Datasets:

parameterlab
/

scaling_mia_the_pile_00_DM_Mathematics

Dataset card Viewer Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
What is the third smallest value in 4/33, 851, -4, -25/36? 4/33 What is the second smallest value in -0.13, -2, 830, 5, -0.4, 3, 8/3? -0.4 What is the smallest value in 0, 0.08, -34, -1/4, 28, 2/7, -0.2? -34 What is the second smallest value in 75.6, -10/7, -2, 20, 4, -0.4? -10/7 Which is the fourth smallest value? (a) 0.3 (b) -1 (c) 4/15 (d) 0.704 (e) -2/213 a What is the third biggest value in 3.2, 11, 52/3, -0.14, 1/4, 5, 1? 5 What is the fourth biggest value in 23, 2, 8.41, -287? -287 Which is the biggest value? (a) -45 (b) -5 (c) -62 (d) -4 (e) 5 (f) 17 f Which is the smallest value? (a) 41 (b) 2 (c) 144/5 (d) -23 (e) 1 d Which is the third smallest value? (a) -0.07532 (b) 23.7 (c) 2/159 b Which is the third smallest value? (a) 2/13 (b) 11 (c) 1/4 (d) 4 (e) -0.1 (f) 57287 c Which is the third smallest value? (a) 6/29 (b) 2/49 (c) -3154 a Which is the fourth biggest value? (a) -0.0989 (b) 3 (c) 57 (d) -94 (e) 1/3 (f) -0.4 (g) -2 a What is the second smallest value in -17, -1/12, 0.129? -1/12 What is the fourth smallest value in -4, 0.3, 63, 1, -1, 5/6? 5/6 What is the smallest value in 0.07, -6, 0.222492? -6 What is the sixth biggest value in 2.4704, 0.3, 14, 3/5, -13, -2/11? -13 What is the second biggest value in -325, -1/74, 1/2293? -1/74 Which is the smallest value? (a) 3/2 (b) -3/461 (c) -31 (d) 0 c Which is the second smallest value? (a) -54 (b) 0.1 (c) -3/4 (d) 715 (e) -7 e What is the third smallest value in 412, 0.396, 17/19, -3/2? 17/19 What is the fourth biggest value in 2, -67, -1/2, 2/9, -6? -6 Which is the fifth smallest value? (a) 0.02 (b) 181 (c) 0.3 (d) -0.1 (e) 5/2 (f) 2/3 e Which is the smallest value? (a) -21 (b) 2/1797 (c) 0 (d) 0.02 a What is the fifth smallest value in 63, -22, 2/15, -3/88, 1, 5, -5/4? 1 Which is the fourth smallest value? (a) 16 (b) 1/12 (c) -966560.9 (d) 3/2 a Which is the smallest value? (a) 1 (b) 24192 (c) 28 a Which is the fourth biggest value? (a) -8.82 (b) -0.3 (c) -2/7 (d) 350 a What is the smallest value in -1/29, -0.2, -26409, -5/4, 0.1? -26409 What is the smallest value in 2, 5, -2/105, -4, 1073, 4/5, -1? -4 Which is the smallest value? (a) -1 (b) 1.7 (c) 0.26 (d) -22 (e) -1/7 (f) -4 d What is the fourth biggest value in 2, -16/3, -2/5, 0, -18, -361? -16/3 What is the second biggest value in -1, 1, -2, 1.57, -15, 0.042? 1 What is the third smallest value in -3, 6, 13/9, 0.02, -0.022? 0.02 Which is the fourth biggest value? (a) -0.11 (b) -0.3 (c) 0.1 (d) -7 (e) 2/11 (f) 0.04 (g) 0.048 f What is the third biggest value in -1/40, -1, -1/2, 2/9, 37.33? -1/40 What is the fourth biggest value in -49, 54, 3, -0.5, -3, 14/13? -0.5 Which is the smallest value? (a) -1741218/11 (b) 6 (c) -4 a What is the third biggest value in -35, 91/3, 3, 0.07, 0.4? 0.4 Which is the fourth smallest value? (a) -3/5 (b) 2/9 (c) -2/9 (d) 4159767 (e) 4 (f) -1 b What is the second biggest value in 7/205, -0.84, -4? -0.84 What is the fourth smallest value in 1, 3, 27, -1/5086? 27 Which is the biggest value? (a) -6 (b) -0.05 (c) 1 (d) -17 (e) -925 (f) -4 c What is the seventh biggest value in -1/3, -3/5, 0.23, -2/5, 0.0692, -2/17, -2/7? -3/5 Which is the fourth smallest value? (a) -36 (b) 102 (c) 0.2 (d) 0.15 b Which is the sixth biggest value? (a) 0.86 (b) -887 (c) 3 (d) -0.04 (e) 2/17 (f) -2 b What is the smallest value in 4, -1/3, 45414, -453? -453 What is the fifth biggest value in -0.5, 625, -1, -5, -0.086? -5 Which is the fifth smallest value? (a) -4 (b) -2/7 (c) -3 (d) 0.3 (e) 53 (f) -3/11 (g) 14 d What is the third smallest value in -2/9, -696, 0.1, 181? 0.1 What is the fourth biggest value in -62/29, 0.029, -4, -2/5, 339? -62/29 What is the biggest value in 2, 31, 2/165, 11353? 11353 Which is the sixth smallest value? (a) 2/15 (b) 1 (c) -15 (d) -0.4 (e) 244 (f) 1/5 e Which is the third biggest value? (a) -15 (b) 0 (c) -4/5 (d) -251405 (e) 2/9 c Which is the sixth smallest value? (a) 2 (b) 0.79 (c) 3/4 (d) 0 (e) -0.9 (f) 3 (g) -1/3 a What is the second smallest value in 75191.8, 2/19, 2, 0? 2/19 What is the fifth biggest value in -63, -8, 1/3, -0.5, -2/9, 0, -10? -8 What is the third smallest value in 1503, -689, -58? 1503 What is the biggest value in -12/5, 0.0415, -4, -2/11, -7/29? 0.0415 Which is the fourth smallest value? (a) 0.235 (b) -2 (c) -0.3 (d) 7351 (e) -4 (f) -3 c What is the fifth biggest value in 52, 0.0124, -9, 1.6, -2/13? -9 What is the second smallest value in 2, -5691741, 0.092? 0.092 Which is the third smallest value? (a) -1/5 (b) 1/1100 (c) -66106 b What is the sixth smallest value in -2, -5/17, 0.016, -0.2, 8, -1/2, 4? 4 What is the second smallest value in -264/115, -186/197, 1? -186/197 What is the fifth smallest value in -0.17, 0, 7/3, -2/9, -0.249, -32, -3? -0.17 What is the second biggest value in -1/3, 2/9, -108, -10002, -4, -2, -3/2? -1/3 Which is the smallest value? (a) -782/5931 (b) -1/2 (c) -0.3 b Which is the biggest value? (a) 2/1227 (b) -0.1 (c) -1/1764 a Which is the third smallest value? (a) -2/95 (b) -1/2 (c) -1317686 a Which is the smallest value? (a) 0.591 (b) -4/5 (c) 5 (d) -7 (e) 57 (f) 0 d Which is the third smallest value? (a) -28862 (b) 2.1 (c) -6 (d) 4/9 d What is the third biggest value in 1256, -32/9, 0.08? -32/9 What is the second biggest value in 3.8, -1/5, -2207, 0.5, -3, -5/2, -0.3? 0.5 What is the third biggest value in 6, 5, -0.1173, 3, 4, -3? 4 What is the fifth smallest value in -0.26, 3/2, -8.7, 5, 1/4? 5 Which is the seventh biggest value? (a) 1 (b) 16 (c) -0.05 (d) -3 (e) 5 (f) 3 (g) -1/9 d What is the fourth smallest value in -0.4, 1/7, -2, -38, 2/5, 3.786? 1/7 What is the third smallest value in -15, -0.0386, 2/3, -0.0419, 5, 2/7? -0.0386 Which is the third biggest value? (a) 3.39 (b) 94/447 (c) -5 (d) 2 b Which is the third smallest value? (a) 189068 (b) 83 (c) 0.1 a Which is the fourth biggest value? (a) 0 (b) -4 (c) -0.59 (d) 32 (e) 7 (f) -2/77 f What is the third biggest value in -324, 5, 0.3, 3/397? 3/397 Which is the third biggest value? (a) 4089 (b) 4 (c) 62224 b What is the fourth biggest value in 3, 3.2, 3/13, 9986? 3/13 Which is the sixth biggest value? (a) 119 (b) -3 (c) 4 (d) 2/417 (e) -0.5 (f) -4 (g) -5 f What is the biggest value in -1/2, -1, 5, -3/10, -2/21, -15/2? 5 What is the sixth smallest value in 2, -23, -14, -13, 1/4, 0.1, -4? 1/4 What is the second smallest value in -4, 6, 0, 1346/3, -0.6, 2? -0.6 Which is the third smallest value? (a) -6 (b) 0.06857 (c) -1.47 b Which is the third smallest value? (a) -66.8 (b) 4 (c) 11 (d) -0.02 (e) -25 d What is the second biggest value in -2431, -0.4, -352? -352 Which is the smallest value? (a) 0.5 (b) 711 (c) -2/11155 c What is the fourth smallest value in 15, -2, -4/195, 0? 15 What is the fifth smallest value in -975, 5, -1/3, 3, -0.66, -4/19? 3 Which is the biggest value? (a) 0.2 (b) 1/7 (c) -151804 (d) 6 (e) 1 (f) -0.5 d Which is the third smallest value? (a) 24 (b) 1 (c) 0 (d) 5.401 (e) 5 e Which is the fourth biggest value? (a) -5 (b) 605 (c) 9 (d) 108 (e) -0.4 (f) 1 f Which is the smallest value? (a) 1/14 (b) 541 (c) -0.08 (d) 3/5 (e) -403 (f) -0.4 (g) -2/3 e Which is the fourth biggest value? (a) 1/1106 (b) 0.5 (c) 0.3 (d) 7/6 (e) 12.8 (f) 0.4 f What is the fourth smallest value in 0.55, -0.5, 11, -3.2? 11 What is the third biggest value in -1, -6/29, 31, -4, 4? -6/29 Which is the fourth biggest value? (a) -0.2 (b) -0.9 (c) -0.005 (d) 2242 b What is the smallest value in -3, 2, 88, -40, 2/3, 2/17? -40 What is the fifth biggest value in -554, -4/7, -2, 1/7, -2/67, 3, 5? -4/7 Which is the third smallest value? (a) -1/2 (b) 4 (c) -1 (d) -30114 a What is the second biggest value in 5.9, 42, -10.5? 5.9 What is the biggest value in -1, 0.1, 28870690? 28870690 Which is the second smallest value? (a) -9 (b) 58601 (c) 2 c Which is the smallest value? (a) 0.4 (b) 3/4 (c) -25 (d) -0.3504 c What is the smallest value in 2/7, 3/7, 4/6931, 1, 4/3, 0? 0 What is the fourth biggest value in -33, 1, 181651, -0.1? -33 What is the second smallest value in 1/8, 1/32,	{ "pile_set_name": "DM Mathematics" }
? -0.1 Let d = 0.005 + -0.038. Let o = d - 5.767. Let l = 6 + o. What is the closest to 2 in 0, 3/7, l? 3/7 Let q = 0.4 + -0.8. Let j = q - -0.3. Let k = j + 0. What is the nearest to k in 2, 0.4, -0.5? -0.5 Let u = -0.4 - -0.3. Let b(c) = -c*3 + 2c*2 + 8c + 4. Let w be b(4). What is the nearest to -0.2 in 0.4, u, w? u Let f = -0.6 + 0.7. Which is the nearest to f? (a) 7 (b) -0.5 (c) 2/3 c Let y = -17 + 17. Let i(s) = -s*3 + 7s*2 - 5s - 8. Let v be i(6). Let p = -3 + v. Which is the nearest to y? (a) -0.4 (b) 1 (c) p a Suppose 4 = 5z - 3n, -2z - n + 2n = -2. Which is the closest to z? (a) -0.3 (b) 0.3 (c) 2/7 b Let h(n) = 3n2 + 17n - 1. Let l be h(-6). Which is the closest to -1? (a) l (b) 3/8 (c) -5 b Suppose -162 = 4j - j. Let y = j + 325/6. Let v = -3 - -7. Which is the closest to 1/4? (a) 4/7 (b) y (c) v b Let q = -4 - -4. Let j = q + -1. Let s be (-6)/4 + (-143)/(-66). What is the nearest to -0.2 in -4, j, s? j Let z = 164.5 + -165. Let q = -0.5 - 0.5. Let l = -32 - -226/7. What is the nearest to q in z, -4, l? z Let k = -4.2 + 4.7. Which is the closest to 0.1? (a) k (b) 0.1 (c) 4 b Let u = -3/44 + -2/11. What is the closest to 0 in u, -0.07, 3? -0.07 Suppose 5z - 14 + 44 = 0. Let j be z(-3 + (-20)/(-6)). Which is the closest to 0? (a) -3/5 (b) j (c) -1 a Let p be (0(-1)/(-3))/(1/1). Let o be 4/126/(-8). Which is the closest to o? (a) p (b) -0.4 (c) 0.4 b Let t = 2.8 + -3. Which is the closest to -1/4? (a) -0.1 (b) t (c) -2/15 b Let t = -7.5 + 6. Let v = t - 0.5. Let p = 91 + -90. Which is the nearest to p? (a) 3 (b) -0.5 (c) v b Let x = -84.11 + 84. Which is the nearest to -0.2? (a) x (b) -3 (c) 2 a Let f = 14 + -14. Which is the nearest to f? (a) 1 (b) 3/2 (c) 5 a Let i = -76 - -76.4. Let h = -5 - -4.6. Which is the closest to -0.1? (a) -4 (b) h (c) i b Let g = 0.9 + -1. Let v = 110/9 - 112/9. Which is the nearest to g? (a) 1/3 (b) v (c) -1 b Let s = 4 - 6. Let h = -155 - -156. What is the closest to h in s, -3, 2? 2 Let q be (2 + -1)/((3 - 1) + -6). Which is the nearest to 1? (a) -1 (b) 1 (c) q b Let g = -2.5 - 0.5. Let x = -5 - g. What is the nearest to x in 2/3, -4, 2/7? -4 Let o = -1.8 + 1.93. Let p = -4.87 - o. Which is the nearest to 0? (a) p (b) -1/2 (c) -4/7 b Let i = 112.986 - -0.014. Let m = 110.04 - i. Let t = m - 0.04. Which is the nearest to -0.1? (a) 2/5 (b) 0.3 (c) t b Let l = 0.04 - -2.96. Let q = 2.6 + -2.4. Which is the nearest to q? (a) 5 (b) -2 (c) l b Let y = 5.94 + 0.06. Let l = 4 - y. Which is the closest to 1? (a) l (b) 2/5 (c) 0.5 c Suppose 3z + 2h - 1 = 0, 4z = z + 5h - 13. Let r be z - ((-2)/(-2) + -6). Suppose 2n = n - 4. Which is the nearest to 2? (a) r (b) -1 (c) n a Suppose -4t = -0t - 8. Suppose -5f - 3c - 667 = 0, -tf = -3f + 3c - 119. Let y = -397/3 - f. What is the nearest to 0.2 in y, -0.1, 0.2? 0.2 Let m = 261/5 + -52. What is the closest to 1/4 in 0.7, m, 1? m Let r = 796/7 - 114. Let k = 3 - 2.5. Which is the closest to r? (a) 0 (b) -0.4 (c) k b Let h = 0.2 - 0.1. Suppose 0 = q - n - 6, 0 = 5q - 10q - 3n - 10. What is the closest to q in 5, h, 0.5? 0.5 Let o be (3/8)/((-2)/156). Let m = o - -29. What is the closest to 1 in 1, 4, m? 1 Let u = 0 + 6. Suppose f - uf + 5 = 0. Let m = -41 - -40.5. What is the nearest to -1/3 in m, -0.1, f? m Let j be ((-3)/18)/(3/(-18)). Let p be -3 - (8/(-6) - j). Which is the closest to p? (a) -3 (b) 0 (c) 0.3 b Let s = 4.64 - 1.64. Let l be -4 + (-4)/(-2) + 7. What is the closest to -2/3 in s, -3/5, l? -3/5 Let x = 0 + 0.4. Let q = x + -0.3. What is the nearest to -2/5 in q, 3/2, 1? q Let w = 2 - 6. Let y = -231.9 - -216. Let s = 16 + y. What is the closest to s in -5, w, 0.4? 0.4 Suppose -4n = 4d - 24, -3n - d = -4 - 10. Let j = 5 - 5.1. Which is the closest to j? (a) -2/13 (b) n (c) -1 a Let p = 4 - 12. Let g = -8 - p. Which is the closest to g? (a) -2 (b) 2/11 (c) 1 b Suppose 0 = 3h - 0h - 258. Let l = h - 169/2. Let g = -2 + 4. Which is the closest to -0.1? (a) g (b) -2 (c) l c Let n = -0.1 - -0.3. Suppose -6 = 2q - 2, 2q = -2z. Let x(i) = i2 - i - 1. Let l be x(0). What is the nearest to l in z, n, 4? n Let t = -233/9 - -26. What is the nearest to -0.1 in t, 2, -0.2? -0.2 Let j = 10 + -18. Let q be j/(-40) + (-16)/30. What is the nearest to q in -2/9, 0.5, 0? -2/9 Let z = -57 + 63. Which is the closest to 2/5? (a) 5 (b) 0.4 (c) z b Let m = 0.4 + -10.4. Which is the closest to m? (a) 2/9 (b) 0.1 (c) 0 c Let p = -2.9 - -13.9. Let n = 7 - p. Which is the closest to 1? (a) -3/8 (b) 0.3 (c) n b Let b = -0.031 + 0.031. What is the nearest to b in -2, 0.5, -5/3? 0.5 Let p be -2 + 0/(2 - -1). Let m be 15/20(-2)/3. Which is the nearest to p? (a) -2 (b) m (c) 2 a Let v = -6.9 + 7. Which is the closest to -0.1? (a) -3 (b) v (c) 0.2 b Let v = 59 + -237/4. What is the closest to -1 in v, -0.3, -2? -0.3 Let j = -38 - -38.29. Let d = j + -0.19. What is the closest to d in 0.1, 2/9, 4? 0.1 Let p be (5/(-9))/5(4 + -1). Let w = -0.3 + 6.3. Let k = -1 + w. What is the nearest to p in 4, 2/3, k? 2/3 Suppose 7r = r. Which is the closest to -6? (a) 3 (b) -4 (c) r b Let t = -22.3 - -22. Let x = 0.42 - 0.02. Which is the nearest to -1? (a) t (b) x (c) -0.1 a Let x be ((-2)/4)/(3/((-36)/(-15))). What is the nearest to -2 in 3, x, 8? x Let z = 0.03 + 1.97. Let b = 15.62 - -0.38. Let m = 15.8 - b. What is the closest to z in 2/9, m, -3/2? 2/9 Suppose -5d - 1 - 4 = 0. Let j(x) = x3 - 2x*2 + 1. Let b be j(d). Let h = -19 - -19.1. What is the nearest to b in 3, 0.4, h? h Let a = 77 - 81. Let g be (-14)/(-8) - 12. What is the closest to 2/5 in g, a, -2? g Let a(b) = -b - 7. Let n be a(-4). What is the closest to n in -3/5, 0.5, 0? -3/5 Let s = -11.8 + 11.6. Which is the closest to -7? (a) -1/2 (b) -1/6 (c) s a Let p = 6 + -5. Which is the nearest to 2? (a) 1/3 (b) p (c) -4 b Let g = -25/2 - -12. Which is the nearest to 0? (a) -1.3 (b) g (c) 2 b Let j = 0.96 + 0.04. What is the nearest to j in 0.3, -4, -0.5? 0.3 Let z(k) = -k*2 + 3k + 6. Let f be z(5). Let w = -3962/15 - -264. What is the nearest to 0.5 in -2/9, f, w? w Let z = -0.1 + -3.9. Let r = -109 + 104. Which is the closest to -2/5? (a) r (b) -3/7 (c) z b Let n = -0.2 - 0.3. Let k(u) = -16u + 15. Let o be k(1). Which is the closest to 0? (a) o (b) n (c) 5/3 b Suppose 0 = -r - 5q - 3 - 8, 4r - 2q = 22. Let i = r + -8. Which is the closest to -2? (a) -0.1 (b) 2/5 (c) i a Let t = 1300/7 - 186. Let r = 0 + -0.1. What is the closest to -0.1 in 0.4, r, t? r Let z = 3 + 4. Let n = 10 - z. Let j be 1 + -3 + 14/8. Which is the closest to -0.1? (a) j (b) -1/8 (c) n b Let p = 1 + -0.9. Let b be 2/(-6)(-4 + 1). Let v be (b/(-5))/((-10)/(-125)). What is the nearest to p in 0.1, v, -2? 0.1 Let l = -9 - -8.97. Let p = 0.47 - l. Which is the nearest to 0.1? (a) -2/3 (b) p (c) -1/6 c Let q = -5160/41 + 126. Let j = q - 160/533. What is the closest to -2/3 in 2, -1, j? -1 Let r be (-44)/56 - (-2)/7. Let h = 60 - 239/4. Which is the nearest to 0.2? (a) h (b) 2/5 (c) r a Let c = 65/2 - 33. Let j = 475/2552 + -1/232. What is the nearest to -5 in 0.2, c, j? c Let w = 7 + -6.7. Let o = -4.02 + 0.02. What is the closest to -1 in w, o, 4? w Let m(g) = -2g. Let f be m(2). Suppose -2 + 1 = l. Which is the closest to l? (a) -2 (b) f (c) 2/7 a Let i = 22 - 67/3. Let s be -3(-1)/(-5)1. Let p = -5 + 8. Which is the closest to i? (a) p (b) 1/2 (c) s c Let p = -1 - -0.9. Let m = -0.3 - -0.5. Let n = p + m. What is the nearest to n in -3, 2, 1? 1 Let g be 2/630/(-6). Let q = 0.26 - -0.04. Which is the nearest to 0? (a) g (b) -1 (c) q c Let t = -1 + 1. Let m be (-3 + -5)1/2. Which is the nearest to t? (a) m (b) -2 (c) -0.5 c Let v = 12 + -12.2. Let t = -42 + 292/7. Which is the nearest to 0.1? (a) v (b) t (c) 2 a Let d = -5 + 3. Let f = 3.7 + -3.6. Which is the closest to 0.3? (a) d (b) -5 (c) f c Let l = -5/28 + 121/364. Let d = 1.3 + 9.7. Let o = 10.9 - d. Which is the nearest to o? (a) 1/4 (b) l (c) 3/7 b Let y be (-54)/(-90) - (1 - (-22)/(-30)). Let j be (6/28)/(12/(-16)). Which is the nearest to j? (a) -5 (b) -2/9 (c) y b Let i = 22.5 + -23. What is	{ "pile_set_name": "DM Mathematics" }
e remainder when 227 is divided by 76. 75 Calculate the remainder when 238 is divided by 62. 52 Calculate the remainder when 417 is divided by 389. 28 Calculate the remainder when 78 is divided by 40. 38 What is the remainder when 327 is divided by 71? 43 Calculate the remainder when 53 is divided by 15. 8 Calculate the remainder when 669 is divided by 14. 11 Calculate the remainder when 892 is divided by 47. 46 Calculate the remainder when 280 is divided by 15. 10 Calculate the remainder when 319 is divided by 164. 155 What is the remainder when 729 is divided by 241? 6 What is the remainder when 8440 is divided by 50? 40 Calculate the remainder when 2997 is divided by 200. 197 What is the remainder when 178 is divided by 3? 1 What is the remainder when 58 is divided by 23? 12 Calculate the remainder when 1111 is divided by 18. 13 Calculate the remainder when 9207 is divided by 47. 42 What is the remainder when 144 is divided by 39? 27 What is the remainder when 4931 is divided by 39? 17 What is the remainder when 79 is divided by 16? 15 What is the remainder when 806 is divided by 37? 29 Calculate the remainder when 32 is divided by 13. 6 What is the remainder when 290 is divided by 73? 71 What is the remainder when 1295 is divided by 264? 239 What is the remainder when 105 is divided by 55? 50 What is the remainder when 36203 is divided by 86? 83 What is the remainder when 340 is divided by 10? 0 Calculate the remainder when 399 is divided by 153. 93 What is the remainder when 87 is divided by 15? 12 Calculate the remainder when 366 is divided by 46. 44 Calculate the remainder when 275 is divided by 271. 4 Calculate the remainder when 107 is divided by 11. 8 Calculate the remainder when 373 is divided by 38. 31 What is the remainder when 2403 is divided by 160? 3 Calculate the remainder when 6381 is divided by 303. 18 Calculate the remainder when 16 is divided by 9. 7 What is the remainder when 131 is divided by 83? 48 What is the remainder when 85 is divided by 33? 19 Calculate the remainder when 7627 is divided by 212. 207 What is the remainder when 122 is divided by 33? 23 Calculate the remainder when 357 is divided by 4. 1 Calculate the remainder when 634 is divided by 16. 10 Calculate the remainder when 1890 is divided by 28. 14 Calculate the remainder when 114 is divided by 20. 14 What is the remainder when 3249 is divided by 58? 1 What is the remainder when 396 is divided by 19? 16 What is the remainder when 44 is divided by 34? 10 Calculate the remainder when 32 is divided by 3. 2 Calculate the remainder when 222 is divided by 33. 24 What is the remainder when 571 is divided by 41? 38 Calculate the remainder when 19595 is divided by 280. 275 Calculate the remainder when 31 is divided by 9. 4 Calculate the remainder when 2323 is divided by 2299. 24 Calculate the remainder when 247 is divided by 131. 116 Calculate the remainder when 51 is divided by 38. 13 What is the remainder when 788 is divided by 25? 13 What is the remainder when 669 is divided by 84? 81 Calculate the remainder when 567 is divided by 71. 70 What is the remainder when 292 is divided by 27? 22 Calculate the remainder when 87 is divided by 17. 2 Calculate the remainder when 554 is divided by 182. 8 What is the remainder when 1752 is divided by 10? 2 Calculate the remainder when 149 is divided by 83. 66 Calculate the remainder when 51 is divided by 49. 2 What is the remainder when 508 is divided by 34? 32 Calculate the remainder when 500 is divided by 154. 38 What is the remainder when 159 is divided by 7? 5 What is the remainder when 81 is divided by 8? 1 Calculate the remainder when 149 is divided by 35. 9 Calculate the remainder when 105 is divided by 12. 9 Calculate the remainder when 99 is divided by 25. 24 Calculate the remainder when 232 is divided by 25. 7 What is the remainder when 827 is divided by 80? 27 Calculate the remainder when 4339 is divided by 41. 34 Calculate the remainder when 569 is divided by 22. 19 What is the remainder when 606 is divided by 7? 4 What is the remainder when 1643 is divided by 65? 18 Calculate the remainder when 964 is divided by 42. 40 Calculate the remainder when 3148 is divided by 25. 23 What is the remainder when 939 is divided by 154? 15 Calculate the remainder when 258 is divided by 204. 54 What is the remainder when 239 is divided by 86? 67 Calculate the remainder when 4335 is divided by 1082. 7 What is the remainder when 1451 is divided by 132? 131 What is the remainder when 488 is divided by 70? 68 What is the remainder when 316 is divided by 23? 17 What is the remainder when 17 is divided by 11? 6 Calculate the remainder when 418 is divided by 138. 4 Calculate the remainder when 43 is divided by 22. 21 What is the remainder when 66 is divided by 53? 13 What is the remainder when 1381 is divided by 362? 295 Calculate the remainder when 1692 is divided by 24. 12 What is the remainder when 584 is divided by 278? 28 Calculate the remainder when 4730 is divided by 64. 58 What is the remainder when 338 is divided by 44? 30 What is the remainder when 992 is divided by 100? 92 What is the remainder when 1194 is divided by 120? 114 What is the remainder when 522 is divided by 176? 170 What is the remainder when 2588 is divided by 70? 68 Calculate the remainder when 156 is divided by 18. 12 What is the remainder when 2130 is divided by 35? 30 Calculate the remainder when 76 is divided by 9. 4 What is the remainder when 206 is divided by 7? 3 What is the remainder when 1980 is divided by 28? 20 Calculate the remainder when 1275 is divided by 42. 15 What is the remainder when 1494 is divided by 1481? 13 What is the remainder when 2335 is divided by 21? 4 Calculate the remainder when 2700 is divided by 247. 230 Calculate the remainder when 591 is divided by 13. 6 What is the remainder when 3077 is divided by 110? 107 Calculate the remainder when 2024 is divided by 32. 8 Calculate the remainder when 349 is divided by 70. 69 Calculate the remainder when 290 is divided by 110. 70 Calculate the remainder when 680 is divided by 22. 20 Calculate the remainder when 228 is divided by 33. 30 Calculate the remainder when 1065 is divided by 82. 81 Calculate the remainder when 120 is divided by 18. 12 Calculate the remainder when 98 is divided by 34. 30 What is the remainder when 90 is divided by 13? 12 Calculate the remainder when 1036 is divided by 80. 76 Calculate the remainder when 354 is divided by 71. 70 Calculate the remainder when 55 is divided by 46. 9 Calculate the remainder when 774 is divided by 97. 95 Calculate the remainder when 66 is divided by 56. 10 What is the remainder when 2691 is divided by 118? 95 Calculate the remainder when 28195 is divided by 241. 239 What is the remainder when 38 is divided by 13? 12 Calculate the remainder when 101 is divided by 23. 9 Calculate the remainder when 1831 is divided by 7. 4 What is the remainder when 1486 is divided by 184? 14 What is the remainder when 968 is divided by 18? 14 What is the remainder when 306 is divided by 8? 2 What is the remainder when 985 is divided by 21? 19 Calculate the remainder when 1625 is divided by 52. 13 What is the remainder when 252 is divided by 8? 4 What is the remainder when 162 is divided by 68? 26 What is the remainder when 18249 is divided by 146? 145 What is the remainder when 2829 is divided by 118? 115 Calculate the remainder when 480 is divided by 61. 53 What is the remainder when 931 is divided by 18? 13 Calculate the remainder when 5303 is divided by 26. 25 Calculate the remainder when 1025 is divided by 999. 26 Calculate the remainder when 120 is divided by 53. 14 What is the remainder when 668 is divided by 127? 33 What is the remainder when 2296 is divided by 114? 16 What is the remainder when 371 is divided by 163? 45 What is the remainder when 471 is divided by 124? 99 Calculate the remainder when 1664 is divided by 137. 20 Calculate the remainder when 11 is divided by 1. 0 What is the remainder when 302 is divided by 80? 62 Calculate the remainder when 5123 is divided by 41. 39 Calculate the remainder when 276 is divided by 82. 30 What is the remainder when 2331 is divided by 53? 52 What is the remainder when 735 is divided by 735? 0 C	{ "pile_set_name": "DM Mathematics" }
be the first derivative of -2 - 7/2f2 + 0f*3 + 0f + 0f4 + 16/5f*5. Find the second derivative of i(z) wrt z. 192z2 Let g(t) = t3 - t*2 - t + 2. Let u be g(2). Suppose uy = 7y - 9. Differentiate -6 + fy + 15 + 3f*3 - 6f*3 with respect to f. -6f*2 Let x(w) be the second derivative of 0 + 0w*6 + 0w*3 + 0w*5 - 5/21w*7 - 11/12w*4 + 0w*2 - 7w. Find the third derivative of x(b) wrt b. -600b2 Let n(f) be the third derivative of 7f7/10 - f5/60 - 9f4 + 3f*2 + 6f. What is the second derivative of n(i) wrt i? 1764i2 - 2 Let z be 0/((-2)/(-3 + 4)). Suppose 2b - 2d + 3d - 17 = z, 0 = 4b - 4d - 64. Find the second derivative of -20i - 5i*2 + bi + 10i2 wrt i. 10 Let x(p) = -1869p*3 + 1773p*2 - 7p + 7. Let j(o) = 934o3 - 887o*2 + 3o - 3. Let s(d) = 7j(d) + 3x(d). What is the third derivative of s(b) wrt b? 5586 What is the second derivative of 19r - 12r - 6 + 28r3 + 70r*3 wrt r? 588r Let g(k) = 11k - 12. Let o = 55 - 60. Let s(f) = -11f + 11. Let t(n) = og(n) - 6s(n). What is the first derivative of t(c) wrt c? 11 Suppose 0 = 4q + g - 13, 3q + g + g = 6. Suppose h + 5t - 10 = -4h, -4 = h + qt. Find the second derivative of 0f*4 + 0f*4 - hf*4 + 4f - f*4 wrt f. -60f*2 Differentiate -76c + 5648 + 5607 - 10900 + 315c wrt c. 239 Let f = -150 + 150. Let g be (-8)/(-2) + (-3)/3. Find the first derivative of 5 + w - 1 - gw + fw wrt w. -2 Let i(x) be the second derivative of x5/20 + 55x*4/6 + 107x*3/6 + 24x - 8. Find the second derivative of i(b) wrt b. 6b + 220 Let s(y) be the third derivative of 49y*4/12 + 47y*3/2 - 47y*2. What is the derivative of s(i) wrt i? 98 Let c(f) be the second derivative of 0f*7 - 5/2f*2 + 0f*6 + 3/20f*5 - f - 1/4f*4 + 0f*3 + 3 - 3/56f*8. Find the third derivative of c(s) wrt s. -360s3 + 18 Let o(s) be the first derivative of s9/432 + 13s6/360 - 8s*3 - 12. Let l(c) be the third derivative of o(c). What is the third derivative of l(i) wrt i? 420i2 Let i(q) be the second derivative of q7/15 + 5q3/3 - 15q*2/2 - 9q. Let m(b) be the first derivative of i(b). What is the derivative of m(n) wrt n? 56n3 Let w(m) be the first derivative of 12m*6 - 15m*2/2 + 2m - 34. What is the second derivative of w(q) wrt q? 1440q3 Let y(c) be the third derivative of -137c*5/60 + 43c*4/24 - 102c*2. What is the second derivative of y(g) wrt g? -274 Let m(i) = -i + 1. Let t(d) = -208d*2 + 12d - 32. Let b(l) = -10m(l) - t(l). Find the second derivative of b(z) wrt z. 416 Find the second derivative of 606t*4 - 1 + 38t - 260t4 - 270t*4 - 210t*4 wrt t. -1608t*2 Let o(r) = 41r*3 - 9r*2 - 18r + 453. Let n(c) = -21c3 + 4c*2 + 8c - 225. Let d(z) = 9n(z) + 4o(z). Differentiate d(t) with respect to t. -75t2 Let f(k) be the first derivative of -9/2k*2 + 16 + 9/2k*4 + 0k + 0k3. What is the second derivative of f(n) wrt n? 108n Let w be (-2 - 4 - -8) + (-1 - -4). Find the second derivative of -44q2 - wq + 18q2 + 17q wrt q. -52 Let v(g) be the first derivative of -g6/40 + g5/6 + g*2 + 15. Let x(y) be the second derivative of v(y). Find the third derivative of x(j) wrt j. -18 Let i(g) be the second derivative of -3g8/280 - g6/120 - 2g3 + 13g. Let b(y) be the second derivative of i(y). Find the third derivative of b(q) wrt q. -432q Let c(h) be the second derivative of -h6/5 + h2 - h - 27. What is the first derivative of c(y) wrt y? -24y3 Let d(u) = -u2 - u + 1. Let x(y) = 2y + 0 + 2 + 3y + 7y2 + 6y. Let p(s) = -2d(s) + x(s). What is the second derivative of p(a) wrt a? 18 Let n(g) = -4g*4 + 8g*3 + 33g - 41. Let f(t) = -3t4 + 5t*3 + 23t - 27. Let a(h) = 7f(h) - 5n(h). Find the second derivative of a(o) wrt o. -12o2 - 30o What is the derivative of 546823y + 320 - 4y*2 - 546823y wrt y? -8y Let p(d) be the third derivative of d5/3 + d4/8 + 59d3/3 + d2 - 68d. What is the second derivative of p(o) wrt o? 40 Let a(o) = -o2 - o + 1. Let y(c) = 94c*3 - 10c*2 - 10c + 70. Let r(z) = -10a(z) + y(z). What is the derivative of r(i) wrt i? 282i*2 Let v(g) = 3g*2 - g. Let w(s) = 3 + 0 - 3 - 3s*2. Let c be 2/(-34/(-42)). Let k(p) = cw(p) + 6v(p). What is the second derivative of k(r) wrt r? -6 Let y(m) = -m - 2 - 2 + 4. Let u(f) = 7f + 7. Let z(d) = u(d) + 3y(d). What is the first derivative of z(b) wrt b? 4 Let w be (-4)/8(-30)/5. Find the second derivative of 17i - i*2 + 3i*2 - wi - 7i2 wrt i. -10 Let y(h) = -h - 5. Let r be y(-5). Suppose 2 = -0w + 4w - 2o, -3w + o + 3 = r. What is the second derivative of 0c*2 - 12c + 3cw + 5c wrt c? 6 Suppose -4x + 6 = -2. Let p(q) be the first derivative of -8 - 6q + 4qx - 2q*2 - 6q*2 + 3q*2. Find the first derivative of p(g) wrt g. -2 Let n = 12 - 8. Let k be (-6 - -6)/((-1)/(-1)). Differentiate kd*n + 2d*4 - 1 - 4d*4 + 3 with respect to d. -8d3 Let r(i) = i2 - 4i - 16. Let d be r(8). Suppose -2 = -3w + d. Find the third derivative of -9qw + 5q2 - q6 + 11q6 + 0q*2 wrt q. 120q3 Find the second derivative of t2 + 139 + 31t5 + 2t*2 + 50 - 3t*4 + 3t*4 - t wrt t. 620t3 + 6 Let s(u) be the second derivative of -u5/10 + 11u4/3 + 120u*2 - 3u - 4. Differentiate s(c) with respect to c. -6c2 + 88c Let a(n) be the second derivative of n7/30 - n5/5 - 13n2/2 - 13n. Let j(k) be the first derivative of a(k). Find the third derivative of j(d) wrt d. 168d Let a be 1(-2 - (-2 - 2)). Suppose -5q - 5 = -5r, -2q + 4r - r - 5 = 0. Find the first derivative of a - 3 + u2 + uq wrt u. 4u Let l be ((105/3)/1)/1. Find the first derivative of 9 + 11y2 - l + y2 + 8y2 wrt y. 40y Let v be (3/(-12) - 0)/(3/(-24)). Find the third derivative of 287n6 - 304n6 + nv + 5n2 wrt n. -2040n*3 Let h(o) = 9o*2 + 4o + 9. Let b(w) = -41w - 133w*2 + 42w*2 - 91 + 2w. Let z(m) = -4b(m) - 39h(m). Find the first derivative of z(s) wrt s. 26s What is the third derivative of -49a*6 + 13a*2 - 4a + 21a4 + 24a*6 + 4a + 23a6 wrt a? -240a*3 + 504a Let g(t) be the third derivative of 19t6/120 + 23t*5/12 - 148t*2. Find the third derivative of g(u) wrt u. 114 Suppose 115 = -5w - 5o, -3w - 43 = -2w + 5o. Let x be (-21)/448/w. What is the third derivative of -k2 + 14k*3 - xk*3 - 4k*4 wrt k? -96k What is the first derivative of 161k4 + 73 - 9 + 7k*4 + 299k*4 + 103 wrt k? 1868k*3 Let x(b) = -7b - 1. Let c(p) = p - 2. Let k be c(0). Let u be x(k). What is the second derivative of ur4 + 5r*5 - 13r*4 - 3r + 0r wrt r? 100r*3 Let g be 6 + (-3 - (3 + -6)). Let k be 1 - 3/(g/(-4)). What is the third derivative of 0nk - n2 - n*3 - 2n*2 + 2n*2 wrt n? -6 Differentiate -65l - 8l + 6 + 14l - 119l with respect to l. -178 Suppose 0 = -4v - 2a + 64, 0 = -2v - 3a + 11 + 17. Find the second derivative of 35g*3 + vg + 22g - 86g wrt g. 210g Let i(p) be the first derivative of p4 - p3/3 - 8. Let w be i(1). Differentiate -wj - j + j - 9 + 2 wrt j. -3 Let f(n) = -n. Let b be f(2). Let w be 1 + (-3 - b - -2). Find the third derivative of 6d2 + 2d*6 + 0d*6 - 4d*w wrt d. 240d3 Let j(l) be the second derivative of -l5/10 - 173l4/6 + 79l*3/3 + 247l. What is the second derivative of j(b) wrt b? -12b - 692 Let u(m) be the second derivative of 173m7/42 + m4/12 + 2m3 - 85m. What is the second derivative of u(g) wrt g? 3460g3 + 2 Suppose 0 = 3m + m - 72. Let j = m - 16. What is the derivative of 0s2 - 2s*3 + 0s*j + 188 - 183 wrt s? -6s*2 What is the third derivative of -92v*6 - 48v*6 - 30v*2 + 165v*6 wrt v? 3000v3 Let s = 8 - 3. Let g = -254 - -258. What is the derivative of ig + s + 6 - 6 wrt i? 4i3 Let h(t) be the third derivative of -7t*6/120 - 31t*4/24 + 137t*3/6 + 5t*2 - 8. Find the first derivative of h(l) wrt l. -21l*2 - 31 Let k(u) be the third derivative of -3u*5/20 - 511u*3/6 - 462u*2. What is the derivative of k(z) wrt z? -18z Let i be (-228)/(-72) + 0 + -3. Let v(p) be the third derivative of -ip3 + 0p + 0p4 - 1/60p6 + p2 +	{ "pile_set_name": "DM Mathematics" }
roduct of -19 and 2.901. -55.119 92311 times -0.3 -27693.3 -0.1 * -289530 28953 0.184 times -1319 -242.696 Work out 6726110 * 4. 26904440 -7 * 8.648 -60.536 Multiply -1 and 2958. -2958 Calculate 1545323. 463596 -38.7-2.3 89.01 What is the product of -68559 and 3? -205677 Product of 4703871 and -0.2. -940774.2 What is -0.4 times -952.9? 381.16 -17107 times -0.1 1710.7 1.2 times 2.3 2.76 Work out -1.347 * 0.9. -1.2123 Calculate -1.894240.5. -0.94712 8363.865 41819.3 51-2.74 -139.74 Product of 0.29529 and -13. -3.83877 Work out -168 -227. 38136 What is 0.159 times -0.0464? -0.0073776 Product of 1037 and 3472. 3600464 What is 0.4 times -6385? -2554 Calculate -16.43819. -312.322 What is 0.1 times -131420? -13142 Multiply -62.935 and -0.1. 6.2935 5 -8784 -43920 20 * 76.58 1531.6 What is -0.32003 times 1? -0.32003 2.5 times -1.068 -2.67 0.4 times 85804 34321.6 What is 1.3 times -19.3? -25.09 Calculate 1222200.5. 61110 Work out -5 12.759. -63.795 4 times 0.7527 3.0108 Multiply 486375 and -0.1. -48637.5 Product of 91.842 and -1. -91.842 Multiply 0.3 and 45381. 13614.3 What is 0 times -9.7875? 0 -150 times -78.9 11835 1721.6 times -1.01 -1738.816 What is 15 times 3063.7? 45955.5 Calculate -28-1.3752. 38.5056 Multiply -314 and -0.87. 273.18 Work out -372.5 -394. 146765 1 * 3453 3453 Calculate -0.5-11.6092. 5.8046 -0.444179 -17671.6 57173 times 17 971941 -1.59 times 2.5 -3.975 -0.46678 times 3 -1.40034 234.353 times 5 1171.765 Product of -983.6 and 0.08. -78.688 -6 * 149205 -895230 Multiply 65696 and 0.4. 26278.4 Product of 1.3 and 103139. 134080.7 Calculate -520-1210. 629200 1538292 times 0.01 15382.92 -55.603 -1 55.603 What is -735 times -85? 62475 0.38646 2593.8 -0.11 16.965 -1.86615 210.20521 4.30941 Multiply 13 and 13.688. 177.944 Multiply 0.2 and -4989. -997.8 -2 times 0.1502088 -0.3004176 What is the product of 169 and 7138? 1206322 0.06164249 9854.94 36.3 times 2 72.6 Multiply -330163 and 3. -990489 -0.44024 -1609.6 0.06311230 707.49 Work out 3509 * 3.69. 12948.21 3107.61 2359.1 Multiply -23 and 11.02. -253.46 Product of 10.8 and -1724. -18619.2 Multiply -124 and 4.5. -558 What is 0.197129 times -0.2? -0.0394258 1.6 times 176.53 282.448 -5 times 38.6261 -193.1305 5118508 times 1 5118508 Product of -624 and -2. 1248 Product of 0.011 and -0.0216. -0.0002376 2 times -17.2412 -34.4824 Calculate 328.1523. 84.4569 566256 times 0.4 226502.4 Multiply 8.2 and -17.32. -142.024 -0.40.0678 -0.02712 Product of 4.212 and 0.1. 0.4212 Work out -1578 -0.026. 41.028 What is the product of -1073 and -16? 17168 Product of -10743 and 15. -161145 Work out -3642 * -70. 254940 Work out -218 * -49.6. 10812.8 Work out 0.06 * 0.06089. 0.0036534 Product of -1868825 and -0.1. 186882.5 What is -3 times 525? -1575 9 * 0.1382 1.2438 -0.1 * -342.48 34.248 What is -9153 times 0.3? -2745.9 What is the product of 0.03352 and 0.285? 0.0095532 Multiply 655.2 and -94. -61588.8 -2 times -6.61 13.22 What is the product of -0.0929 and -0.57? 0.052953 Work out -31 * -274. 8494 0.0624 times 104.4 6.51456 Product of -30078 and 4. -120312 Work out -0.18 * 1.727. -0.31086 -0.741 times -2336 1730.976 What is -1529.11 times 0.2? -305.822 What is 0.19 times 32.5? 6.175 Product of -18 and 0.02496. -0.44928 Work out 2.4966 * 2. 4.9932 Work out -1660.3 * 1.8. -2988.54 What is the product of 0.07 and -2258? -158.06 Product of -0.01447613 and 0.3. -0.004342839 What is -28 times -70.5? 1974 Calculate -3019-0.16. 483.04 0.2-1366 -273.2 What is the product of 0.5 and 722.63? 361.315 What is -79 times -0.6864? 54.2256 -8.0707 * -0.06 0.484242 Multiply 9.202 and -14. -128.828 What is -0.027 times -25.7? 0.6939 Work out -0.8 * 4.7659. -3.81272 0.07626 * 8 0.61008 Multiply -0.06 and 3449.7. -206.982 2094.5 times -0.15 -314.175 Calculate 4.0661360. 0 154154 0.1 15415.4 Product of -0.5 and -1.9807. 0.99035 What is the product of 6 and -181974? -1091844 What is the product of -13.2201 and 0.3? -3.96603 0.3 times -1072228 -321668.4 Work out -6.336 * 389. -2464.704 Calculate 304464. 121784 -386 -9190 3547340 -22743 times -0.05 1137.15 Calculate 0.41840866. 736346.4 What is the product of 0.0742274 and 5? 0.371137 -0.0302-0.34 0.010268 Product of 5 and -13.5024. -67.512 Product of -5 and -9022. 45110 What is the product of -5 and 42.5976? -212.988 -0.0742 times 0.168 -0.0124656 What is the product of -3 and -0.218725? 0.656175 0 times 0.00566 0 Multiply -1071 and 0.03. -32.13 12006 * -26.5 -318159 -4.49-12 53.88 What is the product of -0.5 and 106508? -53254 Calculate -0.089-0.03559. 0.00316751 -0.2 * 1062 -212.4 Product of 206 and -27. -5562 What is the product of 0.58 and 32? 18.56 Calculate -1.71852-0.8. 1.374816 What is the product of 2.1 and -5013? -10527.3 Product of -1.29 and -23.55. 30.3795 -3 times -22284 66852 What is the product of -64.8 and -594? 38491.2 Calculate 0.45346. 2138.4 0.5244052 122026 0.89 -390 -347.1 Multiply -0.2373 and -21. 4.9833 Work out 551 * -222. -122322 98.745 493.7 What is the product of 204.9 and -0.29? -59.421 Calculate -1830.7-10. 18307 -803.9 times 0.092 -73.9588 What is the product of -1009 and -872? 879848 Work out 1.3 * -19966. -25955.8 What is 4603 times 1.2? 5523.6 What is the product of 0.361562 and -4? -1.446248 What is -14.1 times 0.71? -10.011 Work out 0.17 * -5295. -900.15 -15-5406 81090 Product of -19812.29 and -0.1. 1981.229 97979 times -0.1 -9797.9 Product of -1.39 and 54. -75.06 Product of -1824 and 0.02. -36.48 What is -6 times -21599? 129594 Multiply -40.55 and -7. 283.85 Calculate 796.77. 5576.9 -7367177 -1303959 What is 31 times -617? -19127 Work out 0.06 1.1844. 0.071064 4-1120.2 -4480.8 -1049822-0.4 419928.8 Product of 20595 and 0.9. 18535.5 Calculate 454624. 218496 -1902 times -14 26628 -115.1 -18.29 2105.179 1440.96 times -12 -17291.52 What is 62 times -760? -47120 Calculate -0.9174651. -157185.9 2 325 650 0.0089221 * -0.3 -0.00267663 -1290 * 0.041 -52.89 -0.4 * -49.09 19.636 What is 2070 times 525? 1086750 What is -35876.4 times 3? -107629.2 Multiply 1018 and 1.73. 1761.14 8527-1.2 -10232.4 Multiply -69570 and -3. 208710 What is -0.993405 times -0.08? 0.0794724 -0.3 -0.4329 0.12987 0.6 times -0.128468 -0.0770808 -0.2 * 58427 -11685.4 Product of 10.9 and -0.36. -3.924 27 times -774 -20898 Work out -277287.1 * 0. 0 Calculate -491133. -147339 -24007 times -0.12 2880.84 Calculate -937460.012. -1124.952 What is -0.3 times 432170? -129651 175 * 6.4 1120 Multiply 2 and -0.23357. -0.46714 Calculate -0.098527-3. 0.295581 What is the product of 0.16 and -139? -22.24 Work out 2985.8 0.3. 895.74 0.25 * 1513 378.25 What is 14 times -0.030072? -0.421008 Product of -1087 and 725. -788075 What is 97094.89 times -0.3? -29128.467 What is -0.052 times -1.61? 0.08372 13.856 times 4 55.424 Multiply 181.724 and 8. 1453.792 -1185 * -0.303 359.055 What is 3 times 1025540? 3076620 Product of 16 and 3289. 52624 12.1 * 2.06 24.926 What is the product of 0.2 and -146149? -29229.8 What is the product of 50565 and -2? -101130 What is the product of -3.17 and -10? 31.7 2675 times 183 489525 What is 3283 times -22? -72226 4 * -104107 -416428 123545 * -0.2 -24709 0.4-35900 -14360 Work out -4 248388. -993552 Multiply 0.06 and 0.0497936. 0.002987616 0.3 * -0.786159 -0.2358477 Work out 0.5 * 80650. 40325 Product of 8.3 and -1093. -9071.9 Multiply -211.3 and -7. 1479.1 Multiply -0.096987 and -3. 0.290961 What is -0.741 times -7.365? 5.457465 Calculate 0.9-5.644. -5.0796 What is the product of -170 and 10915? -1855550 What is the product of -0.3 and 178.129? -53.4387 Work out 2 20311. 40622 Calculate 14-10.17. -142.38 0.1 times -23.6 -2.36 Multiply -0.01 and -905.2. 9.052 -20.3 times 456.5 -9266.95 Multiply -220897 and -3. 662691 Work out 0.55 0.9613. 0.528715 Calculate -34142-0.4. 13656.8 What is the product of -1.8 and 8.73? -15.714 -0.3 203.896 -61.1688 Calculate 2-4.24716. -8.49432 Product of -23.82 and 45. -1071.9 0.223-6.7 -1.4941 What is 8 times 877? 7016 Work out 0.768 * 23. 17.664 What is the product of 0.6 and 24735? 14841 -7.68713 times -0.02 0.1537426 0.09 times -256 -23.04 What is 236 times -3976? -938336 753*483 363699 What is the product of 11677 and 39? 455403 2483 times -14 -34762 Wha	{ "pile_set_name": "DM Mathematics" }
