linear_model import LogisticRegression
>>> X, y = make_classification(random_state=0)
>>> X_train, X_test, y_train, y_test = train_test_split(
... X, y, random_state=0)
>>> clf = LogisticRegression()
>>> clf.fit(X_train, y_train)
LogisticRegression()
>>> y_pred = clf.predict_proba(X_test)[:, 1]
>>> PrecisionRecallDisplay.from_predictions(
... y_test, y_pred)
<...>
>>> plt.show()
"""
check_matplotlib_support(f"{cls.__name__}.from_predictions")
check_consistent_length(y_true, y_pred, sample_weight)
pos_label = _check_pos_label_consistency(pos_label, y_true)
precision, recall, _ = precision_recall_curve(
y_true, y_pred, pos_label=pos_label, sample_weight=sample_weight
)
average_precision = average_precision_score(
y_true, y_pred, pos_label=pos_label, sample_weight=sample_weight
)
name = name if name is not None else "Classifier"
viz = PrecisionRecallDisplay(
precision=precision,
recall=recall,
average_precision=average_precision,
estimator_name=name,
pos_label=pos_label,
)
return viz.plot(ax=ax, name=name, **kwargs)
| bsd-3-clause |
chaen/DIRAC | Resources/Catalog/FileCatalogClient.py | 3 | 23994 | """ The FileCatalogClient is a class representing the client of the DIRAC File Catalog
"""
import os
from DIRAC import S_OK, S_ERROR
from DIRAC.Core.DISET.TransferClient import TransferClient
from DIRAC.Core.Security.ProxyInfo import getVOfromProxyGroup
from DIRAC.ConfigurationSystem.Client.Helpers.Registry import getVOMSAttributeForGroup, getDNForUsername
from DIRAC.Resources.Catalog.Utilities import checkCatalogArguments
from DIRAC.Resources.Catalog.FileCatalogClientBase import FileCatalogClientBase
__RCSID__ = "$Id$"
class FileCatalogClient(FileCatalogClientBase):
""" Client code to the DIRAC File Catalogue
"""
# The list of methods below is defining the client interface
READ_METHODS = FileCatalogClientBase.READ_METHODS + \
['isFile', 'getFileMetadata',
'getReplicas', 'getReplicaStatus', 'getFileSize', 'isDirectory', 'getDirectoryReplicas',
'listDirectory', 'getDirectoryMetadata', 'getDirectorySize', 'getDirectoryContents',
'getLFNForPFN', 'getLFNForGUID', 'findFilesByMetadata', 'getMetadataFields',
'findDirectoriesByMetadata', 'getReplicasByMetadata', 'findFilesByMetadataDetailed',
'findFilesByMetadataWeb', 'getCompatibleMetadata', 'getMetadataSet', 'getDatasets',
'getFileDescendents', 'getFileAncestors', 'getDirectoryUserMetadata', 'getFileUserMetadata',
'checkDataset', 'getDatasetParameters', 'getDatasetFiles', 'getDatasetAnnotation']
WRITE_METHODS = [
'createLink',
'removeLink',
'addFile',
'setFileStatus',
'addReplica',
'removeReplica',
'removeFile',
'setReplicaStatus',
'setReplicaHost',
'setReplicaProblematic',
'createDirectory',
'setDirectoryStatus',
'removeDirectory',
'changePathMode',
'changePathOwner',
'changePathGroup',
'addMetadataField',
'deleteMetadataField',
'setMetadata',
'setMetadataBulk',
'removeMetadata',
'addMetadataSet',
'addDataset',
'addDatasetAnnotation',
'removeDataset',
'updateDataset',
'freezeDataset',
'releaseDataset',
'addUser',
'deleteUser',
'addGroup',
'deleteGroup',
'repairCatalog',
'rebuildDirectoryUsage']
NO_LFN_METHODS = [
'findFilesByMetadata',
'addMetadataField',
'deleteMetadataField',
'getMetadataFields',
'setMetadata',
'setMetadataBulk',
'removeMetadata',
'getDirectoryUserMetadata',
'findDirectoriesByMetadata',
'getReplicasByMetadata',
'findFilesByMetadataDetailed',
'findFilesByMetadataWeb',
'getCompatibleMetadata',
'addMetadataSet',
'getMetadataSet',
'getFileUserMetadata',
'getLFNForGUID',
'addUser',
'deleteUser',
'addGroup',
'deleteGroup',
'repairCatalog',
'rebuildDirectoryUsage']
ADMIN_METHODS = ['addUser', 'deleteUser', 'addGroup', 'deleteGroup', 'getUsers', 'getGroups',
'getCatalogCounters', 'repairCatalog', 'rebuildDirectoryUsage']
def __init__(self, url=None, **kwargs):
""" Constructor function.
"""
self.serverURL = 'DataManagement/FileCatalog' if not url else url
super(FileCatalogClient, self).__init__(self.serverURL, **kwargs)
##################################################################################
#
##################################################################################
@checkCatalogArguments
def getReplicas(self, lfns, allStatus=False, timeout=120):
""" Get the replicas of the given files
"""
rpcClient = self._getRPC(timeout=timeout)
result = rpcClient.getReplicas(lfns, allStatus)
if not result['OK']:
return result
vo = getVOfromProxyGroup().get('Value', None)
lfnDict = result['Value']
seDict = result['Value'].get('SEPrefixes', {})
for lfn in lfnDict['Successful']:
for se in lfnDict['Successful'][lfn]:
if not lfnDict['Successful'][lfn][se]:
# The PFN was not returned, construct it on the fly
# For some VO's the prefix can be non-standard
voPrefix = seDict.get("VOPrefix", {}).get(se, {}).get(vo)
sePrefix = seDict.get(se, '')
prefix = voPrefix if voPrefix else sePrefix
lfnDict['Successful'][lfn][se] = prefix + lfn
return S_OK(lfnDict)
@checkCatalogArguments
def setReplicaProblematic(self, lfns, revert=False):
"""
Set replicas to problematic.
:param lfn lfns: has to be formated this way :
{ lfn : { se1 : pfn1, se2 : pfn2, ...}, ...}
:param revert: If True, remove the problematic flag
:return: { successful : { lfn : [ ses ] } : failed : { lfn : { se : msg } } }
"""
# This method does a batch treatment because the setReplicaStatus can only take one replica per lfn at once
#
# Illustration :
#
# lfns {'L2': {'S1': 'P3'}, 'L3': {'S3': 'P5', 'S2': 'P4', 'S4': 'P6'}, 'L1': {'S2': 'P2', 'S1': 'P1'}}
#
# loop1: lfnSEs {'L2': ['S1'], 'L3': ['S3', 'S2', 'S4'], 'L1': ['S2', 'S1']}
# loop1 : batch {'L2': {'Status': 'P', 'SE': 'S1', 'PFN': 'P3'},
# 'L3': {'Status': 'P', 'SE': 'S4', 'PFN': 'P6'},
# 'L1': {'Status': 'P', 'SE': 'S1', 'PFN': 'P1'}}
#
# loop2: lfnSEs {'L2': [], 'L3': ['S3', 'S2'], 'L1': ['S2']}
# loop2 : batch {'L3': {'Status': 'P', 'SE': 'S2', 'PFN': 'P4'}, 'L1': {'Status': 'P', 'SE': 'S2', 'PFN': 'P2'}}
#
# loop3: lfnSEs {'L3': ['S3'], 'L1': []}
# loop3 : batch {'L3': {'Status': 'P', 'SE': 'S3', 'PFN': 'P5'}}
#
# loop4: lfnSEs {'L3': []}
# loop4 : batch {}
successful = {}
failed = {}
status = 'AprioriGood' if revert else 'Trash'
# { lfn : [ se1, se2, ...], ...}
lfnsSEs = dict((lfn, [se for se in lfns[lfn]]) for lfn in lfns)
while lfnsSEs:
# { lfn : { 'SE' : se1, 'PFN' : pfn1, 'Status' : status }, ... }
batch = {}
for lfn in lfnsSEs.keys():
# If there are still some Replicas (SE) for the given LFN, we put it in the next batch
# else we remove the entry from the lfnsSEs dict
if lfnsSEs[lfn]:
se = lfnsSEs[lfn].pop()
batch[lfn] = {'SE': se, 'PFN': lfns[lfn][se], 'Status': status}
else:
del lfnsSEs[lfn]
# Happens when there is nothing to treat anymore
if not batch:
break
res = self.setReplicaStatus(batch)
if not res['OK']:
for lfn in batch:
failed.setdefault(lfn, {})[batch[lfn]['SE']] = res['Message']
continue
for lfn in res['Value']['Failed']:
failed.setdefault(lfn, {})[batch[lfn]['SE']] = res['Value']['Failed'][lfn]
for lfn in res['Value']['Successful']:
successful.setdefault(lfn, []).append(batch[lfn]['SE'])
return S_OK({'Successful': successful, 'Failed': failed})
@checkCatalogArguments
def listDirectory(self, lfn, verbose=False, timeout=120):
""" List the given directory's contents
"""
rpcClient = self._getRPC(timeout=timeout)
result = rpcClient.listDirectory(lfn, verbose)
if not result['OK']:
return result
# Force returned directory entries to be LFNs
for entryType in ['Files', 'SubDirs', 'Links']:
for path in result['Value']['Successful']:
entryDict = result['Value']['Successful'][path][entryType]
for fname in entryDict.keys():
detailsDict = entryDict.pop(fname)
lfn = os.path.join(path, os.path.basename(fname))
entryDict[lfn] = detailsDict
return result
@checkCatalogArguments
def getDirectoryMetadata(self, lfns, timeout=120):
''' Get standard directory metadata
'''
rpcClient = self._getRPC(timeout=timeout)
result = rpcClient.getDirectoryMetadata(lfns)
if not result['OK']:
return result
# Add some useful fields
for path in result['Value']['Successful']:
owner = result['Value']['Successful'][path]['Owner']
group = result['Value']['Successful'][path]['OwnerGroup']
res = getDNForUsername(owner)
if res['OK']:
result['Value']['Successful'][path]['OwnerDN'] = res['Value'][0]
else:
result['Value']['Successful'][path]['OwnerDN'] = ''
result['Value']['Successful'][path]['OwnerRole'] = getVOMSAttributeForGroup(group)
return result
@checkCatalogArguments
def removeDirectory(self, lfn, recursive=False, timeout=120):
""" Remove the directory from the File Catalog. The recursive keyword is for the ineterface.
"""
rpcClient = self._getRPC(timeout=timeout)
return rpcClient.removeDirectory(lfn)
@checkCatalogArguments
def getDirectoryReplicas(self, lfns, allStatus=False, timeout=120):
""" Find all the given directories' replicas
"""
rpcClient = self._getRPC(timeout=timeout)
result = rpcClient.getDirectoryReplicas(lfns, allStatus)
if not result['OK']:
return result
seDict = result['Value'].get('SEPrefixes', {})
for path in result['Value']['Successful']:
pathDict = result['Value']['Successful'][path]
for fname in pathDict.keys():
detailsDict = pathDict.pop(fname)
lfn = '%s/%s' % (path, os.path.basename(fname))
for se in detailsDict:
if not detailsDict[se] and se in seDict:
detailsDict[se] = seDict[se] + lfn
pathDict[lfn] = detailsDict
return result
def findFilesByMetadata(self, metaDict, path='/', timeout=120):
""" Find files given the meta data query and the path
"""
rpcClient = self._getRPC(timeout=timeout)
result = rpcClient.findFilesByMetadata(metaDict, path)
if not result['OK']:
return result
if isinstance(result['Value'], list):
return result
elif isinstance(result['Value'], dict):
# Process into the lfn list
fileList = []
for dir_, fList in result['Value'].items():
for fi in fList:
fileList.append(dir_ + '/' + fi)
result['Value'] = fileList
return result
else:
return S_ERROR('Illegal return value type %s' % type(result['Value']))
def getFileUserMetadata(self, path, timeout=120):
"""Get the meta data attached to a file, but also to
the its corresponding directory
"""
directory = "/".join(path.split("/")[:-1])
rpcClient = self._getRPC(timeout=timeout)
result = rpcClient.getFileUserMetadata(path)
if not result['OK']:
return result
fmeta = result['Value']
result = rpcClient.getDirectoryUserMetadata(directory)
if not result['OK']:
return result
fmeta.update(result['Value'])
return S_OK(fmeta)
########################################################################
# Path operations (not updated)
#
@checkCatalogArguments
def changePathOwner(self, lfns, recursive=False, timeout=120):
""" Get replica info for the given list of LFNs
"""
return self._getRPC(timeout=timeout).changePathOwner(lfns, recursive)
@checkCatalogArguments
def changePathGroup(self, lfns, recursive=False, timeout=120):
""" Get replica info for the given list of LFNs
"""
return self._getRPC(timeout=timeout).changePathGroup(lfns, recursive)
@checkCatalogArguments
def changePathMode(self, lfns, recursive=False, timeout=120):
""" Get replica info for the given list of LFNs
"""
return self._getRPC(timeout=timeout).changePathMode(lfns, recursive)
########################################################################
# ACL Operations
#
@checkCatalogArguments
def getPathPermissions(self, lfns, timeout=120):
""" Determine the ACL information for a supplied path
"""
return self._getRPC(timeout=timeout).getPathPermissions(lfns)
@checkCatalogArguments
def hasAccess(self, paths, opType, timeout=120):
""" Determine if the given op can be performed on the paths
The OpType is all the operations exported
"""
return self._getRPC(timeout=timeout).hasAccess(paths, opType)
###################################################################
#
# User/Group write operations
#
def addUser(self, userName, timeout=120):
""" Add a new user to the File Catalog """
return self._getRPC(timeout=timeout).addUser(userName)
def deleteUser(self, userName, timeout=120):
""" Delete user from the File Catalog """
return self._getRPC(timeout=timeout).deleteUser(userName)
def addGroup(self, groupName, timeout=120):
""" Add a new group to the File Catalog """
return self._getRPC(timeout=timeout).addGroup(groupName)
def deleteGroup(self, groupName, timeout=120):
""" Delete group from the File Catalog """
return self._getRPC(timeout=timeout).deleteGroup(groupName)
###################################################################
#
# User/Group read operations
#
def getUsers(self, timeout=120):
""" Get all the users defined in the File Catalog """
return self._getRPC(timeout=timeout).getUsers()
def getGroups(self, timeout=120):
""" Get all the groups defined in the File Catalog """
return self._getRPC(timeout=timeout).getGroups()
########################################################################
#
# Path read operations
#
@checkCatalogArguments
def exists(self, lfns, timeout=120):
""" Check whether the supplied paths exists """
return self._getRPC(timeout=timeout).exists(lfns)
########################################################################
#
# File write operations
#
@checkCatalogArguments
def addFile(self, lfns, timeout=120):
""" Register supplied files """
return self._getRPC(timeout=timeout).addFile(lfns)
@checkCatalogArguments
def removeFile(self, lfns, timeout=120):
""" Remove the supplied lfns """
return self._getRPC(timeout=timeout).removeFile(lfns)
@checkCatalogArguments
def setFileStatus(self, lfns, timeout=120):
""" Remove the supplied lfns """
return self._getRPC(timeout=timeout).setFileStatus(lfns)
@checkCatalogArguments
def addReplica(self, lfns, timeout=120):
""" Register supplied replicas """
return self._getRPC(timeout=timeout).addReplica(lfns)
@checkCatalogArguments
def removeReplica(self, lfns, timeout=120):
""" Remove the supplied replicas """
return self._getRPC(timeout=timeout).removeReplica(lfns)
@checkCatalogArguments
def setReplicaStatus(self, lfns, timeout=120):
""" Set the status for the supplied replicas """
return self._getRPC(timeout=timeout).setReplicaStatus(lfns)
@checkCatalogArguments
def setReplicaHost(self, lfns, timeout=120):
""" Change the registered SE for the supplied replicas """
return self._getRPC(timeout=timeout).setReplicaHost(lfns)
@checkCatalogArguments
def addFileAncestors(self, lfns, timeout=120):
""" Add file ancestor information for the given list of LFNs """
return self._getRPC(timeout=timeout).addFileAncestors(lfns)
########################################################################
#
# File read operations
#
@checkCatalogArguments
def isFile(self, lfns, timeout=120):
""" Check whether the supplied lfns are files """
return self._getRPC(timeout=timeout).isFile(lfns)
@checkCatalogArguments
def getFileSize(self, lfns, timeout=120):
""" Get the size associated to supplied lfns """
return self._getRPC(timeout=timeout).getFileSize(lfns)
@checkCatalogArguments
def getFileMetadata(self, lfns, timeout=120):
""" Get the metadata associated to supplied lfns """
return self._getRPC(timeout=timeout).getFileMetadata(lfns)
@checkCatalogArguments
def getReplicaStatus(self, lfns, timeout=120):
""" Get the status for the supplied replicas """
return self._getRPC(timeout=timeout).getReplicaStatus(lfns)
@checkCatalogArguments
def getFileAncestors(self, lfns, depths, timeout=120):
""" Get the status for the supplied replicas """
return self._getRPC(timeout=timeout).getFileAncestors(lfns, depths)
@checkCatalogArguments
def getFileDescendents(self, lfns, depths, timeout=120):
""" Get the status for the supplied replicas """
return self._getRPC(timeout=timeout).getFileDescendents(lfns, depths)
def getLFNForGUID(self, guids, timeout=120):
"""Get the matching lfns for given guids"""
return self._getRPC(timeout=timeout).getLFNForGUID(guids)
########################################################################
#
# Directory write operations
#
@checkCatalogArguments
def createDirectory(self, lfns, timeout=120):
""" Create the supplied directories """
return self._getRPC(timeout=timeout).createDirectory(lfns)
########################################################################
#
# Directory read operations
#
@checkCatalogArguments
def isDirectory(self, lfns, timeout=120):
""" Determine whether supplied path is a directory """
return self._getRPC(timeout=timeout).isDirectory(lfns)
@checkCatalogArguments
def getDirectorySize(self, lfns, longOut=False, fromFiles=False, timeout=120):
""" Get the size of the supplied directory """
return self._getRPC(timeout=timeout).getDirectorySize(lfns, longOut, fromFiles)
########################################################################
#
# Administrative database operations
#
def getCatalogCounters(self, timeout=120):
""" Get the number of registered directories, files and replicas in various tables """
return self._getRPC(timeout=timeout).getCatalogCounters()
def rebuildDirectoryUsage(self, timeout=120):
""" Rebuild DirectoryUsage table from scratch """
return self._getRPC(timeout=timeout).rebuildDirectoryUsage()
def repairCatalog(self, timeout=120):
""" Repair the catalog inconsistencies """
return self._getRPC(timeout=timeout).repairCatalog()
########################################################################
# Metadata Catalog Operations
#
def addMetadataField(self, fieldName, fieldType, metaType='-d', timeout=120):
""" Add a new metadata field of the given type
"""
return self._getRPC(timeout=timeout).addMetadataField(fieldName, fieldType, metaType)
def deleteMetadataField(self, fieldName, timeout=120):
""" Delete the metadata field
"""
return self._getRPC(timeout=timeout).deleteMetadataField(fieldName)
def getMetadataFields(self, timeout=120):
""" Get all the metadata fields
"""
return self._getRPC(timeout=timeout).getMetadataFields()
def setMetadata(self, path, metadatadict, timeout=120):
""" Set metadata parameter for the given path
"""
return self._getRPC(timeout=timeout).setMetadata(path, metadatadict)
def setMetadataBulk(self, pathMetadataDict, timeout=120):
""" Set metadata parameter for the given path
"""
return self._getRPC(timeout=timeout).setMetadataBulk(pathMetadataDict)
def removeMetadata(self, pathMetadataDict, timeout=120):
""" Remove the specified metadata for the given path
"""
return self._getRPC(timeout=timeout).removeMetadata(pathMetadataDict)
def getDirectoryUserMetadata(self, path, timeout=120):
""" Get all the metadata valid for the given directory path
"""
return self._getRPC(timeout=timeout).getDirectoryUserMetadata(path)
def findDirectoriesByMetadata(self, metaDict, path='/', timeout=120):
""" Find all the directories satisfying the given metadata set
"""
return self._getRPC(timeout=timeout).findDirectoriesByMetadata(metaDict, path)
def getReplicasByMetadata(self, metaDict, path='/', allStatus=False, timeout=120):
""" Find all the files satisfying the given metadata set
"""
return self._getRPC(timeout=timeout).getReplicasByMetadata(metaDict, path, allStatus)
def findFilesByMetadataDetailed(self, metaDict, path='/', timeout=120):
""" Find all the files satisfying the given metadata set
"""
return self._getRPC(timeout=timeout).findFilesByMetadataDetailed(metaDict, path)
def findFilesByMetadataWeb(self, metaDict, path, startItem, maxItems, timeout=120):
""" Find files satisfying the given metadata set
"""
return self._getRPC(timeout=timeout).findFilesByMetadataWeb(metaDict, path, startItem, maxItems)
def getCompatibleMetadata(self, metaDict, path='/', timeout=120):
""" Get metadata values compatible with the given metadata subset
"""
return self._getRPC(timeout=timeout).getCompatibleMetadata(metaDict, path)
def addMetadataSet(self, setName, setDict, timeout=120):
""" Add a new metadata set
"""
return self._getRPC(timeout=timeout).addMetadataSet(setName, setDict)
def getMetadataSet(self, setName, expandFlag, timeout=120):
""" Add a new metadata set
"""
return self._getRPC(timeout=timeout).getMetadataSet(setName, expandFlag)
#########################################################################################
#
# Dataset manipulation methods
#
@checkCatalogArguments
def addDataset(self, datasets, timeout=120):
""" Add a new dynamic dataset defined by its meta query
"""
return self._getRPC(timeout=timeout).addDataset(datasets)
@checkCatalogArguments
def addDatasetAnnotation(self, datasetDict, timeout=120):
""" Add annotation to an already created dataset
"""
return self._getRPC(timeout=timeout).addDatasetAnnotation(datasetDict)
@checkCatalogArguments
def removeDataset(self, datasets, timeout=120):
""" Check the given dynamic dataset for changes since its definition
"""
return self._getRPC(timeout=timeout).removeDataset(datasets)
@checkCatalogArguments
def checkDataset(self, datasets, timeout=120):
""" Check the given dynamic dataset for changes since its definition
"""
return self._getRPC(timeout=timeout).checkDataset(datasets)
@checkCatalogArguments
def updateDataset(self, datasets, timeout=120):
""" Update the given dynamic dataset for changes since its definition
"""
return self._getRPC(timeout=timeout).updateDataset(datasets)
@checkCatalogArguments
def getDatasets(self, datasets, timeout=120):
""" Get parameters of the given dynamic dataset as they are stored in the database
"""
return self._getRPC(timeout=timeout).getDatasets(datasets)
@checkCatalogArguments
def getDatasetParameters(self, datasets, timeout=120):
""" Get parameters of the given dynamic dataset as they are stored in the database
"""
return self._getRPC(timeout=timeout).getDatasetParameters(datasets)
@checkCatalogArguments
def getDatasetAnnotation(self, datasets, timeout=120):
""" Get annotation of the given datasets
"""
return self._getRPC(timeout=timeout).getDatasetAnnotation(datasets)
@checkCatalogArguments
def freezeDataset(self, datasets, timeout=120):
""" Freeze the contents of the dataset making it effectively static
"""
return self._getRPC(timeout=timeout).freezeDataset(datasets)
@checkCatalogArguments
def releaseDataset(self, datasets, timeout=120):
""" Release the contents of the frozen dataset allowing changes in its contents
"""
return self._getRPC(timeout=timeout).releaseDataset(datasets)
@checkCatalogArguments
def getDatasetFiles(self, datasets, timeout=120):
""" Get lfns in the given dataset
two lines !
"""
return self._getRPC(timeout=timeout).getDatasetFiles(datasets)
#############################################################################
def getSEDump(self, seName, outputFilename):
"""
Dump the content of an SE in the given file.
The file contains a list of [lfn,checksum,size] dumped as csv,
separated by '|'
:param seName: name of the StorageElement
:param outputFilename: path to the file where to dump it
:returns: result from the TransferClient
"""
dfc = TransferClient(self.serverURL)
return dfc.receiveFile(outputFilename, seName)
| gpl-3.0 |
pytorch/fairseq | examples/laser/laser_src/laser_transformer.py | 1 | 11947 | # Copyright (c) Facebook, Inc. and its affiliates.
#
# This source code is licensed under the MIT license found in the
# LICENSE file in the root directory of this source tree.
import logging
from typing import Any, Dict, List, Optional
from torch import Tensor
import torch
import torch.nn as nn
from fairseq.models import (
FairseqEncoderDecoderModel,
register_model,
register_model_architecture,
)
from fairseq.models.transformer import (
base_architecture,
Embedding,
TransformerModel,
TransformerEncoder,
TransformerDecoder,
)
from fairseq.modules import (
TransformerDecoderLayer,
)
logger = logging.getLogger(__name__)
@register_model("laser_transformer")
class LaserTransformerModel(FairseqEncoderDecoderModel):
"""Train Transformer for LASER task
Requires --task laser
"""
def __init__(self, encoder, decoder):
super().__init__(encoder, decoder)
def forward(
self,
src_tokens,
src_lengths,
prev_output_tokens=None,
tgt_tokens=None,
tgt_lengths=None,
target_language_id=-1,
dataset_name="",
):
laser_encoder_out = self.encoder(src_tokens, src_lengths)
return self.decoder(
prev_output_tokens, laser_encoder_out, lang_id=target_language_id
)
@staticmethod
def add_args(parser):
"""Add model-specific arguments to the parser."""
TransformerModel.add_args(parser)
parser.add_argument(
"--decoder-lang-embed-dim",
type=int,
metavar="N",
help="decoder language embedding dimension",
)
@classmethod
def build_model(cls, args, task):
base_laser_transformer_architecture(args)
num_langs = task.num_tasks if hasattr(task, "num_tasks") else 0
def load_embed_tokens(dictionary, embed_dim):
num_embeddings = len(dictionary)
padding_idx = dictionary.pad()
return Embedding(num_embeddings, embed_dim, padding_idx)
encoder_embed_tokens = load_embed_tokens(
task.source_dictionary, args.encoder_embed_dim
)
decoder_embed_tokens = load_embed_tokens(
task.target_dictionary, args.decoder_embed_dim
)
num_langs = task.num_tasks if hasattr(task, "num_tasks") else 0
encoder = LaserTransformerEncoder(
args, task.source_dictionary, encoder_embed_tokens
)
decoder = LaserTransformerDecoder(
args,
task.target_dictionary,
decoder_embed_tokens,
num_langs=num_langs,
lang_embed_dim=args.decoder_lang_embed_dim,
)
return cls(encoder, decoder)
class LaserTransformerEncoder(TransformerEncoder):
def __init__(self, *args, **kwargs):
super().__init__(*args, **kwargs)
def forward(self, src_tokens, *args, **kwargs):
encoder_out = super().forward(src_tokens, *args, **kwargs)
x = encoder_out["encoder_out"][0] # T x B x C
padding_mask = src_tokens.eq(self.padding_idx).t().unsqueeze(-1)
if padding_mask.any():
x = x.float().masked_fill_(padding_mask, float("-inf")).type_as(x)
# Build the sentence embedding by max-pooling over the encoder outputs
sentemb = x.max(dim=0)[0]
# The Pytorch Mobile lite interpreter does not supports returning NamedTuple in
# `foward` so we use a dictionary instead.
# TorchScript does not support mixed values so the values are all lists.
# The empty list is equivalent to None.
return {"sentemb": [sentemb]} # B x C
@torch.jit.export
def reorder_encoder_out(self, encoder_out: Dict[str, List[Tensor]], new_order):
"""
Same as the one in transformer.py, with new_sentemb
"""
if len(encoder_out["sentemb"]) == 0:
new_sentemb = []
else:
new_sentemb = [encoder_out["sentemb"][0].index_select(0, new_order)]
return {
"sentemb": new_sentemb, # B x C
}
class LaserTransformerDecoder(TransformerDecoder):
def __init__(self, args, dictionary, *kargs, **kwargs):
self.num_langs = kwargs.get("num_langs", 1)
self.lang_embed_dim = kwargs.get("lang_embed_dim", 0)
kwargs.pop("num_langs", None)
kwargs.pop("lang_embed_dim", None)
super().__init__(args, dictionary, *kargs, **kwargs, no_encoder_attn=True)
if self.lang_embed_dim == 0:
self.embed_lang = None
else:
self.embed_lang = nn.Embedding(self.num_langs, self.lang_embed_dim)
nn.init.uniform_(self.embed_lang.weight, -0.1, 0.1)
if self.output_projection is not None:
laser_output_embed_dim = (
self.output_embed_dim + self.lang_embed_dim + args.encoder_embed_dim
)
self.output_projection = nn.Linear(
laser_output_embed_dim, len(dictionary), bias=False
)
nn.init.normal_(
self.output_projection.weight,
mean=0,
std=laser_output_embed_dim ** -0.5,
)
def build_decoder_layer(self, args, no_encoder_attn=False):
decoder_embed_dim = args.decoder_embed_dim
args.decoder_embed_dim = (
decoder_embed_dim + self.lang_embed_dim + args.encoder_embed_dim
)
res = TransformerDecoderLayer(args, no_encoder_attn=True)
args.decoder_embed_dim = decoder_embed_dim
return res
def extract_features(
self,
prev_output_tokens,
encoder_out: Optional[Dict[str, List[Tensor]]],
incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None,
full_context_alignment: bool = False,
alignment_layer: Optional[int] = None,
alignment_heads: Optional[int] = None,
lang_id: Optional[int] = None,
):
"""
Similar to *forward* but only return features.
Includes several features from "Jointly Learning to Align and
Translate with Transformer Models" (Garg et al., EMNLP 2019).
Args:
full_context_alignment (bool, optional): don't apply
auto-regressive mask to self-attention (default: False).
alignment_layer (int, optional): return mean alignment over
heads at this layer (default: last layer).
alignment_heads (int, optional): only average alignment over
this many heads (default: all heads).
Returns:
tuple:
- the decoder's features of shape `(batch, tgt_len, embed_dim)`
- a dictionary with any model-specific outputs
"""
if alignment_layer is None:
alignment_layer = self.num_layers - 1
# embed positions
positions = (
self.embed_positions(
prev_output_tokens, incremental_state=incremental_state
)
if self.embed_positions is not None
else None
)
if incremental_state is not None:
prev_output_tokens = prev_output_tokens[:, -1:]
if positions is not None:
positions = positions[:, -1:]
bsz, seqlen = prev_output_tokens.size()
# embed tokens and positions
x = self.embed_scale * self.embed_tokens(prev_output_tokens)
if self.quant_noise is not None:
x = self.quant_noise(x)
if self.project_in_dim is not None:
x = self.project_in_dim(x)
if positions is not None:
x += positions
if self.layernorm_embedding is not None:
x = self.layernorm_embedding(x)
x = self.dropout_module(x)
# B x T x C -> T x B x C
x = x.transpose(0, 1)
if self.embed_lang is not None:
lang_ids = prev_output_tokens.data.new_full((bsz,), lang_id)
langemb = self.embed_lang(lang_ids)
langemb = langemb.unsqueeze(0)
repeat_vals = [x.shape[0] // langemb.shape[0]] + [-1] * (
len(langemb.shape) - 1
)
x = torch.cat((x, langemb.expand(*repeat_vals)), dim=-1)
sentemb = encoder_out["sentemb"][0]
sentemb = sentemb.unsqueeze(0)
repeat_vals = [x.shape[0] // sentemb.shape[0]] + [-1] * (len(sentemb.shape) - 1)
x = torch.cat((x, sentemb.expand(*repeat_vals)), dim=-1)
self_attn_padding_mask: Optional[Tensor] = None
if self.cross_self_attention or prev_output_tokens.eq(self.padding_idx).any():
self_attn_padding_mask = prev_output_tokens.eq(self.padding_idx)
# decoder layers
attn: Optional[Tensor] = None
inner_states: List[Optional[Tensor]] = [x]
for idx, layer in enumerate(self.layers):
if incremental_state is None and not full_context_alignment:
self_attn_mask = self.buffered_future_mask(x)
else:
self_attn_mask = None
x, layer_attn, _ = layer(
x,
None,
None,
incremental_state,
self_attn_mask=self_attn_mask,
self_attn_padding_mask=self_attn_padding_mask,
need_attn=bool((idx == alignment_layer)),
need_head_weights=bool((idx == alignment_layer)),
)
inner_states.append(x)
if layer_attn is not None and idx == alignment_layer:
attn = layer_attn.float().to(x)
if attn is not None:
if alignment_heads is not None:
attn = attn[:alignment_heads]
# average probabilities over heads
attn = attn.mean(dim=0)
if self.layer_norm is not None:
x = self.layer_norm(x)
# T x B x C -> B x T x C
x = x.transpose(0, 1)
if self.project_out_dim is not None:
x = self.project_out_dim(x)
return x, {"attn": [attn], "inner_states": inner_states}
def forward(
self,
prev_output_tokens,
encoder_out: Optional[Dict[str, List[Tensor]]] = None,
incremental_state: Optional[Dict[str, Dict[str, Optional[Tensor]]]] = None,
features_only: bool = False,
alignment_layer: Optional[int] = None,
alignment_heads: Optional[int] = None,
src_lengths: Optional[Any] = None,
return_all_hiddens: bool = False,
lang_id: Optional[int] = None,
):
"""
Args:
prev_output_tokens (LongTensor): previous decoder outputs of shape
`(batch, tgt_len)`, for teacher forcing
encoder_out (optional): output from the encoder, used for
encoder-side attention
incremental_state (dict): dictionary used for storing state during
:ref:`Incremental decoding`
features_only (bool, optional): only return features without
applying output layer (default: False).
Returns:
tuple:
- the decoder's output of shape `(batch, tgt_len, vocab)`
- a dictionary with any model-specific outputs
"""
assert lang_id is not None
x, extra = self.extract_features(
prev_output_tokens,
encoder_out=encoder_out,
incremental_state=incremental_state,
alignment_layer=alignment_layer,
alignment_heads=alignment_heads,
lang_id=lang_id,
)
if not features_only:
x = self.output_layer(x)
return x, extra
@register_model_architecture("laser_transformer", "laser_transformer")
def base_laser_transformer_architecture(args):
base_architecture(args)
args.decoder_lang_embed_dim = getattr(args, "decoder_lang_embed_dim", 0)
| mit |
florian-f/sklearn | examples/linear_model/plot_lasso_coordinate_descent_path.py | 4 | 2823 | """
=====================
Lasso and Elastic Net
=====================
Lasso and elastic net (L1 and L2 penalisation) implemented using a
coordinate descent.
The coefficients can be forced to be positive.
"""
print(__doc__)
# Author: Alexandre Gramfort <alexandre.gramfort@inria.fr>
# License: BSD Style.
import numpy as np
import pylab as pl
from sklearn.linear_model import lasso_path, enet_path
from sklearn import datasets
diabetes = datasets.load_diabetes()
X = diabetes.data
y = diabetes.target
X /= X.std(0) # Standardize data (easier to set the l1_ratio parameter)
###############################################################################
# Compute paths
eps = 5e-3 # the smaller it is the longer is the path
print("Computing regularization path using the lasso...")
models = lasso_path(X, y, eps=eps)
alphas_lasso = np.array([model.alpha for model in models])
coefs_lasso = np.array([model.coef_ for model in models])
print("Computing regularization path using the positive lasso...")
models = lasso_path(X, y, eps=eps, positive=True)
alphas_positive_lasso = np.array([model.alpha for model in models])
coefs_positive_lasso = np.array([model.coef_ for model in models])
print("Computing regularization path using the elastic net...")
models = enet_path(X, y, eps=eps, l1_ratio=0.8)
alphas_enet = np.array([model.alpha for model in models])
coefs_enet = np.array([model.coef_ for model in models])
print("Computing regularization path using the positve elastic net...")
models = enet_path(X, y, eps=eps, l1_ratio=0.8, positive=True)
alphas_positive_enet = np.array([model.alpha for model in models])
coefs_positive_enet = np.array([model.coef_ for model in models])
###############################################################################
# Display results
pl.figure(1)
ax = pl.gca()
ax.set_color_cycle(2 * ['b', 'r', 'g', 'c', 'k'])
l1 = pl.plot(coefs_lasso)
l2 = pl.plot(coefs_enet, linestyle='--')
pl.xlabel('-Log(lambda)')
pl.ylabel('weights')
pl.title('Lasso and Elastic-Net Paths')
pl.legend((l1[-1], l2[-1]), ('Lasso', 'Elastic-Net'), loc='lower left')
pl.axis('tight')
pl.figure(2)
ax = pl.gca()
ax.set_color_cycle(2 * ['b', 'r', 'g', 'c', 'k'])
l1 = pl.plot(coefs_lasso)
l2 = pl.plot(coefs_positive_lasso, linestyle='--')
pl.xlabel('-Log(lambda)')
pl.ylabel('weights')
pl.title('Lasso and positive Lasso')
pl.legend((l1[-1], l2[-1]), ('Lasso', 'positive Lasso'), loc='lower left')
pl.axis('tight')
pl.figure(3)
ax = pl.gca()
ax.set_color_cycle(2 * ['b', 'r', 'g', 'c', 'k'])
l1 = pl.plot(coefs_enet)
l2 = pl.plot(coefs_positive_enet, linestyle='--')
pl.xlabel('-Log(lambda)')
pl.ylabel('weights')
pl.title('Elastic-Net and positive Elastic-Net')
pl.legend((l1[-1], l2[-1]), ('Elastic-Net', 'positive Elastic-Net'),
loc='lower left')
pl.axis('tight')
pl.show()
| bsd-3-clause |
luanjunyi/cortana | model/sk_general/train.py | 1 | 3684 | # -*- coding: utf-8 -*-
import sys, os, math
import argparse
import cPickle as pickle
from collections import defaultdict
import numpy as np
import scipy.sparse as sparse
from sklearn import cross_validation
from sklearn.pipeline import Pipeline
from sklearn.grid_search import GridSearchCV
from sklearn.naive_bayes import BernoulliNB
from sklearn.linear_model import LogisticRegression
from sklearn.linear_model import SGDClassifier
from sklearn.neighbors import KNeighborsClassifier
from sklearn.svm import LinearSVC
from sklearn.feature_extraction.text import CountVectorizer, TfidfVectorizer
from sklearn.feature_selection import SelectKBest, chi2
from util.log import _logger
from util import *
from feat.terms.term_categorize import term_category
CLFs = {
"nb": BernoulliNB(fit_prior = False),
"sgd": SGDClassifier(penalty="l2", class_weight="auto", n_iter=100),
"svm_ovr": LinearSVC(loss='l1', penalty="l2", multi_class="ovr", class_weight="auto"),
"svm_sin": LinearSVC(loss='l1', penalty="l2", multi_class="crammer_singer"),
"knn": KNeighborsClassifier(n_neighbors=10, weights = 'distance')
}
class Vectorizer(object):
def __init__(self):
self.count_vec = TfidfVectorizer(binary = True,
ngram_range = (1, 3),
tokenizer = Tokenizer())
self.last_vec = CountVectorizer(binary = True, ngram_range = (1, 1), tokenizer = Tokenizer())
def collect_last_term(self, X):
X_last = list()
tokens = self.last_vec.build_tokenizer()
_logger.debug("Extracting last term for each sentence")
for sent in X:
X_last.append(tokens(sent)[-1])
_logger.debug("Fitting last-term vectorizer")
return X_last
def fit(self, X, y = None):
_logger.debug("Fitting count vectorizer")
self.count_vec.fit(X)
X_last = self.collect_last_term(X)
self.last_vec.fit(X_last)
return self
def transform(self, X, y = None):
#return self.count_vec.transform(X)
_logger.debug("Doing tfidf transform")
Xc = self.count_vec.transform(X)
X_last = self.collect_last_term(X)
_logger.debug("Doing last term transform")
Xl = self.last_vec.transform(X_last)
_logger.debug("stacking features")
ret = sparse.hstack([Xc, Xl])
tokens = self.count_vec.build_tokenizer()
l = list()
for sent in X:
terms = tokens(sent)
l.append(1 if ("__LOCATION__" in terms and "__ORGNIZATION__" in terms) else 0)
l = np.array(l)
l.shape = len(l), 1
ret = sparse.hstack([ret, l])
_logger.debug("vectorization transform done")
return ret
if __name__ == "__main__":
cmd = argparse.ArgumentParser()
cmd.add_argument("--input", help="path of the training data", default = TRAIN_FILE_PATH)
cmd.add_argument("--algo", help="alogrithm to use", required=True, choices = CLFs.keys())
args = cmd.parse_args()
X, y = load_data(args.input)
_logger.info("training using %s" % args.algo)
pipeline = Pipeline([
("vert", TfidfVectorizer(min_df = 1, binary = True, ngram_range = (1, 3),
tokenizer = Tokenizer())),
#("vert", Vectorizer()),
("clf", CLFs[args.algo]),
])
pipeline.fit(X, y)
from decode import test
test(TEST_FILE_PATH, pipeline)
outpath = "%s.model" % args.algo
with open(outpath, "w") as outfile:
pickle.dump(pipeline, outfile)
_logger.info("Model dumpped to %s" % outpath)
| mit |
WilsonWangTHU/clothesDetection | tools/train_svms.py | 42 | 13247 | #!/usr/bin/env python
# --------------------------------------------------------
# Fast R-CNN
# Copyright (c) 2015 Microsoft
# Licensed under The MIT License [see LICENSE for details]
# Written by Ross Girshick
# --------------------------------------------------------
"""
Train post-hoc SVMs using the algorithm and hyper-parameters from
traditional R-CNN.
"""
import _init_paths
from fast_rcnn.config import cfg, cfg_from_file
from datasets.factory import get_imdb
from fast_rcnn.test import im_detect
from utils.timer import Timer
import caffe
import argparse
import pprint
import numpy as np
import numpy.random as npr
import cv2
from sklearn import svm
import os, sys
class SVMTrainer(object):
"""
Trains post-hoc detection SVMs for all classes using the algorithm
and hyper-parameters of traditional R-CNN.
"""
def __init__(self, net, imdb):
self.imdb = imdb
self.net = net
self.layer = 'fc7'
self.hard_thresh = -1.0001
self.neg_iou_thresh = 0.3
dim = net.params['cls_score'][0].data.shape[1]
scale = self._get_feature_scale()
print('Feature dim: {}'.format(dim))
print('Feature scale: {:.3f}'.format(scale))
self.trainers = [SVMClassTrainer(cls, dim, feature_scale=scale)
for cls in imdb.classes]
def _get_feature_scale(self, num_images=100):
TARGET_NORM = 20.0 # Magic value from traditional R-CNN
_t = Timer()
roidb = self.imdb.roidb
total_norm = 0.0
count = 0.0
inds = npr.choice(xrange(self.imdb.num_images), size=num_images,
replace=False)
for i_, i in enumerate(inds):
im = cv2.imread(self.imdb.image_path_at(i))
if roidb[i]['flipped']:
im = im[:, ::-1, :]
_t.tic()
scores, boxes = im_detect(self.net, im, roidb[i]['boxes'])
_t.toc()
feat = self.net.blobs[self.layer].data
total_norm += np.sqrt((feat ** 2).sum(axis=1)).sum()
count += feat.shape[0]
print('{}/{}: avg feature norm: {:.3f}'.format(i_ + 1, num_images,
total_norm / count))
return TARGET_NORM * 1.0 / (total_norm / count)
def _get_pos_counts(self):
counts = np.zeros((len(self.imdb.classes)), dtype=np.int)
roidb = self.imdb.roidb
for i in xrange(len(roidb)):
for j in xrange(1, self.imdb.num_classes):
I = np.where(roidb[i]['gt_classes'] == j)[0]
counts[j] += len(I)
for j in xrange(1, self.imdb.num_classes):
print('class {:s} has {:d} positives'.
format(self.imdb.classes[j], counts[j]))
return counts
def get_pos_examples(self):
counts = self._get_pos_counts()
for i in xrange(len(counts)):
self.trainers[i].alloc_pos(counts[i])
_t = Timer()
roidb = self.imdb.roidb
num_images = len(roidb)
# num_images = 100
for i in xrange(num_images):
im = cv2.imread(self.imdb.image_path_at(i))
if roidb[i]['flipped']:
im = im[:, ::-1, :]
gt_inds = np.where(roidb[i]['gt_classes'] > 0)[0]
gt_boxes = roidb[i]['boxes'][gt_inds]
_t.tic()
scores, boxes = im_detect(self.net, im, gt_boxes)
_t.toc()
feat = self.net.blobs[self.layer].data
for j in xrange(1, self.imdb.num_classes):
cls_inds = np.where(roidb[i]['gt_classes'][gt_inds] == j)[0]
if len(cls_inds) > 0:
cls_feat = feat[cls_inds, :]
self.trainers[j].append_pos(cls_feat)
print 'get_pos_examples: {:d}/{:d} {:.3f}s' \
.format(i + 1, len(roidb), _t.average_time)
def initialize_net(self):
# Start all SVM parameters at zero
self.net.params['cls_score'][0].data[...] = 0
self.net.params['cls_score'][1].data[...] = 0
# Initialize SVMs in a smart way. Not doing this because its such
# a good initialization that we might not learn something close to
# the SVM solution.
# # subtract background weights and biases for the foreground classes
# w_bg = self.net.params['cls_score'][0].data[0, :]
# b_bg = self.net.params['cls_score'][1].data[0]
# self.net.params['cls_score'][0].data[1:, :] -= w_bg
# self.net.params['cls_score'][1].data[1:] -= b_bg
# # set the background weights and biases to 0 (where they shall remain)
# self.net.params['cls_score'][0].data[0, :] = 0
# self.net.params['cls_score'][1].data[0] = 0
def update_net(self, cls_ind, w, b):
self.net.params['cls_score'][0].data[cls_ind, :] = w
self.net.params['cls_score'][1].data[cls_ind] = b
def train_with_hard_negatives(self):
_t = Timer()
roidb = self.imdb.roidb
num_images = len(roidb)
# num_images = 100
for i in xrange(num_images):
im = cv2.imread(self.imdb.image_path_at(i))
if roidb[i]['flipped']:
im = im[:, ::-1, :]
_t.tic()
scores, boxes = im_detect(self.net, im, roidb[i]['boxes'])
_t.toc()
feat = self.net.blobs[self.layer].data
for j in xrange(1, self.imdb.num_classes):
hard_inds = \
np.where((scores[:, j] > self.hard_thresh) &
(roidb[i]['gt_overlaps'][:, j].toarray().ravel() <
self.neg_iou_thresh))[0]
if len(hard_inds) > 0:
hard_feat = feat[hard_inds, :].copy()
new_w_b = \
self.trainers[j].append_neg_and_retrain(feat=hard_feat)
if new_w_b is not None:
self.update_net(j, new_w_b[0], new_w_b[1])
print(('train_with_hard_negatives: '
'{:d}/{:d} {:.3f}s').format(i + 1, len(roidb),
_t.average_time))
def train(self):
# Initialize SVMs using
# a. w_i = fc8_w_i - fc8_w_0
# b. b_i = fc8_b_i - fc8_b_0
# c. Install SVMs into net
self.initialize_net()
# Pass over roidb to count num positives for each class
# a. Pre-allocate arrays for positive feature vectors
# Pass over roidb, computing features for positives only
self.get_pos_examples()
# Pass over roidb
# a. Compute cls_score with forward pass
# b. For each class
# i. Select hard negatives
# ii. Add them to cache
# c. For each class
# i. If SVM retrain criteria met, update SVM
# ii. Install new SVM into net
self.train_with_hard_negatives()
# One final SVM retraining for each class
# Install SVMs into net
for j in xrange(1, self.imdb.num_classes):
new_w_b = self.trainers[j].append_neg_and_retrain(force=True)
self.update_net(j, new_w_b[0], new_w_b[1])
class SVMClassTrainer(object):
"""Manages post-hoc SVM training for a single object class."""
def __init__(self, cls, dim, feature_scale=1.0,
C=0.001, B=10.0, pos_weight=2.0):
self.pos = np.zeros((0, dim), dtype=np.float32)
self.neg = np.zeros((0, dim), dtype=np.float32)
self.B = B
self.C = C
self.cls = cls
self.pos_weight = pos_weight
self.dim = dim
self.feature_scale = feature_scale
self.svm = svm.LinearSVC(C=C, class_weight={1: 2, -1: 1},
intercept_scaling=B, verbose=1,
penalty='l2', loss='l1',
random_state=cfg.RNG_SEED, dual=True)
self.pos_cur = 0
self.num_neg_added = 0
self.retrain_limit = 2000
self.evict_thresh = -1.1
self.loss_history = []
def alloc_pos(self, count):
self.pos_cur = 0
self.pos = np.zeros((count, self.dim), dtype=np.float32)
def append_pos(self, feat):
num = feat.shape[0]
self.pos[self.pos_cur:self.pos_cur + num, :] = feat
self.pos_cur += num
def train(self):
print('>>> Updating {} detector <<<'.format(self.cls))
num_pos = self.pos.shape[0]
num_neg = self.neg.shape[0]
print('Cache holds {} pos examples and {} neg examples'.
format(num_pos, num_neg))
X = np.vstack((self.pos, self.neg)) * self.feature_scale
y = np.hstack((np.ones(num_pos),
-np.ones(num_neg)))
self.svm.fit(X, y)
w = self.svm.coef_
b = self.svm.intercept_[0]
scores = self.svm.decision_function(X)
pos_scores = scores[:num_pos]
neg_scores = scores[num_pos:]
pos_loss = (self.C * self.pos_weight *
np.maximum(0, 1 - pos_scores).sum())
neg_loss = self.C * np.maximum(0, 1 + neg_scores).sum()
reg_loss = 0.5 * np.dot(w.ravel(), w.ravel()) + 0.5 * b ** 2
tot_loss = pos_loss + neg_loss + reg_loss
self.loss_history.append((tot_loss, pos_loss, neg_loss, reg_loss))
for i, losses in enumerate(self.loss_history):
print((' {:d}: obj val: {:.3f} = {:.3f} '
'(pos) + {:.3f} (neg) + {:.3f} (reg)').format(i, *losses))
return ((w * self.feature_scale, b * self.feature_scale),
pos_scores, neg_scores)
def append_neg_and_retrain(self, feat=None, force=False):
if feat is not None:
num = feat.shape[0]
self.neg = np.vstack((self.neg, feat))
self.num_neg_added += num
if self.num_neg_added > self.retrain_limit or force:
self.num_neg_added = 0
new_w_b, pos_scores, neg_scores = self.train()
# scores = np.dot(self.neg, new_w_b[0].T) + new_w_b[1]
# easy_inds = np.where(neg_scores < self.evict_thresh)[0]
not_easy_inds = np.where(neg_scores >= self.evict_thresh)[0]
if len(not_easy_inds) > 0:
self.neg = self.neg[not_easy_inds, :]
# self.neg = np.delete(self.neg, easy_inds)
print(' Pruning easy negatives')
print(' Cache holds {} pos examples and {} neg examples'.
format(self.pos.shape[0], self.neg.shape[0]))
print(' {} pos support vectors'.format((pos_scores <= 1).sum()))
print(' {} neg support vectors'.format((neg_scores >= -1).sum()))
return new_w_b
else:
return None
def parse_args():
"""
Parse input arguments
"""
parser = argparse.ArgumentParser(description='Train SVMs (old skool)')
parser.add_argument('--gpu', dest='gpu_id', help='GPU device id to use [0]',
default=0, type=int)
parser.add_argument('--def', dest='prototxt',
help='prototxt file defining the network',
default=None, type=str)
parser.add_argument('--net', dest='caffemodel',
help='model to test',
default=None, type=str)
parser.add_argument('--cfg', dest='cfg_file',
help='optional config file', default=None, type=str)
parser.add_argument('--imdb', dest='imdb_name',
help='dataset to train on',
default='voc_2007_trainval', type=str)
if len(sys.argv) == 1:
parser.print_help()
sys.exit(1)
args = parser.parse_args()
return args
if __name__ == '__main__':
# Must turn this off to prevent issues when digging into the net blobs to
# pull out features (tricky!)
cfg.DEDUP_BOXES = 0
# Must turn this on because we use the test im_detect() method to harvest
# hard negatives
cfg.TEST.SVM = True
args = parse_args()
print('Called with args:')
print(args)
if args.cfg_file is not None:
cfg_from_file(args.cfg_file)
print('Using config:')
pprint.pprint(cfg)
# fix the random seed for reproducibility
np.random.seed(cfg.RNG_SEED)
# set up caffe
caffe.set_mode_gpu()
if args.gpu_id is not None:
caffe.set_device(args.gpu_id)
net = caffe.Net(args.prototxt, args.caffemodel, caffe.TEST)
net.name = os.path.splitext(os.path.basename(args.caffemodel))[0]
out = os.path.splitext(os.path.basename(args.caffemodel))[0] + '_svm'
out_dir = os.path.dirname(args.caffemodel)
imdb = get_imdb(args.imdb_name)
print 'Loaded dataset `{:s}` for training'.format(imdb.name)
# enhance roidb to contain flipped examples
if cfg.TRAIN.USE_FLIPPED:
print 'Appending horizontally-flipped training examples...'
imdb.append_flipped_roidb()
print 'done'
SVMTrainer(net, imdb).train()
filename = '{}/{}.caffemodel'.format(out_dir, out)
net.save(filename)
print 'Wrote svm model to: {:s}'.format(filename)
| mit |
pytorch/fairseq | tests/test_transformer.py | 1 | 1942 | import argparse
import unittest
from typing import Any, Dict, Sequence
import torch
from fairseq.models import transformer
from tests.test_roberta import FakeTask
def mk_sample(tok: Sequence[int] = None, batch_size: int = 2) -> Dict[str, Any]:
if not tok:
tok = [10, 11, 12, 13, 14, 15, 2]
batch = torch.stack([torch.tensor(tok, dtype=torch.long)] * batch_size)
sample = {
"net_input": {
"src_tokens": batch,
"prev_output_tokens": batch,
"src_lengths": torch.tensor(
[len(tok)] * batch_size, dtype=torch.long, device=batch.device
),
},
"target": batch[:, 1:],
}
return sample
def mk_transformer(**extra_args: Any):
overrides = {
# Use characteristics dimensions
"encoder_embed_dim": 12,
"encoder_ffn_embed_dim": 14,
"decoder_embed_dim": 12,
"decoder_ffn_embed_dim": 14,
# Disable dropout so we have comparable tests.
"dropout": 0,
"attention_dropout": 0,
"activation_dropout": 0,
"encoder_layerdrop": 0,
}
overrides.update(extra_args)
# Overrides the defaults from the parser
args = argparse.Namespace(**overrides)
transformer.tiny_architecture(args)
torch.manual_seed(0)
task = FakeTask(args)
return transformer.TransformerModel.build_model(args, task)
class TransformerTestCase(unittest.TestCase):
def test_forward_backward(self):
model = mk_transformer(encoder_embed_dim=12, decoder_embed_dim=12)
sample = mk_sample()
o, _ = model.forward(**sample["net_input"])
loss = o.sum()
loss.backward()
def test_different_encoder_decoder_embed_dim(self):
model = mk_transformer(encoder_embed_dim=12, decoder_embed_dim=16)
sample = mk_sample()
o, _ = model.forward(**sample["net_input"])
loss = o.sum()
loss.backward()
| mit |
pytorch/fairseq | fairseq/criterions/nat_loss.py | 1 | 6355 | # Copyright (c) Facebook, Inc. and its affiliates.
#
# This source code is licensed under the MIT license found in the
# LICENSE file in the root directory of this source tree.
import math
import torch
import torch.nn.functional as F
from fairseq import metrics, utils
from fairseq.criterions import FairseqCriterion, register_criterion
from fairseq.dataclass import FairseqDataclass
from torch import Tensor
from dataclasses import dataclass, field
@dataclass
class LabelSmoothedDualImitationCriterionConfig(FairseqDataclass):
label_smoothing: float = field(
default=0.0,
metadata={"help": "epsilon for label smoothing, 0 means no label smoothing"},
)
@register_criterion("nat_loss", dataclass=LabelSmoothedDualImitationCriterionConfig)
class LabelSmoothedDualImitationCriterion(FairseqCriterion):
def __init__(self, task, label_smoothing):
super().__init__(task)
self.label_smoothing = label_smoothing
def _compute_loss(
self, outputs, targets, masks=None, label_smoothing=0.0, name="loss", factor=1.0
):
"""
outputs: batch x len x d_model
targets: batch x len
masks: batch x len
policy_logprob: if there is some policy
depends on the likelihood score as rewards.
"""
def mean_ds(x: Tensor, dim=None) -> Tensor:
return (
x.float().mean().type_as(x)
if dim is None
else x.float().mean(dim).type_as(x)
)
if masks is not None:
outputs, targets = outputs[masks], targets[masks]
if masks is not None and not masks.any():
nll_loss = torch.tensor(0)
loss = nll_loss
else:
logits = F.log_softmax(outputs, dim=-1)
if targets.dim() == 1:
losses = F.nll_loss(logits, targets.to(logits.device), reduction="none")
else: # soft-labels
losses = F.kl_div(logits, targets.to(logits.device), reduction="none")
losses = losses.sum(-1)
nll_loss = mean_ds(losses)
if label_smoothing > 0:
loss = (
nll_loss * (1 - label_smoothing) - mean_ds(logits) * label_smoothing
)
else:
loss = nll_loss
loss = loss * factor
return {"name": name, "loss": loss, "nll_loss": nll_loss, "factor": factor}
def _custom_loss(self, loss, name="loss", factor=1.0):
return {"name": name, "loss": loss, "factor": factor}
def forward(self, model, sample, reduce=True):
"""Compute the loss for the given sample.
Returns a tuple with three elements:
1) the loss
2) the sample size, which is used as the denominator for the gradient
3) logging outputs to display while training
"""
nsentences, ntokens = sample["nsentences"], sample["ntokens"]
# B x T
src_tokens, src_lengths = (
sample["net_input"]["src_tokens"],
sample["net_input"]["src_lengths"],
)
tgt_tokens, prev_output_tokens = sample["target"], sample["prev_target"]
outputs = model(src_tokens, src_lengths, prev_output_tokens, tgt_tokens)
losses, nll_loss = [], []
for obj in outputs:
if outputs[obj].get("loss", None) is None:
_losses = self._compute_loss(
outputs[obj].get("out"),
outputs[obj].get("tgt"),
outputs[obj].get("mask", None),
outputs[obj].get("ls", 0.0),
name=obj + "-loss",
factor=outputs[obj].get("factor", 1.0),
)
else:
_losses = self._custom_loss(
outputs[obj].get("loss"),
name=obj + "-loss",
factor=outputs[obj].get("factor", 1.0),
)
losses += [_losses]
if outputs[obj].get("nll_loss", False):
nll_loss += [_losses.get("nll_loss", 0.0)]
loss = sum(l["loss"] for l in losses)
nll_loss = sum(l for l in nll_loss) if len(nll_loss) > 0 else loss.new_tensor(0)
# NOTE:
# we don't need to use sample_size as denominator for the gradient
# here sample_size is just used for logging
sample_size = 1
logging_output = {
"loss": loss.data,
"nll_loss": nll_loss.data,
"ntokens": ntokens,
"nsentences": nsentences,
"sample_size": sample_size,
}
for l in losses:
logging_output[l["name"]] = (
utils.item(l["loss"].data / l["factor"])
if reduce
else l[["loss"]].data / l["factor"]
)
return loss, sample_size, logging_output
@staticmethod
def reduce_metrics(logging_outputs) -> None:
"""Aggregate logging outputs from data parallel training."""
sample_size = utils.item(
sum(log.get("sample_size", 0) for log in logging_outputs)
)
loss = utils.item(sum(log.get("loss", 0) for log in logging_outputs))
nll_loss = utils.item(sum(log.get("nll_loss", 0) for log in logging_outputs))
metrics.log_scalar(
"loss", loss / sample_size / math.log(2), sample_size, round=3
)
metrics.log_scalar(
"nll_loss", nll_loss / sample_size / math.log(2), sample_size, round=3
)
metrics.log_derived(
"ppl", lambda meters: utils.get_perplexity(meters["loss"].avg)
)
for key in logging_outputs[0]:
if key[-5:] == "-loss":
val = sum(log.get(key, 0) for log in logging_outputs)
metrics.log_scalar(
key[:-5],
val / sample_size / math.log(2) if sample_size > 0 else 0.0,
sample_size,
round=3,
)
@staticmethod
def logging_outputs_can_be_summed() -> bool:
"""
Whether the logging outputs returned by `forward` can be summed
across workers prior to calling `reduce_metrics`. Setting this
to True will improves distributed training speed.
"""
return True
| mit |
neilhan/tensorflow | tensorflow/contrib/learn/python/learn/tests/nonlinear_test.py | 9 | 3837 | # Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""Non-linear estimator tests."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import random
import tensorflow as tf
class NonLinearTest(tf.test.TestCase):
"""Non-linear estimator tests."""
def setUp(self):
random.seed(42)
tf.set_random_seed(42)
def testIrisDNN(self):
iris = tf.contrib.learn.datasets.load_iris()
feature_columns = [tf.contrib.layers.real_valued_column("", dimension=4)]
classifier = tf.contrib.learn.DNNClassifier(
feature_columns=feature_columns, hidden_units=[10, 20, 10], n_classes=3,
config=tf.contrib.learn.RunConfig(tf_random_seed=1))
classifier.fit(iris.data, iris.target, max_steps=200)
weights = classifier.weights_
self.assertEqual(weights[0].shape, (4, 10))
self.assertEqual(weights[1].shape, (10, 20))
self.assertEqual(weights[2].shape, (20, 10))
self.assertEqual(weights[3].shape, (10, 3))
biases = classifier.bias_
self.assertEqual(len(biases), 5)
def testBostonDNN(self):
boston = tf.contrib.learn.datasets.load_boston()
feature_columns = [tf.contrib.layers.real_valued_column("", dimension=13)]
regressor = tf.contrib.learn.DNNRegressor(
feature_columns=feature_columns, hidden_units=[10, 20, 10],
config=tf.contrib.learn.RunConfig(tf_random_seed=1))
regressor.fit(
boston.data, boston.target, steps=300, batch_size=boston.data.shape[0])
weights = regressor.weights_
self.assertEqual(weights[0].shape, (13, 10))
self.assertEqual(weights[1].shape, (10, 20))
self.assertEqual(weights[2].shape, (20, 10))
self.assertEqual(weights[3].shape, (10, 1))
biases = regressor.bias_
self.assertEqual(len(biases), 5)
def testDNNDropout0(self):
# Dropout prob == 0.
iris = tf.contrib.learn.datasets.load_iris()
feature_columns = [tf.contrib.layers.real_valued_column("", dimension=4)]
classifier = tf.contrib.learn.DNNClassifier(
feature_columns=feature_columns, hidden_units=[10, 20, 10], n_classes=3,
dropout=0.0, config=tf.contrib.learn.RunConfig(tf_random_seed=1))
classifier.fit(iris.data, iris.target, max_steps=200)
def testDNNDropout0_1(self):
# Dropping only a little.
iris = tf.contrib.learn.datasets.load_iris()
feature_columns = [tf.contrib.layers.real_valued_column("", dimension=4)]
classifier = tf.contrib.learn.DNNClassifier(
feature_columns=feature_columns, hidden_units=[10, 20, 10], n_classes=3,
dropout=0.1, config=tf.contrib.learn.RunConfig(tf_random_seed=1))
classifier.fit(iris.data, iris.target, max_steps=200)
def testDNNDropout0_9(self):
# Dropping out most of it.
iris = tf.contrib.learn.datasets.load_iris()
feature_columns = [tf.contrib.layers.real_valued_column("", dimension=4)]
classifier = tf.contrib.learn.DNNClassifier(
feature_columns=feature_columns, hidden_units=[10, 20, 10], n_classes=3,
dropout=0.9, config=tf.contrib.learn.RunConfig(tf_random_seed=1))
classifier.fit(iris.data, iris.target, max_steps=200)
if __name__ == "__main__":
tf.test.main()
| apache-2.0 |
GoogleCloudPlatform/python-docs-samples | data-science-onramp/vertex-ai/modules/trainer/sklearn_model/task.py | 1 | 3367 | # Copyright 2021 Google LLC
#
# Licensed under the Apache License, Version 2.0 (the "License")
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# https: // www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# [START aiplatform_sklearn_task]
# [START aiplatform_sklearn_task_imports]
import argparse
import os
import re
from google.cloud import storage
import joblib
from sklearn.metrics import mean_absolute_error
from trainer import utils
from trainer.sklearn_model import model
# [END aiplatform_sklearn_task_imports]
# [START aiplatform_sklearn_task_args]
def get_args() -> argparse.Namespace:
parser = argparse.ArgumentParser()
parser.add_argument(
"--input-path",
type=str,
required=True,
help="path to input data"
)
parser.add_argument(
"--degree",
type=int,
help="degree of the polynomial regression, default=1 (linear model)",
)
parser.add_argument(
"--alpha",
type=float,
help="Regularization strength, default=0 (Standard Regression)",
)
parser.add_argument(
"--model-dir",
type=str,
help="Output directory for the model.",
default=os.getenv("AIP_MODEL_DIR"),
)
return parser.parse_args()
# [END aiplatform_sklearn_task_args]
# [START aiplatform_sklearn_task_fit]
def fit_model(
input_path: str,
model_dir: str,
degree: int = 1,
alpha: int = 0
) -> None:
"""Train, evaluate and save model given model configuration"""
print(f"Fitting model with degree={args.degree} and alpha={args.alpha}")
# Split datasets into training and testing
train_feature, eval_feature, train_target, eval_target = utils.load_data(
input_path)
# Create sklearn pipeline for a polynomial model defined in model.py"""
polynomial_model = model.polynomial_model(degree, alpha)
# Fit the sklearn model
print("Fitting model...")
polynomial_model.fit(train_feature, train_target)
# Evaluate the model
print("Evaluating model...")
pred_target = polynomial_model.predict(eval_feature)
mae = mean_absolute_error(eval_target, pred_target)
print(f"Done. Model had MAE={mae}")
# [END aiplatform_sklearn_task_fit]
# [START aiplatform_sklearn_task_export]
# Save model to GCS
print("Saving model")
matches = re.match("gs://(.*?)/(.*)", model_dir)
bucket = matches.group(1)
blob = matches.group(2)
model_dump = "model.joblib"
joblib.dump(polynomial_model, model_dump)
blob_name = os.path.join(blob, model_dump)
client = storage.Client()
client.bucket(bucket).blob(blob_name).upload_from_filename(model_dump)
print("Model saved")
# [END aiplatform_sklearn_task_export]
if __name__ == "__main__":
args = get_args()
kwargs = {}
if args.degree:
kwargs["degree"] = args.degree
if args.alpha:
kwargs["alpha"] = args.alpha
fit_model(args.input_path, args.model_dir, **kwargs)
# [END aiplatform_sklearn_task]
| apache-2.0 |
GoogleCloudPlatform/bigquery-utils | udfs/tests/udf_test_utils.py | 1 | 7285 | # Copyright 2019 Google LLC
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
import argparse
import glob
from pathlib import Path
import json
from yaml import load
from yaml import SafeLoader
# Some javascript libraries have issues with webpack's auto
# minifier and therefore must be placed in the set below
# to instruct webpack to not minify them.
NO_MINIFY_JS_LIBS = {
'js-levenshtein',
}
def get_dir_to_dataset_mappings():
bq_datasets_yaml_path = Path('./dir_to_dataset_map.yaml')
if bq_datasets_yaml_path.is_file():
with open(bq_datasets_yaml_path, 'r') as yaml_file:
return load(yaml_file, Loader=SafeLoader)
else:
return None
def get_all_udf_paths():
return glob.glob('./**/*.sql', recursive=True)
def get_all_npm_package_config_paths(node_modules_path):
"""
Get all paths to the package.json files for every npm package
specified in the udfs/js_libs/js_libs.yaml file.
:param node_modules_path: path to the node_modules directory
:return: Set containing paths to package.json files
"""
js_libs_dict = get_js_libs_from_yaml()
js_libs_with_versions = set()
npm_package_config_paths = set()
for lib_name in js_libs_dict:
for version in js_libs_dict.get(lib_name).get('versions'):
js_libs_with_versions.add(f'{lib_name}-v{version}')
for npm_package_config_path in glob.glob(
f'{node_modules_path}/**/package.json'):
npm_package_name = Path(npm_package_config_path).parent.name
if npm_package_name in js_libs_with_versions:
npm_package_config_paths.add(Path(npm_package_config_path))
return npm_package_config_paths
def get_js_libs_from_yaml():
"""
Get all npm package names from the /udfs/js_libs/js_libs.yaml
file.
:return: dict representation of the js_libs.yaml file
"""
js_libs_yaml_path = Path('./js_libs/js_libs.yaml')
if js_libs_yaml_path.is_file():
with open(js_libs_yaml_path, 'r') as yaml_file:
return load(yaml_file, Loader=SafeLoader)
else:
return None
def generate_js_libs_package_json():
"""
This dynamically generates the main package.json which will be used to build
all the js libs that are specified in the udfs/js_libs/js_libs.yaml file.
"""
js_libs_dict = get_js_libs_from_yaml()
js_libs_package_dict = {
"name": "js-bq-libs",
"version": "1.0.0",
"scripts": {
"build-all-libs": "concurrently \"npm:webpack-*\""
},
"dependencies": {
f'{lib_name}-v{version}': f'npm:{lib_name}@{version}'
for lib_name in js_libs_dict
for version in js_libs_dict.get(lib_name).get('versions')
},
"devDependencies": {
"webpack": "^5.3.1",
"webpack-cli": "^4.1.0",
"concurrently": "^5.3.0"
}
}
# Update with webpack scripts for building all js packages
for lib_name in js_libs_dict:
for version in js_libs_dict.get(lib_name).get('versions'):
js_libs_package_dict.get('scripts').update({
f'webpack-{lib_name}-v{version}':
f'webpack --config {lib_name}-v{version}-webpack.config.js'
})
with open('./package.json', 'w') as js_libs_package_json:
js_libs_package_json.write(json.dumps(js_libs_package_dict, indent=2))
def generate_webpack_configs():
"""
This dynamically generates all the webpack config files needed
to build the single-file js libs which are specified in the
udfs/js_libs/js_libs.yaml file.
See https://webpack.js.org/concepts/configuration/ for more information
on webpack config files.
"""
node_modules_path = Path('./node_modules')
npm_package_config_paths = get_all_npm_package_config_paths(
node_modules_path)
for npm_package_config_path in npm_package_config_paths:
with open(npm_package_config_path) as npm_package_config:
npm_package_json = json.loads(npm_package_config.read())
# Check for js main entrypoint
# https://docs.npmjs.com/cli/v6/configuring-npm/package-json#main
# If no main entrypoint found, check for a single dependency file
# https://docs.npmjs.com/cli/v6/configuring-npm/package-json#files
js_main_entrypoint = npm_package_json.get('main')
js_dependency_files = npm_package_json.get('files')
js_lib_name = npm_package_json.get('name')
js_lib_version = npm_package_json.get('version')
if js_main_entrypoint is not None:
js_main_entrypoint_path = npm_package_config_path.parent / Path(
js_main_entrypoint)
elif len(js_dependency_files) == 1:
js_main_entrypoint_path = npm_package_config_path.parent / Path(
js_dependency_files[0])
webpack_config_file_path = Path(
f'{npm_package_config_path.parent.name}-webpack.config.js')
minimize_js = True if js_lib_name not in NO_MINIFY_JS_LIBS else False
js_lib_file_extension = ".min.js" if minimize_js else ".js"
with open(webpack_config_file_path, 'w') as webpack_config:
webpack_config.write(
f'var path = require("path");\n'
f'module.exports = {{\n'
f' entry: "./{js_main_entrypoint_path}",\n'
f' output: {{\n'
f' path: path.resolve(__dirname, "js_builds"),\n'
f' filename: "{js_lib_name}-v{js_lib_version}{js_lib_file_extension}",\n'
f' library: "{js_lib_name.replace("-", "_")}",\n'
f' libraryTarget: "var",\n'
f' }},\n'
f' optimization: {{\n'
f' minimize: {"true" if minimize_js else "false"}\n'
f' }},\n'
f' mode: "production",\n'
f'}};')
def main():
parser = argparse.ArgumentParser(
description='Utils Class to support testing BigQuery UDFs')
parser.add_argument(
'--generate-js-libs-package-json',
help='Generate package.json file necessary for building '
'javascript libs for BigQuery UDFs',
action='store_true')
parser.add_argument(
'--generate-webpack-configs',
help='Generate webpack config files necessary for building '
'javascript libs for BigQuery UDFs',
action='store_true')
args = parser.parse_args()
if args.generate_js_libs_package_json:
generate_js_libs_package_json()
elif args.generate_webpack_configs:
generate_webpack_configs()
if __name__ == '__main__':
main()
| apache-2.0 |
peastman/msmbuilder | msmbuilder/lumping/pcca.py | 6 | 4084 | from __future__ import print_function, division, absolute_import
import numpy as np
from ..msm import MarkovStateModel
class PCCA(MarkovStateModel):
"""Perron Cluster Cluster Analysis (PCCA) for coarse-graining (lumping)
microstates into macrostates.
Parameters
----------
n_macrostates : int
The desired number of macrostates in the lumped model.
kwargs : optional
Additional keyword arguments to be passed to MarkovStateModel. See
msmbuilder.msm.MarkovStateModel for possible options.
Notes
-----
PCCA is a subclass of MarkovStateModel. However, the MSM properties
and attributes on PCCA refer to the MICROSTATE properties--e.g.
pcca.transmat_ is the microstate transition matrix. To get the
macrostate transition matrix, you must fit a new MarkovStateModel
object on the output (assignments) of PCCA().
"""
def __init__(self, n_macrostates, pcca_tolerance=1e-5, **kwargs):
self.n_macrostates = n_macrostates
self.pcca_tolerance = pcca_tolerance
super(PCCA, self).__init__(**kwargs)
def fit(self, sequences, y=None):
"""Fit a PCCA lumping model using a sequence of cluster assignments.
Parameters
----------
sequences : list(np.ndarray(dtype='int'))
List of arrays of cluster assignments
y : None
Unused, present for sklearn compatibility only.
Returns
-------
self
"""
super(PCCA, self).fit(sequences, y=y)
self._do_lumping()
return self
def _do_lumping(self):
"""Do the PCCA lumping.
Notes
-------
1. Iterate over the eigenvectors, starting with the slowest.
2. Calculate the spread of that eigenvector within each existing
macrostate.
3. Pick the macrostate with the largest eigenvector spread.
4. Split the macrostate based on the sign of the eigenvector.
"""
# Extract non-perron eigenvectors
right_eigenvectors = self.right_eigenvectors_[:, 1:]
assert self.n_states_ > 0
microstate_mapping = np.zeros(self.n_states_, dtype=int)
def spread(x):
return x.max() - x.min()
for i in range(self.n_macrostates - 1):
v = right_eigenvectors[:, i]
all_spreads = np.array([spread(v[microstate_mapping == k])
for k in range(i + 1)])
state_to_split = np.argmax(all_spreads)
inds = ((microstate_mapping == state_to_split) &
(v >= self.pcca_tolerance))
microstate_mapping[inds] = i + 1
self.microstate_mapping_ = microstate_mapping
def partial_transform(self, sequence, mode='clip'):
trimmed_sequence = super(PCCA, self).partial_transform(sequence, mode)
if mode == 'clip':
return [self.microstate_mapping_[seq] for seq in trimmed_sequence]
elif mode == 'fill':
def nan_get(x):
try:
x = int(x)
return self.microstate_mapping_[x]
except ValueError:
return np.nan
return np.asarray([nan_get(x) for x in trimmed_sequence])
else:
raise ValueError
@classmethod
def from_msm(cls, msm, n_macrostates):
"""Create and fit lumped model from pre-existing MSM.
Parameters
----------
msm : MarkovStateModel
The input microstate msm to use.
n_macrostates : int
The number of macrostates
Returns
-------
lumper : cls
The fit PCCA(+) object.
"""
params = msm.get_params()
lumper = cls(n_macrostates, **params)
lumper.transmat_ = msm.transmat_
lumper.populations_ = msm.populations_
lumper.mapping_ = msm.mapping_
lumper.countsmat_ = msm.countsmat_
lumper.n_states_ = msm.n_states_
lumper._do_lumping()
return lumper
| lgpl-2.1 |
cxhernandez/msmbuilder | msmbuilder/lumping/pcca.py | 6 | 4084 | from __future__ import print_function, division, absolute_import
import numpy as np
from ..msm import MarkovStateModel
class PCCA(MarkovStateModel):
"""Perron Cluster Cluster Analysis (PCCA) for coarse-graining (lumping)
microstates into macrostates.
Parameters
----------
n_macrostates : int
The desired number of macrostates in the lumped model.
kwargs : optional
Additional keyword arguments to be passed to MarkovStateModel. See
msmbuilder.msm.MarkovStateModel for possible options.
Notes
-----
PCCA is a subclass of MarkovStateModel. However, the MSM properties
and attributes on PCCA refer to the MICROSTATE properties--e.g.
pcca.transmat_ is the microstate transition matrix. To get the
macrostate transition matrix, you must fit a new MarkovStateModel
object on the output (assignments) of PCCA().
"""
def __init__(self, n_macrostates, pcca_tolerance=1e-5, **kwargs):
self.n_macrostates = n_macrostates
self.pcca_tolerance = pcca_tolerance
super(PCCA, self).__init__(**kwargs)
def fit(self, sequences, y=None):
"""Fit a PCCA lumping model using a sequence of cluster assignments.
Parameters
----------
sequences : list(np.ndarray(dtype='int'))
List of arrays of cluster assignments
y : None
Unused, present for sklearn compatibility only.
Returns
-------
self
"""
super(PCCA, self).fit(sequences, y=y)
self._do_lumping()
return self
def _do_lumping(self):
"""Do the PCCA lumping.
Notes
-------
1. Iterate over the eigenvectors, starting with the slowest.
2. Calculate the spread of that eigenvector within each existing
macrostate.
3. Pick the macrostate with the largest eigenvector spread.
4. Split the macrostate based on the sign of the eigenvector.
"""
# Extract non-perron eigenvectors
right_eigenvectors = self.right_eigenvectors_[:, 1:]
assert self.n_states_ > 0
microstate_mapping = np.zeros(self.n_states_, dtype=int)
def spread(x):
return x.max() - x.min()
for i in range(self.n_macrostates - 1):
v = right_eigenvectors[:, i]
all_spreads = np.array([spread(v[microstate_mapping == k])
for k in range(i + 1)])
state_to_split = np.argmax(all_spreads)
inds = ((microstate_mapping == state_to_split) &
(v >= self.pcca_tolerance))
microstate_mapping[inds] = i + 1
self.microstate_mapping_ = microstate_mapping
def partial_transform(self, sequence, mode='clip'):
trimmed_sequence = super(PCCA, self).partial_transform(sequence, mode)
if mode == 'clip':
return [self.microstate_mapping_[seq] for seq in trimmed_sequence]
elif mode == 'fill':
def nan_get(x):
try:
x = int(x)
return self.microstate_mapping_[x]
except ValueError:
return np.nan
return np.asarray([nan_get(x) for x in trimmed_sequence])
else:
raise ValueError
@classmethod
def from_msm(cls, msm, n_macrostates):
"""Create and fit lumped model from pre-existing MSM.
Parameters
----------
msm : MarkovStateModel
The input microstate msm to use.
n_macrostates : int
The number of macrostates
Returns
-------
lumper : cls
The fit PCCA(+) object.
"""
params = msm.get_params()
lumper = cls(n_macrostates, **params)
lumper.transmat_ = msm.transmat_
lumper.populations_ = msm.populations_
lumper.mapping_ = msm.mapping_
lumper.countsmat_ = msm.countsmat_
lumper.n_states_ = msm.n_states_
lumper._do_lumping()
return lumper
| lgpl-2.1 |
anntzer/scikit-learn | benchmarks/bench_hist_gradient_boosting_categorical_only.py | 12 | 2623 | import argparse
from time import time
from sklearn.preprocessing import KBinsDiscretizer
from sklearn.datasets import make_classification
from sklearn.ensemble import HistGradientBoostingClassifier
from sklearn.ensemble._hist_gradient_boosting.utils import get_equivalent_estimator
parser = argparse.ArgumentParser()
parser.add_argument("--n-leaf-nodes", type=int, default=31)
parser.add_argument("--n-trees", type=int, default=100)
parser.add_argument("--n-features", type=int, default=20)
parser.add_argument("--n-cats", type=int, default=20)
parser.add_argument("--n-samples", type=int, default=10_000)
parser.add_argument("--lightgbm", action="store_true", default=False)
parser.add_argument("--learning-rate", type=float, default=0.1)
parser.add_argument("--max-bins", type=int, default=255)
parser.add_argument("--no-predict", action="store_true", default=False)
parser.add_argument("--verbose", action="store_true", default=False)
args = parser.parse_args()
n_leaf_nodes = args.n_leaf_nodes
n_features = args.n_features
n_categories = args.n_cats
n_samples = args.n_samples
n_trees = args.n_trees
lr = args.learning_rate
max_bins = args.max_bins
verbose = args.verbose
def fit(est, data_train, target_train, libname, **fit_params):
print(f"Fitting a {libname} model...")
tic = time()
est.fit(data_train, target_train, **fit_params)
toc = time()
print(f"fitted in {toc - tic:.3f}s")
def predict(est, data_test):
# We don't report accuracy or ROC because the dataset doesn't really make
# sense: we treat ordered features as un-ordered categories.
if args.no_predict:
return
tic = time()
est.predict(data_test)
toc = time()
print(f"predicted in {toc - tic:.3f}s")
X, y = make_classification(n_samples=n_samples, n_features=n_features, random_state=0)
X = KBinsDiscretizer(n_bins=n_categories, encode="ordinal").fit_transform(X)
print(f"Number of features: {n_features}")
print(f"Number of samples: {n_samples}")
is_categorical = [True] * n_features
est = HistGradientBoostingClassifier(
loss="log_loss",
learning_rate=lr,
max_iter=n_trees,
max_bins=max_bins,
max_leaf_nodes=n_leaf_nodes,
categorical_features=is_categorical,
early_stopping=False,
random_state=0,
verbose=verbose,
)
fit(est, X, y, "sklearn")
predict(est, X)
if args.lightgbm:
est = get_equivalent_estimator(est, lib="lightgbm", n_classes=2)
est.set_params(max_cat_to_onehot=1) # dont use OHE
categorical_features = list(range(n_features))
fit(est, X, y, "lightgbm", categorical_feature=categorical_features)
predict(est, X)
| bsd-3-clause |
coderbone/SickRage | lib/guessit/__main__.py | 29 | 12284 | #!/usr/bin/env python
# -*- coding: utf-8 -*-
#
# GuessIt - A library for guessing information from filenames
# Copyright (c) 2013 Nicolas Wack <wackou@gmail.com>
# Copyright (c) 2013 Rémi Alvergnat <toilal.dev@gmail.com>
#
# GuessIt is free software; you can redistribute it and/or modify it under
# the terms of the Lesser GNU General Public License as published by
# the Free Software Foundation; either version 3 of the License, or
# (at your option) any later version.
#
# GuessIt is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# Lesser GNU General Public License for more details.
#
# You should have received a copy of the Lesser GNU General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
from __future__ import absolute_import, division, print_function, unicode_literals
from collections import defaultdict
import logging
import os
from guessit import PY2, u, guess_file_info
from guessit.options import get_opts
from guessit.__version__ import __version__
def guess_file(filename, info='filename', options=None, **kwargs):
options = options or {}
filename = u(filename)
if not options.get('yaml') and not options.get('show_property'):
print('For:', filename)
guess = guess_file_info(filename, info, options, **kwargs)
if not options.get('unidentified'):
try:
del guess['unidentified']
except KeyError:
pass
if options.get('show_property'):
print(guess.get(options.get('show_property'), ''))
return
if options.get('yaml'):
import yaml
for k, v in guess.items():
if isinstance(v, list) and len(v) == 1:
guess[k] = v[0]
ystr = yaml.safe_dump({filename: dict(guess)}, default_flow_style=False, allow_unicode=True)
i = 0
for yline in ystr.splitlines():
if i == 0:
print("? " + yline[:-1])
elif i == 1:
print(":" + yline[1:])
else:
print(yline)
i += 1
return
print('GuessIt found:', guess.nice_string(options.get('advanced')))
def _supported_properties():
all_properties = defaultdict(list)
transformers_properties = []
from guessit.plugins import transformers
for transformer in transformers.all_transformers():
supported_properties = transformer.supported_properties()
transformers_properties.append((transformer, supported_properties))
if isinstance(supported_properties, dict):
for property_name, possible_values in supported_properties.items():
all_properties[property_name].extend(possible_values)
else:
for property_name in supported_properties:
all_properties[property_name] # just make sure it exists
return all_properties, transformers_properties
def display_transformers():
print('GuessIt transformers:')
_, transformers_properties = _supported_properties()
for transformer, _ in transformers_properties:
print('[@] %s (%s)' % (transformer.name, transformer.priority))
def display_properties(options):
values = options.values
transformers = options.transformers
name_only = options.name_only
print('GuessIt properties:')
all_properties, transformers_properties = _supported_properties()
if name_only:
# the 'container' property does not apply when using the --name-only
# option
del all_properties['container']
if transformers:
for transformer, properties_list in transformers_properties:
print('[@] %s (%s)' % (transformer.name, transformer.priority))
for property_name in properties_list:
property_values = all_properties.get(property_name)
print(' [+] %s' % (property_name,))
if property_values and values:
_display_property_values(property_name, indent=4)
else:
properties_list = sorted(all_properties.keys())
for property_name in properties_list:
property_values = all_properties.get(property_name)
print(' [+] %s' % (property_name,))
if property_values and values:
_display_property_values(property_name, indent=4)
def _display_property_values(property_name, indent=2):
all_properties, _ = _supported_properties()
property_values = all_properties.get(property_name)
for property_value in property_values:
print(indent * ' ' + '[!] %s' % (property_value,))
def run_demo(episodes=True, movies=True, options=None):
# NOTE: tests should not be added here but rather in the tests/ folder
# this is just intended as a quick example
if episodes:
testeps = ['Series/Californication/Season 2/Californication.2x05.Vaginatown.HDTV.XviD-0TV.[tvu.org.ru].avi',
'Series/dexter/Dexter.5x02.Hello,.Bandit.ENG.-.sub.FR.HDTV.XviD-AlFleNi-TeaM.[tvu.org.ru].avi',
'Series/Treme/Treme.1x03.Right.Place,.Wrong.Time.HDTV.XviD-NoTV.[tvu.org.ru].avi',
'Series/Duckman/Duckman - 101 (01) - 20021107 - I, Duckman.avi',
'Series/Duckman/Duckman - S1E13 Joking The Chicken (unedited).avi',
'Series/Simpsons/The_simpsons_s13e18_-_i_am_furious_yellow.mpg',
'Series/Simpsons/Saison 12 Français/Simpsons,.The.12x08.A.Bas.Le.Sergent.Skinner.FR.[tvu.org.ru].avi',
'Series/Dr._Slump_-_002_DVB-Rip_Catalan_by_kelf.avi',
'Series/Kaamelott/Kaamelott - Livre V - Second Volet - HD 704x396 Xvid 2 pass - Son 5.1 - TntRip by Slurm.avi']
for f in testeps:
print('-' * 80)
guess_file(f, options=options, type='episode')
if movies:
testmovies = ['Movies/Fear and Loathing in Las Vegas (1998)/Fear.and.Loathing.in.Las.Vegas.720p.HDDVD.DTS.x264-ESiR.mkv',
'Movies/El Dia de la Bestia (1995)/El.dia.de.la.bestia.DVDrip.Spanish.DivX.by.Artik[SEDG].avi',
'Movies/Blade Runner (1982)/Blade.Runner.(1982).(Director\'s.Cut).CD1.DVDRip.XviD.AC3-WAF.avi',
'Movies/Dark City (1998)/Dark.City.(1998).DC.BDRip.720p.DTS.X264-CHD.mkv',
'Movies/Sin City (BluRay) (2005)/Sin.City.2005.BDRip.720p.x264.AC3-SEPTiC.mkv',
'Movies/Borat (2006)/Borat.(2006).R5.PROPER.REPACK.DVDRip.XviD-PUKKA.avi',
'[XCT].Le.Prestige.(The.Prestige).DVDRip.[x264.HP.He-Aac.{Fr-Eng}.St{Fr-Eng}.Chaps].mkv',
'Battle Royale (2000)/Battle.Royale.(Batoru.Rowaiaru).(2000).(Special.Edition).CD1of2.DVDRiP.XviD-[ZeaL].avi',
'Movies/Brazil (1985)/Brazil_Criterion_Edition_(1985).CD2.English.srt',
'Movies/Persepolis (2007)/[XCT] Persepolis [H264+Aac-128(Fr-Eng)+ST(Fr-Eng)+Ind].mkv',
'Movies/Toy Story (1995)/Toy Story [HDTV 720p English-Spanish].mkv',
'Movies/Pirates of the Caribbean: The Curse of the Black Pearl (2003)/Pirates.Of.The.Carribean.DC.2003.iNT.DVDRip.XviD.AC3-NDRT.CD1.avi',
'Movies/Office Space (1999)/Office.Space.[Dual-DVDRip].[Spanish-English].[XviD-AC3-AC3].[by.Oswald].avi',
'Movies/The NeverEnding Story (1984)/The.NeverEnding.Story.1.1984.DVDRip.AC3.Xvid-Monteque.avi',
'Movies/Juno (2007)/Juno KLAXXON.avi',
'Movies/Chat noir, chat blanc (1998)/Chat noir, Chat blanc - Emir Kusturica (VO - VF - sub FR - Chapters).mkv',
'Movies/Wild Zero (2000)/Wild.Zero.DVDivX-EPiC.srt',
'Movies/El Bosque Animado (1987)/El.Bosque.Animado.[Jose.Luis.Cuerda.1987].[Xvid-Dvdrip-720x432].avi',
'testsmewt_bugs/movies/Baraka_Edition_Collector.avi'
]
for f in testmovies:
print('-' * 80)
guess_file(f, options=options, type='movie')
def submit_bug(filename, options):
import requests # only import when needed
from requests.exceptions import RequestException
try:
opts = dict((k, v) for k, v in options.__dict__.items()
if v and k != 'submit_bug')
r = requests.post('http://guessit.io/bugs', {'filename': filename,
'version': __version__,
'options': str(opts)})
if r.status_code == 200:
print('Successfully submitted file: %s' % r.text)
else:
print('Could not submit bug at the moment, please try again later: %s %s' % (r.status_code, r.reason))
except RequestException as e:
print('Could not submit bug at the moment, please try again later: %s' % e)
def main(args=None, setup_logging=True):
if setup_logging:
from guessit import slogging
slogging.setup_logging()
if PY2: # pragma: no cover
import codecs
import locale
import sys
# see http://bugs.python.org/issue2128
if os.name == 'nt':
for i, a in enumerate(sys.argv):
sys.argv[i] = a.decode(locale.getpreferredencoding())
# see https://github.com/wackou/guessit/issues/43
# and http://stackoverflow.com/questions/4545661/unicodedecodeerror-when-redirecting-to-file
# Wrap sys.stdout into a StreamWriter to allow writing unicode.
sys.stdout = codecs.getwriter(locale.getpreferredencoding())(sys.stdout)
# Needed for guessit.plugins.transformers.reload() to be called.
from guessit.plugins import transformers
if args:
options = get_opts().parse_args(args)
else: # pragma: no cover
options = get_opts().parse_args()
if options.verbose:
logging.getLogger().setLevel(logging.DEBUG)
help_required = True
if options.properties or options.values:
display_properties(options)
help_required = False
elif options.transformers:
display_transformers()
help_required = False
if options.demo:
run_demo(episodes=True, movies=True, options=vars(options))
help_required = False
if options.version:
print('+-------------------------------------------------------+')
print('+ GuessIt ' + __version__ + (28-len(__version__)) * ' ' + '+')
print('+-------------------------------------------------------+')
print('| Please report any bug or feature request at |')
print('| https://github.com/wackou/guessit/issues. |')
print('+-------------------------------------------------------+')
help_required = False
if options.yaml:
try:
import yaml, babelfish
def default_representer(dumper, data):
return dumper.represent_str(str(data))
yaml.SafeDumper.add_representer(babelfish.Language, default_representer)
yaml.SafeDumper.add_representer(babelfish.Country, default_representer)
except ImportError: # pragma: no cover
print('PyYAML not found. Using default output.')
filenames = []
if options.filename:
filenames.extend(options.filename)
if options.input_file:
input_file = open(options.input_file, 'r')
try:
filenames.extend([line.strip() for line in input_file.readlines()])
finally:
input_file.close()
filenames = filter(lambda f: f, filenames)
if filenames:
if options.submit_bug:
for filename in filenames:
help_required = False
submit_bug(filename, options)
else:
for filename in filenames:
help_required = False
guess_file(filename,
info=options.info.split(','),
options=vars(options))
if help_required: # pragma: no cover
get_opts().print_help()
if __name__ == '__main__':
main()
| gpl-3.0 |
ECP-CANDLE/Benchmarks | Pilot3/P3B1/p3b1_baseline_keras2.py | 1 | 9548 | from __future__ import print_function
import candle
import numpy as np
import p3b1 as bmk
from sklearn.metrics import f1_score
from tensorflow.keras import backend as K
from tensorflow.keras.layers import Dense, Dropout, Input
from tensorflow.keras.models import Model
def initialize_parameters(default_model="p3b1_default_model.txt"):
# Build benchmark object
p3b1Bmk = bmk.BenchmarkP3B1(
bmk.file_path,
default_model,
"keras",
prog="p3b1_baseline",
desc="Multi-task (DNN) for data extraction \
from clinical reports - Pilot 3 Benchmark 1",
)
# Initialize parameters
gParameters = candle.finalize_parameters(p3b1Bmk)
# bmk.logger.info('Params: {}'.format(gParameters))
return gParameters
def fetch_data(gParameters):
"""Downloads and decompresses the data if not locally available.
Since the training data depends on the model definition it is not loaded,
instead the local path where the raw data resides is returned
"""
path = gParameters["data_url"]
fpath = candle.fetch_file(path + gParameters["train_data"], "Pilot3", unpack=True)
return fpath
def build_model(
gParameters,
kerasDefaults,
shared_nnet_spec,
individual_nnet_spec,
input_dim,
Y_train,
Y_test,
verbose=False,
):
labels_train = []
labels_test = []
n_out_nodes = []
for idx in range(len(Y_train)):
truth_train = np.array(Y_train[idx], dtype="int32")
truth_test = np.array(Y_test[idx], dtype="int32")
mv = int(np.max(truth_train))
label_train = np.zeros((len(truth_train), mv + 1))
for i in range(len(truth_train)):
label_train[i, truth_train[i]] = 1
label_test = np.zeros((len(truth_test), mv + 1))
for i in range(len(truth_test)):
label_test[i, truth_test[i]] = 1
labels_train.append(label_train)
labels_test.append(label_test)
n_out_nodes.append(mv + 1)
shared_layers = []
# input layer
layer = Input(shape=(input_dim,), name="input")
shared_layers.append(layer)
# shared layers
for k in range(len(shared_nnet_spec)):
layer = Dense(
shared_nnet_spec[k],
activation=gParameters["activation"],
name="shared_layer_" + str(k),
)(shared_layers[-1])
shared_layers.append(layer)
if gParameters["dropout"] > 0:
layer = Dropout(gParameters["dropout"])(shared_layers[-1])
shared_layers.append(layer)
# individual layers
indiv_layers_arr = []
models = []
trainable_count = 0
non_trainable_count = 0
for idx in range(len(individual_nnet_spec)):
indiv_layers = [shared_layers[-1]]
for k in range(len(individual_nnet_spec[idx]) + 1):
if k < len(individual_nnet_spec[idx]):
layer = Dense(
individual_nnet_spec[idx][k],
activation=gParameters["activation"],
name="indiv_layer_" + str(idx) + "_" + str(k),
)(indiv_layers[-1])
indiv_layers.append(layer)
if gParameters["dropout"] > 0:
layer = Dropout(gParameters["dropout"])(indiv_layers[-1])
indiv_layers.append(layer)
else:
layer = Dense(
n_out_nodes[idx],
activation=gParameters["out_activation"],
name="out_" + str(idx),
)(indiv_layers[-1])
indiv_layers.append(layer)
indiv_layers_arr.append(indiv_layers)
model = Model(inputs=[shared_layers[0]], outputs=[indiv_layers[-1]])
# calculate trainable/non-trainable param count for each model
param_counts = candle.compute_trainable_params(model)
trainable_count += param_counts["trainable_params"]
non_trainable_count += param_counts["non_trainable_params"]
models.append(model)
# capture total param counts
gParameters["trainable_params"] = trainable_count
gParameters["non_trainable_params"] = non_trainable_count
gParameters["total_params"] = trainable_count + non_trainable_count
# Define optimizer
optimizer = candle.build_optimizer(
gParameters["optimizer"], gParameters["learning_rate"], kerasDefaults
)
# DEBUG - verify
if verbose:
for k in range(len(models)):
model = models[k]
print("Model: ", k)
model.summary()
for k in range(len(models)):
model = models[k]
model.compile(
loss=gParameters["loss"],
optimizer=optimizer,
metrics=[gParameters["metrics"]],
)
return models, labels_train, labels_test
def train_model(
gParameters, models, X_train, Y_train, X_test, Y_test, fold, verbose=False
):
base_run_id = gParameters["run_id"]
for epoch in range(gParameters["epochs"]):
for k in range(len(models)):
model = models[k]
gParameters["run_id"] = base_run_id + ".{}.{}.{}".format(fold, epoch, k)
candleRemoteMonitor = candle.CandleRemoteMonitor(params=gParameters)
timeoutMonitor = candle.TerminateOnTimeOut(gParameters["timeout"])
model.fit(
{"input": X_train[k]},
{"out_" + str(k): Y_train[k]},
epochs=1,
verbose=verbose,
callbacks=[candleRemoteMonitor, timeoutMonitor],
batch_size=gParameters["batch_size"],
validation_data=(X_test[k], Y_test[k]),
)
return models
def evaluate_model(X_test, truths_test, labels_test, models):
# retrieve truth-pred pair
avg_loss = 0.0
ret = []
for k in range(len(models)):
ret_k = []
feature_test = X_test[k]
truth_test = truths_test[k]
label_test = labels_test[k]
model = models[k]
loss = model.evaluate(feature_test, label_test)
avg_loss = avg_loss + loss[0]
print("In EVALUATE loss: ", loss)
pred = model.predict(feature_test)
ret_k.append(truth_test)
ret_k.append(np.argmax(pred, axis=1))
ret.append(ret_k)
avg_loss = avg_loss / float(len(models))
ret.append(avg_loss)
return ret
def run(gParameters):
fpath = fetch_data(gParameters)
# Get default parameters for initialization and optimizer functions
kerasDefaults = candle.keras_default_config()
# Construct structures common to all folds
# shared_nnet_spec = []
# elem = gParameters['shared_nnet_spec'].split(',')
# for el in elem:
# shared_nnet_spec.append(int(el))
# individual_nnet_spec = []
# indiv = gParameters['ind_nnet_spec'].split(':')
# for ind in indiv:
# indiv_nnet_spec = []
# elem = ind.split(',')
# for el in elem:
# indiv_nnet_spec.append(int(el))
# individual_nnet_spec.append(indiv_nnet_spec)
shared_nnet_spec = gParameters["shared_nnet_spec"]
individual_nnet_spec = gParameters["ind_nnet_spec"]
# Construct features common to all folds
features = []
feat = gParameters["feature_names"].split(":")
for f in feat:
features.append(f)
n_feat = len(feat)
print("Feature names:")
for i in range(n_feat):
print(features[i])
# initialize arrays for all the features
truth_array = [[] for _ in range(n_feat)]
pred_array = [[] for _ in range(n_feat)]
avg_loss = 0.0
# stdout display level
verbose = True
# per fold
for fold in range(gParameters["n_fold"]):
# build data
X_train, Y_train, X_test, Y_test = bmk.build_data(
len(individual_nnet_spec), fold, fpath
)
# build model
input_dim = len(X_train[0][0])
models, labels_train, labels_test = build_model(
gParameters,
kerasDefaults,
shared_nnet_spec,
individual_nnet_spec,
input_dim,
Y_train,
Y_test,
verbose,
)
# train model
models = train_model(
gParameters,
models,
X_train,
labels_train,
X_test,
labels_test,
fold,
verbose,
)
# evaluate model
ret = evaluate_model(X_test, Y_test, labels_test, models)
for i in range(n_feat):
truth_array[i].extend(ret[i][0])
pred_array[i].extend(ret[i][1])
avg_loss += ret[-1]
avg_loss /= float(gParameters["n_fold"])
for task in range(n_feat):
print(
"Task",
task + 1,
":",
features[task],
"- Macro F1 score",
f1_score(truth_array[task], pred_array[task], average="macro"),
)
print(
"Task",
task + 1,
":",
features[task],
"- Micro F1 score",
f1_score(truth_array[task], pred_array[task], average="micro"),
)
return avg_loss
def main():
gParameters = initialize_parameters()
avg_loss = run(gParameters)
print("Average loss: ", avg_loss)
if __name__ == "__main__":
main()
try:
K.clear_session()
except AttributeError: # theano does not have this function
pass
| mit |
google/jax | jax/experimental/jax2tf/examples/saved_model_main.py | 1 | 7779 | # Copyright 2020 The JAX Authors.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# https://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Demonstrates training models and saving the result as a SavedModel.
By default, uses a pure JAX implementation of MNIST. There are flags to choose
a Flax CNN version of MNIST, or to skip the training and just test a
previously saved SavedModel. It is possible to save a batch-polymorphic
version of the model, or a model prepared for specific batch sizes.
Try --help to see all flags.
This file is used both as an executable, and as a library in two other examples.
See discussion in README.md.
"""
import logging
import os
from absl import app
from absl import flags
from jax.experimental.jax2tf.examples import mnist_lib # type: ignore
from jax.experimental.jax2tf.examples import saved_model_lib # type: ignore
import numpy as np
import tensorflow as tf # type: ignore
import tensorflow_datasets as tfds # type: ignore
flags.DEFINE_enum("model", "mnist_flax", ["mnist_flax", "mnist_pure_jax"],
"Which model to use.")
flags.DEFINE_boolean("model_classifier_layer", True,
("The model should include the classifier layer, or just "
"the last layer of logits. Set this to False when you "
"want to reuse the classifier-less model in a larger "
"model. See keras_reuse_main.py and README.md."))
flags.DEFINE_string("model_path", "/tmp/jax2tf/saved_models",
"Path under which to save the SavedModel.")
flags.DEFINE_integer("model_version", 1,
("The version number for the SavedModel. Needed for "
"serving, larger versions will take precedence"),
lower_bound=1)
flags.DEFINE_integer("serving_batch_size", 1,
"For what batch size to prepare the serving signature. "
"Use -1 for converting and saving with batch polymorphism.")
flags.register_validator(
"serving_batch_size",
lambda serving_batch_size: serving_batch_size > 0 or serving_batch_size == -1,
message="--serving_batch_size must be either -1 or a positive integer.")
flags.DEFINE_integer("num_epochs", 3, "For how many epochs to train.",
lower_bound=1)
flags.DEFINE_boolean(
"generate_model", True,
"Train and save a new model. Otherwise, use an existing SavedModel.")
flags.DEFINE_boolean(
"compile_model", True,
"Enable TensorFlow jit_compiler for the SavedModel. This is "
"necessary if you want to use the model for TensorFlow serving.")
flags.DEFINE_boolean("show_model", True, "Show details of saved SavedModel.")
flags.DEFINE_boolean(
"show_images", False,
"Plot some sample images with labels and inference results.")
flags.DEFINE_boolean(
"test_savedmodel", True,
"Test TensorFlow inference using the SavedModel w.r.t. the JAX model.")
FLAGS = flags.FLAGS
def train_and_save():
logging.info("Loading the MNIST TensorFlow dataset")
train_ds = mnist_lib.load_mnist(
tfds.Split.TRAIN, batch_size=mnist_lib.train_batch_size)
test_ds = mnist_lib.load_mnist(
tfds.Split.TEST, batch_size=mnist_lib.test_batch_size)
if FLAGS.show_images:
mnist_lib.plot_images(train_ds, 1, 5, "Training images", inference_fn=None)
the_model_class = pick_model_class()
model_dir = savedmodel_dir(with_version=True)
if FLAGS.generate_model:
model_descr = model_description()
logging.info("Generating model for %s", model_descr)
(predict_fn, predict_params) = the_model_class.train(
train_ds,
test_ds,
FLAGS.num_epochs,
with_classifier=FLAGS.model_classifier_layer)
if FLAGS.serving_batch_size == -1:
# Batch-polymorphic SavedModel
input_signatures = [
tf.TensorSpec((None,) + mnist_lib.input_shape, tf.float32),
]
polymorphic_shapes = "(batch, ...)"
else:
input_signatures = [
# The first one will be the serving signature
tf.TensorSpec((FLAGS.serving_batch_size,) + mnist_lib.input_shape,
tf.float32),
tf.TensorSpec((mnist_lib.train_batch_size,) + mnist_lib.input_shape,
tf.float32),
tf.TensorSpec((mnist_lib.test_batch_size,) + mnist_lib.input_shape,
tf.float32),
]
polymorphic_shapes = None
logging.info("Saving model for %s", model_descr)
saved_model_lib.convert_and_save_model(
predict_fn,
predict_params,
model_dir,
with_gradient=True,
input_signatures=input_signatures,
polymorphic_shapes=polymorphic_shapes,
compile_model=FLAGS.compile_model)
if FLAGS.test_savedmodel:
tf_accelerator, tolerances = tf_accelerator_and_tolerances()
with tf.device(tf_accelerator):
logging.info("Testing savedmodel")
pure_restored_model = tf.saved_model.load(model_dir)
if FLAGS.show_images and FLAGS.model_classifier_layer:
mnist_lib.plot_images(
test_ds,
1,
5,
f"Inference results for {model_descr}",
inference_fn=pure_restored_model)
test_input = np.ones(
(mnist_lib.test_batch_size,) + mnist_lib.input_shape,
dtype=np.float32)
np.testing.assert_allclose(
pure_restored_model(tf.convert_to_tensor(test_input)),
predict_fn(predict_params, test_input), **tolerances)
if FLAGS.show_model:
def print_model(model_dir: str):
cmd = f"saved_model_cli show --all --dir {model_dir}"
print(cmd)
os.system(cmd)
print_model(model_dir)
def pick_model_class():
"""Picks one of PureJaxMNIST or FlaxMNIST."""
if FLAGS.model == "mnist_pure_jax":
return mnist_lib.PureJaxMNIST
elif FLAGS.model == "mnist_flax":
return mnist_lib.FlaxMNIST
else:
raise ValueError(f"Unrecognized model: {FLAGS.model}")
def model_description() -> str:
"""A short description of the picked model."""
res = pick_model_class().name
if not FLAGS.model_classifier_layer:
res += " (features_only)"
return res
def savedmodel_dir(with_version: bool = True) -> str:
"""The directory where we save the SavedModel."""
model_dir = os.path.join(
FLAGS.model_path,
FLAGS.model + ('' if FLAGS.model_classifier_layer else '_features')
)
if with_version:
model_dir = os.path.join(model_dir, str(FLAGS.model_version))
return model_dir
def tf_accelerator_and_tolerances():
"""Picks the TF accelerator to use and the tolerances for numerical checks."""
tf_accelerator = (tf.config.list_logical_devices("TPU") +
tf.config.list_logical_devices("GPU") +
tf.config.list_logical_devices("CPU"))[0]
logging.info("Using tf_accelerator = %s", tf_accelerator)
if tf_accelerator.device_type == "TPU":
tolerances = dict(atol=1e-6, rtol=1e-6)
elif tf_accelerator.device_type == "GPU":
tolerances = dict(atol=1e-6, rtol=1e-4)
elif tf_accelerator.device_type == "CPU":
tolerances = dict(atol=1e-5, rtol=1e-5)
logging.info("Using tolerances %s", tolerances)
return tf_accelerator, tolerances
if __name__ == "__main__":
app.run(lambda _: train_and_save())
| apache-2.0 |
BestSonny/examples | word_language_model/data.py | 9 | 1439 | import os
import torch
class Dictionary(object):
def __init__(self):
self.word2idx = {}
self.idx2word = []
def add_word(self, word):
if word not in self.word2idx:
self.idx2word.append(word)
self.word2idx[word] = len(self.idx2word) - 1
return self.word2idx[word]
def __len__(self):
return len(self.idx2word)
class Corpus(object):
def __init__(self, path):
self.dictionary = Dictionary()
self.train = self.tokenize(os.path.join(path, 'train.txt'))
self.valid = self.tokenize(os.path.join(path, 'valid.txt'))
self.test = self.tokenize(os.path.join(path, 'test.txt'))
def tokenize(self, path):
"""Tokenizes a text file."""
assert os.path.exists(path)
# Add words to the dictionary
with open(path, 'r') as f:
tokens = 0
for line in f:
words = line.split() + ['<eos>']
tokens += len(words)
for word in words:
self.dictionary.add_word(word)
# Tokenize file content
with open(path, 'r') as f:
ids = torch.LongTensor(tokens)
token = 0
for line in f:
words = line.split() + ['<eos>']
for word in words:
ids[token] = self.dictionary.word2idx[word]
token += 1
return ids
| bsd-3-clause |
ECP-CANDLE/Benchmarks | common/darts/architecture.py | 1 | 6846 | import darts.functional as F
import torch
from torch import autograd, optim
class Hyperparameters:
alpha_lr = 3e-4
alpha_wd = 1e-3
class Architecture:
def __init__(self, model, args, hyperparams=Hyperparameters(), device="cpu"):
self.momentum = args.momentum # momentum for optimizer of theta
self.wd = args.weight_decay # weight decay for optimizer of model's theta
self.model = model # main model with respect to theta and alpha
self.device = device
# this is the optimizer to optimize alpha parameter
self.optimizer = optim.Adam(
self.model.arch_parameters(),
lr=hyperparams.alpha_lr,
betas=(0.5, 0.999),
weight_decay=hyperparams.alpha_wd,
)
def comp_unrolled_model(self, data, target, eta, optimizer):
"""Loss on train set and then update w_pi, not-in-place
Parameters
----------
data : torch.tensor
target : torch.tensor
eta : float
optimizer : torch.optim.optimizer
optimizer of theta, not optimizer of alpha
Returns
-------
model_unrolled
"""
# forward to get loss
loss = self.model.loss(data, target)
# flatten current weights
theta = F.flatten(self.model.parameters()).detach()
try:
# fetch momentum data from theta optimizer
moment = F.flatten(
optimizer.state[v]["momentum_buffer"] for v in self.model.parameters()
)
moment.mul_(self.momentum)
except Exception:
moment = torch.zeros_like(theta)
# flatten all gradients
dtheta = F.flatten(autograd.grad(loss, self.model.parameters())).data
# indeed, here we implement a simple SGD with momentum and weight decay
# theta = theta - eta * (moment + weight decay + dtheta)
theta = theta.sub(eta, moment + dtheta + self.wd * theta)
# construct a new model
unrolled_model = self.construct_model_from_theta(theta)
return unrolled_model.to(self.device)
def step(
self, x_train, target_train, x_valid, target_valid, eta, optimizer, unrolled
):
"""
update alpha parameter by manually computing the gradients
:param x_train:
:param target_train:
:param x_valid:
:param target_valid:
:param eta:
:param optimizer: theta optimizer
:param unrolled:
:return:
"""
# alpha optimizer
self.optimizer.zero_grad()
# compute the gradient and write it into tensor.grad
# instead of generated by loss.backward()
if unrolled:
self.backward_step_unrolled(
x_train, target_train, x_valid, target_valid, eta, optimizer
)
else:
# directly optimize alpha on w, instead of w_pi
self.backward_step(x_valid, target_valid)
self.optimizer.step()
def backward_step(self, x_valid, target_valid):
"""
simply train on validate set and backward
:param x_valid:
:param target_valid:
:return:
"""
_, loss = self.model.loss(x_valid, target_valid, reduce="mean")
# both alpha and theta require grad but only alpha optimizer will
# step in current phase.
loss.backward()
def backward_step_unrolled(
self, x_train, target_train, x_valid, target_valid, eta, optimizer
):
"""
train on validate set based on update w_pi
:param x_train:
:param target_train:
:param x_valid:
:param target_valid:
:param eta: 0.01, according to author's comments
:param optimizer: theta optimizer
:return:
"""
# theta_pi = theta - lr * grad
unrolled_model = self.comp_unrolled_model(x_train, target_train, eta, optimizer)
# calculate loss on theta_pi
unrolled_loss = unrolled_model.loss(x_valid, target_valid)
# this will update theta_pi model, but NOT theta model
unrolled_loss.backward()
# grad(L(w', a), a), part of Eq. 6
dalpha = [v.grad for v in unrolled_model.arch_parameters()]
vector = [v.grad.data for v in unrolled_model.parameters()]
implicit_grads = self.hessian_vector_product(vector, x_train, target_train)
for g, ig in zip(dalpha, implicit_grads):
# g = g - eta * ig, from Eq. 6
g.data.sub_(eta, ig.data)
# write updated alpha into original model
for v, g in zip(self.model.arch_parameters(), dalpha):
if v.grad is None:
v.grad = g.data
else:
v.grad.data.copy_(g.data)
def construct_model_from_theta(self, theta):
"""
construct a new model with initialized weight from theta
it use .state_dict() and load_state_dict() instead of
.parameters() + fill_()
:param theta: flatten weights, need to reshape to original shape
:return:
"""
model = self.model.new()
state_dict = self.model.state_dict()
params, offset = {}, 0
for k, v in self.model.named_parameters():
v_length = v.numel()
# restore theta[] value to original shape
params[k] = theta[offset : offset + v_length].view(v.size())
offset += v_length
assert offset == len(theta)
state_dict.update(params)
model.load_state_dict(state_dict)
model.to(self.device)
return model
def hessian_vector_product(self, vector, data, target, r=1e-2):
"""
slightly touch vector value to estimate the gradient with respect to alpha
refer to Eq. 7 for more details.
:param vector: gradient.data of parameters theta
:param x:
:param target:
:param r:
:return:
"""
R = r / F.flatten(vector).norm()
for p, v in zip(self.model.parameters(), vector):
# w+ = w + R * v
p.data.add_(R, v)
loss = self.model.loss(data, target)
# gradient with respect to alpha
grads_p = autograd.grad(loss, self.model.arch_parameters())
for p, v in zip(self.model.parameters(), vector):
# w- = (w+R*v) - 2R*v
p.data.sub_(2 * R, v)
loss = self.model.loss(data, target)
grads_n = autograd.grad(loss, self.model.arch_parameters())
for p, v in zip(self.model.parameters(), vector):
# w = (w+R*v) - 2R*v + R*v
p.data.add_(R, v)
h = [(x - y).div_(2 * R) for x, y in zip(grads_p, grads_n)]
# h len: 2 h0 torch.Size([14, 8])
# print('h len:', len(h), 'h0', h[0].shape)
return h
| mit |
anntzer/scikit-learn | sklearn/impute/_base.py | 7 | 38334 | # Authors: Nicolas Tresegnie <nicolas.tresegnie@gmail.com>
# Sergey Feldman <sergeyfeldman@gmail.com>
# License: BSD 3 clause
import numbers
import warnings
from collections import Counter
import numpy as np
import numpy.ma as ma
from scipy import sparse as sp
from ..base import BaseEstimator, TransformerMixin
from ..utils._param_validation import StrOptions, Hidden
from ..utils.fixes import _mode
from ..utils.sparsefuncs import _get_median
from ..utils.validation import check_is_fitted
from ..utils.validation import FLOAT_DTYPES
from ..utils.validation import _check_feature_names_in
from ..utils._mask import _get_mask
from ..utils import _is_pandas_na
from ..utils import is_scalar_nan
def _check_inputs_dtype(X, missing_values):
if _is_pandas_na(missing_values):
# Allow using `pd.NA` as missing values to impute numerical arrays.
return
if X.dtype.kind in ("f", "i", "u") and not isinstance(missing_values, numbers.Real):
raise ValueError(
"'X' and 'missing_values' types are expected to be"
" both numerical. Got X.dtype={} and "
" type(missing_values)={}.".format(X.dtype, type(missing_values))
)
def _most_frequent(array, extra_value, n_repeat):
"""Compute the most frequent value in a 1d array extended with
[extra_value] * n_repeat, where extra_value is assumed to be not part
of the array."""
# Compute the most frequent value in array only
if array.size > 0:
if array.dtype == object:
# scipy.stats.mode is slow with object dtype array.
# Python Counter is more efficient
counter = Counter(array)
most_frequent_count = counter.most_common(1)[0][1]
# tie breaking similarly to scipy.stats.mode
most_frequent_value = min(
value
for value, count in counter.items()
if count == most_frequent_count
)
else:
mode = _mode(array)
most_frequent_value = mode[0][0]
most_frequent_count = mode[1][0]
else:
most_frequent_value = 0
most_frequent_count = 0
# Compare to array + [extra_value] * n_repeat
if most_frequent_count == 0 and n_repeat == 0:
return np.nan
elif most_frequent_count < n_repeat:
return extra_value
elif most_frequent_count > n_repeat:
return most_frequent_value
elif most_frequent_count == n_repeat:
# tie breaking similarly to scipy.stats.mode
return min(most_frequent_value, extra_value)
class _BaseImputer(TransformerMixin, BaseEstimator):
"""Base class for all imputers.
It adds automatically support for `add_indicator`.
"""
_parameter_constraints: dict = {
"missing_values": ["missing_values"],
"add_indicator": ["boolean"],
}
def __init__(self, *, missing_values=np.nan, add_indicator=False):
self.missing_values = missing_values
self.add_indicator = add_indicator
def _fit_indicator(self, X):
"""Fit a MissingIndicator."""
if self.add_indicator:
self.indicator_ = MissingIndicator(
missing_values=self.missing_values, error_on_new=False
)
self.indicator_._fit(X, precomputed=True)
else:
self.indicator_ = None
def _transform_indicator(self, X):
"""Compute the indicator mask.'
Note that X must be the original data as passed to the imputer before
any imputation, since imputation may be done inplace in some cases.
"""
if self.add_indicator:
if not hasattr(self, "indicator_"):
raise ValueError(
"Make sure to call _fit_indicator before _transform_indicator"
)
return self.indicator_.transform(X)
def _concatenate_indicator(self, X_imputed, X_indicator):
"""Concatenate indicator mask with the imputed data."""
if not self.add_indicator:
return X_imputed
hstack = sp.hstack if sp.issparse(X_imputed) else np.hstack
if X_indicator is None:
raise ValueError(
"Data from the missing indicator are not provided. Call "
"_fit_indicator and _transform_indicator in the imputer "
"implementation."
)
return hstack((X_imputed, X_indicator))
def _concatenate_indicator_feature_names_out(self, names, input_features):
if not self.add_indicator:
return names
indicator_names = self.indicator_.get_feature_names_out(input_features)
return np.concatenate([names, indicator_names])
def _more_tags(self):
return {"allow_nan": is_scalar_nan(self.missing_values)}
class SimpleImputer(_BaseImputer):
"""Univariate imputer for completing missing values with simple strategies.
Replace missing values using a descriptive statistic (e.g. mean, median, or
most frequent) along each column, or using a constant value.
Read more in the :ref:`User Guide <impute>`.
.. versionadded:: 0.20
`SimpleImputer` replaces the previous `sklearn.preprocessing.Imputer`
estimator which is now removed.
Parameters
----------
missing_values : int, float, str, np.nan, None or pandas.NA, default=np.nan
The placeholder for the missing values. All occurrences of
`missing_values` will be imputed. For pandas' dataframes with
nullable integer dtypes with missing values, `missing_values`
can be set to either `np.nan` or `pd.NA`.
strategy : str, default='mean'
The imputation strategy.
- If "mean", then replace missing values using the mean along
each column. Can only be used with numeric data.
- If "median", then replace missing values using the median along
each column. Can only be used with numeric data.
- If "most_frequent", then replace missing using the most frequent
value along each column. Can be used with strings or numeric data.
If there is more than one such value, only the smallest is returned.
- If "constant", then replace missing values with fill_value. Can be
used with strings or numeric data.
.. versionadded:: 0.20
strategy="constant" for fixed value imputation.
fill_value : str or numerical value, default=None
When strategy == "constant", fill_value is used to replace all
occurrences of missing_values.
If left to the default, fill_value will be 0 when imputing numerical
data and "missing_value" for strings or object data types.
verbose : int, default=0
Controls the verbosity of the imputer.
.. deprecated:: 1.1
The 'verbose' parameter was deprecated in version 1.1 and will be
removed in 1.3. A warning will always be raised upon the removal of
empty columns in the future version.
copy : bool, default=True
If True, a copy of X will be created. If False, imputation will
be done in-place whenever possible. Note that, in the following cases,
a new copy will always be made, even if `copy=False`:
- If `X` is not an array of floating values;
- If `X` is encoded as a CSR matrix;
- If `add_indicator=True`.
add_indicator : bool, default=False
If True, a :class:`MissingIndicator` transform will stack onto output
of the imputer's transform. This allows a predictive estimator
to account for missingness despite imputation. If a feature has no
missing values at fit/train time, the feature won't appear on
the missing indicator even if there are missing values at
transform/test time.
Attributes
----------
statistics_ : array of shape (n_features,)
The imputation fill value for each feature.
Computing statistics can result in `np.nan` values.
During :meth:`transform`, features corresponding to `np.nan`
statistics will be discarded.
indicator_ : :class:`~sklearn.impute.MissingIndicator`
Indicator used to add binary indicators for missing values.
`None` if `add_indicator=False`.
n_features_in_ : int
Number of features seen during :term:`fit`.
.. versionadded:: 0.24
feature_names_in_ : ndarray of shape (`n_features_in_`,)
Names of features seen during :term:`fit`. Defined only when `X`
has feature names that are all strings.
.. versionadded:: 1.0
See Also
--------
IterativeImputer : Multivariate imputer that estimates values to impute for
each feature with missing values from all the others.
KNNImputer : Multivariate imputer that estimates missing features using
nearest samples.
Notes
-----
Columns which only contained missing values at :meth:`fit` are discarded
upon :meth:`transform` if strategy is not `"constant"`.
In a prediction context, simple imputation usually performs poorly when
associated with a weak learner. However, with a powerful learner, it can
lead to as good or better performance than complex imputation such as
:class:`~sklearn.impute.IterativeImputer` or :class:`~sklearn.impute.KNNImputer`.
