sl_num
int64 1
315
| Poymer name
stringlengths 6
94
| SMILES (Atoms Ce and Th are placeholders for head and tail information, respectively)
stringlengths 10
130
| Experiment Tg (K)
int64 130
685
| Calculated Tg (K)
float64 138
951
| Calculated Tg std. dev. (K)
float64 1.76
74.7
| Experiment density at 300K (g/cc)
float64 0.84
1.95
⌀ | Calculated density at 300K (g/cc)
float64 0.82
2.05
| Calulated density at 300K std. dev. (g/cc)
float64 0
0.01
| Calculated glass CTE (10-6/K)
float64 104
484
⌀ | Calculated glass CTE std. dev. (10-6/K)
float64 2.66
19.5
⌀ | Calculated rubber CTE (10-6/K)
float64 268
1.68k
| Calculated rubber CTE std. dev. (10-6/K)
float64 12.9
290
|
|---|---|---|---|---|---|---|---|---|---|---|---|---|
101 | Poly(4-cyclohexyl- 1 -butene) | [Ce]CC(CCC1CCCCC1)[Th] | 313 | 301.1422 | 8.47868 | 1.04 | 1.015512 | 0.001938 | 392.104032 | 6.124392 | 975.914615 | 104.440099 |
102 | Poly(hexamethylene sebacamide) | [Ce]NCCCCCCNC(=O)CCCCCCCCC(=O)[Th] | 313 | 318.7764 | 16.083808 | null | 0.901046 | 0.002091 | 409.948947 | 14.895798 | 972.935282 | 75.718457 |
103 | Poly[(pentafluoroethyl)ethylene] | [Ce]CC(C(F)(F)C(F)(F)F)[Th] | 314 | 367.208135 | 10.143621 | null | 1.617776 | 0.006067 | 402.082962 | 11.258687 | 1,032.087179 | 33.089328 |
104 | Poly(11-aminoundecanoic acid) | [Ce]NCCCCCCCCCCC(=O)[Th] | 315 | 304.744805 | 12.347063 | 1.01 | 0.970208 | 0.001746 | 451.364041 | 4.390573 | 1,135.630141 | 143.271889 |
105 | Poly(t-butyl acrylate) | [Ce]CC(C(=O)OC(C)(C)C)[Th] | 315 | 378.438698 | 14.496185 | 1 | 0.995074 | 0.002995 | 368.595629 | 10.093717 | 887.900889 | 61.914175 |
106 | Poly(3-phenoxypropylene oxide) | [Ce]OC(COC1=CC=CC=C1)C[Th] | 315 | 329.563978 | 5.285329 | null | 1.151438 | 0.001629 | 372.178315 | 5.928987 | 973.009382 | 81.382158 |
107 | Poly(2,3,3,3-tetrafluoropropylene) | [Ce]CC(F)(C(F)(F)F)[Th] | 315 | 410.128737 | 8.05073 | null | 1.68747 | 0.007255 | 279.637309 | 8.370835 | 1,092.137533 | 66.113858 |
108 | Poly(10-aminodecanoic acid) | [Ce]C(=O)CCCCCCCCCN[Th] | 316 | 302.017172 | 15.538694 | null | 0.980401 | 0.00192 | 428.651596 | 6.79345 | 1,096.981632 | 136.855727 |
109 | Poly(3,3-dimethylbutyl methacrylate) | [Ce]CC(C)(C(=O)OCCC(C)(C)C)[Th] | 318 | 359.835343 | 5.597642 | null | 1.24254 | 0.002011 | 280.679572 | 5.190415 | 822.418753 | 65.697993 |
110 | Poly[oxy(m-phenylene)] | [Ce]C1=CC(=CC=C1)O[Th] | 318 | 390.992461 | 21.864824 | 1.001 | 0.968881 | 0.003937 | 357.906704 | 14.091132 | 962.909328 | 63.888121 |
111 | Poly(decamethylene sebacamide) | [Ce]NCCCCCCCCCCNC(=O)CCCCCCCCC(=O)[Th] | 319 | 302.012277 | 15.615466 | null | 0.983107 | 0.001238 | 437.370824 | 9.042431 | 1,086.857982 | 127.068069 |