z = -2z - 4. Solve -za + 1 = 11 for a. -5 Let o(m) = -3m*2 + 7m + m*2 + 0m - 4. Let l be o(4). Let x be 81/12 + 6/l. Solve 6 = -4d - x for d. -3 Let c = 29 - 17. Suppose 6x - c = 2x. Suppose 2g + 2o + 10 = 7g, 5g = 4o + 20. Solve -3s + x = -g for s. 1 Let x(t) = -2t + 6. Let w be x(6). Let o = -3 - w. Let i = 290 - 285. Solve -7 = -iq + o for q. 2 Suppose 3w - 5x + 10 = 4w, -8 = -4x. Solve wh = -3h + 6 for h. 2 Let v(j) be the third derivative of j5/60 + j4/4 + j3/2 - j2. Let b be v(-6). Solve -br - 2r = 20 for r. -4 Let l(f) = 2f + 11. Let i be l(-3). Solve -4c + i - 17 = 0 for c. -3 Let x(y) = -y2 - 9y + 2. Suppose k + 3n - 4n = 8, -5n = -2k + 28. Suppose 0 = kz + z + 45. Let f be x(z). Solve -4p + 6 = -f for p. 2 Suppose 0 = 3m + 5l - 1, -7 = 2m - 4m + 3l. Suppose -i - 5z = 17 - 4, 3z - 57 = 3i. Let j = i + 21. Solve 9 = mp + j for p. 3 Let g(u) = 4u - 10. Let d be g(4). Solve -d = i - 2 for i. -4 Let n = -40 - -55. Solve 5f - 40 = -n for f. 5 Let b(a) = -a3 + a2 - a + 5. Let k be b(0). Solve -19 = kw + 6 for w. -5 Suppose -i = -3t, -i = -4i + 4t. Suppose i = 5a - 30 - 0. Solve n = -2n - a for n. -2 Suppose -o + 2o = 2. Suppose 0 = -0z - 4z + p + 8, -oz - 2 = -2p. Solve -g + zg = -10 for g. -5 Suppose -3g + 8g = -60. Let o be g/(-15) - (-1)/5. Solve 0 = -3r + 2r + o for r. 1 Suppose 4c + i - 21 = 0, -2c = c + 4i - 32. Suppose -t + f = -c, t + 0f = -f. Solve -tw = -11 + 1 for w. 5 Let f be (-11)/(-2) + (-1)/(-2). Solve j = fj + 10 for j. -2 Let y = 11 + -4. Let b(l) = l2 - 8l + 9. Let s be b(y). Solve -sw + 3w = -2 for w. -2 Let y be 14/(-35) + (-12)/(-5). Let q = -7 - y. Let k = q + 17. Solve s = -s + k for s. 4 Let j be (-4 - (-4 + (4 - 6))) + 1. Solve 0 = -jk - 0k - 6 for k. -2 Suppose -27 = -2x + x + 4k, 2k = 5x - 135. Let v = 60 - x. Let f = v - 23. Solve 0i - f = -2i for i. 5 Suppose v + 5 = 2s, 0 = -0s - 3s - 4v + 35. Solve -s + 4 = -x for x. 1 Suppose y = -3m - 1, y + 4m = 2m + 2. Suppose 3w + 5x + 1 = -0w, -2x = 4w - y. Let t be 2/4(w - -3). Solve tc - 2 = 1 for c. 1 Let i be (29 + -4 - 1) + -1. Let z = i + -20. Solve -zx = -5x - 8 for x. -4 Let s(j) = -j*2 + 2j + 9. Let k be s(0). Suppose u = 3u - 10. Let i = u + k. Solve -i + 4 = -2n for n. 5 Suppose -4z + 2 = 4b + z, -3z = 6. Suppose -2 = -4h + 2c, bh + c - 5c = -6. Solve hn = 7 + 1 for n. 4 Let u(f) = 3f + 4. Let x(a) = -7a - 8. Let z(c) = -9u(c) - 4x(c). Let y be z(4). Solve 4 = 2b - y for b. 2 Let s = -23 + 16. Let v = s - -12. Suppose -4n - d + 5d - 8 = 0, 4d = 5n + v. Solve -nu + 0u = 3 for u. -1 Suppose 3k = -4o + 6 + 5, -37 = -5o + 4k. Solve 10y + 15 = oy for y. -3 Let k be (-7)/3(18 - 21). Solve k = -4x - 1 for x. -2 Let z(v) = 5v + 3. Suppose 6 + 15 = 3i. Let f = i - 4. Let d be z(f). Solve d - 6 = -4u for u. -3 Let t be (2/2)/((-1)/(-17)). Suppose t = 2x + 2x + f, -3f = -2x - 9. Solve -n - 2 = -x for n. 1 Let s = 12 - 7. Suppose -2p = 2p + sk + 20, -12 = 3k. Suppose pd - 2d = 0. Solve -f + d = 1 for f. -1 Suppose -2t = 3t + 25, 4t = 3g - 8. Let p be 022/g. Solve pl + 6 = 2l for l. 3 Suppose 31 = a + 3z, -5a - 3z + 17 = -126. Solve -8 + a = 5h for h. 4 Suppose 0 = p + p - 14. Let z = -2 + p. Suppose -3k = -2k + o, -4k - 3o = 0. Solve -3t + 2t - z = k for t. -5 Let m(h) be the first derivative of -h*4/4 + 5h3/3 - h2 - 3h - 8. Let u = 5 - 1. Let i be m(u). Solve -1 - i = -2p for p. 3 Suppose -n + 5w + 8 = 0, 2n - 7 = -0w + w. Suppose -n = -2s + 1. Solve o = -so for o. 0 Let p(o) = -o3 + o - 1. Let t be p(-2). Suppose -4b + 2b + 2c = 0, -c = 0. Suppose -5v + 14 + 11 = b. Solve t = -vg + 15 for g. 2 Suppose -5l = 3c - 0l - 40, -2c = -2l. Solve 3 - c = 2i for i. -1 Suppose -y + 2c - 9 = c, 2c - 23 = 3y. Let p be y/((-20)/12) + 16. Solve 4s - p = 1 for s. 5 Let p(y) = y - 2. Let q be p(5). Suppose c + 2c + q = -2l, 34 = 4l - 2c. Solve l = -d - 2d for d. -2 Suppose -5w = -4z + 54, 5w + 1 = -5z - 89. Let j = 22 + 0. Let f = w + j. Solve 3i - 4 - f = 0 for i. 4 Let h = 41 - 38. Solve 0 = b - 0b + h for b. -3 Suppose 0a - 4z - 16 = -4a, -4z - 16 = -2a. Solve a = -2c + 5 - 3 for c. 1 Let g = 35 + -31. Solve -s + g = s for s. 2 Suppose 2d = -0d - 6. Let f = d - -3. Suppose -3s - 3 = -9. Solve sb - 5b - 12 = f for b. -4 Suppose -20p + 320 = -4p. Solve 5 = -5h + p for h. 3 Suppose 5d - 5 = 2s, 5d = 2d - s + 14. Suppose -o = -2 - 2. Solve -3n = -on + d for n. 3 Suppose -8 + 2 = -2s. Suppose -6 = -3u - so, 0 = 2u + 5o - 0 - 10. Solve 2g + 8 = -u for g. -4 Let q be 6-12/4. Let x = q + 6. Solve 0 = f - xf for f. 0 Let q be 2/8 + (-67)/(-4). Suppose -2o - 5 = -q. Solve 0 = -oh + h - 10 for h. -2 Let d = -9 - -9. Solve -t - 2t - 3 = d for t. -1 Let h(l) = l2 + 7l - 8. Let f be h(-8). Let q = 3 + f. Solve 5 = -2m + q for m. -1 Suppose 0 = x + 4y - 20, 1 + 24 = 4x + 5y. Solve i = -xi for i. 0 Let t(m) = -m3 + 8m*2 + 9m + 3. Let k be t(9). Let o be (-10)/4(-1 + -1). Solve i - o = -k for i. 2 Suppose -3r - q + 1 = -2q, -5q = -r - 23. Solve -6 + r = -2l for l. 2 Let z(h) = -h2 + 17h - 9. Let f be z(15). Solve f = -5c + 6 for c. -3 Let h(c) = -c + 0 + 0 + 2. Let a be h(6). Let m = a + 9. Solve -m = d - 0d for d. -5 Suppose 3d - 5b - 31 = 0, -4b = -3d - 2b + 16. Let k be (4/(-3))/(d/(-6)). Suppose -2u + 6 = -4i, -4u = -9u - i + k. Solve 2t = 9 - u for t. 4 Suppose -j = j. Suppose j = 3l - 7 + 1. Suppose 3v = lv. Solve 3y + 2 + 1 = v for y. -1 Suppose -5s - 54 = -11s. Solve 7 = c + s for c. -2 Let z be (-1 - -3)/(-4)0. Suppose -2p + 6 = -0s + 2s, 0 = 3s + 2p - 9. Suppose k = -r + 5, 2r = -zr + sk - 10. Solve -g + r = 3 for g. -2 Let l(z) = z2 - 10z + 8. Let t be l(9). Let g = 0 - t. Let k be g/4 + (-30)/(-8). Solve -kx = -0x - 16 for x. 4 Let y be 182/(-9) - (-2)/9. Let m be y/(-8)12/10. Suppose 6 + 7 = mx - g, -5x - g + 19 = 0. Solve -c - x = -5c for c. 1 Suppose -4c + 48 = -4d, -2c + 26 = -3d - 4c. Let v = 23 + d. Solve -2 = 3k + v for k. -5 Let f = -1 - -1. Solve -9 = -fj - 3j for j. 3 Suppose -4g = -g - 6, -5j - 3g + 1 = 0. Let t = j + 2. Suppose t = -2m + 9. Solve h + m = -1 for h. -5 Let r = 4 + -2. Suppose 0a = ra. Suppose a = -2x - x. Solve x = 2b - 0b - 4 for b. 2 Suppose 2k = -2k - 5x + 36, 0 = -3x + 12. Suppose -ky + 15 = -h, -1 = -5y + 4h + 4. Solve -1 = -yo - 6 for o. -1 Suppose 4z = 34 + 38. Let y be 141/27 + (-4)/z. Suppose j = yj - 8. Solve -7 + 1 = -jf for f. 3 Let r = 6 + 11. Let p be r/4 + (-4)/16. Suppose -3m - 40 = -2q - m, 0 = -4q - 4m + 40. Solve 0 = pk + k + q for k. -3 Let v(z) = -3z - 26. Let s be v(-10). Solve -g = -2g - s for g. -4 Suppose -18 = -3k + 15. Let d(r) = r*2 - 12r + 12. Let h be d(k). Solve -3 = -2a - h for a. 1 Let j be 102/11914/3. Solve -5 + j = w for w. -1 Let t be 40/7 + (-4)/(-14). Let f = t + 2. Solve -2k + 6k - f = 0 for k. 2 Suppose -2j = 5p + 2j - 41, -16 = -4j. Let t(a) = 0 - a + 4 - 3. Let q be t(-3). Solve q = 7n - pn for n. 2 Suppose -m = 0, 2c = -0c - 5m + 24. Solve c = -3v + 3 for v. -3 Let n = 6 - 0. Let m = 6 - n. Suppose o = 4o - 15. Solve mt = t - o for t. 5 Let l be ((-30)/(-2))/((-12)/(-8)). Suppose -5y - 15 = -ly. Suppose -r - 7 = -3f, 0 = -4f + 3r + 9 - y. Solve -fb = b for b. 0 Let j be ((-88)/12)/(2/(-6)). Solve 0 = -5h - 2 + j for h. 4 Suppose -129 + 49 = -5d. Solve -d = -0w + 4w for w. -4 Let m(g) = -g*3 + 10g*2 - 9g + 3. Let h = 8 - -1. Let k be m(h). Solve -kq - q = 0 for q. 0 Suppose -2j + 4u + 5 = 3u, -j - 8 = -4u. Suppose -ji + 3 = 3w - 21, 13 = i - w. Suppose 4k = -h + 13, 3k - 2h = h - i. Solve -7d = -kd + 20 for d. -4 Suppose 3w = -2w + 10. Let q(s) = 2s2 + s - 1. Let u be q(2). Solve -wi = -u + 3 for i. 3 Let s(m) = m*2 + 2m + 2. Let f be -3 + 2 + (2 - 3). Let v be s(f). Suppose 7 = 3h + 1. Solve v = hx + 10 for x. -4 Suppose 0 = a - 2a - 5q - 29, -a + q + 1 = 0. Let d be (5 + 3)/(a/(-10)). Solve d = -2n - 3n for n. -4 Suppose -5 - 10 = -5r. Solve rp + p + 16 = 0 for p. -4 Let x(a) = -a. Let w be x(-4). Suppose -h - w*o + 28	{ "pile_set_name": "DM Mathematics" }
0 divided by 174744753. 10 What is -54493460 divided by -20? 2724673 Divide 30 by 291433. 30/291433 Divide 113101832 by -28275458. -4 Divide -58753431 by -65941. 891 Divide 14 by -197593. -14/197593 What is -1782 divided by -1829? 1782/1829 Calculate 94190 divided by 20. 9419/2 What is 1 divided by -280059791? -1/280059791 Calculate -52 divided by -7674. 26/3837 Divide 147700102 by -13427282. -11 Divide -24338644 by -4. 6084661 Divide -43479 by 35. -43479/35 -5506995 divided by -367133 15 3353910 divided by 1 3353910 Calculate 392406912 divided by 231372. 1696 What is -45689927 divided by -2404733? 19 Calculate -220532 divided by -25. 220532/25 What is -562451004 divided by 15623639? -36 Divide -7 by -2841309. 7/2841309 Calculate 82424443 divided by -4. -82424443/4 Calculate 36428260 divided by 10. 3642826 Calculate 72915725 divided by -14583145. -5 5 divided by 27934951 5/27934951 Calculate -36078746 divided by -3586. 10061 Calculate 0 divided by -1412987. 0 Calculate -23 divided by -4007340. 23/4007340 What is 3529330 divided by -705866? -5 Divide -167352 by 274. -83676/137 Calculate 16841272 divided by 4354. 3868 What is -1 divided by 5499028? -1/5499028 Calculate -936692 divided by 468346. -2 What is 3272228362 divided by 3? 3272228362/3 185649 divided by 30 61883/10 -4 divided by -19428270 2/9714135 -4504764 divided by 4 -1126191 Calculate 21399993 divided by 47. 455319 -192019424 divided by -1376 139549 Calculate 560138 divided by 46. 280069/23 Calculate -2 divided by 11689182. -1/5844591 Divide 26537779 by -66179. -401 What is 48800 divided by 18861? 48800/18861 12838830 divided by 2139805 6 Divide 110 by 186498. 55/93249 Calculate -956700086 divided by 4762. -200903 5446140 divided by -35 -155604 Calculate 991158 divided by -165193. -6 What is -4 divided by 2908679? -4/2908679 Divide 6160653 by 129. 47757 19912662 divided by 948222 21 What is 26 divided by -93006? -13/46503 Calculate 0 divided by -50736276. 0 Divide -378682 by 11. -378682/11 What is -1145 divided by 26495? -229/5299 What is 1732948960 divided by -4? -433237240 17448288 divided by -156 -111848 -15041 divided by 10011 -15041/10011 Calculate 4018940 divided by 5. 803788 -7841461 divided by -2 7841461/2 Divide 2 by 7498268. 1/3749134 Divide 25405 by -1387. -25405/1387 What is 45607104 divided by 6? 7601184 -34232220 divided by -57630 594 Divide -3846 by 11625. -1282/3875 Divide -3945 by -122. 3945/122 Calculate -111 divided by 49490. -111/49490 7225680 divided by -2856 -2530 Calculate -287 divided by 276874. -287/276874 Divide 10769121 by -3509. -3069 -5204216 divided by 1 -5204216 Calculate 15 divided by -5957813. -15/5957813 Divide 8 by 38308712. 1/4788589 Divide 96010 by 1328. 48005/664 14897366 divided by -2 -7448683 122345 divided by -8340 -24469/1668 33801144 divided by -78 -433348 Divide -197924976 by 5208552. -38 What is -193694 divided by 157? -193694/157 Divide 0 by 16074456. 0 -20459843 divided by -3 20459843/3 Divide -184584 by -67. 184584/67 What is 5 divided by 10211730? 1/2042346 Divide 692497 by 9. 692497/9 61230928 divided by 30615464 2 What is 109 divided by -94948? -109/94948 Calculate -7867374 divided by 3933687. -2 Divide 2853090 by -21134. -135 What is -73238090 divided by 5? -14647618 -2 divided by 298905946 -1/149452973 Calculate -3492620 divided by -10. 349262 What is 225596 divided by 9? 225596/9 What is -578 divided by 351824? -289/175912 What is 81719 divided by -1? -81719 157406305 divided by 31481261 5 27446 divided by -750 -13723/375 What is 12198 divided by 10701? 4066/3567 Divide -72347288 by -81016. 893 What is 3548090 divided by 7? 506870 Calculate -118308785 divided by -23661757. 5 Calculate -526212512 divided by 131553128. -4 -92 divided by 58432 -23/14608 Divide -903243474 by 1158. -780003 Divide -325951875 by 9. -36216875 36701565 divided by 183 200555 Calculate -925983 divided by 925983. -1 What is -45948910 divided by -4? 22974455/2 Calculate -329 divided by -116395. 329/116395 What is 385415380 divided by -130340? -2957 -925350522 divided by -3 308450174 What is -8197280 divided by -63056? 130 Calculate -13443940 divided by -3360985. 4 Divide 149006292 by 4382538. 34 Calculate 403848734 divided by 543538. 743 Divide -665619948 by 12. -55468329 Divide -28469724 by -9489908. 3 Divide -770209 by -12. 770209/12 What is 3 divided by 8278142? 3/8278142 1672564 divided by 178 836282/89 Calculate 7383 divided by 60676. 7383/60676 Divide -24 by 537113. -24/537113 Calculate -74461222 divided by 22. -3384601 Divide 2 by -2796474. -1/1398237 Calculate -5526600 divided by -2763300. 2 15 divided by -19888 -15/19888 Divide 143919594 by -9594. -15001 -563 divided by 137612 -563/137612 Divide 408 by 14376. 17/599 -14944 divided by -298 7472/149 -147899 divided by 2 -147899/2 What is 12394 divided by 886? 6197/443 Calculate -17 divided by -12284614. 17/12284614 5684608 divided by 2842304 2 350357 divided by -52 -350357/52 Divide -22 by -317961. 22/317961 -99232092 divided by -6 16538682 What is 826358 divided by 2? 413179 Divide -219396951 by -24489. 8959 Divide 4653418 by -902. -5159 Calculate -90169 divided by 35. -90169/35 1257940512 divided by 17471396 72 Calculate 83010 divided by -2. -41505 -39 divided by 294481 -39/294481 Divide 21204018 by 2. 10602009 Divide 9870012 by 324. 30463 What is -56575796 divided by -2? 28287898 What is 1726011 divided by -147? -82191/7 What is 6960828 divided by -21? -331468 -1756538355 divided by -351307671 5 Calculate 166957493 divided by 3. 166957493/3 -242008 divided by 3 -242008/3 What is 5713354 divided by 49? 5713354/49 Calculate 15600 divided by 520. 30 Calculate 212972 divided by 449. 212972/449 What is -59978611 divided by 1? -59978611 What is 13361 divided by -390? -13361/390 What is 797812880 divided by -444464? -1795 Divide 308299450 by 12331978. 25 7200203 divided by -6 -7200203/6 760733 divided by 760733 1 Divide 121195186 by 121195186. 1 Divide -5114202 by 25. -5114202/25 What is 61881516 divided by -423846? -146 Divide 7519 by -109. -7519/109 Divide 6918330 by 3459165. 2 558888648 divided by 4 139722162 27795220 divided by -43772 -635 Calculate -3 divided by -14959815. 1/4986605 What is 26011232 divided by -250108? -104 -111 divided by 624426 -37/208142 What is -22412 divided by -342? 11206/171 What is -38191276 divided by 4? -9547819 What is -1 divided by 54878022? -1/54878022 -58660569 divided by 4 -58660569/4 Calculate 99961 divided by -10. -99961/10 Divide 11 by 19872608. 11/19872608 What is 148 divided by -1964172? -37/491043 Divide 10570 by -841. -10570/841 Calculate -19 divided by 8489703. -19/8489703 What is 5464023882 divided by 6? 910670647 Calculate -82 divided by 264540. -41/132270 What is 2995 divided by 2435? 599/487 What is -18586245 divided by 1? -18586245 Calculate -2 divided by -11803057. 2/11803057 Divide -5247375 by -3. 1749125 Divide -110345510 by -11034551. 10 -23947 divided by -1977 23947/1977 What is -2958476 divided by 3? -2958476/3 592922184 divided by 7593 78088 Calculate -21660966 divided by -27. 802258 Divide -156126880 by 39031720. -4 What is -54265 divided by 10? -10853/2 Divide -21939 by -115. 21939/115 What is 7745 divided by 788? 7745/788 Calculate -21452144 divided by -5363036. 4 Divide -4 by 294850. -2/147425 Divide -3 by 33171661. -3/33171661 Calculate 19006177 divided by 4. 19006177/4 Divide -1 by -10066881. 1/10066881 Divide -2 by -3885983. 2/3885983 What is 39494 divided by 3? 39494/3 Divide 32741898 by -1666. -19653 Calculate -451476 divided by 14. -225738/7 30 divided by -837313 -30/837313 Divide -10717862 by -465994. 23 What is -38885538 divided by -2? 19442769 Calculate -145040 divided by -152. 18130/19 538545 divided by 179515 3 What is 26 divided by -1515858? -13/757929 Calculate 29537 divided by 90. 29537/90 Calculate -70049953 divided by 4. -70049953/4 Calculate -52 divided by 79676. -13/19919 Calculate -40709172 divided by -1071294. 38 What is -1538754 divided by 21? -73274 0 divided by -2455340 0 Divide 20162994 by -6720998. -3 What is -15932800 divided by -26? 612800 What is 59326 divided by 1715? 59326/1715 What is 13477913 divided by 13711? 983 -3387678 divided by 20 -1693839/10 -4 divided by 3253368 -1/813342 Divide 13 by -818299. -13/81829	{ "pile_set_name": "DM Mathematics" }
-6 + 0. Let f(g) = 9g + 5. Let o(r) = 2r + 1. Let w(a) = -f(a) + 5o(a). Calculate w(y). -6 Let b(v) = v2 - 4v + 1. Let q(t) = t*3 + 5t*2 + 3. Let f be q(-3). Let j(s) = s + 9. Let h be j(5). Let z be (-4)/(-3)f/h. Calculate b(z). -3 Suppose -11i - 12 = i. Suppose 5z - 12 = -2. Let f(l) = l*z + l + 0l + 6l3 + 0l*3 - 2l3. Determine f(i). -4 Let o(y) be the third derivative of -y4/24 + 2y3/3 - 3y*2 + 29y. Calculate o(-4). 8 Let b(h) be the first derivative of h*3/3 + 9h*2/2 + 2h - 15. Give b(-8). -6 Let v(d) = -2d - 11. Let p be 0/(3-1) + (-6)/(-6). Let y be -2p/2 + (-13 - -6). What is v(y)? 5 Let q(y) = 2y + 1. Suppose -v + 0v - 5s = 13, s - 4 = 2v. Let h(m) = -3m - 1. Let j(l) = vh(l) - 4q(l). Give j(-4). -5 Let x(j) = -j*2 - j + 7. Let f be x(0). Let q(o) = -13o*3 + 7o + 16. Let b(y) = -2y3 - y2 + 1. Let v(a) = -6b(a) + q(a). Determine v(f). 10 Let u(z) = -2z2 - 8z - 8. Let y(m) = -2m2 - 40m + 36. Let a be y(-21). Give u(a). -32 Let m(f) be the first derivative of f4/4 + f3 + 5f2/2 + 3f - 122. Calculate m(-4). -33 Let s be 7 + -10 - (-2 - 1)/1. Suppose s = 4b + 41 - 9. Let o(p) = -p2 - 8p - 4. What is o(b)? -4 Let p(g) = g*3 - 4g*2 - 5g. Let v = -1118 - -1122. What is p(v)? -20 Let h(c) = c*3 - 11c*2 - 15c + 16. Let u = 283 + -271. Give h(u). -20 Let r(p) = -p*3 - 7p*2 + 8p + 10. Let v be 1/(-6) + 1703/(-78). Let m be 2/6 - 1 - v/(-3). What is r(m)? 10 Let v(z) = 14z3 + 2z*2 - 35z + 21. Let w(k) = 5k3 + k2 - 12k + 7. Let n(g) = -4v(g) + 11w(g). Let o = 90 + -150. Let h = 65 + o. Give n(h). -17 Let q(n) = n*2 - 2n. Let w = -360 + 363. Determine q(w). 3 Let c = 31 - 26. Let i(h) = -ch + 15 - 9 - 9. Determine i(3). -18 Let n be (-4 - 15/(-5))/((-33)/(-6) + -5). Let h(q) = q3 + 4q*2 - 2q*2 - 3 - 3q - q2. Determine h(n). -1 Let r(w) be the third derivative of -w4/24 - 7w3 - 2w*2 - 56. Calculate r(0). -42 Suppose 0 = -4i + 5c - 23, 0i + 2c = 2i + 10. Let a(v) = 3v + 5. What is a(i)? -1 Let b(u) = 8u. Let x = -588 - -589. What is b(x)? 8 Let z be 15/(270/(-84))(-12)/7. Let n(g) = g - 20. What is n(z)? -12 Let s(i) = 4i - 7. Let m(o) = -6o + 13. Let f(n) = 4m(n) + 7s(n). Give f(-4). -13 Let j(d) be the second derivative of -5/6d*3 - 3/2d*2 + 0 - 1/20d*5 + 5d - 7/12d4. Let k(b) = b - 1. Let y be k(-5). Determine j(y). -9 Let f(b) = b3 - b2 - b + 1. Let u(p) = 4p*3 + 5p*2 - 14p - 8. Suppose -5x = -6x + 1. Let q(t) = xu(t) - 5f(t). What is q(9)? -13 Let t(k) be the first derivative of k*4/4 - 2k*3 + 3k*2 - 9k - 129. Calculate t(6). 27 Suppose 0 = 3b - 3n - 3 + 24, b = -5n - 7. Let s(z) = -z2 - 8z + 2. Let f be s(-8). Let v(p) = 7p2 + p3 - pf + 28p + 8 - 33p. Determine v(b). -6 Let f(h) be the first derivative of h4/2 + 2h*3/3 - 5h*2/2 - 2h - 1. Suppose 239 = -68p + 35. Give f(p). -23 Let j(i) be the second derivative of -1/6i*3 + 0 - 1/2i*4 + 7i + 5/2i2 - 1/20i5. Calculate j(-6). 11 Let i = 328 + -334. Let k(q) = -q2 - 6q - 2. Give k(i). -2 Suppose j + 1 = -u, -j - 1 = -3u - 4. Let k(a) = -a3 - a2 + 8a - 1. Let q(g) = 16g*3 + 2g*2 - 17g + 1. Let w(m) = 2k(m) + q(m). What is w(u)? -14 Suppose 62f - 61f + 2 = 0. Let p(m) = -m3 + 4m2 + m + 4. Let z(w) = w3 - 4w2 - 2w - 5. Let h(a) = fp(a) - 3z(a). Determine h(5). 2 Let y(x) = 3x2. Let o(g) = 13g*2 + 1. Let w(i) = -2o(i) + 9y(i). Let d be (0(2 + 5/(-2)))/(-1). Give w(d). -2 Let h(x) = 3x2 + x3 + 2 - x2 + 0x2. Let g(y) be the first derivative of -y4/4 + 2y3 + 7y*2/2 - 3y + 3. Let w be g(7). What is h(w)? -7 Let k(r) be the first derivative of -r2/2 - 36. Let t(y) = y3 - 3y2 - 7y + 4. Let f(q) = -3k(q) + t(q). Determine f(4). 4 Suppose 0 = -14s + 18s - 784. Suppose -6b - s = b. Let k be (b/42)/((-4)/(-6)). Let y(h) = -h*2 + 2h + 1. What is y(k)? -2 Let f(y) be the second derivative of y7/2520 + y6/72 + 7y5/120 - 19y*4/12 + 13y. Let p(o) be the third derivative of f(o). Calculate p(-7). -14 Suppose -34q + 48q + 42 = 0. Let k(x) be the third derivative of -x6/120 - x5/30 + x4/12 - x3/6 + 3x2. What is k(q)? 2 Let t(g) = -g - 1. Let j be 2/4(22 - 18). Suppose y = 3c + 15, 2y - jc = 3c + 26. Suppose 5v = y - 18. Determine t(v). 2 Let y(f) = -2f + 4. Let c = 9 - 25. Let o = 22 + c. Suppose 0 = -p + o - 2. Give y(p). -4 Suppose u - 19 + 50 = -5p, -2p + 25 = -3u. Let j(z) be the second derivative of -z5/20 - z4 - 2z3 - z2/2 - 5365z. What is j(u)? 10 Let i(r) = r3 + 11r*2 + 12r + 5. Let g(c) = -c3 + c2 + 2c + 2. Let s be g(3). Determine i(s). -15 Let g(o) = o + 94. Let u(z) = z + 23. Let w(b) = -2g(b) + 9u(b). Give w(-6). -23 Let h(z) be the second derivative of z3/3 + 3z*2 + 15z. Suppose 3l = -l - 16. Calculate h(l). -2 Let j(l) be the second derivative of -l4/4 - 4l*2 + 29l - 10. Give j(-4). -56 Let g(x) = 307x2 + 303x*2 - 7x + 305x2 - 1227x*2 + 310x*2 + 7. Determine g(-8). -65 Let k be ((-10)/15 + -2)/(4/(-6)). Let o(x) = 3x - 7x + 3x + 2x. What is o(k)? 4 Let m(y) be the third derivative of y4/24 - y3/3 - y2 + 192. Give m(-3). -5 Suppose 3m + 24 = g - m, 0 = m - 4. Let t = g + -44. Let o(a) = -2a - 2. Calculate o(t). 6 Let j(d) = 4d - 4. Let y(r) = -r*2 + 12r + 10. Let w be y(13). Calculate j(w). -16 Let q(w) = -w + 2. Let j(y) = -2y + 4. Let k(h) = 3j(h) - 5q(h). Let v = -12 + 17. Suppose 0 = -10p + vp. Give k(p). 2 Let b(k) = 2k*2 + 5k - 11. Let f(l) = 3l2 + 10l - 18. Let i(y) = 7b(y) - 4f(y). Determine i(4). 7 Let s(r) = r - 6. Suppose -6h + 140 = -h + 3q, 25 = 2h - 5q. Let y be 12/(-1 + 0) + 2. Let p be 140/h - 4/y. Give s(p). 0 Let v(u) = -6u2 + u. Let d be v(1). Let g(n) = n2 - n - 1. Let r(h) = -h3 - 4h*2 + 6h + 5. Let f(m) = dg(m) - r(m). What is f(-1)? -1 Suppose -12 + 5 = -l. Suppose l = i - 5y, -4i + 9 = -y - 0y. Let n(f) = -3f + 3f - if + 6 + 0f. Calculate n(6). -6 Let m(o) be the third derivative of o6/120 - o4/8 + o*3/6 - 180o2. What is m(2)? 3 Let d(r) be the first derivative of r7/840 - r6/45 + r5/20 - r*4/4 + 6r3 - 20. Let f(h) be the third derivative of d(h). Determine f(7). -13 Let a(d) be the third derivative of -d5/60 + 5d4/24 + d3 - 3d2. Let o be a(7). Let p(g) = -g3 - 8g2 - g - 6. Give p(o). 2 Let b(l) = -l2 + 12l - 20. Let p = 559 + -548. Calculate b(p). -9 Let h(f) be the second derivative of f4/12 - f3/2 - 3f2/2 - f. Suppose -142 = 126r + 236. What is h(r)? 15 Let y(x) = -11x2 - x - x3 - 14x*2 + 21x*2. Calculate y(-3). -6 Let l be -3 - (6 + (-2 - 2)). Let k(f) = -7f - 18. Let x(y) = 3y + 9. Let u(w) = lx(w) - 2k(w). Determine u(0). -9 Let j(n) = n3 + 7n*2 + 13n + 9. Let w be j(-4). Let b(z) = z*3 - 2z*2 - 3z - 5. What is b(w)? 55 Let c(s) = -2s2 - 7s + s*2 + 3 + s. Let x be 0 - 0 - (3 + 49/(-7)). Suppose 0 = xl + 16, w + l + 10 = -0l. What is c(w)? 3 Let f(p) = -p2 - 7p + 9. Let i be ((-2)/3)/(1/18) + 5. Calculate f(i). 9 Let a(r) = -r - 6. Suppose 0 = -0n + 6n + 228. Let z = 33 + n. Calculate a(z). -1 Let r(g) be the third derivative of g5/120 - g4/3 - g*3/2 - 7g2. Let k(h) be the first derivative of r(h). Calculate k(7). -1 Let p(i) be the second derivative of i4/12 - i*3/2 + 3i*2/2 - 165i. Let s = -7 - -4. Let k be 2 - 0 - (2 + s). What is p(k)? 3 Let s(d) be the first derivative of -d*3/3 + 11d*2/2 + 27d + 164. Calculate s(13). 1 Suppose 2m + 19q - 37 = 24q, -q + 7 = 2m. Let r(s) = -s + 8. Give r(m). 2 Let l(z) = -7z2 + 2z - 1. Suppose -1 = -2j + 3j. Let x = j + 2. Give l(x). -6 Let q(c) = 13c - 18. Let k be q(6). Let v(f) = k - 6f - 9f - 61. Determine v(-1). 14 Suppose 2 = -5f + 3u + 5, -5u = -5f + 5. Let z(t) be the second derivative of -t3/6 + t2 - 4t - 11. Determine z(f). 2 Let q(k) = -k*3 + 3k*2 - 5k + 5. Suppose -251c + 248c + 12 = 0. Calculate q(c). -31 Let a(y) be the second derivative of -y4/12 + y2/2 + 345y. Calculate a(3). -8 Let z = -9 + 33. Let w(f) = -4f + f + zf. Calculate w(-1). -21 Suppose -c - 4c + 25 = 4k, -k = c - 5. Let t be 1(2 + 0 + -1). Su	{ "pile_set_name": "DM Mathematics" }
7. Which is the smallest value? (a) t (b) v (c) 3 b Let t = -3156 + 3058. Which is the second biggest value? (a) -3/4 (b) t (c) -2 c Suppose 7s - 9s - 66 = 0. Let j be 2/(-6) + (-11)/s. What is the fourth smallest value in 2, -2/7, 11, j? 11 Let x = 18.7 + -52.7. Let l = -31 - x. Let s = 8 - 11. Which is the third smallest value? (a) -0.1 (b) l (c) s (d) 0.4 d Suppose 8z + 20 = 13z. Let g = 5.48 - 8.98. What is the fourth smallest value in -1/3, z, g, -3? z Let h = 1.567 + -0.067. Let k be (4 + (-185)/45)(-8 - -2). What is the third biggest value in h, 8/5, k? k Let w = 16784.04 - 16784. Which is the second smallest value? (a) w (b) -1.5 (c) 0.3 (d) 17 a Suppose 4 = 5q - u, 3078q - 3080q = 5u + 20. Which is the fourth biggest value? (a) q (b) 96 (c) 15 (d) 2/3 (e) -2 a Let i be (3/6)/(1/6). Let y = -9 + 4. Let n = -7382 - -7382. Which is the biggest value? (a) i (b) n (c) y a Let o = -1179 - -1183. Which is the biggest value? (a) -3/7 (b) -5/8 (c) o c Let t be (13/(-4))/(10 - (-732)/(-72)). What is the second smallest value in 1, t, 4? 4 Let u = -399 + 399.05. Let p = 0.25 - 2.25. Let l = 0.93 - -0.07. Which is the fourth smallest value? (a) -2/15 (b) l (c) u (d) p b Let h = 0.645 - 1.322. Let i = -0.077 - h. Let u be 0/2 + 6/(-15). What is the second smallest value in u, -1, i, -3/5? -3/5 Let m = -2.3089 + 2.7089. Which is the second smallest value? (a) 3 (b) m (c) -0.118 (d) -2/13 c Let u = 2999 + -2994. Which is the biggest value? (a) -1/7 (b) 1 (c) 35 (d) u c Let q = 2.349 - 0.099. Let k = -1.75 - q. What is the third smallest value in 0.6, -0.5, k, -0.04? -0.04 Let u = 1391/12546 - -1/4182. Which is the second smallest value? (a) -2/15 (b) -1/5 (c) -1/9 (d) u (e) 0 a Let p = -448.5 - -479. Let i = p + -30.1. What is the smallest value in -0.04, -0.13, i? -0.13 Let k be (7 - 6)(-68)/119. What is the second smallest value in 3, k, -5, -84? -5 Let v = 7007.1 - 7007. What is the second biggest value in 0.2, -2/9, 0.14, 1/3, v? 0.2 Let t = 11.33 - 10.33. Let y = 125 + -122. What is the smallest value in t, y, 14/5? t Suppose 109 = -7r - 73. Let d = r - -288/11. Which is the third biggest value? (a) 25 (b) 0 (c) d b Let a = -578 + 574. What is the third smallest value in 9, a, -0.4, 1? 1 Let v be (-11)/66186/28. Let h = v + 5/4. What is the smallest value in 1/3, 0.2, h? h Let y = -132.031 - -0.031. Let r = 131.8 + y. What is the fourth smallest value in 0.1, 0.9, r, -5? 0.9 Let h = -0.1188 + 0.1188. Which is the third biggest value? (a) -10 (b) h (c) -100 c Let j = 8 - 13. Let d = -885.22 + 885.2. Which is the third biggest value? (a) d (b) j (c) -1/9 b Suppose -104 + 92 = -4g. What is the smallest value in 4/5, -5, g? -5 Let p = -3358.1 - -3358. Let j = 6.442 + -0.142. Let c = -1.3 + j. What is the smallest value in 3, p, c, 0.1? p Let y = 0.8425 + -1.0425. What is the third biggest value in y, 346/7, 4? y Let j = -310315 + 930943/3. Let x = -0.85 + 0.7. What is the third biggest value in -0.4, x, j, 3? -0.4 Let j be (-16 - (-4715)/287)(-14)/6. Which is the second biggest value? (a) 0.3 (b) 3865 (c) j a Let k = 0.36 + 164.64. Let j = 160 - k. What is the second biggest value in 4, j, 1/13? 1/13 Let t = -126.5428 - 0.1572. Let s = 124 + t. Let n = s + 3.1. Which is the second smallest value? (a) -1/5 (b) -0.18 (c) -2/7 (d) n a Suppose 5x = -4l + 6, 3x - 3486l + 3483l + 18 = 0. Which is the fourth smallest value? (a) -2/5 (b) 2/5 (c) x (d) 1.21 d Let a = 3.35 + -2.9. Let v = -5.55 - a. Let s = -1.01 + 1.41. What is the third smallest value in v, -3/4, s, 3? s Let g = 9956 + -49781/5. Let z be -1 - (-2 + 5)-1. What is the third biggest value in 71, z, g? g Suppose -d + 63 = 2v + 52, 17 = 3v + 2d. What is the third smallest value in -0.2, v, -1/10, 0? 0 Suppose -3w - 2u = 11, -14u = 5w - 12u + 17. Let a be (6/(-12))/(w/30). Let k = 2/29 + 17/174. What is the smallest value in a, 5/3, -4, k? -4 Let t be (-1)/(-3)750/(-100)(-16)/42. Which is the third biggest value? (a) -0.8 (b) 4 (c) 0.2 (d) t c Let a be 4 + 5 + -12 + 6. Let w = 151 + -151.3. What is the biggest value in a, w, 0.4, -1? a Let j = -41 - -152. Let t be -9 - -15 - j/18. Let w = 3 + -4. What is the smallest value in 4, 11, w, t? w Let g = 600.5 - 600.7. What is the fifth biggest value in -0.3, -4, 0.3, g, -3? -4 Let g = 400 + -402. Let y = -0.064 + 0.064. Which is the smallest value? (a) g (b) -0.5 (c) 27 (d) y a Let z be ((-132)/(-8))/(9/(-12)). Suppose 0 = 5h - 3h + 2. Let x be z(h - 3/(-2)). Which is the second smallest value? (a) 1 (b) -2/7 (c) x b Let p = -0.2 + 0.1. Let h = 6.155 - 0.895. Let g = h - 4.96. Which is the third biggest value? (a) 6 (b) g (c) 0.5 (d) p b Let k = 4232.8 - 4229.8. Let q = -13 - -23. Which is the smallest value? (a) q (b) 0.1 (c) k b Let i be (-60)/(-70)(1 - 35/42). Which is the second biggest value? (a) -128 (b) i (c) -2/7 c Let q = 0.204 + -101.204. Let i = 60 + q. Let z = i - -26. What is the second biggest value in z, -1/8, 3/5? -1/8 Let y = -6.61 + -0.43. Let n = 1632 + -1639. Let x = n - y. What is the second biggest value in -1/2, 2, -1/6, x? x Let z be (39/2275-14)/((-9)/(-15)1). Let n = -0.09 + -0.03. Which is the second smallest value? (a) 0.2 (b) n (c) z b Let r be (-1)/7(-55 - -48). What is the third smallest value in -2.5, 0.3, r? r Let y = 43 - 53. Let u(w) = -w3 + 12w*2 + 17w - 17. Let q be u(13). Let r = 36 - q. Which is the fourth biggest value? (a) r (b) y (c) -0.3 (d) -0.4 b Let s be ((-1)/9)/(2/(-8)). Let n = 504.86 - 505. Let l = n + 2.14. What is the smallest value in 6, s, l? s Suppose t + r + 12 - 4 = 0, -4 = -t + 3r. Let x be (-9)/24(35/t)/21. Which is the third biggest value? (a) x (b) -2/25 (c) -1 c Let q = -0.1879 + -1.8121. Let m = 2.29 - -0.11. Let p = m - 0.4. Which is the smallest value? (a) p (b) -0.5 (c) q c Let m = -163199227/492 - -331706. Let y = m + -1/246. Which is the second biggest value? (a) 3/8 (b) 0.01 (c) 4 (d) y a Let g = 37.83 + -4.03. Let x = 31 - g. Let i = -16 + 11. Which is the third smallest value? (a) x (b) i (c) -1 c Let j be -3 - -2 - 496/(-126). Let i be (-11700)/1260 + 26. Let y = j - i. Which is the fourth smallest value? (a) y (b) -4 (c) -1/2 (d) 5 d Let u = 0.1271 - 0.6601. Let n = u - -0.033. Which is the second smallest value? (a) n (b) -4 (c) -0.01 (d) 3 a Let p = -0.23 + 1.05. Let a = -1.82 + p. What is the third smallest value in -2, a, -3, -0.13? a Let u be (3/6)/(1/10). Let g = -540 - -439. What is the second biggest value in u, g, -2? -2 Let m = 8.7 - 8.47. Let f = 1.27 - m. Let b = f - -2.96. What is the smallest value in 1, 25, b? 1 Let z = 725/19 + -2881/76. What is the fifth biggest value in 2/13, 2, -20, z, -3/4? -20 Let s(y) = y3 + 15y*2 + 16y - 2. Let x be s(-14). Let c = x - -40. Let z be (-22)/c + -1 + (-5)/(-25). What is the smallest value in -1.8, -4, z? -4 Let g be -1(-8)/60 + (-3)/9. Which is the second biggest value? (a) g (b) -12 (c) 5 (d) 1 (e) 0.05 d Let a be 8/(-6) + (-22)/(-66). Let q be ((-2)/a)/(4 - -3). What is the biggest value in -2/7, 56, q? 56 Let k = 0.08 + -26.08. Let q = 104 + -73. Let p = q + k. What is the smallest value in -3/5, p, -4, 0.4? -4 Let y(i) = 45i - 854. Let n be y(19). What is the second smallest value in 3, n, -3, -0.2, -6? -3 Let j = 429.978 + -430. Let s = j + -4.978. Suppose 3l + 3 = 2x - 15, -3x - 3l - 3 = 0. Which is the smallest value? (a) s (b) 3/5 (c) x a Let u be 4/8 + 3/18 - (-245)/15. Which is the smallest value? (a) 6 (b) 0.1 (c) u (d) 1/8 b Let z = 2 - 3. Let x = -50725 + 50734. Which is the smallest value? (a) 1 (b) x (c) z (d) 0 c Let s = 0.1822 + 0.1178. Let o be 3/90(-2 + 6). What is the biggest value in s, 4/15, o, 2? 2 Let a = 4999/14 + -357. Let x = -0.114 - -5.114. What is the third biggest value in x, 0, a? 0 Let j be 3/2 - (49/(-2))/(-7). Let h = 1.88 - 2.88. Which is the biggest value? (a) h (b) 0.1 (c) j b Let l = 1361.6 + -1361.5. What is the fourth biggest value in 3/4, -1, l, 6? -1 Let k = -778 + 783.7. Let g = -5.4 + k. What is the second biggest value in 5, -98, g? g Let v = -64 + 86. Suppose -v = -10i - i. Let b be ((-6 -	{ "pile_set_name": "DM Mathematics" }
15 What is the highest common divisor of 7767 and 6163749? 9 What is the highest common divisor of 12889224 and 14? 2 What is the highest common factor of 3774 and 93126? 102 Calculate the greatest common factor of 1654158 and 18. 6 What is the greatest common divisor of 145429757 and 79? 79 What is the greatest common divisor of 522 and 179171541? 261 What is the greatest common factor of 3994073 and 127901? 1619 What is the greatest common factor of 987 and 11767343? 329 What is the highest common factor of 1425109 and 112? 7 Calculate the greatest common factor of 3022262 and 3382. 178 What is the highest common factor of 535185 and 1575? 315 Calculate the greatest common factor of 76440 and 21958755. 1365 What is the highest common divisor of 15594 and 4275378? 138 Calculate the greatest common divisor of 52491661 and 551. 19 What is the greatest common factor of 4579 and 881924558? 4579 What is the greatest common divisor of 1977928 and 52? 4 What is the greatest common divisor of 126 and 9296226? 18 What is the highest common factor of 2314960 and 109440? 1520 What is the greatest common factor of 1688605994 and 843? 281 Calculate the greatest common divisor of 97316460 and 47060. 3620 What is the greatest common factor of 24 and 665682376? 8 What is the greatest common divisor of 551444545 and 6010? 3005 What is the greatest common factor of 10906544 and 2480? 496 What is the greatest common factor of 18893732 and 1768? 884 What is the greatest common factor of 2916 and 17270496? 972 Calculate the highest common divisor of 192208132 and 1286. 1286 Calculate the greatest common divisor of 2105968 and 20640. 688 What is the highest common factor of 38 and 7183881? 19 What is the greatest common factor of 809690 and 316050? 3010 What is the greatest common factor of 216 and 229584? 24 What is the highest common divisor of 46 and 11909262? 46 What is the highest common divisor of 960 and 77954160? 240 What is the greatest common divisor of 99733540 and 360? 20 Calculate the greatest common divisor of 68673157 and 98. 49 Calculate the highest common divisor of 180 and 3496815. 45 Calculate the highest common divisor of 336 and 117612411. 21 What is the highest common divisor of 282345 and 17920? 35 Calculate the highest common divisor of 138092 and 393300. 1748 What is the greatest common divisor of 1566 and 1481204? 58 Calculate the greatest common factor of 919592534 and 1533. 511 Calculate the highest common factor of 141586154 and 4084. 2042 What is the greatest common factor of 5867233 and 15585? 1039 Calculate the greatest common factor of 75571728 and 2928. 48 What is the highest common factor of 9408 and 12377988? 588 Calculate the greatest common divisor of 27 and 1521126540. 27 Calculate the greatest common factor of 9456 and 89964. 12 Calculate the greatest common divisor of 11631869 and 166. 83 Calculate the greatest common divisor of 63286699 and 357. 119 What is the greatest common factor of 14713860 and 60? 60 Calculate the greatest common factor of 387205 and 5330. 65 Calculate the highest common factor of 201320027 and 3603. 1201 Calculate the greatest common divisor of 66564940 and 170. 10 What is the highest common factor of 5488197 and 121? 121 What is the highest common divisor of 8833 and 2753360929? 8833 What is the highest common factor of 6400 and 161843840? 640 Calculate the highest common divisor of 7 and 44578966. 1 What is the highest common factor of 470457 and 27378? 117 Calculate the highest common factor of 68769 and 41967. 9 Calculate the greatest common factor of 5570 and 123610. 10 What is the greatest common divisor of 422280 and 4565520? 6120 Calculate the highest common divisor of 90 and 19641670. 10 What is the highest common factor of 19654624 and 1056? 352 Calculate the greatest common factor of 1282799361 and 30087. 10029 What is the highest common divisor of 188125 and 251335? 1505 Calculate the greatest common factor of 56 and 7315637. 7 What is the highest common divisor of 18383696 and 64? 16 What is the greatest common factor of 272 and 443299004? 68 What is the greatest common factor of 438778 and 96? 2 What is the highest common divisor of 131487 and 3444? 123 Calculate the highest common factor of 201695 and 50895. 1885 What is the highest common divisor of 59450468 and 28? 28 What is the greatest common divisor of 1320 and 1035960? 120 What is the highest common divisor of 2487164073 and 51? 51 What is the greatest common factor of 26440381 and 418? 209 Calculate the highest common factor of 498843 and 675. 9 Calculate the greatest common factor of 60 and 84217580. 20 What is the greatest common divisor of 38611177 and 88? 11 Calculate the greatest common factor of 46544525 and 12627. 1403 What is the highest common factor of 879531 and 96? 3 What is the greatest common factor of 56908544 and 154? 154 Calculate the greatest common divisor of 18146 and 7597584. 86 What is the greatest common factor of 22295 and 90300? 35 Calculate the highest common divisor of 106372 and 122878. 1834 What is the greatest common divisor of 3480 and 393587130? 870 Calculate the greatest common factor of 16 and 110336176. 16 Calculate the greatest common divisor of 307323 and 279. 9 Calculate the highest common divisor of 14381436 and 812442. 12126 Calculate the greatest common factor of 546 and 2072772. 78 Calculate the greatest common factor of 100920 and 2707440. 3480 Calculate the highest common factor of 150 and 20528400. 150 What is the highest common divisor of 63043432 and 12440? 2488 Calculate the highest common factor of 13610 and 102657508. 2722 Calculate the greatest common factor of 1078486 and 24382. 334 What is the highest common divisor of 5858 and 139577? 29 Calculate the greatest common factor of 25355 and 12045. 55 What is the highest common divisor of 711719 and 65149? 41 What is the highest common divisor of 951528 and 173093? 967 What is the highest common divisor of 5155672 and 1488? 248 Calculate the greatest common factor of 814448 and 89162. 218 What is the highest common divisor of 37690857 and 78003? 963 Calculate the greatest common factor of 864 and 4301208. 216 What is the greatest common divisor of 865403 and 80619? 77 What is the greatest common factor of 2921360 and 128? 16 What is the greatest common divisor of 274759119 and 2595? 519 Calculate the highest common factor of 109456 and 4328. 8 What is the highest common divisor of 5616785 and 30? 5 Calculate the greatest common divisor of 112929015 and 3525. 705 Calculate the highest common divisor of 150 and 11799738. 6 Calculate the highest common divisor of 19278 and 2299590. 2754 Calculate the highest common factor of 67450 and 238915. 355 What is the greatest common divisor of 12298 and 3453502? 1118 Calculate the greatest common divisor of 1722231 and 261. 9 Calculate the highest common divisor of 752 and 4825024. 16 What is the highest common divisor of 31961303 and 363? 121 Calculate the greatest common divisor of 48216333 and 33. 33 What is the greatest common divisor of 36184518 and 25574? 1346 Calculate the highest common factor of 163436385 and 74655. 8295 Calculate the highest common factor of 125 and 404784125. 125 What is the greatest common factor of 2336445 and 151875? 1215 Calculate the highest common factor of 5255560 and 136. 8 Calculate the highest common divisor of 27630 and 32310. 90 Calculate the greatest common factor of 33 and 13975687. 11 Calculate the greatest common divisor of 16 and 451336. 8 Calculate the greatest common factor of 1398960 and 2221980. 1740 What is the greatest common factor of 348 and 1680276? 12 What is the greatest common factor of 1285019801 and 52? 13 What is the highest common factor of 55443914 and 26960? 674 What is the greatest common divisor of 437951099 and 538? 269 Calculate the greatest common factor of 165612 and 415140. 444 Calculate the greatest common factor of 15 and 3533914020. 15 What is the highest common divisor of 205938 and 36006? 102 What is the highest common factor of 1828 and 27292? 4 What is the highest common factor of 48672 and 262782? 234 Calculate the highest common divisor of 47435834 and 11561. 1051 What is the greatest common factor of 1053 a	{ "pile_set_name": "DM Mathematics" }
