prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)cc1I | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c12ccc(Cl)s1"
} |
Can you make molecule CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)cc1Br | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c12ccc(Cl)s1"
} |
Can you make molecule CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)c(I)c1 | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c12ccc(Cl)s1"
} |
Can you make molecule CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H]([NH3+])c1cc(Cl)sc1Cl | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 | CC[C@@H](C)[C@@H]([NH3+])c1cc(Cl)sc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c12ccc(Cl)s1"
} |
Can you make molecule CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)c(Cl)c1 | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)s1 | CC[C@@H](C)[C@@H]([NH3+])c1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c12ccc(Cl)s1"
} |
Can you make molecule COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](C)[NH2+]CCOc2ccccc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2ccccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ncccc1Cl"
} |
Can you make molecule COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](C)[NH2+]CCOc2cc(I)cnc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2cc(I)cnc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)cnc1Cl",
"old_substring": "c14ncccc1Cl"
} |
Can you make molecule COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](C)[NH2+]CCOc2cc(I)c(Cl)c(F)n2)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2cc(I)c(Cl)c(F)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1nc&cc(I)c1Cl",
"old_substring": "c14ncccc1Cl"
} |
Can you make molecule COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](C)[NH2+]CCOc2ccc(F)cc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2ccc(F)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c14ncccc1Cl"
} |
Can you make molecule COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@@H](C)[NH2+]CCOc2cc(F)ccc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2ncccc2Cl)c1 | COc1cccc([C@@H](C)[NH2+]CCOc2cc(F)ccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Cl",
"old_substring": "c14ncccc1Cl"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=O)CC(C)(C)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1C(=O)CC(C)(C)NC1CCN(C(=O)OC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=O)CCC(C)(C)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1C(=O)CCC(C)(C)NC1CCN(C(=O)OC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1C(=O)C[C@@H](Br)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1C(=O)C[C@@H](Br)NC1CCN(C(=O)OC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1c1cc(C)n(NC2CCN(C(=O)OC(C)(C)C)CC2)c(=O)c1 | CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1c1cc(C)n(NC2CCN(C(=O)OC(C)(C)C)CC2)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCCN1c1c(C)n(NC2CCN(C(=O)OC(C)(C)C)CC2)ccc1=O | CC[C@@H]1CCCCN1C(=O)NC1CCN(C(=O)OC(C)(C)C)CC1 | CC[C@@H]1CCCCN1c1c(C)n(NC2CCN(C(=O)OC(C)(C)C)CC2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)CC(C)(C)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(NC(=O)CC(C)(C)NCc2ccc(N3CCSCC3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)CCC(C)(C)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(NC(=O)CCC(C)(C)NCc2ccc(N3CCSCC3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)C[C@@H](Br)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(NC(=O)C[C@@H](Br)NCc2ccc(N3CCSCC3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(Nc2cc(C)n(NCc3ccc(N4CCSCC4)cc3)c(=O)c2)c1 | CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(Nc2cc(C)n(NCc3ccc(N4CCSCC4)cc3)c(=O)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(Nc2c(C)n(NCc3ccc(N4CCSCC4)cc3)ccc2=O)c1 | CCOc1cccc(NC(=O)NCc2ccc(N3CCSCC3)cc2)c1 | CCOc1cccc(Nc2c(C)n(NCc3ccc(N4CCSCC4)cc3)ccc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NSC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NSC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCCC(=O)N2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CCCC(=O)N2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CC(C)(C)N2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CC(C)(C)N2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC[S@+]([O-])CCCN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC[S@+]([O-])CCCN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCC(C)(C)N2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CN2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | Cc1cccc(NC(=O)CCC(C)(C)N2CCN(c3ccc4c(c3)OCCO4)C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C7"
} |
Can you make molecule C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1C(CC)(CC)C(=O)CN1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1C(CC)(CC)C(=O)CN1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6CC4=O"
} |
Can you make molecule C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1C(CC)(CC)C(=O)CCN1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1C(CC)(CC)C(=O)CCN1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6CC4=O"
} |
Can you make molecule C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1[C@@H](CC)[S@+]([O-])CN1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1[C@@H](CC)[S@+]([O-])CN1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&[S@](=O)C&",
"old_substring": "C6CC4=O"
} |
Can you make molecule C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1C(=O)[C@@H](CCCC)C(=O)N1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1C(=O)[C@@H](CCCC)C(=O)N1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H](C&=O)C&=O",
"old_substring": "C6CC4=O"
} |
Can you make molecule C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC[S@+]([O-])[C@@H](C)N1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC(=O)N1CCCCCC1 | C=C(C)C(=O)N[C@H](C)c1nc2ccccc2n1CCC[S@+]([O-])[C@@H](C)N1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "C6CC4=O"
} |
Can you make molecule CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[C@H]1CCCC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1CCCC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[NH+]&C1",
"old_substring": "[C@H]19CC[NH+]7C1"
} |
Can you make molecule CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[C@H]1CC[C@H](Cc2ccc(-c3nc4ccccc4s3)o2)O1 | CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1CC[C@H](Cc2ccc(-c3nc4ccccc4s3)o2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@H]&O1",
