id
int64 0
360k
| molecules
dict | ground_truth
stringclasses 1k
values | messages
listlengths 3
3
|
---|---|---|---|
100 | {
"selfies": [
"[C][C][=N][N][=C][N][Ring1][Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][=C][C][Ring2][Ring1][C][C][C][=Branch1][C][=O][N][C][C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][O]"
],
"smiles": [
"CCN(CC)CC",
"CN(C)C(On1nnc2cccnc21)=[N+](C)C",
"CN(C)C=O",
"Cc1nnc2n1-c1ccccc1C(c1ccc(Cl)cc1)=CC2CC(=O)O",
"Cl",
"F[P-](F)(F)(F)(F)F",
"c1ccc(OC2CNC2)cc1",
"Cc1nnc2n1-c1ccccc1C(c1ccc(Cl)cc1)=CC2CC(=O)N1CC(Oc2ccccc2)C1"
]
} | 146 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction by recognizing the specific type of bond formation or cleavage occurring during the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "146",
"role": "assistant"
}
] |
101 | {
"selfies": [
"[C][C][Branch1][Ring1][C][O][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][#C]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[Cl][C][Cl]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[C][C][Branch1][O][C][O][S][Branch1][C][C][=Branch1][C][=O][=O][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC1(CO)CCN(C(=O)OC(C)(C)C)CC1",
"CS(=O)(=O)Cl",
"ClCCl",
"c1ccncc1",
"CC1(COS(C)(=O)=O)CCN(C(=O)OC(C)(C)C)CC1"
]
} | 0 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the presence of specific catalysts or reagents, assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "0",
"role": "assistant"
}
] |
102 | {
"selfies": [
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[Cl]",
"[N][C][=C][C][=C][Branch2][Ring1][=Branch1][C][=C][C][=C][Branch1][N][C][=Branch1][C][=O][C][C][C][=Branch1][C][=O][O][C][=C][Ring1][=N][C][=C][Ring2][Ring1][Ring1][Br]",
"[O]",
"[Zn]",
"[N][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][C][C][C][=Branch1][C][=O][O][C][=C][Ring1][N][C][=C][Ring2][Ring1][C][Br]"
],
"smiles": [
"C1COCCO1",
"Cc1ccccc1",
"Cl",
"Nc1ccc(-c2ccc(C(=O)CCC(=O)O)cc2)cc1Br",
"O",
"[Zn]",
"Nc1ccc(-c2ccc(CCCC(=O)O)cc2)cc1Br"
]
} | 92 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the stereochemical changes in the reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "92",
"role": "assistant"
}
] |
103 | {
"selfies": [
"[C][C][Branch1][Ring2][C][C][#N][N][C][=C][C][Branch1][C][Br][=N][C][=C][Ring1][#Branch1][N+1][=Branch1][C][=O][O-1]",
"[C][C][O]",
"[O]",
"[Cl-1]",
"[Fe]",
"[NH4+1]",
"[C][C][Branch1][Ring2][C][C][#N][N][C][=C][C][Branch1][C][Br][=N][C][=C][Ring1][#Branch1][N]"
],
"smiles": [
"CC(CC#N)Nc1cc(Br)ncc1[N+](=O)[O-]",
"CCO",
"O",
"[Cl-]",
"[Fe]",
"[NH4+]",
"CC(CC#N)Nc1cc(Br)ncc1N"
]
} | 269 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the main reaction type (e.g., substitution, addition, elimination) and use it to classify the reaction into a specific template class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "269",
"role": "assistant"
}
] |
104 | {
"selfies": [
"[C][S][=Branch1][C][=O][=Branch1][C][=O][C][C][=C][C][=C][C][Branch2][Ring1][Branch2][N][C][=N][C][=N][C][Branch1][=N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][=N][Ring1][=C][=C][Ring2][Ring1][Branch1]",
"[O][C][C][=C][C][Branch1][C][F][=C][Branch1][C][F][C][=C][Ring1][Branch2][F]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][C][C][=C][C][=C][C][Branch2][Ring2][#Branch2][N][C][=N][C][=N][C][Branch2][Ring1][=N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][O][C][C][=C][C][Branch1][C][F][=C][Branch1][C][F][C][=C][Ring1][Branch2][F][=N][Ring2][Ring1][Branch2][=C][Ring2][Ring1][#C]"
],
"smiles": [
"CS(=O)(=O)Cc1cccc(Nc2ncnc(-c3ccc(F)cc3F)n2)c1",
"OCc1cc(F)c(F)cc1F",
"CS(=O)(=O)Cc1cccc(Nc2ncnc(-c3ccc(F)cc3OCc3cc(F)c(F)cc3F)n2)c1"
]
} | 485 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the type of heteroatoms involved in the reaction, predict the most likely reaction class from the predefined set.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "485",
"role": "assistant"
}
] |
105 | {
"selfies": [
"[Br][C][C][C][C][Ring1][Ring1]",
"[C][N][Branch1][C][C][C][=O]",
"[O][C][C][O][C][C][Ring1][Branch1][O]",
"[H-1]",
"[Na+1]",
"[O][C][C][O][C][C][Ring1][Branch1][O][C][C][C][C][Ring1][Ring1]"
],
"smiles": [
"BrCC1CC1",
"CN(C)C=O",
"OC1COCC1O",
"[H-]",
"[Na+]",
"OC1COCC1OCC1CC1"
]
} | 95 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given a chemical reaction, classify it into one of the predefined reaction classes from the USPTO 1K TPL dataset.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "95",
"role": "assistant"
}
] |
106 | {
"selfies": [
"[Cl]",
"[N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][Ring1][#Branch2][=O]",
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2]",
"[O][=C][Branch1][P][N][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][Ring1][#Branch2][=O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2]"
],
"smiles": [
"Cl",
"NC1Cc2ccccc2NC1=O",
"O=C(O)c1cc2ccccc2[nH]1",
"O=C(NC1Cc2ccccc2NC1=O)c1cc2ccccc2[nH]1"
]
} | 738 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reactants and products, predict the most likely reaction class that describes the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "738",
"role": "assistant"
}
] |
107 | {
"selfies": [
"[O]",
"[O][=C][Branch1][C][O-1][O-1]",
"[O][=C][C][C][C][N][Ring1][Branch1]",
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][C][Branch1][C][I][=C][Ring1][#Branch1]",
"[Cu]",
"[K+1]",
"[K+1]",
"[O][=C][C][C][C][N][Ring1][Branch1][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2]"
],
"smiles": [
"O",
"O=C([O-])[O-]",
"O=C1CCCN1",
"O=[N+]([O-])c1cccc(I)c1",
"[Cu]",
"[K+]",
"[K+]",
"O=C1CCCN1c1cccc([N+](=O)[O-])c1"
]
} | 921 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the structural changes between the reactants and products, and assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "921",
"role": "assistant"
}
] |
108 | {
"selfies": [
"[C][C][O]",
"[C][C][O][C][=Branch1][C][=O][C][C][C][C][C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][=O]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[BH4-1]",
"[Cl-1]",
"[NH4+1]",
"[Na+1]",
"[C][C][O][C][=Branch1][C][=O][C][C][C][C][C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][O]"
],
"smiles": [
"CCO",
"CCOC(=O)CCCCCCN(CC)c1ccc(C(F)(F)F)cc1C=O",
"CCOC(C)=O",
"Cc1ccccc1",
"[BH4-]",
"[Cl-]",
"[NH4+]",
"[Na+]",
"CCOC(=O)CCCCCCN(CC)c1ccc(C(F)(F)F)cc1CO"
]
} | 356 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key reactive sites in the given reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "356",
"role": "assistant"
}
] |
109 | {
"selfies": [
"[C][C][C][N][=C][=O]",
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][N][Branch1][C][C][C][=O]",
"[N][C][=Branch1][C][=O][N][C][NH1][C][Branch1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][=C][C][=Ring1][N][C][Branch1][C][N][=O]",
"[C][C][C][N][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][Branch1][=Branch1][C][Branch1][C][N][=O][=C][Branch1][#Branch1][N][C][Branch1][C][N][=O][NH1][Ring1][N]"
],
"smiles": [
"CCCN=C=O",
"CCN(CC)CC",
"CN(C)C=O",
"NC(=O)Nc1[nH]c(-c2ccccc2O)cc1C(N)=O",
"CCCNC(=O)Oc1ccccc1-c1cc(C(N)=O)c(NC(N)=O)[nH]1"
]
} | 104 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction into one of the template classes by recognizing the characteristic patterns of atom rearrangements.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "104",
"role": "assistant"
}
] |
110 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][Ring1][C][N][C][=C][Ring1][Branch2]",
"[Cl][C][Cl]",
"[O]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][S][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#C]"
],
"smiles": [
"CC(C)(C)OC(=O)OC(=O)OC(C)(C)C",
"COC(=O)c1ccc(CN)cc1",
"ClCCl",
"O",
"COC(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1"
]
} | 686 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Determine the reaction class based on the specific combination of reactants, reagents, and products present.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "686",
"role": "assistant"
}
] |
111 | {
"selfies": [
"[C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][N][C][=Branch1][C][=O][NH1][C][=C][Branch1][C][Cl][C][Branch1][Branch2][C][O][C][C][O][Ring1][Branch1][=C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][P][C][Ring2][Ring1][=Branch1][=O]",
"[C][N][C][C][C][C][Ring1][Branch1][=O]",
"[O]",
"[O][=S][=Branch1][C][=O][Branch1][C][O][O]",
"[C][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][N][C][=Branch1][C][=O][NH1][C][=C][Branch1][C][Cl][C][Branch1][Ring1][C][=O][=C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][=C][C][Ring2][Ring1][Ring1][=O]"
],
"smiles": [
"CCS(=O)(=O)c1ccc(Cl)cc1Cn1c(=O)[nH]c2c(Cl)c(C3OCCO3)c(OC(F)(F)F)cc2c1=O",
"CN1CCCC1=O",
"O",
"O=S(=O)(O)O",
"CCS(=O)(=O)c1ccc(Cl)cc1Cn1c(=O)[nH]c2c(Cl)c(C=O)c(OC(F)(F)F)cc2c1=O"
]
} | 655 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Assign the reaction to one of the classes by identifying the main functional group transformations occurring in the reaction.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "655",
"role": "assistant"
}
] |
112 | {
"selfies": [
"[Cl][C][Cl]",
"[N][#C][C][=C][C][=C][Branch1][C][N][N][=C][Ring1][#Branch1]",
"[O]",
"[O][=C][Branch1][C][O][C][Branch1][=Branch2][C][C][C][C][C][C][Ring1][Branch1][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[C][=C][C][=C][Branch2][Ring1][Ring2][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][Ring1]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[N][#C][C][=C][C][=C][Branch2][Ring1][#C][N][C][=Branch1][C][=O][C][Branch1][=Branch2][C][C][C][C][C][C][Ring1][Branch1][C][=C][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][Branch2][N][=C][Ring2][Ring1][Branch2]"
],
"smiles": [
"ClCCl",
"N#Cc1ccc(N)nc1",
"O",
"O=C(O)C(CC1CCCC1)c1ccc(Cl)c(Cl)c1",
"O=C1CCC(=O)N1Br",
"c1ccc(P(c2ccccc2)c2ccccc2)cc1",
"c1ccncc1",
"N#Cc1ccc(NC(=O)C(CC2CCCC2)c2ccc(Cl)c(Cl)c2)nc1"
]
} | 368 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reaction's atom-mapping, predict the reaction class that best represents the chemical transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "368",
"role": "assistant"
}
] |
113 | {
"selfies": [
"[C][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][N][C][Branch1][=C][O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][=C][Ring1][S]",
"[C][N][Branch1][C][C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[Cl]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[C][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=C][N][S][=Branch1][C][=O][=Branch1][C][=O][N][Branch1][C][C][C][C][Branch1][=C][O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][F][=C][Ring2][Ring1][=Branch1]"
],
"smiles": [
"CC(=O)c1ccc(N)c(Oc2ccc(F)cc2F)c1",
"CN(C)S(=O)(=O)Cl",
"Cl",
"c1ccncc1",
"CC(=O)c1ccc(NS(=O)(=O)N(C)C)c(Oc2ccc(F)cc2F)c1"
]
} | 395 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the reaction mechanism and use it to classify the reaction into one of the predefined template classes.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "395",