Examples
--------
>>> import numpy as np
>>> from sklearn.impute import SimpleImputer
>>> imp_mean = SimpleImputer(missing_values=np.nan, strategy='mean')
>>> imp_mean.fit([[7, 2, 3], [4, np.nan, 6], [10, 5, 9]])
SimpleImputer()
>>> X = [[np.nan, 2, 3], [4, np.nan, 6], [10, np.nan, 9]]
>>> print(imp_mean.transform(X))
[[ 7. 2. 3. ]
[ 4. 3.5 6. ]
[10. 3.5 9. ]]
"""
_parameter_constraints: dict = {
**_BaseImputer._parameter_constraints,
"strategy": [StrOptions({"mean", "median", "most_frequent", "constant"})],
"fill_value": "no_validation", # any object is valid
"verbose": ["verbose", Hidden(StrOptions({"deprecated"}))],
"copy": ["boolean"],
}
def __init__(
self,
*,
missing_values=np.nan,
strategy="mean",
fill_value=None,
verbose="deprecated",
copy=True,
add_indicator=False,
):
super().__init__(missing_values=missing_values, add_indicator=add_indicator)
self.strategy = strategy
self.fill_value = fill_value
self.verbose = verbose
self.copy = copy
def _validate_input(self, X, in_fit):
if self.strategy in ("most_frequent", "constant"):
# If input is a list of strings, dtype = object.
# Otherwise ValueError is raised in SimpleImputer
# with strategy='most_frequent' or 'constant'
# because the list is converted to Unicode numpy array
if isinstance(X, list) and any(
isinstance(elem, str) for row in X for elem in row
):
dtype = object
else:
dtype = None
else:
dtype = FLOAT_DTYPES
if not in_fit and self._fit_dtype.kind == "O":
# Use object dtype if fitted on object dtypes
dtype = self._fit_dtype
if _is_pandas_na(self.missing_values) or is_scalar_nan(self.missing_values):
force_all_finite = "allow-nan"
else:
force_all_finite = True
try:
X = self._validate_data(
X,
reset=in_fit,
accept_sparse="csc",
dtype=dtype,
force_all_finite=force_all_finite,
copy=self.copy,
)
except ValueError as ve:
if "could not convert" in str(ve):
new_ve = ValueError(
"Cannot use {} strategy with non-numeric data:\n{}".format(
self.strategy, ve
)
)
raise new_ve from None
else:
raise ve
if in_fit:
# Use the dtype seen in `fit` for non-`fit` conversion
self._fit_dtype = X.dtype
_check_inputs_dtype(X, self.missing_values)
if X.dtype.kind not in ("i", "u", "f", "O"):
raise ValueError(
"SimpleImputer does not support data with dtype "
"{0}. Please provide either a numeric array (with"
" a floating point or integer dtype) or "
"categorical data represented either as an array "
"with integer dtype or an array of string values "
"with an object dtype.".format(X.dtype)
)
return X
def fit(self, X, y=None):
"""Fit the imputer on `X`.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Input data, where `n_samples` is the number of samples and
`n_features` is the number of features.
y : Ignored
Not used, present here for API consistency by convention.
Returns
-------
self : object
Fitted estimator.
"""
self._validate_params()
if self.verbose != "deprecated":
warnings.warn(
"The 'verbose' parameter was deprecated in version "
"1.1 and will be removed in 1.3. A warning will "
"always be raised upon the removal of empty columns "
"in the future version.",
FutureWarning,
)
X = self._validate_input(X, in_fit=True)
# default fill_value is 0 for numerical input and "missing_value"
# otherwise
if self.fill_value is None:
if X.dtype.kind in ("i", "u", "f"):
fill_value = 0
else:
fill_value = "missing_value"
else:
fill_value = self.fill_value
# fill_value should be numerical in case of numerical input
if (
self.strategy == "constant"
and X.dtype.kind in ("i", "u", "f")
and not isinstance(fill_value, numbers.Real)
):
raise ValueError(
"'fill_value'={0} is invalid. Expected a "
"numerical value when imputing numerical "
"data".format(fill_value)
)
if sp.issparse(X):
# missing_values = 0 not allowed with sparse data as it would
# force densification
if self.missing_values == 0:
raise ValueError(
"Imputation not possible when missing_values "
"== 0 and input is sparse. Provide a dense "
"array instead."
)
else:
self.statistics_ = self._sparse_fit(
X, self.strategy, self.missing_values, fill_value
)
else:
self.statistics_ = self._dense_fit(
X, self.strategy, self.missing_values, fill_value
)
return self
def _sparse_fit(self, X, strategy, missing_values, fill_value):
"""Fit the transformer on sparse data."""
missing_mask = _get_mask(X, missing_values)
mask_data = missing_mask.data
n_implicit_zeros = X.shape[0] - np.diff(X.indptr)
statistics = np.empty(X.shape[1])
if strategy == "constant":
# for constant strategy, self.statistcs_ is used to store
# fill_value in each column
statistics.fill(fill_value)
else:
for i in range(X.shape[1]):
column = X.data[X.indptr[i] : X.indptr[i + 1]]
mask_column = mask_data[X.indptr[i] : X.indptr[i + 1]]
column = column[~mask_column]
# combine explicit and implicit zeros
mask_zeros = _get_mask(column, 0)
column = column[~mask_zeros]
n_explicit_zeros = mask_zeros.sum()
n_zeros = n_implicit_zeros[i] + n_explicit_zeros
if strategy == "mean":
s = column.size + n_zeros
statistics[i] = np.nan if s == 0 else column.sum() / s
elif strategy == "median":
statistics[i] = _get_median(column, n_zeros)
elif strategy == "most_frequent":
statistics[i] = _most_frequent(column, 0, n_zeros)
super()._fit_indicator(missing_mask)
return statistics
def _dense_fit(self, X, strategy, missing_values, fill_value):
"""Fit the transformer on dense data."""
missing_mask = _get_mask(X, missing_values)
masked_X = ma.masked_array(X, mask=missing_mask)
super()._fit_indicator(missing_mask)
# Mean
if strategy == "mean":
mean_masked = np.ma.mean(masked_X, axis=0)
# Avoid the warning "Warning: converting a masked element to nan."
mean = np.ma.getdata(mean_masked)
mean[np.ma.getmask(mean_masked)] = np.nan
return mean
# Median
elif strategy == "median":
median_masked = np.ma.median(masked_X, axis=0)
# Avoid the warning "Warning: converting a masked element to nan."
median = np.ma.getdata(median_masked)
median[np.ma.getmaskarray(median_masked)] = np.nan
return median
# Most frequent
elif strategy == "most_frequent":
# Avoid use of scipy.stats.mstats.mode due to the required
# additional overhead and slow benchmarking performance.
# See Issue 14325 and PR 14399 for full discussion.
# To be able access the elements by columns
X = X.transpose()
mask = missing_mask.transpose()
if X.dtype.kind == "O":
most_frequent = np.empty(X.shape[0], dtype=object)
else:
most_frequent = np.empty(X.shape[0])
for i, (row, row_mask) in enumerate(zip(X[:], mask[:])):
row_mask = np.logical_not(row_mask).astype(bool)
row = row[row_mask]
most_frequent[i] = _most_frequent(row, np.nan, 0)
return most_frequent
# Constant
elif strategy == "constant":
# for constant strategy, self.statistcs_ is used to store
# fill_value in each column
return np.full(X.shape[1], fill_value, dtype=X.dtype)
def transform(self, X):
"""Impute all missing values in `X`.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
The input data to complete.
Returns
-------
X_imputed : {ndarray, sparse matrix} of shape \
(n_samples, n_features_out)
`X` with imputed values.
"""
check_is_fitted(self)
X = self._validate_input(X, in_fit=False)
statistics = self.statistics_
if X.shape[1] != statistics.shape[0]:
raise ValueError(
"X has %d features per sample, expected %d"
% (X.shape[1], self.statistics_.shape[0])
)
# compute mask before eliminating invalid features
missing_mask = _get_mask(X, self.missing_values)
# Delete the invalid columns if strategy is not constant
if self.strategy == "constant":
valid_statistics = statistics
valid_statistics_indexes = None
else:
# same as np.isnan but also works for object dtypes
invalid_mask = _get_mask(statistics, np.nan)
valid_mask = np.logical_not(invalid_mask)
valid_statistics = statistics[valid_mask]
valid_statistics_indexes = np.flatnonzero(valid_mask)
if invalid_mask.any():
invalid_features = np.arange(X.shape[1])[invalid_mask]
if self.verbose != "deprecated" and self.verbose:
# use feature names warning if features are provided
if hasattr(self, "feature_names_in_"):
invalid_features = self.feature_names_in_[invalid_features]
warnings.warn(
"Skipping features without any observed values:"
f" {invalid_features}. At least one non-missing value is needed"
f" for imputation with strategy='{self.strategy}'."
)
X = X[:, valid_statistics_indexes]
# Do actual imputation
if sp.issparse(X):
if self.missing_values == 0:
raise ValueError(
"Imputation not possible when missing_values "
"== 0 and input is sparse. Provide a dense "
"array instead."
)
else:
# if no invalid statistics are found, use the mask computed
# before, else recompute mask
if valid_statistics_indexes is None:
mask = missing_mask.data
else:
mask = _get_mask(X.data, self.missing_values)
indexes = np.repeat(
np.arange(len(X.indptr) - 1, dtype=int), np.diff(X.indptr)
)[mask]
X.data[mask] = valid_statistics[indexes].astype(X.dtype, copy=False)
else:
# use mask computed before eliminating invalid mask
if valid_statistics_indexes is None:
mask_valid_features = missing_mask
else:
mask_valid_features = missing_mask[:, valid_statistics_indexes]
n_missing = np.sum(mask_valid_features, axis=0)
values = np.repeat(valid_statistics, n_missing)
coordinates = np.where(mask_valid_features.transpose())[::-1]
X[coordinates] = values
X_indicator = super()._transform_indicator(missing_mask)
return super()._concatenate_indicator(X, X_indicator)
def inverse_transform(self, X):
"""Convert the data back to the original representation.
Inverts the `transform` operation performed on an array.
This operation can only be performed after :class:`SimpleImputer` is
instantiated with `add_indicator=True`.
Note that `inverse_transform` can only invert the transform in
features that have binary indicators for missing values. If a feature
has no missing values at `fit` time, the feature won't have a binary
indicator, and the imputation done at `transform` time won't be
inverted.
.. versionadded:: 0.24
Parameters
----------
X : array-like of shape \
(n_samples, n_features + n_features_missing_indicator)
The imputed data to be reverted to original data. It has to be
an augmented array of imputed data and the missing indicator mask.
Returns
-------
X_original : ndarray of shape (n_samples, n_features)
The original `X` with missing values as it was prior
to imputation.
"""
check_is_fitted(self)
if not self.add_indicator:
raise ValueError(
"'inverse_transform' works only when "
"'SimpleImputer' is instantiated with "
"'add_indicator=True'. "
f"Got 'add_indicator={self.add_indicator}' "
"instead."
)
n_features_missing = len(self.indicator_.features_)
non_empty_feature_count = X.shape[1] - n_features_missing
array_imputed = X[:, :non_empty_feature_count].copy()
missing_mask = X[:, non_empty_feature_count:].astype(bool)
n_features_original = len(self.statistics_)
shape_original = (X.shape[0], n_features_original)
X_original = np.zeros(shape_original)
X_original[:, self.indicator_.features_] = missing_mask
full_mask = X_original.astype(bool)
imputed_idx, original_idx = 0, 0
while imputed_idx < len(array_imputed.T):
if not np.all(X_original[:, original_idx]):
X_original[:, original_idx] = array_imputed.T[imputed_idx]
imputed_idx += 1
original_idx += 1
else:
original_idx += 1
X_original[full_mask] = self.missing_values
return X_original
def _more_tags(self):
return {
"allow_nan": (
_is_pandas_na(self.missing_values) or is_scalar_nan(self.missing_values)
)
}
def get_feature_names_out(self, input_features=None):
"""Get output feature names for transformation.
Parameters
----------
input_features : array-like of str or None, default=None
Input features.
- If `input_features` is `None`, then `feature_names_in_` is
used as feature names in. If `feature_names_in_` is not defined,
then the following input feature names are generated:
`["x0", "x1", ..., "x(n_features_in_ - 1)"]`.
- If `input_features` is an array-like, then `input_features` must
match `feature_names_in_` if `feature_names_in_` is defined.
Returns
-------
feature_names_out : ndarray of str objects
Transformed feature names.
"""
input_features = _check_feature_names_in(self, input_features)
non_missing_mask = np.logical_not(_get_mask(self.statistics_, np.nan))
names = input_features[non_missing_mask]
return self._concatenate_indicator_feature_names_out(names, input_features)
class MissingIndicator(TransformerMixin, BaseEstimator):
"""Binary indicators for missing values.
Note that this component typically should not be used in a vanilla
:class:`Pipeline` consisting of transformers and a classifier, but rather
could be added using a :class:`FeatureUnion` or :class:`ColumnTransformer`.
Read more in the :ref:`User Guide <impute>`.
.. versionadded:: 0.20
Parameters
----------
missing_values : int, float, str, np.nan or None, default=np.nan
The placeholder for the missing values. All occurrences of
`missing_values` will be imputed. For pandas' dataframes with
nullable integer dtypes with missing values, `missing_values`
should be set to `np.nan`, since `pd.NA` will be converted to `np.nan`.
features : {'missing-only', 'all'}, default='missing-only'
Whether the imputer mask should represent all or a subset of
features.
- If `'missing-only'` (default), the imputer mask will only represent
features containing missing values during fit time.
- If `'all'`, the imputer mask will represent all features.
sparse : bool or 'auto', default='auto'
Whether the imputer mask format should be sparse or dense.
- If `'auto'` (default), the imputer mask will be of same type as
input.
- If `True`, the imputer mask will be a sparse matrix.
- If `False`, the imputer mask will be a numpy array.
error_on_new : bool, default=True
If `True`, :meth:`transform` will raise an error when there are
features with missing values that have no missing values in
:meth:`fit`. This is applicable only when `features='missing-only'`.
Attributes
----------
features_ : ndarray of shape (n_missing_features,) or (n_features,)
The features indices which will be returned when calling
:meth:`transform`. They are computed during :meth:`fit`. If
`features='all'`, `features_` is equal to `range(n_features)`.
n_features_in_ : int
Number of features seen during :term:`fit`.
.. versionadded:: 0.24
feature_names_in_ : ndarray of shape (`n_features_in_`,)
Names of features seen during :term:`fit`. Defined only when `X`
has feature names that are all strings.
.. versionadded:: 1.0
See Also
--------
SimpleImputer : Univariate imputation of missing values.
IterativeImputer : Multivariate imputation of missing values.
Examples
--------
>>> import numpy as np
>>> from sklearn.impute import MissingIndicator
>>> X1 = np.array([[np.nan, 1, 3],
... [4, 0, np.nan],
... [8, 1, 0]])
>>> X2 = np.array([[5, 1, np.nan],
... [np.nan, 2, 3],
... [2, 4, 0]])
>>> indicator = MissingIndicator()
>>> indicator.fit(X1)
MissingIndicator()
>>> X2_tr = indicator.transform(X2)
>>> X2_tr
array([[False, True],
[ True, False],
[False, False]])
"""
_parameter_constraints: dict = {
"missing_values": [numbers.Real, numbers.Integral, str, None],
"features": [StrOptions({"missing-only", "all"})],
"sparse": ["boolean", StrOptions({"auto"})],
"error_on_new": ["boolean"],
}
def __init__(
self,
*,
missing_values=np.nan,
features="missing-only",
sparse="auto",
error_on_new=True,
):
self.missing_values = missing_values
self.features = features
self.sparse = sparse
self.error_on_new = error_on_new
def _get_missing_features_info(self, X):
"""Compute the imputer mask and the indices of the features
containing missing values.
Parameters
----------
X : {ndarray, sparse matrix} of shape (n_samples, n_features)
The input data with missing values. Note that `X` has been
checked in :meth:`fit` and :meth:`transform` before to call this
function.
Returns
-------
imputer_mask : {ndarray, sparse matrix} of shape \
(n_samples, n_features)
The imputer mask of the original data.
features_with_missing : ndarray of shape (n_features_with_missing)
The features containing missing values.
"""
if not self._precomputed:
imputer_mask = _get_mask(X, self.missing_values)
else:
imputer_mask = X
if sp.issparse(X):
imputer_mask.eliminate_zeros()
if self.features == "missing-only":
n_missing = imputer_mask.getnnz(axis=0)
if self.sparse is False:
imputer_mask = imputer_mask.toarray()
elif imputer_mask.format == "csr":
imputer_mask = imputer_mask.tocsc()
else:
if not self._precomputed:
imputer_mask = _get_mask(X, self.missing_values)
else:
imputer_mask = X
if self.features == "missing-only":
n_missing = imputer_mask.sum(axis=0)
if self.sparse is True:
imputer_mask = sp.csc_matrix(imputer_mask)
if self.features == "all":
features_indices = np.arange(X.shape[1])
else:
features_indices = np.flatnonzero(n_missing)
return imputer_mask, features_indices
def _validate_input(self, X, in_fit):
if not is_scalar_nan(self.missing_values):
force_all_finite = True
else:
force_all_finite = "allow-nan"
X = self._validate_data(
X,
reset=in_fit,
accept_sparse=("csc", "csr"),
dtype=None,
force_all_finite=force_all_finite,
)
_check_inputs_dtype(X, self.missing_values)
if X.dtype.kind not in ("i", "u", "f", "O"):
raise ValueError(
"MissingIndicator does not support data with "
"dtype {0}. Please provide either a numeric array"
" (with a floating point or integer dtype) or "
"categorical data represented either as an array "
"with integer dtype or an array of string values "
"with an object dtype.".format(X.dtype)
)
if sp.issparse(X) and self.missing_values == 0:
# missing_values = 0 not allowed with sparse data as it would
# force densification
raise ValueError(
"Sparse input with missing_values=0 is "
"not supported. Provide a dense "
"array instead."
)
return X
def _fit(self, X, y=None, precomputed=False):
"""Fit the transformer on `X`.
Parameters
----------
X : {array-like, sparse matrix} of shape (n_samples, n_features)
Input data, where `n_samples` is the number of samples and
`n_features` is the number of features.
If `precomputed=True`, then `X` is a mask of the input data.
precomputed : bool
Whether the input data is a mask.
Returns
-------
imputer_mask : {ndarray, sparse matrix} of shape (n_samples, \
n_features)
The imputer mask of the original data.
"""
if precomputed:
if not (hasattr(X, "dtype") and X.dtype.kind == "b"):
raise ValueError("precomputed is True but the input data is not a mask")
self._precomputed = True
else:
self._precomputed = False
# Need not validate X again as it would have already been validated
# in the Imputer calling MissingIndicator
if not self._precomputed:
X = self._validate_input(X, in_fit=True)
self._n_features = X.shape[1]
missing_features_info = self._get_missing_features_info(X)
self.features_ = missing_features_info[1]
return missing_features_info[0]
def fit(self, X, y=None):
"""Fit the transformer on `X`.
Parameters
----------
X : {array-like, sparse matrix} of shape (n_samples, n_features)
Input data, where `n_samples` is the number of samples and
`n_features` is the number of features.
y : Ignored
Not used, present for API consistency by convention.
Returns
-------
self : object
Fitted estimator.
"""
self._validate_params()
self._fit(X, y)
return self
def transform(self, X):
"""Generate missing values indicator for `X`.
Parameters
----------
X : {array-like, sparse matrix} of shape (n_samples, n_features)
The input data to complete.
Returns
-------
Xt : {ndarray, sparse matrix} of shape (n_samples, n_features) \
or (n_samples, n_features_with_missing)
The missing indicator for input data. The data type of `Xt`
will be boolean.
"""
check_is_fitted(self)
# Need not validate X again as it would have already been validated
# in the Imputer calling MissingIndicator
if not self._precomputed:
X = self._validate_input(X, in_fit=False)
else:
if not (hasattr(X, "dtype") and X.dtype.kind == "b"):
raise ValueError("precomputed is True but the input data is not a mask")
imputer_mask, features = self._get_missing_features_info(X)
if self.features == "missing-only":
features_diff_fit_trans = np.setdiff1d(features, self.features_)
if self.error_on_new and features_diff_fit_trans.size > 0:
raise ValueError(
"The features {} have missing values "
"in transform but have no missing values "
"in fit.".format(features_diff_fit_trans)
)
if self.features_.size < self._n_features:
imputer_mask = imputer_mask[:, self.features_]
return imputer_mask
def fit_transform(self, X, y=None):
"""Generate missing values indicator for `X`.
Parameters
----------
X : {array-like, sparse matrix} of shape (n_samples, n_features)
The input data to complete.
y : Ignored
Not used, present for API consistency by convention.
Returns
-------
Xt : {ndarray, sparse matrix} of shape (n_samples, n_features) \
or (n_samples, n_features_with_missing)
The missing indicator for input data. The data type of `Xt`
will be boolean.
"""
self._validate_params()
imputer_mask = self._fit(X, y)
if self.features_.size < self._n_features:
imputer_mask = imputer_mask[:, self.features_]
return imputer_mask
def get_feature_names_out(self, input_features=None):
"""Get output feature names for transformation.
Parameters
----------
input_features : array-like of str or None, default=None
Input features.
- If `input_features` is `None`, then `feature_names_in_` is
used as feature names in. If `feature_names_in_` is not defined,
then the following input feature names are generated:
`["x0", "x1", ..., "x(n_features_in_ - 1)"]`.
- If `input_features` is an array-like, then `input_features` must
match `feature_names_in_` if `feature_names_in_` is defined.
Returns
-------
feature_names_out : ndarray of str objects
Transformed feature names.
"""
input_features = _check_feature_names_in(self, input_features)
prefix = self.__class__.__name__.lower()
return np.asarray(
[
f"{prefix}_{feature_name}"
for feature_name in input_features[self.features_]
],
dtype=object,
)
def _more_tags(self):
return {
"allow_nan": True,
"X_types": ["2darray", "string"],
"preserves_dtype": [],
}
| bsd-3-clause |
pytorch/fairseq | examples/MMPT/mmpt/tasks/retritask.py | 1 | 8413 | # Copyright (c) Facebook, Inc. and its affiliates.
#
# This source code is licensed under the MIT license found in the
# LICENSE file in the root directory of this source tree.
import os
import torch
import pickle
import random
from tqdm import tqdm
from torch.utils.data import DataLoader
from torch.utils.data.distributed import DistributedSampler
from ..processors import (
ShardedHow2MetaProcessor,
ShardedVideoProcessor,
ShardedTextProcessor,
VariedLenAligner,
)
from ..datasets import MMDataset
from .task import Task
from ..modules import vectorpool
from ..evaluators.predictor import Predictor
from ..utils import set_seed, get_local_rank, get_world_size
class RetriTask(Task):
"""abstract class for task with retrival."""
def reshape_subsample(self, sample):
for key in sample:
if torch.is_tensor(sample[key]):
sample[key] = self.flat_subsample(sample[key])
return sample
def flat_subsample(self, tensor):
if tensor.size(0) == 1:
tensor = tensor.squeeze(0)
return tensor
def build_dataloader(self):
"""called by `get_batch_iterator` in fairseqmmtask. """
# TODO: hard-code dataloader for retri for now and configurable in .yaml.
# reuse the `train.lst`.
self.config.dataset.split = "train"
meta_processor = ShardedHow2MetaProcessor(self.config.dataset)
video_processor = ShardedVideoProcessor(self.config.dataset)
text_processor = ShardedTextProcessor(self.config.dataset)
aligner = VariedLenAligner(self.config.dataset)
aligner.subsampling = self.config.dataset.clip_per_video
self.retri_data = MMDataset(
meta_processor, video_processor, text_processor, aligner
)
retri_sampler = DistributedSampler(self.retri_data)
infer_scale = 16
batch_size = self.config.dataset.num_video_per_batch \
* infer_scale
self.retri_dataloader = DataLoader(
self.retri_data,
collate_fn=self.retri_data.collater,
batch_size=batch_size,
shuffle=False,
sampler=retri_sampler,
num_workers=self.config.fairseq.dataset.num_workers
)
return self.retri_dataloader
def retrive_candidates(self, epoch, dataloader=None):
if get_local_rank() == 0:
print("running retrieval model.")
out_dir = os.path.join(
self.config.fairseq.checkpoint.save_dir, "retri")
os.makedirs(out_dir, exist_ok=True)
if not os.path.isfile(
os.path.join(
out_dir, "batched_e" + str(epoch) + "_videos0.pkl")
):
if dataloader is None:
dataloader = self.retri_dataloader
self.model.eval()
self.model.is_train = False
assert self.retri_data.meta_processor.data == \
self.train_data.meta_processor.data # video_ids not mutated.
self._retri_predict(epoch, dataloader)
self.model.train()
self.model.is_train = True
torch.distributed.barrier()
output = self._retri_sync(epoch, out_dir)
torch.distributed.barrier()
self.train_data.meta_processor.set_candidates(output)
return output
class VideoRetriTask(RetriTask):
"""RetriTask on video level."""
def reshape_subsample(self, sample):
if (
hasattr(self.config.dataset, "clip_per_video")
and self.config.dataset.clip_per_video is not None
and self.config.dataset.clip_per_video > 1
):
for key in sample:
if torch.is_tensor(sample[key]):
sample[key] = self.flat_subsample(sample[key])
return sample
def flat_subsample(self, tensor):
if tensor.size(0) == 1:
tensor = tensor.squeeze(0)
return Task.flat_subsample(self, tensor)
def _retri_predict(self, epoch, dataloader):
set_seed(epoch)
# save for retrival.
predictor = VideoPredictor(self.config)
predictor.predict_loop(
self.model, dataloader)
set_seed(epoch) # get the same text clips.
# retrival.
retri_predictor = VideoRetriPredictor(
self.config)
retri_predictor.predict_loop(
self.model, predictor.vecpool.retriver, epoch)
del predictor
del retri_predictor
def _retri_sync(self, epoch, out_dir):
# gpu do the same merge.
batched_videos = []
for local_rank in range(get_world_size()):
fn = os.path.join(
out_dir,
"batched_e" + str(epoch) + "_videos" + str(local_rank) + ".pkl")
with open(fn, "rb") as fr:
batched_videos.extend(pickle.load(fr))
print(
"[INFO] batched_videos",
len(batched_videos), len(batched_videos[0]))
return batched_videos
class VideoPredictor(Predictor):
def __init__(self, config):
vectorpool_cls = getattr(vectorpool, config.vectorpool_cls)
self.vecpool = vectorpool_cls(config)
def predict_loop(
self,
model,
dataloader,
early_stop=-1,
):
with torch.no_grad():
if get_local_rank() == 0:
dataloader = tqdm(dataloader)
for batch_idx, batch in enumerate(dataloader):
if batch_idx == early_stop:
break
self(batch, model)
return self.finalize()
def __call__(self, sample, model, **kwargs):
param = next(model.parameters())
dtype = param.dtype
device = param.device
subsample = sample["vfeats"].size(1)
sample = self.to_ctx(sample, device, dtype)
for key in sample:
if torch.is_tensor(sample[key]):
size = sample[key].size()
if len(size) >= 2:
batch_size = size[0] * size[1]
expanded_size = (
(batch_size,) + size[2:] if len(size) > 2
else (batch_size,)
)
sample[key] = sample[key].view(expanded_size)
outputs = model(**sample)
sample.update(outputs)
self.vecpool(sample, subsample)
def finalize(self):
print("[INFO]", self.vecpool)
if not self.vecpool.retriver.db.is_trained:
self.vecpool.retriver.finalize_training()
return self.vecpool.retriver
class VideoRetriPredictor(Predictor):
"""
Online Retrieval Predictor for Clips (used by RetriTask).
TODO: merge this with VisPredictor?
"""
def __init__(self, config):
self.pred_dir = os.path.join(
config.fairseq.checkpoint.save_dir,
"retri")
self.num_cands = config.num_cands
self.num_video_per_batch = config.dataset.num_video_per_batch
def predict_loop(
self,
model,
retriver,
epoch,
early_stop=-1
):
# a fake loop that only try to recover video vector
# from video_id.
batched_videos = []
# obtain available video_ids.
video_ids = list(retriver.videoid_to_vectoridx.keys())
dataloader = random.sample(
video_ids,
len(video_ids) // self.num_video_per_batch
)
if get_local_rank() == 0:
dataloader = tqdm(dataloader)
for batch_idx, batch in enumerate(dataloader):
# batch is one video id.
if batch_idx == early_stop:
break
video_ids = retriver.search_by_video_ids(
[batch], self.num_cands)[0]
if len(video_ids) > self.num_video_per_batch:
# we moved the center to make cluster robust.
video_ids = random.sample(video_ids, self.num_video_per_batch)
batched_videos.append(video_ids)
return self.finalize(batched_videos, epoch)
def finalize(self, batched_videos, epoch):
fn = os.path.join(
self.pred_dir,
"batched_e" + str(epoch) + "_videos" + str(get_local_rank()) + ".pkl")
with open(fn, "wb") as fw:
pickle.dump(batched_videos, fw, pickle.HIGHEST_PROTOCOL)
return batched_videos
| mit |
ECP-CANDLE/Benchmarks | common/darts/modules/conv/network.py | 1 | 8972 | import torch
import torch.nn as nn
import torch.nn.functional as F
from darts.api import Model
from darts.genotypes import PRIMITIVES, Genotype
from darts.modules.classifier import MultitaskClassifier
from darts.modules.conv import Cell
class Hyperparameters:
c = 8
num_nodes = 2
num_cells = 3
channel_multiplier = 2
stem_channel_multiplier = 2
num_embeddings = 35095 # vocab size
embedding_dim = 1500
class ConvNetwork(Model):
"""Collection of cells"""
def __init__(self, tasks, criterion, device="cpu", hyperparams=Hyperparameters()):
super(ConvNetwork, self).__init__()
self.tasks = tasks
self.criterion = criterion
self.device = device
self.c = hyperparams.c
self.num_cells = hyperparams.num_cells
self.num_nodes = hyperparams.num_nodes
self.channel_multiplier = hyperparams.channel_multiplier
# stem_multiplier is for stem network,
# and multiplier is for general cell
c_curr = hyperparams.stem_channel_multiplier * self.c # 3*16
# stem network, convert 3 channel to c_curr
self.stem = nn.Sequential(
nn.Embedding(
num_embeddings=hyperparams.num_embeddings,
embedding_dim=hyperparams.embedding_dim,
),
nn.Conv1d(hyperparams.embedding_dim, c_curr, 3, padding=1, bias=False),
nn.BatchNorm1d(c_curr),
).to(self.device)
# c_curr means a factor of the output channels of current cell
# output channels = multiplier * c_curr
cpp, cp, c_curr = c_curr, c_curr, self.c
self.cells = nn.ModuleList()
reduction_prev = False
for i in range(hyperparams.num_cells):
# for layer in the middle [1/3, 2/3], reduce via stride=2
if i in [hyperparams.num_cells // 3, 2 * hyperparams.num_cells // 3]:
c_curr *= 2
reduction = True
else:
reduction = False
# [cp, h, h] => [multiplier*c_curr, h/h//2, h/h//2]
# the output channels = multiplier * c_curr
cell = Cell(
hyperparams.num_nodes,
hyperparams.channel_multiplier,
cpp,
cp,
c_curr,
reduction,
reduction_prev,
).to(self.device)
# update reduction_prev
reduction_prev = reduction
self.cells += [cell]
cpp, cp = cp, hyperparams.channel_multiplier * c_curr
# adaptive pooling output size to 1x1
self.global_pooling = nn.AdaptiveAvgPool1d(1)
# since cp records last cell's output channels
# it indicates the input channel number
self.classifier = MultitaskClassifier(cp, tasks)
# k is the total number of edges inside single cell, 14
k = sum(1 for i in range(self.num_nodes) for j in range(2 + i))
num_ops = len(PRIMITIVES) # 8
self.alpha_normal = nn.Parameter(torch.randn(k, num_ops))
self.alpha_reduce = nn.Parameter(torch.randn(k, num_ops))
with torch.no_grad():
# initialize to smaller value
self.alpha_normal.mul_(1e-3)
self.alpha_reduce.mul_(1e-3)
self._arch_parameters = [
self.alpha_normal,
self.alpha_reduce,
]
def new(self):
"""Create a new model initialzed with current alpha parameters.
Weights are left untouched.
Returns
-------
model : Network
New model initialized with current alpha.
"""
model = ConvNetwork(self.tasks, self.criterion).to(self.device)
for x, y in zip(model.arch_parameters(), self.arch_parameters()):
x.data.copy_(y.data)
return model
def forward(self, x):
"""
in: torch.Size([3, 3, 32, 32])
stem: torch.Size([3, 48, 32, 32])
cell: 0 torch.Size([3, 64, 32, 32]) False
cell: 1 torch.Size([3, 64, 32, 32]) False
cell: 2 torch.Size([3, 128, 16, 16]) True
cell: 3 torch.Size([3, 128, 16, 16]) False
cell: 4 torch.Size([3, 128, 16, 16]) False
cell: 5 torch.Size([3, 256, 8, 8]) True
cell: 6 torch.Size([3, 256, 8, 8]) False
cell: 7 torch.Size([3, 256, 8, 8]) False
pool: torch.Size([16, 256, 1, 1])
linear: [b, 10]
:param x:
:return:
"""
# print('network in:', x.shape)
# s0 & s1 means the last cells' output
s0 = s1 = self.stem(x) # [b, 3, 32, 32] => [b, 48, 32, 32]
# print('network stem:', s0.shape)
# print('network stem1:', s1.shape)
for i, cell in enumerate(self.cells):
# weights are shared across all reduction cell or normal cell
# according to current cell's type, it choose which architecture parameters
# to use
if cell.reduction: # if current cell is reduction cell
weights = F.softmax(self.alpha_reduce, dim=-1)
else:
weights = F.softmax(self.alpha_normal, dim=-1) # [14, 8]
# execute cell() firstly and then assign s0=s1, s1=result
s0, s1 = s1, cell(s0, s1, weights) # [40, 64, 32, 32]
# print('cell:',i, s1.shape, cell.reduction, cell.reduction_prev)
# print('\n')
# s1 is the last cell's output
out = self.global_pooling(s1)
# logits = {}
# for task, fc in self.classifier.items():
# logits[task] = fc(out.view(out.size(0), -1))
logits = self.classifier(out.view(out.size(0), -1))
return logits
def loss(self, data, target, reduce="mean"):
"""Calculate a value of loss function"""
logits = self(data)
for task, logit in logits.items():
logits[task] = logit.to(self.device)
losses = {}
for task, label in target.items():
label = label.to(self.device)
losses[task] = self.criterion(logits[task], label)
if reduce:
total = 0
for _, value in losses.items():
total += value
if reduce == "mean":
losses = total / len(losses)
elif reduce == "sum":
losses = total
else:
raise ValueError("Reduced loss must use either `mean` or `sum`!")
return losses
def arch_parameters(self):
return self._arch_parameters
def genotype(self):
"""
:return:
"""
def _parse(weights):
"""
:param weights: [14, 8]
:return:
"""
gene = []
n = 2
start = 0
for i in range(self.num_nodes): # for each node
end = start + n
W = weights[start:end].copy() # [2, 8], [3, 8], ...
edges = sorted(
range(i + 2), # i+2 is the number of connection for node i
key=lambda x: -max(
W[x][k] # by descending order
for k in range(len(W[x])) # get strongest ops
if k != PRIMITIVES.index("none")
),
)[
:2
] # only has two inputs
for j in edges: # for every input nodes j of current node i
k_best = None
for k in range(
len(W[j])
): # get strongest ops for current input j->i
if k != PRIMITIVES.index("none"):
if k_best is None or W[j][k] > W[j][k_best]:
k_best = k
gene.append((PRIMITIVES[k_best], j)) # save ops and input node
start = end
n += 1
return gene
gene_normal = _parse(F.softmax(self.alpha_normal, dim=-1).data.cpu().numpy())
gene_reduce = _parse(F.softmax(self.alpha_reduce, dim=-1).data.cpu().numpy())
concat = range(2 + self.num_nodes - self.channel_multiplier, self.num_nodes + 2)
genotype = Genotype(
normal=gene_normal,
normal_concat=concat,
reduce=gene_reduce,
reduce_concat=concat,
)
return genotype
def new(
c,
num_classes,
num_layers,
criterion,
device,
steps=4,
multiplier=4,
stem_multiplier=3,
):
"""
create a new model and initialize it with current alpha parameters.
However, its weights are left untouched.
:return:
"""
model = ConvNetwork(
c, num_classes, num_layers, criterion, steps, multiplier, stem_multiplier
).to(device)
for x, y in zip(model.arch_parameters(), model.arch_parameters()):
x.data.copy_(y.data)
return model
| mit |
pytorch/fairseq | fairseq/criterions/composite_loss.py | 1 | 3793 | # Copyright (c) Facebook, Inc. and its affiliates.
#
# This source code is licensed under the MIT license found in the
# LICENSE file in the root directory of this source tree.
from fairseq import utils
from fairseq.criterions import LegacyFairseqCriterion, register_criterion
from torch import nn
@register_criterion("composite_loss")
class CompositeLoss(LegacyFairseqCriterion):
"""This is a composite loss that, given a list of model outputs and a list of targets,
computes an average of losses for each output-target pair"""
def __init__(self, args, task):
super().__init__(args, task)
self.underlying_criterion = args.underlying_criterion
@staticmethod
def add_args(parser):
"""Add criterion-specific arguments to the parser."""
# fmt: off
parser.add_argument('--underlying-criterion', type=str, metavar='VAL', required=True,
help='underlying criterion to use for the composite loss')
# fmt: on
@staticmethod
def build_underlying_criterion(args, task):
saved_criterion = args.criterion
args.criterion = args.underlying_criterion
assert saved_criterion != args.underlying_criterion
underlying_criterion = task.build_criterion(args)
args.criterion = saved_criterion
return underlying_criterion
@classmethod
def build_criterion(cls, args, task):
underlying_criterion = CompositeLoss.build_underlying_criterion(args, task)
class FakeModel(nn.Module):
def __init__(self, model, net_out, target):
super().__init__()
self.model = model
self.net_out = net_out
self.target = target
def forward(self, **unused):
return self.net_out
def get_normalized_probs(self, net_output, log_probs, sample=None):
return self.model.get_normalized_probs(
net_output, log_probs, sample=sample
)
def get_targets(self, *unused):
return self.target
@property
def decoder(self):
return self.model.decoder
class _CompositeLoss(LegacyFairseqCriterion):
def __init__(self, args, task, underlying_criterion):
super().__init__(args, task)
self.underlying_criterion = underlying_criterion
def forward(self, model, sample, reduce=True):
net_outputs = model(**sample["net_input"])
targets = sample["target"]
bsz = targets[0].size(0)
loss = net_outputs[0][0].new(1 if reduce else bsz).float().zero_()
sample_size = 0
logging_output = {}
for o, t in zip(net_outputs[0], targets):
m = FakeModel(model, (o, net_outputs[1]), t)
sample["target"] = t
l, ss, logging_output = self.underlying_criterion(m, sample, reduce)
loss += l
sample_size += ss
loss.div_(len(targets))
sample_size /= len(targets)
logging_output["loss"] = utils.item(loss.data) if reduce else loss.data
return loss, sample_size, logging_output
@staticmethod
def aggregate_logging_outputs(logging_outputs):
return underlying_criterion.__class__.aggregate_logging_outputs(
logging_outputs
)
@staticmethod
def reduce_metrics(logging_outputs) -> None:
underlying_criterion.__class__.reduce_metrics(logging_outputs)
return _CompositeLoss(args, task, underlying_criterion)
| mit |
anntzer/scikit-learn | sklearn/linear_model/_stochastic_gradient.py | 4 | 87221 | # Authors: Peter Prettenhofer <peter.prettenhofer@gmail.com> (main author)
# Mathieu Blondel (partial_fit support)
#
# License: BSD 3 clause
"""Classification, regression and One-Class SVM using Stochastic Gradient
Descent (SGD).
"""
import numpy as np
import warnings
from abc import ABCMeta, abstractmethod
from numbers import Integral, Real
from joblib import Parallel
from ..base import clone, is_classifier
from ._base import LinearClassifierMixin, SparseCoefMixin
from ._base import make_dataset
from ..base import BaseEstimator, RegressorMixin, OutlierMixin
from ..utils import check_random_state
from ..utils.metaestimators import available_if
from ..utils.extmath import safe_sparse_dot
from ..utils.multiclass import _check_partial_fit_first_call
from ..utils.validation import check_is_fitted, _check_sample_weight
from ..utils._param_validation import Interval
from ..utils._param_validation import StrOptions
from ..utils._param_validation import Hidden
from ..utils.fixes import delayed
from ..exceptions import ConvergenceWarning
from ..model_selection import StratifiedShuffleSplit, ShuffleSplit
from ._sgd_fast import _plain_sgd
from ..utils import compute_class_weight
from ._sgd_fast import Hinge
from ._sgd_fast import SquaredHinge
from ._sgd_fast import Log
from ._sgd_fast import ModifiedHuber
from ._sgd_fast import SquaredLoss
from ._sgd_fast import Huber
from ._sgd_fast import EpsilonInsensitive
from ._sgd_fast import SquaredEpsilonInsensitive
LEARNING_RATE_TYPES = {
"constant": 1,
"optimal": 2,
"invscaling": 3,
"adaptive": 4,
"pa1": 5,
"pa2": 6,
}
PENALTY_TYPES = {"none": 0, "l2": 2, "l1": 1, "elasticnet": 3}
DEFAULT_EPSILON = 0.1
# Default value of ``epsilon`` parameter.
MAX_INT = np.iinfo(np.int32).max
class _ValidationScoreCallback:
"""Callback for early stopping based on validation score"""
def __init__(self, estimator, X_val, y_val, sample_weight_val, classes=None):
self.estimator = clone(estimator)
self.estimator.t_ = 1 # to pass check_is_fitted
if classes is not None:
self.estimator.classes_ = classes
self.X_val = X_val
self.y_val = y_val
self.sample_weight_val = sample_weight_val
def __call__(self, coef, intercept):
est = self.estimator
est.coef_ = coef.reshape(1, -1)
est.intercept_ = np.atleast_1d(intercept)
return est.score(self.X_val, self.y_val, self.sample_weight_val)
class BaseSGD(SparseCoefMixin, BaseEstimator, metaclass=ABCMeta):
"""Base class for SGD classification and regression."""
_parameter_constraints: dict = {
"fit_intercept": ["boolean"],
"max_iter": [Interval(Integral, 1, None, closed="left")],
"tol": [Interval(Real, 0, None, closed="left"), None],
"shuffle": ["boolean"],
"verbose": ["verbose"],
"random_state": ["random_state"],
"warm_start": ["boolean"],
"average": [Interval(Integral, 0, None, closed="left"), bool, np.bool_],
}
def __init__(
self,
loss,
*,
penalty="l2",
alpha=0.0001,
C=1.0,
l1_ratio=0.15,
fit_intercept=True,
max_iter=1000,
tol=1e-3,
shuffle=True,
verbose=0,
epsilon=0.1,
random_state=None,
learning_rate="optimal",
eta0=0.0,
power_t=0.5,
early_stopping=False,
validation_fraction=0.1,
n_iter_no_change=5,
warm_start=False,
average=False,
):
self.loss = loss
self.penalty = penalty
self.learning_rate = learning_rate
self.epsilon = epsilon
self.alpha = alpha
self.C = C
self.l1_ratio = l1_ratio
self.fit_intercept = fit_intercept
self.shuffle = shuffle
self.random_state = random_state
self.verbose = verbose
self.eta0 = eta0
self.power_t = power_t
self.early_stopping = early_stopping
self.validation_fraction = validation_fraction
self.n_iter_no_change = n_iter_no_change
self.warm_start = warm_start
self.average = average
self.max_iter = max_iter
self.tol = tol
@abstractmethod
def fit(self, X, y):
"""Fit model."""
def _more_validate_params(self, for_partial_fit=False):
"""Validate input params."""
if self.early_stopping and for_partial_fit:
raise ValueError("early_stopping should be False with partial_fit")
if (
self.learning_rate in ("constant", "invscaling", "adaptive")
and self.eta0 <= 0.0
):
raise ValueError("eta0 must be > 0")
if self.learning_rate == "optimal" and self.alpha == 0:
raise ValueError(
"alpha must be > 0 since "
"learning_rate is 'optimal'. alpha is used "
"to compute the optimal learning rate."
)
# raises ValueError if not registered
self._get_penalty_type(self.penalty)
self._get_learning_rate_type(self.learning_rate)
# TODO(1.3): remove "log"
if self.loss == "log":
warnings.warn(
"The loss 'log' was deprecated in v1.1 and will be removed in version "
"1.3. Use `loss='log_loss'` which is equivalent.",
FutureWarning,
)
def _get_loss_function(self, loss):
"""Get concrete ``LossFunction`` object for str ``loss``."""
loss_ = self.loss_functions[loss]
loss_class, args = loss_[0], loss_[1:]
if loss in ("huber", "epsilon_insensitive", "squared_epsilon_insensitive"):
args = (self.epsilon,)
return loss_class(*args)
def _get_learning_rate_type(self, learning_rate):
return LEARNING_RATE_TYPES[learning_rate]
def _get_penalty_type(self, penalty):
penalty = str(penalty).lower()
return PENALTY_TYPES[penalty]
def _allocate_parameter_mem(
self, n_classes, n_features, coef_init=None, intercept_init=None, one_class=0
):
"""Allocate mem for parameters; initialize if provided."""
if n_classes > 2:
# allocate coef_ for multi-class
if coef_init is not None:
coef_init = np.asarray(coef_init, order="C")
if coef_init.shape != (n_classes, n_features):
raise ValueError("Provided ``coef_`` does not match dataset. ")
self.coef_ = coef_init
else:
self.coef_ = np.zeros(
(n_classes, n_features), dtype=np.float64, order="C"
)
# allocate intercept_ for multi-class
if intercept_init is not None:
intercept_init = np.asarray(intercept_init, order="C")
if intercept_init.shape != (n_classes,):
raise ValueError("Provided intercept_init does not match dataset.")
self.intercept_ = intercept_init
else:
self.intercept_ = np.zeros(n_classes, dtype=np.float64, order="C")
else:
# allocate coef_
if coef_init is not None:
coef_init = np.asarray(coef_init, dtype=np.float64, order="C")
coef_init = coef_init.ravel()
if coef_init.shape != (n_features,):
raise ValueError("Provided coef_init does not match dataset.")
self.coef_ = coef_init
else:
self.coef_ = np.zeros(n_features, dtype=np.float64, order="C")
# allocate intercept_
if intercept_init is not None:
intercept_init = np.asarray(intercept_init, dtype=np.float64)
if intercept_init.shape != (1,) and intercept_init.shape != ():
raise ValueError("Provided intercept_init does not match dataset.")
if one_class:
self.offset_ = intercept_init.reshape(
1,
)
else:
self.intercept_ = intercept_init.reshape(
1,
)
else:
if one_class:
self.offset_ = np.zeros(1, dtype=np.float64, order="C")
else:
self.intercept_ = np.zeros(1, dtype=np.float64, order="C")
# initialize average parameters
if self.average > 0:
self._standard_coef = self.coef_
self._average_coef = np.zeros(self.coef_.shape, dtype=np.float64, order="C")
if one_class:
self._standard_intercept = 1 - self.offset_
else:
self._standard_intercept = self.intercept_
self._average_intercept = np.zeros(
self._standard_intercept.shape, dtype=np.float64, order="C"
)
def _make_validation_split(self, y):
"""Split the dataset between training set and validation set.
Parameters
----------
y : ndarray of shape (n_samples, )
Target values.
Returns
-------
validation_mask : ndarray of shape (n_samples, )
Equal to True on the validation set, False on the training set.
"""
n_samples = y.shape[0]
validation_mask = np.zeros(n_samples, dtype=np.bool_)
if not self.early_stopping:
# use the full set for training, with an empty validation set
return validation_mask
if is_classifier(self):
splitter_type = StratifiedShuffleSplit
else:
splitter_type = ShuffleSplit
cv = splitter_type(
test_size=self.validation_fraction, random_state=self.random_state
)
idx_train, idx_val = next(cv.split(np.zeros(shape=(y.shape[0], 1)), y))
if idx_train.shape[0] == 0 or idx_val.shape[0] == 0:
raise ValueError(
"Splitting %d samples into a train set and a validation set "
"with validation_fraction=%r led to an empty set (%d and %d "
"samples). Please either change validation_fraction, increase "
"number of samples, or disable early_stopping."
% (
n_samples,
self.validation_fraction,
idx_train.shape[0],
idx_val.shape[0],
)
)
validation_mask[idx_val] = True
return validation_mask
def _make_validation_score_cb(
self, validation_mask, X, y, sample_weight, classes=None
):
if not self.early_stopping:
return None
return _ValidationScoreCallback(
self,
X[validation_mask],
y[validation_mask],
sample_weight[validation_mask],
classes=classes,
)
def _prepare_fit_binary(est, y, i):
"""Initialization for fit_binary.
Returns y, coef, intercept, average_coef, average_intercept.
"""
y_i = np.ones(y.shape, dtype=np.float64, order="C")
y_i[y != est.classes_[i]] = -1.0
average_intercept = 0
average_coef = None
if len(est.classes_) == 2:
if not est.average:
coef = est.coef_.ravel()
intercept = est.intercept_[0]
else:
coef = est._standard_coef.ravel()
intercept = est._standard_intercept[0]
average_coef = est._average_coef.ravel()
average_intercept = est._average_intercept[0]
else:
if not est.average:
coef = est.coef_[i]
intercept = est.intercept_[i]
else:
coef = est._standard_coef[i]
intercept = est._standard_intercept[i]
average_coef = est._average_coef[i]
average_intercept = est._average_intercept[i]
return y_i, coef, intercept, average_coef, average_intercept
def fit_binary(
est,
i,
X,
y,
alpha,
C,
learning_rate,
max_iter,
pos_weight,
neg_weight,
sample_weight,
validation_mask=None,
random_state=None,
):
"""Fit a single binary classifier.
The i'th class is considered the "positive" class.
Parameters
----------
est : Estimator object
The estimator to fit
i : int
Index of the positive class
X : numpy array or sparse matrix of shape [n_samples,n_features]
Training data
y : numpy array of shape [n_samples, ]
Target values
alpha : float
The regularization parameter
C : float
Maximum step size for passive aggressive
learning_rate : str
The learning rate. Accepted values are 'constant', 'optimal',
'invscaling', 'pa1' and 'pa2'.
max_iter : int
The maximum number of iterations (epochs)
pos_weight : float
The weight of the positive class
neg_weight : float
The weight of the negative class
sample_weight : numpy array of shape [n_samples, ]
The weight of each sample
validation_mask : numpy array of shape [n_samples, ], default=None
Precomputed validation mask in case _fit_binary is called in the
context of a one-vs-rest reduction.
random_state : int, RandomState instance, default=None
If int, random_state is the seed used by the random number generator;
If RandomState instance, random_state is the random number generator;
If None, the random number generator is the RandomState instance used
by `np.random`.
"""
# if average is not true, average_coef, and average_intercept will be
# unused
y_i, coef, intercept, average_coef, average_intercept = _prepare_fit_binary(
est, y, i
)
assert y_i.shape[0] == y.shape[0] == sample_weight.shape[0]
random_state = check_random_state(random_state)
dataset, intercept_decay = make_dataset(
X, y_i, sample_weight, random_state=random_state
)
penalty_type = est._get_penalty_type(est.penalty)
learning_rate_type = est._get_learning_rate_type(learning_rate)
if validation_mask is None:
validation_mask = est._make_validation_split(y_i)
classes = np.array([-1, 1], dtype=y_i.dtype)
validation_score_cb = est._make_validation_score_cb(
validation_mask, X, y_i, sample_weight, classes=classes
)
# numpy mtrand expects a C long which is a signed 32 bit integer under
# Windows
seed = random_state.randint(MAX_INT)
tol = est.tol if est.tol is not None else -np.inf
coef, intercept, average_coef, average_intercept, n_iter_ = _plain_sgd(
coef,
intercept,
average_coef,
average_intercept,
est.loss_function_,
penalty_type,
alpha,
C,
est.l1_ratio,
dataset,
validation_mask,
est.early_stopping,
validation_score_cb,
int(est.n_iter_no_change),
max_iter,
tol,
int(est.fit_intercept),
int(est.verbose),
int(est.shuffle),
seed,
pos_weight,
neg_weight,
learning_rate_type,
est.eta0,
est.power_t,
0,
est.t_,
intercept_decay,
est.average,
)
if est.average:
if len(est.classes_) == 2:
est._average_intercept[0] = average_intercept
else:
est._average_intercept[i] = average_intercept
return coef, intercept, n_iter_
class BaseSGDClassifier(LinearClassifierMixin, BaseSGD, metaclass=ABCMeta):
# TODO(1.3): Remove "log""
loss_functions = {
"hinge": (Hinge, 1.0),
"squared_hinge": (SquaredHinge, 1.0),
"perceptron": (Hinge, 0.0),
"log_loss": (Log,),
"log": (Log,),
"modified_huber": (ModifiedHuber,),
"squared_error": (SquaredLoss,),
"huber": (Huber, DEFAULT_EPSILON),
"epsilon_insensitive": (EpsilonInsensitive, DEFAULT_EPSILON),
"squared_epsilon_insensitive": (SquaredEpsilonInsensitive, DEFAULT_EPSILON),
}
_parameter_constraints: dict = {
**BaseSGD._parameter_constraints,
"loss": [StrOptions(set(loss_functions), deprecated={"log"})],
"early_stopping": ["boolean"],
"validation_fraction": [Interval(Real, 0, 1, closed="neither")],
"n_iter_no_change": [Interval(Integral, 1, None, closed="left")],
"n_jobs": [Integral, None],
"class_weight": [StrOptions({"balanced"}), dict, None],
}
@abstractmethod
def __init__(
self,
loss="hinge",
*,
penalty="l2",
alpha=0.0001,
l1_ratio=0.15,
fit_intercept=True,
max_iter=1000,
tol=1e-3,
shuffle=True,
verbose=0,
epsilon=DEFAULT_EPSILON,
n_jobs=None,
random_state=None,
learning_rate="optimal",
eta0=0.0,
power_t=0.5,
early_stopping=False,
validation_fraction=0.1,
n_iter_no_change=5,
class_weight=None,
warm_start=False,
average=False,
):
super().__init__(
loss=loss,
penalty=penalty,
alpha=alpha,
l1_ratio=l1_ratio,
fit_intercept=fit_intercept,
max_iter=max_iter,
tol=tol,
shuffle=shuffle,
verbose=verbose,
epsilon=epsilon,
random_state=random_state,
learning_rate=learning_rate,
eta0=eta0,
power_t=power_t,
early_stopping=early_stopping,
validation_fraction=validation_fraction,
n_iter_no_change=n_iter_no_change,
warm_start=warm_start,
average=average,
)
self.class_weight = class_weight
self.n_jobs = n_jobs
def _partial_fit(
self,
X,
y,
alpha,
C,
loss,
learning_rate,
max_iter,
classes,
sample_weight,
coef_init,
intercept_init,
):
first_call = not hasattr(self, "classes_")
X, y = self._validate_data(
X,
y,
accept_sparse="csr",
dtype=np.float64,
order="C",
accept_large_sparse=False,
reset=first_call,
)
n_samples, n_features = X.shape
_check_partial_fit_first_call(self, classes)
n_classes = self.classes_.shape[0]
# Allocate datastructures from input arguments
self._expanded_class_weight = compute_class_weight(
self.class_weight, classes=self.classes_, y=y
)
sample_weight = _check_sample_weight(sample_weight, X)
if getattr(self, "coef_", None) is None or coef_init is not None:
self._allocate_parameter_mem(
n_classes, n_features, coef_init, intercept_init
)
elif n_features != self.coef_.shape[-1]:
raise ValueError(
"Number of features %d does not match previous data %d."
% (n_features, self.coef_.shape[-1])
)
self.loss_function_ = self._get_loss_function(loss)
if not hasattr(self, "t_"):
self.t_ = 1.0
# delegate to concrete training procedure
if n_classes > 2:
self._fit_multiclass(
X,
y,
alpha=alpha,
C=C,
learning_rate=learning_rate,
sample_weight=sample_weight,
max_iter=max_iter,
)
elif n_classes == 2:
self._fit_binary(
X,
y,
alpha=alpha,
C=C,
learning_rate=learning_rate,
sample_weight=sample_weight,
max_iter=max_iter,
)
else:
raise ValueError(
"The number of classes has to be greater than one; got %d class"
% n_classes
)
return self
def _fit(
self,
X,
y,
alpha,
C,
loss,
learning_rate,
coef_init=None,
intercept_init=None,
sample_weight=None,
):
if hasattr(self, "classes_"):
# delete the attribute otherwise _partial_fit thinks it's not the first call
delattr(self, "classes_")
# labels can be encoded as float, int, or string literals
# np.unique sorts in asc order; largest class id is positive class
y = self._validate_data(y=y)
classes = np.unique(y)
if self.warm_start and hasattr(self, "coef_"):
if coef_init is None:
coef_init = self.coef_
if intercept_init is None:
intercept_init = self.intercept_
else:
self.coef_ = None
self.intercept_ = None
if self.average > 0:
self._standard_coef = self.coef_
self._standard_intercept = self.intercept_
self._average_coef = None
self._average_intercept = None
# Clear iteration count for multiple call to fit.
self.t_ = 1.0
self._partial_fit(
X,
y,
alpha,
C,
loss,
learning_rate,
self.max_iter,
classes,
sample_weight,
coef_init,
intercept_init,
)
if (
self.tol is not None
and self.tol > -np.inf
and self.n_iter_ == self.max_iter
):
warnings.warn(
"Maximum number of iteration reached before "
"convergence. Consider increasing max_iter to "
"improve the fit.",
ConvergenceWarning,
)
return self
def _fit_binary(self, X, y, alpha, C, sample_weight, learning_rate, max_iter):
"""Fit a binary classifier on X and y."""
coef, intercept, n_iter_ = fit_binary(
self,
1,
X,
y,
alpha,
C,
learning_rate,
max_iter,
self._expanded_class_weight[1],
self._expanded_class_weight[0],
sample_weight,
random_state=self.random_state,
)
self.t_ += n_iter_ * X.shape[0]
self.n_iter_ = n_iter_
# need to be 2d
if self.average > 0:
if self.average <= self.t_ - 1:
self.coef_ = self._average_coef.reshape(1, -1)
self.intercept_ = self._average_intercept
else:
self.coef_ = self._standard_coef.reshape(1, -1)
self._standard_intercept = np.atleast_1d(intercept)
self.intercept_ = self._standard_intercept
else:
self.coef_ = coef.reshape(1, -1)
# intercept is a float, need to convert it to an array of length 1
self.intercept_ = np.atleast_1d(intercept)
def _fit_multiclass(self, X, y, alpha, C, learning_rate, sample_weight, max_iter):
"""Fit a multi-class classifier by combining binary classifiers
Each binary classifier predicts one class versus all others. This
strategy is called OvA (One versus All) or OvR (One versus Rest).
"""
# Precompute the validation split using the multiclass labels
# to ensure proper balancing of the classes.
validation_mask = self._make_validation_split(y)
# Use joblib to fit OvA in parallel.
# Pick the random seed for each job outside of fit_binary to avoid
# sharing the estimator random state between threads which could lead
# to non-deterministic behavior
random_state = check_random_state(self.random_state)
seeds = random_state.randint(MAX_INT, size=len(self.classes_))
result = Parallel(
n_jobs=self.n_jobs, verbose=self.verbose, require="sharedmem"
)(
delayed(fit_binary)(
self,
i,
X,
y,
alpha,
C,
learning_rate,
max_iter,
self._expanded_class_weight[i],
1.0,
sample_weight,
validation_mask=validation_mask,
random_state=seed,
)
for i, seed in enumerate(seeds)
)
# take the maximum of n_iter_ over every binary fit
n_iter_ = 0.0
for i, (_, intercept, n_iter_i) in enumerate(result):
self.intercept_[i] = intercept
n_iter_ = max(n_iter_, n_iter_i)
self.t_ += n_iter_ * X.shape[0]
self.n_iter_ = n_iter_
if self.average > 0:
if self.average <= self.t_ - 1.0:
self.coef_ = self._average_coef
self.intercept_ = self._average_intercept
else:
self.coef_ = self._standard_coef
self._standard_intercept = np.atleast_1d(self.intercept_)
self.intercept_ = self._standard_intercept
def partial_fit(self, X, y, classes=None, sample_weight=None):
"""Perform one epoch of stochastic gradient descent on given samples.
Internally, this method uses ``max_iter = 1``. Therefore, it is not
guaranteed that a minimum of the cost function is reached after calling
it once. Matters such as objective convergence, early stopping, and
learning rate adjustments should be handled by the user.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Subset of the training data.
y : ndarray of shape (n_samples,)
Subset of the target values.
classes : ndarray of shape (n_classes,), default=None
Classes across all calls to partial_fit.
Can be obtained by via `np.unique(y_all)`, where y_all is the
target vector of the entire dataset.
This argument is required for the first call to partial_fit
and can be omitted in the subsequent calls.
Note that y doesn't need to contain all labels in `classes`.
sample_weight : array-like, shape (n_samples,), default=None
Weights applied to individual samples.
If not provided, uniform weights are assumed.
Returns
-------
self : object
Returns an instance of self.
"""
if not hasattr(self, "classes_"):
self._validate_params()
self._more_validate_params(for_partial_fit=True)
if self.class_weight == "balanced":
raise ValueError(
"class_weight '{0}' is not supported for "
"partial_fit. In order to use 'balanced' weights,"
" use compute_class_weight('{0}', "
"classes=classes, y=y). "
"In place of y you can use a large enough sample "
"of the full training set target to properly "
"estimate the class frequency distributions. "
"Pass the resulting weights as the class_weight "
"parameter.".format(self.class_weight)
)
return self._partial_fit(
X,
y,
alpha=self.alpha,
C=1.0,
loss=self.loss,
learning_rate=self.learning_rate,
max_iter=1,
classes=classes,
sample_weight=sample_weight,
coef_init=None,
intercept_init=None,
)
def fit(self, X, y, coef_init=None, intercept_init=None, sample_weight=None):
"""Fit linear model with Stochastic Gradient Descent.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Training data.
y : ndarray of shape (n_samples,)
Target values.
coef_init : ndarray of shape (n_classes, n_features), default=None
The initial coefficients to warm-start the optimization.
intercept_init : ndarray of shape (n_classes,), default=None
The initial intercept to warm-start the optimization.
sample_weight : array-like, shape (n_samples,), default=None
Weights applied to individual samples.
If not provided, uniform weights are assumed. These weights will
be multiplied with class_weight (passed through the
constructor) if class_weight is specified.
Returns
-------
self : object
Returns an instance of self.
"""
self._validate_params()
self._more_validate_params()
return self._fit(
X,
y,
alpha=self.alpha,
C=1.0,
loss=self.loss,
learning_rate=self.learning_rate,
coef_init=coef_init,
intercept_init=intercept_init,
sample_weight=sample_weight,
)
class SGDClassifier(BaseSGDClassifier):
"""Linear classifiers (SVM, logistic regression, etc.) with SGD training.
This estimator implements regularized linear models with stochastic
gradient descent (SGD) learning: the gradient of the loss is estimated
each sample at a time and the model is updated along the way with a
decreasing strength schedule (aka learning rate). SGD allows minibatch
(online/out-of-core) learning via the `partial_fit` method.
For best results using the default learning rate schedule, the data should
have zero mean and unit variance.
This implementation works with data represented as dense or sparse arrays
of floating point values for the features. The model it fits can be
controlled with the loss parameter; by default, it fits a linear support
vector machine (SVM).
The regularizer is a penalty added to the loss function that shrinks model
parameters towards the zero vector using either the squared euclidean norm
L2 or the absolute norm L1 or a combination of both (Elastic Net). If the
parameter update crosses the 0.0 value because of the regularizer, the
update is truncated to 0.0 to allow for learning sparse models and achieve
online feature selection.
Read more in the :ref:`User Guide <sgd>`.
Parameters
----------
loss : {'hinge', 'log_loss', 'log', 'modified_huber', 'squared_hinge',\
'perceptron', 'squared_error', 'huber', 'epsilon_insensitive',\
'squared_epsilon_insensitive'}, default='hinge'
The loss function to be used.
- 'hinge' gives a linear SVM.
- 'log_loss' gives logistic regression, a probabilistic classifier.
- 'modified_huber' is another smooth loss that brings tolerance to
outliers as well as probability estimates.
- 'squared_hinge' is like hinge but is quadratically penalized.
- 'perceptron' is the linear loss used by the perceptron algorithm.
- The other losses, 'squared_error', 'huber', 'epsilon_insensitive' and
'squared_epsilon_insensitive' are designed for regression but can be useful
in classification as well; see
:class:`~sklearn.linear_model.SGDRegressor` for a description.
More details about the losses formulas can be found in the
:ref:`User Guide <sgd_mathematical_formulation>`.
.. deprecated:: 1.1
The loss 'log' was deprecated in v1.1 and will be removed
in version 1.3. Use `loss='log_loss'` which is equivalent.
penalty : {'l2', 'l1', 'elasticnet', None}, default='l2'
The penalty (aka regularization term) to be used. Defaults to 'l2'
which is the standard regularizer for linear SVM models. 'l1' and
'elasticnet' might bring sparsity to the model (feature selection)
not achievable with 'l2'. No penalty is added when set to `None`.
alpha : float, default=0.0001
Constant that multiplies the regularization term. The higher the
value, the stronger the regularization.
Also used to compute the learning rate when set to `learning_rate` is
set to 'optimal'.
Values must be in the range `[0.0, inf)`.
l1_ratio : float, default=0.15
The Elastic Net mixing parameter, with 0 <= l1_ratio <= 1.
l1_ratio=0 corresponds to L2 penalty, l1_ratio=1 to L1.
Only used if `penalty` is 'elasticnet'.
Values must be in the range `[0.0, 1.0]`.
fit_intercept : bool, default=True
Whether the intercept should be estimated or not. If False, the
data is assumed to be already centered.
max_iter : int, default=1000
The maximum number of passes over the training data (aka epochs).
It only impacts the behavior in the ``fit`` method, and not the
:meth:`partial_fit` method.
Values must be in the range `[1, inf)`.
.. versionadded:: 0.19
tol : float or None, default=1e-3
The stopping criterion. If it is not None, training will stop
when (loss > best_loss - tol) for ``n_iter_no_change`` consecutive
epochs.
Convergence is checked against the training loss or the
validation loss depending on the `early_stopping` parameter.
Values must be in the range `[0.0, inf)`.
.. versionadded:: 0.19
shuffle : bool, default=True
Whether or not the training data should be shuffled after each epoch.
verbose : int, default=0
The verbosity level.
Values must be in the range `[0, inf)`.
epsilon : float, default=0.1
Epsilon in the epsilon-insensitive loss functions; only if `loss` is
'huber', 'epsilon_insensitive', or 'squared_epsilon_insensitive'.
For 'huber', determines the threshold at which it becomes less
important to get the prediction exactly right.
For epsilon-insensitive, any differences between the current prediction
and the correct label are ignored if they are less than this threshold.
Values must be in the range `[0.0, inf)`.
n_jobs : int, default=None
The number of CPUs to use to do the OVA (One Versus All, for
multi-class problems) computation.
``None`` means 1 unless in a :obj:`joblib.parallel_backend` context.
``-1`` means using all processors. See :term:`Glossary <n_jobs>`
for more details.
random_state : int, RandomState instance, default=None
Used for shuffling the data, when ``shuffle`` is set to ``True``.
Pass an int for reproducible output across multiple function calls.
See :term:`Glossary <random_state>`.
Integer values must be in the range `[0, 2**32 - 1]`.
learning_rate : str, default='optimal'
The learning rate schedule:
- 'constant': `eta = eta0`
- 'optimal': `eta = 1.0 / (alpha * (t + t0))`
where `t0` is chosen by a heuristic proposed by Leon Bottou.
- 'invscaling': `eta = eta0 / pow(t, power_t)`
- 'adaptive': `eta = eta0`, as long as the training keeps decreasing.
Each time n_iter_no_change consecutive epochs fail to decrease the
training loss by tol or fail to increase validation score by tol if
`early_stopping` is `True`, the current learning rate is divided by 5.
.. versionadded:: 0.20
Added 'adaptive' option
eta0 : float, default=0.0
The initial learning rate for the 'constant', 'invscaling' or
'adaptive' schedules. The default value is 0.0 as eta0 is not used by
the default schedule 'optimal'.
Values must be in the range `(0.0, inf)`.
power_t : float, default=0.5
The exponent for inverse scaling learning rate [default 0.5].
Values must be in the range `(-inf, inf)`.
early_stopping : bool, default=False
Whether to use early stopping to terminate training when validation
score is not improving. If set to `True`, it will automatically set aside
a stratified fraction of training data as validation and terminate
training when validation score returned by the `score` method is not
improving by at least tol for n_iter_no_change consecutive epochs.
.. versionadded:: 0.20
Added 'early_stopping' option
validation_fraction : float, default=0.1
The proportion of training data to set aside as validation set for
early stopping. Must be between 0 and 1.
Only used if `early_stopping` is True.
Values must be in the range `(0.0, 1.0)`.
.. versionadded:: 0.20
Added 'validation_fraction' option
n_iter_no_change : int, default=5
Number of iterations with no improvement to wait before stopping
fitting.
Convergence is checked against the training loss or the
validation loss depending on the `early_stopping` parameter.
Integer values must be in the range `[1, max_iter)`.
.. versionadded:: 0.20
Added 'n_iter_no_change' option
class_weight : dict, {class_label: weight} or "balanced", default=None
Preset for the class_weight fit parameter.
Weights associated with classes. If not given, all classes
are supposed to have weight one.
The "balanced" mode uses the values of y to automatically adjust
weights inversely proportional to class frequencies in the input data
as ``n_samples / (n_classes * np.bincount(y))``.
warm_start : bool, default=False
When set to True, reuse the solution of the previous call to fit as
initialization, otherwise, just erase the previous solution.
See :term:`the Glossary <warm_start>`.
Repeatedly calling fit or partial_fit when warm_start is True can
result in a different solution than when calling fit a single time
because of the way the data is shuffled.
If a dynamic learning rate is used, the learning rate is adapted
depending on the number of samples already seen. Calling ``fit`` resets
this counter, while ``partial_fit`` will result in increasing the
existing counter.
average : bool or int, default=False
When set to `True`, computes the averaged SGD weights across all
updates and stores the result in the ``coef_`` attribute. If set to
an int greater than 1, averaging will begin once the total number of
samples seen reaches `average`. So ``average=10`` will begin
averaging after seeing 10 samples.
Integer values must be in the range `[1, n_samples]`.
Attributes
----------
coef_ : ndarray of shape (1, n_features) if n_classes == 2 else \
(n_classes, n_features)
Weights assigned to the features.
intercept_ : ndarray of shape (1,) if n_classes == 2 else (n_classes,)
Constants in decision function.
n_iter_ : int
The actual number of iterations before reaching the stopping criterion.
For multiclass fits, it is the maximum over every binary fit.
loss_function_ : concrete ``LossFunction``
classes_ : array of shape (n_classes,)
t_ : int
Number of weight updates performed during training.
Same as ``(n_iter_ * n_samples + 1)``.
n_features_in_ : int
Number of features seen during :term:`fit`.
.. versionadded:: 0.24
feature_names_in_ : ndarray of shape (`n_features_in_`,)
Names of features seen during :term:`fit`. Defined only when `X`
has feature names that are all strings.
.. versionadded:: 1.0
See Also
--------
sklearn.svm.LinearSVC : Linear support vector classification.
LogisticRegression : Logistic regression.
Perceptron : Inherits from SGDClassifier. ``Perceptron()`` is equivalent to
``SGDClassifier(loss="perceptron", eta0=1, learning_rate="constant",
penalty=None)``.
Examples
--------
>>> import numpy as np
>>> from sklearn.linear_model import SGDClassifier
>>> from sklearn.preprocessing import StandardScaler
>>> from sklearn.pipeline import make_pipeline
>>> X = np.array([[-1, -1], [-2, -1], [1, 1], [2, 1]])
>>> Y = np.array([1, 1, 2, 2])
>>> # Always scale the input. The most convenient way is to use a pipeline.
>>> clf = make_pipeline(StandardScaler(),
... SGDClassifier(max_iter=1000, tol=1e-3))
>>> clf.fit(X, Y)
Pipeline(steps=[('standardscaler', StandardScaler()),
('sgdclassifier', SGDClassifier())])
>>> print(clf.predict([[-0.8, -1]]))
[1]
"""
_parameter_constraints: dict = {
**BaseSGDClassifier._parameter_constraints,
"penalty": [StrOptions({"l2", "l1", "elasticnet"}), None],
"alpha": [Interval(Real, 0, None, closed="left")],
"l1_ratio": [Interval(Real, 0, 1, closed="both")],
"power_t": [Interval(Real, None, None, closed="neither")],
"epsilon": [Interval(Real, 0, None, closed="left")],
"learning_rate": [
StrOptions({"constant", "optimal", "invscaling", "adaptive"}),
Hidden(StrOptions({"pa1", "pa2"})),
],
"eta0": [Interval(Real, 0, None, closed="left")],
}
def __init__(
self,
loss="hinge",
*,
penalty="l2",
alpha=0.0001,
l1_ratio=0.15,
fit_intercept=True,
max_iter=1000,
tol=1e-3,
shuffle=True,
verbose=0,
epsilon=DEFAULT_EPSILON,
n_jobs=None,
random_state=None,
learning_rate="optimal",
eta0=0.0,
power_t=0.5,
early_stopping=False,
validation_fraction=0.1,
n_iter_no_change=5,
class_weight=None,
warm_start=False,
average=False,
):
super().__init__(
loss=loss,
penalty=penalty,
alpha=alpha,
l1_ratio=l1_ratio,
fit_intercept=fit_intercept,
max_iter=max_iter,
tol=tol,
shuffle=shuffle,
verbose=verbose,
epsilon=epsilon,
n_jobs=n_jobs,
random_state=random_state,
learning_rate=learning_rate,
eta0=eta0,
power_t=power_t,
early_stopping=early_stopping,
validation_fraction=validation_fraction,
n_iter_no_change=n_iter_no_change,
class_weight=class_weight,
warm_start=warm_start,
average=average,
)
def _check_proba(self):
# TODO(1.3): Remove "log"
if self.loss not in ("log_loss", "log", "modified_huber"):
raise AttributeError(
"probability estimates are not available for loss=%r" % self.loss
)
return True
@available_if(_check_proba)
def predict_proba(self, X):
"""Probability estimates.
This method is only available for log loss and modified Huber loss.
Multiclass probability estimates are derived from binary (one-vs.-rest)
estimates by simple normalization, as recommended by Zadrozny and
Elkan.
Binary probability estimates for loss="modified_huber" are given by
(clip(decision_function(X), -1, 1) + 1) / 2. For other loss functions
it is necessary to perform proper probability calibration by wrapping
the classifier with
:class:`~sklearn.calibration.CalibratedClassifierCV` instead.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Input data for prediction.
Returns
-------
ndarray of shape (n_samples, n_classes)
Returns the probability of the sample for each class in the model,
where classes are ordered as they are in `self.classes_`.
References
----------
Zadrozny and Elkan, "Transforming classifier scores into multiclass
probability estimates", SIGKDD'02,
https://dl.acm.org/doi/pdf/10.1145/775047.775151
The justification for the formula in the loss="modified_huber"
case is in the appendix B in:
http://jmlr.csail.mit.edu/papers/volume2/zhang02c/zhang02c.pdf
"""
check_is_fitted(self)
# TODO(1.3): Remove "log"
if self.loss in ("log_loss", "log"):
return self._predict_proba_lr(X)
elif self.loss == "modified_huber":
binary = len(self.classes_) == 2
scores = self.decision_function(X)
if binary:
prob2 = np.ones((scores.shape[0], 2))
prob = prob2[:, 1]
else:
prob = scores
np.clip(scores, -1, 1, prob)
prob += 1.0
prob /= 2.0
if binary:
prob2[:, 0] -= prob
prob = prob2
else:
# the above might assign zero to all classes, which doesn't
# normalize neatly; work around this to produce uniform
# probabilities
prob_sum = prob.sum(axis=1)
all_zero = prob_sum == 0
if np.any(all_zero):
prob[all_zero, :] = 1
prob_sum[all_zero] = len(self.classes_)
# normalize
prob /= prob_sum.reshape((prob.shape[0], -1))
return prob
else:
raise NotImplementedError(
"predict_(log_)proba only supported when"
" loss='log_loss' or loss='modified_huber' "
"(%r given)"
% self.loss
)
@available_if(_check_proba)
def predict_log_proba(self, X):
"""Log of probability estimates.
This method is only available for log loss and modified Huber loss.
When loss="modified_huber", probability estimates may be hard zeros
and ones, so taking the logarithm is not possible.
See ``predict_proba`` for details.
Parameters
----------
X : {array-like, sparse matrix} of shape (n_samples, n_features)
Input data for prediction.
Returns
-------
T : array-like, shape (n_samples, n_classes)
Returns the log-probability of the sample for each class in the
model, where classes are ordered as they are in
`self.classes_`.
"""
return np.log(self.predict_proba(X))
def _more_tags(self):
return {
"_xfail_checks": {
"check_sample_weights_invariance": (
"zero sample_weight is not equivalent to removing samples"
),
}
}
class BaseSGDRegressor(RegressorMixin, BaseSGD):
loss_functions = {
"squared_error": (SquaredLoss,),
"huber": (Huber, DEFAULT_EPSILON),
"epsilon_insensitive": (EpsilonInsensitive, DEFAULT_EPSILON),
"squared_epsilon_insensitive": (SquaredEpsilonInsensitive, DEFAULT_EPSILON),
}
_parameter_constraints: dict = {
**BaseSGD._parameter_constraints,
"loss": [StrOptions(set(loss_functions))],
"early_stopping": ["boolean"],
"validation_fraction": [Interval(Real, 0, 1, closed="neither")],
"n_iter_no_change": [Interval(Integral, 1, None, closed="left")],
}
@abstractmethod
def __init__(
self,
loss="squared_error",
*,
penalty="l2",
alpha=0.0001,
l1_ratio=0.15,
fit_intercept=True,
max_iter=1000,
tol=1e-3,
shuffle=True,
verbose=0,
epsilon=DEFAULT_EPSILON,
random_state=None,
learning_rate="invscaling",
eta0=0.01,
power_t=0.25,
early_stopping=False,
validation_fraction=0.1,
n_iter_no_change=5,
warm_start=False,
average=False,
):
super().__init__(
loss=loss,
penalty=penalty,
alpha=alpha,
l1_ratio=l1_ratio,
fit_intercept=fit_intercept,
max_iter=max_iter,
tol=tol,
shuffle=shuffle,
verbose=verbose,
epsilon=epsilon,
random_state=random_state,
learning_rate=learning_rate,
eta0=eta0,
power_t=power_t,
early_stopping=early_stopping,
validation_fraction=validation_fraction,
n_iter_no_change=n_iter_no_change,
warm_start=warm_start,
average=average,
)
def _partial_fit(
self,
X,
y,
alpha,
C,
loss,
learning_rate,
max_iter,
sample_weight,
coef_init,
intercept_init,
):
first_call = getattr(self, "coef_", None) is None
X, y = self._validate_data(
X,
y,
accept_sparse="csr",
copy=False,
order="C",
dtype=np.float64,
accept_large_sparse=False,
reset=first_call,
)
y = y.astype(np.float64, copy=False)
n_samples, n_features = X.shape
sample_weight = _check_sample_weight(sample_weight, X)
# Allocate datastructures from input arguments
if first_call:
self._allocate_parameter_mem(1, n_features, coef_init, intercept_init)
if self.average > 0 and getattr(self, "_average_coef", None) is None:
self._average_coef = np.zeros(n_features, dtype=np.float64, order="C")
self._average_intercept = np.zeros(1, dtype=np.float64, order="C")
self._fit_regressor(
X, y, alpha, C, loss, learning_rate, sample_weight, max_iter
)
return self
def partial_fit(self, X, y, sample_weight=None):
"""Perform one epoch of stochastic gradient descent on given samples.
Internally, this method uses ``max_iter = 1``. Therefore, it is not
guaranteed that a minimum of the cost function is reached after calling
it once. Matters such as objective convergence and early stopping
should be handled by the user.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Subset of training data.
y : numpy array of shape (n_samples,)
Subset of target values.
sample_weight : array-like, shape (n_samples,), default=None
Weights applied to individual samples.
If not provided, uniform weights are assumed.
Returns
-------
self : object
Returns an instance of self.
"""
if not hasattr(self, "coef_"):
self._validate_params()
self._more_validate_params(for_partial_fit=True)
return self._partial_fit(
X,
y,
self.alpha,
C=1.0,
loss=self.loss,
learning_rate=self.learning_rate,
max_iter=1,
sample_weight=sample_weight,
coef_init=None,
intercept_init=None,
)
def _fit(
self,
X,
y,
alpha,
C,
loss,
learning_rate,
coef_init=None,
intercept_init=None,
sample_weight=None,
):
if self.warm_start and getattr(self, "coef_", None) is not None:
if coef_init is None:
coef_init = self.coef_
if intercept_init is None:
intercept_init = self.intercept_
else:
self.coef_ = None
self.intercept_ = None
# Clear iteration count for multiple call to fit.
self.t_ = 1.0
self._partial_fit(
X,
y,
alpha,
C,
loss,
learning_rate,
self.max_iter,
sample_weight,
coef_init,
intercept_init,
)
if (
self.tol is not None
and self.tol > -np.inf
and self.n_iter_ == self.max_iter
):
warnings.warn(
"Maximum number of iteration reached before "
"convergence. Consider increasing max_iter to "
"improve the fit.",
ConvergenceWarning,
)
return self
def fit(self, X, y, coef_init=None, intercept_init=None, sample_weight=None):
"""Fit linear model with Stochastic Gradient Descent.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Training data.
y : ndarray of shape (n_samples,)
Target values.
coef_init : ndarray of shape (n_features,), default=None
The initial coefficients to warm-start the optimization.
intercept_init : ndarray of shape (1,), default=None
The initial intercept to warm-start the optimization.
sample_weight : array-like, shape (n_samples,), default=None
Weights applied to individual samples (1. for unweighted).
Returns
-------
self : object
Fitted `SGDRegressor` estimator.
"""
self._validate_params()
self._more_validate_params()
return self._fit(
X,
y,
alpha=self.alpha,
C=1.0,
loss=self.loss,
learning_rate=self.learning_rate,
coef_init=coef_init,
intercept_init=intercept_init,
sample_weight=sample_weight,
)
def _decision_function(self, X):
"""Predict using the linear model
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Returns
-------
ndarray of shape (n_samples,)
Predicted target values per element in X.
"""
check_is_fitted(self)
X = self._validate_data(X, accept_sparse="csr", reset=False)
scores = safe_sparse_dot(X, self.coef_.T, dense_output=True) + self.intercept_
return scores.ravel()
def predict(self, X):
"""Predict using the linear model.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Input data.
Returns
-------
ndarray of shape (n_samples,)
Predicted target values per element in X.
"""
return self._decision_function(X)
def _fit_regressor(
self, X, y, alpha, C, loss, learning_rate, sample_weight, max_iter
):
loss_function = self._get_loss_function(loss)
penalty_type = self._get_penalty_type(self.penalty)
learning_rate_type = self._get_learning_rate_type(learning_rate)
if not hasattr(self, "t_"):
self.t_ = 1.0
validation_mask = self._make_validation_split(y)
validation_score_cb = self._make_validation_score_cb(
validation_mask, X, y, sample_weight
)
random_state = check_random_state(self.random_state)
# numpy mtrand expects a C long which is a signed 32 bit integer under
# Windows
seed = random_state.randint(0, MAX_INT)
dataset, intercept_decay = make_dataset(
X, y, sample_weight, random_state=random_state
)
tol = self.tol if self.tol is not None else -np.inf
if self.average:
coef = self._standard_coef
intercept = self._standard_intercept
average_coef = self._average_coef
average_intercept = self._average_intercept
else:
coef = self.coef_
intercept = self.intercept_
average_coef = None # Not used
average_intercept = [0] # Not used
coef, intercept, average_coef, average_intercept, self.n_iter_ = _plain_sgd(
coef,
intercept[0],
average_coef,
average_intercept[0],
loss_function,
penalty_type,
alpha,
C,
self.l1_ratio,
dataset,
validation_mask,
self.early_stopping,
validation_score_cb,
int(self.n_iter_no_change),
max_iter,
tol,
int(self.fit_intercept),
int(self.verbose),
int(self.shuffle),
seed,
1.0,
1.0,
learning_rate_type,
self.eta0,
self.power_t,
0,
self.t_,
intercept_decay,
self.average,
)
self.t_ += self.n_iter_ * X.shape[0]
if self.average > 0:
self._average_intercept = np.atleast_1d(average_intercept)
self._standard_intercept = np.atleast_1d(intercept)
if self.average <= self.t_ - 1.0:
# made enough updates for averaging to be taken into account
self.coef_ = average_coef
self.intercept_ = np.atleast_1d(average_intercept)
else:
self.coef_ = coef
self.intercept_ = np.atleast_1d(intercept)
else:
self.intercept_ = np.atleast_1d(intercept)
class SGDRegressor(BaseSGDRegressor):
"""Linear model fitted by minimizing a regularized empirical loss with SGD.
SGD stands for Stochastic Gradient Descent: the gradient of the loss is
estimated each sample at a time and the model is updated along the way with
a decreasing strength schedule (aka learning rate).
The regularizer is a penalty added to the loss function that shrinks model
parameters towards the zero vector using either the squared euclidean norm
L2 or the absolute norm L1 or a combination of both (Elastic Net). If the
parameter update crosses the 0.0 value because of the regularizer, the
update is truncated to 0.0 to allow for learning sparse models and achieve
online feature selection.
This implementation works with data represented as dense numpy arrays of
floating point values for the features.
Read more in the :ref:`User Guide <sgd>`.
Parameters
----------
loss : str, default='squared_error'
The loss function to be used. The possible values are 'squared_error',
'huber', 'epsilon_insensitive', or 'squared_epsilon_insensitive'
The 'squared_error' refers to the ordinary least squares fit.
'huber' modifies 'squared_error' to focus less on getting outliers
correct by switching from squared to linear loss past a distance of
epsilon. 'epsilon_insensitive' ignores errors less than epsilon and is
linear past that; this is the loss function used in SVR.
'squared_epsilon_insensitive' is the same but becomes squared loss past
a tolerance of epsilon.
More details about the losses formulas can be found in the
:ref:`User Guide <sgd_mathematical_formulation>`.
penalty : {'l2', 'l1', 'elasticnet', None}, default='l2'
The penalty (aka regularization term) to be used. Defaults to 'l2'
which is the standard regularizer for linear SVM models. 'l1' and
'elasticnet' might bring sparsity to the model (feature selection)
not achievable with 'l2'. No penalty is added when set to `None`.
alpha : float, default=0.0001
Constant that multiplies the regularization term. The higher the
value, the stronger the regularization.
Also used to compute the learning rate when set to `learning_rate` is
set to 'optimal'.
l1_ratio : float, default=0.15
The Elastic Net mixing parameter, with 0 <= l1_ratio <= 1.
l1_ratio=0 corresponds to L2 penalty, l1_ratio=1 to L1.
Only used if `penalty` is 'elasticnet'.
fit_intercept : bool, default=True
Whether the intercept should be estimated or not. If False, the
data is assumed to be already centered.
max_iter : int, default=1000
The maximum number of passes over the training data (aka epochs).
It only impacts the behavior in the ``fit`` method, and not the
:meth:`partial_fit` method.
.. versionadded:: 0.19
tol : float or None, default=1e-3
The stopping criterion. If it is not None, training will stop
when (loss > best_loss - tol) for ``n_iter_no_change`` consecutive
epochs.
Convergence is checked against the training loss or the
validation loss depending on the `early_stopping` parameter.
.. versionadded:: 0.19
shuffle : bool, default=True
Whether or not the training data should be shuffled after each epoch.
verbose : int, default=0
The verbosity level.
epsilon : float, default=0.1
Epsilon in the epsilon-insensitive loss functions; only if `loss` is
'huber', 'epsilon_insensitive', or 'squared_epsilon_insensitive'.
For 'huber', determines the threshold at which it becomes less
important to get the prediction exactly right.
For epsilon-insensitive, any differences between the current prediction
and the correct label are ignored if they are less than this threshold.
random_state : int, RandomState instance, default=None
Used for shuffling the data, when ``shuffle`` is set to ``True``.
Pass an int for reproducible output across multiple function calls.
See :term:`Glossary <random_state>`.
learning_rate : str, default='invscaling'
The learning rate schedule:
- 'constant': `eta = eta0`
- 'optimal': `eta = 1.0 / (alpha * (t + t0))`
where t0 is chosen by a heuristic proposed by Leon Bottou.
- 'invscaling': `eta = eta0 / pow(t, power_t)`
- 'adaptive': eta = eta0, as long as the training keeps decreasing.
Each time n_iter_no_change consecutive epochs fail to decrease the
training loss by tol or fail to increase validation score by tol if
early_stopping is True, the current learning rate is divided by 5.
.. versionadded:: 0.20
Added 'adaptive' option
eta0 : float, default=0.01
The initial learning rate for the 'constant', 'invscaling' or
'adaptive' schedules. The default value is 0.01.
power_t : float, default=0.25
The exponent for inverse scaling learning rate.
early_stopping : bool, default=False
Whether to use early stopping to terminate training when validation
score is not improving. If set to True, it will automatically set aside
a fraction of training data as validation and terminate
training when validation score returned by the `score` method is not
improving by at least `tol` for `n_iter_no_change` consecutive
epochs.
.. versionadded:: 0.20
Added 'early_stopping' option
validation_fraction : float, default=0.1
The proportion of training data to set aside as validation set for
early stopping. Must be between 0 and 1.
Only used if `early_stopping` is True.
.. versionadded:: 0.20
Added 'validation_fraction' option
n_iter_no_change : int, default=5
Number of iterations with no improvement to wait before stopping
fitting.
Convergence is checked against the training loss or the
validation loss depending on the `early_stopping` parameter.
.. versionadded:: 0.20
Added 'n_iter_no_change' option
warm_start : bool, default=False
When set to True, reuse the solution of the previous call to fit as
initialization, otherwise, just erase the previous solution.
See :term:`the Glossary <warm_start>`.
Repeatedly calling fit or partial_fit when warm_start is True can
result in a different solution than when calling fit a single time
because of the way the data is shuffled.
If a dynamic learning rate is used, the learning rate is adapted
depending on the number of samples already seen. Calling ``fit`` resets
this counter, while ``partial_fit`` will result in increasing the
existing counter.
average : bool or int, default=False
When set to True, computes the averaged SGD weights across all
updates and stores the result in the ``coef_`` attribute. If set to
an int greater than 1, averaging will begin once the total number of
samples seen reaches `average`. So ``average=10`` will begin
averaging after seeing 10 samples.
Attributes
----------
coef_ : ndarray of shape (n_features,)
Weights assigned to the features.
intercept_ : ndarray of shape (1,)
The intercept term.
n_iter_ : int
The actual number of iterations before reaching the stopping criterion.
t_ : int
Number of weight updates performed during training.
Same as ``(n_iter_ * n_samples + 1)``.
n_features_in_ : int
Number of features seen during :term:`fit`.
.. versionadded:: 0.24
feature_names_in_ : ndarray of shape (`n_features_in_`,)
Names of features seen during :term:`fit`. Defined only when `X`
has feature names that are all strings.
.. versionadded:: 1.0
See Also
--------
HuberRegressor : Linear regression model that is robust to outliers.
Lars : Least Angle Regression model.
Lasso : Linear Model trained with L1 prior as regularizer.
RANSACRegressor : RANSAC (RANdom SAmple Consensus) algorithm.
Ridge : Linear least squares with l2 regularization.
sklearn.svm.SVR : Epsilon-Support Vector Regression.
TheilSenRegressor : Theil-Sen Estimator robust multivariate regression model.
Examples
--------
>>> import numpy as np
>>> from sklearn.linear_model import SGDRegressor
>>> from sklearn.pipeline import make_pipeline
>>> from sklearn.preprocessing import StandardScaler
>>> n_samples, n_features = 10, 5
>>> rng = np.random.RandomState(0)
>>> y = rng.randn(n_samples)
>>> X = rng.randn(n_samples, n_features)
>>> # Always scale the input. The most convenient way is to use a pipeline.
>>> reg = make_pipeline(StandardScaler(),
... SGDRegressor(max_iter=1000, tol=1e-3))
>>> reg.fit(X, y)
Pipeline(steps=[('standardscaler', StandardScaler()),
('sgdregressor', SGDRegressor())])
"""
_parameter_constraints: dict = {
**BaseSGDRegressor._parameter_constraints,
"penalty": [StrOptions({"l2", "l1", "elasticnet"}), None],
"alpha": [Interval(Real, 0, None, closed="left")],
"l1_ratio": [Interval(Real, 0, 1, closed="both")],
"power_t": [Interval(Real, None, None, closed="neither")],
"learning_rate": [
StrOptions({"constant", "optimal", "invscaling", "adaptive"}),
Hidden(StrOptions({"pa1", "pa2"})),
],
"epsilon": [Interval(Real, 0, None, closed="left")],
"eta0": [Interval(Real, 0, None, closed="left")],
}
def __init__(
self,
loss="squared_error",
*,
penalty="l2",
alpha=0.0001,
l1_ratio=0.15,
fit_intercept=True,
max_iter=1000,
tol=1e-3,
shuffle=True,
verbose=0,
epsilon=DEFAULT_EPSILON,
random_state=None,
learning_rate="invscaling",
eta0=0.01,
power_t=0.25,
early_stopping=False,
validation_fraction=0.1,
n_iter_no_change=5,
warm_start=False,
average=False,
):
super().__init__(
loss=loss,
penalty=penalty,
alpha=alpha,
l1_ratio=l1_ratio,
fit_intercept=fit_intercept,
max_iter=max_iter,
tol=tol,
shuffle=shuffle,
verbose=verbose,
epsilon=epsilon,
random_state=random_state,
learning_rate=learning_rate,
eta0=eta0,
power_t=power_t,
early_stopping=early_stopping,
validation_fraction=validation_fraction,
n_iter_no_change=n_iter_no_change,
warm_start=warm_start,
average=average,
)
def _more_tags(self):
return {
"_xfail_checks": {
"check_sample_weights_invariance": (
"zero sample_weight is not equivalent to removing samples"
),
}
}
class SGDOneClassSVM(BaseSGD, OutlierMixin):
"""Solves linear One-Class SVM using Stochastic Gradient Descent.
This implementation is meant to be used with a kernel approximation
technique (e.g. `sklearn.kernel_approximation.Nystroem`) to obtain results
similar to `sklearn.svm.OneClassSVM` which uses a Gaussian kernel by
default.
Read more in the :ref:`User Guide <sgd_online_one_class_svm>`.
.. versionadded:: 1.0
Parameters
----------
nu : float, default=0.5
The nu parameter of the One Class SVM: an upper bound on the
fraction of training errors and a lower bound of the fraction of
support vectors. Should be in the interval (0, 1]. By default 0.5
will be taken.
fit_intercept : bool, default=True
Whether the intercept should be estimated or not. Defaults to True.
max_iter : int, default=1000
The maximum number of passes over the training data (aka epochs).
It only impacts the behavior in the ``fit`` method, and not the
`partial_fit`. Defaults to 1000.
tol : float or None, default=1e-3
The stopping criterion. If it is not None, the iterations will stop
when (loss > previous_loss - tol). Defaults to 1e-3.
shuffle : bool, default=True
Whether or not the training data should be shuffled after each epoch.
Defaults to True.
verbose : int, default=0
The verbosity level.
random_state : int, RandomState instance or None, default=None
The seed of the pseudo random number generator to use when shuffling
the data. If int, random_state is the seed used by the random number
generator; If RandomState instance, random_state is the random number
generator; If None, the random number generator is the RandomState
instance used by `np.random`.
learning_rate : {'constant', 'optimal', 'invscaling', 'adaptive'}, default='optimal'
The learning rate schedule to use with `fit`. (If using `partial_fit`,
learning rate must be controlled directly).
- 'constant': `eta = eta0`
- 'optimal': `eta = 1.0 / (alpha * (t + t0))`
where t0 is chosen by a heuristic proposed by Leon Bottou.
- 'invscaling': `eta = eta0 / pow(t, power_t)`
- 'adaptive': eta = eta0, as long as the training keeps decreasing.
Each time n_iter_no_change consecutive epochs fail to decrease the
training loss by tol or fail to increase validation score by tol if
early_stopping is True, the current learning rate is divided by 5.
eta0 : float, default=0.0
The initial learning rate for the 'constant', 'invscaling' or
'adaptive' schedules. The default value is 0.0 as eta0 is not used by
the default schedule 'optimal'.
power_t : float, default=0.5
The exponent for inverse scaling learning rate [default 0.5].
warm_start : bool, default=False
When set to True, reuse the solution of the previous call to fit as
initialization, otherwise, just erase the previous solution.
See :term:`the Glossary <warm_start>`.
Repeatedly calling fit or partial_fit when warm_start is True can
result in a different solution than when calling fit a single time
because of the way the data is shuffled.
If a dynamic learning rate is used, the learning rate is adapted
depending on the number of samples already seen. Calling ``fit`` resets
this counter, while ``partial_fit`` will result in increasing the
existing counter.
average : bool or int, default=False
When set to True, computes the averaged SGD weights and stores the
result in the ``coef_`` attribute. If set to an int greater than 1,
averaging will begin once the total number of samples seen reaches
average. So ``average=10`` will begin averaging after seeing 10
samples.
Attributes
----------
coef_ : ndarray of shape (1, n_features)
Weights assigned to the features.
offset_ : ndarray of shape (1,)
Offset used to define the decision function from the raw scores.
We have the relation: decision_function = score_samples - offset.
n_iter_ : int
The actual number of iterations to reach the stopping criterion.
t_ : int
Number of weight updates performed during training.
Same as ``(n_iter_ * n_samples + 1)``.
loss_function_ : concrete ``LossFunction``
n_features_in_ : int
Number of features seen during :term:`fit`.
.. versionadded:: 0.24
feature_names_in_ : ndarray of shape (`n_features_in_`,)
Names of features seen during :term:`fit`. Defined only when `X`
has feature names that are all strings.
.. versionadded:: 1.0
See Also
--------
sklearn.svm.OneClassSVM : Unsupervised Outlier Detection.
Notes
-----
This estimator has a linear complexity in the number of training samples
and is thus better suited than the `sklearn.svm.OneClassSVM`
implementation for datasets with a large number of training samples (say
> 10,000).
Examples
--------
>>> import numpy as np
>>> from sklearn import linear_model
>>> X = np.array([[-1, -1], [-2, -1], [1, 1], [2, 1]])
>>> clf = linear_model.SGDOneClassSVM(random_state=42)
>>> clf.fit(X)
SGDOneClassSVM(random_state=42)
>>> print(clf.predict([[4, 4]]))
[1]
"""
loss_functions = {"hinge": (Hinge, 1.0)}
_parameter_constraints: dict = {
**BaseSGD._parameter_constraints,
"nu": [Interval(Real, 0.0, 1.0, closed="right")],
"learning_rate": [
StrOptions({"constant", "optimal", "invscaling", "adaptive"}),
Hidden(StrOptions({"pa1", "pa2"})),
],
"eta0": [Interval(Real, 0, None, closed="left")],
"power_t": [Interval(Real, None, None, closed="neither")],
}
def __init__(
self,
nu=0.5,
fit_intercept=True,
max_iter=1000,
tol=1e-3,
shuffle=True,
verbose=0,
random_state=None,
learning_rate="optimal",
eta0=0.0,
power_t=0.5,
warm_start=False,
average=False,
):
self.nu = nu
super(SGDOneClassSVM, self).__init__(
loss="hinge",
penalty="l2",
C=1.0,
l1_ratio=0,
fit_intercept=fit_intercept,
max_iter=max_iter,
tol=tol,
shuffle=shuffle,
verbose=verbose,
epsilon=DEFAULT_EPSILON,
random_state=random_state,
learning_rate=learning_rate,
eta0=eta0,
power_t=power_t,
early_stopping=False,
validation_fraction=0.1,
n_iter_no_change=5,
warm_start=warm_start,
average=average,
)
def _fit_one_class(self, X, alpha, C, sample_weight, learning_rate, max_iter):
"""Uses SGD implementation with X and y=np.ones(n_samples)."""
# The One-Class SVM uses the SGD implementation with
# y=np.ones(n_samples).
n_samples = X.shape[0]
y = np.ones(n_samples, dtype=np.float64, order="C")
dataset, offset_decay = make_dataset(X, y, sample_weight)
penalty_type = self._get_penalty_type(self.penalty)
learning_rate_type = self._get_learning_rate_type(learning_rate)
# early stopping is set to False for the One-Class SVM. thus
# validation_mask and validation_score_cb will be set to values
# associated to early_stopping=False in _make_validation_split and
# _make_validation_score_cb respectively.
validation_mask = self._make_validation_split(y)
validation_score_cb = self._make_validation_score_cb(
validation_mask, X, y, sample_weight
)
random_state = check_random_state(self.random_state)
# numpy mtrand expects a C long which is a signed 32 bit integer under
# Windows
seed = random_state.randint(0, np.iinfo(np.int32).max)
tol = self.tol if self.tol is not None else -np.inf
one_class = 1
# There are no class weights for the One-Class SVM and they are
# therefore set to 1.
pos_weight = 1
neg_weight = 1
if self.average:
coef = self._standard_coef
intercept = self._standard_intercept
average_coef = self._average_coef
average_intercept = self._average_intercept
else:
coef = self.coef_
intercept = 1 - self.offset_
average_coef = None # Not used
average_intercept = [0] # Not used
coef, intercept, average_coef, average_intercept, self.n_iter_ = _plain_sgd(
coef,
intercept[0],
average_coef,
average_intercept[0],
self.loss_function_,
penalty_type,
alpha,
C,
self.l1_ratio,
dataset,
validation_mask,
self.early_stopping,
validation_score_cb,
int(self.n_iter_no_change),
max_iter,
tol,
int(self.fit_intercept),
int(self.verbose),
int(self.shuffle),
seed,
neg_weight,
pos_weight,
learning_rate_type,
self.eta0,
self.power_t,
one_class,
self.t_,
offset_decay,
self.average,
)
self.t_ += self.n_iter_ * n_samples
if self.average > 0:
self._average_intercept = np.atleast_1d(average_intercept)
self._standard_intercept = np.atleast_1d(intercept)
if self.average <= self.t_ - 1.0:
# made enough updates for averaging to be taken into account
self.coef_ = average_coef
self.offset_ = 1 - np.atleast_1d(average_intercept)
else:
self.coef_ = coef
self.offset_ = 1 - np.atleast_1d(intercept)
else:
self.offset_ = 1 - np.atleast_1d(intercept)
def _partial_fit(
self,
X,
alpha,
C,
loss,
learning_rate,
max_iter,
sample_weight,
coef_init,
offset_init,
):
first_call = getattr(self, "coef_", None) is None
X = self._validate_data(
X,
None,
accept_sparse="csr",
dtype=np.float64,
order="C",
accept_large_sparse=False,
reset=first_call,
)
n_features = X.shape[1]
# Allocate datastructures from input arguments
sample_weight = _check_sample_weight(sample_weight, X)
# We use intercept = 1 - offset where intercept is the intercept of
# the SGD implementation and offset is the offset of the One-Class SVM
# optimization problem.
if getattr(self, "coef_", None) is None or coef_init is not None:
self._allocate_parameter_mem(1, n_features, coef_init, offset_init, 1)
elif n_features != self.coef_.shape[-1]:
raise ValueError(
"Number of features %d does not match previous data %d."
% (n_features, self.coef_.shape[-1])
)
if self.average and getattr(self, "_average_coef", None) is None:
self._average_coef = np.zeros(n_features, dtype=np.float64, order="C")
self._average_intercept = np.zeros(1, dtype=np.float64, order="C")
self.loss_function_ = self._get_loss_function(loss)
if not hasattr(self, "t_"):
self.t_ = 1.0
# delegate to concrete training procedure
self._fit_one_class(
X,
alpha=alpha,
C=C,
learning_rate=learning_rate,
sample_weight=sample_weight,
max_iter=max_iter,
)
return self
def partial_fit(self, X, y=None, sample_weight=None):
"""Fit linear One-Class SVM with Stochastic Gradient Descent.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Subset of the training data.
y : Ignored
Not used, present for API consistency by convention.
sample_weight : array-like, shape (n_samples,), optional
Weights applied to individual samples.
If not provided, uniform weights are assumed.
Returns
-------
self : object
Returns a fitted instance of self.
"""
if not hasattr(self, "coef_"):
self._validate_params()
self._more_validate_params(for_partial_fit=True)
alpha = self.nu / 2
return self._partial_fit(
X,
alpha,
C=1.0,
loss=self.loss,
learning_rate=self.learning_rate,
max_iter=1,
sample_weight=sample_weight,
coef_init=None,
offset_init=None,
)
def _fit(
self,
X,
alpha,
C,
loss,
learning_rate,
coef_init=None,
offset_init=None,
sample_weight=None,
):
if self.warm_start and hasattr(self, "coef_"):
if coef_init is None:
coef_init = self.coef_
if offset_init is None:
offset_init = self.offset_
else:
self.coef_ = None
self.offset_ = None
# Clear iteration count for multiple call to fit.
self.t_ = 1.0
self._partial_fit(
X,
alpha,
C,
loss,
learning_rate,
self.max_iter,
sample_weight,
coef_init,
offset_init,
)
if (
self.tol is not None
and self.tol > -np.inf
and self.n_iter_ == self.max_iter
):
warnings.warn(
"Maximum number of iteration reached before "
"convergence. Consider increasing max_iter to "
"improve the fit.",
ConvergenceWarning,
)
return self
def fit(self, X, y=None, coef_init=None, offset_init=None, sample_weight=None):
"""Fit linear One-Class SVM with Stochastic Gradient Descent.
This solves an equivalent optimization problem of the
One-Class SVM primal optimization problem and returns a weight vector
w and an offset rho such that the decision function is given by
<w, x> - rho.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Training data.
y : Ignored
Not used, present for API consistency by convention.
coef_init : array, shape (n_classes, n_features)
The initial coefficients to warm-start the optimization.
offset_init : array, shape (n_classes,)
The initial offset to warm-start the optimization.
sample_weight : array-like, shape (n_samples,), optional
Weights applied to individual samples.
If not provided, uniform weights are assumed. These weights will
be multiplied with class_weight (passed through the
constructor) if class_weight is specified.
Returns
-------
self : object
Returns a fitted instance of self.
"""
self._validate_params()
self._more_validate_params()
alpha = self.nu / 2
self._fit(
X,
alpha=alpha,
C=1.0,
loss=self.loss,
learning_rate=self.learning_rate,
coef_init=coef_init,
offset_init=offset_init,
sample_weight=sample_weight,
)
return self
def decision_function(self, X):
"""Signed distance to the separating hyperplane.
Signed distance is positive for an inlier and negative for an
outlier.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Testing data.
Returns
-------
dec : array-like, shape (n_samples,)
Decision function values of the samples.
"""
check_is_fitted(self, "coef_")
X = self._validate_data(X, accept_sparse="csr", reset=False)
decisions = safe_sparse_dot(X, self.coef_.T, dense_output=True) - self.offset_
return decisions.ravel()
def score_samples(self, X):
"""Raw scoring function of the samples.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Testing data.
Returns
-------
score_samples : array-like, shape (n_samples,)
Unshiffted scoring function values of the samples.
"""
score_samples = self.decision_function(X) + self.offset_
return score_samples
def predict(self, X):
"""Return labels (1 inlier, -1 outlier) of the samples.
Parameters
----------
X : {array-like, sparse matrix}, shape (n_samples, n_features)
Testing data.
Returns
-------
y : array, shape (n_samples,)
Labels of the samples.
"""
y = (self.decision_function(X) >= 0).astype(np.int32)
y[y == 0] = -1 # for consistency with outlier detectors
return y
def _more_tags(self):
return {
"_xfail_checks": {
"check_sample_weights_invariance": (
"zero sample_weight is not equivalent to removing samples"
)
}
}
| bsd-3-clause |
makcedward/nlpaug | docs/conf.py | 1 | 5657 | #!/usr/bin/env python3
# -*- coding: utf-8 -*-
#
# nlpaug documentation build configuration file, created by
# sphinx-quickstart on Wed Aug 7 07:37:05 2019.
#
# This file is execfile()d with the current directory set to its
# containing dir.
#
# Note that not all possible configuration values are present in this
# autogenerated file.
#
# All configuration values have a default; values that are commented out
# serve to show the default.
# If extensions (or modules to document with autodoc) are in another directory,
# add these directories to sys.path here. If the directory is relative to the
# documentation root, use os.path.abspath to make it absolute, like shown here.
#
import sys, os
from unittest.mock import MagicMock
sys.path.append(os.path.abspath('..'))
# Mock module to bypass pip install
class Mock(MagicMock):
@classmethod
def __getattr__(cls, name):
return MagicMock()
MOCK_MODULES = [
'librosa', 'librosa.display', 'numpy', 'nltk', 'matplotlib', 'matplotlib.pyplot',
'setuptools', 'python-dotenv', 'nltk.corpus', 'torch', 'transformers', 'pandas']
sys.modules.update((mod_name, Mock()) for mod_name in MOCK_MODULES)
# -- General configuration ------------------------------------------------
# If your documentation needs a minimal Sphinx version, state it here.
#
# needs_sphinx = '1.0'
# Add any Sphinx extension module names here, as strings. They can be
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom
# ones.
extensions = ['sphinx.ext.doctest',
'sphinx.ext.todo',
'sphinx.ext.coverage',
'sphinx.ext.mathjax',
'sphinx.ext.viewcode',
'sphinx.ext.githubpages',
'sphinx.ext.autodoc']
# Add any paths that contain templates here, relative to this directory.
templates_path = ['_templates']
# The suffix(es) of source filenames.
# You can specify multiple suffix as a list of string:
#
# source_suffix = ['.rst', '.md']
source_suffix = '.rst'
# The master toctree document.
master_doc = 'index'
# General information about the project.
project = 'nlpaug'
copyright = '2019, Edward Ma'
author = 'Edward Ma'
# The version info for the project you're documenting, acts as replacement for
# |version| and |release|, also used in various other places throughout the
# built documents.
#
# The short X.Y version.
version = '1.1.11'
# The full version, including alpha/beta/rc tags.
release = '1.1.11'
# The language for content autogenerated by Sphinx. Refer to documentation
# for a list of supported languages.
#
# This is also used if you do content translation via gettext catalogs.
# Usually you set "language" from the command line for these cases.
language = None
# List of patterns, relative to source directory, that match files and
# directories to ignore when looking for source files.
# This patterns also effect to html_static_path and html_extra_path
exclude_patterns = []
# The name of the Pygments (syntax highlighting) style to use.
pygments_style = 'sphinx'
# If true, `todo` and `todoList` produce output, else they produce nothing.
todo_include_todos = True
# -- Options for HTML output ----------------------------------------------
# The theme to use for HTML and HTML Help pages. See the documentation for
# a list of builtin themes.
#
# html_theme = 'alabaster'
html_theme = 'sphinx_rtd_theme'
# Theme options are theme-specific and customize the look and feel of a theme
# further. For a list of options available for each theme, see the
# documentation.
#
# html_theme_options = {}
# Add any paths that contain custom static files (such as style sheets) here,
# relative to this directory. They are copied after the builtin static files,
# so a file named "default.css" will overwrite the builtin "default.css".
html_static_path = ['_static']
# Custom sidebar templates, must be a dictionary that maps document names
# to template names.
#
# This is required for the alabaster theme
# refs: http://alabaster.readthedocs.io/en/latest/installation.html#sidebars
html_sidebars = {
'**': [
'relations.html', # needs 'show_related': True theme option to display
'searchbox.html',
]
}
# -- Options for HTMLHelp output ------------------------------------------
# Output file base name for HTML help builder.
htmlhelp_basename = 'nlpaugdoc'
# -- Options for LaTeX output ---------------------------------------------
latex_elements = {
# The paper size ('letterpaper' or 'a4paper').
#
# 'papersize': 'letterpaper',
# The font size ('10pt', '11pt' or '12pt').
#
# 'pointsize': '10pt',
# Additional stuff for the LaTeX preamble.
#
# 'preamble': '',
# Latex figure (float) alignment
#
# 'figure_align': 'htbp',
}
# Grouping the document tree into LaTeX files. List of tuples
# (source start file, target name, title,
# author, documentclass [howto, manual, or own class]).
latex_documents = [
(master_doc, 'nlpaug.tex', 'nlpaug Documentation',
'Edward Ma', 'manual'),
]
# -- Options for manual page output ---------------------------------------
# One entry per manual page. List of tuples
# (source start file, name, description, authors, manual section).
man_pages = [
(master_doc, 'nlpaug', 'nlpaug Documentation',
[author], 1)
]
# -- Options for Texinfo output -------------------------------------------
# Grouping the document tree into Texinfo files. List of tuples
# (source start file, target name, title, author,
# dir menu entry, description, category)
texinfo_documents = [
(master_doc, 'nlpaug', 'nlpaug Documentation',
author, 'nlpaug', 'One line description of project.',
'Miscellaneous'),
]
| mit |
zhmxu/nyu_ml_lectures | fetch_data.py | 20 | 2545 | import os
try:
from urllib.request import urlopen
except ImportError:
from urllib import urlopen
import zipfile
SENTIMENT140_URL = ("http://cs.stanford.edu/people/alecmgo/"
"trainingandtestdata.zip")
SENTIMENT140_ARCHIVE_NAME = "trainingandtestdata.zip"
def get_datasets_folder():
here = os.path.dirname(__file__)
notebooks = os.path.join(here, 'notebooks')
datasets_folder = os.path.abspath(os.path.join(notebooks, 'datasets'))
datasets_archive = os.path.abspath(os.path.join(notebooks, 'datasets.zip'))
if not os.path.exists(datasets_folder):
if os.path.exists(datasets_archive):
print("Extracting " + datasets_archive)
zf = zipfile.ZipFile(datasets_archive)
zf.extractall('.')
assert os.path.exists(datasets_folder)
else:
print("Creating datasets folder: " + datasets_folder)
os.makedirs(datasets_folder)
else:
print("Using existing dataset folder:" + datasets_folder)
return datasets_folder
def check_sentiment140(datasets_folder):
print("Checking availability of the sentiment 140 dataset")
archive_path = os.path.join(datasets_folder, SENTIMENT140_ARCHIVE_NAME)
sentiment140_path = os.path.join(datasets_folder, 'sentiment140')
train_path = os.path.join(sentiment140_path,
'training.1600000.processed.noemoticon.csv')
test_path = os.path.join(sentiment140_path,
'testdata.manual.2009.06.14.csv')
if not os.path.exists(sentiment140_path):
if not os.path.exists(archive_path):
print("Downloading dataset from %s (77MB)" % SENTIMENT140_URL)
opener = urlopen(SENTIMENT140_URL)
open(archive_path, 'wb').write(opener.read())
else:
print("Found archive: " + archive_path)
print("Extracting %s to %s" % (archive_path, sentiment140_path))
zf = zipfile.ZipFile(archive_path)
zf.extractall(sentiment140_path)
print("Checking that the sentiment 140 CSV files exist...")
assert os.path.exists(train_path)
assert os.path.exists(test_path)
print("=> Success!")
if __name__ == "__main__":
datasets_folder = get_datasets_folder()
check_sentiment140(datasets_folder)
print("Loading Labeled Faces Data (~200MB)")
from sklearn.datasets import fetch_lfw_people
fetch_lfw_people(min_faces_per_person=70, resize=0.4,
data_home=datasets_folder)
print("=> Success!")
| cc0-1.0 |
groutr/numpy | numpy/lib/function_base.py | 5 | 143332 | from __future__ import division, absolute_import, print_function
import warnings
import sys
import collections
import operator
import numpy as np
import numpy.core.numeric as _nx
from numpy.core import linspace, atleast_1d, atleast_2d
from numpy.core.numeric import (
ones, zeros, arange, concatenate, array, asarray, asanyarray, empty,
empty_like, ndarray, around, floor, ceil, take, dot, where, intp,
integer, isscalar
)
from numpy.core.umath import (
pi, multiply, add, arctan2, frompyfunc, cos, less_equal, sqrt, sin,
mod, exp, log10
)
from numpy.core.fromnumeric import (
ravel, nonzero, sort, partition, mean, any, sum
)
from numpy.core.numerictypes import typecodes, number
from numpy.lib.twodim_base import diag
from .utils import deprecate
from numpy.core.multiarray import _insert, add_docstring
from numpy.core.multiarray import digitize, bincount, interp as compiled_interp
from numpy.core.umath import _add_newdoc_ufunc as add_newdoc_ufunc
from numpy.compat import long
from numpy.compat.py3k import basestring
# Force range to be a generator, for np.delete's usage.
if sys.version_info[0] < 3:
range = xrange
__all__ = [
'select', 'piecewise', 'trim_zeros', 'copy', 'iterable', 'percentile',
'diff', 'gradient', 'angle', 'unwrap', 'sort_complex', 'disp',
'extract', 'place', 'vectorize', 'asarray_chkfinite', 'average',
'histogram', 'histogramdd', 'bincount', 'digitize', 'cov', 'corrcoef',
'msort', 'median', 'sinc', 'hamming', 'hanning', 'bartlett',
'blackman', 'kaiser', 'trapz', 'i0', 'add_newdoc', 'add_docstring',
'meshgrid', 'delete', 'insert', 'append', 'interp', 'add_newdoc_ufunc'
]
def iterable(y):
"""
Check whether or not an object can be iterated over.
Parameters
----------
y : object
Input object.
Returns
-------
b : {0, 1}
Return 1 if the object has an iterator method or is a sequence,
and 0 otherwise.
Examples
--------
>>> np.iterable([1, 2, 3])
1
>>> np.iterable(2)
0
"""
try:
iter(y)
except:
return 0
return 1
def _hist_optim_numbins_estimator(a, estimator):
"""
A helper function to be called from histogram to deal with estimating optimal number of bins
estimator: str
If estimator is one of ['auto', 'fd', 'scott', 'rice', 'sturges'] this function
will choose the appropriate estimator and return it's estimate for the optimal
number of bins.
"""
assert isinstance(estimator, basestring)
# private function should not be called otherwise
if a.size == 0:
return 1
def sturges(x):
"""
Sturges Estimator
A very simplistic estimator based on the assumption of normality of the data
Poor performance for non-normal data, especially obvious for large X.
Depends only on size of the data.
"""
return np.ceil(np.log2(x.size)) + 1
def rice(x):
"""
Rice Estimator
Another simple estimator, with no normality assumption.
It has better performance for large data, but tends to overestimate number of bins.
The number of bins is proportional to the cube root of data size (asymptotically optimal)
Depends only on size of the data
"""
return np.ceil(2 * x.size ** (1.0 / 3))
def scott(x):
"""
Scott Estimator
The binwidth is proportional to the standard deviation of the data and
inversely proportional to the cube root of data size (asymptotically optimal)
"""
h = 3.5 * x.std() * x.size ** (-1.0 / 3)
if h > 0:
return np.ceil(x.ptp() / h)
return 1
def fd(x):
"""
Freedman Diaconis rule using Inter Quartile Range (IQR) for binwidth
Considered a variation of the Scott rule with more robustness as the IQR
is less affected by outliers than the standard deviation. However the IQR depends on
fewer points than the sd so it is less accurate, especially for long tailed distributions.
If the IQR is 0, we return 1 for the number of bins.
Binwidth is inversely proportional to the cube root of data size (asymptotically optimal)
"""
iqr = np.subtract(*np.percentile(x, [75, 25]))
if iqr > 0:
h = (2 * iqr * x.size ** (-1.0 / 3))
return np.ceil(x.ptp() / h)
# If iqr is 0, default number of bins is 1
return 1
def auto(x):
"""
The FD estimator is usually the most robust method, but it tends to be too small
for small X. The Sturges estimator is quite good for small (<1000) datasets and is
the default in R.
This method gives good off the shelf behaviour.
"""
return max(fd(x), sturges(x))
optimal_numbins_methods = {'sturges': sturges, 'rice': rice, 'scott': scott,
'fd': fd, 'auto': auto}
try:
estimator_func = optimal_numbins_methods[estimator.lower()]
except KeyError:
raise ValueError("{0} not a valid method for `bins`".format(estimator))
else:
# these methods return floats, np.histogram requires an int
return int(estimator_func(a))
def histogram(a, bins=10, range=None, normed=False, weights=None,
density=None):
"""
Compute the histogram of a set of data.
Parameters
----------
a : array_like
Input data. The histogram is computed over the flattened array.
bins : int or sequence of scalars or str, optional
If `bins` is an int, it defines the number of equal-width
bins in the given range (10, by default). If `bins` is a sequence,
it defines the bin edges, including the rightmost edge, allowing
for non-uniform bin widths.
.. versionadded:: 1.11.0
If `bins` is a string from the list below, `histogram` will use the method
chosen to calculate the optimal number of bins (see Notes for more detail
on the estimators). For visualisation, we suggest using the 'auto' option.
'auto'
Maximum of the 'sturges' and 'fd' estimators. Provides good all round performance
'fd' (Freedman Diaconis Estimator)
Robust (resilient to outliers) estimator that takes into account data
variability and data size .
'scott'
Less robust estimator that that takes into account data
variability and data size.
'rice'
Estimator does not take variability into account, only data size.
Commonly overestimates number of bins required.
'sturges'
R's default method, only accounts for data size. Only optimal for
gaussian data and underestimates number of bins for large non-gaussian datasets.
range : (float, float), optional
The lower and upper range of the bins. If not provided, range
is simply ``(a.min(), a.max())``. Values outside the range are
ignored.
normed : bool, optional
This keyword is deprecated in Numpy 1.6 due to confusing/buggy
behavior. It will be removed in Numpy 2.0. Use the density keyword
instead.
If False, the result will contain the number of samples
in each bin. If True, the result is the value of the
probability *density* function at the bin, normalized such that
the *integral* over the range is 1. Note that this latter behavior is
known to be buggy with unequal bin widths; use `density` instead.
weights : array_like, optional
An array of weights, of the same shape as `a`. Each value in `a`
only contributes its associated weight towards the bin count
(instead of 1). If `normed` is True, the weights are normalized,
so that the integral of the density over the range remains 1
density : bool, optional
If False, the result will contain the number of samples
in each bin. If True, the result is the value of the
probability *density* function at the bin, normalized such that
the *integral* over the range is 1. Note that the sum of the
histogram values will not be equal to 1 unless bins of unity
width are chosen; it is not a probability *mass* function.
Overrides the `normed` keyword if given.
Returns
-------
hist : array
The values of the histogram. See `normed` and `weights` for a
description of the possible semantics.
bin_edges : array of dtype float
Return the bin edges ``(length(hist)+1)``.
See Also
--------
histogramdd, bincount, searchsorted, digitize
Notes
-----
All but the last (righthand-most) bin is half-open. In other words, if
`bins` is::
[1, 2, 3, 4]
then the first bin is ``[1, 2)`` (including 1, but excluding 2) and the
second ``[2, 3)``. The last bin, however, is ``[3, 4]``, which *includes*
4.
.. versionadded:: 1.11.0
The methods to estimate the optimal number of bins are well found in literature,
and are inspired by the choices R provides for histogram visualisation.
Note that having the number of bins proportional to :math:`n^{1/3}` is asymptotically optimal,
which is why it appears in most estimators.
These are simply plug-in methods that give good starting points for number of bins.
In the equations below, :math:`h` is the binwidth and :math:`n_h` is the number of bins
'Auto' (maximum of the 'Sturges' and 'FD' estimators)
A compromise to get a good value. For small datasets the sturges
value will usually be chosen, while larger datasets will usually default to FD.
Avoids the overly conservative behaviour of FD and Sturges for small and
large datasets respectively. Switchover point is usually x.size~1000.
'FD' (Freedman Diaconis Estimator)
.. math:: h = 2 \\frac{IQR}{n^{-1/3}}
The binwidth is proportional to the interquartile range (IQR)
and inversely proportional to cube root of a.size. Can be too
conservative for small datasets, but is quite good
for large datasets. The IQR is very robust to outliers.
'Scott'
.. math:: h = \\frac{3.5\\sigma}{n^{-1/3}}
The binwidth is proportional to the standard deviation (sd) of the data
and inversely proportional to cube root of a.size. Can be too
conservative for small datasets, but is quite good
for large datasets. The sd is not very robust to outliers. Values
are very similar to the Freedman Diaconis Estimator in the absence of outliers.
'Rice'
.. math:: n_h = \\left\\lceil 2n^{1/3} \\right\\rceil
The number of bins is only proportional to cube root of a.size.
It tends to overestimate the number of bins
and it does not take into account data variability.
'Sturges'
.. math:: n_h = \\left\\lceil \\log _{2}n+1 \\right\\rceil
The number of bins is the base2 log of a.size.