112 | Poly(N-butyl acrylamide) | [Ce]CC(C(=O)NCCCC)[Th] | 319 | 297.254699 | 38.830107 | null | 1.011008 | 0.003126 | 443.720311 | 10.775673 | 1,053.100698 | 90.256413 |
113 | Poly(vinyl trifluoroacetate) | [Ce]CC(OC(=O)C(F)(F)F)[Th] | 319 | 407.015551 | 9.980196 | null | 1.546789 | 0.002979 | 345.741121 | 11.512704 | 1,041.475252 | 71.355945 |
114 | Poly(p-n-butoxy styrene) | [Ce]CC(C1=CC=C(C=C1)OCCCC)[Th] | 320 | 267.488623 | 10.383393 | null | 1.001312 | 0.003837 | 469.784059 | 7.269295 | 1,163.018947 | 104.845816 |
115 | Poly(isobutyl methacrylate) | [Ce]CC(C)(C(=O)OCC(C)C)[Th] | 321 | 375.179871 | 27.851584 | 1.045 | 1.003563 | 0.004445 | 357.181763 | 14.325263 | 943.12892 | 63.40661 |
116 | Poly(3-methyl-1-butene) | [Ce]CC(C(C)C)[Th] | 323 | 376.638828 | 9.513124 | null | 0.820401 | 0.002349 | 386.883222 | 11.06141 | 1,024.044199 | 67.141701 |
117 | Poly(9-aminononanoic acid) | [Ce]C(=O)CCCCCCCCN[Th] | 324 | 309.675055 | 13.602713 | null | 0.997215 | 0.003219 | 418.348416 | 7.64105 | 1,041.465684 | 116.896376 |
118 | Poly(vinyl butyral) | CCCC1OC([Ce])CC(C[Th])O1 | 324 | 316.402667 | 12.903258 | 1.04 | 1.014848 | 0.001379 | 393.252764 | 8.556758 | 989.584586 | 109.142456 |
119 | Poly(8-aminocaprylic acid) | [Ce]NCCCCCCCC(=O)[Th] | 324 | 336.198788 | 9.762434 | 1.083 | 1.052772 | 0.002201 | 406.119714 | 8.709747 | 1,271.147579 | 165.764812 |
120 | Poly(ethyl methacrylate) | [Ce]CC(C)(C(=O)OCC)[Th] | 324 | 420.320825 | 9.564542 | 1.34 | 1.287589 | 0.002327 | 213.486089 | 4.229106 | 714.654727 | 57.580661 |
121 | Poly(ethylene isophthalate) | C(=O)(O[Ce])C1=CC=CC(=C1)C(=O)OCC[Th] | 324 | 422.191376 | 14.932505 | 1.119 | 1.071475 | 0.00367 | 306.463048 | 10.188545 | 881.426445 | 57.720624 |
122 | Poly[(4-dimethylaminophenyl)phenylsilylenetrimethylene)] | [Ce][Si](C1=CC=CC=C1)(C1=CC=C(N(C)C)C=C1)CCC[Th] | 325 | 385.100726 | 6.816601 | null | 1.048138 | 0.001468 | 344.938281 | 8.534043 | 1,031.337627 | 89.16675 |
123 | Poly(isopropyl methacrylate) | [Ce]CC(C)(C(=O)OC(C)C)[Th] | 327 | 455.410666 | 18.84355 | 1.033 | 1.012558 | 0.004506 | 293.010211 | 10.731233 | 852.787239 | 55.595489 |
124 | Poly(methyl-p-xylylene) | [Ce]CC1=CC=C(C(C)=C1)C[Th] | 328 | 407.642681 | 9.474036 | null | 1.017567 | 0.002438 | 267.843904 | 7.477548 | 976.171269 | 100.331337 |
125 | Poly(vinyl isobutyral) | [Ce]CC(C(=O)C(C)C)[Th] | 329 | 355.615316 | 22.226533 | null | 0.980977 | 0.002432 | 403.047957 | 8.980966 | 883.551152 | 53.447262 |
126 | Poly(p-isopentoxy styrene) | [Ce]CC(C1=CC=C(C=C1)OCCC(C)C)[Th] | 330 | 311.012012 | 17.629702 | 1.24 | 1.201104 | 0.003658 | 404.659761 | 7.245662 | 950.919053 | 71.575441 |