d in 1/2d + 1/2 - 1/2d*3 - 1/2d*g = 0? -1, 1 Let k(q) be the third derivative of 20q*5 + 125/21q*7 + 0 + 0q + 40/3q4 - 3q*2 + 50/3q*6 + 16/3q*3. Find z, given that k(z) = 0. -2/5 Let q = -1335/7 + 191. Factor -2/7 - qt + 4/7t2 - 2/7t*5 - 2/7t*4 + 4/7t*3. -2(t - 1)*2(t + 1)3/7 Let f(n) be the third derivative of -n5/60 + 8n2. Let a(u) = -u3 + 4u*2. Let w be 4/(-2)2 - 1. Let p(r) = wf(r) - a(r). Factor p(h). h2(h + 1) Determine o so that 3/2o2 + 9 + 15/2o = 0. -3, -2 Let o(u) be the third derivative of -u7/840 - u6/240 + 7u5/240 - u4/24 - 26u2. Solve o(i) = 0. -4, 0, 1 Let x(p) be the third derivative of -p8/1008 + 2p7/315 - p6/360 - p5/30 + 17p*2. Suppose x(f) = 0. Calculate f. -1, 0, 2, 3 Let p = -1947 + 5926/3. Let r = -28 + p. Factor -ro*2 - 1/3 + 2/3o. -(o - 1)*2/3 Let k(r) be the first derivative of r + 0r*4 - 1/20r*5 + 0r*2 + 1/6r*3 + 1. Let z(g) be the first derivative of k(g). Factor z(f). -f(f - 1)(f + 1) Let l(x) be the second derivative of -2x*7/7 + 16x*6/15 - 6x*5/5 + 2x*3/3 + 10x. Factor l(d). -4d(d - 1)*3(3d + 1) Let a be (20/(-9) + -3)3. Let x = -15 - a. Find n such that -8/3n - 6n*4 + 8/9 + xn*2 + 46/9n*3 + 2n5 = 0. -2/3, 2/3, 1 Let x(n) be the second derivative of n5/110 - 2n4/33 + 5n*3/33 - 2n*2/11 + 12n. Solve x(q) = 0 for q. 1, 2 Let k(i) be the third derivative of -i9/13440 - i8/6720 + i7/3360 - i5/20 + 5i2. Let q(g) be the third derivative of k(g). What is w in q(w) = 0? -1, 0, 1/3 Let u(g) be the first derivative of 0g + 1/5g2 + 1/25g*5 + 0g*4 + 2 - 1/5g*3. Factor u(o). o(o - 1)*2(o + 2)/5 Let t(d) be the second derivative of d8/2520 - d7/1260 - d*6/270 - 2d*3/3 + d. Let x(y) be the second derivative of t(y). Factor x(w). 2w*2(w - 2)(w + 1)/3 Let b be (-12)/8 - (9 + -7 + -5). Solve -6n*2 + bn*5 + 0 + 9n*3 - 6n*4 + 3/2n = 0. 0, 1 Let d = 6760/11 + -614. Let -4/11 + db - 2/11b*2 = 0. Calculate b. 1, 2 Let i be 6/(-4)(-6)/(-3). Let r(l) = -3l5 - 2l*3 + l. Let x(n) = -4n5 - n4 - 3n3 + n2 + n. Let o(b) = ir(b) + 2x(b). Factor o(f). f(f - 1)*3(f + 1) Let m(u) = -20u3 - 75u*2 - 25u + 5. Let l(s) = 10s3 + 38s*2 + 12s - 3. Let y(f) = 5l(f) + 3m(f). Factor y(q). -5q(q + 3)(2q + 1) Let k(m) = 2m - 7m*2 + 4m2 - m2 - 3m. Let p(s) = -9s*2 - s - 1. Let g(o) = -5k(o) + 2p(o). Suppose g(t) = 0. What is t? -2, 1/2 Suppose 0 = -2m - 0m - 6. Let y be 16/(-4) + m + 11. What is n in 1/2n*3 - 1/2n + 0 - 1/2n2 + 1/2n*y = 0? -1, 0, 1 Let n(w) be the first derivative of -3w*6/4 + 24w*5/5 - 13w*4/2 + 8w3/3 + 8. Factor n(t). -t2(t - 4)(3t - 2)2/2 Let o(w) be the third derivative of -w5/50 + w4/30 + w3/15 - 7w*2. What is b in o(b) = 0? -1/3, 1 Factor -95y + 56y + 47y + 4y2. 4y(y + 2) Let o(p) be the third derivative of p5/45 - p4/6 + 4p*3/9 - 12p*2. Find l, given that o(l) = 0. 1, 2 Suppose -2o - 8 = -4o. Let q(t) be the third derivative of t2 + 0t + 0t3 + 0t*o + 0 - 1/90t*5. Factor q(h). -2h2/3 Let w(n) be the third derivative of n5/240 - n4/24 + n3/6 + 6n2. Let w(d) = 0. What is d? 2 Let c(s) = -5s*2 + 5s - 4. Let q(o) = 11o2 - 11o + 9. Let x(y) = -9c(y) - 4q(y). Factor x(f). f(f - 1) Let x = -24 - -24. Factor d2 - 3d + xd2 + 6d. d(d + 3) What is h in 8/21 - 8/7h + 10/21h2 = 0? 2/5, 2 Factor 81/4s*3 - 3/2s + 9/4s2 + 0. 3s(3s + 1)(9s - 2)/4 Let g(a) be the third derivative of -a8/392 + a7/105 - a*6/210 - 6a*2. Let g(n) = 0. What is n? 0, 1/3, 2 Let q be ((-2)/3 - 0)-3. Suppose -2l = ql. Solve 4/3t + l - 2/3t*2 = 0. 0, 2 Let u = 374/7911 + -3/293. Let q(j) be the second derivative of -2/9j*2 - 3j + 1/54j4 - uj*3 + 0. Factor q(d). 2(d - 2)(d + 1)/9 Let b(r) be the first derivative of -440r*6/3 - 408r*5 - 1415r*4/4 - 220r*3/3 + 45r*2/2 + 10r + 28. Let b(y) = 0. What is y? -1, -1/4, 2/11 Let h(y) be the first derivative of 3y5/5 - 3y*4/4 - 4. Factor h(k). 3k*3(k - 1) Suppose 2j + 3t = -0j - 3, j + 3 = -2t. Factor 9/2kj - 7/2k*2 + 0 - 5/2k*4 + 1/2k*5 + k. k(k - 2)(k - 1)3/2 Let m(a) = -17a*4 - 12a*3 + a + 6. Let l be (-111)/(-18) + (-5)/30. Let x(k) = -9k*4 - 6k*3 + 3. Let z(v) = lm(v) - 11x(v). Factor z(c). -3(c - 1)(c + 1)3 Find g such that -g + g3 + 4g*2 + 6g*2 - 6g*2 - 4 = 0. -4, -1, 1 Factor 4x*3 + 1 - 5/2x - 7x2. (x - 2)(2x + 1)(4x - 1)/2 Let r be (-5)/(-12) - ((-28)/16)/(-7). Suppose 0f - 1/6f2 + 1/6f*4 + 0 + rf*3 - 1/6f5 = 0. Calculate f. -1, 0, 1 Let w(v) = -v3 - v2 - v + 2. Let o be w(0). Let m(r) = -r3 - r*2. Let t(i) = -8i*3 - 5i*2 - i. Let q(n) = ot(n) - 14m(n). Factor q(p). -2p(p - 1)2 Let t(p) = 2 - 4 - 2 - 3p - 2p2 - 3p. Let y(d) = -10d2 - 30d - 20. Let v = 3 - 5. Let o(l) = vy(l) + 11t(l). Factor o(b). -2(b + 1)(b + 2) Let u be (4/21)/((-7)/(-21)). Find s, given that u + 6/7s + 2/7s*2 = 0. -2, -1 Suppose 9v - 12 = 3v. What is y in 0 + 4y*3 + 11/4y*v + 7/4y*4 + 1/2y = 0? -1, -2/7, 0 Factor -25a3 + 10a - 7a2 + 3a*2 + 8a*4 - 2a*5 - 4 + 17a*3. -2(a - 2)(a - 1)3(a + 1) Let m(r) = 4r3 + 20r*2 + 30r - 14. Let b(k) = -k*3 - 4k*2 - 6k + 3. Let g(d) = 28b(d) + 6m(d). Find j, given that g(j) = 0. -1, 0, 3 Let s(w) be the third derivative of w5/75 - w4/15 + 2w3/15 - 6w*2. Solve s(o) = 0 for o. 1 Let v(h) = 75h*5 + 135h*4 + 87h*3 + 12h2 - 15. Let g(j) = -j3 + 1. Let w(r) = -15g(r) - v(r). Factor w(o). -3o*2(o + 1)(5o + 2)*2 Let c(h) be the third derivative of 4h*5/105 + 5h*4/42 + 2h*3/21 + 32h*2 - 2h. Factor c(d). 4(d + 1)(4d + 1)/7 Let g(h) be the second derivative of -2h*7/21 + 8h*6/15 - 3h*5/5 - 4h*4/3 + 8h*3/3 - 12h. Let g(i) = 0. What is i? -1, 0, 1, 2 Let f(r) be the first derivative of -3r4/4 + 5r*3 - 12r*2 + 12r + 15. Find a such that f(a) = 0. 1, 2 Suppose -v - 8 = -5p - 4, -2v = 8. Factor pa - 1/4a*2 + 1/4. -(a - 1)(a + 1)/4 Let u(j) be the first derivative of -2j6/3 + 16j*5/5 - 4j*4 - 8j*3/3 + 10j*2 - 8j - 7. Factor u(f). -4(f - 2)(f - 1)*3(f + 1) Let m(i) = i*2 + 12i + 7. Let o(r) = 4r + 2. Suppose -a - 1 = -3. Let n(k) = am(k) - 7o(k). Find d such that n(d) = 0. 0, 2 Let j = -65/3 - -263/12. Find o such that 1/2o*2 - jo*4 + 0o + 0o3 - 1/4 = 0. -1, 1 Let 25x - 30x2 + 7x*3 + 125/2 - 1/2x*4 = 0. Calculate x. -1, 5 Factor 16/3f*3 + 20/3f*2 + 1/3f*4 + 0 + 0f - 1/3f5. -f2(f - 5)(f + 2)2/3 Let y(z) = -z2 - 4z + 3. Let f(u) = 3u3 - u2. Let m be f(-1). Let s be y(m). Factor 0 + 1 + 2 - sa*2 - 3a + 3. -3(a - 1)(a + 2) Let q be 1116/(-16) - (-2)/(-8). Let h be (-14)/45/q. Find g such that 1/4g*3 + 0g + 0 + 1/4g2 - 1/4g*4 - hg5 = 0. -1, 0, 1 Let m(j) be the first derivative of j5/80 + j4/16 + j3/8 + j2/8 - j + 4. Let v(w) be the first derivative of m(w). What is q in v(q) = 0? -1 Let r(v) be the third derivative of v6/600 - v*5/50 + 3v*4/40 - 25v2. Determine n so that r(n) = 0. 0, 3 Let x(a) be the second derivative of a4/4 - 5a. Suppose x(q) = 0. What is q? 0 Suppose -2/11g - 4/11 + 2/11g2 = 0. What is g? -1, 2 Let b(w) be the third derivative of -w8/100800 + w6/3600 + w5/60 - 2w2. Let i(r) be the third derivative of b(r). Suppose i(t) = 0. What is t? -1, 1 Let g(i) be the third derivative of -i6/40 - 7i5/20 - 3i*4/4 - 3i*2 - 7i. Factor g(v). -3v(v + 1)(v + 6) Factor 2/5g*2 + 12/5g + 18/5. 2(g + 3)2/5 Let a = 23545/108 + -218. Let d(t) be the third derivative of -at*4 - 2t*2 - 1/540t*6 + 1/135t*5 + 0t*3 + 0t + 0. Solve d(y) = 0. 0, 1 Let s(d) = 6d2 - 9d + 9. Let w(y) = y*2 + y - 1. Let t(f) = s(f) - 3w(f). Factor t(p). 3(p - 2)2 Let b(r) be the second derivative of -r6/20 - r5/6 - r4/12 + r3/3 - r2 - 8r. Let v(m) be the first derivative of b(m). Factor v(z). -2(z + 1)2(3z - 1) Suppose 0 = -y + 2y - 2. Let i be ((-8)/(-10))/((-2)/(-5)). Suppose 4wi - 2w*y - 5w*2 = 0. What is w? 0 Let z be 6/2 + 35/(-50)2. Factor 0	{ "pile_set_name": "DM Mathematics" }
(6). Solve -4p = -tn + v, 5p + 2 + 12 = 3n for n. -2 Suppose -3v + 268 = 54v + 10v. Solve -j = -vt - 2j + 6, -3 = 3t - 3j for t. 1 Let j(r) be the third derivative of r5/60 + 5r*4/24 + 11r*3/6 + 50r*2. Let a be j(-3). Solve -5 = -5b, ad - 4b - 10 = b for d. 3 Let r(n) = -45n3 - n2 - 4n - 2. Suppose 0 = -2o + 6o + 4. Let z be r(o). Let x = z + -33. Solve x = j + 3l, 5j - 2l + 3 = -0l for j. 1 Let v(w) = w*2 + 7w - 258. Let b be v(-20). Solve -bp + 9x - 5x + 24 = 0, -3p = 4x + 14 for p. 2 Suppose -7d + 2d = -15, -159 = -2g - 3d. Let t = g + -70. Solve -tr = -4x - 25, -3r + 2x - 3x = -15 for r. 5 Let b = -349 + 349. Solve -2k - 2 = -d, d - 17k + 20k - 2 = b for d. 2 Let x(n) = 3n*2 - 5n + 1. Let u be x(-5). Suppose u = -4y + 109. Solve -2d - 5 = 3v, 3v = -4d + yv - 15 for d. -4 Let o(i) = i*3 + 20i*2 + 27i + 158. Let s be o(-19). Solve 5t - 3j - s = 2, 5j = -2t - 3 for t. 1 Suppose -9x - 5 = -11 - 30. Solve -9 = -xc + 3f, -6f = -5c - 4f + 6 for c. 0 Let q(j) = -3j - 43. Let u(t) = t2 + 17t + 57. Let s be u(-8). Let n be q(s). Solve 2k + 2b + 2 = -2k, k + 13 = nb for k. -3 Let q = 1310 - 752. Let v = -555 + q. Solve u - 3 = 2u, -vo - 12 = 5u for o. 1 Suppose 2c = -o + 9, 0o = 3o + c - 17. Suppose -23 = -oq + 107. Let v = -21 + q. Solve 0 = -vi - 5p + 5, 3i - 33 + 6 = 5p for i. 4 Let m = 210 - 334. Let s = 128 + m. Solve 3t = 2b, 5t - 4 = -2b + sb for t. 2 Let p(v) = v*2 - 29v - 60. Let q(b) = b*2 + 22b - 17. Let y be q(-24). Let g be p(y). Solve -7s + 3z - 35 = -3s, -5s - 35 = -gz for s. -5 Suppose -m - 383 = -385. Suppose 0 = -2a + 3 + 7. Solve 4o + 20 = 2x, 3x + mx - ao = 25 for x. 0 Let w(l) = l2 - l. Let f(c) = -2c*2 + 17c + 21. Let a(z) = f(z) + 4w(z). Let j be a(-2). Solve -jn = -2y - 1 - 6, n = -5y - 9 for y. -2 Let v(i) = -45i - 2291. Let y be v(-51). Solve 0 = 3n - yt + 12, -3t + 5 = -6n - 4 for n. 0 Let l = 7522 - 7499. Solve -3y + 15 = 0, -3b + l - 28 = -y for b. 0 Let s be (-2)/(-4)(-2 - -6). Suppose 13 = 2v - k, 79 = -v - 12k + 23. Solve 0 = -t - sy - 1, v = -3y + y for t. 3 Let k(w) = -2w2 - 20w - 1. Let g = -41 + 80. Suppose 8 = 4d, 5r - d = -4d - g. Let s be k(r). Solve 24 = -4a + 2h, 5a + 2h = -s - 4 for a. -5 Let r be ((-5208)/12)/(-14) - -12. Suppose 22w - rw = -22. Solve 0 = 2a - y + 3, wa + 3y = a + 16 for a. 1 Let h be (208/66 + (-8)/(-44))186/155. Solve 5s + hz = -31 + 10, -5s - 23 = 2z for s. -5 Let n(g) = -3 - 4 + 2g + 27. Let v be n(-7). Suppose v = p + 3. Solve -3z = -4b - 15, -b - 3z + 15 = -pb for b. 0 Let h(s) = 2s - 18. Let o = -6 - -16. Let j be h(o). Suppose p - 1 = j. Solve -5d + 0r = pr - 5, 0 = 2d + 4r + 12 for d. 4 Suppose 209 + 343 = -8u. Let f = -67 - u. Solve 3p - fy - 23 = 0, -5y + 12 = -p + 37 for p. 5 Suppose -8j = -9j + 3. Let a be 23 + (3 + 0)/j. Let g(d) = d3 + d2. Let r be g(1). Solve -4c - 2v - 18 = 0, a = -rc - 6v + 2v for c. -2 Suppose 0 = -12a + 4439 - 1115. Let w = a - 274. Solve 17 = -u + 4n, -wu - 8 = -2u - n for u. -5 Let o(t) = 7t3 - 12t*2 - 7t + 32. Let z(f) = 2f3 + 1. Let u(p) = -o(p) + 4z(p). Let r be u(-11). Solve 8v - 5 = d + 7v, 2d + r = 4v for d. -2 Let v(c) = -2c2 - 2c + 9. Let m be v(-4). Let t be 2 - 8/5 - (-6)/m. Solve -5w = -j - 8, -3j - w - w + 10 = t for j. 2 Let j(i) = i*2 - 30i + 56. Let f be j(28). Suppose f = -c - 79 + 3. Let g = c - -80. Solve 4 = gy, -l + 1 = 5y - 0y for l. -4 Suppose 0 = 2y, f + 14 = 3f - 3y - 10. Solve -f = i - 3r, -2i - 5r + 20 = 2i for i. 0 Suppose -24v = 200 - 680. Solve g - 3i = 4, 2g - 3i + v = 7g for g. 4 Suppose 0 = -3z + 2z + 6. Let p be 2/z - (-11)/3. Suppose 87l - 1744 = -475l + 126l. Solve -6 = 4u - 2v, pv + 26 = -lu + 2v for u. -4 Let q(n) be the second derivative of -n4/6 + 7n*3/6 - 2n*2 + n. Let g = 3615 - 3613. Let j be q(g). Solve -4o = jk + 8, -3o + 8 = 2k + 3k for k. 4 Suppose 29s - 39s + 290 = 0. Suppose -sf + 5f + 24 = 0. Solve -x + 3t - 17 = -f, 4t - 19 = -x for x. -1 Let k = -5241 - -5291. Solve -4r - 51y = -ky - 13, -r - 2y + 5 = 0 for r. 3 Let l(c) = 2c2 + 11c - 12. Let k be l(-7). Suppose 32 = kf - 4. Solve m + 4i = 3, m - fm + 4i = 7 for m. -1 Let o = -72 + 41. Let p = -29 - o. Let i be (6/(-10))/((-1)/5). Solve l - 5z + 4 = -19, -pl + 19 = iz for l. 2 Suppose -4k + 5 = -3k. Suppose 0 = -km + 7 + 8, -w + 3m - 4 = 0. Solve -5z + ws = 6 + 14, 0 = 5z - 4s + 19 for z. -3 Suppose 2a - 4x - 30 = 0, 40x = 36x - 12. Solve 3d = -12o + ao - 15, 3d + o = -9 for d. -2 Suppose -19h = -0h + 17h - 576. Solve 4w = -5n - 8, 21n + 14 = hn - 2w for n. -4 Let f(d) = 14d + 241. Let s be f(-17). Suppose -4g - sm = 8 - 23, -g - 3m = -15. Solve 2n - 3x - 7 = 0, 3n - 4x + 5 - 16 = g for n. 5 Let h(v) = -v3 - 12v*2 + 12v + 161. Let r be h(-12). Solve -c - 2c = -5f - r, -5f = 4c + 24 for c. -1 Suppose -7n = 42 - 70. Let c be (-14)/(-35) - ((-140)/25 + n). Solve 5r - 25 = -3a - ca, 5r = -2a + 25 for a. 0 Let c be ((-2)/20 + 11/16539)2. Let y = 5 + -1. Suppose -6u = -yu. Solve cj - d - 4d = -10, u = j - 3d + 4 for j. -1 Let w be 63/7 + 32. Suppose -q = -3q - wq. Solve -2 = r - h - q, 0 = -2h + 2 for r. -1 Let f be 7 + (1 + -1)/(-1) + -4. Solve -4g + 10 = -5l - 2g, -fl - 6 = -g for l. -2 Let c(u) = -134u + 821. Let s be c(6). Solve m = 5n - 23 + 13, m + 4n = s for m. 5 Suppose 0r - 2v + 20 = r, -12 = -3v. Let t = r - -5. Suppose -7m - 12 = -10m. Solve -4b - 15 + m = 3i, -4b - i - t = 0 for b. -5 Suppose -4p = -l - 19 - 4, -2p - 4l - 2 = 0. Suppose -6z = -pz. Let x = 5 + z. Solve a - 3 = 4i - 1, -xa - 6 = -4i for a. -2 Let k(y) be the second derivative of y5/20 + y4/4 - y*3/6 + 15y*2/2 + 11y + 2. Let a be k(-4). Solve 17 = -o - 4u, -2u - a = 2o + 13 for o. -5 Suppose -2v - 1 = -r, 5v - 4r - 2 = -6r. Solve v = -3j - p + 8, 7 = 4j - p - 6 for j. 3 Suppose -5m - 3t = 9, -20m = -23m + 4t + 12. Suppose -3x + 74 = -2u, m = 5x - 6u + 5u - 114. Solve -v + 3s - 12 = 0, -v + 2s - x = -5v for v. 3 Let m be (48 + 6)/((-3)/(-2)). Suppose 4s - 15 = u, -2u + 6u - 2s = -116. Let q = m + u. Solve -1 = -5i - 2l, i - l - 1 = -q for i. -1 Let x be 7 - (-2 - 5) - (-180)/(-18). Solve y = -4w - 1, -w + 179 - 168 = xy for y. 3 Let c = -5748 + 5795. Solve 0 = 3p - 12, ca = 52a - 3p + 27 for a. -3 Suppose -24 = -17w + 9w. Suppose u + o = w, o + 6 = 2u + 3. Solve 0 = -un - 6, 2n = -4s + 3 - 1 for s. 2 Let g be (-13520)/(-1521) - (-2)/18. Solve 5x - 16 = 3i + 4x, x = -2i - g for i. -5 Suppose -31 - 54 - 6 = -13l. Solve -j - 2s = -2j, 2j = -3s + l for j. 2 Let s = -6950 + 6958. Solve 4i = 4z - s, 4z = -7i + 3i - 24 for z. -2 Suppose 323 - 479 = -3n. Suppose -2m - a + n = -3a, -5m = 2a - 123. Solve 4l + 5f = m, -3l - 10 = -2f - 0f for l. 0 Let q = 3271 + -3252. Solve -5l = 20, -3l - 34 = s - q for s. -3 Let q(f) = -f*2 + 2f + 5. Let r be q(3). Suppose 2u + 4 = 0, 2c - 5c - 3u = -60. Suppose -c = 16y - 18y. Solve rh - 8 = 3o, 5h - y = -4o + 9 for h. 4 Let i(p) be the first derivative of 1/3p3 + 8 + 34p + 13p2. Let l be i(-25). Solve -4g + g = -5h - 8, -5h + 4g = l for h. -1 Suppose 0m = -2m + 24. Let t be (107/(-3))/(-1 + m/9). Let w = t - -107. Solve -5u = -k - wk + 25, 0 = 2k - 4u - 20 for k. 0 Let j(l) = 148l + 2518. Let t be j(-17). Let r = -88 - -130. Let p be 12/r - (-80)/14. Solve p = -3h, -26 = -4u - th + 5h for u. 5 Suppose -3l - 2g - 30 = 6, 3l + 36 = -4g. Let f(k) = -k*3 - 11k*2 + 10k - 21. Let i be f(l). Solve 5n + iu + 14 = 0, n - 1 = -4u - 14 for n. -1 Suppose -3a - 1459 = 2c - 7c, -a = 3. Let o = -287 + c. Solve n + y - 5 = 0, -2n + 4y - 5 = oy for n. 0 Suppose -76 = -4v + 4w, -8v + 10 = -6v + 5w. Suppose 5i = 4y + v - 2, 14 = i + 3y. Solve -4u = -2t, iu - t = -3t - 9 for u. -1 Let c = -130 + 147. Suppose -cp + 25 = -60. Solve 3m + pn - 1 = 1, 4n - 3 = -m for m. -1 Let m = -187 - -199. Suppose 10x + 10 = mx + 2f, -4x = 5f - 22. Suppose 5b + 1 = -q + 3b, -b - 23 = -2q. Solve xd + q	{ "pile_set_name": "DM Mathematics" }
2 + d + 1. Let f(m) = 4m2 + 9m + 3. Let g(i) = -f(i) + 3y(i). Give g(-6). 0 Let c(z) = -z2 + z + 1. Let q(u) = -4u*2 - 5u - 7. Let y(d) = 6c(d) + q(d). Suppose 15 = -3h, -5g - 6h + h - 20 = 0. Determine y(g). -10 Suppose -15 = 5t - 5n, -t - 8n = -4n - 22. Let v(p) be the third derivative of -1/12p4 + 0 + 0p + 2pt + 1/60p*5 - 2/3p*3. Give v(3). -1 Let f(s) = -2s + 8. Let t(n) = -2n2 + 39n - 12. Let r be t(19). Determine f(r). -6 Let j(p) = 53 + p - 26 - 26 + 2p2. Let d(f) = -f2 - 5f + 2. Let l be d(-5). Suppose 2h + 4 = -lh. What is j(h)? 2 Let x(t) = 3t3 + 2t*2 + 4t - 3. Let k(a) = 10a3 + 5a*2 + 13a - 10. Let q(d) = 2k(d) - 7x(d). Let u = 4 - 4. Let n = u + -3. What is q(n)? -2 Let c(f) = f*2 + 2f. Let z be (-16)/6 - 11/33. Determine c(z). 3 Let i(q) be the first derivative of -q*2/2 + q + 7. Let a be (0 + 3)(2 + 1). Let j(x) = 3x - 3. Let p(g) = ai(g) + 4j(g). What is p(3)? 6 Let j(t) be the third derivative of t4/24 + t3/6 - 17t*2. What is j(4)? 5 Let j be 1(-1 - (-3 + 1)). Let s(d) be the second derivative of 1/6d3 + 0 + 3/20d*5 + 1/12d*4 + 2d - 1/2d2. Determine s(j). 4 Let r(t) be the first derivative of -9t*4/4 + 2t3/3 - t2/2 - 6. What is r(1)? -8 Suppose -8 + 10 = 2n. Let z(r) = -5r. Let i be z(n). Let y(m) = -m*2 - 7m + 2. Give y(i). 12 Let u(z) = -292z + 144z + 149z. Calculate u(-7). -7 Let i(v) be the first derivative of -v3/3 - 2v*2 - 2v + 6. Suppose -4t + 4f = 16, f + 12 = -2t - f. What is i(t)? -7 Let y(f) = f2 - 6f*3 + 2f*3 + 3f*3. Let d = 101 + -102. Determine y(d). 2 Let l be 4/(-3)6/(-4). Let d(s) = -1 - 2s + 3s - l. Determine d(0). -3 Let p(z) be the first derivative of -z*2/2 + 6z + 8. What is p(6)? 0 Let y(l) = -l*3 + 7l*2 - 5l + 5. Let b be 0 + (3 + -9)/(-1). Determine y(b). 11 Suppose 0 = -5b - 2j - 41, 3j + 14 = 5. Let g be (15/6)/(3/6). Let l = b + g. Let o(m) = -m3 - m2 + 2. Calculate o(l). 6 Let v(d) = -d - 6. Let b be v(-6). Let a be 12/(-7)-7. Let z(q) = 2 - a - 7 - q2 - q. Determine z(b). -7 Let z(m) be the first derivative of m4/4 - 4m*3/3 - m - 8. Determine z(3). -10 Suppose -2o = 3o - 20. Let d(i) = i2 - 5i - 2. Give d(o). -6 Let u be 4/6117/26. Let x be 38/14 + 6/21. Let b(n) = n3 + u + n2 + n2 + 2n - 2nx. Give b(3). 0 Let i(d) = -4d + 1 - d*2 + 5d + 3d. What is i(6)? -11 Let y(h) = -2h*2 - 4h + 2. Let p(w) = w*3 + 4w*2 - 11w + 2. Let q be p(-6). Give y(q). -14 Let r(n) = -2n - 1. Let c be (-2)/(-2 + 0)1. Calculate r(c). -3 Suppose 8 = -3s + 2. Let y be ((-2)/3)/(s/21). Suppose -6 = o + yx - 5x, 4o - 3x = 9. Let a(c) = -c3 - c2 + 7. Calculate a(o). 7 Suppose -5k + 20 = 3p, 5k = 2k - p + 12. Let w(m) = -m2 + 4m + 4. What is w(k)? 4 Let f(h) = -h - 3. Let c be f(-3). Let s(m) = m - 3. Calculate s(c). -3 Let k(v) = -2 + 4 + 0 - 9v + 11v - 2v2. What is k(3)? -10 Let v(g) be the first derivative of -g3/3 + 3g*2 - 4g - 3. What is v(5)? 1 Let l(j) = 2 + 0 - 207j + 206j. Determine l(-5). 7 Let v(j) be the second derivative of 1/3j4 + j + 1/6j*3 + 0 - 1/20j*5 + 0j2. Let n be v(4). Let z(m) = m2 - 4m + 6. Calculate z(n). 6 Let v be 1 - (0 + -2 + 1). Let p = v - 0. Let h(o) = o3 + 6 - 2 - 4o*2 - po3. Calculate h(-3). -5 Let d(r) = r3 + 10r2 + 14r - 11. Let l be d(-8). Let q(c) = c - 7. Calculate q(l). -2 Let k(s) be the second derivative of -s7/2520 + s6/360 + 7s5/120 + s4/6 + 2s. Let w(g) be the third derivative of k(g). Calculate w(5). -8 Let o(d) = -8d + 27. Let i(c) = -3c + 9. Let v(j) = 11i(j) - 4o(j). Determine v(-11). 2 Let w(z) = 3z + 14. Let q(s) = 5s + 21. Let h(j) = 25j + 105. Let i(n) = -2h(n) + 11q(n). Let l(a) = 5i(a) - 8w(a). Let p = -1 + 1. What is l(p)? -7 Let y be (1 + 15)3/(-6). Let j(q) = -3q + 11. Let a(z) = 2z - 7. Let u = 5 - 10. Let i(g) = uj(g) + ya(g). What is i(6)? -5 Let n be -4 - (0 + (-2 - 2)). Let y(h) = h*2 - h - 3. What is y(n)? -3 Suppose -q + 0q = -c + 2, 2q - 4c + 10 = 0. Let f(h) = h - 4 + 4 - q. Let i be -2 + 8/4 + 1. Determine f(i). 0 Let i = -26 + 17. Let x = 12 + i. Let t(c) = -c*3 + 3c*2 - 3c + 2. Give t(x). -7 Let k(c) = -c*3 - 3c*2 + 2. Let h = -11 + 5. Let b be (5 - -1)/(h/(-28)). Let a be b/(-35)(-10)/(-4). Give k(a). -2 Let s(k) = k*2 + 5 - 3 - 5k - 2k2 + 4. Calculate s(-6). 0 Let s(z) = 0 + 3z - 5 + z*2 - 8z. Suppose 2h - 14 + 2 = 0. Give s(h). 1 Let x(k) = -k + 5. Let l be 46/14 + 4/(-14). Suppose 2 = -2o + 6. Suppose -f = -2j - 2, -j - oj - l = -3f. Give x(f). 5 Let d(w) = w3 + w2 + w + 3. Let l be d(0). Let v(b) = 6b - lb - 7 - 4b. Determine v(-5). -2 Let g(i) be the third derivative of -i5/60 - i4/2 - 4i3/3 - 46i*2 + i. Calculate g(-12). -8 Suppose i - 2s + 1 = 6, s = 3i - 10. Let w(p) = p2 - 2p + 2. Calculate w(i). 5 Let t(n) = -6n3 - 7n*2 - 4. Let l(f) = 6f*3 + 6f*2 + 3. Let r(b) = 5l(b) + 4t(b). Give r(-1). -5 Let i(g) = 2g. Let b(c) = 4c. Let y(f) = -3b(f) + 5i(f). Suppose 5r - 2z + 5 = 0, -5r - 30 = 2z - 5. Let s = -4 - r. Calculate y(s). 2 Let l be 4/(-10) - 40/(-100). Let m(f) = -f - 8. Give m(l). -8 Let k(r) = -r - 1. Let g(t) be the first derivative of 0 + 6t + 2 + 2t2 - 3t - 6. Let d(n) = 2g(n) + 6k(n). Calculate d(4). 8 Let i(r) be the second derivative of r6/180 - r5/20 + r*4/24 + 7r*3/6 - 6r. Let p(o) be the second derivative of i(o). What is p(4)? 9 Suppose 2w - 2b = 0, 5b = w - 4 - 0. Let q = w - -8. Let a(k) = -k3 - 5k*3 + 4k*2 + qk*3. What is a(-4)? 0 Let p(n) = 2n + 3. Suppose -x + 5 = x - 3k, -2k = -5x + 29. What is p(x)? 17 Let m be 38 - (2 - 3)-4. Suppose -14 + m = 4l. Let n(x) = -x3 + 6x*2 - 2x - 6. What is n(l)? 9 Suppose t - 24 = 4t. Let l be (6/4)/((-4)/t). Let w(r) = -r3 - 3r*2 + 5r - 4. Let y(b) = b*2. Let s(v) = w(v) + 5y(v). Calculate s(l). 2 Let b(k) be the second derivative of -k*3/6 - 5k*2/2 - 8k. Give b(-5). 0 Suppose 5i - 28 = i. Let p(q) = q2 - 6q + 5. Give p(i). 12 Suppose 0i = -5i + 5. Let j = 4 + i. Let d = 6 - j. Let m(q) = 4q2 + 1. What is m(d)? 5 Let i(p) = 2p*3 - 3p*2 + 1. Let r be (-2)/(-2) + (-1 - -3). Let a be (-2)/r - (-16)/(-3). Let s be (-2 + 1)a/3. Determine i(s). 5 Let h(s) = -s*3 + 3s*2 - 1. Let z = 6 - 2. Suppose z = -3m - 5. Let f = m - -6. Give h(f). -1 Let f(h) = -1 - 2h2 + 14h2 + 5 - h2 + h3. Let p be f(-11). Let x(q) = q2 - 3q + 1. Determine x(p). 5 Let q(p) be the first derivative of p3/3 + 2p*2 - 7p - 2. Let l = -51 + 45. Give q(l). 5 Let t be 3/(-12)0 - -1. Let o(a) = -2a*2 - a + 2a - t + 3a2 - 7a. Suppose -3c - c = -24. Calculate o(c). -1 Let c(n) = -2n*2 + n + 1. Suppose -32 = 6p - 2p. Let h be ((-1)/2)/(4/p). Let b be (2/h)/2 + -3. Give c(b). -9 Let n(y) = 5y*3 - 3y*2 + 2y - 3. Let s(h) = -6h3 + 3h*2 - 2h + 4. Let z(j) = 5n(j) + 4s(j). Suppose -4b = -2 - 6. Give z(b). 1 Let n(a) be the third derivative of -1/6a*4 + 0 + 1/60a*5 + 0a - a*2 + 1/6a*3. Suppose -34 - 16 = -10g. What is n(g)? 6 Let b(t) be the first derivative of -t4/4 + t3 - 5t2/2 + 4t + 9. Give b(3). -11 Let u(v) = -v*3 + 7v2. Let o be u(7). Let i(n) = -n2 + n + 5. Let r be i(o). Let d(x) = x*2 - 2x - 7. What is d(r)? 8 Suppose -4a = -7a. Let h = a - -2. Let g(p) = 2p3 - 3p*2 + 3p - 2. Let z(v) = -10v3 + 15v*2 - 16v + 10. Let r(c) = -11g(c) - 2z(c). Give r(h). -4 Let a(s) = s*3 - 4s*2 - 3s - 4. Let j be a(5). Let c(q) be the second derivative of -q*3/6 - 15q. Determine c(j). -6 Let c(d) = 6d - 2. Suppose 9u = 13u + 8. Give c(u). -14 Let z(h) be the first derivative of -h4 + 4h*3/3 - 9h*2/2 + 9. Let q(y) = 11y*3 - 13y*2 + 26y + 1. Let r(k) = -3q(k) - 8z(k). Calculate r(6). -3 Let v(p) be the second derivative of p4/12 - p3 + 2p2 + 15p. Determine v(4). -4 Let l = -8 - -14. Let n(y) = 0y3 + 6y - 18y2 + 0y*3 + 23y2 - y3 + 3. Calculate n(l). 3 Let v(g) be the third derivative of 4g2 + 5/24g*4 + 0g - 1/3g3 + 0. Give v(-2). -12 Let u(w) = -w - 3. Let y be u(3). Let p(s) = -s3 - 5s*2 + 9s + 7. Determine p(y). -11 Let l(u) = -3u2 + 4u - 9	{ "pile_set_name": "DM Mathematics" }
d 2i - 5i + i + (-2i + i + 3i)(-2 - 1 + 5) - 1 - 9i + 1 + (0 - 2 + 0)(0 + 0 - 2i) + 4i + 0i - 3i. -2i Expand (-4 + 3 - 1)(-1 - 1 - 1)(-p + 21 - 20 - 2p). -18p + 6 Expand -8c - c - c + (0c - c - c)(2 - 2 - 1). -8c Expand (v*2 + 5v*2 - 4v*2)(-v + v + v) - 2v2 + 2v2 + v3. 3v3 Expand 55o*5 - 175o*3 + 175o*3 + (-1 + 4 - 2)(-3o2 + 3o*2 - 2o*5). 53o*5 Expand -f + f + f + (-2f - 2 + 1 + 4f)(-2 + 4 - 3). -f + 1 Expand 0j2 + 0j*2 - 2j*3 + (-3j + 2j + 3j)(-j2 - j + j) + 50 - 4j3 - 50 + j3 + 0j3 + 0j*3. -7j*3 Expand (0 + 2 + 0)(d - d - d) + (6 - 6 - d)(-4 + 1 + 2) - 1 + 1 - 2d. -3d Expand -2y*3 + 4y*3 + 0y*3 + (4y + 0y - 5y)(y2 - y2 + 2y*2) + (4y2 + y2 - 6y2)(y + y + 0y). -2y*3 Expand -3r + 3r + 3r*4 - 3r*4 + 0r*2 + 0r*2 + (-4r*2 + 3r*2 + 0r*2)(3r2 - 7r*2 + 0r*2). 4r*4 Expand (-6 - 9 - 3)(0v3 + 0v*3 + 3v*3). -54v*3 Expand (-1 + 1 + 2j*2)(-j - 2j + 4j)(-1 + 6 + 0). 10j*3 Expand (3w - 4w + 4w + (4 - 4 + w)(0 - 1 + 2))(-1 + 2 + 0)(0 + 1 + 1). 8w Expand (-2u - u + 5u - u*2)(-4u - u + u). 4u*3 - 8u*2 Expand (3q*2 - 2q + 2q)(-5 + 1 + 1). -9q2 Expand -5h*4 + 4h*4 - 2h*4 + 4h + 2h4 - 4h + (-2h + 5h - h)(4 - 2h*3 - 4) - 2h4 + h3 - h*3 + 2h*4 - 3h*4 - 3h*4. -11h*4 Expand (-4 - 2 - 2)(-1 + 0 + 2)(-2b - 2 + 2). 16b Expand -2g*4 + 4g*4 + 0g4 + (g2 - 3 + 3)((-1 + 1 + 2)(-4g2 + g2 + g2) - 2 + 2 - g2 + 2 - 2 + 6g*2). 3g*4 Expand (6x - 4x + 6x)(-3 + 3 - 2). -16x Expand ((-2h - h + h)(4h3 - 4h*3 - 3h*3) - 5h*4 + 2h*4 + 2h*4)(1 + 3 - 2). 10h4 Expand (-4 - 2 + 3)(4w + 2w + 2 - 4w). -6w - 6 Expand (-3 + 0 + 1 + 4 - 3 + 0 + (-2 + 1 + 0)(-3 + 3 - 1) - 2 - 6 + 4)(-2 + y + 2). -4y Expand (5p - 4p - 3p)(-1 + 0 + 0)(-5p + 1 - 2 + 4p). -2p2 - 2p Expand (-2p3 + p - p)(-3p + 2 - 2) + (0p*2 - 5p*2 + 4p*2)(p*2 - 3 + 3) - 53p*3 + 53p*3 + 4p*4. 9p4 Expand -m2 + 2m - 2m + 2m + (1 - m - 1)(4 - 3 - 2)(5m + 10m + 15m). 29m2 + 2m Expand (3a - a + 0a)((-4a - 3a + 5a)(-1 - 4 + 3) + 12a - 24a - 28a). -72a2 Expand (13 - 13 + m)(-2 - 4 + 4). -2m Expand (5l - 5l - 2l*2)(-2l3 + 0 + 0) + 2l*5 - 3l*5 + 4l*5. 7l*5 Expand (5 + 2 - 2)(3r - 4r + 3r + 0r + 0r - r - r - 4 + 4 + r + r - 3r + (0r - r - r)(0 + 0 - 1) + 3r + r - 3r + 0r + 2r + 0r). 20r Expand (3h - 2h - 2h)((3 - 7 + 2)(6h + 16h - 5h) + 5h - 4h - 2h)(2 + 2 - 3). 35h2 Expand (-1 - 3 + 6 + (-2 + 5 - 2)(0 - 1 + 0))(-4w + w + w). -2w Expand (3 - 1 - 3)(4n3 + 3301n*2 - 3301n*2). -4n*3 Expand (10k - 5k + 26k)(-1 - 2k*3 + 1). -62k*4 Expand -4 + 4 - 2p*2 - 4p2 + p2 + p*2 + (p + 2p - 4p)(2p - 3 + 3) + 0p*2 - 5p*2 + 4p*2 - 3p + 2p2 + 3p. -5p2 Expand 3d*4 - 4d*4 + 3d*4 + (2d*2 - 2d*2 - 3d*3)(-5d + 2d + 2d) + 0d*4 - 3d*4 + 4d*4. 6d*4 Expand (0s + 3s - 2s + 4s - s - 2s - s + s + 2s + (4 - 4 + s)(0 + 0 + 2) + 2s - 2s - s)(-5 + 2s + 5). 10s2 Expand (-2 - l + 2)(2l + 3l - 3l) + 3l*2 + 8l*2 - 8l2. l2 Expand (-1 - 5 + 5)(4 - 4 + 2a) + (0 - 3 + 2)(0a + 4a - 5a) - 3 + 2a + 3. a Expand (5g*2 - 2g*2 + 2g*2)(-2 + 2 + g). 5g3 Expand (2a - 2a3 - 2a)(-a + 6a - 3a - 3a*2). 6a*5 - 4a*4 Expand (-1 + 1 - 2f*2)((9 + 9 - 10)(-4 + 4 + 2) - 6 + 0 + 4). -28f2 Expand (-p2 + 5p2 - 2p*2)(p + 0 + 0) + 1 - 1 + p3 + (p2 + p3 - p2)(-3 - 9 - 2). -11p*3 Expand (0d + d + 0d)(-1 + 2 - 2). -d Expand (0z3 + 0z*3 + 3z*4)(31z - 698 + 68z + 698). 297z5 Expand (-3j + 0j + j)(8 - 8 - 9)(j2 - 8j + 8j)(-1 + 2 + 1). 36j3 Expand (4c - 2c - 4c)((-2c + c + 2c)(-3 - 1 + 6) + 0 - c + 0 + 3 - 2c + 2c + 2c). -6c*2 - 6c Expand -4k2 + 4k2 + k2 + 4k2 + 4 - 2 - 6k*2 + (0 + 0 + k)(2 - 2 - k) - 3k2 - 3k*2 + 4k*2 - 3k*2 + 2k*2 + 0k*2. -5k*2 + 2 Expand (-2l3 - l3 + 5l3)(-l + 4l - 4l) + 2l4 - 3l*4 + 2l*4 - 5l - l*4 + 5l - 3. -2l4 - 3 Expand (2j*4 + 3j*4 - 6j*4)(2j + j - 4j) + (0j + 2j - 4j)(2j4 + 4j - 4j). -3j*5 Expand (1 - 1 + 2d)(5d*4 + 4d*4 - 4d*4)(1 + 3 - 2) + (d*2 - 3d4 - d2)(-d - 1 + 1). 23d*5 Expand 4q + 0q3 + 2q*3 - 5q + (2q2 - 4q*2 + 3q*2)(q - 1 + 1) + 2q3 + 0q*2 + 0q*2 + 2q*3 + 2q*3 - 3q*3. 6q*3 - q Expand (-4o - 3o - 21o)(o - 2 + 1 + 0o). -28o2 + 28o Expand (0n + n + 0n)(2n*3 - 5n*3 + 0n*3) + 3n*4 + 2n4 - n4 - 2n4 - 2n*3 + 2n3. -n4 Expand (-15 + 7 + 23)((-5t*2 + 0t*2 + 3t*2)(3t - 2t - 2t) - t3 + 3t*3 + 0t*3). 60t*3 Expand (-3 + 3 + 1)(1 - 4 - 5)(2u + 0u + u). -24u Expand (2x - 4x*2 - 2x)(x3 - x3 - 2x3) + x5 - 3x + 3x. 9x5 Expand (2g*4 + 0g*4 + 0g*4)(9 - 2 + 5). 24g4 Expand (-1 - 34 - 7)(0t + t + t). -84t Expand (-f*2 + 3f - 10 + 4 + 4)(-4f*3 + 6f*3 + 2f*3). -4f*5 + 12f*4 - 8f*3 Expand (4o - 3o + 0o)(20o*2 + 3o - 3o). 20o*3 Expand 0r - r + 0r + (-2 - 1 - 1)(r + 4r - r). -17r Expand (3n4 - n4 - 6n4 + (n3 - 3n3 + 3n*3)(-2n + n - n) - 3n4 + n4 + n*4)(4 + 0 - 3)(1 + 2 + 0) - 2n - 2n4 + 2n. -23n4 Expand (0p2 + p - 4 + 7 + p2)(-1 + 2p + 1). 2p3 + 2p*2 + 6p Expand (-104 + 104 - 50q4)(0 + 0 - 2q) + 0 + q5 + 0. 101q*5 Expand (-2u*3 + 0u3 + u3)(-158 - 2u + 150 - 14u). 16u*4 + 8u*3 Expand (28a*2 - 4a*2 + 2a*2)(-2a2 - a + a). -52a4 Expand -x3 + x - x + (-3x - 6x + 4x)(5x2 - 6x*2 + 3x*2). -11x*3 Expand (2a + 4 - 4)(-a2 + 2a - 2a)(6a2 + 21a - 21a). -12a5 Expand f5 + 1 - 1 + 3f5 - f5 - 4f5 + (f2 - 4f2 + 2f*2)(0f3 + f3 - 2f*3) + 1 - 5f*5 - 1 + (-2f + 4f - f)(2f2 + 2f*4 - 2f*2). -3f*5 Expand (-3k*2 - 3k*2 + 4k*2)(3 - 1 - 3)(-5 + 2 + 2). -2k2 Expand (c4 - 3c3 + 3c*3)(-c - c + c) - 4c5 + 4c*5 + 2c*5 + (4c2 - c2 - c*2)(2c3 - 3 + 3). 5c*5 Expand (3w + w - 2w)(-4 - 4 + 5) + 1 - w - 1 + 3w + 0w - w. -5w Expand (z3 - 34z + 34z)(-6z + 2z + z). -3z4 Expand (-207l + 9l2 - 3 + 207l)(-1 - 2l + 1). -18l3 + 6l Expand (z - 2z - z)(1 + 1 - 3 + (-6 + 3 + 4)(2 - 2 - 8)). 18z Expand (-2l2 - 2l + 2l + (-5l - 6l2 + 5l)(2 + 1 - 1))(-2l2 + 2 - 2). 28l*4 Expand (2 - 6 + 2)(-5i3 + 5i*3 + 8i*3)(2 - 1 + 0). -16i3 Expand (29 - 17k*2 + 15k*2 + 13)(2 - 1 - 3). 4k2 - 84 Expand 4c*3 + 0c*3 - 2c*3 + 0c*3 + 2c*3 - 3c*3 + (76 - 167 - 95)(3 - 3 + 2c3). -371c*3 Expand (-4g + 2g + 3g + g + 3g - 5g + g + 1 - 1 + (4g + g - 4g)(2 - 5 + 1))(-3g3 + 4g - 4g). 3g*4 Expand 70v - 70v - 2v*3 + (0v*2 - 2v*2 + 0v*2)(0 + 0 - 2v) - 3v*3 + 2v*3 + 2v*3. 3v*3 Expand (2h*2 + 3h - 3h)(-5h + 3h + 3h) + h3 + 2h + h - h. 3h3 + 2h Expand ((-2n + 5 - 5)(1 - 1 + 1) - 1 + 1 - 2n - n + n - n - 3 + 3 - 2n)((-2 + 2 - 1)(2 + 3 - 3) + 1 + 1 - 4). 28n Expand (-2y4 - y2 + y*2)(6 + 2 + 0) - 3y3 - 4y*4 + 3y*3. -20y*4 Expand (3g - 2g - 3g)(5g + 0g - 4g + (-3 + 2 + 2)(1 - 1 + 2g)). -6g2 Expand (2v*3 - 1 + 1)(-3 - 3 + 5 + (-4 + 1 + 2)(-2 + 3 + 0) - 1 + 0 + 2 - 1 + 1 + 2 + 4 - 1 - 1 + 2 - 4 + 4 + 12 + 0 - 1). 32v*3 Expand (5 - 4 + 3 + (0 + 2 - 1)(-3 + 3 - 2))(-q2 - 4q*2 + 2q*2 + (-3q2 + q2 + 3q2)(-3 + 6 - 2) - q*2 + 0q2 - q2). -8q2 Expand ((-2 - 4 + 5)(-3 + 4 + 0) - 2 + 0 + 3 - 1 + 0 - 1 + 1 - 1 + 1)(10y*3 - 2y*3 - 38y*3). 30y*3 Expand -3o*2 - 2o*4 + 3o*2 + (0o - 6o + 4o)(2o*3 + 0o*2 + 0o*2) + 0o*4 + 4o*4 - 6o4 - o4 + o4 - o4 + (1 - 1 - o*4)(-3 - 3 + 4). -7o4 Expand 2c*3 - 3c3 - c3 + (-2c + 4c*2 + 2c)(7c + 26 - 26). 26c3 Expand (-o + 0o + 0o)(5 - 3 - 3)(4o - 2o + 2o). 4o2 Expand 0t*2 - 5t*2 + 4t*2 + (2t + 1 - 1)(-t - 2t + 4t) + 2t*2 - 4t*2 + 4t*2 + 4t*2 - 9 + 9 - t. 7t*2 - t Expand (-5t + 2 + 0 + 4t)(-11t4 + 17t	{ "pile_set_name": "DM Mathematics" }
10/5. Let i be 36/(-10) + 2/(-5). Put -2, z, i in ascending order. i, -2, z Suppose -4a + 15 = -5n, n - 23 = -2n - 4a. Suppose 3m + 5l = -13 + 44, -m - 23 = -5l. Let t be m/(-4) + 110/20. Sort -0.4, t, n in descending order. t, n, -0.4 Let y(l) = -l2 + l + 2. Let d be y(2). Let w = -30 + 31. Let x = 2/25 + -89/175. Sort w, x, d in increasing order. x, d, w Let h = -44 + 16. Let x be (-4)/((-7)/(h/(-104))). Put x, 3, 2/5 in descending order. 3, 2/5, x Let z = 12.34 + -15.1. Let k = 0.24 - z. Sort 0.4, 5, k. 0.4, k, 5 Let x = -2.7 - -3.1. Put -0.3, 17, x in increasing order. -0.3, x, 17 Let q = 336 - 333. Let c be (-3)/(-6)2/1. Put c, -3, q in ascending order. -3, c, q Suppose -3o = 2a + 2, -3a + 0 = 3o + 3. Sort 6, -3, a. -3, a, 6 Suppose -3b = -w - 11, -w - b = w - 13. Suppose -s + wy + 9 = 0, s + 2y + 12 = 3. Suppose 2r - 6r = 8. Sort s, r, 2 in descending order. 2, r, s Let j be (-12)/(-15)(-4 + -1). Let o(k) = -2k + 3. Let z be o(4). Sort j, 2, z in descending order. 2, j, z Let d = 15.5 + -15. Sort d, 0, -0.5 in decreasing order. d, 0, -0.5 Let j = 13/12 - 145/156. Let d be (-15)/5 - (-64)/10. Let s = d - 124/35. Put j, 1/2, s in increasing order. s, j, 1/2 Suppose 4q + q = 2x - 16, 4x + 2q + 16 = 0. Let i be x + (-4)/10 - -2. Let f be -1 - (-1 - 4/(-22)). Put 1, f, i in decreasing order. 1, f, i Let a = -5 + 3. Sort 1/5, a, -4. -4, a, 1/5 Let p = -3 - -2.94. Let w = 0.24 - p. Let d = 4.9 - 0.9. Sort -4, d, w in ascending order. -4, w, d Suppose -a - 2m + 10 = 0, 2a = 5a - m - 9. Sort 1, a, 2. 1, 2, a Let r(n) = n + 2. Let o be r(-4). Let y(m) = m*3 + 3m*2 - m - 1. Let c be y(o). Sort c, 2, -5 in descending order. c, 2, -5 Suppose 5g + 0 - 30 = 0. Let u be (-14)/g - (-3)/3. Sort u, 2/9, -0.3 in increasing order. u, -0.3, 2/9 Let d = 3 + -2. Let i = 4 - d. Let n = i - 7. Sort 0, n, 3 in decreasing order. 3, 0, n Let g be 6/(-9)(-2)/4. Sort 5, g, -1 in ascending order. -1, g, 5 Let z be (0 + 0 - 0)/(-2). Let s be (4/5)/(6/30). Let y be (2/(-3))/(s/(-6)). Put y, z, 4 in decreasing order. 4, y, z Let q be 12 - (-2)/(-3)3. Suppose -3l - q + 1 = 0. Sort l, -1, 2 in increasing order. l, -1, 2 Let h(r) = -r + 1. Let f be h(1). Let p = -35 + 39. Put f, p, 3 in ascending order. f, 3, p Let j(r) = r3 + 4r*2 + 5r + 3. Let y be j(-3). Let v = 188 - 186. Sort 5, v, y in descending order. 5, v, y Let k = 0.1 - -0.2. Put 4, 2, 0, k in descending order. 4, 2, k, 0 Let k be (-3 + 3)(-1 + 2). Suppose -5a + k = 5. Let i = -3 + a. Sort 3, i, -5 in descending order. 3, i, -5 Let k = -7 - -6. Let t = 23 - 25. Suppose 5w - 15 = -3o, -3o + w = -4w + 15. Sort t, o, k. t, k, o Let n = 3.03 - 0.03. Let c = -718.5 + 718. Put 0.4, c, n in ascending order. c, 0.4, n Suppose -2i = -3f + 1 - 0, 0 = -4i + 5f + 1. Sort 2, 0, i. 0, 2, i Let l(y) = 2y2 - 5y + 5. Let o be l(2). Let x = 16 + -21. Put o, x, 0 in decreasing order. o, 0, x Let v = -2/9 - 1/9. Let c(f) = f*3 + 11f*2 - 11f + 10. Let y be c(-12). Let d be (-81)/(-63) - (-2)/y. Sort d, 1, v in increasing order. v, d, 1 Let p = -28.11 - -28. Let g = 0.01 + p. Put 1/4, g, 4 in ascending order. g, 1/4, 4 Let i = 35 - 23. Let g be (12/9)/((-4)/i). Let n be (-8)/4(-6)/4. Put g, n, -1 in descending order. n, -1, g Let q = -30 + 26. Put 0, q, -3, 5 in ascending order. q, -3, 0, 5 Let d = -19/4 + 103/20. Sort 1/2, 0.3, d, 4 in decreasing order. 4, 1/2, d, 0.3 Let r(u) = -u3 + 3u*2 + 2u + 8. Let j be r(4). Sort -2, j, 2. -2, j, 2 Let m be ((-1)/3)/((-9)/(-81)). Put 2, -1, m in descending order. 2, -1, m Let j = -4 - -3. Let z(d) = d. Let w be z(0). Suppose -3p + w = -12. Sort 0, j, p. j, 0, p Suppose 5w - 2h - h + 19 = 0, 3w + 21 = -3h. Put 5, 2, w in ascending order. w, 2, 5 Let j = -5 + 8. Let g = j - 3.2. Let p = 1 + 3. Sort -1, g, p in descending order. p, g, -1 Let q(b) = -b3 + 2b - 1. Let p be q(-2). Sort -17, 4, p in increasing order. -17, p, 4 Let s = -12.2 - -13.2. Put -15, 4/7, -2/11, s in ascending order. -15, -2/11, 4/7, s Let i = 20 - 25. Sort i, 0, -9 in descending order. 0, i, -9 Suppose 0 = w + 5y - 8, -2w + 6w + 5y = 2. Suppose -4g + 3 = -5b, 5g = b + 3 + 6. Put w, 4, b in ascending order. w, b, 4 Let y be (-2)/(-6) - (-238)/51. Suppose 25 = 4d - o - 2, -34 = -yd + o. Sort d, 1, -5 in increasing order. -5, 1, d Let l = 12 + -8. Suppose 7 = -3q - 5. Put l, -1, q in decreasing order. l, -1, q Let r(o) = -2o3 - 2o*2 - o - 2. Let x be r(-2). Let g be x/6(1 - 4). Let i = 8 + g. Put i, -1, 3 in ascending order. -1, 3, i Let p = -19 - -14. Put -0.1, p, 11 in ascending order. p, -0.1, 11 Suppose -u + 8 - 3 = 0. Let l = 0.14 - 0.24. Sort l, -4/3, u. -4/3, l, u Let q be 37/((-21)/(-4)). Put -2, q, 1 in ascending order. -2, 1, q Let n = 17773/110 - -1875/22. Let t = 246 - n. Suppose -3o + 2o = 0. Sort o, t, 5 in descending order. 5, o, t Let i be ((-2)/(-4))/(1/4). Suppose -20 = 2d - 6d, -5d + 85 = -3c. Let a be i/9 + c/9. Sort a, -0.4, -3. -3, a, -0.4 Let k = -1 + 4. Let m = 12 + -12. Sort k, m, 4 in decreasing order. 4, k, m Let x(c) = -3c + 1. Let t be x(1). Suppose -18 = 3k - 6. Sort -0.1, k, t in descending order. -0.1, t, k Let z(w) = w. Let t be z(2). Let c be (-1)/(-4) + 324/(-16). Let f be ((-1)/(-2))/(2/c). Put f, t, 1 in ascending order. f, 1, t Let c be (-9 + 1)/(-2)1. Let h(s) = s*3 + 3s*2 - 4s + 5. Let f be h(-4). Suppose -fv - 2 = -3v. Put -4, v, c in decreasing order. c, v, -4 Let y = 27/16 + -3/16. Sort -1/5, -0.5, y. -0.5, -1/5, y Let h = 0.04 - 0.14. Let n be -1 - (1 - 0) - -1. Let r(w) = 5w3. Let i be r(n). Sort i, h, 5 in decreasing order. 5, h, i Let k(x) = x - 27. Let g be k(27). Let a be -4(-1 - (-1 + 1)). Sort -2, g, a. -2, g, a Suppose w - 5a - 5 = 0, 2w + 4a - 1 - 9 = 0. Put 4, w, 1 in decreasing order. w, 4, 1 Let a = -0.2 + 0.7. Let b = 1.4 - 6.4. Let v = b - -4.8. Put v, a, -0.4 in descending order. a, v, -0.4 Let v = 3 - 6. Suppose d = 5 - 1. Put -5, v, d in descending order. d, v, -5 Suppose -8t - 32 = -72. Let p = 0 - -1. Sort -2, p, t. -2, p, t Suppose 2 = 2w + d + 4, -2 = d. Suppose 2f + x = 7f - 25, w = -2f + 5x + 33. Sort f, 0, -1 in increasing order. -1, 0, f Let t = 111 - 110.96. Sort -2/5, t, 5, 0.5 in decreasing order. 5, 0.5, t, -2/5 Let n = -27.3 - -26. Let g = n - -0.3. Sort 4, g, -0.1 in descending order. 4, -0.1, g Let v(h) = -h3 - 2h*2 + 2 + 0 - 2h + 1 + 2h3. Let u be (-3)/2(-12)/9. Let m be v(u). Put 5, m, 4 in ascending order. m, 4, 5 Suppose 2t = -4y - 0t, -5y - t = 6. Sort -1, y, 3. y, -1, 3 Suppose -2i - 7 = -15. Suppose 0 = 3h + ir - 17, -h + 3r - 1 - 15 = 0. Put -2/3, h, -5 in decreasing order. -2/3, h, -5 Let t(d) = -d3 - d2 - 2. Let y be t(0). Let s be 4/(-6) - 14/(-3). Sort s, y, 5. y, s, 5 Let v = -117 + 115. Let y = 8 - 11. Sort 6, y, v in descending order. 6, v, y Let v = 0 + 1. Let x be -20 + 1 + 4 + -5. Let w be x/6 - (-1 + -2). Put -3/4, v, w in decreasing order. v, w, -3/4 Let t = 4.3 + -0.3. Let c = t - 1. Let n = 2 + -5. Sort n, -5, c in descending order. c, n, -5 Let f = 4.993 - -0.007. Put f, -3, 2/5, -8 in decreasing order. f, 2/5, -3, -8 Let r = -6 - -3. Let p(w) = -3w + 25. Let l be p(11). Let n be (l/(-6))/(6/(-9)). Put r, n, 0 in ascending order. r, n, 0 Suppose 0 = -2u - 2 - 2. Let t = 3 - 3. Sort -4, t, u in decreasing order. t, u, -4 Let f be (1 + 1)/(-2)2. Let z be 96/(-72)(-1 + -2). Put z, 0, f in ascending order. f, 0, z Let t = -18 + 29. Put 3, -1/3, t in decreasing order. t, 3, -1/3 Suppose -4k + 65 = 5. Let t be (-22)/k - (-2)/3. Sort t, 5, 1. t, 1, 5 Let l = -14/3397 + 93329/390655. Let m = -10/23 + l. Put -5, 0.2, m in ascending order. -5, m, 0.2 Suppose 4 = -b - 1. Let g = 0.502 - 0.702. Put -0.1, g, b in descending order. -0.1, g, b Suppose 5 = -a + 4. Let c = -1 - -10. Let v = 5 - c. Put 3, v, a in ascending order. v, a, 3 Let x = -0.6 - -0.51. Let m = x - 3.91. Put 4/9, m, -1/2 in descending order. 4/9, -1/2, m Let t = -7 - -11. Let a = -26 - -23. Let l be (-2)/4 - (-4)/(-12). Sort l, t, a in ascending order. a, l, t Let a = 2 - 2.3. Let w = 10.13 + -0.13. Let c = 6 - w. Sort a, 0.2, c in descending order. 0.2, a, c Let d be (9/2)/(-3)-2. Let s = -0.03 - -0.53. Put d, s, 2 in descending o	{ "pile_set_name": "DM Mathematics" }