This estimator assumes normality of data and is too conservative for larger,
non-normal datasets. This is the default method in R's `hist` method.
Examples
--------
>>> np.histogram([1, 2, 1], bins=[0, 1, 2, 3])
(array([0, 2, 1]), array([0, 1, 2, 3]))
>>> np.histogram(np.arange(4), bins=np.arange(5), density=True)
(array([ 0.25, 0.25, 0.25, 0.25]), array([0, 1, 2, 3, 4]))
>>> np.histogram([[1, 2, 1], [1, 0, 1]], bins=[0,1,2,3])
(array([1, 4, 1]), array([0, 1, 2, 3]))
>>> a = np.arange(5)
>>> hist, bin_edges = np.histogram(a, density=True)
>>> hist
array([ 0.5, 0. , 0.5, 0. , 0. , 0.5, 0. , 0.5, 0. , 0.5])
>>> hist.sum()
2.4999999999999996
>>> np.sum(hist*np.diff(bin_edges))
1.0
.. versionadded:: 1.11.0
Automated Bin Selection Methods example, using 2 peak random data with 2000 points
>>> import matplotlib.pyplot as plt
>>> rng = np.random.RandomState(10) # deterministic random data
>>> a = np.hstack((rng.normal(size = 1000), rng.normal(loc = 5, scale = 2, size = 1000)))
>>> plt.hist(a, bins = 'auto') # plt.hist passes it's arguments to np.histogram
>>> plt.title("Histogram with 'auto' bins")
>>> plt.show()
"""
a = asarray(a)
if weights is not None:
weights = asarray(weights)
if np.any(weights.shape != a.shape):
raise ValueError(
'weights should have the same shape as a.')
weights = weights.ravel()
a = a.ravel()
if (range is not None):
mn, mx = range
if (mn > mx):
raise AttributeError(
'max must be larger than min in range parameter.')
if isinstance(bins, basestring):
bins = _hist_optim_numbins_estimator(a, bins)
# if `bins` is a string for an automatic method,
# this will replace it with the number of bins calculated
# Histogram is an integer or a float array depending on the weights.
if weights is None:
ntype = np.dtype(np.intp)
else:
ntype = weights.dtype
# We set a block size, as this allows us to iterate over chunks when
# computing histograms, to minimize memory usage.
BLOCK = 65536
if not iterable(bins):
if np.isscalar(bins) and bins < 1:
raise ValueError(
'`bins` should be a positive integer.')
if range is None:
if a.size == 0:
# handle empty arrays. Can't determine range, so use 0-1.
range = (0, 1)
else:
range = (a.min(), a.max())
mn, mx = [mi + 0.0 for mi in range]
if mn == mx:
mn -= 0.5
mx += 0.5
# At this point, if the weights are not integer, floating point, or
# complex, we have to use the slow algorithm.
if weights is not None and not (np.can_cast(weights.dtype, np.double) or
np.can_cast(weights.dtype, np.complex)):
bins = linspace(mn, mx, bins + 1, endpoint=True)
if not iterable(bins):
# We now convert values of a to bin indices, under the assumption of
# equal bin widths (which is valid here).
# Initialize empty histogram
n = np.zeros(bins, ntype)
# Pre-compute histogram scaling factor
norm = bins / (mx - mn)
# We iterate over blocks here for two reasons: the first is that for
# large arrays, it is actually faster (for example for a 10^8 array it
# is 2x as fast) and it results in a memory footprint 3x lower in the
# limit of large arrays.
for i in arange(0, len(a), BLOCK):
tmp_a = a[i:i+BLOCK]
if weights is None:
tmp_w = None
else:
tmp_w = weights[i:i + BLOCK]
# Only include values in the right range
keep = (tmp_a >= mn)
keep &= (tmp_a <= mx)
if not np.logical_and.reduce(keep):
tmp_a = tmp_a[keep]
if tmp_w is not None:
tmp_w = tmp_w[keep]
tmp_a = tmp_a.astype(float)
tmp_a -= mn
tmp_a *= norm
# Compute the bin indices, and for values that lie exactly on mx we
# need to subtract one
indices = tmp_a.astype(np.intp)
indices[indices == bins] -= 1
# We now compute the histogram using bincount
if ntype.kind == 'c':
n.real += np.bincount(indices, weights=tmp_w.real, minlength=bins)
n.imag += np.bincount(indices, weights=tmp_w.imag, minlength=bins)
else:
n += np.bincount(indices, weights=tmp_w, minlength=bins).astype(ntype)
# We now compute the bin edges since these are returned
bins = linspace(mn, mx, bins + 1, endpoint=True)
else:
bins = asarray(bins)
if (np.diff(bins) < 0).any():
raise AttributeError(
'bins must increase monotonically.')
# Initialize empty histogram
n = np.zeros(bins.shape, ntype)
if weights is None:
for i in arange(0, len(a), BLOCK):
sa = sort(a[i:i+BLOCK])
n += np.r_[sa.searchsorted(bins[:-1], 'left'),
sa.searchsorted(bins[-1], 'right')]
else:
zero = array(0, dtype=ntype)
for i in arange(0, len(a), BLOCK):
tmp_a = a[i:i+BLOCK]
tmp_w = weights[i:i+BLOCK]
sorting_index = np.argsort(tmp_a)
sa = tmp_a[sorting_index]
sw = tmp_w[sorting_index]
cw = np.concatenate(([zero, ], sw.cumsum()))
bin_index = np.r_[sa.searchsorted(bins[:-1], 'left'),
sa.searchsorted(bins[-1], 'right')]
n += cw[bin_index]
n = np.diff(n)
if density is not None:
if density:
db = array(np.diff(bins), float)
return n/db/n.sum(), bins
else:
return n, bins
else:
# deprecated, buggy behavior. Remove for Numpy 2.0
if normed:
db = array(np.diff(bins), float)
return n/(n*db).sum(), bins
else:
return n, bins
def histogramdd(sample, bins=10, range=None, normed=False, weights=None):
"""
Compute the multidimensional histogram of some data.
Parameters
----------
sample : array_like
The data to be histogrammed. It must be an (N,D) array or data
that can be converted to such. The rows of the resulting array
are the coordinates of points in a D dimensional polytope.
bins : sequence or int, optional
The bin specification:
* A sequence of arrays describing the bin edges along each dimension.
* The number of bins for each dimension (nx, ny, ... =bins)
* The number of bins for all dimensions (nx=ny=...=bins).
range : sequence, optional
A sequence of lower and upper bin edges to be used if the edges are
not given explicitly in `bins`. Defaults to the minimum and maximum
values along each dimension.
normed : bool, optional
If False, returns the number of samples in each bin. If True,
returns the bin density ``bin_count / sample_count / bin_volume``.
weights : (N,) array_like, optional
An array of values `w_i` weighing each sample `(x_i, y_i, z_i, ...)`.
Weights are normalized to 1 if normed is True. If normed is False,
the values of the returned histogram are equal to the sum of the
weights belonging to the samples falling into each bin.
Returns
-------
H : ndarray
The multidimensional histogram of sample x. See normed and weights
for the different possible semantics.
edges : list
A list of D arrays describing the bin edges for each dimension.
See Also
--------
histogram: 1-D histogram
histogram2d: 2-D histogram
Examples
--------
>>> r = np.random.randn(100,3)
>>> H, edges = np.histogramdd(r, bins = (5, 8, 4))
>>> H.shape, edges[0].size, edges[1].size, edges[2].size
((5, 8, 4), 6, 9, 5)
"""
try:
# Sample is an ND-array.
N, D = sample.shape
except (AttributeError, ValueError):
# Sample is a sequence of 1D arrays.
sample = atleast_2d(sample).T
N, D = sample.shape
nbin = empty(D, int)
edges = D*[None]
dedges = D*[None]
if weights is not None:
weights = asarray(weights)
try:
M = len(bins)
if M != D:
raise AttributeError(
'The dimension of bins must be equal to the dimension of the '
' sample x.')
except TypeError:
# bins is an integer
bins = D*[bins]
# Select range for each dimension
# Used only if number of bins is given.
if range is None:
# Handle empty input. Range can't be determined in that case, use 0-1.
if N == 0:
smin = zeros(D)
smax = ones(D)
else:
smin = atleast_1d(array(sample.min(0), float))
smax = atleast_1d(array(sample.max(0), float))
else:
smin = zeros(D)
smax = zeros(D)
for i in arange(D):
smin[i], smax[i] = range[i]
# Make sure the bins have a finite width.
for i in arange(len(smin)):
if smin[i] == smax[i]:
smin[i] = smin[i] - .5
smax[i] = smax[i] + .5
# avoid rounding issues for comparisons when dealing with inexact types
if np.issubdtype(sample.dtype, np.inexact):
edge_dt = sample.dtype
else:
edge_dt = float
# Create edge arrays
for i in arange(D):
if isscalar(bins[i]):
if bins[i] < 1:
raise ValueError(
"Element at index %s in `bins` should be a positive "
"integer." % i)
nbin[i] = bins[i] + 2 # +2 for outlier bins
edges[i] = linspace(smin[i], smax[i], nbin[i]-1, dtype=edge_dt)
else:
edges[i] = asarray(bins[i], edge_dt)
nbin[i] = len(edges[i]) + 1 # +1 for outlier bins
dedges[i] = diff(edges[i])
if np.any(np.asarray(dedges[i]) <= 0):
raise ValueError(
"Found bin edge of size <= 0. Did you specify `bins` with"
"non-monotonic sequence?")
nbin = asarray(nbin)
# Handle empty input.
if N == 0:
return np.zeros(nbin-2), edges
# Compute the bin number each sample falls into.
Ncount = {}
for i in arange(D):
Ncount[i] = digitize(sample[:, i], edges[i])
# Using digitize, values that fall on an edge are put in the right bin.
# For the rightmost bin, we want values equal to the right edge to be
# counted in the last bin, and not as an outlier.
for i in arange(D):
# Rounding precision
mindiff = dedges[i].min()
if not np.isinf(mindiff):
decimal = int(-log10(mindiff)) + 6
# Find which points are on the rightmost edge.
not_smaller_than_edge = (sample[:, i] >= edges[i][-1])
on_edge = (around(sample[:, i], decimal) ==
around(edges[i][-1], decimal))
# Shift these points one bin to the left.
Ncount[i][where(on_edge & not_smaller_than_edge)[0]] -= 1
# Flattened histogram matrix (1D)
# Reshape is used so that overlarge arrays
# will raise an error.
hist = zeros(nbin, float).reshape(-1)
# Compute the sample indices in the flattened histogram matrix.
ni = nbin.argsort()
xy = zeros(N, int)
for i in arange(0, D-1):
xy += Ncount[ni[i]] * nbin[ni[i+1:]].prod()
xy += Ncount[ni[-1]]
# Compute the number of repetitions in xy and assign it to the
# flattened histmat.
if len(xy) == 0:
return zeros(nbin-2, int), edges
flatcount = bincount(xy, weights)
a = arange(len(flatcount))
hist[a] = flatcount
# Shape into a proper matrix
hist = hist.reshape(sort(nbin))
for i in arange(nbin.size):
j = ni.argsort()[i]
hist = hist.swapaxes(i, j)
ni[i], ni[j] = ni[j], ni[i]
# Remove outliers (indices 0 and -1 for each dimension).
core = D*[slice(1, -1)]
hist = hist[core]
# Normalize if normed is True
if normed:
s = hist.sum()
for i in arange(D):
shape = ones(D, int)
shape[i] = nbin[i] - 2
hist = hist / dedges[i].reshape(shape)
hist /= s
if (hist.shape != nbin - 2).any():
raise RuntimeError(
"Internal Shape Error")
return hist, edges
def average(a, axis=None, weights=None, returned=False):
"""
Compute the weighted average along the specified axis.
Parameters
----------
a : array_like
Array containing data to be averaged. If `a` is not an array, a
conversion is attempted.
axis : int, optional
Axis along which to average `a`. If `None`, averaging is done over
the flattened array.
weights : array_like, optional
An array of weights associated with the values in `a`. Each value in
`a` contributes to the average according to its associated weight.
The weights array can either be 1-D (in which case its length must be
the size of `a` along the given axis) or of the same shape as `a`.
If `weights=None`, then all data in `a` are assumed to have a
weight equal to one.
returned : bool, optional
Default is `False`. If `True`, the tuple (`average`, `sum_of_weights`)
is returned, otherwise only the average is returned.
If `weights=None`, `sum_of_weights` is equivalent to the number of
elements over which the average is taken.
Returns
-------
average, [sum_of_weights] : array_type or double
Return the average along the specified axis. When returned is `True`,
return a tuple with the average as the first element and the sum
of the weights as the second element. The return type is `Float`
if `a` is of integer type, otherwise it is of the same type as `a`.
`sum_of_weights` is of the same type as `average`.
Raises
------
ZeroDivisionError
When all weights along axis are zero. See `numpy.ma.average` for a
version robust to this type of error.
TypeError
When the length of 1D `weights` is not the same as the shape of `a`
along axis.
See Also
--------
mean
ma.average : average for masked arrays -- useful if your data contains
"missing" values
Examples
--------
>>> data = range(1,5)
>>> data
[1, 2, 3, 4]
>>> np.average(data)
2.5
>>> np.average(range(1,11), weights=range(10,0,-1))
4.0
>>> data = np.arange(6).reshape((3,2))
>>> data
array([[0, 1],
[2, 3],
[4, 5]])
>>> np.average(data, axis=1, weights=[1./4, 3./4])
array([ 0.75, 2.75, 4.75])
>>> np.average(data, weights=[1./4, 3./4])
Traceback (most recent call last):
...
TypeError: Axis must be specified when shapes of a and weights differ.
"""
if not isinstance(a, np.matrix):
a = np.asarray(a)
if weights is None:
avg = a.mean(axis)
scl = avg.dtype.type(a.size/avg.size)
else:
a = a + 0.0
wgt = np.asarray(weights)
# Sanity checks
if a.shape != wgt.shape:
if axis is None:
raise TypeError(
"Axis must be specified when shapes of a and weights "
"differ.")
if wgt.ndim != 1:
raise TypeError(
"1D weights expected when shapes of a and weights differ.")
if wgt.shape[0] != a.shape[axis]:
raise ValueError(
"Length of weights not compatible with specified axis.")
# setup wgt to broadcast along axis
wgt = np.array(wgt, copy=0, ndmin=a.ndim).swapaxes(-1, axis)
scl = wgt.sum(axis=axis, dtype=np.result_type(a.dtype, wgt.dtype))
if (scl == 0.0).any():
raise ZeroDivisionError(
"Weights sum to zero, can't be normalized")
avg = np.multiply(a, wgt).sum(axis)/scl
if returned:
scl = np.multiply(avg, 0) + scl
return avg, scl
else:
return avg
def asarray_chkfinite(a, dtype=None, order=None):
"""Convert the input to an array, checking for NaNs or Infs.
Parameters
----------
a : array_like
Input data, in any form that can be converted to an array. This
includes lists, lists of tuples, tuples, tuples of tuples, tuples
of lists and ndarrays. Success requires no NaNs or Infs.
dtype : data-type, optional
By default, the data-type is inferred from the input data.
order : {'C', 'F'}, optional
Whether to use row-major (C-style) or
column-major (Fortran-style) memory representation.
Defaults to 'C'.
Returns
-------
out : ndarray
Array interpretation of `a`. No copy is performed if the input
is already an ndarray. If `a` is a subclass of ndarray, a base
class ndarray is returned.
Raises
------
ValueError
Raises ValueError if `a` contains NaN (Not a Number) or Inf (Infinity).
See Also
--------
asarray : Create and array.
asanyarray : Similar function which passes through subclasses.
ascontiguousarray : Convert input to a contiguous array.
asfarray : Convert input to a floating point ndarray.
asfortranarray : Convert input to an ndarray with column-major
memory order.
fromiter : Create an array from an iterator.
fromfunction : Construct an array by executing a function on grid
positions.
Examples
--------
Convert a list into an array. If all elements are finite
``asarray_chkfinite`` is identical to ``asarray``.
>>> a = [1, 2]
>>> np.asarray_chkfinite(a, dtype=float)
array([1., 2.])
Raises ValueError if array_like contains Nans or Infs.
>>> a = [1, 2, np.inf]
>>> try:
... np.asarray_chkfinite(a)
... except ValueError:
... print 'ValueError'
...
ValueError
"""
a = asarray(a, dtype=dtype, order=order)
if a.dtype.char in typecodes['AllFloat'] and not np.isfinite(a).all():
raise ValueError(
"array must not contain infs or NaNs")
return a
def piecewise(x, condlist, funclist, *args, **kw):
"""
Evaluate a piecewise-defined function.
Given a set of conditions and corresponding functions, evaluate each
function on the input data wherever its condition is true.
Parameters
----------
x : ndarray
The input domain.
condlist : list of bool arrays
Each boolean array corresponds to a function in `funclist`. Wherever
`condlist[i]` is True, `funclist[i](x)` is used as the output value.
Each boolean array in `condlist` selects a piece of `x`,
and should therefore be of the same shape as `x`.
The length of `condlist` must correspond to that of `funclist`.
If one extra function is given, i.e. if
``len(funclist) - len(condlist) == 1``, then that extra function
is the default value, used wherever all conditions are false.
funclist : list of callables, f(x,*args,**kw), or scalars
Each function is evaluated over `x` wherever its corresponding
condition is True. It should take an array as input and give an array
or a scalar value as output. If, instead of a callable,
a scalar is provided then a constant function (``lambda x: scalar``) is
assumed.
args : tuple, optional
Any further arguments given to `piecewise` are passed to the functions
upon execution, i.e., if called ``piecewise(..., ..., 1, 'a')``, then
each function is called as ``f(x, 1, 'a')``.
kw : dict, optional
Keyword arguments used in calling `piecewise` are passed to the
functions upon execution, i.e., if called
``piecewise(..., ..., lambda=1)``, then each function is called as
``f(x, lambda=1)``.
Returns
-------
out : ndarray
The output is the same shape and type as x and is found by
calling the functions in `funclist` on the appropriate portions of `x`,
as defined by the boolean arrays in `condlist`. Portions not covered
by any condition have a default value of 0.
See Also
--------
choose, select, where
Notes
-----
This is similar to choose or select, except that functions are
evaluated on elements of `x` that satisfy the corresponding condition from
`condlist`.
The result is::
|--
|funclist[0](x[condlist[0]])
out = |funclist[1](x[condlist[1]])
|...
|funclist[n2](x[condlist[n2]])
|--
Examples
--------
Define the sigma function, which is -1 for ``x < 0`` and +1 for ``x >= 0``.
>>> x = np.linspace(-2.5, 2.5, 6)
>>> np.piecewise(x, [x < 0, x >= 0], [-1, 1])
array([-1., -1., -1., 1., 1., 1.])
Define the absolute value, which is ``-x`` for ``x <0`` and ``x`` for
``x >= 0``.
>>> np.piecewise(x, [x < 0, x >= 0], [lambda x: -x, lambda x: x])
array([ 2.5, 1.5, 0.5, 0.5, 1.5, 2.5])
"""
x = asanyarray(x)
n2 = len(funclist)
if (isscalar(condlist) or not (isinstance(condlist[0], list) or
isinstance(condlist[0], ndarray))):
condlist = [condlist]
condlist = array(condlist, dtype=bool)
n = len(condlist)
# This is a hack to work around problems with NumPy's
# handling of 0-d arrays and boolean indexing with
# numpy.bool_ scalars
zerod = False
if x.ndim == 0:
x = x[None]
zerod = True
if condlist.shape[-1] != 1:
condlist = condlist.T
if n == n2 - 1: # compute the "otherwise" condition.
totlist = np.logical_or.reduce(condlist, axis=0)
condlist = np.vstack([condlist, ~totlist])
n += 1
if (n != n2):
raise ValueError(
"function list and condition list must be the same")
y = zeros(x.shape, x.dtype)
for k in range(n):
item = funclist[k]
if not isinstance(item, collections.Callable):
y[condlist[k]] = item
else:
vals = x[condlist[k]]
if vals.size > 0:
y[condlist[k]] = item(vals, *args, **kw)
if zerod:
y = y.squeeze()
return y
def select(condlist, choicelist, default=0):
"""
Return an array drawn from elements in choicelist, depending on conditions.
Parameters
----------
condlist : list of bool ndarrays
The list of conditions which determine from which array in `choicelist`
the output elements are taken. When multiple conditions are satisfied,
the first one encountered in `condlist` is used.
choicelist : list of ndarrays
The list of arrays from which the output elements are taken. It has
to be of the same length as `condlist`.
default : scalar, optional
The element inserted in `output` when all conditions evaluate to False.
Returns
-------
output : ndarray
The output at position m is the m-th element of the array in
`choicelist` where the m-th element of the corresponding array in
`condlist` is True.
See Also
--------
where : Return elements from one of two arrays depending on condition.
take, choose, compress, diag, diagonal
Examples
--------
>>> x = np.arange(10)
>>> condlist = [x<3, x>5]
>>> choicelist = [x, x**2]
>>> np.select(condlist, choicelist)
array([ 0, 1, 2, 0, 0, 0, 36, 49, 64, 81])
"""
# Check the size of condlist and choicelist are the same, or abort.
if len(condlist) != len(choicelist):
raise ValueError(
'list of cases must be same length as list of conditions')
# Now that the dtype is known, handle the deprecated select([], []) case
if len(condlist) == 0:
# 2014-02-24, 1.9
warnings.warn("select with an empty condition list is not possible"
"and will be deprecated",
DeprecationWarning)
return np.asarray(default)[()]
choicelist = [np.asarray(choice) for choice in choicelist]
choicelist.append(np.asarray(default))
# need to get the result type before broadcasting for correct scalar
# behaviour
dtype = np.result_type(*choicelist)
# Convert conditions to arrays and broadcast conditions and choices
# as the shape is needed for the result. Doing it seperatly optimizes
# for example when all choices are scalars.
condlist = np.broadcast_arrays(*condlist)
choicelist = np.broadcast_arrays(*choicelist)
# If cond array is not an ndarray in boolean format or scalar bool, abort.
deprecated_ints = False
for i in range(len(condlist)):
cond = condlist[i]
if cond.dtype.type is not np.bool_:
if np.issubdtype(cond.dtype, np.integer):
# A previous implementation accepted int ndarrays accidentally.
# Supported here deliberately, but deprecated.
condlist[i] = condlist[i].astype(bool)
deprecated_ints = True
else:
raise ValueError(
'invalid entry in choicelist: should be boolean ndarray')
if deprecated_ints:
# 2014-02-24, 1.9
msg = "select condlists containing integer ndarrays is deprecated " \
"and will be removed in the future. Use `.astype(bool)` to " \
"convert to bools."
warnings.warn(msg, DeprecationWarning)
if choicelist[0].ndim == 0:
# This may be common, so avoid the call.
result_shape = condlist[0].shape
else:
result_shape = np.broadcast_arrays(condlist[0], choicelist[0])[0].shape
result = np.full(result_shape, choicelist[-1], dtype)
# Use np.copyto to burn each choicelist array onto result, using the
# corresponding condlist as a boolean mask. This is done in reverse
# order since the first choice should take precedence.
choicelist = choicelist[-2::-1]
condlist = condlist[::-1]
for choice, cond in zip(choicelist, condlist):
np.copyto(result, choice, where=cond)
return result
def copy(a, order='K'):
"""
Return an array copy of the given object.
Parameters
----------
a : array_like
Input data.
order : {'C', 'F', 'A', 'K'}, optional
Controls the memory layout of the copy. 'C' means C-order,
'F' means F-order, 'A' means 'F' if `a` is Fortran contiguous,
'C' otherwise. 'K' means match the layout of `a` as closely
as possible. (Note that this function and :meth:ndarray.copy are very
similar, but have different default values for their order=
arguments.)
Returns
-------
arr : ndarray
Array interpretation of `a`.
Notes
-----
This is equivalent to
>>> np.array(a, copy=True) #doctest: +SKIP
Examples
--------
Create an array x, with a reference y and a copy z:
>>> x = np.array([1, 2, 3])
>>> y = x
>>> z = np.copy(x)
Note that, when we modify x, y changes, but not z:
>>> x[0] = 10
>>> x[0] == y[0]
True
>>> x[0] == z[0]
False
"""
return array(a, order=order, copy=True)
# Basic operations
def gradient(f, *varargs, **kwargs):
"""
Return the gradient of an N-dimensional array.
The gradient is computed using second order accurate central differences
in the interior and either first differences or second order accurate
one-sides (forward or backwards) differences at the boundaries. The
returned gradient hence has the same shape as the input array.
Parameters
----------
f : array_like
An N-dimensional array containing samples of a scalar function.
varargs : scalar or list of scalar, optional
N scalars specifying the sample distances for each dimension,
i.e. `dx`, `dy`, `dz`, ... Default distance: 1.
single scalar specifies sample distance for all dimensions.
if `axis` is given, the number of varargs must equal the number of axes.
edge_order : {1, 2}, optional
Gradient is calculated using N\ :sup:`th` order accurate differences
at the boundaries. Default: 1.
.. versionadded:: 1.9.1
axis : None or int or tuple of ints, optional
Gradient is calculated only along the given axis or axes
The default (axis = None) is to calculate the gradient for all the axes of the input array.
axis may be negative, in which case it counts from the last to the first axis.
.. versionadded:: 1.11.0
Returns
-------
gradient : list of ndarray
Each element of `list` has the same shape as `f` giving the derivative
of `f` with respect to each dimension.
Examples
--------
>>> x = np.array([1, 2, 4, 7, 11, 16], dtype=np.float)
>>> np.gradient(x)
array([ 1. , 1.5, 2.5, 3.5, 4.5, 5. ])
>>> np.gradient(x, 2)
array([ 0.5 , 0.75, 1.25, 1.75, 2.25, 2.5 ])
For two dimensional arrays, the return will be two arrays ordered by
axis. In this example the first array stands for the gradient in
rows and the second one in columns direction:
>>> np.gradient(np.array([[1, 2, 6], [3, 4, 5]], dtype=np.float))
[array([[ 2., 2., -1.],
[ 2., 2., -1.]]), array([[ 1. , 2.5, 4. ],
[ 1. , 1. , 1. ]])]
>>> x = np.array([0, 1, 2, 3, 4])
>>> dx = np.gradient(x)
>>> y = x**2
>>> np.gradient(y, dx, edge_order=2)
array([-0., 2., 4., 6., 8.])
The axis keyword can be used to specify a subset of axes of which the gradient is calculated
>>> np.gradient(np.array([[1, 2, 6], [3, 4, 5]], dtype=np.float), axis=0)
array([[ 2., 2., -1.],
[ 2., 2., -1.]])
"""
f = np.asanyarray(f)
N = len(f.shape) # number of dimensions
axes = kwargs.pop('axis', None)
if axes is None:
axes = tuple(range(N))
# check axes to have correct type and no duplicate entries
if isinstance(axes, int):
axes = (axes,)
if not isinstance(axes, tuple):
raise TypeError("A tuple of integers or a single integer is required")
# normalize axis values:
axes = tuple(x + N if x < 0 else x for x in axes)
if max(axes) >= N or min(axes) < 0:
raise ValueError("'axis' entry is out of bounds")
if len(set(axes)) != len(axes):
raise ValueError("duplicate value in 'axis'")
n = len(varargs)
if n == 0:
dx = [1.0]*N
elif n == 1:
dx = [varargs[0]]*N
elif n == len(axes):
dx = list(varargs)
else:
raise SyntaxError(
"invalid number of arguments")
edge_order = kwargs.pop('edge_order', 1)
if kwargs:
raise TypeError('"{}" are not valid keyword arguments.'.format(
'", "'.join(kwargs.keys())))
if edge_order > 2:
raise ValueError("'edge_order' greater than 2 not supported")
# use central differences on interior and one-sided differences on the
# endpoints. This preserves second order-accuracy over the full domain.
outvals = []
# create slice objects --- initially all are [:, :, ..., :]
slice1 = [slice(None)]*N
slice2 = [slice(None)]*N
slice3 = [slice(None)]*N
slice4 = [slice(None)]*N
otype = f.dtype.char
if otype not in ['f', 'd', 'F', 'D', 'm', 'M']:
otype = 'd'
# Difference of datetime64 elements results in timedelta64
if otype == 'M':
# Need to use the full dtype name because it contains unit information
otype = f.dtype.name.replace('datetime', 'timedelta')
elif otype == 'm':
# Needs to keep the specific units, can't be a general unit
otype = f.dtype
# Convert datetime64 data into ints. Make dummy variable `y`
# that is a view of ints if the data is datetime64, otherwise
# just set y equal to the the array `f`.
if f.dtype.char in ["M", "m"]:
y = f.view('int64')
else:
y = f
for i, axis in enumerate(axes):
if y.shape[axis] < 2:
raise ValueError(
"Shape of array too small to calculate a numerical gradient, "
"at least two elements are required.")
# Numerical differentiation: 1st order edges, 2nd order interior
if y.shape[axis] == 2 or edge_order == 1:
# Use first order differences for time data
out = np.empty_like(y, dtype=otype)
slice1[axis] = slice(1, -1)
slice2[axis] = slice(2, None)
slice3[axis] = slice(None, -2)
# 1D equivalent -- out[1:-1] = (y[2:] - y[:-2])/2.0
out[slice1] = (y[slice2] - y[slice3])/2.0
slice1[axis] = 0
slice2[axis] = 1
slice3[axis] = 0
# 1D equivalent -- out[0] = (y[1] - y[0])
out[slice1] = (y[slice2] - y[slice3])
slice1[axis] = -1
slice2[axis] = -1
slice3[axis] = -2
# 1D equivalent -- out[-1] = (y[-1] - y[-2])
out[slice1] = (y[slice2] - y[slice3])
# Numerical differentiation: 2st order edges, 2nd order interior
else:
# Use second order differences where possible
out = np.empty_like(y, dtype=otype)
slice1[axis] = slice(1, -1)
slice2[axis] = slice(2, None)
slice3[axis] = slice(None, -2)
# 1D equivalent -- out[1:-1] = (y[2:] - y[:-2])/2.0
out[slice1] = (y[slice2] - y[slice3])/2.0
slice1[axis] = 0
slice2[axis] = 0
slice3[axis] = 1
slice4[axis] = 2
# 1D equivalent -- out[0] = -(3*y[0] - 4*y[1] + y[2]) / 2.0
out[slice1] = -(3.0*y[slice2] - 4.0*y[slice3] + y[slice4])/2.0
slice1[axis] = -1
slice2[axis] = -1
slice3[axis] = -2
slice4[axis] = -3
# 1D equivalent -- out[-1] = (3*y[-1] - 4*y[-2] + y[-3])
out[slice1] = (3.0*y[slice2] - 4.0*y[slice3] + y[slice4])/2.0
# divide by step size
out /= dx[i]
outvals.append(out)
# reset the slice object in this dimension to ":"
slice1[axis] = slice(None)
slice2[axis] = slice(None)
slice3[axis] = slice(None)
slice4[axis] = slice(None)
if len(axes) == 1:
return outvals[0]
else:
return outvals
def diff(a, n=1, axis=-1):
"""
Calculate the n-th discrete difference along given axis.
The first difference is given by ``out[n] = a[n+1] - a[n]`` along
the given axis, higher differences are calculated by using `diff`
recursively.
Parameters
----------
a : array_like
Input array
n : int, optional
The number of times values are differenced.
axis : int, optional
The axis along which the difference is taken, default is the last axis.
Returns
-------
diff : ndarray
The n-th differences. The shape of the output is the same as `a`
except along `axis` where the dimension is smaller by `n`.
.
See Also
--------
gradient, ediff1d, cumsum
Examples
--------
>>> x = np.array([1, 2, 4, 7, 0])
>>> np.diff(x)
array([ 1, 2, 3, -7])
>>> np.diff(x, n=2)
array([ 1, 1, -10])
>>> x = np.array([[1, 3, 6, 10], [0, 5, 6, 8]])
>>> np.diff(x)
array([[2, 3, 4],
[5, 1, 2]])
>>> np.diff(x, axis=0)
array([[-1, 2, 0, -2]])
"""
if n == 0:
return a
if n < 0:
raise ValueError(
"order must be non-negative but got " + repr(n))
a = asanyarray(a)
nd = len(a.shape)
slice1 = [slice(None)]*nd
slice2 = [slice(None)]*nd
slice1[axis] = slice(1, None)
slice2[axis] = slice(None, -1)
slice1 = tuple(slice1)
slice2 = tuple(slice2)
if n > 1:
return diff(a[slice1]-a[slice2], n-1, axis=axis)
else:
return a[slice1]-a[slice2]
def interp(x, xp, fp, left=None, right=None, period=None):
"""
One-dimensional linear interpolation.
Returns the one-dimensional piecewise linear interpolant to a function
with given values at discrete data-points.
Parameters
----------
x : array_like
The x-coordinates of the interpolated values.
xp : 1-D sequence of floats
The x-coordinates of the data points, must be increasing if argument
`period` is not specified. Otherwise, `xp` is internally sorted after
normalizing the periodic boundaries with ``xp = xp % period``.
fp : 1-D sequence of floats
The y-coordinates of the data points, same length as `xp`.
left : float, optional
Value to return for `x < xp[0]`, default is `fp[0]`.
right : float, optional
Value to return for `x > xp[-1]`, default is `fp[-1]`.
period : None or float, optional
A period for the x-coordinates. This parameter allows the proper
interpolation of angular x-coordinates. Parameters `left` and `right`
are ignored if `period` is specified.
.. versionadded:: 1.10.0
Returns
-------
y : float or ndarray
The interpolated values, same shape as `x`.
Raises
------
ValueError
If `xp` and `fp` have different length
If `xp` or `fp` are not 1-D sequences
If `period == 0`
Notes
-----
Does not check that the x-coordinate sequence `xp` is increasing.
If `xp` is not increasing, the results are nonsense.
A simple check for increasing is::
np.all(np.diff(xp) > 0)
Examples
--------
>>> xp = [1, 2, 3]
>>> fp = [3, 2, 0]
>>> np.interp(2.5, xp, fp)
1.0
>>> np.interp([0, 1, 1.5, 2.72, 3.14], xp, fp)
array([ 3. , 3. , 2.5 , 0.56, 0. ])
>>> UNDEF = -99.0
>>> np.interp(3.14, xp, fp, right=UNDEF)
-99.0
Plot an interpolant to the sine function:
>>> x = np.linspace(0, 2*np.pi, 10)
>>> y = np.sin(x)
>>> xvals = np.linspace(0, 2*np.pi, 50)
>>> yinterp = np.interp(xvals, x, y)
>>> import matplotlib.pyplot as plt
>>> plt.plot(x, y, 'o')
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.plot(xvals, yinterp, '-x')
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.show()
Interpolation with periodic x-coordinates:
>>> x = [-180, -170, -185, 185, -10, -5, 0, 365]
>>> xp = [190, -190, 350, -350]
>>> fp = [5, 10, 3, 4]
>>> np.interp(x, xp, fp, period=360)
array([7.5, 5., 8.75, 6.25, 3., 3.25, 3.5, 3.75])
"""
if period is None:
if isinstance(x, (float, int, number)):
return compiled_interp([x], xp, fp, left, right).item()
elif isinstance(x, np.ndarray) and x.ndim == 0:
return compiled_interp([x], xp, fp, left, right).item()
else:
return compiled_interp(x, xp, fp, left, right)
else:
if period == 0:
raise ValueError("period must be a non-zero value")
period = abs(period)
left = None
right = None
return_array = True
if isinstance(x, (float, int, number)):
return_array = False
x = [x]
x = np.asarray(x, dtype=np.float64)
xp = np.asarray(xp, dtype=np.float64)
fp = np.asarray(fp, dtype=np.float64)
if xp.ndim != 1 or fp.ndim != 1:
raise ValueError("Data points must be 1-D sequences")
if xp.shape[0] != fp.shape[0]:
raise ValueError("fp and xp are not of the same length")
# normalizing periodic boundaries
x = x % period
xp = xp % period
asort_xp = np.argsort(xp)
xp = xp[asort_xp]
fp = fp[asort_xp]
xp = np.concatenate((xp[-1:]-period, xp, xp[0:1]+period))
fp = np.concatenate((fp[-1:], fp, fp[0:1]))
if return_array:
return compiled_interp(x, xp, fp, left, right)
else:
return compiled_interp(x, xp, fp, left, right).item()
def angle(z, deg=0):
"""
Return the angle of the complex argument.
Parameters
----------
z : array_like
A complex number or sequence of complex numbers.
deg : bool, optional
Return angle in degrees if True, radians if False (default).
Returns
-------
angle : ndarray or scalar
The counterclockwise angle from the positive real axis on
the complex plane, with dtype as numpy.float64.
See Also
--------
arctan2
absolute
Examples
--------
>>> np.angle([1.0, 1.0j, 1+1j]) # in radians
array([ 0. , 1.57079633, 0.78539816])
>>> np.angle(1+1j, deg=True) # in degrees
45.0
"""
if deg:
fact = 180/pi
else:
fact = 1.0
z = asarray(z)
if (issubclass(z.dtype.type, _nx.complexfloating)):
zimag = z.imag
zreal = z.real
else:
zimag = 0
zreal = z
return arctan2(zimag, zreal) * fact
def unwrap(p, discont=pi, axis=-1):
"""
Unwrap by changing deltas between values to 2*pi complement.
Unwrap radian phase `p` by changing absolute jumps greater than
`discont` to their 2*pi complement along the given axis.
Parameters
----------
p : array_like
Input array.
discont : float, optional
Maximum discontinuity between values, default is ``pi``.
axis : int, optional
Axis along which unwrap will operate, default is the last axis.
Returns
-------
out : ndarray
Output array.
See Also
--------
rad2deg, deg2rad
Notes
-----
If the discontinuity in `p` is smaller than ``pi``, but larger than
`discont`, no unwrapping is done because taking the 2*pi complement
would only make the discontinuity larger.
Examples
--------
>>> phase = np.linspace(0, np.pi, num=5)
>>> phase[3:] += np.pi
>>> phase
array([ 0. , 0.78539816, 1.57079633, 5.49778714, 6.28318531])
>>> np.unwrap(phase)
array([ 0. , 0.78539816, 1.57079633, -0.78539816, 0. ])
"""
p = asarray(p)
nd = len(p.shape)
dd = diff(p, axis=axis)
slice1 = [slice(None, None)]*nd # full slices
slice1[axis] = slice(1, None)
ddmod = mod(dd + pi, 2*pi) - pi
_nx.copyto(ddmod, pi, where=(ddmod == -pi) & (dd > 0))
ph_correct = ddmod - dd
_nx.copyto(ph_correct, 0, where=abs(dd) < discont)
up = array(p, copy=True, dtype='d')
up[slice1] = p[slice1] + ph_correct.cumsum(axis)
return up
def sort_complex(a):
"""
Sort a complex array using the real part first, then the imaginary part.
Parameters
----------
a : array_like
Input array
Returns
-------
out : complex ndarray
Always returns a sorted complex array.
Examples
--------
>>> np.sort_complex([5, 3, 6, 2, 1])
array([ 1.+0.j, 2.+0.j, 3.+0.j, 5.+0.j, 6.+0.j])
>>> np.sort_complex([1 + 2j, 2 - 1j, 3 - 2j, 3 - 3j, 3 + 5j])
array([ 1.+2.j, 2.-1.j, 3.-3.j, 3.-2.j, 3.+5.j])
"""
b = array(a, copy=True)
b.sort()
if not issubclass(b.dtype.type, _nx.complexfloating):
if b.dtype.char in 'bhBH':
return b.astype('F')
elif b.dtype.char == 'g':
return b.astype('G')
else:
return b.astype('D')
else:
return b
def trim_zeros(filt, trim='fb'):
"""
Trim the leading and/or trailing zeros from a 1-D array or sequence.
Parameters
----------
filt : 1-D array or sequence
Input array.
trim : str, optional
A string with 'f' representing trim from front and 'b' to trim from
back. Default is 'fb', trim zeros from both front and back of the
array.
Returns
-------
trimmed : 1-D array or sequence
The result of trimming the input. The input data type is preserved.
Examples
--------
>>> a = np.array((0, 0, 0, 1, 2, 3, 0, 2, 1, 0))
>>> np.trim_zeros(a)
array([1, 2, 3, 0, 2, 1])
>>> np.trim_zeros(a, 'b')
array([0, 0, 0, 1, 2, 3, 0, 2, 1])
The input data type is preserved, list/tuple in means list/tuple out.
>>> np.trim_zeros([0, 1, 2, 0])
[1, 2]
"""
first = 0
trim = trim.upper()
if 'F' in trim:
for i in filt:
if i != 0.:
break
else:
first = first + 1
last = len(filt)
if 'B' in trim:
for i in filt[::-1]:
if i != 0.:
break
else:
last = last - 1
return filt[first:last]
@deprecate
def unique(x):
"""
This function is deprecated. Use numpy.lib.arraysetops.unique()
instead.
"""
try:
tmp = x.flatten()
if tmp.size == 0:
return tmp
tmp.sort()
idx = concatenate(([True], tmp[1:] != tmp[:-1]))
return tmp[idx]
except AttributeError:
items = sorted(set(x))
return asarray(items)
def extract(condition, arr):
"""
Return the elements of an array that satisfy some condition.
This is equivalent to ``np.compress(ravel(condition), ravel(arr))``. If
`condition` is boolean ``np.extract`` is equivalent to ``arr[condition]``.
Note that `place` does the exact opposite of `extract`.
Parameters
----------
condition : array_like
An array whose nonzero or True entries indicate the elements of `arr`
to extract.
arr : array_like
Input array of the same size as `condition`.
Returns
-------
extract : ndarray
Rank 1 array of values from `arr` where `condition` is True.
See Also
--------
take, put, copyto, compress, place
Examples
--------
>>> arr = np.arange(12).reshape((3, 4))
>>> arr
array([[ 0, 1, 2, 3],
[ 4, 5, 6, 7],
[ 8, 9, 10, 11]])
>>> condition = np.mod(arr, 3)==0
>>> condition
array([[ True, False, False, True],
[False, False, True, False],
[False, True, False, False]], dtype=bool)
>>> np.extract(condition, arr)
array([0, 3, 6, 9])
If `condition` is boolean:
>>> arr[condition]
array([0, 3, 6, 9])
"""
return _nx.take(ravel(arr), nonzero(ravel(condition))[0])
def place(arr, mask, vals):
"""
Change elements of an array based on conditional and input values.
Similar to ``np.copyto(arr, vals, where=mask)``, the difference is that
`place` uses the first N elements of `vals`, where N is the number of
True values in `mask`, while `copyto` uses the elements where `mask`
is True.
Note that `extract` does the exact opposite of `place`.
Parameters
----------
arr : array_like
Array to put data into.
mask : array_like
Boolean mask array. Must have the same size as `a`.
vals : 1-D sequence
Values to put into `a`. Only the first N elements are used, where
N is the number of True values in `mask`. If `vals` is smaller
than N it will be repeated.
See Also
--------
copyto, put, take, extract
Examples
--------
>>> arr = np.arange(6).reshape(2, 3)
>>> np.place(arr, arr>2, [44, 55])
>>> arr
array([[ 0, 1, 2],
[44, 55, 44]])
"""
return _insert(arr, mask, vals)
def disp(mesg, device=None, linefeed=True):
"""
Display a message on a device.
Parameters
----------
mesg : str
Message to display.
device : object
Device to write message. If None, defaults to ``sys.stdout`` which is
very similar to ``print``. `device` needs to have ``write()`` and
``flush()`` methods.
linefeed : bool, optional
Option whether to print a line feed or not. Defaults to True.
Raises
------
AttributeError
If `device` does not have a ``write()`` or ``flush()`` method.
Examples
--------
Besides ``sys.stdout``, a file-like object can also be used as it has
both required methods:
>>> from StringIO import StringIO
>>> buf = StringIO()
>>> np.disp('"Display" in a file', device=buf)
>>> buf.getvalue()
'"Display" in a file\\n'
"""
if device is None:
device = sys.stdout
if linefeed:
device.write('%s\n' % mesg)
else:
device.write('%s' % mesg)
device.flush()
return
class vectorize(object):
"""
vectorize(pyfunc, otypes='', doc=None, excluded=None, cache=False)
Generalized function class.
Define a vectorized function which takes a nested sequence
of objects or numpy arrays as inputs and returns a
numpy array as output. The vectorized function evaluates `pyfunc` over
successive tuples of the input arrays like the python map function,
except it uses the broadcasting rules of numpy.
The data type of the output of `vectorized` is determined by calling
the function with the first element of the input. This can be avoided
by specifying the `otypes` argument.
Parameters
----------
pyfunc : callable
A python function or method.
otypes : str or list of dtypes, optional
The output data type. It must be specified as either a string of
typecode characters or a list of data type specifiers. There should
be one data type specifier for each output.
doc : str, optional
The docstring for the function. If `None`, the docstring will be the
``pyfunc.__doc__``.
excluded : set, optional
Set of strings or integers representing the positional or keyword
arguments for which the function will not be vectorized. These will be
passed directly to `pyfunc` unmodified.
.. versionadded:: 1.7.0
cache : bool, optional
If `True`, then cache the first function call that determines the number
of outputs if `otypes` is not provided.
.. versionadded:: 1.7.0
Returns
-------
vectorized : callable
Vectorized function.
Examples
--------
>>> def myfunc(a, b):
... "Return a-b if a>b, otherwise return a+b"
... if a > b:
... return a - b
... else:
... return a + b
>>> vfunc = np.vectorize(myfunc)
>>> vfunc([1, 2, 3, 4], 2)
array([3, 4, 1, 2])
The docstring is taken from the input function to `vectorize` unless it
is specified
>>> vfunc.__doc__
'Return a-b if a>b, otherwise return a+b'
>>> vfunc = np.vectorize(myfunc, doc='Vectorized `myfunc`')
>>> vfunc.__doc__
'Vectorized `myfunc`'
The output type is determined by evaluating the first element of the input,
unless it is specified
>>> out = vfunc([1, 2, 3, 4], 2)
>>> type(out[0])
<type 'numpy.int32'>
>>> vfunc = np.vectorize(myfunc, otypes=[np.float])
>>> out = vfunc([1, 2, 3, 4], 2)
>>> type(out[0])
<type 'numpy.float64'>
The `excluded` argument can be used to prevent vectorizing over certain
arguments. This can be useful for array-like arguments of a fixed length
such as the coefficients for a polynomial as in `polyval`:
>>> def mypolyval(p, x):
... _p = list(p)
... res = _p.pop(0)
... while _p:
... res = res*x + _p.pop(0)
... return res
>>> vpolyval = np.vectorize(mypolyval, excluded=['p'])
>>> vpolyval(p=[1, 2, 3], x=[0, 1])
array([3, 6])
Positional arguments may also be excluded by specifying their position:
>>> vpolyval.excluded.add(0)
>>> vpolyval([1, 2, 3], x=[0, 1])
array([3, 6])
Notes
-----
The `vectorize` function is provided primarily for convenience, not for
performance. The implementation is essentially a for loop.
If `otypes` is not specified, then a call to the function with the
first argument will be used to determine the number of outputs. The
results of this call will be cached if `cache` is `True` to prevent
calling the function twice. However, to implement the cache, the
original function must be wrapped which will slow down subsequent
calls, so only do this if your function is expensive.
The new keyword argument interface and `excluded` argument support
further degrades performance.
"""
def __init__(self, pyfunc, otypes='', doc=None, excluded=None,
cache=False):
self.pyfunc = pyfunc
self.cache = cache
self._ufunc = None # Caching to improve default performance
if doc is None:
self.__doc__ = pyfunc.__doc__
else:
self.__doc__ = doc
if isinstance(otypes, str):
self.otypes = otypes
for char in self.otypes:
if char not in typecodes['All']:
raise ValueError(
"Invalid otype specified: %s" % (char,))
elif iterable(otypes):
self.otypes = ''.join([_nx.dtype(x).char for x in otypes])
else:
raise ValueError(
"Invalid otype specification")
# Excluded variable support
if excluded is None:
excluded = set()
self.excluded = set(excluded)
def __call__(self, *args, **kwargs):
"""
Return arrays with the results of `pyfunc` broadcast (vectorized) over
`args` and `kwargs` not in `excluded`.
"""
excluded = self.excluded
if not kwargs and not excluded:
func = self.pyfunc
vargs = args
else:
# The wrapper accepts only positional arguments: we use `names` and
# `inds` to mutate `the_args` and `kwargs` to pass to the original
# function.
nargs = len(args)
names = [_n for _n in kwargs if _n not in excluded]
inds = [_i for _i in range(nargs) if _i not in excluded]
the_args = list(args)
def func(*vargs):
for _n, _i in enumerate(inds):
the_args[_i] = vargs[_n]
kwargs.update(zip(names, vargs[len(inds):]))
return self.pyfunc(*the_args, **kwargs)
vargs = [args[_i] for _i in inds]
vargs.extend([kwargs[_n] for _n in names])
return self._vectorize_call(func=func, args=vargs)
def _get_ufunc_and_otypes(self, func, args):
"""Return (ufunc, otypes)."""
# frompyfunc will fail if args is empty
if not args:
raise ValueError('args can not be empty')
if self.otypes:
otypes = self.otypes
nout = len(otypes)
# Note logic here: We only *use* self._ufunc if func is self.pyfunc
# even though we set self._ufunc regardless.
if func is self.pyfunc and self._ufunc is not None:
ufunc = self._ufunc
else:
ufunc = self._ufunc = frompyfunc(func, len(args), nout)
else:
# Get number of outputs and output types by calling the function on
# the first entries of args. We also cache the result to prevent
# the subsequent call when the ufunc is evaluated.
# Assumes that ufunc first evaluates the 0th elements in the input
# arrays (the input values are not checked to ensure this)
inputs = [asarray(_a).flat[0] for _a in args]
outputs = func(*inputs)
# Performance note: profiling indicates that -- for simple
# functions at least -- this wrapping can almost double the
# execution time.
# Hence we make it optional.
if self.cache:
_cache = [outputs]
def _func(*vargs):
if _cache:
return _cache.pop()
else:
return func(*vargs)
else:
_func = func
if isinstance(outputs, tuple):
nout = len(outputs)
else:
nout = 1
outputs = (outputs,)
otypes = ''.join([asarray(outputs[_k]).dtype.char
for _k in range(nout)])
# Performance note: profiling indicates that creating the ufunc is
# not a significant cost compared with wrapping so it seems not
# worth trying to cache this.
ufunc = frompyfunc(_func, len(args), nout)
return ufunc, otypes
def _vectorize_call(self, func, args):
"""Vectorized call to `func` over positional `args`."""
if not args:
_res = func()
else:
ufunc, otypes = self._get_ufunc_and_otypes(func=func, args=args)
# Convert args to object arrays first
inputs = [array(_a, copy=False, subok=True, dtype=object)
for _a in args]
outputs = ufunc(*inputs)
if ufunc.nout == 1:
_res = array(outputs,
copy=False, subok=True, dtype=otypes[0])
else:
_res = tuple([array(_x, copy=False, subok=True, dtype=_t)
for _x, _t in zip(outputs, otypes)])
return _res
def cov(m, y=None, rowvar=1, bias=0, ddof=None, fweights=None, aweights=None):
"""
Estimate a covariance matrix, given data and weights.
Covariance indicates the level to which two variables vary together.
If we examine N-dimensional samples, :math:`X = [x_1, x_2, ... x_N]^T`,
then the covariance matrix element :math:`C_{ij}` is the covariance of
:math:`x_i` and :math:`x_j`. The element :math:`C_{ii}` is the variance
of :math:`x_i`.
See the notes for an outline of the algorithm.
Parameters
----------
m : array_like
A 1-D or 2-D array containing multiple variables and observations.
Each row of `m` represents a variable, and each column a single
observation of all those variables. Also see `rowvar` below.
y : array_like, optional
An additional set of variables and observations. `y` has the same form
as that of `m`.
rowvar : int, optional
If `rowvar` is non-zero (default), then each row represents a
variable, with observations in the columns. Otherwise, the relationship
is transposed: each column represents a variable, while the rows
contain observations.
bias : int, optional
Default normalization is by ``(N - 1)``, where ``N`` corresponds to the
number of observations given (unbiased estimate). If `bias` is 1, then
normalization is by ``N``. These values can be overridden by using the
keyword ``ddof`` in numpy versions >= 1.5.
ddof : int, optional
If not ``None`` the default value implied by `bias` is overridden.
Note that ``ddof=1`` will return the unbiased estimate, even if both
`fweights` and `aweights` are specified, and ``ddof=0`` will return
the simple average. See the notes for the details. The default value
is ``None``.
.. versionadded:: 1.5
fweights : array_like, int, optional
1-D array of integer freguency weights; the number of times each
observation vector should be repeated.
.. versionadded:: 1.10
aweights : array_like, optional
1-D array of observation vector weights. These relative weights are
typically large for observations considered "important" and smaller for
observations considered less "important". If ``ddof=0`` the array of
weights can be used to assign probabilities to observation vectors.
.. versionadded:: 1.10
Returns
-------
out : ndarray
The covariance matrix of the variables.
See Also
--------
corrcoef : Normalized covariance matrix
Notes
-----
Assume that the observations are in the columns of the observation
array `m` and let ``f = fweights`` and ``a = aweights`` for brevity. The
steps to compute the weighted covariance are as follows::
>>> w = f * a
>>> v1 = np.sum(w)
>>> v2 = np.sum(w * a)
>>> m -= np.sum(m * w, axis=1, keepdims=True) / v1
>>> cov = np.dot(m * w, m.T) * v1 / (v1**2 - ddof * v2)
Note that when ``a == 1``, the normalization factor
``v1 / (v1**2 - ddof * v2)`` goes over to ``1 / (np.sum(f) - ddof)``
as it should.
Examples
--------
Consider two variables, :math:`x_0` and :math:`x_1`, which
correlate perfectly, but in opposite directions:
>>> x = np.array([[0, 2], [1, 1], [2, 0]]).T
>>> x
array([[0, 1, 2],
[2, 1, 0]])
Note how :math:`x_0` increases while :math:`x_1` decreases. The covariance
matrix shows this clearly:
>>> np.cov(x)
array([[ 1., -1.],
[-1., 1.]])
Note that element :math:`C_{0,1}`, which shows the correlation between
:math:`x_0` and :math:`x_1`, is negative.
Further, note how `x` and `y` are combined:
>>> x = [-2.1, -1, 4.3]
>>> y = [3, 1.1, 0.12]
>>> X = np.vstack((x,y))
>>> print np.cov(X)
[[ 11.71 -4.286 ]
[ -4.286 2.14413333]]
>>> print np.cov(x, y)
[[ 11.71 -4.286 ]
[ -4.286 2.14413333]]
>>> print np.cov(x)
11.71
"""
# Check inputs
if ddof is not None and ddof != int(ddof):
raise ValueError(
"ddof must be integer")
# Handles complex arrays too
m = np.asarray(m)
if y is None:
dtype = np.result_type(m, np.float64)
else:
y = np.asarray(y)
dtype = np.result_type(m, y, np.float64)
X = array(m, ndmin=2, dtype=dtype)
if rowvar == 0 and X.shape[0] != 1:
X = X.T
if X.shape[0] == 0:
return np.array([]).reshape(0, 0)
if y is not None:
y = array(y, copy=False, ndmin=2, dtype=dtype)
if rowvar == 0 and y.shape[0] != 1:
y = y.T
X = np.vstack((X, y))
if ddof is None:
if bias == 0:
ddof = 1
else:
ddof = 0
# Get the product of frequencies and weights
w = None
if fweights is not None:
fweights = np.asarray(fweights, dtype=np.float)
if not np.all(fweights == np.around(fweights)):
raise TypeError(
"fweights must be integer")
if fweights.ndim > 1:
raise RuntimeError(
"cannot handle multidimensional fweights")
if fweights.shape[0] != X.shape[1]:
raise RuntimeError(
"incompatible numbers of samples and fweights")
if any(fweights < 0):
raise ValueError(
"fweights cannot be negative")
w = fweights
if aweights is not None:
aweights = np.asarray(aweights, dtype=np.float)
if aweights.ndim > 1:
raise RuntimeError(
"cannot handle multidimensional aweights")
if aweights.shape[0] != X.shape[1]:
raise RuntimeError(
"incompatible numbers of samples and aweights")
if any(aweights < 0):
raise ValueError(
"aweights cannot be negative")
if w is None:
w = aweights
else:
w *= aweights
avg, w_sum = average(X, axis=1, weights=w, returned=True)
w_sum = w_sum[0]
# Determine the normalization
if w is None:
fact = X.shape[1] - ddof
elif ddof == 0:
fact = w_sum
elif aweights is None:
fact = w_sum - ddof
else:
fact = w_sum - ddof*sum(w*aweights)/w_sum
if fact <= 0:
warnings.warn("Degrees of freedom <= 0 for slice", RuntimeWarning)
fact = 0.0
X -= avg[:, None]
if w is None:
X_T = X.T
else:
X_T = (X*w).T
c = dot(X, X_T.conj())
c *= 1. / np.float64(fact)
return c.squeeze()
def corrcoef(x, y=None, rowvar=1, bias=np._NoValue, ddof=np._NoValue):
"""
Return Pearson product-moment correlation coefficients.
Please refer to the documentation for `cov` for more detail. The
relationship between the correlation coefficient matrix, `R`, and the
covariance matrix, `C`, is
.. math:: R_{ij} = \\frac{ C_{ij} } { \\sqrt{ C_{ii} * C_{jj} } }
The values of `R` are between -1 and 1, inclusive.
Parameters
----------
x : array_like
A 1-D or 2-D array containing multiple variables and observations.
Each row of `x` represents a variable, and each column a single
observation of all those variables. Also see `rowvar` below.
y : array_like, optional
An additional set of variables and observations. `y` has the same
shape as `x`.
rowvar : int, optional
If `rowvar` is non-zero (default), then each row represents a
variable, with observations in the columns. Otherwise, the relationship
is transposed: each column represents a variable, while the rows
contain observations.
bias : _NoValue, optional
Has no effect, do not use.
.. deprecated:: 1.10.0
ddof : _NoValue, optional
Has no effect, do not use.
.. deprecated:: 1.10.0
Returns
-------
R : ndarray
The correlation coefficient matrix of the variables.
See Also
--------
cov : Covariance matrix
Notes
-----
This function accepts but discards arguments `bias` and `ddof`. This is
for backwards compatibility with previous versions of this function. These
arguments had no effect on the return values of the function and can be
safely ignored in this and previous versions of numpy.
"""
if bias is not np._NoValue or ddof is not np._NoValue:
# 2015-03-15, 1.10
warnings.warn('bias and ddof have no effect and are deprecated',
DeprecationWarning)
c = cov(x, y, rowvar)
try:
d = diag(c)
except ValueError: # scalar covariance
# nan if incorrect value (nan, inf, 0), 1 otherwise
return c / c
d = sqrt(d)
# calculate "c / multiply.outer(d, d)" row-wise ... for memory and speed
for i in range(0, d.size):
c[i,:] /= (d * d[i])
return c
def blackman(M):
"""
Return the Blackman window.
The Blackman window is a taper formed by using the first three
terms of a summation of cosines. It was designed to have close to the
minimal leakage possible. It is close to optimal, only slightly worse
than a Kaiser window.
Parameters
----------
M : int
Number of points in the output window. If zero or less, an empty
array is returned.
Returns
-------
out : ndarray
The window, with the maximum value normalized to one (the value one
appears only if the number of samples is odd).
See Also
--------
bartlett, hamming, hanning, kaiser
Notes
-----
The Blackman window is defined as
.. math:: w(n) = 0.42 - 0.5 \\cos(2\\pi n/M) + 0.08 \\cos(4\\pi n/M)
Most references to the Blackman window come from the signal processing
literature, where it is used as one of many windowing functions for
smoothing values. It is also known as an apodization (which means
"removing the foot", i.e. smoothing discontinuities at the beginning
and end of the sampled signal) or tapering function. It is known as a
"near optimal" tapering function, almost as good (by some measures)
as the kaiser window.
References
----------
Blackman, R.B. and Tukey, J.W., (1958) The measurement of power spectra,
Dover Publications, New York.
Oppenheim, A.V., and R.W. Schafer. Discrete-Time Signal Processing.
Upper Saddle River, NJ: Prentice-Hall, 1999, pp. 468-471.
Examples
--------
>>> np.blackman(12)
array([ -1.38777878e-17, 3.26064346e-02, 1.59903635e-01,
4.14397981e-01, 7.36045180e-01, 9.67046769e-01,
9.67046769e-01, 7.36045180e-01, 4.14397981e-01,
1.59903635e-01, 3.26064346e-02, -1.38777878e-17])
Plot the window and the frequency response:
>>> from numpy.fft import fft, fftshift
>>> window = np.blackman(51)
>>> plt.plot(window)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Blackman window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Amplitude")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Sample")
<matplotlib.text.Text object at 0x...>
>>> plt.show()
>>> plt.figure()
<matplotlib.figure.Figure object at 0x...>
>>> A = fft(window, 2048) / 25.5
>>> mag = np.abs(fftshift(A))
>>> freq = np.linspace(-0.5, 0.5, len(A))
>>> response = 20 * np.log10(mag)
>>> response = np.clip(response, -100, 100)
>>> plt.plot(freq, response)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Frequency response of Blackman window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Magnitude [dB]")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Normalized frequency [cycles per sample]")
<matplotlib.text.Text object at 0x...>
>>> plt.axis('tight')
(-0.5, 0.5, -100.0, ...)
>>> plt.show()
"""
if M < 1:
return array([])
if M == 1:
return ones(1, float)
n = arange(0, M)
return 0.42 - 0.5*cos(2.0*pi*n/(M-1)) + 0.08*cos(4.0*pi*n/(M-1))
def bartlett(M):
"""
Return the Bartlett window.
The Bartlett window is very similar to a triangular window, except
that the end points are at zero. It is often used in signal
processing for tapering a signal, without generating too much
ripple in the frequency domain.
Parameters
----------
M : int
Number of points in the output window. If zero or less, an
empty array is returned.
Returns
-------
out : array
The triangular window, with the maximum value normalized to one
(the value one appears only if the number of samples is odd), with
the first and last samples equal to zero.
See Also
--------
blackman, hamming, hanning, kaiser
Notes
-----
The Bartlett window is defined as
.. math:: w(n) = \\frac{2}{M-1} \\left(
\\frac{M-1}{2} - \\left|n - \\frac{M-1}{2}\\right|
\\right)
Most references to the Bartlett window come from the signal
processing literature, where it is used as one of many windowing
functions for smoothing values. Note that convolution with this
window produces linear interpolation. It is also known as an
apodization (which means"removing the foot", i.e. smoothing
discontinuities at the beginning and end of the sampled signal) or
tapering function. The fourier transform of the Bartlett is the product
of two sinc functions.
Note the excellent discussion in Kanasewich.
References
----------
.. [1] M.S. Bartlett, "Periodogram Analysis and Continuous Spectra",
Biometrika 37, 1-16, 1950.
.. [2] E.R. Kanasewich, "Time Sequence Analysis in Geophysics",
The University of Alberta Press, 1975, pp. 109-110.
.. [3] A.V. Oppenheim and R.W. Schafer, "Discrete-Time Signal
Processing", Prentice-Hall, 1999, pp. 468-471.
.. [4] Wikipedia, "Window function",
http://en.wikipedia.org/wiki/Window_function
.. [5] W.H. Press, B.P. Flannery, S.A. Teukolsky, and W.T. Vetterling,
"Numerical Recipes", Cambridge University Press, 1986, page 429.
Examples
--------
>>> np.bartlett(12)
array([ 0. , 0.18181818, 0.36363636, 0.54545455, 0.72727273,
0.90909091, 0.90909091, 0.72727273, 0.54545455, 0.36363636,
0.18181818, 0. ])
Plot the window and its frequency response (requires SciPy and matplotlib):
>>> from numpy.fft import fft, fftshift
>>> window = np.bartlett(51)
>>> plt.plot(window)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Bartlett window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Amplitude")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Sample")
<matplotlib.text.Text object at 0x...>
>>> plt.show()
>>> plt.figure()
<matplotlib.figure.Figure object at 0x...>
>>> A = fft(window, 2048) / 25.5
>>> mag = np.abs(fftshift(A))
>>> freq = np.linspace(-0.5, 0.5, len(A))
>>> response = 20 * np.log10(mag)
>>> response = np.clip(response, -100, 100)
>>> plt.plot(freq, response)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Frequency response of Bartlett window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Magnitude [dB]")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Normalized frequency [cycles per sample]")
<matplotlib.text.Text object at 0x...>
>>> plt.axis('tight')
(-0.5, 0.5, -100.0, ...)
>>> plt.show()
"""
if M < 1:
return array([])
if M == 1:
return ones(1, float)
n = arange(0, M)
return where(less_equal(n, (M-1)/2.0), 2.0*n/(M-1), 2.0 - 2.0*n/(M-1))
def hanning(M):
"""
Return the Hanning window.
The Hanning window is a taper formed by using a weighted cosine.
Parameters
----------
M : int
Number of points in the output window. If zero or less, an
empty array is returned.
Returns
-------
out : ndarray, shape(M,)
The window, with the maximum value normalized to one (the value
one appears only if `M` is odd).
See Also
--------
bartlett, blackman, hamming, kaiser
Notes
-----
The Hanning window is defined as
.. math:: w(n) = 0.5 - 0.5cos\\left(\\frac{2\\pi{n}}{M-1}\\right)
\\qquad 0 \\leq n \\leq M-1
The Hanning was named for Julius von Hann, an Austrian meteorologist.
It is also known as the Cosine Bell. Some authors prefer that it be
called a Hann window, to help avoid confusion with the very similar
Hamming window.
Most references to the Hanning window come from the signal processing
literature, where it is used as one of many windowing functions for
smoothing values. It is also known as an apodization (which means
"removing the foot", i.e. smoothing discontinuities at the beginning
and end of the sampled signal) or tapering function.
References
----------
.. [1] Blackman, R.B. and Tukey, J.W., (1958) The measurement of power
spectra, Dover Publications, New York.
.. [2] E.R. Kanasewich, "Time Sequence Analysis in Geophysics",
The University of Alberta Press, 1975, pp. 106-108.
.. [3] Wikipedia, "Window function",
http://en.wikipedia.org/wiki/Window_function
.. [4] W.H. Press, B.P. Flannery, S.A. Teukolsky, and W.T. Vetterling,
"Numerical Recipes", Cambridge University Press, 1986, page 425.
Examples
--------
>>> np.hanning(12)
array([ 0. , 0.07937323, 0.29229249, 0.57115742, 0.82743037,
0.97974649, 0.97974649, 0.82743037, 0.57115742, 0.29229249,
0.07937323, 0. ])
Plot the window and its frequency response:
>>> from numpy.fft import fft, fftshift
>>> window = np.hanning(51)
>>> plt.plot(window)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Hann window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Amplitude")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Sample")
<matplotlib.text.Text object at 0x...>
>>> plt.show()
>>> plt.figure()
<matplotlib.figure.Figure object at 0x...>
>>> A = fft(window, 2048) / 25.5
>>> mag = np.abs(fftshift(A))
>>> freq = np.linspace(-0.5, 0.5, len(A))
>>> response = 20 * np.log10(mag)
>>> response = np.clip(response, -100, 100)
>>> plt.plot(freq, response)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Frequency response of the Hann window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Magnitude [dB]")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Normalized frequency [cycles per sample]")
<matplotlib.text.Text object at 0x...>
>>> plt.axis('tight')
(-0.5, 0.5, -100.0, ...)
>>> plt.show()
"""
if M < 1:
return array([])
if M == 1:
return ones(1, float)
n = arange(0, M)
return 0.5 - 0.5*cos(2.0*pi*n/(M-1))
def hamming(M):
"""
Return the Hamming window.
The Hamming window is a taper formed by using a weighted cosine.
Parameters
----------
M : int
Number of points in the output window. If zero or less, an
empty array is returned.
Returns
-------
out : ndarray
The window, with the maximum value normalized to one (the value
one appears only if the number of samples is odd).
See Also
--------
bartlett, blackman, hanning, kaiser
Notes
-----
The Hamming window is defined as
.. math:: w(n) = 0.54 - 0.46cos\\left(\\frac{2\\pi{n}}{M-1}\\right)
\\qquad 0 \\leq n \\leq M-1
The Hamming was named for R. W. Hamming, an associate of J. W. Tukey
and is described in Blackman and Tukey. It was recommended for
smoothing the truncated autocovariance function in the time domain.
Most references to the Hamming window come from the signal processing
literature, where it is used as one of many windowing functions for
smoothing values. It is also known as an apodization (which means
"removing the foot", i.e. smoothing discontinuities at the beginning
and end of the sampled signal) or tapering function.
References
----------
.. [1] Blackman, R.B. and Tukey, J.W., (1958) The measurement of power
spectra, Dover Publications, New York.
.. [2] E.R. Kanasewich, "Time Sequence Analysis in Geophysics", The
University of Alberta Press, 1975, pp. 109-110.
.. [3] Wikipedia, "Window function",
http://en.wikipedia.org/wiki/Window_function
.. [4] W.H. Press, B.P. Flannery, S.A. Teukolsky, and W.T. Vetterling,
"Numerical Recipes", Cambridge University Press, 1986, page 425.
Examples
--------
>>> np.hamming(12)
array([ 0.08 , 0.15302337, 0.34890909, 0.60546483, 0.84123594,
0.98136677, 0.98136677, 0.84123594, 0.60546483, 0.34890909,
0.15302337, 0.08 ])
Plot the window and the frequency response:
>>> from numpy.fft import fft, fftshift
>>> window = np.hamming(51)
>>> plt.plot(window)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Hamming window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Amplitude")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Sample")
<matplotlib.text.Text object at 0x...>
>>> plt.show()
>>> plt.figure()
<matplotlib.figure.Figure object at 0x...>
>>> A = fft(window, 2048) / 25.5
>>> mag = np.abs(fftshift(A))
>>> freq = np.linspace(-0.5, 0.5, len(A))
>>> response = 20 * np.log10(mag)
>>> response = np.clip(response, -100, 100)
>>> plt.plot(freq, response)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Frequency response of Hamming window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Magnitude [dB]")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Normalized frequency [cycles per sample]")
<matplotlib.text.Text object at 0x...>
>>> plt.axis('tight')
(-0.5, 0.5, -100.0, ...)
>>> plt.show()
"""
if M < 1:
return array([])
if M == 1:
return ones(1, float)
n = arange(0, M)
return 0.54 - 0.46*cos(2.0*pi*n/(M-1))
## Code from cephes for i0
_i0A = [
-4.41534164647933937950E-18,
3.33079451882223809783E-17,
-2.43127984654795469359E-16,
1.71539128555513303061E-15,
-1.16853328779934516808E-14,
7.67618549860493561688E-14,
-4.85644678311192946090E-13,
2.95505266312963983461E-12,
-1.72682629144155570723E-11,
9.67580903537323691224E-11,
-5.18979560163526290666E-10,
2.65982372468238665035E-9,
-1.30002500998624804212E-8,
6.04699502254191894932E-8,
-2.67079385394061173391E-7,
1.11738753912010371815E-6,
-4.41673835845875056359E-6,
1.64484480707288970893E-5,
-5.75419501008210370398E-5,
1.88502885095841655729E-4,
-5.76375574538582365885E-4,
1.63947561694133579842E-3,
-4.32430999505057594430E-3,
1.05464603945949983183E-2,
-2.37374148058994688156E-2,
4.93052842396707084878E-2,
-9.49010970480476444210E-2,
1.71620901522208775349E-1,
-3.04682672343198398683E-1,
6.76795274409476084995E-1
]
_i0B = [
-7.23318048787475395456E-18,
-4.83050448594418207126E-18,
4.46562142029675999901E-17,
3.46122286769746109310E-17,
-2.82762398051658348494E-16,
-3.42548561967721913462E-16,
1.77256013305652638360E-15,
3.81168066935262242075E-15,
-9.55484669882830764870E-15,
-4.15056934728722208663E-14,
1.54008621752140982691E-14,
3.85277838274214270114E-13,
7.18012445138366623367E-13,
-1.79417853150680611778E-12,
-1.32158118404477131188E-11,
-3.14991652796324136454E-11,
1.18891471078464383424E-11,
4.94060238822496958910E-10,
3.39623202570838634515E-9,
2.26666899049817806459E-8,
2.04891858946906374183E-7,
2.89137052083475648297E-6,
6.88975834691682398426E-5,
3.36911647825569408990E-3,
8.04490411014108831608E-1
]
def _chbevl(x, vals):
b0 = vals[0]
b1 = 0.0
for i in range(1, len(vals)):
b2 = b1
b1 = b0
b0 = x*b1 - b2 + vals[i]
return 0.5*(b0 - b2)
def _i0_1(x):
return exp(x) * _chbevl(x/2.0-2, _i0A)
def _i0_2(x):
return exp(x) * _chbevl(32.0/x - 2.0, _i0B) / sqrt(x)
def i0(x):
"""
Modified Bessel function of the first kind, order 0.
Usually denoted :math:`I_0`. This function does broadcast, but will *not*
"up-cast" int dtype arguments unless accompanied by at least one float or
complex dtype argument (see Raises below).
Parameters
----------
x : array_like, dtype float or complex
Argument of the Bessel function.
Returns
-------
out : ndarray, shape = x.shape, dtype = x.dtype
The modified Bessel function evaluated at each of the elements of `x`.
Raises
------
TypeError: array cannot be safely cast to required type
If argument consists exclusively of int dtypes.
See Also
--------
scipy.special.iv, scipy.special.ive
Notes
-----
We use the algorithm published by Clenshaw [1]_ and referenced by
Abramowitz and Stegun [2]_, for which the function domain is
partitioned into the two intervals [0,8] and (8,inf), and Chebyshev
polynomial expansions are employed in each interval. Relative error on
the domain [0,30] using IEEE arithmetic is documented [3]_ as having a
peak of 5.8e-16 with an rms of 1.4e-16 (n = 30000).
References
----------
.. [1] C. W. Clenshaw, "Chebyshev series for mathematical functions", in
*National Physical Laboratory Mathematical Tables*, vol. 5, London:
Her Majesty's Stationery Office, 1962.
.. [2] M. Abramowitz and I. A. Stegun, *Handbook of Mathematical
Functions*, 10th printing, New York: Dover, 1964, pp. 379.
http://www.math.sfu.ca/~cbm/aands/page_379.htm
.. [3] http://kobesearch.cpan.org/htdocs/Math-Cephes/Math/Cephes.html
Examples
--------
>>> np.i0([0.])
array(1.0)
>>> np.i0([0., 1. + 2j])
array([ 1.00000000+0.j , 0.18785373+0.64616944j])
"""
x = atleast_1d(x).copy()
y = empty_like(x)
ind = (x < 0)
x[ind] = -x[ind]
ind = (x <= 8.0)
y[ind] = _i0_1(x[ind])
ind2 = ~ind
y[ind2] = _i0_2(x[ind2])
return y.squeeze()
## End of cephes code for i0
def kaiser(M, beta):
"""
Return the Kaiser window.
The Kaiser window is a taper formed by using a Bessel function.
Parameters
----------
M : int
Number of points in the output window. If zero or less, an
empty array is returned.
beta : float
Shape parameter for window.
Returns
-------
out : array
The window, with the maximum value normalized to one (the value
one appears only if the number of samples is odd).
See Also
--------
bartlett, blackman, hamming, hanning
Notes
-----
The Kaiser window is defined as
.. math:: w(n) = I_0\\left( \\beta \\sqrt{1-\\frac{4n^2}{(M-1)^2}}
\\right)/I_0(\\beta)
with
.. math:: \\quad -\\frac{M-1}{2} \\leq n \\leq \\frac{M-1}{2},
where :math:`I_0` is the modified zeroth-order Bessel function.
The Kaiser was named for Jim Kaiser, who discovered a simple
approximation to the DPSS window based on Bessel functions. The Kaiser
window is a very good approximation to the Digital Prolate Spheroidal
Sequence, or Slepian window, which is the transform which maximizes the
energy in the main lobe of the window relative to total energy.
The Kaiser can approximate many other windows by varying the beta
parameter.
==== =======================
beta Window shape
==== =======================
0 Rectangular
5 Similar to a Hamming
6 Similar to a Hanning
8.6 Similar to a Blackman
==== =======================
A beta value of 14 is probably a good starting point. Note that as beta
gets large, the window narrows, and so the number of samples needs to be
large enough to sample the increasingly narrow spike, otherwise NaNs will
get returned.
Most references to the Kaiser window come from the signal processing
literature, where it is used as one of many windowing functions for
smoothing values. It is also known as an apodization (which means
"removing the foot", i.e. smoothing discontinuities at the beginning
and end of the sampled signal) or tapering function.
References
----------
.. [1] J. F. Kaiser, "Digital Filters" - Ch 7 in "Systems analysis by
digital computer", Editors: F.F. Kuo and J.F. Kaiser, p 218-285.
John Wiley and Sons, New York, (1966).
.. [2] E.R. Kanasewich, "Time Sequence Analysis in Geophysics", The
University of Alberta Press, 1975, pp. 177-178.
.. [3] Wikipedia, "Window function",
http://en.wikipedia.org/wiki/Window_function
Examples
--------
>>> np.kaiser(12, 14)
array([ 7.72686684e-06, 3.46009194e-03, 4.65200189e-02,
2.29737120e-01, 5.99885316e-01, 9.45674898e-01,
9.45674898e-01, 5.99885316e-01, 2.29737120e-01,
4.65200189e-02, 3.46009194e-03, 7.72686684e-06])
Plot the window and the frequency response:
>>> from numpy.fft import fft, fftshift
>>> window = np.kaiser(51, 14)
>>> plt.plot(window)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Kaiser window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Amplitude")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Sample")
<matplotlib.text.Text object at 0x...>
>>> plt.show()
>>> plt.figure()
<matplotlib.figure.Figure object at 0x...>
>>> A = fft(window, 2048) / 25.5
>>> mag = np.abs(fftshift(A))
>>> freq = np.linspace(-0.5, 0.5, len(A))
>>> response = 20 * np.log10(mag)
>>> response = np.clip(response, -100, 100)
>>> plt.plot(freq, response)
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Frequency response of Kaiser window")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Magnitude [dB]")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("Normalized frequency [cycles per sample]")
<matplotlib.text.Text object at 0x...>
>>> plt.axis('tight')
(-0.5, 0.5, -100.0, ...)
>>> plt.show()
"""
from numpy.dual import i0
if M == 1:
return np.array([1.])
n = arange(0, M)
alpha = (M-1)/2.0
return i0(beta * sqrt(1-((n-alpha)/alpha)**2.0))/i0(float(beta))
def sinc(x):
"""
Return the sinc function.
The sinc function is :math:`\\sin(\\pi x)/(\\pi x)`.
Parameters
----------
x : ndarray
Array (possibly multi-dimensional) of values for which to to
calculate ``sinc(x)``.
Returns
-------
out : ndarray
``sinc(x)``, which has the same shape as the input.
Notes
-----
``sinc(0)`` is the limit value 1.
The name sinc is short for "sine cardinal" or "sinus cardinalis".
The sinc function is used in various signal processing applications,
including in anti-aliasing, in the construction of a Lanczos resampling
filter, and in interpolation.
For bandlimited interpolation of discrete-time signals, the ideal
interpolation kernel is proportional to the sinc function.
References
----------
.. [1] Weisstein, Eric W. "Sinc Function." From MathWorld--A Wolfram Web
Resource. http://mathworld.wolfram.com/SincFunction.html
.. [2] Wikipedia, "Sinc function",
http://en.wikipedia.org/wiki/Sinc_function
Examples
--------
>>> x = np.linspace(-4, 4, 41)
>>> np.sinc(x)
array([ -3.89804309e-17, -4.92362781e-02, -8.40918587e-02,
-8.90384387e-02, -5.84680802e-02, 3.89804309e-17,
6.68206631e-02, 1.16434881e-01, 1.26137788e-01,
8.50444803e-02, -3.89804309e-17, -1.03943254e-01,
-1.89206682e-01, -2.16236208e-01, -1.55914881e-01,
3.89804309e-17, 2.33872321e-01, 5.04551152e-01,
7.56826729e-01, 9.35489284e-01, 1.00000000e+00,
9.35489284e-01, 7.56826729e-01, 5.04551152e-01,
2.33872321e-01, 3.89804309e-17, -1.55914881e-01,
-2.16236208e-01, -1.89206682e-01, -1.03943254e-01,
-3.89804309e-17, 8.50444803e-02, 1.26137788e-01,
1.16434881e-01, 6.68206631e-02, 3.89804309e-17,
-5.84680802e-02, -8.90384387e-02, -8.40918587e-02,
-4.92362781e-02, -3.89804309e-17])
>>> plt.plot(x, np.sinc(x))
[<matplotlib.lines.Line2D object at 0x...>]
>>> plt.title("Sinc Function")
<matplotlib.text.Text object at 0x...>
>>> plt.ylabel("Amplitude")
<matplotlib.text.Text object at 0x...>
>>> plt.xlabel("X")
<matplotlib.text.Text object at 0x...>
>>> plt.show()
It works in 2-D as well:
>>> x = np.linspace(-4, 4, 401)
>>> xx = np.outer(x, x)
>>> plt.imshow(np.sinc(xx))
<matplotlib.image.AxesImage object at 0x...>
"""
x = np.asanyarray(x)
y = pi * where(x == 0, 1.0e-20, x)
return sin(y)/y
def msort(a):
"""
Return a copy of an array sorted along the first axis.
Parameters
----------
a : array_like
Array to be sorted.
Returns
-------
sorted_array : ndarray
Array of the same type and shape as `a`.
See Also
--------
sort
Notes
-----
``np.msort(a)`` is equivalent to ``np.sort(a, axis=0)``.
"""
b = array(a, subok=True, copy=True)
b.sort(0)
return b
def _ureduce(a, func, **kwargs):
"""
Internal Function.
Call `func` with `a` as first argument swapping the axes to use extended
axis on functions that don't support it natively.
Returns result and a.shape with axis dims set to 1.
Parameters
----------
a : array_like
Input array or object that can be converted to an array.
func : callable
Reduction function Kapable of receiving an axis argument.
It is is called with `a` as first argument followed by `kwargs`.
kwargs : keyword arguments
additional keyword arguments to pass to `func`.
Returns
-------
result : tuple
Result of func(a, **kwargs) and a.shape with axis dims set to 1
which can be used to reshape the result to the same shape a ufunc with
keepdims=True would produce.
"""
a = np.asanyarray(a)
axis = kwargs.get('axis', None)
if axis is not None:
keepdim = list(a.shape)
nd = a.ndim
try:
axis = operator.index(axis)
if axis >= nd or axis < -nd:
raise IndexError("axis %d out of bounds (%d)" % (axis, a.ndim))
keepdim[axis] = 1
except TypeError:
sax = set()
for x in axis:
if x >= nd or x < -nd:
raise IndexError("axis %d out of bounds (%d)" % (x, nd))
if x in sax:
raise ValueError("duplicate value in axis")
sax.add(x % nd)
keepdim[x] = 1
keep = sax.symmetric_difference(frozenset(range(nd)))
nkeep = len(keep)
# swap axis that should not be reduced to front
for i, s in enumerate(sorted(keep)):
a = a.swapaxes(i, s)
# merge reduced axis
a = a.reshape(a.shape[:nkeep] + (-1,))
kwargs['axis'] = -1
else:
keepdim = [1] * a.ndim
r = func(a, **kwargs)
return r, keepdim
def median(a, axis=None, out=None, overwrite_input=False, keepdims=False):
"""
Compute the median along the specified axis.
Returns the median of the array elements.
Parameters
----------
a : array_like
Input array or object that can be converted to an array.
axis : int or sequence of int, optional
Axis along which the medians are computed. The default (axis=None)
is to compute the median along a flattened version of the array.
A sequence of axes is supported since version 1.9.0.
out : ndarray, optional
Alternative output array in which to place the result. It must have
the same shape and buffer length as the expected output, but the
type (of the output) will be cast if necessary.
overwrite_input : bool, optional
If True, then allow use of memory of input array (a) for
calculations. The input array will be modified by the call to
median. This will save memory when you do not need to preserve the
contents of the input array. Treat the input as undefined, but it
will probably be fully or partially sorted. Default is False. Note
that, if `overwrite_input` is True and the input is not already an
ndarray, an error will be raised.
keepdims : bool, optional
If this is set to True, the axes which are reduced are left
in the result as dimensions with size one. With this option,
the result will broadcast correctly against the original `arr`.
.. versionadded:: 1.9.0
Returns
-------
median : ndarray
A new array holding the result (unless `out` is specified, in which
case that array is returned instead). If the input contains
integers, or floats of smaller precision than 64, then the output
data-type is float64. Otherwise, the output data-type is the same
as that of the input.
See Also
--------
mean, percentile
Notes
-----
Given a vector V of length N, the median of V is the middle value of
a sorted copy of V, ``V_sorted`` - i.e., ``V_sorted[(N-1)/2]``, when N is
odd. When N is even, it is the average of the two middle values of
``V_sorted``.
Examples
--------
>>> a = np.array([[10, 7, 4], [3, 2, 1]])
>>> a
array([[10, 7, 4],
[ 3, 2, 1]])
>>> np.median(a)
3.5
>>> np.median(a, axis=0)
array([ 6.5, 4.5, 2.5])
>>> np.median(a, axis=1)
array([ 7., 2.])
>>> m = np.median(a, axis=0)
>>> out = np.zeros_like(m)
>>> np.median(a, axis=0, out=m)
array([ 6.5, 4.5, 2.5])
>>> m
array([ 6.5, 4.5, 2.5])
>>> b = a.copy()
>>> np.median(b, axis=1, overwrite_input=True)
array([ 7., 2.])
>>> assert not np.all(a==b)
>>> b = a.copy()
>>> np.median(b, axis=None, overwrite_input=True)
3.5
>>> assert not np.all(a==b)
"""
r, k = _ureduce(a, func=_median, axis=axis, out=out,
overwrite_input=overwrite_input)
if keepdims:
return r.reshape(k)
else:
return r
def _median(a, axis=None, out=None, overwrite_input=False):
# can't be reasonably be implemented in terms of percentile as we have to
# call mean to not break astropy
a = np.asanyarray(a)
# Set the partition indexes
if axis is None:
sz = a.size
else:
sz = a.shape[axis]
if sz % 2 == 0:
szh = sz // 2
kth = [szh - 1, szh]
else:
kth = [(sz - 1) // 2]
# Check if the array contains any nan's
if np.issubdtype(a.dtype, np.inexact):
kth.append(-1)
if overwrite_input:
if axis is None:
part = a.ravel()
part.partition(kth)
else:
a.partition(kth, axis=axis)
part = a
else:
part = partition(a, kth, axis=axis)
if part.shape == ():
# make 0-D arrays work
return part.item()
if axis is None:
axis = 0
indexer = [slice(None)] * part.ndim
index = part.shape[axis] // 2
if part.shape[axis] % 2 == 1:
# index with slice to allow mean (below) to work
indexer[axis] = slice(index, index+1)
else:
indexer[axis] = slice(index-1, index+1)
# Check if the array contains any nan's
if np.issubdtype(a.dtype, np.inexact):
# warn and return nans like mean would
rout = mean(part[indexer], axis=axis, out=out)
part = np.rollaxis(part, axis, part.ndim)
n = np.isnan(part[..., -1])
if rout.ndim == 0:
if n == True:
warnings.warn("Invalid value encountered in median",
RuntimeWarning)
if out is not None:
out[...] = a.dtype.type(np.nan)
rout = out
else:
rout = a.dtype.type(np.nan)
elif np.count_nonzero(n.ravel()) > 0:
warnings.warn("Invalid value encountered in median for" +
" %d results" % np.count_nonzero(n.ravel()),
RuntimeWarning)
rout[n] = np.nan
return rout
else:
# if there are no nans
# Use mean in odd and even case to coerce data type
# and check, use out array.
return mean(part[indexer], axis=axis, out=out)
def percentile(a, q, axis=None, out=None,
overwrite_input=False, interpolation='linear', keepdims=False):
"""
Compute the qth percentile of the data along the specified axis.
Returns the qth percentile of the array elements.
Parameters
----------
a : array_like
Input array or object that can be converted to an array.
q : float in range of [0,100] (or sequence of floats)
Percentile to compute which must be between 0 and 100 inclusive.
axis : int or sequence of int, optional
Axis along which the percentiles are computed. The default (None)
is to compute the percentiles along a flattened version of the array.
A sequence of axes is supported since version 1.9.0.
out : ndarray, optional
Alternative output array in which to place the result. It must
have the same shape and buffer length as the expected output,
but the type (of the output) will be cast if necessary.
overwrite_input : bool, optional
If True, then allow use of memory of input array `a` for
calculations. The input array will be modified by the call to
percentile. This will save memory when you do not need to preserve
the contents of the input array. In this case you should not make
any assumptions about the content of the passed in array `a` after
this function completes -- treat it as undefined. Default is False.
Note that, if the `a` input is not already an array this parameter
will have no effect, `a` will be converted to an array internally
regardless of the value of this parameter.
interpolation : {'linear', 'lower', 'higher', 'midpoint', 'nearest'}
This optional parameter specifies the interpolation method to use,
when the desired quantile lies between two data points `i` and `j`:
* linear: `i + (j - i) * fraction`, where `fraction` is the
fractional part of the index surrounded by `i` and `j`.
* lower: `i`.
* higher: `j`.
* nearest: `i` or `j` whichever is nearest.
* midpoint: (`i` + `j`) / 2.
.. versionadded:: 1.9.0
keepdims : bool, optional
If this is set to True, the axes which are reduced are left
in the result as dimensions with size one. With this option,
the result will broadcast correctly against the original array `a`.
.. versionadded:: 1.9.0
Returns
-------
percentile : scalar or ndarray
If a single percentile `q` is given and axis=None a scalar is
returned. If multiple percentiles `q` are given an array holding
the result is returned. The results are listed in the first axis.
(If `out` is specified, in which case that array is returned
instead). If the input contains integers, or floats of smaller
precision than 64, then the output data-type is float64. Otherwise,
the output data-type is the same as that of the input.
See Also
--------
mean, median
Notes
-----
Given a vector V of length N, the q-th percentile of V is the q-th ranked
value in a sorted copy of V. The values and distances of the two
nearest neighbors as well as the `interpolation` parameter will
determine the percentile if the normalized ranking does not match q
exactly. This function is the same as the median if ``q=50``, the same
as the minimum if ``q=0`` and the same as the maximum if ``q=100``.
Examples
--------
>>> a = np.array([[10, 7, 4], [3, 2, 1]])
>>> a
array([[10, 7, 4],
[ 3, 2, 1]])
>>> np.percentile(a, 50)
array([ 3.5])
>>> np.percentile(a, 50, axis=0)
array([[ 6.5, 4.5, 2.5]])
>>> np.percentile(a, 50, axis=1)
array([[ 7.],
[ 2.]])
>>> m = np.percentile(a, 50, axis=0)
>>> out = np.zeros_like(m)
>>> np.percentile(a, 50, axis=0, out=m)
array([[ 6.5, 4.5, 2.5]])
>>> m
array([[ 6.5, 4.5, 2.5]])
>>> b = a.copy()
>>> np.percentile(b, 50, axis=1, overwrite_input=True)
array([[ 7.],
[ 2.]])
>>> assert not np.all(a==b)
>>> b = a.copy()
>>> np.percentile(b, 50, axis=None, overwrite_input=True)
array([ 3.5])
"""
q = array(q, dtype=np.float64, copy=True)
r, k = _ureduce(a, func=_percentile, q=q, axis=axis, out=out,
overwrite_input=overwrite_input,
interpolation=interpolation)
if keepdims:
if q.ndim == 0:
return r.reshape(k)
else:
return r.reshape([len(q)] + k)
else:
return r
def _percentile(a, q, axis=None, out=None,
overwrite_input=False, interpolation='linear', keepdims=False):
a = asarray(a)
if q.ndim == 0:
# Do not allow 0-d arrays because following code fails for scalar
zerod = True
q = q[None]
else:
zerod = False
# avoid expensive reductions, relevant for arrays with < O(1000) elements
if q.size < 10:
for i in range(q.size):
if q[i] < 0. or q[i] > 100.:
raise ValueError("Percentiles must be in the range [0,100]")
q[i] /= 100.
else:
# faster than any()
if np.count_nonzero(q < 0.) or np.count_nonzero(q > 100.):
raise ValueError("Percentiles must be in the range [0,100]")
q /= 100.
# prepare a for partioning
if overwrite_input:
if axis is None:
ap = a.ravel()
else:
ap = a
else:
if axis is None:
ap = a.flatten()
else:
ap = a.copy()
if axis is None:
axis = 0
Nx = ap.shape[axis]
indices = q * (Nx - 1)
# round fractional indices according to interpolation method
if interpolation == 'lower':
indices = floor(indices).astype(intp)
elif interpolation == 'higher':
indices = ceil(indices).astype(intp)
elif interpolation == 'midpoint':
indices = floor(indices) + 0.5
elif interpolation == 'nearest':
indices = around(indices).astype(intp)
elif interpolation == 'linear':
pass # keep index as fraction and interpolate
else:
raise ValueError(
"interpolation can only be 'linear', 'lower' 'higher', "
"'midpoint', or 'nearest'")
n = np.array(False, dtype=bool) # check for nan's flag
if indices.dtype == intp: # take the points along axis
# Check if the array contains any nan's
if np.issubdtype(a.dtype, np.inexact):
indices = concatenate((indices, [-1]))
ap.partition(indices, axis=axis)
# ensure axis with qth is first
ap = np.rollaxis(ap, axis, 0)
axis = 0
# Check if the array contains any nan's
if np.issubdtype(a.dtype, np.inexact):
indices = indices[:-1]
n = np.isnan(ap[-1:, ...])
if zerod:
indices = indices[0]
r = take(ap, indices, axis=axis, out=out)
else: # weight the points above and below the indices
indices_below = floor(indices).astype(intp)
indices_above = indices_below + 1
indices_above[indices_above > Nx - 1] = Nx - 1
# Check if the array contains any nan's
if np.issubdtype(a.dtype, np.inexact):
indices_above = concatenate((indices_above, [-1]))
weights_above = indices - indices_below
weights_below = 1.0 - weights_above
weights_shape = [1, ] * ap.ndim
weights_shape[axis] = len(indices)
weights_below.shape = weights_shape
weights_above.shape = weights_shape
ap.partition(concatenate((indices_below, indices_above)), axis=axis)
# ensure axis with qth is first
ap = np.rollaxis(ap, axis, 0)
weights_below = np.rollaxis(weights_below, axis, 0)
weights_above = np.rollaxis(weights_above, axis, 0)
axis = 0
# Check if the array contains any nan's
if np.issubdtype(a.dtype, np.inexact):
indices_above = indices_above[:-1]
n = np.isnan(ap[-1:, ...])
x1 = take(ap, indices_below, axis=axis) * weights_below
x2 = take(ap, indices_above, axis=axis) * weights_above
# ensure axis with qth is first
x1 = np.rollaxis(x1, axis, 0)
x2 = np.rollaxis(x2, axis, 0)
if zerod:
x1 = x1.squeeze(0)
x2 = x2.squeeze(0)
if out is not None:
r = add(x1, x2, out=out)
else:
r = add(x1, x2)
if np.any(n):
warnings.warn("Invalid value encountered in median",
RuntimeWarning)
if zerod:
if ap.ndim == 1:
if out is not None:
out[...] = a.dtype.type(np.nan)
r = out
else:
r = a.dtype.type(np.nan)
else:
r[..., n.squeeze(0)] = a.dtype.type(np.nan)
else:
if r.ndim == 1:
r[:] = a.dtype.type(np.nan)
else:
r[..., n.repeat(q.size, 0)] = a.dtype.type(np.nan)
return r
def trapz(y, x=None, dx=1.0, axis=-1):
"""
Integrate along the given axis using the composite trapezoidal rule.
Integrate `y` (`x`) along given axis.
Parameters
----------
y : array_like
Input array to integrate.
x : array_like, optional
If `x` is None, then spacing between all `y` elements is `dx`.
dx : scalar, optional
If `x` is None, spacing given by `dx` is assumed. Default is 1.
axis : int, optional
Specify the axis.
Returns
-------
trapz : float
Definite integral as approximated by trapezoidal rule.
See Also
--------
sum, cumsum
Notes
-----
Image [2]_ illustrates trapezoidal rule -- y-axis locations of points
will be taken from `y` array, by default x-axis distances between
points will be 1.0, alternatively they can be provided with `x` array
or with `dx` scalar. Return value will be equal to combined area under
the red lines.
References
----------
.. [1] Wikipedia page: http://en.wikipedia.org/wiki/Trapezoidal_rule
.. [2] Illustration image:
http://en.wikipedia.org/wiki/File:Composite_trapezoidal_rule_illustration.png
Examples
--------
>>> np.trapz([1,2,3])
4.0
>>> np.trapz([1,2,3], x=[4,6,8])
8.0
>>> np.trapz([1,2,3], dx=2)
8.0
>>> a = np.arange(6).reshape(2, 3)
>>> a
array([[0, 1, 2],
[3, 4, 5]])
>>> np.trapz(a, axis=0)
array([ 1.5, 2.5, 3.5])
>>> np.trapz(a, axis=1)
array([ 2., 8.])
"""
y = asanyarray(y)
if x is None:
d = dx
else:
x = asanyarray(x)
if x.ndim == 1:
d = diff(x)
# reshape to correct shape
shape = [1]*y.ndim
shape[axis] = d.shape[0]
d = d.reshape(shape)
else:
d = diff(x, axis=axis)
nd = len(y.shape)
slice1 = [slice(None)]*nd
slice2 = [slice(None)]*nd
slice1[axis] = slice(1, None)
slice2[axis] = slice(None, -1)
try:
ret = (d * (y[slice1] + y[slice2]) / 2.0).sum(axis)
except ValueError:
# Operations didn't work, cast to ndarray
d = np.asarray(d)
y = np.asarray(y)
ret = add.reduce(d * (y[slice1]+y[slice2])/2.0, axis)
return ret
#always succeed
def add_newdoc(place, obj, doc):
"""Adds documentation to obj which is in module place.
If doc is a string add it to obj as a docstring
If doc is a tuple, then the first element is interpreted as
an attribute of obj and the second as the docstring
(method, docstring)
If doc is a list, then each element of the list should be a
sequence of length two --> [(method1, docstring1),
(method2, docstring2), ...]
This routine never raises an error.
This routine cannot modify read-only docstrings, as appear
in new-style classes or built-in functions. Because this
routine never raises an error the caller must check manually
that the docstrings were changed.
"""
try:
new = getattr(__import__(place, globals(), {}, [obj]), obj)
if isinstance(doc, str):
add_docstring(new, doc.strip())
elif isinstance(doc, tuple):
add_docstring(getattr(new, doc[0]), doc[1].strip())
elif isinstance(doc, list):
for val in doc:
add_docstring(getattr(new, val[0]), val[1].strip())
except:
pass
# Based on scitools meshgrid
def meshgrid(*xi, **kwargs):
"""
Return coordinate matrices from coordinate vectors.
Make N-D coordinate arrays for vectorized evaluations of
N-D scalar/vector fields over N-D grids, given
one-dimensional coordinate arrays x1, x2,..., xn.
.. versionchanged:: 1.9
1-D and 0-D cases are allowed.
Parameters
----------
x1, x2,..., xn : array_like
1-D arrays representing the coordinates of a grid.
indexing : {'xy', 'ij'}, optional
Cartesian ('xy', default) or matrix ('ij') indexing of output.
See Notes for more details.
.. versionadded:: 1.7.0
sparse : bool, optional
If True a sparse grid is returned in order to conserve memory.
Default is False.
.. versionadded:: 1.7.0
copy : bool, optional
If False, a view into the original arrays are returned in order to
conserve memory. Default is True. Please note that
``sparse=False, copy=False`` will likely return non-contiguous
arrays. Furthermore, more than one element of a broadcast array
may refer to a single memory location. If you need to write to the
arrays, make copies first.
.. versionadded:: 1.7.0
Returns
-------
X1, X2,..., XN : ndarray
For vectors `x1`, `x2`,..., 'xn' with lengths ``Ni=len(xi)`` ,
return ``(N1, N2, N3,...Nn)`` shaped arrays if indexing='ij'
or ``(N2, N1, N3,...Nn)`` shaped arrays if indexing='xy'
with the elements of `xi` repeated to fill the matrix along
the first dimension for `x1`, the second for `x2` and so on.
Notes
-----
This function supports both indexing conventions through the indexing
keyword argument. Giving the string 'ij' returns a meshgrid with
matrix indexing, while 'xy' returns a meshgrid with Cartesian indexing.
In the 2-D case with inputs of length M and N, the outputs are of shape
(N, M) for 'xy' indexing and (M, N) for 'ij' indexing. In the 3-D case
with inputs of length M, N and P, outputs are of shape (N, M, P) for
'xy' indexing and (M, N, P) for 'ij' indexing. The difference is
illustrated by the following code snippet::
xv, yv = meshgrid(x, y, sparse=False, indexing='ij')
for i in range(nx):
for j in range(ny):
# treat xv[i,j], yv[i,j]
xv, yv = meshgrid(x, y, sparse=False, indexing='xy')
for i in range(nx):
for j in range(ny):
# treat xv[j,i], yv[j,i]
In the 1-D and 0-D case, the indexing and sparse keywords have no effect.
See Also
--------
index_tricks.mgrid : Construct a multi-dimensional "meshgrid"
using indexing notation.
index_tricks.ogrid : Construct an open multi-dimensional "meshgrid"
using indexing notation.
Examples
--------
>>> nx, ny = (3, 2)
>>> x = np.linspace(0, 1, nx)
>>> y = np.linspace(0, 1, ny)
>>> xv, yv = meshgrid(x, y)
>>> xv
array([[ 0. , 0.5, 1. ],
[ 0. , 0.5, 1. ]])
>>> yv
array([[ 0., 0., 0.],
[ 1., 1., 1.]])
>>> xv, yv = meshgrid(x, y, sparse=True) # make sparse output arrays
>>> xv
array([[ 0. , 0.5, 1. ]])
>>> yv
array([[ 0.],
[ 1.]])
`meshgrid` is very useful to evaluate functions on a grid.
>>> x = np.arange(-5, 5, 0.1)
>>> y = np.arange(-5, 5, 0.1)
>>> xx, yy = meshgrid(x, y, sparse=True)
>>> z = np.sin(xx**2 + yy**2) / (xx**2 + yy**2)
>>> h = plt.contourf(x,y,z)
"""
ndim = len(xi)
copy_ = kwargs.pop('copy', True)
sparse = kwargs.pop('sparse', False)
indexing = kwargs.pop('indexing', 'xy')
if kwargs:
raise TypeError("meshgrid() got an unexpected keyword argument '%s'"
% (list(kwargs)[0],))
if indexing not in ['xy', 'ij']:
raise ValueError(
"Valid values for `indexing` are 'xy' and 'ij'.")
s0 = (1,) * ndim
output = [np.asanyarray(x).reshape(s0[:i] + (-1,) + s0[i + 1::])
for i, x in enumerate(xi)]
shape = [x.size for x in output]
if indexing == 'xy' and ndim > 1:
# switch first and second axis
output[0].shape = (1, -1) + (1,)*(ndim - 2)
output[1].shape = (-1, 1) + (1,)*(ndim - 2)
shape[0], shape[1] = shape[1], shape[0]
if sparse:
if copy_:
return [x.copy() for x in output]
else:
return output
else:
# Return the full N-D matrix (not only the 1-D vector)
if copy_:
mult_fact = np.ones(shape, dtype=int)
return [x * mult_fact for x in output]
else:
return np.broadcast_arrays(*output)
def delete(arr, obj, axis=None):
"""
Return a new array with sub-arrays along an axis deleted. For a one
dimensional array, this returns those entries not returned by
`arr[obj]`.
Parameters
----------
arr : array_like
Input array.
obj : slice, int or array of ints
Indicate which sub-arrays to remove.
axis : int, optional
The axis along which to delete the subarray defined by `obj`.
If `axis` is None, `obj` is applied to the flattened array.
Returns
-------
out : ndarray
A copy of `arr` with the elements specified by `obj` removed. Note
that `delete` does not occur in-place. If `axis` is None, `out` is
a flattened array.
See Also
--------
insert : Insert elements into an array.
append : Append elements at the end of an array.
Notes
-----
Often it is preferable to use a boolean mask. For example:
>>> mask = np.ones(len(arr), dtype=bool)
>>> mask[[0,2,4]] = False
>>> result = arr[mask,...]
Is equivalent to `np.delete(arr, [0,2,4], axis=0)`, but allows further
use of `mask`.
Examples
--------
>>> arr = np.array([[1,2,3,4], [5,6,7,8], [9,10,11,12]])
>>> arr
array([[ 1, 2, 3, 4],
[ 5, 6, 7, 8],
[ 9, 10, 11, 12]])
>>> np.delete(arr, 1, 0)
array([[ 1, 2, 3, 4],
[ 9, 10, 11, 12]])
>>> np.delete(arr, np.s_[::2], 1)
array([[ 2, 4],
[ 6, 8],
[10, 12]])
>>> np.delete(arr, [1,3,5], None)
array([ 1, 3, 5, 7, 8, 9, 10, 11, 12])
"""
wrap = None
if type(arr) is not ndarray:
try:
wrap = arr.__array_wrap__
except AttributeError:
pass
arr = asarray(arr)
ndim = arr.ndim
if axis is None:
if ndim != 1:
arr = arr.ravel()
ndim = arr.ndim
axis = ndim - 1
if ndim == 0:
# 2013-09-24, 1.9
warnings.warn(
"in the future the special handling of scalars will be removed "
"from delete and raise an error", DeprecationWarning)
if wrap:
return wrap(arr)
else:
return arr.copy()
slobj = [slice(None)]*ndim
N = arr.shape[axis]
newshape = list(arr.shape)
if isinstance(obj, slice):
start, stop, step = obj.indices(N)
xr = range(start, stop, step)
numtodel = len(xr)
if numtodel <= 0:
if wrap:
return wrap(arr.copy())
else:
return arr.copy()
# Invert if step is negative:
if step < 0:
step = -step
start = xr[-1]
stop = xr[0] + 1
newshape[axis] -= numtodel
new = empty(newshape, arr.dtype, arr.flags.fnc)
# copy initial chunk
if start == 0:
pass
else:
slobj[axis] = slice(None, start)
new[slobj] = arr[slobj]
# copy end chunck
if stop == N:
pass
else:
slobj[axis] = slice(stop-numtodel, None)
slobj2 = [slice(None)]*ndim
slobj2[axis] = slice(stop, None)
new[slobj] = arr[slobj2]
# copy middle pieces
if step == 1:
pass
else: # use array indexing.
keep = ones(stop-start, dtype=bool)
keep[:stop-start:step] = False
slobj[axis] = slice(start, stop-numtodel)
slobj2 = [slice(None)]*ndim
slobj2[axis] = slice(start, stop)
arr = arr[slobj2]
slobj2[axis] = keep
new[slobj] = arr[slobj2]
if wrap:
return wrap(new)
else:
return new
_obj = obj
obj = np.asarray(obj)
# After removing the special handling of booleans and out of
# bounds values, the conversion to the array can be removed.
if obj.dtype == bool:
warnings.warn(
"in the future insert will treat boolean arrays and array-likes "
"as boolean index instead of casting it to integer", FutureWarning)
obj = obj.astype(intp)
if isinstance(_obj, (int, long, integer)):
# optimization for a single value
obj = obj.item()
if (obj < -N or obj >= N):
raise IndexError(
"index %i is out of bounds for axis %i with "
"size %i" % (obj, axis, N))
if (obj < 0):
obj += N
newshape[axis] -= 1
new = empty(newshape, arr.dtype, arr.flags.fnc)
slobj[axis] = slice(None, obj)
new[slobj] = arr[slobj]
slobj[axis] = slice(obj, None)
slobj2 = [slice(None)]*ndim
slobj2[axis] = slice(obj+1, None)
new[slobj] = arr[slobj2]
else:
if obj.size == 0 and not isinstance(_obj, np.ndarray):
obj = obj.astype(intp)
if not np.can_cast(obj, intp, 'same_kind'):
# obj.size = 1 special case always failed and would just
# give superfluous warnings.
# 2013-09-24, 1.9
warnings.warn(
"using a non-integer array as obj in delete will result in an "
"error in the future", DeprecationWarning)
obj = obj.astype(intp)
keep = ones(N, dtype=bool)
# Test if there are out of bound indices, this is deprecated
inside_bounds = (obj < N) & (obj >= -N)
if not inside_bounds.all():
# 2013-09-24, 1.9
warnings.warn(
"in the future out of bounds indices will raise an error "
"instead of being ignored by `numpy.delete`.",
DeprecationWarning)
obj = obj[inside_bounds]
positive_indices = obj >= 0
if not positive_indices.all():
warnings.warn(
"in the future negative indices will not be ignored by "
"`numpy.delete`.", FutureWarning)
obj = obj[positive_indices]
keep[obj, ] = False
slobj[axis] = keep
new = arr[slobj]
if wrap:
return wrap(new)
else:
return new
def insert(arr, obj, values, axis=None):
"""
Insert values along the given axis before the given indices.
Parameters
----------
arr : array_like
Input array.
obj : int, slice or sequence of ints
Object that defines the index or indices before which `values` is
inserted.
.. versionadded:: 1.8.0
Support for multiple insertions when `obj` is a single scalar or a
sequence with one element (similar to calling insert multiple
times).
values : array_like
Values to insert into `arr`. If the type of `values` is different
from that of `arr`, `values` is converted to the type of `arr`.
`values` should be shaped so that ``arr[...,obj,...] = values``
is legal.
axis : int, optional
Axis along which to insert `values`. If `axis` is None then `arr`
is flattened first.
Returns
-------
out : ndarray
A copy of `arr` with `values` inserted. Note that `insert`
does not occur in-place: a new array is returned. If
`axis` is None, `out` is a flattened array.
See Also
--------
append : Append elements at the end of an array.
concatenate : Join a sequence of arrays along an existing axis.
delete : Delete elements from an array.
Notes
-----
Note that for higher dimensional inserts `obj=0` behaves very different
from `obj=[0]` just like `arr[:,0,:] = values` is different from
`arr[:,[0],:] = values`.
Examples
--------
>>> a = np.array([[1, 1], [2, 2], [3, 3]])
>>> a
array([[1, 1],
[2, 2],
[3, 3]])
>>> np.insert(a, 1, 5)
array([1, 5, 1, 2, 2, 3, 3])
>>> np.insert(a, 1, 5, axis=1)
array([[1, 5, 1],
[2, 5, 2],
[3, 5, 3]])
Difference between sequence and scalars:
>>> np.insert(a, [1], [[1],[2],[3]], axis=1)
array([[1, 1, 1],
[2, 2, 2],
[3, 3, 3]])
>>> np.array_equal(np.insert(a, 1, [1, 2, 3], axis=1),
... np.insert(a, [1], [[1],[2],[3]], axis=1))
True
>>> b = a.flatten()
>>> b
array([1, 1, 2, 2, 3, 3])
>>> np.insert(b, [2, 2], [5, 6])
array([1, 1, 5, 6, 2, 2, 3, 3])
>>> np.insert(b, slice(2, 4), [5, 6])
array([1, 1, 5, 2, 6, 2, 3, 3])
>>> np.insert(b, [2, 2], [7.13, False]) # type casting
array([1, 1, 7, 0, 2, 2, 3, 3])
>>> x = np.arange(8).reshape(2, 4)
>>> idx = (1, 3)
>>> np.insert(x, idx, 999, axis=1)
array([[ 0, 999, 1, 2, 999, 3],
[ 4, 999, 5, 6, 999, 7]])
"""
wrap = None
if type(arr) is not ndarray:
try:
wrap = arr.__array_wrap__
except AttributeError:
pass
arr = asarray(arr)
ndim = arr.ndim
if axis is None:
if ndim != 1:
arr = arr.ravel()
ndim = arr.ndim
axis = ndim - 1
else:
if ndim > 0 and (axis < -ndim or axis >= ndim):
raise IndexError(
"axis %i is out of bounds for an array of "
"dimension %i" % (axis, ndim))
if (axis < 0):
axis += ndim
if (ndim == 0):
# 2013-09-24, 1.9
warnings.warn(
"in the future the special handling of scalars will be removed "
"from insert and raise an error", DeprecationWarning)
arr = arr.copy()
arr[...] = values
if wrap:
return wrap(arr)
else:
return arr
slobj = [slice(None)]*ndim
N = arr.shape[axis]
newshape = list(arr.shape)
if isinstance(obj, slice):
# turn it into a range object
indices = arange(*obj.indices(N), **{'dtype': intp})
else:
# need to copy obj, because indices will be changed in-place
indices = np.array(obj)
if indices.dtype == bool:
# See also delete
warnings.warn(
"in the future insert will treat boolean arrays and "
"array-likes as a boolean index instead of casting it to "
"integer", FutureWarning)
indices = indices.astype(intp)
# Code after warning period:
#if obj.ndim != 1:
# raise ValueError('boolean array argument obj to insert '
# 'must be one dimensional')
#indices = np.flatnonzero(obj)
elif indices.ndim > 1:
raise ValueError(
"index array argument obj to insert must be one dimensional "
"or scalar")
if indices.size == 1:
index = indices.item()
if index < -N or index > N:
raise IndexError(
"index %i is out of bounds for axis %i with "
"size %i" % (obj, axis, N))
if (index < 0):
index += N
# There are some object array corner cases here, but we cannot avoid
# that:
values = array(values, copy=False, ndmin=arr.ndim, dtype=arr.dtype)
if indices.ndim == 0:
# broadcasting is very different here, since a[:,0,:] = ... behaves
# very different from a[:,[0],:] = ...! This changes values so that
# it works likes the second case. (here a[:,0:1,:])
values = np.rollaxis(values, 0, (axis % values.ndim) + 1)
numnew = values.shape[axis]
newshape[axis] += numnew
new = empty(newshape, arr.dtype, arr.flags.fnc)
slobj[axis] = slice(None, index)
new[slobj] = arr[slobj]
slobj[axis] = slice(index, index+numnew)
new[slobj] = values
slobj[axis] = slice(index+numnew, None)
slobj2 = [slice(None)] * ndim
slobj2[axis] = slice(index, None)
new[slobj] = arr[slobj2]
if wrap:
return wrap(new)
return new
elif indices.size == 0 and not isinstance(obj, np.ndarray):
# Can safely cast the empty list to intp
indices = indices.astype(intp)
if not np.can_cast(indices, intp, 'same_kind'):
# 2013-09-24, 1.9
warnings.warn(
"using a non-integer array as obj in insert will result in an "
"error in the future", DeprecationWarning)
indices = indices.astype(intp)
indices[indices < 0] += N
numnew = len(indices)
order = indices.argsort(kind='mergesort') # stable sort
indices[order] += np.arange(numnew)
newshape[axis] += numnew
old_mask = ones(newshape[axis], dtype=bool)
old_mask[indices] = False
new = empty(newshape, arr.dtype, arr.flags.fnc)
slobj2 = [slice(None)]*ndim
slobj[axis] = indices
slobj2[axis] = old_mask
new[slobj] = values
new[slobj2] = arr
if wrap:
return wrap(new)
return new
def append(arr, values, axis=None):
"""
Append values to the end of an array.
Parameters
----------
arr : array_like
Values are appended to a copy of this array.
values : array_like
These values are appended to a copy of `arr`. It must be of the
correct shape (the same shape as `arr`, excluding `axis`). If
`axis` is not specified, `values` can be any shape and will be
flattened before use.
axis : int, optional
The axis along which `values` are appended. If `axis` is not
given, both `arr` and `values` are flattened before use.
Returns
-------
append : ndarray
A copy of `arr` with `values` appended to `axis`. Note that
`append` does not occur in-place: a new array is allocated and
filled. If `axis` is None, `out` is a flattened array.
See Also
--------
insert : Insert elements into an array.
delete : Delete elements from an array.
Examples
--------
>>> np.append([1, 2, 3], [[4, 5, 6], [7, 8, 9]])
array([1, 2, 3, 4, 5, 6, 7, 8, 9])
When `axis` is specified, `values` must have the correct shape.
>>> np.append([[1, 2, 3], [4, 5, 6]], [[7, 8, 9]], axis=0)
array([[1, 2, 3],
[4, 5, 6],
[7, 8, 9]])
>>> np.append([[1, 2, 3], [4, 5, 6]], [7, 8, 9], axis=0)
Traceback (most recent call last):
...
ValueError: arrays must have same number of dimensions
"""
arr = asanyarray(arr)
if axis is None:
if arr.ndim != 1:
arr = arr.ravel()
values = ravel(values)
axis = arr.ndim-1
return concatenate((arr, values), axis=axis)
| bsd-3-clause |
slundberg/shap | tests/explainers/common.py | 1 | 5184 | import tempfile
import numpy as np
import pytest
import shap
def basic_xgboost_scenario(max_samples=None, dataset=shap.datasets.adult):
""" Create a basic XGBoost model on a data set.
"""
xgboost = pytest.importorskip('xgboost')
# get a dataset on income prediction
X, y = dataset()
if max_samples is not None:
X = X.iloc[:max_samples]
y = y[:max_samples]
X = X.values
# train an XGBoost model (but any other model type would also work)
model = xgboost.XGBClassifier()
model.fit(X, y)
return model, X
def basic_translation_scenario():
""" Create a basic transformers translation model and tokenizer.
"""
AutoTokenizer = pytest.importorskip("transformers").AutoTokenizer
AutoModelForSeq2SeqLM = pytest.importorskip("transformers").AutoModelForSeq2SeqLM
tokenizer = AutoTokenizer.from_pretrained("Helsinki-NLP/opus-mt-en-es")
model = AutoModelForSeq2SeqLM.from_pretrained("Helsinki-NLP/opus-mt-en-es")
# define the input sentences we want to translate
data = [
"In this picture, there are four persons: my father, my mother, my brother and my sister.",
"Transformers have rapidly become the model of choice for NLP problems, replacing older recurrent neural network models"
]
return model, tokenizer, data
def test_additivity(explainer_type, model, masker, data, **kwargs):
""" Test explainer and masker for additivity on a single output prediction problem.
"""
explainer = explainer_type(model, masker, **kwargs)
shap_values = explainer(data)
# a multi-output additivity check
if len(shap_values.shape) == 3:
# this works with ragged arrays and for models that we can't call directly (they get auto-wrapped)
for i in range(shap_values.shape[0]):
row = shap_values[i]
if callable(explainer.masker.shape):
all_on_masked = explainer.masker(np.ones(explainer.masker.shape(data[i])[1], dtype=np.bool), data[i])
else:
all_on_masked = explainer.masker(np.ones(explainer.masker.shape[1], dtype=np.bool), data[i])
if not isinstance(all_on_masked, tuple):
all_on_masked = (all_on_masked,)
out = explainer.model(*all_on_masked)
assert np.max(np.abs(row.base_values + row.values.sum(0) - out) < 1e6)
else:
assert np.max(np.abs(shap_values.base_values + shap_values.values.sum(1) - model(data)) < 1e6)
def test_interactions_additivity(explainer_type, model, masker, data, **kwargs):
""" Test explainer and masker for additivity on a single output prediction problem.
"""
explainer = explainer_type(model, masker, **kwargs)
shap_values = explainer(data, interactions=True)
assert np.max(np.abs(shap_values.base_values + shap_values.values.sum((1, 2)) - model(data)) < 1e6)
# def test_multi_class(explainer_type, model, masker, data, **kwargs):
# """ Test explainer and masker for additivity on a multi-class prediction problem.
# """
# explainer_kwargs = {k: kwargs[k] for k in kwargs if k in ["algorithm"]}
# explainer = explainer_type(model.predict_proba, masker, **explainer_kwargs)
# shap_values = explainer(data)
# assert np.max(np.abs(shap_values.base_values + shap_values.values.sum(1) - model.predict_proba(data)) < 1e6)
# def test_interactions(explainer_type):
# """ Check that second order interactions have additivity.
# """
# model, X = basic_xgboost(100)
# # build an Exact explainer and explain the model predictions on the given dataset
# explainer = explainer_type(model.predict, X)
# shap_values = explainer(X, interactions=True)
# assert np.max(np.abs(shap_values.base_values + shap_values.values.sum((1, 2)) - model.predict(X[:100])) < 1e6)
def test_serialization(explainer_type, model, masker, data, rtol=1e-05, atol=1e-8, **kwargs):
""" Test serialization with a given explainer algorithm.
"""
explainer_kwargs = {k: v for k,v in kwargs.items() if k in ["algorithm"]}
explainer_original = explainer_type(model, masker, **explainer_kwargs)
shap_values_original = explainer_original(data[:1])
# Serialization
with tempfile.TemporaryFile() as temp_serialization_file:
save_kwargs = {k: v for k,v in kwargs.items() if k in ["model_saver", "masker_saver"]}
explainer_original.save(temp_serialization_file, **save_kwargs)
# Deserialization
temp_serialization_file.seek(0)
load_kwargs = {k: v for k,v in kwargs.items() if k in ["model_loader", "masker_loader"]}
explainer_new = explainer_type.load(temp_serialization_file, **load_kwargs)
call_kwargs = {k: v for k,v in kwargs.items() if k in ["max_evals"]}
shap_values_new = explainer_new(data[:1], **call_kwargs)
assert np.allclose(shap_values_original.base_values, shap_values_new.base_values, rtol=rtol, atol=atol)
assert np.allclose(shap_values_original[0].values, shap_values_new[0].values, rtol=rtol, atol=atol)
assert isinstance(explainer_original, type(explainer_new))
assert isinstance(explainer_original.masker, type(explainer_new.masker))
| mit |
kyleniemeyer/PyTeCK | pyteck/__main__.py | 1 | 3466 | from argparse import ArgumentParser
import multiprocessing
from .eval_model import evaluate_model
parser = ArgumentParser(description='PyTeCK: Evaluate '
'performance of kinetic models using '
'experimental ignition delay data.'
)
parser.add_argument('-m', '--model',
type=str,
required=True,
help='Input model filename (e.g., mech.cti).'
)
parser.add_argument('-k', '--model-keys',
type=str,
dest='model_keys_file',
required=True,
help='YAML file with keys for species in models.'
)
parser.add_argument('-d', '--dataset',
type=str,
required=True,
help='Filename for list of datasets.'
)
parser.add_argument('-dp', '--data-path',
type=str,
dest='data_path',
required=False,
default='data',
help='Local directory holding dataset files.'
)
parser.add_argument('-mp', '--model-path',
type=str,
dest='model_path',
required=False,
default='models',
help='Local directory holding model files.'
)
parser.add_argument('-rp', '--results-path',
type=str,
dest='results_path',
required=False,
default='results',
help='Local directory holding result HDF5 files.'
)
parser.add_argument('-v', '--model-variant',
type=str,
dest='model_variant_file',
required=False,
help='YAML with variants for models for, e.g., bath '
'gases and pressures.'
)
parser.add_argument('-nt', '--num-threads',
type=int,
dest='num_threads',
default=multiprocessing.cpu_count()-1 or 1,
required=False,
help='The number of threads to use to run simulations in '
'parallel.'
)
parser.add_argument('-p', '--print',
dest='print_results',
action='store_true',
default=False,
help='Print model evaluation results to screen.'
)
parser.add_argument('--restart',
dest='restart',
action='store_true',
default=False,
help='Reuse prior results files, and only calculate new ones.'
)
parser.add_argument('--skip-validation',
dest='skip_validation',
action='store_true',
default=False,
help='Skips ChemKED file validation.'
)
args = parser.parse_args()
evaluate_model(args.model, args.model_keys_file, args.dataset,
args.data_path, args.model_path, args.results_path,
args.model_variant_file, args.num_threads, args.print_results,
args.restart, args.skip_validation,
)
| mit |
ndingwall/scikit-learn | sklearn/utils/fixes.py | 1 | 7209 | """Compatibility fixes for older version of python, numpy and scipy
If you add content to this file, please give the version of the package
at which the fixe is no longer needed.