127 | Poly(sec-butyl methacrylate) | [Ce]CC(C)(C(=O)OC(C)CC)[Th] | 330 | 324.09989 | 12.726396 | null | 1.038998 | 0.002383 | 365.817063 | 10.456466 | 925.133303 | 96.337715 |
128 | Poly(7-aminoheptanoic acid) | [Ce]C(=O)CCCCCCN[Th] | 330 | 428.678758 | 31.988733 | 1.052 | 0.998862 | 0.004747 | 340.440591 | 9.678167 | 876.757141 | 47.508106 |
129 | Poly(hexamethylene adipamide) | [Ce]C(=O)CCCCC(=O)NCCCCCCN[Th] | 330 | 322.930383 | 5.540175 | 1.07 | 1.069469 | 0.002166 | 336.942101 | 6.795127 | 850.789261 | 79.597138 |
130 | Poly(n-butyl a-chloroacrylate) | [Ce]C(Cl)(C(=O)OCCCC)C[Th] | 330 | 299.312022 | 16.84802 | null | 0.986494 | 0.003469 | 451.15716 | 11.613865 | 1,136.545464 | 96.442884 |
131 | Poly(oxydiphenylsilylene-1,3-phenylene) | [Ce]O[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC(=CC=C1)[Th] | 331 | 413.153892 | 16.436008 | null | 1.650037 | 0.005359 | 399.009345 | 19.519032 | 1,021.068212 | 24.155066 |
132 | Poly[(heptafluoropropyl)ethylene] | [Ce]CC(C(F)(F)C(F)(F)C(F)(F)F)[Th] | 331 | 427.933967 | 8.787143 | null | 1.144817 | 0.002421 | 246.260112 | 4.035481 | 828.46231 | 54.799353 |
133 | Poly(3-cyclopentyl- 1 -propene) | [Ce]CC(CC1CCCC1)[Th] | 333 | 369.247505 | 14.798746 | null | 1.054963 | 0.00391 | 322.281731 | 8.022443 | 908.943425 | 85.092816 |
134 | Poly(3-phenyl- 1-propene) | [Ce]CC(CC1=CC=CC=C1)[Th] | 333 | 350.881898 | 14.464831 | null | 0.910638 | 0.003022 | 421.934687 | 8.749274 | 958.29249 | 65.989327 |
135 | Poly(p-xylylene) | [Ce]CC1=CC=C(C=C1)C[Th] | 333 | 386.731279 | 6.386189 | 1.046 | 1.020299 | 0.001906 | 293.146416 | 4.552616 | 800.634635 | 45.754251 |
136 | Poly(e-caprolactam) | [Ce]NCCCCCC(=O)[Th] | 335 | 332.709378 | 8.377635 | 1.084 | 1.069731 | 0.001897 | 342.405387 | 5.097095 | 852.903099 | 81.368387 |
137 | Poly(ethylene- 1 ,4-naphthalenedicarboxylate) | [Ce]OC(=O)C1=CC=C(C2=CC=CC=C12)C(=O)OCC[Th] | 337 | 441.961801 | 5.185663 | 1.33 | 1.291871 | 0.001518 | 190.061171 | 5.075025 | 653.366036 | 49.386724 |
138 | Poly(p-n-propoxy styrene) | [Ce]CC(C1=CC=C(C=C1)OCCC)[Th] | 343 | 329.471623 | 34.597073 | null | 1.01226 | 0.003318 | 426.621611 | 12.069656 | 1,122.783749 | 84.82532 |
139 | Poly(n-propyl a-chloroacrylate) | [Ce]C(Cl)(C(=O)OCCC)C[Th] | 344 | 393.422203 | 27.004175 | 1.3 | 1.244297 | 0.004776 | 344.480925 | 13.848375 | 886.447346 | 60.375748 |
140 | Poly(ethylene-1,5-naphthalenedicarboxylate) | [Ce]OC(=O)C1=CC=CC2=C(C=CC=C12)C(=O)OCC[Th] | 344 | 433.515438 | 12.022477 | null | 1.301554 | 0.001809 | 198.667616 | 4.053157 | 643.585434 | 47.463477 |