"old_substring": "[C@H]19CC[NH+]7C1"
} |
Can you make molecule CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[C@H]1C=C[C@H](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1C=C[C@H](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]19CC[NH+]7C1"
} |
Can you make molecule CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[C@H]1CCN(Cc2ccc(-c3nc4ccccc4s3)o2)C1=O | CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1CCN(Cc2ccc(-c3nc4ccccc4s3)o2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCN&C1=O",
"old_substring": "[C@H]19CC[NH+]7C1"
} |
Can you make molecule CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[C@H]1C=C[C@@H](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1CC[NH+](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | CCOC[C@H]1C=C[C@@H](Cc2ccc(-c3nc4ccccc4s3)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]19CC[NH+]7C1"
} |
Can you make molecule CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)C[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOSC(=O)C[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCC(=C=O)C[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOCC(=C=O)C[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC(=O)CCCC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC(=O)CC(C)(C)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[S@+]([O-])CCC[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC(=O)[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | CCOC[S@+]([O-])CCC[C@]1(Cc2cccc(Cl)c2)CCCN(C(=O)c2ccnn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C37=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCCCC2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCCCCC2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2(C)C)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC[C@H]2C)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC[C@H]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC[C@H]1C",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCC(C)(C)C2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCCC2)C1 | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(=O)N1CC[C@H]([NH+]2CCC(C)(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]16CCCC1"
} |
Can you make molecule CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | C=CSOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | C=CCCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCC[C@@H](NC(=O)NCCCOCCCCl)C1 | CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | CC[C@@H]1CCC[C@@H](NC(=O)NCCCOCCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCC[C@@H](NC(=O)NCCCOCCCCS)C1 | CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | CC[C@@H]1CCC[C@@H](NC(=O)NCCCOCCCCS)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCC[C@@H](NC(=O)NCCCOCCCBr)C1 | CCOCCCNC(=O)N[C@@H]1CCC[C@@H](CC)C1 | CC[C@@H]1CCC[C@@H](NC(=O)NCCCOCCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cccc(F)c1F)Nc1cccc(Br)n1 | O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 | O=C(/C=C/Sc1cccc(F)c1F)Nc1cccc(Br)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(c2cccc(F)c2F)CC1)Nc1cccc(Br)n1 | O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 | O=C(NN=C1CCC(c2cccc(F)c2F)CC1)Nc1cccc(Br)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1cccc(Br)n1)C(=O)Sc1cccc(F)c1F | O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 | C/C(=N\ONc1cccc(Br)n1)C(=O)Sc1cccc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(Br)n1)C1=CC[C@H](c2cccc(F)c2F)S1 | O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 | O=C(Nc1cccc(Br)n1)C1=CC[C@H](c2cccc(F)c2F)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc(-c2cccc(F)c2F)cc1)Nc1cccc(Br)n1 | O=C(Cc1cccc(F)c1F)Nc1cccc(Br)n1 | O=C(NN=Cc1ccc(-c2cccc(F)c2F)cc1)Nc1cccc(Br)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C2C4"
} |
Can you make molecule COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NSC(=O)C[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NSC(=O)C[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NCC(=C=O)C[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NCC(=C=O)C[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CCCC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC(=O)CCCC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC(=O)CC(C)(C)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC(=O)CC(C)(C)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1NC[S@+]([O-])CCC[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | COc1ccccc1NC[S@+]([O-])CCC[C@@H]1CCCN(C(=O)Nc2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C39=O"
} |
Can you make molecule O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2I)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2Br)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)c(I)c2)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)c(I)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2cc(Cl)ccc2Cl)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2cc(Cl)ccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)c(Cl)c2)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)cc2)CC1 | O=C(NCc1ccc([N+]2=CCCC2)cc1)NC1(c2ccc(Cl)c(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)NCS[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)NCS[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N35"
} |
Can you make molecule CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N1CC([C@@H]2CCC[NH+](Cc3ncccc3C)C2)C1 | CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)N1CC([C@@H]2CCC[NH+](Cc3ncccc3C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N35"
} |
Can you make molecule CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)NC(=N)S[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)NC(=N)S[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N35"
} |
Can you make molecule CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)c1nsc([C@@H]2CCC[NH+](Cc3ncccc3C)C2)c1N | CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)c1nsc([C@@H]2CCC[NH+](Cc3ncccc3C)C2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N35"
} |