"""
# Authors: Emmanuelle Gouillart <emmanuelle.gouillart@normalesup.org>
# Gael Varoquaux <gael.varoquaux@normalesup.org>
# Fabian Pedregosa <fpedregosa@acm.org>
# Lars Buitinck
#
# License: BSD 3 clause
from functools import update_wrapper
from distutils.version import LooseVersion
import functools
import numpy as np
import scipy.sparse as sp
import scipy
import scipy.stats
from scipy.sparse.linalg import lsqr as sparse_lsqr # noqa
from numpy.ma import MaskedArray as _MaskedArray # TODO: remove in 0.25
from .._config import config_context, get_config
from .deprecation import deprecated
try:
from pkg_resources import parse_version # type: ignore
except ImportError:
# setuptools not installed
parse_version = LooseVersion # type: ignore
np_version = parse_version(np.__version__)
sp_version = parse_version(scipy.__version__)
if sp_version >= parse_version('1.4'):
from scipy.sparse.linalg import lobpcg
else:
# Backport of lobpcg functionality from scipy 1.4.0, can be removed
# once support for sp_version < parse_version('1.4') is dropped
# mypy error: Name 'lobpcg' already defined (possibly by an import)
from ..externals._lobpcg import lobpcg # type: ignore # noqa
def _object_dtype_isnan(X):
return X != X
# TODO: replace by copy=False, when only scipy > 1.1 is supported.
def _astype_copy_false(X):
"""Returns the copy=False parameter for
{ndarray, csr_matrix, csc_matrix}.astype when possible,
otherwise don't specify
"""
if sp_version >= parse_version('1.1') or not sp.issparse(X):
return {'copy': False}
else:
return {}
def _joblib_parallel_args(**kwargs):
"""Set joblib.Parallel arguments in a compatible way for 0.11 and 0.12+
For joblib 0.11 this maps both ``prefer`` and ``require`` parameters to
a specific ``backend``.
Parameters
----------
prefer : str in {'processes', 'threads'} or None
Soft hint to choose the default backend if no specific backend
was selected with the parallel_backend context manager.
require : 'sharedmem' or None
Hard condstraint to select the backend. If set to 'sharedmem',
the selected backend will be single-host and thread-based even
if the user asked for a non-thread based backend with
parallel_backend.
See joblib.Parallel documentation for more details
"""
import joblib
if parse_version(joblib.__version__) >= parse_version('0.12'):
return kwargs
extra_args = set(kwargs.keys()).difference({'prefer', 'require'})
if extra_args:
raise NotImplementedError('unhandled arguments %s with joblib %s'
% (list(extra_args), joblib.__version__))
args = {}
if 'prefer' in kwargs:
prefer = kwargs['prefer']
if prefer not in ['threads', 'processes', None]:
raise ValueError('prefer=%s is not supported' % prefer)
args['backend'] = {'threads': 'threading',
'processes': 'multiprocessing',
None: None}[prefer]
if 'require' in kwargs:
require = kwargs['require']
if require not in [None, 'sharedmem']:
raise ValueError('require=%s is not supported' % require)
if require == 'sharedmem':
args['backend'] = 'threading'
return args
class loguniform(scipy.stats.reciprocal):
"""A class supporting log-uniform random variables.
Parameters
----------
low : float
The minimum value
high : float
The maximum value
Methods
-------
rvs(self, size=None, random_state=None)
Generate log-uniform random variables
The most useful method for Scikit-learn usage is highlighted here.
For a full list, see
`scipy.stats.reciprocal
<https://docs.scipy.org/doc/scipy/reference/generated/scipy.stats.reciprocal.html>`_.
This list includes all functions of ``scipy.stats`` continuous
distributions such as ``pdf``.
Notes
-----
This class generates values between ``low`` and ``high`` or
low <= loguniform(low, high).rvs() <= high
The logarithmic probability density function (PDF) is uniform. When
``x`` is a uniformly distributed random variable between 0 and 1, ``10**x``
are random variales that are equally likely to be returned.
This class is an alias to ``scipy.stats.reciprocal``, which uses the
reciprocal distribution:
https://en.wikipedia.org/wiki/Reciprocal_distribution
Examples
--------
>>> from sklearn.utils.fixes import loguniform
>>> rv = loguniform(1e-3, 1e1)
>>> rvs = rv.rvs(random_state=42, size=1000)
>>> rvs.min() # doctest: +SKIP
0.0010435856341129003
>>> rvs.max() # doctest: +SKIP
9.97403052786026
"""
@deprecated(
'MaskedArray is deprecated in version 0.23 and will be removed in version '
'0.25. Use numpy.ma.MaskedArray instead.'
)
class MaskedArray(_MaskedArray):
pass # TODO: remove in 0.25
def _take_along_axis(arr, indices, axis):
"""Implements a simplified version of np.take_along_axis if numpy
version < 1.15"""
if np_version >= parse_version('1.15'):
return np.take_along_axis(arr=arr, indices=indices, axis=axis)
else:
if axis is None:
arr = arr.flatten()
if not np.issubdtype(indices.dtype, np.intp):
raise IndexError('`indices` must be an integer array')
if arr.ndim != indices.ndim:
raise ValueError(
"`indices` and `arr` must have the same number of dimensions")
shape_ones = (1,) * indices.ndim
dest_dims = (
list(range(axis)) +
[None] +
list(range(axis+1, indices.ndim))
)
# build a fancy index, consisting of orthogonal aranges, with the
# requested index inserted at the right location
fancy_index = []
for dim, n in zip(dest_dims, arr.shape):
if dim is None:
fancy_index.append(indices)
else:
ind_shape = shape_ones[:dim] + (-1,) + shape_ones[dim+1:]
fancy_index.append(np.arange(n).reshape(ind_shape))
fancy_index = tuple(fancy_index)
return arr[fancy_index]
# remove when https://github.com/joblib/joblib/issues/1071 is fixed
def delayed(function):
"""Decorator used to capture the arguments of a function."""
@functools.wraps(function)
def delayed_function(*args, **kwargs):
return _FuncWrapper(function), args, kwargs
return delayed_function
class _FuncWrapper:
""""Load the global configuration before calling the function."""
def __init__(self, function):
self.function = function
self.config = get_config()
update_wrapper(self, self.function)
def __call__(self, *args, **kwargs):
with config_context(**self.config):
return self.function(*args, **kwargs)
| bsd-3-clause |
ndingwall/scikit-learn | sklearn/random_projection.py | 5 | 23301 | # -*- coding: utf8
"""Random Projection transformers.
Random Projections are a simple and computationally efficient way to
reduce the dimensionality of the data by trading a controlled amount
of accuracy (as additional variance) for faster processing times and
smaller model sizes.
The dimensions and distribution of Random Projections matrices are
controlled so as to preserve the pairwise distances between any two
samples of the dataset.
The main theoretical result behind the efficiency of random projection is the
`Johnson-Lindenstrauss lemma (quoting Wikipedia)
<https://en.wikipedia.org/wiki/Johnson%E2%80%93Lindenstrauss_lemma>`_:
In mathematics, the Johnson-Lindenstrauss lemma is a result
concerning low-distortion embeddings of points from high-dimensional
into low-dimensional Euclidean space. The lemma states that a small set
of points in a high-dimensional space can be embedded into a space of
much lower dimension in such a way that distances between the points are
nearly preserved. The map used for the embedding is at least Lipschitz,
and can even be taken to be an orthogonal projection.
"""
# Authors: Olivier Grisel <olivier.grisel@ensta.org>,
# Arnaud Joly <a.joly@ulg.ac.be>
# License: BSD 3 clause
import warnings
from abc import ABCMeta, abstractmethod
import numpy as np
import scipy.sparse as sp
from .base import BaseEstimator, TransformerMixin
from .utils import check_random_state
from .utils.extmath import safe_sparse_dot
from .utils.random import sample_without_replacement
from .utils.validation import check_array, check_is_fitted
from .utils.validation import _deprecate_positional_args
from .exceptions import DataDimensionalityWarning
__all__ = ["SparseRandomProjection",
"GaussianRandomProjection",
"johnson_lindenstrauss_min_dim"]
@_deprecate_positional_args
def johnson_lindenstrauss_min_dim(n_samples, *, eps=0.1):
"""Find a 'safe' number of components to randomly project to.
The distortion introduced by a random projection `p` only changes the
distance between two points by a factor (1 +- eps) in an euclidean space
with good probability. The projection `p` is an eps-embedding as defined
by:
(1 - eps) ||u - v||^2 < ||p(u) - p(v)||^2 < (1 + eps) ||u - v||^2
Where u and v are any rows taken from a dataset of shape (n_samples,
n_features), eps is in ]0, 1[ and p is a projection by a random Gaussian
N(0, 1) matrix of shape (n_components, n_features) (or a sparse
Achlioptas matrix).
The minimum number of components to guarantee the eps-embedding is
given by:
n_components >= 4 log(n_samples) / (eps^2 / 2 - eps^3 / 3)
Note that the number of dimensions is independent of the original
number of features but instead depends on the size of the dataset:
the larger the dataset, the higher is the minimal dimensionality of
an eps-embedding.
Read more in the :ref:`User Guide <johnson_lindenstrauss>`.
Parameters
----------
n_samples : int or array-like of int
Number of samples that should be a integer greater than 0. If an array
is given, it will compute a safe number of components array-wise.
eps : float or ndarray of shape (n_components,), dtype=float, \
default=0.1
Maximum distortion rate in the range (0,1 ) as defined by the
Johnson-Lindenstrauss lemma. If an array is given, it will compute a
safe number of components array-wise.
Returns
-------
n_components : int or ndarray of int
The minimal number of components to guarantee with good probability
an eps-embedding with n_samples.
Examples
--------
>>> johnson_lindenstrauss_min_dim(1e6, eps=0.5)
663
>>> johnson_lindenstrauss_min_dim(1e6, eps=[0.5, 0.1, 0.01])
array([ 663, 11841, 1112658])
>>> johnson_lindenstrauss_min_dim([1e4, 1e5, 1e6], eps=0.1)
array([ 7894, 9868, 11841])
References
----------
.. [1] https://en.wikipedia.org/wiki/Johnson%E2%80%93Lindenstrauss_lemma
.. [2] Sanjoy Dasgupta and Anupam Gupta, 1999,
"An elementary proof of the Johnson-Lindenstrauss Lemma."
http://citeseer.ist.psu.edu/viewdoc/summary?doi=10.1.1.45.3654
"""
eps = np.asarray(eps)
n_samples = np.asarray(n_samples)
if np.any(eps <= 0.0) or np.any(eps >= 1):
raise ValueError(
"The JL bound is defined for eps in ]0, 1[, got %r" % eps)
if np.any(n_samples) <= 0:
raise ValueError(
"The JL bound is defined for n_samples greater than zero, got %r"
% n_samples)
denominator = (eps ** 2 / 2) - (eps ** 3 / 3)
return (4 * np.log(n_samples) / denominator).astype(int)
def _check_density(density, n_features):
"""Factorize density check according to Li et al."""
if density == 'auto':
density = 1 / np.sqrt(n_features)
elif density <= 0 or density > 1:
raise ValueError("Expected density in range ]0, 1], got: %r"
% density)
return density
def _check_input_size(n_components, n_features):
"""Factorize argument checking for random matrix generation."""
if n_components <= 0:
raise ValueError("n_components must be strictly positive, got %d" %
n_components)
if n_features <= 0:
raise ValueError("n_features must be strictly positive, got %d" %
n_features)
def _gaussian_random_matrix(n_components, n_features, random_state=None):
"""Generate a dense Gaussian random matrix.
The components of the random matrix are drawn from
N(0, 1.0 / n_components).
Read more in the :ref:`User Guide <gaussian_random_matrix>`.
Parameters
----------
n_components : int,
Dimensionality of the target projection space.
n_features : int,
Dimensionality of the original source space.
random_state : int, RandomState instance or None, default=None
Controls the pseudo random number generator used to generate the matrix
at fit time.
Pass an int for reproducible output across multiple function calls.
See :term:`Glossary <random_state>`.
Returns
-------
components : ndarray of shape (n_components, n_features)
The generated Gaussian random matrix.
See Also
--------
GaussianRandomProjection
"""
_check_input_size(n_components, n_features)
rng = check_random_state(random_state)
components = rng.normal(loc=0.0,
scale=1.0 / np.sqrt(n_components),
size=(n_components, n_features))
return components
def _sparse_random_matrix(n_components, n_features, density='auto',
random_state=None):
"""Generalized Achlioptas random sparse matrix for random projection.
Setting density to 1 / 3 will yield the original matrix by Dimitris
Achlioptas while setting a lower value will yield the generalization
by Ping Li et al.
If we note :math:`s = 1 / density`, the components of the random matrix are
drawn from:
- -sqrt(s) / sqrt(n_components) with probability 1 / 2s
- 0 with probability 1 - 1 / s
- +sqrt(s) / sqrt(n_components) with probability 1 / 2s
Read more in the :ref:`User Guide <sparse_random_matrix>`.
Parameters
----------
n_components : int,
Dimensionality of the target projection space.
n_features : int,
Dimensionality of the original source space.
density : float or 'auto', default='auto'
Ratio of non-zero component in the random projection matrix in the
range `(0, 1]`
If density = 'auto', the value is set to the minimum density
as recommended by Ping Li et al.: 1 / sqrt(n_features).
Use density = 1 / 3.0 if you want to reproduce the results from
Achlioptas, 2001.
random_state : int, RandomState instance or None, default=None
Controls the pseudo random number generator used to generate the matrix
at fit time.
Pass an int for reproducible output across multiple function calls.
See :term:`Glossary <random_state>`.
Returns
-------
components : {ndarray, sparse matrix} of shape (n_components, n_features)
The generated Gaussian random matrix. Sparse matrix will be of CSR
format.
See Also
--------
SparseRandomProjection
References
----------
.. [1] Ping Li, T. Hastie and K. W. Church, 2006,
"Very Sparse Random Projections".
https://web.stanford.edu/~hastie/Papers/Ping/KDD06_rp.pdf
.. [2] D. Achlioptas, 2001, "Database-friendly random projections",
http://www.cs.ucsc.edu/~optas/papers/jl.pdf
"""
_check_input_size(n_components, n_features)
density = _check_density(density, n_features)
rng = check_random_state(random_state)
if density == 1:
# skip index generation if totally dense
components = rng.binomial(1, 0.5, (n_components, n_features)) * 2 - 1
return 1 / np.sqrt(n_components) * components
else:
# Generate location of non zero elements
indices = []
offset = 0
indptr = [offset]
for _ in range(n_components):
# find the indices of the non-zero components for row i
n_nonzero_i = rng.binomial(n_features, density)
indices_i = sample_without_replacement(n_features, n_nonzero_i,
random_state=rng)
indices.append(indices_i)
offset += n_nonzero_i
indptr.append(offset)
indices = np.concatenate(indices)
# Among non zero components the probability of the sign is 50%/50%
data = rng.binomial(1, 0.5, size=np.size(indices)) * 2 - 1
# build the CSR structure by concatenating the rows
components = sp.csr_matrix((data, indices, indptr),
shape=(n_components, n_features))
return np.sqrt(1 / density) / np.sqrt(n_components) * components
class BaseRandomProjection(TransformerMixin, BaseEstimator, metaclass=ABCMeta):
"""Base class for random projections.
Warning: This class should not be used directly.
Use derived classes instead.
"""
@abstractmethod
def __init__(self, n_components='auto', *, eps=0.1, dense_output=False,
random_state=None):
self.n_components = n_components
self.eps = eps
self.dense_output = dense_output
self.random_state = random_state
@abstractmethod
def _make_random_matrix(self, n_components, n_features):
"""Generate the random projection matrix.
Parameters
----------
n_components : int,
Dimensionality of the target projection space.
n_features : int,
Dimensionality of the original source space.
Returns
-------
components : {ndarray, sparse matrix} of shape \
(n_components, n_features)
The generated random matrix. Sparse matrix will be of CSR format.
"""
def fit(self, X, y=None):
"""Generate a sparse random projection matrix.
Parameters
----------
X : {ndarray, sparse matrix} of shape (n_samples, n_features)
Training set: only the shape is used to find optimal random
matrix dimensions based on the theory referenced in the
afore mentioned papers.
y
Ignored
Returns
-------
self
"""
X = self._validate_data(X, accept_sparse=['csr', 'csc'])
n_samples, n_features = X.shape
if self.n_components == 'auto':
self.n_components_ = johnson_lindenstrauss_min_dim(
n_samples=n_samples, eps=self.eps)
if self.n_components_ <= 0:
raise ValueError(
'eps=%f and n_samples=%d lead to a target dimension of '
'%d which is invalid' % (
self.eps, n_samples, self.n_components_))
elif self.n_components_ > n_features:
raise ValueError(
'eps=%f and n_samples=%d lead to a target dimension of '
'%d which is larger than the original space with '
'n_features=%d' % (self.eps, n_samples, self.n_components_,
n_features))
else:
if self.n_components <= 0:
raise ValueError("n_components must be greater than 0, got %s"
% self.n_components)
elif self.n_components > n_features:
warnings.warn(
"The number of components is higher than the number of"
" features: n_features < n_components (%s < %s)."
"The dimensionality of the problem will not be reduced."
% (n_features, self.n_components),
DataDimensionalityWarning)
self.n_components_ = self.n_components
# Generate a projection matrix of size [n_components, n_features]
self.components_ = self._make_random_matrix(self.n_components_,
n_features)
# Check contract
assert self.components_.shape == (self.n_components_, n_features), (
'An error has occurred the self.components_ matrix has '
' not the proper shape.')
return self
def transform(self, X):
"""Project the data by using matrix product with the random matrix
Parameters
----------
X : {ndarray, sparse matrix} of shape (n_samples, n_features)
The input data to project into a smaller dimensional space.
Returns
-------
X_new : {ndarray, sparse matrix} of shape (n_samples, n_components)
Projected array.
"""
X = check_array(X, accept_sparse=['csr', 'csc'])
check_is_fitted(self)
if X.shape[1] != self.components_.shape[1]:
raise ValueError(
'Impossible to perform projection:'
'X at fit stage had a different number of features. '
'(%s != %s)' % (X.shape[1], self.components_.shape[1]))
X_new = safe_sparse_dot(X, self.components_.T,
dense_output=self.dense_output)
return X_new
class GaussianRandomProjection(BaseRandomProjection):
"""Reduce dimensionality through Gaussian random projection.
The components of the random matrix are drawn from N(0, 1 / n_components).
Read more in the :ref:`User Guide <gaussian_random_matrix>`.
.. versionadded:: 0.13
Parameters
----------
n_components : int or 'auto', default='auto'
Dimensionality of the target projection space.
n_components can be automatically adjusted according to the
number of samples in the dataset and the bound given by the
Johnson-Lindenstrauss lemma. In that case the quality of the
embedding is controlled by the ``eps`` parameter.
It should be noted that Johnson-Lindenstrauss lemma can yield
very conservative estimated of the required number of components
as it makes no assumption on the structure of the dataset.
eps : float, default=0.1
Parameter to control the quality of the embedding according to
the Johnson-Lindenstrauss lemma when `n_components` is set to
'auto'. The value should be strictly positive.
Smaller values lead to better embedding and higher number of
dimensions (n_components) in the target projection space.
random_state : int, RandomState instance or None, default=None
Controls the pseudo random number generator used to generate the
projection matrix at fit time.
Pass an int for reproducible output across multiple function calls.
See :term:`Glossary <random_state>`.
Attributes
----------
n_components_ : int
Concrete number of components computed when n_components="auto".
components_ : ndarray of shape (n_components, n_features)
Random matrix used for the projection.
Examples
--------
>>> import numpy as np
>>> from sklearn.random_projection import GaussianRandomProjection
>>> rng = np.random.RandomState(42)
>>> X = rng.rand(100, 10000)
>>> transformer = GaussianRandomProjection(random_state=rng)
>>> X_new = transformer.fit_transform(X)
>>> X_new.shape
(100, 3947)
See Also
--------
SparseRandomProjection
"""
@_deprecate_positional_args
def __init__(self, n_components='auto', *, eps=0.1, random_state=None):
super().__init__(
n_components=n_components,
eps=eps,
dense_output=True,
random_state=random_state)
def _make_random_matrix(self, n_components, n_features):
""" Generate the random projection matrix.
Parameters
----------
n_components : int,
Dimensionality of the target projection space.
n_features : int,
Dimensionality of the original source space.
Returns
-------
components : {ndarray, sparse matrix} of shape \
(n_components, n_features)
The generated random matrix. Sparse matrix will be of CSR format.
"""
random_state = check_random_state(self.random_state)
return _gaussian_random_matrix(n_components,
n_features,
random_state=random_state)
class SparseRandomProjection(BaseRandomProjection):
"""Reduce dimensionality through sparse random projection.
Sparse random matrix is an alternative to dense random
projection matrix that guarantees similar embedding quality while being
much more memory efficient and allowing faster computation of the
projected data.
If we note `s = 1 / density` the components of the random matrix are
drawn from:
- -sqrt(s) / sqrt(n_components) with probability 1 / 2s
- 0 with probability 1 - 1 / s
- +sqrt(s) / sqrt(n_components) with probability 1 / 2s
Read more in the :ref:`User Guide <sparse_random_matrix>`.
.. versionadded:: 0.13
Parameters
----------
n_components : int or 'auto', default='auto'
Dimensionality of the target projection space.
n_components can be automatically adjusted according to the
number of samples in the dataset and the bound given by the
Johnson-Lindenstrauss lemma. In that case the quality of the
embedding is controlled by the ``eps`` parameter.
It should be noted that Johnson-Lindenstrauss lemma can yield
very conservative estimated of the required number of components
as it makes no assumption on the structure of the dataset.
density : float or 'auto', default='auto'
Ratio in the range (0, 1] of non-zero component in the random
projection matrix.
If density = 'auto', the value is set to the minimum density
as recommended by Ping Li et al.: 1 / sqrt(n_features).
Use density = 1 / 3.0 if you want to reproduce the results from
Achlioptas, 2001.
eps : float, default=0.1
Parameter to control the quality of the embedding according to
the Johnson-Lindenstrauss lemma when n_components is set to
'auto'. This value should be strictly positive.
Smaller values lead to better embedding and higher number of
dimensions (n_components) in the target projection space.
dense_output : bool, default=False
If True, ensure that the output of the random projection is a
dense numpy array even if the input and random projection matrix
are both sparse. In practice, if the number of components is
small the number of zero components in the projected data will
be very small and it will be more CPU and memory efficient to
use a dense representation.
If False, the projected data uses a sparse representation if
the input is sparse.
random_state : int, RandomState instance or None, default=None
Controls the pseudo random number generator used to generate the
projection matrix at fit time.
Pass an int for reproducible output across multiple function calls.
See :term:`Glossary <random_state>`.
Attributes
----------
n_components_ : int
Concrete number of components computed when n_components="auto".
components_ : sparse matrix of shape (n_components, n_features)
Random matrix used for the projection. Sparse matrix will be of CSR
format.
density_ : float in range 0.0 - 1.0
Concrete density computed from when density = "auto".
Examples
--------
>>> import numpy as np
>>> from sklearn.random_projection import SparseRandomProjection
>>> rng = np.random.RandomState(42)
>>> X = rng.rand(100, 10000)
>>> transformer = SparseRandomProjection(random_state=rng)
>>> X_new = transformer.fit_transform(X)
>>> X_new.shape
(100, 3947)
>>> # very few components are non-zero
>>> np.mean(transformer.components_ != 0)
0.0100...
See Also
--------
GaussianRandomProjection
References
----------
.. [1] Ping Li, T. Hastie and K. W. Church, 2006,
"Very Sparse Random Projections".
https://web.stanford.edu/~hastie/Papers/Ping/KDD06_rp.pdf
.. [2] D. Achlioptas, 2001, "Database-friendly random projections",
https://users.soe.ucsc.edu/~optas/papers/jl.pdf
"""
@_deprecate_positional_args
def __init__(self, n_components='auto', *, density='auto', eps=0.1,
dense_output=False, random_state=None):
super().__init__(
n_components=n_components,
eps=eps,
dense_output=dense_output,
random_state=random_state)
self.density = density
def _make_random_matrix(self, n_components, n_features):
""" Generate the random projection matrix
Parameters
----------
n_components : int
Dimensionality of the target projection space.
n_features : int
Dimensionality of the original source space.
Returns
-------
components : {ndarray, sparse matrix} of shape \
(n_components, n_features)
The generated random matrix. Sparse matrix will be of CSR format.
"""
random_state = check_random_state(self.random_state)
self.density_ = _check_density(self.density, n_features)
return _sparse_random_matrix(n_components,
n_features,
density=self.density_,
random_state=random_state)
| bsd-3-clause |
ElDeveloper/scikit-learn | sklearn/cluster/mean_shift_.py | 7 | 15079 | """Mean shift clustering algorithm.
Mean shift clustering aims to discover *blobs* in a smooth density of
samples. It is a centroid based algorithm, which works by updating candidates
for centroids to be the mean of the points within a given region. These
candidates are then filtered in a post-processing stage to eliminate
near-duplicates to form the final set of centroids.
Seeding is performed using a binning technique for scalability.
"""
# Authors: Conrad Lee <conradlee@gmail.com>
# Alexandre Gramfort <alexandre.gramfort@inria.fr>
# Gael Varoquaux <gael.varoquaux@normalesup.org>
# Martino Sorbaro <martino.sorbaro@ed.ac.uk>
import numpy as np
import warnings
from collections import defaultdict
from ..externals import six
from ..utils.validation import check_is_fitted
from ..utils import extmath, check_random_state, gen_batches, check_array
from ..base import BaseEstimator, ClusterMixin
from ..neighbors import NearestNeighbors
from ..metrics.pairwise import pairwise_distances_argmin
from ..externals.joblib import Parallel
from ..externals.joblib import delayed
def estimate_bandwidth(X, quantile=0.3, n_samples=None, random_state=0):
"""Estimate the bandwidth to use with the mean-shift algorithm.
That this function takes time at least quadratic in n_samples. For large
datasets, it's wise to set that parameter to a small value.
Parameters
----------
X : array-like, shape=[n_samples, n_features]
Input points.
quantile : float, default 0.3
should be between [0, 1]
0.5 means that the median of all pairwise distances is used.
n_samples : int, optional
The number of samples to use. If not given, all samples are used.
random_state : int or RandomState
Pseudo-random number generator state used for random sampling.
Returns
-------
bandwidth : float
The bandwidth parameter.
"""
random_state = check_random_state(random_state)
if n_samples is not None:
idx = random_state.permutation(X.shape[0])[:n_samples]
X = X[idx]
nbrs = NearestNeighbors(n_neighbors=int(X.shape[0] * quantile))
nbrs.fit(X)
bandwidth = 0.
for batch in gen_batches(len(X), 500):
d, _ = nbrs.kneighbors(X[batch, :], return_distance=True)
bandwidth += np.max(d, axis=1).sum()
return bandwidth / X.shape[0]
# separate function for each seed's iterative loop
def _mean_shift_single_seed(my_mean, X, nbrs, max_iter):
# For each seed, climb gradient until convergence or max_iter
bandwidth = nbrs.get_params()['radius']
stop_thresh = 1e-3 * bandwidth # when mean has converged
completed_iterations = 0
while True:
# Find mean of points within bandwidth
i_nbrs = nbrs.radius_neighbors([my_mean], bandwidth,
return_distance=False)[0]
points_within = X[i_nbrs]
if len(points_within) == 0:
break # Depending on seeding strategy this condition may occur
my_old_mean = my_mean # save the old mean
my_mean = np.mean(points_within, axis=0)
# If converged or at max_iter, adds the cluster
if (extmath.norm(my_mean - my_old_mean) < stop_thresh or
completed_iterations == max_iter):
return tuple(my_mean), len(points_within)
completed_iterations += 1
def mean_shift(X, bandwidth=None, seeds=None, bin_seeding=False,
min_bin_freq=1, cluster_all=True, max_iter=300,
n_jobs=1):
"""Perform mean shift clustering of data using a flat kernel.
Read more in the :ref:`User Guide <mean_shift>`.
Parameters
----------
X : array-like, shape=[n_samples, n_features]
Input data.
bandwidth : float, optional
Kernel bandwidth.
If bandwidth is not given, it is determined using a heuristic based on
the median of all pairwise distances. This will take quadratic time in
the number of samples. The sklearn.cluster.estimate_bandwidth function
can be used to do this more efficiently.
seeds : array-like, shape=[n_seeds, n_features] or None
Point used as initial kernel locations. If None and bin_seeding=False,
each data point is used as a seed. If None and bin_seeding=True,
see bin_seeding.
bin_seeding : boolean, default=False
If true, initial kernel locations are not locations of all
points, but rather the location of the discretized version of
points, where points are binned onto a grid whose coarseness
corresponds to the bandwidth. Setting this option to True will speed
up the algorithm because fewer seeds will be initialized.
Ignored if seeds argument is not None.
min_bin_freq : int, default=1
To speed up the algorithm, accept only those bins with at least
min_bin_freq points as seeds.
cluster_all : boolean, default True
If true, then all points are clustered, even those orphans that are
not within any kernel. Orphans are assigned to the nearest kernel.
If false, then orphans are given cluster label -1.
max_iter : int, default 300
Maximum number of iterations, per seed point before the clustering
operation terminates (for that seed point), if has not converged yet.
n_jobs : int
The number of jobs to use for the computation. This works by computing
each of the n_init runs in parallel.
If -1 all CPUs are used. If 1 is given, no parallel computing code is
used at all, which is useful for debugging. For n_jobs below -1,
(n_cpus + 1 + n_jobs) are used. Thus for n_jobs = -2, all CPUs but one
are used.
Returns
-------
cluster_centers : array, shape=[n_clusters, n_features]
Coordinates of cluster centers.
labels : array, shape=[n_samples]
Cluster labels for each point.
Notes
-----
See examples/cluster/plot_meanshift.py for an example.
"""
if bandwidth is None:
bandwidth = estimate_bandwidth(X)
elif bandwidth <= 0:
raise ValueError("bandwidth needs to be greater than zero or None,\
got %f" % bandwidth)
if seeds is None:
if bin_seeding:
seeds = get_bin_seeds(X, bandwidth, min_bin_freq)
else:
seeds = X
n_samples, n_features = X.shape
center_intensity_dict = {}
nbrs = NearestNeighbors(radius=bandwidth).fit(X)
# execute iterations on all seeds in parallel
all_res = Parallel(n_jobs=n_jobs)(
delayed(_mean_shift_single_seed)
(seed, X, nbrs, max_iter) for seed in seeds)
# copy results in a dictionary
for i in range(len(seeds)):
if all_res[i] is not None:
center_intensity_dict[all_res[i][0]] = all_res[i][1]
if not center_intensity_dict:
# nothing near seeds
raise ValueError("No point was within bandwidth=%f of any seed."
" Try a different seeding strategy \
or increase the bandwidth."
% bandwidth)
# POST PROCESSING: remove near duplicate points
# If the distance between two kernels is less than the bandwidth,
# then we have to remove one because it is a duplicate. Remove the
# one with fewer points.
sorted_by_intensity = sorted(center_intensity_dict.items(),
key=lambda tup: tup[1], reverse=True)
sorted_centers = np.array([tup[0] for tup in sorted_by_intensity])
unique = np.ones(len(sorted_centers), dtype=np.bool)
nbrs = NearestNeighbors(radius=bandwidth).fit(sorted_centers)
for i, center in enumerate(sorted_centers):
if unique[i]:
neighbor_idxs = nbrs.radius_neighbors([center],
return_distance=False)[0]
unique[neighbor_idxs] = 0
unique[i] = 1 # leave the current point as unique
cluster_centers = sorted_centers[unique]
# ASSIGN LABELS: a point belongs to the cluster that it is closest to
nbrs = NearestNeighbors(n_neighbors=1).fit(cluster_centers)
labels = np.zeros(n_samples, dtype=np.int)
distances, idxs = nbrs.kneighbors(X)
if cluster_all:
labels = idxs.flatten()
else:
labels.fill(-1)
bool_selector = distances.flatten() <= bandwidth
labels[bool_selector] = idxs.flatten()[bool_selector]
return cluster_centers, labels
def get_bin_seeds(X, bin_size, min_bin_freq=1):
"""Finds seeds for mean_shift.
Finds seeds by first binning data onto a grid whose lines are
spaced bin_size apart, and then choosing those bins with at least
min_bin_freq points.
Parameters
----------
X : array-like, shape=[n_samples, n_features]
Input points, the same points that will be used in mean_shift.
bin_size : float
Controls the coarseness of the binning. Smaller values lead
to more seeding (which is computationally more expensive). If you're
not sure how to set this, set it to the value of the bandwidth used
in clustering.mean_shift.
min_bin_freq : integer, optional
Only bins with at least min_bin_freq will be selected as seeds.
Raising this value decreases the number of seeds found, which
makes mean_shift computationally cheaper.
Returns
-------
bin_seeds : array-like, shape=[n_samples, n_features]
Points used as initial kernel positions in clustering.mean_shift.
"""
# Bin points
bin_sizes = defaultdict(int)
for point in X:
binned_point = np.round(point / bin_size)
bin_sizes[tuple(binned_point)] += 1
# Select only those bins as seeds which have enough members
bin_seeds = np.array([point for point, freq in six.iteritems(bin_sizes) if
freq >= min_bin_freq], dtype=np.float32)
if len(bin_seeds) == len(X):
warnings.warn("Binning data failed with provided bin_size=%f,"
" using data points as seeds." % bin_size)
return X
bin_seeds = bin_seeds * bin_size
return bin_seeds
class MeanShift(BaseEstimator, ClusterMixin):
"""Mean shift clustering using a flat kernel.
Mean shift clustering aims to discover "blobs" in a smooth density of
samples. It is a centroid-based algorithm, which works by updating
candidates for centroids to be the mean of the points within a given
region. These candidates are then filtered in a post-processing stage to
eliminate near-duplicates to form the final set of centroids.
Seeding is performed using a binning technique for scalability.
Read more in the :ref:`User Guide <mean_shift>`.
Parameters
----------
bandwidth : float, optional
Bandwidth used in the RBF kernel.
If not given, the bandwidth is estimated using
sklearn.cluster.estimate_bandwidth; see the documentation for that
function for hints on scalability (see also the Notes, below).
seeds : array, shape=[n_samples, n_features], optional
Seeds used to initialize kernels. If not set,
the seeds are calculated by clustering.get_bin_seeds
with bandwidth as the grid size and default values for
other parameters.
bin_seeding : boolean, optional
If true, initial kernel locations are not locations of all
points, but rather the location of the discretized version of
points, where points are binned onto a grid whose coarseness
corresponds to the bandwidth. Setting this option to True will speed
up the algorithm because fewer seeds will be initialized.
default value: False
Ignored if seeds argument is not None.
min_bin_freq : int, optional
To speed up the algorithm, accept only those bins with at least
min_bin_freq points as seeds. If not defined, set to 1.
cluster_all : boolean, default True
If true, then all points are clustered, even those orphans that are
not within any kernel. Orphans are assigned to the nearest kernel.
If false, then orphans are given cluster label -1.
n_jobs : int
The number of jobs to use for the computation. This works by computing
each of the n_init runs in parallel.
If -1 all CPUs are used. If 1 is given, no parallel computing code is
used at all, which is useful for debugging. For n_jobs below -1,
(n_cpus + 1 + n_jobs) are used. Thus for n_jobs = -2, all CPUs but one
are used.
Attributes
----------
cluster_centers_ : array, [n_clusters, n_features]
Coordinates of cluster centers.
labels_ :
Labels of each point.
Notes
-----
Scalability:
Because this implementation uses a flat kernel and
a Ball Tree to look up members of each kernel, the complexity will is
to O(T*n*log(n)) in lower dimensions, with n the number of samples
and T the number of points. In higher dimensions the complexity will
tend towards O(T*n^2).
Scalability can be boosted by using fewer seeds, for example by using
a higher value of min_bin_freq in the get_bin_seeds function.
Note that the estimate_bandwidth function is much less scalable than the
mean shift algorithm and will be the bottleneck if it is used.
References
----------
Dorin Comaniciu and Peter Meer, "Mean Shift: A robust approach toward
feature space analysis". IEEE Transactions on Pattern Analysis and
Machine Intelligence. 2002. pp. 603-619.
"""
def __init__(self, bandwidth=None, seeds=None, bin_seeding=False,
min_bin_freq=1, cluster_all=True, n_jobs=1):
self.bandwidth = bandwidth
self.seeds = seeds
self.bin_seeding = bin_seeding
self.cluster_all = cluster_all
self.min_bin_freq = min_bin_freq
self.n_jobs = n_jobs
def fit(self, X, y=None):
"""Perform clustering.
Parameters
-----------
X : array-like, shape=[n_samples, n_features]
Samples to cluster.
"""
X = check_array(X)
self.cluster_centers_, self.labels_ = \
mean_shift(X, bandwidth=self.bandwidth, seeds=self.seeds,
min_bin_freq=self.min_bin_freq,
bin_seeding=self.bin_seeding,
cluster_all=self.cluster_all, n_jobs=self.n_jobs)
return self
def predict(self, X):
"""Predict the closest cluster each sample in X belongs to.
Parameters
----------
X : {array-like, sparse matrix}, shape=[n_samples, n_features]
New data to predict.
Returns
-------
labels : array, shape [n_samples,]
Index of the cluster each sample belongs to.
"""
check_is_fitted(self, "cluster_centers_")
return pairwise_distances_argmin(X, self.cluster_centers_)
| bsd-3-clause |
kagayakidan/scikit-learn | examples/exercises/plot_iris_exercise.py | 320 | 1602 | """
================================
SVM Exercise
================================
A tutorial exercise for using different SVM kernels.
This exercise is used in the :ref:`using_kernels_tut` part of the
:ref:`supervised_learning_tut` section of the :ref:`stat_learn_tut_index`.
"""
print(__doc__)
import numpy as np
import matplotlib.pyplot as plt
from sklearn import datasets, svm
iris = datasets.load_iris()
X = iris.data
y = iris.target
X = X[y != 0, :2]
y = y[y != 0]
n_sample = len(X)
np.random.seed(0)
order = np.random.permutation(n_sample)
X = X[order]
y = y[order].astype(np.float)
X_train = X[:.9 * n_sample]
y_train = y[:.9 * n_sample]
X_test = X[.9 * n_sample:]
y_test = y[.9 * n_sample:]
# fit the model
for fig_num, kernel in enumerate(('linear', 'rbf', 'poly')):
clf = svm.SVC(kernel=kernel, gamma=10)
clf.fit(X_train, y_train)
plt.figure(fig_num)
plt.clf()
plt.scatter(X[:, 0], X[:, 1], c=y, zorder=10, cmap=plt.cm.Paired)
# Circle out the test data
plt.scatter(X_test[:, 0], X_test[:, 1], s=80, facecolors='none', zorder=10)
plt.axis('tight')
x_min = X[:, 0].min()
x_max = X[:, 0].max()
y_min = X[:, 1].min()
y_max = X[:, 1].max()
XX, YY = np.mgrid[x_min:x_max:200j, y_min:y_max:200j]
Z = clf.decision_function(np.c_[XX.ravel(), YY.ravel()])
# Put the result into a color plot
Z = Z.reshape(XX.shape)
plt.pcolormesh(XX, YY, Z > 0, cmap=plt.cm.Paired)
plt.contour(XX, YY, Z, colors=['k', 'k', 'k'], linestyles=['--', '-', '--'],
levels=[-.5, 0, .5])
plt.title(kernel)
plt.show()
| bsd-3-clause |
shahankhatch/scikit-learn | sklearn/utils/fixes.py | 132 | 12882 | """Compatibility fixes for older version of python, numpy and scipy
If you add content to this file, please give the version of the package
at which the fixe is no longer needed.
"""
# Authors: Emmanuelle Gouillart <emmanuelle.gouillart@normalesup.org>
# Gael Varoquaux <gael.varoquaux@normalesup.org>
# Fabian Pedregosa <fpedregosa@acm.org>
# Lars Buitinck
#
# License: BSD 3 clause
import inspect
import warnings
import sys
import functools
import os
import errno
import numpy as np
import scipy.sparse as sp
import scipy
def _parse_version(version_string):
version = []
for x in version_string.split('.'):
try:
version.append(int(x))
except ValueError:
# x may be of the form dev-1ea1592
version.append(x)
return tuple(version)
np_version = _parse_version(np.__version__)
sp_version = _parse_version(scipy.__version__)
try:
from scipy.special import expit # SciPy >= 0.10
with np.errstate(invalid='ignore', over='ignore'):
if np.isnan(expit(1000)): # SciPy < 0.14
raise ImportError("no stable expit in scipy.special")
except ImportError:
def expit(x, out=None):
"""Logistic sigmoid function, ``1 / (1 + exp(-x))``.
See sklearn.utils.extmath.log_logistic for the log of this function.
"""
if out is None:
out = np.empty(np.atleast_1d(x).shape, dtype=np.float64)
out[:] = x
# 1 / (1 + exp(-x)) = (1 + tanh(x / 2)) / 2
# This way of computing the logistic is both fast and stable.
out *= .5
np.tanh(out, out)
out += 1
out *= .5
return out.reshape(np.shape(x))
# little danse to see if np.copy has an 'order' keyword argument
if 'order' in inspect.getargspec(np.copy)[0]:
def safe_copy(X):
# Copy, but keep the order
return np.copy(X, order='K')
else:
# Before an 'order' argument was introduced, numpy wouldn't muck with
# the ordering
safe_copy = np.copy
try:
if (not np.allclose(np.divide(.4, 1, casting="unsafe"),
np.divide(.4, 1, casting="unsafe", dtype=np.float))
or not np.allclose(np.divide(.4, 1), .4)):
raise TypeError('Divide not working with dtype: '
'https://github.com/numpy/numpy/issues/3484')
divide = np.divide
except TypeError:
# Compat for old versions of np.divide that do not provide support for
# the dtype args
def divide(x1, x2, out=None, dtype=None):
out_orig = out
if out is None:
out = np.asarray(x1, dtype=dtype)
if out is x1:
out = x1.copy()
else:
if out is not x1:
out[:] = x1
if dtype is not None and out.dtype != dtype:
out = out.astype(dtype)
out /= x2
if out_orig is None and np.isscalar(x1):
out = np.asscalar(out)
return out
try:
np.array(5).astype(float, copy=False)
except TypeError:
# Compat where astype accepted no copy argument
def astype(array, dtype, copy=True):
if not copy and array.dtype == dtype:
return array
return array.astype(dtype)
else:
astype = np.ndarray.astype
try:
with warnings.catch_warnings(record=True):
# Don't raise the numpy deprecation warnings that appear in
# 1.9, but avoid Python bug due to simplefilter('ignore')
warnings.simplefilter('always')
sp.csr_matrix([1.0, 2.0, 3.0]).max(axis=0)
except (TypeError, AttributeError):
# in scipy < 14.0, sparse matrix min/max doesn't accept an `axis` argument
# the following code is taken from the scipy 0.14 codebase
def _minor_reduce(X, ufunc):
major_index = np.flatnonzero(np.diff(X.indptr))
if X.data.size == 0 and major_index.size == 0:
# Numpy < 1.8.0 don't handle empty arrays in reduceat
value = np.zeros_like(X.data)
else:
value = ufunc.reduceat(X.data, X.indptr[major_index])
return major_index, value
def _min_or_max_axis(X, axis, min_or_max):
N = X.shape[axis]
if N == 0:
raise ValueError("zero-size array to reduction operation")
M = X.shape[1 - axis]
mat = X.tocsc() if axis == 0 else X.tocsr()
mat.sum_duplicates()
major_index, value = _minor_reduce(mat, min_or_max)
not_full = np.diff(mat.indptr)[major_index] < N
value[not_full] = min_or_max(value[not_full], 0)
mask = value != 0
major_index = np.compress(mask, major_index)
value = np.compress(mask, value)
from scipy.sparse import coo_matrix
if axis == 0:
res = coo_matrix((value, (np.zeros(len(value)), major_index)),
dtype=X.dtype, shape=(1, M))
else:
res = coo_matrix((value, (major_index, np.zeros(len(value)))),
dtype=X.dtype, shape=(M, 1))
return res.A.ravel()
def _sparse_min_or_max(X, axis, min_or_max):
if axis is None:
if 0 in X.shape:
raise ValueError("zero-size array to reduction operation")
zero = X.dtype.type(0)
if X.nnz == 0:
return zero
m = min_or_max.reduce(X.data.ravel())
if X.nnz != np.product(X.shape):
m = min_or_max(zero, m)
return m
if axis < 0:
axis += 2
if (axis == 0) or (axis == 1):
return _min_or_max_axis(X, axis, min_or_max)
else:
raise ValueError("invalid axis, use 0 for rows, or 1 for columns")
def sparse_min_max(X, axis):
return (_sparse_min_or_max(X, axis, np.minimum),
_sparse_min_or_max(X, axis, np.maximum))
else:
def sparse_min_max(X, axis):
return (X.min(axis=axis).toarray().ravel(),
X.max(axis=axis).toarray().ravel())
try:
from numpy import argpartition
except ImportError:
# numpy.argpartition was introduced in v 1.8.0
def argpartition(a, kth, axis=-1, kind='introselect', order=None):
return np.argsort(a, axis=axis, order=order)
try:
from itertools import combinations_with_replacement
except ImportError:
# Backport of itertools.combinations_with_replacement for Python 2.6,
# from Python 3.4 documentation (http://tinyurl.com/comb-w-r), copyright
# Python Software Foundation (https://docs.python.org/3/license.html)
def combinations_with_replacement(iterable, r):
# combinations_with_replacement('ABC', 2) --> AA AB AC BB BC CC
pool = tuple(iterable)
n = len(pool)
if not n and r:
return
indices = [0] * r
yield tuple(pool[i] for i in indices)
while True:
for i in reversed(range(r)):
if indices[i] != n - 1:
break
else:
return
indices[i:] = [indices[i] + 1] * (r - i)
yield tuple(pool[i] for i in indices)
try:
from numpy import isclose
except ImportError:
def isclose(a, b, rtol=1.e-5, atol=1.e-8, equal_nan=False):
"""
Returns a boolean array where two arrays are element-wise equal within
a tolerance.
This function was added to numpy v1.7.0, and the version you are
running has been backported from numpy v1.8.1. See its documentation
for more details.
"""
def within_tol(x, y, atol, rtol):
with np.errstate(invalid='ignore'):
result = np.less_equal(abs(x - y), atol + rtol * abs(y))
if np.isscalar(a) and np.isscalar(b):
result = bool(result)
return result
x = np.array(a, copy=False, subok=True, ndmin=1)
y = np.array(b, copy=False, subok=True, ndmin=1)
xfin = np.isfinite(x)
yfin = np.isfinite(y)
if all(xfin) and all(yfin):
return within_tol(x, y, atol, rtol)
else:
finite = xfin & yfin
cond = np.zeros_like(finite, subok=True)
# Since we're using boolean indexing, x & y must be the same shape.
# Ideally, we'd just do x, y = broadcast_arrays(x, y). It's in
# lib.stride_tricks, though, so we can't import it here.
x = x * np.ones_like(cond)
y = y * np.ones_like(cond)
# Avoid subtraction with infinite/nan values...
cond[finite] = within_tol(x[finite], y[finite], atol, rtol)
# Check for equality of infinite values...
cond[~finite] = (x[~finite] == y[~finite])
if equal_nan:
# Make NaN == NaN
cond[np.isnan(x) & np.isnan(y)] = True
return cond
if np_version < (1, 7):
# Prior to 1.7.0, np.frombuffer wouldn't work for empty first arg.
def frombuffer_empty(buf, dtype):
if len(buf) == 0:
return np.empty(0, dtype=dtype)
else:
return np.frombuffer(buf, dtype=dtype)
else:
frombuffer_empty = np.frombuffer
if np_version < (1, 8):
def in1d(ar1, ar2, assume_unique=False, invert=False):
# Backport of numpy function in1d 1.8.1 to support numpy 1.6.2
# Ravel both arrays, behavior for the first array could be different
ar1 = np.asarray(ar1).ravel()
ar2 = np.asarray(ar2).ravel()
# This code is significantly faster when the condition is satisfied.
if len(ar2) < 10 * len(ar1) ** 0.145:
if invert:
mask = np.ones(len(ar1), dtype=np.bool)
for a in ar2:
mask &= (ar1 != a)
else:
mask = np.zeros(len(ar1), dtype=np.bool)
for a in ar2:
mask |= (ar1 == a)
return mask
# Otherwise use sorting
if not assume_unique:
ar1, rev_idx = np.unique(ar1, return_inverse=True)
ar2 = np.unique(ar2)
ar = np.concatenate((ar1, ar2))
# We need this to be a stable sort, so always use 'mergesort'
# here. The values from the first array should always come before
# the values from the second array.
order = ar.argsort(kind='mergesort')
sar = ar[order]
if invert:
bool_ar = (sar[1:] != sar[:-1])
else:
bool_ar = (sar[1:] == sar[:-1])
flag = np.concatenate((bool_ar, [invert]))
indx = order.argsort(kind='mergesort')[:len(ar1)]
if assume_unique:
return flag[indx]
else:
return flag[indx][rev_idx]
else:
from numpy import in1d
if sp_version < (0, 15):
# Backport fix for scikit-learn/scikit-learn#2986 / scipy/scipy#4142
from ._scipy_sparse_lsqr_backport import lsqr as sparse_lsqr
else:
from scipy.sparse.linalg import lsqr as sparse_lsqr
if sys.version_info < (2, 7, 0):
# partial cannot be pickled in Python 2.6
# http://bugs.python.org/issue1398
class partial(object):
def __init__(self, func, *args, **keywords):
functools.update_wrapper(self, func)
self.func = func
self.args = args
self.keywords = keywords
def __call__(self, *args, **keywords):
args = self.args + args
kwargs = self.keywords.copy()
kwargs.update(keywords)
return self.func(*args, **kwargs)
else:
from functools import partial
if np_version < (1, 6, 2):
# Allow bincount to accept empty arrays
# https://github.com/numpy/numpy/commit/40f0844846a9d7665616b142407a3d74cb65a040
def bincount(x, weights=None, minlength=None):
if len(x) > 0:
return np.bincount(x, weights, minlength)
else:
if minlength is None:
minlength = 0
minlength = np.asscalar(np.asarray(minlength, dtype=np.intp))
return np.zeros(minlength, dtype=np.intp)
else:
from numpy import bincount
if 'exist_ok' in inspect.getargspec(os.makedirs).args:
makedirs = os.makedirs
else:
def makedirs(name, mode=0o777, exist_ok=False):
"""makedirs(name [, mode=0o777][, exist_ok=False])
Super-mkdir; create a leaf directory and all intermediate ones. Works
like mkdir, except that any intermediate path segment (not just the
rightmost) will be created if it does not exist. If the target
directory already exists, raise an OSError if exist_ok is False.
Otherwise no exception is raised. This is recursive.
"""
try:
os.makedirs(name, mode=mode)
except OSError as e:
if (not exist_ok or e.errno != errno.EEXIST
or not os.path.isdir(name)):
raise
| bsd-3-clause |
kevin-intel/scikit-learn | setup.py | 1 | 11665 | #! /usr/bin/env python
#
# Copyright (C) 2007-2009 Cournapeau David <cournape@gmail.com>
# 2010 Fabian Pedregosa <fabian.pedregosa@inria.fr>
# License: 3-clause BSD
import sys
import os
import platform
import shutil
# We need to import setuptools before because it monkey-patches distutils
import setuptools # noqa
from distutils.command.clean import clean as Clean
from distutils.command.sdist import sdist
import traceback
import importlib
try:
import builtins
except ImportError:
# Python 2 compat: just to be able to declare that Python >=3.7 is needed.
import __builtin__ as builtins
# This is a bit (!) hackish: we are setting a global variable so that the
# main sklearn __init__ can detect if it is being loaded by the setup
# routine, to avoid attempting to load components that aren't built yet:
# the numpy distutils extensions that are used by scikit-learn to
# recursively build the compiled extensions in sub-packages is based on the
# Python import machinery.
builtins.__SKLEARN_SETUP__ = True
DISTNAME = 'scikit-learn'
DESCRIPTION = 'A set of python modules for machine learning and data mining'
with open('README.rst') as f:
LONG_DESCRIPTION = f.read()
MAINTAINER = 'Andreas Mueller'
MAINTAINER_EMAIL = 'amueller@ais.uni-bonn.de'
URL = 'http://scikit-learn.org'
DOWNLOAD_URL = 'https://pypi.org/project/scikit-learn/#files'
LICENSE = 'new BSD'
PROJECT_URLS = {
'Bug Tracker': 'https://github.com/scikit-learn/scikit-learn/issues',
'Documentation': 'https://scikit-learn.org/stable/documentation.html',
'Source Code': 'https://github.com/scikit-learn/scikit-learn'
}
# We can actually import a restricted version of sklearn that
# does not need the compiled code
import sklearn # noqa
import sklearn._min_dependencies as min_deps # noqa
from sklearn.externals._packaging.version import parse as parse_version # noqa
VERSION = sklearn.__version__
# For some commands, use setuptools
SETUPTOOLS_COMMANDS = {
'develop', 'release', 'bdist_egg', 'bdist_rpm',
'bdist_wininst', 'install_egg_info', 'build_sphinx',
'egg_info', 'easy_install', 'upload', 'bdist_wheel',
'--single-version-externally-managed',
}
if SETUPTOOLS_COMMANDS.intersection(sys.argv):
extra_setuptools_args = dict(
zip_safe=False, # the package can run out of an .egg file
include_package_data=True,
extras_require={
key: min_deps.tag_to_packages[key] for
key in ['examples', 'docs', 'tests', 'benchmark']
},
)
else:
extra_setuptools_args = dict()
# Custom clean command to remove build artifacts
class CleanCommand(Clean):
description = "Remove build artifacts from the source tree"
def run(self):
Clean.run(self)
# Remove c files if we are not within a sdist package
cwd = os.path.abspath(os.path.dirname(__file__))
remove_c_files = not os.path.exists(os.path.join(cwd, 'PKG-INFO'))
if remove_c_files:
print('Will remove generated .c files')
if os.path.exists('build'):
shutil.rmtree('build')
for dirpath, dirnames, filenames in os.walk('sklearn'):
for filename in filenames:
if any(filename.endswith(suffix) for suffix in
(".so", ".pyd", ".dll", ".pyc")):
os.unlink(os.path.join(dirpath, filename))
continue
extension = os.path.splitext(filename)[1]
if remove_c_files and extension in ['.c', '.cpp']:
pyx_file = str.replace(filename, extension, '.pyx')
if os.path.exists(os.path.join(dirpath, pyx_file)):
os.unlink(os.path.join(dirpath, filename))
for dirname in dirnames:
if dirname == '__pycache__':
shutil.rmtree(os.path.join(dirpath, dirname))
cmdclass = {'clean': CleanCommand, 'sdist': sdist}
# Custom build_ext command to set OpenMP compile flags depending on os and
# compiler. Also makes it possible to set the parallelism level via
# and environment variable (useful for the wheel building CI).
# build_ext has to be imported after setuptools
try:
from numpy.distutils.command.build_ext import build_ext # noqa
class build_ext_subclass(build_ext):
def finalize_options(self):
super().finalize_options()
if self.parallel is None:
# Do not override self.parallel if already defined by
# command-line flag (--parallel or -j)
parallel = os.environ.get("SKLEARN_BUILD_PARALLEL")
if parallel:
self.parallel = int(parallel)
if self.parallel:
print("setting parallel=%d " % self.parallel)
def build_extensions(self):
from sklearn._build_utils.openmp_helpers import get_openmp_flag
if sklearn._OPENMP_SUPPORTED:
openmp_flag = get_openmp_flag(self.compiler)
for e in self.extensions:
e.extra_compile_args += openmp_flag
e.extra_link_args += openmp_flag
build_ext.build_extensions(self)
cmdclass['build_ext'] = build_ext_subclass
except ImportError:
# Numpy should not be a dependency just to be able to introspect
# that python 3.7 is required.
pass
# Optional wheelhouse-uploader features
# To automate release of binary packages for scikit-learn we need a tool
# to download the packages generated by travis and appveyor workers (with
# version number matching the current release) and upload them all at once
# to PyPI at release time.
# The URL of the artifact repositories are configured in the setup.cfg file.
WHEELHOUSE_UPLOADER_COMMANDS = {'fetch_artifacts', 'upload_all'}
if WHEELHOUSE_UPLOADER_COMMANDS.intersection(sys.argv):
import wheelhouse_uploader.cmd
cmdclass.update(vars(wheelhouse_uploader.cmd))
def configuration(parent_package='', top_path=None):
if os.path.exists('MANIFEST'):
os.remove('MANIFEST')
from numpy.distutils.misc_util import Configuration
from sklearn._build_utils import _check_cython_version
config = Configuration(None, parent_package, top_path)
# Avoid non-useful msg:
# "Ignoring attempt to set 'name' (from ... "
config.set_options(ignore_setup_xxx_py=True,
assume_default_configuration=True,
delegate_options_to_subpackages=True,
quiet=True)
# Cython is required by config.add_subpackage for templated extensions
# that need the tempita sub-submodule. So check that we have the correct
# version of Cython so as to be able to raise a more informative error
# message from the start if it's not the case.
_check_cython_version()
config.add_subpackage('sklearn')
return config
def check_package_status(package, min_version):
"""
Returns a dictionary containing a boolean specifying whether given package
is up-to-date, along with the version string (empty string if
not installed).
"""
package_status = {}
try:
module = importlib.import_module(package)
package_version = module.__version__
package_status['up_to_date'] = parse_version(
package_version) >= parse_version(min_version)
package_status['version'] = package_version
except ImportError:
traceback.print_exc()
package_status['up_to_date'] = False
package_status['version'] = ""
req_str = "scikit-learn requires {} >= {}.\n".format(
package, min_version)
instructions = ("Installation instructions are available on the "
"scikit-learn website: "
"http://scikit-learn.org/stable/install.html\n")
if package_status['up_to_date'] is False:
if package_status['version']:
raise ImportError("Your installation of {} "
"{} is out-of-date.\n{}{}"
.format(package, package_status['version'],
req_str, instructions))
else:
raise ImportError("{} is not "
"installed.\n{}{}"
.format(package, req_str, instructions))
def setup_package():
metadata = dict(name=DISTNAME,
maintainer=MAINTAINER,
maintainer_email=MAINTAINER_EMAIL,
description=DESCRIPTION,
license=LICENSE,
url=URL,
download_url=DOWNLOAD_URL,
project_urls=PROJECT_URLS,
version=VERSION,
long_description=LONG_DESCRIPTION,
classifiers=['Intended Audience :: Science/Research',
'Intended Audience :: Developers',
'License :: OSI Approved',
'Programming Language :: C',
'Programming Language :: Python',
'Topic :: Software Development',
'Topic :: Scientific/Engineering',
'Development Status :: 5 - Production/Stable',
'Operating System :: Microsoft :: Windows',
'Operating System :: POSIX',
'Operating System :: Unix',
'Operating System :: MacOS',
'Programming Language :: Python :: 3',
'Programming Language :: Python :: 3.7',
'Programming Language :: Python :: 3.8',
'Programming Language :: Python :: 3.9',
('Programming Language :: Python :: '
'Implementation :: CPython'),
('Programming Language :: Python :: '
'Implementation :: PyPy')
],
cmdclass=cmdclass,
python_requires=">=3.7",
install_requires=min_deps.tag_to_packages['install'],
package_data={'': ['*.pxd']},
**extra_setuptools_args)
commands = [arg for arg in sys.argv[1:] if not arg.startswith('-')]
if all(command in ('egg_info', 'dist_info', 'clean', 'check')
for command in commands):
# These actions are required to succeed without Numpy for example when
# pip is used to install Scikit-learn when Numpy is not yet present in
# the system.
# These commands use setup from setuptools
from setuptools import setup
metadata['version'] = VERSION
else:
if sys.version_info < (3, 6):
raise RuntimeError(
"Scikit-learn requires Python 3.7 or later. The current"
" Python version is %s installed in %s."
% (platform.python_version(), sys.executable))
check_package_status('numpy', min_deps.NUMPY_MIN_VERSION)
check_package_status('scipy', min_deps.SCIPY_MIN_VERSION)
# These commands require the setup from numpy.distutils because they
# may use numpy.distutils compiler classes.
from numpy.distutils.core import setup
metadata['configuration'] = configuration
setup(**metadata)
if __name__ == "__main__":
setup_package()
| bsd-3-clause |
mkraemer67/pylearn2 | pylearn2/tests/test_theano.py | 45 | 4805 | """ Include tests related to Theano.
1) One test on one thing Pylearn2 depend to be done by Theano.
2) One test for a rare corner case crash in Theano that we where not
able to reproduce rapidly enough without having this tests depend on
Pylearn2.
"""
__authors__ = "Ian Goodfellow"
__copyright__ = "Copyright 2010-2012, Universite de Montreal"
__credits__ = ["Ian Goodfellow"]
__license__ = "3-clause BSD"
__maintainer__ = "LISA Lab"
__email__ = "pylearn-dev@googlegroups"
import numpy as np
import theano
from theano import tensor as T
import pylearn2
from pylearn2.config import yaml_parse
from pylearn2.testing.skip import skip_if_no_gpu
def test_grad():
"""Tests that the theano grad method returns a list if it is passed a list
and a single variable if it is passed a single variable.
pylearn2 depends on theano behaving this way but theano developers have
repeatedly changed it """
X = T.matrix()
y = X.sum()
G = T.grad(y, [X])
assert isinstance(G, list)
G = T.grad(y, X)
assert not isinstance(G, list)
def test_biglayer():
"""Test a crash during Theano compilation. It would be too long to
redo this test without depending on Pylearn2. So we put it
here.
"""
skip_if_no_gpu()
yaml_string = """
!obj:pylearn2.train.Train {
dataset: &train
!obj:pylearn2.testing.datasets.random_one_hot_topological_dense_design_matrix {
rng: !obj:numpy.random.RandomState { seed: [2014, 6, 6] },
shape: &input_shape [%(xsize)i, %(ysize)i],
channels: 4,
axes: ['c', 0, 1, 'b'],
num_examples: 128,
num_classes: 10
},
model: !obj:pylearn2.models.mlp.MLP {
batch_size: 128,
layers: [
!obj:pylearn2.models.mlp.FlattenerLayer {
raw_layer: !obj:pylearn2.models.mlp.CompositeLayer {
layer_name: 'h0',
layers: [
!obj:pylearn2.models.mlp.MLP {
layer_name: 'h1',
layers: [
!obj:pylearn2.models.maxout.MaxoutConvC01B {
layer_name: 'conv00',
tied_b: 1,
W_lr_scale: .05,
b_lr_scale: .05,
num_channels: 16,
num_pieces: 1,
kernel_shape: [1, 1],
pool_shape: [4, 4],
pool_stride: [4, 4],
irange: .005,
max_kernel_norm: 0.9,
}
]},
!obj:pylearn2.models.maxout.Maxout {
layer_name: 'max0',
W_lr_scale: .1,
b_lr_scale: .1,
num_units: 16,
irange: .005,
max_col_norm: 1.9365,
num_pieces: 1,
}
]
}
},
!obj:pylearn2.models.mlp.Softmax {
max_col_norm: 1.9365,
layer_name: 'y',
n_classes: 10,
irange: .005
}
],
input_space: !obj:pylearn2.space.Conv2DSpace {
shape: *input_shape,
num_channels: 4,
axes: ['c', 0, 1, 'b'],
},
},
algorithm: !obj:pylearn2.training_algorithms.sgd.SGD {
learning_rate: .05,
learning_rule: !obj:pylearn2.training_algorithms.learning_rule.Momentum {
init_momentum: 0.5,
},
monitoring_dataset:
{
'train': *train
},
termination_criterion: !obj:pylearn2.termination_criteria.EpochCounter {
max_epochs: 3
},
},
extensions: [
!obj:pylearn2.training_algorithms.learning_rule.MomentumAdjustor {
start: 1,
saturate: 250,
final_momentum: .7
}
]
}
"""
try:
orig_floatX = theano.config.floatX
theano.config.floatX = 'float32'
theano.sandbox.cuda.use('gpu')
x_size, y_size = 4, 4
parameters = {'xsize': x_size, 'ysize': y_size}
test = yaml_parse.load(yaml_string % parameters)
test.main_loop()
finally:
theano.config.floatX = orig_floatX
theano.sandbox.cuda.unuse()
| bsd-3-clause |
llooker/public-datasets-pipelines | datasets/census_bureau_acs/pipelines/schooldistrictsecondary_2019_5yr/schooldistrictsecondary_2019_5yr_dag.py | 1 | 32894 | # Copyright 2021 Google LLC
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
from airflow import DAG
from airflow.providers.cncf.kubernetes.operators import kubernetes_pod
from airflow.providers.google.cloud.transfers import gcs_to_bigquery
default_args = {
"owner": "Google",
"depends_on_past": False,
"start_date": "2021-03-01",
}
with DAG(
dag_id="census_bureau_acs.schooldistrictsecondary_2019_5yr",
default_args=default_args,
max_active_runs=1,
schedule_interval="@once",
catchup=False,
default_view="graph",
) as dag:
# Run CSV transform within kubernetes pod
transform_csv = kubernetes_pod.KubernetesPodOperator(
task_id="transform_csv",
startup_timeout_seconds=600,
name="schooldistrictsecondary_2019_5yr",
namespace="composer",
service_account_name="datasets",
image_pull_policy="Always",
image="{{ var.json.census_bureau_acs.container_registry.run_csv_transform_kub }}",
env_vars={
"SOURCE_URL": "https://api.census.gov/data/2019/acs/acs~year_report~?get=NAME,~group_id~_~row_position~E&for=~api_naming_convention~:*&in=state:~state_code~&key=550e53635053be51754b09b5e9f5009c94aa0586",
"YEAR_REPORT": "5",
"API_NAMING_CONVENTION": "school%20district%20(secondary)",
"TARGET_FILE": "files/data_output.csv",
"TARGET_GCS_BUCKET": "{{ var.value.composer_bucket }}",
"TARGET_GCS_PATH": "data/census_bureau_acs/schooldistrictsecondary_2019_5yr/data_output.csv",
"PIPELINE_NAME": "schooldistrictsecondary_2019_5yr",
"GEOGRAPHY": "schooldistrictsecondary",
"REPORT_LEVEL": "state_level",
"CONCAT_COL": '["state","school_district"]',
"RENAME_MAPPINGS": '{"0":"name", "1":"KPI_Value", "2":"state", "3":"school_district"}',
"CSV_HEADERS": '["geo_id","aggregate_travel_time_to_work","amerindian_including_hispanic","amerindian_pop","armed_forces","asian_including_hispanic","asian_male_45_54","asian_male_55_64","asian_pop","associates_degree","bachelors_degree","bachelors_degree_2","bachelors_degree_or_higher_25_64","black_including_hispanic","black_male_45_54","black_male_55_64","black_pop","children","children_in_single_female_hh","civilian_labor_force","commute_10_14_mins","commute_15_19_mins","commute_20_24_mins","commute_25_29_mins","commute_30_34_mins","commute_35_39_mins","commute_35_44_mins","commute_40_44_mins","commute_45_59_mins","commute_5_9_mins","commute_60_89_mins","commute_60_more_mins","commute_90_more_mins","commute_less_10_mins","commuters_16_over","commuters_by_bus","commuters_by_car_truck_van","commuters_by_carpool","commuters_by_public_transportation","commuters_by_subway_or_elevated","commuters_drove_alone","different_house_year_ago_different_city","different_house_year_ago_same_city","dwellings_10_to_19_units","dwellings_1_units_attached","dwellings_1_units_detached","dwellings_20_to_49_units","dwellings_2_units","dwellings_3_to_4_units","dwellings_50_or_more_units","dwellings_5_to_9_units","employed_agriculture_forestry_fishing_hunting_mining","employed_arts_entertainment_recreation_accommodation_food","employed_construction","employed_education_health_social","employed_finance_insurance_real_estate","employed_information","employed_manufacturing","employed_other_services_not_public_admin","employed_pop","employed_public_administration","employed_retail_trade","employed_science_management_admin_waste","employed_transportation_warehousing_utilities","employed_wholesale_trade","families_with_young_children","family_households","father_in_labor_force_one_parent_families_with_young_children","father_one_parent_families_with_young_children","female_10_to_14","female_15_to_17","female_18_to_19","female_20","female_21","female_22_to_24","female_25_to_29","female_30_to_34","female_35_to_39","female_40_to_44","female_45_to_49","female_50_to_54","female_55_to_59","female_5_to_9","female_60_to_61","female_62_to_64","female_65_to_66","female_67_to_69","female_70_to_74","female_75_to_79","female_80_to_84","female_85_and_over","female_female_households","female_pop","female_under_5","four_more_cars","gini_index","graduate_professional_degree","group_quarters","high_school_diploma","high_school_including_ged","hispanic_any_race","hispanic_male_45_54","hispanic_male_55_64","hispanic_pop","households","households_public_asst_or_food_stamps","households_retirement_income","housing_built_1939_or_earlier","housing_built_2000_to_2004","housing_built_2005_or_later","housing_units","housing_units_renter_occupied","in_grades_1_to_4","in_grades_5_to_8","in_grades_9_to_12","in_school","in_undergrad_college","income_100000_124999","income_10000_14999","income_125000_149999","income_150000_199999","income_15000_19999","income_200000_or_more","income_20000_24999","income_25000_29999","income_30000_34999","income_35000_39999","income_40000_44999","income_45000_49999","income_50000_59999","income_60000_74999","income_75000_99999","income_less_10000","income_per_capita","less_one_year_college","less_than_high_school_graduate","male_10_to_14","male_15_to_17","male_18_to_19","male_20","male_21","male_22_to_24","male_25_to_29","male_30_to_34","male_35_to_39","male_40_to_44","male_45_64_associates_degree","male_45_64_bachelors_degree","male_45_64_grade_9_12","male_45_64_graduate_degree","male_45_64_high_school","male_45_64_less_than_9_grade","male_45_64_some_college","male_45_to_49","male_45_to_64","male_50_to_54","male_55_to_59","male_5_to_9","male_60_to_61","male_62_to_64","male_65_to_66","male_67_to_69","male_70_to_74","male_75_to_79","male_80_to_84","male_85_and_over","male_male_households","male_pop","male_under_5","management_business_sci_arts_employed","married_households","masters_degree","median_age","median_income","median_rent","median_year_structure_built","million_dollar_housing_units","mobile_homes","mortgaged_housing_units","no_car","no_cars","nonfamily_households","not_hispanic_pop","not_in_labor_force","not_us_citizen_pop","occupation_management_arts","occupation_natural_resources_construction_maintenance","occupation_production_transportation_material","occupation_sales_office","occupation_services","occupied_housing_units","one_car","one_parent_families_with_young_children","one_year_more_college","other_race_pop","owner_occupied_housing_units","owner_occupied_housing_units_lower_value_quartile","owner_occupied_housing_units_median_value","owner_occupied_housing_units_upper_value_quartile","percent_income_spent_on_rent","pop_16_over","pop_25_64","pop_25_years_over","pop_5_years_over","pop_determined_poverty_status","pop_in_labor_force","population_1_year_and_over","population_3_years_over","poverty","rent_10_to_15_percent","rent_15_to_20_percent","rent_20_to_25_percent","rent_25_to_30_percent","rent_30_to_35_percent","rent_35_to_40_percent","rent_40_to_50_percent","rent_burden_not_computed","rent_over_50_percent","rent_under_10_percent","renter_occupied_housing_units_paying_cash_median_gross_rent","sales_office_employed","some_college_and_associates_degree","speak_only_english_at_home","speak_spanish_at_home","speak_spanish_at_home_low_english","three_cars","total_pop","two_cars","two_or_more_races_pop","two_parent_families_with_young_children","two_parents_father_in_labor_force_families_with_young_children","two_parents_in_labor_force_families_with_young_children","two_parents_mother_in_labor_force_families_with_young_children","two_parents_not_in_labor_force_families_with_young_children","unemployed_pop","vacant_housing_units","vacant_housing_units_for_rent","vacant_housing_units_for_sale","walked_to_work","white_including_hispanic","white_male_45_54","white_male_55_64","white_pop","worked_at_home","workers_16_and_over"]',
},
resources={
"request_memory": "2G",
"request_cpu": "1",
"request_ephemeral_storage": "10G",
},
)
# Task to load CSV data to a BigQuery table
load_to_bq = gcs_to_bigquery.GCSToBigQueryOperator(
task_id="load_to_bq",
bucket="{{ var.value.composer_bucket }}",
source_objects=[
"data/census_bureau_acs/schooldistrictsecondary_2019_5yr/data_output.csv"
],
source_format="CSV",
destination_project_dataset_table="census_bureau_acs.schooldistrictsecondary_2019_5yr",
skip_leading_rows=1,
allow_quoted_newlines=True,
write_disposition="WRITE_TRUNCATE",
schema_fields=[
{"name": "geo_id", "type": "string", "mode": "nullable"},
{
"name": "aggregate_travel_time_to_work",
"type": "float",
"mode": "nullable",
},
{
"name": "amerindian_including_hispanic",
"type": "float",
"mode": "nullable",
},
{"name": "amerindian_pop", "type": "float", "mode": "nullable"},
{"name": "armed_forces", "type": "float", "mode": "nullable"},
{"name": "asian_including_hispanic", "type": "float", "mode": "nullable"},
{"name": "asian_male_45_54", "type": "float", "mode": "nullable"},
{"name": "asian_male_55_64", "type": "float", "mode": "nullable"},
{"name": "asian_pop", "type": "float", "mode": "nullable"},
{"name": "associates_degree", "type": "float", "mode": "nullable"},
{"name": "bachelors_degree", "type": "float", "mode": "nullable"},
{"name": "bachelors_degree_2", "type": "float", "mode": "nullable"},
{
"name": "bachelors_degree_or_higher_25_64",
"type": "float",
"mode": "nullable",
},
{"name": "black_including_hispanic", "type": "float", "mode": "nullable"},
{"name": "black_male_45_54", "type": "float", "mode": "nullable"},
{"name": "black_male_55_64", "type": "float", "mode": "nullable"},
{"name": "black_pop", "type": "float", "mode": "nullable"},
{"name": "children", "type": "float", "mode": "nullable"},
{
"name": "children_in_single_female_hh",
"type": "float",
"mode": "nullable",
},
{"name": "civilian_labor_force", "type": "float", "mode": "nullable"},
{"name": "commute_10_14_mins", "type": "float", "mode": "nullable"},
{"name": "commute_15_19_mins", "type": "float", "mode": "nullable"},
{"name": "commute_20_24_mins", "type": "float", "mode": "nullable"},
{"name": "commute_25_29_mins", "type": "float", "mode": "nullable"},
{"name": "commute_30_34_mins", "type": "float", "mode": "nullable"},
{"name": "commute_35_39_mins", "type": "float", "mode": "nullable"},
{"name": "commute_35_44_mins", "type": "float", "mode": "nullable"},
{"name": "commute_40_44_mins", "type": "float", "mode": "nullable"},
{"name": "commute_45_59_mins", "type": "float", "mode": "nullable"},
{"name": "commute_5_9_mins", "type": "float", "mode": "nullable"},
{"name": "commute_60_89_mins", "type": "float", "mode": "nullable"},
{"name": "commute_60_more_mins", "type": "float", "mode": "nullable"},
{"name": "commute_90_more_mins", "type": "float", "mode": "nullable"},
{"name": "commute_less_10_mins", "type": "float", "mode": "nullable"},
{"name": "commuters_16_over", "type": "float", "mode": "nullable"},
{"name": "commuters_by_bus", "type": "float", "mode": "nullable"},
{"name": "commuters_by_car_truck_van", "type": "float", "mode": "nullable"},
{"name": "commuters_by_carpool", "type": "float", "mode": "nullable"},
{
"name": "commuters_by_public_transportation",
"type": "float",
"mode": "nullable",
},
{
"name": "commuters_by_subway_or_elevated",
"type": "float",
"mode": "nullable",
},
{"name": "commuters_drove_alone", "type": "float", "mode": "nullable"},
{
"name": "different_house_year_ago_different_city",
"type": "float",
"mode": "nullable",
},
{
"name": "different_house_year_ago_same_city",
"type": "float",
"mode": "nullable",
},
{"name": "dwellings_10_to_19_units", "type": "float", "mode": "nullable"},
{"name": "dwellings_1_units_attached", "type": "float", "mode": "nullable"},
{"name": "dwellings_1_units_detached", "type": "float", "mode": "nullable"},
{"name": "dwellings_20_to_49_units", "type": "float", "mode": "nullable"},
{"name": "dwellings_2_units", "type": "float", "mode": "nullable"},
{"name": "dwellings_3_to_4_units", "type": "float", "mode": "nullable"},
{"name": "dwellings_50_or_more_units", "type": "float", "mode": "nullable"},
{"name": "dwellings_5_to_9_units", "type": "float", "mode": "nullable"},
{
"name": "employed_agriculture_forestry_fishing_hunting_mining",
"type": "float",
"mode": "nullable",
},
{
"name": "employed_arts_entertainment_recreation_accommodation_food",
"type": "float",
"mode": "nullable",
},
{"name": "employed_construction", "type": "float", "mode": "nullable"},
{
"name": "employed_education_health_social",
"type": "float",
"mode": "nullable",
},
{
"name": "employed_finance_insurance_real_estate",
"type": "float",
"mode": "nullable",
},
{"name": "employed_information", "type": "float", "mode": "nullable"},
{"name": "employed_manufacturing", "type": "float", "mode": "nullable"},
{
"name": "employed_other_services_not_public_admin",
"type": "float",
"mode": "nullable",
},
{"name": "employed_pop", "type": "float", "mode": "nullable"},
{
"name": "employed_public_administration",
"type": "float",
"mode": "nullable",
},
{"name": "employed_retail_trade", "type": "float", "mode": "nullable"},
{
"name": "employed_science_management_admin_waste",
"type": "float",
"mode": "nullable",
},
{
"name": "employed_transportation_warehousing_utilities",
"type": "float",
"mode": "nullable",
},
{"name": "employed_wholesale_trade", "type": "float", "mode": "nullable"},
{
"name": "families_with_young_children",
"type": "float",
"mode": "nullable",
},
{"name": "family_households", "type": "float", "mode": "nullable"},
{
"name": "father_in_labor_force_one_parent_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{
"name": "father_one_parent_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{"name": "female_10_to_14", "type": "float", "mode": "nullable"},
{"name": "female_15_to_17", "type": "float", "mode": "nullable"},
{"name": "female_18_to_19", "type": "float", "mode": "nullable"},
{"name": "female_20", "type": "float", "mode": "nullable"},
{"name": "female_21", "type": "float", "mode": "nullable"},
{"name": "female_22_to_24", "type": "float", "mode": "nullable"},
{"name": "female_25_to_29", "type": "float", "mode": "nullable"},
{"name": "female_30_to_34", "type": "float", "mode": "nullable"},
{"name": "female_35_to_39", "type": "float", "mode": "nullable"},
{"name": "female_40_to_44", "type": "float", "mode": "nullable"},
{"name": "female_45_to_49", "type": "float", "mode": "nullable"},
{"name": "female_50_to_54", "type": "float", "mode": "nullable"},
{"name": "female_55_to_59", "type": "float", "mode": "nullable"},
{"name": "female_5_to_9", "type": "float", "mode": "nullable"},
{"name": "female_60_to_61", "type": "float", "mode": "nullable"},
{"name": "female_62_to_64", "type": "float", "mode": "nullable"},
{"name": "female_65_to_66", "type": "float", "mode": "nullable"},
{"name": "female_67_to_69", "type": "float", "mode": "nullable"},
{"name": "female_70_to_74", "type": "float", "mode": "nullable"},
{"name": "female_75_to_79", "type": "float", "mode": "nullable"},
{"name": "female_80_to_84", "type": "float", "mode": "nullable"},
{"name": "female_85_and_over", "type": "float", "mode": "nullable"},
{"name": "female_female_households", "type": "float", "mode": "nullable"},
{"name": "female_pop", "type": "float", "mode": "nullable"},
{"name": "female_under_5", "type": "float", "mode": "nullable"},
{"name": "four_more_cars", "type": "float", "mode": "nullable"},
{"name": "gini_index", "type": "float", "mode": "nullable"},
{
"name": "graduate_professional_degree",
"type": "float",
"mode": "nullable",
},
{"name": "group_quarters", "type": "float", "mode": "nullable"},
{"name": "high_school_diploma", "type": "float", "mode": "nullable"},
{"name": "high_school_including_ged", "type": "float", "mode": "nullable"},
{"name": "hispanic_any_race", "type": "float", "mode": "nullable"},
{"name": "hispanic_male_45_54", "type": "float", "mode": "nullable"},
{"name": "hispanic_male_55_64", "type": "float", "mode": "nullable"},
{"name": "hispanic_pop", "type": "float", "mode": "nullable"},
{"name": "households", "type": "float", "mode": "nullable"},
{
"name": "households_public_asst_or_food_stamps",
"type": "float",
"mode": "nullable",
},
{
"name": "households_retirement_income",
"type": "float",
"mode": "nullable",
},
{
"name": "housing_built_1939_or_earlier",
"type": "float",
"mode": "nullable",
},
{"name": "housing_built_2000_to_2004", "type": "float", "mode": "nullable"},
{
"name": "housing_built_2005_or_later",
"type": "float",
"mode": "nullable",
},
{"name": "housing_units", "type": "float", "mode": "nullable"},
{
"name": "housing_units_renter_occupied",
"type": "float",
"mode": "nullable",
},
{"name": "in_grades_1_to_4", "type": "float", "mode": "nullable"},
{"name": "in_grades_5_to_8", "type": "float", "mode": "nullable"},
{"name": "in_grades_9_to_12", "type": "float", "mode": "nullable"},
{"name": "in_school", "type": "float", "mode": "nullable"},
{"name": "in_undergrad_college", "type": "float", "mode": "nullable"},
{"name": "income_100000_124999", "type": "float", "mode": "nullable"},
{"name": "income_10000_14999", "type": "float", "mode": "nullable"},
{"name": "income_125000_149999", "type": "float", "mode": "nullable"},
{"name": "income_150000_199999", "type": "float", "mode": "nullable"},
{"name": "income_15000_19999", "type": "float", "mode": "nullable"},
{"name": "income_200000_or_more", "type": "float", "mode": "nullable"},
{"name": "income_20000_24999", "type": "float", "mode": "nullable"},
{"name": "income_25000_29999", "type": "float", "mode": "nullable"},
{"name": "income_30000_34999", "type": "float", "mode": "nullable"},
{"name": "income_35000_39999", "type": "float", "mode": "nullable"},
{"name": "income_40000_44999", "type": "float", "mode": "nullable"},
{"name": "income_45000_49999", "type": "float", "mode": "nullable"},
{"name": "income_50000_59999", "type": "float", "mode": "nullable"},
{"name": "income_60000_74999", "type": "float", "mode": "nullable"},
{"name": "income_75000_99999", "type": "float", "mode": "nullable"},
{"name": "income_less_10000", "type": "float", "mode": "nullable"},
{"name": "income_per_capita", "type": "float", "mode": "nullable"},
{"name": "less_one_year_college", "type": "float", "mode": "nullable"},
{
"name": "less_than_high_school_graduate",
"type": "float",
"mode": "nullable",
},
{"name": "male_10_to_14", "type": "float", "mode": "nullable"},
{"name": "male_15_to_17", "type": "float", "mode": "nullable"},
{"name": "male_18_to_19", "type": "float", "mode": "nullable"},
{"name": "male_20", "type": "float", "mode": "nullable"},
{"name": "male_21", "type": "float", "mode": "nullable"},
{"name": "male_22_to_24", "type": "float", "mode": "nullable"},
{"name": "male_25_to_29", "type": "float", "mode": "nullable"},
{"name": "male_30_to_34", "type": "float", "mode": "nullable"},
{"name": "male_35_to_39", "type": "float", "mode": "nullable"},
{"name": "male_40_to_44", "type": "float", "mode": "nullable"},
{
"name": "male_45_64_associates_degree",
"type": "float",
"mode": "nullable",
},
{
"name": "male_45_64_bachelors_degree",
"type": "float",
"mode": "nullable",
},
{"name": "male_45_64_grade_9_12", "type": "float", "mode": "nullable"},
{"name": "male_45_64_graduate_degree", "type": "float", "mode": "nullable"},
{"name": "male_45_64_high_school", "type": "float", "mode": "nullable"},
{
"name": "male_45_64_less_than_9_grade",
"type": "float",
"mode": "nullable",
},
{"name": "male_45_64_some_college", "type": "float", "mode": "nullable"},
{"name": "male_45_to_49", "type": "float", "mode": "nullable"},
{"name": "male_45_to_64", "type": "float", "mode": "nullable"},
{"name": "male_50_to_54", "type": "float", "mode": "nullable"},
{"name": "male_55_to_59", "type": "float", "mode": "nullable"},
{"name": "male_5_to_9", "type": "float", "mode": "nullable"},
{"name": "male_60_to_61", "type": "float", "mode": "nullable"},
{"name": "male_62_to_64", "type": "float", "mode": "nullable"},
{"name": "male_65_to_66", "type": "float", "mode": "nullable"},
{"name": "male_67_to_69", "type": "float", "mode": "nullable"},
{"name": "male_70_to_74", "type": "float", "mode": "nullable"},
{"name": "male_75_to_79", "type": "float", "mode": "nullable"},
{"name": "male_80_to_84", "type": "float", "mode": "nullable"},
{"name": "male_85_and_over", "type": "float", "mode": "nullable"},
{"name": "male_male_households", "type": "float", "mode": "nullable"},
{"name": "male_pop", "type": "float", "mode": "nullable"},
{"name": "male_under_5", "type": "float", "mode": "nullable"},
{
"name": "management_business_sci_arts_employed",
"type": "float",
"mode": "nullable",
},
{"name": "married_households", "type": "float", "mode": "nullable"},
{"name": "masters_degree", "type": "float", "mode": "nullable"},
{"name": "median_age", "type": "float", "mode": "nullable"},
{"name": "median_income", "type": "float", "mode": "nullable"},
{"name": "median_rent", "type": "float", "mode": "nullable"},
{
"name": "median_year_structure_built",
"type": "float",
"mode": "nullable",
},
{
"name": "million_dollar_housing_units",
"type": "float",
"mode": "nullable",
},
{"name": "mobile_homes", "type": "float", "mode": "nullable"},
{"name": "mortgaged_housing_units", "type": "float", "mode": "nullable"},
{"name": "no_car", "type": "float", "mode": "nullable"},
{"name": "no_cars", "type": "float", "mode": "nullable"},
{"name": "nonfamily_households", "type": "float", "mode": "nullable"},
{"name": "not_hispanic_pop", "type": "float", "mode": "nullable"},
{"name": "not_in_labor_force", "type": "float", "mode": "nullable"},
{"name": "not_us_citizen_pop", "type": "float", "mode": "nullable"},
{"name": "occupation_management_arts", "type": "float", "mode": "nullable"},
{
"name": "occupation_natural_resources_construction_maintenance",
"type": "float",
"mode": "nullable",
},
{
"name": "occupation_production_transportation_material",
"type": "float",
"mode": "nullable",
},
{"name": "occupation_sales_office", "type": "float", "mode": "nullable"},
{"name": "occupation_services", "type": "float", "mode": "nullable"},
{"name": "occupied_housing_units", "type": "float", "mode": "nullable"},
{"name": "one_car", "type": "float", "mode": "nullable"},
{
"name": "one_parent_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{"name": "one_year_more_college", "type": "float", "mode": "nullable"},
{"name": "other_race_pop", "type": "float", "mode": "nullable"},
{
"name": "owner_occupied_housing_units",
"type": "float",
"mode": "nullable",
},
{
"name": "owner_occupied_housing_units_lower_value_quartile",
"type": "float",
"mode": "nullable",
},
{
"name": "owner_occupied_housing_units_median_value",
"type": "float",
"mode": "nullable",
},
{
"name": "owner_occupied_housing_units_upper_value_quartile",
"type": "float",
"mode": "nullable",
},
{
"name": "percent_income_spent_on_rent",
"type": "float",
"mode": "nullable",
},
{"name": "pop_16_over", "type": "float", "mode": "nullable"},
{"name": "pop_25_64", "type": "float", "mode": "nullable"},
{"name": "pop_25_years_over", "type": "float", "mode": "nullable"},
{"name": "pop_5_years_over", "type": "float", "mode": "nullable"},
{
"name": "pop_determined_poverty_status",
"type": "float",
"mode": "nullable",
},
{"name": "pop_in_labor_force", "type": "float", "mode": "nullable"},
{"name": "population_1_year_and_over", "type": "float", "mode": "nullable"},
{"name": "population_3_years_over", "type": "float", "mode": "nullable"},
{"name": "poverty", "type": "float", "mode": "nullable"},
{"name": "rent_10_to_15_percent", "type": "float", "mode": "nullable"},
{"name": "rent_15_to_20_percent", "type": "float", "mode": "nullable"},
{"name": "rent_20_to_25_percent", "type": "float", "mode": "nullable"},
{"name": "rent_25_to_30_percent", "type": "float", "mode": "nullable"},
{"name": "rent_30_to_35_percent", "type": "float", "mode": "nullable"},
{"name": "rent_35_to_40_percent", "type": "float", "mode": "nullable"},
{"name": "rent_40_to_50_percent", "type": "float", "mode": "nullable"},
{"name": "rent_burden_not_computed", "type": "float", "mode": "nullable"},
{"name": "rent_over_50_percent", "type": "float", "mode": "nullable"},
{"name": "rent_under_10_percent", "type": "float", "mode": "nullable"},
{
"name": "renter_occupied_housing_units_paying_cash_median_gross_rent",
"type": "float",
"mode": "nullable",
},
{"name": "sales_office_employed", "type": "float", "mode": "nullable"},
{
"name": "some_college_and_associates_degree",
"type": "float",
"mode": "nullable",
},
{"name": "speak_only_english_at_home", "type": "float", "mode": "nullable"},
{"name": "speak_spanish_at_home", "type": "float", "mode": "nullable"},
{
"name": "speak_spanish_at_home_low_english",
"type": "float",
"mode": "nullable",
},
{"name": "three_cars", "type": "float", "mode": "nullable"},
{"name": "total_pop", "type": "float", "mode": "nullable"},
{"name": "two_cars", "type": "float", "mode": "nullable"},
{"name": "two_or_more_races_pop", "type": "float", "mode": "nullable"},
{
"name": "two_parent_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{
"name": "two_parents_father_in_labor_force_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{
"name": "two_parents_in_labor_force_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{
"name": "two_parents_mother_in_labor_force_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{
"name": "two_parents_not_in_labor_force_families_with_young_children",
"type": "float",
"mode": "nullable",
},
{"name": "unemployed_pop", "type": "float", "mode": "nullable"},
{"name": "vacant_housing_units", "type": "float", "mode": "nullable"},
{
"name": "vacant_housing_units_for_rent",
"type": "float",
"mode": "nullable",
},
{
"name": "vacant_housing_units_for_sale",
"type": "float",
"mode": "nullable",
},
{"name": "walked_to_work", "type": "float", "mode": "nullable"},
{"name": "white_including_hispanic", "type": "float", "mode": "nullable"},
{"name": "white_male_45_54", "type": "float", "mode": "nullable"},
{"name": "white_male_55_64", "type": "float", "mode": "nullable"},
{"name": "white_pop", "type": "float", "mode": "nullable"},
{"name": "worked_at_home", "type": "float", "mode": "nullable"},
{"name": "workers_16_and_over", "type": "float", "mode": "nullable"},
],
)
transform_csv >> load_to_bq
| apache-2.0 |
rhythmsosad/polyglot | polyglot/text.py | 5 | 17075 | #!/usr/bin/env python
# -*- coding: utf-8 -*-
import sys
import numpy as np
from polyglot.base import Sequence, TextFile, TextFiles
from polyglot.detect import Detector, Language
from polyglot.decorators import cached_property
from polyglot.downloader import Downloader
from polyglot.load import load_embeddings, load_morfessor_model
from polyglot.mapping import CountedVocabulary
from polyglot.mixins import BlobComparableMixin, StringlikeMixin
from polyglot.tag import get_pos_tagger, get_ner_tagger
from polyglot.tokenize import SentenceTokenizer, WordTokenizer
from polyglot.transliteration import Transliterator
from polyglot.utils import _print
from .mixins import basestring
import six
from six import text_type as unicode
class BaseBlob(StringlikeMixin, BlobComparableMixin):
"""An abstract base class that Sentence, Text will inherit from.
Includes words, POS tag, NP, and word count properties. Also includes
basic dunder and string methods for making objects like Python strings.
:param text: A string.
"""
def __init__(self, text):
if not isinstance(text, basestring):
raise TypeError('The `text` argument passed to `__init__(text)` '
'must be a unicode string, not {0}'.format(type(text)))
self.raw = text
if not isinstance(text, unicode):
self.raw = text.decode("utf-8")
self.string = self.raw
self.__lang = None
@cached_property
def detected_languages(self):
return Detector(self.raw, quiet=True)
@property
def language(self):
if self.__lang is None:
self.__lang = self.detected_languages.language
return self.__lang
@language.setter
def language(self, value):
self.__lang = Language.from_code(value)
@property
def word_tokenizer(self):
word_tokenizer = WordTokenizer(locale=self.language.code)
return word_tokenizer
@property
def words(self):
"""Return a list of word tokens. This excludes punctuation characters.
If you want to include punctuation characters, access the ``tokens``
property.
:returns: A :class:`WordList <WordList>` of word tokens.
"""
return self.tokens
@cached_property
def tokens(self):
"""Return a list of tokens, using this blob's tokenizer object
(defaults to :class:`WordTokenizer <textblob.tokenizers.WordTokenizer>`).
"""
seq = self.word_tokenizer.transform(Sequence(self.raw))
return WordList(seq.tokens(), parent=self, language=self.language.code)
def tokenize(self, tokenizer=None):
"""Return a list of tokens, using ``tokenizer``.
:param tokenizer: (optional) A tokenizer object. If None, defaults to
this blob's default tokenizer.
"""
t = tokenizer if tokenizer is not None else self.tokenizer
return WordList(t.tokenize(self.raw), parent=self)
@cached_property
def polarity(self):
"""Return the polarity score as a float within the range [-1.0, 1.0]
"""
scores = [w.polarity for w in self.words if w.polarity != 0]
return sum(scores) / float(len(scores))
@cached_property
def ne_chunker(self):
return get_ner_tagger(lang=self.language.code)
@cached_property
def pos_tagger(self):
return get_pos_tagger(lang=self.language.code)
@cached_property
def morpheme_analyzer(self):
return load_morfessor_model(lang=self.language.code)
def transliterate(self, target_language="en"):
"""Transliterate the string to the target language."""
return WordList([w.transliterate(target_language) for w in self.words],
language=target_language, parent=self)
@cached_property
def morphemes(self):
words, score = self.morpheme_analyzer.viterbi_segment(self.raw)
return WordList(words, language=self.language.code, parent=self)
@cached_property
def entities(self):
"""Returns a list of entities for this blob."""
start = 0
end = 0
prev_tag = u'O'
chunks = []
for i, (w, tag) in enumerate(self.ne_chunker.annotate(self.words)):
if tag != prev_tag:
if prev_tag == u'O':
start = i
else:
chunks.append(Chunk(self.words[start: i], start, i, tag=prev_tag,
parent=self))
prev_tag = tag
if tag != u'O':
chunks.append(Chunk(self.words[start: i+1], start, i+1, tag=tag,
parent=self))
return chunks
@cached_property
def pos_tags(self):
"""Returns an list of tuples of the form (word, POS tag).
Example:
::
[('At', 'ADP'), ('eight', 'NUM'), ("o'clock", 'NOUN'), ('on', 'ADP'),
('Thursday', 'NOUN'), ('morning', 'NOUN')]
:rtype: list of tuples
"""
tagged_words = []
for word,t in self.pos_tagger.annotate(self.words):
word.pos_tag = t
tagged_words.append((word, t))
return tagged_words
@cached_property
def word_counts(self):
"""Dictionary of word frequencies in this text.
"""
counts = defaultdict(int)
for word in self.words:
counts[word] += 1
return counts
@cached_property
def np_counts(self):
"""Dictionary of noun phrase frequencies in this text.
"""
counts = defaultdict(int)
for phrase in self.noun_phrases:
counts[phrase] += 1
return counts
def ngrams(self, n=3):
"""Return a list of n-grams (tuples of n successive words) for this
blob.
:rtype: List of :class:`WordLists <WordList>`
"""
if n <= 0:
return []
grams = [WordList(self.words[i:i+n], parent=self)
for i in range(len(self.words) - n + 1)]
return grams
def detect_language(self):
"""Detect the blob's language using the Google Translate API.
Requires an internet connection.
Usage:
::
>>> b = Text("bonjour")
>>> b.language
u'fr'
"""
return self.language.code
def correct(self):
"""Attempt to correct the spelling of a blob.
.. versionadded:: 0.6.0
:rtype: :class:`BaseBlob <BaseBlob>`
"""
# regex matches: contraction or word or punctuation or whitespace
tokens = nltk.tokenize.regexp_tokenize(self.raw, "\w*('\w*)+|\w+|[^\w\s]|\s")
corrected = (Word(w).correct() for w in tokens)
ret = ''.join(corrected)
return self.__class__(ret)
def _cmpkey(self):
"""Key used by ComparableMixin to implement all rich comparison
operators.
"""
return self.raw
def _strkey(self):
"""Key used by StringlikeMixin to implement string methods."""
return self.raw
def __hash__(self):
return hash(self._cmpkey())
def __add__(self, other):
'''Concatenates two text objects the same way Python strings are
concatenated.
Arguments:
- `other`: a string or a text object
'''
if isinstance(other, basestring):
return self.__class__(self.raw + other)
elif isinstance(other, BaseBlob):
return self.__class__(self.raw + other.raw)
else:
raise TypeError('Operands must be either strings or {0} objects'
.format(self.__class__.__name__))
def split(self, sep=None, maxsplit=sys.maxsize):
"""Behaves like the built-in str.split() except returns a
WordList.
:rtype: :class:`WordList <WordList>`
"""
return WordList(self._strkey().split(sep, maxsplit), parent=self)
class Word(unicode):
"""A simple word representation. Includes methods for inflection,
translation, and WordNet integration.
"""
def __new__(cls, string, language=None, pos_tag=None):
"""Return a new instance of the class. It is necessary to override
this method in order to handle the extra pos_tag argument in the
constructor.
"""
return super(Word, cls).__new__(cls, string)
def __init__(self, string, language=None, pos_tag=None):
self.string = string
self.pos_tag = pos_tag
self.__lang = language
def __repr__(self):
return repr(self.string)
def __str__(self):
return self.string
@cached_property
def morpheme_analyzer(self):
return load_morfessor_model(lang=self.language)
@cached_property
def morphemes(self):
words, score = self.morpheme_analyzer.viterbi_segment(self.string)
return WordList(words, parent=self, language=self.language)
@cached_property
def detected_languages(self):
return Detector(self.string, quiet=True)
@property
def language(self):
if self.__lang is None:
self.__lang = self.detected_languages.language.code
return self.__lang
@language.setter
def language(self, value):
self.__lang = value
@property
def vector(self):
embeddings = load_embeddings(lang=self.language, type="sgns",
task="embeddings")
return embeddings[self.string]
@property
def neighbors(self):
embeddings = load_embeddings(lang=self.language, type="sgns",
task="embeddings")
return embeddings.nearest_neighbors(self.string)
@property
def polarity(self):
embeddings = load_embeddings(lang=self.language, type="", task="sentiment")
return embeddings.get(self.string, [0])[0]
def detect_language(self):
"""Detect the word's language."""
return self.language
def transliterate(self, target_language="en"):
"""Transliterate the string to the target language."""
t = Transliterator(source_lang=self.language,
target_lang=target_language)
return t.transliterate(self.string)
class WordList(list):
"""A list-like collection of words."""
def __init__(self, collection, parent=None, language="en"):
"""Initialize a WordList. Takes a collection of strings as
its only argument.
"""
self._collection = [Word(w, language=language) for w in collection]
self.parent = parent
super(WordList, self).__init__(self._collection)
def __str__(self):
return str(self._collection)
def __repr__(self):
"""Returns a string representation for debugging."""
class_name = self.__class__.__name__
return '{cls}({lst})'.format(cls=class_name, lst=repr(self._collection))
def __getitem__(self, key):
"""Returns a string at the given index."""
if isinstance(key, slice):
return self.__class__(self._collection[key])
else:
return self._collection[key]
def __getslice__(self, i, j):
# This is included for Python 2.* compatibility
return self.__class__(self._collection[i:j])
def __iter__(self):
return iter(self._collection)
def count(self, strg, case_sensitive=False, *args, **kwargs):
"""Get the count of a word or phrase `s` within this WordList.
:param strg: The string to count.
:param case_sensitive: A boolean, whether or not the search is case-sensitive.
"""
if not case_sensitive:
return [word.lower() for word in self].count(strg.lower(), *args,
**kwargs)
return self._collection.count(strg, *args, **kwargs)
def append(self, obj):
"""Append an object to end. If the object is a string, appends a
:class:`Word <Word>` object.
"""
if isinstance(obj, basestring):
return self._collection.append(Word(obj))
else:
return self._collection.append(obj)
def extend(self, iterable):
"""Extend WordList by appending elements from ``iterable``. If an element
is a string, appends a :class:`Word <Word>` object.
"""
[self._collection.append(Word(e) if isinstance(e, basestring) else e)
for e in iterable]
return self
def upper(self):
"""Return a new WordList with each word upper-cased."""
return self.__class__([word.upper() for word in self])
def lower(self):
"""Return a new WordList with each word lower-cased."""
return self.__class__([word.lower() for word in self])
class Chunk(WordList):
"""A subsequence within a WordList object. Inherits from :class:`WordList <WordList>`.
:param subsequence: A list, the raw sentence.
:param start_index: An int, the index where this chunk begins
in WordList. If not given, defaults to 0.
:param end_index: An int, the index where this chunk ends in
a WordList. If not given, defaults to the
length of the sentence - 1.
:param parent: Original Baseblob.
"""
def __init__(self, subsequence, start_index=0, end_index=None, tag="",
parent=None):
super(Chunk, self).__init__(collection=subsequence, parent=parent)
#: The start index within a Text
self.start = start_index
#: The end index within a Text
self.end = end_index or len(sentence) - 1
class_name = self.__class__.__name__
self.tag = tag if tag else class_name
def __repr__(self):
"""Returns a string representation for debugging."""
return '{tag}({lst})'.format(tag=self.tag, lst=repr(self._collection))
@cached_property
def positive_sentiment(self):
"""Positive sentiment of the entity."""
pos, neg = self._sentiment()
return pos
@cached_property
def negative_sentiment(self):
"""Negative sentiment of the entity."""
pos, neg = self._sentiment()
return neg
def _sentiment(self, distance=True):
"""Calculates the sentiment of an entity as it appears in text."""
sum_pos = 0
sum_neg = 0
text = self.parent
entity_positions = range(self.start, self.end)
non_entity_positions = set(range(len(text.words))).difference(entity_positions)
if not distance:
non_entity_polarities = np.array([text.words[i].polarity for i in non_entity_positions])
sum_pos = sum(non_entity_polarities == 1)
sum_neg = sum(non_entity_polarities == -1)
else:
polarities = np.array([w.polarity for w in text.words])
polarized_positions = np.argwhere(polarities != 0)[0]
polarized_non_entity_positions = non_entity_positions.intersection(polarized_positions)
sentence_len = len(text.words)
for i in polarized_non_entity_positions:
min_dist = min(abs(self.start - i), abs(self.end - i))
if text.words[i].polarity == 1:
sum_pos += 1.0 - (min_dist - 1.0) / (2.0 * sentence_len)
else:
sum_neg += 1.0 - (min_dist - 1.0) / (2.0 *sentence_len)
return (sum_pos, sum_neg)
class Sentence(BaseBlob):
"""A sentence within a Text object. Inherits from :class:`BaseBlob <BaseBlob>`.
:param sentence: A string, the raw sentence.
:param start_index: An int, the index where this sentence begins
in Text. If not given, defaults to 0.
:param end_index: An int, the index where this sentence ends in
a Text. If not given, defaults to the
length of the sentence - 1.
"""
def __init__(self, sentence, start_index=0, end_index=None):
super(Sentence, self).__init__(sentence)
#: The start index within a Text
self.start = start_index
#: The end index within a Text
self.end = end_index or len(sentence) - 1
@property
def dict(self):
'''The dict representation of this sentence.'''
return {
'raw': self.raw,
'start_index': self.start_index,
'end_index': self.end_index,
'entities': self.entities,
'polarity': self.polarity,
}
class Text(BaseBlob):
""".
"""
def __init__(self, text):
super(Text, self).__init__(text)
def __str__(self):
if len(self.raw) > 1000:
return u"{}...{}".format(self.raw[:500], self.raw[-500:])
else:
return self.raw
@property
def sentences(self):
"""Return list of :class:`Sentence <Sentence>` objects."""
return self._create_sentence_objects()
@property
def raw_sentences(self):
"""List of strings, the raw sentences in the blob."""
return [sentence.raw for sentence in self.sentences]
@property
def serialized(self):
"""Returns a list of each sentence's dict representation."""
return [sentence.dict for sentence in self.sentences]
def to_json(self, *args, **kwargs):
'''Return a json representation (str) of this blob.
Takes the same arguments as json.dumps.
.. versionadded:: 0.5.1
'''
return json.dumps(self.serialized, *args, **kwargs)
@property
def json(self):
'''The json representation of this blob.
.. versionchanged:: 0.5.1
Made ``json`` a property instead of a method to restore backwards
compatibility that was broken after version 0.4.0.
'''
return self.to_json()
def _create_sentence_objects(self):
'''Returns a list of Sentence objects from the raw text.
'''
sentence_objects = []
sent_tokenizer = SentenceTokenizer(locale=self.language.code)
seq = Sequence(self.raw)
seq = sent_tokenizer.transform(seq)
for start_index, end_index in zip(seq.idx[:-1], seq.idx[1:]):
# Sentences share the same models as their parent blob
sent = seq.text[start_index: end_index].strip()
if not sent: continue
s = Sentence(sent, start_index=start_index, end_index=end_index)
s.detected_languages = self.detected_languages
sentence_objects.append(s)
return sentence_objects
| gpl-3.0 |
mclaughlin6464/pylearn2 | pylearn2/models/svm.py | 6 | 3259 | """Wrappers for SVM models."""
__authors__ = "Ian Goodfellow"
__copyright__ = "Copyright 2010-2012, Universite de Montreal"
__credits__ = ["Ian Goodfellow"]
__license__ = "3-clause BSD"
__maintainer__ = "LISA Lab"
__email__ = "pylearn-dev@googlegroups"
import numpy as np
import warnings
try:
from sklearn.multiclass import OneVsRestClassifier
from sklearn.svm import SVC
except ImportError:
warnings.warn("Could not import sklearn.")
class OneVsRestClassifier(object):
"""
See `sklearn.multiclass.OneVsRestClassifier`.
Notes
-----
This class is a dummy class included so that sphinx
can import DenseMulticlassSVM and document it even
when sklearn is not installed.
"""
def __init__(self, estimator):
raise RuntimeError("sklearn not available.")
class DenseMulticlassSVM(OneVsRestClassifier):
"""
sklearn does very different things behind the scenes depending
upon the exact identity of the class you use. The only way to
get an SVM implementation that works with dense data is to use
the `SVC` class, which implements one-against-one
classification. This wrapper uses it to implement one-against-
rest classification, which generally works better in my
experiments.
To avoid duplicating the training data, use only numpy ndarrays
whose tags.c_contigous flag is true, and which are in float64
format.
Parameters
----------
C : float
SVM regularization parameter.
See SVC.__init__ for details.
kernel : str
Type of kernel to use.
See SVC.__init__ for details.
gamma : float
Optional parameter of kernel.
See SVC.__init__ for details.
coef0 : float
Optional parameter of kernel.
See SVC.__init__ for details.
degree : int
Degree of kernel, if kernel is polynomial.
See SVC.__init__ for details.
"""
def __init__(self, C, kernel='rbf', gamma=1.0, coef0=1.0, degree=3):
estimator = SVC(C=C, kernel=kernel, gamma=gamma, coef0=coef0,
degree=degree)
super(DenseMulticlassSVM, self).__init__(estimator)
def fit(self, X, y):
"""
Fit underlying estimators.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Data.
y : array-like, shape = [n_samples] or [n_samples, n_classes]
Multi-class targets. An indicator matrix turns on multilabel
classification.
Returns
-------
self
"""
super(DenseMulticlassSVM, self).fit(X, y)
return self
def decision_function(self, X):
"""
Returns the distance of each sample from the decision boundary for
each class.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
A 2D ndarray with each row containing the input features for one
example.
Returns
-------
T : array-like, shape = [n_samples, n_classes]
"""
return np.column_stack([estimator.decision_function(X)
for estimator in self.estimators_])
| bsd-3-clause |
tobegit3hub/deep_cnn | java_predict_client/src/main/proto/tensorflow/examples/learn/boston.py | 25 | 1932 | # Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""Example of DNNRegressor for Housing dataset."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
from sklearn import cross_validation
from sklearn import metrics
from sklearn import preprocessing
import tensorflow as tf
from tensorflow.contrib import learn
def main(unused_argv):
# Load dataset
boston = learn.datasets.load_dataset('boston')
x, y = boston.data, boston.target
# Split dataset into train / test
x_train, x_test, y_train, y_test = cross_validation.train_test_split(
x, y, test_size=0.2, random_state=42)
# Scale data (training set) to 0 mean and unit standard deviation.
scaler = preprocessing.StandardScaler()
x_train = scaler.fit_transform(x_train)
# Build 2 layer fully connected DNN with 10, 10 units respectively.
feature_columns = learn.infer_real_valued_columns_from_input(x_train)
regressor = learn.DNNRegressor(
feature_columns=feature_columns, hidden_units=[10, 10])
# Fit
regressor.fit(x_train, y_train, steps=5000, batch_size=1)
# Predict and score
y_predicted = list(
regressor.predict(scaler.transform(x_test), as_iterable=True))
score = metrics.mean_squared_error(y_predicted, y_test)
print('MSE: {0:f}'.format(score))
if __name__ == '__main__':
tf.app.run()
| apache-2.0 |
yzl0083/orange | Orange/testing/unit/tests/test_logreg.py | 6 | 2374 | from Orange.testing import testing
try:
import unittest2 as unittest
except:
import unittest
from orngLR import LogRegLearner, Univariate_LogRegLearner, StepWiseFSS, StepWiseFSS_Filter
from Orange.classification.logreg import LibLinearLogRegLearner, dump
import Orange
def datasets_iter():
for name, (data,) in testing.datasets_iter(testing.CLASSIFICATION_DATASETS):
if len(data.domain.class_var.values) == 2:
yield name, (data,)
@testing.data_driven(data_iter=datasets_iter())
class TestLogRegLearner(testing.LearnerTestCase):
LEARNER = LogRegLearner
@testing.test_on_data
def test_learner_on(self, dataset):
""" Test LogRegLearner.
"""
if len(dataset) < len(dataset.domain):
raise unittest.SkipTest("Not enough examples")
testing.LearnerTestCase.test_learner_on(self, dataset)
@testing.data_driven(data_iter=datasets_iter())
class TestStepWiseFSS(unittest.TestCase):
@testing.test_on_data
def test_stepwise_fss_on(self, dataset):
""" Test StepWiseFSS.
"""
if len(dataset) < len(dataset.domain):
raise unittest.SkipTest("No enough examples")
attrs = StepWiseFSS(dataset)
new_dataset = StepWiseFSS_Filter(dataset)
self.assertTrue([a1 == a2 for a1, a2 in zip(attrs, new_dataset.domain.attributes)])
@testing.datasets_driven(datasets=testing.CLASSIFICATION_DATASETS)
class TestLibLinearLogRegLearner(testing.LearnerTestCase):
LEARNER = LibLinearLogRegLearner
@testing.test_on_data
def test_learner_on(self, dataset):
""" Test LibLinearLogRegLearner.
"""
testing.LearnerTestCase.test_learner_on(self, dataset)
class TestUtils(unittest.TestCase):
def test_dump(self):
"""Test for dump() failing (OverflowError: math range error on math.exp)
on classifiers with high beta"""
quality = Orange.feature.Discrete('quality')
quality.add_value('low')
quality.add_value('high')
price = Orange.feature.Continuous('price')
variables = [price, quality]
matrix = [[0.01, 'high'], [0.001, 'low']]
domain = Orange.data.Domain(variables)
data = Orange.data.Table(domain, matrix)
classifier = LogRegLearner(data)
text_dump = dump(classifier)
if __name__ == "__main__":
unittest.main()
| gpl-3.0 |
mfjb/scikit-learn | benchmarks/bench_mnist.py | 153 | 6006 | """
=======================
MNIST dataset benchmark
=======================
Benchmark on the MNIST dataset. The dataset comprises 70,000 samples
and 784 features. Here, we consider the task of predicting
10 classes - digits from 0 to 9 from their raw images. By contrast to the
covertype dataset, the feature space is homogenous.
Example of output :
[..]
Classification performance:
===========================
Classifier train-time test-time error-rat
------------------------------------------------------------
Nystroem-SVM 105.07s 0.91s 0.0227
ExtraTrees 48.20s 1.22s 0.0288
RandomForest 47.17s 1.21s 0.0304
SampledRBF-SVM 140.45s 0.84s 0.0486
CART 22.84s 0.16s 0.1214
dummy 0.01s 0.02s 0.8973
"""
from __future__ import division, print_function
# Author: Issam H. Laradji
# Arnaud Joly <arnaud.v.joly@gmail.com>
# License: BSD 3 clause
import os
from time import time
import argparse
import numpy as np
from sklearn.datasets import fetch_mldata
from sklearn.datasets import get_data_home
from sklearn.ensemble import ExtraTreesClassifier
from sklearn.ensemble import RandomForestClassifier
from sklearn.dummy import DummyClassifier
from sklearn.externals.joblib import Memory
from sklearn.kernel_approximation import Nystroem
from sklearn.kernel_approximation import RBFSampler
from sklearn.metrics import zero_one_loss
from sklearn.pipeline import make_pipeline
from sklearn.svm import LinearSVC
from sklearn.tree import DecisionTreeClassifier
from sklearn.utils import check_array
# Memoize the data extraction and memory map the resulting
# train / test splits in readonly mode
memory = Memory(os.path.join(get_data_home(), 'mnist_benchmark_data'),
mmap_mode='r')
@memory.cache
def load_data(dtype=np.float32, order='F'):
"""Load the data, then cache and memmap the train/test split"""
######################################################################
## Load dataset
print("Loading dataset...")
data = fetch_mldata('MNIST original')
X = check_array(data['data'], dtype=dtype, order=order)
y = data["target"]
# Normalize features
X = X / 255
## Create train-test split (as [Joachims, 2006])
print("Creating train-test split...")
n_train = 60000
X_train = X[:n_train]
y_train = y[:n_train]
X_test = X[n_train:]
y_test = y[n_train:]
return X_train, X_test, y_train, y_test
ESTIMATORS = {
"dummy": DummyClassifier(),
'CART': DecisionTreeClassifier(),
'ExtraTrees': ExtraTreesClassifier(n_estimators=100),
'RandomForest': RandomForestClassifier(n_estimators=100),
'Nystroem-SVM':
make_pipeline(Nystroem(gamma=0.015, n_components=1000), LinearSVC(C=100)),
'SampledRBF-SVM':
make_pipeline(RBFSampler(gamma=0.015, n_components=1000), LinearSVC(C=100))
}
if __name__ == "__main__":
parser = argparse.ArgumentParser()
parser.add_argument('--classifiers', nargs="+",
choices=ESTIMATORS, type=str,
default=['ExtraTrees', 'Nystroem-SVM'],
help="list of classifiers to benchmark.")
parser.add_argument('--n-jobs', nargs="?", default=1, type=int,
help="Number of concurrently running workers for "
"models that support parallelism.")
parser.add_argument('--order', nargs="?", default="C", type=str,
choices=["F", "C"],
help="Allow to choose between fortran and C ordered "
"data")
parser.add_argument('--random-seed', nargs="?", default=0, type=int,
help="Common seed used by random number generator.")
args = vars(parser.parse_args())
print(__doc__)
X_train, X_test, y_train, y_test = load_data(order=args["order"])
print("")
print("Dataset statistics:")
print("===================")
print("%s %d" % ("number of features:".ljust(25), X_train.shape[1]))
print("%s %d" % ("number of classes:".ljust(25), np.unique(y_train).size))
print("%s %s" % ("data type:".ljust(25), X_train.dtype))
print("%s %d (size=%dMB)" % ("number of train samples:".ljust(25),
X_train.shape[0], int(X_train.nbytes / 1e6)))
print("%s %d (size=%dMB)" % ("number of test samples:".ljust(25),
X_test.shape[0], int(X_test.nbytes / 1e6)))
print()
print("Training Classifiers")
print("====================")
error, train_time, test_time = {}, {}, {}
for name in sorted(args["classifiers"]):
print("Training %s ... " % name, end="")
estimator = ESTIMATORS[name]
estimator_params = estimator.get_params()
estimator.set_params(**{p: args["random_seed"]
for p in estimator_params
if p.endswith("random_state")})
if "n_jobs" in estimator_params:
estimator.set_params(n_jobs=args["n_jobs"])
time_start = time()
estimator.fit(X_train, y_train)
train_time[name] = time() - time_start
time_start = time()
y_pred = estimator.predict(X_test)
test_time[name] = time() - time_start
error[name] = zero_one_loss(y_test, y_pred)
print("done")
print()
print("Classification performance:")
print("===========================")
print("{0: <24} {1: >10} {2: >11} {3: >12}"
"".format("Classifier ", "train-time", "test-time", "error-rate"))
print("-" * 60)
for name in sorted(args["classifiers"], key=error.get):
print("{0: <23} {1: >10.2f}s {2: >10.2f}s {3: >12.4f}"
"".format(name, train_time[name], test_time[name], error[name]))
print()
| bsd-3-clause |
ssaeger/scikit-learn | sklearn/decomposition/tests/test_nmf.py | 12 | 9004 | import numpy as np
from scipy import linalg
from sklearn.decomposition import (NMF, ProjectedGradientNMF,
non_negative_factorization)
from sklearn.decomposition import nmf # For testing internals
from scipy.sparse import csc_matrix
from sklearn.utils.testing import assert_true
from sklearn.utils.testing import assert_false
from sklearn.utils.testing import assert_raise_message
from sklearn.utils.testing import assert_array_almost_equal
from sklearn.utils.testing import assert_almost_equal
from sklearn.utils.testing import assert_greater
from sklearn.utils.testing import assert_less
from sklearn.utils.testing import ignore_warnings
from sklearn.base import clone
random_state = np.random.mtrand.RandomState(0)
def test_initialize_nn_output():
# Test that initialization does not return negative values
data = np.abs(random_state.randn(10, 10))
for init in ('random', 'nndsvd', 'nndsvda', 'nndsvdar'):
W, H = nmf._initialize_nmf(data, 10, init=init, random_state=0)
assert_false((W < 0).any() or (H < 0).any())
@ignore_warnings
def test_parameter_checking():
A = np.ones((2, 2))
name = 'spam'
msg = "Invalid solver parameter: got 'spam' instead of one of"
assert_raise_message(ValueError, msg, NMF(solver=name).fit, A)
msg = "Invalid init parameter: got 'spam' instead of one of"
assert_raise_message(ValueError, msg, NMF(init=name).fit, A)
msg = "Invalid sparseness parameter: got 'spam' instead of one of"
assert_raise_message(ValueError, msg, NMF(sparseness=name).fit, A)
msg = "Negative values in data passed to"
assert_raise_message(ValueError, msg, NMF().fit, -A)
assert_raise_message(ValueError, msg, nmf._initialize_nmf, -A,
2, 'nndsvd')
clf = NMF(2, tol=0.1).fit(A)
assert_raise_message(ValueError, msg, clf.transform, -A)
def test_initialize_close():
# Test NNDSVD error
# Test that _initialize_nmf error is less than the standard deviation of
# the entries in the matrix.
A = np.abs(random_state.randn(10, 10))
W, H = nmf._initialize_nmf(A, 10, init='nndsvd')
error = linalg.norm(np.dot(W, H) - A)
sdev = linalg.norm(A - A.mean())
assert_true(error <= sdev)
def test_initialize_variants():
# Test NNDSVD variants correctness
# Test that the variants 'nndsvda' and 'nndsvdar' differ from basic
# 'nndsvd' only where the basic version has zeros.
data = np.abs(random_state.randn(10, 10))
W0, H0 = nmf._initialize_nmf(data, 10, init='nndsvd')
Wa, Ha = nmf._initialize_nmf(data, 10, init='nndsvda')
War, Har = nmf._initialize_nmf(data, 10, init='nndsvdar',
random_state=0)
for ref, evl in ((W0, Wa), (W0, War), (H0, Ha), (H0, Har)):
assert_true(np.allclose(evl[ref != 0], ref[ref != 0]))
@ignore_warnings
def test_nmf_fit_nn_output():
# Test that the decomposition does not contain negative values
A = np.c_[5 * np.ones(5) - np.arange(1, 6),
5 * np.ones(5) + np.arange(1, 6)]
for solver in ('pg', 'cd'):
for init in (None, 'nndsvd', 'nndsvda', 'nndsvdar'):
model = NMF(n_components=2, solver=solver, init=init,
random_state=0)
transf = model.fit_transform(A)
assert_false((model.components_ < 0).any() or
(transf < 0).any())
@ignore_warnings
def test_nmf_fit_close():
# Test that the fit is not too far away
for solver in ('pg', 'cd'):
pnmf = NMF(5, solver=solver, init='nndsvd', random_state=0)
X = np.abs(random_state.randn(6, 5))
assert_less(pnmf.fit(X).reconstruction_err_, 0.05)
def test_nls_nn_output():
# Test that NLS solver doesn't return negative values
A = np.arange(1, 5).reshape(1, -1)
Ap, _, _ = nmf._nls_subproblem(np.dot(A.T, -A), A.T, A, 0.001, 100)
assert_false((Ap < 0).any())
def test_nls_close():
# Test that the NLS results should be close
A = np.arange(1, 5).reshape(1, -1)
Ap, _, _ = nmf._nls_subproblem(np.dot(A.T, A), A.T, np.zeros_like(A),
0.001, 100)
assert_true((np.abs(Ap - A) < 0.01).all())
@ignore_warnings
def test_nmf_transform():
# Test that NMF.transform returns close values
A = np.abs(random_state.randn(6, 5))
for solver in ('pg', 'cd'):
m = NMF(solver=solver, n_components=4, init='nndsvd', random_state=0)
ft = m.fit_transform(A)
t = m.transform(A)
assert_array_almost_equal(ft, t, decimal=2)
@ignore_warnings
def test_nmf_inverse_transform():
# Test that NMF.inverse_transform returns close values
random_state = np.random.RandomState(0)
A = np.abs(random_state.randn(6, 4))
for solver in ('pg', 'cd'):
m = NMF(solver=solver, n_components=4, init='random', random_state=0)
ft = m.fit_transform(A)
t = m.transform(A)
A_new = m.inverse_transform(t)
assert_array_almost_equal(A, A_new, decimal=2)
@ignore_warnings
def test_n_components_greater_n_features():
# Smoke test for the case of more components than features.
A = np.abs(random_state.randn(30, 10))
NMF(n_components=15, random_state=0, tol=1e-2).fit(A)
@ignore_warnings
def test_projgrad_nmf_sparseness():
# Test sparseness
# Test that sparsity constraints actually increase sparseness in the
# part where they are applied.
tol = 1e-2
A = np.abs(random_state.randn(10, 10))
m = ProjectedGradientNMF(n_components=5, random_state=0, tol=tol).fit(A)
data_sp = ProjectedGradientNMF(n_components=5, sparseness='data',
random_state=0,
tol=tol).fit(A).data_sparseness_
comp_sp = ProjectedGradientNMF(n_components=5, sparseness='components',
random_state=0,
tol=tol).fit(A).comp_sparseness_
assert_greater(data_sp, m.data_sparseness_)
assert_greater(comp_sp, m.comp_sparseness_)
@ignore_warnings
def test_sparse_input():
# Test that sparse matrices are accepted as input
from scipy.sparse import csc_matrix
A = np.abs(random_state.randn(10, 10))
A[:, 2 * np.arange(5)] = 0
A_sparse = csc_matrix(A)
for solver in ('pg', 'cd'):
est1 = NMF(solver=solver, n_components=5, init='random',
random_state=0, tol=1e-2)
est2 = clone(est1)
W1 = est1.fit_transform(A)
W2 = est2.fit_transform(A_sparse)
H1 = est1.components_
H2 = est2.components_
assert_array_almost_equal(W1, W2)
assert_array_almost_equal(H1, H2)
@ignore_warnings
def test_sparse_transform():
# Test that transform works on sparse data. Issue #2124
A = np.abs(random_state.randn(3, 2))
A[A > 1.0] = 0
A = csc_matrix(A)
for solver in ('pg', 'cd'):
model = NMF(solver=solver, random_state=0, tol=1e-4, n_components=2)
A_fit_tr = model.fit_transform(A)
A_tr = model.transform(A)
assert_array_almost_equal(A_fit_tr, A_tr, decimal=1)
@ignore_warnings
def test_non_negative_factorization_consistency():
# Test that the function is called in the same way, either directly
# or through the NMF class
A = np.abs(random_state.randn(10, 10))
A[:, 2 * np.arange(5)] = 0
for solver in ('pg', 'cd'):
W_nmf, H, _ = non_negative_factorization(
A, solver=solver, random_state=1, tol=1e-2)
W_nmf_2, _, _ = non_negative_factorization(
A, H=H, update_H=False, solver=solver, random_state=1, tol=1e-2)
model_class = NMF(solver=solver, random_state=1, tol=1e-2)
W_cls = model_class.fit_transform(A)
W_cls_2 = model_class.transform(A)
assert_array_almost_equal(W_nmf, W_cls, decimal=10)
assert_array_almost_equal(W_nmf_2, W_cls_2, decimal=10)
@ignore_warnings
def test_non_negative_factorization_checking():
A = np.ones((2, 2))
# Test parameters checking is public function
nnmf = non_negative_factorization
msg = "Number of components must be positive; got (n_components='2')"
assert_raise_message(ValueError, msg, nnmf, A, A, A, '2')
msg = "Negative values in data passed to NMF (input H)"
assert_raise_message(ValueError, msg, nnmf, A, A, -A, 2, 'custom')
msg = "Negative values in data passed to NMF (input W)"
assert_raise_message(ValueError, msg, nnmf, A, -A, A, 2, 'custom')
msg = "Array passed to NMF (input H) is full of zeros"
assert_raise_message(ValueError, msg, nnmf, A, A, 0 * A, 2, 'custom')
def test_safe_compute_error():
A = np.abs(random_state.randn(10, 10))
A[:, 2 * np.arange(5)] = 0
A_sparse = csc_matrix(A)
W, H = nmf._initialize_nmf(A, 5, init='random', random_state=0)
error = nmf._safe_compute_error(A, W, H)
error_sparse = nmf._safe_compute_error(A_sparse, W, H)
assert_almost_equal(error, error_sparse)
| bsd-3-clause |
jballanc/openmicroscopy | components/tools/OmeroPy/test/integration/test_icontainer.py | 4 | 21029 | #!/usr/bin/env python
# -*- coding: utf-8 -*-
"""
Integration test focused on the omero.api.IContainer interface
a running server.