"role": "assistant"
}
] |
114 | {
"selfies": [
"[N][#C][C][C][C][Branch1][C][F][C][N][Ring1][=Branch1][C][=Branch1][C][=O][C][N][C][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][Branch1][Branch1][C][C][Ring1][=Branch2][C][C][Ring1][O]",
"[N][C][=C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][C][Branch1][C][F][=C][Ring1][=N]",
"[N][#C][C][C][C][Branch1][C][F][C][N][Ring1][=Branch1][C][=Branch1][C][=O][C][N][C][C][C][C][Branch2][Ring1][O][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][C][Branch1][C][F][=C][Ring1][=N][Branch1][=Branch1][C][C][Ring2][Ring1][=Branch1][C][C][Ring2][Ring1][Branch2]"
],
"smiles": [
"N#CC1CC(F)CN1C(=O)CNC12CCC(C(=O)O)(CC1)CC2",
"Nc1ccc(N2CCOCC2)c(F)c1",
"N#CC1CC(F)CN1C(=O)CNC12CCC(C(=O)Nc3ccc(N4CCOCC4)c(F)c3)(CC1)CC2"
]
} | 365 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key structural motifs in the reactants and products that are indicative of a particular reaction class.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "365",
"role": "assistant"
}
] |
115 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1]",
"[C][O][C][=C][C][=C][Branch2][=Branch1][C][C][N][Branch1][=C][C][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][C][=N][C][=C][Branch2][Ring2][Branch1][C][=N][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=N][C][=C][Ring1][N][C][C][N][Ring1][Branch1][C][=C][C][Branch1][Ring1][C][=O][=C][C][=C][Ring1][Branch2][F][C][=N][Ring2][Ring1][=C][C][=C][Ring2][Ring2][#C]",
"[C][O][C][=C][C][=C][Branch2][=Branch1][S][C][N][Branch1][=C][C][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][Branch2][C][=N][C][=C][Branch2][Branch1][Ring1][C][=N][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=N][C][=C][Ring1][N][C][C][N][Ring1][Branch1][C][=C][C][Branch1][P][C][N][C][C][N][Branch1][=Branch1][C][Branch1][C][C][=O][C][C][Ring1][=Branch2][=C][C][=C][Ring1][S][F][C][=N][Ring2][Ring2][=Branch1][C][=C][Ring2][Branch1][#Branch1]"
],
"smiles": [
"CC(=O)N1CCNCC1",
"COc1ccc(CN(Cc2ccc(OC)cc2)c2ncc(-c3nc(N4CCOCC4)nc4c3CCN4c3cc(C=O)ccc3F)cn2)cc1",
"COc1ccc(CN(Cc2ccc(OC)cc2)c2ncc(-c3nc(N4CCOCC4)nc4c3CCN4c3cc(CN4CCN(C(C)=O)CC4)ccc3F)cn2)cc1"
]
} | 567 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction by recognizing the specific type of bond formation or cleavage occurring during the transformation.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "567",
"role": "assistant"
}
] |
116 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][Branch1][C][C][C]",
"[C][C][Branch1][C][O][C][O]",
"[C][C][=N][C][=C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][C][=C][Ring2][Ring1][Ring1][C][=C][N][=C][Branch1][C][F][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=C][Ring1][=N]",
"[H-1]",
"[Na+1]",
"[C][C][=N][C][=C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][C][=C][Ring2][Ring1][Ring1][C][=C][N][=C][Branch1][Branch2][O][C][C][Branch1][C][C][O][C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][=C][Ring1][P]"
],
"smiles": [
"CC(=O)N(C)C",
"CC(O)CO",
"Cc1ncc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-c1cnc(F)c(N2CCOCC2)c1",
"[H-]",
"[Na+]",
"Cc1ncc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-c1cnc(OCC(C)O)c(N2CCOCC2)c1"
]
} | 541 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the presence of specific catalysts or reagents, assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "541",
"role": "assistant"
}
] |
117 | {
"selfies": [
"[C][#C][C][Br]",
"[C][C][Branch1][C][C][=O]",
"[C][C][=N][N][Branch1][S][C][=C][C][Branch1][C][O][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][F][C][=Branch1][C][=O][N][Ring1][#C][C][C][C][F]",
"[O][=C][Branch1][C][O-1][O-1]",
"[K+1]",
"[K+1]",
"[C][#C][C][O][C][=C][C][Branch2][Ring1][C][N][N][=C][Branch1][C][C][N][Branch1][Branch1][C][C][C][F][C][Ring1][#Branch2][=O][=C][Branch1][C][F][C][=C][Ring2][Ring1][C][Cl]"
],
"smiles": [
"C#CCBr",
"CC(C)=O",
"Cc1nn(-c2cc(O)c(Cl)cc2F)c(=O)n1CCCF",
"O=C([O-])[O-]",
"[K+]",
"[K+]",
"C#CCOc1cc(-n2nc(C)n(CCCF)c2=O)c(F)cc1Cl"
]
} | 154 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the stereochemical changes in the reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "154",
"role": "assistant"
}
] |
118 | {
"selfies": [
"[C][O][N]",
"[Cl]",
"[O][=C][Branch2][Ring1][#Branch1][N][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][O][C][=Branch1][C][=O][O][C][=C][C][=C][N][=C][Ring1][=Branch1][N][C][=C][Branch1][C][F][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][Ring1][N]",
"[C][O][N][C][=Branch1][C][=O][C][Branch1][C][O][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][=Branch1][C][=O][C][=C][C][=C][N][=C][Ring1][=Branch1][N][C][=C][Branch1][C][F][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][=N][Ring1][N]"
],
"smiles": [
"CON",
"Cl",
"O=C(NC(Cc1ccccc1)C(O)C(=O)O)c1cccnc1-n1cc(F)c(-c2ccccc2)n1",
"CONC(=O)C(O)C(Cc1ccccc1)NC(=O)c1cccnc1-n1cc(F)c(-c2ccccc2)n1"
]
} | 480 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the main reaction type (e.g., substitution, addition, elimination) and use it to classify the reaction into a specific template class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "480",
"role": "assistant"
}
] |
119 | {
"selfies": [
"[C][C][C][N][C][Ring1][Branch1]",
"[C][C][N][=C][=N][C][C][C][N][Branch1][C][C][C]",
"[Cl][C][Branch1][C][Cl][Cl]",
"[Cl][C][Cl]",
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[O][N][N][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=N][C][=C][Ring1][=Branch1][N][C][C][C][C][Ring1][Branch1]"
],
"smiles": [
"C1CCNC1",
"CCN=C=NCCCN(C)C",
"ClC(Cl)Cl",
"ClCCl",
"O=C(O)C=Cc1ccncc1",
"On1nnc2ccccc21",
"O=C(C=Cc1ccncc1)N1CCCC1"
]
} | 517 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the type of heteroatoms involved in the reaction, predict the most likely reaction class from the predefined set.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "517",
"role": "assistant"
}
] |
120 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][O][C][=C][C][=C][Branch2][Ring2][C][C][N][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][=C][Ring1][S][C][#N][C][=C][Ring2][Ring1][#Branch2]",
"[Al+3]",
"[H-1]",
"[H-1]",
"[H-1]",
"[H-1]",
"[Li+1]",
"[C][O][C][=C][C][=C][Branch2][Ring2][C][C][N][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][=C][Ring1][S][C][N][C][=C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"C1CCOC1",
"COc1ccc(CNc2ccc(-c3ccc(C(F)(F)F)cc3)cc2C#N)cc1",
"[Al+3]",
"[H-]",
"[H-]",
"[H-]",
"[H-]",
"[Li+]",
"COc1ccc(CNc2ccc(-c3ccc(C(F)(F)F)cc3)cc2CN)cc1"
]
} | 175 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given a chemical reaction, classify it into one of the predefined reaction classes from the USPTO 1K TPL dataset.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "175",
"role": "assistant"
}
] |
121 | {
"selfies": [
"[C][N][Branch1][C][C][C][=O]",
"[C][N][C][C][C][C][Ring1][Branch1][=O]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[N][#C][C][=C][C][Branch1][C][F][=C][C][Branch1][C][F][=C][Ring1][Branch2]",
"[O]",
"[O][=C][Branch1][C][O-1][O-1]",
"[K+1]",
"[K+1]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][P][O][C][=C][C][Branch1][C][F][=C][C][Branch1][Ring1][C][#N][=C][Ring1][=Branch2][C][=C][Ring1][S]"
],
"smiles": [
"CN(C)C=O",
"CN1CCCC1=O",
"CS(=O)(=O)c1ccc(O)cc1",
"Cc1ccccc1",
"N#Cc1cc(F)cc(F)c1",
"O",
"O=C([O-])[O-]",
"[K+]",
"[K+]",
"CS(=O)(=O)c1ccc(Oc2cc(F)cc(C#N)c2)cc1"
]
} | 564 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reactants and products, predict the most likely reaction class that describes the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "564",
"role": "assistant"
}
] |
122 | {
"selfies": [
"[C][C][C][C][Branch2][Ring1][=Branch1][N][C][C][C][C][=C][C][Branch1][C][F][=C][C][Branch1][C][F][=C][Ring1][Branch2][C][Ring1][N][C][=Branch1][C][=O][N][C][=N][N][=C][Branch1][#Branch2][C][Branch1][C][C][Branch1][C][C][C][=O][S][Ring1][#Branch2]"
],
"smiles": [
"CC(=O)OI1(OC(C)=O)(OC(C)=O)OC(=O)c2ccccc21",
"CCCC(NC1CCc2cc(F)cc(F)c2C1)C(=O)Nc1nnc(C(C)(C)CO)s1",
"CS(C)=O",
"ClCCl",
"CCCC(NC1CCc2cc(F)cc(F)c2C1)C(=O)Nc1nnc(C(C)(C)C=O)s1"
]
} | 142 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the structural changes between the reactants and products, and assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "142",
"role": "assistant"
}
] |
123 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][Branch1][Ring2][C][C][O][=C][Branch1][C][F][F]",
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[C][C][Branch1][N][C][C][O][S][Branch1][C][C][=Branch1][C][=O][=O][=C][Branch1][C][F][F]"
],
"smiles": [
"C1CCOC1",
"CC(CCO)=C(F)F",
"CCN(CC)CC",
"CS(=O)(=O)Cl",
"CC(CCOS(C)(=O)=O)=C(F)F"
]
} | 0 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key reactive sites in the given reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "0",
"role": "assistant"
}
] |
124 | {
"selfies": [
"[Br][B][Branch1][C][Br][Br]",
"[C][O][C][=C][C][Branch2][Ring1][Ring1][N][N][=C][Branch1][C][C][N][Branch1][=Branch1][C][Branch1][C][F][F][C][Ring1][=Branch2][=O][=C][Branch1][C][F][C][=C][Ring1][P][Cl]",
"[Cl][C][Cl]",
"[O]",
"[C][C][=N][N][Branch1][S][C][=C][C][Branch1][C][O][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][F][C][=Branch1][C][=O][N][Ring1][#C][C][Branch1][C][F][F]"
],
"smiles": [
"BrB(Br)Br",
"COc1cc(-n2nc(C)n(C(F)F)c2=O)c(F)cc1Cl",
"ClCCl",
"O",
"Cc1nn(-c2cc(O)c(Cl)cc2F)c(=O)n1C(F)F"
]
} | 48 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction into one of the template classes by recognizing the characteristic patterns of atom rearrangements.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "48",
"role": "assistant"
}
] |
125 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][Cl]",
"[O]",
"[O][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][C][=C][C][=C][Branch1][Ring1][C][O][C][=C][Ring1][Branch2][C][Ring1][O]",
"[O][=C][Branch1][C][O-1][O]",
"[Cl-1]",
"[Na+1]",
"[Na+1]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][N][Branch1][#C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][S]"
],
"smiles": [
"C1CCOC1",
"CCN(CC)CC",
"CCOC(C)=O",
"CS(=O)(=O)Cl",
"O",
"O=C(OCc1ccccc1)N1Cc2ccc(CO)cc2C1",
"O=C([O-])O",
"[Cl-]",
"[Na+]",
"[Na+]",
"CS(=O)(=O)OCc1ccc2c(c1)CN(C(=O)OCc1ccccc1)C2"
]
} | 0 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Determine the reaction class based on the specific combination of reactants, reagents, and products present.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "0",
"role": "assistant"
}
] |
126 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][C][O][C][C][Ring1][#Branch1]",
"[C][C][Branch1][C][C][O][C][=Branch1][C][=O][N+1][=Branch1][C][=N-1][C][=Branch1][C][=O][O][C][Branch1][C][C][C]",
"[C][C][O][C][C][=N][C][=C][N][=C][C][=C][Branch1][C][O][C][=C][C][Ring1][#Branch1][=C][Ring1][O][N][Ring1][=C][C][C][C][O][C][Branch1][C][C][Branch1][C][C][O][Ring1][#Branch1]",
