molecules
dict | messages
listlengths 3
3
|
|---|---|
{
"smiles": [
"OCC(O)C(O)C(O)CO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "OCC(O)C(O)C(O)CO",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)C1C(O)C(O)C2C3OCC4=C3C(C)(CCC4O)CCC12C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "CC(C)C1C(O)C(O)C2C3OCC4=C3C(C)(CCC4O)CCC12C",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1ccc(-n2[nH]c(C)c(C=Nc3ccc4[nH]c(=O)[nH]c4c3)c2=O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "Cc1ccc(-n2[nH]c(C)c(C=Nc3ccc4[nH]c(=O)[nH]c4c3)c2=O)cc1",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=CCOc1c2occc2cc2ccc(=O)oc12)CC1C=C(C)C(=O)O1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "CC(=CCOc1c2occc2cc2ccc(=O)oc12)CC1C=C(C)C(=O)O1",
"role": "assistant"
}
] |
{
"smiles": [
"C=C(C)C1CCC(C)(OC)C2CCC(C)C2C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "C=C(C)C1CCC(C)(OC)C2CCC(C)C2C1",
"role": "assistant"
}
] |
{
"smiles": [
"NC(=O)CCCCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "NC(=O)CCCCC(=O)O",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(C2OC(c3ccc(OC)c(OC)c3)C(C)C2C)ccc1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1cc(C2OC(c3ccc(OC)c(OC)c3)C(C)C2C)ccc1O",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1CCCC(C)(C)C1CCC1(C)c2c(O)cc3c(c2OC1C)C(=O)C=C(OC)C3=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "C=C1CCCC(C)(C)C1CCC1(C)c2c(O)cc3c(c2OC1C)C(=O)C=C(OC)C3=O",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCCCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "CCC=CCCCCO",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC1C=CC(=O)C1C=CC(O)CC=CCCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me the SMILES of it?",
"role": "user"
},
{
"content": "CCC=CCC=CCC1C=CC(=O)C1C=CC(O)CC=CCCC(=O)O",
"role": "assistant"
}
] |
{
"smiles": [
"CC1=CC(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C=CC=CC(=O)NC2=C(C)C(=O)c3c(cc(C)c(O)c3C1=O)C2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC1=CC(C)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)C=CC=CC(=O)NC2=C(C)C(=O)c3c(cc(C)c(O)c3C1=O)C2=O",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)C(C)=CCOc1ccc(CCCO)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "COC(=O)C(C)=CCOc1ccc(CCCO)cc1",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCC=CCC=CCC=CCC=CCCCCO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCCCCO",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)=CCC1(O)C(O)C(O)(CC=C(C)C)C(O)C(O)(CC=C(C)C)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)=CCC1(O)C(O)C(O)(CC=C(C)C)C(O)C(O)(CC=C(C)C)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1CC2OC3C4C(CC(C)C(OC(=O)CCC)C24)C(C)COC3(C)C(OC(C)=O)CC1OC(C)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "C=C1CC2OC3C4C(CC(C)C(OC(=O)CCC)C24)C(C)COC3(C)C(OC(C)=O)CC1OC(C)=O",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(NC(=O)c2ccc(C(C)(C)C)cc2)c(OC)cc1NC(=O)CN1CCCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "COc1cc(NC(=O)c2ccc(C(C)(C)C)cc2)c(OC)cc1NC(=O)CN1CCCCC1",