Copyright 2008-2013 Glencoe Software, Inc. All rights reserved.
Use is subject to license terms supplied in LICENSE.txt
"""
import test.integration.library as lib
import pytest
import omero
from omero_model_PixelsI import PixelsI
from omero_model_ImageI import ImageI
from omero_model_DatasetI import DatasetI
from omero_model_ExperimenterI import ExperimenterI
from omero_model_ExperimenterGroupI import ExperimenterGroupI
from omero_model_GroupExperimenterMapI import GroupExperimenterMapI
from omero_model_DatasetImageLinkI import DatasetImageLinkI
from omero_model_ImageAnnotationLinkI import ImageAnnotationLinkI
from omero_model_CommentAnnotationI import CommentAnnotationI
from omero.rtypes import rstring, rtime
from uuid import uuid4
class TestIContainer(lib.ITest):
def testFindAnnotations(self):
ipojo = self.client.sf.getContainerService()
i = ImageI()
i.setName(rstring("name"))
i.setAcquisitionDate(rtime(0))
i = ipojo.createDataObject(i,None)
def testFindAndCountAnnotationsForSharedData(self):
uuid = self.root.sf.getAdminService().getEventContext().sessionUuid
query = self.root.sf.getQueryService()
update = self.root.sf.getUpdateService()
admin = self.root.sf.getAdminService()
ipojo = self.root.sf.getContainerService()
### create new users
#group1
new_gr1 = ExperimenterGroupI()
new_gr1.name = rstring("group1_%s" % uuid)
gid = admin.createGroup(new_gr1)
#new user1
new_exp = ExperimenterI()
new_exp.omeName = rstring("user1_%s" % uuid)
new_exp.firstName = rstring("New")
new_exp.lastName = rstring("Test")
defaultGroup = admin.getGroup(gid)
listOfGroups = list()
listOfGroups.append(admin.lookupGroup("user"))
eid = admin.createExperimenterWithPassword(new_exp, rstring("ome"), defaultGroup, listOfGroups)
#new user2
new_exp2 = ExperimenterI()
new_exp2.omeName = rstring("user2_%s" % uuid)
new_exp2.firstName = rstring("New2")
new_exp2.lastName = rstring("Test2")
defaultGroup = admin.getGroup(gid)
listOfGroups = list()
listOfGroups.append(admin.lookupGroup("user"))
eid2 = admin.createExperimenterWithPassword(new_exp2, rstring("ome"), defaultGroup, listOfGroups)
## get users
user1 = admin.getExperimenter(eid)
user2 = admin.getExperimenter(eid2)
## login as user1
cl1 = self.new_client(user=user1, password="ome")
update1 = cl1.sf.getUpdateService()
ipojo1 = cl1.sf.getContainerService()
# create image
img = ImageI()
img.setName(rstring('test1154-img-%s' % (uuid)))
img.setAcquisitionDate(rtime(0))
# default permission 'rw----':
img = update1.saveAndReturnObject(img)
img.unload()
ann1 = CommentAnnotationI()
ann1.textValue = rstring("user comment - %s" % uuid)
l_ann1 = ImageAnnotationLinkI()
l_ann1.setParent(img)
l_ann1.setChild(ann1)
update1.saveObject(l_ann1)
#user retrives the annotations for image
coll_count = ipojo1.getCollectionCount("Image", "ome.model.containers.Image_annotationLinks", [img.id.val], None)
assert 1 == coll_count.get(img.id.val, [])
#assert 1 == len(ipojo1.findAnnotations("Image", [img.id.val], None, None).get(img.id.val, []))
## login as user2
cl2 = self.new_client(user=user2, password="ome")
update2 = cl1.sf.getUpdateService()
ann = CommentAnnotationI()
ann.textValue = rstring("user2 comment - %s" % uuid)
l_ann = ImageAnnotationLinkI()
l_ann.setParent(img)
l_ann.setChild(ann)
update2.saveObject(l_ann)
#do they see the same vals?
#print ipojo1.getCollectionCount("Image", "ome.model.containers.Image_annotationLinks", [img.id.val], None)
#print ipojo.getCollectionCount("Image", "ome.model.containers.Image_annotationLinks", [img.id.val], None)
#print len(ipojo1.findAnnotations("Image", [img.id.val], None, None).get(img.id.val, []))
#print len(ipojo.findAnnotations("Image", [img.id.val], None, None).get(img.id.val, []))
coll_count = ipojo1.getCollectionCount("Image", "ome.model.containers.Image_annotationLinks", [img.id.val], None)
assert 2 == coll_count.get(img.id.val, [])
#anns = ipojo1.findAnnotations("Image", [img.id.val], None, None).get(img.id.val, [])
#assert 2 == len(anns)
#assert anns[0].details.permissions == 'rw----'
#assert anns[1].details.permissions == 'rw----'
cl1.sf.closeOnDestroy()
cl2.sf.closeOnDestroy()
def testCreateAfterBlitzPort(self):
ipojo = self.client.sf.getContainerService()
i = ImageI()
i.setName(rstring("name"))
i.setAcquisitionDate(rtime(0))
i = ipojo.createDataObject(i,None)
o = i.getDetails().owner
assert -1 == o.sizeOfGroupExperimenterMap()
class TestSplitFilesets(lib.ITest):
def checkSplitFilesets(self, client, dtypeIdsMap, expected):
"""
To check we get the expected result from iContainer.getImagesBySplitFilesets()
we do the query with dtype & ids and compare the returned data with
the specified dict.
"""
container = client.sf.getContainerService()
result = container.getImagesBySplitFilesets(dtypeIdsMap, None)
def cmpLists(listOne, listTwo):
""" Returns True if both lists have the same items """
if (len(listOne) != len(listTwo)):
return False
for one in listOne:
if one not in listTwo:
return False
return True
# compare result with expected...
assert set(result.keys()) == set(expected.keys()), "Result should have expected Fileset IDs"
for fsId, expectedDict in expected.items():
assert cmpLists(expectedDict[True], result[fsId][True]), "True ImageIDs should match"
assert cmpLists(expectedDict[False], result[fsId][False]), "False ImageIDs should match"
def testFilesetSplitByImage(self):
"""
Fileset of 2 Images, we test split using 1 Image ID
"""
client, user = self.new_client_and_user(perms="rw----")
images = self.importMIF(2, client=client)
# Lookup the fileset
imgId = images[0].id.val
query = client.sf.getQueryService()
filesetId = query.get('Image', imgId).fileset.id.val
# Define what we expect & query split fileset
expected = {filesetId: {True: [imgId], False: [images[1].id.val]}}
self.checkSplitFilesets(client, {'Image': [imgId]}, expected)
def testFilesetNotSplitByImage(self):
"""
Fileset of 2 Images with No split (query with both Image IDs)
"""
client, user = self.new_client_and_user(perms="rw----")
images = self.importMIF(2, client=client)
# Lookup the fileset
imgIds = [i.id.val for i in images]
query = client.sf.getQueryService()
filesetId = query.get('Image', imgIds[0]).fileset.id.val
# Define what we expect & query split fileset
expected = {}
self.checkSplitFilesets(client, {'Image': imgIds}, expected)
def testFilesetSplitByDatasetAndProject(self):
"""
Fileset of 2 Images, one in a Dataset. Test split using Dataset ID
"""
client, user = self.new_client_and_user(perms="rw----")
update = client.sf.getUpdateService()
query = client.sf.getQueryService()
# Dataset contains 1 image of a 2-image fileset
images = self.importMIF(2, client=client)
ds = omero.model.DatasetI()
ds.name = omero.rtypes.rstring("testFilesetSplitByDataset")
ds = update.saveAndReturnObject(ds)
link = omero.model.DatasetImageLinkI()
link.setParent(ds.proxy())
link.setChild(images[0].proxy())
link = update.saveAndReturnObject(link)
# Dataset in Project
pr = omero.model.ProjectI()
pr.name = omero.rtypes.rstring("testFilesetSplitByProject")
pr = update.saveAndReturnObject(pr)
link = omero.model.ProjectDatasetLinkI()
link.setParent(pr.proxy())
link.setChild(ds.proxy())
link = update.saveAndReturnObject(link)
# Lookup the fileset
imgId = images[0].id.val
filesetId = query.get('Image', imgId).fileset.id.val
# Define what we expect & query split fileset
expected = {filesetId: {True: [imgId], False: [images[1].id.val]}}
self.checkSplitFilesets(client, {'Dataset': [ds.id.val]}, expected)
# Expect same result if query via Project
self.checkSplitFilesets(client, {'Project': [pr.id.val]}, expected)
# No split if we include the extra image ID
expected = {}
idsMap = {'Dataset': [ds.id.val], "Image": [images[1].id.val]}
self.checkSplitFilesets(client, idsMap, expected)
idsMap = {'Project': [pr.id.val], "Image": [images[1].id.val]}
self.checkSplitFilesets(client, idsMap, expected)
def testFilesetNotSplitByDatasets(self):
"""
Fileset of 2 Images, both in different Datasets. Test Not split using Dataset IDs
"""
client, user = self.new_client_and_user(perms="rw----")
update = client.sf.getUpdateService()
query = client.sf.getQueryService()
# Datasets each contain 1 image of a 2-image fileset
datasets = self.createDatasets(2, "testFilesetNotSplitByDatasets", client=client)
images = self.importMIF(2, client=client)
for i in range(2):
link = omero.model.DatasetImageLinkI()
link.setParent(datasets[i].proxy())
link.setChild(images[i].proxy())
link = update.saveAndReturnObject(link)
# Another Dataset contains both images
ds = omero.model.DatasetI()
ds.name = omero.rtypes.rstring("testFilesetNotSplitByDatasets")
ds = update.saveAndReturnObject(ds)
for i in images:
link = omero.model.DatasetImageLinkI()
link.setParent(ds.proxy())
link.setChild(i.proxy())
link = update.saveAndReturnObject(link)
# Lookup the fileset
imgId = images[0].id.val
filesetId = query.get('Image', imgId).fileset.id.val
# No split if we pass in both Dataset IDs...
dsIds = [d.id.val for d in datasets]
expected = {}
self.checkSplitFilesets(client, {'Dataset': dsIds}, expected)
# ...or the Dataset that contains both images
self.checkSplitFilesets(client, {'Dataset': [ds.id.val]}, expected)
# confirm split if we choose one Dataset
expected = {filesetId: {True: [imgId], False: [images[1].id.val]}}
self.checkSplitFilesets(client, {'Dataset': [datasets[0].id.val]}, expected)
def testGetImagesBySplitFilesetsManyCases(self):
query = self.client.sf.getQueryService()
update = self.client.sf.getUpdateService()
ipojo = self.client.sf.getContainerService()
admin = self.client.sf.getAdminService()
eventContext = admin.getEventContext()
# entity hierarchy
project_dataset_hierarchy = [(0, [0,1])]
dataset_image_hierarchy = [(0, [0,1]), (1, [2,6]), (2, [3,4,5])]
screen_plate_hierarchy = [(0, [0,1])]
plate_well_hierarchy = [(0, [0,1]), (1, [2,6]), (2, [3,4,5])]
well_image_hierarchy = [(0, [0]), (1, [1]), (2, [2]), (3, [3]), (4, [4]), (5, [5])]
fileset_image_hierarchy = [(0, [0]), (1, [1,2]), (2, [3,4,5])]
# test data, input and expected output value, is by list index
test_cases = [({'Image': [0,1,2,3,4,5]}, {}),
({'Image': [6]}, {}),
({'Image': [0,1]}, {1: {True: [1], False: [2]}}),
({'Image': [3]}, {2: {True: [3], False: [4,5]}}),
({'Image': [5]}, {2: {True: [5], False: [3,4]}}),
({'Image': [3,4]}, {2: {True: [3,4], False: [5]}}),
({'Image': [0,1,5,6]}, {1: {True: [1], False: [2]}, 2: {True: [5], False: [3,4]}}),
({'Fileset': [0], 'Image': [0,3,4,5,6]}, {}),
({'Fileset': [0,1,2], 'Image': [0]}, {}),
({'Well': [0,1,2,3,4,5]}, {}),
({'Well': [6]}, {}),
({'Well': [0,1]}, {1: {True: [1], False: [2]}}),
({'Well': [3]}, {2: {True: [3], False: [4,5]}}),
({'Well': [5]}, {2: {True: [5], False: [3,4]}}),
({'Well': [3,4]}, {2: {True: [3,4], False: [5]}}),
({'Well': [0,1,5,6]}, {1: {True: [1], False: [2]}, 2: {True: [5], False: [3,4]}}),
({'Image': [0,1], 'Well': [5,6]}, {1: {True: [1], False: [2]}, 2: {True: [5], False: [3,4]}}),
({'Fileset': [0], 'Well': [0,3,4,5,6]}, {}),
({'Fileset': [0,1,2], 'Well': [0]}, {}),
({'Fileset': [2]}, {}),
({'Dataset': [0]}, {1: {True: [1], False: [2]}}),
({'Dataset': [1]}, {1: {True: [2], False: [1]}}),
({'Dataset': [2]}, {}),
({'Dataset': [1], 'Image': [0,1]}, {}),
({'Project': [0]}, {}),
({'Project': [0], 'Image': [3]}, {2: {True: [3], False: [4,5]}}),
({'Dataset': [0], 'Fileset': [1]}, {}),
({'Plate': [0]}, {1: {True: [1], False: [2]}}),
({'Plate': [1]}, {1: {True: [2], False: [1]}}),
({'Plate': [2]}, {}),
({'Plate': [1], 'Image': [0,1]}, {}),
({'Plate': [1], 'Well': [0,1]}, {}),
({'Plate': [1], 'Image': [0], 'Well': [1]}, {}),
({'Screen': [0]}, {}),
({'Screen': [0], 'Image': [3]}, {2: {True: [3], False: [4,5]}}),
({'Screen': [0], 'Well': [3]}, {2: {True: [3], False: [4,5]}}),
({'Screen': [0], 'Image': [3], 'Well': [3]}, {2: {True: [3], False: [4,5]}}),
({'Plate': [0], 'Fileset': [1]}, {})]
# TODO: consider factoring some of the below out into library functions for use by other tests
# name entity lists
projects = []
datasets = []
screens = []
plates = []
wells = []
filesets = []
images = []
named_entities = {'Project': projects, 'Dataset': datasets, 'Screen': screens, 'Plate': plates,
'Well': wells, 'Fileset': filesets, 'Image': images}
# note all test case input values
all_inputs = {}
for name in named_entities.keys():
all_inputs[name] = []
for input, expected in test_cases:
for name, ids in input.items():
all_inputs[name] += ids
# create test entities named in test case input values
parents = lambda hierarchy: [ from_index for from_index, to_indices in hierarchy ]
children = lambda hierarchy: sum([ to_indices for from_index, to_indices in hierarchy ], [])
for project_index in set(all_inputs['Project'] + parents(project_dataset_hierarchy)):
project = omero.model.ProjectI()
project.name = rstring('Project #%i' % project_index)
project.id = update.saveAndReturnObject(project).id
projects.append(query.get('Project', project.id.val))
for dataset_index in set(all_inputs['Dataset'] + children(project_dataset_hierarchy) + parents(dataset_image_hierarchy)):
dataset = omero.model.DatasetI()
dataset.name = rstring('Dataset #%i' % dataset_index)
dataset.id = update.saveAndReturnObject(dataset).id
datasets.append(query.get('Dataset', dataset.id.val))
for screen_index in set(all_inputs['Screen'] + parents(screen_plate_hierarchy)):
screen = omero.model.ScreenI()
screen.name = rstring('Screen #%i' % screen_index)
screen.id = update.saveAndReturnObject(screen).id
screens.append(query.get('Screen', screen.id.val))
for plate_index in set(all_inputs['Plate'] + children(screen_plate_hierarchy) + parents(plate_well_hierarchy)):
plate = omero.model.PlateI()
plate.name = rstring('Plate #%i' % plate_index)
plate.id = update.saveAndReturnObject(plate).id
plates.append(query.get('Plate', plate.id.val))
for well_index in set(all_inputs['Well'] + children(plate_well_hierarchy) + parents(well_image_hierarchy)):
well = omero.model.WellI()
wells.append(well) # cannot save until attached to plate
for fileset_index in set(all_inputs['Fileset'] + parents(fileset_image_hierarchy)):
fileset = omero.model.FilesetI()
fileset.templatePrefix = rstring('%s_%i/%s' % (eventContext.userName, eventContext.userId, uuid4()))
fileset.id = update.saveAndReturnObject(fileset).id
filesets.append(query.get('Fileset', fileset.id.val))
for image_index in set(all_inputs['Image'] + children(dataset_image_hierarchy)
+ children(well_image_hierarchy)
+ children(fileset_image_hierarchy)):
image = omero.model.ImageI()
image.name = rstring('Image #%i' % image_index)
image.acquisitionDate = rtime(0L)
image.id = update.saveAndReturnObject(image).id
images.append(query.get('Image', image.id.val))
# associate test entities
for project_index, dataset_indices in project_dataset_hierarchy:
for dataset_index in dataset_indices:
project_dataset = omero.model.ProjectDatasetLinkI()
project_dataset.parent = projects[project_index]
project_dataset.child = datasets[dataset_index]
update.saveAndReturnObject(project_dataset)
for dataset_index, image_indices in dataset_image_hierarchy:
for image_index in image_indices:
dataset_image = omero.model.DatasetImageLinkI()
dataset_image.parent = datasets[dataset_index]
dataset_image.child = images[image_index]
update.saveAndReturnObject(dataset_image)
for screen_index, plate_indices in screen_plate_hierarchy:
for plate_index in plate_indices:
screen_plate = omero.model.ScreenPlateLinkI()
screen_plate.parent = screens[screen_index]
screen_plate.child = plates[plate_index]
update.saveAndReturnObject(screen_plate)
for plate_index, well_indices in plate_well_hierarchy:
for well_index in well_indices:
wells[well_index].plate = plates[plate_index]
for well_index, image_indices in well_image_hierarchy:
for image_index in image_indices:
well_sample = omero.model.WellSampleI()
well_sample.well = wells[well_index]
well_sample.image = images[image_index]
wells[well_index].addWellSample(well_sample)
for well in named_entities['Well']:
well.id = update.saveAndReturnObject(well).id
for fileset_index, image_indices in fileset_image_hierarchy:
for image_index in image_indices:
images[image_index].fileset = filesets[fileset_index]
update.saveAndReturnObject(images[image_index])
# translate list indices into database IDs and check that test cases run as expected
for named_indices, fileset_split in test_cases:
referenced = {}
for name, indices in named_indices.items():
referenced[name] = [ named_entities[name][index].id.val for index in indices ]
expected = {}
for fileset_index, image_indices in fileset_split.items():
fileset_id = filesets[fileset_index].id.val
expected[fileset_id] = {}
for included in [False, True]:
expected[fileset_id][included] = [ images[image_index].id.val for image_index in image_indices[included] ]
if ipojo.getImagesBySplitFilesets(referenced, None) != expected:
raise Exception('for referenced ' + str(named_indices) + ' expected ' + str(fileset_split))
| gpl-2.0 |
fbuentello/NBA-Machine-Learning-Tutorial | runNBA_Data.py | 1 | 3729 | # runNBA_Data.py
import time
import pandas as pd
import numpy as np
# Machine Learning algorithms
from sklearn.pipeline import Pipeline
from sklearn.linear_model import LinearRegression
from sklearn.preprocessing import PolynomialFeatures,scale
from sklearn.cross_validation import train_test_split, KFold
from sklearn.learning_curve import learning_curve
# Plot modules
import matplotlib.pyplot as plt
from matplotlib import style
style.use("ggplot")
pd.options.display.max_columns = 50
pd.set_option('expand_frame_repr', False)
# Custom modules
from nbaImport import readMongo, WANTED_FEATURES, PER_FEATURES
def flatten(objToFlatten):
return [item for sublist in objToFlatten for item in sublist]
def BuildDataSet():
# 1
nbaFrame = readMongo(db='YOUR DATABASE',collection='above50Games',
query= {}, queryReturn=WANTED_FEATURES, no_id=False,
mongo_uri='YOUR URI')
# 2
statsDF = pd.DataFrame(list(flatten(nbaFrame.Seasons)))
print(statsDF)
# 1
stats = pd.DataFrame(list(statsDF.totals.values))
stats['FT_M'] = stats['FTA'] - stats['FT']
stats['FG_M'] = stats['FGA'] - stats['FG']
stats[PER_FEATURES] = stats[PER_FEATURES].astype(float)
# 2
stats['PER'] = pd.DataFrame(list(statsDF.advanced.values))
# 3
stats = stats.reindex(np.random.permutation(stats.index))
X = np.array(stats[PER_FEATURES].values)
y = (stats["PER"].values.tolist())
return X,y
def PlotLearningCurve(X_data, y_data,algorithm, s_time):
print('PlotLearningCurve called')
# 1
sizes = np.array([.1,.2,.5,.8,.99])
train_sizes, train_scores, test_scores = learning_curve(
algorithm,
X_data,
y_data,
train_sizes=sizes)
print('after learning_curve')
train_mean = np.mean(train_scores, axis=1)
train_std = np.std(train_scores, axis=1)
test_mean = np.mean(test_scores, axis=1)
test_std = np.std(test_scores, axis=1)
# 2
plt.figure(figsize=(15,10)) # Width, Height
# Training Set
plt.fill_between(train_sizes, train_mean-train_std,
train_mean+train_std, alpha=0.1, color="r")
# Cross Validation Set
plt.fill_between(train_sizes, test_mean-test_std,
test_mean+test_std, alpha=0.1, color="g")
# Graph Legend text
trainLabel = ('%.3f%% Training score' % (train_mean[4]))
testLabel = ('%.3f%% Cross-validation score' % (test_mean[4]))
# Plot lines
plt.plot(train_sizes, train_mean, 'o-', color="r", label=trainLabel)
plt.plot(train_sizes, test_mean, 'o-', color="g", label=testLabel)
# Place title, X-axis label, Y-axis label
plt.suptitle('Linear Regression: NBA PER', fontsize=20)
plt.xlabel('Training examples')
plt.ylabel('Accuracy')
# Set limit on Y-axis, Place graph legend
plt.ylim((0.5, 1.1))
plt.xlim((0, 6500))
plt.legend(loc="best")
# Print duration of program
print("--- %s seconds ---" % (time.time() - s_time))
plt.show()
def Analysis(_deg=1):
start_time = time.time()
# 1
X, y = BuildDataSet()
linear_regression = LinearRegression()
# 2
polynomial_features = PolynomialFeatures(degree=_deg, include_bias=False)
# 3
algorithm = Pipeline([("polynomial_features", polynomial_features),
("linear_regression", linear_regression)])
#========================================================================== */
print('after Pipeline')
# 4
PlotLearningCurve(X, y, algorithm, start_time)
Analysis(3) | apache-2.0 |
waterponey/scikit-learn | examples/decomposition/plot_faces_decomposition.py | 42 | 4843 | """
============================
Faces dataset decompositions
============================
This example applies to :ref:`olivetti_faces` different unsupervised
matrix decomposition (dimension reduction) methods from the module
:py:mod:`sklearn.decomposition` (see the documentation chapter
:ref:`decompositions`) .
"""
print(__doc__)
# Authors: Vlad Niculae, Alexandre Gramfort
# License: BSD 3 clause
import logging
from time import time
from numpy.random import RandomState
import matplotlib.pyplot as plt
from sklearn.datasets import fetch_olivetti_faces
from sklearn.cluster import MiniBatchKMeans
from sklearn import decomposition
# Display progress logs on stdout
logging.basicConfig(level=logging.INFO,
format='%(asctime)s %(levelname)s %(message)s')
n_row, n_col = 2, 3
n_components = n_row * n_col
image_shape = (64, 64)
rng = RandomState(0)
###############################################################################
# Load faces data
dataset = fetch_olivetti_faces(shuffle=True, random_state=rng)
faces = dataset.data
n_samples, n_features = faces.shape
# global centering
faces_centered = faces - faces.mean(axis=0)
# local centering
faces_centered -= faces_centered.mean(axis=1).reshape(n_samples, -1)
print("Dataset consists of %d faces" % n_samples)
###############################################################################
def plot_gallery(title, images, n_col=n_col, n_row=n_row):
plt.figure(figsize=(2. * n_col, 2.26 * n_row))
plt.suptitle(title, size=16)
for i, comp in enumerate(images):
plt.subplot(n_row, n_col, i + 1)
vmax = max(comp.max(), -comp.min())
plt.imshow(comp.reshape(image_shape), cmap=plt.cm.gray,
interpolation='nearest',
vmin=-vmax, vmax=vmax)
plt.xticks(())
plt.yticks(())
plt.subplots_adjust(0.01, 0.05, 0.99, 0.93, 0.04, 0.)
###############################################################################
# List of the different estimators, whether to center and transpose the
# problem, and whether the transformer uses the clustering API.
estimators = [
('Eigenfaces - PCA using randomized SVD',
decomposition.PCA(n_components=n_components, svd_solver='randomized',
whiten=True),
True),
('Non-negative components - NMF',
decomposition.NMF(n_components=n_components, init='nndsvda', tol=5e-3),
False),
('Independent components - FastICA',
decomposition.FastICA(n_components=n_components, whiten=True),
True),
('Sparse comp. - MiniBatchSparsePCA',
decomposition.MiniBatchSparsePCA(n_components=n_components, alpha=0.8,
n_iter=100, batch_size=3,
random_state=rng),
True),
('MiniBatchDictionaryLearning',
decomposition.MiniBatchDictionaryLearning(n_components=15, alpha=0.1,
n_iter=50, batch_size=3,
random_state=rng),
True),
('Cluster centers - MiniBatchKMeans',
MiniBatchKMeans(n_clusters=n_components, tol=1e-3, batch_size=20,
max_iter=50, random_state=rng),
True),
('Factor Analysis components - FA',
decomposition.FactorAnalysis(n_components=n_components, max_iter=2),
True),
]
###############################################################################
# Plot a sample of the input data
plot_gallery("First centered Olivetti faces", faces_centered[:n_components])
###############################################################################
# Do the estimation and plot it
for name, estimator, center in estimators:
print("Extracting the top %d %s..." % (n_components, name))
t0 = time()
data = faces
if center:
data = faces_centered
estimator.fit(data)
train_time = (time() - t0)
print("done in %0.3fs" % train_time)
if hasattr(estimator, 'cluster_centers_'):
components_ = estimator.cluster_centers_
else:
components_ = estimator.components_
# Plot an image representing the pixelwise variance provided by the
# estimator e.g its noise_variance_ attribute. The Eigenfaces estimator,
# via the PCA decomposition, also provides a scalar noise_variance_
# (the mean of pixelwise variance) that cannot be displayed as an image
# so we skip it.
if (hasattr(estimator, 'noise_variance_') and
estimator.noise_variance_.ndim > 0): # Skip the Eigenfaces case
plot_gallery("Pixelwise variance",
estimator.noise_variance_.reshape(1, -1), n_col=1,
n_row=1)
plot_gallery('%s - Train time %.1fs' % (name, train_time),
components_[:n_components])
plt.show()
| bsd-3-clause |
pompiduskus/scikit-learn | sklearn/metrics/metrics.py | 232 | 1262 | import warnings
warnings.warn("sklearn.metrics.metrics is deprecated and will be removed in "
"0.18. Please import from sklearn.metrics",
DeprecationWarning)
from .ranking import auc
from .ranking import average_precision_score
from .ranking import label_ranking_average_precision_score
from .ranking import precision_recall_curve
from .ranking import roc_auc_score
from .ranking import roc_curve
from .classification import accuracy_score
from .classification import classification_report
from .classification import confusion_matrix
from .classification import f1_score
from .classification import fbeta_score
from .classification import hamming_loss
from .classification import hinge_loss
from .classification import jaccard_similarity_score
from .classification import log_loss
from .classification import matthews_corrcoef
from .classification import precision_recall_fscore_support
from .classification import precision_score
from .classification import recall_score
from .classification import zero_one_loss
from .regression import explained_variance_score
from .regression import mean_absolute_error
from .regression import mean_squared_error
from .regression import median_absolute_error
from .regression import r2_score
| bsd-3-clause |
mne-tools/mne-tools.github.io | stable/_downloads/52b26bfb61145291f5108dc7fd05ccee/35_artifact_correction_regression.py | 5 | 9910 | # -*- coding: utf-8 -*-
"""
.. _tut-artifact-regression:
===================================
Repairing artifacts with regression
===================================
This tutorial covers removal of artifacts using regression as in Gratton et al.
(1983) :footcite:`GrattonEtAl1983` and Croft & Barry (2000)
:footcite:`CroftBarry2000`.
Generally speaking, artifacts that result in time waveforms on the sensors
that are accurately reflected by some reference signal can be removed by
regression. Blink artifacts captured by bipolar EOG channels provide a good
example of this, so we will demonstrate this here.
Although ECG signals are well captured by bipolar ECG electrodes,
regression-based removal of ECG artifacts usually does not work very well.
This is likely because the heart acts like a rotating dipole, and
therefore the ECG channel time waveform recorded from the ECG electrode sites
does not reflect the same temporal dynamics that manifest at each MEG channel
(obtained by sampling some component of the related magnetic vector field).
Other approaches like :ref:`ICA <tut-artifact-ica>` or
:ref:`SSP <tut-artifact-ssp>` will likely work better for ECG.
Furthermore, regression approaches are usually performed in situations where
there are few channels available, and removing an entire signal component is
undesirable. Hence, most articles on the topic concern EEG and it is
unusual to see the technique applied to MEG. For this reason, we will restrict
the analysis in this tutorial to EEG data only.
Prepare the data
^^^^^^^^^^^^^^^^
We begin as always by importing the necessary Python modules and loading some
data. The :ref:`MNE-Sample <sample-dataset>` dataset has some clear, large
blink artifacts, especially during the presentation of visual stimuli.
"""
# %%
import numpy as np
import mne
from mne.preprocessing import EOGRegression
data_path = mne.datasets.sample.data_path()
raw_fname = data_path / 'MEG' / 'sample' / 'sample_audvis_raw.fif'
raw = mne.io.read_raw_fif(raw_fname)
raw.pick(['eeg', 'eog', 'stim'])
raw.load_data()
# The regression technique works regardless of chosen reference. However, it is
# important to choose a reference before proceeding with the analysis.
raw.set_eeg_reference('average')
# Removing slow drifts makes for more stable regression coefficients. Make sure
# to apply the same filter to both EEG and EOG channels!
raw.filter(0.3, 40)
# make epochs
events = mne.find_events(raw)
event_id = {'visual/left': 3, 'visual/right': 4}
epochs = mne.Epochs(raw, events, event_id=event_id, preload=True)
# %%
# Visualize the original data
# ^^^^^^^^^^^^^^^^^^^^^^^^^^^
# Let's first look at the `~mne.Evoked` data (average across epochs) without
# any corrections applied.
# we'll try to keep a consistent ylim across figures
plot_kwargs = dict(picks='all', ylim=dict(eeg=(-10, 10), eog=(-5, 15)))
# plot the evoked for the EEG and the EOG sensors
fig = epochs.average('all').plot(**plot_kwargs)
fig.set_size_inches(6, 6)
# %%
# We can see there is some EOG activity that is likely bleeding into the EEG
# evoked response. At around 250ms this becomes especially noticeable. Let's
# apply regression to subtract the EOG signal from the EEG signals to clean it
# up.
# %%
# Compute and apply EOG regression
# ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
# Now, we'll compare the evoked response before and after we regress out the
# EOG signal. First, let's try plain regression, and then we'll explore more
# advanced techniques.
# Perform regression using the EOG sensor as independent variable and the EEG
# sensors as dependent variables.
model_plain = EOGRegression(picks='eeg', picks_artifact='eog').fit(epochs)
fig = model_plain.plot(vlim=(None, 0.4)) # regression coefficients as topomap
fig.set_size_inches(3, 2)
# %%
# The regression coefficients show the linear relationship between each EEG
# sensor and the EOG sensor. Note that occipital sensors have a positive
# relationship, as we set a common-average reference when we loaded the data
# above.
#
# Now we are ready to use these coefficients to subtract the EOG signal from
# the EEG signals.
epochs_clean_plain = model_plain.apply(epochs)
# After regression, we should redo the baseline correction
epochs_clean_plain.apply_baseline()
# Show the evoked potential computed on the corrected data
fig = epochs_clean_plain.average('all').plot(**plot_kwargs)
fig.set_size_inches(6, 6)
# %%
# Regressing the EOG signal out of the EEG signals has reduced the peak around
# 250ms that was partly there because of eye artifacts.
#
# In the :ref:`MNE-Sample dataset <sample-dataset>`, there are no segments of
# data that are particularly unstable, so the basic form of regression produces
# robust coefficients. However, this may not be the case in every dataset, so
# let's explore some variations that may improve the estimation of the
# regression coefficients.
#
# One potential problem is that the EOG sensor does not only pick up eye
# artifacts, but also a bit of EEG signal. This means we are prone to
# overestimating the regression coefficients if the EOG sensors are placed too
# close to the EEG sensors. However, there is a correction we can apply to
# alleviate this.
#
# Subtract the evoked response from the epoch data before regression
# ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
# Gratton et al. (1983) :footcite:`GrattonEtAl1983` suggest computing
# regression coefficients on epoch data with the evoked response subtracted
# out. The idea is that the EEG signal components relevant to the study are in
# the evoked, so by removing them, mostly noise components will be left. Since
# EOG artifacts are unlikely to be strictly time-locked to the stimulus onset,
# enough EOG information will likely remain to be able to estimate robust
# regression coefficients.
# create epochs with the evoked subtracted out
epochs_sub = epochs.copy().subtract_evoked()
# perform regression
model_sub = EOGRegression(picks='eeg', picks_artifact='eog').fit(epochs_sub)
fig = model_sub.plot(vlim=(None, 0.4))
fig.set_size_inches(3, 2)
# apply the regression coefficients to the original epochs
epochs_clean_sub = model_plain.apply(epochs).apply_baseline()
fig = epochs_clean_sub.average('all').plot(**plot_kwargs)
fig.set_size_inches(6, 6)
# %%
# We see that we obtain the same regression coefficients, even with the evoked
# removed from the epochs.
#
# Create EOG evoked before regression
# ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
# It is advantageous to estimate the regression coefficients on a piece of data
# with lots of EOG activity. As EOG activity is typically much larger than EEG,
# the EOG artifacts will dominate the signal and the regression coefficients
# will reflect mostly the influence of the EOG. To amplify this effect, Croft &
# Barry (2000) :footcite:`CroftBarry2000` suggest creating epochs based on
# blink onsets and computing the evoked blink response. The averaging procedure
# will suppress EEG signals that are not strictly time-locked with the blink
# response. Ideally, one would create evokeds for both blinks and saccades, and
# create two separate regression models. However, we will restrict ourselves to
# just blink epochs, since MNE-Python contains an automated method for creating
# those.
#
# .. note:: This is very similar to the approach taken by :ref:`SSP
# <tut-artifact-ssp>`. The difference is that :ref:`SSP
# <tut-artifact-ssp>` estimates signal components that are maximally
# correlated with the artifact and removes any data along that
# component (thereby reducing the rank of the non-EOG data), whereas
# the regression approach uses the ongoing EOG signal to determine
# how much data to remove (thereby not necessarily reducing the rank
# of the non-EOG data). Generally, SSP tends to err on the side of
# removing too much data, eliminating artifacts and true brain
# signals alike, whereas regression will err on the side of not
# removing enough, leaving some artifact signals still present in the
# signal.
eog_epochs = mne.preprocessing.create_eog_epochs(raw)
# We need to explicitly specify that we want to average the EOG channel too.
eog_evoked = eog_epochs.average('all')
eog_evoked.plot('all')
fig.set_size_inches(6, 6)
# perform regression on the evoked blink response
model_evoked = EOGRegression(picks='eeg', picks_artifact='eog').fit(eog_evoked)
fig = model_evoked.plot(vlim=(None, 0.4))
fig.set_size_inches(3, 2)
# apply the regression coefficients to the original epochs
epochs_clean_evoked = model_evoked.apply(epochs).apply_baseline()
fig = epochs_clean_evoked.average('all').plot(**plot_kwargs)
fig.set_size_inches(6, 6)
# for good measure, also show the effect on the blink evoked
eog_evoked_clean = model_evoked.apply(eog_evoked)
eog_evoked_clean.apply_baseline()
eog_evoked_clean.plot('all')
fig.set_size_inches(6, 6)
# %%
# We see that again, the regression weights have been correctly estimated.
#
# Visualize the effect on raw data
# ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
# Once we have obtained robust regression weights, we can use them to apply the
# regression directly to raw, epoched, and evoked data. Here, we will use the
# regression weights obtained from the blink evoked and apply it to an instance
# of `~mne.io.Raw`.
order = np.concatenate([ # plotting order: EOG first, then EEG
mne.pick_types(raw.info, meg=False, eog=True),
mne.pick_types(raw.info, meg=False, eeg=True),
])
raw_kwargs = dict(events=eog_epochs.events, order=order, start=13, duration=3,
n_channels=10, scalings=dict(eeg=50e-6, eog=250e-6))
# plot original data
raw.plot(**raw_kwargs)
# regress (using coefficients computed previously) and plot
raw_clean = model_evoked.apply(raw)
raw_clean.plot(**raw_kwargs)
# %%
# References
# ^^^^^^^^^^
# .. footbibliography::
| bsd-3-clause |
bsipocz/statsmodels | statsmodels/stats/tests/test_diagnostic.py | 21 | 40146 | # -*- coding: utf-8 -*-
"""Tests for Regression Diagnostics and Specification Tests
Created on Thu Feb 09 13:19:47 2012
Author: Josef Perktold
License: BSD-3
currently all tests are against R
"""
#import warnings
#warnings.simplefilter("default")
# ResourceWarning doesn't exist in python 2
#warnings.simplefilter("ignore", ResourceWarning)
import os
import numpy as np
from numpy.testing import (assert_, assert_almost_equal, assert_equal,
assert_approx_equal, assert_allclose)
from nose import SkipTest
from statsmodels.regression.linear_model import OLS, GLSAR
from statsmodels.tools.tools import add_constant
from statsmodels.datasets import macrodata
import statsmodels.stats.sandwich_covariance as sw
import statsmodels.stats.diagnostic as smsdia
import json
#import statsmodels.sandbox.stats.diagnostic as smsdia
import statsmodels.stats.outliers_influence as oi
cur_dir = os.path.abspath(os.path.dirname(__file__))
def compare_t_est(sp, sp_dict, decimal=(14, 14)):
assert_almost_equal(sp[0], sp_dict['statistic'], decimal=decimal[0])
assert_almost_equal(sp[1], sp_dict['pvalue'], decimal=decimal[1])
def notyet_atst():
d = macrodata.load().data
realinv = d['realinv']
realgdp = d['realgdp']
realint = d['realint']
endog = realinv
exog = add_constant(np.c_[realgdp, realint])
res_ols1 = OLS(endog, exog).fit()
#growth rates
gs_l_realinv = 400 * np.diff(np.log(d['realinv']))
gs_l_realgdp = 400 * np.diff(np.log(d['realgdp']))
lint = d['realint'][:-1]
tbilrate = d['tbilrate'][:-1]
endogg = gs_l_realinv
exogg = add_constant(np.c_[gs_l_realgdp, lint])
exogg2 = add_constant(np.c_[gs_l_realgdp, tbilrate])
res_ols = OLS(endogg, exogg).fit()
res_ols2 = OLS(endogg, exogg2).fit()
#the following were done accidentally with res_ols1 in R,
#with original Greene data
params = np.array([-272.3986041341653, 0.1779455206941112,
0.2149432424658157])
cov_hac_4 = np.array([1321.569466333051, -0.2318836566017612,
37.01280466875694, -0.2318836566017614, 4.602339488102263e-05,
-0.0104687835998635, 37.012804668757, -0.0104687835998635,
21.16037144168061]).reshape(3,3, order='F')
cov_hac_10 = np.array([2027.356101193361, -0.3507514463299015,
54.81079621448568, -0.350751446329901, 6.953380432635583e-05,
-0.01268990195095196, 54.81079621448564, -0.01268990195095195,
22.92512402151113]).reshape(3,3, order='F')
#goldfeld-quandt
het_gq_greater = dict(statistic=13.20512768685082, df1=99, df2=98,
pvalue=1.246141976112324e-30, distr='f')
het_gq_less = dict(statistic=13.20512768685082, df1=99, df2=98, pvalue=1.)
het_gq_2sided = dict(statistic=13.20512768685082, df1=99, df2=98,
pvalue=1.246141976112324e-30, distr='f')
#goldfeld-quandt, fraction = 0.5
het_gq_greater_2 = dict(statistic=87.1328934692124, df1=48, df2=47,
pvalue=2.154956842194898e-33, distr='f')
gq = smsdia.het_goldfeldquandt(endog, exog, split=0.5)
compare_t_est(gq, het_gq_greater, decimal=(13, 14))
assert_equal(gq[-1], 'increasing')
harvey_collier = dict(stat=2.28042114041313, df=199,
pvalue=0.02364236161988260, distr='t')
#hc = harvtest(fm, order.by=ggdp , data = list())
harvey_collier_2 = dict(stat=0.7516918462158783, df=199,
pvalue=0.4531244858006127, distr='t')
##################################
class TestDiagnosticG(object):
def __init__(self):
d = macrodata.load().data
#growth rates
gs_l_realinv = 400 * np.diff(np.log(d['realinv']))
gs_l_realgdp = 400 * np.diff(np.log(d['realgdp']))
lint = d['realint'][:-1]
tbilrate = d['tbilrate'][:-1]
endogg = gs_l_realinv
exogg = add_constant(np.c_[gs_l_realgdp, lint])
exogg2 = add_constant(np.c_[gs_l_realgdp, tbilrate])
exogg3 = add_constant(np.c_[gs_l_realgdp])
res_ols = OLS(endogg, exogg).fit()
res_ols2 = OLS(endogg, exogg2).fit()
res_ols3 = OLS(endogg, exogg3).fit()
self.res = res_ols
self.res2 = res_ols2
self.res3 = res_ols3
self.endog = self.res.model.endog
self.exog = self.res.model.exog
def test_basic(self):
#mainly to check I got the right regression
#> mkarray(fm$coefficients, "params")
params = np.array([-9.48167277465485, 4.3742216647032,
-0.613996969478989])
assert_almost_equal(self.res.params, params, decimal=12)
def test_hac(self):
res = self.res
#> nw = NeweyWest(fm, lag = 4, prewhite = FALSE, verbose=TRUE)
#> nw2 = NeweyWest(fm, lag=10, prewhite = FALSE, verbose=TRUE)
#> mkarray(nw, "cov_hac_4")
cov_hac_4 = np.array([1.385551290884014, -0.3133096102522685,
-0.0597207976835705, -0.3133096102522685, 0.1081011690351306,
0.000389440793564336, -0.0597207976835705, 0.000389440793564339,
0.0862118527405036]).reshape(3,3, order='F')
#> mkarray(nw2, "cov_hac_10")
cov_hac_10 = np.array([1.257386180080192, -0.2871560199899846,
-0.03958300024627573, -0.2871560199899845, 0.1049107028987101,
0.0003896205316866944, -0.03958300024627578, 0.0003896205316866961,
0.0985539340694839]).reshape(3,3, order='F')
cov = sw.cov_hac_simple(res, nlags=4, use_correction=False)
bse_hac = sw.se_cov(cov)
assert_almost_equal(cov, cov_hac_4, decimal=14)
assert_almost_equal(bse_hac, np.sqrt(np.diag(cov)), decimal=14)
cov = sw.cov_hac_simple(res, nlags=10, use_correction=False)
bse_hac = sw.se_cov(cov)
assert_almost_equal(cov, cov_hac_10, decimal=14)
assert_almost_equal(bse_hac, np.sqrt(np.diag(cov)), decimal=14)
def test_het_goldfeldquandt(self):
#TODO: test options missing
#> gq = gqtest(fm, alternative='greater')
#> mkhtest_f(gq, 'het_gq_greater', 'f')
het_gq_greater = dict(statistic=0.5313259064778423,
pvalue=0.9990217851193723,
parameters=(98, 98), distr='f')
#> gq = gqtest(fm, alternative='less')
#> mkhtest_f(gq, 'het_gq_less', 'f')
het_gq_less = dict(statistic=0.5313259064778423,
pvalue=0.000978214880627621,
parameters=(98, 98), distr='f')
#> gq = gqtest(fm, alternative='two.sided')
#> mkhtest_f(gq, 'het_gq_two_sided', 'f')
het_gq_two_sided = dict(statistic=0.5313259064778423,
pvalue=0.001956429761255241,
parameters=(98, 98), distr='f')
#> gq = gqtest(fm, fraction=0.1, alternative='two.sided')
#> mkhtest_f(gq, 'het_gq_two_sided_01', 'f')
het_gq_two_sided_01 = dict(statistic=0.5006976835928314,
pvalue=0.001387126702579789,
parameters=(88, 87), distr='f')
#> gq = gqtest(fm, fraction=0.5, alternative='two.sided')
#> mkhtest_f(gq, 'het_gq_two_sided_05', 'f')
het_gq_two_sided_05 = dict(statistic=0.434815645134117,
pvalue=0.004799321242905568,
parameters=(48, 47), distr='f')
endogg, exogg = self.endog, self.exog
#tests
gq = smsdia.het_goldfeldquandt(endogg, exogg, split=0.5)
compare_t_est(gq, het_gq_greater, decimal=(14, 14))
assert_equal(gq[-1], 'increasing')
gq = smsdia.het_goldfeldquandt(endogg, exogg, split=0.5,
alternative='decreasing')
compare_t_est(gq, het_gq_less, decimal=(14, 14))
assert_equal(gq[-1], 'decreasing')
gq = smsdia.het_goldfeldquandt(endogg, exogg, split=0.5,
alternative='two-sided')
compare_t_est(gq, het_gq_two_sided, decimal=(14, 14))
assert_equal(gq[-1], 'two-sided')
#TODO: forcing the same split as R 202-90-90-1=21
gq = smsdia.het_goldfeldquandt(endogg, exogg, split=90, drop=21,
alternative='two-sided')
compare_t_est(gq, het_gq_two_sided_01, decimal=(14, 14))
assert_equal(gq[-1], 'two-sided')
#TODO other options ???
def test_het_breusch_pagan(self):
res = self.res
bptest = dict(statistic=0.709924388395087, pvalue=0.701199952134347,
parameters=(2,), distr='f')
bp = smsdia.het_breuschpagan(res.resid, res.model.exog)
compare_t_est(bp, bptest, decimal=(12, 12))
def test_het_white(self):
res = self.res
#TODO: regressiontest, compare with Greene or Gretl or Stata
hw = smsdia.het_white(res.resid, res.model.exog)
hw_values = (33.503722896538441, 2.9887960597830259e-06,
7.7945101228430946, 1.0354575277704231e-06)
assert_almost_equal(hw, hw_values)
def test_het_arch(self):
#test het_arch and indirectly het_lm against R
#> library(FinTS)
#> at = ArchTest(residuals(fm), lags=4)
#> mkhtest(at, 'archtest_4', 'chi2')
archtest_4 = dict(statistic=3.43473400836259,
pvalue=0.487871315392619, parameters=(4,),
distr='chi2')
#> at = ArchTest(residuals(fm), lags=12)
#> mkhtest(at, 'archtest_12', 'chi2')
archtest_12 = dict(statistic=8.648320999014171,
pvalue=0.732638635007718, parameters=(12,),
distr='chi2')
at4 = smsdia.het_arch(self.res.resid, maxlag=4)
at12 = smsdia.het_arch(self.res.resid, maxlag=12)
compare_t_est(at4[:2], archtest_4, decimal=(12, 13))
compare_t_est(at12[:2], archtest_12, decimal=(12, 13))
def test_het_arch2(self):
#test autolag options, this also test het_lm
#unfortunately optimal lag=1 for this data
resid = self.res.resid
res1 = smsdia.het_arch(resid, maxlag=1, autolag=None, store=True)
rs1 = res1[-1]
res2 = smsdia.het_arch(resid, maxlag=5, autolag='aic', store=True)
rs2 = res2[-1]
assert_almost_equal(rs2.resols.params, rs1.resols.params, decimal=13)
assert_almost_equal(res2[:4], res1[:4], decimal=13)
#test that smallest lag, maxlag=1 works
res3 = smsdia.het_arch(resid, maxlag=1, autolag='aic')
assert_almost_equal(res3[:4], res1[:4], decimal=13)
def test_acorr_breusch_godfrey(self):
res = self.res
#bgf = bgtest(fm, order = 4, type="F")
breuschgodfrey_f = dict(statistic=1.179280833676792,
pvalue=0.321197487261203,
parameters=(4,195,), distr='f')
#> bgc = bgtest(fm, order = 4, type="Chisq")
#> mkhtest(bgc, "breuschpagan_c", "chi2")
breuschgodfrey_c = dict(statistic=4.771042651230007,
pvalue=0.3116067133066697,
parameters=(4,), distr='chi2')
bg = smsdia.acorr_breusch_godfrey(res, nlags=4)
bg_r = [breuschgodfrey_c['statistic'], breuschgodfrey_c['pvalue'],
breuschgodfrey_f['statistic'], breuschgodfrey_f['pvalue']]
assert_almost_equal(bg, bg_r, decimal=13)
# check that lag choice works
bg2 = smsdia.acorr_breusch_godfrey(res, nlags=None)
bg3 = smsdia.acorr_breusch_godfrey(res, nlags=14)
assert_almost_equal(bg2, bg3, decimal=13)
def test_acorr_ljung_box(self):
res = self.res
#> bt = Box.test(residuals(fm), lag=4, type = "Ljung-Box")
#> mkhtest(bt, "ljung_box_4", "chi2")
ljung_box_4 = dict(statistic=5.23587172795227, pvalue=0.263940335284713,
parameters=(4,), distr='chi2')
#> bt = Box.test(residuals(fm), lag=4, type = "Box-Pierce")
#> mkhtest(bt, "ljung_box_bp_4", "chi2")
ljung_box_bp_4 = dict(statistic=5.12462932741681,
pvalue=0.2747471266820692,
parameters=(4,), distr='chi2')
#ddof correction for fitted parameters in ARMA(p,q) fitdf=p+q
#> bt = Box.test(residuals(fm), lag=4, type = "Ljung-Box", fitdf=2)
#> mkhtest(bt, "ljung_box_4df2", "chi2")
ljung_box_4df2 = dict(statistic=5.23587172795227,
pvalue=0.0729532930400377,
parameters=(2,), distr='chi2')
#> bt = Box.test(residuals(fm), lag=4, type = "Box-Pierce", fitdf=2)
#> mkhtest(bt, "ljung_box_bp_4df2", "chi2")
ljung_box_bp_4df2 = dict(statistic=5.12462932741681,
pvalue=0.0771260128929921,
parameters=(2,), distr='chi2')
lb, lbpval, bp, bppval = smsdia.acorr_ljungbox(res.resid, 4,
boxpierce=True)
compare_t_est([lb[-1], lbpval[-1]], ljung_box_4, decimal=(13, 14))
compare_t_est([bp[-1], bppval[-1]], ljung_box_bp_4, decimal=(13, 14))
def test_harvey_collier(self):
#> hc = harvtest(fm, order.by = NULL, data = list())
#> mkhtest_f(hc, 'harvey_collier', 't')
harvey_collier = dict(statistic=0.494432160939874,
pvalue=0.6215491310408242,
parameters=(198), distr='t')
#> hc2 = harvtest(fm, order.by=ggdp , data = list())
#> mkhtest_f(hc2, 'harvey_collier_2', 't')
harvey_collier_2 = dict(statistic=1.42104628340473,
pvalue=0.1568762892441689,
parameters=(198), distr='t')
hc = smsdia.linear_harvey_collier(self.res)
compare_t_est(hc, harvey_collier, decimal=(12, 12))
def test_rainbow(self):
#rainbow test
#> rt = raintest(fm)
#> mkhtest_f(rt, 'raintest', 'f')
raintest = dict(statistic=0.6809600116739604, pvalue=0.971832843583418,
parameters=(101, 98), distr='f')
#> rt = raintest(fm, center=0.4)
#> mkhtest_f(rt, 'raintest_center_04', 'f')
raintest_center_04 = dict(statistic=0.682635074191527,
pvalue=0.971040230422121,
parameters=(101, 98), distr='f')
#> rt = raintest(fm, fraction=0.4)
#> mkhtest_f(rt, 'raintest_fraction_04', 'f')
raintest_fraction_04 = dict(statistic=0.565551237772662,
pvalue=0.997592305968473,
parameters=(122, 77), distr='f')
#> rt = raintest(fm, order.by=ggdp)
#Warning message:
#In if (order.by == "mahalanobis") { :
# the condition has length > 1 and only the first element will be used
#> mkhtest_f(rt, 'raintest_order_gdp', 'f')
raintest_order_gdp = dict(statistic=1.749346160513353,
pvalue=0.002896131042494884,
parameters=(101, 98), distr='f')
rb = smsdia.linear_rainbow(self.res)
compare_t_est(rb, raintest, decimal=(13, 14))
rb = smsdia.linear_rainbow(self.res, frac=0.4)
compare_t_est(rb, raintest_fraction_04, decimal=(13, 14))
def test_compare_lr(self):
res = self.res
res3 = self.res3 #nested within res
#lrtest
#lrt = lrtest(fm, fm2)
#Model 1: ginv ~ ggdp + lint
#Model 2: ginv ~ ggdp
lrtest = dict(loglike1=-763.9752181602237, loglike2=-766.3091902020184,
chi2value=4.66794408358942, pvalue=0.03073069384028677,
df=(4,3,1))
lrt = res.compare_lr_test(res3)
assert_almost_equal(lrt[0], lrtest['chi2value'], decimal=11)
assert_almost_equal(lrt[1], lrtest['pvalue'], decimal=11)
waldtest = dict(fvalue=4.65216373312492, pvalue=0.03221346195239025,
df=(199,200,1))
wt = res.compare_f_test(res3)
assert_almost_equal(wt[0], waldtest['fvalue'], decimal=11)
assert_almost_equal(wt[1], waldtest['pvalue'], decimal=11)
def test_compare_nonnested(self):
res = self.res
res2 = self.res2
#jt = jtest(fm, lm(ginv ~ ggdp + tbilrate))
#Estimate Std. Error t value Pr(>|t|)
jtest = [('M1 + fitted(M2)', 1.591505670785873, 0.7384552861695823,
2.155182176352370, 0.032354572525314450, '*'),
('M2 + fitted(M1)', 1.305687653016899, 0.4808385176653064,
2.715438978051544, 0.007203854534057954, '**')]
jt1 = smsdia.compare_j(res2, res)
assert_almost_equal(jt1, jtest[0][3:5], decimal=13)
jt2 = smsdia.compare_j(res, res2)
assert_almost_equal(jt2, jtest[1][3:5], decimal=14)
#Estimate Std. Error z value Pr(>|z|)
coxtest = [('fitted(M1) ~ M2', -0.782030488930356, 0.599696502782265,
-1.304043770977755, 1.922186587840554e-01, ' '),
('fitted(M2) ~ M1', -2.248817107408537, 0.392656854330139,
-5.727181590258883, 1.021128495098556e-08, '***')]
ct1 = smsdia.compare_cox(res, res2)
assert_almost_equal(ct1, coxtest[0][3:5], decimal=13)
ct2 = smsdia.compare_cox(res2, res)
assert_almost_equal(ct2, coxtest[1][3:5], decimal=12)
#TODO should be approx
# Res.Df Df F Pr(>F)
encomptest = [('M1 vs. ME', 198, -1, 4.644810213266983,
0.032354572525313666, '*'),
('M2 vs. ME', 198, -1, 7.373608843521585,
0.007203854534058054, '**')]
# Estimate Std. Error t value
petest = [('M1 + log(fit(M1))-fit(M2)', -229.281878354594596,
44.5087822087058598, -5.15139, 6.201281252449979e-07),
('M2 + fit(M1)-exp(fit(M2))', 0.000634664704814,
0.0000462387010349, 13.72583, 1.319536115230356e-30)]
def test_cusum_ols(self):
#R library(strucchange)
#> sc = sctest(ginv ~ ggdp + lint, type="OLS-CUSUM")
#> mkhtest(sc, 'cusum_ols', 'BB')
cusum_ols = dict(statistic=1.055750610401214, pvalue=0.2149567397376543,
parameters=(), distr='BB') #Brownian Bridge
k_vars=3
cs_ols = smsdia.breaks_cusumolsresid(self.res.resid, ddof=k_vars) #
compare_t_est(cs_ols, cusum_ols, decimal=(12, 12))
def test_breaks_hansen(self):
#> sc = sctest(ginv ~ ggdp + lint, type="Nyblom-Hansen")
#> mkhtest(sc, 'breaks_nyblom_hansen', 'BB')
breaks_nyblom_hansen = dict(statistic=1.0300792740544484,
pvalue=0.1136087530212015,
parameters=(), distr='BB')
bh = smsdia.breaks_hansen(self.res)
assert_almost_equal(bh[0], breaks_nyblom_hansen['statistic'],
decimal=13)
#TODO: breaks_hansen doesn't return pvalues
def test_recursive_residuals(self):
reccumres_standardize = np.array([-2.151, -3.748, -3.114, -3.096,
-1.865, -2.230, -1.194, -3.500, -3.638, -4.447, -4.602, -4.631, -3.999,
-4.830, -5.429, -5.435, -6.554, -8.093, -8.567, -7.532, -7.079, -8.468,
-9.320, -12.256, -11.932, -11.454, -11.690, -11.318, -12.665, -12.842,
-11.693, -10.803, -12.113, -12.109, -13.002, -11.897, -10.787, -10.159,
-9.038, -9.007, -8.634, -7.552, -7.153, -6.447, -5.183, -3.794, -3.511,
-3.979, -3.236, -3.793, -3.699, -5.056, -5.724, -4.888, -4.309, -3.688,
-3.918, -3.735, -3.452, -2.086, -6.520, -7.959, -6.760, -6.855, -6.032,
-4.405, -4.123, -4.075, -3.235, -3.115, -3.131, -2.986, -1.813, -4.824,
-4.424, -4.796, -4.000, -3.390, -4.485, -4.669, -4.560, -3.834, -5.507,
-3.792, -2.427, -1.756, -0.354, 1.150, 0.586, 0.643, 1.773, -0.830,
-0.388, 0.517, 0.819, 2.240, 3.791, 3.187, 3.409, 2.431, 0.668, 0.957,
-0.928, 0.327, -0.285, -0.625, -2.316, -1.986, -0.744, -1.396, -1.728,
-0.646, -2.602, -2.741, -2.289, -2.897, -1.934, -2.532, -3.175, -2.806,
-3.099, -2.658, -2.487, -2.515, -2.224, -2.416, -1.141, 0.650, -0.947,
0.725, 0.439, 0.885, 2.419, 2.642, 2.745, 3.506, 4.491, 5.377, 4.624,
5.523, 6.488, 6.097, 5.390, 6.299, 6.656, 6.735, 8.151, 7.260, 7.846,
8.771, 8.400, 8.717, 9.916, 9.008, 8.910, 8.294, 8.982, 8.540, 8.395,
7.782, 7.794, 8.142, 8.362, 8.400, 7.850, 7.643, 8.228, 6.408, 7.218,
7.699, 7.895, 8.725, 8.938, 8.781, 8.350, 9.136, 9.056, 10.365, 10.495,
10.704, 10.784, 10.275, 10.389, 11.586, 11.033, 11.335, 11.661, 10.522,
10.392, 10.521, 10.126, 9.428, 9.734, 8.954, 9.949, 10.595, 8.016,
6.636, 6.975])
rr = smsdia.recursive_olsresiduals(self.res, skip=3, alpha=0.95)
assert_equal(np.round(rr[5][1:], 3), reccumres_standardize) #extra zero in front
#assert_equal(np.round(rr[3][4:], 3), np.diff(reccumres_standardize))
assert_almost_equal(rr[3][4:], np.diff(reccumres_standardize),3)
assert_almost_equal(rr[4][3:].std(ddof=1), 10.7242, decimal=4)
#regression number, visually checked with graph from gretl
ub0 = np.array([ 13.37318571, 13.50758959, 13.64199346, 13.77639734,
13.91080121])
ub1 = np.array([ 39.44753774, 39.58194162, 39.7163455 , 39.85074937,
39.98515325])
lb, ub = rr[6]
assert_almost_equal(ub[:5], ub0, decimal=7)
assert_almost_equal(lb[:5], -ub0, decimal=7)
assert_almost_equal(ub[-5:], ub1, decimal=7)
assert_almost_equal(lb[-5:], -ub1, decimal=7)
#test a few values with explicit OLS
endog = self.res.model.endog
exog = self.res.model.exog
params = []
ypred = []
for i in range(3,10):
resi = OLS(endog[:i], exog[:i]).fit()
ypred.append(resi.model.predict(resi.params, exog[i]))
params.append(resi.params)
assert_almost_equal(rr[2][3:10], ypred, decimal=12)
assert_almost_equal(rr[0][3:10], endog[3:10] - ypred, decimal=12)
assert_almost_equal(rr[1][2:9], params, decimal=12)
def test_normality(self):
res = self.res
#> library(nortest) #Lilliefors (Kolmogorov-Smirnov) normality test
#> lt = lillie.test(residuals(fm))
#> mkhtest(lt, "lilliefors", "-")
lilliefors1 = dict(statistic=0.0723390908786589,
pvalue=0.01204113540102896, parameters=(), distr='-')
#> lt = lillie.test(residuals(fm)**2)
#> mkhtest(lt, "lilliefors", "-")
lilliefors2 = dict(statistic=0.301311621898024,
pvalue=1.004305736618051e-51,
parameters=(), distr='-')
#> lt = lillie.test(residuals(fm)[1:20])
#> mkhtest(lt, "lilliefors", "-")
lilliefors3 = dict(statistic=0.1333956004203103,
pvalue=0.4618672180799566, parameters=(), distr='-')
lf1 = smsdia.lilliefors(res.resid)
lf2 = smsdia.lilliefors(res.resid**2)
lf3 = smsdia.lilliefors(res.resid[:20])
compare_t_est(lf1, lilliefors1, decimal=(14, 14))
compare_t_est(lf2, lilliefors2, decimal=(14, 14)) #pvalue very small
assert_approx_equal(lf2[1], lilliefors2['pvalue'], significant=10)
compare_t_est(lf3, lilliefors3, decimal=(14, 1))
#R uses different approximation for pvalue in last case
#> ad = ad.test(residuals(fm))
#> mkhtest(ad, "ad3", "-")
adr1 = dict(statistic=1.602209621518313, pvalue=0.0003937979149362316,
parameters=(), distr='-')
#> ad = ad.test(residuals(fm)**2)
#> mkhtest(ad, "ad3", "-")
adr2 = dict(statistic=np.inf, pvalue=np.nan, parameters=(), distr='-')
#> ad = ad.test(residuals(fm)[1:20])
#> mkhtest(ad, "ad3", "-")
adr3 = dict(statistic=0.3017073732210775, pvalue=0.5443499281265933,
parameters=(), distr='-')
ad1 = smsdia.normal_ad(res.resid)
compare_t_est(ad1, adr1, decimal=(11, 13))
ad2 = smsdia.normal_ad(res.resid**2)
assert_(np.isinf(ad2[0]))
ad3 = smsdia.normal_ad(res.resid[:20])
compare_t_est(ad3, adr3, decimal=(11, 12))
def test_influence(self):
res = self.res
#this test is slow
infl = oi.OLSInfluence(res)
fp = open(os.path.join(cur_dir,"results/influence_lsdiag_R.json"))
lsdiag = json.load(fp)
#basic
assert_almost_equal(np.array(lsdiag['cov.scaled']).reshape(3, 3),
res.cov_params(), decimal=14)
assert_almost_equal(np.array(lsdiag['cov.unscaled']).reshape(3, 3),
res.normalized_cov_params, decimal=14)
c0, c1 = infl.cooks_distance #TODO: what's c1
assert_almost_equal(c0, lsdiag['cooks'], decimal=14)
assert_almost_equal(infl.hat_matrix_diag, lsdiag['hat'], decimal=14)
assert_almost_equal(infl.resid_studentized_internal,
lsdiag['std.res'], decimal=14)
#slow:
#infl._get_all_obs() #slow, nobs estimation loop, called implicitly
dffits, dffth = infl.dffits
assert_almost_equal(dffits, lsdiag['dfits'], decimal=14)
assert_almost_equal(infl.resid_studentized_external,
lsdiag['stud.res'], decimal=14)
import pandas
fn = os.path.join(cur_dir,"results/influence_measures_R.csv")
infl_r = pandas.read_csv(fn, index_col=0)
conv = lambda s: 1 if s=='TRUE' else 0
fn = os.path.join(cur_dir,"results/influence_measures_bool_R.csv")
#not used yet:
#infl_bool_r = pandas.read_csv(fn, index_col=0,
# converters=dict(zip(lrange(7),[conv]*7)))
infl_r2 = np.asarray(infl_r)
assert_almost_equal(infl.dfbetas, infl_r2[:,:3], decimal=13)
assert_almost_equal(infl.cov_ratio, infl_r2[:,4], decimal=14)
#duplicates
assert_almost_equal(dffits, infl_r2[:,3], decimal=14)
assert_almost_equal(c0, infl_r2[:,5], decimal=14)
assert_almost_equal(infl.hat_matrix_diag, infl_r2[:,6], decimal=14)
#Note: for dffits, R uses a threshold around 0.36, mine: dffits[1]=0.24373
#TODO: finish and check thresholds and pvalues
'''
R has
>>> np.nonzero(np.asarray(infl_bool_r["dffit"]))[0]
array([ 6, 26, 63, 76, 90, 199])
>>> np.nonzero(np.asarray(infl_bool_r["cov.r"]))[0]
array([ 4, 26, 59, 61, 63, 72, 76, 84, 91, 92, 94, 95, 108,
197, 198])
>>> np.nonzero(np.asarray(infl_bool_r["hat"]))[0]
array([ 62, 76, 84, 90, 91, 92, 95, 108, 197, 199])
'''
class TestDiagnosticGPandas(TestDiagnosticG):
def __init__(self):
d = macrodata.load_pandas().data
#growth rates
d['gs_l_realinv'] = 400 * np.log(d['realinv']).diff()
d['gs_l_realgdp'] = 400 * np.log(d['realgdp']).diff()
d['lint'] = d['realint'].shift(1)
d['tbilrate'] = d['tbilrate'].shift(1)
d = d.dropna()
self.d = d
endogg = d['gs_l_realinv']
exogg = add_constant(d[['gs_l_realgdp', 'lint']])
exogg2 = add_constant(d[['gs_l_realgdp', 'tbilrate']])
exogg3 = add_constant(d[['gs_l_realgdp']])
res_ols = OLS(endogg, exogg).fit()
res_ols2 = OLS(endogg, exogg2).fit()
res_ols3 = OLS(endogg, exogg3).fit()
self.res = res_ols
self.res2 = res_ols2
self.res3 = res_ols3
self.endog = self.res.model.endog
self.exog = self.res.model.exog
def grangertest():
#> gt = grangertest(ginv, ggdp, order=4)
#> gt
#Granger causality test
#
#Model 1: ggdp ~ Lags(ggdp, 1:4) + Lags(ginv, 1:4)
#Model 2: ggdp ~ Lags(ggdp, 1:4)
grangertest = dict(fvalue=1.589672703015157, pvalue=0.178717196987075,
df=(198,193))
def test_outlier_influence_funcs():
#smoke test
x = add_constant(np.random.randn(10, 2))
y = x.sum(1) + np.random.randn(10)
res = OLS(y, x).fit()
oi.summary_table(res, alpha=0.05)
res2 = OLS(y, x[:,0]).fit()
oi.summary_table(res2, alpha=0.05)
infl = res2.get_influence()
infl.summary_table()
def test_influence_wrapped():
from pandas import DataFrame
from pandas.util.testing import assert_series_equal
d = macrodata.load_pandas().data
#growth rates
gs_l_realinv = 400 * np.log(d['realinv']).diff().dropna()
gs_l_realgdp = 400 * np.log(d['realgdp']).diff().dropna()
lint = d['realint'][:-1]
# re-index these because they won't conform to lint
gs_l_realgdp.index = lint.index
gs_l_realinv.index = lint.index
data = dict(const=np.ones_like(lint), lint=lint, lrealgdp=gs_l_realgdp)
#order is important
exog = DataFrame(data, columns=['const','lrealgdp','lint'])
res = OLS(gs_l_realinv, exog).fit()
#basic
# already tested
#assert_almost_equal(lsdiag['cov.scaled'],
# res.cov_params().values.ravel(), decimal=14)
#assert_almost_equal(lsdiag['cov.unscaled'],
# res.normalized_cov_params.values.ravel(), decimal=14)
infl = oi.OLSInfluence(res)
# smoke test just to make sure it works, results separately tested
df = infl.summary_frame()
assert_(isinstance(df, DataFrame))
#this test is slow
fp = open(os.path.join(cur_dir,"results/influence_lsdiag_R.json"))
lsdiag = json.load(fp)
c0, c1 = infl.cooks_distance #TODO: what's c1, it's pvalues? -ss
#NOTE: we get a hard-cored 5 decimals with pandas testing
assert_almost_equal(c0, lsdiag['cooks'], 14)
assert_almost_equal(infl.hat_matrix_diag, (lsdiag['hat']), 14)
assert_almost_equal(infl.resid_studentized_internal,
lsdiag['std.res'], 14)
#slow:
dffits, dffth = infl.dffits
assert_almost_equal(dffits, lsdiag['dfits'], 14)
assert_almost_equal(infl.resid_studentized_external,
lsdiag['stud.res'], 14)
import pandas
fn = os.path.join(cur_dir,"results/influence_measures_R.csv")
infl_r = pandas.read_csv(fn, index_col=0)
conv = lambda s: 1 if s=='TRUE' else 0
fn = os.path.join(cur_dir,"results/influence_measures_bool_R.csv")
#not used yet:
#infl_bool_r = pandas.read_csv(fn, index_col=0,
# converters=dict(zip(lrange(7),[conv]*7)))
infl_r2 = np.asarray(infl_r)
#TODO: finish wrapping this stuff
assert_almost_equal(infl.dfbetas, infl_r2[:,:3], decimal=13)
assert_almost_equal(infl.cov_ratio, infl_r2[:,4], decimal=14)
def test_influence_dtype():
# see #2148 bug when endog is integer
y = np.ones(20)
np.random.seed(123)
x = np.random.randn(20, 3)
res1 = OLS(y, x).fit()
res2 = OLS(y*1., x).fit()
cr1 = res1.get_influence().cov_ratio
cr2 = res2.get_influence().cov_ratio
assert_allclose(cr1, cr2, rtol=1e-14)
# regression test for values
cr3 = np.array(
[ 1.22239215, 1.31551021, 1.52671069, 1.05003921, 0.89099323,
1.57405066, 1.03230092, 0.95844196, 1.15531836, 1.21963623,
0.87699564, 1.16707748, 1.10481391, 0.98839447, 1.08999334,
1.35680102, 1.46227715, 1.45966708, 1.13659521, 1.22799038])
assert_almost_equal(cr1, cr3, decimal=8)
def test_outlier_test():
# results from R with NA -> 1. Just testing interface here because
# outlier_test is just a wrapper
labels = ['accountant', 'pilot', 'architect', 'author', 'chemist',
'minister', 'professor', 'dentist', 'reporter', 'engineer',
'undertaker', 'lawyer', 'physician', 'welfare.worker', 'teacher',
'conductor', 'contractor', 'factory.owner', 'store.manager',
'banker', 'bookkeeper', 'mail.carrier', 'insurance.agent',
'store.clerk', 'carpenter', 'electrician', 'RR.engineer',
'machinist', 'auto.repairman', 'plumber', 'gas.stn.attendant',
'coal.miner', 'streetcar.motorman', 'taxi.driver',
'truck.driver', 'machine.operator', 'barber', 'bartender',
'shoe.shiner', 'cook', 'soda.clerk', 'watchman', 'janitor',
'policeman', 'waiter']
#Duncan's prestige data from car
exog = [[1.0, 62.0, 86.0], [1.0, 72.0, 76.0], [1.0, 75.0, 92.0],
[1.0, 55.0, 90.0], [1.0, 64.0, 86.0], [1.0, 21.0, 84.0],
[1.0, 64.0, 93.0], [1.0, 80.0, 100.0], [1.0, 67.0, 87.0],
[1.0, 72.0, 86.0], [1.0, 42.0, 74.0], [1.0, 76.0, 98.0],
[1.0, 76.0, 97.0], [1.0, 41.0, 84.0], [1.0, 48.0, 91.0],
[1.0, 76.0, 34.0], [1.0, 53.0, 45.0], [1.0, 60.0, 56.0],
[1.0, 42.0, 44.0], [1.0, 78.0, 82.0], [1.0, 29.0, 72.0],
[1.0, 48.0, 55.0], [1.0, 55.0, 71.0], [1.0, 29.0, 50.0],
[1.0, 21.0, 23.0], [1.0, 47.0, 39.0], [1.0, 81.0, 28.0],
[1.0, 36.0, 32.0], [1.0, 22.0, 22.0], [1.0, 44.0, 25.0],
[1.0, 15.0, 29.0], [1.0, 7.0, 7.0], [1.0, 42.0, 26.0],
[1.0, 9.0, 19.0], [1.0, 21.0, 15.0], [1.0, 21.0, 20.0],
[1.0, 16.0, 26.0], [1.0, 16.0, 28.0], [1.0, 9.0, 17.0],
[1.0, 14.0, 22.0], [1.0, 12.0, 30.0], [1.0, 17.0, 25.0],
[1.0, 7.0, 20.0], [1.0, 34.0, 47.0], [1.0, 8.0, 32.0]]
endog = [ 82., 83., 90., 76., 90., 87., 93., 90., 52., 88., 57.,
89., 97., 59., 73., 38., 76., 81., 45., 92., 39., 34.,
41., 16., 33., 53., 67., 57., 26., 29., 10., 15., 19.,
10., 13., 24., 20., 7., 3., 16., 6., 11., 8., 41.,
10.]
ndarray_mod = OLS(endog, exog).fit()
rstudent = [3.1345185839, -2.3970223990, 2.0438046359, -1.9309187757,
1.8870465798, -1.7604905300, -1.7040324156, 1.6024285876,
-1.4332485037, -1.1044851583, 1.0688582315, 1.0185271840,
-0.9024219332, -0.9023876471, -0.8830953936, 0.8265782334,
0.8089220547, 0.7682770197, 0.7319491074, -0.6665962829,
0.5227352794, -0.5135016547, 0.5083881518, 0.4999224372,
-0.4980818221, -0.4759717075, -0.4293565820, -0.4114056499,
-0.3779540862, 0.3556874030, 0.3409200462, 0.3062248646,
0.3038999429, -0.3030815773, -0.1873387893, 0.1738050251,
0.1424246593, -0.1292266025, 0.1272066463, -0.0798902878,
0.0788467222, 0.0722556991, 0.0505098280, 0.0233215136,
0.0007112055]
unadj_p = [0.003177202, 0.021170298, 0.047432955, 0.060427645, 0.066248120,
0.085783008, 0.095943909, 0.116738318, 0.159368890, 0.275822623,
0.291386358, 0.314400295, 0.372104049, 0.372122040, 0.382333561,
0.413260793, 0.423229432, 0.446725370, 0.468363101, 0.508764039,
0.603971990, 0.610356737, 0.613905871, 0.619802317, 0.621087703,
0.636621083, 0.669911674, 0.682917818, 0.707414459, 0.723898263,
0.734904667, 0.760983108, 0.762741124, 0.763360242, 0.852319039,
0.862874018, 0.887442197, 0.897810225, 0.899398691, 0.936713197,
0.937538115, 0.942749758, 0.959961394, 0.981506948, 0.999435989]
bonf_p = [0.1429741, 0.9526634, 2.1344830, 2.7192440, 2.9811654, 3.8602354,
4.3174759, 5.2532243, 7.1716001, 12.4120180, 13.1123861, 14.1480133,
16.7446822, 16.7454918, 17.2050103, 18.5967357, 19.0453245,
20.1026416, 21.0763395, 22.8943818, 27.1787396, 27.4660532,
27.6257642, 27.8911043, 27.9489466, 28.6479487, 30.1460253,
30.7313018, 31.8336506, 32.5754218, 33.0707100, 34.2442399,
34.3233506, 34.3512109, 38.3543568, 38.8293308, 39.9348989,
40.4014601, 40.4729411, 42.1520939, 42.1892152, 42.4237391,
43.1982627, 44.1678127, 44.9746195]
bonf_p = np.array(bonf_p)
bonf_p[bonf_p > 1] = 1
sorted_labels = ["minister", "reporter", "contractor", "insurance.agent",
"machinist", "store.clerk", "conductor", "factory.owner",
"mail.carrier", "streetcar.motorman", "carpenter", "coal.miner",
"bartender", "bookkeeper", "soda.clerk", "chemist", "RR.engineer",
"professor", "electrician", "gas.stn.attendant", "auto.repairman",
"watchman", "banker", "machine.operator", "dentist", "waiter",
"shoe.shiner", "welfare.worker", "plumber", "physician", "pilot",
"engineer", "accountant", "lawyer", "undertaker", "barber",
"store.manager", "truck.driver", "cook", "janitor", "policeman",
"architect", "teacher", "taxi.driver", "author"]
res2 = np.c_[rstudent, unadj_p, bonf_p]
res = oi.outlier_test(ndarray_mod, method='b', labels=labels, order=True)
np.testing.assert_almost_equal(res.values, res2, 7)
np.testing.assert_equal(res.index.tolist(), sorted_labels) # pylint: disable-msg=E1103
if __name__ == '__main__':
import nose
nose.runmodule(argv=[__file__, '-vvs', '-x'], exit=False)
#t = TestDiagnosticG()
#t.test_basic()
#t.test_hac()
#t.test_acorr_breusch_godfrey()
#t.test_acorr_ljung_box()
#t.test_het_goldfeldquandt()
#t.test_het_breusch_pagan()
#t.test_het_white()
#t.test_compare_lr()
#t.test_compare_nonnested()
#t.test_influence()
##################################################
'''
J test
Model 1: ginv ~ ggdp + lint
Model 2: ginv ~ ggdp + tbilrate
Estimate Std. Error t value Pr(>|t|)
M1 + fitted(M2) 1.591505670785873 0.7384552861695823 2.15518 0.0323546 *
M2 + fitted(M1) 1.305687653016899 0.4808385176653064 2.71544 0.0072039 **
---
Signif. codes: 0 ‘***’ 0.001 ‘**’ 0.01 ‘*’ 0.05 ‘.’ 0.1 ‘ ’ 1
= lm(ginv ~ ggdp + tbilrate)
> ct = coxtest(fm, fm3)
> ct
Cox test
Model 1: ginv ~ ggdp + lint
Model 2: ginv ~ ggdp + tbilrate
Estimate Std. Error z value Pr(>|z|)
fitted(M1) ~ M2 -0.782030488930356 0.599696502782265 -1.30404 0.19222
fitted(M2) ~ M1 -2.248817107408537 0.392656854330139 -5.72718 1.0211e-08 ***
---
Signif. codes: 0 ‘***’ 0.001 ‘**’ 0.01 ‘*’ 0.05 ‘.’ 0.1 ‘ ’ 1
> et = encomptest(fm, fm3)
> et
Encompassing test
Model 1: ginv ~ ggdp + lint
Model 2: ginv ~ ggdp + tbilrate
Model E: ginv ~ ggdp + lint + tbilrate
Res.Df Df F Pr(>F)
M1 vs. ME 198 -1 4.64481 0.0323546 *
M2 vs. ME 198 -1 7.37361 0.0072039 **
---
Signif. codes: 0 ‘***’ 0.001 ‘**’ 0.01 ‘*’ 0.05 ‘.’ 0.1 ‘ ’ 1
> fm4 = lm(realinv ~ realgdp + realint, data=d)
> fm5 = lm(log(realinv) ~ realgdp + realint, data=d)
> pet = petest(fm4, fm5)
> pet
PE test
Model 1: realinv ~ realgdp + realint
Model 2: log(realinv) ~ realgdp + realint
Estimate Std. Error t value
M1 + log(fit(M1))-fit(M2) -229.281878354594596 44.5087822087058598 -5.15139
M2 + fit(M1)-exp(fit(M2)) 0.000634664704814 0.0000462387010349 13.72583
Pr(>|t|)
M1 + log(fit(M1))-fit(M2) 6.2013e-07 ***
M2 + fit(M1)-exp(fit(M2)) < 2.22e-16 ***
---
Signif. codes: 0 ‘***’ 0.001 ‘**’ 0.01 ‘*’ 0.05 ‘.’ 0.1 ‘ ’ 1
'''
| bsd-3-clause |
chrisndodge/edx-platform | lms/djangoapps/course_blocks/transformers/tests/test_hidden_content.py | 17 | 2597 | """
Tests for HiddenContentTransformer.
"""
from datetime import timedelta
import ddt
from django.utils.timezone import now
from nose.plugins.attrib import attr
from ..hidden_content import HiddenContentTransformer
from .helpers import BlockParentsMapTestCase, update_block
@attr(shard=3)
@ddt.ddt
class HiddenContentTransformerTestCase(BlockParentsMapTestCase):
"""
VisibilityTransformer Test
"""
TRANSFORMER_CLASS_TO_TEST = HiddenContentTransformer
ALL_BLOCKS = {0, 1, 2, 3, 4, 5, 6}
class DueDateType(object):
"""
Use constant enum types for deterministic ddt test method names (rather than dynamically generated timestamps)
"""
none = 1,
future = 2,
past = 3
TODAY = now()
PAST_DATE = TODAY - timedelta(days=30)
FUTURE_DATE = TODAY + timedelta(days=30)
@classmethod
def due(cls, enum_value):
"""
Returns a start date for the given enum value
"""
if enum_value == cls.future:
return cls.FUTURE_DATE
elif enum_value == cls.past:
return cls.PAST_DATE
else:
return None
# Following test cases are based on BlockParentsMapTestCase.parents_map
@ddt.data(
({}, ALL_BLOCKS),
({0: DueDateType.none}, ALL_BLOCKS),
({0: DueDateType.future}, ALL_BLOCKS),
({1: DueDateType.none}, ALL_BLOCKS),
({1: DueDateType.future}, ALL_BLOCKS),
({4: DueDateType.none}, ALL_BLOCKS),
({4: DueDateType.future}, ALL_BLOCKS),
({0: DueDateType.past}, {}),
({1: DueDateType.past}, ALL_BLOCKS - {1, 3, 4}),
({2: DueDateType.past}, ALL_BLOCKS - {2, 5}),
({4: DueDateType.past}, ALL_BLOCKS - {4}),
({1: DueDateType.past, 2: DueDateType.past}, {0}),
({1: DueDateType.none, 2: DueDateType.past}, ALL_BLOCKS - {2, 5}),
({1: DueDateType.past, 2: DueDateType.none}, ALL_BLOCKS - {1, 3, 4}),
)
@ddt.unpack
def test_hidden_content(
self,
hide_due_values,
expected_visible_blocks,
):
for idx, due_date_type in hide_due_values.iteritems():
block = self.get_block(idx)
block.due = self.DueDateType.due(due_date_type)
block.hide_after_due = True
update_block(block)
self.assert_transform_results(
self.student,
expected_visible_blocks,
blocks_with_differing_access=None,
transformers=self.transformers,
)
| agpl-3.0 |
cauchycui/scikit-learn | sklearn/neighbors/tests/test_nearest_centroid.py | 302 | 4121 | """
Testing for the nearest centroid module.
"""
import numpy as np
from scipy import sparse as sp
from numpy.testing import assert_array_equal
from numpy.testing import assert_equal
from sklearn.neighbors import NearestCentroid
from sklearn import datasets
from sklearn.metrics.pairwise import pairwise_distances
# toy sample
X = [[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1]]
X_csr = sp.csr_matrix(X) # Sparse matrix
y = [-1, -1, -1, 1, 1, 1]
T = [[-1, -1], [2, 2], [3, 2]]
T_csr = sp.csr_matrix(T)
true_result = [-1, 1, 1]
# also load the iris dataset
# and randomly permute it
iris = datasets.load_iris()
rng = np.random.RandomState(1)
perm = rng.permutation(iris.target.size)
iris.data = iris.data[perm]
iris.target = iris.target[perm]
def test_classification_toy():
# Check classification on a toy dataset, including sparse versions.
clf = NearestCentroid()
clf.fit(X, y)
assert_array_equal(clf.predict(T), true_result)
# Same test, but with a sparse matrix to fit and test.
clf = NearestCentroid()
clf.fit(X_csr, y)
assert_array_equal(clf.predict(T_csr), true_result)
# Fit with sparse, test with non-sparse
clf = NearestCentroid()
clf.fit(X_csr, y)
assert_array_equal(clf.predict(T), true_result)
# Fit with non-sparse, test with sparse
clf = NearestCentroid()
clf.fit(X, y)
assert_array_equal(clf.predict(T_csr), true_result)
# Fit and predict with non-CSR sparse matrices
clf = NearestCentroid()
clf.fit(X_csr.tocoo(), y)
assert_array_equal(clf.predict(T_csr.tolil()), true_result)
def test_precomputed():
clf = NearestCentroid(metric="precomputed")
clf.fit(X, y)
S = pairwise_distances(T, clf.centroids_)
assert_array_equal(clf.predict(S), true_result)
def test_iris():
# Check consistency on dataset iris.
for metric in ('euclidean', 'cosine'):
clf = NearestCentroid(metric=metric).fit(iris.data, iris.target)
score = np.mean(clf.predict(iris.data) == iris.target)
assert score > 0.9, "Failed with score = " + str(score)
def test_iris_shrinkage():
# Check consistency on dataset iris, when using shrinkage.
for metric in ('euclidean', 'cosine'):
for shrink_threshold in [None, 0.1, 0.5]:
clf = NearestCentroid(metric=metric,
shrink_threshold=shrink_threshold)
clf = clf.fit(iris.data, iris.target)
score = np.mean(clf.predict(iris.data) == iris.target)
assert score > 0.8, "Failed with score = " + str(score)
def test_pickle():
import pickle
# classification
obj = NearestCentroid()
obj.fit(iris.data, iris.target)
score = obj.score(iris.data, iris.target)
s = pickle.dumps(obj)
obj2 = pickle.loads(s)
assert_equal(type(obj2), obj.__class__)
score2 = obj2.score(iris.data, iris.target)
assert_array_equal(score, score2,
"Failed to generate same score"
" after pickling (classification).")
def test_shrinkage_threshold_decoded_y():
clf = NearestCentroid(shrink_threshold=0.01)
y_ind = np.asarray(y)
y_ind[y_ind == -1] = 0
clf.fit(X, y_ind)
centroid_encoded = clf.centroids_
clf.fit(X, y)
assert_array_equal(centroid_encoded, clf.centroids_)
def test_predict_translated_data():
# Test that NearestCentroid gives same results on translated data
rng = np.random.RandomState(0)
X = rng.rand(50, 50)
y = rng.randint(0, 3, 50)
noise = rng.rand(50)
clf = NearestCentroid(shrink_threshold=0.1)
clf.fit(X, y)
y_init = clf.predict(X)
clf = NearestCentroid(shrink_threshold=0.1)
X_noise = X + noise
clf.fit(X_noise, y)
y_translate = clf.predict(X_noise)
assert_array_equal(y_init, y_translate)
def test_manhattan_metric():
# Test the manhattan metric.
clf = NearestCentroid(metric='manhattan')
clf.fit(X, y)
dense_centroid = clf.centroids_
clf.fit(X_csr, y)
assert_array_equal(clf.centroids_, dense_centroid)
assert_array_equal(dense_centroid, [[-1, -1], [1, 1]])
| bsd-3-clause |
AlexRobson/scikit-learn | sklearn/qda.py | 139 | 7682 | """
Quadratic Discriminant Analysis
"""
# Author: Matthieu Perrot <matthieu.perrot@gmail.com>
#
# License: BSD 3 clause
import warnings
import numpy as np
from .base import BaseEstimator, ClassifierMixin
from .externals.six.moves import xrange
from .utils import check_array, check_X_y
from .utils.validation import check_is_fitted
from .utils.fixes import bincount
__all__ = ['QDA']
class QDA(BaseEstimator, ClassifierMixin):
"""
Quadratic Discriminant Analysis (QDA)
A classifier with a quadratic decision boundary, generated
by fitting class conditional densities to the data
and using Bayes' rule.
The model fits a Gaussian density to each class.
Read more in the :ref:`User Guide <lda_qda>`.
Parameters
----------
priors : array, optional, shape = [n_classes]
Priors on classes
reg_param : float, optional
Regularizes the covariance estimate as
``(1-reg_param)*Sigma + reg_param*np.eye(n_features)``
Attributes
----------
covariances_ : list of array-like, shape = [n_features, n_features]
Covariance matrices of each class.
means_ : array-like, shape = [n_classes, n_features]
Class means.
priors_ : array-like, shape = [n_classes]
Class priors (sum to 1).
rotations_ : list of arrays
For each class k an array of shape [n_features, n_k], with
``n_k = min(n_features, number of elements in class k)``
It is the rotation of the Gaussian distribution, i.e. its
principal axis.
scalings_ : list of arrays
For each class k an array of shape [n_k]. It contains the scaling
of the Gaussian distributions along its principal axes, i.e. the
variance in the rotated coordinate system.
Examples
--------
>>> from sklearn.qda import QDA
>>> import numpy as np
>>> X = np.array([[-1, -1], [-2, -1], [-3, -2], [1, 1], [2, 1], [3, 2]])
>>> y = np.array([1, 1, 1, 2, 2, 2])
>>> clf = QDA()
>>> clf.fit(X, y)
QDA(priors=None, reg_param=0.0)
>>> print(clf.predict([[-0.8, -1]]))
[1]
See also
--------
sklearn.lda.LDA: Linear discriminant analysis
"""
def __init__(self, priors=None, reg_param=0.):
self.priors = np.asarray(priors) if priors is not None else None
self.reg_param = reg_param
def fit(self, X, y, store_covariances=False, tol=1.0e-4):
"""
Fit the QDA model according to the given training data and parameters.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Training vector, where n_samples in the number of samples and
n_features is the number of features.
y : array, shape = [n_samples]
Target values (integers)
store_covariances : boolean
If True the covariance matrices are computed and stored in the
`self.covariances_` attribute.
tol : float, optional, default 1.0e-4
Threshold used for rank estimation.
"""
X, y = check_X_y(X, y)
self.classes_, y = np.unique(y, return_inverse=True)
n_samples, n_features = X.shape
n_classes = len(self.classes_)
if n_classes < 2:
raise ValueError('y has less than 2 classes')
if self.priors is None:
self.priors_ = bincount(y) / float(n_samples)
else:
self.priors_ = self.priors
cov = None
if store_covariances:
cov = []
means = []
scalings = []
rotations = []
for ind in xrange(n_classes):
Xg = X[y == ind, :]
meang = Xg.mean(0)
means.append(meang)
if len(Xg) == 1:
raise ValueError('y has only 1 sample in class %s, covariance '
'is ill defined.' % str(self.classes_[ind]))
Xgc = Xg - meang
# Xgc = U * S * V.T
U, S, Vt = np.linalg.svd(Xgc, full_matrices=False)
rank = np.sum(S > tol)
if rank < n_features:
warnings.warn("Variables are collinear")
S2 = (S ** 2) / (len(Xg) - 1)
S2 = ((1 - self.reg_param) * S2) + self.reg_param
if store_covariances:
# cov = V * (S^2 / (n-1)) * V.T
cov.append(np.dot(S2 * Vt.T, Vt))
scalings.append(S2)
rotations.append(Vt.T)
if store_covariances:
self.covariances_ = cov
self.means_ = np.asarray(means)
self.scalings_ = scalings
self.rotations_ = rotations
return self
def _decision_function(self, X):
check_is_fitted(self, 'classes_')
X = check_array(X)
norm2 = []
for i in range(len(self.classes_)):
R = self.rotations_[i]
S = self.scalings_[i]
Xm = X - self.means_[i]
X2 = np.dot(Xm, R * (S ** (-0.5)))
norm2.append(np.sum(X2 ** 2, 1))
norm2 = np.array(norm2).T # shape = [len(X), n_classes]
u = np.asarray([np.sum(np.log(s)) for s in self.scalings_])
return (-0.5 * (norm2 + u) + np.log(self.priors_))
def decision_function(self, X):
"""Apply decision function to an array of samples.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Array of samples (test vectors).
Returns
-------
C : array, shape = [n_samples, n_classes] or [n_samples,]
Decision function values related to each class, per sample.
In the two-class case, the shape is [n_samples,], giving the
log likelihood ratio of the positive class.
"""
dec_func = self._decision_function(X)
# handle special case of two classes
if len(self.classes_) == 2:
return dec_func[:, 1] - dec_func[:, 0]
return dec_func
def predict(self, X):
"""Perform classification on an array of test vectors X.
The predicted class C for each sample in X is returned.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Returns
-------
C : array, shape = [n_samples]
"""
d = self._decision_function(X)
y_pred = self.classes_.take(d.argmax(1))
return y_pred
def predict_proba(self, X):
"""Return posterior probabilities of classification.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Array of samples/test vectors.
Returns
-------
C : array, shape = [n_samples, n_classes]
Posterior probabilities of classification per class.
"""
values = self._decision_function(X)
# compute the likelihood of the underlying gaussian models
# up to a multiplicative constant.
likelihood = np.exp(values - values.max(axis=1)[:, np.newaxis])
# compute posterior probabilities
return likelihood / likelihood.sum(axis=1)[:, np.newaxis]
def predict_log_proba(self, X):
"""Return posterior probabilities of classification.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Array of samples/test vectors.
Returns
-------
C : array, shape = [n_samples, n_classes]
Posterior log-probabilities of classification per class.
"""
# XXX : can do better to avoid precision overflows
probas_ = self.predict_proba(X)
return np.log(probas_)
| bsd-3-clause |
smartscheduling/scikit-learn-categorical-tree | sklearn/manifold/t_sne.py | 6 | 19987 | # Author: Alexander Fabisch -- <afabisch@informatik.uni-bremen.de>
# License: BSD 3 clause (C) 2014
# This is the standard t-SNE implementation. There are faster modifications of
# the algorithm:
# * Barnes-Hut-SNE: reduces the complexity of the gradient computation from
# N^2 to N log N (http://arxiv.org/abs/1301.3342)
# * Fast Optimization for t-SNE:
# http://cseweb.ucsd.edu/~lvdmaaten/workshops/nips2010/papers/vandermaaten.pdf
import numpy as np
from scipy import linalg
from scipy.spatial.distance import pdist
from scipy.spatial.distance import squareform
from ..base import BaseEstimator
from ..utils import check_array
from ..utils import check_random_state
from ..utils.extmath import _ravel
from ..decomposition import RandomizedPCA
from ..metrics.pairwise import pairwise_distances
from . import _utils
MACHINE_EPSILON = np.finfo(np.double).eps
def _joint_probabilities(distances, desired_perplexity, verbose):
"""Compute joint probabilities p_ij from distances.
Parameters
----------
distances : array, shape (n_samples * (n_samples-1) / 2,)
Distances of samples are stored as condensed matrices, i.e.
we omit the diagonal and duplicate entries and store everything
in a one-dimensional array.
desired_perplexity : float
Desired perplexity of the joint probability distributions.
verbose : int
Verbosity level.
Returns
-------
P : array, shape (n_samples * (n_samples-1) / 2,)
Condensed joint probability matrix.
"""
# Compute conditional probabilities such that they approximately match
# the desired perplexity
conditional_P = _utils._binary_search_perplexity(
distances, desired_perplexity, verbose)
P = conditional_P + conditional_P.T
sum_P = np.maximum(np.sum(P), MACHINE_EPSILON)
P = np.maximum(squareform(P) / sum_P, MACHINE_EPSILON)
return P
def _kl_divergence(params, P, alpha, n_samples, n_components):
"""t-SNE objective function: KL divergence of p_ijs and q_ijs.
Parameters
----------
params : array, shape (n_params,)
Unraveled embedding.
P : array, shape (n_samples * (n_samples-1) / 2,)
Condensed joint probability matrix.
alpha : float
Degrees of freedom of the Student's-t distribution.
n_samples : int
Number of samples.
n_components : int
Dimension of the embedded space.
Returns
-------
kl_divergence : float
Kullback-Leibler divergence of p_ij and q_ij.
grad : array, shape (n_params,)
Unraveled gradient of the Kullback-Leibler divergence with respect to
the embedding.
"""
X_embedded = params.reshape(n_samples, n_components)
# Q is a heavy-tailed distribution: Student's t-distribution
n = pdist(X_embedded, "sqeuclidean")
n += 1.
n /= alpha
n **= (alpha + 1.0) / -2.0
Q = np.maximum(n / (2.0 * np.sum(n)), MACHINE_EPSILON)
# Optimization trick below: np.dot(x, y) is faster than
# np.sum(x * y) because it calls BLAS
# Objective: C (Kullback-Leibler divergence of P and Q)
kl_divergence = 2.0 * np.dot(P, np.log(P / Q))
# Gradient: dC/dY
grad = np.ndarray((n_samples, n_components))
PQd = squareform((P - Q) * n)
for i in range(n_samples):
np.dot(_ravel(PQd[i]), X_embedded[i] - X_embedded, out=grad[i])
grad = grad.ravel()
c = 2.0 * (alpha + 1.0) / alpha
grad *= c
return kl_divergence, grad
def _gradient_descent(objective, p0, it, n_iter, n_iter_without_progress=30,
momentum=0.5, learning_rate=1000.0, min_gain=0.01,
min_grad_norm=1e-7, min_error_diff=1e-7, verbose=0,
args=None):
"""Batch gradient descent with momentum and individual gains.
Parameters
----------
objective : function or callable
Should return a tuple of cost and gradient for a given parameter
vector.
p0 : array-like, shape (n_params,)
Initial parameter vector.
it : int
Current number of iterations (this function will be called more than
once during the optimization).
n_iter : int
Maximum number of gradient descent iterations.
n_iter_without_progress : int, optional (default: 30)
Maximum number of iterations without progress before we abort the
optimization.
momentum : float, within (0.0, 1.0), optional (default: 0.5)
The momentum generates a weight for previous gradients that decays
exponentially.
learning_rate : float, optional (default: 1000.0)
The learning rate should be extremely high for t-SNE! Values in the
range [100.0, 1000.0] are common.
min_gain : float, optional (default: 0.01)
Minimum individual gain for each parameter.
min_grad_norm : float, optional (default: 1e-7)
If the gradient norm is below this threshold, the optimization will
be aborted.
min_error_diff : float, optional (default: 1e-7)
If the absolute difference of two successive cost function values
is below this threshold, the optimization will be aborted.
verbose : int, optional (default: 0)
Verbosity level.
args : sequence
Arguments to pass to objective function.
Returns
-------
p : array, shape (n_params,)
Optimum parameters.
error : float
Optimum.
i : int
Last iteration.
"""
if args is None:
args = []
p = p0.copy().ravel()
update = np.zeros_like(p)
gains = np.ones_like(p)
error = np.finfo(np.float).max
best_error = np.finfo(np.float).max
best_iter = 0
for i in range(it, n_iter):
new_error, grad = objective(p, *args)
error_diff = np.abs(new_error - error)
error = new_error
grad_norm = linalg.norm(grad)
if error < best_error:
best_error = error
best_iter = i
elif i - best_iter > n_iter_without_progress:
if verbose >= 2:
print("[t-SNE] Iteration %d: did not make any progress "
"during the last %d episodes. Finished."
% (i + 1, n_iter_without_progress))
break
if min_grad_norm >= grad_norm:
if verbose >= 2:
print("[t-SNE] Iteration %d: gradient norm %f. Finished."
% (i + 1, grad_norm))
break
if min_error_diff >= error_diff:
if verbose >= 2:
print("[t-SNE] Iteration %d: error difference %f. Finished."
% (i + 1, error_diff))
break
inc = update * grad >= 0.0
dec = np.invert(inc)
gains[inc] += 0.05
gains[dec] *= 0.95
np.clip(gains, min_gain, np.inf)
grad *= gains
update = momentum * update - learning_rate * grad
p += update
if verbose >= 2 and (i + 1) % 10 == 0:
print("[t-SNE] Iteration %d: error = %.7f, gradient norm = %.7f"
% (i + 1, error, grad_norm))
return p, error, i
def trustworthiness(X, X_embedded, n_neighbors=5, precomputed=False):
"""Expresses to what extent the local structure is retained.
The trustworthiness is within [0, 1]. It is defined as
.. math::
T(k) = 1 - \frac{2}{nk (2n - 3k - 1)} \sum^n_{i=1}
\sum_{j \in U^{(k)}_i (r(i, j) - k)}
where :math:`r(i, j)` is the rank of the embedded datapoint j
according to the pairwise distances between the embedded datapoints,
:math:`U^{(k)}_i` is the set of points that are in the k nearest
neighbors in the embedded space but not in the original space.
* "Neighborhood Preservation in Nonlinear Projection Methods: An
Experimental Study"
J. Venna, S. Kaski
* "Learning a Parametric Embedding by Preserving Local Structure"
L.J.P. van der Maaten
Parameters
----------
X : array, shape (n_samples, n_features) or (n_samples, n_samples)
If the metric is 'precomputed' X must be a square distance
matrix. Otherwise it contains a sample per row.
X_embedded : array, shape (n_samples, n_components)
Embedding of the training data in low-dimensional space.
n_neighbors : int, optional (default: 5)
Number of neighbors k that will be considered.
precomputed : bool, optional (default: False)
Set this flag if X is a precomputed square distance matrix.
Returns
-------
trustworthiness : float
Trustworthiness of the low-dimensional embedding.
"""
if precomputed:
dist_X = X
else:
dist_X = pairwise_distances(X, squared=True)
dist_X_embedded = pairwise_distances(X_embedded, squared=True)
ind_X = np.argsort(dist_X, axis=1)
ind_X_embedded = np.argsort(dist_X_embedded, axis=1)[:, 1:n_neighbors + 1]
n_samples = X.shape[0]
t = 0.0
ranks = np.zeros(n_neighbors)
for i in range(n_samples):
for j in range(n_neighbors):
ranks[j] = np.where(ind_X[i] == ind_X_embedded[i, j])[0][0]
ranks -= n_neighbors
t += np.sum(ranks[ranks > 0])
t = 1.0 - t * (2.0 / (n_samples * n_neighbors *
(2.0 * n_samples - 3.0 * n_neighbors - 1.0)))
return t
class TSNE(BaseEstimator):
"""t-distributed Stochastic Neighbor Embedding.
t-SNE [1] is a tool to visualize high-dimensional data. It converts
similarities between data points to joint probabilities and tries
to minimize the Kullback-Leibler divergence between the joint
probabilities of the low-dimensional embedding and the
high-dimensional data. t-SNE has a cost function that is not convex,
i.e. with different initializations we can get different results.
It is highly recommended to use another dimensionality reduction
method (e.g. PCA for dense data or TruncatedSVD for sparse data)
to reduce the number of dimensions to a reasonable amount (e.g. 50)
if the number of features is very high. This will suppress some
noise and speed up the computation of pairwise distances between
samples. For more tips see Laurens van der Maaten's FAQ [2].
Parameters
----------
n_components : int, optional (default: 2)
Dimension of the embedded space.
perplexity : float, optional (default: 30)
The perplexity is related to the number of nearest neighbors that
is used in other manifold learning algorithms. Larger datasets
usually require a larger perplexity. Consider selcting a value
between 5 and 50. The choice is not extremely critical since t-SNE
is quite insensitive to this parameter.
early_exaggeration : float, optional (default: 4.0)
Controls how tight natural clusters in the original space are in
the embedded space and how much space will be between them. For
larger values, the space between natural clusters will be larger
in the embedded space. Again, the choice of this parameter is not
very critical. If the cost function increases during initial
optimization, the early exaggeration factor or the learning rate
might be too high.
learning_rate : float, optional (default: 1000)
The learning rate can be a critical parameter. It should be
between 100 and 1000. If the cost function increases during initial
optimization, the early exaggeration factor or the learning rate
might be too high. If the cost function gets stuck in a bad local
minimum increasing the learning rate helps sometimes.
n_iter : int, optional (default: 1000)
Maximum number of iterations for the optimization. Should be at
least 200.
metric : string or callable, optional
The metric to use when calculating distance between instances in a
feature array. If metric is a string, it must be one of the options
allowed by scipy.spatial.distance.pdist for its metric parameter, or
a metric listed in pairwise.PAIRWISE_DISTANCE_FUNCTIONS.
If metric is "precomputed", X is assumed to be a distance matrix.
Alternatively, if metric is a callable function, it is called on each
pair of instances (rows) and the resulting value recorded. The callable
should take two arrays from X as input and return a value indicating
the distance between them. The default is "euclidean" which is
interpreted as squared euclidean distance.
init : string, optional (default: "random")
Initialization of embedding. Possible options are 'random' and 'pca'.
PCA initialization cannot be used with precomputed distances and is
usually more globally stable than random initialization.
verbose : int, optional (default: 0)
Verbosity level.
random_state : int or RandomState instance or None (default)
Pseudo Random Number generator seed control. If None, use the
numpy.random singleton. Note that different initializations
might result in different local minima of the cost function.
Attributes
----------
embedding_ : array-like, shape (n_samples, n_components)
Stores the embedding vectors.
training_data_ : array-like, shape (n_samples, n_features)
Stores the training data.
Examples
--------
>>> import numpy as np
>>> from sklearn.manifold import TSNE
>>> X = np.array([[0, 0, 0], [0, 1, 1], [1, 0, 1], [1, 1, 1]])
>>> model = TSNE(n_components=2, random_state=0)
>>> model.fit_transform(X) # doctest: +ELLIPSIS, +NORMALIZE_WHITESPACE
array([[ 887.28..., 238.61...],
[ -714.79..., 3243.34...],
[ 957.30..., -2505.78...],
[-1130.28..., -974.78...])
References
----------
[1] van der Maaten, L.J.P.; Hinton, G.E. Visualizing High-Dimensional Data
Using t-SNE. Journal of Machine Learning Research 9:2579-2605, 2008.
[2] van der Maaten, L.J.P. t-Distributed Stochastic Neighbor Embedding
http://homepage.tudelft.nl/19j49/t-SNE.html
"""
def __init__(self, n_components=2, perplexity=30.0,
early_exaggeration=4.0, learning_rate=1000.0, n_iter=1000,
metric="euclidean", init="random", verbose=0,
random_state=None):
if init not in ["pca", "random"]:
raise ValueError("'init' must be either 'pca' or 'random'")
self.n_components = n_components
self.perplexity = perplexity
self.early_exaggeration = early_exaggeration
self.learning_rate = learning_rate
self.n_iter = n_iter
self.metric = metric
self.init = init
self.verbose = verbose
self.random_state = random_state
def fit(self, X, y=None):
"""Fit the model using X as training data.
Parameters
----------
X : array, shape (n_samples, n_features) or (n_samples, n_samples)
If the metric is 'precomputed' X must be a square distance
matrix. Otherwise it contains a sample per row.
"""
X = check_array(X, accept_sparse=['csr', 'csc', 'coo'], dtype=np.float64)
random_state = check_random_state(self.random_state)
if self.early_exaggeration < 1.0:
raise ValueError("early_exaggeration must be at least 1, but is "
"%f" % self.early_exaggeration)
if self.n_iter < 200:
raise ValueError("n_iter should be at least 200")
if self.metric == "precomputed":
if self.init == 'pca':
raise ValueError("The parameter init=\"pca\" cannot be used "
"with metric=\"precomputed\".")
if X.shape[0] != X.shape[1]:
raise ValueError("X should be a square distance matrix")
distances = X
else:
if self.verbose:
print("[t-SNE] Computing pairwise distances...")
if self.metric == "euclidean":
distances = pairwise_distances(X, metric=self.metric, squared=True)
else:
distances = pairwise_distances(X, metric=self.metric)
# Degrees of freedom of the Student's t-distribution. The suggestion
# alpha = n_components - 1 comes from "Learning a Parametric Embedding
# by Preserving Local Structure" Laurens van der Maaten, 2009.
alpha = max(self.n_components - 1.0, 1)
n_samples = X.shape[0]
self.training_data_ = X
P = _joint_probabilities(distances, self.perplexity, self.verbose)
if self.init == 'pca':
pca = RandomizedPCA(n_components=self.n_components,
random_state=random_state)
X_embedded = pca.fit_transform(X)
elif self.init == 'random':
X_embedded = None
else:
raise ValueError("Unsupported initialization scheme: %s"
% self.init)
self.embedding_ = self._tsne(P, alpha, n_samples, random_state,
X_embedded=X_embedded)
def _tsne(self, P, alpha, n_samples, random_state, X_embedded=None):
"""Runs t-SNE."""
# t-SNE minimizes the Kullback-Leiber divergence of the Gaussians P
# and the Student's t-distributions Q. The optimization algorithm that
# we use is batch gradient descent with three stages:
# * early exaggeration with momentum 0.5
# * early exaggeration with momentum 0.8
# * final optimization with momentum 0.8
# The embedding is initialized with iid samples from Gaussians with
# standard deviation 1e-4.
if X_embedded is None:
# Initialize embedding randomly
X_embedded = 1e-4 * random_state.randn(n_samples,
self.n_components)
params = X_embedded.ravel()
# Early exaggeration
P *= self.early_exaggeration
params, error, it = _gradient_descent(
_kl_divergence, params, it=0, n_iter=50, momentum=0.5,
min_grad_norm=0.0, min_error_diff=0.0,
learning_rate=self.learning_rate, verbose=self.verbose,
args=[P, alpha, n_samples, self.n_components])
params, error, it = _gradient_descent(
_kl_divergence, params, it=it + 1, n_iter=100, momentum=0.8,
min_grad_norm=0.0, min_error_diff=0.0,
learning_rate=self.learning_rate, verbose=self.verbose,
args=[P, alpha, n_samples, self.n_components])
if self.verbose:
print("[t-SNE] Error after %d iterations with early "
"exaggeration: %f" % (it + 1, error))
# Final optimization
P /= self.early_exaggeration
params, error, it = _gradient_descent(
_kl_divergence, params, it=it + 1, n_iter=self.n_iter,
momentum=0.8, learning_rate=self.learning_rate,
verbose=self.verbose, args=[P, alpha, n_samples,
self.n_components])
if self.verbose:
print("[t-SNE] Error after %d iterations: %f" % (it + 1, error))
X_embedded = params.reshape(n_samples, self.n_components)
return X_embedded
def fit_transform(self, X, y=None):
"""Transform X to the embedded space.
Parameters
----------
X : array, shape (n_samples, n_features) or (n_samples, n_samples)
If the metric is 'precomputed' X must be a square distance
matrix. Otherwise it contains a sample per row.
Returns
-------
X_new : array, shape (n_samples, n_components)
Embedding of the training data in low-dimensional space.
"""
self.fit(X)
return self.embedding_
| bsd-3-clause |
smartscheduling/scikit-learn-categorical-tree | sklearn/utils/class_weight.py | 20 | 6468 | # Authors: Andreas Mueller
# Manoj Kumar
# License: BSD 3 clause
import numpy as np
from ..externals import six
from ..utils.fixes import in1d
from .fixes import bincount
def compute_class_weight(class_weight, classes, y):
"""Estimate class weights for unbalanced datasets.
Parameters
----------
class_weight : dict, 'auto' or None
If 'auto', class weights will be given inverse proportional
to the frequency of the class in the data.
If a dictionary is given, keys are classes and values
are corresponding class weights.
If None is given, the class weights will be uniform.
classes : ndarray
Array of the classes occurring in the data, as given by
``np.unique(y_org)`` with ``y_org`` the original class labels.
y : array-like, shape (n_samples,)
Array of original class labels per sample;
Returns
-------
class_weight_vect : ndarray, shape (n_classes,)
Array with class_weight_vect[i] the weight for i-th class
"""
# Import error caused by circular imports.
from ..preprocessing import LabelEncoder
if class_weight is None or len(class_weight) == 0:
# uniform class weights
weight = np.ones(classes.shape[0], dtype=np.float64, order='C')
elif class_weight == 'auto':
# Find the weight of each class as present in y.
le = LabelEncoder()
y_ind = le.fit_transform(y)
if not all(np.in1d(classes, le.classes_)):
raise ValueError("classes should have valid labels that are in y")
# inversely proportional to the number of samples in the class
recip_freq = 1. / bincount(y_ind)
weight = recip_freq[le.transform(classes)] / np.mean(recip_freq)
else:
# user-defined dictionary
weight = np.ones(classes.shape[0], dtype=np.float64, order='C')
if not isinstance(class_weight, dict):
raise ValueError("class_weight must be dict, 'auto', or None,"
" got: %r" % class_weight)
for c in class_weight:
i = np.searchsorted(classes, c)
if classes[i] != c:
raise ValueError("Class label %d not present." % c)
else:
weight[i] = class_weight[c]
return weight
def compute_sample_weight(class_weight, y, indices=None):
"""Estimate sample weights by class for unbalanced datasets.
Parameters
----------
class_weight : dict, list of dicts, "auto", or None, optional
Weights associated with classes in the form ``{class_label: weight}``.
If not given, all classes are supposed to have weight one. For
multi-output problems, a list of dicts can be provided in the same
order as the columns of y.
The "auto" mode uses the values of y to automatically adjust
weights inversely proportional to class frequencies in the input data.
For multi-output, the weights of each column of y will be multiplied.
y : array-like, shape = [n_samples] or [n_samples, n_outputs]
Array of original class labels per sample.
indices : array-like, shape (n_subsample,), or None
Array of indices to be used in a subsample. Can be of length less than
n_samples in the case of a subsample, or equal to n_samples in the
case of a bootstrap subsample with repeated indices. If None, the
sample weight will be calculated over the full sample. Only "auto" is
supported for class_weight if this is provided.
Returns
-------
sample_weight_vect : ndarray, shape (n_samples,)
Array with sample weights as applied to the original y
"""
y = np.atleast_1d(y)
if y.ndim == 1:
y = np.reshape(y, (-1, 1))
n_outputs = y.shape[1]
if isinstance(class_weight, six.string_types):
if class_weight != 'auto':
raise ValueError('The only valid preset for class_weight is '
'"auto". Given "%s".' % class_weight)
elif (indices is not None and
not isinstance(class_weight, six.string_types)):
raise ValueError('The only valid class_weight for subsampling is '
'"auto". Given "%s".' % class_weight)
elif n_outputs > 1:
if (not hasattr(class_weight, "__iter__") or
isinstance(class_weight, dict)):
raise ValueError("For multi-output, class_weight should be a "
"list of dicts, or a valid string.")
if len(class_weight) != n_outputs:
raise ValueError("For multi-output, number of elements in "
"class_weight should match number of outputs.")
expanded_class_weight = []
for k in range(n_outputs):
y_full = y[:, k]
classes_full = np.unique(y_full)
classes_missing = None
if class_weight == 'auto' or n_outputs == 1:
class_weight_k = class_weight
else:
class_weight_k = class_weight[k]
if indices is not None:
# Get class weights for the subsample, covering all classes in
# case some labels that were present in the original data are
# missing from the sample.
y_subsample = y[indices, k]
classes_subsample = np.unique(y_subsample)
weight_k = np.choose(np.searchsorted(classes_subsample,
classes_full),
compute_class_weight(class_weight_k,
classes_subsample,
y_subsample),
mode='clip')
classes_missing = set(classes_full) - set(classes_subsample)
else:
weight_k = compute_class_weight(class_weight_k,
classes_full,
y_full)
weight_k = weight_k[np.searchsorted(classes_full, y_full)]
if classes_missing:
# Make missing classes' weight zero
weight_k[in1d(y_full, list(classes_missing))] = 0.
expanded_class_weight.append(weight_k)
expanded_class_weight = np.prod(expanded_class_weight,
axis=0,
dtype=np.float64)
return expanded_class_weight
| bsd-3-clause |
bodacea/opendatatools | ckandump/ckan_calls.py | 1 | 3584 | #!/usr/bin/env python
'''
Add and access data in CKAN2.0 instance (e.g. datahub.io)
References include:
* http://docs.ckan.org/en/ckan-2.0/api.html
* http://ckan.readthedocs.org/en/ckan-1.7.1/using-data-api.html
Sara-Jayne Terp, 2013
'''
import urllib2
import urllib
import json
import pickle
import ckanclient
import pprint
'''
call_ckan_api:
Sara-Jayne Terp, 2013
'''
#Globals
ckan = None
def call_ckan_api(ckanurl, apikey, apicall, data):
# Make the HTTP request.
data_string = urllib.quote(json.dumps(data))
headers = {'Authorization': apikey}
req = urllib2.Request(ckanurl+'api/3/'+apicall, data_string, headers)
response = urllib2.urlopen(req)
# Use the json module to load CKAN's response into a dictionary.
## assert response.code == 200
response_dict = json.loads(response.read())
# Check the contents of the response.
## assert response_dict['success'] is True
result = response_dict['result']
## pprint.pprint(result)
return(result)
def check_ckan_package(ckanurl, apikey, packagename, ownername):
action = "action/package_show"
ckandata = {'name':packagename,'owner_org':ownername}
result = call_ckan_api(ckanurl, apikey, action, ckandata)
return(result)
def create_ckan_package(ckanurl, apikey, packagename, ownername):
action = "action/package_create"
ckandata = {'name':packagename,'owner_org':ownername}
result = call_ckan_api(ckanurl, apikey, action, ckandata)
return(result)
def create_ckan_resource(ckanurl, apikey, data,
resourcename, packagename, ownername):
action = "action/resource_create"
#NB Must put owner_org in here, or call will fail
ckandata = {'name':resourcename,
'package_id':packagename,
'owner_org':ownername}
ckandata.update(data)
result = call_ckan_api(ckanurl, apikey, action, ckandata)
return(result)
#Read in CKAN and google keys
def read_keys(keyfile):
fin = open(keyfile, 'rb')
ckankeys = {}
googlekeys = {}
ckankeys['url'] = fin.readline().strip()
ckankeys['apikey'] = fin.readline().strip()
googlekeys['user'] = fin.readline().strip()
googlekeys['pass'] = fin.readline().strip()
googlekeys['doc'] = fin.readline().strip()
fin.close()
return(ckankeys, googlekeys)
def dump_ckan_to_pickle(keyfile):
#Connect
[ckankeys, googlekeys] = read_keys(keyfile)
fout = open("pickled_ckan_contents.pk1", "wb")
ckan = ckanclient.CkanClient(
base_location=ckankeys['url']+'api',
api_key=ckankeys['apikey'])
#tag list
tag_list = ckan.tag_register_get()
pickle.dump(tag_list, fout, -1) #force pickle to use highest protocol available
#packages
package_entities = {}
package_list = ckan.package_register_get()
print package_list
for package_name in package_list:
ckan.package_entity_get(package_name)
package_entities[package_name] = ckan.last_message
pickle.dump(package_entities, fout, -1)
#groups
groups = {}
group_list = ckan.group_register_get()
print group_list
for group_name in group_list:
groups[group_name] = ckan.group_entity_get(group_name)
pickle.dump(groups, fout, -1)
###datasets
##datasets = {}
##dataset_list = ckan.dataset_register_get()
##for dataset_name in dataset_list:
## datasets[dataset_name] = ckan.dataset_entity_get(dataset_name)
##pickle.dump(datasets, fout, -1)
fout.close()
return()
def reverse_ckan_pickle(filename):
fin = open(filename, 'rb')
tags = pickle.load(fin)
packages = pickle.load(fin)
groups = pickle.load(fin)
fin.close()
return tags, packages, groups
| gpl-3.0 |
cauchycui/scikit-learn | examples/linear_model/plot_logistic_l1_l2_sparsity.py | 377 | 2601 | """
==============================================
L1 Penalty and Sparsity in Logistic Regression
==============================================
Comparison of the sparsity (percentage of zero coefficients) of solutions when
L1 and L2 penalty are used for different values of C. We can see that large
values of C give more freedom to the model. Conversely, smaller values of C
constrain the model more. In the L1 penalty case, this leads to sparser
solutions.
We classify 8x8 images of digits into two classes: 0-4 against 5-9.
The visualization shows coefficients of the models for varying C.
