text stringlengths 943 1.84k |
|---|
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)CC(=N)N.CCOC(=O)CC(=O)C=Cc1cccs1>CCO>CCOC(=O)C1=C(C)NC(N)=C(C(=O)OCC)C1Cc1cccs1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)O.CC(C)OC(=O)CC(=O)C=Cc1cccc([N+](=O)[O-])c1.CCCOC(=O)CC(=N)N.CCO>>CCCOC(=O)C1=C(N)NC(C)=C(C(=O)OC(C)C)C1c1cccc([N+](=O)[O-])c1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)CC(=N)N.N#Cc1cccc(C=O)c1.O=C1CCCC(=O)C1>CCO.CN(C)C=O>CCOC(=O)C1=C(N)NC2=C(C(=O)CCC2)C1c1cccc(C#N)c1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)CC(=N)N.O=C1CCCC(=O)C1.O=Cc1cccc(Br)c1>CCO>CCOC(=O)C1=C(N)NC2=C(C(=O)CCC2)C1c1cccc(Br)c1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)CC(=N)N.O=C1CCCC(=O)C1.O=Cc1ccccc1Br>CCO>CCOC(=O)C1=C(N)NC2=C(C(=O)CCC2)C1c1ccccc1Br
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)CC(=N)N.CCOC(=O)c1cccc(C=O)c1.O=C1CCCC(=O)C1>CCO>CCOC(=O)C1=C(N)NC2=C(C(=O)CCC2)C1c1cccc(C(=O)OCC)c1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)CC(=N)N.O=C1CCCC(=O)C1.[N-]=[N+]=Nc1ccccc1C=O>CCO>CCOC(=O)C1=C(N)NC2=C(C(=O)CCC2)C1c1ccccc1N=[N+]=[N-]
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C(C)C1CCC(C)=C1CCC=O>CCOCC.Cl[Sn](Cl)(Cl)Cl.O=C([O-])[O-].O=C([O-])[O-].[K+].[Na+].c1ccccc1>C=C1CC(O)CCC2=C(C)CCC12
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C1CC(O)CCC2=C(C)CCC12>CCO.O=[Pt].[H][H]>CC1=C2CCC(O)CC(C)C2CC1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC1=C2CCC(O)CC(C)C2CC1>CCO.[Pd]>CC1CCC2C(C)CC(O)CCC12
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C1CC(O)CCC2=C(C)CCC12>CC(C)=O.O=S(=O)(O)O.O=[Cr](=O)=O>C=C1CC(=O)CCC2=C(C)CCC12
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C(C)Br.C=C1CC(=O)CCC2=C(C)CCC12>C1CCOC1.II.[Mg]>C=C1CC(O)(C(=C)C)CCC2=C(C)CCC12
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C1CC(O)CCC2=C(C)CCC12.CCC(=O)Cl>ClCCl.c1ccncc1>C=C1CC(OC(=O)CC)CCC2=C(C)CCC12
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C1CC(O)CCC2=C(C)CCC12.CC(=O)OC(C)=O>O=C([O-])[O-].O=CO.[Na+].c1ccncc1>C=C1CC(OC=O)CCC2=C(C)CCC12
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)O.N#CC1CCC(=O)C1CCCCCCCO>CC(C)C[Al+]CC(C)C.CCOCC.[H-].c1ccccc1>O=CC1CCC(O)C1CCCCCCCO
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)=O.CCCCCC(=O)C=CC1CCC(O)C1CCCCCCCO>CC(C)=O.O.O=S(=O)(O)O.O=[Cr](=O)=O.[Cr]>CCCCCC(=O)C=CC1CCC(=O)C1CCCCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(=O)C=CC1CCC(=O)C1CCCCCCC(=O)O>CCO.[BH4-].[Na+].[OH-]>CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C1=COCCC1.N#CCCCCCCO>Cl.c1ccccc1>N#CCCCCCCOC1CCCCO1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
N#CCCCCCCOC1CCCCO1.O=S(=O)(O)O>CC(C)C[Al+]CC(C)C.CCOCC.[H-].c1ccccc1>O=CCCCCCCOC1CCCCO1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)=O.CCCCCC(=O)C=CC1CC(CCCCCCCO)C(O)C1C.O>CC(C)=O.O=S(=O)(O)O.O=[Cr](=O)=O.[Cr]>CCCCCC(=O)C=CC1CC(C)C(=O)C1CCCCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(=O)C=CC1CC(C)C(=O)C1CCCCCCC(=O)O>CCO.[BH4-].[Na+].[OH-]>CCCCCC(O)C=CC1CC(C)C(O)C1CCCCCCC(=O)O