"[C][=C][C][=C][Branch2][Ring1][Ring2][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][Ring1]",
"[C][C][O][C][C][=N][C][=C][N][=C][C][=C][Branch2][Ring1][=Branch2][O][C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][=C][C][Ring2][Ring1][Ring2][=C][Ring2][Ring1][Branch2][N][Ring2][Ring1][O][C][C][C][O][C][Branch1][C][C][Branch1][C][C][O][Ring1][#Branch1]"
],
"smiles": [
"C1CCOC1",
"CC(C)(C)OC(=O)N1CCC(O)CC1",
"CC(C)OC(=O)[N+](=[N-])C(=O)OC(C)C",
"CCOCc1nc2cnc3cc(O)ccc3c2n1CC1COC(C)(C)O1",
"c1ccc(P(c2ccccc2)c2ccccc2)cc1",
"CCOCc1nc2cnc3cc(OC4CCN(C(=O)OC(C)(C)C)CC4)ccc3c2n1CC1COC(C)(C)O1"
]
} | 846 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Assign the reaction to one of the classes by identifying the main functional group transformations occurring in the reaction.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "846",
"role": "assistant"
}
] |
127 | {
"selfies": [
"[C][O]",
"[N][C][=C][C][=N][C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][=C][Ring1][N][N+1][=Branch1][C][=O][O-1]",
"[Cl-1]",
"[Fe]",
"[NH4+1]",
"[N][C][=C][C][=N][C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][=C][Ring1][N][N]"
],
"smiles": [
"CO",
"Nc1ccnc(-c2ccncc2)c1[N+](=O)[O-]",
"[Cl-]",
"[Fe]",
"[NH4+]",
"Nc1ccnc(-c2ccncc2)c1N"
]
} | 269 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reaction's atom-mapping, predict the reaction class that best represents the chemical transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "269",
"role": "assistant"
}
] |
128 | {
"selfies": [
"[Br][C][=C][C][=C][C][=C][N][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1]",
"[C][#C][N][C][=C][Branch1][=C][C][=C][C][Branch1][C][C][=C][C][=C][Ring1][#Branch1][Ring1][#Branch2][C][N][Branch1][C][C][C][C][Ring1][=C]",
"[C][C][C][C][N+1][Branch1][Branch1][C][C][C][C][Branch1][Branch1][C][C][C][C][C][C][C][C]",
"[O]",
"[F-1]",
"[C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=C][Branch2][Ring1][Ring2][N][Ring1][=Branch1][C][#C][C][=C][C][=C][C][=C][N][=C][C][=C][Ring1][#Branch2][Ring1][=Branch1][C][C][N][Branch1][C][C][C][Ring2][Ring1][Ring2]"
],
"smiles": [
"Brc1cccc2cnccc12",
"C#Cn1c2c(c3cc(C)ccc31)CN(C)CC2",
"CCCC[N+](CCCC)(CCCC)CCCC",
"O",
"[F-]",
"Cc1ccc2c(c1)c1c(n2C#Cc2cccc3cnccc23)CCN(C)C1"
]
} | 659 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the reaction mechanism and use it to classify the reaction into one of the predefined template classes.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "659",
"role": "assistant"
}
] |
129 | {
"selfies": [
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][N][Branch1][C][C][C][=O]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][N][C][C][C][Branch1][C][N][C][C][O][Ring1][#Branch1][=C][Ring1][=N]",
"[Cl][C][Cl]",
"[O][=C][Branch1][C][Cl][C][=Branch1][C][=O][Cl]",
"[O][=C][Branch1][C][O][C][Branch2][Ring1][=Branch1][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][Branch1][C][F][Branch1][C][F][O][Ring1][Branch2][C][C][Ring1][=C]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Ring2][#C][C][C][C][Branch2][Ring2][Ring1][N][C][=Branch1][C][=O][C][Branch2][Ring1][=Branch1][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][Branch1][C][F][Branch1][C][F][O][Ring1][Branch2][C][C][Ring1][=C][C][C][O][Ring2][Ring1][#Branch1][=C][Ring2][Ring1][=N]"
],
"smiles": [
"CCN(CC)CC",
"CN(C)C=O",
"COC(=O)c1cccc(C2CC(N)CCO2)c1",
"ClCCl",
"O=C(Cl)C(=O)Cl",
"O=C(O)C1(c2ccc3c(c2)OC(F)(F)O3)CC1",
"COC(=O)c1cccc(C2CC(NC(=O)C3(c4ccc5c(c4)OC(F)(F)O5)CC3)CCO2)c1"
]
} | 230 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key structural motifs in the reactants and products that are indicative of a particular reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "230",
"role": "assistant"
}
] |
130 | {
"selfies": [
"[C][C][C][C][O][C][C][O][C][=C][C][=C][Branch2][Branch1][P][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=C][Branch2][Ring2][=Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring1][Branch1][S][C][C][=N][N][=C][Branch1][Ring2][S][C][C][N][Ring1][Branch2][C][C][Branch1][C][C][C][C][=C][Ring2][Ring1][Ring2][C][C][N][Ring2][Ring1][#C][C][C][Branch1][C][C][C][C][=C][Ring2][Ring2][N]",
"[Cl][C][Cl]",
"[O][=C][Branch1][Ring1][O][O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]",
"[O][=S][Branch1][C][O-1][Branch1][C][O-1][=S]",
"[Na+1]",
"[Na+1]",
"[C][C][C][C][O][C][C][O][C][=C][C][=C][Branch2][=Branch1][Ring2][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=C][Branch2][Ring2][=Branch2][C][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring1][Branch2][S][=Branch1][C][=O][C][C][=N][N][=C][Branch1][Ring2][S][C][C][N][Ring1][Branch2][C][C][Branch1][C][C][C][C][=C][Ring2][Ring1][Branch1][C][C][N][Ring2][Ring1][S][C][C][Branch1][C][C][C][C][=C][Ring2][Ring2][=N]"
],
"smiles": [
"CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc(SCc4nnc(SCC)n4CC(C)C)cc2)CCN3CC(C)C)cc1",
"ClCCl",
"O=C(OO)c1cccc(Cl)c1",
"O=S([O-])([O-])=S",
"[Na+]",
"[Na+]",
"CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc(S(=O)Cc4nnc(SCC)n4CC(C)C)cc2)CCN3CC(C)C)cc1"
]
} | 500 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction by recognizing the specific type of bond formation or cleavage occurring during the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "500",
"role": "assistant"
}
] |
131 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][O][C][=Branch1][C][=O][C][C][=C][C][=C][C][Branch1][Branch2][N][C][=N][N][=N][Ring1][Branch1][=N][Ring1][O]",
"[Li+1]",
"[OH1-1]",
"[O][=C][Branch1][C][O][C][C][=C][C][=C][C][Branch1][Branch2][N][C][=N][N][=N][Ring1][Branch1][=N][Ring1][O]"
],
"smiles": [
"C1CCOC1",
"COC(=O)Cc1cccc(-n2cnnn2)n1",
"[Li+]",
"[OH-]",
"O=C(O)Cc1cccc(-n2cnnn2)n1"
]
} | 88 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the presence of specific catalysts or reagents, assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "88",
"role": "assistant"
}
] |
132 | {
"selfies": [
"[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][N][Branch1][C][C][C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[C][O][C][Cl]",
"[Cl]",
"[Cl][C][Cl]",
"[O][=C][C][=C][C][Branch1][C][Cl][=C][C][Branch1][C][Cl][=C][Ring1][Branch2][O]",
"[C][O][C][O][C][=C][Branch1][C][Cl][C][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][C][=O]"
],
"smiles": [
"CCN(C(C)C)C(C)C",
"CCOC(C)=O",
"CN(C)c1ccncc1",
"COCCl",
"Cl",
"ClCCl",
"O=Cc1cc(Cl)cc(Cl)c1O",
"COCOc1c(Cl)cc(Cl)cc1C=O"
]
} | 375 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the stereochemical changes in the reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "375",
"role": "assistant"
}
] |
133 | {
"selfies": [
"[C][C][N][=C][=N][C][C][C][N][Branch1][C][C][C]",
"[C][N][Branch1][C][C][C][=O]",
"[Cl]",
"[Cl]",
"[N][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O]",
"[O][=C][Branch1][C][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][=C][Ring1][Branch1][NH1][C][=Branch1][C][=O][C][=N][C][=C][N][Ring1][#Branch2][Ring1][Branch1]",
"[O][=C][Branch1][C][O-1][O]",
"[O][C][=C][C][=C][C][NH1][N][=N][C][Ring1][=Branch2][=Ring1][Branch1]",
"[Na+1]",
"[O][=C][Branch2][Ring1][=N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][=C][Ring1][Branch1][NH1][C][=Branch1][C][=O][C][=N][C][=C][N][Ring1][#Branch2][Ring1][Branch1][N][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CCN=C=NCCCN(C)C",
"CN(C)C=O",
"Cl",
"Cl",
"Nc1ccccc1",
"O",
"O=C(O)Cc1cccc2c1Cc1c-2[nH]c(=O)c2nccn12",
"O=C([O-])O",
"Oc1cccc2[nH]nnc12",
"[Na+]",
"O=C(Cc1cccc2c1Cc1c-2[nH]c(=O)c2nccn12)Nc1ccccc1"
]
} | 365 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the main reaction type (e.g., substitution, addition, elimination) and use it to classify the reaction into a specific template class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "365",
"role": "assistant"
}
] |
134 | {
"selfies": [
"[C][C][O][P][=Branch1][C][=O][Branch1][#Branch1][C][C][=Branch1][C][=O][Cl][O][C][C]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][C][=O]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[C][C][O][P][=Branch1][C][=O][Branch2][Ring1][Ring2][C][C][=Branch1][C][=O][N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][C][=O][O][C][C]"
],
"smiles": [
"CCOP(=O)(CC(=O)Cl)OCC",
"Cc1ccccc1",
"Nc1cc(Cl)ccc1C=O",
"c1ccncc1",
"CCOP(=O)(CC(=O)Nc1cc(Cl)ccc1C=O)OCC"
]
} | 9 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the type of heteroatoms involved in the reaction, predict the most likely reaction class from the predefined set.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "9",
"role": "assistant"
}
] |
135 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][Branch1][C][C][C][=C][C][=C][Branch1][P][C][Branch1][=Branch2][C][=C][C][C][C][C][Ring1][=Branch1][=C][Ring1][N][C][=O][C][=Branch1][C][=O][C][C][Branch1][C][C][Branch1][C][C][O][Ring2][Ring1][Ring1]",
"[F][C][Branch1][C][F][Branch1][C][F][C][=C][C][=C][Branch1][Ring1][Mg][Br][C][=C][Ring1][Branch2]",
"[O][=C][Branch1][C][O-1][O]",
"[Na+1]",
"[C][C][Branch1][C][C][C][=C][C][=C][Branch2][Ring2][Branch1][C][Branch1][=Branch2][C][=C][C][C][C][C][Ring1][=Branch1][=C][Ring1][N][C][Branch1][C][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][=Branch1][C][=O][C][C][Branch1][C][C][Branch1][C][C][O][Ring2][Ring1][=N]"
],
"smiles": [
"C1CCOC1",
"CC(C)c1cc2c(c(C3=CCCCC3)c1C=O)C(=O)CC(C)(C)O2",
"FC(F)(F)c1ccc([Mg]Br)cc1",
"O=C([O-])O",
"[Na+]",
"CC(C)c1cc2c(c(C3=CCCCC3)c1C(O)c1ccc(C(F)(F)F)cc1)C(=O)CC(C)(C)O2"
]
} | 309 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given a chemical reaction, classify it into one of the predefined reaction classes from the USPTO 1K TPL dataset.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "309",
"role": "assistant"
}
] |
136 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][Ring2][C][C][N][C][=C][Ring1][=Branch2]",
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][S][Ring1][O]",
"[C][O][C][=C][C][=C][Branch2][Ring1][=Branch2][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=N][C][=C][Ring1][=Branch1][S][Ring1][O][C][=C][Ring2][Ring1][=Branch1]"
],
"smiles": [
"COc1ccc(CCN)cc1",
"O=C(O)c1ccc(-c2ccncc2)s1",
"COc1ccc(CCNC(=O)c2ccc(-c3ccncc3)s2)cc1"
]
} | 736 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reactants and products, predict the most likely reaction class that describes the transformation.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "736",
"role": "assistant"
}
] |
137 | {
"selfies": [
"[C][C][=Branch1][C][=O][C][C][C][C][=Branch1][C][=O][O]",
"[C][I]",
"[C][N][Branch1][C][C][C][=O]",
"[O]",
"[O][=C][Branch1][C][O-1][O-1]",
"[K+1]",
"[K+1]",
"[C][O][C][=Branch1][C][=O][C][C][C][C][Branch1][C][C][=O]"
],
"smiles": [
"CC(=O)CCCC(=O)O",
"CI",
"CN(C)C=O",
"O",
"O=C([O-])[O-]",
"[K+]",
"[K+]",
"COC(=O)CCCC(C)=O"
]
} | 415 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the structural changes between the reactants and products, and assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "415",
"role": "assistant"
}
] |
138 | {
"selfies": [