"""
print(__doc__)
# Authors: Alexandre Gramfort <alexandre.gramfort@inria.fr>
# Mathieu Blondel <mathieu@mblondel.org>
# Andreas Mueller <amueller@ais.uni-bonn.de>
# License: BSD 3 clause
import numpy as np
import matplotlib.pyplot as plt
from sklearn.linear_model import LogisticRegression
from sklearn import datasets
from sklearn.preprocessing import StandardScaler
digits = datasets.load_digits()
X, y = digits.data, digits.target
X = StandardScaler().fit_transform(X)
# classify small against large digits
y = (y > 4).astype(np.int)
# Set regularization parameter
for i, C in enumerate((100, 1, 0.01)):
# turn down tolerance for short training time
clf_l1_LR = LogisticRegression(C=C, penalty='l1', tol=0.01)
clf_l2_LR = LogisticRegression(C=C, penalty='l2', tol=0.01)
clf_l1_LR.fit(X, y)
clf_l2_LR.fit(X, y)
coef_l1_LR = clf_l1_LR.coef_.ravel()
coef_l2_LR = clf_l2_LR.coef_.ravel()
# coef_l1_LR contains zeros due to the
# L1 sparsity inducing norm
sparsity_l1_LR = np.mean(coef_l1_LR == 0) * 100
sparsity_l2_LR = np.mean(coef_l2_LR == 0) * 100
print("C=%.2f" % C)
print("Sparsity with L1 penalty: %.2f%%" % sparsity_l1_LR)
print("score with L1 penalty: %.4f" % clf_l1_LR.score(X, y))
print("Sparsity with L2 penalty: %.2f%%" % sparsity_l2_LR)
print("score with L2 penalty: %.4f" % clf_l2_LR.score(X, y))
l1_plot = plt.subplot(3, 2, 2 * i + 1)
l2_plot = plt.subplot(3, 2, 2 * (i + 1))
if i == 0:
l1_plot.set_title("L1 penalty")
l2_plot.set_title("L2 penalty")
l1_plot.imshow(np.abs(coef_l1_LR.reshape(8, 8)), interpolation='nearest',
cmap='binary', vmax=1, vmin=0)
l2_plot.imshow(np.abs(coef_l2_LR.reshape(8, 8)), interpolation='nearest',
cmap='binary', vmax=1, vmin=0)
plt.text(-8, 3, "C = %.2f" % C)
l1_plot.set_xticks(())
l1_plot.set_yticks(())
l2_plot.set_xticks(())
l2_plot.set_yticks(())
plt.show()
| bsd-3-clause |
lorenzo-desantis/mne-python | examples/inverse/plot_label_activation_from_stc.py | 50 | 1949 | """
==================================================
Extracting time course from source_estimate object
==================================================
Load a SourceEstimate object from stc files and
extract the time course of activation in
individual labels, as well as in a complex label
formed through merging two labels.
"""
# Author: Christian Brodbeck <christianbrodbeck@nyu.edu>
#
# License: BSD (3-clause)
import os
import mne
from mne.datasets import sample
import matplotlib.pyplot as plt
print(__doc__)
data_path = sample.data_path()
os.environ['SUBJECTS_DIR'] = data_path + '/subjects'
meg_path = data_path + '/MEG/sample'
# load the stc
stc = mne.read_source_estimate(meg_path + '/sample_audvis-meg')
# load the labels
aud_lh = mne.read_label(meg_path + '/labels/Aud-lh.label')
aud_rh = mne.read_label(meg_path + '/labels/Aud-rh.label')
# extract the time course for different labels from the stc
stc_lh = stc.in_label(aud_lh)
stc_rh = stc.in_label(aud_rh)
stc_bh = stc.in_label(aud_lh + aud_rh)
# calculate center of mass and transform to mni coordinates
vtx, _, t_lh = stc_lh.center_of_mass('sample')
mni_lh = mne.vertex_to_mni(vtx, 0, 'sample')[0]
vtx, _, t_rh = stc_rh.center_of_mass('sample')
mni_rh = mne.vertex_to_mni(vtx, 1, 'sample')[0]
# plot the activation
plt.figure()
plt.axes([.1, .275, .85, .625])
hl = plt.plot(stc.times, stc_lh.data.mean(0), 'b')[0]
hr = plt.plot(stc.times, stc_rh.data.mean(0), 'g')[0]
hb = plt.plot(stc.times, stc_bh.data.mean(0), 'r')[0]
plt.xlabel('Time (s)')
plt.ylabel('Source amplitude (dSPM)')
plt.xlim(stc.times[0], stc.times[-1])
# add a legend including center-of-mass mni coordinates to the plot
labels = ['LH: center of mass = %s' % mni_lh.round(2),
'RH: center of mass = %s' % mni_rh.round(2),
'Combined LH & RH']
plt.figlegend([hl, hr, hb], labels, 'lower center')
plt.suptitle('Average activation in auditory cortex labels', fontsize=20)
plt.show()
| bsd-3-clause |
cauchycui/scikit-learn | sklearn/utils/__init__.py | 131 | 14185 | """
The :mod:`sklearn.utils` module includes various utilities.
"""
from collections import Sequence
import numpy as np
from scipy.sparse import issparse
import warnings
from .murmurhash import murmurhash3_32
from .validation import (as_float_array,
assert_all_finite,
check_random_state, column_or_1d, check_array,
check_consistent_length, check_X_y, indexable,
check_symmetric, DataConversionWarning)
from .class_weight import compute_class_weight, compute_sample_weight
from ..externals.joblib import cpu_count
__all__ = ["murmurhash3_32", "as_float_array",
"assert_all_finite", "check_array",
"check_random_state",
"compute_class_weight", "compute_sample_weight",
"column_or_1d", "safe_indexing",
"check_consistent_length", "check_X_y", 'indexable',
"check_symmetric"]
class deprecated(object):
"""Decorator to mark a function or class as deprecated.
Issue a warning when the function is called/the class is instantiated and
adds a warning to the docstring.
The optional extra argument will be appended to the deprecation message
and the docstring. Note: to use this with the default value for extra, put
in an empty of parentheses:
>>> from sklearn.utils import deprecated
>>> deprecated() # doctest: +ELLIPSIS
<sklearn.utils.deprecated object at ...>
>>> @deprecated()
... def some_function(): pass
"""
# Adapted from http://wiki.python.org/moin/PythonDecoratorLibrary,
# but with many changes.
def __init__(self, extra=''):
"""
Parameters
----------
extra: string
to be added to the deprecation messages
"""
self.extra = extra
def __call__(self, obj):
if isinstance(obj, type):
return self._decorate_class(obj)
else:
return self._decorate_fun(obj)
def _decorate_class(self, cls):
msg = "Class %s is deprecated" % cls.__name__
if self.extra:
msg += "; %s" % self.extra
# FIXME: we should probably reset __new__ for full generality
init = cls.__init__
def wrapped(*args, **kwargs):
warnings.warn(msg, category=DeprecationWarning)
return init(*args, **kwargs)
cls.__init__ = wrapped
wrapped.__name__ = '__init__'
wrapped.__doc__ = self._update_doc(init.__doc__)
wrapped.deprecated_original = init
return cls
def _decorate_fun(self, fun):
"""Decorate function fun"""
msg = "Function %s is deprecated" % fun.__name__
if self.extra:
msg += "; %s" % self.extra
def wrapped(*args, **kwargs):
warnings.warn(msg, category=DeprecationWarning)
return fun(*args, **kwargs)
wrapped.__name__ = fun.__name__
wrapped.__dict__ = fun.__dict__
wrapped.__doc__ = self._update_doc(fun.__doc__)
return wrapped
def _update_doc(self, olddoc):
newdoc = "DEPRECATED"
if self.extra:
newdoc = "%s: %s" % (newdoc, self.extra)
if olddoc:
newdoc = "%s\n\n%s" % (newdoc, olddoc)
return newdoc
def safe_mask(X, mask):
"""Return a mask which is safe to use on X.
Parameters
----------
X : {array-like, sparse matrix}
Data on which to apply mask.
mask: array
Mask to be used on X.
Returns
-------
mask
"""
mask = np.asarray(mask)
if np.issubdtype(mask.dtype, np.int):
return mask
if hasattr(X, "toarray"):
ind = np.arange(mask.shape[0])
mask = ind[mask]
return mask
def safe_indexing(X, indices):
"""Return items or rows from X using indices.
Allows simple indexing of lists or arrays.
Parameters
----------
X : array-like, sparse-matrix, list.
Data from which to sample rows or items.
indices : array-like, list
Indices according to which X will be subsampled.
"""
if hasattr(X, "iloc"):
# Pandas Dataframes and Series
try:
return X.iloc[indices]
except ValueError:
# Cython typed memoryviews internally used in pandas do not support
# readonly buffers.
warnings.warn("Copying input dataframe for slicing.",
DataConversionWarning)
return X.copy().iloc[indices]
elif hasattr(X, "shape"):
if hasattr(X, 'take') and (hasattr(indices, 'dtype') and
indices.dtype.kind == 'i'):
# This is often substantially faster than X[indices]
return X.take(indices, axis=0)
else:
return X[indices]
else:
return [X[idx] for idx in indices]
def resample(*arrays, **options):
"""Resample arrays or sparse matrices in a consistent way
The default strategy implements one step of the bootstrapping
procedure.
Parameters
----------
*arrays : sequence of indexable data-structures
Indexable data-structures can be arrays, lists, dataframes or scipy
sparse matrices with consistent first dimension.
replace : boolean, True by default
Implements resampling with replacement. If False, this will implement
(sliced) random permutations.
n_samples : int, None by default
Number of samples to generate. If left to None this is
automatically set to the first dimension of the arrays.
random_state : int or RandomState instance
Control the shuffling for reproducible behavior.
Returns
-------
resampled_arrays : sequence of indexable data-structures
Sequence of resampled views of the collections. The original arrays are
not impacted.
Examples
--------
It is possible to mix sparse and dense arrays in the same run::
>>> X = np.array([[1., 0.], [2., 1.], [0., 0.]])
>>> y = np.array([0, 1, 2])
>>> from scipy.sparse import coo_matrix
>>> X_sparse = coo_matrix(X)
>>> from sklearn.utils import resample
>>> X, X_sparse, y = resample(X, X_sparse, y, random_state=0)
>>> X
array([[ 1., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> X_sparse # doctest: +ELLIPSIS +NORMALIZE_WHITESPACE
<3x2 sparse matrix of type '<... 'numpy.float64'>'
with 4 stored elements in Compressed Sparse Row format>
>>> X_sparse.toarray()
array([[ 1., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> y
array([0, 1, 0])
>>> resample(y, n_samples=2, random_state=0)
array([0, 1])
See also
--------
:func:`sklearn.utils.shuffle`
"""
random_state = check_random_state(options.pop('random_state', None))
replace = options.pop('replace', True)
max_n_samples = options.pop('n_samples', None)
if options:
raise ValueError("Unexpected kw arguments: %r" % options.keys())
if len(arrays) == 0:
return None
first = arrays[0]
n_samples = first.shape[0] if hasattr(first, 'shape') else len(first)
if max_n_samples is None:
max_n_samples = n_samples
if max_n_samples > n_samples:
raise ValueError("Cannot sample %d out of arrays with dim %d" % (
max_n_samples, n_samples))
check_consistent_length(*arrays)
if replace:
indices = random_state.randint(0, n_samples, size=(max_n_samples,))
else:
indices = np.arange(n_samples)
random_state.shuffle(indices)
indices = indices[:max_n_samples]
# convert sparse matrices to CSR for row-based indexing
arrays = [a.tocsr() if issparse(a) else a for a in arrays]
resampled_arrays = [safe_indexing(a, indices) for a in arrays]
if len(resampled_arrays) == 1:
# syntactic sugar for the unit argument case
return resampled_arrays[0]
else:
return resampled_arrays
def shuffle(*arrays, **options):
"""Shuffle arrays or sparse matrices in a consistent way
This is a convenience alias to ``resample(*arrays, replace=False)`` to do
random permutations of the collections.
Parameters
----------
*arrays : sequence of indexable data-structures
Indexable data-structures can be arrays, lists, dataframes or scipy
sparse matrices with consistent first dimension.
random_state : int or RandomState instance
Control the shuffling for reproducible behavior.
n_samples : int, None by default
Number of samples to generate. If left to None this is
automatically set to the first dimension of the arrays.
Returns
-------
shuffled_arrays : sequence of indexable data-structures
Sequence of shuffled views of the collections. The original arrays are
not impacted.
Examples
--------
It is possible to mix sparse and dense arrays in the same run::
>>> X = np.array([[1., 0.], [2., 1.], [0., 0.]])
>>> y = np.array([0, 1, 2])
>>> from scipy.sparse import coo_matrix
>>> X_sparse = coo_matrix(X)
>>> from sklearn.utils import shuffle
>>> X, X_sparse, y = shuffle(X, X_sparse, y, random_state=0)
>>> X
array([[ 0., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> X_sparse # doctest: +ELLIPSIS +NORMALIZE_WHITESPACE
<3x2 sparse matrix of type '<... 'numpy.float64'>'
with 3 stored elements in Compressed Sparse Row format>
>>> X_sparse.toarray()
array([[ 0., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> y
array([2, 1, 0])
>>> shuffle(y, n_samples=2, random_state=0)
array([0, 1])
See also
--------
:func:`sklearn.utils.resample`
"""
options['replace'] = False
return resample(*arrays, **options)
def safe_sqr(X, copy=True):
"""Element wise squaring of array-likes and sparse matrices.
Parameters
----------
X : array like, matrix, sparse matrix
copy : boolean, optional, default True
Whether to create a copy of X and operate on it or to perform
inplace computation (default behaviour).
Returns
-------
X ** 2 : element wise square
"""
X = check_array(X, accept_sparse=['csr', 'csc', 'coo'])
if issparse(X):
if copy:
X = X.copy()
X.data **= 2
else:
if copy:
X = X ** 2
else:
X **= 2
return X
def gen_batches(n, batch_size):
"""Generator to create slices containing batch_size elements, from 0 to n.
The last slice may contain less than batch_size elements, when batch_size
does not divide n.
Examples
--------
>>> from sklearn.utils import gen_batches
>>> list(gen_batches(7, 3))
[slice(0, 3, None), slice(3, 6, None), slice(6, 7, None)]
>>> list(gen_batches(6, 3))
[slice(0, 3, None), slice(3, 6, None)]
>>> list(gen_batches(2, 3))
[slice(0, 2, None)]
"""
start = 0
for _ in range(int(n // batch_size)):
end = start + batch_size
yield slice(start, end)
start = end
if start < n:
yield slice(start, n)
def gen_even_slices(n, n_packs, n_samples=None):
"""Generator to create n_packs slices going up to n.
Pass n_samples when the slices are to be used for sparse matrix indexing;
slicing off-the-end raises an exception, while it works for NumPy arrays.
Examples
--------
>>> from sklearn.utils import gen_even_slices
>>> list(gen_even_slices(10, 1))
[slice(0, 10, None)]
>>> list(gen_even_slices(10, 10)) #doctest: +ELLIPSIS
[slice(0, 1, None), slice(1, 2, None), ..., slice(9, 10, None)]
>>> list(gen_even_slices(10, 5)) #doctest: +ELLIPSIS
[slice(0, 2, None), slice(2, 4, None), ..., slice(8, 10, None)]
>>> list(gen_even_slices(10, 3))
[slice(0, 4, None), slice(4, 7, None), slice(7, 10, None)]
"""
start = 0
if n_packs < 1:
raise ValueError("gen_even_slices got n_packs=%s, must be >=1" % n_packs)
for pack_num in range(n_packs):
this_n = n // n_packs
if pack_num < n % n_packs:
this_n += 1
if this_n > 0:
end = start + this_n
if n_samples is not None:
end = min(n_samples, end)
yield slice(start, end, None)
start = end
def _get_n_jobs(n_jobs):
"""Get number of jobs for the computation.
This function reimplements the logic of joblib to determine the actual
number of jobs depending on the cpu count. If -1 all CPUs are used.
If 1 is given, no parallel computing code is used at all, which is useful
for debugging. For n_jobs below -1, (n_cpus + 1 + n_jobs) are used.
Thus for n_jobs = -2, all CPUs but one are used.
Parameters
----------
n_jobs : int
Number of jobs stated in joblib convention.
Returns
-------
n_jobs : int
The actual number of jobs as positive integer.
Examples
--------
>>> from sklearn.utils import _get_n_jobs
>>> _get_n_jobs(4)
4
>>> jobs = _get_n_jobs(-2)
>>> assert jobs == max(cpu_count() - 1, 1)
>>> _get_n_jobs(0)
Traceback (most recent call last):
...
ValueError: Parameter n_jobs == 0 has no meaning.
"""
if n_jobs < 0:
return max(cpu_count() + 1 + n_jobs, 1)
elif n_jobs == 0:
raise ValueError('Parameter n_jobs == 0 has no meaning.')
else:
return n_jobs
def tosequence(x):
"""Cast iterable x to a Sequence, avoiding a copy if possible."""
if isinstance(x, np.ndarray):
return np.asarray(x)
elif isinstance(x, Sequence):
return x
else:
return list(x)
class ConvergenceWarning(UserWarning):
"""Custom warning to capture convergence problems"""
class DataDimensionalityWarning(UserWarning):
"""Custom warning to notify potential issues with data dimensionality"""
| bsd-3-clause |
AlexRobson/scikit-learn | sklearn/utils/__init__.py | 131 | 14185 | """
The :mod:`sklearn.utils` module includes various utilities.
"""
from collections import Sequence
import numpy as np
from scipy.sparse import issparse
import warnings
from .murmurhash import murmurhash3_32
from .validation import (as_float_array,
assert_all_finite,
check_random_state, column_or_1d, check_array,
check_consistent_length, check_X_y, indexable,
check_symmetric, DataConversionWarning)
from .class_weight import compute_class_weight, compute_sample_weight
from ..externals.joblib import cpu_count
__all__ = ["murmurhash3_32", "as_float_array",
"assert_all_finite", "check_array",
"check_random_state",
"compute_class_weight", "compute_sample_weight",
"column_or_1d", "safe_indexing",
"check_consistent_length", "check_X_y", 'indexable',
"check_symmetric"]
class deprecated(object):
"""Decorator to mark a function or class as deprecated.
Issue a warning when the function is called/the class is instantiated and
adds a warning to the docstring.
The optional extra argument will be appended to the deprecation message
and the docstring. Note: to use this with the default value for extra, put
in an empty of parentheses:
>>> from sklearn.utils import deprecated
>>> deprecated() # doctest: +ELLIPSIS
<sklearn.utils.deprecated object at ...>
>>> @deprecated()
... def some_function(): pass
"""
# Adapted from http://wiki.python.org/moin/PythonDecoratorLibrary,
# but with many changes.
def __init__(self, extra=''):
"""
Parameters
----------
extra: string
to be added to the deprecation messages
"""
self.extra = extra
def __call__(self, obj):
if isinstance(obj, type):
return self._decorate_class(obj)
else:
return self._decorate_fun(obj)
def _decorate_class(self, cls):
msg = "Class %s is deprecated" % cls.__name__
if self.extra:
msg += "; %s" % self.extra
# FIXME: we should probably reset __new__ for full generality
init = cls.__init__
def wrapped(*args, **kwargs):
warnings.warn(msg, category=DeprecationWarning)
return init(*args, **kwargs)
cls.__init__ = wrapped
wrapped.__name__ = '__init__'
wrapped.__doc__ = self._update_doc(init.__doc__)
wrapped.deprecated_original = init
return cls
def _decorate_fun(self, fun):
"""Decorate function fun"""
msg = "Function %s is deprecated" % fun.__name__
if self.extra:
msg += "; %s" % self.extra
def wrapped(*args, **kwargs):
warnings.warn(msg, category=DeprecationWarning)
return fun(*args, **kwargs)
wrapped.__name__ = fun.__name__
wrapped.__dict__ = fun.__dict__
wrapped.__doc__ = self._update_doc(fun.__doc__)
return wrapped
def _update_doc(self, olddoc):
newdoc = "DEPRECATED"
if self.extra:
newdoc = "%s: %s" % (newdoc, self.extra)
if olddoc:
newdoc = "%s\n\n%s" % (newdoc, olddoc)
return newdoc
def safe_mask(X, mask):
"""Return a mask which is safe to use on X.
Parameters
----------
X : {array-like, sparse matrix}
Data on which to apply mask.
mask: array
Mask to be used on X.
Returns
-------
mask
"""
mask = np.asarray(mask)
if np.issubdtype(mask.dtype, np.int):
return mask
if hasattr(X, "toarray"):
ind = np.arange(mask.shape[0])
mask = ind[mask]
return mask
def safe_indexing(X, indices):
"""Return items or rows from X using indices.
Allows simple indexing of lists or arrays.
Parameters
----------
X : array-like, sparse-matrix, list.
Data from which to sample rows or items.
indices : array-like, list
Indices according to which X will be subsampled.
"""
if hasattr(X, "iloc"):
# Pandas Dataframes and Series
try:
return X.iloc[indices]
except ValueError:
# Cython typed memoryviews internally used in pandas do not support
# readonly buffers.
warnings.warn("Copying input dataframe for slicing.",
DataConversionWarning)
return X.copy().iloc[indices]
elif hasattr(X, "shape"):
if hasattr(X, 'take') and (hasattr(indices, 'dtype') and
indices.dtype.kind == 'i'):
# This is often substantially faster than X[indices]
return X.take(indices, axis=0)
else:
return X[indices]
else:
return [X[idx] for idx in indices]
def resample(*arrays, **options):
"""Resample arrays or sparse matrices in a consistent way
The default strategy implements one step of the bootstrapping
procedure.
Parameters
----------
*arrays : sequence of indexable data-structures
Indexable data-structures can be arrays, lists, dataframes or scipy
sparse matrices with consistent first dimension.
replace : boolean, True by default
Implements resampling with replacement. If False, this will implement
(sliced) random permutations.
n_samples : int, None by default
Number of samples to generate. If left to None this is
automatically set to the first dimension of the arrays.
random_state : int or RandomState instance
Control the shuffling for reproducible behavior.
Returns
-------
resampled_arrays : sequence of indexable data-structures
Sequence of resampled views of the collections. The original arrays are
not impacted.
Examples
--------
It is possible to mix sparse and dense arrays in the same run::
>>> X = np.array([[1., 0.], [2., 1.], [0., 0.]])
>>> y = np.array([0, 1, 2])
>>> from scipy.sparse import coo_matrix
>>> X_sparse = coo_matrix(X)
>>> from sklearn.utils import resample
>>> X, X_sparse, y = resample(X, X_sparse, y, random_state=0)
>>> X
array([[ 1., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> X_sparse # doctest: +ELLIPSIS +NORMALIZE_WHITESPACE
<3x2 sparse matrix of type '<... 'numpy.float64'>'
with 4 stored elements in Compressed Sparse Row format>
>>> X_sparse.toarray()
array([[ 1., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> y
array([0, 1, 0])
>>> resample(y, n_samples=2, random_state=0)
array([0, 1])
See also
--------
:func:`sklearn.utils.shuffle`
"""
random_state = check_random_state(options.pop('random_state', None))
replace = options.pop('replace', True)
max_n_samples = options.pop('n_samples', None)
if options:
raise ValueError("Unexpected kw arguments: %r" % options.keys())
if len(arrays) == 0:
return None
first = arrays[0]
n_samples = first.shape[0] if hasattr(first, 'shape') else len(first)
if max_n_samples is None:
max_n_samples = n_samples
if max_n_samples > n_samples:
raise ValueError("Cannot sample %d out of arrays with dim %d" % (
max_n_samples, n_samples))
check_consistent_length(*arrays)
if replace:
indices = random_state.randint(0, n_samples, size=(max_n_samples,))
else:
indices = np.arange(n_samples)
random_state.shuffle(indices)
indices = indices[:max_n_samples]
# convert sparse matrices to CSR for row-based indexing
arrays = [a.tocsr() if issparse(a) else a for a in arrays]
resampled_arrays = [safe_indexing(a, indices) for a in arrays]
if len(resampled_arrays) == 1:
# syntactic sugar for the unit argument case
return resampled_arrays[0]
else:
return resampled_arrays
def shuffle(*arrays, **options):
"""Shuffle arrays or sparse matrices in a consistent way
This is a convenience alias to ``resample(*arrays, replace=False)`` to do
random permutations of the collections.
Parameters
----------
*arrays : sequence of indexable data-structures
Indexable data-structures can be arrays, lists, dataframes or scipy
sparse matrices with consistent first dimension.
random_state : int or RandomState instance
Control the shuffling for reproducible behavior.
n_samples : int, None by default
Number of samples to generate. If left to None this is
automatically set to the first dimension of the arrays.
Returns
-------
shuffled_arrays : sequence of indexable data-structures
Sequence of shuffled views of the collections. The original arrays are
not impacted.
Examples
--------
It is possible to mix sparse and dense arrays in the same run::
>>> X = np.array([[1., 0.], [2., 1.], [0., 0.]])
>>> y = np.array([0, 1, 2])
>>> from scipy.sparse import coo_matrix
>>> X_sparse = coo_matrix(X)
>>> from sklearn.utils import shuffle
>>> X, X_sparse, y = shuffle(X, X_sparse, y, random_state=0)
>>> X
array([[ 0., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> X_sparse # doctest: +ELLIPSIS +NORMALIZE_WHITESPACE
<3x2 sparse matrix of type '<... 'numpy.float64'>'
with 3 stored elements in Compressed Sparse Row format>
>>> X_sparse.toarray()
array([[ 0., 0.],
[ 2., 1.],
[ 1., 0.]])
>>> y
array([2, 1, 0])
>>> shuffle(y, n_samples=2, random_state=0)
array([0, 1])
See also
--------
:func:`sklearn.utils.resample`
"""
options['replace'] = False
return resample(*arrays, **options)
def safe_sqr(X, copy=True):
"""Element wise squaring of array-likes and sparse matrices.
Parameters
----------
X : array like, matrix, sparse matrix
copy : boolean, optional, default True
Whether to create a copy of X and operate on it or to perform
inplace computation (default behaviour).
Returns
-------
X ** 2 : element wise square
"""
X = check_array(X, accept_sparse=['csr', 'csc', 'coo'])
if issparse(X):
if copy:
X = X.copy()
X.data **= 2
else:
if copy:
X = X ** 2
else:
X **= 2
return X
def gen_batches(n, batch_size):
"""Generator to create slices containing batch_size elements, from 0 to n.
The last slice may contain less than batch_size elements, when batch_size
does not divide n.
Examples
--------
>>> from sklearn.utils import gen_batches
>>> list(gen_batches(7, 3))
[slice(0, 3, None), slice(3, 6, None), slice(6, 7, None)]
>>> list(gen_batches(6, 3))
[slice(0, 3, None), slice(3, 6, None)]
>>> list(gen_batches(2, 3))
[slice(0, 2, None)]
"""
start = 0
for _ in range(int(n // batch_size)):
end = start + batch_size
yield slice(start, end)
start = end
if start < n:
yield slice(start, n)
def gen_even_slices(n, n_packs, n_samples=None):
"""Generator to create n_packs slices going up to n.
Pass n_samples when the slices are to be used for sparse matrix indexing;
slicing off-the-end raises an exception, while it works for NumPy arrays.
Examples
--------
>>> from sklearn.utils import gen_even_slices
>>> list(gen_even_slices(10, 1))
[slice(0, 10, None)]
>>> list(gen_even_slices(10, 10)) #doctest: +ELLIPSIS
[slice(0, 1, None), slice(1, 2, None), ..., slice(9, 10, None)]
>>> list(gen_even_slices(10, 5)) #doctest: +ELLIPSIS
[slice(0, 2, None), slice(2, 4, None), ..., slice(8, 10, None)]
>>> list(gen_even_slices(10, 3))
[slice(0, 4, None), slice(4, 7, None), slice(7, 10, None)]
"""
start = 0
if n_packs < 1:
raise ValueError("gen_even_slices got n_packs=%s, must be >=1" % n_packs)
for pack_num in range(n_packs):
this_n = n // n_packs
if pack_num < n % n_packs:
this_n += 1
if this_n > 0:
end = start + this_n
if n_samples is not None:
end = min(n_samples, end)
yield slice(start, end, None)
start = end
def _get_n_jobs(n_jobs):
"""Get number of jobs for the computation.
This function reimplements the logic of joblib to determine the actual
number of jobs depending on the cpu count. If -1 all CPUs are used.
If 1 is given, no parallel computing code is used at all, which is useful
for debugging. For n_jobs below -1, (n_cpus + 1 + n_jobs) are used.
Thus for n_jobs = -2, all CPUs but one are used.
Parameters
----------
n_jobs : int
Number of jobs stated in joblib convention.
Returns
-------
n_jobs : int
The actual number of jobs as positive integer.
Examples
--------
>>> from sklearn.utils import _get_n_jobs
>>> _get_n_jobs(4)
4
>>> jobs = _get_n_jobs(-2)
>>> assert jobs == max(cpu_count() - 1, 1)
>>> _get_n_jobs(0)
Traceback (most recent call last):
...
ValueError: Parameter n_jobs == 0 has no meaning.
"""
if n_jobs < 0:
return max(cpu_count() + 1 + n_jobs, 1)
elif n_jobs == 0:
raise ValueError('Parameter n_jobs == 0 has no meaning.')
else:
return n_jobs
def tosequence(x):
"""Cast iterable x to a Sequence, avoiding a copy if possible."""
if isinstance(x, np.ndarray):
return np.asarray(x)
elif isinstance(x, Sequence):
return x
else:
return list(x)
class ConvergenceWarning(UserWarning):
"""Custom warning to capture convergence problems"""
class DataDimensionalityWarning(UserWarning):
"""Custom warning to notify potential issues with data dimensionality"""
| bsd-3-clause |
smartscheduling/scikit-learn-categorical-tree | examples/feature_selection/plot_rfe_with_cross_validation.py | 225 | 1384 | """
===================================================
Recursive feature elimination with cross-validation
===================================================
A recursive feature elimination example with automatic tuning of the
number of features selected with cross-validation.
"""
print(__doc__)
import matplotlib.pyplot as plt
from sklearn.svm import SVC
from sklearn.cross_validation import StratifiedKFold
from sklearn.feature_selection import RFECV
from sklearn.datasets import make_classification
# Build a classification task using 3 informative features
X, y = make_classification(n_samples=1000, n_features=25, n_informative=3,
n_redundant=2, n_repeated=0, n_classes=8,
n_clusters_per_class=1, random_state=0)
# Create the RFE object and compute a cross-validated score.
svc = SVC(kernel="linear")
# The "accuracy" scoring is proportional to the number of correct
# classifications
rfecv = RFECV(estimator=svc, step=1, cv=StratifiedKFold(y, 2),
scoring='accuracy')
rfecv.fit(X, y)
print("Optimal number of features : %d" % rfecv.n_features_)
# Plot number of features VS. cross-validation scores
plt.figure()
plt.xlabel("Number of features selected")
plt.ylabel("Cross validation score (nb of correct classifications)")
plt.plot(range(1, len(rfecv.grid_scores_) + 1), rfecv.grid_scores_)
plt.show()
| bsd-3-clause |
AlexRobson/scikit-learn | sklearn/tests/test_base.py | 215 | 7045 | # Author: Gael Varoquaux
# License: BSD 3 clause
import numpy as np
import scipy.sparse as sp
from sklearn.utils.testing import assert_array_equal
from sklearn.utils.testing import assert_true
from sklearn.utils.testing import assert_false
from sklearn.utils.testing import assert_equal
from sklearn.utils.testing import assert_not_equal
from sklearn.utils.testing import assert_raises
from sklearn.base import BaseEstimator, clone, is_classifier
from sklearn.svm import SVC
from sklearn.pipeline import Pipeline
from sklearn.grid_search import GridSearchCV
from sklearn.utils import deprecated
#############################################################################
# A few test classes
class MyEstimator(BaseEstimator):
def __init__(self, l1=0, empty=None):
self.l1 = l1
self.empty = empty
class K(BaseEstimator):
def __init__(self, c=None, d=None):
self.c = c
self.d = d
class T(BaseEstimator):
def __init__(self, a=None, b=None):
self.a = a
self.b = b
class DeprecatedAttributeEstimator(BaseEstimator):
def __init__(self, a=None, b=None):
self.a = a
if b is not None:
DeprecationWarning("b is deprecated and renamed 'a'")
self.a = b
@property
@deprecated("Parameter 'b' is deprecated and renamed to 'a'")
def b(self):
return self._b
class Buggy(BaseEstimator):
" A buggy estimator that does not set its parameters right. "
def __init__(self, a=None):
self.a = 1
class NoEstimator(object):
def __init__(self):
pass
def fit(self, X=None, y=None):
return self
def predict(self, X=None):
return None
class VargEstimator(BaseEstimator):
"""Sklearn estimators shouldn't have vargs."""
def __init__(self, *vargs):
pass
#############################################################################
# The tests
def test_clone():
# Tests that clone creates a correct deep copy.
# We create an estimator, make a copy of its original state
# (which, in this case, is the current state of the estimator),
# and check that the obtained copy is a correct deep copy.
from sklearn.feature_selection import SelectFpr, f_classif
selector = SelectFpr(f_classif, alpha=0.1)
new_selector = clone(selector)
assert_true(selector is not new_selector)
assert_equal(selector.get_params(), new_selector.get_params())
selector = SelectFpr(f_classif, alpha=np.zeros((10, 2)))
new_selector = clone(selector)
assert_true(selector is not new_selector)
def test_clone_2():
# Tests that clone doesn't copy everything.
# We first create an estimator, give it an own attribute, and
# make a copy of its original state. Then we check that the copy doesn't
# have the specific attribute we manually added to the initial estimator.
from sklearn.feature_selection import SelectFpr, f_classif
selector = SelectFpr(f_classif, alpha=0.1)
selector.own_attribute = "test"
new_selector = clone(selector)
assert_false(hasattr(new_selector, "own_attribute"))
def test_clone_buggy():
# Check that clone raises an error on buggy estimators.
buggy = Buggy()
buggy.a = 2
assert_raises(RuntimeError, clone, buggy)
no_estimator = NoEstimator()
assert_raises(TypeError, clone, no_estimator)
varg_est = VargEstimator()
assert_raises(RuntimeError, clone, varg_est)
def test_clone_empty_array():
# Regression test for cloning estimators with empty arrays
clf = MyEstimator(empty=np.array([]))
clf2 = clone(clf)
assert_array_equal(clf.empty, clf2.empty)
clf = MyEstimator(empty=sp.csr_matrix(np.array([[0]])))
clf2 = clone(clf)
assert_array_equal(clf.empty.data, clf2.empty.data)
def test_clone_nan():
# Regression test for cloning estimators with default parameter as np.nan
clf = MyEstimator(empty=np.nan)
clf2 = clone(clf)
assert_true(clf.empty is clf2.empty)
def test_repr():
# Smoke test the repr of the base estimator.
my_estimator = MyEstimator()
repr(my_estimator)
test = T(K(), K())
assert_equal(
repr(test),
"T(a=K(c=None, d=None), b=K(c=None, d=None))"
)
some_est = T(a=["long_params"] * 1000)
assert_equal(len(repr(some_est)), 415)
def test_str():
# Smoke test the str of the base estimator
my_estimator = MyEstimator()
str(my_estimator)
def test_get_params():
test = T(K(), K())
assert_true('a__d' in test.get_params(deep=True))
assert_true('a__d' not in test.get_params(deep=False))
test.set_params(a__d=2)
assert_true(test.a.d == 2)
assert_raises(ValueError, test.set_params, a__a=2)
def test_get_params_deprecated():
# deprecated attribute should not show up as params
est = DeprecatedAttributeEstimator(a=1)
assert_true('a' in est.get_params())
assert_true('a' in est.get_params(deep=True))
assert_true('a' in est.get_params(deep=False))
assert_true('b' not in est.get_params())
assert_true('b' not in est.get_params(deep=True))
assert_true('b' not in est.get_params(deep=False))
def test_is_classifier():
svc = SVC()
assert_true(is_classifier(svc))
assert_true(is_classifier(GridSearchCV(svc, {'C': [0.1, 1]})))
assert_true(is_classifier(Pipeline([('svc', svc)])))
assert_true(is_classifier(Pipeline([('svc_cv',
GridSearchCV(svc, {'C': [0.1, 1]}))])))
def test_set_params():
# test nested estimator parameter setting
clf = Pipeline([("svc", SVC())])
# non-existing parameter in svc
assert_raises(ValueError, clf.set_params, svc__stupid_param=True)
# non-existing parameter of pipeline
assert_raises(ValueError, clf.set_params, svm__stupid_param=True)
# we don't currently catch if the things in pipeline are estimators
# bad_pipeline = Pipeline([("bad", NoEstimator())])
# assert_raises(AttributeError, bad_pipeline.set_params,
# bad__stupid_param=True)
def test_score_sample_weight():
from sklearn.tree import DecisionTreeClassifier
from sklearn.tree import DecisionTreeRegressor
from sklearn import datasets
rng = np.random.RandomState(0)
# test both ClassifierMixin and RegressorMixin
estimators = [DecisionTreeClassifier(max_depth=2),
DecisionTreeRegressor(max_depth=2)]
sets = [datasets.load_iris(),
datasets.load_boston()]
for est, ds in zip(estimators, sets):
est.fit(ds.data, ds.target)
# generate random sample weights
sample_weight = rng.randint(1, 10, size=len(ds.target))
# check that the score with and without sample weights are different
assert_not_equal(est.score(ds.data, ds.target),
est.score(ds.data, ds.target,
sample_weight=sample_weight),
msg="Unweighted and weighted scores "
"are unexpectedly equal")
| bsd-3-clause |
smartscheduling/scikit-learn-categorical-tree | examples/cluster/plot_agglomerative_clustering_metrics.py | 388 | 4492 | """
Agglomerative clustering with different metrics
===============================================
Demonstrates the effect of different metrics on the hierarchical clustering.
The example is engineered to show the effect of the choice of different
metrics. It is applied to waveforms, which can be seen as
high-dimensional vector. Indeed, the difference between metrics is
usually more pronounced in high dimension (in particular for euclidean
and cityblock).
We generate data from three groups of waveforms. Two of the waveforms
(waveform 1 and waveform 2) are proportional one to the other. The cosine
distance is invariant to a scaling of the data, as a result, it cannot
distinguish these two waveforms. Thus even with no noise, clustering
using this distance will not separate out waveform 1 and 2.
We add observation noise to these waveforms. We generate very sparse
noise: only 6% of the time points contain noise. As a result, the
l1 norm of this noise (ie "cityblock" distance) is much smaller than it's
l2 norm ("euclidean" distance). This can be seen on the inter-class
distance matrices: the values on the diagonal, that characterize the
spread of the class, are much bigger for the Euclidean distance than for
the cityblock distance.
When we apply clustering to the data, we find that the clustering
reflects what was in the distance matrices. Indeed, for the Euclidean
distance, the classes are ill-separated because of the noise, and thus
the clustering does not separate the waveforms. For the cityblock
distance, the separation is good and the waveform classes are recovered.
Finally, the cosine distance does not separate at all waveform 1 and 2,
thus the clustering puts them in the same cluster.
"""
# Author: Gael Varoquaux
# License: BSD 3-Clause or CC-0
import matplotlib.pyplot as plt
import numpy as np
from sklearn.cluster import AgglomerativeClustering
from sklearn.metrics import pairwise_distances
np.random.seed(0)
# Generate waveform data
n_features = 2000
t = np.pi * np.linspace(0, 1, n_features)
def sqr(x):
return np.sign(np.cos(x))
X = list()
y = list()
for i, (phi, a) in enumerate([(.5, .15), (.5, .6), (.3, .2)]):
for _ in range(30):
phase_noise = .01 * np.random.normal()
amplitude_noise = .04 * np.random.normal()
additional_noise = 1 - 2 * np.random.rand(n_features)
# Make the noise sparse
additional_noise[np.abs(additional_noise) < .997] = 0
X.append(12 * ((a + amplitude_noise)
* (sqr(6 * (t + phi + phase_noise)))
+ additional_noise))
y.append(i)
X = np.array(X)
y = np.array(y)
n_clusters = 3
labels = ('Waveform 1', 'Waveform 2', 'Waveform 3')
# Plot the ground-truth labelling
plt.figure()
plt.axes([0, 0, 1, 1])
for l, c, n in zip(range(n_clusters), 'rgb',
labels):
lines = plt.plot(X[y == l].T, c=c, alpha=.5)
lines[0].set_label(n)
plt.legend(loc='best')
plt.axis('tight')
plt.axis('off')
plt.suptitle("Ground truth", size=20)
# Plot the distances
for index, metric in enumerate(["cosine", "euclidean", "cityblock"]):
avg_dist = np.zeros((n_clusters, n_clusters))
plt.figure(figsize=(5, 4.5))
for i in range(n_clusters):
for j in range(n_clusters):
avg_dist[i, j] = pairwise_distances(X[y == i], X[y == j],
metric=metric).mean()
avg_dist /= avg_dist.max()
for i in range(n_clusters):
for j in range(n_clusters):
plt.text(i, j, '%5.3f' % avg_dist[i, j],
verticalalignment='center',
horizontalalignment='center')
plt.imshow(avg_dist, interpolation='nearest', cmap=plt.cm.gnuplot2,
vmin=0)
plt.xticks(range(n_clusters), labels, rotation=45)
plt.yticks(range(n_clusters), labels)
plt.colorbar()
plt.suptitle("Interclass %s distances" % metric, size=18)
plt.tight_layout()
# Plot clustering results
for index, metric in enumerate(["cosine", "euclidean", "cityblock"]):
model = AgglomerativeClustering(n_clusters=n_clusters,
linkage="average", affinity=metric)
model.fit(X)
plt.figure()
plt.axes([0, 0, 1, 1])
for l, c in zip(np.arange(model.n_clusters), 'rgbk'):
plt.plot(X[model.labels_ == l].T, c=c, alpha=.5)
plt.axis('tight')
plt.axis('off')
plt.suptitle("AgglomerativeClustering(affinity=%s)" % metric, size=20)
plt.show()
| bsd-3-clause |
wanghaven/nupic | examples/opf/experiments/spatial_classification/category_0/description.py | 32 | 1598 | # ----------------------------------------------------------------------
# Numenta Platform for Intelligent Computing (NuPIC)
# Copyright (C) 2013, Numenta, Inc. Unless you have an agreement
# with Numenta, Inc., for a separate license for this software code, the
# following terms and conditions apply:
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero Public License version 3 as
# published by the Free Software Foundation.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
# See the GNU Affero Public License for more details.
#
# You should have received a copy of the GNU Affero Public License
# along with this program. If not, see http://www.gnu.org/licenses.
#
# http://numenta.org/licenses/
# ----------------------------------------------------------------------
## This file defines parameters for a prediction experiment.
import os
from nupic.frameworks.opf.expdescriptionhelpers import importBaseDescription
# the sub-experiment configuration
config = \
{
'dataSource': 'file://' + os.path.join(os.path.dirname(__file__),
'../datasets/category_0.csv'),
'errorMetric': 'avg_err',
'modelParams': {
'sensorParams': { 'verbosity': 0},
'clParams': {
'clVerbosity': 0,
},
}
}
mod = importBaseDescription('../base/description.py', config)
locals().update(mod.__dict__)
| agpl-3.0 |
aestrivex/mne-python | examples/realtime/plot_compute_rt_decoder.py | 8 | 3603 | """
=======================
Decoding real-time data
=======================
Supervised machine learning applied to MEG data in sensor space.
Here the classifier is updated every 5 trials and the decoding
accuracy is plotted
"""
# Authors: Mainak Jas <mainak@neuro.hut.fi>
#
# License: BSD (3-clause)
import numpy as np
import matplotlib.pyplot as plt
import mne
from mne.realtime import MockRtClient, RtEpochs
from mne.datasets import sample
print(__doc__)
# Fiff file to simulate the realtime client
data_path = sample.data_path()
raw_fname = data_path + '/MEG/sample/sample_audvis_filt-0-40_raw.fif'
raw = mne.io.Raw(raw_fname, preload=True)
tmin, tmax = -0.2, 0.5
event_id = dict(aud_l=1, vis_l=3)
tr_percent = 60 # Training percentage
min_trials = 10 # minimum trials after which decoding should start
# select gradiometers
picks = mne.pick_types(raw.info, meg='grad', eeg=False, eog=True,
stim=True, exclude=raw.info['bads'])
# create the mock-client object
rt_client = MockRtClient(raw)
# create the real-time epochs object
rt_epochs = RtEpochs(rt_client, event_id, tmin, tmax, picks=picks, decim=1,
reject=dict(grad=4000e-13, eog=150e-6))
# start the acquisition
rt_epochs.start()
# send raw buffers
rt_client.send_data(rt_epochs, picks, tmin=0, tmax=90, buffer_size=1000)
# Decoding in sensor space using a linear SVM
n_times = len(rt_epochs.times)
from sklearn import preprocessing # noqa
from sklearn.svm import SVC # noqa
from sklearn.pipeline import Pipeline # noqa
from sklearn.cross_validation import cross_val_score, ShuffleSplit # noqa
from mne.decoding import ConcatenateChannels, FilterEstimator # noqa
scores_x, scores, std_scores = [], [], []
filt = FilterEstimator(rt_epochs.info, 1, 40)
scaler = preprocessing.StandardScaler()
concatenator = ConcatenateChannels()
clf = SVC(C=1, kernel='linear')
concat_classifier = Pipeline([('filter', filt), ('concat', concatenator),
('scaler', scaler), ('svm', clf)])
data_picks = mne.pick_types(rt_epochs.info, meg='grad', eeg=False, eog=True,
stim=False, exclude=raw.info['bads'])
for ev_num, ev in enumerate(rt_epochs.iter_evoked()):
print("Just got epoch %d" % (ev_num + 1))
if ev_num == 0:
X = ev.data[None, data_picks, :]
y = int(ev.comment) # the comment attribute contains the event_id
else:
X = np.concatenate((X, ev.data[None, data_picks, :]), axis=0)
y = np.append(y, int(ev.comment))
if ev_num >= min_trials:
cv = ShuffleSplit(len(y), 5, test_size=0.2, random_state=42)
scores_t = cross_val_score(concat_classifier, X, y, cv=cv,
n_jobs=1) * 100
std_scores.append(scores_t.std())
scores.append(scores_t.mean())
scores_x.append(ev_num)
# Plot accuracy
plt.clf()
plt.plot(scores_x, scores, '+', label="Classif. score")
plt.hold(True)
plt.plot(scores_x, scores)
plt.axhline(50, color='k', linestyle='--', label="Chance level")
hyp_limits = (np.asarray(scores) - np.asarray(std_scores),
np.asarray(scores) + np.asarray(std_scores))
plt.fill_between(scores_x, hyp_limits[0], y2=hyp_limits[1],
color='b', alpha=0.5)
plt.xlabel('Trials')
plt.ylabel('Classification score (% correct)')
plt.xlim([min_trials, 50])
plt.ylim([30, 105])
plt.title('Real-time decoding')
plt.show(block=False)
plt.pause(0.01)
plt.show()
| bsd-3-clause |
fbossy/SickRage | lib/guessit/transfo/guess_date.py | 29 | 2355 | #!/usr/bin/env python
# -*- coding: utf-8 -*-
#
# GuessIt - A library for guessing information from filenames
# Copyright (c) 2013 Nicolas Wack <wackou@gmail.com>
#
# GuessIt is free software; you can redistribute it and/or modify it under
# the terms of the Lesser GNU General Public License as published by
# the Free Software Foundation; either version 3 of the License, or
# (at your option) any later version.
#
# GuessIt is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
# Lesser GNU General Public License for more details.
#
# You should have received a copy of the Lesser GNU General Public License
# along with this program. If not, see <http://www.gnu.org/licenses/>.
#
from __future__ import absolute_import, division, print_function, unicode_literals
from guessit.containers import DefaultValidator
from guessit.plugins.transformers import Transformer
from guessit.matcher import GuessFinder
from guessit.date import search_date
class GuessDate(Transformer):
def __init__(self):
Transformer.__init__(self, 50)
def register_arguments(self, opts, naming_opts, output_opts, information_opts, webservice_opts, other_options):
naming_opts.add_argument('-Y', '--date-year-first', action='store_true', dest='date_year_first', default=None,
help='If short date is found, consider the first digits as the year.')
naming_opts.add_argument('-D', '--date-day-first', action='store_true', dest='date_day_first', default=None,
help='If short date is found, consider the second digits as the day.')
def supported_properties(self):
return ['date']
@staticmethod
def guess_date(string, node=None, options=None):
date, span = search_date(string, options.get('date_year_first') if options else False, options.get('date_day_first') if options else False)
if date and span and DefaultValidator.validate_string(string, span): # ensure we have a separator before and after date
return {'date': date}, span
return None, None
def process(self, mtree, options=None):
GuessFinder(self.guess_date, 1.0, self.log, options).process_nodes(mtree.unidentified_leaves())
| gpl-3.0 |
cauchycui/scikit-learn | examples/cluster/plot_kmeans_silhouette_analysis.py | 240 | 5885 | """
===============================================================================
Selecting the number of clusters with silhouette analysis on KMeans clustering
===============================================================================
Silhouette analysis can be used to study the separation distance between the
resulting clusters. The silhouette plot displays a measure of how close each
point in one cluster is to points in the neighboring clusters and thus provides
a way to assess parameters like number of clusters visually. This measure has a
range of [-1, 1].
Silhoette coefficients (as these values are referred to as) near +1 indicate
that the sample is far away from the neighboring clusters. A value of 0
indicates that the sample is on or very close to the decision boundary between
two neighboring clusters and negative values indicate that those samples might
have been assigned to the wrong cluster.
In this example the silhouette analysis is used to choose an optimal value for
``n_clusters``. The silhouette plot shows that the ``n_clusters`` value of 3, 5
and 6 are a bad pick for the given data due to the presence of clusters with
below average silhouette scores and also due to wide fluctuations in the size
of the silhouette plots. Silhouette analysis is more ambivalent in deciding
between 2 and 4.
Also from the thickness of the silhouette plot the cluster size can be
visualized. The silhouette plot for cluster 0 when ``n_clusters`` is equal to
2, is bigger in size owing to the grouping of the 3 sub clusters into one big
cluster. However when the ``n_clusters`` is equal to 4, all the plots are more
or less of similar thickness and hence are of similar sizes as can be also
verified from the labelled scatter plot on the right.
"""
from __future__ import print_function
from sklearn.datasets import make_blobs
from sklearn.cluster import KMeans
from sklearn.metrics import silhouette_samples, silhouette_score
import matplotlib.pyplot as plt
import matplotlib.cm as cm
import numpy as np
print(__doc__)
# Generating the sample data from make_blobs
# This particular setting has one distict cluster and 3 clusters placed close
# together.
X, y = make_blobs(n_samples=500,
n_features=2,
centers=4,
cluster_std=1,
center_box=(-10.0, 10.0),
shuffle=True,
random_state=1) # For reproducibility
range_n_clusters = [2, 3, 4, 5, 6]
for n_clusters in range_n_clusters:
# Create a subplot with 1 row and 2 columns
fig, (ax1, ax2) = plt.subplots(1, 2)
fig.set_size_inches(18, 7)
# The 1st subplot is the silhouette plot
# The silhouette coefficient can range from -1, 1 but in this example all
# lie within [-0.1, 1]
ax1.set_xlim([-0.1, 1])
# The (n_clusters+1)*10 is for inserting blank space between silhouette
# plots of individual clusters, to demarcate them clearly.
ax1.set_ylim([0, len(X) + (n_clusters + 1) * 10])
# Initialize the clusterer with n_clusters value and a random generator
# seed of 10 for reproducibility.
clusterer = KMeans(n_clusters=n_clusters, random_state=10)
cluster_labels = clusterer.fit_predict(X)
# The silhouette_score gives the average value for all the samples.
# This gives a perspective into the density and separation of the formed
# clusters
silhouette_avg = silhouette_score(X, cluster_labels)
print("For n_clusters =", n_clusters,
"The average silhouette_score is :", silhouette_avg)
# Compute the silhouette scores for each sample
sample_silhouette_values = silhouette_samples(X, cluster_labels)
y_lower = 10
for i in range(n_clusters):
# Aggregate the silhouette scores for samples belonging to
# cluster i, and sort them
ith_cluster_silhouette_values = \
sample_silhouette_values[cluster_labels == i]
ith_cluster_silhouette_values.sort()
size_cluster_i = ith_cluster_silhouette_values.shape[0]
y_upper = y_lower + size_cluster_i
color = cm.spectral(float(i) / n_clusters)
ax1.fill_betweenx(np.arange(y_lower, y_upper),
0, ith_cluster_silhouette_values,
facecolor=color, edgecolor=color, alpha=0.7)
# Label the silhouette plots with their cluster numbers at the middle
ax1.text(-0.05, y_lower + 0.5 * size_cluster_i, str(i))
# Compute the new y_lower for next plot
y_lower = y_upper + 10 # 10 for the 0 samples
ax1.set_title("The silhouette plot for the various clusters.")
ax1.set_xlabel("The silhouette coefficient values")
ax1.set_ylabel("Cluster label")
# The vertical line for average silhoutte score of all the values
ax1.axvline(x=silhouette_avg, color="red", linestyle="--")
ax1.set_yticks([]) # Clear the yaxis labels / ticks
ax1.set_xticks([-0.1, 0, 0.2, 0.4, 0.6, 0.8, 1])
# 2nd Plot showing the actual clusters formed
colors = cm.spectral(cluster_labels.astype(float) / n_clusters)
ax2.scatter(X[:, 0], X[:, 1], marker='.', s=30, lw=0, alpha=0.7,
c=colors)
# Labeling the clusters
centers = clusterer.cluster_centers_
# Draw white circles at cluster centers
ax2.scatter(centers[:, 0], centers[:, 1],
marker='o', c="white", alpha=1, s=200)
for i, c in enumerate(centers):
ax2.scatter(c[0], c[1], marker='$%d$' % i, alpha=1, s=50)
ax2.set_title("The visualization of the clustered data.")
ax2.set_xlabel("Feature space for the 1st feature")
ax2.set_ylabel("Feature space for the 2nd feature")
plt.suptitle(("Silhouette analysis for KMeans clustering on sample data "
"with n_clusters = %d" % n_clusters),
fontsize=14, fontweight='bold')
plt.show()
| bsd-3-clause |
wanghaven/nupic | tests/swarming/nupic/swarming/experiments/smart_speculation_temporal/description.py | 32 | 16827 | # ----------------------------------------------------------------------
# Numenta Platform for Intelligent Computing (NuPIC)
# Copyright (C) 2013, Numenta, Inc. Unless you have an agreement
# with Numenta, Inc., for a separate license for this software code, the
# following terms and conditions apply:
#
# This program is free software: you can redistribute it and/or modify
# it under the terms of the GNU Affero Public License version 3 as
# published by the Free Software Foundation.
#
# This program is distributed in the hope that it will be useful,
# but WITHOUT ANY WARRANTY; without even the implied warranty of
# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.
# See the GNU Affero Public License for more details.
#
# You should have received a copy of the GNU Affero Public License
# along with this program. If not, see http://www.gnu.org/licenses.
#
# http://numenta.org/licenses/
# ----------------------------------------------------------------------
"""
Template file used by the OPF Experiment Generator to generate the actual
description.py file by replacing $XXXXXXXX tokens with desired values.
This description.py file was generated by:
'/Users/ronmarianetti/nupic/eng/lib/python2.6/site-packages/nupic/frameworks/opf/expGenerator/ExpGenerator.py'
"""
from nupic.frameworks.opf.expdescriptionapi import ExperimentDescriptionAPI
from nupic.frameworks.opf.expdescriptionhelpers import (
updateConfigFromSubConfig,
applyValueGettersToContainer,
DeferredDictLookup)
from nupic.frameworks.opf.clamodelcallbacks import *
from nupic.frameworks.opf.metrics import MetricSpec
from nupic.frameworks.opf.opfutils import (InferenceType,
InferenceElement)
from nupic.support import aggregationDivide
from nupic.frameworks.opf.opftaskdriver import (
IterationPhaseSpecLearnOnly,
IterationPhaseSpecInferOnly,
IterationPhaseSpecLearnAndInfer)
# Model Configuration Dictionary:
#
# Define the model parameters and adjust for any modifications if imported
# from a sub-experiment.
#
# These fields might be modified by a sub-experiment; this dict is passed
# between the sub-experiment and base experiment
#
#
# NOTE: Use of DEFERRED VALUE-GETTERs: dictionary fields and list elements
# within the config dictionary may be assigned futures derived from the
# ValueGetterBase class, such as DeferredDictLookup.
# This facility is particularly handy for enabling substitution of values in
# the config dictionary from other values in the config dictionary, which is
# needed by permutation.py-based experiments. These values will be resolved
# during the call to applyValueGettersToContainer(),
# which we call after the base experiment's config dictionary is updated from
# the sub-experiment. See ValueGetterBase and
# DeferredDictLookup for more details about value-getters.
#
# For each custom encoder parameter to be exposed to the sub-experiment/
# permutation overrides, define a variable in this section, using key names
# beginning with a single underscore character to avoid collisions with
# pre-defined keys (e.g., _dsEncoderFieldName2_N).
#
# Example:
# config = dict(
# _dsEncoderFieldName2_N = 70,
# _dsEncoderFieldName2_W = 5,
# dsEncoderSchema = [
# base=dict(
# fieldname='Name2', type='ScalarEncoder',
# name='Name2', minval=0, maxval=270, clipInput=True,
# n=DeferredDictLookup('_dsEncoderFieldName2_N'),
# w=DeferredDictLookup('_dsEncoderFieldName2_W')),
# ],
# )
# updateConfigFromSubConfig(config)
# applyValueGettersToContainer(config)
config = {
# Type of model that the rest of these parameters apply to.
'model': "CLA",
# Version that specifies the format of the config.
'version': 1,
# Intermediate variables used to compute fields in modelParams and also
# referenced from the control section.
'aggregationInfo': { 'days': 0,
'fields': [],
'hours': 0,
'microseconds': 0,
'milliseconds': 0,
'minutes': 0,
'months': 0,
'seconds': 0,
'weeks': 0,
'years': 0},
'predictAheadTime': None,
# Model parameter dictionary.
'modelParams': {
# The type of inference that this model will perform
'inferenceType': 'TemporalNextStep',
'sensorParams': {
# Sensor diagnostic output verbosity control;
# if > 0: sensor region will print out on screen what it's sensing
# at each step 0: silent; >=1: some info; >=2: more info;
# >=3: even more info (see compute() in py/regions/RecordSensor.py)
'verbosity' : 0,
# Example:
# dsEncoderSchema = [
# DeferredDictLookup('__field_name_encoder'),
# ],
#
# (value generated from DS_ENCODER_SCHEMA)
'encoders': { u'A': { 'fieldname': u'daynight',
'n': 300,
'name': u'daynight',
'type': 'SDRCategoryEncoder',
'w': 21},
u'B': { 'fieldname': u'daynight',
'n': 300,
'name': u'daynight',
'type': 'SDRCategoryEncoder',
'w': 21},
u'C': { 'fieldname': u'precip',
'n': 300,
'name': u'precip',
'type': 'SDRCategoryEncoder',
'w': 21},
u'D': { 'clipInput': True,
'fieldname': u'visitor_winloss',
'maxval': 0.78600000000000003,
'minval': 0.0,
'n': 150,
'name': u'visitor_winloss',
'type': 'AdaptiveScalarEncoder',
'w': 21},
u'E': { 'clipInput': True,
'fieldname': u'home_winloss',
'maxval': 0.69999999999999996,
'minval': 0.0,
'n': 150,
'name': u'home_winloss',
'type': 'AdaptiveScalarEncoder',
'w': 21},
u'F': { 'dayOfWeek': (7, 1),
'fieldname': u'timestamp',
'name': u'timestamp_dayOfWeek',
'type': 'DateEncoder'},
u'G': { 'fieldname': u'timestamp',
'name': u'timestamp_timeOfDay',
'timeOfDay': (7, 1),
'type': 'DateEncoder'},
u'pred': { 'clipInput': True,
'fieldname': u'attendance',
'maxval': 36067,
'minval': 0,
'n': 150,
'name': u'attendance',
'type': 'AdaptiveScalarEncoder',
'w': 21}},
# A dictionary specifying the period for automatically-generated
# resets from a RecordSensor;
#
# None = disable automatically-generated resets (also disabled if
# all of the specified values evaluate to 0).
# Valid keys is the desired combination of the following:
# days, hours, minutes, seconds, milliseconds, microseconds, weeks
#
# Example for 1.5 days: sensorAutoReset = dict(days=1,hours=12),
#
# (value generated from SENSOR_AUTO_RESET)
'sensorAutoReset' : None,
},
'spEnable': True,
'spParams': {
# SP diagnostic output verbosity control;
# 0: silent; >=1: some info; >=2: more info;
'spVerbosity' : 0,
'globalInhibition': 1,
# Number of cell columns in the cortical region (same number for
# SP and TP)
# (see also tpNCellsPerCol)
'columnCount': 2048,
'inputWidth': 0,
# SP inhibition control (absolute value);
# Maximum number of active columns in the SP region's output (when
# there are more, the weaker ones are suppressed)
'numActiveColumnsPerInhArea': 40,
'seed': 1956,
# potentialPct
# What percent of the columns's receptive field is available
# for potential synapses. At initialization time, we will
# choose potentialPct * (2*potentialRadius+1)^2
'potentialPct': 1.0,
# The default connected threshold. Any synapse whose
# permanence value is above the connected threshold is
# a "connected synapse", meaning it can contribute to the
# cell's firing. Typical value is 0.10. Cells whose activity
# level before inhibition falls below minDutyCycleBeforeInh
# will have their own internal synPermConnectedCell
# threshold set below this default value.
# (This concept applies to both SP and TP and so 'cells'
# is correct here as opposed to 'columns')
'synPermConnected': 0.1,
'synPermActiveInc': 0.1,
'synPermInactiveDec': 0.01,
},
# Controls whether TP is enabled or disabled;
# TP is necessary for making temporal predictions, such as predicting
# the next inputs. Without TP, the model is only capable of
# reconstructing missing sensor inputs (via SP).
'tpEnable' : True,
'tpParams': {
# TP diagnostic output verbosity control;
# 0: silent; [1..6]: increasing levels of verbosity
# (see verbosity in nupic/trunk/py/nupic/research/TP.py and TP10X*.py)
'verbosity': 0,
# Number of cell columns in the cortical region (same number for
# SP and TP)
# (see also tpNCellsPerCol)
'columnCount': 2048,
# The number of cells (i.e., states), allocated per column.
'cellsPerColumn': 32,
'inputWidth': 2048,
'seed': 1960,
# Temporal Pooler implementation selector (see _getTPClass in
# CLARegion.py).
'temporalImp': 'cpp',
# New Synapse formation count
# NOTE: If None, use spNumActivePerInhArea
#
# TODO: need better explanation
'newSynapseCount': 15,
# Maximum number of synapses per segment
# > 0 for fixed-size CLA
# -1 for non-fixed-size CLA
#
# TODO: for Ron: once the appropriate value is placed in TP
# constructor, see if we should eliminate this parameter from
# description.py.
'maxSynapsesPerSegment': 32,
# Maximum number of segments per cell
# > 0 for fixed-size CLA
# -1 for non-fixed-size CLA
#
# TODO: for Ron: once the appropriate value is placed in TP
# constructor, see if we should eliminate this parameter from
# description.py.
'maxSegmentsPerCell': 128,
# Initial Permanence
# TODO: need better explanation
'initialPerm': 0.21,
# Permanence Increment
'permanenceInc': 0.1,
# Permanence Decrement
# If set to None, will automatically default to tpPermanenceInc
# value.
'permanenceDec' : 0.1,
'globalDecay': 0.0,
'maxAge': 0,
# Minimum number of active synapses for a segment to be considered
# during search for the best-matching segments.
# None=use default
# Replaces: tpMinThreshold
'minThreshold': 12,
# Segment activation threshold.
# A segment is active if it has >= tpSegmentActivationThreshold
# connected synapses that are active due to infActiveState
# None=use default
# Replaces: tpActivationThreshold
'activationThreshold': 16,
'outputType': 'normal',
# "Pay Attention Mode" length. This tells the TP how many new
# elements to append to the end of a learned sequence at a time.
# Smaller values are better for datasets with short sequences,
# higher values are better for datasets with long sequences.
'pamLength': 1,
},
'clParams': {
'regionName' : 'CLAClassifierRegion',
# Classifier diagnostic output verbosity control;
# 0: silent; [1..6]: increasing levels of verbosity
'clVerbosity' : 0,
# This controls how fast the classifier learns/forgets. Higher values
# make it adapt faster and forget older patterns faster.
'alpha': 0.001,
# This is set after the call to updateConfigFromSubConfig and is
# computed from the aggregationInfo and predictAheadTime.
'steps': '1',
},
'trainSPNetOnlyIfRequested': False,
},
}
# end of config dictionary
# Adjust base config dictionary for any modifications if imported from a
# sub-experiment
updateConfigFromSubConfig(config)
# Compute predictionSteps based on the predictAheadTime and the aggregation
# period, which may be permuted over.
if config['predictAheadTime'] is not None:
predictionSteps = int(round(aggregationDivide(
config['predictAheadTime'], config['aggregationInfo'])))
assert (predictionSteps >= 1)
config['modelParams']['clParams']['steps'] = str(predictionSteps)
# Adjust config by applying ValueGetterBase-derived
# futures. NOTE: this MUST be called after updateConfigFromSubConfig() in order
# to support value-getter-based substitutions from the sub-experiment (if any)
applyValueGettersToContainer(config)
control = {
# The environment that the current model is being run in
"environment": 'nupic',
# Input stream specification per py/nupicengine/cluster/database/StreamDef.json.
#
'dataset' : { u'info': u'baseball benchmark test',
u'streams': [ { u'columns': [ u'daynight',
u'precip',
u'home_winloss',
u'visitor_winloss',
u'attendance',
u'timestamp'],
u'info': u'OAK01.csv',
u'source': u'file://extra/baseball_stadium/OAK01reformatted.csv'}],
u'version': 1},
# Iteration count: maximum number of iterations. Each iteration corresponds
# to one record from the (possibly aggregated) dataset. The task is
# terminated when either number of iterations reaches iterationCount or
# all records in the (possibly aggregated) database have been processed,
# whichever occurs first.
#
# iterationCount of -1 = iterate over the entire dataset
#'iterationCount' : ITERATION_COUNT,
# Metrics: A list of MetricSpecs that instantiate the metrics that are
# computed for this experiment
'metrics':[
MetricSpec(field=u'attendance', inferenceElement=InferenceElement.prediction,
metric='aae', params={'window': 1000}),
MetricSpec(field=u'attendance', inferenceElement=InferenceElement.prediction,
metric='trivial_aae', params={'window': 1000}),
MetricSpec(field=u'attendance', inferenceElement=InferenceElement.prediction,
metric='nupicScore_scalar', params={'frequencyWindow': 1000, 'movingAverageWindow': 1000}),
MetricSpec(field=u'attendance', inferenceElement=InferenceElement.prediction,
metric='nupicScore_scalar', params={'frequencyWindow': 1000})
],
# Logged Metrics: A sequence of regular expressions that specify which of
# the metrics from the Inference Specifications section MUST be logged for
# every prediction. The regex's correspond to the automatically generated
# metric labels. This is similar to the way the optimization metric is
# specified in permutations.py.
'loggedMetrics': ['.*nupicScore.*'],
}
descriptionInterface = ExperimentDescriptionAPI(modelConfig=config,
control=control)
| agpl-3.0 |
briancappello/PyTradeLib | pytradelib/quandl/wiki.py | 1 | 2556 | import os
import sys
from pandas.io.common import urlencode as _encode_url
from pytradelib.downloader import Downloader
from pytradelib.utils import _sanitize_dates, csv_to_df
class QuandlDailyWikiProvider(object):
def __init__(self, api_key=None, batch_size=20, sleep=20):
self._api_key = api_key
self._downloader = Downloader(batch_size=batch_size, sleep=sleep)
@property
def api_key(self):
return self._api_key
@api_key.setter
def api_key(self, api_key):
self._api_key = api_key
def download(self, symbols, start=None, end=None):
if isinstance(symbols, str):
url = self._construct_url(symbols, start, end)
csv = self._downloader.download(url)
return csv_to_df(csv)
elif isinstance(symbols, (list, tuple)):
urls = [self._construct_url(symbol, start, end)
for symbol in symbols]
elif isinstance(symbols, dict):
urls = [self._construct_url(symbol, d['start'], d['end'])
for symbol, d in symbols.items()]
else:
raise Exception('symbols must be a string, a list of strings, or a dict of string to start/end dates')
results = {}
for url, csv in self._downloader.download(urls):
symbol, df = self._url_to_symbol(url), csv_to_df(csv)
results[symbol] = df
print('parsed results for ' + symbol)
return results
def _construct_url(self, symbol, start=None, end=None):
"""
Get historical data for the given name from quandl.
Date format is datetime
Returns a DataFrame.
"""
start, end = _sanitize_dates(start, end)
# if no specific dataset was provided, default to free WIKI dataset
if '/' not in symbol:
symbol = 'WIKI/' + symbol
url = 'https://www.quandl.com/api/v3/datasets/%s.csv?' % symbol
query_params = {'start_date': start.strftime('%Y-%m-%d'),
'end_date': end.strftime('%Y-%m-%d'),
'collapse': 'daily'}
if self._api_key or 'QUANDL_API_KEY' in os.environ:
query_params['api_key'] = self._api_key or os.environ['QUANDL_API_KEY']
else:
print('Please provide your API key in the constructor, or set the QUANDL_API_KEY environment variable')
sys.exit(1)
return url + _encode_url(query_params)
def _url_to_symbol(self, url):
return url[url.rfind('/')+1:url.rfind('.csv')]
| gpl-3.0 |
NelisVerhoef/scikit-learn | examples/cluster/plot_kmeans_digits.py | 228 | 4524 | """
===========================================================
A demo of K-Means clustering on the handwritten digits data
===========================================================
In this example we compare the various initialization strategies for
K-means in terms of runtime and quality of the results.
As the ground truth is known here, we also apply different cluster
quality metrics to judge the goodness of fit of the cluster labels to the
ground truth.
Cluster quality metrics evaluated (see :ref:`clustering_evaluation` for
definitions and discussions of the metrics):
=========== ========================================================
Shorthand full name
=========== ========================================================
homo homogeneity score
compl completeness score
v-meas V measure
ARI adjusted Rand index
AMI adjusted mutual information
silhouette silhouette coefficient
=========== ========================================================
"""
print(__doc__)
from time import time
import numpy as np
import matplotlib.pyplot as plt
from sklearn import metrics
from sklearn.cluster import KMeans
from sklearn.datasets import load_digits
from sklearn.decomposition import PCA
from sklearn.preprocessing import scale
np.random.seed(42)
digits = load_digits()
data = scale(digits.data)
n_samples, n_features = data.shape
n_digits = len(np.unique(digits.target))
labels = digits.target
sample_size = 300
print("n_digits: %d, \t n_samples %d, \t n_features %d"
% (n_digits, n_samples, n_features))
print(79 * '_')
print('% 9s' % 'init'
' time inertia homo compl v-meas ARI AMI silhouette')
def bench_k_means(estimator, name, data):
t0 = time()
estimator.fit(data)
print('% 9s %.2fs %i %.3f %.3f %.3f %.3f %.3f %.3f'
% (name, (time() - t0), estimator.inertia_,
metrics.homogeneity_score(labels, estimator.labels_),
metrics.completeness_score(labels, estimator.labels_),
metrics.v_measure_score(labels, estimator.labels_),
metrics.adjusted_rand_score(labels, estimator.labels_),
metrics.adjusted_mutual_info_score(labels, estimator.labels_),
metrics.silhouette_score(data, estimator.labels_,
metric='euclidean',
sample_size=sample_size)))
bench_k_means(KMeans(init='k-means++', n_clusters=n_digits, n_init=10),
name="k-means++", data=data)
bench_k_means(KMeans(init='random', n_clusters=n_digits, n_init=10),
name="random", data=data)
# in this case the seeding of the centers is deterministic, hence we run the
# kmeans algorithm only once with n_init=1
pca = PCA(n_components=n_digits).fit(data)
bench_k_means(KMeans(init=pca.components_, n_clusters=n_digits, n_init=1),
name="PCA-based",
data=data)
print(79 * '_')
###############################################################################
# Visualize the results on PCA-reduced data
reduced_data = PCA(n_components=2).fit_transform(data)
kmeans = KMeans(init='k-means++', n_clusters=n_digits, n_init=10)
kmeans.fit(reduced_data)
# Step size of the mesh. Decrease to increase the quality of the VQ.
h = .02 # point in the mesh [x_min, m_max]x[y_min, y_max].
# Plot the decision boundary. For that, we will assign a color to each
x_min, x_max = reduced_data[:, 0].min() - 1, reduced_data[:, 0].max() + 1
y_min, y_max = reduced_data[:, 1].min() - 1, reduced_data[:, 1].max() + 1
xx, yy = np.meshgrid(np.arange(x_min, x_max, h), np.arange(y_min, y_max, h))
# Obtain labels for each point in mesh. Use last trained model.
Z = kmeans.predict(np.c_[xx.ravel(), yy.ravel()])
# Put the result into a color plot
Z = Z.reshape(xx.shape)
plt.figure(1)
plt.clf()
plt.imshow(Z, interpolation='nearest',
extent=(xx.min(), xx.max(), yy.min(), yy.max()),
cmap=plt.cm.Paired,
aspect='auto', origin='lower')
plt.plot(reduced_data[:, 0], reduced_data[:, 1], 'k.', markersize=2)
# Plot the centroids as a white X
centroids = kmeans.cluster_centers_
plt.scatter(centroids[:, 0], centroids[:, 1],
marker='x', s=169, linewidths=3,
color='w', zorder=10)
plt.title('K-means clustering on the digits dataset (PCA-reduced data)\n'
'Centroids are marked with white cross')
plt.xlim(x_min, x_max)
plt.ylim(y_min, y_max)
plt.xticks(())
plt.yticks(())
plt.show()
| bsd-3-clause |
alexeyum/scikit-learn | sklearn/tests/test_grid_search.py | 66 | 28856 | """
Testing for grid search module (sklearn.grid_search)
"""
from collections import Iterable, Sized
from sklearn.externals.six.moves import cStringIO as StringIO
from sklearn.externals.six.moves import xrange
from itertools import chain, product
import pickle
import warnings
import sys
import numpy as np
import scipy.sparse as sp
from sklearn.utils.testing import assert_equal
from sklearn.utils.testing import assert_not_equal
from sklearn.utils.testing import assert_raises
from sklearn.utils.testing import assert_warns
from sklearn.utils.testing import assert_raise_message
from sklearn.utils.testing import assert_false, assert_true
from sklearn.utils.testing import assert_array_equal
from sklearn.utils.testing import assert_almost_equal
from sklearn.utils.testing import assert_array_almost_equal
from sklearn.utils.testing import assert_no_warnings
from sklearn.utils.testing import ignore_warnings
from sklearn.utils.mocking import CheckingClassifier, MockDataFrame
from scipy.stats import bernoulli, expon, uniform
from sklearn.externals.six.moves import zip
from sklearn.base import BaseEstimator
from sklearn.datasets import make_classification
from sklearn.datasets import make_blobs
from sklearn.datasets import make_multilabel_classification
from sklearn.svm import LinearSVC, SVC
from sklearn.tree import DecisionTreeRegressor
from sklearn.tree import DecisionTreeClassifier
from sklearn.cluster import KMeans
from sklearn.neighbors import KernelDensity
from sklearn.metrics import f1_score
from sklearn.metrics import make_scorer
from sklearn.metrics import roc_auc_score
from sklearn.exceptions import ChangedBehaviorWarning
from sklearn.exceptions import FitFailedWarning
with warnings.catch_warnings():
warnings.simplefilter('ignore')
from sklearn.grid_search import (GridSearchCV, RandomizedSearchCV,
ParameterGrid, ParameterSampler)
from sklearn.cross_validation import KFold, StratifiedKFold
from sklearn.preprocessing import Imputer
from sklearn.pipeline import Pipeline
# Neither of the following two estimators inherit from BaseEstimator,
# to test hyperparameter search on user-defined classifiers.
class MockClassifier(object):
"""Dummy classifier to test the cross-validation"""
def __init__(self, foo_param=0):
self.foo_param = foo_param
def fit(self, X, Y):
assert_true(len(X) == len(Y))
return self
def predict(self, T):
return T.shape[0]
predict_proba = predict
decision_function = predict
transform = predict
def score(self, X=None, Y=None):
if self.foo_param > 1:
score = 1.
else:
score = 0.
return score
def get_params(self, deep=False):
return {'foo_param': self.foo_param}
def set_params(self, **params):
self.foo_param = params['foo_param']
return self
class LinearSVCNoScore(LinearSVC):
"""An LinearSVC classifier that has no score method."""
@property
def score(self):
raise AttributeError
X = np.array([[-1, -1], [-2, -1], [1, 1], [2, 1]])
y = np.array([1, 1, 2, 2])
def assert_grid_iter_equals_getitem(grid):
assert_equal(list(grid), [grid[i] for i in range(len(grid))])
def test_parameter_grid():
# Test basic properties of ParameterGrid.
params1 = {"foo": [1, 2, 3]}
grid1 = ParameterGrid(params1)
assert_true(isinstance(grid1, Iterable))
assert_true(isinstance(grid1, Sized))
assert_equal(len(grid1), 3)
assert_grid_iter_equals_getitem(grid1)
params2 = {"foo": [4, 2],
"bar": ["ham", "spam", "eggs"]}
grid2 = ParameterGrid(params2)
assert_equal(len(grid2), 6)
# loop to assert we can iterate over the grid multiple times
for i in xrange(2):
# tuple + chain transforms {"a": 1, "b": 2} to ("a", 1, "b", 2)
points = set(tuple(chain(*(sorted(p.items())))) for p in grid2)
assert_equal(points,
set(("bar", x, "foo", y)
for x, y in product(params2["bar"], params2["foo"])))
assert_grid_iter_equals_getitem(grid2)
# Special case: empty grid (useful to get default estimator settings)
empty = ParameterGrid({})
assert_equal(len(empty), 1)
assert_equal(list(empty), [{}])
assert_grid_iter_equals_getitem(empty)
assert_raises(IndexError, lambda: empty[1])
has_empty = ParameterGrid([{'C': [1, 10]}, {}, {'C': [.5]}])
assert_equal(len(has_empty), 4)
assert_equal(list(has_empty), [{'C': 1}, {'C': 10}, {}, {'C': .5}])
assert_grid_iter_equals_getitem(has_empty)
def test_grid_search():
# Test that the best estimator contains the right value for foo_param
clf = MockClassifier()
grid_search = GridSearchCV(clf, {'foo_param': [1, 2, 3]}, verbose=3)
# make sure it selects the smallest parameter in case of ties
old_stdout = sys.stdout
sys.stdout = StringIO()
grid_search.fit(X, y)
sys.stdout = old_stdout
assert_equal(grid_search.best_estimator_.foo_param, 2)
for i, foo_i in enumerate([1, 2, 3]):
assert_true(grid_search.grid_scores_[i][0]
== {'foo_param': foo_i})
# Smoke test the score etc:
grid_search.score(X, y)
grid_search.predict_proba(X)
grid_search.decision_function(X)
grid_search.transform(X)
# Test exception handling on scoring
grid_search.scoring = 'sklearn'
assert_raises(ValueError, grid_search.fit, X, y)
@ignore_warnings
def test_grid_search_no_score():
# Test grid-search on classifier that has no score function.
clf = LinearSVC(random_state=0)
X, y = make_blobs(random_state=0, centers=2)
Cs = [.1, 1, 10]
clf_no_score = LinearSVCNoScore(random_state=0)
grid_search = GridSearchCV(clf, {'C': Cs}, scoring='accuracy')
grid_search.fit(X, y)
grid_search_no_score = GridSearchCV(clf_no_score, {'C': Cs},
scoring='accuracy')
# smoketest grid search
grid_search_no_score.fit(X, y)
# check that best params are equal
assert_equal(grid_search_no_score.best_params_, grid_search.best_params_)
# check that we can call score and that it gives the correct result
assert_equal(grid_search.score(X, y), grid_search_no_score.score(X, y))
# giving no scoring function raises an error
grid_search_no_score = GridSearchCV(clf_no_score, {'C': Cs})
assert_raise_message(TypeError, "no scoring", grid_search_no_score.fit,
[[1]])
def test_grid_search_score_method():
X, y = make_classification(n_samples=100, n_classes=2, flip_y=.2,
random_state=0)
clf = LinearSVC(random_state=0)
grid = {'C': [.1]}
search_no_scoring = GridSearchCV(clf, grid, scoring=None).fit(X, y)
search_accuracy = GridSearchCV(clf, grid, scoring='accuracy').fit(X, y)
search_no_score_method_auc = GridSearchCV(LinearSVCNoScore(), grid,
scoring='roc_auc').fit(X, y)
search_auc = GridSearchCV(clf, grid, scoring='roc_auc').fit(X, y)
# Check warning only occurs in situation where behavior changed:
# estimator requires score method to compete with scoring parameter
score_no_scoring = assert_no_warnings(search_no_scoring.score, X, y)
score_accuracy = assert_warns(ChangedBehaviorWarning,
search_accuracy.score, X, y)
score_no_score_auc = assert_no_warnings(search_no_score_method_auc.score,
X, y)
score_auc = assert_warns(ChangedBehaviorWarning,
search_auc.score, X, y)
# ensure the test is sane
assert_true(score_auc < 1.0)
assert_true(score_accuracy < 1.0)
assert_not_equal(score_auc, score_accuracy)
assert_almost_equal(score_accuracy, score_no_scoring)
assert_almost_equal(score_auc, score_no_score_auc)
def test_trivial_grid_scores():
# Test search over a "grid" with only one point.
# Non-regression test: grid_scores_ wouldn't be set by GridSearchCV.
clf = MockClassifier()
grid_search = GridSearchCV(clf, {'foo_param': [1]})
grid_search.fit(X, y)
assert_true(hasattr(grid_search, "grid_scores_"))
random_search = RandomizedSearchCV(clf, {'foo_param': [0]}, n_iter=1)
random_search.fit(X, y)
assert_true(hasattr(random_search, "grid_scores_"))
def test_no_refit():
# Test that grid search can be used for model selection only
clf = MockClassifier()
grid_search = GridSearchCV(clf, {'foo_param': [1, 2, 3]}, refit=False)
grid_search.fit(X, y)
assert_true(hasattr(grid_search, "best_params_"))
def test_grid_search_error():
# Test that grid search will capture errors on data with different
# length
X_, y_ = make_classification(n_samples=200, n_features=100, random_state=0)
clf = LinearSVC()
cv = GridSearchCV(clf, {'C': [0.1, 1.0]})
assert_raises(ValueError, cv.fit, X_[:180], y_)
def test_grid_search_iid():
# test the iid parameter
# noise-free simple 2d-data
X, y = make_blobs(centers=[[0, 0], [1, 0], [0, 1], [1, 1]], random_state=0,
cluster_std=0.1, shuffle=False, n_samples=80)
# split dataset into two folds that are not iid
# first one contains data of all 4 blobs, second only from two.
mask = np.ones(X.shape[0], dtype=np.bool)
mask[np.where(y == 1)[0][::2]] = 0
mask[np.where(y == 2)[0][::2]] = 0
# this leads to perfect classification on one fold and a score of 1/3 on
# the other
svm = SVC(kernel='linear')
# create "cv" for splits
cv = [[mask, ~mask], [~mask, mask]]
# once with iid=True (default)
grid_search = GridSearchCV(svm, param_grid={'C': [1, 10]}, cv=cv)
grid_search.fit(X, y)
first = grid_search.grid_scores_[0]
assert_equal(first.parameters['C'], 1)
assert_array_almost_equal(first.cv_validation_scores, [1, 1. / 3.])
# for first split, 1/4 of dataset is in test, for second 3/4.
# take weighted average
assert_almost_equal(first.mean_validation_score,
1 * 1. / 4. + 1. / 3. * 3. / 4.)
# once with iid=False
grid_search = GridSearchCV(svm, param_grid={'C': [1, 10]}, cv=cv,
iid=False)
grid_search.fit(X, y)
first = grid_search.grid_scores_[0]
assert_equal(first.parameters['C'], 1)
# scores are the same as above
assert_array_almost_equal(first.cv_validation_scores, [1, 1. / 3.])
# averaged score is just mean of scores
assert_almost_equal(first.mean_validation_score,
np.mean(first.cv_validation_scores))
def test_grid_search_one_grid_point():
X_, y_ = make_classification(n_samples=200, n_features=100, random_state=0)
param_dict = {"C": [1.0], "kernel": ["rbf"], "gamma": [0.1]}
clf = SVC()
cv = GridSearchCV(clf, param_dict)
cv.fit(X_, y_)
clf = SVC(C=1.0, kernel="rbf", gamma=0.1)
clf.fit(X_, y_)
assert_array_equal(clf.dual_coef_, cv.best_estimator_.dual_coef_)
def test_grid_search_bad_param_grid():
param_dict = {"C": 1.0}
clf = SVC()
assert_raises(ValueError, GridSearchCV, clf, param_dict)
param_dict = {"C": []}
clf = SVC()
assert_raises(ValueError, GridSearchCV, clf, param_dict)
param_dict = {"C": np.ones(6).reshape(3, 2)}
clf = SVC()
assert_raises(ValueError, GridSearchCV, clf, param_dict)
def test_grid_search_sparse():
# Test that grid search works with both dense and sparse matrices
X_, y_ = make_classification(n_samples=200, n_features=100, random_state=0)
clf = LinearSVC()
cv = GridSearchCV(clf, {'C': [0.1, 1.0]})
cv.fit(X_[:180], y_[:180])
y_pred = cv.predict(X_[180:])
C = cv.best_estimator_.C
X_ = sp.csr_matrix(X_)
clf = LinearSVC()
cv = GridSearchCV(clf, {'C': [0.1, 1.0]})
cv.fit(X_[:180].tocoo(), y_[:180])
y_pred2 = cv.predict(X_[180:])
C2 = cv.best_estimator_.C
assert_true(np.mean(y_pred == y_pred2) >= .9)
assert_equal(C, C2)
def test_grid_search_sparse_scoring():
X_, y_ = make_classification(n_samples=200, n_features=100, random_state=0)
clf = LinearSVC()
cv = GridSearchCV(clf, {'C': [0.1, 1.0]}, scoring="f1")
cv.fit(X_[:180], y_[:180])
y_pred = cv.predict(X_[180:])
C = cv.best_estimator_.C
X_ = sp.csr_matrix(X_)
clf = LinearSVC()
cv = GridSearchCV(clf, {'C': [0.1, 1.0]}, scoring="f1")
cv.fit(X_[:180], y_[:180])
y_pred2 = cv.predict(X_[180:])
C2 = cv.best_estimator_.C
assert_array_equal(y_pred, y_pred2)
assert_equal(C, C2)
# Smoke test the score
# np.testing.assert_allclose(f1_score(cv.predict(X_[:180]), y[:180]),
# cv.score(X_[:180], y[:180]))
# test loss where greater is worse
def f1_loss(y_true_, y_pred_):
return -f1_score(y_true_, y_pred_)
F1Loss = make_scorer(f1_loss, greater_is_better=False)
cv = GridSearchCV(clf, {'C': [0.1, 1.0]}, scoring=F1Loss)
cv.fit(X_[:180], y_[:180])
y_pred3 = cv.predict(X_[180:])
C3 = cv.best_estimator_.C
assert_equal(C, C3)
assert_array_equal(y_pred, y_pred3)
def test_grid_search_precomputed_kernel():
# Test that grid search works when the input features are given in the
# form of a precomputed kernel matrix
X_, y_ = make_classification(n_samples=200, n_features=100, random_state=0)
# compute the training kernel matrix corresponding to the linear kernel
K_train = np.dot(X_[:180], X_[:180].T)
y_train = y_[:180]
clf = SVC(kernel='precomputed')
cv = GridSearchCV(clf, {'C': [0.1, 1.0]})
cv.fit(K_train, y_train)
assert_true(cv.best_score_ >= 0)
# compute the test kernel matrix
K_test = np.dot(X_[180:], X_[:180].T)
y_test = y_[180:]
y_pred = cv.predict(K_test)
assert_true(np.mean(y_pred == y_test) >= 0)
# test error is raised when the precomputed kernel is not array-like
# or sparse
assert_raises(ValueError, cv.fit, K_train.tolist(), y_train)
def test_grid_search_precomputed_kernel_error_nonsquare():
# Test that grid search returns an error with a non-square precomputed
# training kernel matrix
K_train = np.zeros((10, 20))
y_train = np.ones((10, ))
clf = SVC(kernel='precomputed')
cv = GridSearchCV(clf, {'C': [0.1, 1.0]})
assert_raises(ValueError, cv.fit, K_train, y_train)
def test_grid_search_precomputed_kernel_error_kernel_function():
# Test that grid search returns an error when using a kernel_function
X_, y_ = make_classification(n_samples=200, n_features=100, random_state=0)
kernel_function = lambda x1, x2: np.dot(x1, x2.T)
clf = SVC(kernel=kernel_function)
cv = GridSearchCV(clf, {'C': [0.1, 1.0]})
assert_raises(ValueError, cv.fit, X_, y_)
class BrokenClassifier(BaseEstimator):
"""Broken classifier that cannot be fit twice"""
def __init__(self, parameter=None):
self.parameter = parameter
def fit(self, X, y):
assert_true(not hasattr(self, 'has_been_fit_'))
self.has_been_fit_ = True
def predict(self, X):
return np.zeros(X.shape[0])
@ignore_warnings
def test_refit():
# Regression test for bug in refitting
# Simulates re-fitting a broken estimator; this used to break with
# sparse SVMs.
X = np.arange(100).reshape(10, 10)
y = np.array([0] * 5 + [1] * 5)
clf = GridSearchCV(BrokenClassifier(), [{'parameter': [0, 1]}],
scoring="precision", refit=True)
clf.fit(X, y)
def test_gridsearch_nd():
# Pass X as list in GridSearchCV
X_4d = np.arange(10 * 5 * 3 * 2).reshape(10, 5, 3, 2)
y_3d = np.arange(10 * 7 * 11).reshape(10, 7, 11)
check_X = lambda x: x.shape[1:] == (5, 3, 2)
check_y = lambda x: x.shape[1:] == (7, 11)
clf = CheckingClassifier(check_X=check_X, check_y=check_y)
grid_search = GridSearchCV(clf, {'foo_param': [1, 2, 3]})
grid_search.fit(X_4d, y_3d).score(X, y)
assert_true(hasattr(grid_search, "grid_scores_"))
def test_X_as_list():
# Pass X as list in GridSearchCV
X = np.arange(100).reshape(10, 10)
y = np.array([0] * 5 + [1] * 5)
clf = CheckingClassifier(check_X=lambda x: isinstance(x, list))
cv = KFold(n=len(X), n_folds=3)
grid_search = GridSearchCV(clf, {'foo_param': [1, 2, 3]}, cv=cv)
grid_search.fit(X.tolist(), y).score(X, y)
assert_true(hasattr(grid_search, "grid_scores_"))
def test_y_as_list():
# Pass y as list in GridSearchCV
X = np.arange(100).reshape(10, 10)
y = np.array([0] * 5 + [1] * 5)
clf = CheckingClassifier(check_y=lambda x: isinstance(x, list))
cv = KFold(n=len(X), n_folds=3)
grid_search = GridSearchCV(clf, {'foo_param': [1, 2, 3]}, cv=cv)
grid_search.fit(X, y.tolist()).score(X, y)
assert_true(hasattr(grid_search, "grid_scores_"))
def test_pandas_input():
# check cross_val_score doesn't destroy pandas dataframe
types = [(MockDataFrame, MockDataFrame)]
try:
from pandas import Series, DataFrame
types.append((DataFrame, Series))
except ImportError:
pass
X = np.arange(100).reshape(10, 10)
y = np.array([0] * 5 + [1] * 5)
for InputFeatureType, TargetType in types:
# X dataframe, y series
X_df, y_ser = InputFeatureType(X), TargetType(y)
check_df = lambda x: isinstance(x, InputFeatureType)
check_series = lambda x: isinstance(x, TargetType)
clf = CheckingClassifier(check_X=check_df, check_y=check_series)
grid_search = GridSearchCV(clf, {'foo_param': [1, 2, 3]})
grid_search.fit(X_df, y_ser).score(X_df, y_ser)
grid_search.predict(X_df)
assert_true(hasattr(grid_search, "grid_scores_"))
def test_unsupervised_grid_search():
# test grid-search with unsupervised estimator
X, y = make_blobs(random_state=0)
km = KMeans(random_state=0)
grid_search = GridSearchCV(km, param_grid=dict(n_clusters=[2, 3, 4]),
scoring='adjusted_rand_score')
grid_search.fit(X, y)
# ARI can find the right number :)
assert_equal(grid_search.best_params_["n_clusters"], 3)
# Now without a score, and without y
grid_search = GridSearchCV(km, param_grid=dict(n_clusters=[2, 3, 4]))
grid_search.fit(X)
assert_equal(grid_search.best_params_["n_clusters"], 4)
def test_gridsearch_no_predict():
# test grid-search with an estimator without predict.
# slight duplication of a test from KDE
def custom_scoring(estimator, X):
return 42 if estimator.bandwidth == .1 else 0
X, _ = make_blobs(cluster_std=.1, random_state=1,
centers=[[0, 1], [1, 0], [0, 0]])
search = GridSearchCV(KernelDensity(),
param_grid=dict(bandwidth=[.01, .1, 1]),
scoring=custom_scoring)
search.fit(X)
assert_equal(search.best_params_['bandwidth'], .1)
assert_equal(search.best_score_, 42)
def test_param_sampler():
# test basic properties of param sampler
param_distributions = {"kernel": ["rbf", "linear"],
"C": uniform(0, 1)}
sampler = ParameterSampler(param_distributions=param_distributions,
n_iter=10, random_state=0)
samples = [x for x in sampler]
assert_equal(len(samples), 10)
for sample in samples:
assert_true(sample["kernel"] in ["rbf", "linear"])
assert_true(0 <= sample["C"] <= 1)
def test_randomized_search_grid_scores():
# Make a dataset with a lot of noise to get various kind of prediction
# errors across CV folds and parameter settings
X, y = make_classification(n_samples=200, n_features=100, n_informative=3,
random_state=0)
# XXX: as of today (scipy 0.12) it's not possible to set the random seed
# of scipy.stats distributions: the assertions in this test should thus
# not depend on the randomization
params = dict(C=expon(scale=10),
gamma=expon(scale=0.1))
n_cv_iter = 3
n_search_iter = 30
search = RandomizedSearchCV(SVC(), n_iter=n_search_iter, cv=n_cv_iter,
param_distributions=params, iid=False)
search.fit(X, y)
assert_equal(len(search.grid_scores_), n_search_iter)
# Check consistency of the structure of each cv_score item
for cv_score in search.grid_scores_:
assert_equal(len(cv_score.cv_validation_scores), n_cv_iter)
# Because we set iid to False, the mean_validation score is the
# mean of the fold mean scores instead of the aggregate sample-wise
# mean score
assert_almost_equal(np.mean(cv_score.cv_validation_scores),
cv_score.mean_validation_score)
assert_equal(list(sorted(cv_score.parameters.keys())),
list(sorted(params.keys())))
# Check the consistency with the best_score_ and best_params_ attributes
sorted_grid_scores = list(sorted(search.grid_scores_,
key=lambda x: x.mean_validation_score))
best_score = sorted_grid_scores[-1].mean_validation_score
assert_equal(search.best_score_, best_score)
tied_best_params = [s.parameters for s in sorted_grid_scores
if s.mean_validation_score == best_score]
assert_true(search.best_params_ in tied_best_params,
"best_params_={0} is not part of the"
" tied best models: {1}".format(
search.best_params_, tied_best_params))
def test_grid_search_score_consistency():
# test that correct scores are used
clf = LinearSVC(random_state=0)
X, y = make_blobs(random_state=0, centers=2)
Cs = [.1, 1, 10]
for score in ['f1', 'roc_auc']:
grid_search = GridSearchCV(clf, {'C': Cs}, scoring=score)
grid_search.fit(X, y)
cv = StratifiedKFold(n_folds=3, y=y)
for C, scores in zip(Cs, grid_search.grid_scores_):
clf.set_params(C=C)
scores = scores[2] # get the separate runs from grid scores
i = 0
for train, test in cv:
clf.fit(X[train], y[train])
if score == "f1":
correct_score = f1_score(y[test], clf.predict(X[test]))
elif score == "roc_auc":
dec = clf.decision_function(X[test])
correct_score = roc_auc_score(y[test], dec)
assert_almost_equal(correct_score, scores[i])
i += 1
def test_pickle():
# Test that a fit search can be pickled
clf = MockClassifier()
grid_search = GridSearchCV(clf, {'foo_param': [1, 2, 3]}, refit=True)
grid_search.fit(X, y)
pickle.dumps(grid_search) # smoke test
random_search = RandomizedSearchCV(clf, {'foo_param': [1, 2, 3]},
refit=True, n_iter=3)
random_search.fit(X, y)
pickle.dumps(random_search) # smoke test
def test_grid_search_with_multioutput_data():
# Test search with multi-output estimator
X, y = make_multilabel_classification(random_state=0)
est_parameters = {"max_depth": [1, 2, 3, 4]}
cv = KFold(y.shape[0], random_state=0)
estimators = [DecisionTreeRegressor(random_state=0),
DecisionTreeClassifier(random_state=0)]
# Test with grid search cv
for est in estimators:
grid_search = GridSearchCV(est, est_parameters, cv=cv)
grid_search.fit(X, y)
for parameters, _, cv_validation_scores in grid_search.grid_scores_:
est.set_params(**parameters)
for i, (train, test) in enumerate(cv):
est.fit(X[train], y[train])
correct_score = est.score(X[test], y[test])
assert_almost_equal(correct_score,
cv_validation_scores[i])
# Test with a randomized search
for est in estimators:
random_search = RandomizedSearchCV(est, est_parameters,
cv=cv, n_iter=3)
random_search.fit(X, y)
for parameters, _, cv_validation_scores in random_search.grid_scores_:
est.set_params(**parameters)
for i, (train, test) in enumerate(cv):
est.fit(X[train], y[train])
correct_score = est.score(X[test], y[test])
assert_almost_equal(correct_score,
cv_validation_scores[i])
def test_predict_proba_disabled():
# Test predict_proba when disabled on estimator.
X = np.arange(20).reshape(5, -1)
y = [0, 0, 1, 1, 1]
clf = SVC(probability=False)
gs = GridSearchCV(clf, {}, cv=2).fit(X, y)
assert_false(hasattr(gs, "predict_proba"))
def test_grid_search_allows_nans():
# Test GridSearchCV with Imputer
X = np.arange(20, dtype=np.float64).reshape(5, -1)
X[2, :] = np.nan
y = [0, 0, 1, 1, 1]
p = Pipeline([
('imputer', Imputer(strategy='mean', missing_values='NaN')),
('classifier', MockClassifier()),
])
GridSearchCV(p, {'classifier__foo_param': [1, 2, 3]}, cv=2).fit(X, y)
class FailingClassifier(BaseEstimator):
"""Classifier that raises a ValueError on fit()"""
FAILING_PARAMETER = 2
def __init__(self, parameter=None):
self.parameter = parameter
def fit(self, X, y=None):
if self.parameter == FailingClassifier.FAILING_PARAMETER:
raise ValueError("Failing classifier failed as required")
def predict(self, X):
return np.zeros(X.shape[0])
def test_grid_search_failing_classifier():
# GridSearchCV with on_error != 'raise'
# Ensures that a warning is raised and score reset where appropriate.
X, y = make_classification(n_samples=20, n_features=10, random_state=0)
clf = FailingClassifier()
# refit=False because we only want to check that errors caused by fits
# to individual folds will be caught and warnings raised instead. If
# refit was done, then an exception would be raised on refit and not
# caught by grid_search (expected behavior), and this would cause an
# error in this test.
gs = GridSearchCV(clf, [{'parameter': [0, 1, 2]}], scoring='accuracy',
refit=False, error_score=0.0)
assert_warns(FitFailedWarning, gs.fit, X, y)
# Ensure that grid scores were set to zero as required for those fits
# that are expected to fail.
assert all(np.all(this_point.cv_validation_scores == 0.0)
for this_point in gs.grid_scores_
if this_point.parameters['parameter'] ==
FailingClassifier.FAILING_PARAMETER)
gs = GridSearchCV(clf, [{'parameter': [0, 1, 2]}], scoring='accuracy',
refit=False, error_score=float('nan'))
assert_warns(FitFailedWarning, gs.fit, X, y)
assert all(np.all(np.isnan(this_point.cv_validation_scores))
for this_point in gs.grid_scores_
if this_point.parameters['parameter'] ==
FailingClassifier.FAILING_PARAMETER)
def test_grid_search_failing_classifier_raise():
# GridSearchCV with on_error == 'raise' raises the error
X, y = make_classification(n_samples=20, n_features=10, random_state=0)
clf = FailingClassifier()
# refit=False because we want to test the behaviour of the grid search part
gs = GridSearchCV(clf, [{'parameter': [0, 1, 2]}], scoring='accuracy',
refit=False, error_score='raise')
# FailingClassifier issues a ValueError so this is what we look for.
assert_raises(ValueError, gs.fit, X, y)
def test_parameters_sampler_replacement():
# raise error if n_iter too large
params = {'first': [0, 1], 'second': ['a', 'b', 'c']}
sampler = ParameterSampler(params, n_iter=7)
assert_raises(ValueError, list, sampler)
# degenerates to GridSearchCV if n_iter the same as grid_size
sampler = ParameterSampler(params, n_iter=6)
samples = list(sampler)
assert_equal(len(samples), 6)
for values in ParameterGrid(params):
assert_true(values in samples)
# test sampling without replacement in a large grid
params = {'a': range(10), 'b': range(10), 'c': range(10)}
sampler = ParameterSampler(params, n_iter=99, random_state=42)
samples = list(sampler)
assert_equal(len(samples), 99)
hashable_samples = ["a%db%dc%d" % (p['a'], p['b'], p['c'])
for p in samples]
assert_equal(len(set(hashable_samples)), 99)
# doesn't go into infinite loops
params_distribution = {'first': bernoulli(.5), 'second': ['a', 'b', 'c']}
sampler = ParameterSampler(params_distribution, n_iter=7)
samples = list(sampler)
assert_equal(len(samples), 7)
| bsd-3-clause |
snnn/tensorflow | tensorflow/contrib/eager/python/evaluator.py | 26 | 13672 | # Copyright 2017 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
# ==============================================================================
"""Class Evaluator holds Metrics for the duration of an evaluation run."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import six
from tensorflow.contrib.eager.python import datasets
from tensorflow.contrib.eager.python import metrics
from tensorflow.python.eager import context
from tensorflow.python.eager import function
from tensorflow.python.framework import errors_impl
from tensorflow.python.framework import ops
from tensorflow.python.ops import control_flow_ops
from tensorflow.python.ops import summary_ops_v2 as summary_ops
class Evaluator(object):
"""This holds and updates Metrics for the duration of a single eval run.
Usage:
evaluator = my_model.evaluator() # or MyEvaluator(my_model)
for example_batch in ...:
evaluator(example_batch)
results = evaluator.all_metric_results(optional_summary_logdir)
Or, if you are getting your examples from a tf.data.Dataset, you can use
the evaluate_on_dataset() method.
Implementers of Evaluators should
(a) Call `track_metric()` and/or `track_evaluator()` in __init__().
(b) Override the `call()` method. It will be passed the output of the
model's `eval_data()` method, and should call its contained metrics
(treating them as callables) and any child Evaluators (using their
call() method to avoid calling eval_data() again).
Args:
model: A `Model` object with an `eval_data()` method.
"""
def __init__(self, model):
self._model = model
self._metrics = {}
self._evaluators = {}
if not context.executing_eagerly():
self.call = function.defun(self.call)
# ---- API for users ----
def __call__(self, *args, **kwargs):
"""Update metrics with a minibatch of input examples.
Args:
*args:
**kwargs: Arguments representing an input mini-batch of examples to
pass to self.model.eval_data().
Returns:
The op to execute or None if executing eagerly.
"""
return self.call(self._model.eval_data(*args, **kwargs))
def init_variables(self):
"""Return an op for initializing all contained uninitialized variables.
Only for graph execution. Should be called after variables are created
in the first execution of __call__().
Returns:
An op.
Raises:
RuntimeError: if eager execution is enabled.
@compatibility(eager)
Only for graph execution.
@end_compatibility
"""
if context.executing_eagerly():
raise RuntimeError("Evaluator.init_variables() not needed when "
"eager execution is enabled.")
return control_flow_ops.group([m.init_variables() for _, m in self.metrics])
def all_metric_results(self, summary_logdir=None):
"""Computes results for all contained metrics.
Args:
summary_logdir: An optional string. If specified, metric results
will be written as summaries to this directory.
Returns:
A `dict` mapping string names to tensors.
"""
if summary_logdir is None:
with summary_ops.never_record_summaries():
return self._all_metric_results()
else:
def f():
with summary_ops.create_file_writer(
summary_logdir).as_default(), summary_ops.always_record_summaries():
return self._all_metric_results()
if context.executing_eagerly():
return f()
else:
return function.defun(f)()
def _all_metric_results(self):
"""Implementation of `all_metric_results` in the summary context."""
results = {}
for name, metric in six.iteritems(self._metrics):
results[name] = metric.result()
for prefix, evaluator in six.iteritems(self._evaluators):
for name, metric in six.iteritems(evaluator._metrics): # pylint: disable=protected-access
results[prefix + "/" + name] = metric.result()
return results
def evaluate_on_dataset(self, dataset, *args, **kwargs):
"""Convenience method for performing an eval on a Dataset.
Args:
dataset: Dataset object with the input data to evaluate on.
*args:
**kwargs: Optional additional arguments to __call__(), except
`summary_logdir`: if specified, metrics will be written as summaries
to this directory.
Returns:
@compatibility(eager)
When eager execution is enabled, this returns the result of performing
an evaluation as a dictionary. With graph execution, this returns a tuple
(init_op, call_op, results_op) which may be executed using this code:
```python
sess.run(init_op)
try:
while True:
sess.run(call_op)
except tf.errors.OutOfRangeError:
pass
return sess.run(results_op) # A dictionary
# equivalently:
return evaluator.run_evaluation(init_op, call_op, results_op, sess=sess)
```
@end_compatibility
"""
summary_logdir = kwargs.pop("summary_logdir", None)
if context.executing_eagerly():
for example in datasets.Iterator(dataset):
self.__call__(example, *args, **kwargs)
return self.all_metric_results(summary_logdir)
# Graph construction
call_op = self.__call__(dataset.make_one_shot_iterator().get_next(), *args,
**kwargs)
init_op = self.init_variables()
results_op = self.all_metric_results(summary_logdir)
return (init_op, call_op, results_op)
@staticmethod
def run_evaluation(init_op, call_op, results_op, sess=None):
"""Convenience method for running the ops returned by evaluate_on_dataset.
Args:
init_op: An op that initializes/resets evaluation state.
call_op: An op that updates evaluation state on a mini-batch of examples.
Must generate an tf.errors.OutOfRangeError when done.
results_op: A dictionary of tensors that compute the final evaluation
results from the evaluation state.
sess: The Session to run the evaluation in. Defaults to the default
Session.
Returns:
A dictionary of values, parallel to results_op.
Raises:
RuntimeError: if eager execution is enabled.
@compatibility(eager)
Only for graph execution.
@end_compatibility
"""
if context.executing_eagerly():
raise RuntimeError("Evaluator.run_evaluation() not supported when "
"eager execution is enabled.")
sess = sess or ops.get_default_session()
sess.run(init_op)
try:
while True:
sess.run(call_op)
except errors_impl.OutOfRangeError:
pass
return sess.run(results_op)
# ---- To be implemented by descendants ---
def call(self, eval_data):
"""Update metrics using the output of self.model.
Note: This function is executed as a graph function in graph mode.
This means:
a) Operations on the same resource are executed in textual order.
This should make it easier to do things like add the updated
value of a variable to another, for example.
b) You don't need to worry about collecting the update ops to execute.
All update ops added to the graph by this function will be executed.
As a result, code should generally work the same way with graph or
eager execution.
Args:
eval_data: The output of self.model.eval_data() on a mini-batch of
examples.
"""
raise NotImplementedError("Evaluators must define a call member function.")
# ---- For use by descendants ---
@property
def model(self):
return self._model
def track_metric(self, metric):
"""Add a Metric to be tracked.
Metrics can only be tracked by one `Evaluator`. Metrics must be
tracked or they will not appear in `all_metric_results()`.
Args:
metric: A `Metric` object.
Returns:
The `metric` passed into this function.
Raises:
RuntimeError: If called before __init__.
TypeError: If `metric` is not of the correct type.
ValueError: If there is a name collision between Metrics or `metric`
has already been added to another `Evaluator`.
"""
if not hasattr(self, "_metrics"):
raise RuntimeError(
"Need to call Evaluator.__init__ before adding metrics")
if not isinstance(metric, metrics.Metric):
raise TypeError(
"Evaluator.track_metric() passed type %s, not a tfe.metrics.Metric" %
(type(metric),))
if metric.name in self._metrics:
if metric is self._metrics[metric.name]:
return metric
raise ValueError(
"Attempt to add two Metrics with the name '%s' to the same Evaluator "
"'%s'" % (metric.name, self.name))
# pylint: disable=protected-access
if hasattr(metric, "_added_to_an_evaluator"):
raise ValueError("Metric %s already added to Evaluator %s" %
(metric.name, metric._added_to_an_evaluator))
metric._added_to_an_evaluator = self.__class__.__name__
# pylint: enable=protected-access
self._metrics[metric.name] = metric
return metric
def track_evaluator(self, prefix, evaluator):
"""Add a contained `Evaluator`.
This is for delegating to another `Evaluator`, e.g. for when you have a
model with multiple heads. Users should manually invoke the child
`Evaluator`'s `call` method from their `call` method.
Args:
prefix: A string. Metrics from `evaluator` are exported with this
prefix and a '/'.
evaluator: An `Evaluator` object.
Returns:
The value of `evaluator` passed into this function.
Raises:
RuntimeError: If called before __init__.
TypeError: If `evaluator` is not of the correct type.
ValueError: If an `Evaluator` has already been added with that `prefix`.
"""
if not hasattr(self, "_evaluators"):
raise RuntimeError(
"Need to call Evaluator.__init__ before adding evaluators")
if not isinstance(evaluator, Evaluator):
raise TypeError(
"Evaluator.track_evaluator() passed type %s, not a tfe.Evaluator." %
(type(evaluator),))
if prefix in self._evaluators:
if evaluator is self._evaluators[prefix]:
return evaluator
raise RuntimeError(
"Attempt to add two Evaluators with the same prefix '%s'." % prefix)
self._evaluators[prefix] = evaluator
return evaluator
@property
def metric_variables(self):
v = []
for metric in six.itervalues(self._metrics):
v += metric.variables
for evaluator in six.itervalues(self._evaluators):
v += evaluator.metric_variables
return v
@property
def metrics(self):
"""Returns a list of (prefix, metric) pairs."""
m = []
for metric in six.itervalues(self._metrics):
m.append(("", metric))
for prefix, evaluator in six.iteritems(self._evaluators):
m += [(prefix + "/" + p, m) for p, m in evaluator.metrics]
return m
class SparseSoftmaxEvaluator(Evaluator):
"""Evaluator for a sparse softmax model.
Computes a standard set of metrics for single-label, multi-class
models.
Args:
model: A `SparseSoftmaxModel` object or a `Model` whose `eval_data()`
method produces a `dict` containing values for the loss, true
label, predicted class, and optional weights.
loss_key: Optional key for looking up the value of the loss in the
`eval_data()` dict. Defaults to "loss".
label_key: Optional key for looking up the value of the label in the
`eval_data()` dict. Defaults to "label".
predicted_class_key: Optional key for looking up the value of the
predicted class in the `eval_data()` dict. Defaults to "predicted_class".
weights_key: Optional key for looking up the value of the weights
in the `eval_data()` dict. Defaults to "weights". Note that weights
are optional, and default to 1 if not present in `eval_data`.
"""
def __init__(self, model, loss_key="loss", label_key="label",
predicted_class_key="predicted_class", weights_key="weights"):
super(SparseSoftmaxEvaluator, self).__init__(model)
# TODO(josh11b): Expand this to include everything from the standard
# SparseSoftmax Head.
self.avg_loss = self.track_metric(metrics.Mean("Avg Loss"))
self.accuracy = self.track_metric(metrics.Accuracy())
self.loss_key = loss_key
self.label_key = label_key
self.predicted_class_key = predicted_class_key
self.weights_key = weights_key
def call(self, eval_data):
"""Update metrics for `eval_data` dict (described above)."""
weights = eval_data.get(self.weights_key, None)
if weights is None:
self.avg_loss(eval_data[self.loss_key])
self.accuracy(eval_data[self.label_key],
eval_data[self.predicted_class_key])
else:
self.avg_loss(eval_data[self.loss_key], weights=weights)
self.accuracy(eval_data[self.label_key],
eval_data[self.predicted_class_key],
weights=weights)
| apache-2.0 |
lucidfrontier45/scikit-learn | examples/svm/plot_separating_hyperplane_unbalanced.py | 5 | 1363 | """
=================================================
SVM: Separating hyperplane for unbalanced classes
=================================================
Find the optimal separating hyperplane using an SVC for classes that
are unbalanced.
We first find the separating plane with a plain SVC and then plot
(dashed) the separating hyperplane with automatically correction for
unbalanced classes.
"""
print __doc__
import numpy as np
import pylab as pl
from sklearn import svm
# we create 40 separable points
rng = np.random.RandomState(0)
n_samples_1 = 1000
n_samples_2 = 100
X = np.r_[1.5 * rng.randn(n_samples_1, 2),
0.5 * rng.randn(n_samples_2, 2) + [2, 2]]
y = [0] * (n_samples_1) + [1] * (n_samples_2)
# fit the model and get the separating hyperplane
clf = svm.SVC(kernel='linear', C=1.0)
clf.fit(X, y)
w = clf.coef_[0]
a = -w[0] / w[1]
xx = np.linspace(-5, 5)
yy = a * xx - clf.intercept_[0] / w[1]
# get the separating hyperplane using weighted classes
wclf = svm.SVC(kernel='linear', class_weight={1: 10})
wclf.fit(X, y)
ww = wclf.coef_[0]
wa = -ww[0] / ww[1]
wyy = wa * xx - wclf.intercept_[0] / ww[1]
# plot separating hyperplanes and samples
h0 = pl.plot(xx, yy, 'k-', label='no weights')
h1 = pl.plot(xx, wyy, 'k--', label='with weights')
pl.scatter(X[:, 0], X[:, 1], c=y, cmap=pl.cm.Paired)
pl.legend()
pl.axis('tight')
pl.show()
| bsd-3-clause |
pandaproject/panda | panda/migrations/0031_rename_dataset_related_stories.py | 6 | 14078 | # -*- coding: utf-8 -*-
import datetime
from south.db import db
from south.v2 import SchemaMigration
from django.db import models
class Migration(SchemaMigration):
def forwards(self, orm):
db.rename_column('panda_dataset', 'related_stories', 'related_links')
def backwards(self, orm):
db.rename_column('panda_dataset', 'related_links', 'related_stories')
models = {
'auth.group': {
'Meta': {'object_name': 'Group'},
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}),
'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'})
},
'auth.permission': {
'Meta': {'ordering': "('content_type__app_label', 'content_type__model', 'codename')", 'unique_together': "(('content_type', 'codename'),)", 'object_name': 'Permission'},
'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['contenttypes.ContentType']"}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'name': ('django.db.models.fields.CharField', [], {'max_length': '50'})
},
'auth.user': {
'Meta': {'object_name': 'User'},
'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}),
'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}),
'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}),
'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}),
'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}),
'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}),
'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}),
'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}),
'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}),
'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}),
'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '255'})
},
'contenttypes.contenttype': {
'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"},
'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}),
'name': ('django.db.models.fields.CharField', [], {'max_length': '100'})
},
'panda.activitylog': {
'Meta': {'unique_together': "(('user', 'when'),)", 'object_name': 'ActivityLog'},
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'activity_logs'", 'to': "orm['auth.User']"}),
'when': ('django.db.models.fields.DateField', [], {'auto_now': 'True', 'blank': 'True'})
},
'panda.category': {
'Meta': {'object_name': 'Category'},
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'name': ('django.db.models.fields.CharField', [], {'max_length': '64'}),
'slug': ('django.db.models.fields.SlugField', [], {'max_length': '256'})
},
'panda.dataset': {
'Meta': {'ordering': "['-creation_date']", 'object_name': 'Dataset'},
'categories': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'datasets'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['panda.Category']"}),
'column_schema': ('panda.fields.JSONField', [], {'default': 'None', 'null': 'True'}),
'creation_date': ('django.db.models.fields.DateTimeField', [], {'null': 'True'}),
'creator': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'datasets'", 'to': "orm['auth.User']"}),
'current_task': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['panda.TaskStatus']", 'null': 'True', 'blank': 'True'}),
'description': ('django.db.models.fields.TextField', [], {'blank': 'True'}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'initial_upload': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'initial_upload_for'", 'null': 'True', 'to': "orm['panda.DataUpload']"}),
'last_modification': ('django.db.models.fields.TextField', [], {'default': 'None', 'null': 'True', 'blank': 'True'}),
'last_modified': ('django.db.models.fields.DateTimeField', [], {'default': 'None', 'null': 'True', 'blank': 'True'}),
'last_modified_by': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']", 'null': 'True', 'blank': 'True'}),
'locked': ('django.db.models.fields.BooleanField', [], {'default': 'False'}),
'locked_at': ('django.db.models.fields.DateTimeField', [], {'default': 'None', 'null': 'True'}),
'name': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'related_links': ('panda.fields.JSONField', [], {'default': '[]'}),
'row_count': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}),
'sample_data': ('panda.fields.JSONField', [], {'default': 'None', 'null': 'True'}),
'slug': ('django.db.models.fields.SlugField', [], {'max_length': '256'})
},
'panda.dataupload': {
'Meta': {'ordering': "['creation_date']", 'object_name': 'DataUpload'},
'columns': ('panda.fields.JSONField', [], {'null': 'True'}),
'creation_date': ('django.db.models.fields.DateTimeField', [], {}),
'creator': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']"}),
'data_type': ('django.db.models.fields.CharField', [], {'max_length': '4', 'null': 'True', 'blank': 'True'}),
'dataset': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'data_uploads'", 'null': 'True', 'to': "orm['panda.Dataset']"}),
'dialect': ('panda.fields.JSONField', [], {'null': 'True'}),
'encoding': ('django.db.models.fields.CharField', [], {'default': "'utf-8'", 'max_length': '32'}),
'filename': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'guessed_types': ('panda.fields.JSONField', [], {'null': 'True'}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'imported': ('django.db.models.fields.BooleanField', [], {'default': 'False'}),
'original_filename': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'sample_data': ('panda.fields.JSONField', [], {'null': 'True'}),
'size': ('django.db.models.fields.IntegerField', [], {}),
'title': ('django.db.models.fields.TextField', [], {'max_length': '256'})
},
'panda.export': {
'Meta': {'ordering': "['creation_date']", 'object_name': 'Export'},
'creation_date': ('django.db.models.fields.DateTimeField', [], {}),
'creator': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']"}),
'dataset': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'exports'", 'null': 'True', 'to': "orm['panda.Dataset']"}),
'filename': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'original_filename': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'size': ('django.db.models.fields.IntegerField', [], {}),
'title': ('django.db.models.fields.TextField', [], {'max_length': '256'})
},
'panda.notification': {
'Meta': {'ordering': "['-sent_at']", 'object_name': 'Notification'},
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'message': ('django.db.models.fields.TextField', [], {}),
'read_at': ('django.db.models.fields.DateTimeField', [], {'default': 'None', 'null': 'True', 'blank': 'True'}),
'recipient': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'notifications'", 'to': "orm['auth.User']"}),
'sent_at': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}),
'type': ('django.db.models.fields.CharField', [], {'default': "'Info'", 'max_length': '16'}),
'url': ('django.db.models.fields.URLField', [], {'default': 'None', 'max_length': '200', 'null': 'True'})
},
'panda.relatedupload': {
'Meta': {'ordering': "['creation_date']", 'object_name': 'RelatedUpload'},
'creation_date': ('django.db.models.fields.DateTimeField', [], {}),
'creator': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']"}),
'dataset': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'related_uploads'", 'to': "orm['panda.Dataset']"}),
'filename': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'original_filename': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'size': ('django.db.models.fields.IntegerField', [], {}),
'title': ('django.db.models.fields.TextField', [], {'max_length': '256'})
},
'panda.searchlog': {
'Meta': {'object_name': 'SearchLog'},
'dataset': ('django.db.models.fields.related.ForeignKey', [], {'default': 'None', 'related_name': "'searches'", 'null': 'True', 'to': "orm['panda.Dataset']"}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'query': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'search_logs'", 'to': "orm['auth.User']"}),
'when': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'})
},
'panda.searchsubscription': {
'Meta': {'object_name': 'SearchSubscription'},
'category': ('django.db.models.fields.related.ForeignKey', [], {'default': 'None', 'related_name': "'search_subscriptions'", 'null': 'True', 'to': "orm['panda.Category']"}),
'dataset': ('django.db.models.fields.related.ForeignKey', [], {'default': 'None', 'related_name': "'search_subscriptions'", 'null': 'True', 'to': "orm['panda.Dataset']"}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'last_run': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}),
'query': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'query_human': ('django.db.models.fields.TextField', [], {}),
'query_url': ('django.db.models.fields.CharField', [], {'max_length': '256'}),
'user': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'search_subscriptions'", 'to': "orm['auth.User']"})
},
'panda.taskstatus': {
'Meta': {'object_name': 'TaskStatus'},
'creator': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'tasks'", 'null': 'True', 'to': "orm['auth.User']"}),
'end': ('django.db.models.fields.DateTimeField', [], {'null': 'True'}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'message': ('django.db.models.fields.CharField', [], {'max_length': '255', 'blank': 'True'}),
'start': ('django.db.models.fields.DateTimeField', [], {'null': 'True'}),
'status': ('django.db.models.fields.CharField', [], {'default': "'PENDING'", 'max_length': '50'}),
'task_description': ('django.db.models.fields.TextField', [], {}),
'task_name': ('django.db.models.fields.CharField', [], {'max_length': '255'}),
'traceback': ('django.db.models.fields.TextField', [], {'default': 'None', 'null': 'True', 'blank': 'True'})
},
'panda.userprofile': {
'Meta': {'object_name': 'UserProfile'},
'activation_key': ('django.db.models.fields.CharField', [], {'max_length': '40', 'null': 'True', 'blank': 'True'}),
'activation_key_expiration': ('django.db.models.fields.DateTimeField', [], {}),
'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}),
'show_login_help': ('django.db.models.fields.BooleanField', [], {'default': 'True'}),
'user': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['auth.User']", 'unique': 'True'})
}
}
complete_apps = ['panda']
| mit |
markusnagel/fuel | fuel/converters/__init__.py | 2 | 1299 | """Data conversion modules for built-in datasets.
Conversion submodules generate an HDF5 file that is compatible with
their corresponding built-in dataset.
Conversion functions accept a single argument, `subparser`, which is an
`argparse.ArgumentParser` instance that it needs to fill with its own
specific arguments. They should set a `func` default argument for the
subparser with a function that will get called and given the parsed
command-line arguments, and is expected to download the required files.