141 | Poly(vinyl propional) | [Ce]CC(C(C)C(=O))[Th] | 345 | 426.695559 | 17.998515 | null | 1.008636 | 0.002804 | 271.682868 | 7.190388 | 695.042096 | 43.294289 |
142 | Poly(ethylene terephthalate) | [Ce]CCOC(=O)C1=CC=C(C=C1)C(=O)O[Th] | 345 | 434.032378 | 7.402032 | 1.385 | 1.278861 | 0.002408 | 210.012211 | 5.796779 | 690.896253 | 59.244009 |
143 | Poly(sec-butyl a-chloroacrylate) | [Ce]C(Cl)(C(=O)OC(C)CC)C[Th] | 347 | 380.000128 | 14.783709 | 1.24 | 1.18406 | 0.004431 | 328.58934 | 9.973545 | 824.8927 | 46.224024 |
144 | Poly(3-cyclohexyl- 1-propene) | [Ce]CC(CC1CCCCC1)[Th] | 348 | 421.944681 | 10.220274 | 1.385 | 1.373166 | 0.004206 | 218.990163 | 4.870662 | 798.510098 | 78.004437 |
145 | Poly(vinyl cyclopentane) | [Ce]CC(C1CCCC1)[Th] | 348 | 359.47235 | 12.104974 | null | 0.899126 | 0.003731 | 348.622581 | 10.698102 | 888.113858 | 55.345868 |
146 | Poly(vinyl chloride) | [Ce]CC(Cl)[Th] | 348 | 423.206705 | 17.793163 | null | 0.913014 | 0.003689 | 356.40168 | 10.308123 | 868.565948 | 56.590701 |
147 | Poly(2-hydroxypropyl methacrylate) | [Ce]CC(C)(C(=O)OCC(O)C)[Th] | 349 | 402.660319 | 12.716284 | null | 1.155012 | 0.003992 | 238.460586 | 10.096991 | 813.382983 | 56.249 |
148 | Poly(p-methoxymethyl styrene) | [Ce]CC(C1=CC=C(C=C1)COC)[Th] | 350 | 375.69795 | 23.91884 | null | 1.049872 | 0.001845 | 417.412642 | 5.701099 | 1,060.181869 | 87.045754 |
149 | Poly(chloro-p-xylylene) | [Ce]CC1=CC=C(C(Cl)=C1)C[Th] | 353 | 408.691834 | 8.2136 | null | 1.224619 | 0.002689 | 242.323373 | 4.145189 | 804.361386 | 67.293684 |
150 | Poly(bromo-p-xylylene) | [Ce]CC1=CC=C(C(Br)=C1)C[Th] | 353 | 429.946159 | 11.175809 | null | 1.584533 | 0.003376 | 215.950985 | 4.856794 | 725.058854 | 55.500394 |
151 | Poly(vinyl acetal) | [Ce]CC(OC(=O)C)[Th] | 355 | 409.235986 | 10.210316 | null | 1.149064 | 0.003726 | 323.560796 | 11.074267 | 950.046533 | 85.582129 |
152 | Poly(ethylene oxybenzoate) | [Ce]OC1=CC=C(C=C1)C(=O)OCC[Th] | 355 | 391.142052 | 6.219244 | null | 1.246191 | 0.002278 | 242.331781 | 5.731823 | 798.364199 | 72.888329 |
153 | Poly(vinyl alcohol) | [Ce]CC(O)[Th] | 358 | 412.724457 | 10.76299 | 1.19 | 1.219419 | 0.003829 | 179.333752 | 10.862055 | 755.617779 | 79.353193 |
154 | Poly[oxy(p-phenylene)] | [Ce]C1=CC=C(C=C1)O[Th] | 358 | 391.31995 | 13.60107 | null | 1.24275 | 0.001609 | 249.47509 | 5.258076 | 820.601909 | 80.388281 |
155 | Poly(p-sec-butyl styrene) | [Ce]CC(C1=CC=C(C=C1)C(C)CC)[Th] | 359 | 413.580015 | 26.48884 | null | 0.938583 | 0.002319 | 417.909725 | 11.321773 | 1,016.373857 | 57.29577 |