"[Br][C][C][C][C][Br]",
"[C][C][Branch1][C][C][=O]",
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][O][C][Branch1][C][F][=C][Ring1][Branch2]",
"[O][=C][Branch1][C][O-1][O-1]",
"[I-1]",
"[K+1]",
"[K+1]",
"[K+1]",
"[C][C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#Branch1][O][C][C][C][C][Br][C][Branch1][C][F][=C][Ring1][=N]"
],
"smiles": [
"BrCCCCBr",
"CC(C)=O",
"CCOC(=O)c1ccc(O)c(F)c1",
"O=C([O-])[O-]",
"[I-]",
"[K+]",
"[K+]",
"[K+]",
"CCOC(=O)c1ccc(OCCCCBr)c(F)c1"
]
} | 385 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key reactive sites in the given reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "385",
"role": "assistant"
}
] |
139 | {
"selfies": [
"[C][O]",
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][C][C][=C][N][Branch2][Ring1][Ring2][C][=C][Branch1][C][F][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][#Branch2][F][N][=Ring1][S]",
"[Pd]",
"[N][C][=C][C][Branch1][C][F][=C][Branch2][Ring1][=N][N][C][=C][C][Branch2][Ring1][Ring1][N][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][=N][Ring1][P][C][Branch1][C][F][=C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CO",
"O=C(O)c1ccccc1C(=O)Nc1ccn(-c2c(F)cc([N+](=O)[O-])cc2F)n1",
"[Pd]",
"Nc1cc(F)c(-n2ccc(NC(=O)c3ccccc3C(=O)O)n2)c(F)c1"
]
} | 1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction into one of the template classes by recognizing the characteristic patterns of atom rearrangements.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "1",
"role": "assistant"
}
] |
140 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][N]",
"[O][=C][Branch1][C][O][C][N][C][Branch1][=Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1][=N][C][=C][C][=C][N][=C][Ring1][=Branch1][Ring1][#C]",
"[O][=C][Branch1][Branch2][N][C][=C][N][=C][Ring1][Branch1][N][C][=C][N][=C][Ring1][Branch1]",
"[C][N][C][=Branch1][C][=O][C][N][C][Branch1][=Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1][=N][C][=C][C][=C][N][=C][Ring1][=Branch1][Ring1][#C]"
],
"smiles": [
"C1CCOC1",
"CN",
"O=C(O)Cn1c(-c2ccccn2)nc2cccnc21",
"O=C(n1ccnc1)n1ccnc1",
"CNC(=O)Cn1c(-c2ccccn2)nc2cccnc21"
]
} | 230 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Determine the reaction class based on the specific combination of reactants, reagents, and products present.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "230",
"role": "assistant"
}
] |
141 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][#Branch1][C][=N][C][Branch1][C][Cl][=C][C][Branch1][C][C][=C][Branch1][C][C][S][C][Ring1][#Branch1][=N][Ring1][N][C][=C][Ring2][Ring1][C]",
"[N][C][C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][O][Ring1][=Branch1]",
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring2][#Branch2][C][=N][C][Branch2][Ring1][Ring1][N][C][C][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][O][Ring1][=Branch1][=C][C][Branch1][C][C][=C][Branch1][C][C][S][C][Ring1][#Branch1][=N][Ring2][Ring1][#Branch1][C][=C][Ring2][Ring1][=N]"
],
"smiles": [
"COC(=O)c1ccc(-c2nc(Cl)c3c(C)c(C)sc3n2)cc1",
"NCCc1ccc2c(c1)OCO2",
"COC(=O)c1ccc(-c2nc(NCCc3ccc4c(c3)OCO4)c3c(C)c(C)sc3n2)cc1"
]
} | 723 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Assign the reaction to one of the classes by identifying the main functional group transformations occurring in the reaction.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "723",
"role": "assistant"
}
] |
142 | {
"selfies": [
"[C][C][C][C][C][N][Branch2][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][N][N][=C][C][=N][Ring1][Branch1][C][Ring2][Ring1][Ring2][C][N]",
"[Cl][C][=C][C][=C][Branch1][C][Br][N][=C][Ring1][#Branch1]",
"[C][C][C][C][C][N][Branch2][Ring1][#Branch1][C][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][C][=C][Ring1][#Branch1][N][N][=C][C][=N][Ring1][Branch1][C][Ring2][Ring1][Ring2][C][N][C][=C][C][=C][Branch1][C][Cl][C][=N][Ring1][#Branch1]"
],
"smiles": [
"CC1CCCN(C(=O)c2cc(F)ccc2-n2nccn2)C1CN",
"Clc1ccc(Br)nc1",
"CC1CCCN(C(=O)c2cc(F)ccc2-n2nccn2)C1CNc1ccc(Cl)cn1"
]
} | 715 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reaction's atom-mapping, predict the reaction class that best represents the chemical transformation.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "715",
"role": "assistant"
}
] |
143 | {
"selfies": [
"[N-1][=N+1][=N][C][C][C][C][Branch2][Ring2][=Branch1][N][C][C][C][C][C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][C][Ring2][Ring1][Ring2][=O][C][Branch1][P][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring2][Ring2][Branch1]"
],
"smiles": [
"CCN(C(C)C)C(C)C",
"CCOC(C)=O",
"CN(C)C(On1nnc2cccnc21)=[N+](C)C",
"CN(C)C=O",
"F[P-](F)(F)(F)(F)F",
"O=C(O)c1cccc(C(F)(F)F)c1",
"[N-]=[N+]=NC1CCC(N2CCCCC(N)C2=O)C(CS(=O)(=O)c2ccccc2)C1",
"[N-]=[N+]=NC1CCC(N2CCCCC(NC(=O)c3cccc(C(F)(F)F)c3)C2=O)C(CS(=O)(=O)c2ccccc2)C1"
]
} | 718 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the reaction mechanism and use it to classify the reaction into one of the predefined template classes.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "718",
"role": "assistant"
}
] |
144 | {
"selfies": [
"[C][C][O][C][C]",
"[C][N][Branch1][C][C][C][=O]",
"[C][N][Branch1][C][C][C][C][Cl]",
"[C][O-1]",
"[Cl]",
"[O][C][=C][C][=C][C][Branch1][=C][C][=N][C][=N][C][=C][C][=C][Ring1][=Branch1][O][Ring1][=Branch2][=C][Ring1][#C]",
"[Na+1]",
"[C][N][Branch1][C][C][C][C][O][C][=C][C][=C][C][Branch1][=C][C][=N][C][=N][C][=C][C][=C][Ring1][=Branch1][O][Ring1][=Branch2][=C][Ring1][#C]"
],
"smiles": [
"CCOCC",
"CN(C)C=O",
"CN(C)CCCl",
"C[O-]",
"Cl",
"Oc1cccc(-c2nc3ncccc3o2)c1",
"[Na+]",
"CN(C)CCOc1cccc(-c2nc3ncccc3o2)c1"
]
} | 74 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key structural motifs in the reactants and products that are indicative of a particular reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "74",
"role": "assistant"
}
] |
145 | {
"selfies": [
"[Br][C][=C][C][=C][C][Branch1][=Branch2][N][C][C][N][C][C][Ring1][=Branch1][=C][Ring1][N]",
"[C][C][O][C][=Branch1][C][=O][N][C][=N][C][=C][C][Branch1][C][C][=C][Branch1][C][C][C][=C][Ring1][Branch2][N][=C][Ring1][N][O][C]",
"[C][O][C][=N][C][=C][C][Branch1][C][C][=C][Branch1][C][C][C][=C][Ring1][Branch2][N][=C][Ring1][N][N][C][=Branch1][C][=O][N][C][C][N][Branch1][N][C][=C][C][=C][C][Branch1][C][Br][=C][Ring1][#Branch1][C][C][Ring1][=N]"
],
"smiles": [
"Brc1cccc(N2CCNCC2)c1",
"CCOC(=O)Nc1nc2cc(C)c(C)cc2nc1OC",
"COc1nc2cc(C)c(C)cc2nc1NC(=O)N1CCN(c2cccc(Br)c2)CC1"
]
} | 613 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction by recognizing the specific type of bond formation or cleavage occurring during the transformation.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "613",
"role": "assistant"
}
] |
146 | {
"selfies": [
"[Br][C][C][C][C][Br]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O]",
"[O][C][C][C][C][Ring1][Ring1]",
"[H-1]",
"[Na+1]",
"[Br][C][C][C][C][O][C][C][C][C][Ring1][Ring1]"
],
"smiles": [
"BrCCCCBr",
"Cc1ccccc1",
"O",
"OCC1CC1",
"[H-]",
"[Na+]",
"BrCCCCOCC1CC1"
]
} | 95 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the presence of specific catalysts or reagents, assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "95",
"role": "assistant"
}
] |
147 | {
"selfies": [
"[C][N][Branch1][C][C][C][=O]",
"[N][#C][C][Br]",
"[O]",
"[O][=C][Branch1][C][O-1][O-1]",
"[O][=C][C][=C][C][=C][C][Branch1][O][S][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring1][=C][N][Ring2][Ring1][C][C][=C][C][Branch1][C][F][=C][Branch1][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][C][=C][Ring1][=C][O]",
"[K+1]",
"[K+1]",
"[N][#C][C][O][C][=C][C][Branch1][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][=C][Branch1][C][F][C][=C][Ring1][=C][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][O][S][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring1][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CN(C)C=O",
"N#CCBr",
"O",
"O=C([O-])[O-]",
"O=c1ccc2cc(SCc3ccccc3)ccc2n1-c1cc(F)c(-c2cccc(F)c2)cc1O",
"[K+]",
"[K+]",
"N#CCOc1cc(-c2cccc(F)c2)c(F)cc1-n1c(=O)ccc2cc(SCc3ccccc3)ccc21"
]
} | 802 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the stereochemical changes in the reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "802",
"role": "assistant"
}
] |
148 | {
"selfies": [
"[C][C][O][C][C]",
"[C][N][Branch1][C][C][C][=O]",
"[C][C][=C][C][=N][C][Branch1][C][S][=N][Ring1][#Branch1]",
"[Cl]",
"[Cl][C][=C][C][=C][Branch1][C][Cl][C][Branch1][Ring1][C][Br][=C][Ring1][=Branch2][Cl]",
"[O][=C][Branch1][C][O-1][O-1]",
"[K+1]",
"[K+1]",
"[C][C][=C][C][=N][C][Branch2][Ring1][C][S][C][C][=C][Branch1][C][Cl][C][=C][C][Branch1][C][Cl][=C][Ring1][Branch2][Cl][=N][Ring1][P]"
],
"smiles": [
"CCOCC",
"CN(C)C=O",
"Cc1ccnc(S)n1",
"Cl",
"Clc1ccc(Cl)c(CBr)c1Cl",
"O=C([O-])[O-]",
"[K+]",
"[K+]",
"Cc1ccnc(SCc2c(Cl)ccc(Cl)c2Cl)n1"
]
} | 699 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the main reaction type (e.g., substitution, addition, elimination) and use it to classify the reaction into a specific template class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "699",
"role": "assistant"
}
] |
149 | {
"selfies": [
"[C][N][Branch1][C][C][C][C][=Branch1][C][=O][O]",
"[C][C][=C][C][=C][N][C][=C][Branch2][Ring2][O][C][=C][C][=C][Branch2][Ring1][#C][C][C][Branch1][Ring1][C][N][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#Branch1][O][C][Branch1][C][C][C][C][Branch1][C][Cl][=C][Ring1][O][C][=C][Ring2][Ring1][Branch2][N][=C][Ring2][Ring1][P][Ring2][Ring1][=N]",
"[C][C][=C][C][=C][N][C][=C][Branch2][Branch1][Branch1][C][=C][C][=C][Branch2][Ring2][=Branch2][C][C][Branch1][=N][C][N][C][=Branch1][C][=O][C][N][Branch1][C][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][#Branch1][O][C][Branch1][C][C][C][C][Branch1][C][Cl][=C][Ring1][O][C][=C][Ring2][Ring1][=C][N][=C][Ring2][Ring2][#Branch1][Ring2][Ring2][Ring1]"
],
"smiles": [
"CN(C)CC(=O)O",
"Cc1cccn2cc(-c3ccc(CC(CN)NC(=O)c4ccc(OC(C)C)c(Cl)c4)cc3)nc12",
"Cc1cccn2cc(-c3ccc(CC(CNC(=O)CN(C)C)NC(=O)c4ccc(OC(C)C)c(Cl)c4)cc3)nc12"
]
} | 230 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the type of heteroatoms involved in the reaction, predict the most likely reaction class from the predefined set.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "230",
"role": "assistant"
}
] |
150 | {
"selfies": [
"[C][C][=Branch1][C][=O][O]",
"[C][C][O]",
"[C][C][C][=N][N][C][Branch2][Ring1][C][C][=C][Branch1][Ring1][O][C][C][=C][Branch1][C][C][C][=C][Ring1][=Branch2][O][C][=C][C][=C][C][Ring1][P][=C][Ring2][Ring1][Ring2][N+1][=Branch1][C][=O][O-1]",
"[O]",
"[Zn]",
"[C][C][C][=N][N][C][Branch2][Ring1][C][C][=C][Branch1][Ring1][O][C][C][=C][Branch1][C][C][C][=C][Ring1][=Branch2][O][C][=C][C][=C][C][Ring1][P][=C][Ring2][Ring1][Ring2][N]"
],
"smiles": [
"CC(=O)O",
"CCO",
"CCc1nn2c(-c3c(OC)cc(C)cc3OC)cccc2c1[N+](=O)[O-]",
"O",
"[Zn]",
"CCc1nn2c(-c3c(OC)cc(C)cc3OC)cccc2c1N"
]
} | 628 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given a chemical reaction, classify it into one of the predefined reaction classes from the USPTO 1K TPL dataset.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "628",