"""
from fuel.converters import adult
from fuel.converters import binarized_mnist
from fuel.converters import caltech101_silhouettes
from fuel.converters import cifar10
from fuel.converters import cifar100
from fuel.converters import iris
from fuel.converters import mnist
from fuel.converters import svhn
from fuel.converters import ilsvrc2010
__version__ = '0.2'
all_converters = (
('adult', adult.fill_subparser),
('binarized_mnist', binarized_mnist.fill_subparser),
('caltech101_silhouettes', caltech101_silhouettes.fill_subparser),
('cifar10', cifar10.fill_subparser),
('cifar100', cifar100.fill_subparser),
('iris', iris.fill_subparser),
('mnist', mnist.fill_subparser),
('svhn', svhn.fill_subparser),
('ilsvrc2010', ilsvrc2010.fill_subparser))
| mit |
xiawei0000/Kinectforactiondetect | TheanoDL/LogisticRegressionMNIST.py | 2 | 15142 | """
This tutorial introduces logistic regression using Theano and stochastic
gradient descent.
Logistic regression is a probabilistic, linear classifier. It is parametrized
by a weight matrix :math:`W` and a bias vector :math:`b`. Classification is
done by projecting data points onto a set of hyperplanes, the distance to
which is used to determine a class membership probability.
Mathematically, this can be written as:
.. math::
P(Y=i|x, W,b) &= softmax_i(W x + b) \\
&= \frac {e^{W_i x + b_i}} {\sum_j e^{W_j x + b_j}}
The output of the model or prediction is then done by taking the argmax of
the vector whose i'th element is P(Y=i|x).
.. math::
y_{pred} = argmax_i P(Y=i|x,W,b)
This tutorial presents a stochastic gradient descent optimization method
suitable for large datasets, and a conjugate gradient optimization method
that is suitable for smaller datasets.
References:
- textbooks: "Pattern Recognition and Machine Learning" -
Christopher M. Bishop, section 4.3.2
"""
__docformat__ = 'restructedtext en'
import cPickle
import gzip
import os
import sys
import time
import numpy
import theano
import theano.tensor as T
class LogisticRegression(object):
"""Multi-class Logistic Regression Class
The logistic regression is fully described by a weight matrix :math:`W`
and bias vector :math:`b`. Classification is done by projecting data
points onto a set of hyperplanes, the distance to which is used to
determine a class membership probability.
"""
def __init__(self, input, n_in, n_out):
""" Initialize the parameters of the logistic regression
:type input: theano.tensor.TensorType
:param input: symbolic variable that describes the input of the
architecture (one minibatch)
:type n_in: int
:param n_in: number of input units, the dimension of the space in
which the datapoints lie
:type n_out: int
:param n_out: number of output units, the dimension of the space in
which the labels lie
"""
# initialize with 0 the weights W as a matrix of shape (n_in, n_out)
self.W = theano.shared(value=numpy.zeros((n_in, n_out),
dtype=theano.config.floatX),
name='W', borrow=True)
# initialize the baises b as a vector of n_out 0s
self.b = theano.shared(value=numpy.zeros((n_out,),
dtype=theano.config.floatX),
name='b', borrow=True)
# compute vector of class-membership probabilities in symbolic form
self.p_y_given_x = T.nnet.softmax(T.dot(input, self.W) + self.b)
# compute prediction as class whose probability is maximal in
# symbolic form
self.y_pred = T.argmax(self.p_y_given_x, axis=1)
# parameters of the model
self.params = [self.W, self.b]
def negative_log_likelihood(self, y):
"""Return the mean of the negative log-likelihood of the prediction
of this model under a given target distribution.
.. math::
\frac{1}{|\mathcal{D}|} \mathcal{L} (\theta=\{W,b\}, \mathcal{D}) =
\frac{1}{|\mathcal{D}|} \sum_{i=0}^{|\mathcal{D}|} \log(P(Y=y^{(i)}|x^{(i)}, W,b)) \\
\ell (\theta=\{W,b\}, \mathcal{D})
:type y: theano.tensor.TensorType
:param y: corresponds to a vector that gives for each example the
correct label
Note: we use the mean instead of the sum so that
the learning rate is less dependent on the batch size
"""
# y.shape[0] is (symbolically) the number of rows in y, i.e.,
# number of examples (call it n) in the minibatch
# T.arange(y.shape[0]) is a symbolic vector which will contain
# [0,1,2,... n-1] T.log(self.p_y_given_x) is a matrix of
# Log-Probabilities (call it LP) with one row per example and
# one column per class LP[T.arange(y.shape[0]),y] is a vector
# v containing [LP[0,y[0]], LP[1,y[1]], LP[2,y[2]], ...,
# LP[n-1,y[n-1]]] and T.mean(LP[T.arange(y.shape[0]),y]) is
# the mean (across minibatch examples) of the elements in v,
# i.e., the mean log-likelihood across the minibatch.
return -T.mean(T.log(self.p_y_given_x)[T.arange(y.shape[0]), y])
def errors(self, y):
"""Return a float representing the number of errors in the minibatch
over the total number of examples of the minibatch ; zero one
loss over the size of the minibatch
:type y: theano.tensor.TensorType
:param y: corresponds to a vector that gives for each example the
correct label
"""
# check if y has same dimension of y_pred
if y.ndim != self.y_pred.ndim:
raise TypeError('y should have the same shape as self.y_pred',
('y', target.type, 'y_pred', self.y_pred.type))
# check if y is of the correct datatype
if y.dtype.startswith('int'):
# the T.neq operator returns a vector of 0s and 1s, where 1
# represents a mistake in prediction
return T.mean(T.neq(self.y_pred, y))
else:
raise NotImplementedError()
def load_data(dataset):
''' Loads the dataset
:type dataset: string
:param dataset: the path to the dataset (here MNIST)
'''
#############
# LOAD DATA #
#############
# Download the MNIST dataset if it is not present
data_dir, data_file = os.path.split(dataset)
if data_dir == "" and not os.path.isfile(dataset):
# Check if dataset is in the data directory.
new_path = os.path.join(os.path.split(__file__)[0], "..", "data", dataset)
if os.path.isfile(new_path) or data_file == 'mnist.pkl.gz':
dataset = new_path
if (not os.path.isfile(dataset)) and data_file == 'mnist.pkl.gz':
import urllib
origin = 'http://www.iro.umontreal.ca/~lisa/deep/data/mnist/mnist.pkl.gz'
print 'Downloading data from %s' % origin
urllib.urlretrieve(origin, dataset)
print '... loading data'
# Load the dataset
f = gzip.open(dataset, 'rb')
train_set, valid_set, test_set = cPickle.load(f)
f.close()
#train_set, valid_set, test_set format: tuple(input, target)
#input is an numpy.ndarray of 2 dimensions (a matrix)
#witch row's correspond to an example. target is a
#numpy.ndarray of 1 dimensions (vector)) that have the same length as
#the number of rows in the input. It should give the target
#target to the example with the same index in the input.
def shared_dataset(data_xy, borrow=True):
""" Function that loads the dataset into shared variables
The reason we store our dataset in shared variables is to allow
Theano to copy it into the GPU memory (when code is run on GPU).
Since copying data into the GPU is slow, copying a minibatch everytime
is needed (the default behaviour if the data is not in a shared
variable) would lead to a large decrease in performance.
"""
data_x, data_y = data_xy
shared_x = theano.shared(numpy.asarray(data_x,
dtype=theano.config.floatX),
borrow=borrow)
shared_y = theano.shared(numpy.asarray(data_y,
dtype=theano.config.floatX),
borrow=borrow)
# When storing data on the GPU it has to be stored as floats
# therefore we will store the labels as ``floatX`` as well
# (``shared_y`` does exactly that). But during our computations
# we need them as ints (we use labels as index, and if they are
# floats it doesn't make sense) therefore instead of returning
# ``shared_y`` we will have to cast it to int. This little hack
# lets ous get around this issue
return shared_x, T.cast(shared_y, 'int32')
test_set_x, test_set_y = shared_dataset(test_set)
valid_set_x, valid_set_y = shared_dataset(valid_set)
train_set_x, train_set_y = shared_dataset(train_set)
rval = [(train_set_x, train_set_y), (valid_set_x, valid_set_y),
(test_set_x, test_set_y)]
return rval
def sgd_optimization_mnist(learning_rate=0.13, n_epochs=1000,
dataset='mnist.pkl.gz',
batch_size=600):
"""
Demonstrate stochastic gradient descent optimization of a log-linear
model
This is demonstrated on MNIST.
:type learning_rate: float
:param learning_rate: learning rate used (factor for the stochastic
gradient)
:type n_epochs: int
:param n_epochs: maximal number of epochs to run the optimizer
:type dataset: string
:param dataset: the path of the MNIST dataset file from
http://www.iro.umontreal.ca/~lisa/deep/data/mnist/mnist.pkl.gz
"""
datasets = load_data(dataset)
train_set_x, train_set_y = datasets[0]
valid_set_x, valid_set_y = datasets[1]
test_set_x, test_set_y = datasets[2]
# compute number of minibatches for training, validation and testing
n_train_batches = train_set_x.get_value(borrow=True).shape[0] / batch_size
n_valid_batches = valid_set_x.get_value(borrow=True).shape[0] / batch_size
n_test_batches = test_set_x.get_value(borrow=True).shape[0] / batch_size
######################
# BUILD ACTUAL MODEL #
######################
print '... building the model'
# allocate symbolic variables for the data
index = T.lscalar() # index to a [mini]batch
x = T.matrix('x') # the data is presented as rasterized images
y = T.ivector('y') # the labels are presented as 1D vector of
# [int] labels
# construct the logistic regression class
# Each MNIST image has size 28*28
classifier = LogisticRegression(input=x, n_in=28 * 28, n_out=10)
# the cost we minimize during training is the negative log likelihood of
# the model in symbolic format
cost = classifier.negative_log_likelihood(y)
# compiling a Theano function that computes the mistakes that are made by
# the model on a minibatch
test_model = theano.function(inputs=[index],
outputs=classifier.errors(y),
givens={
x: test_set_x[index * batch_size: (index + 1) * batch_size],
y: test_set_y[index * batch_size: (index + 1) * batch_size]})
validate_model = theano.function(inputs=[index],
outputs=classifier.errors(y),
givens={
x: valid_set_x[index * batch_size:(index + 1) * batch_size],
y: valid_set_y[index * batch_size:(index + 1) * batch_size]})
# compute the gradient of cost with respect to theta = (W,b)
g_W = T.grad(cost=cost, wrt=classifier.W)
g_b = T.grad(cost=cost, wrt=classifier.b)
# specify how to update the parameters of the model as a list of
# (variable, update expression) pairs.
updates = [(classifier.W, classifier.W - learning_rate * g_W),
(classifier.b, classifier.b - learning_rate * g_b)]
# compiling a Theano function `train_model` that returns the cost, but in
# the same time updates the parameter of the model based on the rules
# defined in `updates`
train_model = theano.function(inputs=[index],
outputs=cost,
updates=updates,
givens={
x: train_set_x[index * batch_size:(index + 1) * batch_size],
y: train_set_y[index * batch_size:(index + 1) * batch_size]})
###############
# TRAIN MODEL #
###############
print '... training the model'
# early-stopping parameters
patience = 5000 # look as this many examples regardless
patience_increase = 2 # wait this much longer when a new best is
# found
improvement_threshold = 0.995 # a relative improvement of this much is
# considered significant
validation_frequency = min(n_train_batches, patience / 2)
# go through this many
# minibatche before checking the network
# on the validation set; in this case we
# check every epoch
best_params = None
best_validation_loss = numpy.inf
test_score = 0.
start_time = time.clock()
done_looping = False
epoch = 0
while (epoch < n_epochs) and (not done_looping):
epoch = epoch + 1
for minibatch_index in xrange(n_train_batches):
minibatch_avg_cost = train_model(minibatch_index)
# iteration number
iter = (epoch - 1) * n_train_batches + minibatch_index
if (iter + 1) % validation_frequency == 0:
# compute zero-one loss on validation set
validation_losses = [validate_model(i)
for i in xrange(n_valid_batches)]
this_validation_loss = numpy.mean(validation_losses)
print('epoch %i, minibatch %i/%i, validation error %f %%' % \
(epoch, minibatch_index + 1, n_train_batches,
this_validation_loss * 100.))
# if we got the best validation score until now
if this_validation_loss < best_validation_loss:
#improve patience if loss improvement is good enough
if this_validation_loss < best_validation_loss * \
improvement_threshold:
patience = max(patience, iter * patience_increase)
best_validation_loss = this_validation_loss
# test it on the test set
test_losses = [test_model(i)
for i in xrange(n_test_batches)]
test_score = numpy.mean(test_losses)
print((' epoch %i, minibatch %i/%i, test error of best'
' model %f %%') %
(epoch, minibatch_index + 1, n_train_batches,
test_score * 100.))
if patience <= iter:
done_looping = True
break
end_time = time.clock()
print(('Optimization complete with best validation score of %f %%,'
'with test performance %f %%') %
(best_validation_loss * 100., test_score * 100.))
print 'The code run for %d epochs, with %f epochs/sec' % (
epoch, 1. * epoch / (end_time - start_time))
print >> sys.stderr, ('The code for file ' +
os.path.split(__file__)[1] +
' ran for %.1fs' % ((end_time - start_time)))
if __name__ == '__main__':
sgd_optimization_mnist() | mit |
npuichigo/ttsflow | third_party/tensorflow/tensorflow/examples/tutorials/input_fn/boston.py | 75 | 2920 | # Copyright 2016 The TensorFlow Authors. All Rights Reserved.
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing, software
# distributed under the License is distributed on an "AS IS" BASIS,
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
# See the License for the specific language governing permissions and
# limitations under the License.
"""DNNRegressor with custom input_fn for Housing dataset."""
from __future__ import absolute_import
from __future__ import division
from __future__ import print_function
import itertools
import pandas as pd
import tensorflow as tf
tf.logging.set_verbosity(tf.logging.INFO)
COLUMNS = ["crim", "zn", "indus", "nox", "rm", "age",
"dis", "tax", "ptratio", "medv"]
FEATURES = ["crim", "zn", "indus", "nox", "rm",
"age", "dis", "tax", "ptratio"]
LABEL = "medv"
def get_input_fn(data_set, num_epochs=None, shuffle=True):
return tf.estimator.inputs.pandas_input_fn(
x=pd.DataFrame({k: data_set[k].values for k in FEATURES}),
y=pd.Series(data_set[LABEL].values),
num_epochs=num_epochs,
shuffle=shuffle)
def main(unused_argv):
# Load datasets
training_set = pd.read_csv("boston_train.csv", skipinitialspace=True,
skiprows=1, names=COLUMNS)
test_set = pd.read_csv("boston_test.csv", skipinitialspace=True,
skiprows=1, names=COLUMNS)
# Set of 6 examples for which to predict median house values
prediction_set = pd.read_csv("boston_predict.csv", skipinitialspace=True,
skiprows=1, names=COLUMNS)
# Feature cols
feature_cols = [tf.feature_column.numeric_column(k) for k in FEATURES]
# Build 2 layer fully connected DNN with 10, 10 units respectively.
regressor = tf.estimator.DNNRegressor(feature_columns=feature_cols,
hidden_units=[10, 10],
model_dir="/tmp/boston_model")
# Train
regressor.train(input_fn=get_input_fn(training_set), steps=5000)
# Evaluate loss over one epoch of test_set.
ev = regressor.evaluate(
input_fn=get_input_fn(test_set, num_epochs=1, shuffle=False))
loss_score = ev["loss"]
print("Loss: {0:f}".format(loss_score))
# Print out predictions over a slice of prediction_set.
y = regressor.predict(
input_fn=get_input_fn(prediction_set, num_epochs=1, shuffle=False))
# .predict() returns an iterator of dicts; convert to a list and print
# predictions
predictions = list(p["predictions"] for p in itertools.islice(y, 6))
print("Predictions: {}".format(str(predictions)))
if __name__ == "__main__":
tf.app.run()
| apache-2.0 |
alexeyum/scikit-learn | sklearn/metrics/tests/test_ranking.py | 31 | 41905 | from __future__ import division, print_function
import numpy as np
from itertools import product
import warnings
from scipy.sparse import csr_matrix
from sklearn import datasets
from sklearn import svm
from sklearn import ensemble
from sklearn.datasets import make_multilabel_classification
from sklearn.random_projection import sparse_random_matrix
from sklearn.utils.validation import check_array, check_consistent_length
from sklearn.utils.validation import check_random_state
from sklearn.utils.testing import assert_raises, clean_warning_registry
from sklearn.utils.testing import assert_raise_message
from sklearn.utils.testing import assert_equal
from sklearn.utils.testing import assert_almost_equal
from sklearn.utils.testing import assert_array_equal
from sklearn.utils.testing import assert_array_almost_equal
from sklearn.utils.testing import assert_warns
from sklearn.metrics import auc
from sklearn.metrics import average_precision_score
from sklearn.metrics import coverage_error
from sklearn.metrics import label_ranking_average_precision_score
from sklearn.metrics import precision_recall_curve
from sklearn.metrics import label_ranking_loss
from sklearn.metrics import roc_auc_score
from sklearn.metrics import roc_curve
from sklearn.exceptions import UndefinedMetricWarning
###############################################################################
# Utilities for testing
def make_prediction(dataset=None, binary=False):
"""Make some classification predictions on a toy dataset using a SVC
If binary is True restrict to a binary classification problem instead of a
multiclass classification problem
"""
if dataset is None:
# import some data to play with
dataset = datasets.load_iris()
X = dataset.data
y = dataset.target
if binary:
# restrict to a binary classification task
X, y = X[y < 2], y[y < 2]
n_samples, n_features = X.shape
p = np.arange(n_samples)
rng = check_random_state(37)
rng.shuffle(p)
X, y = X[p], y[p]
half = int(n_samples / 2)
# add noisy features to make the problem harder and avoid perfect results
rng = np.random.RandomState(0)
X = np.c_[X, rng.randn(n_samples, 200 * n_features)]
# run classifier, get class probabilities and label predictions
clf = svm.SVC(kernel='linear', probability=True, random_state=0)
probas_pred = clf.fit(X[:half], y[:half]).predict_proba(X[half:])
if binary:
# only interested in probabilities of the positive case
# XXX: do we really want a special API for the binary case?
probas_pred = probas_pred[:, 1]
y_pred = clf.predict(X[half:])
y_true = y[half:]
return y_true, y_pred, probas_pred
###############################################################################
# Tests
def _auc(y_true, y_score):
"""Alternative implementation to check for correctness of
`roc_auc_score`."""
pos_label = np.unique(y_true)[1]
# Count the number of times positive samples are correctly ranked above
# negative samples.
pos = y_score[y_true == pos_label]
neg = y_score[y_true != pos_label]
diff_matrix = pos.reshape(1, -1) - neg.reshape(-1, 1)
n_correct = np.sum(diff_matrix > 0)
return n_correct / float(len(pos) * len(neg))
def _average_precision(y_true, y_score):
"""Alternative implementation to check for correctness of
`average_precision_score`."""
pos_label = np.unique(y_true)[1]
n_pos = np.sum(y_true == pos_label)
order = np.argsort(y_score)[::-1]
y_score = y_score[order]
y_true = y_true[order]
score = 0
for i in range(len(y_score)):
if y_true[i] == pos_label:
# Compute precision up to document i
# i.e, percentage of relevant documents up to document i.
prec = 0
for j in range(0, i + 1):
if y_true[j] == pos_label:
prec += 1.0
prec /= (i + 1.0)
score += prec
return score / n_pos
def test_roc_curve():
# Test Area under Receiver Operating Characteristic (ROC) curve
y_true, _, probas_pred = make_prediction(binary=True)
expected_auc = _auc(y_true, probas_pred)
for drop in [True, False]:
fpr, tpr, thresholds = roc_curve(y_true, probas_pred,
drop_intermediate=drop)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, expected_auc, decimal=2)
assert_almost_equal(roc_auc, roc_auc_score(y_true, probas_pred))
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_end_points():
# Make sure that roc_curve returns a curve start at 0 and ending and
# 1 even in corner cases
rng = np.random.RandomState(0)
y_true = np.array([0] * 50 + [1] * 50)
y_pred = rng.randint(3, size=100)
fpr, tpr, thr = roc_curve(y_true, y_pred, drop_intermediate=True)
assert_equal(fpr[0], 0)
assert_equal(fpr[-1], 1)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thr.shape)
def test_roc_returns_consistency():
# Test whether the returned threshold matches up with tpr
# make small toy dataset
y_true, _, probas_pred = make_prediction(binary=True)
fpr, tpr, thresholds = roc_curve(y_true, probas_pred)
# use the given thresholds to determine the tpr
tpr_correct = []
for t in thresholds:
tp = np.sum((probas_pred >= t) & y_true)
p = np.sum(y_true)
tpr_correct.append(1.0 * tp / p)
# compare tpr and tpr_correct to see if the thresholds' order was correct
assert_array_almost_equal(tpr, tpr_correct, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_nonrepeating_thresholds():
# Test to ensure that we don't return spurious repeating thresholds.
# Duplicated thresholds can arise due to machine precision issues.
dataset = datasets.load_digits()
X = dataset['data']
y = dataset['target']
# This random forest classifier can only return probabilities
# significant to two decimal places
clf = ensemble.RandomForestClassifier(n_estimators=100, random_state=0)
# How well can the classifier predict whether a digit is less than 5?
# This task contributes floating point roundoff errors to the probabilities
train, test = slice(None, None, 2), slice(1, None, 2)
probas_pred = clf.fit(X[train], y[train]).predict_proba(X[test])
y_score = probas_pred[:, :5].sum(axis=1) # roundoff errors begin here
y_true = [yy < 5 for yy in y[test]]
# Check for repeating values in the thresholds
fpr, tpr, thresholds = roc_curve(y_true, y_score, drop_intermediate=False)
assert_equal(thresholds.size, np.unique(np.round(thresholds, 2)).size)
def test_roc_curve_multi():
# roc_curve not applicable for multi-class problems
y_true, _, probas_pred = make_prediction(binary=False)
assert_raises(ValueError, roc_curve, y_true, probas_pred)
def test_roc_curve_confidence():
# roc_curve for confidence scores
y_true, _, probas_pred = make_prediction(binary=True)
fpr, tpr, thresholds = roc_curve(y_true, probas_pred - 0.5)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.90, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_hard():
# roc_curve for hard decisions
y_true, pred, probas_pred = make_prediction(binary=True)
# always predict one
trivial_pred = np.ones(y_true.shape)
fpr, tpr, thresholds = roc_curve(y_true, trivial_pred)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.50, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
# always predict zero
trivial_pred = np.zeros(y_true.shape)
fpr, tpr, thresholds = roc_curve(y_true, trivial_pred)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.50, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
# hard decisions
fpr, tpr, thresholds = roc_curve(y_true, pred)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.78, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_one_label():
y_true = [1, 1, 1, 1, 1, 1, 1, 1, 1, 1]
y_pred = [0, 1, 0, 1, 0, 1, 0, 1, 0, 1]
# assert there are warnings
w = UndefinedMetricWarning
fpr, tpr, thresholds = assert_warns(w, roc_curve, y_true, y_pred)
# all true labels, all fpr should be nan
assert_array_equal(fpr,
np.nan * np.ones(len(thresholds)))
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
# assert there are warnings
fpr, tpr, thresholds = assert_warns(w, roc_curve,
[1 - x for x in y_true],
y_pred)
# all negative labels, all tpr should be nan
assert_array_equal(tpr,
np.nan * np.ones(len(thresholds)))
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_toydata():
# Binary classification
y_true = [0, 1]
y_score = [0, 1]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [1, 1])
assert_almost_equal(roc_auc, 1.)
y_true = [0, 1]
y_score = [1, 0]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1, 1])
assert_array_almost_equal(fpr, [0, 0, 1])
assert_almost_equal(roc_auc, 0.)
y_true = [1, 0]
y_score = [1, 1]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [0, 1])
assert_almost_equal(roc_auc, 0.5)
y_true = [1, 0]
y_score = [1, 0]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [1, 1])
assert_almost_equal(roc_auc, 1.)
y_true = [1, 0]
y_score = [0.5, 0.5]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [0, 1])
assert_almost_equal(roc_auc, .5)
y_true = [0, 0]
y_score = [0.25, 0.75]
# assert UndefinedMetricWarning because of no positive sample in y_true
tpr, fpr, _ = assert_warns(UndefinedMetricWarning, roc_curve, y_true, y_score)
assert_raises(ValueError, roc_auc_score, y_true, y_score)
assert_array_almost_equal(tpr, [0., 0.5, 1.])
assert_array_almost_equal(fpr, [np.nan, np.nan, np.nan])
y_true = [1, 1]
y_score = [0.25, 0.75]
# assert UndefinedMetricWarning because of no negative sample in y_true
tpr, fpr, _ = assert_warns(UndefinedMetricWarning, roc_curve, y_true, y_score)
assert_raises(ValueError, roc_auc_score, y_true, y_score)
assert_array_almost_equal(tpr, [np.nan, np.nan])
assert_array_almost_equal(fpr, [0.5, 1.])
# Multi-label classification task
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [0, 1]])
assert_raises(ValueError, roc_auc_score, y_true, y_score, average="macro")
assert_raises(ValueError, roc_auc_score, y_true, y_score,
average="weighted")
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), 1.)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), 1.)
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_raises(ValueError, roc_auc_score, y_true, y_score, average="macro")
assert_raises(ValueError, roc_auc_score, y_true, y_score,
average="weighted")
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), 0.5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), 0.5)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_almost_equal(roc_auc_score(y_true, y_score, average="macro"), 0)
assert_almost_equal(roc_auc_score(y_true, y_score, average="weighted"), 0)
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), 0)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), 0)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0.5, 0.5], [0.5, 0.5]])
assert_almost_equal(roc_auc_score(y_true, y_score, average="macro"), .5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="weighted"), .5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), .5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), .5)
def test_roc_curve_drop_intermediate():
# Test that drop_intermediate drops the correct thresholds
y_true = [0, 0, 0, 0, 1, 1]
y_score = [0., 0.2, 0.5, 0.6, 0.7, 1.0]
tpr, fpr, thresholds = roc_curve(y_true, y_score, drop_intermediate=True)
assert_array_almost_equal(thresholds, [1., 0.7, 0.])
# Test dropping thresholds with repeating scores
y_true = [0, 0, 0, 0, 0, 0, 0,
1, 1, 1, 1, 1, 1]
y_score = [0., 0.1, 0.6, 0.6, 0.7, 0.8, 0.9,
0.6, 0.7, 0.8, 0.9, 0.9, 1.0]
tpr, fpr, thresholds = roc_curve(y_true, y_score, drop_intermediate=True)
assert_array_almost_equal(thresholds,
[1.0, 0.9, 0.7, 0.6, 0.])
def test_auc():
# Test Area Under Curve (AUC) computation
x = [0, 1]
y = [0, 1]
assert_array_almost_equal(auc(x, y), 0.5)
x = [1, 0]
y = [0, 1]
assert_array_almost_equal(auc(x, y), 0.5)
x = [1, 0, 0]
y = [0, 1, 1]
assert_array_almost_equal(auc(x, y), 0.5)
x = [0, 1]
y = [1, 1]
assert_array_almost_equal(auc(x, y), 1)
x = [0, 0.5, 1]
y = [0, 0.5, 1]
assert_array_almost_equal(auc(x, y), 0.5)
def test_auc_duplicate_values():
# Test Area Under Curve (AUC) computation with duplicate values
# auc() was previously sorting the x and y arrays according to the indices
# from numpy.argsort(x), which was reordering the tied 0's in this example
# and resulting in an incorrect area computation. This test detects the
# error.
x = [-2.0, 0.0, 0.0, 0.0, 1.0]
y1 = [2.0, 0.0, 0.5, 1.0, 1.0]
y2 = [2.0, 1.0, 0.0, 0.5, 1.0]
y3 = [2.0, 1.0, 0.5, 0.0, 1.0]
for y in (y1, y2, y3):
assert_array_almost_equal(auc(x, y, reorder=True), 3.0)
def test_auc_errors():
# Incompatible shapes
assert_raises(ValueError, auc, [0.0, 0.5, 1.0], [0.1, 0.2])
# Too few x values
assert_raises(ValueError, auc, [0.0], [0.1])
# x is not in order
assert_raises(ValueError, auc, [1.0, 0.0, 0.5], [0.0, 0.0, 0.0])
def test_auc_score_non_binary_class():
# Test that roc_auc_score function returns an error when trying
# to compute AUC for non-binary class values.
rng = check_random_state(404)
y_pred = rng.rand(10)
# y_true contains only one class value
y_true = np.zeros(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = -np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
# y_true contains three different class values
y_true = rng.randint(0, 3, size=10)
assert_raise_message(ValueError, "multiclass format is not supported",
roc_auc_score, y_true, y_pred)
clean_warning_registry()
with warnings.catch_warnings(record=True):
rng = check_random_state(404)
y_pred = rng.rand(10)
# y_true contains only one class value
y_true = np.zeros(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = -np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
# y_true contains three different class values
y_true = rng.randint(0, 3, size=10)
assert_raise_message(ValueError, "multiclass format is not supported",
roc_auc_score, y_true, y_pred)
def test_precision_recall_curve():
y_true, _, probas_pred = make_prediction(binary=True)
_test_precision_recall_curve(y_true, probas_pred)
# Use {-1, 1} for labels; make sure original labels aren't modified
y_true[np.where(y_true == 0)] = -1
y_true_copy = y_true.copy()
_test_precision_recall_curve(y_true, probas_pred)
assert_array_equal(y_true_copy, y_true)
labels = [1, 0, 0, 1]
predict_probas = [1, 2, 3, 4]
p, r, t = precision_recall_curve(labels, predict_probas)
assert_array_almost_equal(p, np.array([0.5, 0.33333333, 0.5, 1., 1.]))
assert_array_almost_equal(r, np.array([1., 0.5, 0.5, 0.5, 0.]))
assert_array_almost_equal(t, np.array([1, 2, 3, 4]))
assert_equal(p.size, r.size)
assert_equal(p.size, t.size + 1)
def test_precision_recall_curve_pos_label():
y_true, _, probas_pred = make_prediction(binary=False)
pos_label = 2
p, r, thresholds = precision_recall_curve(y_true,
probas_pred[:, pos_label],
pos_label=pos_label)
p2, r2, thresholds2 = precision_recall_curve(y_true == pos_label,
probas_pred[:, pos_label])
assert_array_almost_equal(p, p2)
assert_array_almost_equal(r, r2)
assert_array_almost_equal(thresholds, thresholds2)
assert_equal(p.size, r.size)
assert_equal(p.size, thresholds.size + 1)
def _test_precision_recall_curve(y_true, probas_pred):
# Test Precision-Recall and aread under PR curve
p, r, thresholds = precision_recall_curve(y_true, probas_pred)
precision_recall_auc = auc(r, p)
assert_array_almost_equal(precision_recall_auc, 0.85, 2)
assert_array_almost_equal(precision_recall_auc,
average_precision_score(y_true, probas_pred))
assert_almost_equal(_average_precision(y_true, probas_pred),
precision_recall_auc, 1)
assert_equal(p.size, r.size)
assert_equal(p.size, thresholds.size + 1)
# Smoke test in the case of proba having only one value
p, r, thresholds = precision_recall_curve(y_true,
np.zeros_like(probas_pred))
precision_recall_auc = auc(r, p)
assert_array_almost_equal(precision_recall_auc, 0.75, 3)
assert_equal(p.size, r.size)
assert_equal(p.size, thresholds.size + 1)
def test_precision_recall_curve_errors():
# Contains non-binary labels
assert_raises(ValueError, precision_recall_curve,
[0, 1, 2], [[0.0], [1.0], [1.0]])
def test_precision_recall_curve_toydata():
with np.errstate(all="raise"):
# Binary classification
y_true = [0, 1]
y_score = [0, 1]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [1, 1])
assert_array_almost_equal(r, [1, 0])
assert_almost_equal(auc_prc, 1.)
y_true = [0, 1]
y_score = [1, 0]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [0.5, 0., 1.])
assert_array_almost_equal(r, [1., 0., 0.])
assert_almost_equal(auc_prc, 0.25)
y_true = [1, 0]
y_score = [1, 1]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [0.5, 1])
assert_array_almost_equal(r, [1., 0])
assert_almost_equal(auc_prc, .75)
y_true = [1, 0]
y_score = [1, 0]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [1, 1])
assert_array_almost_equal(r, [1, 0])
assert_almost_equal(auc_prc, 1.)
y_true = [1, 0]
y_score = [0.5, 0.5]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [0.5, 1])
assert_array_almost_equal(r, [1, 0.])
assert_almost_equal(auc_prc, .75)
y_true = [0, 0]
y_score = [0.25, 0.75]
assert_raises(Exception, precision_recall_curve, y_true, y_score)
assert_raises(Exception, average_precision_score, y_true, y_score)
y_true = [1, 1]
y_score = [0.25, 0.75]
p, r, _ = precision_recall_curve(y_true, y_score)
assert_almost_equal(average_precision_score(y_true, y_score), 1.)
assert_array_almost_equal(p, [1., 1., 1.])
assert_array_almost_equal(r, [1, 0.5, 0.])
# Multi-label classification task
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [0, 1]])
assert_raises(Exception, average_precision_score, y_true, y_score,
average="macro")
assert_raises(Exception, average_precision_score, y_true, y_score,
average="weighted")
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 1.)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 1.)
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_raises(Exception, average_precision_score, y_true, y_score,
average="macro")
assert_raises(Exception, average_precision_score, y_true, y_score,
average="weighted")
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 0.625)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 0.625)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_almost_equal(average_precision_score(y_true, y_score,
average="macro"), 0.25)
assert_almost_equal(average_precision_score(y_true, y_score,
average="weighted"), 0.25)
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 0.25)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 0.25)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0.5, 0.5], [0.5, 0.5]])
assert_almost_equal(average_precision_score(y_true, y_score,
average="macro"), 0.75)
assert_almost_equal(average_precision_score(y_true, y_score,
average="weighted"), 0.75)
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 0.75)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 0.75)
def test_score_scale_invariance():
# Test that average_precision_score and roc_auc_score are invariant by
# the scaling or shifting of probabilities
y_true, _, probas_pred = make_prediction(binary=True)
roc_auc = roc_auc_score(y_true, probas_pred)
roc_auc_scaled = roc_auc_score(y_true, 100 * probas_pred)
roc_auc_shifted = roc_auc_score(y_true, probas_pred - 10)
assert_equal(roc_auc, roc_auc_scaled)
assert_equal(roc_auc, roc_auc_shifted)
pr_auc = average_precision_score(y_true, probas_pred)
pr_auc_scaled = average_precision_score(y_true, 100 * probas_pred)
pr_auc_shifted = average_precision_score(y_true, probas_pred - 10)
assert_equal(pr_auc, pr_auc_scaled)
assert_equal(pr_auc, pr_auc_shifted)
def check_lrap_toy(lrap_score):
# Check on several small example that it works
assert_almost_equal(lrap_score([[0, 1]], [[0.25, 0.75]]), 1)
assert_almost_equal(lrap_score([[0, 1]], [[0.75, 0.25]]), 1 / 2)
assert_almost_equal(lrap_score([[1, 1]], [[0.75, 0.25]]), 1)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.25, 0.5, 0.75]]), 1)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.25, 0.5, 0.75]]), 1 / 2)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.25, 0.5, 0.75]]), 1)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.25, 0.5, 0.75]]), 1 / 3)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.25, 0.5, 0.75]]),
(2 / 3 + 1 / 1) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.25, 0.5, 0.75]]),
(2 / 3 + 1 / 2) / 2)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.75, 0.5, 0.25]]), 1 / 3)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.75, 0.5, 0.25]]), 1 / 2)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.75, 0.5, 0.25]]),
(1 / 2 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.75, 0.5, 0.25]]),
(1 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(lrap_score([[1, 1, 1]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.5, 0.75, 0.25]]), 1 / 3)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.5, 0.75, 0.25]]), 1)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.5, 0.75, 0.25]]),
(1 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.5, 0.75, 0.25]]), 1 / 2)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.5, 0.75, 0.25]]),
(1 / 2 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.5, 0.75, 0.25]]), 1)
assert_almost_equal(lrap_score([[1, 1, 1]], [[0.5, 0.75, 0.25]]), 1)
# Tie handling
assert_almost_equal(lrap_score([[1, 0]], [[0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[0, 1]], [[0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[1, 1]], [[0.5, 0.5]]), 1)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.25, 0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.25, 0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.25, 0.5, 0.5]]), 1 / 3)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.25, 0.5, 0.5]]),
(2 / 3 + 1 / 2) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.25, 0.5, 0.5]]),
(2 / 3 + 1 / 2) / 2)
assert_almost_equal(lrap_score([[1, 1, 1]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.5, 0.5, 0.5]]), 2 / 3)
assert_almost_equal(lrap_score([[1, 1, 1, 0]], [[0.5, 0.5, 0.5, 0.5]]),
3 / 4)
def check_zero_or_all_relevant_labels(lrap_score):
random_state = check_random_state(0)
for n_labels in range(2, 5):
y_score = random_state.uniform(size=(1, n_labels))
y_score_ties = np.zeros_like(y_score)
# No relevant labels
y_true = np.zeros((1, n_labels))
assert_equal(lrap_score(y_true, y_score), 1.)
assert_equal(lrap_score(y_true, y_score_ties), 1.)
# Only relevant labels
y_true = np.ones((1, n_labels))
assert_equal(lrap_score(y_true, y_score), 1.)
assert_equal(lrap_score(y_true, y_score_ties), 1.)
# Degenerate case: only one label
assert_almost_equal(lrap_score([[1], [0], [1], [0]],
[[0.5], [0.5], [0.5], [0.5]]), 1.)
def check_lrap_error_raised(lrap_score):
# Raise value error if not appropriate format
assert_raises(ValueError, lrap_score,
[0, 1, 0], [0.25, 0.3, 0.2])
assert_raises(ValueError, lrap_score, [0, 1, 2],
[[0.25, 0.75, 0.0], [0.7, 0.3, 0.0], [0.8, 0.2, 0.0]])
assert_raises(ValueError, lrap_score, [(0), (1), (2)],
[[0.25, 0.75, 0.0], [0.7, 0.3, 0.0], [0.8, 0.2, 0.0]])
# Check that y_true.shape != y_score.shape raise the proper exception
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [0, 1])
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [[0, 1]])
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [[0], [1]])
assert_raises(ValueError, lrap_score, [[0, 1]], [[0, 1], [0, 1]])
assert_raises(ValueError, lrap_score, [[0], [1]], [[0, 1], [0, 1]])
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [[0], [1]])
def check_lrap_only_ties(lrap_score):
# Check tie handling in score
# Basic check with only ties and increasing label space
for n_labels in range(2, 10):
y_score = np.ones((1, n_labels))
# Check for growing number of consecutive relevant
for n_relevant in range(1, n_labels):
# Check for a bunch of positions
for pos in range(n_labels - n_relevant):
y_true = np.zeros((1, n_labels))
y_true[0, pos:pos + n_relevant] = 1
assert_almost_equal(lrap_score(y_true, y_score),
n_relevant / n_labels)
def check_lrap_without_tie_and_increasing_score(lrap_score):
# Check that Label ranking average precision works for various
# Basic check with increasing label space size and decreasing score
for n_labels in range(2, 10):
y_score = n_labels - (np.arange(n_labels).reshape((1, n_labels)) + 1)
# First and last
y_true = np.zeros((1, n_labels))
y_true[0, 0] = 1
y_true[0, -1] = 1
assert_almost_equal(lrap_score(y_true, y_score),
(2 / n_labels + 1) / 2)
# Check for growing number of consecutive relevant label
for n_relevant in range(1, n_labels):
# Check for a bunch of position
for pos in range(n_labels - n_relevant):
y_true = np.zeros((1, n_labels))
y_true[0, pos:pos + n_relevant] = 1
assert_almost_equal(lrap_score(y_true, y_score),
sum((r + 1) / ((pos + r + 1) * n_relevant)
for r in range(n_relevant)))
def _my_lrap(y_true, y_score):
"""Simple implementation of label ranking average precision"""
check_consistent_length(y_true, y_score)
y_true = check_array(y_true)
y_score = check_array(y_score)
n_samples, n_labels = y_true.shape
score = np.empty((n_samples, ))
for i in range(n_samples):
# The best rank correspond to 1. Rank higher than 1 are worse.
# The best inverse ranking correspond to n_labels.
unique_rank, inv_rank = np.unique(y_score[i], return_inverse=True)
n_ranks = unique_rank.size
rank = n_ranks - inv_rank
# Rank need to be corrected to take into account ties
# ex: rank 1 ex aequo means that both label are rank 2.
corr_rank = np.bincount(rank, minlength=n_ranks + 1).cumsum()
rank = corr_rank[rank]
relevant = y_true[i].nonzero()[0]
if relevant.size == 0 or relevant.size == n_labels:
score[i] = 1
continue
score[i] = 0.
for label in relevant:
# Let's count the number of relevant label with better rank
# (smaller rank).
n_ranked_above = sum(rank[r] <= rank[label] for r in relevant)
# Weight by the rank of the actual label
score[i] += n_ranked_above / rank[label]
score[i] /= relevant.size
return score.mean()
def check_alternative_lrap_implementation(lrap_score, n_classes=5,
n_samples=20, random_state=0):
_, y_true = make_multilabel_classification(n_features=1,
allow_unlabeled=False,
random_state=random_state,
n_classes=n_classes,
n_samples=n_samples)
# Score with ties
y_score = sparse_random_matrix(n_components=y_true.shape[0],
n_features=y_true.shape[1],
random_state=random_state)
if hasattr(y_score, "toarray"):
y_score = y_score.toarray()
score_lrap = label_ranking_average_precision_score(y_true, y_score)
score_my_lrap = _my_lrap(y_true, y_score)
assert_almost_equal(score_lrap, score_my_lrap)
# Uniform score
random_state = check_random_state(random_state)
y_score = random_state.uniform(size=(n_samples, n_classes))
score_lrap = label_ranking_average_precision_score(y_true, y_score)
score_my_lrap = _my_lrap(y_true, y_score)
assert_almost_equal(score_lrap, score_my_lrap)
def test_label_ranking_avp():
for fn in [label_ranking_average_precision_score, _my_lrap]:
yield check_lrap_toy, fn
yield check_lrap_without_tie_and_increasing_score, fn
yield check_lrap_only_ties, fn
yield check_zero_or_all_relevant_labels, fn
yield check_lrap_error_raised, label_ranking_average_precision_score
for n_samples, n_classes, random_state in product((1, 2, 8, 20),
(2, 5, 10),
range(1)):
yield (check_alternative_lrap_implementation,
label_ranking_average_precision_score,
n_classes, n_samples, random_state)
def test_coverage_error():
# Toy case
assert_almost_equal(coverage_error([[0, 1]], [[0.25, 0.75]]), 1)
assert_almost_equal(coverage_error([[0, 1]], [[0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 1]], [[0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[0, 0]], [[0.75, 0.25]]), 0)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.25, 0.5, 0.75]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.25, 0.5, 0.75]]), 1)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.25, 0.5, 0.75]]), 2)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.25, 0.5, 0.75]]), 2)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.75, 0.5, 0.25]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.75, 0.5, 0.25]]), 2)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.75, 0.5, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.5, 0.75, 0.25]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.5, 0.75, 0.25]]), 3)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.5, 0.75, 0.25]]), 1)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.5, 0.75, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.5, 0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.5, 0.75, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.5, 0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.5, 0.75, 0.25]]), 3)
# Non trival case
assert_almost_equal(coverage_error([[0, 1, 0], [1, 1, 0]],
[[0.1, 10., -3], [0, 1, 3]]),
(1 + 3) / 2.)
assert_almost_equal(coverage_error([[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [0, 1, 3], [0, 2, 0]]),
(1 + 3 + 3) / 3.)
assert_almost_equal(coverage_error([[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [3, 1, 3], [0, 2, 0]]),
(1 + 3 + 3) / 3.)
def test_coverage_tie_handling():
assert_almost_equal(coverage_error([[0, 0]], [[0.5, 0.5]]), 0)
assert_almost_equal(coverage_error([[1, 0]], [[0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 1]], [[0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[1, 1]], [[0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.25, 0.5, 0.5]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.25, 0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.25, 0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.25, 0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.25, 0.5, 0.5]]), 3)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.25, 0.5, 0.5]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.25, 0.5, 0.5]]), 3)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.25, 0.5, 0.5]]), 3)
def test_label_ranking_loss():
assert_almost_equal(label_ranking_loss([[0, 1]], [[0.25, 0.75]]), 0)
assert_almost_equal(label_ranking_loss([[0, 1]], [[0.75, 0.25]]), 1)
assert_almost_equal(label_ranking_loss([[0, 0, 1]], [[0.25, 0.5, 0.75]]),
0)
assert_almost_equal(label_ranking_loss([[0, 1, 0]], [[0.25, 0.5, 0.75]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[0, 1, 1]], [[0.25, 0.5, 0.75]]),
0)
assert_almost_equal(label_ranking_loss([[1, 0, 0]], [[0.25, 0.5, 0.75]]),
2 / 2)
assert_almost_equal(label_ranking_loss([[1, 0, 1]], [[0.25, 0.5, 0.75]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[1, 1, 0]], [[0.25, 0.5, 0.75]]),
2 / 2)
# Undefined metrics - the ranking doesn't matter
assert_almost_equal(label_ranking_loss([[0, 0]], [[0.75, 0.25]]), 0)
assert_almost_equal(label_ranking_loss([[1, 1]], [[0.75, 0.25]]), 0)
assert_almost_equal(label_ranking_loss([[0, 0]], [[0.5, 0.5]]), 0)
assert_almost_equal(label_ranking_loss([[1, 1]], [[0.5, 0.5]]), 0)
assert_almost_equal(label_ranking_loss([[0, 0, 0]], [[0.5, 0.75, 0.25]]),
0)
assert_almost_equal(label_ranking_loss([[1, 1, 1]], [[0.5, 0.75, 0.25]]),
0)
assert_almost_equal(label_ranking_loss([[0, 0, 0]], [[0.25, 0.5, 0.5]]),
0)
assert_almost_equal(label_ranking_loss([[1, 1, 1]], [[0.25, 0.5, 0.5]]), 0)
# Non trival case
assert_almost_equal(label_ranking_loss([[0, 1, 0], [1, 1, 0]],
[[0.1, 10., -3], [0, 1, 3]]),
(0 + 2 / 2) / 2.)
assert_almost_equal(label_ranking_loss(
[[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [0, 1, 3], [0, 2, 0]]),
(0 + 2 / 2 + 1 / 2) / 3.)
assert_almost_equal(label_ranking_loss(
[[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [3, 1, 3], [0, 2, 0]]),
(0 + 2 / 2 + 1 / 2) / 3.)
# Sparse csr matrices
assert_almost_equal(label_ranking_loss(
csr_matrix(np.array([[0, 1, 0], [1, 1, 0]])),
[[0.1, 10, -3], [3, 1, 3]]),
(0 + 2 / 2) / 2.)
def test_ranking_appropriate_input_shape():
# Check that y_true.shape != y_score.shape raise the proper exception
assert_raises(ValueError, label_ranking_loss, [[0, 1], [0, 1]], [0, 1])
assert_raises(ValueError, label_ranking_loss, [[0, 1], [0, 1]], [[0, 1]])
assert_raises(ValueError, label_ranking_loss,
[[0, 1], [0, 1]], [[0], [1]])
assert_raises(ValueError, label_ranking_loss, [[0, 1]], [[0, 1], [0, 1]])
assert_raises(ValueError, label_ranking_loss,
[[0], [1]], [[0, 1], [0, 1]])
assert_raises(ValueError, label_ranking_loss, [[0, 1], [0, 1]], [[0], [1]])
def test_ranking_loss_ties_handling():
# Tie handling
assert_almost_equal(label_ranking_loss([[1, 0]], [[0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[0, 1]], [[0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[0, 0, 1]], [[0.25, 0.5, 0.5]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[0, 1, 0]], [[0.25, 0.5, 0.5]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[0, 1, 1]], [[0.25, 0.5, 0.5]]), 0)
assert_almost_equal(label_ranking_loss([[1, 0, 0]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[1, 0, 1]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[1, 1, 0]], [[0.25, 0.5, 0.5]]), 1)
| bsd-3-clause |
lucidfrontier45/scikit-learn | sklearn/svm/tests/test_svm.py | 2 | 20512 | """
Testing for Support Vector Machine module (sklearn.svm)
TODO: remove hard coded numerical results when possible
"""
import warnings
import numpy as np
from numpy.testing import (assert_array_equal, assert_array_almost_equal,
assert_almost_equal)
from scipy import sparse
from nose.tools import assert_raises, assert_true, assert_equal, assert_false
from sklearn import svm, linear_model, datasets, metrics, base
from sklearn.datasets.samples_generator import make_classification
from sklearn.metrics import f1_score
from sklearn.utils import check_random_state
from sklearn.utils import ConvergenceWarning
from sklearn.utils.testing import assert_greater, assert_less
# toy sample
X = [[-2, -1], [-1, -1], [-1, -2], [1, 1], [1, 2], [2, 1]]
Y = [1, 1, 1, 2, 2, 2]
T = [[-1, -1], [2, 2], [3, 2]]
true_result = [1, 2, 2]
# also load the iris dataset
iris = datasets.load_iris()
rng = check_random_state(42)
perm = rng.permutation(iris.target.size)
iris.data = iris.data[perm]
iris.target = iris.target[perm]
def test_libsvm_parameters():
"""
Test parameters on classes that make use of libsvm.
"""
clf = svm.SVC(kernel='linear').fit(X, Y)
assert_array_equal(clf.dual_coef_, [[0.25, -.25]])
assert_array_equal(clf.support_, [1, 3])
assert_array_equal(clf.support_vectors_, (X[1], X[3]))
assert_array_equal(clf.intercept_, [0.])
assert_array_equal(clf.predict(X), Y)
def test_libsvm_iris():
"""
Check consistency on dataset iris.
"""
# shuffle the dataset so that labels are not ordered
for k in ('linear', 'rbf'):
clf = svm.SVC(kernel=k).fit(iris.data, iris.target)
assert_greater(np.mean(clf.predict(iris.data) == iris.target), 0.9)
# check deprecated ``label_`` attribute:
with warnings.catch_warnings(record=True):
# catch deprecation warning
assert_array_equal(clf.label_, np.sort(clf.label_))
assert_array_equal(clf.classes_, np.sort(clf.classes_))
# check also the low-level API
model = svm.libsvm.fit(iris.data, iris.target.astype(np.float64))
pred = svm.libsvm.predict(iris.data, *model)
assert_greater(np.mean(pred == iris.target), .95)
model = svm.libsvm.fit(iris.data, iris.target.astype(np.float64),
kernel='linear')
pred = svm.libsvm.predict(iris.data, *model, kernel='linear')
assert_greater(np.mean(pred == iris.target), .95)
pred = svm.libsvm.cross_validation(iris.data,
iris.target.astype(np.float64), 5,
kernel='linear')
assert_greater(np.mean(pred == iris.target), .95)
def test_single_sample_1d():
"""
Test whether SVCs work on a single sample given as a 1-d array
"""
clf = svm.SVC().fit(X, Y)
clf.predict(X[0])
clf = svm.LinearSVC(random_state=0).fit(X, Y)
clf.predict(X[0])
def test_precomputed():
"""
SVC with a precomputed kernel.
We test it with a toy dataset and with iris.
"""
clf = svm.SVC(kernel='precomputed')
# Gram matrix for train data (square matrix)
# (we use just a linear kernel)
K = np.dot(X, np.array(X).T)
clf.fit(K, Y)
# Gram matrix for test data (rectangular matrix)
KT = np.dot(T, np.array(X).T)
pred = clf.predict(KT)
assert_raises(ValueError, clf.predict, KT.T)
assert_array_equal(clf.dual_coef_, [[0.25, -.25]])
assert_array_equal(clf.support_, [1, 3])
assert_array_equal(clf.intercept_, [0])
assert_array_almost_equal(clf.support_, [1, 3])
assert_array_equal(pred, true_result)
# Gram matrix for test data but compute KT[i,j]
# for support vectors j only.
KT = np.zeros_like(KT)
for i in range(len(T)):
for j in clf.support_:
KT[i, j] = np.dot(T[i], X[j])
pred = clf.predict(KT)
assert_array_equal(pred, true_result)
# same as before, but using a callable function instead of the kernel
# matrix. kernel is just a linear kernel
kfunc = lambda x, y: np.dot(x, y.T)
clf = svm.SVC(kernel=kfunc)
clf.fit(X, Y)
pred = clf.predict(T)
assert_array_equal(clf.dual_coef_, [[0.25, -.25]])
assert_array_equal(clf.intercept_, [0])
assert_array_almost_equal(clf.support_, [1, 3])
assert_array_equal(pred, true_result)
# test a precomputed kernel with the iris dataset
# and check parameters against a linear SVC
clf = svm.SVC(kernel='precomputed')
clf2 = svm.SVC(kernel='linear')
K = np.dot(iris.data, iris.data.T)
clf.fit(K, iris.target)
clf2.fit(iris.data, iris.target)
pred = clf.predict(K)
assert_array_almost_equal(clf.support_, clf2.support_)
assert_array_almost_equal(clf.dual_coef_, clf2.dual_coef_)
assert_array_almost_equal(clf.intercept_, clf2.intercept_)
assert_almost_equal(np.mean(pred == iris.target), .99, decimal=2)
# Gram matrix for test data but compute KT[i,j]
# for support vectors j only.
K = np.zeros_like(K)
for i in range(len(iris.data)):
for j in clf.support_:
K[i, j] = np.dot(iris.data[i], iris.data[j])
pred = clf.predict(K)
assert_almost_equal(np.mean(pred == iris.target), .99, decimal=2)
clf = svm.SVC(kernel=kfunc)
clf.fit(iris.data, iris.target)
assert_almost_equal(np.mean(pred == iris.target), .99, decimal=2)
def test_svr():
"""
Test Support Vector Regression
"""
diabetes = datasets.load_diabetes()
for clf in (svm.NuSVR(kernel='linear', nu=.4, C=1.0),
svm.NuSVR(kernel='linear', nu=.4, C=10.),
svm.SVR(kernel='linear', C=10.)):
clf.fit(diabetes.data, diabetes.target)
assert_greater(clf.score(diabetes.data, diabetes.target), 0.02)
def test_svr_errors():
X = [[0.0], [1.0]]
y = [0.0, 0.5]
# Bad kernel
clf = svm.SVR(kernel=lambda x, y: np.array([[1.0]]))
clf.fit(X, y)
assert_raises(ValueError, clf.predict, X)
def test_oneclass():
"""
Test OneClassSVM
"""
clf = svm.OneClassSVM()
clf.fit(X)
pred = clf.predict(T)
assert_array_almost_equal(pred, [-1, -1, -1])
assert_array_almost_equal(clf.intercept_, [-1.008], decimal=3)
assert_array_almost_equal(clf.dual_coef_,
[[0.632, 0.233, 0.633, 0.234, 0.632, 0.633]],
decimal=3)
assert_raises(ValueError, lambda: clf.coef_)
def test_oneclass_decision_function():
"""
Test OneClassSVM decision function
"""
clf = svm.OneClassSVM()
rnd = check_random_state(2)
# Generate train data
X = 0.3 * rnd.randn(100, 2)
X_train = np.r_[X + 2, X - 2]
# Generate some regular novel observations
X = 0.3 * rnd.randn(20, 2)
X_test = np.r_[X + 2, X - 2]
# Generate some abnormal novel observations
X_outliers = rnd.uniform(low=-4, high=4, size=(20, 2))
# fit the model
clf = svm.OneClassSVM(nu=0.1, kernel="rbf", gamma=0.1)
clf.fit(X_train)
# predict things
y_pred_test = clf.predict(X_test)
assert_greater(np.mean(y_pred_test == 1), .9)
y_pred_outliers = clf.predict(X_outliers)
assert_greater(np.mean(y_pred_outliers == -1), .9)
dec_func_test = clf.decision_function(X_test)
assert_array_equal((dec_func_test > 0).ravel(), y_pred_test == 1)
dec_func_outliers = clf.decision_function(X_outliers)
assert_array_equal((dec_func_outliers > 0).ravel(), y_pred_outliers == 1)
def test_tweak_params():
"""
Make sure some tweaking of parameters works.
We change clf.dual_coef_ at run time and expect .predict() to change
accordingly. Notice that this is not trivial since it involves a lot
of C/Python copying in the libsvm bindings.
The success of this test ensures that the mapping between libsvm and
the python classifier is complete.
"""
clf = svm.SVC(kernel='linear', C=1.0)
clf.fit(X, Y)
assert_array_equal(clf.dual_coef_, [[.25, -.25]])
assert_array_equal(clf.predict([[-.1, -.1]]), [1])
clf.dual_coef_ = np.array([[.0, 1.]])
assert_array_equal(clf.predict([[-.1, -.1]]), [2])
def test_probability():
"""
Predict probabilities using SVC
This uses cross validation, so we use a slightly bigger testing set.
"""
for clf in (svm.SVC(probability=True, C=1.0),
svm.NuSVC(probability=True)):
clf.fit(iris.data, iris.target)
prob_predict = clf.predict_proba(iris.data)
assert_array_almost_equal(
np.sum(prob_predict, 1), np.ones(iris.data.shape[0]))
assert_true(np.mean(np.argmax(prob_predict, 1)
== clf.predict(iris.data)) > 0.9)
assert_almost_equal(clf.predict_proba(iris.data),
np.exp(clf.predict_log_proba(iris.data)), 8)
def test_decision_function():
"""
Test decision_function
Sanity check, test that decision_function implemented in python
returns the same as the one in libsvm
"""
# multi class:
clf = svm.SVC(kernel='linear', C=0.1).fit(iris.data, iris.target)
dec = np.dot(iris.data, clf.coef_.T) + clf.intercept_
assert_array_almost_equal(dec, clf.decision_function(iris.data))
# binary:
clf.fit(X, Y)
dec = np.dot(X, clf.coef_.T) + clf.intercept_
prediction = clf.predict(X)
assert_array_almost_equal(dec, clf.decision_function(X))
assert_array_almost_equal(
prediction,
clf.classes_[(clf.decision_function(X) > 0).astype(np.int).ravel()])
expected = np.array([[-1.], [-0.66], [-1.], [0.66], [1.], [1.]])
assert_array_almost_equal(clf.decision_function(X), expected, 2)
def test_weight():
"""
Test class weights
"""
clf = svm.SVC(class_weight={1: 0.1})
# we give a small weights to class 1
clf.fit(X, Y)
# so all predicted values belong to class 2
assert_array_almost_equal(clf.predict(X), [2] * 6)
X_, y_ = make_classification(n_samples=200, n_features=10,
weights=[0.833, 0.167], random_state=2)
for clf in (linear_model.LogisticRegression(),
svm.LinearSVC(random_state=0), svm.SVC()):
clf.set_params(class_weight={0: .1, 1: 10})
clf.fit(X_[:100], y_[:100])
y_pred = clf.predict(X_[100:])
assert_true(f1_score(y_[100:], y_pred) > .3)
def test_sample_weights():
"""
Test weights on individual samples
"""
# TODO: check on NuSVR, OneClass, etc.
clf = svm.SVC()
clf.fit(X, Y)
assert_array_equal(clf.predict(X[2]), [1.])
sample_weight = [.1] * 3 + [10] * 3
clf.fit(X, Y, sample_weight=sample_weight)
assert_array_equal(clf.predict(X[2]), [2.])
def test_auto_weight():
"""Test class weights for imbalanced data"""
from sklearn.linear_model import LogisticRegression
# we take as dataset a the two-dimensional projection of iris so
# that it is not separable and remove half of predictors from
# class 1
from sklearn.utils import compute_class_weight
X, y = iris.data[:, :2], iris.target
unbalanced = np.delete(np.arange(y.size), np.where(y > 1)[0][::2])
classes = np.unique(y[unbalanced])
class_weights = compute_class_weight('auto', classes, y[unbalanced])
assert_true(np.argmax(class_weights) == 2)
for clf in (svm.SVC(kernel='linear'), svm.LinearSVC(random_state=0),
LogisticRegression()):
# check that score is better when class='auto' is set.
y_pred = clf.fit(X[unbalanced], y[unbalanced]).predict(X)
clf.set_params(class_weight='auto')
y_pred_balanced = clf.fit(X[unbalanced], y[unbalanced],).predict(X)
assert_true(metrics.f1_score(y, y_pred)
<= metrics.f1_score(y, y_pred_balanced))
def test_bad_input():
"""
Test that it gives proper exception on deficient input
"""
# impossible value of C
assert_raises(ValueError, svm.SVC(C=-1).fit, X, Y)
# impossible value of nu
clf = svm.NuSVC(nu=0.0)
assert_raises(ValueError, clf.fit, X, Y)
Y2 = Y[:-1] # wrong dimensions for labels
assert_raises(ValueError, clf.fit, X, Y2)
# Test with arrays that are non-contiguous.
for clf in (svm.SVC(), svm.LinearSVC(random_state=0)):
Xf = np.asfortranarray(X)
assert_false(Xf.flags['C_CONTIGUOUS'])
yf = np.ascontiguousarray(np.tile(Y, (2, 1)).T)
yf = yf[:, -1]
assert_false(yf.flags['F_CONTIGUOUS'])
assert_false(yf.flags['C_CONTIGUOUS'])
clf.fit(Xf, yf)
assert_array_equal(clf.predict(T), true_result)
# error for precomputed kernelsx
clf = svm.SVC(kernel='precomputed')
assert_raises(ValueError, clf.fit, X, Y)
# sample_weight bad dimensions
clf = svm.SVC()
assert_raises(ValueError, clf.fit, X, Y, sample_weight=range(len(X) - 1))
# predict with sparse input when trained with dense
clf = svm.SVC().fit(X, Y)
assert_raises(ValueError, clf.predict, sparse.lil_matrix(X))
Xt = np.array(X).T
clf.fit(np.dot(X, Xt), Y)
assert_raises(ValueError, clf.predict, X)
clf = svm.SVC()
clf.fit(X, Y)
assert_raises(ValueError, clf.predict, Xt)
def test_linearsvc_parameters():
"""
Test possible parameter combinations in LinearSVC
"""
# generate list of possible parameter combinations
params = [(dual, loss, penalty) for dual in [True, False]
for loss in ['l1', 'l2', 'lr'] for penalty in ['l1', 'l2']]
for dual, loss, penalty in params:
if loss == 'l1' and penalty == 'l1':
assert_raises(ValueError, svm.LinearSVC, penalty=penalty,
loss=loss, dual=dual)
elif loss == 'l1' and penalty == 'l2' and not dual:
assert_raises(ValueError, svm.LinearSVC, penalty=penalty,
loss=loss, dual=dual)
elif penalty == 'l1' and dual:
assert_raises(ValueError, svm.LinearSVC, penalty=penalty,
loss=loss, dual=dual)
else:
svm.LinearSVC(penalty=penalty, loss=loss, dual=dual)
def test_linearsvc():
"""
Test basic routines using LinearSVC
"""
clf = svm.LinearSVC(random_state=0).fit(X, Y)
# by default should have intercept
assert_true(clf.fit_intercept)
assert_array_equal(clf.predict(T), true_result)
assert_array_almost_equal(clf.intercept_, [0], decimal=3)
# the same with l1 penalty
clf = svm.LinearSVC(penalty='l1', dual=False, random_state=0).fit(X, Y)
assert_array_equal(clf.predict(T), true_result)
# l2 penalty with dual formulation
clf = svm.LinearSVC(penalty='l2', dual=True, random_state=0).fit(X, Y)
assert_array_equal(clf.predict(T), true_result)
# l2 penalty, l1 loss
clf = svm.LinearSVC(penalty='l2', loss='l1', dual=True, random_state=0)
clf.fit(X, Y)
assert_array_equal(clf.predict(T), true_result)
# test also decision function
dec = clf.decision_function(T)
res = (dec > 0).astype(np.int) + 1
assert_array_equal(res, true_result)
def test_linearsvc_crammer_singer():
"""Test LinearSVC with crammer_singer multi-class svm"""
ovr_clf = svm.LinearSVC(random_state=0).fit(iris.data, iris.target)
cs_clf = svm.LinearSVC(multi_class='crammer_singer', random_state=0)
cs_clf.fit(iris.data, iris.target)
# similar prediction for ovr and crammer-singer:
assert_true((ovr_clf.predict(iris.data) ==
cs_clf.predict(iris.data)).mean() > .9)
# classifiers shouldn't be the same
assert_true((ovr_clf.coef_ != cs_clf.coef_).all())
# test decision function
assert_array_equal(cs_clf.predict(iris.data),
np.argmax(cs_clf.decision_function(iris.data), axis=1))
dec_func = np.dot(iris.data, cs_clf.coef_.T) + cs_clf.intercept_
assert_array_almost_equal(dec_func, cs_clf.decision_function(iris.data))
def test_linearsvc_iris():
"""
Test that LinearSVC gives plausible predictions on the iris dataset
Also, test symbolic class names (classes_).
"""
target = iris.target_names[iris.target]
clf = svm.LinearSVC(random_state=0).fit(iris.data, target)
assert_equal(set(clf.classes_), set(iris.target_names))
assert_greater(np.mean(clf.predict(iris.data) == target), 0.8)
dec = clf.decision_function(iris.data)
pred = iris.target_names[np.argmax(dec, 1)]
assert_array_equal(pred, clf.predict(iris.data))
def test_dense_liblinear_intercept_handling(classifier=svm.LinearSVC):
"""
Test that dense liblinear honours intercept_scaling param
"""
X = [[2, 1],
[3, 1],
[1, 3],
[2, 3]]
y = [0, 0, 1, 1]
clf = classifier(fit_intercept=True, penalty='l1', loss='l2',
dual=False, C=4, tol=1e-7, random_state=0)
assert_true(clf.intercept_scaling == 1, clf.intercept_scaling)
assert_true(clf.fit_intercept)
# when intercept_scaling is low the intercept value is highly "penalized"
# by regularization
clf.intercept_scaling = 1
clf.fit(X, y)
assert_almost_equal(clf.intercept_, 0, decimal=5)
# when intercept_scaling is sufficiently high, the intercept value
# is not affected by regularization
clf.intercept_scaling = 100
clf.fit(X, y)
intercept1 = clf.intercept_
assert_less(intercept1, -1)
# when intercept_scaling is sufficiently high, the intercept value
# doesn't depend on intercept_scaling value
clf.intercept_scaling = 1000
clf.fit(X, y)
intercept2 = clf.intercept_
assert_array_almost_equal(intercept1, intercept2, decimal=2)
def test_liblinear_set_coef():
# multi-class case
clf = svm.LinearSVC().fit(iris.data, iris.target)
values = clf.decision_function(iris.data)
clf.coef_ = clf.coef_.copy()
clf.intercept_ = clf.intercept_.copy()
values2 = clf.decision_function(iris.data)
assert_array_almost_equal(values, values2)
# binary-class case
X = [[2, 1],
[3, 1],
[1, 3],
[2, 3]]
y = [0, 0, 1, 1]
clf = svm.LinearSVC().fit(X, y)
values = clf.decision_function(X)
clf.coef_ = clf.coef_.copy()
clf.intercept_ = clf.intercept_.copy()
values2 = clf.decision_function(X)
assert_array_equal(values, values2)
def test_immutable_coef_property():
"""Check that primal coef modification are not silently ignored"""
svms = [
svm.SVC(kernel='linear').fit(iris.data, iris.target),
svm.NuSVC(kernel='linear').fit(iris.data, iris.target),
svm.SVR(kernel='linear').fit(iris.data, iris.target),
svm.NuSVR(kernel='linear').fit(iris.data, iris.target),
svm.OneClassSVM(kernel='linear').fit(iris.data),
]
for clf in svms:
assert_raises(AttributeError, clf.__setattr__, 'coef_', np.arange(3))
assert_raises((RuntimeError, ValueError),
clf.coef_.__setitem__, (0, 0), 0)
def test_inheritance():
# check that SVC classes can do inheritance
class ChildSVC(svm.SVC):
def __init__(self, foo=0):
self.foo = foo
svm.SVC.__init__(self)
clf = ChildSVC()
clf.fit(iris.data, iris.target)
clf.predict(iris.data[-1])
clf.decision_function(iris.data[-1])
def test_linearsvc_verbose():
# stdout: redirect
import os
stdout = os.dup(1) # save original stdout
os.dup2(os.pipe()[1], 1) # replace it
# actual call
clf = svm.LinearSVC(verbose=1)
clf.fit(X, Y)
# stdout: restore
os.dup2(stdout, 1) # restore original stdout
def test_svc_clone_with_callable_kernel():
a = svm.SVC(kernel=lambda x, y: np.dot(x, y.T), probability=True)
b = base.clone(a)
b.fit(X, Y)
b.predict(X)
b.predict_proba(X)
b.decision_function(X)
def test_svc_bad_kernel():
svc = svm.SVC(kernel=lambda x, y: x)
assert_raises(ValueError, svc.fit, X, Y)
def test_timeout():
a = svm.SVC(kernel=lambda x, y: np.dot(x, y.T), probability=True,
max_iter=1)
with warnings.catch_warnings(record=True) as foo:
# Hackish way to reset the warning counter
from sklearn.svm import base
base.__warningregistry__ = {}
warnings.simplefilter("always")
a.fit(X, Y)
assert_equal(len(foo), 1, msg=foo)
assert_equal(foo[0].category, ConvergenceWarning, msg=foo[0].category)
if __name__ == '__main__':
import nose
nose.runmodule()
| bsd-3-clause |
alexeyum/scikit-learn | examples/cluster/plot_kmeans_silhouette_analysis.py | 82 | 5888 | """
===============================================================================
Selecting the number of clusters with silhouette analysis on KMeans clustering
===============================================================================
Silhouette analysis can be used to study the separation distance between the
resulting clusters. The silhouette plot displays a measure of how close each
point in one cluster is to points in the neighboring clusters and thus provides
a way to assess parameters like number of clusters visually. This measure has a
range of [-1, 1].
Silhouette coefficients (as these values are referred to as) near +1 indicate
that the sample is far away from the neighboring clusters. A value of 0
indicates that the sample is on or very close to the decision boundary between
two neighboring clusters and negative values indicate that those samples might
have been assigned to the wrong cluster.
In this example the silhouette analysis is used to choose an optimal value for
``n_clusters``. The silhouette plot shows that the ``n_clusters`` value of 3, 5
and 6 are a bad pick for the given data due to the presence of clusters with
below average silhouette scores and also due to wide fluctuations in the size
of the silhouette plots. Silhouette analysis is more ambivalent in deciding
between 2 and 4.
Also from the thickness of the silhouette plot the cluster size can be
visualized. The silhouette plot for cluster 0 when ``n_clusters`` is equal to
2, is bigger in size owing to the grouping of the 3 sub clusters into one big
cluster. However when the ``n_clusters`` is equal to 4, all the plots are more
or less of similar thickness and hence are of similar sizes as can be also
verified from the labelled scatter plot on the right.
"""
from __future__ import print_function
from sklearn.datasets import make_blobs
from sklearn.cluster import KMeans
from sklearn.metrics import silhouette_samples, silhouette_score
import matplotlib.pyplot as plt
import matplotlib.cm as cm
import numpy as np
print(__doc__)
# Generating the sample data from make_blobs
# This particular setting has one distinct cluster and 3 clusters placed close
# together.
X, y = make_blobs(n_samples=500,
n_features=2,
centers=4,
cluster_std=1,
center_box=(-10.0, 10.0),
shuffle=True,
random_state=1) # For reproducibility
range_n_clusters = [2, 3, 4, 5, 6]
for n_clusters in range_n_clusters:
# Create a subplot with 1 row and 2 columns
fig, (ax1, ax2) = plt.subplots(1, 2)
fig.set_size_inches(18, 7)
# The 1st subplot is the silhouette plot
# The silhouette coefficient can range from -1, 1 but in this example all
# lie within [-0.1, 1]
ax1.set_xlim([-0.1, 1])
# The (n_clusters+1)*10 is for inserting blank space between silhouette
# plots of individual clusters, to demarcate them clearly.
ax1.set_ylim([0, len(X) + (n_clusters + 1) * 10])
# Initialize the clusterer with n_clusters value and a random generator
# seed of 10 for reproducibility.
clusterer = KMeans(n_clusters=n_clusters, random_state=10)
cluster_labels = clusterer.fit_predict(X)
# The silhouette_score gives the average value for all the samples.
# This gives a perspective into the density and separation of the formed
# clusters
silhouette_avg = silhouette_score(X, cluster_labels)
print("For n_clusters =", n_clusters,
"The average silhouette_score is :", silhouette_avg)
# Compute the silhouette scores for each sample
sample_silhouette_values = silhouette_samples(X, cluster_labels)
y_lower = 10
for i in range(n_clusters):
# Aggregate the silhouette scores for samples belonging to
# cluster i, and sort them
ith_cluster_silhouette_values = \
sample_silhouette_values[cluster_labels == i]
ith_cluster_silhouette_values.sort()
size_cluster_i = ith_cluster_silhouette_values.shape[0]
y_upper = y_lower + size_cluster_i
color = cm.spectral(float(i) / n_clusters)
ax1.fill_betweenx(np.arange(y_lower, y_upper),
0, ith_cluster_silhouette_values,
facecolor=color, edgecolor=color, alpha=0.7)
# Label the silhouette plots with their cluster numbers at the middle
ax1.text(-0.05, y_lower + 0.5 * size_cluster_i, str(i))
# Compute the new y_lower for next plot
y_lower = y_upper + 10 # 10 for the 0 samples
ax1.set_title("The silhouette plot for the various clusters.")
ax1.set_xlabel("The silhouette coefficient values")
ax1.set_ylabel("Cluster label")
# The vertical line for average silhouette score of all the values
ax1.axvline(x=silhouette_avg, color="red", linestyle="--")
ax1.set_yticks([]) # Clear the yaxis labels / ticks
ax1.set_xticks([-0.1, 0, 0.2, 0.4, 0.6, 0.8, 1])
# 2nd Plot showing the actual clusters formed
colors = cm.spectral(cluster_labels.astype(float) / n_clusters)
ax2.scatter(X[:, 0], X[:, 1], marker='.', s=30, lw=0, alpha=0.7,
c=colors)
# Labeling the clusters
centers = clusterer.cluster_centers_
# Draw white circles at cluster centers
ax2.scatter(centers[:, 0], centers[:, 1],
marker='o', c="white", alpha=1, s=200)
for i, c in enumerate(centers):
ax2.scatter(c[0], c[1], marker='$%d$' % i, alpha=1, s=50)
ax2.set_title("The visualization of the clustered data.")
ax2.set_xlabel("Feature space for the 1st feature")
ax2.set_ylabel("Feature space for the 2nd feature")
plt.suptitle(("Silhouette analysis for KMeans clustering on sample data "
"with n_clusters = %d" % n_clusters),
fontsize=14, fontweight='bold')
plt.show()
| bsd-3-clause |
DSLituiev/scikit-learn | examples/text/document_classification_20newsgroups.py | 36 | 10499 | """
======================================================
Classification of text documents using sparse features
======================================================
This is an example showing how scikit-learn can be used to classify documents
by topics using a bag-of-words approach. This example uses a scipy.sparse
matrix to store the features and demonstrates various classifiers that can
efficiently handle sparse matrices.
The dataset used in this example is the 20 newsgroups dataset. It will be
automatically downloaded, then cached.
The bar plot indicates the accuracy, training time (normalized) and test time
(normalized) of each classifier.
"""
# Author: Peter Prettenhofer <peter.prettenhofer@gmail.com>
# Olivier Grisel <olivier.grisel@ensta.org>
# Mathieu Blondel <mathieu@mblondel.org>
# Lars Buitinck
# License: BSD 3 clause
from __future__ import print_function
import logging
import numpy as np
from optparse import OptionParser
import sys
from time import time
import matplotlib.pyplot as plt
from sklearn.datasets import fetch_20newsgroups
from sklearn.feature_extraction.text import TfidfVectorizer
from sklearn.feature_extraction.text import HashingVectorizer
from sklearn.feature_selection import SelectKBest, chi2
from sklearn.linear_model import RidgeClassifier
from sklearn.pipeline import Pipeline
from sklearn.svm import LinearSVC
from sklearn.linear_model import SGDClassifier
from sklearn.linear_model import Perceptron
from sklearn.linear_model import PassiveAggressiveClassifier
from sklearn.naive_bayes import BernoulliNB, MultinomialNB
from sklearn.neighbors import KNeighborsClassifier
from sklearn.neighbors import NearestCentroid
from sklearn.ensemble import RandomForestClassifier
from sklearn.utils.extmath import density
from sklearn import metrics
# Display progress logs on stdout
logging.basicConfig(level=logging.INFO,
format='%(asctime)s %(levelname)s %(message)s')
# parse commandline arguments
op = OptionParser()
op.add_option("--report",
action="store_true", dest="print_report",
help="Print a detailed classification report.")
op.add_option("--chi2_select",
action="store", type="int", dest="select_chi2",
help="Select some number of features using a chi-squared test")
op.add_option("--confusion_matrix",
action="store_true", dest="print_cm",
help="Print the confusion matrix.")
op.add_option("--top10",
action="store_true", dest="print_top10",
help="Print ten most discriminative terms per class"
" for every classifier.")
op.add_option("--all_categories",
action="store_true", dest="all_categories",
help="Whether to use all categories or not.")
op.add_option("--use_hashing",
action="store_true",
help="Use a hashing vectorizer.")
op.add_option("--n_features",
action="store", type=int, default=2 ** 16,
help="n_features when using the hashing vectorizer.")
op.add_option("--filtered",
action="store_true",
help="Remove newsgroup information that is easily overfit: "
"headers, signatures, and quoting.")
(opts, args) = op.parse_args()
if len(args) > 0:
op.error("this script takes no arguments.")
sys.exit(1)
print(__doc__)
op.print_help()
print()
###############################################################################
# Load some categories from the training set
if opts.all_categories:
categories = None
else:
categories = [
'alt.atheism',
'talk.religion.misc',
'comp.graphics',
'sci.space',
]
if opts.filtered:
remove = ('headers', 'footers', 'quotes')
else:
remove = ()
print("Loading 20 newsgroups dataset for categories:")
print(categories if categories else "all")
data_train = fetch_20newsgroups(subset='train', categories=categories,
shuffle=True, random_state=42,
remove=remove)
data_test = fetch_20newsgroups(subset='test', categories=categories,
shuffle=True, random_state=42,
remove=remove)
print('data loaded')
categories = data_train.target_names # for case categories == None
def size_mb(docs):
return sum(len(s.encode('utf-8')) for s in docs) / 1e6
data_train_size_mb = size_mb(data_train.data)
data_test_size_mb = size_mb(data_test.data)
print("%d documents - %0.3fMB (training set)" % (
len(data_train.data), data_train_size_mb))
print("%d documents - %0.3fMB (test set)" % (
len(data_test.data), data_test_size_mb))
print("%d categories" % len(categories))
print()
# split a training set and a test set
y_train, y_test = data_train.target, data_test.target
print("Extracting features from the training data using a sparse vectorizer")
t0 = time()
if opts.use_hashing:
vectorizer = HashingVectorizer(stop_words='english', non_negative=True,
n_features=opts.n_features)
X_train = vectorizer.transform(data_train.data)
else:
vectorizer = TfidfVectorizer(sublinear_tf=True, max_df=0.5,
stop_words='english')
X_train = vectorizer.fit_transform(data_train.data)
duration = time() - t0
print("done in %fs at %0.3fMB/s" % (duration, data_train_size_mb / duration))
print("n_samples: %d, n_features: %d" % X_train.shape)
print()
print("Extracting features from the test data using the same vectorizer")
t0 = time()
X_test = vectorizer.transform(data_test.data)
duration = time() - t0
print("done in %fs at %0.3fMB/s" % (duration, data_test_size_mb / duration))
print("n_samples: %d, n_features: %d" % X_test.shape)
print()
# mapping from integer feature name to original token string
if opts.use_hashing:
feature_names = None
else:
feature_names = vectorizer.get_feature_names()
if opts.select_chi2:
print("Extracting %d best features by a chi-squared test" %
opts.select_chi2)
t0 = time()
ch2 = SelectKBest(chi2, k=opts.select_chi2)
X_train = ch2.fit_transform(X_train, y_train)
X_test = ch2.transform(X_test)
if feature_names:
# keep selected feature names
feature_names = [feature_names[i] for i
in ch2.get_support(indices=True)]
print("done in %fs" % (time() - t0))
print()
if feature_names:
feature_names = np.asarray(feature_names)
def trim(s):
"""Trim string to fit on terminal (assuming 80-column display)"""
return s if len(s) <= 80 else s[:77] + "..."
###############################################################################
# Benchmark classifiers
def benchmark(clf):
print('_' * 80)
print("Training: ")
print(clf)
t0 = time()
clf.fit(X_train, y_train)
train_time = time() - t0
print("train time: %0.3fs" % train_time)
t0 = time()
pred = clf.predict(X_test)
test_time = time() - t0
print("test time: %0.3fs" % test_time)
score = metrics.accuracy_score(y_test, pred)
print("accuracy: %0.3f" % score)
if hasattr(clf, 'coef_'):
print("dimensionality: %d" % clf.coef_.shape[1])
print("density: %f" % density(clf.coef_))
if opts.print_top10 and feature_names is not None:
print("top 10 keywords per class:")
for i, category in enumerate(categories):
top10 = np.argsort(clf.coef_[i])[-10:]
print(trim("%s: %s"
% (category, " ".join(feature_names[top10]))))
print()
if opts.print_report:
print("classification report:")
print(metrics.classification_report(y_test, pred,
target_names=categories))
if opts.print_cm:
print("confusion matrix:")
print(metrics.confusion_matrix(y_test, pred))
print()
clf_descr = str(clf).split('(')[0]
return clf_descr, score, train_time, test_time
results = []
for clf, name in (
(RidgeClassifier(tol=1e-2, solver="lsqr"), "Ridge Classifier"),
(Perceptron(n_iter=50), "Perceptron"),
(PassiveAggressiveClassifier(n_iter=50), "Passive-Aggressive"),
(KNeighborsClassifier(n_neighbors=10), "kNN"),
(RandomForestClassifier(n_estimators=100), "Random forest")):
print('=' * 80)
print(name)
results.append(benchmark(clf))
for penalty in ["l2", "l1"]:
print('=' * 80)
print("%s penalty" % penalty.upper())
# Train Liblinear model
results.append(benchmark(LinearSVC(loss='l2', penalty=penalty,
dual=False, tol=1e-3)))
# Train SGD model
results.append(benchmark(SGDClassifier(alpha=.0001, n_iter=50,
penalty=penalty)))
# Train SGD with Elastic Net penalty
print('=' * 80)
print("Elastic-Net penalty")
results.append(benchmark(SGDClassifier(alpha=.0001, n_iter=50,
penalty="elasticnet")))
# Train NearestCentroid without threshold
print('=' * 80)
print("NearestCentroid (aka Rocchio classifier)")
results.append(benchmark(NearestCentroid()))
# Train sparse Naive Bayes classifiers
print('=' * 80)
print("Naive Bayes")
results.append(benchmark(MultinomialNB(alpha=.01)))
results.append(benchmark(BernoulliNB(alpha=.01)))
print('=' * 80)
print("LinearSVC with L1-based feature selection")
# The smaller C, the stronger the regularization.
# The more regularization, the more sparsity.
results.append(benchmark(Pipeline([
('feature_selection', LinearSVC(penalty="l1", dual=False, tol=1e-3)),
('classification', LinearSVC())
])))
# make some plots
indices = np.arange(len(results))
results = [[x[i] for x in results] for i in range(4)]
clf_names, score, training_time, test_time = results
training_time = np.array(training_time) / np.max(training_time)
test_time = np.array(test_time) / np.max(test_time)
plt.figure(figsize=(12, 8))
plt.title("Score")
plt.barh(indices, score, .2, label="score", color='navy')
plt.barh(indices + .3, training_time, .2, label="training time",
color='c')
plt.barh(indices + .6, test_time, .2, label="test time", color='darkorange')
plt.yticks(())
plt.legend(loc='best')
plt.subplots_adjust(left=.25)
plt.subplots_adjust(top=.95)
plt.subplots_adjust(bottom=.05)
for i, c in zip(indices, clf_names):
plt.text(-.3, i, c)
plt.show()
| bsd-3-clause |
BiaDarkia/scikit-learn | sklearn/cluster/tests/test_dbscan.py | 55 | 13916 | """
Tests for DBSCAN clustering algorithm
"""
import pickle
import numpy as np
from scipy.spatial import distance
from scipy import sparse
from sklearn.utils.testing import assert_equal
from sklearn.utils.testing import assert_array_equal
from sklearn.utils.testing import assert_raises
from sklearn.utils.testing import assert_in
from sklearn.utils.testing import assert_not_in
from sklearn.neighbors import NearestNeighbors
from sklearn.cluster.dbscan_ import DBSCAN
from sklearn.cluster.dbscan_ import dbscan
from sklearn.cluster.tests.common import generate_clustered_data
from sklearn.metrics.pairwise import pairwise_distances
n_clusters = 3
X = generate_clustered_data(n_clusters=n_clusters)
def test_dbscan_similarity():
# Tests the DBSCAN algorithm with a similarity array.
# Parameters chosen specifically for this task.
eps = 0.15
min_samples = 10
# Compute similarities
D = distance.squareform(distance.pdist(X))
D /= np.max(D)
# Compute DBSCAN
core_samples, labels = dbscan(D, metric="precomputed", eps=eps,
min_samples=min_samples)
# number of clusters, ignoring noise if present
n_clusters_1 = len(set(labels)) - (1 if -1 in labels else 0)
assert_equal(n_clusters_1, n_clusters)
db = DBSCAN(metric="precomputed", eps=eps, min_samples=min_samples)
labels = db.fit(D).labels_
n_clusters_2 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_2, n_clusters)
def test_dbscan_feature():
# Tests the DBSCAN algorithm with a feature vector array.
# Parameters chosen specifically for this task.
# Different eps to other test, because distance is not normalised.
eps = 0.8
min_samples = 10
metric = 'euclidean'
# Compute DBSCAN
# parameters chosen for task
core_samples, labels = dbscan(X, metric=metric, eps=eps,
min_samples=min_samples)
# number of clusters, ignoring noise if present
n_clusters_1 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_1, n_clusters)
db = DBSCAN(metric=metric, eps=eps, min_samples=min_samples)
labels = db.fit(X).labels_
n_clusters_2 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_2, n_clusters)
def test_dbscan_sparse():
core_sparse, labels_sparse = dbscan(sparse.lil_matrix(X), eps=.8,
min_samples=10)
core_dense, labels_dense = dbscan(X, eps=.8, min_samples=10)
assert_array_equal(core_dense, core_sparse)
assert_array_equal(labels_dense, labels_sparse)
def test_dbscan_sparse_precomputed():
D = pairwise_distances(X)
nn = NearestNeighbors(radius=.9).fit(X)
D_sparse = nn.radius_neighbors_graph(mode='distance')
# Ensure it is sparse not merely on diagonals:
assert D_sparse.nnz < D.shape[0] * (D.shape[0] - 1)
core_sparse, labels_sparse = dbscan(D_sparse,
eps=.8,
min_samples=10,
metric='precomputed')
core_dense, labels_dense = dbscan(D, eps=.8, min_samples=10,
metric='precomputed')
assert_array_equal(core_dense, core_sparse)
assert_array_equal(labels_dense, labels_sparse)
def test_dbscan_no_core_samples():
rng = np.random.RandomState(0)
X = rng.rand(40, 10)
X[X < .8] = 0
for X_ in [X, sparse.csr_matrix(X)]:
db = DBSCAN(min_samples=6).fit(X_)
assert_array_equal(db.components_, np.empty((0, X_.shape[1])))
assert_array_equal(db.labels_, -1)
assert_equal(db.core_sample_indices_.shape, (0,))
def test_dbscan_callable():
# Tests the DBSCAN algorithm with a callable metric.
# Parameters chosen specifically for this task.
# Different eps to other test, because distance is not normalised.
eps = 0.8
min_samples = 10
# metric is the function reference, not the string key.
metric = distance.euclidean
# Compute DBSCAN
# parameters chosen for task
core_samples, labels = dbscan(X, metric=metric, eps=eps,
min_samples=min_samples,
algorithm='ball_tree')
# number of clusters, ignoring noise if present
n_clusters_1 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_1, n_clusters)
db = DBSCAN(metric=metric, eps=eps, min_samples=min_samples,
algorithm='ball_tree')
labels = db.fit(X).labels_
n_clusters_2 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_2, n_clusters)
def test_dbscan_metric_params():
# Tests that DBSCAN works with the metrics_params argument.
eps = 0.8
min_samples = 10
p = 1
# Compute DBSCAN with metric_params arg
db = DBSCAN(metric='minkowski', metric_params={'p': p}, eps=eps,
min_samples=min_samples, algorithm='ball_tree').fit(X)
core_sample_1, labels_1 = db.core_sample_indices_, db.labels_
# Test that sample labels are the same as passing Minkowski 'p' directly
db = DBSCAN(metric='minkowski', eps=eps, min_samples=min_samples,
algorithm='ball_tree', p=p).fit(X)
core_sample_2, labels_2 = db.core_sample_indices_, db.labels_
assert_array_equal(core_sample_1, core_sample_2)
assert_array_equal(labels_1, labels_2)
# Minkowski with p=1 should be equivalent to Manhattan distance
db = DBSCAN(metric='manhattan', eps=eps, min_samples=min_samples,
algorithm='ball_tree').fit(X)
core_sample_3, labels_3 = db.core_sample_indices_, db.labels_
assert_array_equal(core_sample_1, core_sample_3)
assert_array_equal(labels_1, labels_3)
def test_dbscan_balltree():
# Tests the DBSCAN algorithm with balltree for neighbor calculation.
eps = 0.8
min_samples = 10
D = pairwise_distances(X)
core_samples, labels = dbscan(D, metric="precomputed", eps=eps,
min_samples=min_samples)
# number of clusters, ignoring noise if present
n_clusters_1 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_1, n_clusters)
db = DBSCAN(p=2.0, eps=eps, min_samples=min_samples, algorithm='ball_tree')
labels = db.fit(X).labels_
n_clusters_2 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_2, n_clusters)
db = DBSCAN(p=2.0, eps=eps, min_samples=min_samples, algorithm='kd_tree')
labels = db.fit(X).labels_
n_clusters_3 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_3, n_clusters)
db = DBSCAN(p=1.0, eps=eps, min_samples=min_samples, algorithm='ball_tree')
labels = db.fit(X).labels_
n_clusters_4 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_4, n_clusters)
db = DBSCAN(leaf_size=20, eps=eps, min_samples=min_samples,
algorithm='ball_tree')
labels = db.fit(X).labels_
n_clusters_5 = len(set(labels)) - int(-1 in labels)
assert_equal(n_clusters_5, n_clusters)
def test_input_validation():
# DBSCAN.fit should accept a list of lists.
X = [[1., 2.], [3., 4.]]
DBSCAN().fit(X) # must not raise exception
def test_dbscan_badargs():
# Test bad argument values: these should all raise ValueErrors
assert_raises(ValueError,
dbscan,
X, eps=-1.0)
assert_raises(ValueError,
dbscan,
X, algorithm='blah')
assert_raises(ValueError,
dbscan,
X, metric='blah')
assert_raises(ValueError,
dbscan,
X, leaf_size=-1)
assert_raises(ValueError,
dbscan,
X, p=-1)
def test_pickle():
obj = DBSCAN()
s = pickle.dumps(obj)
assert_equal(type(pickle.loads(s)), obj.__class__)
def test_boundaries():
# ensure min_samples is inclusive of core point
core, _ = dbscan([[0], [1]], eps=2, min_samples=2)
assert_in(0, core)
# ensure eps is inclusive of circumference
core, _ = dbscan([[0], [1], [1]], eps=1, min_samples=2)
assert_in(0, core)
core, _ = dbscan([[0], [1], [1]], eps=.99, min_samples=2)
assert_not_in(0, core)
def test_weighted_dbscan():
# ensure sample_weight is validated
assert_raises(ValueError, dbscan, [[0], [1]], sample_weight=[2])
assert_raises(ValueError, dbscan, [[0], [1]], sample_weight=[2, 3, 4])
# ensure sample_weight has an effect
assert_array_equal([], dbscan([[0], [1]], sample_weight=None,
min_samples=6)[0])
assert_array_equal([], dbscan([[0], [1]], sample_weight=[5, 5],
min_samples=6)[0])
assert_array_equal([0], dbscan([[0], [1]], sample_weight=[6, 5],
min_samples=6)[0])
assert_array_equal([0, 1], dbscan([[0], [1]], sample_weight=[6, 6],
min_samples=6)[0])
# points within eps of each other:
assert_array_equal([0, 1], dbscan([[0], [1]], eps=1.5,
sample_weight=[5, 1], min_samples=6)[0])
# and effect of non-positive and non-integer sample_weight:
assert_array_equal([], dbscan([[0], [1]], sample_weight=[5, 0],
eps=1.5, min_samples=6)[0])
assert_array_equal([0, 1], dbscan([[0], [1]], sample_weight=[5.9, 0.1],
eps=1.5, min_samples=6)[0])
assert_array_equal([0, 1], dbscan([[0], [1]], sample_weight=[6, 0],
eps=1.5, min_samples=6)[0])
assert_array_equal([], dbscan([[0], [1]], sample_weight=[6, -1],
eps=1.5, min_samples=6)[0])
# for non-negative sample_weight, cores should be identical to repetition
rng = np.random.RandomState(42)
sample_weight = rng.randint(0, 5, X.shape[0])
core1, label1 = dbscan(X, sample_weight=sample_weight)
assert_equal(len(label1), len(X))
X_repeated = np.repeat(X, sample_weight, axis=0)
core_repeated, label_repeated = dbscan(X_repeated)
core_repeated_mask = np.zeros(X_repeated.shape[0], dtype=bool)
core_repeated_mask[core_repeated] = True
core_mask = np.zeros(X.shape[0], dtype=bool)
core_mask[core1] = True
assert_array_equal(np.repeat(core_mask, sample_weight), core_repeated_mask)
# sample_weight should work with precomputed distance matrix
D = pairwise_distances(X)
core3, label3 = dbscan(D, sample_weight=sample_weight,
metric='precomputed')
assert_array_equal(core1, core3)
assert_array_equal(label1, label3)
# sample_weight should work with estimator
est = DBSCAN().fit(X, sample_weight=sample_weight)
core4 = est.core_sample_indices_
label4 = est.labels_
assert_array_equal(core1, core4)
assert_array_equal(label1, label4)
est = DBSCAN()
label5 = est.fit_predict(X, sample_weight=sample_weight)
core5 = est.core_sample_indices_
assert_array_equal(core1, core5)
assert_array_equal(label1, label5)
assert_array_equal(label1, est.labels_)
def test_dbscan_core_samples_toy():
X = [[0], [2], [3], [4], [6], [8], [10]]
n_samples = len(X)
for algorithm in ['brute', 'kd_tree', 'ball_tree']:
# Degenerate case: every sample is a core sample, either with its own
# cluster or including other close core samples.
core_samples, labels = dbscan(X, algorithm=algorithm, eps=1,
min_samples=1)
assert_array_equal(core_samples, np.arange(n_samples))
assert_array_equal(labels, [0, 1, 1, 1, 2, 3, 4])
# With eps=1 and min_samples=2 only the 3 samples from the denser area
# are core samples. All other points are isolated and considered noise.
core_samples, labels = dbscan(X, algorithm=algorithm, eps=1,
min_samples=2)
assert_array_equal(core_samples, [1, 2, 3])
assert_array_equal(labels, [-1, 0, 0, 0, -1, -1, -1])
# Only the sample in the middle of the dense area is core. Its two
# neighbors are edge samples. Remaining samples are noise.
core_samples, labels = dbscan(X, algorithm=algorithm, eps=1,
min_samples=3)
assert_array_equal(core_samples, [2])
assert_array_equal(labels, [-1, 0, 0, 0, -1, -1, -1])
# It's no longer possible to extract core samples with eps=1:
# everything is noise.
core_samples, labels = dbscan(X, algorithm=algorithm, eps=1,
min_samples=4)
assert_array_equal(core_samples, [])
assert_array_equal(labels, -np.ones(n_samples))
def test_dbscan_precomputed_metric_with_degenerate_input_arrays():
# see https://github.com/scikit-learn/scikit-learn/issues/4641 for
# more details
X = np.eye(10)
labels = DBSCAN(eps=0.5, metric='precomputed').fit(X).labels_
assert_equal(len(set(labels)), 1)
X = np.zeros((10, 10))
labels = DBSCAN(eps=0.5, metric='precomputed').fit(X).labels_
assert_equal(len(set(labels)), 1)
def test_dbscan_precomputed_metric_with_initial_rows_zero():
# sample matrix with initial two row all zero
ar = np.array([
[0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0],
[0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.0],
[0.0, 0.0, 0.0, 0.0, 0.1, 0.0, 0.0],
[0.0, 0.0, 0.0, 0.0, 0.1, 0.0, 0.0],
[0.0, 0.0, 0.1, 0.1, 0.0, 0.0, 0.3],
[0.0, 0.0, 0.0, 0.0, 0.0, 0.0, 0.1],
[0.0, 0.0, 0.0, 0.0, 0.3, 0.1, 0.0]
])
matrix = sparse.csr_matrix(ar)
labels = DBSCAN(eps=0.2, metric='precomputed',
min_samples=2).fit(matrix).labels_
assert_array_equal(labels, [-1, -1, 0, 0, 0, 1, 1])
| bsd-3-clause |
ClimbsRocks/scikit-learn | sklearn/covariance/robust_covariance.py | 103 | 29653 | """
Robust location and covariance estimators.
Here are implemented estimators that are resistant to outliers.
"""
# Author: Virgile Fritsch <virgile.fritsch@inria.fr>
#
# License: BSD 3 clause
import warnings
import numbers
import numpy as np
from scipy import linalg
from scipy.stats import chi2
from . import empirical_covariance, EmpiricalCovariance
from ..utils.extmath import fast_logdet, pinvh
from ..utils import check_random_state, check_array
# Minimum Covariance Determinant
# Implementing of an algorithm by Rousseeuw & Van Driessen described in
# (A Fast Algorithm for the Minimum Covariance Determinant Estimator,
# 1999, American Statistical Association and the American Society
# for Quality, TECHNOMETRICS)
# XXX Is this really a public function? It's not listed in the docs or
# exported by sklearn.covariance. Deprecate?
def c_step(X, n_support, remaining_iterations=30, initial_estimates=None,
verbose=False, cov_computation_method=empirical_covariance,
random_state=None):
"""C_step procedure described in [Rouseeuw1984]_ aiming at computing MCD.
Parameters
----------
X : array-like, shape (n_samples, n_features)
Data set in which we look for the n_support observations whose
scatter matrix has minimum determinant.
n_support : int, > n_samples / 2
Number of observations to compute the robust estimates of location
and covariance from.
remaining_iterations : int, optional
Number of iterations to perform.
According to [Rouseeuw1999]_, two iterations are sufficient to get
close to the minimum, and we never need more than 30 to reach
convergence.
initial_estimates : 2-tuple, optional
Initial estimates of location and shape from which to run the c_step
procedure:
- initial_estimates[0]: an initial location estimate
- initial_estimates[1]: an initial covariance estimate
verbose : boolean, optional
Verbose mode.
random_state : integer or numpy.RandomState, optional
The random generator used. If an integer is given, it fixes the
seed. Defaults to the global numpy random number generator.
cov_computation_method : callable, default empirical_covariance
The function which will be used to compute the covariance.
Must return shape (n_features, n_features)
Returns
-------
location : array-like, shape (n_features,)
Robust location estimates.
covariance : array-like, shape (n_features, n_features)
Robust covariance estimates.
support : array-like, shape (n_samples,)
A mask for the `n_support` observations whose scatter matrix has
minimum determinant.
References
----------
.. [Rouseeuw1999] A Fast Algorithm for the Minimum Covariance Determinant
Estimator, 1999, American Statistical Association and the American
Society for Quality, TECHNOMETRICS
"""
X = np.asarray(X)
random_state = check_random_state(random_state)
return _c_step(X, n_support, remaining_iterations=remaining_iterations,
initial_estimates=initial_estimates, verbose=verbose,
cov_computation_method=cov_computation_method,
random_state=random_state)
def _c_step(X, n_support, random_state, remaining_iterations=30,
initial_estimates=None, verbose=False,
cov_computation_method=empirical_covariance):
n_samples, n_features = X.shape
# Initialisation
support = np.zeros(n_samples, dtype=bool)
if initial_estimates is None:
# compute initial robust estimates from a random subset
support[random_state.permutation(n_samples)[:n_support]] = True
else:
# get initial robust estimates from the function parameters
location = initial_estimates[0]
covariance = initial_estimates[1]
# run a special iteration for that case (to get an initial support)
precision = pinvh(covariance)
X_centered = X - location
dist = (np.dot(X_centered, precision) * X_centered).sum(1)
# compute new estimates
support[np.argsort(dist)[:n_support]] = True
X_support = X[support]
location = X_support.mean(0)
covariance = cov_computation_method(X_support)
# Iterative procedure for Minimum Covariance Determinant computation
det = fast_logdet(covariance)
previous_det = np.inf
while (det < previous_det) and (remaining_iterations > 0):
# save old estimates values
previous_location = location
previous_covariance = covariance
previous_det = det
previous_support = support
# compute a new support from the full data set mahalanobis distances
precision = pinvh(covariance)
X_centered = X - location
dist = (np.dot(X_centered, precision) * X_centered).sum(axis=1)
# compute new estimates
support = np.zeros(n_samples, dtype=bool)
support[np.argsort(dist)[:n_support]] = True
X_support = X[support]
location = X_support.mean(axis=0)
covariance = cov_computation_method(X_support)
det = fast_logdet(covariance)
# update remaining iterations for early stopping
remaining_iterations -= 1
previous_dist = dist
dist = (np.dot(X - location, precision) * (X - location)).sum(axis=1)
# Catch computation errors
if np.isinf(det):
raise ValueError(
"Singular covariance matrix. "
"Please check that the covariance matrix corresponding "
"to the dataset is full rank and that MinCovDet is used with "
"Gaussian-distributed data (or at least data drawn from a "
"unimodal, symmetric distribution.")
# Check convergence
if np.allclose(det, previous_det):
# c_step procedure converged
if verbose:
print("Optimal couple (location, covariance) found before"
" ending iterations (%d left)" % (remaining_iterations))
results = location, covariance, det, support, dist
elif det > previous_det:
# determinant has increased (should not happen)
warnings.warn("Warning! det > previous_det (%.15f > %.15f)"
% (det, previous_det), RuntimeWarning)
results = previous_location, previous_covariance, \
previous_det, previous_support, previous_dist
# Check early stopping
if remaining_iterations == 0:
if verbose:
print('Maximum number of iterations reached')
results = location, covariance, det, support, dist
return results
def select_candidates(X, n_support, n_trials, select=1, n_iter=30,
verbose=False,
cov_computation_method=empirical_covariance,
random_state=None):
"""Finds the best pure subset of observations to compute MCD from it.
The purpose of this function is to find the best sets of n_support
observations with respect to a minimization of their covariance
matrix determinant. Equivalently, it removes n_samples-n_support
observations to construct what we call a pure data set (i.e. not
containing outliers). The list of the observations of the pure
data set is referred to as the `support`.
Starting from a random support, the pure data set is found by the
c_step procedure introduced by Rousseeuw and Van Driessen in
[Rouseeuw1999]_.
Parameters
----------
X : array-like, shape (n_samples, n_features)
Data (sub)set in which we look for the n_support purest observations.
n_support : int, [(n + p + 1)/2] < n_support < n
The number of samples the pure data set must contain.
select : int, int > 0
Number of best candidates results to return.
n_trials : int, nb_trials > 0 or 2-tuple
Number of different initial sets of observations from which to
run the algorithm.
Instead of giving a number of trials to perform, one can provide a
list of initial estimates that will be used to iteratively run
c_step procedures. In this case:
- n_trials[0]: array-like, shape (n_trials, n_features)
is the list of `n_trials` initial location estimates
- n_trials[1]: array-like, shape (n_trials, n_features, n_features)
is the list of `n_trials` initial covariances estimates
n_iter : int, nb_iter > 0
Maximum number of iterations for the c_step procedure.
(2 is enough to be close to the final solution. "Never" exceeds 20).
random_state : integer or numpy.RandomState, default None
The random generator used. If an integer is given, it fixes the
seed. Defaults to the global numpy random number generator.
cov_computation_method : callable, default empirical_covariance
The function which will be used to compute the covariance.
Must return shape (n_features, n_features)
verbose : boolean, default False
Control the output verbosity.
See Also
---------
c_step
Returns
-------
best_locations : array-like, shape (select, n_features)
The `select` location estimates computed from the `select` best
supports found in the data set (`X`).
best_covariances : array-like, shape (select, n_features, n_features)
The `select` covariance estimates computed from the `select`
best supports found in the data set (`X`).
best_supports : array-like, shape (select, n_samples)
The `select` best supports found in the data set (`X`).
References
----------
.. [Rouseeuw1999] A Fast Algorithm for the Minimum Covariance Determinant
Estimator, 1999, American Statistical Association and the American
Society for Quality, TECHNOMETRICS
"""
random_state = check_random_state(random_state)
n_samples, n_features = X.shape
if isinstance(n_trials, numbers.Integral):
run_from_estimates = False
elif isinstance(n_trials, tuple):
run_from_estimates = True
estimates_list = n_trials
n_trials = estimates_list[0].shape[0]
else:
raise TypeError("Invalid 'n_trials' parameter, expected tuple or "
" integer, got %s (%s)" % (n_trials, type(n_trials)))
# compute `n_trials` location and shape estimates candidates in the subset
all_estimates = []
if not run_from_estimates:
# perform `n_trials` computations from random initial supports
for j in range(n_trials):
all_estimates.append(
_c_step(
X, n_support, remaining_iterations=n_iter, verbose=verbose,
cov_computation_method=cov_computation_method,
random_state=random_state))
else:
# perform computations from every given initial estimates
for j in range(n_trials):
initial_estimates = (estimates_list[0][j], estimates_list[1][j])
all_estimates.append(_c_step(
X, n_support, remaining_iterations=n_iter,
initial_estimates=initial_estimates, verbose=verbose,
cov_computation_method=cov_computation_method,
random_state=random_state))
all_locs_sub, all_covs_sub, all_dets_sub, all_supports_sub, all_ds_sub = \
zip(*all_estimates)
# find the `n_best` best results among the `n_trials` ones
index_best = np.argsort(all_dets_sub)[:select]
best_locations = np.asarray(all_locs_sub)[index_best]
best_covariances = np.asarray(all_covs_sub)[index_best]
best_supports = np.asarray(all_supports_sub)[index_best]
best_ds = np.asarray(all_ds_sub)[index_best]
return best_locations, best_covariances, best_supports, best_ds
def fast_mcd(X, support_fraction=None,
cov_computation_method=empirical_covariance,
random_state=None):
"""Estimates the Minimum Covariance Determinant matrix.
Read more in the :ref:`User Guide <robust_covariance>`.
Parameters
----------
X : array-like, shape (n_samples, n_features)
The data matrix, with p features and n samples.
support_fraction : float, 0 < support_fraction < 1
The proportion of points to be included in the support of the raw
MCD estimate. Default is None, which implies that the minimum
value of support_fraction will be used within the algorithm:
`[n_sample + n_features + 1] / 2`.
random_state : integer or numpy.RandomState, optional
The generator used to randomly subsample. If an integer is
given, it fixes the seed. Defaults to the global numpy random
number generator.
cov_computation_method : callable, default empirical_covariance
The function which will be used to compute the covariance.
Must return shape (n_features, n_features)
Notes
-----
The FastMCD algorithm has been introduced by Rousseuw and Van Driessen
in "A Fast Algorithm for the Minimum Covariance Determinant Estimator,
1999, American Statistical Association and the American Society
for Quality, TECHNOMETRICS".
The principle is to compute robust estimates and random subsets before
pooling them into a larger subsets, and finally into the full data set.
Depending on the size of the initial sample, we have one, two or three
such computation levels.
Note that only raw estimates are returned. If one is interested in
the correction and reweighting steps described in [Rouseeuw1999]_,
see the MinCovDet object.
References
----------
.. [Rouseeuw1999] A Fast Algorithm for the Minimum Covariance
Determinant Estimator, 1999, American Statistical Association
and the American Society for Quality, TECHNOMETRICS
.. [Butler1993] R. W. Butler, P. L. Davies and M. Jhun,
Asymptotics For The Minimum Covariance Determinant Estimator,
The Annals of Statistics, 1993, Vol. 21, No. 3, 1385-1400
Returns
-------
location : array-like, shape (n_features,)
Robust location of the data.
covariance : array-like, shape (n_features, n_features)
Robust covariance of the features.
support : array-like, type boolean, shape (n_samples,)
A mask of the observations that have been used to compute
the robust location and covariance estimates of the data set.
"""
random_state = check_random_state(random_state)
X = check_array(X, ensure_min_samples=2, estimator='fast_mcd')
n_samples, n_features = X.shape
# minimum breakdown value
if support_fraction is None:
n_support = int(np.ceil(0.5 * (n_samples + n_features + 1)))
else:
n_support = int(support_fraction * n_samples)
# 1-dimensional case quick computation
# (Rousseeuw, P. J. and Leroy, A. M. (2005) References, in Robust
# Regression and Outlier Detection, John Wiley & Sons, chapter 4)
if n_features == 1:
if n_support < n_samples:
# find the sample shortest halves
X_sorted = np.sort(np.ravel(X))
diff = X_sorted[n_support:] - X_sorted[:(n_samples - n_support)]
halves_start = np.where(diff == np.min(diff))[0]
# take the middle points' mean to get the robust location estimate
location = 0.5 * (X_sorted[n_support + halves_start]
+ X_sorted[halves_start]).mean()
support = np.zeros(n_samples, dtype=bool)
X_centered = X - location
support[np.argsort(np.abs(X_centered), 0)[:n_support]] = True
covariance = np.asarray([[np.var(X[support])]])
location = np.array([location])
# get precision matrix in an optimized way
precision = pinvh(covariance)
dist = (np.dot(X_centered, precision) * (X_centered)).sum(axis=1)
else:
support = np.ones(n_samples, dtype=bool)
covariance = np.asarray([[np.var(X)]])
location = np.asarray([np.mean(X)])
X_centered = X - location
# get precision matrix in an optimized way
precision = pinvh(covariance)
dist = (np.dot(X_centered, precision) * (X_centered)).sum(axis=1)
# Starting FastMCD algorithm for p-dimensional case
if (n_samples > 500) and (n_features > 1):
# 1. Find candidate supports on subsets
# a. split the set in subsets of size ~ 300
n_subsets = n_samples // 300
n_samples_subsets = n_samples // n_subsets
samples_shuffle = random_state.permutation(n_samples)
h_subset = int(np.ceil(n_samples_subsets *
(n_support / float(n_samples))))
# b. perform a total of 500 trials
n_trials_tot = 500
# c. select 10 best (location, covariance) for each subset
n_best_sub = 10
n_trials = max(10, n_trials_tot // n_subsets)
n_best_tot = n_subsets * n_best_sub
all_best_locations = np.zeros((n_best_tot, n_features))
try:
all_best_covariances = np.zeros((n_best_tot, n_features,
n_features))
except MemoryError:
# The above is too big. Let's try with something much small
# (and less optimal)
all_best_covariances = np.zeros((n_best_tot, n_features,
n_features))
n_best_tot = 10
n_best_sub = 2
for i in range(n_subsets):
low_bound = i * n_samples_subsets
high_bound = low_bound + n_samples_subsets
current_subset = X[samples_shuffle[low_bound:high_bound]]
best_locations_sub, best_covariances_sub, _, _ = select_candidates(
current_subset, h_subset, n_trials,
select=n_best_sub, n_iter=2,
cov_computation_method=cov_computation_method,
random_state=random_state)
subset_slice = np.arange(i * n_best_sub, (i + 1) * n_best_sub)
all_best_locations[subset_slice] = best_locations_sub
all_best_covariances[subset_slice] = best_covariances_sub
# 2. Pool the candidate supports into a merged set
# (possibly the full dataset)
n_samples_merged = min(1500, n_samples)
h_merged = int(np.ceil(n_samples_merged *
(n_support / float(n_samples))))
if n_samples > 1500:
n_best_merged = 10
else:
n_best_merged = 1
# find the best couples (location, covariance) on the merged set
selection = random_state.permutation(n_samples)[:n_samples_merged]
locations_merged, covariances_merged, supports_merged, d = \
select_candidates(
X[selection], h_merged,
n_trials=(all_best_locations, all_best_covariances),
select=n_best_merged,
cov_computation_method=cov_computation_method,
random_state=random_state)
# 3. Finally get the overall best (locations, covariance) couple
if n_samples < 1500:
# directly get the best couple (location, covariance)
location = locations_merged[0]
covariance = covariances_merged[0]
support = np.zeros(n_samples, dtype=bool)
dist = np.zeros(n_samples)
support[selection] = supports_merged[0]
dist[selection] = d[0]
else:
# select the best couple on the full dataset
locations_full, covariances_full, supports_full, d = \
select_candidates(
X, n_support,
n_trials=(locations_merged, covariances_merged),
select=1,
cov_computation_method=cov_computation_method,
random_state=random_state)
location = locations_full[0]
covariance = covariances_full[0]
support = supports_full[0]
dist = d[0]
elif n_features > 1:
# 1. Find the 10 best couples (location, covariance)
# considering two iterations
n_trials = 30
n_best = 10
locations_best, covariances_best, _, _ = select_candidates(
X, n_support, n_trials=n_trials, select=n_best, n_iter=2,
cov_computation_method=cov_computation_method,
random_state=random_state)
# 2. Select the best couple on the full dataset amongst the 10
locations_full, covariances_full, supports_full, d = select_candidates(
X, n_support, n_trials=(locations_best, covariances_best),
select=1, cov_computation_method=cov_computation_method,
random_state=random_state)
location = locations_full[0]
covariance = covariances_full[0]
support = supports_full[0]
dist = d[0]
return location, covariance, support, dist
class MinCovDet(EmpiricalCovariance):
"""Minimum Covariance Determinant (MCD): robust estimator of covariance.
The Minimum Covariance Determinant covariance estimator is to be applied
on Gaussian-distributed data, but could still be relevant on data
drawn from a unimodal, symmetric distribution. It is not meant to be used
with multi-modal data (the algorithm used to fit a MinCovDet object is
likely to fail in such a case).
One should consider projection pursuit methods to deal with multi-modal
datasets.
Read more in the :ref:`User Guide <robust_covariance>`.
Parameters
----------
store_precision : bool
Specify if the estimated precision is stored.
assume_centered : Boolean
If True, the support of the robust location and the covariance
estimates is computed, and a covariance estimate is recomputed from
it, without centering the data.
Useful to work with data whose mean is significantly equal to
zero but is not exactly zero.
If False, the robust location and covariance are directly computed
with the FastMCD algorithm without additional treatment.
support_fraction : float, 0 < support_fraction < 1
The proportion of points to be included in the support of the raw
MCD estimate. Default is None, which implies that the minimum
value of support_fraction will be used within the algorithm:
[n_sample + n_features + 1] / 2
random_state : integer or numpy.RandomState, optional
The random generator used. If an integer is given, it fixes the
seed. Defaults to the global numpy random number generator.
Attributes
----------
raw_location_ : array-like, shape (n_features,)
The raw robust estimated location before correction and re-weighting.
raw_covariance_ : array-like, shape (n_features, n_features)
The raw robust estimated covariance before correction and re-weighting.
raw_support_ : array-like, shape (n_samples,)
A mask of the observations that have been used to compute
the raw robust estimates of location and shape, before correction
and re-weighting.
location_ : array-like, shape (n_features,)
Estimated robust location
covariance_ : array-like, shape (n_features, n_features)
Estimated robust covariance matrix
precision_ : array-like, shape (n_features, n_features)
Estimated pseudo inverse matrix.
(stored only if store_precision is True)
support_ : array-like, shape (n_samples,)
A mask of the observations that have been used to compute
the robust estimates of location and shape.
dist_ : array-like, shape (n_samples,)
Mahalanobis distances of the training set (on which `fit` is called)
observations.
References
----------
.. [Rouseeuw1984] `P. J. Rousseeuw. Least median of squares regression.
J. Am Stat Ass, 79:871, 1984.`
.. [Rouseeuw1999] `A Fast Algorithm for the Minimum Covariance Determinant
Estimator, 1999, American Statistical Association and the American
Society for Quality, TECHNOMETRICS`
.. [Butler1993] `R. W. Butler, P. L. Davies and M. Jhun,
Asymptotics For The Minimum Covariance Determinant Estimator,
The Annals of Statistics, 1993, Vol. 21, No. 3, 1385-1400`
"""
_nonrobust_covariance = staticmethod(empirical_covariance)
def __init__(self, store_precision=True, assume_centered=False,
support_fraction=None, random_state=None):
self.store_precision = store_precision
self.assume_centered = assume_centered
self.support_fraction = support_fraction
self.random_state = random_state
def fit(self, X, y=None):
"""Fits a Minimum Covariance Determinant with the FastMCD algorithm.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Training data, where n_samples is the number of samples
and n_features is the number of features.
y : not used, present for API consistence purpose.
Returns
-------
self : object
Returns self.
"""
X = check_array(X, ensure_min_samples=2, estimator='MinCovDet')
random_state = check_random_state(self.random_state)
n_samples, n_features = X.shape
# check that the empirical covariance is full rank
if (linalg.svdvals(np.dot(X.T, X)) > 1e-8).sum() != n_features:
warnings.warn("The covariance matrix associated to your dataset "
"is not full rank")
# compute and store raw estimates
raw_location, raw_covariance, raw_support, raw_dist = fast_mcd(
X, support_fraction=self.support_fraction,
cov_computation_method=self._nonrobust_covariance,
random_state=random_state)
if self.assume_centered:
raw_location = np.zeros(n_features)
raw_covariance = self._nonrobust_covariance(X[raw_support],
assume_centered=True)
# get precision matrix in an optimized way
precision = pinvh(raw_covariance)
raw_dist = np.sum(np.dot(X, precision) * X, 1)
self.raw_location_ = raw_location
self.raw_covariance_ = raw_covariance
self.raw_support_ = raw_support
self.location_ = raw_location
self.support_ = raw_support
self.dist_ = raw_dist
# obtain consistency at normal models
self.correct_covariance(X)
# re-weight estimator
self.reweight_covariance(X)
return self
def correct_covariance(self, data):
"""Apply a correction to raw Minimum Covariance Determinant estimates.
Correction using the empirical correction factor suggested
by Rousseeuw and Van Driessen in [Rouseeuw1984]_.
Parameters
----------
data : array-like, shape (n_samples, n_features)
The data matrix, with p features and n samples.
The data set must be the one which was used to compute
the raw estimates.
Returns
-------
covariance_corrected : array-like, shape (n_features, n_features)
Corrected robust covariance estimate.
"""
correction = np.median(self.dist_) / chi2(data.shape[1]).isf(0.5)
covariance_corrected = self.raw_covariance_ * correction
self.dist_ /= correction
return covariance_corrected
def reweight_covariance(self, data):
"""Re-weight raw Minimum Covariance Determinant estimates.
Re-weight observations using Rousseeuw's method (equivalent to
deleting outlying observations from the data set before
computing location and covariance estimates). [Rouseeuw1984]_
Parameters
----------
data : array-like, shape (n_samples, n_features)
The data matrix, with p features and n samples.
The data set must be the one which was used to compute
the raw estimates.
Returns
-------
location_reweighted : array-like, shape (n_features, )
Re-weighted robust location estimate.
covariance_reweighted : array-like, shape (n_features, n_features)
Re-weighted robust covariance estimate.
support_reweighted : array-like, type boolean, shape (n_samples,)
A mask of the observations that have been used to compute
the re-weighted robust location and covariance estimates.
"""
n_samples, n_features = data.shape
mask = self.dist_ < chi2(n_features).isf(0.025)
if self.assume_centered:
location_reweighted = np.zeros(n_features)
else:
location_reweighted = data[mask].mean(0)
covariance_reweighted = self._nonrobust_covariance(
data[mask], assume_centered=self.assume_centered)
support_reweighted = np.zeros(n_samples, dtype=bool)
support_reweighted[mask] = True
self._set_covariance(covariance_reweighted)
self.location_ = location_reweighted
self.support_ = support_reweighted
X_centered = data - self.location_
self.dist_ = np.sum(
np.dot(X_centered, self.get_precision()) * X_centered, 1)
return location_reweighted, covariance_reweighted, support_reweighted
| bsd-3-clause |
DSLituiev/scikit-learn | examples/hetero_feature_union.py | 286 | 6236 | """
=============================================
Feature Union with Heterogeneous Data Sources
=============================================
Datasets can often contain components of that require different feature
extraction and processing pipelines. This scenario might occur when:
1. Your dataset consists of heterogeneous data types (e.g. raster images and
text captions)
2. Your dataset is stored in a Pandas DataFrame and different columns
require different processing pipelines.
This example demonstrates how to use
:class:`sklearn.feature_extraction.FeatureUnion` on a dataset containing
different types of features. We use the 20-newsgroups dataset and compute
standard bag-of-words features for the subject line and body in separate
pipelines as well as ad hoc features on the body. We combine them (with
weights) using a FeatureUnion and finally train a classifier on the combined
set of features.
The choice of features is not particularly helpful, but serves to illustrate
the technique.
"""
# Author: Matt Terry <matt.terry@gmail.com>
#
# License: BSD 3 clause
from __future__ import print_function
import numpy as np
from sklearn.base import BaseEstimator, TransformerMixin
from sklearn.datasets import fetch_20newsgroups
from sklearn.datasets.twenty_newsgroups import strip_newsgroup_footer
from sklearn.datasets.twenty_newsgroups import strip_newsgroup_quoting
from sklearn.decomposition import TruncatedSVD
from sklearn.feature_extraction import DictVectorizer
from sklearn.feature_extraction.text import TfidfVectorizer
from sklearn.metrics import classification_report
from sklearn.pipeline import FeatureUnion
from sklearn.pipeline import Pipeline
from sklearn.svm import SVC
class ItemSelector(BaseEstimator, TransformerMixin):
"""For data grouped by feature, select subset of data at a provided key.
The data is expected to be stored in a 2D data structure, where the first
index is over features and the second is over samples. i.e.
>> len(data[key]) == n_samples
Please note that this is the opposite convention to sklearn feature
matrixes (where the first index corresponds to sample).
ItemSelector only requires that the collection implement getitem
(data[key]). Examples include: a dict of lists, 2D numpy array, Pandas
DataFrame, numpy record array, etc.
>> data = {'a': [1, 5, 2, 5, 2, 8],
'b': [9, 4, 1, 4, 1, 3]}
>> ds = ItemSelector(key='a')
>> data['a'] == ds.transform(data)
ItemSelector is not designed to handle data grouped by sample. (e.g. a
list of dicts). If your data is structured this way, consider a
transformer along the lines of `sklearn.feature_extraction.DictVectorizer`.
Parameters
----------
key : hashable, required
The key corresponding to the desired value in a mappable.
"""
def __init__(self, key):
self.key = key
def fit(self, x, y=None):
return self
def transform(self, data_dict):
return data_dict[self.key]
class TextStats(BaseEstimator, TransformerMixin):
"""Extract features from each document for DictVectorizer"""
def fit(self, x, y=None):
return self
def transform(self, posts):
return [{'length': len(text),
'num_sentences': text.count('.')}
for text in posts]
class SubjectBodyExtractor(BaseEstimator, TransformerMixin):
"""Extract the subject & body from a usenet post in a single pass.
Takes a sequence of strings and produces a dict of sequences. Keys are
`subject` and `body`.