"role": "assistant"
}
] |
{
"smiles": [
"CC(COc1ccccc1)N(CCCl)Cc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(COc1ccccc1)N(CCCl)Cc1ccccc1",
"role": "assistant"
}
] |
{
"smiles": [
"CNCC1Oc2ccc(NC(=O)CCC(F)(F)F)cc2CC(=O)N(C(C)CO)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "CNCC1Oc2ccc(NC(=O)CCC(F)(F)F)cc2CC(=O)N(C(C)CO)CC1C",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1C2(C)CC3C4(C)CCC(=O)C(C)(C)C4CCC3(C)C1(C(=O)OC)C(=O)C(C)C2=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "C=C1C2(C)CC3C4(C)CCC(=O)C(C)(C)C4CCC3(C)C1(C(=O)OC)C(=O)C(C)C2=O",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)NC1C(O)OC(CO)C(OC2OC(COC3OC(CO)C(O)C(O)C3OC3OC(CO)C(OC4OC(COC5(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O5)C(O)C(O)C4O)C(O)C3NC(C)=O)C(O)C(OC3OC(CO)C(OC4OC(CO)C(OC5OC(COC6(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O6)C(O)C(O)C5O)C(O)C4NC(C)=O)C(O)C3OC3OC(CO)C(OC4OC(CO)C(O)C(OC5(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O5)C4O)C(O)C3NC(C)=O)C2O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "CC(=O)NC1C(O)OC(CO)C(OC2OC(COC3OC(CO)C(O)C(O)C3OC3OC(CO)C(OC4OC(COC5(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O5)C(O)C(O)C4O)C(O)C3NC(C)=O)C(O)C(OC3OC(CO)C(OC4OC(CO)C(OC5OC(COC6(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O6)C(O)C(O)C5O)C(O)C4NC(C)=O)C(O)C3OC3OC(CO)C(OC4OC(CO)C(O)C(OC5(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O5)C4O)C(O)C3NC(C)=O)C2O)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"Cc1cc2c(c(C)c1CCOC(=O)c1ccccc1)C(=O)C(C)C2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "Cc1cc2c(c(C)c1CCOC(=O)c1ccccc1)C(=O)C(C)C2",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)NC1C(O)OC(COC2OC(C)C(O)C(O)C2O)C(OC2OC(CO)C(OC3OC(COC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(O)C5O)C(O)C4NC(C)=O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(O)C5O)C(O)C4NC(C)=O)C3O)C(O)C2NC(C)=O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC(=O)NC1C(O)OC(COC2OC(C)C(O)C(O)C2O)C(OC2OC(CO)C(OC3OC(COC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(O)C5O)C(O)C4NC(C)=O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(O)C5O)C(O)C4NC(C)=O)C3O)C(O)C2NC(C)=O)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)=CC(=O)OC1CCC(C)(C)C2(C)C1(C)CC(CO)C21CO1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC(C)=CC(=O)OC1CCC(C)(C)C2(C)C1(C)CC(CO)C21CO1",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CC2OC(=O)C3(C)CCCC(C)(C23)C12CC(=O)C1(CCOC1)O2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC1CC2OC(=O)C3(C)CCCC(C)(C23)C12CC(=O)C1(CCOC1)O2",
"role": "assistant"
}
] |
{
"smiles": [
"CC12C=CC(=O)C=C1CC(O)C1C2CCC2(C)C(O)CCC12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC12C=CC(=O)C=C1CC(O)C1C2CCC2(C)C(O)CCC12",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(O)CC(O)(C(=O)O)C(=O)C=Cc1ccc(O)c(O)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "O=C(O)CC(O)(C(=O)O)C(=O)C=Cc1ccc(O)c(O)c1",
"role": "assistant"
}
] |
{
"smiles": [
"CCCNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCCCNC(=O)C(C)N(C)C(=O)C=CCN(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "CCCNc1nc(Nc2ccc(C#N)cc2)ncc1C#CCCCNC(=O)C(C)N(C)C(=O)C=CCN(C)C",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(=O)N1CC(C)C(OC)CN(C)C(=O)c2ccc(NC(=O)Nc3ccccc3)cc2OCC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CCC(=O)N1CC(C)C(OC)CN(C)C(=O)c2ccc(NC(=O)Nc3ccccc3)cc2OCC1C",
"role": "assistant"
}
] |
{
"smiles": [
"CCOCCOC1CCC(CC(C)C2CC(=O)C(C)C=C(C)C(O)C(OC)C(=O)C(C)CC(C)C=CC=CC=C(C)C(OC)CC3CCC(C)C(O)(O3)C(=O)C(=O)N3CCCCC3C(=O)O2)CC1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CCOCCOC1CCC(CC(C)C2CC(=O)C(C)C=C(C)C(O)C(OC)C(=O)C(C)CC(C)C=CC=CC=C(C)C(OC)CC3CCC(C)C(O)(O3)C(=O)C(=O)N3CCCCC3C(=O)O2)CC1OC",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)OCC1=CC2C3C(C)(C)C3(OC(C)=O)CC(C)C2(O)C2C=C(C)C(=O)C2(O)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me the SMILES of it?",
"role": "user"
},
{
"content": "CC(=O)OCC1=CC2C3C(C)(C)C3(OC(C)=O)CC(C)C2(O)C2C=C(C)C(=O)C2(O)C1",
"role": "assistant"
}
] |
{
"smiles": [
"CC(CCC(=O)O)C1CC(=O)C2(C)C3=C(C(O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(CCC(=O)O)C1CC(=O)C2(C)C3=C(C(O)CC12C)C1(C)CCC(O)C(C)(C)C1CC3O",
"role": "assistant"
}
] |
{
"smiles": [
"CC12C(=O)C=CC=C1C=CC1C2CCC2(O)C(=O)OC3(C)C4CC5(C)C(COC16C(=O)OC23C56)C(=O)O4"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "CC12C(=O)C=CC=C1C=CC1C2CCC2(O)C(=O)OC3(C)C4CC5(C)C(COC16C(=O)OC23C56)C(=O)O4",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)=CCCC(C)(O)C1CC=C(C)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "CC(C)=CCCC(C)(O)C1CC=C(C)CC1",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)OC1=C(C)C(O)C2C(OC(=O)c3ccccc3)C(C)C(OC(C)=O)C2(OC(C)=O)C(OC(C)=O)C(C)=CCC(C)(C)C(OC(C)=O)C1OC(C)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "CC(=O)OC1=C(C)C(O)C2C(OC(=O)c3ccccc3)C(C)C(OC(C)=O)C2(OC(C)=O)C(OC(C)=O)C(C)=CCC(C)(C)C(OC(C)=O)C1OC(C)=O",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C=CC(Cl)C(C)(Cl)C=CBr)=CBr"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC(C=CC(Cl)C(C)(Cl)C=CBr)=CBr",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)NC1C(OC2C(O)C(CO)OC(OC3C(NC(C)=O)C(O)OC(CO)C3OC3OC(C)C(O)C(O)C3O)C2OC2OC(C)C(O)C(O)C2O)OC(CO)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "CC(=O)NC1C(OC2C(O)C(CO)OC(OC3C(NC(C)=O)C(O)OC(CO)C3OC3OC(C)C(O)C(O)C3O)C2OC2OC(C)C(O)C(O)C2O)OC(CO)C(O)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1C(=O)OC2CC(C)C3CCC(=O)C3(C)CC12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "C=C1C(=O)OC2CC(C)C3CCC(=O)C3(C)CC12",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CC(=O)NCCNC(=O)CCC(=O)N(O)CCCCCN1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CC(=O)NCCNC(=O)CCC(=O)N(O)CCCCCN1",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)NC1C(OCC2OC(O)C(NC(C)=O)C(OC3OC(CO)C(OC4OC(COC5(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O5)C(O)C(O)C4O)C(O)C3NC(C)=O)C2O)OC(CO)C(OC2OC(COC3(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O3)C(O)C(O)C2O