4t2 - 6. Find the second derivative of o(j) wrt j. 60j*3 Let z(w) = -4w + 3w + 3w*2 + 3w. Let j(o) = -3o2 - 3o. Let l(q) = -4j(q) - 5z(q). What is the second derivative of l(y) wrt y? -6 Find the third derivative of 0x6 + 6x*2 - 5x*6 - 7x*6 + 7x*2 wrt x. -1440x*3 Find the third derivative of 0m*2 - 7m*3 + 5m*3 - 7m*3 - 7m*2 wrt m. -54 What is the second derivative of -4y*3 + 7y - 3y + 3y*3 + 7y wrt y? -6y Let g = 8 + -4. Find the third derivative of 2p*2 + 2p2 - p6 - 3p2 + gp*6 wrt p. 360p*3 Let k be 2/(-4) - 15/(120/(-16)). Let r(i) be the second derivative of 0 - 2i + 0i3 + 0i*4 + ki*2 + 1/5i*5. What is the derivative of r(y) wrt y? 12y*2 Let q(c) be the first derivative of 7c*5/5 - 9c - 10. What is the derivative of q(m) wrt m? 28m3 Let q(a) be the second derivative of a3 + 7a*2/2 + 4a. What is the first derivative of q(c) wrt c? 6 Let g(y) = y*2 - 5y - 8. Let v be g(6). Let c = v - -4. What is the derivative of c - 2 + 1 + k wrt k? 1 Let m(y) = -6y3 - 3y*2 - 2y - 2. Let t(p) = 18p3 + 10p*2 + 7p + 7. Let w(h) = -7m(h) - 2t(h). Find the third derivative of w(s) wrt s. 36 Let d(u) be the second derivative of u5/5 - u4/4 + 5u. What is the third derivative of d(n) wrt n? 24 Let d(p) be the second derivative of -p11/9240 - p7/840 - p4/6 - 4p. Let u(a) be the third derivative of d(a). Find the third derivative of u(n) wrt n. -720n3 Find the third derivative of -a3 - 24a2 + a3 - 54a4 - 37a*2 wrt a. -1296a Let s = -7 + 9. Differentiate sl2 + 1 - 3 + 2l*2 + 3 wrt l. 8l Let f(u) = -u + 1. Let c(a) be the third derivative of a*4/24 - 2a*3/3 - 4a*2. Let n(o) = 2c(o) + 6f(o). Differentiate n(i) wrt i. -4 Let j = 8 - 9. Let q be -1(-4 + j + 3). Differentiate -1 + 3r2 - rq + 0 + 2r*2 wrt r. 8r Let r(n) = -18n4 - 2n*2 - 19n - 2. Let p(c) = 72c4 + 9c*2 + 75c + 9. Let x(w) = -2p(w) - 9r(w). Find the second derivative of x(a) wrt a. 216a2 Let f(p) be the first derivative of -2p - 1 + 1/3p3 + 1/2p*2. Let l(o) be the first derivative of f(o). What is the derivative of l(t) wrt t? 2 Let l(k) = -k - 1. Let p(t) = 34t*2 + 6t + 50. Let s(v) = 6l(v) + p(v). What is the derivative of s(o) wrt o? 68o Suppose -4t = -d - 2, 2d = 7d - 2t - 8. What is the second derivative of -17x2 + x - 2x + 18xd wrt x? 2 Let o(f) be the third derivative of 0 - 1/105f*7 - 1/20f5 - f2 + 0f4 + 0f*6 + 0f + 0f3. What is the third derivative of o(s) wrt s? -48s Let m(s) = 2s2 + s. Let j be m(1). Let h = 6 + -3. Find the second derivative of fj + f - fh + f5 wrt f. 20f*3 What is the third derivative of -3j*3 - 10 + 4j*3 + 22 + 2j*2 - 3j*5 - 10 wrt j? -180j*2 + 6 Let v = 2 - -3. Find the second derivative of -2u + 0u4 + 0u*4 - 2u*v - 2u wrt u. -40u3 Let f(n) be the second derivative of n6/30 + 5n*2/2 + 13n. Differentiate f(g) wrt g. 4g3 Let c(t) be the second derivative of -4t + 0t6 + 0 + 0t*2 - 1/12t*4 + 0t*3 + 0t*5 + 2/21t*7. Find the third derivative of c(k) wrt k. 240k*2 Let r(j) = 6j*3 - 2j*2 + 7j. Let o(z) = -z*2 - z. Let y(b) = -2o(b) + r(b). Find the second derivative of y(a) wrt a. 36a Let k(i) be the second derivative of -i6/30 + 53i*4/12 - 27i*2/2 - 25i. What is the first derivative of k(b) wrt b? -4b3 + 106b Let y(c) be the first derivative of c6/3 - c2/2 - 3. Find the second derivative of y(w) wrt w. 40w3 Let q(w) be the first derivative of w2 + 5w - 2. What is the first derivative of q(h) wrt h? 2 Let s(u) be the second derivative of u*4/6 - 3u*2/2 - 12u. What is the first derivative of s(q) wrt q? 4q Let f(x) be the third derivative of x8/42 - x5/15 + 8x*2. What is the third derivative of f(b) wrt b? 480b2 Let r(g) be the second derivative of -g9/1008 - g6/120 + g3/2 + 3g. Let v(k) be the second derivative of r(k). Find the third derivative of v(j) wrt j. -180j2 Let r(u) be the third derivative of -u5/5 + u*4/6 + 4u2. Find the second derivative of r(i) wrt i. -24 Let z(b) be the second derivative of b8/84 + b*5/15 + 3b*2/2 + 4b. Let y(i) be the first derivative of z(i). Find the third derivative of y(x) wrt x. 240x2 Find the third derivative of -18j*2 - 12 - 19 + 3j*4 + 31 wrt j. 72j Let t(p) be the third derivative of -p*7/210 - 13p*5/60 - 35p4/12 + p2 + 6p. Find the second derivative of t(u) wrt u. -12u*2 - 26 Let r(j) be the first derivative of -1/6j*6 - 1/2j*2 - 1 + 0j + 0j4 + 0j*3 + 0j*5. What is the second derivative of r(z) wrt z? -20z3 Let l(z) be the second derivative of -z5/12 - 2z3/3 + 3z*2/2 + z. Let j(s) be the first derivative of l(s). What is the derivative of j(y) wrt y? -10y Let x(u) be the second derivative of 0 + 0u2 + 1/12u*4 + 1/3u*3 + 2u. What is the second derivative of x(n) wrt n? 2 Let d(w) = w*2 + 8w - 5. Let t be d(-9). Find the third derivative of -m*6 + 8m*6 - tm*6 - 2m2 + m2 wrt m. 360m3 Let o(d) be the first derivative of -7d*4/4 - 2d*3/3 + 9. What is the third derivative of o(u) wrt u? -42 Let r(h) = -35h*4 + 3h + 8. Let c(s) = -71s4 + 7s + 15. Let x(q) = 3c(q) - 7r(q). Differentiate x(b) with respect to b. 128b3 Let w(z) be the first derivative of 15z*4/4 + 7z*2 + 8. Find the second derivative of w(t) wrt t. 90t Suppose 2 + 6 = 2o. Suppose -op + p = -3. Differentiate -p + g + g - g - 3g wrt g. -2 Let u be 15(-4 + (-3)/(-1)). Let t = 21 - u. What is the first derivative of -m*4 + tm - 3 - 36m wrt m? -4m*3 Suppose 2 + 3 = -h, -20 = 3s + 4h. Let a = 2 + s. Find the third derivative of w4 + 4w*2 + 3w*2 - 5w*a wrt w. 24w Let v(x) be the third derivative of -1/24x4 + 0x + 0x6 + 0x*5 + 0 + 1/70x*7 + 0x*3 - 3x*2. What is the second derivative of v(h) wrt h? 36h*2 Let b(m) = -1. Let l(o) = 29o + 6. Let v(c) = 10c + 2. Let q(w) = -6l(w) + 17v(w). Let j(k) = 5b(k) - q(k). Differentiate j(u) wrt u. 4 Let f be 4(1 + -3 - -3). Differentiate -5s*2 - 23s*3 + 26s*3 + 5s*2 + f wrt s. 9s*2 Let g(l) be the second derivative of -3l*5/20 + 3l*2/2 - 3l. Differentiate g(y) wrt y. -9y2 Suppose -4 = 2x - 16. Find the third derivative of -3v4 + 3v*4 + 5v*6 - 7v*x - 3v*2 wrt v. -240v*3 Find the third derivative of 7f*4 - 17 + 17 + 5f*2 wrt f. 168f Differentiate 4 - 11 - 7 - 6g wrt g. -6 Let u(i) = i5 - 6i*4 - 6i*2 + 15i - 6. Let g(p) = -5p4 - 5p*2 + 14p - 5. Let h(n) = -6g(n) + 5u(n). What is the second derivative of h(t) wrt t? 100t3 Let k(c) be the first derivative of 1 + 2/3c*3 + 1/4c*4 + 0c*2 + 3c. Let s(p) be the first derivative of k(p). Find the second derivative of s(z) wrt z. 6 Let a = 5 + -4. What is the first derivative of -8r + 7r + a + 1 wrt r? -1 Let s be 1/(-2) + (-2)/(-4). Suppose s = -0g + g - 2. What is the third derivative of -2c*6 + 4c*6 + 3cg - c2 wrt c? 240c3 Find the second derivative of 7729d*4 - 7729d*4 + 3d + 25d5 wrt d. 500d3 Let x(t) = t3 - 7t2 - 4t. Let j(y) = -2y3 + 8y*2 + 3y. Let f(d) = 4j(d) + 3x(d). Find the third derivative of f(z) wrt z. -30 Suppose 0 + 12 = 4d. What is the third derivative of -8c*3 + 2c + 3c2 - 2c + 7cd wrt c? -6 Let x(a) be the first derivative of a5/5 - 5a*2/2 + 7. What is the second derivative of x(r) wrt r? 12r*2 Let d(g) be the second derivative of 13g*5/10 - 2g*4/3 + 11g. Find the third derivative of d(p) wrt p. 156 Let z = 2 - 0. Find the second derivative of -3d4 - 21d*z + 21d*2 - 7d wrt d. -36d2 Let m(t) = -t3 + 3t*2 - 2t + 3. Let q be m(2). Find the second derivative of -5s + 4s - qs5 - s5 + 2s*5 wrt s. -40s*3 Let f be ((-3)/48)/((-9)/2 - -3). Let t(r) be the third derivative of 0r - 2/3r3 + 0 + fr*4 - 3r*2. Differentiate t(h) wrt h. 1 Let v = 4 - 2. What is the third derivative of 5z*2 + 0z*v + 0z*5 + 3z5 + z5 wrt z? 240z2 Differentiate -5 + 7 - 16z*3 - 6 - 3z*3 wrt z. -57z*2 What is the third derivative of -20w*6 + 8w*6 + 2w*2 - 3w*2 wrt w? -1440w**3 Let n(w) be the third	{ "pile_set_name": "DM Mathematics" }
z wrt z. -8970086 Find the first derivative of -2luz3 - 1370999luz*2 + 65146lz3 + 4l - 1 wrt u. -2lz*3 - 1370999lz2 Find the third derivative of 55a*4 - 4502a*3 - 3a*2 + 45807138a wrt a. 1320a - 27012 Find the third derivative of -987g5 - g4 + 1011g3 + 174g*2 + 4161 wrt g. -59220g*2 - 24g + 6066 Find the second derivative of 13145920s2 - 17024180s wrt s. 26291840 Find the first derivative of -1224322772m2 + 983676751 wrt m. -2448645544m Find the third derivative of 7014464n3s*3 + 4n*2s*3 + 15n*2s*2 - 46s*3 + 16s wrt n. 42086784s3 Find the third derivative of 2129543d*4 - 10717928d*2. 51109032d Find the second derivative of 703541776b2 + 92783305b wrt b. 1407083552 Find the second derivative of 17928550c3 - 6113086c - 3. 107571300c What is the third derivative of r5 - 1663r*4 - 625r*3 + 38110404r*2 wrt r? 60r*2 - 39912r - 3750 What is the third derivative of -4g2m*3 + 6853g*2m*2 + 1318077g*2my3 - 3gm3y*3 + 51gm3y*2 wrt y? 7908462g*2m - 18gm*3 Find the third derivative of 2923827x*4y + 4x3y3 + x2y3 + x2y*2 - 2xy3 - 167912y*3 - 3y*2 wrt x. 70171848xy + 24y*3 Find the third derivative of 17719087i*3 - 13580144i*2 wrt i. 106314522 Find the first derivative of 127671245k*2 - 6846042. 255342490k What is the second derivative of -6393922q5 + 47706q + 8 wrt q? -127878440q3 What is the second derivative of -2936a*2s - 3805a2 + 15as + a - 23556s - 3 wrt a? -5872s - 7610 What is the second derivative of -324151575l*2 - 701047283l wrt l? -648303150 What is the second derivative of 8869l4 + 733l*3 + 2485l + 2412? 106428l2 + 4398l What is the second derivative of 114u3v*2 + 230u*3 - 5u*2v*2 - 29uv2 + 47955uv - 15v*2 - 1 wrt v? 228u*3 - 10u*2 - 58u - 30 Find the first derivative of 2518kv - 4157966k + 1998v wrt v. 2518k + 1998 Find the third derivative of -1481163i*4 - 18i*3 - 412595534i*2. -35547912i - 108 Find the third derivative of 2d6 + 260926408d*4 - 11952896d*2 - 14. 240d*3 + 6262233792d Find the second derivative of -7822871f3 - 250098f - 2. -46937226f What is the derivative of 3q*3 - 334801q + 2153549? 9q2 - 334801 Find the second derivative of 144027916r*3 + 73647249r wrt r. 864167496r What is the second derivative of -14093292d*4 + 7662645d + 3 wrt d? -169119504d2 What is the third derivative of -4206756k*3s*3 + 12k*2s*2 + 2ks3 + 3ks2 - 23s*3 + 5s wrt k? -25240536s3 Find the first derivative of -4ps4 + 6ps - 21058p - 5190s2 + 67 wrt s. -16ps3 + 6p - 10380s Differentiate -396153c + 39394260 wrt c. -396153 Differentiate -11825005ay*2 - 11y*2 - 14y + 3117 wrt a. -11825005y2 Find the second derivative of 2a*2g*3 - 2a*2gs - 24a*2g + 13a2 + 396695824ag3s + 1830ags + 6gs wrt g. 12a*2g + 2380174944ags Find the third derivative of 4fn4r - 26fn*2r - 668321n4r*3 - 609058r*3 wrt n. 96fnr - 16039704nr*3 Find the second derivative of -1211s*4 + 18s*3 + 100s*2 + 280453330s wrt s. -14532s2 + 108s + 200 What is the second derivative of 13280074i2 + 3484i - 967 wrt i? 26560148 Differentiate 3l3p + 133199068l3 - 10898812l*2p wrt p. 3l3 - 10898812l*2 Find the first derivative of -10522699i*3 + 45414925. -31568097i*2 Find the third derivative of -3in6 + 461864in5 - 719in2 + 3in - i - 20n*2 - 1 wrt n. -360in3 + 27711840in2 What is the second derivative of -962202586r*2 - 188595265r? -1924405172 Differentiate -282s3 - 1823s*2 - 3s - 488093483 wrt s. -846s2 - 3646s - 3 Find the third derivative of 506s6 + 469s5 + s4 - 19052663s2. 60720s*3 + 28140s*2 + 24s What is the derivative of 84936093f + 103165387? 84936093 Find the second derivative of 3729k*3 - 27k*2 - 3k + 7580183 wrt k. 22374k - 54 Find the second derivative of 156914365k*3 + 48901133k wrt k. 941486190k What is the derivative of 1590022a - 36718650 wrt a? 1590022 Find the first derivative of -44497158q2z + 30q2 - 19q + 445 wrt z. -44497158q2 What is the derivative of -99i*3 - 139558i + 125608516? -297i2 - 139558 Differentiate -2908286m*3w*2 + 167w*2 - 44w - 72 with respect to m. -8724858m2w*2 Find the third derivative of 25772173t*3 + 85t*2 - 7t - 9567 wrt t. 154633038 What is the second derivative of 17932819w2 - 724835w + 2 wrt w? 35865638 What is the first derivative of 108ax - 85497a - 2406608x wrt a? 108x - 85497 What is the third derivative of -44173213j*4 - 145476468j*2 wrt j? -1060157112j What is the derivative of 19839185w2 - 2243703? 39678370w What is the third derivative of 9s2u3 + s2u - 4s*2 - 98918su3 - 18su2 - 4su + 15 wrt u? 54s*2 - 593508s Find the third derivative of -20359u6 - 191u*5 + 77036991u*2 wrt u. -2443080u*3 - 11460u*2 Differentiate -89c*2 - 60705c - 22166658 wrt c. -178c - 60705 What is the derivative of -96ln2 + 442ln - 41l - 233n2 + 558350 wrt n? -192ln + 442l - 466n What is the first derivative of 120393s*4 - 20s*3 - 12st + 131206593t wrt s? 481572s3 - 60s*2 - 12t What is the second derivative of 467t5 - 91t*3z*2 - 10tz - 29t + 361z2 wrt t? 9340t*3 - 546tz2 Find the third derivative of 858i*2r*4 - 971390i*2r*2 + 14i*2 + 17806ir3 + 2r*2 wrt r. 20592i*2r + 106836i Find the third derivative of -46x*4 + 47555x*3 + 25x*2 - 34x - 1261. -1104x + 285330 What is the third derivative of 253b*3f*4 + 721b*3f2 - b3 - 20b2f - 2bf*4 + 5878bf3 + bf*2 - f wrt f? 6072b*3f - 48bf + 35268b Differentiate -16240974g + 11859008 with respect to g. -16240974 What is the derivative of 47919993p + 75392249 wrt p? 47919993 Find the third derivative of 11499284w*4 - 21111862w*2 wrt w. 275982816w What is the second derivative of 796bpz2 + 55bpz - bz2 - 5bz - b - 15pz2 - 5172pz - 2p - 85z2 wrt z? 1592bp - 2b - 30p - 170 Differentiate 21070ipv*2 - 3ip - 3iv2 - 112pv2 + 10pv - p - 13v*2 + 2v + 2 wrt i. 21070pv*2 - 3p - 3v2 What is the second derivative of 13342392cj2y + 3cjy - 9cj - 28c + 2jy - 45j + 7y wrt j? 26684784cy Differentiate -2n2 + 8673090n - 48848325 wrt n. -4n + 8673090 Find the second derivative of -35022019j*3 - 33225309j. -210132114j What is the second derivative of 893352j*3 + 4104j - 34 wrt j? 5360112j What is the second derivative of 70157810o*3 + 15o - 186167 wrt o? 420946860o What is the second derivative of -19709269q3 - q2 - 43065300q? -118255614q - 2 Find the third derivative of -265d4 - 30081d*3 + 9d*2 - 37414d. -6360d - 180486 Find the third derivative of -182348781z*3 - 438959z*2 + 2z - 3 wrt z. -1094092686 Find the second derivative of -11733352g4 + 5737527g - 1 wrt g. -140800224g2 Find the second derivative of -31012646a*4 + 2a*3 + 12091047a wrt a. -372151752a2 + 12a Find the second derivative of 6980310g3 + 7242049g wrt g. 41881860g What is the derivative of -3kpuy3 - kpu + 1112kpy*2 - 2kp - 6ky2 - 4593517pu - 2py3 + 69y*2 wrt u? -3kpy*3 - kp - 4593517p Find the third derivative of -g4 + 4758249g*3 + 122g*2 - 33600. -24g + 28549494 What is the third derivative of r*5 + 387r*4 + 103412r*3 - 77r*2 + 59r + 12756 wrt r? 60r2 + 9288r + 620472 What is the second derivative of 298930ho*2s*2 - hos2 + 26hs2 - 44h + 2o2s*2 - 5o*2s + 3os + 64s2 - 2 wrt o? 597860hs2 + 4s*2 - 10s Find the second derivative of -12709367a2 + 4a + 5434765 wrt a. -25418734 Differentiate 2121014g - 12275257. 2121014 Find the second derivative of -4103450i*3 + 22890i - 487. -24620700i What is the second derivative of -592492488t*5 + 587291924t wrt t? -11849849760t3 Find the second derivative of -421252239h*3 + 91h - 174236 wrt h. -2527513434h What is the second derivative of 14588599w*4 + 8545944w? 175063188w*2 What is the first deriva	{ "pile_set_name": "DM Mathematics" }
s are there in thirty-seven halves of a milligram? 18500 What is 123.235344 milliseconds in days? 0.000001426335 What is 5/4 of a gram in milligrams? 1250 What is 86.477283ms in hours? 0.0000240214675 Convert 69864.7mg to grams. 69.8647 What is 0.5172038t in micrograms? 517203800000 How many days are there in 293.085 minutes? 0.20353125 What is 992878.7 centimeters in meters? 9928.787 How many millilitres are there in eleven halves of a litre? 5500 How many millimeters are there in 31/5 of a centimeter? 62 What is nineteen quarters of a millennium in decades? 475 What is twenty-three sevenths of a week in hours? 552 What is three fifths of a decade in months? 72 How many centimeters are there in one quarter of a kilometer? 25000 Convert 74.12337 grams to tonnes. 0.00007412337 How many meters are there in 50395.21um? 0.05039521 What is seven eighths of a litre in millilitres? 875 How many litres are there in 0.7830609ml? 0.0007830609 What is 4/3 of a century in months? 1600 How many kilograms are there in 7.670234 nanograms? 0.000000000007670234 Convert 55.79733mm to centimeters. 5.579733 What is eighty-one halves of a litre in millilitres? 40500 How many micrograms are there in 7.83391mg? 7833.91 How many milliseconds are there in 14.7996 minutes? 887976 Convert 725597.5 decades to millennia. 7255.975 How many micrometers are there in 85781.42m? 85781420000 What is seventy-four fifths of a litre in millilitres? 14800 What is 3/10 of a litre in millilitres? 300 How many millimeters are there in twenty-nine halves of a meter? 14500 How many meters are there in 5659.333nm? 0.000005659333 What is 0.8823736ml in litres? 0.0008823736 How many seconds are there in 19/4 of a minute? 285 What is 2.087604 millilitres in litres? 0.002087604 Convert 0.643286 millilitres to litres. 0.000643286 What is 13/4 of a litre in millilitres? 3250 How many millennia are there in 6798.636 years? 6.798636 What is 27/5 of a millisecond in microseconds? 5400 Convert 389607.3 kilograms to grams. 389607300 Convert 0.8265813 weeks to seconds. 499916.37024 How many millilitres are there in 13/8 of a litre? 1625 How many minutes are there in 2/21 of a week? 960 What is 59/4 of a minute in seconds? 885 What is sixty-seven fifths of a millennium in centuries? 134 How many seconds are there in 3/28 of a week? 64800 How many seconds are there in fourty-two fifths of a hour? 30240 What is 705949.1g in tonnes? 0.7059491 How many millilitres are there in fifty-five halves of a litre? 27500 How many kilograms are there in one tenth of a tonne? 100 How many seconds are there in 549.9961 weeks? 332637641.28 What is 533.0508 hours in microseconds? 1918982880000 Convert 6743.051kg to grams. 6743051 What is 1/5 of a litre in millilitres? 200 What is 16203.23l in millilitres? 16203230 What is twelve sevenths of a week in hours? 288 What is 451.9044 nanograms in milligrams? 0.0004519044 Convert 303001.4 litres to millilitres. 303001400 How many minutes are there in 53/5 of a day? 15264 How many months are there in twenty-two fifteenths of a century? 1760 What is 13/4 of a litre in millilitres? 3250 How many litres are there in 186.4298 millilitres? 0.1864298 How many litres are there in 10737.4 millilitres? 10.7374 What is one quarter of a micrometer in nanometers? 250 How many millilitres are there in fourty-one halves of a litre? 20500 What is 25/2 of a tonne in kilograms? 12500 Convert 243056.4 nanometers to micrometers. 243.0564 How many minutes are there in one ninth of a day? 160 How many years are there in 37/2 of a millennium? 18500 What is three tenths of a litre in millilitres? 300 What is 644.8669 centimeters in micrometers? 6448669 What is eight thirds of a day in minutes? 3840 How many centuries are there in 878579.6 millennia? 8785796 What is 200.356281 microseconds in days? 0.0000000023189384375 What is two fifteenths of a hour in minutes? 8 Convert 131244.57 months to centuries. 109.370475 What is 3/8 of a microgram in nanograms? 375 What is five quarters of a kilogram in grams? 1250 Convert 321.1796 weeks to days. 2248.2572 Convert 43.68702 millilitres to litres. 0.04368702 What is 67.88511ml in litres? 0.06788511 What is seventeen quarters of a milligram in micrograms? 4250 What is 3/5 of a litre in millilitres? 600 What is 1329.6696 microseconds in minutes? 0.00002216116 How many decades are there in 3/10 of a century? 3 What is 29/5 of a centimeter in millimeters? 58 What is 39.38422m in micrometers? 39384220 Convert 698.9061 tonnes to micrograms. 698906100000000 How many millilitres are there in 1819.02l? 1819020 What is 2/15 of a week in minutes? 1344 How many millennia are there in 29.906952 months? 0.002492246 How many millilitres are there in 89782.09 litres? 89782090 How many years are there in 47/4 of a millennium? 11750 What is 51/5 of a litre in millilitres? 10200 What is 141.05349 months in decades? 1.17544575 Convert 908647.9 hours to minutes. 54518874 How many millilitres are there in thirteen quarters of a litre? 3250 Convert 934873.3 years to months. 11218479.6 How many millilitres are there in 0.798435 litres? 798.435 Convert 0.825712 millennia to centuries. 8.25712 How many months are there in 1/4 of a millennium? 3000 How many months are there in 1/5 of a century? 240 How many milligrams are there in 6972.882g? 6972882 How many seconds are there in 2/15 of a minute? 8 What is 5/4 of a century in months? 1500 What is 46/5 of a litre in millilitres? 9200 How many centimeters are there in 9/16 of a kilometer? 56250 What is 5.798887 litres in millilitres? 5798.887 How many litres are there in 0.6730765 millilitres? 0.0006730765 What is 31/5 of a millennium in decades? 620 What is 1/4 of a micrometer in nanometers? 250 How many nanoseconds are there in 1808.83 days? 156282912000000000 What is fifty-four fifths of a microsecond in nanoseconds? 10800 What is 29/2 of a year in months? 174 How many litres are there in 732.8414 millilitres? 0.7328414 What is 157.2014 centuries in months? 188641.68 What is 0.5102919ng in kilograms? 0.0000000000005102919 Convert 7897.539 meters to kilometers. 7.897539 Convert 5308.82 grams to kilograms. 5.30882 What is seven fifteenths of a minute in seconds? 28 How many years are there in 3/5 of a millennium? 600 What is 0.3817008 nanometers in meters? 0.0000000003817008 What is 3/10 of a minute in seconds? 18 What is 43/2 of a second in milliseconds? 21500 How many meters are there in twenty-five halves of a kilometer? 12500 What is 3/5 of a centimeter in micrometers? 6000 What is fifteen quarters of a millisecond in microseconds? 3750 How many nanoseconds are there in 6/25 of a microsecond? 240 How many seconds are there in 0.5191054 weeks? 313954.94592 Convert 204.9058mg to tonnes. 0.0000002049058 What is 0.0904867 centuries in months? 108.58404 What is 15.930981 months in centuries? 0.0132758175 Convert 0.6697853cm to micrometers. 6697.853 How many tonnes are there in 9324.006 nanograms? 0.000000000009324006 How many meters are there in twenty-one halves of a kilometer? 10500 How many milligrams are there in thirteen fifths of a gram? 2600 How many millilitres are there in 7/4 of a litre? 1750 How many weeks are there in 31.689021 days? 4.527003 How many nanograms are there in twenty-one quarters of a microgram? 5250 How many millilitres are there in 1/5 of a litre? 200 What is 952733.8um in millimeters? 952.7338 How many minutes are there in 4/7 of a week? 5760 How many kilograms are there in 3/50 of a tonne? 60 How many kilograms are there in thirty-one fifths of a tonne? 6200 How many millilitres are there in 31.34718 litres? 31347.18 What is thirty-seven fifths of a century in years? 740 What is 45/2 of a minute in seconds? 1350 How many millilitres are there in 11571.16 litres? 11571160 Convert 465873.1 nanoseconds to milliseconds. 0.4658731 What is seven quarters of a decade in months? 210 How many millilitres are there in 33.19811l? 33198.11 What is 2493.5 minutes in milliseconds? 149610000 Convert 281.6064 millilitres to litres. 0.2816064 How many meters are there in one fifth of a kilometer? 200 Convert 9.00825 decades to years. 90.0825 How many nanograms are there in one tenth of a milligram? 100000 What is six	{ "pile_set_name": "DM Mathematics" }
+ sqrt(80)) - (-1 + sqrt(80) + 3)))*2. -597sqrt(5)/5 + 39781/20 Simplify ((sqrt(4800) - (1 + sqrt(4800))) + 2)-1. -1 Simplify 6((5(sqrt(12) - ((sqrt(132)-3)/sqrt(11) - sqrt(12)))/sqrt(4))*2 + -3). 11232 Simplify (5(sqrt(3) + sqrt(12)-5 + 2sqrt(27)))*2. 675 Simplify ((sqrt(171) - (sqrt(171) + -2sqrt(171)-2 - sqrt(171))) + sqrt(171))/(sqrt(54)/(sqrt(6) + sqrt(54)))3. -24sqrt(19) Simplify ((5sqrt(72)/sqrt(6))/(sqrt(6) + sqrt(150)-2))2. 50/81 Simplify (sqrt(78)-23 - 2(sqrt(78) - -2sqrt(78)))/(sqrt(48)/((sqrt(8) + 1sqrt(8))-1)). 24sqrt(13) Simplify -1 + ((sqrt(65) - sqrt(65)2)/sqrt(5) + (sqrt(13) - (1 + sqrt(13))-4))*2 - (1sqrt(78)1)/(sqrt(96)-1). 129sqrt(13)/4 + 223 Simplify 5(-1sqrt(171) + 1 + (1sqrt(171))*2 + -1). -15sqrt(19) + 855 Simplify -3 + (1 + 2sqrt(11) + sqrt(275)-1 - (((-1sqrt(88))/sqrt(8))2 + (5(-1 + sqrt(11)))*2)). -313 + 47sqrt(11) Simplify (-4(-33sqrt(243) + 3)6 + 0)*2. -279936sqrt(3) + 11342592 Simplify ((sqrt(60)/(sqrt(45)/(sqrt(18)/sqrt(2))))/(-5-1(sqrt(4) - sqrt(64))))*2-5. -1/15 Simplify (sqrt(204) - -5(sqrt(204) + sqrt(204)-1))/((sqrt(1728) - (sqrt(1728)-2 + sqrt(1728))) + sqrt(1728) + sqrt(1728) + sqrt(12) + sqrt(12))6 + -4. -4 + 3sqrt(17)/25 Simplify (sqrt(48)/sqrt(2) + sqrt(6))/(sqrt(22)/sqrt(99)) - (2sqrt(243)4 + 4)2. -15568 - 567sqrt(3) Simplify (sqrt(27)/(sqrt(9)/sqrt(3)))/(sqrt(12)/sqrt(4)1) + 4. sqrt(3) + 4 Simplify 2-4sqrt(468) + sqrt(468) + -1((sqrt(13) - 2sqrt(13)) + -4). -41sqrt(13) + 4 Simplify (1(5((0 + sqrt(325))4 + 0) + -2))2. -400sqrt(13) + 130004 Simplify sqrt(125)5 + 0 + ((sqrt(125) + -2 + sqrt(125))1)*2. -15sqrt(5) + 504 Simplify (1 + ((-1 + sqrt(448))-6 - sqrt(448)))2 + -3. -784sqrt(7) + 21998 Simplify 1((sqrt(50) - sqrt(1250)) + 5) - (sqrt(800) + -4(sqrt(800) - ((sqrt(800) - (3 + sqrt(800))) + sqrt(800)))*2 + sqrt(800)). -60sqrt(2) + 41 Simplify (4sqrt(684))2-5 - sqrt(209)/(sqrt(33)/(sqrt(3) - sqrt(147))). -54720 + 6sqrt(19) Simplify ((sqrt(343) - (-3 + sqrt(343) - sqrt(343)))-4 - (sqrt(343)2 + -4 + sqrt(343)))2 + 5. 784sqrt(7) + 16876 Simplify -5 + (sqrt(242)3 + 0)2 + -2. 2171 Simplify ((1 + sqrt(72) + 2)-6-4)2 + 0. 20736sqrt(2) + 46656 Simplify (((sqrt(1331) - (3 + sqrt(1331))) + -3 - sqrt(1331)1-4) + 4)*2. -176sqrt(11) + 21300 Simplify (4((sqrt(325) - (sqrt(325) + (sqrt(325) + 3)-2)) + (sqrt(325) + (-1sqrt(325) + sqrt(325))1 - sqrt(325)))-6)2. 69120sqrt(13) + 769536 Simplify 4 + (-5 + sqrt(500)/((sqrt(10) + sqrt(250) - sqrt(10))-2 + sqrt(10) + sqrt(10)))2. 25sqrt(2)/4 + 953/32 Simplify ((-1 + sqrt(3))-4 - -3(sqrt(3) + 2)) + (sqrt(75)-1)2 + 1. -sqrt(3) + 86 Simplify sqrt(432)-2-1 + (0 + -1sqrt(432))*2. 24sqrt(3) + 432 Simplify ((sqrt(77) + (sqrt(77) - (4sqrt(77) + sqrt(77)) - sqrt(77)))4)/((-4((sqrt(11) - sqrt(22)/sqrt(2)) + sqrt(11)) - sqrt(11)) + sqrt(11)). 4sqrt(7) Simplify (5 + (sqrt(720) - (sqrt(720) + (sqrt(720)-1 - sqrt(720)) + 1) - (-1 + sqrt(720) + 2)))2. 72sqrt(5) + 729 Simplify -4 + -42((sqrt(2448) - (2 + (sqrt(2448) - (-2 + sqrt(2448)))))*2 + -3). -19692 + 768sqrt(17) Simplify ((sqrt(42)/(sqrt(35)/sqrt(5)))/(sqrt(250)/sqrt(5) + sqrt(50)))*2. 3/100 Simplify (-2-1sqrt(640))/((sqrt(22) + sqrt(198) + sqrt(22))/sqrt(11) + sqrt(150)/sqrt(3)). 8sqrt(5)/5 Simplify -5 + (-3 + 25sqrt(300)-6)2. 3600sqrt(3) + 1080004 Simplify -5 + (-5sqrt(117) - sqrt(13)) + (-1sqrt(39))/sqrt(3). -17sqrt(13) - 5 Simplify -3 + (0 + sqrt(153))2 + 3 + (4 + -1 + sqrt(153) - sqrt(153)). 156 Simplify (sqrt(33) - sqrt(99)/sqrt(3)-3 - (sqrt(297) - sqrt(33))-3)/(sqrt(352)/sqrt(2)-4). -5sqrt(3)/8 Simplify ((sqrt(1008) + 4 + -4)2 - -5(4sqrt(1008) + sqrt(1008) + sqrt(1008))) + -2. 360sqrt(7) + 1006 Simplify (sqrt(117) + -2sqrt(117) + 4 - (-1sqrt(117) - sqrt(117) - sqrt(117))1)2 + (-3 + sqrt(117) + -4)2 + 1. 6sqrt(13) + 651 Simplify (4 + (2sqrt(637)2 - sqrt(637)) + 2)5. 30 + 105sqrt(13) Simplify (sqrt(45) + sqrt(45) + sqrt(45) + (-2sqrt(90) - sqrt(90))/sqrt(2) + 1 + sqrt(3645) + sqrt(3645))23-1. -43743 - 324sqrt(5) Simplify (-4sqrt(28)/sqrt(2))/sqrt(2) + (sqrt(2688)1)/sqrt(6). 4sqrt(7) Simplify ((-2(0 + sqrt(2448)) - (1sqrt(2448) - sqrt(2448))-2) + -5)*2. 240sqrt(17) + 9817 Simplify (4sqrt(605)2)2 + 0 - (2 + -2 + sqrt(605) + sqrt(605) + sqrt(605) + sqrt(605) + sqrt(605))23. -6655 Simplify (sqrt(1000)4)/sqrt(5) - (-2sqrt(242) + 2). -2 + 62sqrt(2) Simplify (((sqrt(147) - (1 + sqrt(147)))-6 + sqrt(147) + (-1 + sqrt(147))2)5)2 + 4. 4200sqrt(3) + 33479 Simplify (1sqrt(77)-1)/(1(sqrt(7) + sqrt(28)/sqrt(4)) + sqrt(7)) - (0 + sqrt(1100)1 + sqrt(11))*2-5. -sqrt(11)/3 + 6655 Simplify (sqrt(320) + 0 - sqrt(320)) + -3 - 4sqrt(10)/sqrt(2)5. -20sqrt(5) - 3 Simplify -4(1sqrt(130)-1 - sqrt(130) - sqrt(130))/(sqrt(160) + sqrt(160) + sqrt(160)-2 - sqrt(10)). -12sqrt(13) Simplify -5 + ((sqrt(28) + sqrt(28)2 + 4)2 - (sqrt(308)-5 - sqrt(308))/sqrt(11)). 60sqrt(7) + 263 Simplify -2((0 + sqrt(475))-2 - -1-1sqrt(475))2. -8550 Simplify (sqrt(110)/sqrt(20))/(sqrt(11)-4-5 + sqrt(11)). sqrt(2)/42 Simplify (((sqrt(65) - (sqrt(65) - (1(sqrt(65)1 - sqrt(65)) - sqrt(65)))) + sqrt(65) - sqrt(65))4)/(sqrt(50)/(sqrt(10)-25)). 40sqrt(13) Simplify ((sqrt(19) - (5 + sqrt(475)) - sqrt(95)/(sqrt(5)-5)) + 1)*2. 152sqrt(19)/5 + 7259/25 Simplify (sqrt(605)/sqrt(275))/(sqrt(176)/sqrt(4)). sqrt(5)/10 Simplify 2 + ((sqrt(5) + -4 + (sqrt(5) - (sqrt(5) + 1)))5 - ((sqrt(5) - sqrt(5)-12) + 5)). -28 + 2sqrt(5) Simplify -1((sqrt(560) + 2sqrt(560))/sqrt(10))/(-1sqrt(800)). 3sqrt(7)/10 Simplify -1 + (-2 + sqrt(72) + 2 - sqrt(72) - ((sqrt(72) + 2sqrt(72))1 - sqrt(72)))*2. 287 Simplify (-4 + sqrt(128)-2 - sqrt(128) - 3(sqrt(50) + 1 + sqrt(50) + sqrt(2))) + -4. -57sqrt(2) - 11 Simplify (sqrt(468)-3 - sqrt(468) - sqrt(52))/(sqrt(48)/(sqrt(60)/sqrt(5))). -13sqrt(13) Simplify -4 + (2sqrt(128) - sqrt(128)) + 4 + sqrt(16)/(sqrt(512)1). 65sqrt(2)/8 Simplify ((sqrt(891) - (sqrt(891) + 2(sqrt(891) + -4))) + -2 + sqrt(891) + sqrt(891) + 2)*2. 64 Simplify 5(1(sqrt(153) + -4) - sqrt(153)24)2. 840sqrt(17) + 37565 Simplify -4((sqrt(125) - (sqrt(125)-1)*2) + 4) + 3. -20sqrt(5) + 487 Simplify (sqrt(44)-4)2 + (sqrt(1331)-1)2 + 2 + 5 + (sqrt(275))2. 2317 Simplify (sqrt(637)3 + sqrt(104)/(sqrt(40)/sqrt(5)))2 - ((sqrt(1573) + 1 - sqrt(1573))2 - ((sqrt(65)-3)/sqrt(5) - sqrt(13))). -4sqrt(13) + 6291 Simplify 5 + (4(-1sqrt(4) + sqrt(4))/sqrt(2) + -1 + sqrt(4)/(sqrt(32) + sqrt(2)))2. -2sqrt(2)/5 + 152/25 Simplify -1 + (0 + sqrt(300) + 0 - (sqrt(300) + 3)6). -50sqrt(3) - 19 Simplify ((3 + sqrt(405))*2 + sqrt(5)-3 + 1)4 + -1. 204sqrt(5) + 1659 Simplify ((sqrt(136)3)/sqrt(8) + -5 - (-3 + sqrt(2448))-4)*2. -1734sqrt(17) + 44506 Simplify ((sqrt(117)-15-5)/(-3sqrt(90)/(-2sqrt(10))))2. 32500/9 Simplify (-5 + -5(-1(-2 + sqrt(891)))2 + 5)2. -8950 + 360sqrt(11) Simplify (2 + sqrt(147)-4 - sqrt(147))*2 + sqrt(432)-1-6. -68sqrt(3) + 3679 Simplify (sqrt(224) - (-1(sqrt(224) + sqrt(224)-1 - sqrt(224)) + sqrt(224) + sqrt(224)))/(sqrt(32)-4-2). -sqrt(7)/4 Simplify ((sqrt(85) - 62sqrt(85))-5)/((sqrt(280)/(sqrt(7) - sqrt(252) - sqrt(7)))/sqrt(8)). -330sqrt(17) Simplify (sqrt(55) - sqrt(220)/sqrt(4)5)/(sqrt(110)/(-4sqrt(10))). 16sqrt(5) Simplify (-1 + 5 + sqrt(108) + -2)4-2-4. 64 + 192sqrt(3) Simplify (-5 + (sqrt(1573) + -1 + sqrt(1573))2 + ((sqrt(1573) - 2sqrt(1573))-4 - sqrt(1573)))3. -33sqrt(13) + 18864 Simplify -5(2sqrt(16)-6)/(sqrt(200)1 + sqrt(8)). 10sqrt(2) Simplify (-4sqrt(2754)-2)/(sqrt(16)/(-3sqrt(512) - sqrt(512))). -2304sqrt(17) Simplify (-5 + 2((sqrt(38)/sqrt(2))2 - sqrt(19)) - (-2(sqrt(19) + -1) + sqrt(209)/sqrt(44)))1. -sqrt(19)/2 + 31 Simplify -5((sqrt(3) + (sqrt(30) - sqrt(30)-1)/sqrt(10))-4 - sqrt(36)/((sqrt(240)/sqrt(4))/sqrt(5))). 65sqrt(3) Simplify ((sqrt(24)-14)/((sqrt(96)4 - sqrt(96) - sqrt(96))/sqrt(8)))*2. 8 Simplify -1(-4 + 3 + -1 + sqrt(192))*2 + -1. -197 + 32sqrt(3) Simplify -6(sqrt(5) + 4)26 + (sqrt(160) + sqrt(160) + (4sqrt(160) - sqrt(160)))/sqrt(2). -756 - 268sqrt(5) Simplify ((1 + 1 + 1sqrt(475) + sqrt(475) + 3)-6)**2	{ "pile_set_name": "DM Mathematics" }
-s - 2 Let u = 213 + -132. Let g = u - 76. Let f(k) = 1. Let b(j) = j - 4. Give gb(i) + 20f(i). 5i Suppose -a = -0 + 1. Let b(u) = -u - 2u - 2 - 3u + 9u + u2. Let v(k) be the second derivative of -k4/12 - k3/6 + k2/2 - 37k. Give ab(g) - 2v(g). g2 - g Let q(f) = f2 - f - 1. Let w(h) = 2h + 2 - 4483h2 + 0 + 4480h*2. Give -5q(u) - w(u). -2u2 + 3u + 3 Let v(l) = 13l3 - 5l*2 + 10l + 4. Let u(s) = -14s3 + 6s*2 - 12s - 6. Calculate 5u(t) + 6v(t). 8t3 - 6 Let k(i) = -2i*2 - 6i + 1. Let t(d) = 10d - 4d - 1 + d + 0 + 35d2 - 33d*2. Let p = -8 + 6. Let o be p/7 - (-153)/21. What is ok(v) + 6t(v)? -2v2 + 1 Let c(w) = w2. Let x(a) = -3a2 + 8a + 5. What is 2c(r) + x(r)? -r2 + 8r + 5 Suppose 27z - 82 = -14z. Let w(l) = 1292l2 - 153l + 153. Let d(y) = 17y2 - 2y + 2. What is zw(o) - 153d(o)? -17o2 Let c(g) = g. Let w = 8 + -10. Let r(y) = y2 - 27y*3 - 27y*3 + 3y + 55y3. Determine wc(o) + r(o). o3 + o2 + o Let j(o) be the third derivative of o*5/3 - 17o*4/24 - 4o*3/3 - 146o*2. Let l(r) = 7r*2 - 6r - 3. Calculate -4j(g) + 11l(g). -3g2 + 2g - 1 Let q(v) = -1 + 0v - 5 + 3v. Let g be (0 + -1)(-191 + -2). Let i(s) = -g + 100 - 2s + 98. Determine -5i(j) - 4q(j). -2j - 1 Let x(a) = -7a - 2. Let u(f) = -3f - 1. Let s be (104/78)/((-4)/15). Give su(v) + 2x(v). v + 1 Let h(l) = -l - 1. Let z = 99 + -127. Let o(p) = -p3 - 7p - 7. Calculate zh(j) + 4o(j). -4j3 Let q(w) = 153w + 11. Let t(z) = -2. What is q(b) + 6t(b)? 153b - 1 Let u(o) = -5o3 - 73o*2 - 3o - 3. Let c(j) = -16j3 - 220j*2 - 10j - 10. Calculate 3c(k) - 10u(k). 2k3 + 70k*2 Let b(t) = -4t - 7. Let m(n) be the second derivative of 1/2n3 + 0 + 3n*2 + 3n. Suppose 0 = -2v - 8 - 0, -v - 29 = 5d. Give db(h) - 6m(h). 2h - 1 Let y(s) = 2s*2 - 10. Let t(m) = 0 + 7 - 2. Let g(h) = 3. Let b(a) = -7g(a) + 4t(a). Let w be 0 - 1/(-6) - (-142)/12. What is wb(r) - y(r)? -2r2 - 2 Let j(q) = -16q. Let d(i) = 21i + 1. Give 2d(g) + 3j(g). -6g + 2 Let n(i) = 27135i3 - 134i*2 - 134i + 402. Let s(b) = 603b3 - 3b*2 - 3b + 9. Calculate 3n(k) - 134s(k). 603k3 Let t(v) = 2v - 1. Let z(f) = 10f2 + 2f - 1. Let y be z(1). Let k = y + -16. Let l(j) = 3 - 1 - 1 + 4j - 2. What is kt(m) + 3l(m)? 2m + 2 Let f(z) = -4z2 - 2z. Let n(s) = 13s2 + 7s. Let t be (-11)/(8/(-16)). Let l(r) = 3r*2 + 29r + 25. Let w be l(-9). Give tn(k) + wf(k). -2k2 Let h be 55/10 + 3 + 42/(-12). Let g(s) = -4s*2 - 7s. Let p(k) = -2k2 - 4k. What is hp(y) - 3g(y)? 2y2 + y Let q(x) = -9x*2 - 42x - 13. Let k(n) = 5n2 + 21n + 7. Calculate 11k(w) + 6q(w). w*2 - 21w - 1 Let v(c) = -1. Let j = -725 - -724. Let x(s) = 17s + 4. What is jx(i) - 2v(i)? -17i - 2 Let b(o) = 8o3 + 3o*2 - 3o. Let q(f) be the first derivative of -175f4/4 - 65f*3/3 + 65f*2/2 + 70. What is -130b(z) - 6q(z)? 10z*3 Let i(j) be the first derivative of -7j*2/2 + 277. Let t(u) = -u. Calculate i(g) - 6t(g). -g Let t be (-1)/211-4. Let n(o) = -3. Let m(d) = 10. Let c(u) = 2m(u) + 7n(u). Let i(w) = -w - 12. Give tc(q) - 2i(q). 2q + 2 Let v(r) be the second derivative of 7r*3/6 - 5r*2/2 + 12r. Let y(n) = 4 - 20 + 9 + 9 - 3n. Determine 4v(t) + 9y(t). t - 2 Let j(p) = -p. Let z(m) = 5m + 5m + 0m. Let w = -37 - -29. Suppose 3s - 4 = 7s. Give sz(t) + wj(t). -2t Let f(x) = -38x*3 - 11x*2 - 29x + 14. Let w(t) = -13t3 - 4t*2 - 10t + 5. Give 4f(a) - 11w(a). -9a3 - 6a + 1 Let x(v) = -11v2 + 5v + 30. Let a(l) = -13l2 + 6l + 31. Give 4a(j) - 5x(j). 3j2 - j - 26 Let n(x) = -6x + 17. Let i(z) = z - 3. Suppose h + 5 = 18. Suppose 0l + 2a = -3l + 47, 2a - h = -l. Let j = -11 + l. Determine jn(w) + 34i(w). -2w Let n(c) = c3 + 4c*2 - c + 2. Let s(d) = -31d + 30d - 10d*2 + 1 + 11d*2. Determine -n(v) + 2s(v). -v*3 - 2v*2 - v Let p(v) = -1212v - 19. Let b(g) = 605g + 11. Give -5b(r) - 3p(r). 611r + 2 Let u(z) = -6z - 1. Let j(w) = 5w + 1. Let l = -41 - -43. Calculate lu(y) + 3j(y). 3y + 1 Let c(a) = -112a - 20. Let n(t) = -37t - 7. What is -6c(h) + 17n(h)? 43h + 1 Let u(w) = 14w - 18. Let f(b) = 185b - 235. Determine 3f(d) - 40u(d). -5d + 15 Let w(x) = -91 - x2 + 70 + 21. Let v be 3 + (0 - 2) - 8. Let y = -6 + 9. Let z(c) = -2c*2. Give vw(h) + yz(h). h2 Let h(o) be the first derivative of 4o3/3 + o2/2 + 4o + 19. Let v(s) be the first derivative of -5s3/3 - s2 - 5s + 3. Determine 3h(q) + 2v(q). 2q*2 - q + 2 Let a(v) = 3v - 5. Let u(q) = -4q + 10. Let s(j) = 5a(j) + 3u(j). Let b(o) = -6o - 11. What is 6b(x) + 13s(x)? 3x - 1 Let r = -1306 + 1293. Let l(y) = 5y*3 - 6y*2 - y - 6. Let w(t) = -11t*3 + 13t*2 + 2t + 13. What is rl(s) - 6w(s)? s3 + s Let z(y) = y2 + 9y - 9. Let p(m) = 5m*2 + 46m - 46. Give -2p(r) + 11z(r). r*2 + 7r - 7 Let p = -7 + 13. Let x(g) = -26g2 + 23g + 5. Let c(v) = -13v2 + 12v + 3. Let u(n) = -5c(n) + 3x(n). Let i(l) = 7l2 - 5l. What is pu(j) + 11i(j)? -j*2 - j Let c(x) = 2x*2 + 7x + 4. Suppose 2h + 12 = 32. Suppose -5o + 5g - h = 0, 0 = 3o + g + 6 + 4. Let s(b) = -b*2 - 6b - 3. Determine oc(d) - 4s(d). -2d2 + 3d Let m(o) = 3o3 - 6o*2 + 10. Let u(c) = -5 + 12 - 17c*2 + 22 + 9c*3. Give 17m(d) - 6u(d). -3d3 - 4 Let o(m) = -m3 + 3m2 + 2. Let j(y) = -4y*2 - 3. Let c be 1/(-1)218/(-12). Give co(d) + 2j(d). -3d3 + d2 Let a(v) = 1. Let d(w) = w3 + w2 + w + 2. Let c be d(0). Suppose 0 = -cu - 10u + 12. Let n(j) = -5j2 + 1. Give ua(h) - n(h). 5h2 Let c(g) = 74g - 11. Let r(u) = -66 + 7u - 70 + 8u + 194 - 60. Determine -2c(s) + 11r(s). 17s Let u(d) = -390d*3 - 4d*2 - 4. Let o(s) = 389s*3 + 3s*2 + 3. Determine -4o(v) - 3u(v). -386v*3 Let s be 4 + (-13)/3 - (-104)/24. Let p be 22/(41). Let u(n) = -1 - 2n*2 - 3 + 5n - p. Let x(h) = -2h2 + 4h - 4. Determine su(c) - 5x(c). 2c2 Let n(c) = -6c*2 - 7c. Let v(p) = 5p2 - 3p. Let j(r) = -r*2 + r. Let z = -28 + 24. Let g(s) = zj(s) - v(s). Calculate 21g(o) - 3n(o). -3o2 Let j be 1/(-11) + (-102)/(-264)8. Let i(y) = -2y - 4. Let l(s) = -2s - 3. Let v(c) = 2c + 3. Let m(d) = 3l(d) + 4v(d). Determine jm(t) + 2i(t). 2t + 1 Let s(d) = d + 1. Let m(g) = -2g + 13. Let a(l) = l + 4. Let x(v) = -2a(v) + m(v). Calculate 2s(c) + x(c). -2c + 7 Let c(m) = -m*2 + m - 1. Let o = -20 - 0. Let x be (12/(-10))/(8/o). Let h be 2/(x - 10/2). Let p(v) = -2v*3 + 3v*2 - 3v + 3. Calculate hp(y) - 3c(y). 2y3 Let d(f) = -8f + 5. Let g(r) = 88r - 56. Let c(b) = -3b - 13. Let m be c(-6). Determine mg(z) + 56d(z). -8z Let p(k) = k2. Let y(q) be the first derivative of -q3 - 21. Suppose 0 = -7a - 0 + 28. Suppose -2g + 18 + 35 = 5x, 14 = 2x - g. Give ay(r) + xp(r). -3r*2 Let n(t) = 79t + 1490. Let b(x) = 43x + 745. Give -11b(h) + 6n(h). h + 745 Let f(m) = -2m*2 + 4m + 5. Let a(v) = 3v2 - 6 - 30v + 17v + 8v. Calculate -5a(k) - 6f(k). -3k2 + k Let j(i) = i - 1. Let n = -709 - -712. Let q(c) be the third derivative of -c4/24 + 2c*3/3 - 2c*2. Determine nj(x) + q(x). 2x + 1 Let a(s) = 23s*2 - 6s + 8. Let i(p) = 17 - 8p2 - 20 + 2p + 0p. Let x(c) = -6a(c) - 17i(c). Let w(t) = -t3 - t2 + t + 1. Determine -2w(f) + x(f). 2f3 + 1 Let f(h) = -18h*3 + 4h*2 + h - 20. Let p(j) = -3j3 + j2 + j. Give -f(i) + 5p(i). 3i3 + i2 + 4i + 20 Let l(z) = -z. Let y = -7 - -10. Suppose 0 = 4a + 2s - s + y, -2a - 4s + 16 = 0. Let t(i) be the first derivative of -i3/3 - 2i - 36. Give al(u) - t(u). u2 + 2u + 2 Let o(n) = 793152n - 2176. Let h(g) = -1094g + 3. Calculate 2176h(a) + 3o(a). -1088a Let u(d) = -d - 2. Let y(o) be the first derivative of -o5/120 + 14o*3/3 + 5. Let s(g) be the third derivative of y(g). Give 4s(w) - u(w). -3w + 2 Let j(o) = -2o*2 + 3o + 3. Let p(s) = -8s - 14. Let x be p(-2). Let k(t) = -5t + xt - 6t + 1 + 10t. What is -j(w) + 3k(w)? 2w2 Let p be (-1 - 40) + 28/21-3. Let n(o) = 5o + 4. Let d(z) = 55z + 45. Determine pn(h) + 4d(h). -5h Let r(n) = -n	{ "pile_set_name": "DM Mathematics" }
0.3 times -4837.85 -1451.355 Work out 17.814 * 0.1. 1.7814 Multiply 0.66 and 0.464. 0.30624 Work out -3070206 * -0.4. 1228082.4 0.82.46157 1.969256 -455337-8 3642696 32 times -607.2 -19430.4 Calculate -0.05242.01. -12.1005 0.065277.1 0.463417 -526220.3 -15786.6 Calculate 2079399-1. -2079399 Multiply -0.407 and 0.05. -0.02035 -48 * -4898 235104 -800.39 -7202.7 What is 2.7135 times 3? 8.1405 -4 times 3941.4 -15765.6 What is the product of 0.055 and -1428? -78.54 Calculate 1-4030. -4030 What is the product of 866.3076 and 0.1? 86.63076 Multiply 1890.51 and -5. -9452.55 Calculate -295-787. 232165 What is the product of 318 and 107? 34026 Calculate -0.1476609. -10725.26 0.478 31.2 2363 times 14 33082 0.4 1172672 469068.8 11689154 4675660 Product of -2213.44 and -0.1. 221.344 What is -11 times -8753? 96283 0.358 times -220 -78.76 Work out -44.331 -1. 44.331 Product of 1795 and 1.2. 2154 What is -0.058847 times -1? 0.058847 1144 * -2705 -3094520 Multiply 5 and 0.142072. 0.71036 1.46262 8766.8 -140200.4 -5608 Multiply 142 and 444. 63048 Multiply -4.2 and 1.0535. -4.4247 Calculate -4.440.0567. -0.251748 Work out -2819.4 -8. 22555.2 Multiply -0.09 and 390.71. -35.1639 Multiply -16983 and 34.2. -580818.6 0.4 times -56.438 -22.5752 Multiply -2 and 190.72. -381.44 What is -17 times -125? 2125 2995 times 0.03 89.85 Product of 187566.7 and 0.1. 18756.67 What is the product of -0.031 and 8670? -268.77 999.2 * 3 2997.6 -0.1397169 -39716.9 Calculate -1962-3.4. 6670.8 -216410 times 0.01 -2164.1 Product of 13141 and 0.067. 880.447 -25020 0 What is 3.1555 times 7? 22.0885 Multiply 74 and -204. -15096 What is the product of 5 and 448? 2240 -28 times -39537 1107036 -32.36866 3 -97.10598 Product of -240 and -0.04402. 10.5648 0.2 times -17807.6 -3561.52 0.9 * 2.3718 2.13462 Multiply -33 and -0.217. 7.161 Multiply -73387 and 0.4. -29354.8 Calculate 30.222491. 30.22249 Product of 403.2 and 0.02. 8.064 14301.40.4 5720.56 What is -0.4 times -1933.78? 773.512 -116890 times 11 -1285790 Product of 0.3 and -101.4. -30.42 Multiply 60040 and 0.16. 9606.4 6.3990.398 2.546802 Multiply -17.1 and 0.0874. -1.49454 What is 3068131 times -4? -12272524 -5657 -147 831579 Work out -33759 * 0.11. -3713.49 Calculate -6701.22. -817.4 What is the product of 4156 and 0.021? 87.276 -4216.37 -687.54 0.4 * -0.044232 -0.0176928 Calculate -0.1910895. -2070.05 What is 24 times 3167? 76008 Multiply 0.07 and 5040. 352.8 Work out 0.5 -8434. -4217 Product of -4 and -0.42367. 1.69468 -0.0873 * -1066 93.0618 Multiply -0.25 and 0.58232. -0.14558 -49 times 0.628 -30.772 Multiply -0.115206 and -2. 0.230412 70028 * -0.08 -5602.24 Work out 624 * -7.5. -4680 What is the product of -0.6 and -1030? 618 Product of -6 and -0.1801. 1.0806 03566 0 Multiply 0.1 and -26271.7. -2627.17 What is the product of -8 and 1056.53? -8452.24 Multiply 16057 and -43. -690451 Work out -51639.9 0.9. -46475.91 Product of -72 and 69.01. -4968.72 What is the product of 1065 and -419.4? -446661 Multiply -0.01 and 3644. -36.44 0.2 times 5852 1170.4 Work out 60.193 * 5. 300.965 Calculate -0.2-0.736688. 0.1473376 Product of -84.8 and 521. -44180.8 162863 62863 What is the product of -2 and 5.48778? -10.97556 Work out -6228 * -1.17. 7286.76 Product of 0.049257 and 5. 0.246285 17852 times 0.082 1463.864 What is -188 times -0.15801? 29.70588 -0.0856 * -26 2.2256 What is -5.809 times 4? -23.236 14.46 * 0.368 5.32128 Work out -3.3 * -982. 3240.6 Work out -0.8 * -0.685. 0.548 Product of -19 and 12756. -242364 Work out -4.3453 * -25. 108.6325 Calculate -1118.1617. -19008.72 Work out -0.408 26. -10.608 Multiply 16893 and -5. -84465 15965-0.3 -4789.5 130203-2 -260406 -776.4 * 0.02 -15.528 697 * -177 -123369 What is the product of 2624 and 0.19? 498.56 125 * -154 -19250 1.1-7796 -8575.6 Multiply 0.179 and -617. -110.443 What is the product of 1903 and -39? -74217 Calculate -349-6. 2094 Multiply -72 and 7.434. -535.248 What is the product of -2183.8 and 0.9? -1965.42 Calculate -241151.4-0.3. 72345.42 -12.56 times -4.4 55.264 Product of -6.27 and -1. 6.27 What is 1.861 times 169? 314.509 Calculate 22-18.6321. -409.9062 0.5 * 0.0414 0.0207 Calculate 123150.18. 2216.7 7.5-14.67 -110.025 Calculate -21.7392-5. 108.696 0.081 times -410 -33.21 Product of 706.92 and 0.2. 141.384 Multiply 613941 and -0.4. -245576.4 What is the product of -3 and 0.040434? -0.121302 Multiply -5 and 1.7202. -8.601 Product of 3 and 63142. 189426 Work out 1271 -10. -12710 0.03629 * -300 -10.887 Work out 24 * 0.04816. 1.15584 -669 times 2.641 -1766.829 What is 0 times -11.6895? 0 Calculate -105.4-0.0682. 7.18828 -11 -16065 176715 Multiply 124393 and 0. 0 What is 0.18 times -24.028? -4.32504 -529484 times -0.3 158845.2 Work out -100588 * 15. -1508820 Product of 37.5 and -0.175. -6.5625 Calculate 40.43397. 137238.8 What is -745.55 times -2? 1491.1 What is the product of 22824 and -0.351? -8011.224 Multiply -52.76 and 26. -1371.76 What is -0.05 times -317? 15.85 Multiply -0.04 and 47.31. -1.8924 Multiply 0.4 and -11270.65. -4508.26 Product of -74.54 and 0. 0 0.06 113.27 6.7962 What is the product of -0.111974 and -38? 4.255012 What is the product of -1312.7 and 2? -2625.4 Multiply 9 and -4.4231. -39.8079 3129 times -176 -550704 What is the product of -46 and 6834? -314364 0.566852 33426 What is the product of 115990 and -0.4? -46396 0.109059 -17 -1.854003 -241.972 -483.94 Product of 0.3 and 22256. 6676.8 -434.1-0.005 2.1705 Calculate 19645-0.2. -3929 -0.7 -1517.6 1062.32 2016 times -0.8 -1612.8 -0.013016 times 0.04 -0.00052064 -7974.8 -3825.6 1 times -10459 -10459 Calculate -5-358.77. 1793.85 Work out -33 * -125976. 4157208 Multiply -62174 and 0.5. -31087 Calculate 178714. 25018 -0.093952 4 -0.375808 Product of -1.95067 and -6. 11.70402 Work out 5 * -5.9428. -29.714 Product of 44.43 and -0.4. -17.772 4335-0.02 -86.7 Multiply 4.05 and -1.501. -6.07905 Work out -10 9458.9. -94589 211004 84400 Work out -0.08 0.014131. -0.00113048 -2208.3 * -0.1 220.83 1 * 145050 145050 -1.6 times -60035 96056 What is the product of 16 and -20300? -324800 Work out -143 * -60. 8580 Calculate -21-2091. 43911 -0.30.007666 -0.0022998 7431-0.03 -222.93 Work out 1668 -0.876. -1461.168 -24 * 2592 -62208 What is -0.5 times 10147.8? -5073.9 1976 times 2686 5307536 -3.32-2123 7048.36 Multiply 10502 and -0.27. -2835.54 Work out -138347 0. 0 0 times 607.5 0 Product of -21.6 and 1.42. -30.672 What is the product of -0.076 and 2407? -182.932 218-128.1 -27925.8 Product of -0.2 and -22.9117. 4.58234 Multiply 124063 and 0. 0 -1 times 396954 -396954 -0.3 -0.04743 0.014229 What is the product of 0.3 and -37110? -11133 Calculate 45.6890.2. 9.1378 Work out -325 -1.76. 572 What is the product of -5.7808 and 1? -5.7808 44263 times 0.5 22131.5 Multiply 2880 and -58. -167040 What is 0.1 times -294155? -29415.5 -12.20.199 -2.4278 What is the product of 2.483 and -41? -101.803 1500 -5 -7500 Work out -23457 * 0.4. -9382.8 Product of -3 and -0.087372. 0.262116 Work out 0.2 * 168838. 33767.6 0.6 times -278579 -167147.4 Product of -238670 and 0.1. -23867 -21882 * 4 -87528 What is 0.3 times 1128040? 338412 What is 3 times 1057292? 3171876 Work out 0.03 * 158101. 4743.03 1516 times 10 15160 1.95-0.16 -0.312 -4821.9 -915.8 -26-35390 920140 What is the product of -664 and 1.221? -810.744 What is the product of -46 and -63.45? 2918.7 What is -0.3 times -8254.87? 2476.461 Multiply 5 and 0.6883. 3.4415 Calculate 2-0.07883. -0.15766 Product of -596 and 56. -33376 What is 71 times -1967? -139657 Product of -6 and -0.56. 3.36 5 * 4.951 24.755 What is the product of -0.2 and 298915? -59783 Calculate -5-47539. 237695 Multiply 31.92 and 0.21. 6.7032 4383 times 13.9 60923.7 -2.2 times 0.08028 -0.176616 Product of 20 and -28.64. -572.8 Calculate -10.590.5. -5.295 13984 * -14 -195776 Work out 0.4 * -21.282. -8.5128 4.36 * -17 -74.12 Calculate -0.3-0.237542. 0.0712626 What is -27 times 3481? -93987 Product of -0.06 and 980990. -58859.4 -1031180 -311800 -8 * -11.64 93.12 What is the product of 33.52 and -0.05? -1.676 What is the product of 104 and 49? 5096 What is the product of 0.2 and 110994? 22198.8 Multiply 185.4504 and -0.1. -18.54504 What	{ "pile_set_name": "DM Mathematics" }