"role": "assistant"
}
] |
151 | {
"selfies": [
"[Br][C][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1]",
"[C][C][O]",
"[C][C][O][C][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1]"
],
"smiles": [
"BrCc1ccc(Br)cc1",
"CCO",
"CCOCc1ccc(Br)cc1"
]
} | 464 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reactants and products, predict the most likely reaction class that describes the transformation.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "464",
"role": "assistant"
}
] |
152 | {
"selfies": [
"[C][C][O][C][C]",
"[N][C][C][C][C][=Branch1][C][=O][O]",
"[O][=C][Branch1][C][Cl][O][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]",
"[Na+1]",
"[OH1-1]",
"[O][=C][Branch1][C][O][C][C][C][N][C][=Branch1][C][=O][O][C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]"
],
"smiles": [
"CCOCC",
"NCCCC(=O)O",
"O=C(Cl)OCc1ccc([N+](=O)[O-])cc1",
"[Na+]",
"[OH-]",
"O=C(O)CCCNC(=O)OCc1ccc([N+](=O)[O-])cc1"
]
} | 479 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the structural changes between the reactants and products, and assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "479",
"role": "assistant"
}
] |
153 | {
"selfies": [
"[C][C][C][C][=C][Branch1][N][O][C][C][C][C][C][C][=Branch1][C][=O][O][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][Ring2][Ring1][C][O]",
"[N][C][C][C][C][C][=C][C][=C][C][=N][Ring1][=Branch1]",
"[C][C][C][C][=C][Branch2][Ring1][Branch2][O][C][C][C][C][C][C][=Branch1][C][=O][N][C][C][C][C][C][=C][C][=C][C][=N][Ring1][=Branch1][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][=O][=C][Ring2][Ring1][N][O]"
],
"smiles": [
"CCCc1c(OCCCCCC(=O)O)ccc(C(C)=O)c1O",
"NCCCCc1ccccn1",
"CCCc1c(OCCCCCC(=O)NCCCCc2ccccn2)ccc(C(C)=O)c1O"
]
} | 230 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key reactive sites in the given reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "230",
"role": "assistant"
}
] |
154 | {
"selfies": [
"[C][C][N][C][C][N][Ring1][=Branch1]",
"[C][S][Branch1][C][C][=O]",
"[C][S][C][=N][C][=N][C][=C][Branch1][=C][N][Branch1][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][=C][Branch1][C][Cl][N][=C][Ring2][Ring1][Ring2][Ring1][S]",
"[C][S][C][=N][C][=N][C][=C][Branch1][=C][N][Branch1][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][=C][Branch1][=Branch2][N][C][C][N][C][C][Ring1][=Branch1][N][=C][Ring2][Ring1][=Branch2][Ring2][Ring1][Branch1]"
],
"smiles": [
"C1CNCCN1",
"CS(C)=O",
"CSc1ncnc2c(N(C)Cc3ccccc3)nc(Cl)nc12",
"CSc1ncnc2c(N(C)Cc3ccccc3)nc(N3CCNCC3)nc12"
]
} | 36 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction into one of the template classes by recognizing the characteristic patterns of atom rearrangements.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "36",
"role": "assistant"
}
] |
155 | {
"selfies": [
"[C][C][C][C][Branch1][Branch2][C][C][=Branch1][C][=O][O][C][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]",
"[C][O][C][=C][C][=C][Branch1][C][F][C][Branch2][Ring1][Branch1][C][=C][C][Branch1][Ring1][C][Cl][=C][C][=C][Ring1][Branch2][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][Ring1]",
"[C][C][C][C][Branch1][Branch2][C][C][=Branch1][C][=O][O][C][C][=C][C][=C][Branch2][Ring2][Branch1][O][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][Branch1][=C][C][=C][C][Branch1][Ring1][O][C][=C][C][=C][Ring1][Branch2][F][=C][Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][O]"
],
"smiles": [
"CCCC(CC(=O)OC)c1ccc(O)cc1",
"COc1ccc(F)c(-c2cc(CCl)ccc2C(C)(C)C)c1",
"CCCC(CC(=O)OC)c1ccc(OCc2ccc(C(C)(C)C)c(-c3cc(OC)ccc3F)c2)cc1"
]
} | 49 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Determine the reaction class based on the specific combination of reactants, reagents, and products present.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "49",
"role": "assistant"
}
] |
156 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch2][Ring1][=C][C][Branch1][=C][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][=Branch2]",
"[Cl][C][Cl]",
"[O][=C][Branch1][C][O][C][Branch1][C][F][Branch1][C][F][F]",
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch2][Ring1][=C][C][Branch1][=C][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CC(C)(C)OC(=O)c1ccc(C(C(=O)Nc2ccccc2)C(=O)Nc2ccccc2)cc1",
"ClCCl",
"O=C(O)C(F)(F)F",
"O=C(O)c1ccc(C(C(=O)Nc2ccccc2)C(=O)Nc2ccccc2)cc1"
]
} | 752 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Assign the reaction to one of the classes by identifying the main functional group transformations occurring in the reaction.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "752",
"role": "assistant"
}
] |
157 | {
"selfies": [
"[C][C][O]",
"[C][C][O][C][=Branch1][C][=O][C][C][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][N][Branch1][#Branch1][C][C][C][C][Ring1][Ring2][C][C][Ring1][N]",
"[Na+1]",
"[OH1-1]",
"[O][=C][Branch1][C][O][C][C][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][N][Branch1][#Branch1][C][C][C][C][Ring1][Ring2][C][C][Ring1][N]"
],
"smiles": [
"CCO",
"CCOC(=O)CCCOc1ccc2c(c1)CCN(C1CCC1)CC2",
"[Na+]",
"[OH-]",
"O=C(O)CCCOc1ccc2c(c1)CCN(C1CCC1)CC2"
]
} | 7 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reaction's atom-mapping, predict the reaction class that best represents the chemical transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "7",
"role": "assistant"
}
] |
158 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][C][Branch1][C][F][Branch1][C][F][F]",
"[Cl][C][Branch1][C][Cl][Branch1][C][Cl][Cl]",
"[O]",
"[O][=C][Branch1][#C][O][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[N][#C][C][=C][C][=C][Branch1][Ring1][C][Br][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][N]"
],
"smiles": [
"Cc1ccc(C#N)cc1C(F)(F)F",
"ClC(Cl)(Cl)Cl",
"O",
"O=C(OOC(=O)c1ccccc1)c1ccccc1",
"O=C1CCC(=O)N1Br",
"N#Cc1ccc(CBr)c(C(F)(F)F)c1"
]
} | 29 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the reaction mechanism and use it to classify the reaction into one of the predefined template classes.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "29",
"role": "assistant"
}
] |
159 | {
"selfies": [
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[C][C][Branch1][C][C][O][B][Branch1][=C][C][=C][C][=C][O][C][=C][C][Ring1][Branch1][=C][Ring1][=Branch2][O][C][Ring1][#C][Branch1][C][C][C]",
"[C][C][N][C][C][Branch2][Ring1][=N][C][C][N][Branch2][Ring1][Ring1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Br][C][=C][Ring1][#Branch1][C][C][Ring1][S][O][C][C][Ring2][Ring1][Branch1][=O]",
"[C][O]",
"[Cl][C][Cl]",
"[Cl][Pd][Cl]",
"[O][=C][Branch1][C][O-1][O-1]",
"[Fe+2]",
"[K+1]",
"[K+1]",
"[C][=C][C][=C][Branch2][Ring1][Ring1][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C-1][C][=C][C][=C][Ring1][Branch1][C][=C][Ring2][Ring1][C]",
"[C][=C][C][=C][Branch2][Ring1][Ring1][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C-1][C][=C][C][=C][Ring1][Branch1][C][=C][Ring2][Ring1][C]",
"[C][C][N][C][C][Branch2][Ring2][#Branch2][C][C][N][Branch2][Ring1][#C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=C][C][=C][C][=C][O][C][=C][C][Ring1][Branch1][=C][Ring1][=Branch2][C][=C][Ring1][#C][C][C][Ring2][Ring1][Branch2][O][C][C][Ring2][Ring1][=N][=O]"
],
"smiles": [
"C1COCCO1",
"CC1(C)OB(c2ccc3occc3c2)OC1(C)C",
"CCN1CC2(CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)OCC1=O",
"CO",
"ClCCl",
"Cl[Pd]Cl",
"O=C([O-])[O-]",
"[Fe+2]",
"[K+]",
"[K+]",
"c1ccc(P(c2ccccc2)[c-]2cccc2)cc1",
"c1ccc(P(c2ccccc2)[c-]2cccc2)cc1",
"CCN1CC2(CCN(S(=O)(=O)c3ccc(-c4ccc5occc5c4)cc3)CC2)OCC1=O"
]
} | 933 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key structural motifs in the reactants and products that are indicative of a particular reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "933",
"role": "assistant"
}
] |
160 | {
"selfies": [
"[C][O][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1][Cl]",
"[Cl]",
"[Cl][C][Cl]",
"[O][=C][Branch1][C][Cl][C][C][C][C][C][Br]",
"[Al+3]",
"[Cl-1]",
"[Cl-1]",
"[Cl-1]",
"[C][O][C][=C][C][=C][Branch1][O][C][=Branch1][C][=O][C][C][C][C][C][Br][C][Branch1][C][Cl][=C][Ring1][#C][Cl]"
],
"smiles": [
"COc1cccc(Cl)c1Cl",
"Cl",
"ClCCl",
"O=C(Cl)CCCCCBr",
"[Al+3]",
"[Cl-]",
"[Cl-]",
"[Cl-]",
"COc1ccc(C(=O)CCCCCBr)c(Cl)c1Cl"
]
} | 31 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction by recognizing the specific type of bond formation or cleavage occurring during the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "31",
"role": "assistant"
}
] |
161 | {
"selfies": [
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]",
"[C][C][=C][C][=C][C][Branch2][Ring1][=Branch2][C][O][C][=N][C][=Ring1][Branch1][C][=Branch1][C][=O][N][C][C][=N][N][Branch1][Ring2][C][C][O][C][=Ring1][Branch2][=C][Ring2][Ring1][=Branch1]",
"[Cl][C][Cl]",
"[C][C][=C][C][=C][Branch2][Ring2][=N][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][N][C][=C][Branch2][Ring1][Branch2][N][C][=Branch1][C][=O][C][N][=C][O][C][=Ring1][Branch1][C][=C][C][=C][C][Branch1][C][C][=C][Ring1][#Branch1][C][=N][Ring2][Ring1][Ring2][C][=C][Ring2][Ring1][S]"
],
"smiles": [
"CCN(CC)CC",
"Cc1ccc(S(=O)(=O)Cl)cc1",
"Cc1cccc(-c2ocnc2C(=O)Nc2cnn(CCO)c2)c1",
"ClCCl",
"Cc1ccc(S(=O)(=O)OCCn2cc(NC(=O)c3ncoc3-c3cccc(C)c3)cn2)cc1"
]
} | 197 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the presence of specific catalysts or reagents, assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "197",
"role": "assistant"
}
] |
162 | {
"selfies": [
"[C][C][C][C][Branch1][C][N][=N][O]",
"[C][C][C][=C][C][=C][Branch2][Ring1][=N][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][N][Branch1][N][C][=Branch1][C][=O][C][C][C][C][C][Ring1][Branch1][C][Ring1][S][C][=C][Ring2][Ring1][=Branch1]",
"[C][C][C][C][=N][O][C][Branch2][Ring2][Branch1][C][C][C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][C][C][C][=C][Ring1][Branch2][C][N][Branch1][N][C][=Branch1][C][=O][C][C][C][C][C][Ring1][Branch1][C][Ring2][Ring1][Branch1][=N][Ring2][Ring1][#Branch2]"
],
"smiles": [
"CCCC(N)=NO",
"CCc1ccc(C2CC(C(=O)O)CN(C(=O)C3CCCC3)C2)cc1",
"CCCc1noc(C2CC(c3ccc(CC)cc3)CN(C(=O)C3CCCC3)C2)n1"
]
} | 728 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the stereochemical changes in the reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "728",
"role": "assistant"
}
] |
163 | {
"selfies": [
"[C][C][O]",
"[C][O][C][=Branch1][C][=O][C][C][S][C][C][C][Ring1][=Branch1][O][C][C][O][Ring1][Branch1]",
"[K+1]",
"[OH1-1]",
"[O][=C][Branch1][C][O][C][C][S][C][C][C][Ring1][=Branch1][O][C][C][O][Ring1][Branch1]"
],
"smiles": [
"CCO",
"COC(=O)C1CSCCC12OCCO2",
"[K+]",
"[OH-]",
"O=C(O)C1CSCCC12OCCO2"
]
} | 88 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the main reaction type (e.g., substitution, addition, elimination) and use it to classify the reaction into a specific template class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "88",
"role": "assistant"
}
] |
164 | {
"selfies": [