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC(=O)NC1C(OCC2OC(O)C(NC(C)=O)C(OC3OC(CO)C(OC4OC(COC5(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O5)C(O)C(O)C4O)C(O)C3NC(C)=O)C2O)OC(CO)C(OC2OC(COC3(C(=O)O)CC(O)C(NC(C)=O)C(C(O)C(O)CO)O3)C(O)C(O)C2O)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"COC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)OC(CC(C)=O)CC3O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "COC1=CC(=O)c2c(O)c3c(c(O)c2C1=O)OC(CC(C)=O)CC3O",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(O)c1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)cc(O)c1OC",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)O)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)O)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
{
"smiles": [
"O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(C3OCC(O)C(O)C3O)c(O)c12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(C3OCC(O)C(O)C3O)c(O)c12",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CCC2(CC1=O)C(C)CC(=O)C2C(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "CC1CCC2(CC1=O)C(C)CC(=O)C2C(C)C",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)NC1C(OC2C(O)C(CO)OC(OC3C(O)C(CO)OC(O)C3NC(C)=O)C2O)OC(CO)C(OC2OC(COS(=O)(=O)O)C(O)C(O)C2O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "CC(=O)NC1C(OC2C(O)C(CO)OC(OC3C(O)C(CO)OC(O)C3NC(C)=O)C2O)OC(CO)C(OC2OC(COS(=O)(=O)O)C(O)C(O)C2O)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)OC1CC2C(C)(CO)CCCC2(C)C2CCC3CC12C=C3C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC(=O)OC1CC2C(C)(CO)CCCC2(C)C2CCC3CC12C=C3C",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1CCCC(=NNC(=O)c2ccc(CN3c4cccc5cccc(c45)S3(=O)=O)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "O=C1CCCC(=NNC(=O)c2ccc(CN3c4cccc5cccc(c45)S3(=O)=O)cc2)C1",
"role": "assistant"
}
] |
{
"smiles": [
"COc1c(O)ccc2cnc3c4cc5c(cc4ccc3c12)OCO5"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "COc1c(O)ccc2cnc3c4cc5c(cc4ccc3c12)OCO5",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)C1=C2CCC3C(=O)OC(c4ccoc4)CC3(C)C2CCC1OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "COC(=O)C1=C2CCC3C(=O)OC(c4ccoc4)CC3(C)C2CCC1OC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O",
"role": "assistant"
}
] |
{
"smiles": [
"CC=Cc1ccc2n(c1=O)CC1NC2C(C(=O)NCc2ccc3c(c2)OCO3)C1CO"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "CC=Cc1ccc2n(c1=O)CC1NC2C(C(=O)NCc2ccc3c(c2)OCO3)C1CO",
"role": "assistant"
}
] |
{
"smiles": [
"CC1OC(Oc2cc(O)c3c(=O)c(OC4OC(CO)C(O)C(O)C4O)c(-c4ccc(O)c(O)c4)oc3c2)C(O)C(O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "CC1OC(Oc2cc(O)c3c(=O)c(OC4OC(CO)C(O)C(O)C4O)c(-c4ccc(O)c(O)c4)oc3c2)C(O)C(O)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)C(C)=CCCC(C=O)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(=O)C(C)(C)C1CC3"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)C(C)=CCCC(C=O)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(=O)C(C)(C)C1CC3",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)C1(O)C(=O)OC2CCN3CC=C(COC(=O)C(O)(C(C)C)C(C)OC(=O)C1O)C23"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CCC(C)C1(O)C(=O)OC2CCN3CC=C(COC(=O)C(O)(C(C)C)C(C)OC(=O)C1O)C23",