nutes are there between 1:03 AM and 7:15 AM? 372 What is 530 minutes after 4:12 AM? 1:02 PM What is 677 minutes before 9:43 PM? 10:26 AM What is 250 minutes before 2:50 PM? 10:40 AM What is 251 minutes after 3:26 AM? 7:37 AM What is 557 minutes after 4:19 AM? 1:36 PM What is 530 minutes after 12:24 AM? 9:14 AM What is 2 minutes after 11:50 PM? 11:52 PM How many minutes are there between 2:18 PM and 10:29 PM? 491 What is 197 minutes after 11:13 AM? 2:30 PM How many minutes are there between 2:33 PM and 1:55 AM? 682 What is 181 minutes after 12:37 PM? 3:38 PM What is 373 minutes after 5:55 PM? 12:08 AM What is 27 minutes after 7:24 AM? 7:51 AM What is 207 minutes before 6:50 AM? 3:23 AM How many minutes are there between 11:26 PM and 4:22 AM? 296 How many minutes are there between 11:13 AM and 9:31 PM? 618 How many minutes are there between 8:23 AM and 10:42 AM? 139 How many minutes are there between 4:23 AM and 2:10 PM? 587 What is 539 minutes after 10:58 PM? 7:57 AM What is 130 minutes after 1:53 AM? 4:03 AM What is 331 minutes after 7:34 PM? 1:05 AM What is 657 minutes after 2:11 PM? 1:08 AM What is 524 minutes before 8:22 PM? 11:38 AM What is 231 minutes before 3:26 PM? 11:35 AM How many minutes are there between 6:04 PM and 10:57 PM? 293 What is 141 minutes before 2:25 AM? 12:04 AM What is 391 minutes before 2:56 PM? 8:25 AM How many minutes are there between 9:10 PM and 1:14 AM? 244 How many minutes are there between 7:52 AM and 10:32 AM? 160 What is 700 minutes before 3:03 AM? 3:23 PM How many minutes are there between 10:07 AM and 5:11 PM? 424 What is 473 minutes after 3:43 PM? 11:36 PM What is 612 minutes before 1:37 AM? 3:25 PM What is 564 minutes after 8:26 AM? 5:50 PM How many minutes are there between 12:30 AM and 6:24 AM? 354 What is 408 minutes after 8:43 AM? 3:31 PM What is 661 minutes before 3:16 PM? 4:15 AM How many minutes are there between 9:08 PM and 12:45 AM? 217 What is 446 minutes after 3:39 PM? 11:05 PM What is 194 minutes before 4:03 AM? 12:49 AM How many minutes are there between 11:12 AM and 7:12 PM? 480 How many minutes are there between 1:45 AM and 4:41 AM? 176 How many minutes are there between 2:48 PM and 5:07 PM? 139 How many minutes are there between 8:12 PM and 7:19 AM? 667 What is 10 minutes after 11:03 AM? 11:13 AM How many minutes are there between 4:18 AM and 9:21 AM? 303 What is 605 minutes before 4:09 AM? 6:04 PM What is 186 minutes before 4:17 AM? 1:11 AM What is 320 minutes before 8:14 AM? 2:54 AM How many minutes are there between 8:25 PM and 7:44 AM? 679 How many minutes are there between 4:48 PM and 4:36 AM? 708 How many minutes are there between 5:11 AM and 9:15 AM? 244 How many minutes are there between 11:25 AM and 4:43 PM? 318 How many minutes are there between 6:35 PM and 6:00 AM? 685 How many minutes are there between 4:17 PM and 8:08 PM? 231 How many minutes are there between 7:07 PM and 9:29 PM? 142 How many minutes are there between 9:56 AM and 3:23 PM? 327 What is 211 minutes before 6:00 AM? 2:29 AM What is 647 minutes before 8:28 PM? 9:41 AM How many minutes are there between 11:38 AM and 1:57 PM? 139 What is 596 minutes before 9:24 AM? 11:28 PM How many minutes are there between 2:17 AM and 11:37 AM? 560 How many minutes are there between 11:52 AM and 6:40 PM? 408 What is 628 minutes before 12:53 AM? 2:25 PM What is 581 minutes before 2:03 AM? 4:22 PM What is 410 minutes after 1:01 PM? 7:51 PM What is 480 minutes before 1:10 AM? 5:10 PM What is 463 minutes after 3:27 AM? 11:10 AM What is 572 minutes before 7:42 PM? 10:10 AM How many minutes are there between 8:24 PM and 10:02 PM? 98 How many minutes are there between 1:35 PM and 9:01 PM? 446 What is 572 minutes before 9:18 AM? 11:46 PM What is 421 minutes before 6:21 PM? 11:20 AM How many minutes are there between 1:37 PM and 5:51 PM? 254 What is 128 minutes after 2:02 AM? 4:10 AM What is 553 minutes before 7:35 AM? 10:22 PM What is 313 minutes after 10:13 AM? 3:26 PM How many minutes are there between 8:39 PM and 7:03 AM? 624 What is 260 minutes after 8:43 AM? 1:03 PM How many minutes are there between 11:38 AM and 5:00 PM? 322 What is 4 minutes before 8:56 AM? 8:52 AM What is 589 minutes after 9:06 PM? 6:55 AM How many minutes are there between 6:48 AM and 5:06 PM? 618 What is 591 minutes after 6:48 AM? 4:39 PM What is 283 minutes after 1:13 PM? 5:56 PM How many minutes are there between 12:27 AM and 2:09 AM? 102 How many minutes are there between 7:49 AM and 5:35 PM? 586 How many minutes are there between 3:07 AM and 7:16 AM? 249 What is 418 minutes before 5:23 AM? 10:25 PM How many minutes are there between 5:55 AM and 10:04 AM? 249 How many minutes are there between 1:32 AM and 11:00 AM? 568 What is 558 minutes before 8:00 PM? 10:42 AM How many minutes are there between 10:46 AM and 10:07 PM? 681 What is 341 minutes after 4:08 PM? 9:49 PM What is 309 minutes after 3:51 PM? 9:00 PM What is 255 minutes before 1:49 AM? 9:34 PM What is 504 minutes after 11:28 PM? 7:52 AM How many minutes are there between 11:04 AM and 8:21 PM? 557 How many minutes are there between 7:22 PM and 2:04 AM? 402 What is 158 minutes after 11:11 PM? 1:49 AM What is 283 minutes before 10:32 AM? 5:49 AM How many minutes are there between 12:38 AM and 6:49 AM? 371 What is 253 minutes after 1:38 AM? 5:51 AM How many minutes are there between 12:04 PM and 7:52 PM? 468 How many minutes are there between 2:38 PM and 11:23 PM? 525 What is 508 minutes before 7:56 AM? 11:28 PM How many minutes are there between 4:39 PM and 4:27 AM? 708 How many minutes are there between 6:57 PM and 7:48 PM? 51 What is 12 minutes before 6:11 PM? 5:59 PM What is 260 minutes before 11:16 PM? 6:56 PM What is 318 minutes after 6:45 AM? 12:03 PM How many minutes are there between 1:06 AM and 8:44 AM? 458 What is 488 minutes after 3:57 AM? 12:05 PM What is 154 minutes before 9:38 PM? 7:04 PM How many minutes are there between 2:59 PM and 3:10 PM? 11 What is 141 minutes before 9:09 PM? 6:48 PM How many minutes are there between 6:54 PM and 8:30 PM? 96 What is 627 minutes before 7:43 PM? 9:16 AM What is 40 minutes after 11:38 PM? 12:18 AM What is 557 minutes before 12:21 AM? 3:04 PM How many minutes are there between 11:21 AM and 1:29 PM? 128 How many minutes are there between 12:30 AM and 11:47 AM? 677 What is 172 minutes before 10:37 PM? 7:45 PM How many minutes are there between 1:01 AM and 10:00 AM? 539 How many minutes are there between 5:26 AM and 12:11 PM? 405 What is 197 minutes after 7:35 AM? 10:52 AM What is 624 minutes before 8:30 PM? 10:06 AM What is 570 minutes before 1:33 AM? 4:03 PM How many minutes are there between 11:58 PM and 6:12 AM? 374 How many minutes are there between 3:01 AM and 5:57 AM? 176 How many minutes are there between 4:27 PM and 4:46 PM? 19 How many minutes are there between 1:06 AM and 6:50 AM? 344 What is 115 minutes after 11:45 AM? 1:40 PM What is 194 minutes before 8:06 AM? 4:52 AM What is 564 minutes after 4:55 PM? 2:19 AM What is 126 minutes before 7:01 PM? 4:55 PM How many minutes are there between 8:36 PM and 7:38 AM? 662 How many minutes are there between 7:33 AM and 7:32 PM? 719 What is 41 minutes before 5:46 PM? 5:05 PM What is 376 minutes before 3:50 PM? 9:34 AM What is 371 minutes after 2:52 PM? 9:03 PM What is 53 minutes before 8:23 PM? 7:30 PM How many minutes are there between 11:20 AM and 8:27 PM? 547 What is 142 minutes after 10:08 PM? 12:30 AM What is 652 minutes after 11:08 PM? 10:00 AM What is 485 minutes after 4:41 PM? 12:46 AM How many minutes are there between 10:31 PM and 7:21 AM? 530 What is 217 minutes after 1:10 PM? 4:47 PM What is 51 minutes before 5:24 AM? 4:33 AM What is 71 minutes after 2:19 PM? 3:30 PM How many minutes are there between 2:15 PM and 2:48 PM? 33 How many minutes are there between 2:27 AM and 11:34 AM? 547 What is 634 minutes after 3:18 PM? 1:52 AM How many minutes are there between 9:53 PM and 12:03 AM? 130 How many minutes are there between 5:09 AM and 6:31 AM? 82 How many minutes are there between 2:30 AM and 4:02 AM? 92 How many minutes are there between 7:57 AM and 7:29 PM? 692 How many minutes are there between 3:32 AM and 2:49 PM? 677 What is 185 minutes before 11:53 PM? 8:48 PM How many minutes are there	{ "pile_set_name": "DM Mathematics" }
Sort 12, a, 1. a, 1, 12 Suppose 3z + 10 = 4c, 5c + 4z + 3 + 0 = 0. Let r = -295 + 655/2. Let d = 33 - r. Sort 3, d, c in descending order. 3, c, d Let a = -27.63 + 27.13. Sort -0.08, 0.02, a, 5. a, -0.08, 0.02, 5 Suppose -2c - 91 = -15c. Sort c, 5, 0, 4 in decreasing order. c, 5, 4, 0 Let d = 519 - 523. Put -0.2, -6/7, d, -0.16 in decreasing order. -0.16, -0.2, -6/7, d Suppose -121 = -4i - 425. Let n = -77 - i. Put 3, n, 5 in descending order. 5, 3, n Suppose 2g - 6g - 3d + 20 = 0, -3d = 0. Suppose 0 = gi - 2i. Sort -1, i, -3. -3, -1, i Suppose 0n - 5n = -2j - 12, -3j + 5n - 8 = 0. Let k(d) = d - 4. Let z be k(j). Suppose -4m - 616 = -628. Sort z, -1, m in decreasing order. m, z, -1 Suppose -q = -5z + 6, -2z - 2 = 3q - 1. Sort -2, q, 188 in increasing order. -2, q, 188 Let y = -0.57 + 0.77. Sort y, 2/7, -7. -7, y, 2/7 Let z(b) = b*3 + 2b*2 - 11b + 39. Let f be z(-6). Sort -3, f, -5. f, -5, -3 Suppose -6h = 8h - 14. Put 3, h, -3, -4 in decreasing order. 3, h, -3, -4 Let b be 8 + (-490)/63 + 93/(-54). Put b, 0.4, -3, 0 in ascending order. -3, b, 0, 0.4 Suppose 2j = 3j - 3d + 7, 4j + 5d = 6. Sort 4, -2, 2, j. -2, j, 2, 4 Let f(v) = -2v - 2. Let o be f(0). Let y(z) = z*3 - 6z*2 + 5z + 6. Let w be y(5). Let g be 5/1 - (w - 4). Put 1, o, g in increasing order. o, 1, g Suppose 0 = -5j + 21 + 19. Let i be (-4 + j)/922. Let f = -1.024 - -0.024. Put i, 1/5, f in increasing order. f, i, 1/5 Let d = 7 - 4. Sort 5, 4/11, d in decreasing order. 5, d, 4/11 Let y = -240 - -220. Put -0.4, y, -4 in descending order. -0.4, -4, y Let l be (((-306)/27)/(-17))/((-1)/(-3)). Sort 1, 4, -4, l in decreasing order. 4, l, 1, -4 Let z be 8/24 - 10/3 - -15. Suppose -za = -7a - 40. Let t be 9/(-7) + (-10)/(-35). Sort t, 3, a in increasing order. t, 3, a Let q be ((-65)/(-15))/(-13) + 7/3. Let o = -13 - -19. Put q, 1, -3, o in ascending order. -3, 1, q, o Let j = 3 + -8. Let a(l) = -l*3 - 6l*2 - 24l - 142. Let k be a(-6). Sort k, j, -2 in increasing order. j, -2, k Suppose 0 = -4m - 5h + 7 - 24, -5m = -4h - 30. Suppose 3j - 12 = 3. Suppose -c - 3q + 2 = -2q, 0 = -jc + 5q + 30. Sort c, -4, m in descending order. c, m, -4 Let l = -942 + 931. Put 4, l, -2, -3 in ascending order. l, -3, -2, 4 Let b = 18 + -16. Let r be -1(0(-4)/(-4))/(-1). Sort r, 1, b, 4 in descending order. 4, b, 1, r Let r = 20 - 21. Let l be 2 - (-1 - -3) - r. Let j = 1 + -1. Sort -3, j, l in decreasing order. l, j, -3 Let m = 3488 + -3488. Let n(d) = d3 + 4d*2 - 5d + 4. Let i be n(-5). Sort 12, m, i. m, i, 12 Suppose -4c - 4r = -0r, -4r = -16. Let i be (-16 - -10)c/6. Sort 2, i, -4 in increasing order. -4, 2, i Let d = -686 + 685.9. Let y(m) = 2m*2 + 2m + 2. Let i be y(-2). Suppose 2 = b + i. Put b, d, 1/2 in increasing order. b, d, 1/2 Let v = -99.6 - -95.6. Sort v, -21, 3 in descending order. 3, v, -21 Let b = 0.1415 + -0.3415. Sort -5/3, b, 6, 0.02 in descending order. 6, 0.02, b, -5/3 Let n = -213 + 213. Sort n, 10, -8. -8, n, 10 Let l be ((-345)/3 + 3)/((-80)/(-280)). Sort -1, -0.4, l in decreasing order. -0.4, -1, l Let p be (2 - 96)/2 - 1. Suppose 0 = o + 2 + 4. Let x be (16/o)/((-32)/p). Put x, 0, 1 in descending order. 1, 0, x Let z = 11.36 - 11.56. Put -0.6, z, 2/7 in ascending order. -0.6, z, 2/7 Let k(d) = -d*3 - 6d*2 - 5d + 3. Let o be k(-5). Put -3, 2/5, 22, o in ascending order. -3, 2/5, o, 22 Let v = 3.4 - 3.3. Sort 0.4, 0.8, -4, v in increasing order. -4, v, 0.4, 0.8 Let t(a) = a*2 + 40a - 171. Let n be t(-44). Sort 1, 3, n in descending order. n, 3, 1 Let h be 21/(-9) - (-4)/(-6). Sort h, 0, 1, -34 in descending order. 1, 0, h, -34 Let o be (-18)/(-3)2/(-8). Let q = 6473 - 6472. Sort o, 0.5, 2/13, q in increasing order. o, 2/13, 0.5, q Let f = -27 - -24. Let h be 45/24 - f/(-2). Let y = 0 + -2. Put 2/5, y, h in decreasing order. 2/5, h, y Suppose 0 = -105o + 83o - 22. Sort 0, -581, 3, o. -581, o, 0, 3 Let j(w) = w2 - 11w + 23. Let d be j(4). Sort d, 20, 0. d, 0, 20 Let d be (0 + -1)/((-2)/(-4)). Let c = -3 + 6. Let f(l) = l*3 + 46l*2 + 92l + 177. Let z be f(-44). Put d, c, z in ascending order. d, z, c Let v = 4 + -7. Suppose 4w = -19 - 1. Let x(l) = -2l - 2. Let n be x(-2). Put n, v, w in ascending order. w, v, n Let c = 1608/143 + -210/13. Put 5, -3/4, c in increasing order. c, -3/4, 5 Suppose -173r = -113r - 120. Put -4, 5, 6, r in decreasing order. 6, 5, r, -4 Let g = 21 - 20. Let c(r) = -r*2 - r + 1. Let u(m) = -4m*2 - 12m + 10. Let k(b) = 5c(b) - u(b). Let l be k(7). Sort 4, g, l in descending order. 4, g, l Let k be 12/(-16)4/(-5). Let h = 15.1 - 16. Sort h, k, 3. h, k, 3 Let d = -64 - -29. Let x = 30 + d. Sort x, 2/9, -2 in descending order. 2/9, -2, x Let z be 9/(-20)(-35)/(-42). Put 0.1, 2, -4, z in decreasing order. 2, 0.1, z, -4 Let f = 6 - 2. Suppose -3a + fn = -4a + 8, 43 = 4a + 5n. Suppose -2b - 2x - 19 = -7, -2b + 4x + a = 0. Sort -5, 0, b in increasing order. -5, b, 0 Let r be ((-24)/(-32))/(3/8). Put r, -1, -3, 17 in decreasing order. 17, r, -1, -3 Suppose 0d - 6 = -2d. Suppose 12j - 12 = 9j. Suppose df + j = -5. Sort 1, f, 3 in increasing order. f, 1, 3 Suppose -26p - 29 = 3p. Suppose 2d + 6 = 2a, -15 = 4a + 6d - d. Suppose -q + f = 1, -2q + af = -3f - 2. Put p, q, 3 in ascending order. q, p, 3 Let g = 9/67 + -179/335. Let p = -179/4 - -44. Sort p, g, 3 in descending order. 3, g, p Let w = 1.458 + -0.458. Put -1/3, -4, w, -1 in increasing order. -4, -1, -1/3, w Let x = 1 + 1. Suppose -xw = -0w. Let y be 4/(-8)-152/(-3). Sort y, w, -2 in ascending order. y, -2, w Let p be ((-18)/4)/((-1)/4 + 1). Let g be (-25 + 13)2/p. Put 3, 0, g, 8 in decreasing order. 8, g, 3, 0 Let n = 23 - 23. Let m be (4/(-10))/((-2)/10). Put n, -2, m, 3 in decreasing order. 3, m, n, -2 Let q = 2/3417 + -2244979/17085. Let d = q + 131. Let g be 4/9 - (-6)/(-27). Put d, g, 4 in descending order. 4, g, d Let y = -1138 + 14792/13. Sort -0.4, y, 0.3 in increasing order. -0.4, y, 0.3 Let s = 35 - 733/21. Suppose -5k + 222 = -78. Let l = k + -178/3. Put s, -3, l in descending order. l, s, -3 Let r be (-368)/5 - (-2)/(-5). Put 2, -2/3, r in increasing order. r, -2/3, 2 Let z = 2 + -2. Let n = 0.1 + z. Let b be (8/401-3)/((-48)/20). Put b, 4, n in increasing order. n, b, 4 Suppose 4m - 5g - 13 = 0, -11 = -4m + 2g + g. Suppose ms + 6 = 5s. Let v be s/(((-4)/(-2))/(-1)). Put v, -2, -5 in ascending order. -5, -2, v Let n(q) = -q*3 - 11q*2 + 14q + 14. Let d be n(-12). Let g = d - -7. Put 5, 0.16, g, -0.1 in descending order. 5, 0.16, -0.1, g Suppose -16 = -4u, -6 - 13 = 5m - u. Suppose -s = r - 3s + 19, -5s = 3r + 2. Sort m, 0, r, 3 in increasing order. r, m, 0, 3 Let n be (-589)/(-760) - (-4)/(-10). Let b = 17 + -19. Sort n, b, 0.1, 3 in descending order. 3, n, 0.1, b Let c = -18 - -28. Suppose 4y = -y + c. Let z be 9/(-1 + -2) + 4. Sort z, -5, y in descending order. y, z, -5 Let v = 0.1 - -0.1. Let o = -5829.5 - -5829. Put v, o, -3/19, -4 in descending order. v, -3/19, o, -4 Let h(p) = -4p - 22. Let l be h(-7). Let q be 4/(16/12) - l. Put q, 4, 2 in ascending order. q, 2, 4 Suppose 3d + 0d + 5q - 77 = 0, 0 = -3d + 4q + 41. Suppose g = 5r - d, 2r - 5g = -g + 4. Sort 1/2, 4/3, r, -3/7 in decreasing order. r, 4/3, 1/2, -3/7 Let v(y) = y3 - 8y*2 - 10y + 14. Let n be v(9). Sort -69, n, 2 in descending order. n, 2, -69 Let t = 16 - 11. Let s(u) = -2u2 + 11u - 4. Let f be s(t). Put f, -0.3, 0.4, -0.5 in increasing order. -0.5, -0.3, 0.4, f Suppose 0 = 3h - 3, -5q - 25 = -7h + 2h. Let r be 3(q + (-32)/(-12)). Let v = 0.37 + -0.17. Sort -8, v, r in descending order. v, r, -8 Suppose 3 + 15 = 2k. Suppose -9c + 6c + 15 = 0. Suppose 5b + 5 = 0, -h - cb + 3 = 12. Put h, -3, k in descending order. k, -3, h Let l(g) = g3 - g2 - g + 1. Let j be l(1). Let h = 13 + j. Let b be ((-4)/6)/(h/(-39)). Put b, -3, -4 in descending order. b, -3, -4 Suppose -4 = -2a + o + 2, 0 = 2o + 8. Put a, -35, -4 in descending order. a, -4, -35 Suppose 4r = 2r - 3h - 85, -46 = r + 5h. Let v = 46 + r. Put -2, 2, v, -8 in increasing order. -8, -2, 2, v Suppose -2p - 4f + 6 = 0, 14f = 5p + 16*f - 7. Put p, 240, 3, 2 in descending order. 240, 3, 2, p Suppose 0 =	{ "pile_set_name": "DM Mathematics" }
mber? False Is 181877909 composite? False Is 23671181 a prime number? True Is 2417153 a composite number? False Is 15056837 a composite number? True Is 1000333 composite? False Is 24798759 composite? True Is 73442459 a prime number? True Is 24503987 composite? True Is 18571523 a composite number? True Is 1873934 a composite number? True Is 97487137 a prime number? False Is 351086 prime? False Is 167802301 composite? False Is 49124209 composite? False Is 47288737 a prime number? False Is 255525829 composite? True Is 5415617 a prime number? True Is 517135379 prime? True Is 718046663 prime? False Is 2336177 prime? True Is 21458441 prime? False Is 15150067 a composite number? True Is 5689669 a prime number? False Is 23697929 a composite number? False Is 12788327 a prime number? True Is 133373113 a prime number? False Is 23529487 a prime number? True Is 830519 a composite number? True Is 89403109 a prime number? True Is 242775191 prime? True Is 76508897 a prime number? True Is 201879133 a composite number? True Is 33509129 a prime number? True Is 1212671 prime? True Is 958735 composite? True Is 70236989 composite? True Is 57040091 a composite number? False Is 13046197 a prime number? True Is 882061 a composite number? False Is 690366181 a prime number? False Is 2077987 a prime number? True Is 3308359 prime? True Is 19583083 prime? False Is 18965867 a prime number? False Is 1966001 a prime number? False Is 2299723 prime? False Is 93012611 a prime number? True Is 194508413 composite? True Is 127241437 a composite number? False Is 5524133 composite? True Is 198591889 composite? False Is 33440101 a prime number? True Is 8498663 a composite number? False Is 1297841 a composite number? False Is 10658101 a composite number? False Is 83307461 prime? False Is 451252649 prime? True Is 332094911 a composite number? False Is 6760771 a composite number? False Is 27703441 a composite number? True Is 12000217 prime? False Is 843129053 prime? False Is 70663471 prime? False Is 37762673 composite? True Is 40460609 a prime number? False Is 459761351 a composite number? True Is 2271487 composite? True Is 1647031 a composite number? False Is 17508551 composite? False Is 214663961 prime? True Is 6671699 a prime number? False Is 15895819 a composite number? False Is 238549229 a prime number? True Is 1532815 prime? False Is 585313 composite? False Is 32415154 a composite number? True Is 1047329957 a prime number? True Is 1112465 composite? True Is 1647389 prime? True Is 2047699 a prime number? True Is 155677 composite? True Is 40140761 prime? True Is 4444163 a prime number? False Is 16441721 a composite number? False Is 40705073 prime? True Is 39089733 composite? True Is 1698889 composite? True Is 59531011 prime? True Is 2961557 a prime number? True Is 5970359 a composite number? False Is 56329151 composite? False Is 7803611 prime? True Is 7555381 prime? False Is 15788957 prime? False Is 14319007 composite? False Is 251635079 composite? False Is 3045239 composite? True Is 31114249 prime? True Is 24985711 composite? False Is 56341943 a composite number? True Is 3468461 prime? True Is 553382683 composite? True Is 19006837 a prime number? False Is 54251969 a prime number? True Is 334851709 prime? True Is 92879 composite? True Is 777505 a prime number? False Is 4675163 a composite number? False Is 36205061 a composite number? True Is 173524291 a prime number? False Is 201240899 a prime number? True Is 41207657 a composite number? False Is 201477541 a composite number? True Is 436727761 composite? True Is 1295839 prime? True Is 1589803 composite? False Is 1514321 composite? False Is 280550401 prime? True Is 2538409 a composite number? True Is 22518179 a prime number? True Is 467402671 a composite number? False Is 117317821 composite? False Is 11964977 prime? False Is 5231927 a composite number? True Is 10931797 a composite number? False Is 1205231 a composite number? False Is 32363029 composite? True Is 428922539 a prime number? True Is 1909407 a composite number? True Is 95879921 composite? False Is 30616741 a prime number? False Is 17759849 composite? True Is 1705721 a prime number? True Is 146805667 a prime number? False Is 3657187 prime? True Is 80745794 a prime number? False Is 6306959 a prime number? False Is 4611331 composite? True Is 808364147 prime? False Is 185913269 prime? True Is 7345582 a composite number? True Is 404967 a prime number? False Is 304587329 prime? True Is 75035113 prime? False Is 803022287 prime? True Is 1208927 a prime number? True Is 17775943 composite? False Is 14890481 prime? False Is 52899391 a composite number? True Is 8529683 a prime number? False Is 1817789 a prime number? False Is 514711 prime? True Is 171007 a composite number? False Is 1221049 composite? False Is 1671881 a prime number? False Is 16239407 prime? True Is 478542763 a composite number? False Is 6836015 composite? True Is 41703113 composite? True Is 9458177 composite? True Is 11894821 a prime number? False Is 33129871 a prime number? True Is 186250061 a composite number? False Is 3382733 a composite number? False Is 1878119 a composite number? False Is 2476273 a composite number? False Is 53051707 prime? True Is 1945689 a prime number? False Is 101877823 a composite number? False Is 636429959 composite? True Is 246518 composite? True Is 9234697 a prime number? True Is 45741389 composite? True Is 18648199 prime? True Is 6590027 a composite number? False Is 156960323 prime? False Is 1085891 a composite number? False Is 143503849 a composite number? False Is 1402061 a prime number? True Is 80524979 a composite number? False Is 32823617 a composite number? True Is 6900757 a composite number? True Is 406347 prime? False Is 179747845 a prime number? False Is 1588273 a composite number? False Is 150470309 composite? True Is 27241567 prime? False Is 137829571 prime? False Is 216642653 a prime number? False Is 755026 composite? True Is 9994486 prime? False Is 19981183 prime? True Is 5830589 composite? False Is 26346713 prime? True Is 1937917 prime? True Is 314225771 prime? True Is 641904007 prime? True Is 39211357 prime? True Is 102928717 composite? False Is 357544999 a prime number? False Is 1690883 prime? True Is 10086931 a composite number? False Is 819563 prime? True Is 46973161 a composite number? False Is 100427111 a composite number? True Is 206726101 prime? False Is 1485947 composite? False Is 9064573 a prime number? False Is 28183453 a composite number? True Is 207028649 a composite number? False Is 7704857 a prime number? False Is 11174441 a prime number? False Is 1977067 a prime number? True Is 35962907 prime? False Is 66693293 a composite number? False Is 32369439 composite? True Is 187263703 composite? True Is 11744741 prime? False Is 2529391 a composite number? False Is 23363 prime? False Is 16887877 prime? True Is 8464307 prime? True Is 1337450721 composite? True Is 193164637 a prime number? True Is 105182549 composite? False Is 167668421 a prime number? True Is 12887747 prime? False Is 2020045 a composite number? True Is 6673981 composite? False Is 1708996121 prime? False Is 404941 a prime number? True Is 10746467 composite? False Is 75142489 composite? False Is 114867085 composite? True Is 3919339 a prime number? False Is 10568759 a prime number? True Is 24427957 a composite number? False Is 8900641 a prime number? True Is 40835471 composite? True Is 23222779 a prime number? False Is 192445343 composite? True Is 234610067 composite? False Is 59605971 composite? True Is 496804813 a prime number? False Is 3208559 composite? False Is 1068119 prime? False Is 4915961 prime? True Is 1488902 prime? False Is 689693 prime? True Is 508206383 a composite number? False Is 70782433 composite? True Is 31249921 a prime number? False Is 1369398269 composite? False Is 169292593 prime? False Is 111612143 a prime number? True Is 24399719 prime? True Is 355766366 a prime number? False Is 1379154773 composite? True Is 6813817 a composite number? False Is 805029 a prime number? False Is 16127461 composite? True Is 99395495 composite? True Is 49971931 a composite number? True Is 26486099 a composite number? False Is 925513 a prime number? True Is 41503723 a composite number? False Is 95	{ "pile_set_name": "DM Mathematics" }
value of (-1)/1((-8)/(-12))/2? -1/3 Evaluate (2/(-12))/(5/20). -2/3 Calculate (654/(-981))/((-1)/((-6)/(-4))). 1 Evaluate 38/7215. 5 What is the value of 18/(-4)32/24? -6 Calculate ((-1)/((-22)/66))/((-6)/16). -8 15/(-2)7/(245/7) -3/2 What is the value of 0/(-1)5/(-5)? 0 What is ((-2)/(-2))/(6(-5)/(-120))? 4 What is the value of (-4)/(1-2)129/(-258)? -1 ((-1)/(-1))/(((-21)/7)/12) -4 What is the value of (16/12)/(434/(-93))? -2/7 Calculate ((-12)/68)/1(-18)/27. 2/17 Calculate 121/93. 4 Evaluate (-16)/1221/(-70). 2/5 Calculate (-1)/((-3)/9)(-18)/27. -2 Calculate ((-1)/2)/(-1)(-48)/(-8). 3 -112/(-21)175/(-50) -2 Calculate (2/(-28))/((-30)/(-105)). -1/4 (20/175)/(18/(-135)) -6/7 Calculate (1/(-6))/(32/96). -1/2 (-7)/7(-1)/(28/8) 2/7 Calculate 18/18121/2. 6 What is the value of (-3)/1387(-16)/(-28)? -2/23 ((-6)/30)/(5(-6)/(-50)) -1/3 What is -2610/(-40)? 3 Evaluate ((-2)/(-91))/(104/364). 1/13 ((-920)/(-230))/((-8)/22) -11 What is (-15)/18136/(-135)? 2/9 What is the value of (4/(-2))/(168/12)? -1/7 Evaluate ((-4)/68)/(1/2). -2/17 What is the value of ((-2)/(-8))/(-1(-1)/(-4))? -1 Evaluate (((-165)/12)/(-11))/5. 1/4 Calculate ((-238)/238)/((-5)/8). 8/5 What is 14/56(-24)/(-18)? 1/3 What is the value of (-18)/15(-55)/(-22)? -3 What is (79/(-2370))/((-1)/(-3))? -1/10 What is the value of 42/168(-4)/7? -1/7 What is ((-6)/(-16))/(5(-57)/190)? -1/4 Calculate (-24)/427/(-102)3. 2/17 3/(-22)16/36-3 2/11 Calculate 4/15/(-30). -2/3 Evaluate ((-16)/10)/(115/(-575)). 8 What is the value of 6(-2)/61? -2 Evaluate (-24)/(-27)1/(-4)3. -2/3 What is (-6)/(-4)18/(-27)? -1 What is ((63/(-10))/(-21))/((-6)/(-5))? 1/4 Calculate (-30)/78-14/(-10). -2/13 Evaluate 10/(-4)4/(-2). 5 What is (914/(-210))/(18/(-20))? 2/3 Evaluate 5(-24)/4205/(-2). 5/7 What is the value of ((-22)/2640-36)/(6/(-5))? -1/4 Calculate (15/20)/(2/(-8)1). -3 Evaluate 5/26/5. 3 What is 6/(-81)((-9)/(-3))/3? -2/27 What is (12/34)/(90/30)? 2/17 (2(-1)/15)/(12/18) -1/5 ((-1)/(-2))/(8/32) 2 (-3)/(-2)68/(-36) -2 12/2-43/24 -3 What is the value of (12/(-1176)-7)/((-1)/(-4))? 2/7 Calculate (1/(-4))/((-3)/4)6. 2 What is (-13)/(-26)20/(-2)? -5 What is ((-100)/(-480))/((-1)/(-6))? 5/4 (4/(-6))/(3/(-92)) 4 (1(-6)/(-2))/1 3 What is 15((-1)/(-2))/((-3)/2)? -5 What is (548/(-822))/(((-4)/(-6))/2)? -2 What is ((-7)/(98/(-21)))/(151)? 1/10 Calculate (1/3)/(6(-3)/(-162)). 3 What is 18/244(-1)/6? -1/2 Evaluate 117/(-78)2/(-12). 1/4 What is the value of ((-1)/6)/(2(-5)/80)? 4/3 What is the value of ((-2)/(-4))/((-3)/(27/(-6)))? 3/4 (-38)/(-19)63/(-18) -7 What is (-10)/1512/2? -4 Evaluate (-1)/112/12. -1 ((-2)/((-4)/(-4)))/3 -2/3 What is the value of ((-392)/343)/((-4)/(-14))? -4 What is the value of 20/(-36)((-36)/10)/3? 2/3 What is (-12)/2266/6? -6 (2/(-12)1)/((-10)/12) 1/5 6(-3)/(-6)-11 -3 What is the value of 2-315/(-18)? 5 What is the value of (14/7)/(48/(-8))? -1/3 What is the value of 86/(-15)(-30)/12? 8 Evaluate (-72)/132121/(-22). 3 Evaluate (1/(-4))/((-3)/12). 1 Calculate (2/(-3))/(264/36). -1/11 (1/((-2)/3))/(42/84) -3 What is (6/45-3)/(8/(-100))? 5 What is the value of (-3)/(-2)7(-60)/315? -2 What is 1/(((-1)/(-6))/((-8)/456))? -2/19 What is the value of ((-4)/(-110))/(((-8)/(-2))/(-20))? -2/11 Evaluate (4/(-7))/(10/(-30)6). 2/7 Evaluate ((-4)/2)/((-12)/4). 2/3 What is the value of -3-7(-8)/24? -7 What is (-2)/((-14)/2808)? 5 What is ((-2)/2)/(54/378)? -7 What is the value of (18/16)/((-22)/(-176))? 9 ((-2)/6)/(1/(-3)) 1 (2/4)/((-35)/(-10)) 1/7 Calculate 2/124/(-2). -1/3 What is (3/6)/(((-91)/14)/(-13))? 1 5/804-8 -2 Calculate -48/6144/(-192). 4 What is the value of (-18)/34/40? -3/5 Calculate -5(-1)/(-15)24/2. -4 What is the value of (-15)/3144/(-90)? 8 What is the value of ((-32)/(-20))/(20/100)? 8 Calculate (-9)/1218/27. -1/2 Evaluate (-31/30)/(-1). 0 Calculate 108/(-36)6/10. -9/5 ((3/21)/((-4)/(-8)))/1 2/7 What is the value of (-91)/208-8-2? -7 What is 14/91(-130)/(-20)? 1 What is ((-1)/6)/(90/(-120))? 2/9 What is 1(-4)/(-72)-4? -2/9 (20/(-45))/(4/(-18)) 2 Calculate 5/2232/40. 2/11 (-3)/(-2)(-43)/((-344)/16) 3 Evaluate (3(-4)/(-72))/((-2)/8). -2/3 What is (1/(-24)-3)/((-11)/(-11))? 1/8 (20/(-50))/((-8)/60) 3 What is the value of 0/(-2)-118/(-88)? 0 What is 10/4(-360)/(-300)? 3 Calculate (102/(-18))/170/(-2). 0 Calculate ((-4)/4)/(-1)10/(-5). -2 Calculate (-9)/12(-40)/(-30). -1 What is the value of (210/567)/((-10)/(-36))? 4/3 3/(-51)((-20)/2)/5 2/17 What is the value of 280/422(-3)/(-10)? 4 What is the value of ((-52)/78)/(5/((-45)/(-2)))? -3 248/558(-18)/(-4) 2 What is (2/1)/(4/4)? 2 Calculate 0/(125/(-5)). 0 What is (((-36)/(-54))/(1/(-6)))/1? -4 (6/18)/((-1)/3) -1 Evaluate 20/1016/4. 8 Calculate 1/((8/(-4))/(-2)). 1 What is the value of (112/288)/((-14)/(-6))? 1/6 Evaluate (12/(-81))/(2/(-3))-1. -2/9 Evaluate 3/96/(-4)4. -2 Evaluate ((-6)/4)/(3(-30)/(-36)). -3/5 Calculate (26/(-195)6)/((-12)/(-10)). -2/3 Calculate (88/55)/((-3)/(30/4)). -4 What is 5/((-30)/4)15/(-5)? 2 (-1)/((-3)/((-6)/(-2))) 1 Evaluate ((180/10)/(-9))/((-8)/(-2)). -1/2 Evaluate ((-185)/148)/(2/(16/2)). -5 What is (50/175)/((-15)/7)-3? 2/5 (-1)/(5/2-1) 2/5 What is the value of (-13)/(1911/(-14))1/1? 2/21 (-42)/3501010/(-16) 3/4 (-30)/(-25)(30/(-9))/(-2) 2 Calculate 1(10/(-15))/((-2)/(-1)). -1/3 What is the value of (5/(-30))/((-8)/6)2? 1/4 What is (-46)/(-92)2-9? -9 What is (2/(-3))/((-30)/(-18))5? -2 16/60(-3)/(-2)10 4 Evaluate (3/10)/((-21)/28)2. -4/5 Evaluate ((-72)/1355)/((-2)/6). 8 4/((-4)/(-3))(-264)/198 -4 (4/(-70))/(((-36)/(-30))/(-6)) 2/7 What is the value of ((-8)/18)/(30/135-1)? 2 Evaluate (-5)/(((-4)/(-6))/(212/(-159))). 10 What is the value of ((-21)/(-42))/(2/(-12))? -3 Calculate ((12/69)/2)/(1/(-1)). -2/23 What is ((-31)/(-93))/((-1)/(-15))? 5 Evaluate 3(-1)/14(-22)/(-11). -3/7 (-42)/25/15 -7 What is the value of ((-2)/((-88)/33))/(1/4)? 3 What is (-4)/(-3)(-3)/(-30)-1? -2/15 What is 5/60((-75)/10)/5? -1/8 Calculate 8/(-9)5/((-20)/1). 2/9 What is (12/2)/(6(-7)/21)? -3 Evaluate (840/90)/(8/(-6)). -7 Calculate (-352)/(-440)5/14. 2/7 Evaluate ((-60)/525)/(2/10). -4/7 What is the value of (2/(-8))/((-25)/(-20))? -1/5 What is the value of (-9)/42-46/6? 6/7 1/21/((-2)/(-2)) 1/2 What is the value of (6/4)/((-6)/2)2? -1 (-18)/60(-25)/(-30) -1/4 Calculate (1/106)/((-54)/(-450)). 5 (3/(-2))/((-3)/(-8)) -4 What is the value of 2/(-4)(-8)/2? 2 What is the value of (100/10)/(-10)-3? 3 What is (8/20)/((-18)/90)? -2 What is the value of (61)/(((-675)/30)/15)? -4 Calculate 7/126-92/1. -1 Calculate (-40)/126/(-10). 2 4/(1132/968) 11 (0/(-27))/(21) 0 (20/((-4400)/20))/(2/2) -1/11 What is the value of (525/630)/((-2)/((-12)/(-10)))? -1/2 Calculate (4/2)/(23/((-207)/18)). -1 (2/33)/((-7)/((-84)/(-8))) -1/11 Evaluate 20/(16/(-4))(-39)/(-130). -3/2 What is the value of (0/(-1))/((-13)/(130/(-30)))? 0 ((-15)/(-9))/((-11)/(-33)) 5 Calculate 0/(-1)3/3. 0 What is ((-156)/(-520))/(1/(10/4))? 3/4 What is (-7)/(-21)(-6)/(-2)? 1 What is the value of (12/(-4))/(-9)9? 3 What is (1568/2805)/((-4)/(-22))? 2 Calculate (-20)/(-154/8). 8/3 6-15/(-50) 3/5 Calculate (2/((-4)/(-2)))/(8/(-32)). -4 Evaluate ((28/8)/(-7))/(25/(-10)). 1/5 Evaluate 4/(4/(-3))14/21. -2 What is the value of 54/(-54)51? -5 (5/(75/(-6)))/((-28)/(-35)) -1/2 ((-6)/(168/7))/((-1)/(-16)) -4 What is 27/(-36)4/(-1)-2? -6 Evaluate ((-8)/(-102))/((36/(-27))/(-2)). 2/17 Evaluate ((-3)/15)/((-10)/(-25))-2. 1 Calculate (4/(46))/((-2)/4). -1/3 5(-8)/(-50)(-10)/(-4) 2 (14/(-21)-1)/((-1)/12) -8 What is 3/(-3)(-6)/(-6)? -1 Calculate ((-16)/(-4))/(11/(33/150)). 2/25 Calculate (2/12)/((-42)/(-28)). 1/9 (-2)/1413/(-624)21 1/16 What is the value of (1/14)/(2/7)? 1/4 (6/10)/(-1)5 -3 What is the value of ((-4)/3)/((-40)/150)? 5 What is the value of (28/665)/(6/(-15))? -2/19 What is the value of (39/26)/((-1)/(-4)-2)? -3 (((-99)/(-36))/11)/(1/4) 1 What is the value of (60/48)/(1/4)? 5 Evaluate (20/40)/((-14)/4). -1/7 8/(-3)-7(-27)/(-4788) 2/19 What is ((-156)/(-364))/((-6)/(-8))? 4/7 Evaluate 180/(-24)6/9. -5 What is 6/(-21)14/8? -1/2 What is (15/(-20))/(3/(-1))20? 5 What is the value of (15/15)/((-4)/44)? -	{ "pile_set_name": "DM Mathematics" }
b*2 + 326b*2 - 172b*2 + 0b*2 wrt b. 2058 Let k(w) = 1522w*3 + 4w*2 - 910w + 4. Let v(g) = 1518g3 + 5g*2 - 909g + 5. Let n(h) = 5k(h) - 4v(h). What is the second derivative of n(l) wrt l? 9228l Let h(m) = 27m - 46. Let g(u) = 14u - 23. Let c be (-7 - -14) + 4/(-2). Let j = 57 + -59. Let d(z) = cg(z) + jh(z). Find the first derivative of d(y) wrt y. 16 Let g be (-6)/6 + -1 + (1 - -34). Differentiate go*2 + 22o*2 - 500 + 12o*2 + 443 wrt o. 134o Differentiate 4233d2 - 3363 + 51d - 610 - 4236d2 + 770 with respect to d. -6d + 51 Let y(o) = -3o + 19. Let q(m) = -3221m + 2121. Let z(k) = q(k) - 4y(k). What is the derivative of z(d) wrt d? -3209 Let p(t) be the third derivative of 3t*8/7 - 2t*6/15 - 37t*5/20 - 2t*3/3 - 2602t*2. Find the third derivative of p(w) wrt w. 8640w*2 - 96 Let v be 3((-4)/28)/(7/(-49)). Let y(c) be the second derivative of 0c3 - vc*2 + 13/12c*4 + 3c + 0. What is the first derivative of y(w) wrt w? 26w Let a(m) = 14m*3 - 2m*2 - 5m. Let n(h) = -h*3. Suppose 139w = 141w + 2. Let o(x) = wa(x) + 4n(x). What is the third derivative of o(k) wrt k? -108 Let f(b) = -8b*2 + 1870b + 9615. Let r(i) = 7i2 - 1873i - 9610. Let p(z) = -4f(z) - 5r(z). What is the first derivative of p(g) wrt g? -6g + 1885 Let d(p) = 864p*3 + 5p*2 - 773. Let l(t) = -869t*3 - 6t*2 + 773. Let a(g) = 6d(g) + 5l(g). What is the first derivative of a(x) wrt x? 2517x*2 Suppose -6y - 158 = -1820. Suppose -4d - 5s = -y, 0d - 5d + 3s = -337. Find the second derivative of -g3 + g3 - 3g*4 - 55g + dg wrt g. -36g*2 Let a = -761 + 766. Find the third derivative of 10f*4 - 1 + 19f*4 - 29f*4 - 236f*a + 170f*2 wrt f. -14160f*2 Let b(y) be the second derivative of -2y9/945 - y5/10 - 53y4/12 + y - 4. Let k(j) be the third derivative of b(j). Differentiate k(f) wrt f. -128f*3 Let b(s) be the first derivative of 711s5/5 - s4/2 - 3036s - 2723. What is the first derivative of b(l) wrt l? 2844l*3 - 6l*2 Let z(a) be the first derivative of 0a - 4a2 - 74 + 56/3a*3. Find the second derivative of z(u) wrt u. 112 Let f(d) = -24d - 210. Let i be f(-9). Find the third derivative of -120x3 - 86x*2 + 120x*3 - 26x*6 - ix*2 - 22x*2 wrt x. -3120x*3 Let s(d) be the second derivative of 7/20d*5 + 1/4d*4 + 0 - 137d - 1/15d6 - 10/3d*3 + 0d*2. What is the third derivative of s(t) wrt t? -48t + 42 Let n(p) = -271p + 212. Let v be 5/290/25. Let s(u) = 68u - 53. Let l(x) = vs(x) + 2n(x). What is the derivative of l(c) wrt c? 70 Find the second derivative of 2447v + 22v3 - 12v*2 + 17v*4 + 64 - 63 - 26v*3 + 0v*3 wrt v. 204v*2 - 24v - 24 Let f(q) be the second derivative of 15 + 0q3 + 91/20q*5 - q - 30q*2 + 0q*4. Differentiate f(o) wrt o. 273o*2 Let g = -97 + 100. What is the derivative of -872l*3 + 1533l*g + 249 - 933l*3 wrt l? -816l2 Let k(t) = t3 + 10t + 2. Let g(w) = -2702w*3 + 60w + 1121. Let f(l) = g(l) - 6k(l). What is the first derivative of f(u) wrt u? -8124u*2 Differentiate 3223 + 615i + 159i - 286 + 708i + 432i with respect to i. 1914 Suppose -12t + 10t = -138. Let v = t - 64. Find the third derivative of -19s*5 - 23s*2 - 3s*5 - 15s*v wrt s. -2220s*2 Find the second derivative of -18l + 1 - 14899l5 - 2l*4 - 4 + 2l*4 + 19374l*5 wrt l. 89500l*3 Find the second derivative of -87 + 86 + 1827h*3 + 1784h + 125h3 - 45h*3 - 494h wrt h. 11442h Let y = 13226 - 79351/6. Let u(q) be the second derivative of 0 + 0q*3 + 37q - yq4 + 0q*2 - 13/20q*5. Find the third derivative of u(r) wrt r. -78 Let n = 3 + 1. Suppose nh = -3s + 12, -4s + 20 = s + 2h. Find the third derivative of -224w*3 - 12w*2 + 224w*3 - 17w*s wrt w. -408w Let m(g) = g. Let u be m(-6). Let i = u - -23. Find the third derivative of 2v5 + iv*2 - 6v*2 - 7v5 + v5 wrt v. -240v2 Let k(l) = -112l*3 + 526l*2 - 10l + 5. Let a(r) = -115r3 + 525r*2 - 8r + 4. Let f(d) = 5a(d) - 4k(d). Find the third derivative of f(n) wrt n. -762 Let n(h) = -4h3 - 2h*2 + 48h - 3148. Let w(i) = i*3 + 2i - 10. Let k(c) = 2n(c) + 2w(c). Differentiate k(u) wrt u. -18u2 - 8u + 100 Let l(b) be the third derivative of -993b5/20 + 2429b*3/3 + 357b*2 + 8b. Find the first derivative of l(w) wrt w. -5958w Suppose 3a = -5p + 20, 20 = 5a + 7p - 2p. Find the second derivative of 34y5 - 67y + ay5 + 22y*5 wrt y. 1120y*3 Find the third derivative of -40722o*5 - 20o - 3o3 + 5o*4 - 5o*6 - 5o*4 - 40731o*5 - 2 + 52o*2 + 81511o*5 wrt o. -600o*3 + 3480o*2 - 18 Let j(q) = -2q + 1. Let y(d) = 17d4 + 41d*2 - 16d + 6. Let l(x) = -8j(x) + y(x). What is the third derivative of l(f) wrt f? 408f Let u be (-1)/44 + 6. Differentiate -78 + 3w*4 + 20w*2 - 12w*2 - u - 59 + 33 with respect to w. 12w*3 + 16w Suppose 27z - 716 - 67 = 0. What is the derivative of z + 79q*3 - 166q*3 - 12q*2 + 88q*3 wrt q? 3q*2 - 24q What is the second derivative of 83n - 2 - 2n*5 + 11n*5 - 24n - 9n3 + 0 wrt n? 180n*3 - 54n Let f(i) = 471i - 1905. Let n(c) = 941c - 3808. Let m(o) = -5f(o) + 2n(o). Find the first derivative of m(a) wrt a. -473 Differentiate 0c3 + 12c + 351c2 - 1063c*2 + 351c*2 - 8c*3 + 355c*2 + 5169 wrt c. -24c*2 - 12c + 12 Let x = 103 - 34. Find the third derivative of 13y - xy*5 + 11y*5 - 59y*2 + 61y*2 wrt y. -3480y*2 Suppose -156740 = -9i - 8i. What is the third derivative of 2j*3 - 9j*3 - ij + 2j2 + 9236j wrt j? -42 Suppose -45 = d - 47. What is the second derivative of -77b2 + 58b - 83b2 + 136b*d wrt b? -48 Let k(t) = -128t*3 + 5t + 6. Let g be k(-1). Find the first derivative of -55 + 54 + 2r2 + 6r - g - 100 wrt r. 4r + 6 Let a(p) be the second derivative of 15/4p*4 + 3/20p*5 + 0p*3 - 8p - 1/2p2 + 11/42p*7 + 0p*6 + 3. Find the third derivative of a(o) wrt o. 660o*2 + 18 Find the third derivative of 30m*2 + 728m*3 - 3200 - 2876m*3 - 273 - 1551m*3 - 28m*2 wrt m. -22194 Let c = 370 + -368. Find the third derivative of 29j*2 + 183j*4 - 2j - 17jc + 16j*2 + 3j*2 wrt j. 4392j Let p(f) be the second derivative of 293f6/10 + 5f*4 - 5f*3/6 + 1345f. Find the third derivative of p(h) wrt h. 21096h Let v be (-5 - (-1 + 3))2/(-7). Suppose vu - 4 = -0. What is the second derivative of 3o*2 + u + 18o - 14o2 - 2 wrt o? -22 Let j(k) = 6k*2 + 6k. Let r be j(-2). What is the first derivative of 92 + 21 - r + 127i2 + 17 wrt i? 254i Let x(t) be the second derivative of 359t7/21 - 472t*4/3 - 1523t. Find the third derivative of x(y) wrt y. 43080y2 Suppose 9u = -221 + 842. What is the third derivative of -556 + 1109 - ur6 - 553 + 70r*2 wrt r? -8280r*3 Let s(i) be the first derivative of 1847i*3/3 + 1593i - 1482. Find the first derivative of s(k) wrt k. 3694k Find the third derivative of -42 + 476t + 79t2 - 1149t*3 - 5554t*3 - 76t*2 - 467t wrt t. -40218 Suppose 4g = -16 + 44. Find the third derivative of -2h*6 + 2h*2 + g - 1 - 1 - 12h*4 wrt h. -240h*3 - 288h Let q be (26/3)/(2/3). Let r = -394 + 397. Find the second derivative of -14s - rs*4 + qs - 10s wrt s. -36s*2 Let u(n) be the first derivative of -4885n*3/3 - 2n*2 - 119n - 416. What is the second derivative of u(j) wrt j? -9770 Let w(q) = 2q3 - q2 + q + 2. Let x be w(-1). Let m(n) = n + 4. Let o be m(x). Differentiate c2 - 4 + 3 - 12c*o + 0 with respect to c. -22c Let k(d) be the first derivative of -3/4d4 + 0d*5 + 0d - 2/3d6 - 1/3d*3 + 31/2d*2 - 51. What is the third derivative of k(c) wrt c? -240c*2 - 18 Let s(b) = -119809b*2 - 680b + 420. Let j(q) = -11979q2 - 68q + 42. Let i(o) = -61j(o) + 6s(o). What is the second derivative of i(t) wrt t? 23730 Let y(u) = 531u3 + 6u*2 + 6u + 103. Let n(p) = 2125p3 + 23p*2 + 27p + 411. Let a(t) = 2n(t) - 9y(t). What is the third derivative of a(m) wrt m? -3174 Differentiate -1593 - 599 + 23a2 + 72a - 1169 - 6737 + 80 with respect to a. 46a + 72 Let o(a) = -35a - 980. Let w be o(-28). Let b(f) be	{ "pile_set_name": "DM Mathematics" }