Can you make molecule CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N(C)C(=S)S[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)N[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | CCCC(=O)N(C)C(=S)S[C@@H]1CCC[NH+](Cc2ncccc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1(c2cccc(Cl)c2)CCC1)NCc1cccs1 | O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 | O=C(/C=C/SC1(c2cccc(Cl)c2)CCC1)NCc1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2cccs2)nc1C1(c2cccc(Cl)c2)CCC1 | O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 | O=Cc1sc(NCc2cccs2)nc1C1(c2cccc(Cl)c2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2cccs2)sc1C1(c2cccc(Cl)c2)CCC1 | O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 | O=Cc1nc(NCc2cccs2)sc1C1(c2cccc(Cl)c2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1cccs1)N/N=C/CC1(c2cccc(Cl)c2)CCC1 | O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 | O=C(NCc1cccs1)N/N=C/CC1(c2cccc(Cl)c2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1cccc(C2(N3CCC(=NONCc4cccs4)CC3)CCC2)c1 | O=C(NCc1cccs1)C1(c2cccc(Cl)c2)CCC1 | Clc1cccc(C2(N3CCC(=NONCc4cccs4)CC3)CCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C35"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](SCNC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](SCNC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N35"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](C2CN(C(=O)[C@@H](C)Sc3ncn[nH]3)C2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](C2CN(C(=O)[C@@H](C)Sc3ncn[nH]3)C2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N35"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](SC(=N)NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](SC(=N)NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N35"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](c2snc(C(=O)[C@@H](C)Sc3ncn[nH]3)c2N)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](c2snc(C(=O)[C@@H](C)Sc3ncn[nH]3)c2N)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N35"
} |
Can you make molecule C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@@H](SC(=S)N(C)C(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](NC(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | C[C@H]1[C@@H](SC(=S)N(C)C(=O)[C@@H](C)Sc2ncn[nH]2)CCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]([NH2+]Cc2cnc(Cl)cc2I)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2cnc(Cl)cc2I)c2ccc(F)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)cc1I",
"old_substring": "c18ccc(Cl)nc1"
} |
Can you make molecule COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)cc2I)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)cc2I)c2ccc(F)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c18ccc(Cl)nc1"
} |
Can you make molecule COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)s2)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)s2)c2ccc(F)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c18ccc(Cl)nc1"
} |
Can you make molecule COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)cc2Br)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)cc2Br)c2ccc(F)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c18ccc(Cl)nc1"
} |
Can you make molecule COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]([NH2+]Cc2cnc(Cl)c(Cl)c2)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2ccc(Cl)nc2)c2ccc(F)cc2)cc1 | COc1ccc([C@@H]([NH2+]Cc2cnc(Cl)c(Cl)c2)c2ccc(F)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)c(Cl)c1",
"old_substring": "c18ccc(Cl)nc1"
} |
Can you make molecule COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)[C@H](C)Sc2cc(I)ccc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2cc(I)ccc2Cl)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)[C@H](C)Sc2cc(Br)ccc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2cc(Br)ccc2Cl)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)[C@H](C)Sc2sc3sccc3c2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2sc3sccc3c2Cl)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)[C@H](C)Sc2sc3ccccc3c2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2sc3ccccc3c2Cl)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)[C@H](C)Sc2cc(Br)c(F)cc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2ccccc2Cl)cc(OC)c1 | COc1cc(NC(=O)[C@H](C)Sc2cc(Br)c(F)cc2Cl)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CCN1CCC(=NNC(=O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCC(=NNC(=O)c2ccccc2Cl)CC1 | CCN1CCC(=NNC(=O)c2ccccc2)CC1 | CCN1CCC(=NNC(=O)c2ccccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCN1CCC(=NNC(=O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCC(=NNC(=O)c2ccc(I)cc2)CC1 | CCN1CCC(=NNC(=O)c2ccccc2)CC1 | CCN1CCC(=NNC(=O)c2ccc(I)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCN1CCC(=NNC(=O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCC(=NNC(=O)c2ccc(C)c(I)c2)CC1 | CCN1CCC(=NNC(=O)c2ccccc2)CC1 | CCN1CCC(=NNC(=O)c2ccc(C)c(I)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCN1CCC(=NNC(=O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCC(=NNC(=O)c2cccc(Br)c2)CC1 | CCN1CCC(=NNC(=O)c2ccccc2)CC1 | CCN1CCC(=NNC(=O)c2cccc(Br)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCN1CCC(=NNC(=O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCC(=NNC(=O)c2cccc(C)c2C)CC1 | CCN1CCC(=NNC(=O)c2ccccc2)CC1 | CCN1CCC(=NNC(=O)c2cccc(C)c2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@H](C)N=O)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@H](C)N=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N=O",
"old_substring": "[C@H]5(C)O"
} |
Can you make molecule CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](O)CCBr)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](O)CCBr)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(O)CCBr",
"old_substring": "[C@H]5(C)O"
} |
Can you make molecule CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@H]2OC2(C)C)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@H]2OC2(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&OC1(C)C",
"old_substring": "[C@H]5(C)O"
} |
Can you make molecule CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](Cl)C#N)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](Cl)C#N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(Cl)C#N",
"old_substring": "[C@H]5(C)O"
} |
Can you make molecule CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@H](C)CC)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@@H](C)O)CC1 | CCCOc1ccc(Br)cc1C[NH+]1CCC([C@H](C)CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)CC",
"old_substring": "[C@H]5(C)O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.