"role": "assistant"
}
] |
{
"smiles": [
"CCCC#Cc1ccc2c(c1)OC(CN(C)Cc1ccccc1)C(C)CN(C(C)CO)S2(=O)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "CCCC#Cc1ccc2c(c1)OC(CN(C)Cc1ccccc1)C(C)CN(C(C)CO)S2(=O)=O",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)CC1NC(=O)C(C(C)C)NC(=O)C(C)NC(=O)C(CCC(=O)O)NC(=O)C(Cc2c[nH]c3ccccc23)NC1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "CC(C)CC1NC(=O)C(C(C)C)NC(=O)C(C)NC(=O)C(CCC(=O)O)NC(=O)C(Cc2c[nH]c3ccccc23)NC1=O",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)=CCc1c(O)cc2c(c1O)C(=O)CC(c1ccc3c(c1)C=CC(C)(C)O3)O2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "CC(C)=CCc1c(O)cc2c(c1O)C(=O)CC(c1ccc3c(c1)C=CC(C)(C)O3)O2",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)C=C(C)CCC=C(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)C=C(C)CCC=C(C)C",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(OC3OC(COC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(OC6OC(CO)C(OC7OC(CO)C(O)C(OC8OC(CO)C(OC9OC(CO)C(O)C(OC%10OC(CO)C(OC%11OC(CO)C(O)C(O)C%11O)C(O)C%10NC(C)=O)C9O)C(O)C8NC(C)=O)C7O)C(O)C6NC(C)=O)C5O)C(O)C4NC(C)=O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(OC6OC(CO)C(OC7OC(CO)C(O)C(OC8OC(CO)C(OC9OC(CO)C(O)C(OC%10OC(CO)C(OC%11OC(CO)C(O)C(O)C%11O)C(O)C%10NC(C)=O)C9O)C(O)C8NC(C)=O)C7O)C(O)C6NC(C)=O)C5O)C(O)C4NC(C)=O)C3O)C(O)C2NC(C)=O)C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me the SMILES of it?",
"role": "user"
},
{
"content": "CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(OC3OC(COC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(OC6OC(CO)C(OC7OC(CO)C(O)C(OC8OC(CO)C(OC9OC(CO)C(O)C(OC%10OC(CO)C(OC%11OC(CO)C(O)C(O)C%11O)C(O)C%10NC(C)=O)C9O)C(O)C8NC(C)=O)C7O)C(O)C6NC(C)=O)C5O)C(O)C4NC(C)=O)C(O)C(OC4OC(CO)C(O)C(O)C4OC4OC(CO)C(OC5OC(CO)C(O)C(OC6OC(CO)C(OC7OC(CO)C(O)C(OC8OC(CO)C(OC9OC(CO)C(O)C(OC%10OC(CO)C(OC%11OC(CO)C(O)C(O)C%11O)C(O)C%10NC(C)=O)C9O)C(O)C8NC(C)=O)C7O)C(O)C6NC(C)=O)C5O)C(O)C4NC(C)=O)C3O)C(O)C2NC(C)=O)C1O",
"role": "assistant"
}
] |
{
"smiles": [
"C=C1CCC2C(C3C1CC(O)C3(C)O)C2(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "C=C1CCC2C(C3C1CC(O)C3(C)O)C2(C)C",
"role": "assistant"
}
] |
{
"smiles": [
"N#CCc1ccc(O)c(Br)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "N#CCc1ccc(O)c(Br)c1",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1OCC(O)C(C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(O)c(O)c(O)c4c3C(=O)OC2C4O)OC(=O)c2cc(O)c(O)c(O)c2-c2c1cc(O)c(O)c2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "O=C1OCC(O)C(C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(O)c(O)c(O)c4c3C(=O)OC2C4O)OC(=O)c2cc(O)c(O)c(O)c2-c2c1cc(O)c(O)c2O",
"role": "assistant"
}
] |
{
"smiles": [
"CCC(C)C(=O)C1=C(NCCO)C(C)(O)C(=O)C(C)=C1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CCC(C)C(=O)C1=C(NCCO)C(C)(O)C(=O)C(C)=C1OC",
"role": "assistant"
}
] |
{
"smiles": [