156 | Poly(p-ethoxy styrene) | [Ce]CC(C1=CC=C(C=C1)OCC)[Th] | 359 | 399.269335 | 24.990055 | null | 1.033743 | 0.00314 | 367.777698 | 10.519545 | 1,099.134281 | 92.109689 |
157 | Poly(2-hydroxyethyl methacrylate) | [Ce]CC(C)(C(=O)OCCO)[Th] | 359 | 421.26015 | 12.798771 | 1.15 | 1.208918 | 0.003694 | 202.762267 | 6.370119 | 721.539065 | 56.574698 |
158 | Poly(2-methyl-5-t-butyl styrene) | [Ce]CC(C1=C(C)C=CC(=C1)C(C)(C)C)[Th] | 360 | 455.048177 | 7.528811 | null | 1.288902 | 0.002793 | 194.631344 | 5.39404 | 518.101269 | 12.861888 |
159 | Poly(p-isopropyl styrene) | [Ce]CC(C1=CC=C(C=C1)C(C)C)[Th] | 360 | 444.33888 | 24.657303 | null | 0.941786 | 0.004236 | 398.990678 | 11.9397 | 1,020.342991 | 72.14228 |
160 | Poly[thio(p-phenylene)] | [Ce]C1=CC=C(C=C1)S[Th] | 360 | 512.483406 | 30.2978 | null | 0.91171 | 0.003052 | 307.567067 | 14.00825 | 708.994892 | 31.948173 |
161 | Poly(p-methoxy styrene) | [Ce]CC(C1=CC=C(C=C1)OC)[Th] | 362 | 439.284281 | 13.231664 | null | 1.065294 | 0.002247 | 301.492521 | 7.43925 | 996.112111 | 75.915721 |
162 | Poly(vinyl cyclohexane) | [Ce]CC(C1CCCCC1)[Th] | 363 | 451.062139 | 21.24186 | 1.27 | 1.218625 | 0.006694 | 272.142166 | 8.830376 | 802.806882 | 50.714375 |
163 | Poly(4-methoxy-2-methyl styrene) | [Ce]CC(C1=C(C)C=C(C=C1)OC)[Th] | 363 | 466.110514 | 14.891305 | null | 1.039204 | 0.003954 | 277.9719 | 8.340544 | 920.986535 | 56.43522 |
164 | Poly(cyano-p-xylylene) | [Ce]CC1=CC=C(C(C#N)=C1)C[Th] | 363 | 476.786434 | 19.508818 | 0.95 | 0.876625 | 0.005287 | 258.892795 | 11.242827 | 839.356521 | 51.424373 |
165 | Poly(m-xylylene adipamide) | [Ce]C(=O)CCCCC(=O)NCC1=CC=CC(=C1)CN[Th] | 363 | 461.270848 | 10.687636 | null | 1.071548 | 0.002834 | 195.421234 | 6.376313 | 722.944555 | 52.343504 |
166 | Poly(m-chloro styrene) | [Ce]CC(C1=CC(Cl)=C(C=C1))[Th] | 363 | 530.164067 | 29.851283 | null | 1.486942 | 0.008299 | 286.429007 | 10.553735 | 1,142.941483 | 83.587361 |
167 | Poly(isopropyl a-chloroacrylate) | [Ce]C(Cl)(C(=O)OC(C)C)C[Th] | 363 | 397.906321 | 11.005462 | null | 1.16 | 0.003525 | 239.27679 | 7.553755 | 742.116418 | 61.93501 |
168 | Poly(a,a,a',a'-tetrafluoro-p-xylylene) | [Ce]C(F)(F)C1=CC=C(C=C1)C(F)(F)[Th] | 363 | 460.595916 | 8.866469 | null | 1.188058 | 0.00321 | 247.831361 | 9.229928 | 774.201379 | 41.919232 |
169 | Poly(2-chloroethyl methacrylate) | [Ce]CC(C)(C(=O)OCCCl)[Th] | 365 | 403.690812 | 8.091467 | 1.32 | 1.26846 | 0.002827 | 252.764717 | 5.76509 | 735.187264 | 53.193106 |
170 | Poly(cyclohexylmethylsilane) | [Ce][Si](C)(C1CCCCC1)[Th] | 366 | 452.859842 | 15.055917 | 1.39 | 1.312426 | 0.004076 | 275.889821 | 9.972473 | 806.680926 | 54.357258 |