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[C][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring1][O][C][C][N][Branch1][=C][C][=N][C][=N][C][NH1][C][=C][C][Ring1][=Branch2][=Ring1][Branch1][C][Ring1][=C]",
"[C][O]",
"[Cl]",
"[Cl][C][Branch1][C][Cl][Cl]",
"[C][C][C][N][C][Ring1][Ring2][C][C][N][Branch1][=C][C][=N][C][=N][C][NH1][C][=C][C][Ring1][=Branch2][=Ring1][Branch1][C][Ring1][=C]"
],
"smiles": [
"C1COCCO1",
"CC1CN(C(=O)OC(C)(C)C)C12CCN(c1ncnc3[nH]ccc13)C2",
"CO",
"Cl",
"ClC(Cl)Cl",
"CC1CNC12CCN(c1ncnc3[nH]ccc13)C2"
]
} | 575 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the type of heteroatoms involved in the reaction, predict the most likely reaction class from the predefined set.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "575",
"role": "assistant"
}
] |
165 | {
"selfies": [
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[C][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][C][N][C][C][N][Branch1][O][C][C][N][C][C][C][C][C][Ring1][=Branch1][C][Ring1][=N][=C][Branch1][Ring1][C][#N][C][#N]",
"[N][C][C][C][C][C][C][Ring1][=Branch1]",
"[O]",
"[I-1]",
"[K+1]",
"[N][#C][C][Branch1][Ring1][C][#N][=C][N][Branch1][=N][C][C][C][N][C][C][C][C][C][C][Ring1][=Branch1][C][C][N][Ring1][#C][C][C][N][C][C][C][C][C][Ring1][=Branch1]"
],
"smiles": [
"C1COCCO1",
"CS(=O)(=O)OCCCN1CCN(CCN2CCCCC2)C1=C(C#N)C#N",
"NC1CCCCC1",
"O",
"[I-]",
"[K+]",
"N#CC(C#N)=C1N(CCCNC2CCCCC2)CCN1CCN1CCCCC1"
]
} | 559 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given a chemical reaction, classify it into one of the predefined reaction classes from the USPTO 1K TPL dataset.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "559",
"role": "assistant"
}
] |
166 | {
"selfies": [
"[C][C][C][Branch1][C][C][=O]",
"[C][C][O]",
"[N][N][C][C][=C][NH1][C][=Branch1][C][=O][C][=Ring1][#Branch1]",
"[C][C][C][Branch1][C][C][=N][N][C][C][=C][NH1][C][=Branch1][C][=O][C][=Ring1][#Branch1]"
],
"smiles": [
"CCC(C)=O",
"CCO",
"NNc1cc[nH]c(=O)c1",
"CCC(C)=NNc1cc[nH]c(=O)c1"
]
} | 285 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reactants and products, predict the most likely reaction class that describes the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "285",
"role": "assistant"
}
] |
167 | {
"selfies": [
"[C][C][O]",
"[C][C][O][C][=Branch1][C][=O][C][O][C][=C][C][=N][C][=C][Ring1][=Branch1][C][=Ring1][=Branch2][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][F]",
"[Cl]",
"[Fe]",
"[C][C][O][C][=Branch1][C][=O][C][O][C][=C][C][=N][C][=C][Ring1][=Branch1][C][=Ring1][=Branch2][O][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][F]"
],
"smiles": [
"CCO",
"CCOC(=O)c1oc2ccncc2c1Oc1ccc([N+](=O)[O-])cc1F",
"Cl",
"[Fe]",
"CCOC(=O)c1oc2ccncc2c1Oc1ccc(N)cc1F"
]
} | 335 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the structural changes between the reactants and products, and assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "335",
"role": "assistant"
}
] |
168 | {
"selfies": [
"[C][C][#N]",
"[C][C][Branch1][C][C][O][C][C][=C][C][Branch1][S][C][Branch1][C][O][C][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring1][P][O][Ring2][Ring1][=Branch1]",
"[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]",
"[C][C][O][C][C]",
"[N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=N][C][C][C][O][C][C][C][C][C][C][C][Br][=C][Ring2][Ring1][C]",
"[O]",
"[C][C][Branch1][C][C][O][C][C][=C][C][Branch2][Ring2][S][C][Branch1][C][O][C][N][Branch2][Ring1][=C][C][C][C][C][C][C][C][O][C][C][C][C][=C][C][=C][C][Branch1][=Branch2][S][Branch1][C][N][=Branch1][C][=O][=O][=C][Ring1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][=C][Ring2][Ring2][=Branch1][O][Ring2][Ring2][O]"
],
"smiles": [
"CC#N",
"CC1(C)OCc2cc(C(O)CNCc3ccccc3)ccc2O1",
"CCN(C(C)C)C(C)C",
"CCOCC",
"NS(=O)(=O)c1cccc(CCCOCCCCCCCBr)c1",
"O",
"CC1(C)OCc2cc(C(O)CN(CCCCCCCOCCCc3cccc(S(N)(=O)=O)c3)Cc3ccccc3)ccc2O1"
]
} | 722 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key reactive sites in the given reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "722",
"role": "assistant"
}
] |
169 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][Branch1][C][C][C]",
"[C][O][C][=C][C][=C][C][Branch2][Ring2][N][O][C][=C][Branch2][Ring1][O][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][N][=C][N][=C][Ring2][Ring1][Ring2][O][C][C][O][=C][Ring2][Ring1][#C]",
"[Cl][C][=N][C][=C][Branch1][C][Br][C][=N][Ring1][#Branch1]",
"[Cl-1]",
"[H-1]",
"[NH4+1]",
"[Na+1]",
"[C][O][C][=C][C][=C][C][Branch2][Branch1][#Branch1][O][C][=C][Branch2][Ring1][O][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][N][=C][N][=C][Ring2][Ring1][Ring2][O][C][C][O][C][=N][C][=C][Branch1][C][Br][C][=N][Ring1][#Branch1][=C][Ring2][Ring2][=Branch1]"
],
"smiles": [
"CC(=O)N(C)C",
"COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCO)c1",
"Clc1ncc(Br)cn1",
"[Cl-]",
"[H-]",
"[NH4+]",
"[Na+]",
"COc1cccc(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOc2ncc(Br)cn2)c1"
]
} | 37 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction into one of the template classes by recognizing the characteristic patterns of atom rearrangements.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "37",
"role": "assistant"
}
] |
170 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][C][C][N][C][C][Ring1][=Branch1]",
"[Cl][C][Cl]",
"[O]",
"[O][=C][Branch1][C][O-1][O]",
"[O][C][C][C][Br]",
"[Cl-1]",
"[Na+1]",
"[Na+1]",
"[C][C][=Branch1][C][=O][N][C][C][N][Branch1][Branch1][C][C][C][O][C][C][Ring1][#Branch2]"
],
"smiles": [
"CC(=O)N1CCNCC1",
"ClCCl",
"O",
"O=C([O-])O",
"OCCCBr",
"[Cl-]",
"[Na+]",
"[Na+]",
"CC(=O)N1CCN(CCCO)CC1"
]
} | 73 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Determine the reaction class based on the specific combination of reactants, reagents, and products present.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "73",
"role": "assistant"
}
] |
171 | {
"selfies": [
"[Cl][C][Cl]",
"[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][Br]",
"[O][C][C][C][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#Branch2]",
"[C][=C][C][=C][Branch2][Ring1][Ring2][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring2][Ring1][Ring1]",
"[Br][C][C][C][C][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#Branch2]"
],
"smiles": [
"ClCCl",
"O=C1CCC(=O)N1Br",
"OCCCC1CCCc2ccccc21",
"c1ccc(P(c2ccccc2)c2ccccc2)cc1",
"BrCCCC1CCCc2ccccc21"
]
} | 581 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Assign the reaction to one of the classes by identifying the main functional group transformations occurring in the reaction.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "581",
"role": "assistant"
}
] |
172 | {
"selfies": [
"[C][C][#N]",
"[C][C][Branch1][C][C][N]",
"[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][N][Branch1][C][C][C][Branch1][#C][O][N][N][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2][=N+1][Branch1][C][C][C]",
"[C][N][Branch1][C][C][C][C][N][N][=C][Branch2][Ring2][Ring1][C][=C][N][=C][C][=Branch1][Ring2][=N][Ring1][=Branch1][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][N][Ring1][=Branch2][C][O][C][C][Si][Branch1][C][C][Branch1][C][C][C][C][=C][Branch1][C][F][C][=C][Branch1][C][Cl][C][=C][Ring1][Branch2][Ring2][Ring1][#C]",
"[F][B-1][Branch1][C][F][Branch1][C][F][F]",
"[O]",
"[C][C][Branch1][C][C][N][C][=Branch1][C][=O][C][=C][N][Branch1][=N][C][O][C][C][Si][Branch1][C][C][Branch1][C][C][C][C][=N][C][=C][Branch2][Ring1][=N][C][=N][N][Branch1][Branch2][C][C][N][Branch1][C][C][C][C][=C][C][Branch1][C][Cl][=C][C][Branch1][C][F][=C][Ring1][S][Ring1][Branch2][N][=C][Ring2][Ring1][P][Ring2][Ring1][=Branch1]"
],
"smiles": [
"CC#N",
"CC(C)N",
"CCN(C(C)C)C(C)C",
"CCOC(C)=O",
"CN(C)C(On1nnc2ccccc21)=[N+](C)C",
"CN(C)CCn1nc(-c2cnc3c(n2)c(C(=O)O)cn3COCC[Si](C)(C)C)c2c(F)cc(Cl)cc21",
"F[B-](F)(F)F",
"O",
"CC(C)NC(=O)c1cn(COCC[Si](C)(C)C)c2ncc(-c3nn(CCN(C)C)c4cc(Cl)cc(F)c34)nc12"
]
} | 737 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reaction's atom-mapping, predict the reaction class that best represents the chemical transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "737",
"role": "assistant"
}
] |
173 | {
"selfies": [
"[C][C][Branch2][Ring2][=C][N][C][=N][C][Branch1][S][N][C][C][=C][Branch1][=Branch1][C][C][C][Ring1][Ring1][NH1][N][=Ring1][Branch2][=C][Branch1][C][F][C][=C][Ring1][S][C][N][C][=Branch1][C][=O][C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CCN(C(C)C)C(C)C",
"CN(C)C(On1nnc2ccccc21)=[N+](C)C",
"CN(C)C=O",
"CC(Nc1nc(Nc2cc(C3CC3)[nH]n2)c(F)cc1CN)c1ccc(F)cc1",
"ClCCl",
"F[P-](F)(F)(F)(F)F",
"O=C1CCC(C(=O)O)N1",
"CC(Nc1nc(Nc2cc(C3CC3)[nH]n2)c(F)cc1CNC(=O)C1CCC(=O)N1)c1ccc(F)cc1"
]
} | 216 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the reaction mechanism and use it to classify the reaction into one of the predefined template classes.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "216",
"role": "assistant"
}
] |
174 | {
"selfies": [
"[C][#C][C][Branch1][C][O][C][C][C][C][Ring1][=Branch1][F]",
"[N][C][=Branch1][C][=O][C][C][=C][N][Branch1][Ring2][N][=Ring1][Branch1][C][=C][C][Branch1][C][I][=C][C][=C][Ring1][#Branch1][O][C][C][Ring1][=N]",
"[N][C][=Branch1][C][=O][C][C][=C][N][Branch1][Ring2][N][=Ring1][Branch1][C][=C][C][Branch1][=C][C][#C][C][Branch1][C][O][C][C][C][C][Ring1][=Branch1][F][=C][C][=C][Ring1][#C][O][C][C][Ring2][Ring1][Branch1]"
],
"smiles": [
"C#CC1(O)CCCC1F",
"NC(=O)c1cc2n(n1)-c1cc(I)ccc1OCC2",
"NC(=O)c1cc2n(n1)-c1cc(C#CC3(O)CCCC3F)ccc1OCC2"
]
} | 664 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key structural motifs in the reactants and products that are indicative of a particular reaction class.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "664",
"role": "assistant"
}
] |
175 | {
"selfies": [
"[C][C][Branch1][C][C][Branch2][Ring1][C][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][N][C][=C][Branch1][S][C][=Branch1][C][=O][C][=C][N][=C][C][Branch1][C][N][=C][Ring1][#Branch1][C][=C][N][=C][N][=C][Ring1][=Branch1][Ring2][Ring1][C]",
"[C][C][N][Branch1][=Branch1][C][Branch1][C][C][C][C][Branch1][C][C][C]",
"[O][=C][Branch1][C][O][C][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2]",
"[C][C][Branch1][C][C][Branch2][Ring1][C][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][N][C][=C][Branch2][Ring2][=Branch2][C][=Branch1][C][=O][C][=C][N][=C][C][Branch2][Ring1][=Branch2][N][C][=Branch1][C][=O][C][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][=C][Ring2][Ring1][Ring2][C][=C][N][=C][N][=C][Ring1][=Branch1][Ring2][Ring1][#C]"
],
"smiles": [
"CC(C)(CO[Si](C)(C)C(C)(C)C)n1cc(C(=O)c2cncc(N)c2)c2cncnc21",
"CCN(C(C)C)C(C)C",
"O=C(O)Cc1cccc(C(F)(F)F)c1",
"CC(C)(CO[Si](C)(C)C(C)(C)C)n1cc(C(=O)c2cncc(NC(=O)Cc3cccc(C(F)(F)F)c3)c2)c2cncnc21"
]
} | 724 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction by recognizing the specific type of bond formation or cleavage occurring during the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "724",
"role": "assistant"
}
] |
176 | {
"selfies": [
"[Cl][C][Cl]",