"C=C=CCC(OC(C)=O)C1=COC(OC(C)=O)C2C(=C)CCC3OC3(C)CCC12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "C=C=CCC(OC(C)=O)C1=COC(OC(C)=O)C2C(=C)CCC3OC3(C)CCC12",
"role": "assistant"
}
] |
{
"smiles": [
"O=CC1OC(=O)c2cc(O)c(O)c(O)c2Oc2cc3c(c(O)c2O)-c2c(cc(O)c(O)c2O)C(=O)OCC2OC(OC(=O)c4cc(O)c(O)c(O)c4Oc4cc5c(c(O)c4O)-c4c(cc(O)c(O)c4O)C(=O)OC(C(O)COC5=O)C1OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c1cc(O)c(O)c(O)c1)C2OC3=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "O=CC1OC(=O)c2cc(O)c(O)c(O)c2Oc2cc3c(c(O)c2O)-c2c(cc(O)c(O)c2O)C(=O)OCC2OC(OC(=O)c4cc(O)c(O)c(O)c4Oc4cc5c(c(O)c4O)-c4c(cc(O)c(O)c4O)C(=O)OC(C(O)COC5=O)C1OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c1cc(O)c(O)c(O)c1)C(OC(=O)c1cc(O)c(O)c(O)c1)C2OC3=O",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)N(C)CC1OCc2cn(nn2)CCCC(=O)N(C(C)CO)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me the SMILES of it?",
"role": "user"
},
{
"content": "COC(=O)N(C)CC1OCc2cn(nn2)CCCC(=O)N(C(C)CO)CC1C",
"role": "assistant"
}
] |
{
"smiles": [
"CNCC(O)c1ccc(O)c2[nH]c(=O)sc12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "CNCC(O)c1ccc(O)c2[nH]c(=O)sc12",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(C=Cc1ccccc1)N1CCCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "O=C(C=Cc1ccccc1)N1CCCCC1",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc2c(cc1OC)OC=CC2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "COc1cc2c(cc1OC)OC=CC2",
"role": "assistant"
}
] |
{
"smiles": [
"O=C1OC(C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(O)c(O)c(O)c4c3C(=O)OC2C4O)C(OC(=O)c2cc(O)c(O)c(O)c2)COC(=O)c2cc(O)c(O)c(O)c2C2C1=CC(O)=C(O)C2O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "O=C1OC(C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(O)c(O)c(O)c4c3C(=O)OC2C4O)C(OC(=O)c2cc(O)c(O)c(O)c2)COC(=O)c2cc(O)c(O)c(O)c2C2C1=CC(O)=C(O)C2O",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)C1CCC2(C)C(O)CCC(C=O)=CC12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)C1CCC2(C)C(O)CCC(C=O)=CC12",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(C=Cc1ccc(O)cc1)OCC1CCCN2CCCCC12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "O=C(C=Cc1ccc(O)cc1)OCC1CCCN2CCCCC12",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)C1=C2Nc3ccccc3C23CCN2CCCC(C(C)O)(C1)C23"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "COC(=O)C1=C2Nc3ccccc3C23CCN2CCCC(C(C)O)(C1)C23",
"role": "assistant"
}
] |
{
"smiles": [
"O=c1c(-c2ccc(O)c(O)c2)coc2c(O)c(O)cc(O)c12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "O=c1c(-c2ccc(O)c(O)c2)coc2c(O)c(O)cc(O)c12",
"role": "assistant"
}
] |
{
"smiles": [
"C=CC(C)(Cl)C(Cl)C=CC(=C)C(Cl)Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "C=CC(C)(Cl)C(Cl)C=CC(=C)C(Cl)Cl",
"role": "assistant"
}
] |
{
"smiles": [
"O=C([O-])C(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "O=C([O-])C(=O)Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1",
"role": "assistant"
}
] |
{
"smiles": [