171 | Poly(ethyl a-chloroacrylate) | [Ce]CC(Cl)(C(=O)OCC)[Th] | 366 | 548.3058 | 33.552203 | null | 0.924176 | 0.004655 | 199.109397 | 10.300517 | 727.868063 | 51.09251 |
172 | Poly(1,4-cyclohexylidene dimethylene terephthalate) | [Ce]C(=O)C1=CC=C(C=C1)C(=O)OCC1CCC(CC1)CO[Th] | 368 | 426.864317 | 5.549878 | 1.196 | 1.156404 | 0.001999 | 225.331385 | 4.181651 | 740.600218 | 67.599428 |
173 | Poly(m-methyl styrene) | [Ce]CC(C1=CC(C)=C(C=C1))[Th] | 370 | 452.346241 | 8.81913 | null | 0.97709 | 0.002993 | 308.765109 | 10.196675 | 914.690851 | 48.756653 |
174 | Poly(2,5-dimethyl-p-xylylene) | [Ce]CC1=C(C)C=C(C(C)=C1)C[Th] | 373 | 484.348608 | 5.629854 | null | 0.973676 | 0.002848 | 233.11115 | 7.106647 | 1,010.413092 | 104.286195 |
175 | Polystyrene | [Ce]CC(C1=CC=CC=C1)[Th] | 373 | 438.467487 | 4.248451 | 1.92 | 2.049001 | 0.00527 | 216.80397 | 6.226646 | 817.469435 | 70.040122 |
176 | Phenoxy resin | [Ce]C1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)OCC(O)CO[Th] | 373 | 457.533739 | 14.350949 | 1.05 | 1.014307 | 0.003515 | 284.164106 | 6.371755 | 842.284331 | 50.195861 |
177 | Polychlorotrifluoroethylene | [Ce]C(F)(F)C(F)(Cl)[Th] | 373 | 423.067768 | 8.808586 | null | 1.128056 | 0.001988 | 225.403775 | 3.824426 | 936.491312 | 94.482557 |
178 | Poly(p-methyl styrene) | [Ce]CC(C1=CC=C(C=C1)C)[Th] | 374 | 491.487867 | 7.033676 | 1.04 | 0.975547 | 0.002657 | 310.986839 | 10.341109 | 979.175715 | 74.435519 |
179 | Poly(2,5-difluoro styrene) | [Ce]CC(C1=C(F)C=C(C(F)=C1))[Th] | 374 | 469.184064 | 10.505491 | null | 1.242829 | 0.003917 | 254.460587 | 9.029878 | 892.160846 | 38.107544 |
180 | Poly(o-ethyl styrene) | [Ce]CC(C1=C(CC)C=C(C=C1))[Th] | 376 | 433.897351 | 23.946807 | null | 0.98201 | 0.003552 | 299.770171 | 11.222518 | 764.977014 | 35.990052 |
181 | Poly(3,5-dimethyl styrene) | [Ce]CC(C1=CC(C)=C(C(C)=C1))[Th] | 377 | 460.78735 | 2.769738 | null | 0.953188 | 0.001342 | 320.000612 | 9.092029 | 957.826573 | 49.224932 |
182 | Poly(cyclohexyl methacrylate) | [Ce]CC(C)(C(=O)OC1CCCCC1)[Th] | 377 | 461.237412 | 17.321846 | 1.098 | 1.022527 | 0.003186 | 252.84878 | 10.284857 | 771.193881 | 47.167507 |
183 | Poly(o-vinyl pyridine) | [Ce]CC(C1=NC=CC=C1)[Th] | 377 | 506.58085 | 8.830393 | null | 1.076158 | 0.001817 | 222.636451 | 6.470314 | 722.278648 | 49.702381 |
184 | Polyacrylonitrile | [Ce]CC(C#N)[Th] | 378 | 483.890333 | 13.089991 | 1.17 | 1.117777 | 0.004242 | 196.320664 | 8.300187 | 802.125467 | 50.895715 |
185 | Poly(methyl methacrylate) | [Ce]CC(C)(C(=O)OC)[Th] | 378 | 454.25768 | 9.240833 | 1.184 | 1.078257 | 0.002068 | 157.518926 | 5.723541 | 532.09801 | 15.984068 |