"""
def fit(self, x, y=None):
return self
def transform(self, posts):
features = np.recarray(shape=(len(posts),),
dtype=[('subject', object), ('body', object)])
for i, text in enumerate(posts):
headers, _, bod = text.partition('\n\n')
bod = strip_newsgroup_footer(bod)
bod = strip_newsgroup_quoting(bod)
features['body'][i] = bod
prefix = 'Subject:'
sub = ''
for line in headers.split('\n'):
if line.startswith(prefix):
sub = line[len(prefix):]
break
features['subject'][i] = sub
return features
pipeline = Pipeline([
# Extract the subject & body
('subjectbody', SubjectBodyExtractor()),
# Use FeatureUnion to combine the features from subject and body
('union', FeatureUnion(
transformer_list=[
# Pipeline for pulling features from the post's subject line
('subject', Pipeline([
('selector', ItemSelector(key='subject')),
('tfidf', TfidfVectorizer(min_df=50)),
])),
# Pipeline for standard bag-of-words model for body
('body_bow', Pipeline([
('selector', ItemSelector(key='body')),
('tfidf', TfidfVectorizer()),
('best', TruncatedSVD(n_components=50)),
])),
# Pipeline for pulling ad hoc features from post's body
('body_stats', Pipeline([
('selector', ItemSelector(key='body')),
('stats', TextStats()), # returns a list of dicts
('vect', DictVectorizer()), # list of dicts -> feature matrix
])),
],
# weight components in FeatureUnion
transformer_weights={
'subject': 0.8,
'body_bow': 0.5,
'body_stats': 1.0,
},
)),
# Use a SVC classifier on the combined features
('svc', SVC(kernel='linear')),
])
# limit the list of categories to make running this exmaple faster.
categories = ['alt.atheism', 'talk.religion.misc']
train = fetch_20newsgroups(random_state=1,
subset='train',
categories=categories,
)
test = fetch_20newsgroups(random_state=1,
subset='test',
categories=categories,
)
pipeline.fit(train.data, train.target)
y = pipeline.predict(test.data)
print(classification_report(y, test.target))
| bsd-3-clause |
untom/scikit-learn | sklearn/cluster/tests/test_birch.py | 339 | 5603 | """
Tests for the birch clustering algorithm.
"""
from scipy import sparse
import numpy as np
from sklearn.cluster.tests.common import generate_clustered_data
from sklearn.cluster.birch import Birch
from sklearn.cluster.hierarchical import AgglomerativeClustering
from sklearn.datasets import make_blobs
from sklearn.linear_model import ElasticNet
from sklearn.metrics import pairwise_distances_argmin, v_measure_score
from sklearn.utils.testing import assert_greater_equal
from sklearn.utils.testing import assert_equal
from sklearn.utils.testing import assert_greater
from sklearn.utils.testing import assert_almost_equal
from sklearn.utils.testing import assert_array_equal
from sklearn.utils.testing import assert_raises
from sklearn.utils.testing import assert_warns
def test_n_samples_leaves_roots():
# Sanity check for the number of samples in leaves and roots
X, y = make_blobs(n_samples=10)
brc = Birch()
brc.fit(X)
n_samples_root = sum([sc.n_samples_ for sc in brc.root_.subclusters_])
n_samples_leaves = sum([sc.n_samples_ for leaf in brc._get_leaves()
for sc in leaf.subclusters_])
assert_equal(n_samples_leaves, X.shape[0])
assert_equal(n_samples_root, X.shape[0])
def test_partial_fit():
# Test that fit is equivalent to calling partial_fit multiple times
X, y = make_blobs(n_samples=100)
brc = Birch(n_clusters=3)
brc.fit(X)
brc_partial = Birch(n_clusters=None)
brc_partial.partial_fit(X[:50])
brc_partial.partial_fit(X[50:])
assert_array_equal(brc_partial.subcluster_centers_,
brc.subcluster_centers_)
# Test that same global labels are obtained after calling partial_fit
# with None
brc_partial.set_params(n_clusters=3)
brc_partial.partial_fit(None)
assert_array_equal(brc_partial.subcluster_labels_, brc.subcluster_labels_)
def test_birch_predict():
# Test the predict method predicts the nearest centroid.
rng = np.random.RandomState(0)
X = generate_clustered_data(n_clusters=3, n_features=3,
n_samples_per_cluster=10)
# n_samples * n_samples_per_cluster
shuffle_indices = np.arange(30)
rng.shuffle(shuffle_indices)
X_shuffle = X[shuffle_indices, :]
brc = Birch(n_clusters=4, threshold=1.)
brc.fit(X_shuffle)
centroids = brc.subcluster_centers_
assert_array_equal(brc.labels_, brc.predict(X_shuffle))
nearest_centroid = pairwise_distances_argmin(X_shuffle, centroids)
assert_almost_equal(v_measure_score(nearest_centroid, brc.labels_), 1.0)
def test_n_clusters():
# Test that n_clusters param works properly
X, y = make_blobs(n_samples=100, centers=10)
brc1 = Birch(n_clusters=10)
brc1.fit(X)
assert_greater(len(brc1.subcluster_centers_), 10)
assert_equal(len(np.unique(brc1.labels_)), 10)
# Test that n_clusters = Agglomerative Clustering gives
# the same results.
gc = AgglomerativeClustering(n_clusters=10)
brc2 = Birch(n_clusters=gc)
brc2.fit(X)
assert_array_equal(brc1.subcluster_labels_, brc2.subcluster_labels_)
assert_array_equal(brc1.labels_, brc2.labels_)
# Test that the wrong global clustering step raises an Error.
clf = ElasticNet()
brc3 = Birch(n_clusters=clf)
assert_raises(ValueError, brc3.fit, X)
# Test that a small number of clusters raises a warning.
brc4 = Birch(threshold=10000.)
assert_warns(UserWarning, brc4.fit, X)
def test_sparse_X():
# Test that sparse and dense data give same results
X, y = make_blobs(n_samples=100, centers=10)
brc = Birch(n_clusters=10)
brc.fit(X)
csr = sparse.csr_matrix(X)
brc_sparse = Birch(n_clusters=10)
brc_sparse.fit(csr)
assert_array_equal(brc.labels_, brc_sparse.labels_)
assert_array_equal(brc.subcluster_centers_,
brc_sparse.subcluster_centers_)
def check_branching_factor(node, branching_factor):
subclusters = node.subclusters_
assert_greater_equal(branching_factor, len(subclusters))
for cluster in subclusters:
if cluster.child_:
check_branching_factor(cluster.child_, branching_factor)
def test_branching_factor():
# Test that nodes have at max branching_factor number of subclusters
X, y = make_blobs()
branching_factor = 9
# Purposefully set a low threshold to maximize the subclusters.
brc = Birch(n_clusters=None, branching_factor=branching_factor,
threshold=0.01)
brc.fit(X)
check_branching_factor(brc.root_, branching_factor)
brc = Birch(n_clusters=3, branching_factor=branching_factor,
threshold=0.01)
brc.fit(X)
check_branching_factor(brc.root_, branching_factor)
# Raises error when branching_factor is set to one.
brc = Birch(n_clusters=None, branching_factor=1, threshold=0.01)
assert_raises(ValueError, brc.fit, X)
def check_threshold(birch_instance, threshold):
"""Use the leaf linked list for traversal"""
current_leaf = birch_instance.dummy_leaf_.next_leaf_
while current_leaf:
subclusters = current_leaf.subclusters_
for sc in subclusters:
assert_greater_equal(threshold, sc.radius)
current_leaf = current_leaf.next_leaf_
def test_threshold():
# Test that the leaf subclusters have a threshold lesser than radius
X, y = make_blobs(n_samples=80, centers=4)
brc = Birch(threshold=0.5, n_clusters=None)
brc.fit(X)
check_threshold(brc, 0.5)
brc = Birch(threshold=5.0, n_clusters=None)
brc.fit(X)
check_threshold(brc, 5.)
| bsd-3-clause |
ClimbsRocks/scikit-learn | sklearn/manifold/locally_linear.py | 36 | 25852 | """Locally Linear Embedding"""
# Author: Fabian Pedregosa -- <fabian.pedregosa@inria.fr>
# Jake Vanderplas -- <vanderplas@astro.washington.edu>
# License: BSD 3 clause (C) INRIA 2011
import numpy as np
from scipy.linalg import eigh, svd, qr, solve
from scipy.sparse import eye, csr_matrix
from ..base import BaseEstimator, TransformerMixin
from ..utils import check_random_state, check_array
from ..utils.arpack import eigsh
from ..utils.validation import check_is_fitted
from ..utils.validation import FLOAT_DTYPES
from ..neighbors import NearestNeighbors
def barycenter_weights(X, Z, reg=1e-3):
"""Compute barycenter weights of X from Y along the first axis
We estimate the weights to assign to each point in Y[i] to recover
the point X[i]. The barycenter weights sum to 1.
Parameters
----------
X : array-like, shape (n_samples, n_dim)
Z : array-like, shape (n_samples, n_neighbors, n_dim)
reg: float, optional
amount of regularization to add for the problem to be
well-posed in the case of n_neighbors > n_dim
Returns
-------
B : array-like, shape (n_samples, n_neighbors)
Notes
-----
See developers note for more information.
"""
X = check_array(X, dtype=FLOAT_DTYPES)
Z = check_array(Z, dtype=FLOAT_DTYPES, allow_nd=True)
n_samples, n_neighbors = X.shape[0], Z.shape[1]
B = np.empty((n_samples, n_neighbors), dtype=X.dtype)
v = np.ones(n_neighbors, dtype=X.dtype)
# this might raise a LinalgError if G is singular and has trace
# zero
for i, A in enumerate(Z.transpose(0, 2, 1)):
C = A.T - X[i] # broadcasting
G = np.dot(C, C.T)
trace = np.trace(G)
if trace > 0:
R = reg * trace
else:
R = reg
G.flat[::Z.shape[1] + 1] += R
w = solve(G, v, sym_pos=True)
B[i, :] = w / np.sum(w)
return B
def barycenter_kneighbors_graph(X, n_neighbors, reg=1e-3, n_jobs=1):
"""Computes the barycenter weighted graph of k-Neighbors for points in X
Parameters
----------
X : {array-like, sparse matrix, BallTree, KDTree, NearestNeighbors}
Sample data, shape = (n_samples, n_features), in the form of a
numpy array, sparse array, precomputed tree, or NearestNeighbors
object.
n_neighbors : int
Number of neighbors for each sample.
reg : float, optional
Amount of regularization when solving the least-squares
problem. Only relevant if mode='barycenter'. If None, use the
default.
n_jobs : int, optional (default = 1)
The number of parallel jobs to run for neighbors search.
If ``-1``, then the number of jobs is set to the number of CPU cores.
Returns
-------
A : sparse matrix in CSR format, shape = [n_samples, n_samples]
A[i, j] is assigned the weight of edge that connects i to j.
See also
--------
sklearn.neighbors.kneighbors_graph
sklearn.neighbors.radius_neighbors_graph
"""
knn = NearestNeighbors(n_neighbors + 1, n_jobs=n_jobs).fit(X)
X = knn._fit_X
n_samples = X.shape[0]
ind = knn.kneighbors(X, return_distance=False)[:, 1:]
data = barycenter_weights(X, X[ind], reg=reg)
indptr = np.arange(0, n_samples * n_neighbors + 1, n_neighbors)
return csr_matrix((data.ravel(), ind.ravel(), indptr),
shape=(n_samples, n_samples))
def null_space(M, k, k_skip=1, eigen_solver='arpack', tol=1E-6, max_iter=100,
random_state=None):
"""
Find the null space of a matrix M.
Parameters
----------
M : {array, matrix, sparse matrix, LinearOperator}
Input covariance matrix: should be symmetric positive semi-definite
k : integer
Number of eigenvalues/vectors to return
k_skip : integer, optional
Number of low eigenvalues to skip.
eigen_solver : string, {'auto', 'arpack', 'dense'}
auto : algorithm will attempt to choose the best method for input data
arpack : use arnoldi iteration in shift-invert mode.
For this method, M may be a dense matrix, sparse matrix,
or general linear operator.
Warning: ARPACK can be unstable for some problems. It is
best to try several random seeds in order to check results.
dense : use standard dense matrix operations for the eigenvalue
decomposition. For this method, M must be an array
or matrix type. This method should be avoided for
large problems.
tol : float, optional
Tolerance for 'arpack' method.
Not used if eigen_solver=='dense'.
max_iter : maximum number of iterations for 'arpack' method
not used if eigen_solver=='dense'
random_state: numpy.RandomState or int, optional
The generator or seed used to determine the starting vector for arpack
iterations. Defaults to numpy.random.
"""
if eigen_solver == 'auto':
if M.shape[0] > 200 and k + k_skip < 10:
eigen_solver = 'arpack'
else:
eigen_solver = 'dense'
if eigen_solver == 'arpack':
random_state = check_random_state(random_state)
# initialize with [-1,1] as in ARPACK
v0 = random_state.uniform(-1, 1, M.shape[0])
try:
eigen_values, eigen_vectors = eigsh(M, k + k_skip, sigma=0.0,
tol=tol, maxiter=max_iter,
v0=v0)
except RuntimeError as msg:
raise ValueError("Error in determining null-space with ARPACK. "
"Error message: '%s'. "
"Note that method='arpack' can fail when the "
"weight matrix is singular or otherwise "
"ill-behaved. method='dense' is recommended. "
"See online documentation for more information."
% msg)
return eigen_vectors[:, k_skip:], np.sum(eigen_values[k_skip:])
elif eigen_solver == 'dense':
if hasattr(M, 'toarray'):
M = M.toarray()
eigen_values, eigen_vectors = eigh(
M, eigvals=(k_skip, k + k_skip - 1), overwrite_a=True)
index = np.argsort(np.abs(eigen_values))
return eigen_vectors[:, index], np.sum(eigen_values)
else:
raise ValueError("Unrecognized eigen_solver '%s'" % eigen_solver)
def locally_linear_embedding(
X, n_neighbors, n_components, reg=1e-3, eigen_solver='auto', tol=1e-6,
max_iter=100, method='standard', hessian_tol=1E-4, modified_tol=1E-12,
random_state=None, n_jobs=1):
"""Perform a Locally Linear Embedding analysis on the data.
Read more in the :ref:`User Guide <locally_linear_embedding>`.
Parameters
----------
X : {array-like, sparse matrix, BallTree, KDTree, NearestNeighbors}
Sample data, shape = (n_samples, n_features), in the form of a
numpy array, sparse array, precomputed tree, or NearestNeighbors
object.
n_neighbors : integer
number of neighbors to consider for each point.
n_components : integer
number of coordinates for the manifold.
reg : float
regularization constant, multiplies the trace of the local covariance
matrix of the distances.
eigen_solver : string, {'auto', 'arpack', 'dense'}
auto : algorithm will attempt to choose the best method for input data
arpack : use arnoldi iteration in shift-invert mode.
For this method, M may be a dense matrix, sparse matrix,
or general linear operator.
Warning: ARPACK can be unstable for some problems. It is
best to try several random seeds in order to check results.
dense : use standard dense matrix operations for the eigenvalue
decomposition. For this method, M must be an array
or matrix type. This method should be avoided for
large problems.
tol : float, optional
Tolerance for 'arpack' method
Not used if eigen_solver=='dense'.
max_iter : integer
maximum number of iterations for the arpack solver.
method : {'standard', 'hessian', 'modified', 'ltsa'}
standard : use the standard locally linear embedding algorithm.
see reference [1]_
hessian : use the Hessian eigenmap method. This method requires
n_neighbors > n_components * (1 + (n_components + 1) / 2.
see reference [2]_
modified : use the modified locally linear embedding algorithm.
see reference [3]_
ltsa : use local tangent space alignment algorithm
see reference [4]_
hessian_tol : float, optional
Tolerance for Hessian eigenmapping method.
Only used if method == 'hessian'
modified_tol : float, optional
Tolerance for modified LLE method.
Only used if method == 'modified'
random_state: numpy.RandomState or int, optional
The generator or seed used to determine the starting vector for arpack
iterations. Defaults to numpy.random.
n_jobs : int, optional (default = 1)
The number of parallel jobs to run for neighbors search.
If ``-1``, then the number of jobs is set to the number of CPU cores.
Returns
-------
Y : array-like, shape [n_samples, n_components]
Embedding vectors.
squared_error : float
Reconstruction error for the embedding vectors. Equivalent to
``norm(Y - W Y, 'fro')**2``, where W are the reconstruction weights.
References
----------
.. [1] `Roweis, S. & Saul, L. Nonlinear dimensionality reduction
by locally linear embedding. Science 290:2323 (2000).`
.. [2] `Donoho, D. & Grimes, C. Hessian eigenmaps: Locally
linear embedding techniques for high-dimensional data.
Proc Natl Acad Sci U S A. 100:5591 (2003).`
.. [3] `Zhang, Z. & Wang, J. MLLE: Modified Locally Linear
Embedding Using Multiple Weights.`
http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.70.382
.. [4] `Zhang, Z. & Zha, H. Principal manifolds and nonlinear
dimensionality reduction via tangent space alignment.
Journal of Shanghai Univ. 8:406 (2004)`
"""
if eigen_solver not in ('auto', 'arpack', 'dense'):
raise ValueError("unrecognized eigen_solver '%s'" % eigen_solver)
if method not in ('standard', 'hessian', 'modified', 'ltsa'):
raise ValueError("unrecognized method '%s'" % method)
nbrs = NearestNeighbors(n_neighbors=n_neighbors + 1, n_jobs=n_jobs)
nbrs.fit(X)
X = nbrs._fit_X
N, d_in = X.shape
if n_components > d_in:
raise ValueError("output dimension must be less than or equal "
"to input dimension")
if n_neighbors >= N:
raise ValueError("n_neighbors must be less than number of points")
if n_neighbors <= 0:
raise ValueError("n_neighbors must be positive")
M_sparse = (eigen_solver != 'dense')
if method == 'standard':
W = barycenter_kneighbors_graph(
nbrs, n_neighbors=n_neighbors, reg=reg, n_jobs=n_jobs)
# we'll compute M = (I-W)'(I-W)
# depending on the solver, we'll do this differently
if M_sparse:
M = eye(*W.shape, format=W.format) - W
M = (M.T * M).tocsr()
else:
M = (W.T * W - W.T - W).toarray()
M.flat[::M.shape[0] + 1] += 1 # W = W - I = W - I
elif method == 'hessian':
dp = n_components * (n_components + 1) // 2
if n_neighbors <= n_components + dp:
raise ValueError("for method='hessian', n_neighbors must be "
"greater than "
"[n_components * (n_components + 3) / 2]")
neighbors = nbrs.kneighbors(X, n_neighbors=n_neighbors + 1,
return_distance=False)
neighbors = neighbors[:, 1:]
Yi = np.empty((n_neighbors, 1 + n_components + dp), dtype=np.float64)
Yi[:, 0] = 1
M = np.zeros((N, N), dtype=np.float64)
use_svd = (n_neighbors > d_in)
for i in range(N):
Gi = X[neighbors[i]]
Gi -= Gi.mean(0)
# build Hessian estimator
if use_svd:
U = svd(Gi, full_matrices=0)[0]
else:
Ci = np.dot(Gi, Gi.T)
U = eigh(Ci)[1][:, ::-1]
Yi[:, 1:1 + n_components] = U[:, :n_components]
j = 1 + n_components
for k in range(n_components):
Yi[:, j:j + n_components - k] = (U[:, k:k + 1] *
U[:, k:n_components])
j += n_components - k
Q, R = qr(Yi)
w = Q[:, n_components + 1:]
S = w.sum(0)
S[np.where(abs(S) < hessian_tol)] = 1
w /= S
nbrs_x, nbrs_y = np.meshgrid(neighbors[i], neighbors[i])
M[nbrs_x, nbrs_y] += np.dot(w, w.T)
if M_sparse:
M = csr_matrix(M)
elif method == 'modified':
if n_neighbors < n_components:
raise ValueError("modified LLE requires "
"n_neighbors >= n_components")
neighbors = nbrs.kneighbors(X, n_neighbors=n_neighbors + 1,
return_distance=False)
neighbors = neighbors[:, 1:]
# find the eigenvectors and eigenvalues of each local covariance
# matrix. We want V[i] to be a [n_neighbors x n_neighbors] matrix,
# where the columns are eigenvectors
V = np.zeros((N, n_neighbors, n_neighbors))
nev = min(d_in, n_neighbors)
evals = np.zeros([N, nev])
# choose the most efficient way to find the eigenvectors
use_svd = (n_neighbors > d_in)
if use_svd:
for i in range(N):
X_nbrs = X[neighbors[i]] - X[i]
V[i], evals[i], _ = svd(X_nbrs,
full_matrices=True)
evals **= 2
else:
for i in range(N):
X_nbrs = X[neighbors[i]] - X[i]
C_nbrs = np.dot(X_nbrs, X_nbrs.T)
evi, vi = eigh(C_nbrs)
evals[i] = evi[::-1]
V[i] = vi[:, ::-1]
# find regularized weights: this is like normal LLE.
# because we've already computed the SVD of each covariance matrix,
# it's faster to use this rather than np.linalg.solve
reg = 1E-3 * evals.sum(1)
tmp = np.dot(V.transpose(0, 2, 1), np.ones(n_neighbors))
tmp[:, :nev] /= evals + reg[:, None]
tmp[:, nev:] /= reg[:, None]
w_reg = np.zeros((N, n_neighbors))
for i in range(N):
w_reg[i] = np.dot(V[i], tmp[i])
w_reg /= w_reg.sum(1)[:, None]
# calculate eta: the median of the ratio of small to large eigenvalues
# across the points. This is used to determine s_i, below
rho = evals[:, n_components:].sum(1) / evals[:, :n_components].sum(1)
eta = np.median(rho)
# find s_i, the size of the "almost null space" for each point:
# this is the size of the largest set of eigenvalues
# such that Sum[v; v in set]/Sum[v; v not in set] < eta
s_range = np.zeros(N, dtype=int)
evals_cumsum = np.cumsum(evals, 1)
eta_range = evals_cumsum[:, -1:] / evals_cumsum[:, :-1] - 1
for i in range(N):
s_range[i] = np.searchsorted(eta_range[i, ::-1], eta)
s_range += n_neighbors - nev # number of zero eigenvalues
# Now calculate M.
# This is the [N x N] matrix whose null space is the desired embedding
M = np.zeros((N, N), dtype=np.float64)
for i in range(N):
s_i = s_range[i]
# select bottom s_i eigenvectors and calculate alpha
Vi = V[i, :, n_neighbors - s_i:]
alpha_i = np.linalg.norm(Vi.sum(0)) / np.sqrt(s_i)
# compute Householder matrix which satisfies
# Hi*Vi.T*ones(n_neighbors) = alpha_i*ones(s)
# using prescription from paper
h = alpha_i * np.ones(s_i) - np.dot(Vi.T, np.ones(n_neighbors))
norm_h = np.linalg.norm(h)
if norm_h < modified_tol:
h *= 0
else:
h /= norm_h
# Householder matrix is
# >> Hi = np.identity(s_i) - 2*np.outer(h,h)
# Then the weight matrix is
# >> Wi = np.dot(Vi,Hi) + (1-alpha_i) * w_reg[i,:,None]
# We do this much more efficiently:
Wi = (Vi - 2 * np.outer(np.dot(Vi, h), h) +
(1 - alpha_i) * w_reg[i, :, None])
# Update M as follows:
# >> W_hat = np.zeros( (N,s_i) )
# >> W_hat[neighbors[i],:] = Wi
# >> W_hat[i] -= 1
# >> M += np.dot(W_hat,W_hat.T)
# We can do this much more efficiently:
nbrs_x, nbrs_y = np.meshgrid(neighbors[i], neighbors[i])
M[nbrs_x, nbrs_y] += np.dot(Wi, Wi.T)
Wi_sum1 = Wi.sum(1)
M[i, neighbors[i]] -= Wi_sum1
M[neighbors[i], i] -= Wi_sum1
M[i, i] += s_i
if M_sparse:
M = csr_matrix(M)
elif method == 'ltsa':
neighbors = nbrs.kneighbors(X, n_neighbors=n_neighbors + 1,
return_distance=False)
neighbors = neighbors[:, 1:]
M = np.zeros((N, N))
use_svd = (n_neighbors > d_in)
for i in range(N):
Xi = X[neighbors[i]]
Xi -= Xi.mean(0)
# compute n_components largest eigenvalues of Xi * Xi^T
if use_svd:
v = svd(Xi, full_matrices=True)[0]
else:
Ci = np.dot(Xi, Xi.T)
v = eigh(Ci)[1][:, ::-1]
Gi = np.zeros((n_neighbors, n_components + 1))
Gi[:, 1:] = v[:, :n_components]
Gi[:, 0] = 1. / np.sqrt(n_neighbors)
GiGiT = np.dot(Gi, Gi.T)
nbrs_x, nbrs_y = np.meshgrid(neighbors[i], neighbors[i])
M[nbrs_x, nbrs_y] -= GiGiT
M[neighbors[i], neighbors[i]] += 1
return null_space(M, n_components, k_skip=1, eigen_solver=eigen_solver,
tol=tol, max_iter=max_iter, random_state=random_state)
class LocallyLinearEmbedding(BaseEstimator, TransformerMixin):
"""Locally Linear Embedding
Read more in the :ref:`User Guide <locally_linear_embedding>`.
Parameters
----------
n_neighbors : integer
number of neighbors to consider for each point.
n_components : integer
number of coordinates for the manifold
reg : float
regularization constant, multiplies the trace of the local covariance
matrix of the distances.
eigen_solver : string, {'auto', 'arpack', 'dense'}
auto : algorithm will attempt to choose the best method for input data
arpack : use arnoldi iteration in shift-invert mode.
For this method, M may be a dense matrix, sparse matrix,
or general linear operator.
Warning: ARPACK can be unstable for some problems. It is
best to try several random seeds in order to check results.
dense : use standard dense matrix operations for the eigenvalue
decomposition. For this method, M must be an array
or matrix type. This method should be avoided for
large problems.
tol : float, optional
Tolerance for 'arpack' method
Not used if eigen_solver=='dense'.
max_iter : integer
maximum number of iterations for the arpack solver.
Not used if eigen_solver=='dense'.
method : string ('standard', 'hessian', 'modified' or 'ltsa')
standard : use the standard locally linear embedding algorithm. see
reference [1]
hessian : use the Hessian eigenmap method. This method requires
``n_neighbors > n_components * (1 + (n_components + 1) / 2``
see reference [2]
modified : use the modified locally linear embedding algorithm.
see reference [3]
ltsa : use local tangent space alignment algorithm
see reference [4]
hessian_tol : float, optional
Tolerance for Hessian eigenmapping method.
Only used if ``method == 'hessian'``
modified_tol : float, optional
Tolerance for modified LLE method.
Only used if ``method == 'modified'``
neighbors_algorithm : string ['auto'|'brute'|'kd_tree'|'ball_tree']
algorithm to use for nearest neighbors search,
passed to neighbors.NearestNeighbors instance
random_state: numpy.RandomState or int, optional
The generator or seed used to determine the starting vector for arpack
iterations. Defaults to numpy.random.
n_jobs : int, optional (default = 1)
The number of parallel jobs to run.
If ``-1``, then the number of jobs is set to the number of CPU cores.
Attributes
----------
embedding_vectors_ : array-like, shape [n_components, n_samples]
Stores the embedding vectors
reconstruction_error_ : float
Reconstruction error associated with `embedding_vectors_`
nbrs_ : NearestNeighbors object
Stores nearest neighbors instance, including BallTree or KDtree
if applicable.
References
----------
.. [1] `Roweis, S. & Saul, L. Nonlinear dimensionality reduction
by locally linear embedding. Science 290:2323 (2000).`
.. [2] `Donoho, D. & Grimes, C. Hessian eigenmaps: Locally
linear embedding techniques for high-dimensional data.
Proc Natl Acad Sci U S A. 100:5591 (2003).`
.. [3] `Zhang, Z. & Wang, J. MLLE: Modified Locally Linear
Embedding Using Multiple Weights.`
http://citeseerx.ist.psu.edu/viewdoc/summary?doi=10.1.1.70.382
.. [4] `Zhang, Z. & Zha, H. Principal manifolds and nonlinear
dimensionality reduction via tangent space alignment.
Journal of Shanghai Univ. 8:406 (2004)`
"""
def __init__(self, n_neighbors=5, n_components=2, reg=1E-3,
eigen_solver='auto', tol=1E-6, max_iter=100,
method='standard', hessian_tol=1E-4, modified_tol=1E-12,
neighbors_algorithm='auto', random_state=None, n_jobs=1):
self.n_neighbors = n_neighbors
self.n_components = n_components
self.reg = reg
self.eigen_solver = eigen_solver
self.tol = tol
self.max_iter = max_iter
self.method = method
self.hessian_tol = hessian_tol
self.modified_tol = modified_tol
self.random_state = random_state
self.neighbors_algorithm = neighbors_algorithm
self.n_jobs = n_jobs
def _fit_transform(self, X):
self.nbrs_ = NearestNeighbors(self.n_neighbors,
algorithm=self.neighbors_algorithm,
n_jobs=self.n_jobs)
random_state = check_random_state(self.random_state)
X = check_array(X)
self.nbrs_.fit(X)
self.embedding_, self.reconstruction_error_ = \
locally_linear_embedding(
self.nbrs_, self.n_neighbors, self.n_components,
eigen_solver=self.eigen_solver, tol=self.tol,
max_iter=self.max_iter, method=self.method,
hessian_tol=self.hessian_tol, modified_tol=self.modified_tol,
random_state=random_state, reg=self.reg, n_jobs=self.n_jobs)
def fit(self, X, y=None):
"""Compute the embedding vectors for data X
Parameters
----------
X : array-like of shape [n_samples, n_features]
training set.
Returns
-------
self : returns an instance of self.
"""
self._fit_transform(X)
return self
def fit_transform(self, X, y=None):
"""Compute the embedding vectors for data X and transform X.
Parameters
----------
X : array-like of shape [n_samples, n_features]
training set.
Returns
-------
X_new: array-like, shape (n_samples, n_components)
"""
self._fit_transform(X)
return self.embedding_
def transform(self, X):
"""
Transform new points into embedding space.
Parameters
----------
X : array-like, shape = [n_samples, n_features]
Returns
-------
X_new : array, shape = [n_samples, n_components]
Notes
-----
Because of scaling performed by this method, it is discouraged to use
it together with methods that are not scale-invariant (like SVMs)
"""
check_is_fitted(self, "nbrs_")
X = check_array(X)
ind = self.nbrs_.kneighbors(X, n_neighbors=self.n_neighbors,
return_distance=False)
weights = barycenter_weights(X, self.nbrs_._fit_X[ind],
reg=self.reg)
X_new = np.empty((X.shape[0], self.n_components))
for i in range(X.shape[0]):
X_new[i] = np.dot(self.embedding_[ind[i]].T, weights[i])
return X_new
| bsd-3-clause |
DSLituiev/scikit-learn | sklearn/metrics/tests/test_ranking.py | 31 | 41905 | from __future__ import division, print_function
import numpy as np
from itertools import product
import warnings
from scipy.sparse import csr_matrix
from sklearn import datasets
from sklearn import svm
from sklearn import ensemble
from sklearn.datasets import make_multilabel_classification
from sklearn.random_projection import sparse_random_matrix
from sklearn.utils.validation import check_array, check_consistent_length
from sklearn.utils.validation import check_random_state
from sklearn.utils.testing import assert_raises, clean_warning_registry
from sklearn.utils.testing import assert_raise_message
from sklearn.utils.testing import assert_equal
from sklearn.utils.testing import assert_almost_equal
from sklearn.utils.testing import assert_array_equal
from sklearn.utils.testing import assert_array_almost_equal
from sklearn.utils.testing import assert_warns
from sklearn.metrics import auc
from sklearn.metrics import average_precision_score
from sklearn.metrics import coverage_error
from sklearn.metrics import label_ranking_average_precision_score
from sklearn.metrics import precision_recall_curve
from sklearn.metrics import label_ranking_loss
from sklearn.metrics import roc_auc_score
from sklearn.metrics import roc_curve
from sklearn.exceptions import UndefinedMetricWarning
###############################################################################
# Utilities for testing
def make_prediction(dataset=None, binary=False):
"""Make some classification predictions on a toy dataset using a SVC
If binary is True restrict to a binary classification problem instead of a
multiclass classification problem
"""
if dataset is None:
# import some data to play with
dataset = datasets.load_iris()
X = dataset.data
y = dataset.target
if binary:
# restrict to a binary classification task
X, y = X[y < 2], y[y < 2]
n_samples, n_features = X.shape
p = np.arange(n_samples)
rng = check_random_state(37)
rng.shuffle(p)
X, y = X[p], y[p]
half = int(n_samples / 2)
# add noisy features to make the problem harder and avoid perfect results
rng = np.random.RandomState(0)
X = np.c_[X, rng.randn(n_samples, 200 * n_features)]
# run classifier, get class probabilities and label predictions
clf = svm.SVC(kernel='linear', probability=True, random_state=0)
probas_pred = clf.fit(X[:half], y[:half]).predict_proba(X[half:])
if binary:
# only interested in probabilities of the positive case
# XXX: do we really want a special API for the binary case?
probas_pred = probas_pred[:, 1]
y_pred = clf.predict(X[half:])
y_true = y[half:]
return y_true, y_pred, probas_pred
###############################################################################
# Tests
def _auc(y_true, y_score):
"""Alternative implementation to check for correctness of
`roc_auc_score`."""
pos_label = np.unique(y_true)[1]
# Count the number of times positive samples are correctly ranked above
# negative samples.
pos = y_score[y_true == pos_label]
neg = y_score[y_true != pos_label]
diff_matrix = pos.reshape(1, -1) - neg.reshape(-1, 1)
n_correct = np.sum(diff_matrix > 0)
return n_correct / float(len(pos) * len(neg))
def _average_precision(y_true, y_score):
"""Alternative implementation to check for correctness of
`average_precision_score`."""
pos_label = np.unique(y_true)[1]
n_pos = np.sum(y_true == pos_label)
order = np.argsort(y_score)[::-1]
y_score = y_score[order]
y_true = y_true[order]
score = 0
for i in range(len(y_score)):
if y_true[i] == pos_label:
# Compute precision up to document i
# i.e, percentage of relevant documents up to document i.
prec = 0
for j in range(0, i + 1):
if y_true[j] == pos_label:
prec += 1.0
prec /= (i + 1.0)
score += prec
return score / n_pos
def test_roc_curve():
# Test Area under Receiver Operating Characteristic (ROC) curve
y_true, _, probas_pred = make_prediction(binary=True)
expected_auc = _auc(y_true, probas_pred)
for drop in [True, False]:
fpr, tpr, thresholds = roc_curve(y_true, probas_pred,
drop_intermediate=drop)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, expected_auc, decimal=2)
assert_almost_equal(roc_auc, roc_auc_score(y_true, probas_pred))
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_end_points():
# Make sure that roc_curve returns a curve start at 0 and ending and
# 1 even in corner cases
rng = np.random.RandomState(0)
y_true = np.array([0] * 50 + [1] * 50)
y_pred = rng.randint(3, size=100)
fpr, tpr, thr = roc_curve(y_true, y_pred, drop_intermediate=True)
assert_equal(fpr[0], 0)
assert_equal(fpr[-1], 1)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thr.shape)
def test_roc_returns_consistency():
# Test whether the returned threshold matches up with tpr
# make small toy dataset
y_true, _, probas_pred = make_prediction(binary=True)
fpr, tpr, thresholds = roc_curve(y_true, probas_pred)
# use the given thresholds to determine the tpr
tpr_correct = []
for t in thresholds:
tp = np.sum((probas_pred >= t) & y_true)
p = np.sum(y_true)
tpr_correct.append(1.0 * tp / p)
# compare tpr and tpr_correct to see if the thresholds' order was correct
assert_array_almost_equal(tpr, tpr_correct, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_nonrepeating_thresholds():
# Test to ensure that we don't return spurious repeating thresholds.
# Duplicated thresholds can arise due to machine precision issues.
dataset = datasets.load_digits()
X = dataset['data']
y = dataset['target']
# This random forest classifier can only return probabilities
# significant to two decimal places
clf = ensemble.RandomForestClassifier(n_estimators=100, random_state=0)
# How well can the classifier predict whether a digit is less than 5?
# This task contributes floating point roundoff errors to the probabilities
train, test = slice(None, None, 2), slice(1, None, 2)
probas_pred = clf.fit(X[train], y[train]).predict_proba(X[test])
y_score = probas_pred[:, :5].sum(axis=1) # roundoff errors begin here
y_true = [yy < 5 for yy in y[test]]
# Check for repeating values in the thresholds
fpr, tpr, thresholds = roc_curve(y_true, y_score, drop_intermediate=False)
assert_equal(thresholds.size, np.unique(np.round(thresholds, 2)).size)
def test_roc_curve_multi():
# roc_curve not applicable for multi-class problems
y_true, _, probas_pred = make_prediction(binary=False)
assert_raises(ValueError, roc_curve, y_true, probas_pred)
def test_roc_curve_confidence():
# roc_curve for confidence scores
y_true, _, probas_pred = make_prediction(binary=True)
fpr, tpr, thresholds = roc_curve(y_true, probas_pred - 0.5)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.90, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_hard():
# roc_curve for hard decisions
y_true, pred, probas_pred = make_prediction(binary=True)
# always predict one
trivial_pred = np.ones(y_true.shape)
fpr, tpr, thresholds = roc_curve(y_true, trivial_pred)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.50, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
# always predict zero
trivial_pred = np.zeros(y_true.shape)
fpr, tpr, thresholds = roc_curve(y_true, trivial_pred)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.50, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
# hard decisions
fpr, tpr, thresholds = roc_curve(y_true, pred)
roc_auc = auc(fpr, tpr)
assert_array_almost_equal(roc_auc, 0.78, decimal=2)
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_one_label():
y_true = [1, 1, 1, 1, 1, 1, 1, 1, 1, 1]
y_pred = [0, 1, 0, 1, 0, 1, 0, 1, 0, 1]
# assert there are warnings
w = UndefinedMetricWarning
fpr, tpr, thresholds = assert_warns(w, roc_curve, y_true, y_pred)
# all true labels, all fpr should be nan
assert_array_equal(fpr,
np.nan * np.ones(len(thresholds)))
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
# assert there are warnings
fpr, tpr, thresholds = assert_warns(w, roc_curve,
[1 - x for x in y_true],
y_pred)
# all negative labels, all tpr should be nan
assert_array_equal(tpr,
np.nan * np.ones(len(thresholds)))
assert_equal(fpr.shape, tpr.shape)
assert_equal(fpr.shape, thresholds.shape)
def test_roc_curve_toydata():
# Binary classification
y_true = [0, 1]
y_score = [0, 1]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [1, 1])
assert_almost_equal(roc_auc, 1.)
y_true = [0, 1]
y_score = [1, 0]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1, 1])
assert_array_almost_equal(fpr, [0, 0, 1])
assert_almost_equal(roc_auc, 0.)
y_true = [1, 0]
y_score = [1, 1]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [0, 1])
assert_almost_equal(roc_auc, 0.5)
y_true = [1, 0]
y_score = [1, 0]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [1, 1])
assert_almost_equal(roc_auc, 1.)
y_true = [1, 0]
y_score = [0.5, 0.5]
tpr, fpr, _ = roc_curve(y_true, y_score)
roc_auc = roc_auc_score(y_true, y_score)
assert_array_almost_equal(tpr, [0, 1])
assert_array_almost_equal(fpr, [0, 1])
assert_almost_equal(roc_auc, .5)
y_true = [0, 0]
y_score = [0.25, 0.75]
# assert UndefinedMetricWarning because of no positive sample in y_true
tpr, fpr, _ = assert_warns(UndefinedMetricWarning, roc_curve, y_true, y_score)
assert_raises(ValueError, roc_auc_score, y_true, y_score)
assert_array_almost_equal(tpr, [0., 0.5, 1.])
assert_array_almost_equal(fpr, [np.nan, np.nan, np.nan])
y_true = [1, 1]
y_score = [0.25, 0.75]
# assert UndefinedMetricWarning because of no negative sample in y_true
tpr, fpr, _ = assert_warns(UndefinedMetricWarning, roc_curve, y_true, y_score)
assert_raises(ValueError, roc_auc_score, y_true, y_score)
assert_array_almost_equal(tpr, [np.nan, np.nan])
assert_array_almost_equal(fpr, [0.5, 1.])
# Multi-label classification task
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [0, 1]])
assert_raises(ValueError, roc_auc_score, y_true, y_score, average="macro")
assert_raises(ValueError, roc_auc_score, y_true, y_score,
average="weighted")
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), 1.)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), 1.)
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_raises(ValueError, roc_auc_score, y_true, y_score, average="macro")
assert_raises(ValueError, roc_auc_score, y_true, y_score,
average="weighted")
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), 0.5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), 0.5)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_almost_equal(roc_auc_score(y_true, y_score, average="macro"), 0)
assert_almost_equal(roc_auc_score(y_true, y_score, average="weighted"), 0)
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), 0)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), 0)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0.5, 0.5], [0.5, 0.5]])
assert_almost_equal(roc_auc_score(y_true, y_score, average="macro"), .5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="weighted"), .5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="samples"), .5)
assert_almost_equal(roc_auc_score(y_true, y_score, average="micro"), .5)
def test_roc_curve_drop_intermediate():
# Test that drop_intermediate drops the correct thresholds
y_true = [0, 0, 0, 0, 1, 1]
y_score = [0., 0.2, 0.5, 0.6, 0.7, 1.0]
tpr, fpr, thresholds = roc_curve(y_true, y_score, drop_intermediate=True)
assert_array_almost_equal(thresholds, [1., 0.7, 0.])
# Test dropping thresholds with repeating scores
y_true = [0, 0, 0, 0, 0, 0, 0,
1, 1, 1, 1, 1, 1]
y_score = [0., 0.1, 0.6, 0.6, 0.7, 0.8, 0.9,
0.6, 0.7, 0.8, 0.9, 0.9, 1.0]
tpr, fpr, thresholds = roc_curve(y_true, y_score, drop_intermediate=True)
assert_array_almost_equal(thresholds,
[1.0, 0.9, 0.7, 0.6, 0.])
def test_auc():
# Test Area Under Curve (AUC) computation
x = [0, 1]
y = [0, 1]
assert_array_almost_equal(auc(x, y), 0.5)
x = [1, 0]
y = [0, 1]
assert_array_almost_equal(auc(x, y), 0.5)
x = [1, 0, 0]
y = [0, 1, 1]
assert_array_almost_equal(auc(x, y), 0.5)
x = [0, 1]
y = [1, 1]
assert_array_almost_equal(auc(x, y), 1)
x = [0, 0.5, 1]
y = [0, 0.5, 1]
assert_array_almost_equal(auc(x, y), 0.5)
def test_auc_duplicate_values():
# Test Area Under Curve (AUC) computation with duplicate values
# auc() was previously sorting the x and y arrays according to the indices
# from numpy.argsort(x), which was reordering the tied 0's in this example
# and resulting in an incorrect area computation. This test detects the
# error.
x = [-2.0, 0.0, 0.0, 0.0, 1.0]
y1 = [2.0, 0.0, 0.5, 1.0, 1.0]
y2 = [2.0, 1.0, 0.0, 0.5, 1.0]
y3 = [2.0, 1.0, 0.5, 0.0, 1.0]
for y in (y1, y2, y3):
assert_array_almost_equal(auc(x, y, reorder=True), 3.0)
def test_auc_errors():
# Incompatible shapes
assert_raises(ValueError, auc, [0.0, 0.5, 1.0], [0.1, 0.2])
# Too few x values
assert_raises(ValueError, auc, [0.0], [0.1])
# x is not in order
assert_raises(ValueError, auc, [1.0, 0.0, 0.5], [0.0, 0.0, 0.0])
def test_auc_score_non_binary_class():
# Test that roc_auc_score function returns an error when trying
# to compute AUC for non-binary class values.
rng = check_random_state(404)
y_pred = rng.rand(10)
# y_true contains only one class value
y_true = np.zeros(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = -np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
# y_true contains three different class values
y_true = rng.randint(0, 3, size=10)
assert_raise_message(ValueError, "multiclass format is not supported",
roc_auc_score, y_true, y_pred)
clean_warning_registry()
with warnings.catch_warnings(record=True):
rng = check_random_state(404)
y_pred = rng.rand(10)
# y_true contains only one class value
y_true = np.zeros(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
y_true = -np.ones(10, dtype="int")
assert_raise_message(ValueError, "ROC AUC score is not defined",
roc_auc_score, y_true, y_pred)
# y_true contains three different class values
y_true = rng.randint(0, 3, size=10)
assert_raise_message(ValueError, "multiclass format is not supported",
roc_auc_score, y_true, y_pred)
def test_precision_recall_curve():
y_true, _, probas_pred = make_prediction(binary=True)
_test_precision_recall_curve(y_true, probas_pred)
# Use {-1, 1} for labels; make sure original labels aren't modified
y_true[np.where(y_true == 0)] = -1
y_true_copy = y_true.copy()
_test_precision_recall_curve(y_true, probas_pred)
assert_array_equal(y_true_copy, y_true)
labels = [1, 0, 0, 1]
predict_probas = [1, 2, 3, 4]
p, r, t = precision_recall_curve(labels, predict_probas)
assert_array_almost_equal(p, np.array([0.5, 0.33333333, 0.5, 1., 1.]))
assert_array_almost_equal(r, np.array([1., 0.5, 0.5, 0.5, 0.]))
assert_array_almost_equal(t, np.array([1, 2, 3, 4]))
assert_equal(p.size, r.size)
assert_equal(p.size, t.size + 1)
def test_precision_recall_curve_pos_label():
y_true, _, probas_pred = make_prediction(binary=False)
pos_label = 2
p, r, thresholds = precision_recall_curve(y_true,
probas_pred[:, pos_label],
pos_label=pos_label)
p2, r2, thresholds2 = precision_recall_curve(y_true == pos_label,
probas_pred[:, pos_label])
assert_array_almost_equal(p, p2)
assert_array_almost_equal(r, r2)
assert_array_almost_equal(thresholds, thresholds2)
assert_equal(p.size, r.size)
assert_equal(p.size, thresholds.size + 1)
def _test_precision_recall_curve(y_true, probas_pred):
# Test Precision-Recall and aread under PR curve
p, r, thresholds = precision_recall_curve(y_true, probas_pred)
precision_recall_auc = auc(r, p)
assert_array_almost_equal(precision_recall_auc, 0.85, 2)
assert_array_almost_equal(precision_recall_auc,
average_precision_score(y_true, probas_pred))
assert_almost_equal(_average_precision(y_true, probas_pred),
precision_recall_auc, 1)
assert_equal(p.size, r.size)
assert_equal(p.size, thresholds.size + 1)
# Smoke test in the case of proba having only one value
p, r, thresholds = precision_recall_curve(y_true,
np.zeros_like(probas_pred))
precision_recall_auc = auc(r, p)
assert_array_almost_equal(precision_recall_auc, 0.75, 3)
assert_equal(p.size, r.size)
assert_equal(p.size, thresholds.size + 1)
def test_precision_recall_curve_errors():
# Contains non-binary labels
assert_raises(ValueError, precision_recall_curve,
[0, 1, 2], [[0.0], [1.0], [1.0]])
def test_precision_recall_curve_toydata():
with np.errstate(all="raise"):
# Binary classification
y_true = [0, 1]
y_score = [0, 1]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [1, 1])
assert_array_almost_equal(r, [1, 0])
assert_almost_equal(auc_prc, 1.)
y_true = [0, 1]
y_score = [1, 0]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [0.5, 0., 1.])
assert_array_almost_equal(r, [1., 0., 0.])
assert_almost_equal(auc_prc, 0.25)
y_true = [1, 0]
y_score = [1, 1]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [0.5, 1])
assert_array_almost_equal(r, [1., 0])
assert_almost_equal(auc_prc, .75)
y_true = [1, 0]
y_score = [1, 0]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [1, 1])
assert_array_almost_equal(r, [1, 0])
assert_almost_equal(auc_prc, 1.)
y_true = [1, 0]
y_score = [0.5, 0.5]
p, r, _ = precision_recall_curve(y_true, y_score)
auc_prc = average_precision_score(y_true, y_score)
assert_array_almost_equal(p, [0.5, 1])
assert_array_almost_equal(r, [1, 0.])
assert_almost_equal(auc_prc, .75)
y_true = [0, 0]
y_score = [0.25, 0.75]
assert_raises(Exception, precision_recall_curve, y_true, y_score)
assert_raises(Exception, average_precision_score, y_true, y_score)
y_true = [1, 1]
y_score = [0.25, 0.75]
p, r, _ = precision_recall_curve(y_true, y_score)
assert_almost_equal(average_precision_score(y_true, y_score), 1.)
assert_array_almost_equal(p, [1., 1., 1.])
assert_array_almost_equal(r, [1, 0.5, 0.])
# Multi-label classification task
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [0, 1]])
assert_raises(Exception, average_precision_score, y_true, y_score,
average="macro")
assert_raises(Exception, average_precision_score, y_true, y_score,
average="weighted")
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 1.)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 1.)
y_true = np.array([[0, 1], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_raises(Exception, average_precision_score, y_true, y_score,
average="macro")
assert_raises(Exception, average_precision_score, y_true, y_score,
average="weighted")
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 0.625)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 0.625)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0, 1], [1, 0]])
assert_almost_equal(average_precision_score(y_true, y_score,
average="macro"), 0.25)
assert_almost_equal(average_precision_score(y_true, y_score,
average="weighted"), 0.25)
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 0.25)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 0.25)
y_true = np.array([[1, 0], [0, 1]])
y_score = np.array([[0.5, 0.5], [0.5, 0.5]])
assert_almost_equal(average_precision_score(y_true, y_score,
average="macro"), 0.75)
assert_almost_equal(average_precision_score(y_true, y_score,
average="weighted"), 0.75)
assert_almost_equal(average_precision_score(y_true, y_score,
average="samples"), 0.75)
assert_almost_equal(average_precision_score(y_true, y_score,
average="micro"), 0.75)
def test_score_scale_invariance():
# Test that average_precision_score and roc_auc_score are invariant by
# the scaling or shifting of probabilities
y_true, _, probas_pred = make_prediction(binary=True)
roc_auc = roc_auc_score(y_true, probas_pred)
roc_auc_scaled = roc_auc_score(y_true, 100 * probas_pred)
roc_auc_shifted = roc_auc_score(y_true, probas_pred - 10)
assert_equal(roc_auc, roc_auc_scaled)
assert_equal(roc_auc, roc_auc_shifted)
pr_auc = average_precision_score(y_true, probas_pred)
pr_auc_scaled = average_precision_score(y_true, 100 * probas_pred)
pr_auc_shifted = average_precision_score(y_true, probas_pred - 10)
assert_equal(pr_auc, pr_auc_scaled)
assert_equal(pr_auc, pr_auc_shifted)
def check_lrap_toy(lrap_score):
# Check on several small example that it works
assert_almost_equal(lrap_score([[0, 1]], [[0.25, 0.75]]), 1)
assert_almost_equal(lrap_score([[0, 1]], [[0.75, 0.25]]), 1 / 2)
assert_almost_equal(lrap_score([[1, 1]], [[0.75, 0.25]]), 1)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.25, 0.5, 0.75]]), 1)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.25, 0.5, 0.75]]), 1 / 2)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.25, 0.5, 0.75]]), 1)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.25, 0.5, 0.75]]), 1 / 3)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.25, 0.5, 0.75]]),
(2 / 3 + 1 / 1) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.25, 0.5, 0.75]]),
(2 / 3 + 1 / 2) / 2)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.75, 0.5, 0.25]]), 1 / 3)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.75, 0.5, 0.25]]), 1 / 2)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.75, 0.5, 0.25]]),
(1 / 2 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.75, 0.5, 0.25]]),
(1 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(lrap_score([[1, 1, 1]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.5, 0.75, 0.25]]), 1 / 3)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.5, 0.75, 0.25]]), 1)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.5, 0.75, 0.25]]),
(1 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.5, 0.75, 0.25]]), 1 / 2)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.5, 0.75, 0.25]]),
(1 / 2 + 2 / 3) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.5, 0.75, 0.25]]), 1)
assert_almost_equal(lrap_score([[1, 1, 1]], [[0.5, 0.75, 0.25]]), 1)
# Tie handling
assert_almost_equal(lrap_score([[1, 0]], [[0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[0, 1]], [[0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[1, 1]], [[0.5, 0.5]]), 1)
assert_almost_equal(lrap_score([[0, 0, 1]], [[0.25, 0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[0, 1, 0]], [[0.25, 0.5, 0.5]]), 0.5)
assert_almost_equal(lrap_score([[0, 1, 1]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(lrap_score([[1, 0, 0]], [[0.25, 0.5, 0.5]]), 1 / 3)
assert_almost_equal(lrap_score([[1, 0, 1]], [[0.25, 0.5, 0.5]]),
(2 / 3 + 1 / 2) / 2)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.25, 0.5, 0.5]]),
(2 / 3 + 1 / 2) / 2)
assert_almost_equal(lrap_score([[1, 1, 1]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(lrap_score([[1, 1, 0]], [[0.5, 0.5, 0.5]]), 2 / 3)
assert_almost_equal(lrap_score([[1, 1, 1, 0]], [[0.5, 0.5, 0.5, 0.5]]),
3 / 4)
def check_zero_or_all_relevant_labels(lrap_score):
random_state = check_random_state(0)
for n_labels in range(2, 5):
y_score = random_state.uniform(size=(1, n_labels))
y_score_ties = np.zeros_like(y_score)
# No relevant labels
y_true = np.zeros((1, n_labels))
assert_equal(lrap_score(y_true, y_score), 1.)
assert_equal(lrap_score(y_true, y_score_ties), 1.)
# Only relevant labels
y_true = np.ones((1, n_labels))
assert_equal(lrap_score(y_true, y_score), 1.)
assert_equal(lrap_score(y_true, y_score_ties), 1.)
# Degenerate case: only one label
assert_almost_equal(lrap_score([[1], [0], [1], [0]],
[[0.5], [0.5], [0.5], [0.5]]), 1.)
def check_lrap_error_raised(lrap_score):
# Raise value error if not appropriate format
assert_raises(ValueError, lrap_score,
[0, 1, 0], [0.25, 0.3, 0.2])
assert_raises(ValueError, lrap_score, [0, 1, 2],
[[0.25, 0.75, 0.0], [0.7, 0.3, 0.0], [0.8, 0.2, 0.0]])
assert_raises(ValueError, lrap_score, [(0), (1), (2)],
[[0.25, 0.75, 0.0], [0.7, 0.3, 0.0], [0.8, 0.2, 0.0]])
# Check that y_true.shape != y_score.shape raise the proper exception
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [0, 1])
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [[0, 1]])
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [[0], [1]])
assert_raises(ValueError, lrap_score, [[0, 1]], [[0, 1], [0, 1]])
assert_raises(ValueError, lrap_score, [[0], [1]], [[0, 1], [0, 1]])
assert_raises(ValueError, lrap_score, [[0, 1], [0, 1]], [[0], [1]])
def check_lrap_only_ties(lrap_score):
# Check tie handling in score
# Basic check with only ties and increasing label space
for n_labels in range(2, 10):
y_score = np.ones((1, n_labels))
# Check for growing number of consecutive relevant
for n_relevant in range(1, n_labels):
# Check for a bunch of positions
for pos in range(n_labels - n_relevant):
y_true = np.zeros((1, n_labels))
y_true[0, pos:pos + n_relevant] = 1
assert_almost_equal(lrap_score(y_true, y_score),
n_relevant / n_labels)
def check_lrap_without_tie_and_increasing_score(lrap_score):
# Check that Label ranking average precision works for various
# Basic check with increasing label space size and decreasing score
for n_labels in range(2, 10):
y_score = n_labels - (np.arange(n_labels).reshape((1, n_labels)) + 1)
# First and last
y_true = np.zeros((1, n_labels))
y_true[0, 0] = 1
y_true[0, -1] = 1
assert_almost_equal(lrap_score(y_true, y_score),
(2 / n_labels + 1) / 2)
# Check for growing number of consecutive relevant label
for n_relevant in range(1, n_labels):
# Check for a bunch of position
for pos in range(n_labels - n_relevant):
y_true = np.zeros((1, n_labels))
y_true[0, pos:pos + n_relevant] = 1
assert_almost_equal(lrap_score(y_true, y_score),
sum((r + 1) / ((pos + r + 1) * n_relevant)
for r in range(n_relevant)))
def _my_lrap(y_true, y_score):
"""Simple implementation of label ranking average precision"""
check_consistent_length(y_true, y_score)
y_true = check_array(y_true)
y_score = check_array(y_score)
n_samples, n_labels = y_true.shape
score = np.empty((n_samples, ))
for i in range(n_samples):
# The best rank correspond to 1. Rank higher than 1 are worse.
# The best inverse ranking correspond to n_labels.
unique_rank, inv_rank = np.unique(y_score[i], return_inverse=True)
n_ranks = unique_rank.size
rank = n_ranks - inv_rank
# Rank need to be corrected to take into account ties
# ex: rank 1 ex aequo means that both label are rank 2.
corr_rank = np.bincount(rank, minlength=n_ranks + 1).cumsum()
rank = corr_rank[rank]
relevant = y_true[i].nonzero()[0]
if relevant.size == 0 or relevant.size == n_labels:
score[i] = 1
continue
score[i] = 0.
for label in relevant:
# Let's count the number of relevant label with better rank
# (smaller rank).
n_ranked_above = sum(rank[r] <= rank[label] for r in relevant)
# Weight by the rank of the actual label
score[i] += n_ranked_above / rank[label]
score[i] /= relevant.size
return score.mean()
def check_alternative_lrap_implementation(lrap_score, n_classes=5,
n_samples=20, random_state=0):
_, y_true = make_multilabel_classification(n_features=1,
allow_unlabeled=False,
random_state=random_state,
n_classes=n_classes,
n_samples=n_samples)
# Score with ties
y_score = sparse_random_matrix(n_components=y_true.shape[0],
n_features=y_true.shape[1],
random_state=random_state)
if hasattr(y_score, "toarray"):
y_score = y_score.toarray()
score_lrap = label_ranking_average_precision_score(y_true, y_score)
score_my_lrap = _my_lrap(y_true, y_score)
assert_almost_equal(score_lrap, score_my_lrap)
# Uniform score
random_state = check_random_state(random_state)
y_score = random_state.uniform(size=(n_samples, n_classes))
score_lrap = label_ranking_average_precision_score(y_true, y_score)
score_my_lrap = _my_lrap(y_true, y_score)
assert_almost_equal(score_lrap, score_my_lrap)
def test_label_ranking_avp():
for fn in [label_ranking_average_precision_score, _my_lrap]:
yield check_lrap_toy, fn
yield check_lrap_without_tie_and_increasing_score, fn
yield check_lrap_only_ties, fn
yield check_zero_or_all_relevant_labels, fn
yield check_lrap_error_raised, label_ranking_average_precision_score
for n_samples, n_classes, random_state in product((1, 2, 8, 20),
(2, 5, 10),
range(1)):
yield (check_alternative_lrap_implementation,
label_ranking_average_precision_score,
n_classes, n_samples, random_state)
def test_coverage_error():
# Toy case
assert_almost_equal(coverage_error([[0, 1]], [[0.25, 0.75]]), 1)
assert_almost_equal(coverage_error([[0, 1]], [[0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 1]], [[0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[0, 0]], [[0.75, 0.25]]), 0)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.25, 0.5, 0.75]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.25, 0.5, 0.75]]), 1)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.25, 0.5, 0.75]]), 2)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.25, 0.5, 0.75]]), 2)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.25, 0.5, 0.75]]), 3)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.75, 0.5, 0.25]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.75, 0.5, 0.25]]), 2)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.75, 0.5, 0.25]]), 1)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.75, 0.5, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.75, 0.5, 0.25]]), 3)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.5, 0.75, 0.25]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.5, 0.75, 0.25]]), 3)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.5, 0.75, 0.25]]), 1)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.5, 0.75, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.5, 0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.5, 0.75, 0.25]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.5, 0.75, 0.25]]), 2)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.5, 0.75, 0.25]]), 3)
# Non trival case
assert_almost_equal(coverage_error([[0, 1, 0], [1, 1, 0]],
[[0.1, 10., -3], [0, 1, 3]]),
(1 + 3) / 2.)
assert_almost_equal(coverage_error([[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [0, 1, 3], [0, 2, 0]]),
(1 + 3 + 3) / 3.)
assert_almost_equal(coverage_error([[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [3, 1, 3], [0, 2, 0]]),
(1 + 3 + 3) / 3.)
def test_coverage_tie_handling():
assert_almost_equal(coverage_error([[0, 0]], [[0.5, 0.5]]), 0)
assert_almost_equal(coverage_error([[1, 0]], [[0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 1]], [[0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[1, 1]], [[0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 0, 0]], [[0.25, 0.5, 0.5]]), 0)
assert_almost_equal(coverage_error([[0, 0, 1]], [[0.25, 0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 1, 0]], [[0.25, 0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[0, 1, 1]], [[0.25, 0.5, 0.5]]), 2)
assert_almost_equal(coverage_error([[1, 0, 0]], [[0.25, 0.5, 0.5]]), 3)
assert_almost_equal(coverage_error([[1, 0, 1]], [[0.25, 0.5, 0.5]]), 3)
assert_almost_equal(coverage_error([[1, 1, 0]], [[0.25, 0.5, 0.5]]), 3)
assert_almost_equal(coverage_error([[1, 1, 1]], [[0.25, 0.5, 0.5]]), 3)
def test_label_ranking_loss():
assert_almost_equal(label_ranking_loss([[0, 1]], [[0.25, 0.75]]), 0)
assert_almost_equal(label_ranking_loss([[0, 1]], [[0.75, 0.25]]), 1)
assert_almost_equal(label_ranking_loss([[0, 0, 1]], [[0.25, 0.5, 0.75]]),
0)
assert_almost_equal(label_ranking_loss([[0, 1, 0]], [[0.25, 0.5, 0.75]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[0, 1, 1]], [[0.25, 0.5, 0.75]]),
0)
assert_almost_equal(label_ranking_loss([[1, 0, 0]], [[0.25, 0.5, 0.75]]),
2 / 2)
assert_almost_equal(label_ranking_loss([[1, 0, 1]], [[0.25, 0.5, 0.75]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[1, 1, 0]], [[0.25, 0.5, 0.75]]),
2 / 2)
# Undefined metrics - the ranking doesn't matter
assert_almost_equal(label_ranking_loss([[0, 0]], [[0.75, 0.25]]), 0)
assert_almost_equal(label_ranking_loss([[1, 1]], [[0.75, 0.25]]), 0)
assert_almost_equal(label_ranking_loss([[0, 0]], [[0.5, 0.5]]), 0)
assert_almost_equal(label_ranking_loss([[1, 1]], [[0.5, 0.5]]), 0)
assert_almost_equal(label_ranking_loss([[0, 0, 0]], [[0.5, 0.75, 0.25]]),
0)
assert_almost_equal(label_ranking_loss([[1, 1, 1]], [[0.5, 0.75, 0.25]]),
0)
assert_almost_equal(label_ranking_loss([[0, 0, 0]], [[0.25, 0.5, 0.5]]),
0)
assert_almost_equal(label_ranking_loss([[1, 1, 1]], [[0.25, 0.5, 0.5]]), 0)
# Non trival case
assert_almost_equal(label_ranking_loss([[0, 1, 0], [1, 1, 0]],
[[0.1, 10., -3], [0, 1, 3]]),
(0 + 2 / 2) / 2.)
assert_almost_equal(label_ranking_loss(
[[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [0, 1, 3], [0, 2, 0]]),
(0 + 2 / 2 + 1 / 2) / 3.)
assert_almost_equal(label_ranking_loss(
[[0, 1, 0], [1, 1, 0], [0, 1, 1]],
[[0.1, 10, -3], [3, 1, 3], [0, 2, 0]]),
(0 + 2 / 2 + 1 / 2) / 3.)
# Sparse csr matrices
assert_almost_equal(label_ranking_loss(
csr_matrix(np.array([[0, 1, 0], [1, 1, 0]])),
[[0.1, 10, -3], [3, 1, 3]]),
(0 + 2 / 2) / 2.)
def test_ranking_appropriate_input_shape():
# Check that y_true.shape != y_score.shape raise the proper exception
assert_raises(ValueError, label_ranking_loss, [[0, 1], [0, 1]], [0, 1])
assert_raises(ValueError, label_ranking_loss, [[0, 1], [0, 1]], [[0, 1]])
assert_raises(ValueError, label_ranking_loss,
[[0, 1], [0, 1]], [[0], [1]])
assert_raises(ValueError, label_ranking_loss, [[0, 1]], [[0, 1], [0, 1]])
assert_raises(ValueError, label_ranking_loss,
[[0], [1]], [[0, 1], [0, 1]])
assert_raises(ValueError, label_ranking_loss, [[0, 1], [0, 1]], [[0], [1]])
def test_ranking_loss_ties_handling():
# Tie handling
assert_almost_equal(label_ranking_loss([[1, 0]], [[0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[0, 1]], [[0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[0, 0, 1]], [[0.25, 0.5, 0.5]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[0, 1, 0]], [[0.25, 0.5, 0.5]]),
1 / 2)
assert_almost_equal(label_ranking_loss([[0, 1, 1]], [[0.25, 0.5, 0.5]]), 0)
assert_almost_equal(label_ranking_loss([[1, 0, 0]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[1, 0, 1]], [[0.25, 0.5, 0.5]]), 1)
assert_almost_equal(label_ranking_loss([[1, 1, 0]], [[0.25, 0.5, 0.5]]), 1)
| bsd-3-clause |
ahoyosid/scikit-learn | sklearn/metrics/metrics.py | 232 | 1262 | import warnings
warnings.warn("sklearn.metrics.metrics is deprecated and will be removed in "
"0.18. Please import from sklearn.metrics",
DeprecationWarning)
from .ranking import auc
from .ranking import average_precision_score
from .ranking import label_ranking_average_precision_score
from .ranking import precision_recall_curve
from .ranking import roc_auc_score
from .ranking import roc_curve
from .classification import accuracy_score
from .classification import classification_report
from .classification import confusion_matrix
from .classification import f1_score
from .classification import fbeta_score
from .classification import hamming_loss
from .classification import hinge_loss
from .classification import jaccard_similarity_score
from .classification import log_loss
from .classification import matthews_corrcoef
from .classification import precision_recall_fscore_support
from .classification import precision_score
from .classification import recall_score
from .classification import zero_one_loss
from .regression import explained_variance_score
from .regression import mean_absolute_error
from .regression import mean_squared_error
from .regression import median_absolute_error
from .regression import r2_score
| bsd-3-clause |
idlead/scikit-learn | examples/linear_model/plot_bayesian_ridge.py | 17 | 2733 | """
=========================
Bayesian Ridge Regression
=========================
Computes a Bayesian Ridge Regression on a synthetic dataset.
See :ref:`bayesian_ridge_regression` for more information on the regressor.
Compared to the OLS (ordinary least squares) estimator, the coefficient
weights are slightly shifted toward zeros, which stabilises them.
As the prior on the weights is a Gaussian prior, the histogram of the
estimated weights is Gaussian.
The estimation of the model is done by iteratively maximizing the
marginal log-likelihood of the observations.
"""
print(__doc__)
import numpy as np
import matplotlib.pyplot as plt
from scipy import stats
from sklearn.linear_model import BayesianRidge, LinearRegression
###############################################################################
# Generating simulated data with Gaussian weigthts
np.random.seed(0)
n_samples, n_features = 100, 100
X = np.random.randn(n_samples, n_features) # Create Gaussian data
# Create weigts with a precision lambda_ of 4.
lambda_ = 4.
w = np.zeros(n_features)
# Only keep 10 weights of interest
relevant_features = np.random.randint(0, n_features, 10)
for i in relevant_features:
w[i] = stats.norm.rvs(loc=0, scale=1. / np.sqrt(lambda_))
# Create noise with a precision alpha of 50.
alpha_ = 50.
noise = stats.norm.rvs(loc=0, scale=1. / np.sqrt(alpha_), size=n_samples)
# Create the target
y = np.dot(X, w) + noise
###############################################################################
# Fit the Bayesian Ridge Regression and an OLS for comparison
clf = BayesianRidge(compute_score=True)
clf.fit(X, y)
ols = LinearRegression()
ols.fit(X, y)
###############################################################################
# Plot true weights, estimated weights and histogram of the weights
lw = 2
plt.figure(figsize=(6, 5))
plt.title("Weights of the model")
plt.plot(clf.coef_, color='lightgreen', linewidth=lw,
label="Bayesian Ridge estimate")
plt.plot(w, color='gold', linewidth=lw, label="Ground truth")
plt.plot(ols.coef_, color='navy', linestyle='--', label="OLS estimate")
plt.xlabel("Features")
plt.ylabel("Values of the weights")
plt.legend(loc="best", prop=dict(size=12))
plt.figure(figsize=(6, 5))
plt.title("Histogram of the weights")
plt.hist(clf.coef_, bins=n_features, color='gold', log=True)
plt.scatter(clf.coef_[relevant_features], 5 * np.ones(len(relevant_features)),
color='navy', label="Relevant features")
plt.ylabel("Features")
plt.xlabel("Values of the weights")
plt.legend(loc="upper left")
plt.figure(figsize=(6, 5))
plt.title("Marginal log-likelihood")
plt.plot(clf.scores_, color='navy', linewidth=lw)
plt.ylabel("Score")
plt.xlabel("Iterations")
plt.show()
| bsd-3-clause |
idlead/scikit-learn | sklearn/utils/metaestimators.py | 281 | 2353 | """Utilities for meta-estimators"""
# Author: Joel Nothman
# Andreas Mueller
# Licence: BSD
from operator import attrgetter
from functools import update_wrapper
__all__ = ['if_delegate_has_method']
class _IffHasAttrDescriptor(object):
"""Implements a conditional property using the descriptor protocol.
Using this class to create a decorator will raise an ``AttributeError``
if the ``attribute_name`` is not present on the base object.
This allows ducktyping of the decorated method based on ``attribute_name``.
See https://docs.python.org/3/howto/descriptor.html for an explanation of
descriptors.
"""
def __init__(self, fn, attribute_name):
self.fn = fn
self.get_attribute = attrgetter(attribute_name)
# update the docstring of the descriptor
update_wrapper(self, fn)
def __get__(self, obj, type=None):
# raise an AttributeError if the attribute is not present on the object
if obj is not None:
# delegate only on instances, not the classes.
# this is to allow access to the docstrings.
self.get_attribute(obj)
# lambda, but not partial, allows help() to work with update_wrapper
out = lambda *args, **kwargs: self.fn(obj, *args, **kwargs)
# update the docstring of the returned function
update_wrapper(out, self.fn)
return out
def if_delegate_has_method(delegate):
"""Create a decorator for methods that are delegated to a sub-estimator
This enables ducktyping by hasattr returning True according to the
sub-estimator.
>>> from sklearn.utils.metaestimators import if_delegate_has_method
>>>
>>>
>>> class MetaEst(object):
... def __init__(self, sub_est):
... self.sub_est = sub_est
...
... @if_delegate_has_method(delegate='sub_est')
... def predict(self, X):
... return self.sub_est.predict(X)
...
>>> class HasPredict(object):
... def predict(self, X):
... return X.sum(axis=1)
...
>>> class HasNoPredict(object):
... pass
...
>>> hasattr(MetaEst(HasPredict()), 'predict')
True
>>> hasattr(MetaEst(HasNoPredict()), 'predict')
False
"""
return lambda fn: _IffHasAttrDescriptor(fn, '%s.%s' % (delegate, fn.__name__))
| bsd-3-clause |
txomon/SpockBot | spock/mcmap/mapdata.py | 1 | 41665 | from spock.utils import BoundingBox
# Materials
MCM_MAT_ROCK = 0x00
MCM_MAT_DIRT = 0x01
MCM_MAT_WOOD = 0x02
MCM_MAT_WEB = 0x03
MCM_MAT_WOOL = 0x04
MCM_MAT_VINE = 0x05
MCM_MAT_LEAVES = 0x06
# Gate
MCM_GATE_SOUTH = 0x00
MCM_GATE_WEST = 0x01
MCM_GATE_NORTH = 0x02
MCM_GATE_EAST = 0x03
MCM_GATE_CLOSE = 0x00
MCM_GATE_OPEN = 0x01
MCM_GATE_UNPOWERED = 0x00
MCM_GATE_POWERED = 0x01
# Door
MCM_DOOR_WEST = 0x00
MCM_DOOR_NORTH = 0x01
MCM_DOOR_EAST = 0x02
MCM_DOOR_SOUTH = 0x03
MCM_DOOR_CLOSE = 0x00
MCM_DOOR_OPEN = 0x01
MCM_DOOR_LOWER = 0x00
MCM_DOOR_UPPER = 0x01
MCM_DOOR_HINGE_LEFT = 0x00
MCM_DOOR_HINGE_RIGHT = 0x01
# Trapdoor
MCM_TRAPDOOR_WEST = 0x00
MCM_TRAPDOOR_NORTH = 0x01
MCM_TRAPDOOR_EAST = 0x02
MCM_TRAPDOOR_SOUTH = 0x03
MCM_TRAPDOOR_CLOSE = 0x00
MCM_TRAPDOOR_OPEN = 0x01
MCM_TRAPDOOR_LOWER = 0x00
MCM_TRAPDOOR_UPPER = 0x01
# Slab
MCM_SLAB_LOWER = 0x00
MCM_SLAB_UPPER = 0x01
blocks = {}
def map_block(block_id):
def inner(cl):
blocks[block_id] = cl
cl.block_id = block_id
return cl
return inner
def get_block(block_id, meta=0, init=True):
if init:
return blocks[block_id](meta) if block_id < len(blocks) else None
else:
return blocks[block_id] if block_id < len(blocks) else None
class MapBlock(object):
display_name = 'Map Block'
name = 'map_block'
hardness = 0
stack_size = 64
diggable = True
material = None
harvest_tools = None
def __init__(self, meta):
self.bounding_box = BoundingBox(1, 1)
def change_meta(self, meta):
pass
class FenceBlock(MapBlock):
def __init__(self, meta):
self.bounding_box = BoundingBox(1, 1.5)
class GateBlock(MapBlock):
def __init__(self, meta):
self.direction = meta & 0x03
self.open = (meta >> 2) & 0x01 == MCM_GATE_OPEN
self.powered = meta >> 3 == MCM_GATE_POWERED
if self.open:
self.bounding_box = None
else:
self.bounding_box = BoundingBox(1, 1.5)
class DoorBlock(MapBlock):
def __init__(self, meta):
self.section = (meta >> 3) & 0x1
if self.section == MCM_DOOR_LOWER:
self.open = (meta >> 2) & 0x01 == MCM_DOOR_OPEN
self.direction = meta & 0x03
if not self.open:
self.bounding_box = BoundingBox(1, 2)
else:
self.bounding_box = None
elif self.section == MCM_DOOR_UPPER:
self.hinge = meta & 0x01
self.bounding_box = None
class SlabBlock(MapBlock):
def __init__(self, meta):
self.orientation = (meta >> 3) & 0x1
self.bounding_box = BoundingBox(1, 1)
class StairBlock(MapBlock):
def __init__(self, meta):
self.bounding_box = BoundingBox(1, 1)
class TrapdoorBlock(MapBlock):
def __init__(self, meta):
self.direction = meta & 0x03
self.open = (meta >> 2) & 0x01 == MCM_TRAPDOOR_OPEN
self.orientation = (meta >> 3) & 0x1
if self.open == MCM_TRAPDOOR_OPEN:
self.bounding_box = None
elif self.orientation == MCM_TRAPDOOR_UPPER:
self.bounding_box = BoundingBox(1, 1)
elif self.orientation == MCM_TRAPDOOR_LOWER:
self.bounding_box = BoundingBox(1, 0.4)
class NoCollisionBlock(MapBlock):
def __init__(self, meta):
self.bounding_box = None
@map_block(0)
class AirBlock(NoCollisionBlock):
display_name = 'Air'
name = 'air'
diggable = False
@map_block(1)
class StoneBlock(MapBlock):
display_name = 'Stone'
name = 'stone'
hardness = 1.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(2)
class GrassBlock(MapBlock):
display_name = 'Grass Block'
name = 'grass'
hardness = 0.6
material = MCM_MAT_DIRT
@map_block(3)
class DirtBlock(MapBlock):
display_name = 'Dirt'
name = 'dirt'
hardness = 0.5
material = MCM_MAT_DIRT
@map_block(4)
class CobbleBlock(MapBlock):
display_name = 'Cobblestone'
name = 'stonebrick'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(5)
class WoodplankBlock(MapBlock):
display_name = 'Wooden Planks'
name = 'wood'
hardness = 2
material = MCM_MAT_WOOD
@map_block(6)
class SaplingBlock(NoCollisionBlock):
display_name = 'Sapling'
name = 'sapling'
@map_block(7)
class BedrockBlock(MapBlock):
display_name = 'Bedrock'
name = 'bedrock'
hardness = None
diggable = False
@map_block(8)
class WaterBlock(NoCollisionBlock):
display_name = 'Water'
name = 'water'
hardness = 100
diggable = False
@map_block(9)
class StationarywaterBlock(NoCollisionBlock):
display_name = 'Stationary Water'
name = 'waterStationary'
hardness = 100
diggable = False
@map_block(10)
class LavaBlock(NoCollisionBlock):
display_name = 'Lava'
name = 'lava'
hardness = 100
diggable = False
@map_block(11)
class StationarylavaBlock(NoCollisionBlock):
display_name = 'Stationary Lava'
name = 'lavaStationary'
hardness = 100
diggable = False
@map_block(12)
class SandBlock(MapBlock):
display_name = 'Sand'
name = 'sand'
hardness = 0.5
material = MCM_MAT_DIRT
@map_block(13)
class GravelBlock(MapBlock):
display_name = 'Gravel'
name = 'gravel'
hardness = 0.6
material = MCM_MAT_DIRT
@map_block(14)
class GoldoreBlock(MapBlock):
display_name = 'Gold Ore'
name = 'oreGold'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(15)
class IronoreBlock(MapBlock):
display_name = 'Iron Ore'
name = 'oreIron'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (274, 257, 278)
@map_block(16)
class CoaloreBlock(MapBlock):
display_name = 'Coal Ore'
name = 'oreCoal'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(17)
class Woodblock(MapBlock):
display_name = 'Wood'
name = 'log'
hardness = 2
material = MCM_MAT_WOOD
@map_block(18)
class LeavesBlock(MapBlock):
display_name = 'Leaves'
name = 'leaves'
hardness = 0.2
material = MCM_MAT_LEAVES
@map_block(19)
class SpongeBlock(MapBlock):
display_name = 'Sponge'
name = 'sponge'
hardness = 0.6
@map_block(20)
class GlassBlock(MapBlock):
display_name = 'Glass'
name = 'glass'
hardness = 0.3
@map_block(21)
class LapisoreBlock(MapBlock):
display_name = 'Lapis Lazuli Ore'
name = 'oreLapis'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (274, 257, 278)
@map_block(22)
class LapisBlock(MapBlock):
display_name = 'Lapis Lazuli Block'
name = 'blockLapis'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (274, 257, 278)
@map_block(23)
class DispenserBlock(MapBlock):
display_name = 'Dispenser'
name = 'dispenser'
hardness = 3.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(24)
class SandstoneBlock(MapBlock):
display_name = 'Sandstone'
name = 'sandStone'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(25)
class NoteBlock(MapBlock):
display_name = 'Note Block'
name = 'musicBlock'
hardness = 0.8
material = MCM_MAT_WOOD
@map_block(26)
class BedBlock(MapBlock):
display_name = 'Bed'
name = 'bed'
hardness = 0.2
stack_size = 1
@map_block(27)
class PoweredrailBlock(NoCollisionBlock):
display_name = 'Powered Rail'
name = 'goldenRail'
hardness = 0.7
material = MCM_MAT_ROCK
@map_block(28)
class DetectorrailBlock(NoCollisionBlock):
display_name = 'Detector Rail'
name = 'detectorRail'
hardness = 0.7
material = MCM_MAT_ROCK
@map_block(29)
class StickypistonBlock(MapBlock):
display_name = 'Sticky Piston'
name = 'pistonStickyBase'
@map_block(30)
class CobwebBlock(NoCollisionBlock):
display_name = 'Cobweb'
name = 'web'
hardness = 4
material = MCM_MAT_WEB
harvest_tools = (359, 267, 268, 272, 276, 283)
@map_block(31)
class TallgrassBlock(NoCollisionBlock):
display_name = 'Grass'
name = 'tallgrass'
@map_block(32)
class DeadbushBlock(NoCollisionBlock):
display_name = 'Dead Bush'
name = 'deadbush'
@map_block(33)
class PistonBlock(MapBlock):
display_name = 'Piston'
name = 'pistonBase'
@map_block(34)
class PistonextensionBlock(MapBlock):
display_name = 'Piston Extension'
name = 'pistonExtension'
@map_block(35)
class WoolBlock(MapBlock):
display_name = 'Wool'
name = 'cloth'
hardness = 0.8
material = MCM_MAT_WOOL
@map_block(36)
class PistonmovedBlock(MapBlock):
display_name = 'Block Moved by Piston'
name = 'blockMovedByPiston'
@map_block(37)
class FlowerBlock(NoCollisionBlock):
display_name = 'Flower'
name = 'flower'
@map_block(38)
class RoseBlock(NoCollisionBlock):
display_name = 'Rose'
name = 'rose'
@map_block(39)
class BrownshroomBlock(NoCollisionBlock):
display_name = 'Brown Mushroom'
name = 'mushroomBrown'
@map_block(40)
class RedshroomBlock(NoCollisionBlock):
display_name = 'Red Mushroom'
name = 'mushroomRed'
@map_block(41)
class GoldBlock(MapBlock):
display_name = 'Block of Gold'
name = 'blockGold'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(42)
class IronBlock(MapBlock):
display_name = 'Block of Iron'
name = 'blockIron'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (274, 257, 278)
@map_block(43)
class DoublestoneslabBlock(MapBlock):
display_name = 'Double Stone Slab'
name = 'stoneSlabDouble'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(44)
class StoneslabBlock(SlabBlock):
display_name = 'Stone Slab'
name = 'stoneSlab'
hardness = 2
@map_block(45)
class BricksBlock(MapBlock):
display_name = 'Bricks'
name = 'brick'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(46)
class TntBlock(MapBlock):
display_name = 'TNT'
name = 'tnt'
@map_block(47)
class BookshelfBlock(MapBlock):
display_name = 'Bookshelf'
name = 'bookshelf'
hardness = 1.5
material = MCM_MAT_WOOD
@map_block(48)
class MossstoneBlock(MapBlock):
display_name = 'Moss Stone'
name = 'stoneMoss'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(49)
class ObsidianBlock(MapBlock):
display_name = 'Obsidian'
name = 'obsidian'
hardness = 50
material = MCM_MAT_ROCK
harvest_tools = (278,)
@map_block(50)
class TorchBlock(NoCollisionBlock):
display_name = 'Torch'
name = 'torch'
@map_block(51)
class FireBlock(NoCollisionBlock):
display_name = 'Fire'
name = 'fire'
@map_block(52)
class MobspawnerBlock(MapBlock):
display_name = 'Monster Spawner'
name = 'mobSpawner'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(53)
class WoodstairBlock(StairBlock):
display_name = 'Wooden Stairs'
name = 'stairsWood'
material = MCM_MAT_WOOD
@map_block(54)
class ChestBlock(MapBlock):
display_name = 'Chest'
name = 'chest'
hardness = 2.5
material = MCM_MAT_WOOD
@map_block(55)
class RedstonedustBlock(NoCollisionBlock):
display_name = 'Redstone Dust'
name = 'redstoneDust'
@map_block(56)
class DiamondoreBlock(MapBlock):
display_name = 'Diamond Ore'
name = 'oreDiamond'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(57)
class DiamondBlock(MapBlock):
display_name = 'Block of Diamond'
name = 'blockDiamond'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(58)
class CraftingBlock(MapBlock):
display_name = 'Crafting Table'
name = 'workbench'
hardness = 2.5
material = MCM_MAT_WOOD
@map_block(59)
class CropsBlock(NoCollisionBlock):
display_name = 'Wheat Crops'
name = 'wheat'
@map_block(60)
class FarmBlock(MapBlock):
display_name = 'Farmland'
name = 'farmland'
hardness = 0.6
material = MCM_MAT_DIRT
@map_block(61)
class FurnaceBlock(MapBlock):
display_name = 'Furnace'
name = 'furnace'
hardness = 3.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(62)
class BurningfurnaceBlock(MapBlock):
display_name = 'Burning Furnace'
name = 'furnaceBurning'
hardness = 3.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(63)
class StandingsignBlock(NoCollisionBlock):
display_name = 'Sign Post'
name = 'signPost'
hardness = 1
stack_size = 16
material = MCM_MAT_WOOD
@map_block(64)
class WooddoorBlock(DoorBlock):
display_name = 'Wooden Door'
name = 'doorWood'
hardness = 3
stack_size = 1
material = MCM_MAT_WOOD
@map_block(65)
class LadderBlock(NoCollisionBlock):
display_name = 'Ladder'
name = 'ladder'
hardness = 0.4
@map_block(66)
class RailBlock(NoCollisionBlock):
display_name = 'Rail'
name = 'rail'
hardness = 0.7
material = MCM_MAT_ROCK
@map_block(67)
class CobblestairBlock(StairBlock):
display_name = 'Cobblestone Stairs'
name = 'stairsStone'
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(68)
class WallsignBlock(NoCollisionBlock):
display_name = 'Wall Sign'
name = 'signWall'
hardness = 1
stack_size = 16
material = MCM_MAT_WOOD
@map_block(69)
class LeverBlock(NoCollisionBlock):
display_name = 'Lever'
name = 'lever'
hardness = 0.5
@map_block(70)
class StoneplateBlock(NoCollisionBlock):
display_name = 'Stone Pressure Plate'
name = 'stonePressurePlate'
hardness = 0.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(71)
class IrondoorBlock(DoorBlock):
display_name = 'Iron Door'
name = 'doorIron'
hardness = 5
stack_size = 1
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(72)
class WoodplateBlock(NoCollisionBlock):
display_name = 'Wooden Pressure Plate'
name = 'woodPressurePlate'
hardness = 0.5
material = MCM_MAT_WOOD
@map_block(73)
class RedstoneoreBlock(MapBlock):
display_name = 'Redstone Ore'
name = 'oreRedstone'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(74)
class GlowingredstoneoreBlock(MapBlock):
display_name = 'Glowing Redstone Ore'
name = 'oreRedstoneGlowing'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(75)
class RedstonetorchoffBlock(NoCollisionBlock):
display_name = 'Redstone Torch (Inactive)'
name = 'notGateInactive'
@map_block(76)
class RedstonetorchonBlock(NoCollisionBlock):
display_name = 'Redstone Torch (Active)'
name = 'notGateActive'
@map_block(77)
class StonebuttonBlock(NoCollisionBlock):
display_name = 'Stone Button'
name = 'buttonStone'
hardness = 0.5
@map_block(78)
class GroundsnowBlock(NoCollisionBlock):
display_name = 'Snow'
name = 'snow'
hardness = 0.1
material = MCM_MAT_DIRT
harvest_tools = (269, 273, 256, 277, 284)
@map_block(79)
class IceBlock(MapBlock):
display_name = 'Ice'
name = 'ice'
hardness = 0.5
material = MCM_MAT_ROCK
@map_block(80)
class SnowBlock(MapBlock):
display_name = 'Snow Block'
name = 'snowBlock'
hardness = 0.2
material = MCM_MAT_DIRT
harvest_tools = (269, 273, 256, 277, 284)
@map_block(81)
class CactusBlock(MapBlock):
display_name = 'Cactus'
name = 'cactus'
hardness = 0.4
@map_block(82)
class ClayBlock(MapBlock):
display_name = 'Clay'
name = 'clay'
hardness = 0.6
material = MCM_MAT_DIRT
@map_block(83)
class ReedsBlock(NoCollisionBlock):
display_name = 'Sugar cane'
name = 'reeds'
@map_block(84)
class JukeboxBlock(MapBlock):
display_name = 'Jukebox'
name = 'jukebox'
hardness = 2
material = MCM_MAT_WOOD
@map_block(85)
class WoodfenceBlock(FenceBlock):
display_name = 'Fence'
name = 'fence'
hardness = 2
material = MCM_MAT_WOOD
@map_block(86)
class PumpkinBlock(MapBlock):
display_name = 'Pumpkin'
name = 'pumpkin'
hardness = 1
material = 'plant'
@map_block(87)
class NetherrackBlock(MapBlock):
display_name = 'Netherrack'
name = 'hellrock'
hardness = 0.4
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(88)
class SoulsandBlock(MapBlock):
display_name = 'Soul Sand'
name = 'hellsand'
hardness = 0.5
material = MCM_MAT_DIRT
@map_block(89)
class GlowstoneBlock(MapBlock):
display_name = 'Glowstone'
name = 'lightgem'
hardness = 0.3
@map_block(90)
class PortalBlock(NoCollisionBlock):
display_name = 'Portal'
name = 'portal'
hardness = None
diggable = False
@map_block(91)
class JackBlock(MapBlock):
display_name = 'Jack \'o\' Lantern'
name = 'litpumpkin'
hardness = 1
material = 'plant'
@map_block(92)
class CakeBlock(MapBlock):
display_name = 'Cake'
name = 'cake'
hardness = 0.5
stack_size = 1
@map_block(93)
class RedstonerepoffBlock(NoCollisionBlock):
display_name = 'Redstone Repeater (Inactive)'
name = 'redstoneRepeaterInactive'
@map_block(94)
class RedstonereponBlock(NoCollisionBlock):
display_name = 'Redstone Repeater (Active)'
name = 'redstoneRepeaterActive'
@map_block(95)
class LockedchestBlock(MapBlock):
display_name = 'Locked chest'
name = 'lockedchest'
@map_block(96)
class OaktrapdoorBlock(TrapdoorBlock):
display_name = 'Trapdoor'
name = 'trapdoor'
hardness = 3
material = MCM_MAT_WOOD
@map_block(97)
class MonstereggBlock(MapBlock):
display_name = 'Monster Egg'
name = 'monsterStoneEgg'
hardness = 0.75
@map_block(98)
class StonebrickBlock(MapBlock):
display_name = 'Stone Brick'
name = 'stonebricksmooth'
hardness = 1.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(99)
class HugebrownshroomBlock(MapBlock):
display_name = 'Huge Brown Mushroom'
name = 'mushroomHugeBrown'
hardness = 0.2
material = MCM_MAT_WOOD
@map_block(100)
class HugeredshroomBlock(MapBlock):
display_name = 'Huge Red Mushroom'
name = 'mushroomHugeRed'
hardness = 0.2
material = MCM_MAT_WOOD
@map_block(101)
class IronfenceBlock(FenceBlock):
display_name = 'Iron Bars'
name = 'fenceIron'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(102)
class GlasspaneBlock(MapBlock):
display_name = 'Glass Pane'
name = 'glassPane'
hardness = 0.3
@map_block(103)
class MelonBlock(MapBlock):
display_name = 'Melon'
name = 'melon'
hardness = 1
material = 'melon'
@map_block(104)
class PumpkinstemBlock(NoCollisionBlock):
display_name = 'Pumpkin Stem'
name = 'pumpkinStem'
@map_block(105)
class MelonstemBlock(NoCollisionBlock):
display_name = 'Melon Stem'
name = 'melonStem'
@map_block(106)
class VinesBlock(NoCollisionBlock):
display_name = 'Vines'
name = 'vine'
hardness = 0.2
material = MCM_MAT_VINE
@map_block(107)
class WoodfencegateBlock(GateBlock):
display_name = 'Fence Gate'
name = 'fenceGate'
hardness = 2
material = MCM_MAT_WOOD
@map_block(108)
class BrickstairBlock(StairBlock):
display_name = 'Brick Stairs'
name = 'stairsBrick'
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(109)
class StonebrickstairBlock(StairBlock):
display_name = 'Stone Brick Stairs'
name = 'stairsStoneBrickSmooth'
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(110)
class MyceliumBlock(MapBlock):
display_name = 'Mycelium'
name = 'mycel'
hardness = 0.6
material = MCM_MAT_DIRT
@map_block(111)
class LilypadBlock(MapBlock):
display_name = 'Lily Pad'
name = 'waterlily'
def __init__(self, meta):
self.bounding_box = BoundingBox(1, 0.2, 1)
@map_block(112)
class NetherbrickBlock(MapBlock):
display_name = 'Nether Brick'
name = 'netherBrick'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(113)
class NetherbrickfenceBlock(FenceBlock):
display_name = 'Nether Brick Fence'
name = 'netherFence'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(114)
class NetherbrickstairBlock(StairBlock):
display_name = 'Nether Brick Stairs'
name = 'stairsNetherBrick'
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(115)
class NetherwartBlock(NoCollisionBlock):
display_name = 'Nether Wart'
name = 'netherStalk'
@map_block(116)
class EnchantmentBlock(MapBlock):
display_name = 'Enchantment Table'
name = 'enchantmentTable'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(117)
class BrewingBlock(MapBlock):
display_name = 'Brewing Stand'
name = 'brewingStand'
hardness = 0.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(118)
class CauldronBlock(MapBlock):
display_name = 'Cauldron'
name = 'cauldron'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(119)
class EndportalBlock(NoCollisionBlock):
display_name = 'End Portal'
name = 'endPortal'
hardness = None
diggable = False
@map_block(120)
class EndportalframeBlock(MapBlock):
display_name = 'End Portal Frame'
name = 'endPortalFrame'
hardness = None
diggable = False
@map_block(121)
class EndstoneBlock(MapBlock):
display_name = 'End Stone'
name = 'whiteStone'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(122)
class DragoneggBlock(MapBlock):
display_name = 'Dragon Egg'
name = 'dragonEgg'
hardness = 3
@map_block(123)
class RedstonelampoffBlock(MapBlock):
display_name = 'Redstone Lamp (Inactive)'
name = 'redstoneLightInactive'
hardness = 0.3
@map_block(124)
class RedstonelamponBlock(MapBlock):
display_name = 'Redstone Lamp (Active)'
name = 'redstoneLightActive'
hardness = 0.3
@map_block(125)
class WooddoubleslabBlock(MapBlock):
display_name = 'Wooden Double Slab'
name = 'woodSlabDouble'
hardness = 2
material = MCM_MAT_WOOD
@map_block(126)
class WoodslabBlock(SlabBlock):
display_name = 'Wooden Slab'
name = 'woodSlab'
hardness = 2
@map_block(127)
class CocoapodBlock(MapBlock):
display_name = 'Cocoa Pod'
name = 'cocoa'
hardness = 0.2
material = 'plant'
@map_block(128)
class SandstonestairBlock(StairBlock):
display_name = 'Sandstone Stairs'
name = 'stairsSandStone'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(129)
class EmeraldoreBlock(MapBlock):
display_name = 'Emerald Ore'
name = 'oreEmerald'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(130)
class EnderchestBlock(MapBlock):
display_name = 'Ender Chest'
name = 'enderChest'
hardness = 22.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(131)
class TripwirehookBlock(NoCollisionBlock):
display_name = 'Tripwire Hook'
name = 'tripWireSource'
@map_block(132)
class TripwireBlock(NoCollisionBlock):
display_name = 'Tripwire'
name = 'tripWire'
@map_block(133)
class EmeraldBlock(MapBlock):
display_name = 'Block of Emerald'
name = 'blockEmerald'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (257, 278)
@map_block(134)
class SprucestairBlock(StairBlock):
display_name = 'Spruce Wood Stairs'
name = 'stairsWoodSpruce'
@map_block(135)
class BirchstairBlock(StairBlock):
display_name = 'Birch Wood Stairs'
name = 'stairsWoodBirch'
@map_block(136)
class JunglestairBlock(StairBlock):
display_name = 'Jungle Wood Stairs'
name = 'stairsWoodJungle'
@map_block(137)
class CommandBlock(MapBlock):
display_name = 'Command Block'
name = 'commandBlock'
hardness = None
diggable = False
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(138)
class BeaconBlock(MapBlock):
display_name = 'Beacon'
name = 'beacon'
hardness = 3
@map_block(139)
class CobblewallBlock(FenceBlock):
display_name = 'Cobblestone Wall'
name = 'cobbleWall'
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(140)
class FlowerpotBlock(MapBlock):
display_name = 'Flower Pot'
name = 'flowerPot'
@map_block(141)
class CarrotBlock(NoCollisionBlock):
display_name = 'Carrots'
name = 'carrots'
@map_block(142)
class PotatoBlock(NoCollisionBlock):
display_name = 'Potatoes'
name = 'potatoes'
@map_block(143)
class WoodbuttonBlock(NoCollisionBlock):
display_name = 'Wooden Button'
name = 'buttonWood'
hardness = 0.5
@map_block(144)
class MobheadBlock(MapBlock):
display_name = 'Mob Head'
name = 'skull'
hardness = 1
@map_block(145)
class AnvilBlock(MapBlock):
display_name = 'Anvil'
name = 'anvil'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(146)
class TrappedchestBlock(MapBlock):
display_name = 'Trapped Chest'
name = 'trappedChest'
hardness = 2.5
material = MCM_MAT_WOOD
@map_block(147)
class WeightedplatelightBlock(NoCollisionBlock):
display_name = 'Weighted Pressure plate (Light)'
name = 'pressurePlateWeightedLight'
hardness = 0.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(148)
class WeightedplateheavyBlock(NoCollisionBlock):
display_name = 'Weighted Pressure plate (Heavy)'
name = 'pressurePlateWeightedHeavy'
hardness = 0.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(149)
class ComparatoroffBlock(NoCollisionBlock):
display_name = 'Redstone Comparator (Inactive)'
name = 'redstoneComparatorInactive'
@map_block(150)
class ComparatoronBlock(NoCollisionBlock):
display_name = 'Redstone Comparator (Active)'
name = 'redstoneComparatorActive'
@map_block(151)
class LightsensorBlock(MapBlock):
display_name = 'Daylight Sensor'
name = 'daylightSensor'
hardness = 0.2
material = MCM_MAT_WOOD
@map_block(152)
class RedstoneBlock(MapBlock):
display_name = 'Block of Redstone'
name = 'redstoneBlock'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(153)
class NetherquartzoreBlock(MapBlock):
display_name = 'Nether Quartz Ore'
name = 'netherQuartzOre'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(154)
class HopperBlock(MapBlock):
display_name = 'Hopper'
name = 'hopper'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(155)
class QuartzBlock(MapBlock):
display_name = 'Block of Quartz'
name = 'quartzBlock'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(156)
class QuartzstairBlock(StairBlock):
display_name = 'Quartz Stairs'
name = 'quartzStairs'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(157)
class ActivatorrailBlock(NoCollisionBlock):
display_name = 'Activator Rail'
name = 'activatorRail'
hardness = 0.7
material = MCM_MAT_ROCK
@map_block(158)
class DropperBlock(MapBlock):
display_name = 'Dropper'
name = 'dropper'
hardness = 3.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(159)
class StainedclayBlock(MapBlock):
display_name = 'Stained Clay'
name = 'stainedClay'
hardness = 1.25
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(160)
class StainedglasspaneBlock(MapBlock):
display_name = 'Stained Glass Pane'
name = 'stainedGlassPane'
hardness = 0.3
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(161)
class AcacialeavesBlock(MapBlock):
display_name = 'Acacia Leaves'
name = 'acaciaLeaves'
hardness = 0.2
material = MCM_MAT_LEAVES
@map_block(162)
class AcaciawoodBlock(MapBlock):
display_name = 'Acacia Wood'
name = 'acaciaWood'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(163)
class AcaciastairBlock(StairBlock):
display_name = 'Acacia Stairs'
name = 'acaciaStairs'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(164)
class DarkoakstairBlock(StairBlock):
display_name = 'Dark Oak Stairs'
name = 'darkoakStairs'
hardness = 2
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(165)
class SlimeBlock(MapBlock):
display_name = 'Slime'
name = 'slime'
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(166)
class BarrierBlock(MapBlock):
display_name = 'Barrier'
name = 'barrier'
hardness = None
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(167)
class IrontrapdoorBlock(TrapdoorBlock):
display_name = 'Iron Trapdoor'
name = 'ironTrapdoor'
hardness = 3
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(168)
class PrismarineBlock(MapBlock):
display_name = 'Prismarine'
name = 'prismarine'
hardness = 1.5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(169)
class SealanternBlock(MapBlock):
display_name = 'Sea Lantern'
name = 'seaLantern'
hardness = 0.3
material = MCM_MAT_ROCK
@map_block(170)
class HaybaleBlock(MapBlock):
display_name = 'Hay Bale'
name = 'haybale'
hardness = 0.5
material = MCM_MAT_ROCK
@map_block(171)
class CarpetBlock(NoCollisionBlock):
display_name = 'Carpet'
name = 'carpet'
material = MCM_MAT_WOOL
@map_block(172)
class HardenedclayBlock(MapBlock):
display_name = 'Hardened Clay'
name = 'hardenedClay'
hardness = 1.25
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(173)
class CoalBlock(MapBlock):
display_name = 'Coal'
name = 'coal'
hardness = 5
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(174)
class PackediceBlock(MapBlock):
display_name = 'Packed Ice'
name = 'packedIce'
hardness = 0.5
material = MCM_MAT_ROCK
@map_block(175)
class SunflowerBlock(NoCollisionBlock):
display_name = 'Sunflower'
name = 'sunflower'
material = MCM_MAT_ROCK
@map_block(176)
class BannerfreeBlock(NoCollisionBlock):
display_name = 'Free Standing Banner'
name = 'bannerFree'
hardness = 1
stack_size = 1
material = MCM_MAT_ROCK
@map_block(177)
class BannerwallBlock(NoCollisionBlock):
display_name = 'Wall Mounted Banner'
name = 'bannerWall'
hardness = 1
stack_size = 1
material = MCM_MAT_ROCK
@map_block(178)
class LightsensorinvertedBlock(MapBlock):
display_name = 'Inverted Daylight Sensor'
name = 'daylightSensorInverted'
hardness = 0.2
material = MCM_MAT_WOOD
@map_block(179)
class RedsandstoneBlock(MapBlock):
display_name = 'Red Sandstone'
name = 'redSandstone'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(180)
class RedsandstonestairBlock(StairBlock):
display_name = 'Red Sandstone Stairs'
name = 'redSandstoneStairs'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(181)
class RedsandstonedoubleslabBlock(MapBlock):
display_name = 'Red Sandstone Double Slab'
name = 'redSandstoneDoubleSlab'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(182)
class RedsandstoneslabBlock(SlabBlock):
display_name = 'Red Sandstone Slab'
name = 'redSandstoneSlab'
hardness = 0.8
material = MCM_MAT_ROCK
harvest_tools = (270, 274, 257, 278, 285)
@map_block(183)
class FencegatespruceBlock(GateBlock):
display_name = 'Spruce Fence Gate'
name = 'fenceGateSpruce'
hardness = 2
material = MCM_MAT_WOOD
@map_block(184)
class FencegatebirchBlock(GateBlock):
display_name = 'Birch Fence Gate'
name = 'fenceGateBirch'
hardness = 2
material = MCM_MAT_WOOD
@map_block(185)
class FencegatejungleBlock(GateBlock):
display_name = 'Jungle Fence Gate'
name = 'fenceGateJungle'
hardness = 2
material = MCM_MAT_WOOD
@map_block(186)
class FencegatedarkoakBlock(GateBlock):
display_name = 'Dark Oak Fence Gate'
name = 'fenceGateDarkOak'
hardness = 2
material = MCM_MAT_WOOD
@map_block(187)
class FencegateacaciaBlock(GateBlock):
display_name = 'Acacia Fence Gate'
name = 'fenceGateAcacia'
hardness = 2
material = MCM_MAT_WOOD
@map_block(188)
class FencespruceBlock(FenceBlock):
display_name = 'Spruce Fence'
name = 'fenceSpruce'
hardness = 2
material = MCM_MAT_WOOD
@map_block(189)
class FencebirchBlock(FenceBlock):
display_name = 'Birch Fence'
name = 'fenceBirch'
hardness = 2
material = MCM_MAT_WOOD
@map_block(190)
class FencejungleBlock(FenceBlock):
display_name = 'Jungle Fence'
name = 'fenceJungle'
hardness = 2
material = MCM_MAT_WOOD
@map_block(191)
class FencedarkoakBlock(FenceBlock):
display_name = 'Dark Oak Fence'
name = 'fenceDarkOak'
hardness = 2
material = MCM_MAT_WOOD
@map_block(192)
class FenceacaciaBlock(FenceBlock):
display_name = 'Acacia Fence'
name = 'fenceAcacia'
hardness = 2
material = MCM_MAT_WOOD
@map_block(193)
class DoorspruceBlock(DoorBlock):
display_name = 'Spruce Door'
name = 'doorSpruce'
hardness = 3
stack_size = 1
material = MCM_MAT_WOOD
@map_block(194)
class DoorbirchBlock(DoorBlock):
display_name = 'Birch Door'
name = 'doorBirch'
hardness = 3
stack_size = 1
material = MCM_MAT_WOOD
@map_block(195)
class DoorjungleBlock(DoorBlock):
display_name = 'Jungle Door'
name = 'DoorJungle'
hardness = 3
stack_size = 1
material = MCM_MAT_WOOD
@map_block(196)
class DooracaciaBlock(DoorBlock):
display_name = 'Acacia Door'
name = 'doorAcacia'
hardness = 3
stack_size = 1
material = MCM_MAT_WOOD
@map_block(197)
class DoordarkoakBlock(DoorBlock):
display_name = 'Dark Oak Door'
name = 'doorDarkOak'
hardness = 3
stack_size = 1
material = MCM_MAT_WOOD
blocks = tuple(blocks[i] for i in range(len(blocks)))
biomes = {}
def map_biome(biome_id):
def inner(cl):
biomes[biome_id] = cl
cl.biome_id = biome_id
return cl
return inner
def get_biome(biome_id):
return biomes[biome_id]() if biome_id in biomes else None
class MapBiome(object):
name = 'Map Biome'
temperature = 0.0
@map_biome(0)
class OceanBiome(MapBiome):
name = 'Ocean'
temperature = 0.5
@map_biome(1)
class PlainsBiome(MapBiome):
name = 'Plains'
temperature = 0.8
@map_biome(2)
class DesertBiome(MapBiome):
name = 'Desert'
temperature = 2
@map_biome(3)
class ExtremeHillsBiome(MapBiome):
name = 'Extreme Hills'
temperature = 0.2
@map_biome(4)
class ForestBiome(MapBiome):
name = 'Forest'
temperature = 0.7
@map_biome(5)
class TaigaBiome(MapBiome):
name = 'Taiga'
temperature = 0.05
@map_biome(6)
class SwamplandBiome(MapBiome):
name = 'Swampland'
temperature = 0.8
@map_biome(7)
class RiverBiome(MapBiome):
name = 'River'
temperature = 0.5
@map_biome(8)
class HellBiome(MapBiome):
name = 'Hell'
temperature = 2
@map_biome(9)
class SkyBiome(MapBiome):
name = 'Sky'
temperature = 0.5
@map_biome(10)
class FrozenOceanBiome(MapBiome):
name = 'Frozen Ocean'
temperature = 0
@map_biome(11)
class FrozenRiverBiome(MapBiome):
name = 'Frozen River'
temperature = 0
@map_biome(12)
class IcePlainsBiome(MapBiome):
name = 'Ice Plains'
temperature = 0
@map_biome(13)
class IceMountainsBiome(MapBiome):
name = 'Ice Mountains'
temperature = 0
@map_biome(14)
class MushroomIslandBiome(MapBiome):
name = 'Mushroom Island'
temperature = 0.9
@map_biome(15)
class MushroomIslandShoreBiome(MapBiome):
name = 'Mushroom Island Shore'
temperature = 0.9
@map_biome(16)
class BeachBiome(MapBiome):
name = 'Beach'
temperature = 0.8
@map_biome(17)
class DesertHillsBiome(MapBiome):
name = 'Desert Hills'
temperature = 2
@map_biome(18)
class ForestHillsBiome(MapBiome):
name = 'Forest Hills'
temperature = 0.7
@map_biome(19)
class TaigaHillsBiome(MapBiome):
name = 'Taiga Hills'
temperature = 0.05
@map_biome(20)
class ExtremeTaigaHillsEdgeBiome(MapBiome):
name = 'Extreme Hills Edge'
temperature = 0.2
@map_biome(21)
class JungleBiome(MapBiome):
name = 'Jungle'
temperature = 1.2
@map_biome(22)
class JungleHillsBiome(MapBiome):
name = 'Jungle Hills'
temperature = 1.2
@map_biome(23)
class JungleEdgeBiome(MapBiome):
name = 'Jungle Edge'
temperature = 0.95
@map_biome(24)
class DeepOceanBiome(MapBiome):
name = 'Deep Ocean'
temperature = 0.5
@map_biome(25)
class StoneBeachBiome(MapBiome):
name = 'Stone Beach'
temperature = 0.2
@map_biome(26)
class ColdBeachBiome(MapBiome):
name = 'Cold Beach'
temperature = 0
@map_biome(27)
class BirchForestBiome(MapBiome):
name = 'Birch Forest'
temperature = 0.6
@map_biome(28)
class BirchForestHillsBiome(MapBiome):
name = 'Birch Forest Hills'
temperature = 0.6
@map_biome(29)
class RoofedForestBiome(MapBiome):
name = 'Roofed Forest'
temperature = 0.7
@map_biome(30)
class ColdTaigaBiome(MapBiome):
name = 'Cold Taiga'
temperature = 0
@map_biome(31)
class ColdTaigaHillsBiome(MapBiome):
name = 'Cold Taiga Hills'
temperature = 0
@map_biome(32)
class MegaTaigaBiome(MapBiome):
name = 'Mega Taiga'
temperature = 0.3
@map_biome(33)
class MegaTaigaHillsBiome(MapBiome):
name = 'Mega Taiga Hills'
temperature = 0.3
@map_biome(34)
class ExtremeHillsPlusBiome(MapBiome):
name = 'Extreme Hills+'
temperature = 0.2
@map_biome(35)
class SavannaBiome(MapBiome):
name = 'Savanna'
temperature = 1.0
@map_biome(36)
class SavannaPlateauBiome(MapBiome):
name = 'Savanna Plateau'
temperature = 1.0
@map_biome(37)
class MesaBiome(MapBiome):
name = 'Mesa'
temperature = 1.0
@map_biome(38)
class MesaPlateauFBiome(MapBiome):
name = 'Mesa Plateau F'
temperature = 1.0
@map_biome(39)
class MesaPlateauBiome(MapBiome):
name = 'Mesa Plateau'
temperature = 1.0
@map_biome(129)
class SunflowerPlainsBiome(MapBiome):
name = 'Sunflower Plains'
temperature = 0.8
@map_biome(130)
class DesertMBiome(MapBiome):
name = 'Desert M'
temperature = 2
@map_biome(131)
class ExtremeHillsMBiome(MapBiome):
name = 'Extreme Hills M'
temperature = 0.2
@map_biome(132)
class FlowerForestBiome(MapBiome):
name = 'Flower Forest'
temperature = 0.7
@map_biome(133)
class TaigaMBiome(MapBiome):
name = 'Taiga M'
temperature = 0.25
@map_biome(134)
class SwamplandMBiome(MapBiome):
name = 'Swampland M'
temperature = 0.8
@map_biome(140)
class IcePlainsSpikesBiome(MapBiome):
name = 'Ice Plains Spikes'
temperature = 0
@map_biome(149)
class JungleMBiome(MapBiome):
name = 'Jungle M'
temperature = 0.95
@map_biome(151)
class JungleEdgeMBiome(MapBiome):
name = 'Jungle Edge M'
temperature = 0.95
@map_biome(155)
class BirchForestMBiome(MapBiome):
name = 'Birch Forest M'
temperature = 0.6
@map_biome(156)
class BirchForestHillsMBiome(MapBiome):
name = 'Birch Forest Hills M'
temperature = 0.6
@map_biome(157)
class RoofedForestMBiome(MapBiome):
name = 'Roofed Forest M'
temperature = 0.7
@map_biome(158)
class ColdTaigaMBiome(MapBiome):
name = 'Cold Taiga M'
temperature = 0
@map_biome(160)
class MegaSpruceTaigaBiome(MapBiome):
name = 'Mega Spruce Taiga'
temperature = 0.25
@map_biome(161)
class MegaSpruceTaigaHillsBiome(MapBiome):
name = 'Mega Spruce Taiga Hills'
temperature = 0.25
@map_biome(162)
class ExtremeHillsPlusMBiome(MapBiome):
name = 'Extreme Hills+ M'
temperature = 0.2
@map_biome(163)
class SavannaMBiome(MapBiome):
name = 'Savanna M'
temperature = 1.0
@map_biome(164)
class SavannaPlateauMBiome(MapBiome):
name = 'Savanna Plateau M'
temperature = 1.0
@map_biome(165)
class MesaBRyceBiome(MapBiome):
name = 'Mesa (Bryce)'
temperature = 1.0
@map_biome(166)
class MesaPlateauFMBiome(MapBiome):
name = 'Mesa Plateau F M'
temperature = 1.0
@map_biome(167)
class MesaPlateauMBiome(MapBiome):
name = 'Mesa Plateau M'
temperature = 1.0
| mit |
mbaijal/incubator-mxnet | tests/python/unittest/test_gluon_contrib.py | 8 | 10138 | # Licensed to the Apache Software Foundation (ASF) under one
# or more contributor license agreements. See the NOTICE file
# distributed with this work for additional information
# regarding copyright ownership. The ASF licenses this file
# to you under the Apache License, Version 2.0 (the
# "License"); you may not use this file except in compliance
# with the License. You may obtain a copy of the License at
#
# http://www.apache.org/licenses/LICENSE-2.0
#
# Unless required by applicable law or agreed to in writing,
# software distributed under the License is distributed on an
# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
# KIND, either express or implied. See the License for the
# specific language governing permissions and limitations
# under the License.
from __future__ import print_function
import mxnet as mx
from mxnet.gluon import contrib
from mxnet.gluon import nn
from mxnet.gluon.contrib.nn import Concurrent, HybridConcurrent, Identity, SparseEmbedding
from mxnet.test_utils import almost_equal
from common import setup_module, with_seed, teardown
import numpy as np
from numpy.testing import assert_allclose
def check_rnn_cell(cell, prefix, in_shape=(10, 50), out_shape=(10, 100), begin_state=None):
inputs = [mx.sym.Variable('rnn_t%d_data'%i) for i in range(3)]
outputs, _ = cell.unroll(3, inputs, begin_state=begin_state)
outputs = mx.sym.Group(outputs)
assert sorted(cell.collect_params().keys()) == [prefix+'h2h_bias', prefix+'h2h_weight',
prefix+'i2h_bias', prefix+'i2h_weight']
assert outputs.list_outputs() == [prefix+'t0_out_output', prefix+'t1_out_output', prefix+'t2_out_output']
args, outs, auxs = outputs.infer_shape(rnn_t0_data=in_shape,
rnn_t1_data=in_shape,
rnn_t2_data=in_shape)
assert outs == [out_shape]*3
def check_rnn_forward(layer, inputs):
inputs.attach_grad()
layer.collect_params().initialize()
with mx.autograd.record():
layer.unroll(3, inputs, merge_outputs=True)[0].backward()
mx.autograd.backward(layer.unroll(3, inputs, merge_outputs=False)[0])
mx.nd.waitall()
@with_seed()
def test_rnn_cells():
check_rnn_forward(contrib.rnn.Conv1DLSTMCell((5, 7), 10, (3,), (3,)),
mx.nd.ones((8, 3, 5, 7)))
check_rnn_forward(contrib.rnn.Conv1DRNNCell((5, 7), 10, (3,), (3,)),
mx.nd.ones((8, 3, 5, 7)))
check_rnn_forward(contrib.rnn.Conv1DGRUCell((5, 7), 10, (3,), (3,)),
mx.nd.ones((8, 3, 5, 7)))
net = mx.gluon.rnn.SequentialRNNCell()
net.add(contrib.rnn.Conv1DLSTMCell((5, 7), 10, (3,), (3,)))
net.add(contrib.rnn.Conv1DRNNCell((10, 5), 11, (3,), (3,)))
net.add(contrib.rnn.Conv1DGRUCell((11, 3), 12, (3,), (3,)))
check_rnn_forward(net, mx.nd.ones((8, 3, 5, 7)))
@with_seed()
def test_convrnn():
cell = contrib.rnn.Conv1DRNNCell((10, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 50), out_shape=(1, 100, 48))
cell = contrib.rnn.Conv2DRNNCell((10, 20, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 20, 50), out_shape=(1, 100, 18, 48))
cell = contrib.rnn.Conv3DRNNCell((10, 20, 30, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 20, 30, 50), out_shape=(1, 100, 18, 28, 48))
@with_seed()
def test_convlstm():
cell = contrib.rnn.Conv1DLSTMCell((10, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 50), out_shape=(1, 100, 48))
cell = contrib.rnn.Conv2DLSTMCell((10, 20, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 20, 50), out_shape=(1, 100, 18, 48))
cell = contrib.rnn.Conv3DLSTMCell((10, 20, 30, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 20, 30, 50), out_shape=(1, 100, 18, 28, 48))
@with_seed()
def test_convgru():
cell = contrib.rnn.Conv1DGRUCell((10, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 50), out_shape=(1, 100, 48))
cell = contrib.rnn.Conv2DGRUCell((10, 20, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 20, 50), out_shape=(1, 100, 18, 48))
cell = contrib.rnn.Conv3DGRUCell((10, 20, 30, 50), 100, 3, 3, prefix='rnn_')
check_rnn_cell(cell, prefix='rnn_', in_shape=(1, 10, 20, 30, 50), out_shape=(1, 100, 18, 28, 48))
@with_seed()
def test_conv_fill_shape():
cell = contrib.rnn.Conv1DLSTMCell((0, 7), 10, (3,), (3,))
cell.hybridize()
check_rnn_forward(cell, mx.nd.ones((8, 3, 5, 7)))
assert cell.i2h_weight.shape[1] == 5, cell.i2h_weight.shape[1]
@with_seed()
def test_lstmp():
nhid = 100
nproj = 64
cell = contrib.rnn.LSTMPCell(nhid, nproj, prefix='rnn_')
inputs = [mx.sym.Variable('rnn_t%d_data'%i) for i in range(3)]
outputs, _ = cell.unroll(3, inputs)
outputs = mx.sym.Group(outputs)
expected_params = ['rnn_h2h_bias', 'rnn_h2h_weight', 'rnn_h2r_weight', 'rnn_i2h_bias', 'rnn_i2h_weight']
expected_outputs = ['rnn_t0_out_output', 'rnn_t1_out_output', 'rnn_t2_out_output']
assert sorted(cell.collect_params().keys()) == expected_params
assert outputs.list_outputs() == expected_outputs, outputs.list_outputs()
args, outs, auxs = outputs.infer_shape(rnn_t0_data=(10,50), rnn_t1_data=(10,50), rnn_t2_data=(10,50))
assert outs == [(10, nproj), (10, nproj), (10, nproj)]
@with_seed()
def test_vardrop():
def check_vardrop(drop_inputs, drop_states, drop_outputs):
cell = contrib.rnn.VariationalDropoutCell(mx.gluon.rnn.RNNCell(100, prefix='rnn_'),
drop_outputs=drop_outputs,
drop_states=drop_states,
drop_inputs=drop_inputs)
cell.collect_params().initialize(init='xavier')
input_data = mx.nd.random_uniform(shape=(10, 3, 50), ctx=mx.context.current_context())
with mx.autograd.record():
outputs1, _ = cell.unroll(3, input_data, merge_outputs=True)
mx.nd.waitall()
outputs2, _ = cell.unroll(3, input_data, merge_outputs=True)
assert not almost_equal(outputs1.asnumpy(), outputs2.asnumpy())
inputs = [mx.sym.Variable('rnn_t%d_data'%i) for i in range(3)]
outputs, _ = cell.unroll(3, inputs, merge_outputs=False)
outputs = mx.sym.Group(outputs)
args, outs, auxs = outputs.infer_shape(rnn_t0_data=(10,50), rnn_t1_data=(10,50), rnn_t2_data=(10,50))
assert outs == [(10, 100), (10, 100), (10, 100)]
cell.reset()
cell.hybridize()
with mx.autograd.record():
outputs3, _ = cell.unroll(3, input_data, merge_outputs=True)
mx.nd.waitall()
outputs4, _ = cell.unroll(3, input_data, merge_outputs=True)
assert not almost_equal(outputs3.asnumpy(), outputs4.asnumpy())
assert not almost_equal(outputs1.asnumpy(), outputs3.asnumpy())
check_vardrop(0.5, 0.5, 0.5)
check_vardrop(0.5, 0, 0.5)
def test_concurrent():
model = HybridConcurrent(axis=1)
model.add(nn.Dense(128, activation='tanh', in_units=10))
model.add(nn.Dense(64, activation='tanh', in_units=10))
model.add(nn.Dense(32, in_units=10))
model2 = Concurrent(axis=1)
model2.add(nn.Dense(128, activation='tanh', in_units=10))
model2.add(nn.Dense(64, activation='tanh', in_units=10))
model2.add(nn.Dense(32, in_units=10))
# symbol
x = mx.sym.var('data')
y = model(x)
assert len(y.list_arguments()) == 7
# ndarray
model.initialize(mx.init.Xavier(magnitude=2.24))
model2.initialize(mx.init.Xavier(magnitude=2.24))
x = model(mx.nd.zeros((32, 10)))
x2 = model2(mx.nd.zeros((32, 10)))
assert x.shape == (32, 224)
assert x2.shape == (32, 224)
x.wait_to_read()
x2.wait_to_read()
@with_seed()
def test_identity():
model = Identity()
x = mx.nd.random.uniform(shape=(128, 33, 64))
mx.test_utils.assert_almost_equal(model(x).asnumpy(),
x.asnumpy())
@with_seed()
def test_sparse_embedding():
layer = SparseEmbedding(10, 100)
layer.initialize()
trainer = mx.gluon.Trainer(layer.collect_params(), 'sgd')
x = mx.nd.array([3,4,2,0,1])
with mx.autograd.record():
y = layer(x)
y.backward()
assert (layer.weight.grad().asnumpy()[:5] == 1).all()
assert (layer.weight.grad().asnumpy()[5:] == 0).all()
def test_datasets():
wikitext2_train = contrib.data.text.WikiText2(root='data/wikitext-2', segment='train')
wikitext2_val = contrib.data.text.WikiText2(root='data/wikitext-2', segment='validation',
vocab=wikitext2_train.vocabulary)
wikitext2_test = contrib.data.text.WikiText2(root='data/wikitext-2', segment='test')
assert len(wikitext2_train) == 59305, len(wikitext2_train)
assert len(wikitext2_train.vocabulary) == 33278, len(wikitext2_train.vocabulary)
assert len(wikitext2_train.frequencies) == 33277, len(wikitext2_train.frequencies)
assert len(wikitext2_val) == 6181, len(wikitext2_val)
assert len(wikitext2_val.vocabulary) == 33278, len(wikitext2_val.vocabulary)
assert len(wikitext2_val.frequencies) == 13776, len(wikitext2_val.frequencies)
assert len(wikitext2_test) == 6974, len(wikitext2_test)
assert len(wikitext2_test.vocabulary) == 14143, len(wikitext2_test.vocabulary)
assert len(wikitext2_test.frequencies) == 14142, len(wikitext2_test.frequencies)
assert wikitext2_test.frequencies['English'] == 32
def test_sampler():
interval_sampler = contrib.data.IntervalSampler(10, 3)
assert sorted(list(interval_sampler)) == list(range(10))
interval_sampler = contrib.data.IntervalSampler(10, 3, rollover=False)
assert list(interval_sampler) == [0, 3, 6, 9]
if __name__ == '__main__':
import nose
nose.runmodule()
| apache-2.0 |