illilitres? 6129.012 How many millennia are there in 69377.55 centuries? 6937.755 Convert 4685.113 millilitres to litres. 4.685113 How many years are there in 3/5 of a decade? 6 What is 1111.986 months in centuries? 0.926655 How many centuries are there in 0.4438649 millennia? 4.438649 How many nanograms are there in seventeen quarters of a microgram? 4250 What is 3/10 of a litre in millilitres? 300 How many years are there in seven halves of a millennium? 3500 How many centuries are there in 1/5 of a millennium? 2 What is 55/4 of a milligram in micrograms? 13750 What is 6/5 of a decade in months? 144 What is 5360.124mm in micrometers? 5360124 How many months are there in eleven halves of a century? 6600 How many months are there in fifteen quarters of a century? 4500 How many millilitres are there in five quarters of a litre? 1250 What is 40641.67ml in litres? 40.64167 How many days are there in 65312.604 minutes? 45.355975 Convert 41937.7ng to kilograms. 0.0000000419377 What is one quarter of a century in years? 25 Convert 8.84714 years to decades. 0.884714 Convert 0.0148605 millilitres to litres. 0.0000148605 How many millilitres are there in 76.9927 litres? 76992.7 How many days are there in twelve sevenths of a week? 12 How many hours are there in three sevenths of a week? 72 Convert 0.6093389 hours to seconds. 2193.62004 Convert 692364.4ml to litres. 692.3644 How many nanograms are there in 5/8 of a microgram? 625 What is 1/24 of a decade in months? 5 Convert 179.7423 minutes to nanoseconds. 10784538000000 How many micrograms are there in 21/2 of a milligram? 10500 How many millimeters are there in 45/8 of a meter? 5625 What is 200.6837 micrograms in nanograms? 200683.7 How many minutes are there in twenty-one halves of a day? 15120 How many nanograms are there in 355.3001 grams? 355300100000 How many millimeters are there in 6800.448 kilometers? 6800448000 What is 0.3572632 decades in millennia? 0.003572632 How many litres are there in 2534.588ml? 2.534588 Convert 5946.256 hours to seconds. 21406521.6 What is 0.4405321 litres in millilitres? 440.5321 How many nanograms are there in eleven eighths of a microgram? 1375 What is 3/25 of a century in months? 144 What is 8.099091 weeks in nanoseconds? 4898330236800000 What is 208.5686km in nanometers? 208568600000000 How many centimeters are there in 3359.991nm? 0.0003359991 How many hours are there in 25/4 of a week? 1050 Convert 0.2308899 minutes to seconds. 13.853394 Convert 7980.602 years to months. 95767.224 What is 11/2 of a centimeter in micrometers? 55000 What is 0.4817149ml in litres? 0.0004817149 How many weeks are there in 69.317024 days? 9.902432 Convert 0.3300129us to nanoseconds. 330.0129 How many nanograms are there in 52/5 of a microgram? 10400 What is 98048.5ml in litres? 98.0485 What is 1777.6ml in litres? 1.7776 What is 27/5 of a millimeter in micrometers? 5400 How many decades are there in 6/5 of a century? 12 What is 21/4 of a week in minutes? 52920 Convert 5421.401 litres to millilitres. 5421401 How many kilograms are there in 0.0791818t? 79.1818 How many months are there in 1/10 of a millennium? 1200 What is fourty-nine fifths of a millisecond in microseconds? 9800 How many millimeters are there in 7/2 of a centimeter? 35 How many seconds are there in nine tenths of a day? 77760 What is 1.4945226 months in years? 0.12454355 Convert 8705.171 millilitres to litres. 8.705171 What is 11/7 of a week in hours? 264 Convert 56702.28 grams to milligrams. 56702280 What is 2170.0731 months in millennia? 0.180839425 What is 3.255392mg in tonnes? 0.000000003255392 How many microseconds are there in 274.8958 seconds? 274895800 Convert 8219.85 millimeters to kilometers. 0.00821985 What is 13/4 of a micrometer in nanometers? 3250 How many minutes are there in one fifth of a hour? 12 Convert 8607.867 decades to millennia. 86.07867 Convert 1574.29377 hours to weeks. 9.37079625 How many litres are there in 374878.1 millilitres? 374.8781 Convert 248.7319 hours to nanoseconds. 895434840000000 How many millilitres are there in 43/2 of a litre? 21500 Convert 8369.134 millilitres to litres. 8.369134 How many millimeters are there in 3/40 of a meter? 75 How many minutes are there in twenty-eight ninths of a day? 4480 How many millilitres are there in five quarters of a litre? 1250 Convert 55.44137 tonnes to nanograms. 55441370000000000 What is 11/2 of a tonne in kilograms? 5500 How many micrometers are there in 2/125 of a meter? 16000 What is eleven halves of a kilogram in grams? 5500 Convert 117253.4mm to nanometers. 117253400000 What is 3146.536 micrometers in millimeters? 3.146536 Convert 574553.6 years to decades. 57455.36 What is 33116.46l in millilitres? 33116460 How many months are there in 11/2 of a century? 6600 What is thirty-one fifths of a litre in millilitres? 6200 Convert 10838.06 days to microseconds. 936408384000000 What is 3/25 of a kilometer in centimeters? 12000 What is thirty-three fifths of a minute in seconds? 396 How many months are there in fifty-one quarters of a year? 153 What is one twentieth of a tonne in kilograms? 50 How many nanograms are there in 753860.8 tonnes? 753860800000000000000 What is 3/40 of a kilogram in grams? 75 How many years are there in 71948.4 millennia? 71948400 Convert 7447.923kg to milligrams. 7447923000 What is 230.9506l in millilitres? 230950.6 What is 3/25 of a tonne in kilograms? 120 What is 6/25 of a minute in milliseconds? 14400 What is 7/4 of a kilogram in grams? 1750 Convert 0.7405229um to kilometers. 0.0000000007405229 What is 51657.33ml in litres? 51.65733 How many milligrams are there in 0.5732039ng? 0.0000005732039 What is 11/8 of a microgram in nanograms? 1375 What is 5/8 of a micrometer in nanometers? 625 What is 48956.19 centuries in months? 58747428 Convert 63.42169 days to hours. 1522.12056 Convert 546.6795 millilitres to litres. 0.5466795 How many millilitres are there in 3/5 of a litre? 600 What is 911124.3 centuries in years? 91112430 What is fourty-eight fifths of a tonne in kilograms? 9600 What is 11/2 of a litre in millilitres? 5500 Convert 0.5971838nm to millimeters. 0.0000005971838 What is fourty-two fifths of a meter in centimeters? 840 How many micrograms are there in 83162.76t? 83162760000000000 What is fifty-seven halves of a decade in years? 285 What is fifteen quarters of a litre in millilitres? 3750 How many nanograms are there in 662796.7 kilograms? 662796700000000000 What is nineteen quarters of a century in years? 475 Convert 96.23735 milliseconds to nanoseconds. 96237350 What is 0.0840074 millennia in decades? 8.40074 How many micrograms are there in six fifths of a milligram? 1200 Convert 23994.39um to nanometers. 23994390 What is twenty-nine halves of a litre in millilitres? 14500 What is one quarter of a litre in millilitres? 250 What is nine fourteenths of a week in minutes? 6480 How many months are there in fourty-three thirds of a century? 17200 How many milliseconds are there in 253282.3s? 253282300 How many litres are there in 437.0909ml? 0.4370909 What is 37/5 of a milligram in micrograms? 7400 What is 0.400759um in nanometers? 400.759 How many months are there in 27/5 of a century? 6480 How many seconds are there in 1/30 of a day? 2880 How many millilitres are there in 74/5 of a litre? 14800 How many microseconds are there in five eighths of a millisecond? 625 How many hours are there in 145242.3 minutes? 2420.705 What is 1/5 of a millennium in centuries? 2 How many nanograms are there in 9756.903 grams? 9756903000000 What is 85.2517 seconds in milliseconds? 85251.7 How many kilograms are there in 0.3677587mg? 0.0000003677587 What is 37/2 of a litre in millilitres? 18500 What is 9141.735 weeks in minutes? 92148688.8 What is three sixteenths of a week in minutes? 1890 What is 6/5 of a litre in millilitres? 1200 Convert 0.7856515 years to months. 9.427818 What is 43.24143 weeks in hours? 7264.56024 What is twenty-five halves of a kilometer in meters? 12500 What is 15/4 of a centimeter in micrometers? 37500 How many millilitres are there in twenty-seven fifths of a litre? 5400 What is 20806.87 hours in minutes? 1248412.2 Convert 349896.1m to kilometers. 349.8961 What is thirteen eighths of a decad	{ "pile_set_name": "DM Mathematics" }
7n(k). Let b(r) = -r2 + 4r + 4. Give -5b(s) - 6o(s). -s*2 - 2s + 10 Let n(x) = -x3 + x2. Let m = 24898 + -24892. Let o(j) = 3j3 - j2. Calculate mn(b) + 3o(b). 3b*3 + 3b*2 Let u(n) = -19n*3 + 3n*2 + 3n. Let y(r) = 11r2 + 19r*2 - 7r + 15r2 + r2 + 39r*3 - 53r*2. What is 14u(l) + 6y(l)? -32l*3 Let r(b) = -564b + 56. Let f(j) = -627j + 55. What is 6f(t) - 7r(t)? 186t - 62 Let d(r) = -1570r3 + 70r*2 + 770r. Let v(i) = -i3 - i2 - 11i. What is -3d(n) - 210v(n)? 4920n*3 Suppose -966 = -16z + 1866. Let j = -185 + z. Let r(w) = 4w3 + 15w*2 + 5w. Let n(g) = 6g3 + 22g*2 + 8g. Calculate jr(f) + 5n(f). -2f3 - 10f*2 Let z(p) = 2 + 259p - 21p2 + 240p - 497p. Let t(j) = 1196j*2 - 115j - 115. What is -2t(k) - 115z(k)? 23k2 Let b(u) = -928u*3 - 10u*2 - 5u + 10. Let q(g) = 928g3 + 8g*2 + 4g - 8. What is 4b(h) + 5q(h)? 928h3 Let n(w) be the second derivative of 17w3/6 - w2 - 282w. Suppose 5q = 4o + 3q - 16, 4o + 2q - 16 = 0. Let k(j) = 8j - 1. Give on(c) - 9k(c). -4c + 1 Let n(r) = -r*2 - 5. Let g = 1948 + -1950. Let c(b) = -4b*2 - 7b - 1. Let k(f) = f*2 + 2f + f - f. Let d(h) = -2c(h) - 7k(h). Give gn(w) - 5d(w). -3w2 Let n(a) = -2a*2 + 21a + 1. Let z(r) = 3r2 - 31r - 1. Suppose 2o - 12 = -1747i + 1745i, 0 = 2o + 4i - 10. Give on(d) + 5z(d). d2 - 8d + 2 Let t(x) = 21744x - 7. Let r(j) = -7256j + 2. Determine 10r(l) + 3t(l). -7328l - 1 Let s(f) be the first derivative of -9f*2/2 + f - 4. Let r(n) = 13n - 1. Suppose 161 = 15x + 236. Calculate xr(u) - 7s(u). -2u - 2 Let o(t) = -4t + 1. Let b(l) = 13 - 37 + 17 + 8 + l. Let p be -2 - 4(-15)/20. What is po(f) - b(f)? -5f Let t(a) = 7a - 8. Let h = 6252 - 6246. Let n(y) = 6y - 7. Give hn(k) - 5t(k). k - 2 Let x(z) = 6z3 - 11z*2 - 56z. Let p(b) = 2b3 + b2 + 2b. Determine -2p(n) + x(n). 2n*3 - 13n*2 - 60n Let c(b) be the third derivative of b5/20 - b4/4 - 10b3/3 - b2 - 178. Let t(x) = 4x*2 - 7x - 21. What is -6c(j) + 5t(j)? 2j2 + j + 15 Let f(o) = -4o + 2. Let d(i) = 48i - 62. Calculate d(y) + 8f(y). 16y - 46 Let l(o) = -261o*3 + 16o*2 + 7o - 5. Let k(c) = -262c3 + 19c*2 + 8c - 6. Determine 6k(a) - 7l(a). 255a3 + 2a*2 - a - 1 Let u(c) = 9c*2 - 28c + 56. Let r(f) = -10f2 + 24f - 55. Determine -7r(y) - 6u(y). 16y2 + 49 Let o(q) = -q + 1. Let p be ((-12)/(-20))/(2/10 + 0). Suppose -l - 3m = -3 + 56, pm = -3. Let b(w) = -10w*2 + 50w - 50. Give lo(g) - b(g). 10g*2 Let a(y) = 4y*2 - y - 1. Let l(o) = 20o*2 - 6o - 715. Calculate -6a(p) + l(p). -4p*2 - 709 Suppose 423 - 245 = 89l. Let q(o) be the second derivative of 30o - 1/2o*l + 0. Let p(u) = -2u*3 - 1. Calculate -p(k) + 4q(k). 2k3 - 3 Let x(r) = -r + 17. Let u(b) = -3b + 33. Determine 2u(z) - 5x(z). -z - 19 Let n(b) = -539375b2 + 539372b*2 - b - 4b. Let v(k) = 7k2 + 11k. Let j be -5(2 + 0 - 1). Determine jn(r) - 2v(r). r2 + 3r Let v(w) = 2w + 5. Let c(z) = -6z + 32. What is -c(o) + 4v(o)? 14o - 12 Let z(p) = -728p. Let b(d) = 181d. What is 22b(c) + 6z(c)? -386c Suppose 2y - 19 = 5v, v + 3v + 18 = 3y. Let t(f) = -7. Let u(i) = 20. Let l(k) = -3t(k) - u(k). Let a(s) = -11s - 3 + 4 + 8s. Calculate vl(x) + a(x). -3x - 2 Let t(x) = -2x - 65. Let n be t(-32). Let j(g) = -2g*2 + g - 3. Let c(q) = 8 + 13 + 12 - 2q*2 - 32 + 3q*2. Determine nj(a) - 3c(a). -a2 - a Let d(k) = -38k*3 + 9k*2 + 2219k - 1. Let s(l) = 23l3 - 5l*2 - 1109l + 1. Give 3d(u) + 5s(u). u*3 + 2u*2 + 1112u + 2 Let b(d) = d. Let g(f) = -10f + 1. Let j(a) = 18b(a) + 2g(a). Let t(o) = 3. Let w(y) = 8y - 2. Let s(i) = -2t(i) + w(i). What is 9j(u) + 2s(u)? -2u + 2 Let o(r) = 4r3 - 5r2 + 6. Let d = -11 + 9. Let j(u) be the second derivative of u5/10 - u*4/6 + 3u*2/2 + 777u. Determine do(n) + 5j(n). 2n3 + 3 Let n(c) = 7c - 509 - 512 + 2031 - 513 - 507 - 2c. Let l(v) = -9v + 19. Let f = -17 - -11. Calculate fl(s) - 11n(s). -s - 4 Let t(v) = -99v - 125. Let n(u) = 19u + 21. Give -23n(h) - 4t(h). -41h + 17 Let g(c) = -321c*2 + 7c - 15. Let p(n) = 158n2 - 3n + 7. Calculate -3g(b) - 7p(b). -143b2 - 4 Suppose -4h - 4 + 61 = 3s, 4s + 74 = 3h. Let p = -721 - -730. Let w(k) = -p + h - 15 - 9k. Let l(d) = -5d - 3. What is 5l(j) - 3w(j)? 2j + 3 Let v(u) = 43u3 - 5u*2 + 6u*2 + 2u*2 + 4 + 4u - 11u2 + 4u2. Let l(x) = x2 - x - 1. Determine 4l(r) + v(r). 43r*3 Let q(d) = -1403d. Let s(i) be the third derivative of 13i4/6 + 998i*2 - 2i + 3. Calculate 6q(b) + 161s(b). -46b Let v(n) = n + 4. Let p(b) = 236b + 467. Let c be p(-2). Let a(j) = -j - 5j + 3 + 5j - 11. Calculate cv(s) - 3a(s). -2s + 4 Let h(f) = -10810f - 1311. Let u(t) = -t - 19. Give -h(j) + 69u(j). 10741j Let r(x) = 12x - 185. Let t(y) = y - 16. Let m(z) = 3r(z) - 33t(z). Let w(s) = s - 14. Determine 2m(h) - 5w(h). h + 16 Let p(i) = -2i3 - i2 + 2i + 2. Let k(y) = -3y3 - y2 + 2y + 3. Suppose 547l = 588l - 164. Give lp(v) - 3k(v). v3 - v2 + 2v - 1 Let f(c) = -19c2 + 4c + 4. Let p(y) = -1196y2 + 253y + 253. Let q(w) = 568w - 3661. Let z be q(6). Calculate zf(b) + 4p(b). 23b2 Let k(h) = -h3 - 4h2 + 15h - 9. Let o(y) = y*3 + 8y*2 - 29y + 15. Determine 5k(a) + 3o(a). -2a3 + 4a*2 - 12a Let v(k) = -52k2 - 220k + 812. Let i(d) = 8d2 + 34d - 127. Determine 32i(s) + 5v(s). -4s2 - 12s - 4 Let v(r) = -r - 7. Let g be v(8). Let l be 4 - 15(-5)/g. Let o(i) = 1. Let b(f) = 7f*2 + 3. Give lb(y) + 3o(y). -7y*2 Let z(d) = 6d*3 - 72d*2 + 9d + 6. Let k(w) = 3w3 - 35w*2 + 5w + 3. Give -5k(l) + 3z(l). 3l3 - 41l*2 + 2l + 3 Let v(c) = -10091c3 + 3c*2 - 3c - 3. Let o(t) = 181632t3 - 55t*2 + 55t + 55. Calculate -3o(w) - 55v(w). 10109w3 Let x(j) = 40 + 22 - j2 + 27 - 88 - 3j + 4j. Let h(w) = -2w*2 - 1. Determine h(t) + x(t). -3t*2 + t Let t(o) = -6o*2 - o + 1. Let k be (-15)/(-18)-2 - 280/210. Let s(c) = 7c2 + c. What is ks(j) - 4t(j)? 3j*2 + j - 4 Let s(i) = -2i - 6. Let d(w) = 3w + 14. Let u(v) = 3d(v) + 7s(v). Let a(f) = f. Let p be 48/22 - 4/22. Suppose 2g - 4 + p = 0. Give gu(l) + 6a(l). l Let r(u) = 4u3 + 2u*2 - 14. Let p(f) = 225f*3 - 393f*3 + 3f*2 - 21 + 174f*3. Give -5p(t) + 8r(t). 2t3 + t2 - 7 Let w(m) = 295 - 512 - 3m2 - 13m*3 + 3m + 0m + 214. Suppose 6o - 4o + 6 = 0. Let f(d) = 38d*3 + 8d*2 - 8d + 8. Calculate of(n) - 8w(n). -10n3 Let i(d) = 29d*3 + 16d*2 + 92. Let n(j) = 18j*3 + 10j*2 + 61. Determine 5i(g) - 8n(g). g3 - 28 Let q(o) = -2o*2 + 4o - 16. Let s(a) = -2a + 11 + 20 + 65a*2 - a - 63a*2 - 15. Give 5q(v) + 6s(v). 2v*2 + 2v + 16 Let l(s) = -24s2 - 5s - 5. Suppose -4u + 6 + 86 = -3b, 3b = -12. Let y be (-10)/u(-10)/(-1). Let q(g) = 132g2 + 28g + 28. Give yq(n) - 28l(n). 12n2 Let x(y) = -39y*2 - 18y + 6. Let r(c) = -35c2 - 19c + 5. Determine 9r(h) - 8x(h). -3h2 - 27h - 3 Suppose 61l = 49l + 504. Let t be (-147)/l24/14. Let w(r) = -1 + 0 + 2r + 2r. Let j(c) = -4c + 1. Determine tw(i) - 5j(i). -4i + 1 Let p(g) = 84 - 11g + 75 + 88 - 261. Let t(w) = -7w - 9. Calculate -5p(v) + 8t(v). -v - 2 Let v(n) be the third derivative of -n5/30 + n4/12 - n3/2 - 5n*2. Let m = 18960 - 18967. Let z(c) = 6c*2 - 6c + 10. Determine mv(f) - 2z(f). 2f2 - 2f + 1 Suppose 4v = -4t + 320, 4t + 20v = 22v + 296. Let f be (t/8 - 9)2. Let s(p) = -p*2 + 0p + 0 - 1 + p. Let m(r) = 6r2 - r + 1. What is fs(x) + m(x)? 5x2 Let p(j) = 50j*3 + 10j*2 + 3j + 3. Let b(z) = -49z3 - 11z*2 - 4z - 4. Determine 4b(m) + 5p(m). 54m3 + 6m*2 - m - 1 Let n(g) = -4g + 7. Let w(h) = -9h + 13. Let t = 28501 - 28488. Give tn(j) - 6w(j). 2j + 13 Let c(h) = -6h2 + 3h + 8. Let n(z) = z*2 - 1. Calculate 2c(v) + 14n(v). 2v*2 + 6v + 2 Let k(r) = -8 - 3r - 5 + 13. Let m(b) = 6b + 1. Let a be (3/1)/(24/16). Determine am(g) + 5k(g). -3g + 2 Let y(h) = h2 + 140h + 1054. Let k be y(-8). Let c(m) = -2m*3 + 4	{ "pile_set_name": "DM Mathematics" }
11111? -110100000011100100 In base 6, what is 2005 + -4245042? -4243033 In base 3, what is -12201 - -1201000002210? 1200222220002 In base 12, what is -30581278 + 4? -30581274 In base 11, what is -16279399 - -5? -16279394 In base 16, what is 9 - -22aed8? 22aee1 In base 3, what is 1020221102 - 110020? 1020111012 In base 2, what is -1000101010000110011001010 - 1? -1000101010000110011001011 In base 4, what is 11 + 33232312300? 33232312311 In base 6, what is 255334 - -5303? 305041 In base 9, what is 1 - -7457546? 7457547 In base 6, what is 2235 + 11? 2250 In base 3, what is -12201000011101 - -12? -12201000011012 In base 16, what is -7e - -92ae8? 92a6a In base 14, what is -17 + -b63cb? -b6404 In base 16, what is 53f479e - 2? 53f479c In base 5, what is 11220222020 + 13? 11220222033 In base 6, what is 14010 + -41101? -23051 In base 5, what is -1 - 41142114243? -41142114244 In base 10, what is 115 + -182503? -182388 In base 12, what is 4 - -1955a741? 1955a745 In base 8, what is -465 + 57334? 56647 In base 2, what is 10011001011011011000 + -110111100? 10011001010100011100 In base 5, what is -1424 - -21020334? 21013410 In base 13, what is 414a + 10781? 148cb In base 2, what is 0 + 1101010101010110111001? 1101010101010110111001 In base 16, what is -2a6 + -8487d? -84b23 In base 8, what is 3110224 - -553? 3110777 In base 14, what is c5ba5 - 58a? c5619 In base 16, what is -1334 + -70b? -1a3f In base 3, what is 0 + -21110202012120120? -21110202012120120 In base 2, what is -1101010011100101 - -1101? -1101010011011000 In base 14, what is 2 - -189975c? 1899760 In base 12, what is -2149 + -a170? -102b9 In base 3, what is -112012120 - -100122? -111211221 In base 13, what is 556 + -43a7? -3b51 In base 11, what is -3 + 79a3613? 79a3610 In base 7, what is 114422 - -335? 115060 In base 16, what is 2f1 - -fafe5? fb2d6 In base 6, what is 2 + -1542430? -1542424 In base 12, what is -3 + -1164a961? -1164a964 In base 3, what is -1020101101 + -20? -1020101121 In base 8, what is 3174 + 13245? 16441 In base 9, what is 32687162 - 0? 32687162 In base 11, what is 5886336 - 2? 5886334 In base 14, what is 283 - 44612? -4436d In base 3, what is -1202 + 210120022100210? 210120022022001 In base 6, what is -14040223 + 2? -14040221 In base 4, what is -2101322 + 30003? -2011313 In base 16, what is 2ba72 + 1224? 2cc96 In base 6, what is 1203555111 - -10? 1203555121 In base 2, what is -11 - 110010101000001111111? -110010101000010000010 In base 14, what is 5 + ba1b9? ba1c0 In base 11, what is -a27 + -2263? -318a In base 2, what is 11001100011 - 10010110111110000? -10010011110001101 In base 12, what is -707b3 - 2637? -7322a In base 2, what is -1111000111110011 - 100110011? -1111001100100110 In base 4, what is -2121302302221 + 2? -2121302302213 In base 7, what is -4 + 52050564? 52050560 In base 5, what is 10113424333 + 141? 10113430024 In base 13, what is 89cc08 - 49? 89cb8c In base 12, what is 6 + 10b61a7? 10b61b1 In base 2, what is -1100111 - -1110110100011110? 1110110010110111 In base 14, what is 11923c7 + -4? 11923c3 In base 13, what is -11199b + 5b? -111940 In base 2, what is 1101001010 + -10001111100110010? -10001101111101000 In base 13, what is 69 - -9c1b1? 9c24a In base 14, what is 12c9d95 - 4? 12c9d91 In base 12, what is 5 - 2774102? -27740b9 In base 6, what is -20344422 - 4? -20344430 In base 2, what is 100100 - -100010100100000010101? 100010100100000111001 In base 8, what is 152433376 + 0? 152433376 In base 11, what is 8a1107 - -4? 8a1110 In base 3, what is 20011020022221 + 11210? 20011020111201 In base 4, what is -300213323 + 131? -300213132 In base 10, what is -10356683 + -5? -10356688 In base 13, what is 23a0a5 + -17? 23a08b In base 5, what is -10 - -412421222? 412421212 In base 12, what is b77224 - 71? b77173 In base 10, what is -3 + -2896180? -2896183 In base 5, what is 303104332104 + 4? 303104332113 In base 15, what is b8ec74 - 5? b8ec6e In base 5, what is -10 - -312333010? 312333000 In base 11, what is 73 + -5563236? -5563173 In base 2, what is 1001000100010111010010 + 1000? 1001000100010111011010 In base 7, what is 301504062 + -3? 301504056 In base 5, what is -1231043303 + -2? -1231043310 In base 4, what is -10 - -3221220323? 3221220313 In base 14, what is c15 + -3044? -222d In base 10, what is -1212682 - -5? -1212677 In base 14, what is -4371c52a - -3? -4371c527 In base 15, what is -61 - 56974? -569d5 In base 2, what is 11000001101001111100 + 110? 11000001101010000010 In base 15, what is -2 + -333d7c? -333d7e In base 16, what is 5925660 - 4? 592565c In base 4, what is -13032000332 - 13? -13032001011 In base 15, what is 8a + c71ce? c7269 In base 13, what is a04648 + -26? a04622 In base 13, what is -292888 - -45? -292843 In base 16, what is -2716 + 1515? -1201 In base 13, what is 16c670a - 81? 16c6659 In base 6, what is 5 + 205550221? 205550230 In base 6, what is -132201 + -11433? -144034 In base 7, what is -12 - -463012426? 463012414 In base 4, what is 22 + 20310231231? 20310231313 In base 9, what is -570 - -3361574? 3361004 In base 14, what is -4503a38 - 1? -4503a39 In base 3, what is -110222120221 + 100212? -110222020002 In base 8, what is -2251 + -505351? -507622 In base 8, what is -422102 + 414? -421466 In base 14, what is 1 + -10c1ba07? -10c1ba06 In base 12, what is 8 + 438922? 43892a In base 10, what is 224 + -167? 57 In base 5, what is -230111 - -41343? -133213 In base 7, what is -2343 + -234404? -240050 In base 4, what is 112101 + 1112331? 1231032 In base 6, what is 30245 - 23253? 2552 In base 6, what is 11311104441 + -1? 11311104440 In base 6, what is 105411 - 1535451? -1430040 In base 6, what is -111423 - 1250? -113113 In base 15, what is 36e + -1696? -1327 In base 15, what is -83237 - -2e? -83208 In base 12, what is -135a3 - -31a6? -103b9 In base 11, what is 39a - -5350? 573a In base 8, what is -7467 + 23775? 14306 In base 3, what is -120021020222110 - -12? -120021020222021 In base 3, what is 11122022000210000 + 21? 11122022000210021 In base 8, what is 3 + 22160510? 22160513 In base 2, what is -111010011110010010111000 + -1? -111010011110010010111001 In base 16, what is 5c7 + -1397? -dd0 In base 14, what is 48a251 + 2d? 48a280 In base 12, what is -863b983 - 4? -863b987 In base 2, what is -1100010000010100011 - -1100100000? -1100001110110000011 In base 9, what is 3 - 24136131? -24136127 In base 12, what is -4779a20 + 24? -47799b8 In base 4, what is -302122030213 + 132? -302122030021 In base 3, what is -11 + -2202000120112102? -2202000120112120 In base 14, what is 4950 - -183d? 638d In base 12, what is -198a61 - 587? -199428 In base 10, what is -15575 + -1169? -16744 In base 14, what is 21a50954 - -2? 21a50956 In base 8, what is -3 - 2104365? -2104370 In base 15, what is 41562 + 84? 415e6 In base 6, what is 22254453 - -3243? 22302140 In base 6, what is 125424004420 - 5? 125424004411 In base 3, what is 102022211 - 11021? 102011120 In base 7, what is 40050520331 - -5? 40050520336 In base 14, what is b738d1c7 + -1? b738d1c6 In base 14, what is 69c7 - 19? 69ac In base 14, what is d2425b - 36? d24225 In base 16, what is -7 - -1fe0cf? 1fe0c8 In base 11, what is 3 + -4157a10? -4157a08 In base 7, what is 111550622 + -11? 111550611 In base 5, what is 1143142223 + -1333? 1143140340 In base 3, what is -20 + 20220101020022001? 20220101020021211 In base 10, what is -7306603 + -1? -7306604 In base 6, what is 12113225 - -203? 12113432 In base 15, what is 594db - -20? 5950b In base 16, what is 8071f - 42a? 802f5 In base 3, what is -2022 + 122211012020122? 122211012011100 In base 15, what is 24 - 20425d? -204239 In base 14, what is -4 + -261261? -261265 In base 10, what is 5428629 + -20? 5428609 In base 5, what is 404442 - 314322? 40120 In base 7, what is -30404312 - -4? -30404305 In base 8, what is -1037 + 103155? 102116 In base 6, what is -4 + 341502330? 341502322 In base 6, what is -4313303113 + -1? -4313303114 In base 13, what is -1bc036 - -89? -1bbc7a In base 7, what is -3 - 201651664? -201652000 In base 4, what is 10013220 + 31310122? 101330002 In base 16, what is -7 - 240add? -240ae4 In base 2, what is -10111110110 - -101001? -10111001101 In base 7, what is 223352612 - -3? 223352615 In base 11, what is 137 + -2112747? -2112610 In base 4, what is -33 + -11310022323? -113	{ "pile_set_name": "DM Mathematics" }
- 20 = 5i - 5q, -i - 5q = q + 35 for i. -5 Solve 2b + 36071 = 4o + 36099, -4o - 8b + 12 = 0 for o. -5 Solve -2c = -2d, 2c - 46 = d - 44 for c. 2 Solve -o + 3b = -14597 + 14612, -2o + 14 = 5b for o. -3 Solve -4w - 12 = 0, -8n - 2 - 1 = 3w + 6 for n. 0 Solve -3i = -5n + 14, 56n - 53n + 9 = -4i for n. 1 Solve -132 = 3f - 5x, 16586 - 16394 = -5f - x for f. -39 Solve -3h - c = 10 + 5, -c - 7 = -47h + 48h for h. -4 Solve -5d + 24 = -4w + 2w, 27d - 28d = -4w - 30 for d. 2 Solve 4g = 2s + 46, 4g - 119 = s - 70 for g. 13 Solve -43o = -48o - 27 - 31 - 2, 2o = -u - 25 for u. -1 Solve -5n = -2m - 6, 38m - 33m + 15 = 5n for m. -3 Solve 0 = -12v + 270p - 272p + 218, p - 19 = -v for v. 18 Solve -597j + a = -596j + 4, j + a = -6 for j. -5 Solve 13z - 107 - 79 = -3i, 0 = 4i + 2z - 18 for i. -3 Solve y + 4 = -2n, 2807n - 2809n = 5y + 20 for y. -4 Solve 5m = -17n + 272 - 454, -3n - 36 = -3m for m. 1 Solve -4s = 4y - 32, -3s - 159y = -162y + 30 for s. -1 Solve -1219p = -1215p - 5f - 51, -2f = -14p + 17p - 21 for p. 9 Solve -2d = -3t - 19, -5d + 10t = 15t - 60 for d. 11 Solve o - 1 = -4i, 23i + o + 4 = 24 for i. 1 Solve 8 = -2l - 75a + 74a, -10 = -l + 3a for l. -2 Solve 8z = 10z + 4i - 24, 2i = -5z + 20 for z. 2 Solve -5k - 2y = -37, -45 = -3y - 27 for k. 5 Solve -3x - 64 = 4n, 541 - 561 = x + n for x. -16 Solve 2 = -2l - 5u, 3l + 20u - 22u = 16 for l. 4 Solve 39b - 34b + 25 = 0, 5m + 10 = -2b for m. 0 Solve -2l - 5f - 7 = 0, 4f = 321l - 324l for l. 4 Solve -4m - 3i = 61 - 37, 10i = -120 for m. 3 Solve 4f + 14 = 5o, 7173o + 5f = 7169o - 38 for o. -2 Solve -55m = -57m + 4o + 2, -7m + 19 = -2o for m. 3 Solve -4x = -j + 28, -5j + 3188 - 3192 = -2x for j. -4 Solve -4i + k - 8 = -0k, -2i + 2k - 10 = 0 for i. -1 Solve -30763n - 36 = -5z - 30765n, z = -5n - 2 for z. 8 Solve z + 15 = -782h + 778h, -5z = -4h + 3 for z. -3 Solve 45m + 30 = 40m - 5t, 2m + 12 = -5t for m. -6 Solve -2j - 94 = -4d - 100, 4j - d = 12 for j. 3 Solve -y - 34x + 30x = -16, 4y - 13 = x for y. 4 Solve -3b - 2s - 3 = 0, 0 = b - 5s + 867 + 873 - 1739 for b. -1 Solve 4g + v + 3 = 0, 0 = -g + 12v - 16v - 12 for g. 0 Solve -3m = -5y + 23, 4m + 6 + 14 = 4y for m. -1 Solve 201 - 211 = 2n - 3a, 4a + 10 = -2n for n. -5 Solve 5h = -9r + 133, -48r + 80 = -43r + 4h for r. 12 Solve 0 = 6p + 18, -5p + 12p + 2 = 2x - 31 for x. 6 Solve -27s = 4h - 22s - 5, h + 3 = 3s for h. 0 Solve -3b = 2a + 2, 0 = -a - 5b + 155 - 170 for a. 5 Solve 5x = 3a - 6, -3x - 292 = x + a - 311 for x. 3 Solve 4944v - 9 = 3z + 4941v, z + 2v + 3 = 0 for z. -3 Solve 2g + 255q + 83 = 226q, -5g = 2q - 4 for g. 2 Solve 18q + 0b + 4b - 26 = 15q, 2b = 4 for q. 6 Solve -4g = z - 7, -2z - 3g + 5g = -4 for z. 3 Solve -h + 0h - 15 = -2q, -2q + 59 = -5h for h. -11 Solve -3a = 112j - 111j + 18, 2a + 1 = 3j for j. -3 Solve 5t + 3u = -9, -5t - 13 = -2u + 3u for t. -3 Solve 3d + 16q - 37 = 21q, 0 = q - 4q - 15 for d. 4 Solve 0 = 5a + 5q + 25, 3a + q + 57 - 42 = 0 for a. -5 Solve -5o + 32 = g, 103g - 208g + 21 = -102g for o. 5 Solve -5d = -i - 30, 8515d + i - 103 = 8501d for d. 7 Solve 0 = -m + 2n + 2 + 2, 0 = -59n + 63n + 8 for m. 0 Solve 316 = -4n - 4d + 288, 5n + 2d = -26 for n. -4 Solve -4n = 4o - 28, 57743 = -5n + 3o + 57770 for n. 6 Solve b - 1 = g, -2b - 40 = 11g - 16 for b. -1 Solve 0 = 2p + 2b - 4, 3683p - b + 18 = 3688p for p. 4 Solve 3u - 4u - 58f - 11 = -57f, 4f + 32 = 0 for u. -3 Solve 0 = 2u - 3o + 1, -2u + 841 = 2o + 857 for u. -5 Solve 296c - 145c = 148c + k - 12, -5k - 30 = 3c for c. -5 Solve 4y + 1225 = -2w + 1197, 0 = -5y + 3w - 13 for y. -5 Solve -31 = -2y - 5s, 7y - 2s = 1636 - 1625 for y. 3 Solve a - 40h + 7 = -38h, 38 = -4a - 2h for a. -9 Solve -15 = 3t - 3c - 54, -189 = -t + 17c for t. 2 Solve -3r + 3h = 15, 1965r = 1966r + 5h + 5 for r. -5 Solve 5t + 77 = -6i + 82, -t = 3i - 1 for i. 0 Solve -4j - 4k - 55 = -63, 2k = j - 5 for j. 3 Solve -15 = -5b - 2j, -10146j = -4b - 10149j + 12 for b. 3 Solve i + q - 26 = -6, -4q + 17 = i for i. 21 Solve -11366w - 3o + 18 = -11363w, -18w = -4o - 20 for w. 2 Solve -2d = -2f + 10, 5d + 19 = 3d + 5f for d. -2 Solve 0 = -4j + 5v + 14, 155j + 3v + 9 = 158j for j. 1 Solve -m + 30 = -205o + 201o, 0 = 4m - 8 - 0 for o. -7 Solve -4r + 5i = 24, -5r - 239i - 9 = -1019 + 59 for r. -1 Solve 20 = 4a, z + 2283a = 2288a - 21 for z. 4 Solve -37d - 2k + 5 = -34d, 4d + 3k = 7 for d. 1 Solve -1378s = 5u - 1384s + 12, 5s - 10 = -3u for u. 0 Solve -2n = -4q - 13365 + 13375, -3q = -2n - 6 for q. 4 Solve 4r - 84 = -4d, -1522d - 123 = -1527d + r for d. 24 Solve 4g + 5 = -2p - 3, 7 + 11 = -9p for g. -1 Solve z - 2a - 10293 = -10281, 3a + 25 = 5z for z. 2 Solve -380o + 378o + 5d = d + 14, -o - 5d = 0 for o. -5 Solve 1399o + h + h = 1400o - 8, 4h + 4 = 0 for o. 6 Solve 11n - 6n + 5 = 0, 3n + 3 = -6s for s. 0 Solve l + 3b + 4 = 0, 5l + 26b - 16 = 23b for l. 5 Solve 56 = -4w + 4t, 4w = 3t - 376 + 315 for w. -19 Solve 2x - 114 = -4n - 120, 5n - 6x - 35 = 0 for n. 1 Solve 37q - 25 = 32q + 5f, 5q - 4f = 17 for q. -3 Solve 5v - 85 + 34 = -2a, -2v - 5a = -33 for v. 9 Solve -g - 13 = -4k, -7g = 4g + 5k - 102 for g. 7 Solve 2n - 3b - 21 = -4n, 4n - 5b - 5 = 0 for n. 5 Solve -2947r + 2948r - 14 = 5a, 5a - 2 = -3r for a. -2 Solve 4m - 3u = -5, 115m - 114m - 4 = -u for m. 1 Solve 9y + 8 = 7y, 3i = -4y - 4 for i. 4 Solve 4g - 12412 = 3q - 12405, -3q - 4g + 1 = 0 for q. -1 Solve w = 5t - 7, -4w - 85 + 57 = -3t for t. 0 Solve -5h - 4b = 24, 8h + 2b - 98 = -132 for h. -4 Solve -170o + 23 = -l - 184o, l - 4o = -41 for l. -37 Solve -4o + 2q = 4, 385o + 10 = 381o - q for o. -2 Solve 2i - 3d + 76 = 0, -420i + 54 = -423i + 2d for i. -2 Solve -6s - 10 = -7s - p, 60 = -5s + 6p for s. 0 Solve 1 = 2s - 5l, -l - 2219 = -2220 for s. 3 Solve g = -z + 10, 3z = 4z - 5g + 201 - 157 for z. 1 Solve 2a + 4f - 34 = 0, 44f - 150 = 4a + 94 for a. 5 Solve 528y - 527y + 2 = 0, 3j + 3y = -21 for j. -5 Solve 0 = -614u + 619u + x + 3, -4u = -2x + 8 for u. -1 Solve 4a + 2 = 7k, 4k - 14 = -2738a + 2736a for a. 3 Solve -42p + 20p = -17p - 20, 2h - 20 = -3p for h. 4 Solve 0 = -5z - i + 19, z - 748i = -1502i + 750i for z. 4 Solve -2s + 3 = -r, 0 = -8s - 63r + 58r + 21 for s. 2 Solve -z - k = -10, 10445k = 3z + 10441k - 2 for z. 6 Solve 4o = 5w - 155 + 153, -3o + 3w = 0 for o. 2 Solve -4r + 2i = 22, 4i - 126 = -2r - 132 for r. -5 Solve 5u + 311m - 313m + 9 = 0, 4u + 31 = 5m for u. 1 Solve -4i - 16 = -4d, -1945i - 10 = -d - 1950i for d. 5 Solve 155h = 150h - 3b + 92, 0 = -2h + 3b + 41 for h. 19 Solve 2f + 2z = -39 + 45, 0 = 3f + 2z - 7 for f. 1 Solve 0 = -4k + 16, -u + 85k = 83k + 3 for u. 5 Solve 3f + 294a - 296a - 5 = 0, -5f + 5a = 0 for f. 5 Solve -4k = -4, 10k = -153m + 154m + 14 for m. -4 Solve 11s + 22 = 12s - 2d, 3d + 33 = -4s for s. 0 Solve l + q = -5, -137q - 20 = -6l - 133q for l. 0 Solve -10 = 2g + 3h, 104g - 101g + 12 = -3h for g. -2 Solve 5m + 5o - 6o = 6, 5m - 14 = -o for m. 2 Solve -4n - 78o + 76o = -14, 0 = 3n + 2o - 11 for n. 3 Solve -5y + 56 = 4u, 139y = -5u + 134y + 60 for u. 4 Solve 0 = -3j + 2n + 1, 543j - 539j + 36 = -2n for j. -5 Solve 0 = -4s + d + 23, -29 = -2s + 2d - 13 for s. 5 Solve -3l + 0 = -15, -4x + 15 = -l for x. 5 Solve -20s + 22s = -4d - 22, d - 22 = 5s for s. -5 Solve i - 10t + 13t = 10, 0 = -i + 4t - 25 for i. -5 Solve -3q + 0q + 19 = -4x, -q + 2 = 3x for q. 5 Solve 2f = 2s + 2, 71f - 69f - 2 = 55s for f. 1 Solve 0 = 14x - 13x + 5z - 27, z - 3 = x for x. 2 Solve 5p - 20 = 0, -3p + 141 = -2y + 133 for y. 2 Solve -3n = -13c + 1, -169n + 172n - 13 = -c for n. 4 Solve 2h = y + h, -20 - 16 = -2y + 11h for y. -4 Solve -u - 5n - 30 = 0, -394n + 10 = 3u - 399n for u. -5 Solve 2n + 10488 - 10517 = 3g, -4n + 38 = -2g for g. -5 Solve 2 = -f, i - 5f - 14 = -0i for i. 4 Solve 2*x = -5	{ "pile_set_name": "DM Mathematics" }
undreds digit of 78442? 4 What is the thousands digit of 9984? 9 What is the units digit of 1711? 1 What is the hundreds digit of 5454? 4 What is the tens digit of 24216? 1 What is the units digit of 61869? 9 What is the units digit of 11204? 4 What is the tens digit of 3202? 0 What is the tens digit of 3922? 2 What is the thousands digit of 1599? 1 What is the units digit of 946? 6 What is the hundreds digit of 395? 3 What is the hundreds digit of 6613? 6 What is the hundred thousands digit of 118370? 1 What is the hundreds digit of 458? 4 What is the hundreds digit of 116311? 3 What is the units digit of 10675? 5 What is the hundreds digit of 9596? 5 What is the units digit of 980? 0 What is the tens digit of 185? 8 What is the units digit of 951? 1 What is the tens digit of 33793? 9 What is the thousands digit of 1644? 1 What is the units digit of 506? 6 What is the hundreds digit of 908? 9 What is the units digit of 3454? 4 What is the units digit of 171? 1 What is the hundreds digit of 10425? 4 What is the tens digit of 460? 6 What is the units digit of 6612? 2 What is the hundreds digit of 8075? 0 What is the units digit of 554? 4 What is the units digit of 79809? 9 What is the tens digit of 1494? 9 What is the hundreds digit of 211? 2 What is the units digit of 5858? 8 What is the thousands digit of 10999? 0 What is the units digit of 8253? 3 What is the tens digit of 1982? 8 What is the thousands digit of 4782? 4 What is the hundreds digit of 30811? 8 What is the hundreds digit of 5070? 0 What is the hundreds digit of 4591? 5 What is the tens digit of 37550? 5 What is the thousands digit of 29557? 9 What is the thousands digit of 1780? 1 What is the units digit of 5594? 4 What is the units digit of 1812? 2 What is the tens digit of 1877? 7 What is the tens digit of 314? 1 What is the units digit of 36884? 4 What is the units digit of 1662? 2 What is the ten thousands digit of 14581? 1 What is the tens digit of 863? 6 What is the tens digit of 9571? 7 What is the tens digit of 9106? 0 What is the thousands digit of 6247? 6 What is the units digit of 3720? 0 What is the ten thousands digit of 19209? 1 What is the units digit of 9901? 1 What is the tens digit of 1682? 8 What is the tens digit of 15221? 2 What is the tens digit of 1523? 2 What is the hundreds digit of 1470? 4 What is the hundred thousands digit of 137771? 1 What is the thousands digit of 1202? 1 What is the units digit of 1502? 2 What is the units digit of 8593? 3 What is the hundreds digit of 2885? 8 What is the units digit of 577? 7 What is the ten thousands digit of 20121? 2 What is the units digit of 802? 2 What is the units digit of 1902? 2 What is the units digit of 559? 9 What is the units digit of 441? 1 What is the hundreds digit of 4708? 7 What is the hundred thousands digit of 131522? 1 What is the units digit of 95153? 3 What is the tens digit of 15470? 7 What is the units digit of 10973? 3 What is the tens digit of 1021? 2 What is the ten thousands digit of 18461? 1 What is the units digit of 450? 0 What is the ten thousands digit of 43592? 4 What is the units digit of 620? 0 What is the units digit of 543? 3 What is the tens digit of 473? 7 What is the units digit of 5502? 2 What is the hundreds digit of 5560? 5 What is the thousands digit of 1078? 1 What is the units digit of 56776? 6 What is the thousands digit of 2391? 2 What is the hundreds digit of 150449? 4 What is the thousands digit of 2511? 2 What is the hundreds digit of 6861? 8 What is the tens digit of 1447? 4 What is the hundreds digit of 802? 8 What is the units digit of 78094? 4 What is the thousands digit of 2890? 2 What is the thousands digit of 21473? 1 What is the hundreds digit of 2090? 0 What is the thousands digit of 3646? 3 What is the tens digit of 44289? 8 What is the thousands digit of 20734? 0 What is the hundreds digit of 40831? 8 What is the tens digit of 74099? 9 What is the hundreds digit of 1069? 0 What is the units digit of 497? 7 What is the tens digit of 9810? 1 What is the tens digit of 420? 2 What is the thousands digit of 18243? 8 What is the hundreds digit of 48564? 5 What is the units digit of 5864? 4 What is the tens digit of 66785? 8 What is the hundreds digit of 6508? 5 What is the ten thousands digit of 16542? 1 What is the tens digit of 1314? 1 What is the hundreds digit of 585? 5 What is the tens digit of 4684? 8 What is the ten thousands digit of 35616? 3 What is the tens digit of 1129? 2 What is the ten thousands digit of 15204? 1 What is the units digit of 14947? 7 What is the hundreds digit of 6892? 8 What is the hundreds digit of 16747? 7 What is the tens digit of 2030? 3 What is the tens digit of 1550? 5 What is the tens digit of 4416? 1 What is the units digit of 421? 1 What is the thousands digit of 18489? 8 What is the hundreds digit of 940? 9 What is the ten thousands digit of 32889? 3 What is the tens digit of 4396? 9 What is the tens digit of 22691? 9 What is the hundreds digit of 22267? 2 What is the units digit of 298? 8 What is the tens digit of 545? 4 What is the tens digit of 1083? 8 What is the thousands digit of 6457? 6 What is the tens digit of 9821? 2 What is the units digit of 62838? 8 What is the hundreds digit of 2120? 1 What is the tens digit of 394? 9 What is the units digit of 1136? 6 What is the hundreds digit of 346? 3 What is the hundreds digit of 99793? 7 What is the hundreds digit of 5294? 2 What is the units digit of 471? 1 What is the tens digit of 757? 5 What is the units digit of 16450? 0 What is the hundreds digit of 14651? 6 What is the units digit of 18179? 9 What is the hundreds digit of 23109? 1 What is the tens digit of 8871? 7 What is the units digit of 76678? 8 What is the units digit of 28691? 1 What is the thousands digit of 1076? 1 What is the tens digit of 26343? 4 What is the thousands digit of 20643? 0 What is the tens digit of 2313? 1 What is the hundred thousands digit of 158345? 1 What is the hundreds digit of 100607? 6 What is the tens digit of 1906? 0 What is the thousands digit of 2047? 2 What is the tens digit of 12694? 9 What is the units digit of 1209? 9 What is the units digit of 923? 3 What is the hundred thousands digit of 108144? 1 What is the hundreds digit of 888? 8 What is the ten thousands digit of 11249? 1 What is the tens digit of 1972? 7 What is the hundreds digit of 2976? 9 What is the hundreds digit of 19079? 0 What is the hundreds digit of 1724? 7 What is the ten thousands digit of 36130? 3 What is the thousands digit of 38647? 8 What is the hundreds digit of 67894? 8 What is the thousands digit of 19591? 9 What is the thousands digit of 2022? 2 What is the units digit of 22645? 5 What is the units digit of 3372? 2 What is the units digit of 922? 2 What is the tens digit of 4065? 6 What is the hundreds digit of 587? 5 What is the tens digit of 2397? 9 What is the units digit of 9? 9 What is the tens digit of 2898? 9 What is the thousands digit of 16967? 6 What is the ten thousands digit of 34320? 3 What is the hundreds digit of 8194? 1 What is the ten thousands digit of 10889? 1 What is the thousands digit of 3034? 3 What is the hundreds digit of 1237? 2 What is the ten thousands digit of 58257? 5 What is the units digit of 67981? 1 What is the tens digit of 28? 2 What is the thousands digit of 11806? 1 What is the units digit of 274? 4 What is the hundreds digit of 186? 1 What is the thousands digit of 35485? 5 What is the hundreds digit of 163? 1 What is the hundreds digit of 4443? 4 What is the tens digit of 1702? 0 What is the tens digit of 389? 8 What is the ten thousands digit of 58284? 5 What is the tens digit of 4166? 6 What is the units digit of 101659? 9 What is the units digit of 114678? 8 What is the hundreds digit of 7628? 6 What is the tens digit of 41005? 0 What is the hundreds digit of 1275? 2 What is the hundreds digit of 163? 1 What is the hundreds digit of 31127? 1 What is the ten thousands digit of 32821? 3 What is the units digit of 24165? 5 What is the hundreds digit of 1069? 0 What is the hundreds digit of 1401? 4 What is the tens digit of 927? 2 What is the tens digit of 21751? 5 What is the tens digit of 10090? 9 What is the hundreds digit of 175476? 4 What is th	{ "pile_set_name": "DM Mathematics" }