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOCC.O=CCCCCCOC1CCCCO1.c1ccccc1>>O=C1CCC=C1CCCCCCO
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)(O)C#N.O=C1CCC=C1CCCCCCO>CO.O=C([O-])[O-].[Na+]>N#CC1CCC(=O)C1CCCCCCO
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=CC1CCC(O)C1CCCCCCO>C1CCOC1>CCCCCC(=O)C=CC1CCC(O)C1CCCCCCO
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)=O.CCCCCC(=O)C=CC1CCC(O)C1CCCCCCO>CC(C)=O.O.O=S(=O)(O)O.O=[Cr](=O)=O.[Cr]>CCCCCC(=O)C=CC1CCC(=O)C1CCCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C1=COCCC1.OCCCCCCO>Cl.ClC(Cl)Cl>OCCCCCCOC1CCCCO1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
OCCCCCCOC1CCCCO1>CC(=O)O.CCN(CC)CC.CCOCC.CS(C)=O.O>O=CCCCCCOC1CCCCO1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCC(CC)C(=O)C=CC1CCC(=O)C1CCCCCCC(=O)O>CCO.[BH4-].[Na+].[OH-]>CCCCC(CC)C(O)C=CC1CCC(O)C1CCCCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=[N+]=[N-].CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)O>CCOCC>CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)OC
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=[N+]=[N-].CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)OC.C[O+](C)[B-](F)(F)F>CCOCC>CCCCCC(C=CC1CCC(OC)C1CCCCCCC(=O)OC)OC
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)OC.CN>CCO.CC[O-].[Na+].[Na]>CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)NC
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)OC.NN>CO.O>CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)NN
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(=O)CCC1CCC(=O)C1CCCCCCC(=O)O>CCO.[BH4-].[Na+].[OH-]>CCCCCC(O)CCC1CCC(O)C1CCCCCCC(=O)O
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)OC.O=C(OO)c1cccc(Cl)c1>ClCCl>CCCCCC(O)C1OC1C1CCC(O)C1CCCCCCC(=O)OC
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCC(O)C=CC1CCC(O)C1CCCCCCC(=O)OC.ICI>CCOCC.II.[Cl-].[Cu].[NH4+].[Zn]>CCCCCC(O)C1CC1C1CCC(O)C1CCCCCCC(=O)OC
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCC(CC)C(O)C=CC1CCC(O)C1CCCCCCC(=O)O>CCO.[H][H].[Pd]>CCCCC(CC)C(O)CCC1CCC(O)C1CCCCCCC(=O)O
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
N[C@@H](Cc1ccccc1)C(=O)O>B.C1CCOC1.CCOCC.CSC.FB(F)F.O.[Na+].[OH-]>NC(CO)Cc1ccccc1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)(C)C(=O)NNc1cc(Cl)c(Cl)cc1[N+](=O)[O-].ClP(Cl)(Cl)(Cl)Cl>ClC(Cl)(Cl)Cl.Oc1ccccc1>CC(C)(C)C(Cl)=NNc1cc(Cl)c(Cl)cc1[N+](=O)[O-]
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
N#CC#N.Nc1ccc(Cl)cc1N>C#N.CO.[Na+].[OH-]>Nc1nc2ccc(Cl)cc2nc1N
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCC(=O)OC(=O)CC.Nc1nc2ccc(Cl)cc2nc1N>CCC(=O)O>CCc1nc2nc3cc(Cl)ccc3nc2[nH]1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC#N.Clc1ccc2nc(Cl)c(Cl)nc2c1.N>>Cc1nc2nc3cc(Cl)ccc3nc2[nH]1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=[N+]([O-])c1ccc2nc(NC3=NCCN3)[nH]c2c1>CN(C)C=O.[Pd]>Nc1ccc2nc(NC3=NCCN3)[nH]c2c1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)OC(C)=O.Nc1ccc2nc(NC3=NCCN3)[nH]c2c1>CCO>CC(=O)Nc1ccc2nc(NC3=NCCN3)[nH]c2c1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