"[F][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][C][O][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]",
"[O][=S][Branch1][C][Cl][Cl]",
"[Al+3]",
"[Cl-1]",
"[Cl-1]",
"[Cl-1]",
"[O][=C][Branch1][=N][C][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1]"
],
"smiles": [
"ClCCl",
"Fc1ccccc1",
"O=C(O)Cc1ccc(F)cc1",
"O=S(Cl)Cl",
"[Al+3]",
"[Cl-]",
"[Cl-]",
"[Cl-]",
"O=C(Cc1ccc(F)cc1)c1ccc(F)cc1"
]
} | 435 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the presence of specific catalysts or reagents, assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "435",
"role": "assistant"
}
] |
177 | {
"selfies": [
"[Cl][C][Cl]",
"[N][C][Branch1][Ring1][C][O][C][C][=C][C][=C][Branch1][C][I][C][=C][Ring1][#Branch1]",
"[O][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][C][C][Branch1][=N][C][C][=C][C][=C][Branch1][C][I][C][=C][Ring1][#Branch1][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"ClCCl",
"NC(CO)Cc1ccc(I)cc1",
"O=Cc1ccccc1",
"OCC(Cc1ccc(I)cc1)NCc1ccccc1"
]
} | 468 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the stereochemical changes in the reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "468",
"role": "assistant"
}
] |
178 | {
"selfies": [
"[C][C][C][O][C][Ring1][Branch1]",
"[C][C][O][C][=Branch1][C][=O][C][N][=C][N][C][=Ring1][Branch1][C][N][Branch1][C][C][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=N]",
"[Cl]",
"[N]",
"[O]",
"[BH4-1]",
"[Li+1]",
"[C][N][C][C][=C][Branch1][Ring1][C][O][N][=C][N][Ring1][#Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][S][=O]"
],
"smiles": [
"C1CCOC1",
"CCOC(=O)c1ncn2c1CN(C)C(=O)c1ccccc1-2",
"Cl",
"N",
"O",
"[BH4-]",
"[Li+]",
"CN1Cc2c(CO)ncn2-c2ccccc2C1=O"
]
} | 286 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the main reaction type (e.g., substitution, addition, elimination) and use it to classify the reaction into a specific template class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "286",
"role": "assistant"
}
] |
179 | {
"selfies": [
"[C][C][O][C][C][O][Ring1][=Branch1]",
"[C][C][N][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][Branch2][Ring2][Branch2][N][C][C][N][Branch1][C][C][C][Branch2][Ring1][=Branch2][C][C][=C][N][Branch1][S][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Ring1][=C][C][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][N][Ring2][Ring2][Ring2]",
"[Na+1]",
"[OH1-1]",
"[C][C][N][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=Branch1][C][=O][C][=C][C][Branch1][C][F][=C][Branch2][Ring1][Branch1][N][C][C][N][Branch1][C][C][C][Branch1][Branch2][C][C][=C][NH1][C][=Ring1][Branch1][C][Ring1][N][C][=C][Ring2][Ring1][Ring1][Ring2][Ring1][O]"
],
"smiles": [
"C1COCCO1",
"CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C)C(c4ccn(S(=O)(=O)c5ccccc5)c4)C3)cc21",
"[Na+]",
"[OH-]",
"CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(C)C(c4cc[nH]c4)C3)cc21"
]
} | 771 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the type of heteroatoms involved in the reaction, predict the most likely reaction class from the predefined set.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "771",
"role": "assistant"
}
] |
180 | {
"selfies": [
"[C][C][=C][Branch1][=Branch1][C][Branch1][C][N][=O][N][Branch1][C][C][C][=C][Branch1][C][Br][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][S][Ring1][=Branch2]",
"[O][B][Branch1][C][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2]",
"[C][C][=C][Branch1][=Branch1][C][Branch1][C][N][=O][N][Branch1][C][C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][C][=C][Branch1][Ring1][C][#N][C][=C][Ring2][Ring1][=Branch2][Ring2][Ring1][C]"
],
"smiles": [
"Cc1c(C(N)=O)n(C)c2c(Br)cc(C#N)cc12",
"OB(O)c1ccc(C(F)(F)F)cc1",
"Cc1c(C(N)=O)n(C)c2c(-c3ccc(C(F)(F)F)cc3)cc(C#N)cc12"
]
} | 833 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given a chemical reaction, classify it into one of the predefined reaction classes from the USPTO 1K TPL dataset.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "833",
"role": "assistant"
}
] |
181 | {
"selfies": [
"[C][N][Branch1][C][C][C][=O]",
"[C][S][C][=N][N][=C][Branch1][P][C][=C][C][=C][NH1][C][=C][Branch1][C][I][C][Ring1][=Branch1][=C][Ring1][#Branch2][S][Ring1][#C]",
"[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][Cl][C][=C][Ring1][#Branch2]",
"[H-1]",
"[Na+1]",
"[C][S][C][=N][N][=C][Branch2][Ring2][Branch1][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][Branch1][C][I][=C][N][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1][S][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CN(C)C=O",
"CSc1nnc(-c2ccc3[nH]cc(I)c3c2)s1",
"Cc1ccc(S(=O)(=O)Cl)cc1",
"[H-]",
"[Na+]",
"CSc1nnc(-c2ccc3c(c2)c(I)cn3S(=O)(=O)c2ccc(C)cc2)s1"
]
} | 648 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reactants and products, predict the most likely reaction class that describes the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "648",
"role": "assistant"
}
] |
182 | {
"selfies": [
"[C][#C][C][Branch1][C][O][C][C][C][N][Branch1][C][C][C][Ring1][Branch2][=O]",
"[N][C][=Branch1][C][=O][C][=N][C][=C][Branch1][Ring2][S][Ring1][Branch1][C][C][O][C][=C][C][Branch1][C][F][=C][Branch1][C][Br][C][=C][Ring1][Branch2][Ring1][=C]",
"[C][N][C][C][C][C][Branch1][C][O][Branch2][Ring1][P][C][#C][C][=C][C][=C][Branch1][=Branch1][C][=C][Ring1][=Branch1][F][O][C][C][C][S][C][Branch1][=Branch1][C][Branch1][C][N][=O][=N][C][=Ring1][Branch2][Ring1][S][C][Ring2][Ring1][O][=O]"
],
"smiles": [
"C#CC1(O)CCCN(C)C1=O",
"NC(=O)c1nc2c(s1)CCOc1cc(F)c(Br)cc1-2",
"CN1CCCC(O)(C#Cc2cc3c(cc2F)OCCc2sc(C(N)=O)nc2-3)C1=O"
]
} | 659 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the structural changes between the reactants and products, and assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "659",
"role": "assistant"
}
] |
183 | {
"selfies": [
"[C][C][O]",
"[C][C][O][C][=Branch1][C][=O][C][C][N][Branch1][S][C][C][=Branch1][C][=O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[Pd]",
"[C][C][O][C][=Branch1][C][=O][C][C][N][Branch1][#Branch1][C][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CCO",
"CCOC(=O)CCN(CC(=O)OCc1ccccc1)C(=O)OC(C)(C)C",
"[Pd]",
"CCOC(=O)CCN(CC(=O)O)C(=O)OC(C)(C)C"
]
} | 186 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key reactive sites in the given reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "186",
"role": "assistant"
}
] |
184 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][C][C][O][C][Branch2][Ring1][#Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#C][C][Ring2][Ring1][=Branch1]",
"[C][C][O][C][C]",
"[Al+3]",
"[H-1]",
"[H-1]",
"[H-1]",
"[H-1]",
"[Li+1]",
"[Na+1]",
"[OH1-1]",
"[C][C][N][C][C][O][C][Branch2][Ring1][#Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#C][C][Ring2][Ring1][=Branch1]"
],
"smiles": [
"CC(=O)N1CCOC(C=C2c3ccccc3CCc3ccccc32)C1",
"CCOCC",
"[Al+3]",
"[H-]",
"[H-]",
"[H-]",
"[H-]",
"[Li+]",
"[Na+]",
"[OH-]",
"CCN1CCOC(C=C2c3ccccc3CCc3ccccc32)C1"
]
} | 112 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction into one of the template classes by recognizing the characteristic patterns of atom rearrangements.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "112",
"role": "assistant"
}
] |
185 | {
"selfies": [
"[C][C][C][C][N][=C][Branch1][C][C][N][Branch2][Ring1][Ring2][C][=C][C][=C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=N][C][=Branch1][C][=O][C][=Ring2][Ring1][Branch1][C][C][=C][C][=C][Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][#N][C][=C][Ring1][=C]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][S][Branch1][C][C][=O]",
"[O]",
"[O][=C][Branch1][C][O-1][O]",
"[Cl-1]",
"[NH3+1][O]",
"[Na+1]",
"[C][C][C][C][N][=C][Branch1][C][C][N][Branch2][Ring1][Ring2][C][=C][C][=C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=N][C][=Branch1][C][=O][C][=Ring2][Ring1][Branch1][C][C][=C][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=N][O][C][=Branch1][C][=O][NH1][Ring1][=Branch1][C][=C][Ring2][Ring1][C]"
],
"smiles": [
"CCCc1nc(C)n(-c2ccc(Oc3ccccc3)cc2)c(=O)c1Cc1ccc(-c2ccccc2C#N)cc1",
"CCOC(C)=O",
"CS(C)=O",
"O",
"O=C([O-])O",
"[Cl-]",
"[NH3+]O",
"[Na+]",
"CCCc1nc(C)n(-c2ccc(Oc3ccccc3)cc2)c(=O)c1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1"
]
} | 979 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Determine the reaction class based on the specific combination of reactants, reagents, and products present.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "979",
"role": "assistant"
}
] |
186 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][Branch1][C][C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][#C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][C]",
"[C][O][C][C][O][C]",
"[Na+1]",
"[OH1-1]",
"[C][C][=C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][C][Branch1][N][N][C][=Branch1][C][=O][O][C][Branch1][C][C][C][=C][Ring2][Ring1][Branch1][C][=Branch1][C][=O][O]"
],
"smiles": [
"COC(=O)c1c(C)cc(OCc2ccccc2)cc1NC(=O)OC(C)C",
"COCCOC",
"[Na+]",
"[OH-]",
"Cc1cc(OCc2ccccc2)cc(NC(=O)OC(C)C)c1C(=O)O"
]
} | 222 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Assign the reaction to one of the classes by identifying the main functional group transformations occurring in the reaction.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "222",
"role": "assistant"
}
] |
187 | {
"selfies": [
"[C][C][=C][Branch2][Ring1][Branch2][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][Ring1][=Branch2][S][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring2][Ring1][#Branch1][Ring1][#Branch1]",
"[O][C][C][C][C][O][C][Ring1][Branch1]",
"[C][C][=C][Branch2][Ring1][S][S][=Branch1][C][=O][=Branch1][C][=O][N][C][=C][C][=C][C][Branch1][=C][C][=Branch1][C][=O][O][C][C][C][C][O][C][Ring1][Branch1][=C][Ring1][#C][S][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring2][Ring1][=N][Ring1][#Branch1]"
],
"smiles": [
"Cc1c(S(=O)(=O)Nc2cccc(C(=O)O)c2)sc2ccc(Cl)cc12",
"OCC1CCOC1",
"Cc1c(S(=O)(=O)Nc2cccc(C(=O)OCC3CCOC3)c2)sc2ccc(Cl)cc12"
]
} | 33 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reaction's atom-mapping, predict the reaction class that best represents the chemical transformation.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "33",
"role": "assistant"
}
] |
188 | {
"selfies": [
"[C][=Branch1][#Branch2][=N][C][C][C][C][C][C][Ring1][=Branch1][=N][C][C][C][C][C][C][Ring1][=Branch1]",
"[C][C][C][O][C][Ring1][Branch1]",
"[C][O][C][=C][Branch1][C][C][C][=C][Branch2][Ring1][#Branch2][C][Branch1][#Branch1][O][C][Branch1][C][N][=O][=C][Ring1][O][C][C][=C][Branch1][C][C][C][C][C][=Branch1][C][=O][O][C][=Branch1][C][=O][O][C][Ring2][Ring1][Branch1]",
"[O][C][C][N][C][C][O][C][C][Ring1][=Branch1]",
"[C][O][C][=C][Branch1][C][C][C][=C][Branch2][Ring2][Ring2][C][Branch1][#Branch1][O][C][Branch1][C][N][=O][=C][Ring1][O][C][C][=C][Branch1][C][C][C][C][C][=Branch1][C][=O][O][C][C][N][C][C][O][C][C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][Ring2][Ring1][=N]"
],
"smiles": [
"C(=NC1CCCCC1)=NC1CCCCC1",
"C1CCOC1",
"COc1c(C)c2c(c(OC(N)=O)c1CC=C(C)CCC(=O)O)C(=O)OC2",