"COC1CC2C(C)(C)C(=O)CCC2(C)C2=C1C1(C)CCC(C(C)C(CC=C(C)C(=O)O)OC(C)=O)C1(C)CC2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "COC1CC2C(C)(C)C(=O)CCC2(C)C2=C1C1(C)CCC(C(C)C(CC=C(C)C(=O)O)OC(C)=O)C1(C)CC2",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)=CCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(C)=CCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O",
"role": "assistant"
}
] |
{
"smiles": [
"C=CCC=CCC=CCCCCCCCc1cccc(O)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me the SMILES of it?",
"role": "user"
},
{
"content": "C=CCC=CCC=CCCCCCCCc1cccc(O)c1",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(CC2COC(=O)C2Cc2ccc(OC3OC(CO)C(O)C(O)C3O)c(OC)c2)cc1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1ccc(CC2COC(=O)C2Cc2ccc(OC3OC(CO)C(O)C(O)C3O)c(OC)c2)cc1OC",
"role": "assistant"
}
] |
{
"smiles": [
"CCCCCCCCCCCCCCC=COC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCC=COC(COC(=O)CCCCCCCCCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C",
"role": "assistant"
}
] |
{
"smiles": [
"COc1cc(C=CC2c3c(ccc4c3OCO4)-c3ccc4cc5c(cc4c3N2C)OCO5)ccc1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "COc1cc(C=CC2c3c(ccc4c3OCO4)-c3ccc4cc5c(cc4c3N2C)OCO5)ccc1O",
"role": "assistant"
}
] |
{
"smiles": [
"CC=C1CC(C)C(O)(CO)C(=O)OCC2=CCN3CCC(OC1=O)C23"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC=C1CC(C)C(O)(CO)C(=O)OCC2=CCN3CCC(OC1=O)C23",
"role": "assistant"
}
] |
{
"smiles": [
"COC(=O)C1CC2=CC(=O)CCC2(C)C23OC2CC2(C)C(CCC2(O)CCC(=O)O)C13"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "COC(=O)C1CC2=CC(=O)CCC2(C)C23OC2CC2(C)C(CCC2(O)CCC(=O)O)C13",
"role": "assistant"
}
] |
{
"smiles": [
"CCCC(=O)Nc1ccc2c(c1)C(=O)N(C)CC(OC)C(C)CN(CC1CCCC1)C(C)CO2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "CCCC(=O)Nc1ccc2c(c1)C(=O)N(C)CC(OC)C(C)CN(CC1CCCC1)C(C)CO2",
"role": "assistant"
}
] |
{
"smiles": [
"OC1(c2ccc(Cl)cc2)CCN(Cc2c[nH]c3ccccc23)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "OC1(c2ccc(Cl)cc2)CCN(Cc2c[nH]c3ccccc23)CC1",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)OC1CC2(C)CC(O)(C3CC(=O)C(C)=CC3O)CCC2C2(C)CCCC(C)(C)C12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Please give me the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CC(=O)OC1CC2(C)CC(O)(C3CC(=O)C(C)=CC3O)CCC2C2(C)CCCC(C)(C)C12",
"role": "assistant"
}
] |
{
"smiles": [
"COC1CC(=O)C2(C)C3CCC4(C)C(CC(O)C4C(C)(O)C4CC(C)C(C)C(=O)O4)C3CC3OC32C1O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "COC1CC(=O)C2(C)C3CCC4(C)C(CC(O)C4C(C)(O)C4CC(C)C(C)C(=O)O4)C3CC3OC32C1O",
"role": "assistant"
}
] |
{
"smiles": [
"CC1=C2C3=CCC4C5(C)CCC(O)C(C)(CO)C5CCC4(C)C3(C)CCC2(C(=O)OC2OC(CO)C(O)C(O)C2O)CCC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC1=C2C3=CCC4C5(C)CCC(O)C(C)(CO)C5CCC4(C)C3(C)CCC2(C(=O)OC2OC(CO)C(O)C(O)C2O)CCC1C",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CCCCOC(CN(C)CC2CC2)C(C)CN(C(C)CO)C(=O)c2cc(NC(=O)CCC(F)(F)F)ccc2O1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "CC1CCCCOC(CN(C)CC2CC2)C(C)CN(C(C)CO)C(=O)c2cc(NC(=O)CCC(F)(F)F)ccc2O1",
"role": "assistant"
}
] |
{
"smiles": [