N#CNC(=N)N.Nc1ccc(F)cc1N>>N=C(N)Nc1nc2ccc(F)cc2[nH]1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)CCC(C)C.OCC=CCO>C1CCCCC1.O.O=C(O)CC(O)(CC(=O)O)C(=O)O.Oc1ccc(O)cc1>CC(C)CCC1(C)OCC=CCO1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
Clc1nc(Cl)nc(Cl)n1.Oc1ccccc1>ClC(Cl)Cl.[Na+].[OH-]>Clc1nc(Cl)nc(Oc2ccccc2)n1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
NNc1cccc(Cl)c1.OC1=NCCCCC1>CC(=O)O.COC>Clc1cccc(NN=C2CCCCCN2)c1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
NNc1ccccc1.OC1=NCCCCC1>CO.COC.N>c1ccc(NN=C2CCCCCN2)cc1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(Cl)C(Cl)Cl.O=C(O)C(=NO)c1ccco1>ClCCl>O=C(O)C(=NOC(=O)C(Cl)Cl)c1ccco1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)(N)CO.c1ccccc1>CC(C)=O>CC1(C)COC(C)(C)N1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
Cc1ccccc1C(O)CC1CCN(C)C1>N.[Li]>CC1=C(CCC2CCN(C)C2)CC=CC1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C1CCNCC1.O=C(O)CCC(=O)c1ccc(F)cc1>C1CCOC1.CCN(CC)CC.CCOC(=O)Cl>O=C(CCC(=O)N1CCCCC1)c1ccc(F)cc1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCCCCCCCCC(Br)C(=O)Br.CCCCCCCCCCC(Br)C(=O)Cl.[O-][O-].[OH-]>CCCCCCCCCCCC(=O)Cl.Cc1ccccc1.O.O=S(=O)(O)O.OO.[Na+]>CCCCCCCCCCCC(=O)OOC(=O)C(Br)CCCCCCCCCC
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(O)c1ccc2c(c1)C(=O)OC2=O>CCOCCOC(C)=O.Oc1ccccc1>O=C(O)CCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(O)c1ccc2c(c1)C(=O)OC2=O>COc1ccccc1.Oc1ccccc1>O=C(O)CCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(O)c1ccc2c(c1)C(=O)OC2=O>Oc1ccccc1>O=C(O)CCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(O)c1ccc2c(c1)C(=O)OC2=O>Clc1ccccc1Cl>O=C(O)CCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(O)c1ccc2c(c1)C(=O)OC2=O>CC(=O)c1ccccc1>O=C(O)CCCCC(=O)O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
Cn1nc(S(C)=O)c(=O)c2ccccc21.O=C(OO)c1cccc(Cl)c1>ClC(Cl)Cl.O=C([O-])O.[Na+]>Cn1nc(S(C)(=O)=O)c(=O)c2ccccc21
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC1(C)c2cc(O)ccc2OC1N1CCCCC1.CS(=O)(=O)Cl>O.c1ccncc1>CC1(C)c2cc(OS(C)(=O)=O)ccc2OC1N1CCCCC1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC1(C)c2cc(OS(C)(=O)=O)ccc2OC1O>CC(=O)O.O>CC1(C)C(=O)Oc2ccc(OS(C)(=O)=O)cc21
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3C=CC4=CC(=O)C5CC5[C@@]4(C)[C@@H]3CC[C@@]21C>Cc1ccccc1.[Pd]>CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)C5CC5[C@@]4(C)[C@@H]3CC[C@@]21C
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
Cc1cc2nc(N)sc2cc1C.NN>Cl.NN.O>Cc1cc2nc(NN)sc2cc1C
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
Cc1cccc2sc(N(C)C)nc12.NN>Br.O.OCCO>Cc1cccc2sc(NN)nc12
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CNc1nc2c(C)cccc2s1.NN>Br.O.OCCO>Cc1cccc2sc(NN)nc12
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)Nc1nnc(C(F)(F)C(Cl)Cl)s1>O=S(=O)(O)O.[Na+].[OH-]>Nc1nnc(C(F)(F)C(Cl)Cl)s1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