186 | Poly(vinyl formal) | [Ce]CC1OCOC(C1)[Th] | 378 | 494.085692 | 8.1579 | 1.23 | 1.164786 | 0.005593 | 180.077973 | 6.110922 | 959.943309 | 106.254534 |
187 | Poly(o-fluoro styrene) | [Ce]CC(C1=C(F)C=C(C=C1))[Th] | 378 | 457.555558 | 8.451786 | null | 1.134366 | 0.002504 | 257.552718 | 7.969303 | 816.933604 | 39.988113 |
188 | Poly(2,3,4,5,6-pentafluoro styrene) | [Ce]CC(C1=C(F)C(F)=C(F)(C(F)=C1(F)))[Th] | 378 | 461.215846 | 12.182398 | null | 1.492432 | 0.004436 | 268.321847 | 4.130222 | 919.412887 | 28.605687 |
189 | Poly(p-fluoro styrene) | [Ce]CC(C1=CC=C(C=C1)F)[Th] | 379 | 471.92295 | 9.047261 | 1.15 | 1.355453 | 0.002296 | 132.909011 | 2.662061 | 475.872875 | 23.254794 |
190 | Poly(acrylic acid) | [Ce]CC(C(=O)O)[Th] | 379 | 465.584462 | 9.81468 | null | 1.130231 | 0.00352 | 276.813002 | 8.42519 | 857.331806 | 46.99537 |
191 | Poly(t-butyl methacrylate) | [Ce]CC(C)(C(=O)OC(C)(C)C)[Th] | 380 | 514.964736 | 15.997557 | 1.02 | 0.961573 | 0.004883 | 248.590785 | 8.646958 | 772.27362 | 43.430113 |
192 | Poly(3,4-dimethyl styrene) | [Ce]CC(C1=CC(C)=C(C=C1)C)[Th] | 384 | 482.991505 | 10.38692 | null | 0.955423 | 0.004364 | 301.165215 | 12.386686 | 949.000755 | 55.520323 |
193 | Poly(2-fluoro-5-methyl styrene) | [Ce]CC(C1=C(F)C=C(C(C)=C1))[Th] | 384 | 468.104749 | 12.672001 | null | 1.077686 | 0.002844 | 287.460275 | 9.477838 | 862.953531 | 37.728925 |
194 | Resin F | [Ce]C1=CC=CC(=C1)NC(=O)CCCC(=O)NC1=CC=CC(=C1)OCC(O)CO[Th] | 384 | 443.853725 | 9.631644 | null | 1.236963 | 0.00327 | 183.154731 | 6.44309 | 714.247731 | 59.032925 |
195 | Poly(2,4-dimethyl styrene) | [Ce]CC(C1=C(C)C=C(C=C1)C)[Th] | 385 | 526.021442 | 14.977179 | null | 0.955886 | 0.004298 | 279.402076 | 8.698784 | 890.827334 | 53.209194 |
196 | Poly(p-methoxycarbonyl styrene) | [Ce]CC(C1=CC=C(C=C1)C(=O)OC)[Th] | 386 | 491.885468 | 17.142371 | null | 1.130639 | 0.004298 | 255.823395 | 4.287639 | 851.070107 | 63.088395 |
197 | Poly(3-methyl-4-chloro styrene) | [Ce]CC(C1=CC(C)=C(C=C1)Cl)[Th] | 387 | 491.580533 | 13.180864 | null | 1.137345 | 0.004702 | 272.441015 | 7.795529 | 811.919904 | 42.702707 |
198 | Poly(cyclohexyl a-chloroacrylate) | [Ce]C(Cl)(C(=O)OC1CCCCC1)C[Th] | 387 | 468.077504 | 14.787336 | 1.25 | 1.180208 | 0.002643 | 243.175793 | 8.98057 | 740.906978 | 43.418165 |
199 | Poly(p-xylylene sebacamide) | [Ce]NCC1=CC=C(C=C1)CNC(=O)CCCCCCCCC(=O)[Th] | 388 | 371.821444 | 16.479719 | null | 1.089706 | 0.002008 | 311.563624 | 5.120354 | 847.701513 | 78.673564 |
200 | Poly[thio bis(4-phenyl)carbonate] | [Ce]C1=CC=C(C=C1)SC1=CC=C(C=C1)OC(=O)O[Th] | 388 | 442.881346 | 11.812882 | 1.355 | 1.321578 | 0.001805 | 202.130637 | 4.651575 | 644.025386 | 44.205027 |