"C#CC=CCC1OC(C(Br)CC)CC(OC(C)=O)C(Cl)CC1OC(C)=O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "I'd like the SMILES of this molecule <molecule_2d>. Can you do that?",
"role": "user"
},
{
"content": "C#CC=CCC1OC(C(Br)CC)CC(OC(C)=O)C(Cl)CC1OC(C)=O",
"role": "assistant"
}
] |
{
"smiles": [
"CC1CN(C(C)CO)C(=O)CCCn2cc(nn2)COC1CN(C)C(=O)Nc1ccccc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. What is the corresponding SMILES representation?",
"role": "user"
},
{
"content": "CC1CN(C(C)CO)C(=O)CCCn2cc(nn2)COC1CN(C)C(=O)Nc1ccccc1F",
"role": "assistant"
}
] |
{
"smiles": [
"COc1c2c3c(c4c1OCO4)-c1ccccc1CC3N(C)CC2"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "COc1c2c3c(c4c1OCO4)-c1ccccc1CC3N(C)CC2",
"role": "assistant"
}
] |
{
"smiles": [
"O=C(NCCc1ccc(Cl)cc1)Nc1ccc(Cl)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you provide the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "O=C(NCCc1ccc(Cl)cc1)Nc1ccc(Cl)cc1",
"role": "assistant"
}
] |
{
"smiles": [
"CCc1ccc(C2=C(C)C(=O)C3(O2)C(=O)NC(OC)(C(=O)c2ccccc2)C3O)o1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Provide the SMILES of this molecule <molecule_2d> .",
"role": "user"
},
{
"content": "CCc1ccc(C2=C(C)C(=O)C3(O2)C(=O)NC(OC)(C(=O)c2ccccc2)C3O)o1",
"role": "assistant"
}
] |
{
"smiles": [
"CC(=O)CCCC(C)(C)C(=O)C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "CC(=O)CCCC(C)(C)C(=O)C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C",
"role": "assistant"
}
] |
{
"smiles": [
"CC=CC(=O)c1c(OC)cc(OC)c(OC)c1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> What is the SMILES of this molecule?",
"role": "user"
},
{
"content": "CC=CC(=O)c1c(OC)cc(OC)c(OC)c1OC",
"role": "assistant"
}
] |
{
"smiles": [
"CC(C)C(O)C(O)CC(C)C1C(O)CC2C3CC(O)C4CC(O)CCC4(C)C3CCC21C"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Given the molecule <molecule_2d>, write its SMILES notation.",
"role": "user"
},
{
"content": "CC(C)C(O)C(O)CC(C)C1C(O)CC2C3CC(O)C4CC(O)CCC4(C)C3CCC21C",
"role": "assistant"
}
] |
{
"smiles": [
"CC1(C)C(=O)C2(O)CC34OC3CCC3(C)C4=C(C(=O)OC3c3ccoc3)C2(O)C2(C)OC(=O)CC12"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Could you give me the SMILES of this molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "CC1(C)C(=O)C2(O)CC34OC3CCC3(C)C4=C(C(=O)OC3c3ccoc3)C2(O)C2(C)OC(=O)CC12",
"role": "assistant"
}
] |
{
"smiles": [
"CCC=CCC(O)C=CC1OC(=O)CC(O)C1CC=CCCCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "<molecule_2d> The above is a compound. Could you please tell me the SMILES of it?",
"role": "user"
},
{
"content": "CCC=CCC(O)C=CC1OC(=O)CC(O)C1CC=CCCCC(=O)O",
"role": "assistant"
}
] |
{
"smiles": [
"COc1ccc(C23Oc4cc5c(c(OC)c4C(O)(C(C(=O)N4CCCC4NC(=O)C=C(C)C)C2c2ccccc2)C3O)OCO5)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a representation of a molecule. Please help me to understand the molecule.",
"role": "system"
},
{
"content": "Tell me the SMILES of this molecule: <molecule_2d>",
"role": "user"
},
{
"content": "COc1ccc(C23Oc4cc5c(c(OC)c4C(O)(C(C(=O)N4CCCC4NC(=O)C=C(C)C)C2c2ccccc2)C3O)OCO5)cc1",
"role": "assistant"
}
] |