Nc1nnc(C(F)(F)C(Cl)Cl)s1.O=C(Cl)Cl>Clc1ccccc1>O=C=Nc1nnc(C(F)(F)C(Cl)Cl)s1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C(C)C1CCC(C)=C1CC(C)CO>CO.[Ni]>CC1=C(CC(C)CO)C(C(C)C)CC1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=C(C)C1CCC(C)=C1CC(C)C=O>C.C1COCCO1.[Pd]>CC1=C(CC(C)C=O)C(C(C)C)CC1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)C(C)=CC1=C(C)CCC1C(C)C>CCOCC.O.[Al+3].[H-].[Li+]>CC(=CC1=C(C)CCC1C(C)C)CO
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCC1CCCC(C)C1=NC(C)COC.O=C(Cl)CCl>CCN(CC)CC.c1ccccc1>CCC1=C(N(C(=O)CCl)C(C)COC)C(C)CCC1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C=CCCl.O=C(c1ccccc1)C(O)c1ccccc1>CS(C)=O.[Na+].[OH-]>C=CCC(O)(C(=O)c1ccccc1)c1ccccc1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(O)(C(=O)c1ccccc1)c1ccccc1.COS(=O)(=O)c1ccc(C)cc1>CS(C)=O.[Na+].[OH-]>COC(C)(C(=O)c1ccccc1)c1ccccc1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CI.O=C(c1ccccc1)C(O)c1ccccc1.c1ccc(Oc2ccccc2)cc1>CS(C)=O.[Na+].[OH-]>CC(Oc1ccccc1)(C(=O)c1ccccc1)c1ccccc1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCC(C)(C)N=NC(C)(C#N)CCC(=O)O.ClP(Cl)(Cl)(Cl)Cl>CCCCC>CCC(C)(C)N=NC(C)(C#N)CCC(=O)Cl
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)CC(C)(Cl)N=NC(C)(C)C.OCCCCO>C1COCCO1.[H-].[H][H].[Na+]>CC(C)CC(C)(N=NC(C)(C)C)OCCCCOC(C)(CC(C)C)N=NC(C)(C)C
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)CC(C)(Cl)N=NC(C)(C)C.O=C([O-])CCC(=O)[O-]>CN(C)C=O.[Na+]>CC(C)CC(C)(N=NC(C)(C)C)OC(=O)CCC(=O)OC(C)(CC(C)C)N=NC(C)(C)C
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)(C)N=NC1(Cl)CCCCC1.[S-2]>CO.O.[Na+]>CC(C)(C)N=NC1(SC2(N=NC(C)(C)C)CCCCC2)CCCCC1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)CC(=O)F.c1cc2c3c(cccc3c1)CC2>C=C1CC(=O)O1.CC(=O)C(C)=O.COc1ccc2cc(OC)ccc2c1.Cc1ccccc1.ClC(Cl)Cl.ClCCCl.[Al+3].[Cl-].c1cc2ccc3cccc4ccc(c1)c2c34>CC(=O)CC(=O)c1ccccc1C
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
NC(N)=O.O=C(Cl)c1coc2ccccc2c1=O>O=S(=O)(O)O.c1ccccc1>NC(=O)NC(=O)c1coc2ccccc2c1=O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(Cl)c1coc2ccccc2c1=O.[NH4+]>[OH-]>NC(=O)c1coc2ccccc2c1=O
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOc1ccccc1N.Cc1ccccc1C(=O)Br>CC(C)=O.O=C([O-])O.[Na+]>CCOc1ccccc1NC(=O)c1ccccc1C
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
C#CCBr.Cc1ccccc1C(=O)Nc1cccc(O)c1>CC(C)=O.O=C([O-])[O-].[Na+]>C#CCOc1cccc(NC(=O)c2ccccc2C)c1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
COc1cccc(N)c1.Cc1ccccc1C(=O)O>CCN(CC)CC.Cc1ccccc1.ClP(Cl)Cl>COc1cccc(NC(=O)c2ccccc2C)c1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOc1ccccc1N.Cc1ccccc1C(=O)O>CC(C)=O.O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3>CCOc1ccccc1NC(=O)c1ccccc1C
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)Oc1cccc(N)c1.Cc1ccccc1C(=O)O>CCN(CC)CC.Cc1ccccc1C.O=P(Cl)(Cl)Cl>Cc1ccccc1C(=O)Nc1cccc(OC(C)C)c1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCCOc1cccc(N)c1.Cc1ccccc1C(=O)O>Cl.Clc1ccccc1.O=S(Cl)Cl.O=S=O>CCCOc1cccc(NC(=O)c2ccccc2C)c1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C(Nc1csc(Br)n1)C(F)(F)F>CC(=O)[O-].CCO.O.[Na+].[Pd]>O=C(Nc1cscn1)C(F)(F)F