27 What are the prime factors of 710580924? 2, 3, 19, 115429 What are the prime factors of 57935352? 2, 3, 2413973 List the prime factors of 165954592. 2, 5186081 What are the prime factors of 96866527? 17, 5698031 List the prime factors of 32695982. 2, 11, 1486181 What are the prime factors of 13545846? 2, 3, 53, 4733 List the prime factors of 791847377. 359, 2205703 List the prime factors of 2869180493. 53, 449, 120569 What are the prime factors of 83398912? 2, 325777 What are the prime factors of 968094? 2, 3, 53783 List the prime factors of 32359660. 2, 5, 19, 31, 41, 67 List the prime factors of 48901147. 59, 828833 What are the prime factors of 2384921431? 103, 1049, 22073 What are the prime factors of 3439701? 3, 382189 What are the prime factors of 21966301? 7, 127, 24709 What are the prime factors of 378169689? 3, 126056563 List the prime factors of 113888327. 7, 31, 524831 List the prime factors of 11072927. 11072927 List the prime factors of 13174216. 2, 11, 23, 283 List the prime factors of 66806767. 31, 2155057 What are the prime factors of 29713806? 2, 3, 29, 56923 What are the prime factors of 25902495? 3, 5, 575611 List the prime factors of 50965368. 2, 3, 2123557 List the prime factors of 108919852. 2, 27229963 List the prime factors of 2585231749. 1361, 1899509 List the prime factors of 3413070581. 29, 31, 47, 80777 What are the prime factors of 579633311? 347, 1670413 List the prime factors of 123738049. 123738049 List the prime factors of 1396227631. 31, 45039601 List the prime factors of 28763744. 2, 898867 List the prime factors of 9078683. 9078683 List the prime factors of 11237117. 11237117 List the prime factors of 555266998. 2, 11, 13, 43, 163, 277 What are the prime factors of 79196703? 3, 59, 447439 What are the prime factors of 54704120? 2, 5, 23, 97, 613 What are the prime factors of 314230795? 5, 79, 379, 2099 List the prime factors of 482043308. 2, 120510827 What are the prime factors of 159043902? 2, 3, 26507317 List the prime factors of 58333424. 2, 73, 49943 What are the prime factors of 48372917? 19, 47, 2851 What are the prime factors of 103739611? 149, 696239 What are the prime factors of 1426071216? 2, 3, 683, 43499 What are the prime factors of 31706592? 2, 3, 19, 17383 List the prime factors of 25365240. 2, 3, 5, 70459 List the prime factors of 201394998. 2, 3, 7, 2819 What are the prime factors of 58642990? 2, 5, 7, 89, 9413 What are the prime factors of 781284414? 2, 3, 2617, 49757 What are the prime factors of 142955383? 37, 433, 8923 List the prime factors of 208126828. 2, 7, 13, 571777 List the prime factors of 71122593. 3, 23707531 List the prime factors of 164440249. 5923, 27763 What are the prime factors of 3783025639? 113, 1321, 25343 What are the prime factors of 976836125? 5, 7814689 What are the prime factors of 215720956? 2, 11, 17, 23, 12539 What are the prime factors of 1420832742? 2, 3, 7, 33829351 List the prime factors of 96875118. 2, 3, 5381951 List the prime factors of 136991312. 2, 23, 191, 1949 What are the prime factors of 1810357082? 2, 1789, 505969 List the prime factors of 873333293. 7, 1223, 102013 What are the prime factors of 640445884? 2, 13, 12316267 What are the prime factors of 49130401? 49130401 List the prime factors of 357068314. 2, 53, 3368569 List the prime factors of 176121991. 176121991 What are the prime factors of 306545858? 2, 311, 492839 What are the prime factors of 8810287? 29, 303803 List the prime factors of 6303114545. 5, 7, 13, 263, 52673 What are the prime factors of 60664487? 13, 4666499 List the prime factors of 153412750. 2, 5, 613651 List the prime factors of 166792325. 5, 7, 53, 367 What are the prime factors of 165752893? 29, 5715617 What are the prime factors of 227105431? 7, 17, 1908449 What are the prime factors of 89324055? 3, 5, 1984979 What are the prime factors of 3622587069? 3, 17, 71031119 What are the prime factors of 96878579? 7, 13839797 What are the prime factors of 87304078? 2, 17, 2567767 List the prime factors of 406986330. 2, 3, 5, 1433, 9467 List the prime factors of 5089938578. 2, 73, 3187, 10939 List the prime factors of 305857117. 19, 53, 303731 List the prime factors of 155526233. 155526233 List the prime factors of 8424874. 2, 4212437 List the prime factors of 84459395. 5, 16891879 What are the prime factors of 2335250058? 2, 3, 6367, 61129 List the prime factors of 27992665. 5, 5598533 What are the prime factors of 73958869? 23, 3215603 What are the prime factors of 116283958? 2, 7, 743, 1597 What are the prime factors of 137112856? 2, 41, 418027 List the prime factors of 4867830202. 2, 191, 977, 13043 What are the prime factors of 6215681? 23, 53, 5099 What are the prime factors of 2394629244? 2, 3, 7, 401, 2633 List the prime factors of 39110858. 2, 1009, 19381 What are the prime factors of 663704494? 2, 151, 2197697 List the prime factors of 178959113. 23, 338297 List the prime factors of 481726745. 5, 353, 272933 What are the prime factors of 79782470? 2, 5, 7978247 List the prime factors of 33470689. 7, 4781527 What are the prime factors of 247018829? 19, 61, 213131 What are the prime factors of 289634518? 2, 19, 7621961 List the prime factors of 8242724348. 2, 2060681087 What are the prime factors of 808251185? 5, 7, 1993, 11587 List the prime factors of 1011709242. 2, 3, 31, 397, 4567 List the prime factors of 6003497. 6003497 What are the prime factors of 365808991? 167, 2190473 List the prime factors of 764902421. 23, 1409, 23603 List the prime factors of 70468746. 2, 3, 263, 44657 List the prime factors of 111086317. 111086317 List the prime factors of 2440891266. 2, 3, 11, 1823, 20287 List the prime factors of 995879709. 3, 11, 41, 107, 2293 List the prime factors of 90470348. 2, 97, 431, 541 List the prime factors of 1368495361. 167, 8194583 List the prime factors of 95380630. 2, 5, 1117, 8539 List the prime factors of 19583775. 3, 5, 19, 509 List the prime factors of 129360258. 2, 3, 7186681 What are the prime factors of 24808240? 2, 5, 53, 5851 List the prime factors of 29261881. 11, 19, 140009 List the prime factors of 9279279470. 2, 5, 19, 48838313 What are the prime factors of 3134508586? 2, 11, 17, 23, 364393 What are the prime factors of 434591355? 3, 5, 11, 71, 37097 What are the prime factors of 358648067? 37, 2917, 3323 List the prime factors of 1344864. 2, 3, 14009 List the prime factors of 1033994452. 2, 37, 6986449 List the prime factors of 758475129. 3, 79, 3200317 What are the prime factors of 4970271? 3, 131, 12647 What are the prime factors of 415842015? 3, 5, 17, 941, 1733 What are the prime factors of 23391593? 23391593 List the prime factors of 120671065. 5, 31, 778523 What are the prime factors of 411664048? 2, 29, 157, 5651 What are the prime factors of 71103493? 3907, 18199 What are the prime factors of 1789738202? 2, 7, 89, 1436387 What are the prime factors of 43706514? 2, 3, 7284419 What are the prime factors of 929923239? 3, 7, 17, 1601, 1627 List the prime factors of 71970254. 2, 37, 47, 20693 List the prime factors of 1409947055. 5, 11, 2330491 List the prime factors of 496831939. 17359, 28621 List the prime factors of 5488918805. 5, 89, 739, 16691 List the prime factors of 1596725373. 3, 532241791 List the prime factors of 2811564029. 37, 75988217 List the prime factors of 3510532830. 2, 3, 5, 7, 2861, 5843 What are the prime factors of 2083812006? 2, 3, 23, 97, 155671 List the prime factors of 2390870719. 19, 6581, 19121 What are the prime factors of 86652519? 3, 17, 1699069 What are the prime factors of 4198479? 3, 1399493 What are the prime factors of 11418992? 2, 13, 41, 103 What are the prime factors of 48705375? 3, 5, 23, 5647 List the prime factors of 376224351. 3, 191, 656587 What are the prime factors of 1669608234? 2, 3, 7, 4416953 List the prime factors of 240823646. 2, 7, 97, 177337 What are the prime factors of 5080146? 2, 3, 41, 107, 193 What are the prime factors of 52456227? 3, 599, 29191 List the prime factors of 757655865. 3, 5, 16836797 What are the prime factors of 7222164? 2, 3, 563, 1069 List the prime factors of 1150745775. 3, 5, 23, 773, 863 What are the prime factors of 1621123823? 11, 4493, 32801 List the prime factors of 1181211808. 2, 7, 61, 137, 631	{ "pile_set_name": "DM Mathematics" }
215. Let r(q) = fz(q) + 7y(q). What is the tens digit of r(0)? 7 Suppose 5s - 18468 = 3j, 2s - 4458 = -5j + 2923. What is the tens digit of s? 9 Let s(t) = 8t3 + 18t*2 - 224t - 5. What is the units digit of s(18)? 1 Suppose h - 6h = 5g - 35, 4h = -g + 16. Suppose -2q + 467 = 3n, 3q - hn - 695 = -2n. What is the units digit of q? 2 Let k be (-7)/(21/(-9)) + 39. Suppose -8y = -2y + k. What is the tens digit of ((-18)/y)/((-8)/(-56))? 1 Let l(t) = -260t + 4 + 5 - 18. Let s(p) = -p3 - 2p*2 - 1. Let r be s(0). What is the hundreds digit of l(r)? 2 Let n be 108/48 + 2/(-8). Suppose -4y + 16 = -0y + 5f, 2f + 16 = 4y. Suppose 315 = 3i - nd - d, -93 = -i + yd. What is the units digit of i? 9 Suppose 0 = 24d - 17d + 840. What is the hundreds digit of (-3 - 54)8/(d/175)? 6 What is the units digit of (-24 + 6 - -5) + 5916? 3 Suppose -24839 = -16x + 8409. Suppose 0 = 4d + 5o - 2062, 2o - 5o - x = -4d. What is the units digit of d? 8 Let j = -2580 - -4406. What is the thousands digit of j? 1 Suppose -534i = -166i - 10294432. What is the thousands digit of i? 7 Let h = -576 - -621. Let v(f) = -f*3 + 47f*2 - 68f - 24. What is the units digit of v(h)? 6 Let q = 347 - 327. Suppose 5x + q = 0, x = 2z - 49 - 177. What is the tens digit of z? 1 Let h(o) = -252o - 1348. What is the hundreds digit of h(-16)? 6 Let j = -31 + 34. Suppose 0 = 4c - jr - 6 + 13, 4c - 18 = -2r. Suppose 5a = cs + 165, -a + 4s + 83 = 32. What is the tens digit of a? 3 Let q = 103 + -96. Suppose 0 = qc - 4080 - 1464. What is the hundreds digit of c? 7 Let g(c) be the second derivative of -13c4/12 + c2 + 18c. Let j(n) = -n - 1. Let q(x) = -g(x) - 5j(x). What is the units digit of q(-3)? 5 Let n be 6/10(-2 + 7). Suppose -5u - b + 1420 = 0, 1136 = u + 3u + nb. What is the tens digit of u? 8 What is the hundreds digit of (8156/7)/((-207)/(-5796))? 6 Let f be 30849/70 + (-21)/(-70). Let y = f - 273. What is the hundreds digit of y? 1 Let n(t) = 9t2 + 3t - 7. Suppose -h - 30 = -5c, -c - 4h + 3 + 3 = 0. Let y be (22/12 + (-9)/c)12. What is the tens digit of n(y)? 4 What is the ten thousands digit of (44403 - -1) + ((-48)/18)/(13/39)? 4 Let a(c) = -c3 + 32c*2 - 59c - 40. Let v be a(30). What is the units digit of (1647 - -47) + v/2? 9 Let r = -50 - -53. Let b(k) = 299k + 390. Let h(w) = 10w + 13. Let m(j) = rb(j) - 91h(j). What is the tens digit of m(-4)? 3 Let k(w) = w*2 + 4w - 16. Let b be ((-80)/32)/((-2)/8-2). Let i be k(b). Let h(l) = l3 + 12l*2 - 7l - 9. What is the hundreds digit of h(i)? 1 Let r(m) be the second derivative of 11m4/12 + 17m*3/6 + 36m*2 - 200m. What is the units digit of r(-9)? 0 Suppose 24p - 25p = -5. Let r be 2(-57)/(-30) + 1/p. Suppose 3x - 417 = -rs + 4x, 3s - 304 = -x. What is the units digit of s? 3 Let u(p) = 3p*2 - 13p + 16. Suppose 48 = 3r + 195. Let d be 36/30 + -1 - r/5. What is the units digit of u(d)? 6 Let w(l) = 510l + 8885. What is the hundreds digit of w(-13)? 2 Let o = 13893 + -8114. What is the units digit of o? 9 What is the thousands digit of (5634/30)/((-6)/56)125/(-10)? 1 Let f = -16 - -12. Let c be (f - -3)/(2/38). Let j = 100 + c. What is the tens digit of j? 8 Let y(f) = 2f*2 - 31f + 29. Let g = -82 - -105. What is the tens digit of y(g)? 7 Suppose -29z + 863602 - 146345 = 0. What is the ten thousands digit of z? 2 Let u = -76 + 80. Suppose um = -4x + 58 + 250, -5m - 2x + 370 = 0. What is the tens digit of (-1 - (-4 - -2)) + m? 7 Let s = 6217 + 66107. What is the thousands digit of s? 2 Suppose -3 = -a + 3t + 9, 3 = -2a - 3t. What is the thousands digit of a + 1 - (-17)/((-17)/(-1272))? 1 Suppose 32v - 67v = -580755. What is the thousands digit of v? 6 Suppose -9a = 6a + 30. Let t(j) = -48j - 9. Let w be t(a). Let c = -71 + w. What is the tens digit of c? 1 Let q be 45 - 38 - (-2 - 1). Suppose -5x + 3847 = 3t, -x = -5t - 765 - q. What is the tens digit of x? 7 Let z = 5980 + -3326. What is the tens digit of z? 5 Suppose -23f - 170 = -6f. What is the tens digit of ((-4)/f)/((-296)/100 - -3)? 1 What is the hundreds digit of (-60 - -151)/(2/214)? 7 Let k be (-4)/8(-149 + 3). Let m = -37 + k. Suppose s - 4q - 27 = 0, -q = 2s - 0q - m. What is the units digit of s? 9 Suppose -5 = -3p + 7. Suppose 3w = -5j - 0w - 4, 0 = 4j + 2w + p. What is the tens digit of -3 + (28 + 2/j - 2)? 2 Suppose 0 = -16n + 19n + 3r + 1368, 3r = -5n - 2274. Let j = -249 - n. What is the tens digit of j? 0 Suppose 12l - 13l + 2v + 5001 = 0, -3l + 2v = -15007. What is the hundreds digit of l? 0 Suppose -3q - 306 = -3h, -2q + h + 3h = 198. Let a = q - -316. Let n = a - 110. What is the hundreds digit of n? 1 Suppose -2w - p = -7273, -180p - 14552 = -4w - 184p. What is the tens digit of w? 3 Let o = 55288 - 35689. What is the ten thousands digit of o? 1 Let i = -29 - -31. Let s be i((-34)/(-4) + -3). Let z = 121 - s. What is the hundreds digit of z? 1 Suppose 0 = 2q - 3a - 23619, 5a = q + a - 11812. What is the tens digit of 4/(-26) - q/(-533)? 2 Let m = 16615 - 5747. What is the units digit of m? 8 Let l = -113 - -113. What is the hundreds digit of 79475/225 - (l + 4/18)? 3 Let b(g) be the second derivative of 1/6g4 - 3g*3 + 0 - 16g - 3g2. What is the tens digit of b(10)? 1 Suppose -m = 11m + 300. What is the units digit of 1 + 53 + 20 + m? 9 Let g = 10856 + 19148. What is the thousands digit of g? 0 Let i(c) = c*3 + 3c - 92. Let p(f) = 4f3 + 12f - 367. Suppose 19 + 17 = -4u. Let t(g) = ui(g) + 2p(g). What is the tens digit of t(0)? 9 Let f(k) = -12k + 7. Suppose 0 = -4g - 154 - 30. Let u = g + 38. What is the tens digit of f(u)? 0 Let r = 2122 - -4838. What is the tens digit of r? 6 Suppose 2751z - 116595 = 2736z. What is the units digit of z? 3 Suppose 2 = u - 2t - 7, -2t + 21 = 5u. Let g be (-33)/(-6) - 32175/(-78). Suppose -4v = -3b + 163 + g, 0 = v + u. What is the hundreds digit of b? 1 Suppose -108 = 81p - 84p. Let m = 25 + p. Let g = m - 41. What is the tens digit of g? 2 Suppose 576a = 558a + 70416. What is the thousands digit of a? 3 Suppose 203 = 5x - 97. Suppose 114 + x = 3g. Let f = 85 - g. What is the units digit of f? 7 Let m be (124/6)/(2/21). Let n be m/5 + 1 + 12/(-30). Suppose 0 = -nu + 48u - 264. What is the units digit of u? 6 Let w = 13855 + -12304. What is the hundreds digit of w? 5 Let f(x) = -1298x3 + 8x*2 - 30x + 1. What is the tens digit of f(-3)? 0 Let q(w) = -w*3 + 3w*2 + 5w - 17. Let a be q(6). Let p = -160 - a. Let y = -46 - p. What is the tens digit of y? 1 Let i(c) = -c*3 - 17c*2 + 60c + 3. Let a be i(-20). Let s(o) = o + 7 + 5o - o + 13o*2. What is the tens digit of s(a)? 3 Suppose -18u = -16u - 744. Let j = u - 156. What is the units digit of j? 6 Suppose -7 + 16 = 2o - 3f, 6 = -o - 2f. Suppose 2m + 2p - 1266 = o, 0m + 3m = -2p + 1896. What is the hundreds digit of m? 6 Let r(w) be the first derivative of 2w*3/3 - 9w*2/2 - 14w + 42. Let g be r(6). Let m(h) = 5h3 - 5h*2 + 3h + 3. What is the hundreds digit of m(g)? 2 What is the hundreds digit of 2/(-10) + 7360374/870? 4 Let o(d) = 11d2 + 31d + 39. Let p be ((-36)/(-8))/(45/(-10) - -4). What is the units digit of o(p)? 1 Suppose 87j = 26j - 2135. Let l = 455 - 221. Let s = l + j. What is the hundreds digit of s? 1 Let d(o) = -o*2 - 362o - 9. What is the hundreds digit of d(-42)? 4 Suppose 0b = -2b + 10. Suppose -bl + 25 = -5. Suppose -282 = -2p + g - lg, -735 = -5p - 5g. What is the units digit of p? 1 Let i be (-8 - -2)70/(-6). Suppose -o = -22b + 21b + 1, 3b - 1 = 2o. What is the tens digit of (-7)/(-14)(i - o)? 3 Let n = 178 - 186. Let c be 1 + -5 + (-6)/(-6). What is the units digit of (284/n)/(c/6)? 1 Suppose -5m - 2r = 12, 4 = -2m + 3r + 3. Let g(a) = -95a + 4. Let s be g(m). Suppose -4d = -s - 86. What is the tens digit of d? 7 Let v(b) = 1958b + 113. What is the tens digit of v(12)? 0 Let d be (-21)/(-63) + 7/(-3). Let p be 0/(1/(1/d)). Suppose 6i + 2i - 360 = p. What is the units digit of i? 5 Let p = 31499 - 16392. What is the tens digit of p? 0 Suppose 3r - 14 + 5 = 0. Let w(m) = -m3 + m2 + 8m - 1. Let z be w	{ "pile_set_name": "DM Mathematics" }
onds are there in twenty-eight thirds of a minute? 560 How many micrometers are there in 8/25 of a centimeter? 3200 How many minutes are there in 67/3 of a hour? 1340 How many microseconds are there in 2256.407s? 2256407000 What is 5/8 of a litre in millilitres? 625 Convert 8.955755 meters to micrometers. 8955755 What is three tenths of a micrometer in nanometers? 300 How many hours are there in eight thirds of a week? 448 Convert 268.4323 centuries to months. 322118.76 What is 5.09634mg in tonnes? 0.00000000509634 Convert 614.6187l to millilitres. 614618.7 How many nanograms are there in seventeen halves of a microgram? 8500 How many decades are there in 9.446958 centuries? 94.46958 How many minutes are there in 18/5 of a week? 36288 What is seven eighths of a millimeter in micrometers? 875 What is 51/2 of a millennium in decades? 2550 What is 6/5 of a century in months? 1440 What is 49/4 of a millimeter in micrometers? 12250 Convert 3832.379 millennia to years. 3832379 What is twenty-one fifths of a litre in millilitres? 4200 How many seconds are there in three tenths of a minute? 18 Convert 5.30822 weeks to seconds. 3210411.456 How many minutes are there in seven quarters of a hour? 105 Convert 9694.42 decades to millennia. 96.9442 Convert 338686.6 kilometers to centimeters. 33868660000 Convert 287.1978t to grams. 287197800 What is 78.88448 centuries in decades? 788.8448 How many microseconds are there in thirty-three fifths of a millisecond? 6600 What is 13.9837 meters in nanometers? 13983700000 What is 10/3 of a hour in seconds? 12000 How many micrograms are there in 5/4 of a milligram? 1250 What is 27/5 of a millennium in centuries? 54 What is 29/5 of a millennium in centuries? 58 What is 620.4497m in centimeters? 62044.97 What is 3/32 of a kilogram in milligrams? 93750 Convert 734934.1ug to kilograms. 0.0007349341 How many millilitres are there in 413.6812l? 413681.2 Convert 7.870706um to nanometers. 7870.706 How many millilitres are there in fifty-seven fifths of a litre? 11400 What is 497.11446us in hours? 0.00000013808735 How many millimeters are there in seven halves of a centimeter? 35 How many micrograms are there in 11/2 of a milligram? 5500 How many years are there in thirteen quarters of a century? 325 What is twenty-seven halves of a litre in millilitres? 13500 What is 5/8 of a litre in millilitres? 625 Convert 21728.75 grams to micrograms. 21728750000 What is 7/8 of a litre in millilitres? 875 What is seventy-five quarters of a meter in centimeters? 1875 What is 7/4 of a week in minutes? 17640 What is 530.6038 litres in millilitres? 530603.8 Convert 77.37128 centuries to years. 7737.128 Convert 1459.533 grams to tonnes. 0.001459533 What is 11/8 of a millimeter in micrometers? 1375 What is thirty-one fifths of a kilogram in grams? 6200 How many months are there in twenty-five quarters of a decade? 750 How many millilitres are there in 61/2 of a litre? 30500 What is seventy-six fifths of a millimeter in micrometers? 15200 How many minutes are there in eighteen fifths of a week? 36288 Convert 85.97385mm to nanometers. 85973850 What is 35.81907 milligrams in nanograms? 35819070 What is fourty-eight fifths of a century in months? 11520 How many millimeters are there in fifty-nine fifths of a centimeter? 118 What is 7/8 of a litre in millilitres? 875 What is six fifths of a milligram in micrograms? 1200 What is eleven eighths of a microsecond in nanoseconds? 1375 Convert 856.4494 years to millennia. 0.8564494 What is 6.541687 hours in minutes? 392.50122 How many milliseconds are there in 7801.612 minutes? 468096720 How many centimeters are there in thirty-seven fifths of a meter? 740 How many years are there in 89022.91 millennia? 89022910 How many months are there in 37/2 of a decade? 2220 How many micrometers are there in twenty-one quarters of a millimeter? 5250 What is 3/50 of a microgram in nanograms? 60 How many milliseconds are there in 1/5 of a minute? 12000 How many nanograms are there in 1/4 of a microgram? 250 Convert 717.2591 decades to months. 86071.092 How many litres are there in 7.746167 millilitres? 0.007746167 Convert 802.9881 millennia to years. 802988.1 How many months are there in eight thirds of a millennium? 32000 How many centimeters are there in 6/5 of a meter? 120 What is 7/2 of a micrometer in nanometers? 3500 How many millilitres are there in 54/5 of a litre? 10800 How many centimeters are there in 12/25 of a kilometer? 48000 What is 7.916276km in millimeters? 7916276 Convert 109120.68ms to minutes. 1.818678 Convert 23.1056 millilitres to litres. 0.0231056 What is 3/50 of a millennium in years? 60 How many millilitres are there in 886.5291l? 886529.1 How many seconds are there in 2/27 of a day? 6400 Convert 26606.56 litres to millilitres. 26606560 How many nanograms are there in 972505.3 kilograms? 972505300000000000 What is 986016.4 microseconds in milliseconds? 986.0164 How many millimeters are there in 8/25 of a meter? 320 What is four fifteenths of a minute in seconds? 16 Convert 265313.6 hours to microseconds. 955128960000000 What is 34.36083 millennia in decades? 3436.083 How many tonnes are there in 57.7577ug? 0.0000000000577577 What is 59.1125ug in milligrams? 0.0591125 How many centimeters are there in three eighths of a kilometer? 37500 How many seconds are there in 58/3 of a hour? 69600 How many millilitres are there in 3/8 of a litre? 375 Convert 147947.5mm to centimeters. 14794.75 What is 460002.8l in millilitres? 460002800 What is 69/2 of a hour in minutes? 2070 What is fifteen quarters of a century in years? 375 What is 7/6 of a decade in months? 140 Convert 0.9492853 millennia to years. 949.2853 Convert 382.5609ml to litres. 0.3825609 What is 3/8 of a gram in milligrams? 375 Convert 0.067877 millilitres to litres. 0.000067877 How many hours are there in 29.712744 nanoseconds? 0.00000000000825354 How many grams are there in seventy-five quarters of a kilogram? 18750 What is 29/3 of a year in months? 116 What is 6.763955 millimeters in kilometers? 0.000006763955 What is 3810.444 years in millennia? 3.810444 Convert 3.182814 tonnes to milligrams. 3182814000 Convert 141.308064 seconds to days. 0.00163551 What is fourty-three quarters of a litre in millilitres? 10750 How many meters are there in 8/25 of a kilometer? 320 How many millilitres are there in 9/10 of a litre? 900 What is 3/5 of a milligram in micrograms? 600 What is 59/5 of a century in decades? 118 What is 25/8 of a millisecond in microseconds? 3125 What is 11/4 of a litre in millilitres? 2750 Convert 18.84828nm to micrometers. 0.01884828 How many days are there in eleven sevenths of a week? 11 What is 13/4 of a litre in millilitres? 3250 How many kilometers are there in 1.01199 nanometers? 0.00000000000101199 How many months are there in 3/32 of a millennium? 1125 How many centimeters are there in one tenth of a meter? 10 Convert 5.892496 litres to millilitres. 5892.496 What is 1/10 of a litre in millilitres? 100 How many decades are there in 3/5 of a century? 6 What is 1/4 of a litre in millilitres? 250 Convert 0.728953km to centimeters. 72895.3 Convert 65106.49ug to tonnes. 0.00000006510649 How many weeks are there in 103897.5147ns? 0.00000000017178821875 How many centuries are there in three fifths of a millennium? 6 How many minutes are there in eleven quarters of a week? 27720 What is fourty-three quarters of a gram in milligrams? 10750 What is 9.534169 hours in seconds? 34323.0084 How many seconds are there in 1/10 of a minute? 6 How many micrometers are there in 54/5 of a millimeter? 10800 How many kilometers are there in 61065.59um? 0.00006106559 How many meters are there in 3/10 of a kilometer? 300 How many nanograms are there in twenty-five quarters of a microgram? 6250 What is 827198.6l in millilitres? 827198600 What is fifty sevenths of a week in minutes? 72000 How many grams are there in 1.96567 micrograms? 0.00000196567 What is 15/4 of a kilogram in grams? 3750 How many millilitres are there in six fifths of a litre? 1200 Convert 6.187222 decades to centuries. 0.6187222 Convert 69.90788 millilitres to litres. 0.06990788 What is 5/24 of a decade in months? 25 How many micrometers are there in 13/5 of a millimeter	{ "pile_set_name": "DM Mathematics" }
0000 Let h = 0.72 + -1.99. What is h rounded to 1 decimal place? -1.3 Let b = -2 + 21.8. Let x = b + -18. Let j = -1.809 + x. Round j to 2 decimal places. -0.01 Let k = 34649556 - 34649557.9999983. Let u = 2 + k. Round u to 6 dps. 0.000002 Let v = -0.0700108 - -0.07. Round v to 6 decimal places. -0.000011 Let b = -133765 - -133764.840018. Let t = b - -0.16. Round t to five decimal places. 0.00002 Let p = 5.9 - -14.3. Round p to zero decimal places. 20 Let s = -24.725 - -25. Round s to two decimal places. 0.28 Suppose -2n + 1199990 = -3n - 5o, 3o + 5999994 = -5n. Round n to the nearest one million. -1000000 Let z = -5 + 1. Let x = -5073481 - -5073477.000009. Let h = x - z. What is h rounded to 5 dps? 0.00001 Let l = 4.584 + 1.526. Let x = l + -0.11. Let h = x + -6.0002. Round h to four decimal places. -0.0002 Let s = 746 + -745.8732. Let l = s + -0.101. Round l to 3 dps. 0.026 Let v = 96837212.9028 + -96814991. Let b = v + -22204.90280035. Let y = b - 17. Round y to 7 decimal places. -0.0000004 Suppose 4r = 4b + 4, -2r - b = -6b + 10. Suppose rx = 3s - 93745, -s + 3x = -2s + 31253. Let n be (-288)/30-31s. Round n to the nearest 1000000. 9000000 Let z = 0.28 + -0.2800017. What is z rounded to six decimal places? -0.000002 Let c(d) = -d2 - 7d - 6. Let o be c(-6). Suppose -6v + v + 31000 = o. Round v to the nearest 1000. 6000 Let m = 56 - 30. Let w = m + -26.0044. Round w to 3 decimal places. -0.004 Let z = 11 + -11. Suppose -n + zn = -114. Let o = n + -47. What is o rounded to the nearest 10? 70 Let t = -0.25 - -0.196. What is t rounded to two dps? -0.05 Let l be (-238400)/(-4)(-5)/2. What is l rounded to the nearest 10000? -150000 Suppose 0 = 5d - 3068 - 28847. Let l = -12383 + d. What is l rounded to the nearest 10000? -10000 Let m = -99.00488 + 99. What is m rounded to 3 dps? -0.005 Let p(j) = -j*2 - 7j + 5. Let a be p(-7). What is a rounded to the nearest ten? 10 Let j = 0.103 - 0.10359. What is j rounded to four dps? -0.0006 Let h = 0.161 + -0.3522. Let t = 0.177 + h. Round t to 3 dps. -0.014 Let q(b) = -5081b3 + 4b*2 - 5b - 8. Let z be q(-7). Let o be (-10)/(-35) - z/21. What is o rounded to the nearest 10000? -80000 Let t = -275 + 277.22. Let c = 3 - t. Round c to one decimal place. 0.8 Let l = -16360926.39999924 - -16360926. Let t = 0.4 + l. What is t rounded to 7 decimal places? 0.0000008 Let v(i) = -i. Let b be v(-4). Suppose -4y = -y + 5r + 5065, -y + br = 1660. What is y rounded to the nearest one hundred? -1700 Let z be 6/(-5)(-20)/(-6). Let j be (0 - 7 - z) + -163997. What is j rounded to the nearest 10000? -160000 Let x(q) = -6q2 - 8q + 2. Let s(y) = -y*2 - y. Let z(w) = 5s(w) - x(w). Let d be z(-4). Let h = -3 + d. Round h to 1 decimal place. -1 Let o = 8 - 0. Suppose -5g - 2f = -18, -4f - o = -4g + 3g. Suppose 0 = 4b - 20, 0 = 2d + gb + b - 185. Round d to the nearest 10. 80 Let m = -212402 - -212370.99882. Let i = m - -31. What is i rounded to 4 decimal places? -0.0012 Let h = 292.021 - 571.864. Let n = 280 + h. Let l = 0.15627 - n. Round l to 4 dps. -0.0007 Let y = -84 + 27. Let o = y + 57.000037. What is o rounded to five decimal places? 0.00004 Let q(r) = 10 - 2 + 4574r - 13325r. Let n be q(8). What is n rounded to the nearest 100000? -100000 Let k = -39363580.000053 + 39363500. Let j = 8.7 - -71.3. Let f = k + j. Round f to 5 decimal places. -0.00005 Let s = 19 + -17. Suppose 169998 = -b + sg, -b - b - 2g - 340002 = 0. What is b rounded to the nearest 100000? -200000 Let z = 0.18 - -29.82. Let q = z - 30.00042. What is q rounded to 4 dps? -0.0004 Let v = -0.054 + 0.055. Round v to two decimal places. 0 Let s = 0.97 + -1.83. What is s rounded to the nearest integer? -1 Let d be -15/(-3)75. Suppose -5s + 465 + d = 0. What is s rounded to the nearest ten? 120 Suppose -4 = 2p - 3i, 0i + 5i = 5p + 5. Let t be (-2)/(-7) - 710/(-14). Let a = t - p. What is a rounded to the nearest one hundred? 100 Let o be (0 + 1)(-1 + -57). Let m = 18 - o. What is m rounded to the nearest ten? 80 Let f = 0.032 - 0.0319966. What is f rounded to five decimal places? 0 Let k = -0.28 - -0.275. Round k to two dps. -0.01 Let d = -2.6 - -5.2. Let p = d - 2. Let t = 0.600007 - p. Round t to six decimal places. 0.000007 Let p = 0.037 + -0.925. Let j = p + 0.028. What is j rounded to one dp? -0.9 Let z = 2.23 - 2.1946. Round z to 3 decimal places. 0.035 Let s = 1552 + 33148. Round s to the nearest ten thousand. 30000 Let z = -3.5 - -86.5. Let m = z - 40. Let g = 42.999946 - m. Round g to five dps. -0.00005 Let m = 44.4 - 41. Let i = -0.6 - m. Let x = -4.2 - i. What is x rounded to the nearest integer? 0 Suppose -4c + 138942 = 4i - 2i, -3c = -6. Suppose i = 5a - 7033. What is a rounded to the nearest 1000? 15000 Let h = 69 + -69.0042. What is h rounded to 3 dps? -0.004 Let p(j) = -j3 - j2 + 3j + 1. Let q be p(-2). Let i(u) = -56001u - 1. Let s be i(q). What is s rounded to the nearest 10000? 60000 Suppose -2l = 3l - 460. Let m = l - 196. What is m rounded to the nearest 10? -100 Let p = -643105.922865 - -0.922865. Let m = p - -643107.99999. Let n = -3 + m. What is n rounded to 4 decimal places? 0 Let q = -0.0807 - 0.0391. Let m = 0.093 + q. What is m rounded to 3 dps? -0.027 Let b(d) = d*2 - 5d - 1. Let f be b(6). Suppose fj + 2424 = 16549. Suppose 1175 = -c - j. What is c rounded to the nearest 1000? -4000 Let d = -618.3 - -520.64. Let i = d - -99. What is i rounded to one dp? 1.3 Let h be -3 - 4/(8/6). Let p be 2 + h + 2/1. Let f be -7599998 - (0 + (0 - p)). Round f to the nearest one million. -8000000 Let y = 60 - 59.06. Let a = 0.93867 - y. Round a to 4 dps. -0.0013 Let l = 513 - 266. Suppose l - 101 = 2x. What is x rounded to the nearest 10? 70 Let c = 0.143 + -0.14299943. Round c to seven decimal places. 0.0000006 Let u = 43.00314 + -43. Round u to four decimal places. 0.0031 Let a(g) = -1371999g2 - 3g - 10. Let f be a(5). Round f to the nearest one million. -34000000 Let p = 12352142 + 14547858. Round p to the nearest one million. 27000000 Let k be 1245525/(-6) + (-1)/(-2). Let s = k - -295587. Round s to the nearest 10000. 90000 Let l(t) = 10277t2 + 5t - 2. Let v be l(6). Round v to the nearest one hundred thousand. 400000 Let z = 7 - 5. Suppose -2t + 3009255 = 949265. Suppose -k = -c - t, 0 = -c - zk - 1729752 + 699742. What is c rounded to the nearest one hundred thousand? -1000000 Let d = 0.05864 + -0.056. What is d rounded to 3 decimal places? 0.003 Suppose -28 = -7m + 3m. Suppose -mk = -3k - 43998888. Suppose 3599722 = 2u + k. Round u to the nearest 1000000. -4000000 Let y = 12735022 - 12735021.72401397. Let b = y - 2.47598293. Let p = 2.2 + b. Round p to 6 decimal places. 0.000003 Let o be (-1172715)/(0 + (-9)/(-12)). Let i = o - -1073620. What is i rounded to the nearest 100000? -500000 Let t = 0.3903409 + -23.8951309. Let d = t - -0.54179. Let i = d + 23. What is i rounded to two dps? 0.04 Let b = 0.27 - -0.13. Let t = b + -0.37. Round t to 1 decimal place. 0 Let u = -2.9 + 2.899999811. Round u to seven dps. -0.0000002 Let o(m) = 134m*2 - 8m - 2. Let s be o(-11). What is s rounded to the nearest one thousand? 16000 Let b = -144 - -180.1. Let r = -33 + b. Round r to the nearest integer. 3 Let c = 33 - 74. Let i = c - -41.019. Round i to 3 decimal places. 0.019 Let l = -5 - -9. Let h = 3.999952 - l. What is h rounded to 5 decimal places? -0.00005 Let p = -2.1 - 35.9. Let q = -38.00000061 - p. Round q to seven decimal places. -0.0000006 Let u be -1501/(1 + 2). Let l = u + 67. Round l to the nearest ten. -100 Let t(l) = 4200000l. Let f(g) = g - 1. Let x be f(-1). Let n be t(x). What is n rounded to the nearest 1000000? -8000000 Let n = 13.8 + -19. Let o = -0.4 + n. Let r = 5.600039 + o. Round r to five decimal places. 0.00004 Suppose -517856 = 2w - 2037856. Round w to the nearest one hundred thousand. 800000 Let n = 462016 - 462209.893. Let u = n - -194. Let k = u + -0.044. What is k rounded to 2 dps? 0.06 Let f = 239383.32114 - 304603.5206. Let c = f + 65217. Let q = c - -3.2. What is q rounded to four decimal places? 0.0005 Let x = 863 + -693.1. Let d = -160 + x. What is d rounded to zero decimal places? 10 Let g(y) = y2 - 5y + 3. Let l be	{ "pile_set_name": "DM Mathematics" }
Calculate the common denominator of 13/469 and 61/6692. 448364 Calculate the common denominator of 79/167444 and 97/574. 1172108 What is the smallest common multiple of 7280 and 590? 429520 What is the common denominator of -193/465780 and 77/18? 1397340 Find the common denominator of 29/582 and -47/2134. 6402 Find the common denominator of -97/36 and -47/20568. 61704 Calculate the common denominator of 31/26600 and -69/928. 3085600 What is the least common multiple of 2024 and 12696? 139656 What is the smallest common multiple of 6771 and 666? 40626 Calculate the smallest common multiple of 174250 and 34850. 174250 What is the common denominator of -67/171 and 41/15? 855 Find the common denominator of -24/368203 and 45/68. 1472812 What is the lowest common multiple of 14365 and 70720? 919360 Calculate the smallest common multiple of 10466 and 20932. 20932 Calculate the common denominator of -111/209174 and -43/44823. 627522 Calculate the least common multiple of 3980 and 19900. 19900 Find the common denominator of -161/7524 and -149/12276. 233244 What is the common denominator of -125/2982 and -157/779580? 5457060 Calculate the common denominator of -55/84969 and -47/113292. 339876 Calculate the smallest common multiple of 24 and 5136. 5136 What is the smallest common multiple of 12170 and 80? 97360 Find the common denominator of 4/125 and -169/40350. 201750 Find the common denominator of 43/80 and -87/18080. 18080 Calculate the lowest common multiple of 22660 and 264. 135960 Calculate the smallest common multiple of 98 and 46592. 326144 What is the lowest common multiple of 40108 and 2? 40108 Calculate the common denominator of 40/47 and -67/34874. 34874 What is the least common multiple of 1809 and 1206? 3618 What is the common denominator of 173/95820 and -73/622830? 1245660 Find the common denominator of 47/1100 and 61/330. 3300 What is the common denominator of 41/5246 and -97/37698? 1621014 What is the smallest common multiple of 82626 and 20? 826260 What is the smallest common multiple of 29925 and 6650? 59850 Calculate the smallest common multiple of 2420 and 88. 4840 What is the least common multiple of 18 and 74952? 74952 Find the common denominator of -117/230 and -173/11730. 11730 What is the smallest common multiple of 402 and 7314? 490038 Find the common denominator of 115/247368 and 45/783332. 4699992 Calculate the common denominator of 31/6669 and 58/81. 20007 Find the common denominator of -53/176 and -23/9952. 109472 Find the common denominator of -43/2218592 and 83/1109296. 2218592 What is the lowest common multiple of 525096 and 3168? 2100384 Calculate the least common multiple of 26741 and 4114. 53482 Calculate the lowest common multiple of 20028 and 2856. 4766664 What is the lowest common multiple of 252 and 100548? 100548 Find the common denominator of -133/52560 and -53/36. 52560 Calculate the common denominator of -145/76986 and 25/2068. 1693692 Calculate the lowest common multiple of 104907 and 264. 839256 What is the smallest common multiple of 616 and 131880? 1450680 Calculate the common denominator of -103/85122 and 59/4. 170244 What is the least common multiple of 29010 and 600? 580200 Find the common denominator of -48/12965 and -107/57046. 285230 Calculate the common denominator of -79/310 and 60/9889. 98890 Calculate the least common multiple of 47262 and 5. 236310 Calculate the common denominator of -39/44 and 7/32096. 353056 What is the common denominator of 11/54528 and 155/42? 381696 Calculate the common denominator of 103/197346 and 83/44562. 1381422 Calculate the smallest common multiple of 10 and 224046. 1120230 Find the common denominator of -13/1870 and 71/9350. 9350 What is the common denominator of -71/663 and -67/1445? 56355 Calculate the common denominator of -49/4526 and -23/6424. 199144 Calculate the common denominator of 17/72762 and 97/804. 145524 Calculate the common denominator of 107/420780 and -79/21. 2945460 Calculate the least common multiple of 17784 and 64. 142272 What is the common denominator of 13/19080 and 113/120204? 1202040 What is the common denominator of 71/288 and -31/249568? 2246112 What is the smallest common multiple of 325140 and 1? 325140 What is the smallest common multiple of 109388 and 92? 109388 Find the common denominator of 27/85280 and -15/2. 85280 What is the lowest common multiple of 2415 and 7245? 7245 Calculate the common denominator of -42/11 and 10/148757. 1636327 What is the least common multiple of 75 and 23223? 580575 What is the smallest common multiple of 13893 and 2277? 958617 What is the common denominator of -83/10566 and 43/73962? 73962 Find the common denominator of -133/36360 and -41/5. 36360 Find the common denominator of 23/1205 and -46/4085. 984485 Find the common denominator of 9/3497 and 23/13181. 171353 Calculate the smallest common multiple of 14465 and 13150. 144650 Calculate the common denominator of -53/792 and -139/924. 5544 Find the common denominator of -63/7436 and -131/264. 44616 Calculate the least common multiple of 12786 and 732. 1559892 Calculate the smallest common multiple of 34755 and 12909. 451815 Calculate the smallest common multiple of 542400 and 108480. 542400 Calculate the common denominator of 50/17 and -49/11255. 191335 Calculate the lowest common multiple of 109463 and 5593. 766241 Calculate the common denominator of -1/10003 and -31/1848. 2640792 Calculate the lowest common multiple of 504273 and 168091. 504273 Find the common denominator of -29/7840 and -79/4480. 31360 Find the common denominator of 91/6 and 115/60222. 60222 Calculate the common denominator of 125/693876 and 39/40. 6938760 What is the least common multiple of 373 and 10? 3730 Calculate the smallest common multiple of 354 and 4248. 4248 What is the lowest common multiple of 48516 and 2444? 2280252 What is the smallest common multiple of 113344 and 453376? 453376 Calculate the lowest common multiple of 2948 and 341. 91388 What is the least common multiple of 43980 and 8? 87960 Calculate the lowest common multiple of 5265 and 1485. 57915 Calculate the least common multiple of 8 and 259307. 2074456 Calculate the lowest common multiple of 34461 and 29538. 206766 Calculate the common denominator of 20/6851 and 48/455. 239785 Calculate the common denominator of 95/27992 and -61/27992. 27992 Calculate the common denominator of 55/4 and -32/33655. 134620 What is the common denominator of 12/119 and -13/51? 357 Find the common denominator of -7/2592 and -13/7776. 7776 What is the lowest common multiple of 22715 and 12390? 136290 Calculate the common denominator of 71/28530 and -98/975. 1854450 What is the lowest common multiple of 50 and 609585? 6095850 What is the common denominator of 55/2082 and 73/5552? 16656 Find the common denominator of -65/2241 and 19/28884. 259956 What is the lowest common multiple of 8168 and 6? 24504 Calculate the least common multiple of 37450 and 428. 74900 Calculate the common denominator of -99/6080 and 101/256. 24320 What is the lowest common multiple of 461922 and 24? 1847688 What is the smallest common multiple of 137875 and 16545? 413625 Calculate the lowest common multiple of 65205 and 4536. 521640 Calculate the smallest common multiple of 97461 and 702. 584766 What is the lowest common multiple of 19684 and 171? 177156 Calculate the least common multiple of 24 and 4524. 9048 Calculate the common denominator of 9/87874 and 46/7461. 790866 What is the common denominator of 19/15309 and 64/14175? 382725 Calculate the least common multiple of 162 and 59373. 118746 Calculate the common denominator of 69/752 and -103/136. 12784 What is the lowest common multiple of 130778 and 34116? 784668 Calculate the lowest common multiple of 1739 and 12267. 453879 Calculate the common denominator of -19/7613 and -25/10856. 3593336 Find the common denominator of -25/72744 and -143/31176. 218232 What is the common denominator of 109/29510 and 18/669877? 6698770 What is the smallest common multiple of 21 and 4200? 4200 What is the lowest common multiple of 15272 and 16? 30544 Find the common denominator of -11/9 and -43/4843. 43587 What is the common denominator of 85/18102 and -17/12930? 90510 Calculate the lowest common multiple of 252	{ "pile_set_name": "DM Mathematics" }