"OCCN1CCOCC1",
"COc1c(C)c2c(c(OC(N)=O)c1CC=C(C)CCC(=O)OCCN1CCOCC1)C(=O)OC2"
]
} | 17 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the reaction mechanism and use it to classify the reaction into one of the predefined template classes.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "17",
"role": "assistant"
}
] |
189 | {
"selfies": [
"[C][C][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[C][C][O]",
"[C][O][C][C][Br]",
"[C][C][N][Branch1][Branch1][C][C][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CCNCc1ccccc1",
"CCO",
"COCCBr",
"CCN(CCOC)Cc1ccccc1"
]
} | 722 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key structural motifs in the reactants and products that are indicative of a particular reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "722",
"role": "assistant"
}
] |
190 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][N][Branch1][=N][C][=Branch1][C][=O][C][C][C][N][C][C][Ring1][=Branch1][C][Ring1][=N]",
"[C][C][N][Branch1][Ring1][C][C][C][C]",
"[C][C][O][C][Branch1][C][C][=O]",
"[C][N][Branch1][C][C][C][=O]",
"[F][C][Branch1][C][F][Branch1][C][F][C][=C][C][=C][C][Branch1][C][Cl][=N][Ring1][#Branch1]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][N][Branch2][Ring2][C][C][=Branch1][C][=O][C][C][C][N][Branch2][Ring1][Ring1][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=N][Ring1][#Branch2][C][C][Ring1][S][C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)OC(=O)NC1CCN(C(=O)C2CCNCC2)C1",
"CCN(CC)CC",
"CCOC(C)=O",
"CN(C)C=O",
"FC(F)(F)c1cccc(Cl)n1",
"CC(C)(C)OC(=O)NC1CCN(C(=O)C2CCN(c3cccc(C(F)(F)F)n3)CC2)C1"
]
} | 220 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction by recognizing the specific type of bond formation or cleavage occurring during the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "220",
"role": "assistant"
}
] |
191 | {
"selfies": [
"[C][#C][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]",
"[C][C][Branch1][C][C][Branch1][C][C][O]",
"[O]",
"[O][=C][O][C][Branch1][#Branch1][C][Branch1][C][O][C][O][C][Branch1][C][O][=C][Ring1][#Branch2][O]",
"[N-1][=N+1][=N][C][C][C][C][N][C][=C][Branch2][Ring1][#Branch2][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][N][=N][Ring2][Ring1][Ring2]",
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][=C][N][Branch2][Ring2][=Branch2][C][C][C][C][N][C][=C][Branch2][Ring1][#Branch2][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][Branch1][#Branch2][O][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][O][N][=N][Ring2][Ring1][Ring2][N][=N][Ring2][Ring1][=N]"
],
"smiles": [
"C#CCNC(=O)OC(C)(C)C",
"CC(C)(C)O",
"O",
"O=C1OC(C(O)CO)C(O)=C1O",
"[N-]=[N+]=NCCCCn1cc(C(=O)NCc2cccc(OC(F)(F)F)c2)nn1",
"CC(C)(C)OC(=O)NCc1cn(CCCCn2cc(C(=O)NCc3cccc(OC(F)(F)F)c3)nn2)nn1"
]
} | 963 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the presence of specific catalysts or reagents, assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "963",
"role": "assistant"
}
] |
192 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch2][Ring1][C][N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][N+1][=Branch1][C][=O][O-1][C][C][Ring1][P]",
"[C][O]",
"[Pt]",
"[C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch1][=C][N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][N][C][C][Ring1][#C]"
],
"smiles": [
"CCOC(=O)N1CCC(Nc2cc(Cl)ccc2[N+](=O)[O-])CC1",
"CO",
"[Pt]",
"CCOC(=O)N1CCC(Nc2cc(Cl)ccc2N)CC1"
]
} | 1 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the stereochemical changes in the reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "1",
"role": "assistant"
}
] |
193 | {
"selfies": [
"[C][O]",
"[C][O][C][=Branch1][C][=O][C][O][C][C][=N][C][=C][S][Ring1][Branch1]",
"[BH4-1]",
"[Na+1]",
"[O][C][C][O][C][C][=N][C][=C][S][Ring1][Branch1]"
],
"smiles": [
"CO",
"COC(=O)COCc1nccs1",
"[BH4-]",
"[Na+]",
"OCCOCc1nccs1"
]
} | 343 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the main reaction type (e.g., substitution, addition, elimination) and use it to classify the reaction into a specific template class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "343",
"role": "assistant"
}
] |
194 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring2][Ring1][Ring1][C][C][=C][C][Branch2][Ring1][Branch1][C][=C][C][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][=C][=C][C][=C][Ring2][Ring1][Ring2][C]",
"[C][O]",
"[Cl][C][Branch1][C][Cl][Cl]",
"[Pd]",
"[C][C][O][C][=Branch1][C][=O][C][=C][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][N][Ring2][Ring1][Ring1][C][C][=C][C][Branch1][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1][=C][C][=C][Ring1][=N][C]"
],
"smiles": [
"CCOC(=O)c1c(-c2ccc(C(C)(C)C)cc2)c2ccccc2n1Cc1cc(-c2ccc(OCc3ccccc3)cc2)ccc1C",
"CO",
"ClC(Cl)Cl",
"[Pd]",
"CCOC(=O)c1c(-c2ccc(C(C)(C)C)cc2)c2ccccc2n1Cc1cc(-c2ccc(O)cc2)ccc1C"
]
} | 23 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the type of heteroatoms involved in the reaction, predict the most likely reaction class from the predefined set.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "23",
"role": "assistant"
}
] |
195 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][O][C][=C][Ring1][#Branch2]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O]",
"[O][=C][Branch1][Branch1][C][C][C][Cl][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][C][C][O]",
"[Cl][C][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][C][O][Ring1][O]"
],
"smiles": [
"Cc1ccc(S(=O)(=O)O)cc1",
"Cc1ccccc1",
"O",
"O=C(CCCCl)c1ccccc1",
"OCCO",
"ClCCCC1(c2ccccc2)OCCO1"
]
} | 93 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given a chemical reaction, classify it into one of the predefined reaction classes from the USPTO 1K TPL dataset.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "93",
"role": "assistant"
}
] |
196 | {
"selfies": [
"[C][C][=Branch1][C][=O][O][C][Branch1][C][C][=O]",
"[C][C][N][C][C][Branch1][C][O][C][C][C][C][C][Ring1][#Branch1][N][C][=N][C][Branch2][Ring2][Branch1][C][=Branch1][C][=O][N][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][C][O-1][O]",
"[Na+1]",
"[C][=C][C][=N][C][=C][Ring1][=Branch1]",
"[C][C][N][Branch2][=Branch1][Ring2][C][C][Branch1][C][O][C][C][C][C][C][Ring1][#Branch1][N][C][=N][C][Branch2][Ring2][Branch1][C][=Branch1][C][=O][N][C][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][C][=O]"
],
"smiles": [
"CC(=O)OC(C)=O",
"CCNCC1(O)CCCCC1n1cnc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2Cc2ccccc2)c1-c1ccccc1",
"O=C([O-])O",
"[Na+]",
"c1ccncc1",
"CCN(CC1(O)CCCCC1n1cnc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2Cc2ccccc2)c1-c1ccccc1)C(C)=O"
]
} | 369 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the reactants and products, predict the most likely reaction class that describes the transformation.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "369",
"role": "assistant"
}
] |
197 | {
"selfies": [
"[C][C][O][C][Branch1][C][C][=O]",
"[N][#C][C][=C][C][Branch1][C][O][=C][C][=N][N][Branch2][Ring1][O][C][=C][C][Branch1][C][F][=C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][C][F][=C][Ring1][S][C][Ring2][Ring1][Branch1][=C][Ring2][Ring1][#Branch2]",
"[Pd]",
"[N][#C][C][=C][C][Branch1][C][O][=C][C][=N][N][Branch2][Ring1][C][C][=C][C][Branch1][C][F][=C][Branch1][C][O][C][Branch1][C][F][=C][Ring1][=Branch2][C][Ring1][=C][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CCOC(C)=O",
"N#Cc1cc(O)c2cnn(-c3cc(F)c(OCc4ccccc4)c(F)c3)c2c1",
"[Pd]",
"N#Cc1cc(O)c2cnn(-c3cc(F)c(O)c(F)c3)c2c1"
]
} | 698 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Analyze the structural changes between the reactants and products, and assign the reaction to the appropriate class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "698",
"role": "assistant"
}
] |
198 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O-1]",
"[C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[Cl]",
"[Cl][C][Branch1][C][Cl][Cl]",
"[F][C][Branch1][C][F][Branch1][C][F][C][=C][C][=C][S][C][Branch1][C][Br][=N][C][Ring1][=Branch1][=C][Ring1][#Branch2]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch1][O][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"[O][=C][Branch2][Ring2][=Branch2][C][O][C][C][C][C][Branch2][Ring1][O][N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=N][C][C][Ring2][Ring1][Ring2][N][C][C][N][C][C][Ring1][=Branch1]",
"[Na+1]",
"[Pd]",
"[Pd]",
"[C][=C][C][=C][Branch2][Branch1][#C][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2][C][=C][Branch2][Ring1][Ring2][P][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][C][=C][Ring2][Ring1][#Branch1][Ring1][=Branch1][C][=C][Ring2][Ring2][=C]",
"[O][=C][Branch2][Ring2][=Branch2][C][O][C][C][C][C][Branch2][Ring1][O][N][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][=N][C][C][Ring2][Ring1][Ring2][N][C][C][N][Branch2][Ring1][Branch2][C][=N][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][C][=C][Ring1][#Branch2][S][Ring1][=N][C][C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC(C)(C)[O-]",
"Cc1ccccc1",
"Cl",
"ClC(Cl)Cl",
"FC(F)(F)c1ccc2sc(Br)nc2c1",
"O=C(C=Cc1ccccc1)C=Cc1ccccc1",
"O=C(C=Cc1ccccc1)C=Cc1ccccc1",
"O=C(C=Cc1ccccc1)C=Cc1ccccc1",
"O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCNCC1",
"[Na+]",
"[Pd]",
"[Pd]",
"c1ccc(P(c2ccccc2)c2ccc3ccccc3c2-c2c(P(c3ccccc3)c3ccccc3)ccc3ccccc23)cc1",
"O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(c2nc3cc(C(F)(F)F)ccc3s2)CC1"
]
} | 657 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify the key reactive sites in the given reaction and use them to determine the corresponding reaction class.\n<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "657",
"role": "assistant"
}
] |
199 | {
"selfies": [
"[N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1]",
"[O][=C][Branch1][=Branch2][C][C][=C][C][=C][S][Ring1][Branch1][N][C][=C][C][=C][C][Branch2][Ring1][N][C][=N][N][C][=C][Branch1][C][F][C][=C][C][Ring1][#Branch1][=C][Ring1][#Branch2][C][=C][C][=N][C][Branch1][C][Cl][=N][Ring1][#Branch1][=C][Ring2][Ring1][#Branch1]",
"[O][=C][Branch1][=Branch2][C][C][=C][C][=C][S][Ring1][Branch1][N][C][=C][C][=C][C][Branch2][Ring2][#Branch1][C][=N][N][C][=C][Branch1][C][F][C][=C][C][Ring1][#Branch1][=C][Ring1][#Branch2][C][=C][C][=N][C][Branch1][=N][N][C][=C][C][=C][C][Branch1][C][F][=C][Ring1][#Branch1][=N][Ring1][=C][=C][Ring2][Ring1][=C]"
],
"smiles": [
"Nc1cccc(F)c1",
"O=C(Cc1cccs1)Nc1cccc(-c2nn3cc(F)ccc3c2-c2ccnc(Cl)n2)c1",
"O=C(Cc1cccs1)Nc1cccc(-c2nn3cc(F)ccc3c2-c2ccnc(Nc3cccc(F)c3)n2)c1"
]
} | 808 | [
{
"content": "You are a chemist. Now you are given a reaction equation. Please predict the class of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the class number. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Classify the reaction into one of the template classes by recognizing the characteristic patterns of atom rearrangements.\n<molecule_2d>.<molecule_2d>>><molecule_2d>",
"role": "user"
},
{
"content": "808",
"role": "assistant"
}
] |