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
O=C1CCC(=O)N1Br.O=C1OCc2ccccc21>ClC(Cl)(Cl)Cl.O=C1CCC(=O)N1>O=C1OC(Br)c2ccccc21
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)O.CC(C)OC(=O)CC(=N)N.CCO.CCOC(=O)CC(=O)C=Cc1ccccc1[N+](=O)[O-]>>CCOC(=O)C1=C(C)NC(N)=C(C(=O)OC(C)C)C1c1ccccc1[N+](=O)[O-]
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)O.CC(C)OC(=O)CC(=N)N.CCO.COC(=O)CC(=O)C=Cc1ccccc1[N+](=O)[O-]>>COC(=O)C1=C(C)NC(N)=C(C(=O)OC(C)C)C1c1ccccc1[N+](=O)[O-]
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
COc1ccc(C2CC(F)(F)C2(Cl)Cl)cc1>CCO.[K+].[OH-]>COc1ccc(C2=C(Cl)C(F)(F)C2)cc1
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
COc1ccc(C2CC(O)(c3ccc(OC)cc3)C2)cc1>CCO.[H][H].[Pd]>COc1ccc(C2CC(c3ccc(OC)cc3)C2)cc1
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)CC/C=C(\C)CCC=C(C)C.CCOC(=O)CCl.CC[O-]>CC(=O)O.CO.O.[K+].[Na+].[OH-]>CC(C)=CCCC(C)=CCCC(C)C=O
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(C)=CCCC(C)=CCCC(C)C=O.CCOC(=O)CBr>O=S(=O)(O)O.[Zn].c1ccccc1>CCOC(=O)CC(O)C(C)CCC=C(C)CCC=C(C)C
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CCOC(=O)CC(O)C(C)CCC=C(C)CCC=C(C)C>O.O=[Cr](=O)([O-])O[Cr](=O)(=O)[O-].[Cr+6].[O-2].c1cc[nH+]cc1.c1ccncc1>CCOC(=O)CC(=O)C(C)CCC=C(C)CCC=C(C)C
### Response:
Not high-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)OCC=C(C)CCC=C(C)CBr.CCOC(=O)CC(=O)C(C)CCC=C(C)CCC=C(C)C>CCOCC.[H-].[Na+]>CC(C)=CCCC(C)=CCCC(C)C(=O)CCC(C)=CCCC(C)=CCO
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)OC(C)=O.CC(C)=CCCC(C)=CCCC(C)C(=O)CCC(C)=CCCC(C)=CCO>c1ccncc1>CC(=O)OCC=C(C)CCC=C(C)CCC(=O)C(C)CCC=C(C)CCC=C(C)C
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)OC(C)=O.CC(C)=CCCC(C)=CCCC(C)C(O)CCC(C)=CCCC(C)=CCO>c1ccncc1>CC(=O)OCC=C(C)CCC=C(C)CCC(O)C(C)CCC=C(C)CCC=C(C)C
### Response:
High-yielding |
### Instruction: You are an expert chemist. Your task is to predict reaction yields based on SMILES representations of organic reactions.
Reaction SMILES consist of potentially three parts (reactants, agents, and products) each separated by an arrow symbol '>'.
Reactants are listed before the arrow symbol. If a reaction includes agents, such as catalysts or solvents,
they can be included after the reactants between two arrow symbols. Products are listed after the second arrow symbol,
representing the resulting substances of the reaction.
You can only predict wether the reaction is 'High-yielding' or 'Not high-yielding'.
'High-yielding' reaction means the yield rate of the reaction is above 70%.
'Not high-yielding' means the yield rate of the reaction is below 70%.
Please answer with only 'High-yielding' or 'Not high-yielding', no other information can be provided.
### Input:
CC(=O)OCC=C(C)CCC=C(C)CBr.CCOC(=O)CC(=O)C(C)C>CCOCC.[H-].[Na+]>CC(=CCO)CCC=C(C)CCC(=O)C(C)C
### Response:
High-yielding |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.