Solve 13o + mo = 2o for o. 0 Suppose 13y - 10y = 9. Suppose 14 = p + yx, -p - 2x + 0x = -12. Suppose -2s + p = 4. Solve -s + 6 = -4z for z. -1 Let u be 1 - -3 - (-7 - -26). Let l be (u/20)/(3/(-8)). Solve lo = 4o + 4 for o. -2 Let p = -8 - -10. Suppose 2 = -0x + x. Suppose 15 = 5l - 4y, -3y - 4 + 10 = xl. Solve -lt + t = p for t. -1 Suppose -34y - 24 = -42y. Solve 8 = yv - 7v for v. -2 Let o be (-10)/(7/((-14)/4)). Suppose 0 = on - 4x + 1 - 67, -3n + 5x = -37. Let h be 2/n + (-5)/35. Solve -4 = -2z - hz for z. 2 Let m(v) = -v*2 - v + 4. Let q be m(-2). Let o = 8 + -8. Solve qc = -oc for c. 0 Suppose 5z + 326 = 3m + 40, -m + z + 92 = 0. Let r = m - 85. Solve 5 = -rv + v for v. -5 Suppose -51 = 2y - 51. Solve -5v + 0v = y for v. 0 Suppose 5z = 4a - 15, 4z = -2a - 11 - 1. Solve -3s + 5s - 10 = a for s. 5 Let f(p) = p + 11. Let g be f(7). Let a be 9/g(2 - -2). Solve al + l = 6 for l. 2 Let o be (-3)/(-1) + (-7)/(-7). Let c(u) = u3 + 10u*2 + 7u - 15. Let q be c(-9). Solve 0 = oj - qj for j. 0 Suppose -2p + 3p - 9 = 0. Let x = -6 + p. Suppose 0 = -2k - xk. Solve kn + 3n + 12 = 0 for n. -4 Suppose -3z + 9 = 4v - 0, 5z = 5v + 15. Suppose 10t + z = 43. Solve -c = tc + 15 for c. -3 Let v be (4/48-27)/((-3)/12). Solve vj = -2j for j. 0 Let u be 1/((-7)/4) - (-1854)/721. Solve um - 10 = -2 for m. 4 Suppose q + 105 = 6q. Let p = q - 6. Solve 0 = -6r + 3r + p for r. 5 Let z(o) = -o + 25. Let q be z(22). Suppose -2y - 2b = 6, 3y - b - 26 = qb. Solve -2 = ym - 3m for m. 2 Suppose -2q + 3h + 15 = 0, 2q = 5q - 4h - 21. Suppose 27l - 49 = -4v + 32l, 5v + 3l - 15 = 0. Solve qy + v = y for y. -3 Let d = 330 - 528. Let l be (-2 + 0 - d/36)2. Solve 0 = u - l + 5 for u. 2 Let z be ((-105)/(-14) - 8)/((-1)/32). Solve -3h - 25 = -z for h. -3 Let q(b) = 5b2 + 1. Let y be q(1). Let r(z) = z2 + 2z - 16. Let s be r(0). Let w be (-50)/s - 1/8. Solve -wc + 0c = -y for c. 2 Let i = 85 - 83. Solve i = -r - 1 for r. -3 Suppose 0 = -9h + h. Suppose t - 5 + 2 = h. Solve 2f + t = -f for f. -1 Let a = 346 - 331. Solve 4m + a = -5 for m. -5 Let r = 890 + -877. Let z(o) = o3 - o2 + 3o - 3. Let c be z(2). Suppose -10 = -4h - p, 5h - 2p - 12 = c. Solve -2d - r + h = 0 for d. -5 Suppose -11k + 54 = -5k. Suppose -100 - 26 = -ki. Solve -4o = -i + 2 for o. 3 Suppose 37u - 38u = -6. Let a(n) = -n*3 - 2n - 2. Let y be a(-2). Solve -y = us - s for s. -2 Let g(k) = -8k - 2. Let r(z) = z + 1. Let a(w) = -g(w) - 4r(w). Let y(n) = -n + 2. Let q be y(1). Let v be a(q). Solve -vb = -5 - 1 for b. 3 Suppose -110z - 270 = -3n - 113z, 0 = 4n - z - 385. Solve nv - 91v = 0 for v. 0 Let u be (-27)/(-5) - 12/(-20). Suppose -2o = -4 - u. Solve -oi = -i + 8 for i. -2 Let v be 3/(648/(-222) + 3). Suppose 0 = -6s - 13 + v. Solve -3d + s - 1 = 0 for d. 1 Suppose 8g + 6 = 10g. Let s be ((-12)/g - -4)/2. Solve 4q - 4 + 0 = s for q. 1 Let c(l) = l3 + 27l*2 - 2l - 47. Let s be c(-27). Solve -sn + 4n = 0 for n. 0 Let h(c) = 3c2 - 9c - 10. Let n be h(-1). Solve v + nv = 12 for v. 4 Suppose -153a = -164a + 33. Solve 5w = -aw - 32 for w. -4 Suppose -2 = -v - u, -5u + 22 = -0v + v. Let t(x) = 3x + 12. Let q be t(v). Solve -q = 3j + 6 for j. -3 Let x = 389 + -379. Solve -x + 14 = f for f. 4 Suppose 8j = 7j + 47. Let v be j(-1 + 3 + -1). Let d be v/9 - 10/45. Solve -dn + 9 = -6 for n. 3 Let k be (-2 - (-3 - -3)) + 5. Solve -5x = -kx - 10 for x. 5 Suppose 0 = 3w + 4c - 10, -3c - 4 = -c. Suppose 0 = -2z + 3z - wz. Solve z = h + 1 - 6 for h. 5 Let d(r) = r3 + 12r*2 - 15r - 22. Let v be d(-13). Solve -4x - 8 = -v for x. -1 Let z be (20 - (21 + -15)) + (0 - -1). Solve -z = 25j - 20j for j. -3 Let r be (2 + 40)2/4. Let z be (-280)/r + (-2)/3. Let f = 15 + z. Solve -f = m + 1 for m. -2 Let k be (145/(-25) - -6) + (-2)/10. Solve k = c - 0 + 2 for c. -2 Suppose -f - 5x + 3 = -2, -5x + 65 = 5f. Solve k = 6k + f for k. -3 Let f(z) = z + 8. Let w = 14 - 27. Let a = -21 - w. Let x be f(a). Solve -5o + 0 - 15 = x for o. -3 Suppose 394 = -12c + 466. Solve 116r = 113r - c for r. -2 Suppose 7v + 34 = 5d + 6v, 3d - 4v - 34 = 0. Solve 0 = -du - 10u + 48 for u. 3 Suppose -3x - 28t + 29t + 11 = 0, 5t = 20. Solve xp - 11 = -26 for p. -3 Suppose 35 = 4f + 223. Let d = -47 - f. Solve d = 2m - m - 5 for m. 5 Suppose 222a = 228a - 234. Solve -37 = -w - a for w. -2 Let x be (53 - -3)/14(0 + 1). Solve -u + 9 = -xu for u. -3 Let c = -29 - -34. Suppose 3 + 3 = 2z + cm, -z = 4m - 3. Solve 0 = -t + zt + 2 for t. -1 Let r(s) = 1 + 8 + 2 - s - 2. Let l be r(7). Solve 5k = 7k - l for k. 1 Suppose 0 = 2f - 4f - 48. Let g = -19 - f. Solve j - gj = 0 for j. 0 Suppose 6o - 5o = 33. Suppose 4x + 2q = -10 - 12, x - 5q = -o. Let h(m) = -2m - 10. Let b be h(x). Solve 3g - b = 6g for g. -2 Suppose 0 = 2t - 6. Let x = -23 - -15. Let h = t - x. Solve h - 3 = 2g for g. 4 Suppose 7c - 43 = 6c - 4y, 10 = 2y. Solve -s = 25 - c for s. -2 Let a = 1 + 18. Let o = -41 + 46. Solve -ot + 6 + a = 0 for t. 5 Suppose 0 = -5f + 3h + 85, -f - 5 = -5h. Solve 3q = -q - f for q. -5 Let q = -8 + 11. Let g be (-11)/24-1. Let d = -19 + g. Solve qt + d = -3 for t. -2 Let z = 32 + -42. Let n = -7 - z. Solve n = 2d - d for d. 3 Let t(p) = -p - 2 - 2p + 4p. Suppose -n = 3d + 8, 1 = -2n + 3d + 21. Let c be t(n). Solve 2u - 8 = -c for u. 3 Suppose -76h = 1088 - 4280. Solve 45n - hn + 6 = 0 for n. -2 Let f(i) = -8i*2 + 35i + 20. Let o be f(4). Solve -57h + 65h = o for h. 4 Let w be -6 - (-1 - -41)/(-5). Solve -wr + 3r + 2 = 0 for r. -2 Let d be 2 - (-2)/((-6)/(-3)). Let g = -27 - -37. Solve -5a - g = -da for a. -5 Let j = -225 + 243. Solve -h = 5h + j for h. -3 Suppose 2g = 9 + 5. Solve 0w = gw for w. 0 Let y(p) = -2p2 + 39p - 10. Let g be y(19). Solve -gk - 28 = -73 for k. 5 Let o(f) = 32f*2 - 67f - 3. Let u be o(3). Solve -104 = -4y - u for y. 5 Let s be 5/(-5) - (-1)/(3/18). Suppose -6z + 1 = -sz. Solve -2i + z = 5 for i. -2 Suppose 8w = -12w + 60. Solve -w = -2l - l for l. 1 Let y be (-3 - -12)/(-36) + (-1)/(-4). Suppose 0 = -3x - y - 0. Solve b - 2 = -xb for b. 2 Suppose -8j - 37 + 277 = 0. Solve 28o = jo + 6 for o. -3 Let b(l) = 2l2 - 21l + 1. Let a be b(11). Solve a = -d + 5d for d. 3 Let g(b) = 3b + 76. Let m be g(-23). Suppose 0 = -5y - u - 3 - 2, 4u = -20. Solve 5t + m + 3 = y for t. -2 Let s = -38 - -50. Suppose 0 = 8l - s - 4. Solve ld - 2 = d for d. 2 Suppose -2p = 3p - 4a + 1, -2p - 2 = -2a. Solve 4 + 2 = pk for k. 2 Let k = 16 - 1. Suppose -7l + 132 + 78 = 0. Suppose l = 7n - 2n. Solve k = z - nz for z. -3 Let g = 3 - -9. Suppose z + 0 = 4. Suppose -zt + g = 4. Solve 0 = 3p + t + 10 for p. -4 Let a = 0 - 0. Suppose 0 = 30i - 43i + 52. Suppose -2h - q + aq = 5, 0 = -ih - 4q - 20. Solve -4d = -hd for d. 0 Let d(t) = -2t + 4. Let q be d(2). Let u be q/(-6 - -4 - -3). Solve u = x - 3 for x. 3 Let c(i) = i*2 - 10i + 3. Let s(w) = -4w + 3. Let b be s(3). Let h = 1 - b. Let q be c(h). Solve -qu + 22 = 7 for u. 5 Suppose -5z = 122 - 127. Solve -7f = -8f - z for f. -1 Suppose -2c = -5a + 9 + 19, -3c = -3a + 15. Solve -10 = 2q - a for q. -2 Suppose -3v + 0 + 12 = 0. Suppose 5c = 5q + 5, 3c - 3 = 6q - q. Suppose q = 2n - 4y + v, 3 = -2n + 7n + 3y. Solve -4w + 8 = -nw for w. 2 Let h(p) = -p*3 - 20p*2 - 20p - 16. Let o be h(-19). Let a be (2/3)/((-2)/(-6)). Solve -m + o = -am for m. -3 Let q be 133 + (4/(-3))/(20/30). Solve 127z - qz - 20 = 0 for z. -5 Suppose 2 = 7f - 6f. Suppose -5 - 5 = -c. Let v(b) = -b2 + 11b - 8. Let u be v(c). Solve -fi = ui for i. 0 Let m = -101 + 106. Solve 3r = -2 + m for r. 1 Suppose 2u - 4u = 0. Suppose 4n - 3n - 5 = 0. Solve uy - n = 5y for y. -1 Let v = 1 + 5. Suppose 11x - 3x = 16. Suppose -xp = g, 3p = 2g - 2p - 9. Solve 4c = vc - g for c. 1 Let x be 4/6 - 21/(-9). Suppose t - 21 = -0t + 2q, 0 = -t + 3q + 19. Suppose t = 4c - 3p, 2c - p = -2c + 19. Solve -c = xd + 11 for d. -5 Let t(k) = k2 + 28k + 211. Let z be t(-16). Solve 4m - zm = 0 for m. 0 Suppose -3j = 2j + 5i - 750, 3j + 5*i	{ "pile_set_name": "DM Mathematics" }
3)(-3n - 3 + 0n - n). 8n + 6 Expand (0v + 0v - v*2)(-29 + 5v3 - 3v*3 + 30). -2v5 - v2 Expand (-1 + 0 - 5)(-3w - 3 + 6w - 5w). 12w + 18 Expand (2 + 0p - p - 4)(-1876 + 73p + 1876). -73p2 - 146p Expand (5v - 3v - v)(17 + 3 + 20)(0v - v - v). -80v2 Expand u2 + 5u2 + 4u*2 + (0u + 4u - 2u)(0u - u - u) - 2u2 + 0 + 0. 4u*2 Expand (-11 + 11 + z)((-7 + 3 + 0)(2z - 3 + 3) + 4z - z - z). -6z*2 Expand (16w + 2w4 - 16w)((-2w + 3 - 3)(-6 + 2 + 3) + (-3 + 4 + 1)(-2w + w - 2w)). -8w5 Expand -2 + 7 - 4w + 2w + (4 - 4 + 2)(4w - 3w + 8w). 16w + 5 Expand (3x - 2x*2 - 3x)(-2x + 0 - 6 + 4) + 3x3 - 3x3 + x3. 5x3 + 4x*2 Expand 2h*3 + 0h3 - h3 + (3h2 - h2 + 0h*2)(-5h + 0h + 4h) - 1351h*3 - 14 + 1353h3 + 3. h3 - 11 Expand (0o4 + 4o*3 + 0o*4 - 2o*4)(-o - 2o + o) + 5 - 4 - 9o*5 - 2. -5o*5 - 8o*4 - 1 Expand ((1 - 3 + 3)(0 - 3 + 4) - 4 - 17 + 5 + 2 - 5 + 5 - 1 - 1 + 4 + (1 - 2 - 1)(-3 - 1 + 2))(-4p3 - 1 + 1). 28p*3 Expand (-5k*2 - 5k*2 + 4k*2)(-1 + 1 - 2k). 12k*3 Expand -5p*4 + 5p*3 - 5p3 + (-1 + p2 + 1)(3p*2 + 0p*2 - 5p*2) + 6p*4 + 0p*3 + 0p*3 + 0p*2 + 2p*4 + 0p2. p4 Expand (c + 0c + c)(-8 - 4 + 5). -14c Expand (-25 - 1 - 8 + (-2 - 2 + 5)(1 - 1 - 1) - 1 - 1 + 4)(-5h + 2h + 2h). 33h Expand -2z*5 - 4z*5 + 38z*5 - 2z*5 + 4z*5 + 0z*5 + 2z*4 - 2z*5 - 2z*4 + (5z*2 - 3z*2 - 3z*2)(-z*3 + 1 - 1). 33z*5 Expand (2 - 1 + 9)(-4 + 1 + 1)(-2p - 6p + p). 140p Expand (-2c2 + 2c*2 + 2c*2)(3 - 6 + 1) + (3c2 - 6c*2 - 7c*2)(4 + 0 + 1). -54c2 Expand (-4b - 24 + 24)(-b + 3b + 0b). -8b*2 Expand (1 - 2 + 4)(9 - 9 - 15n). -45n Expand (0 + 0 - 2p)(p*3 - 5p*3 + 3p*3) + 2p2 - p4 - 2p2 + (p + p3 - p)((3p - 4p + 3p)(-4 + 0 + 3) - 4p + 5p + 7p). 7p*4 Expand (-1 + 2 - 3)(-2f2 - 5f2 - f2). 16f2 Expand -6v - 2v - 6v + (2 + 3 - 4)(-4 - 2v + 4). -16v Expand (-1 + b - b2 + 1)(-5 + 4 + 6). -5b2 + 5b Expand (-9a + 0a + 3a)(1 - 2a - 1) + 0a*2 + 5a2 - a2 - 2a2 - 3a*2 + 3a2 - a2 + a - a + (2a - 2a + a)(-2a - 2 + 2). 11a2 Expand 5r*2 - 9r*4 - 5r*2 - 2r4 + r2 - r*2 + (5r - r - 2r)(-r*3 + 0r3 - r3) + r*4 - 3r*4 + 0r*4. -17r*4 Expand 3p - 5p + p + (p + p + 0p)(4 - 6 - 1) - 4 + p + 4 + (-1 + 1 + 2)(-5p + p + 2p). -10p Expand (y2 + 5y*2 - 4y*2 + (y - 2y + 2y)(3y - 4y + 4y))(10y2 + 5y2 - y2). 70y4 Expand (6 - 1 - 2)(a + a - a) + 0a + a + 0a - 4a + 5a - 2a. 3a Expand (2o2 + 2o*2 - 6o*2)(-2o + 0 + 0) + 5o*3 - 3o*3 - 4o*3 + 2o3 + o3 - 4o3 + (-4 + 3 - 1)(1 - 1 + o*3) - 1 + 1 - 2o*3. -3o*3 Expand -6n*4 + 3n4 + n4 + (5n3 + 0n*3 - 3n*3)(-3n - n + 2n) - 3n4 + 3n*4 + 2n*4 + (2n2 - n2 - 3n2)(8n2 + 22n - 22n). -20n*4 Expand (-4g*4 + 5g*4 + 2g4 + (-g2 + 0g + 0g)(-2g*2 + 5g*2 - 5g*2))(-2 - 9 + 1). -50g4 Expand -w - 2w*4 + w + (4w - w - w)(7w*3 + 5w*3 - 7w*3) - 26w + 1 + 26w - w4. 7w*4 + 1 Expand 22 - 10 - 11 + 14t - t*2 - 3t*2 + 2t*2 + 2t*2 + (3t - 5t + 3t)(-3 + 3 + t). t2 + 14t + 1 Expand 0 - 2u + 0 + (3 - 3 + 2)(-2u - u + u). -6u Expand (-5 + m*4 + 4 - 1)(0 + 0 - 3m)(0 + 0 + 2). -6m5 + 12m Expand (h*2 - 2h3 - h2 + (-h*2 - 4h*2 + 4h*2)(2h + 4 - 4) - h3 - 3h3 - h3 + h2 - h2 + 2h3)(2 - 2 + 1). -7h3 Expand (-3w + 0w + 2w)(5w + 6 - 6) - 4w2 + 3w*2 + 3w*2. -3w*2 Expand ((-2z + 3z + 0z)(0z*2 + 2z2 - z2) + z*3 + 3z*3 - 7z*3)(19z - 11z - 3z)(-4 + 3 + 0). 10z4 Expand (3 - 3 + 1)(v - 2 + 1 - 1). v - 2 Expand (0g3 - 17g*3 + 2g*3)(4g2 - 2g2 - g2 + 2g). -15g*5 - 30g*4 Expand 2p*3 + 0p3 - p3 + (-2p3 - 4p*3 + 4p*3)(5 - 3 - 4). 5p3 Expand (i - 1 + 1)(2123i - 53i*3 - 2123i) + i - i + 2i4. -51i*4 Expand (-3x*2 - 2x*2 + 4x*2)(x + 88x3 - 175x*3 + 84x*3 - 5x*2). 3x*5 + 5x4 - x3 Expand (3m - 5m - 2m)(-2m4 + 3m4 + m4) + (3m4 - 3m*4 - 2m*4)(2m + m - 2m). -10m5 Expand (13i*3 - 2i*3 - 3i*3)(0 - 1 + 2) - 3i3 + 3i3 - i3. 7i3 Expand (-2s + 8 - 3 - 6)(-s - 2s + 0s). 6s*2 + 3s Expand 0d + 3d - 2d - 3 - 2d + 3 + (-4d + 2d + 5d)(-1 - 5 + 5). -4d Expand (0d + 2d - 4d)(2 + 4 - 1)(6 - 6 + 5d). -50d*2 Expand (-a + a - 2a)(4a - 4a + 4a). -8a2 Expand (-2x*2 + 2x*2 - 2x*2)(-1 + 1 - 3x) + 0x*3 + 3x*3 - 4x*3 + 2x + x3 + x3 + 0x. 7x*3 + 2x Expand (2v - 5v + 2v)(19v - 6 - 3 - 17v). -2v2 + 9v Expand -2i3 - 2i*4 + 2i*3 + (-2 - i + 2)(i + 3 - 3)(-3i + 0i + 2i)(3i + i - 3i). -i4 Expand (f + 2f - 5f)(0f2 - 2f*2 - 2f*2) + (-f - 2f + 5f)(-2f + 2f + 2f2). 12f*3 Expand (0n + 0n + 2n)(13n - 6n + 16n). 46n2 Expand (-5x + 3x + 0x)(-3 + 2 + 3) + 2x + 0x + 0x + (2 + 3 - 1)(-153 + 20x + 153). 78x Expand 3y*5 - 2y*5 + 0y*5 + (-3 + 5 - 3)(4y5 + 12y*5 - 17y*5) + (3y - 3y - y)(-y*4 + 3y4 - y4). y*5 Expand (-1 - 2i*3 + 1)(-1 + 3 - 3) + 0 + 1 + 4i3 - i3. 5i*3 + 1 Expand -3m + 3m - 2m + (-2 - 4 + 4)(m + 6 - 6). -4m Expand (-3 + 5 + 0)(1 - p - 1) + 0 - p + 0 + 4p - 3p + 6p. 4p Expand (-3 - 2 + 6)(-2v + 0 + 0) - 5v + 2v + 2v + (-5 + 2 - 1)(-2v + 0v + 3v). -7v Expand (-i3 + 4i*3 - 5i*3)((2 - 2 + 2i)(-3 + 1 + 4) + (-3 + 2 + 0)(0i - 4i + 6i) + 3i - 2i - 2i). -2i*4 Expand (-10a*5 - 6a5 + a5)(-3 - 1 + 5) - 2a*3 + 2a*5 + 2a*3. -13a*5 Expand (1 - 1 + 3 + (1 + 0 + 0)(3 - 2 + 1) - 2 + 2 + 1 - 1 + 2 - 2)(1 - 1 - v). -5v Expand -2h + 1 - 1 + (-3 - 1 + 2)(-h + 0h + 2h) - h + 0h + 0h + 5h - 5h + 8h + 0h + 0h + h. 4h Expand -3d2 + 1 + 3d2 + d2 - d - 2d2 + d + (2 - 2 - 3d)(d - 3d + 4d) - d2 + 2d*2 - 2d2 + 1 - 1 + d2. -7d2 + 1 Expand ((0 - 2 + 1)(-6s + 5s - 2s) + 2s + s - s)(9s*2 - 9s*2 + 3s*3). 15s*4 Expand (-2h3 - h3 - 4h3)(-2h + 5h - 4h + 5). 7h*4 - 35h*3 Expand (-l + 4l - 5l)(-2 - 2 + 3)(-7l*2 + 7l*2 - 5l3) + l4 + 3l4 - 6l*4. -12l*4 Expand (-3x - 4x + 6x)(-4x + 3x + 0x) + (x - 5x + 2x)(5x - 3x - 3x) - x*2 + 2x*2 - 2x*2 + 5x - 4x2 - 5x. -2x2 Expand (2r2 - r3 - r - 2r2)(3r2 - 3r*2 + 6r*2). -6r*5 - 6r*3 Expand (2 + 1 - 5)(-x + x + 3x) - 4x + 0x - 7x + x + 0 + 0 + (x + 0 + 0)(-2 + 3 + 0). -15x Expand (2f2 - 5f*2 + 0f*2)(4f - 2 + 3f - 5f). -6f*3 + 6f*2 Expand (-2o + 2o - o)(4o2 - 4o*2 + 2o*4) + (0o*4 + 2o*4 - 7o*4)(-4 - 4o + 4). 18o*5 Expand (3r + 1 - 1)(0r3 + r4 + 0r3) + 4r5 - r5 - 4r5 + r + r5 + 0r5 + r5. 4r5 + r Expand -k2 - 3k*2 + 6k*2 + (4k2 - k2 + k*2)(2 + 1 - 2) + (3 - k - 3)(2k - 3k - k). 8k*2 Expand (-3t + 0t + 0t + (0t + 5t - 3t)(-2 - 2 + 2) - 3t + 9 - 9)(-t + 2t4 + t - t3). -20t*5 + 10t*4 Expand (14 + 2 - 12 - 28)(-2d - d + 5d). -48d Expand (5a*2 - 2a*2 - 2a*2)(4a3 - 4a*3 + 9a*3) + (-4a + 3a + 0a)(-2a*4 - 3a*2 + 3a*2). 11a*5 Expand (-4b - 11 + 11 + (-2 - 1 + 2)(0b + 5b - 4b) - 2 + 2 - b)(6b*3 + 2b3 - b3). -42b4 Expand (v2 + v2 - 2 + v2)(-12v + 12v + 2v2 - 1). 6v*4 - 7v*2 + 2 Expand (5 + 1 - 3)(0 + 3 - 2)(a - 4a + 6a)(5a - 3a - a). 9a2 Expand (0o - o - o)((6 + 6 - 4)(-1 + 0 + 3) + 1 - 4 + 4). -34o Expand (n3 - 2n5 + n5 - 2n3)(-2 + 5 + 2) + n*5 - 3n5 + n5 + (0n3 + 0n*3 + 2n*4)(-2n - n + 2n). -8n5 - 5n*3 Expand 3a*5 + 0a*2 + 0a*2 + 3a*5 + 0 + 0 + (2a*4 - 3a*4 + 0a*4)(-a + 0a + 2a). 5a5 Expand (2y*2 + 0y*2 - 4y*2)(23y3 + 19691y - 19691y). -46y5 Expand (1 - g2 - 1)(4g*2 + 2g*2 - 4g*2) - 4g*4 + 0g*4 + 3g4 + g4 - 4g4 - 2g*4. -8g*4 Expand (-10r + 10r + r3)(3r - 3r + 2r + 0r - r + 3r + (-4r + r + 2r)(-1 + 3 - 3) + r + 4 - 4 + 0r + 0r + 2r + 0 - 2r + 0). 6r*4 Expand	{ "pile_set_name": "DM Mathematics" }
sand? 4297000 Round -0.054455601 to 5 dps. -0.05446 Round -2693.951505 to the nearest integer. -2694 What is -0.00016556228 rounded to 5 decimal places? -0.00017 What is 0.2758569 rounded to 2 dps? 0.28 What is -0.029308496 rounded to four dps? -0.0293 Round -0.00203740618 to five decimal places. -0.00204 Round -140261.192 to the nearest ten thousand. -140000 Round 0.0002490183899 to 6 decimal places. 0.000249 Round -120.484856 to the nearest integer. -120 Round -36650.5474 to the nearest 10000. -40000 What is -369.3892157 rounded to 1 dp? -369.4 What is 0.4268275 rounded to 3 dps? 0.427 Round 401542.316 to the nearest one thousand. 402000 Round -132500939.32 to the nearest 1000000. -133000000 Round 0.00049016558 to six decimal places. 0.00049 Round -197.664347 to the nearest ten. -200 Round 0.14943083 to four decimal places. 0.1494 What is -0.000093866283 rounded to 5 dps? -0.00009 Round -0.000004091731 to 5 decimal places. 0 What is 1.602271751 rounded to four dps? 1.6023 What is 32180.5585 rounded to 0 decimal places? 32181 What is 23831522760 rounded to the nearest one million? 23832000000 Round 1901.24225 to the nearest one thousand. 2000 What is 0.002545773194 rounded to 4 dps? 0.0025 What is 37274229 rounded to the nearest one hundred thousand? 37300000 Round 0.799424509 to 1 decimal place. 0.8 Round -2.48042574 to 2 dps. -2.48 Round -0.05104510881 to 6 dps. -0.051045 What is 0.000673519071 rounded to six dps? 0.000674 Round -2669.58179 to 0 dps. -2670 Round -2.67715532 to three dps. -2.677 Round -1.978934296 to 1 dp. -2 What is 760946361 rounded to the nearest one million? 761000000 What is -8731202.91 rounded to the nearest 10000? -8730000 Round -178987091 to the nearest one hundred thousand. -179000000 What is 10.9344779 rounded to 3 decimal places? 10.934 Round -0.2914874785 to five decimal places. -0.29149 Round 24702725.26 to the nearest 100000. 24700000 Round 1606053.36 to the nearest 10. 1606050 Round 25971.8211 to the nearest ten. 25970 What is 0.0015608479 rounded to four decimal places? 0.0016 Round -21168.3567 to the nearest ten. -21170 Round -2685506.01 to the nearest 1000. -2686000 What is -0.063599012 rounded to four decimal places? -0.0636 What is -0.003055562049 rounded to 7 dps? -0.0030556 What is 0.006313707328 rounded to 3 decimal places? 0.006 What is -1307577.54 rounded to the nearest 10000? -1310000 Round -0.0000027779436 to 6 decimal places. -0.000003 What is 1572948.159 rounded to the nearest 10000? 1570000 Round -0.7945891058 to two dps. -0.79 What is -367.9774788 rounded to the nearest ten? -370 What is -13.342589052 rounded to 4 dps? -13.3426 What is 830522260 rounded to the nearest 1000000? 831000000 Round -481.67671 to one dp. -481.7 What is -0.00549316905 rounded to 7 decimal places? -0.0054932 What is -214.193146 rounded to two decimal places? -214.19 What is 2.06928141 rounded to four decimal places? 2.0693 Round -4.6674127 to 2 decimal places. -4.67 Round 99517.3964 to the nearest 100. 99500 Round 3201.4544 to the nearest 10. 3200 Round -1391.94622 to the nearest ten. -1390 What is 0.000096459196 rounded to 7 decimal places? 0.0000965 Round 27036748.9 to the nearest 10000. 27040000 What is -7496.5295 rounded to the nearest one hundred? -7500 What is -0.00007602336726 rounded to six dps? -0.000076 Round -0.004690641055 to five dps. -0.00469 What is 0.00686519126 rounded to three dps? 0.007 Round 640425.8517 to the nearest 100000. 600000 What is 12.95253238 rounded to the nearest ten? 10 Round 0.435122439 to 2 dps. 0.44 What is -3651.367663 rounded to the nearest 10? -3650 What is -432948370 rounded to the nearest 10000? -432950000 What is 3.4271093 rounded to two dps? 3.43 What is -184585.411 rounded to the nearest ten thousand? -180000 What is 0.0272715679 rounded to five decimal places? 0.02727 What is -1775290.31 rounded to the nearest 1000? -1775000 What is 706321681 rounded to the nearest one million? 706000000 Round -3798254.581 to the nearest one thousand. -3798000 What is 0.0021272519 rounded to seven dps? 0.0021273 Round -21773.3922 to the nearest one thousand. -22000 Round -0.211001699 to 2 dps. -0.21 Round 200980840 to the nearest 1000000. 201000000 Round -3669.79763 to one decimal place. -3669.8 Round 232377691 to the nearest 10000. 232380000 Round 1.45915002 to two dps. 1.46 What is -1035531540 rounded to the nearest 1000000? -1036000000 Round -0.052655637 to two decimal places. -0.05 Round 0.00066409593 to 6 dps. 0.000664 What is -12.3830818 rounded to one dp? -12.4 What is -2742.8413 rounded to the nearest 100? -2700 Round 18103259.7 to the nearest one thousand. 18103000 What is 1648.95993 rounded to the nearest ten? 1650 What is -15.40725783 rounded to two decimal places? -15.41 Round 28.0965214 to 1 decimal place. 28.1 Round 81.97495 to 1 decimal place. 82 What is 8386737.4 rounded to the nearest ten thousand? 8390000 Round -0.00271123529 to six dps. -0.002711 What is -646702.652 rounded to the nearest 100000? -600000 What is 87026.5748 rounded to the nearest one thousand? 87000 What is -418286.4 rounded to the nearest 1000? -418000 Round 0.0418251438 to 3 dps. 0.042 What is -737499.874 rounded to the nearest 10000? -740000 What is 12.1927951 rounded to 1 dp? 12.2 Round -87375674.7 to the nearest one hundred thousand. -87400000 Round -40795971.8 to the nearest 1000000. -41000000 What is 3152484.7 rounded to the nearest ten thousand? 3150000 Round 0.000600503 to 3 decimal places. 0.001 Round -205.76197 to zero dps. -206 Round 0.031908068 to 4 dps. 0.0319 Round 1923.27059 to the nearest one hundred. 1900 Round 491.6086406 to the nearest 10. 490 Round -0.19901194 to 2 dps. -0.2 What is -0.1800557462 rounded to one dp? -0.2 What is -3818.51134 rounded to the nearest 1000? -4000 Round 0.0980844611 to three dps. 0.098 Round 0.18160092 to 2 decimal places. 0.18 Round -104854.137 to the nearest one thousand. -105000 What is -0.96670766 rounded to 2 decimal places? -0.97 What is -14.90677232 rounded to one decimal place? -14.9 What is -46124.9088 rounded to the nearest ten thousand? -50000 Round -0.2157220658 to two dps. -0.22 Round -0.007385574 to 4 decimal places. -0.0074 What is -238.168752 rounded to the nearest integer? -238 What is -9.80242791 rounded to 1 decimal place? -9.8 Round -56670621200 to the nearest one million. -56671000000 Round -0.0002798520436 to 5 dps. -0.00028 Round 653281.471 to the nearest 100000. 700000 Round 3411.14833 to the nearest 100. 3400 Round -308749.8886 to the nearest ten thousand. -310000 Round 414030917 to the nearest one million. 414000000 What is -102934199.7 rounded to the nearest 100000? -102900000 What is -0.1505505083 rounded to two dps? -0.15 What is -6148.805169 rounded to one decimal place? -6148.8 What is 188843.211 rounded to the nearest 1000? 189000 Round 36951.25422 to the nearest ten. 36950 What is -0.002953676601 rounded to seven dps? -0.0029537 What is -0.575689672 rounded to 3 decimal places? -0.576 What is 0.0000176737396 rounded to five decimal places? 0.00002 What is -929.53731 rounded to the nearest one hundred? -900 Round -7121222.943 to the nearest 100. -7121200 Round 48.856761 to one dp. 48.9 What is 6181628.039 rounded to the nearest ten thousand? 6180000 Round -381.579333 to two dps. -381.58 Round -17.557766 to three decimal places. -17.558 What is 2277956550 rounded to the nearest one hundred thousand? 2278000000 What is 340.547487 rounded to 2 dps? 340.55 What is -0.0002553768635 rounded to 6 decimal places? -0.000255 Round 596881.18 to the nearest 100. 596900 Round -0.0154303414 to 6 decimal places. -0.01543 Round -6264.318844 to the nearest 100. -6300 What is 0.00024243988 rounded to 6 decimal places? 0.000242 Round 0.0000369602471 to 5 decimal places. 0.00004 Round -0.12083196768 to three decimal places. -0.121 What is 1.99759572 rounded to 0 decimal places? 2 What is 0.00062956355 rounded to four dps? 0.0006 Round -5606923.75 to the nearest ten thousand. -5610000 Round -228653818 to the nearest 10000. -228650000 Round -0.01364554 to four dps. -0.0136 What is -0.0141997827 rounded to 5 decimal places? -0.0142 What is -1.69983184 rounded to one dp? -1.7 What is 7515.858015 rounded to the nearest integer? 7516 What is -0.00077	{ "pile_set_name": "DM Mathematics" }
ss -4 + d - 2 - 1 - 4d in the form w + ad and give w. -7 Rearrange 12t3 - 47t*2 + 47t*2 + (4 - 2t - 4)(3t*2 - 3t*2 - 2t*2) to z + at + qt3 + wt*2 and give q. 16 Express 27 - 14 - 20s - 13 as z + bs and give b. -20 Express 0z - 3z + z + (-3 + z + 3)(-1 - 2 + 4) + 3z - 11z - 8z in the form t + az and give a. -17 Rearrange -528 + 528 - k - 16k to the form fk + q and give f. -17 Rearrange 0r + 4r - r - 2r to the form y + kr and give k. 1 Express 11a4 - 16a + 16a + (1 + 2a - 1)(-3a*3 + 6a*3 + 0a3) - a4 + 2a4 - 3a*4 as pa + ta2 + wa*3 + oa*4 + x and give o. 15 Express -5q - q - 15q as n + dq and give n. 0 Express 2l - 1 + 0l - 2l + l2 - l3 in the form n + fl*3 + sl*2 + hl and give n. -1 Rearrange 2p - 13p*4 + 8p4 + p3 - p*2 - 2p to the form d + vp2 + xp*4 + rp + cp3 and give r. 0 Express (0 + 1 + 0)(2 - 2 - 2)(-c + 2c*3 + c)(-11 - 3 - 6) in the form lc2 + mc + gc3 + t and give g. 80 Rearrange 4h*3 - 2h2 - h4 - 2h + 639 - 639 to the form th*2 + ih*3 + q + bh + oh4 and give b. -2 Rearrange (-2 - 2d*2 + 2)(-6d2 - 2d*2 + 4d*2) + (-3d*2 + 2d - 2d)(-d*2 - 1 + 1) to the form zd*2 + yd*4 + xd*3 + hd + i and give x. 0 Rearrange -8t + 7t*2 + 2 - 2 + 0t to mt + jt2 + p and give j. 7 Rearrange 1 - 1 + h2 + (-4h + 2h*2 + 4h)(0 + 3 - 2) - 60 + 60 - 12h*2 - 2h*2 + 0 + 0 to x + fh*2 + nh and give f. -11 Express (0g + 28g + g)(-4 + 0 + 2)(-1 - 5 + 5) in the form b + fg and give f. 58 Rearrange -2c*3 + 3 + 9 - 24c*2 + 22c*2 to vc + tc2 + d + rc*3 and give d. 12 Express (36f + 30f - 62f)(4 - 5 + 0) + (-6f + 2f + 2f)(2 - 3 + 3) in the form of + g and give o. -8 Rearrange (-3k2 - 4k + 4k)(1 - 2 + 2) - k*2 + 8 - 8 to the form qk + dk2 + l and give d. -4 Rearrange (-6m*2 + 548 - 548)(m + 3m2 - m) to nm*3 + fm*4 + pm*2 + j + qm and give f. -18 Express -188t2 - 2t*3 + 3t*3 + 0t - t + 194t2 as bt*3 + j + ht + wt2 and give w. 6 Rearrange 43o - 5o2 + o2 - 45o to the form io2 + m + do and give i. -4 Rearrange 2b2 + 42b - b*3 - 20b + 2b4 - 24b - 2 to the form vb3 + tb + i + mb2 + db*4 and give i. -2 Rearrange 3x*2 - 4x*4 + 2 - 9x*4 + 6x*2 - 2x*3 + x + 11x*4 to mx*4 + sx*2 + g + tx*3 + jx and give g. 2 Rearrange -31 + 15 - t4 + 7 - t2 + 7 to xt3 + ot + dt4 + r + ht*2 and give h. -1 Rearrange 6 + 19v - 6 + 7v to o + hv and give h. 26 Express -3x + 0x + 2x - 4x + 7x + 3x + (-2x + 3x + x)(11 - 5 + 1) as ux + b and give u. 19 Express l + 0l4 - 4l*4 + 3l*4 + 3l*2 in the form fl*3 + z + tl + ql4 + bl*2 and give q. -1 Express -23i*4 + 72i*4 - 14i*4 + (4i + 2i - 4i)(0i + 0i + i3) as qi*3 + f + ci*4 + ji*2 + ti and give c. 37 Express 43t - 20 - 19 + 39 as at + x and give a. 43 Express -6z2 - 5 + 2 - 2z + 3 in the form hz + uz*2 + m and give h. -2 Express 0 + 2b2 - 4 - b3 + b*4 + 3 as pb + kb4 + g + mb*2 + jb*3 and give k. 1 Express 1217 - 1217 + 6k*2 in the form u + ak*2 + sk and give a. 6 Rearrange (2t - 3t + 4t)(5 - 4 - 2)(5t + t - 4t) to the form dt*2 + jt + v and give d. -6 Express (l*3 - 4l3 + l3)(-2 - 9 - 3)(3 - 1 - 4) in the form j + ul3 + kl + yl2 and give u. -56 Express (5c*2 + 0c*2 - 4c*2)(16c - 159 + 159) + 2c + 2c3 - 2c in the form jc + rc*3 + b + ac*2 and give r. 18 Rearrange -3h + 3h - 12h*2 - 1 to the form wh + c + ih2 and give i. -12 Rearrange -2w + 2w3 + 5w*2 - 5w*4 + 6w*4 - 3w*2 + 5w to the form i + cw3 + gw*2 + vw*4 + sw and give v. 1 Express (3o3 + o4 - 3o*3)(-3 - 2 + 4) - 24o4 + 48o*3 - 48o*3 in the form zo*2 + go*4 + bo + uo3 + n and give g. -25 Express (64t + 146t - 61t + (5 - 2 - 2)(2t + 1 - 1))(-3 - 1 + 2)(2 + 2 - 6) as ft + p and give f. 604 Express (0 + 9 + 38)(1 + 2 - 2)(2d - 2d + d2)(2d - 1 + 1) in the form f + sd*3 + od + xd2 and give s. 94 Express -4n*4 + 1 - n - 23n*2 + 7n2 - n3 + 17n2 in the form kn + xn4 + q + cn*2 + zn*3 and give z. -1 Express (6g - 22g + 1 + 10g)(0g3 - g3 + 0g3) in the form b + tg*3 + fg*4 + kg + yg2 and give f. 6 Rearrange -9a + a - a + (-2a + 3a - 3a)(-1 - 2 + 4) - 2a - 3a + 3a to the form q + va and give v. -13 Express 3y + 2y2 - y3 - y + 0y as ry + c + fy2 + gy*3 and give g. -1 Rearrange -47n*2 + 47n*2 + 8n*3 + (0 + 0 - 1)(-n*3 - 3n*3 + 3n*3) to the form an*3 + b + gn*2 + kn and give a. 9 Rearrange -8m + 3m*2 + 15m - 2 - m to the form cm + gm*2 + k and give k. -2 Express -3p*4 - 6p4 - 1 - p3 + 3p4 + 0 in the form a + xp + sp4 + cp*2 + fp*3 and give f. -1 Express (18 - 6 - 9)(o2 + o2 + 0o2) as so*2 + j + fo and give s. 6 Rearrange ((1 + 0 - 2)(2p - p + p) - 3p - 3 + 3)(-22p2 + 4p - 4p) to tp*2 + ip*3 + b + xp and give i. 110 Express 2q + q2 + 3q - 4q + 3 - 10q*4 + 8q*4 in the form i + yq*4 + kq*3 + uq + wq2 and give u. 1 Rearrange 2 - 8n*4 - 7n*3 - 2n*2 + 28n*4 + 2n*3 - 19n*4 to bn*4 + wn*3 + sn*2 + un + m and give s. -2 Rearrange -7i2 + 22i*2 - 24i*3 + 2 - 15i*2 to the form hi + zi3 + gi2 + a and give z. -24 Rearrange -h2 + 2 - 7h + 0h*2 - 6 + 0h*2 to the form a + nh + qh2 and give q. -1 Rearrange (5o + 19 - 19)(2o - 2o + 3o)(-2o*2 + 4o2 - o2) to p + no2 + ro*3 + mo*4 + fo and give m. 15 Express -14 - 4y + 12 + 0y + y*3 as a + ly*2 + uy*3 + xy and give a. -2 Rearrange -i - 5i2 + 3i*2 + 3i2 + i3 to the form n + oi + fi*2 + ui*3 and give o. -1 Rearrange (r - 7r - 2 + r)(2r + 2 - 4r - 1) to the form d + jr + sr2 and give s. 10 Rearrange -4a*3 - 2a4 - a3 - 1 + a*2 + 5a*3 to sa*4 + na*2 + ya + wa3 + o and give s. -2 Rearrange 7z*2 + 20z*3 - 4z - 6z2 - 6z*3 to the form oz*2 + k + gz + cz3 and give g. -4 Express -16a + 0a - 2a in the form va + g and give v. -18 Express (4b - b - 4b)(-21b + 45b - 33b) as ib + c + jb2 and give j. 9 Rearrange (-28s + 27s - 52s)(3 - 2 - 3 + 0) to as + z and give a. 106 Rearrange -4x + 3x - x + (2 - 5 + 0)(2x + 1 - 1) + x - 4x + 5x + (-3x + 3x + 2x + 2)(4 - 1 - 1) to the form i + px and give p. -2 Express -2u*4 + 0u*4 + 7u*3 + 10u*2 - 4u*3 as du*2 + bu + ou4 + vu*3 + i and give i. 0 Rearrange -3 + 6 + 18k - 3 to z + tk and give t. 18 Express o4 + 161o + 0o4 - 160o - 1 + o*3 as xo*2 + p + ko + yo3 + no*4 and give n. 1 Rearrange (16q*3 - 16q*3 + 23q*3)(2 - 2 + q + q) to iq2 + y + bq + nq4 + mq*3 and give n. 46 Rearrange 4r*2 + 0r*2 + 0r*2 + 3r2 + r2 - 2r2 + (-r - r + r)(r - 2r - r) to sr*2 + pr + l and give s. 8 Rearrange -s + 2s - 3s to f + ls and give l. -2 Rearrange 5 + 16c*4 + 3c*2 - 3 - 15c*4 - 10c - 4c2 to y + gc + lc2 + dc*4 + zc*3 and give l. -1 Rearrange -m - 2 + 2 - 3m + 5m - 4m + (4m - 3m + m)(-1 + 0 + 0) + 15 + 5 + 2 - m + (0 - 3 + 1)(m - 1 + 1) + 3m - 2m + 0m to f + hm and give h. -7 Rearrange -726i3 + 0i*2 + 718i3 - i2 + (4i - 2i - 4i)(i*2 - 2 + 2) - 3i3 - i3 + 2i3 to gi*3 + qi*2 + o + ri and give g. -12 Rearrange l*2 + 0l + 4l4 - 2l*2 - 2l*4 + l to sl*4 + nl*2 + h + ul*3 + gl and give s. 2 Express -23p2 + 12p*2 + 12p*2 + 7p*3 + 4p*3 in the form lp + hp3 + i + up*2 and give u. 1 Rearrange (0m*2 - 3m*4 + 0m*2)(-26 - 10 - 2 - 17) to nm4 + um + dm2 + h + im*3 and give n. 165 Rearrange -14a + 2a - 13a + a to the form xa + m and give x. -24 Express -184b + 0 - 9b2 + 183b + 0 as l + ub2 + gb and give g. -1 Express k*2 - 2k*3 - 2k*2 + 2 + k + 0k*2 as vk*2 + h + zk*3 + qk and give v. -1 Express -2v2 - 220v + 7v2 - v2 + 222v as d + bv2 + yv and give d. 0 Rearrange m - 12552m2 + 24m*3 + 12552m*2 to n + ym + wm2 + pm*3 and give p. 24 Express 7p*2 - 5p*2 - 3 + 0p*2 + 9p*2 as jp*	{ "pile_set_name": "DM Mathematics" }
vide 128 by -1. -128 6 divided by 17 6/17 Calculate 14 divided by 13. 14/13 -6070 divided by -1 6070 Calculate 558 divided by -1. -558 1607 divided by -1 -1607 What is -400 divided by -5? 80 Divide -3306 by -3. 1102 235 divided by -3 -235/3 -552 divided by -6 92 Calculate 1288 divided by -46. -28 Calculate 6 divided by 48. 1/8 Calculate 6362 divided by -1. -6362 1740 divided by 4 435 -16 divided by -348 4/87 What is 55 divided by 55? 1 What is 129 divided by -1? -129 What is -23 divided by 14? -23/14 -96 divided by 4 -24 What is 22 divided by -30? -11/15 Calculate 4734 divided by 789. 6 What is -7 divided by -99? 7/99 Calculate 4192 divided by 4. 1048 -24 divided by 37 -24/37 Divide 11805 by -6. -3935/2 -2 divided by 5901 -2/5901 Calculate 2400 divided by -80. -30 Calculate -5 divided by 125. -1/25 Divide 28 by -28. -1 18 divided by 6 3 Divide -8 by -33. 8/33 Divide -5 by 51. -5/51 What is -25800 divided by -5? 5160 -915 divided by -3 305 What is 580 divided by -10? -58 0 divided by -298 0 Calculate 26 divided by -205. -26/205 What is -2585 divided by 5? -517 Calculate 3534 divided by -3. -1178 17115 divided by -163 -105 -790 divided by 10 -79 What is -246 divided by -82? 3 -1863 divided by -81 23 69 divided by 1 69 0 divided by -92 0 Divide -465 by 93. -5 What is -146 divided by -73? 2 What is -6 divided by -89? 6/89 -225 divided by 1 -225 What is -223 divided by -1? 223 Divide 10 by -185. -2/37 Calculate -6355 divided by 2. -6355/2 Divide -200 by -5. 40 2 divided by -12 -1/6 What is 3 divided by 38? 3/38 What is 128 divided by -8? -16 Calculate 198 divided by -22. -9 -1277 divided by -3 1277/3 Calculate 11 divided by 7. 11/7 Calculate 15849 divided by 587. 27 Calculate -121 divided by 3. -121/3 Calculate 1027 divided by 5. 1027/5 What is 64 divided by -8? -8 2 divided by -1 -2 Calculate 335 divided by 1. 335 Divide 3224 by -806. -4 -7 divided by 1854 -7/1854 What is 28 divided by 7? 4 What is -24 divided by -7? 24/7 0 divided by 67 0 0 divided by 64 0 What is -1564 divided by 1? -1564 Divide 4 by 8091. 4/8091 Calculate 75045 divided by -5. -15009 Divide 296 by 8. 37 Calculate 4 divided by 3333. 4/3333 What is -100 divided by 100? -1 What is 0 divided by 2812? 0 Divide -5 by -10. 1/2 Calculate 43 divided by 43. 1 14824 divided by 1853 8 Divide -60 by -30. 2 What is -1 divided by 273? -1/273 What is 7200 divided by 4? 1800 Calculate -15603 divided by 2229. -7 Divide -492 by -23. 492/23 What is 168 divided by 3? 56 What is 4752 divided by -176? -27 Calculate -87 divided by 4. -87/4 What is -71384 divided by -2? 35692 Calculate 4060 divided by 2030. 2 What is 0 divided by 24? 0 Calculate 0 divided by 3. 0 758 divided by -17 -758/17 Divide -17590 by -5. 3518 What is 57 divided by 8? 57/8 Calculate 5 divided by -102. -5/102 Calculate 931 divided by -2. -931/2 Divide 539 by -11. -49 Calculate -4 divided by 1604. -1/401 Calculate -2 divided by 60. -1/30 Divide -2564 by -641. 4 Calculate 741 divided by -6. -247/2 Divide -1793 by -1793. 1 What is -2980 divided by -596? 5 Divide 2 by -164. -1/82 -26220 divided by 138 -190 Calculate 3 divided by 6. 1/2 Divide 0 by -1981. 0 Calculate -377 divided by -29. 13 Divide -247 by 119. -247/119 Calculate 2 divided by -2623. -2/2623 Divide -572 by 572. -1 What is -1200 divided by -8? 150 What is 229 divided by -1? -229 What is 4137 divided by 21? 197 Divide -192 by -8. 24 -2601 divided by -867 3 Calculate 126 divided by 7. 18 Divide -10080 by 315. -32 What is 20 divided by -56? -5/14 What is 3 divided by -2000? -3/2000 What is 0 divided by 1950? 0 Divide -122 by -5. 122/5 Calculate -592 divided by -2. 296 What is -60 divided by 2? -30 What is -495 divided by 15? -33 76 divided by -2 -38 What is 4 divided by -151? -4/151 Divide 700 by -2. -350 8 divided by -40 -1/5 Divide -524 by 131. -4 What is -404 divided by 404? -1 Calculate -325 divided by -5. 65 Divide -1879 by -1879. 1 What is 2 divided by -40? -1/20 Divide 4 by -3527. -4/3527 Calculate -105 divided by 35. -3 Divide 5 by 308. 5/308 Divide -15 by 78. -5/26 What is -1155 divided by -77? 15 Calculate -586 divided by -293. 2 What is -92 divided by -5? 92/5 What is -1584 divided by -36? 44 Divide -2836 by 709. -4 Divide -3 by -357. 1/119 Divide 856 by -214. -4 Divide -41 by -5. 41/5 What is -4 divided by -24? 1/6 Calculate -6663 divided by 3. -2221 What is -688 divided by 2? -344 Divide -14 by 87. -14/87 Divide 609 by -21. -29 Divide 8 by 18. 4/9 Divide 0 by 105. 0 Calculate -108 divided by 36. -3 Divide 3 by 31. 3/31 Calculate -21 divided by -3. 7 Calculate 212 divided by -53. -4 Divide 13 by 13. 1 What is -390 divided by -130? 3 What is 81 divided by -394? -81/394 Calculate -5 divided by -2108. 5/2108 8162 divided by -22 -371 Calculate -6 divided by 1. -6 Divide -1041 by 3. -347 Calculate -2861 divided by -6. 2861/6 Calculate 1278 divided by -6. -213 Divide -6520 by -326. 20 -6 divided by -2 3 What is 3600 divided by 3? 1200 Calculate -17100 divided by -6. 2850 -16 divided by -60 4/15 What is -646 divided by 5? -646/5 Divide 31 by -28. -31/28 What is 594 divided by 2? 297 17 divided by 37 17/37 Calculate 0 divided by -2. 0 316 divided by 8 79/2 Calculate -3 divided by -341. 3/341 Calculate 513 divided by 57. 9 600 divided by -150 -4 What is 1100 divided by -220? -5 Calculate -4 divided by -86. 2/43 126 divided by -3 -42 Divide -101 by -3. 101/3 -199 divided by 24 -199/24 25 divided by 40 5/8 255 divided by 5 51 Calculate -371 divided by -4. 371/4 Divide 7 by 9. 7/9 What is 11970 divided by 855? 14 Divide 0 by 7. 0 Divide -1413 by 4. -1413/4 What is -5 divided by -35? 1/7 Divide -9030 by -35. 258 -4 divided by 501 -4/501 Divide 1220 by -4. -305 Calculate 0 divided by 2627. 0 Divide 0 by -904. 0 What is 3 divided by -3? -1 Divide -451 by 41. -11 143 divided by 4 143/4 What is 8 divided by 57? 8/57 Calculate 41 divided by 41. 1 What is -1848 divided by -462? 4 0 divided by -2310 0 What is 430 divided by 86? 5 Divide 128 by -2. -64 Divide -93726 by 6. -15621 Divide -684 by -5. 684/5 17 divided by -37 -17/37 Divide 1 by -271. -1/271 Calculate 272 divided by -68. -4 Calculate -612 divided by 204. -3 Divide -628 by 314. -2 Divide 1490 by 298. 5 Divide 4644 by 2. 2322 Divide -135 by 5. -27 What is 4769 divided by 4? 4769/4 -1064 divided by 38 -28 What is 280 divided by -70? -4 What is 264 divided by -132? -2 What is -774 divided by -258? 3 Divide -3 by 515. -3/515 Calculate -2732 divided by 2. -1366 28 divided by 296 7/74 Divide 4191 by 3. 1397 Divide 1 by -3. -1/3 Divide -1 by 46. -1/46 What is -26 divided by 14? -13/7 -56 divided by 6 -28/3 29 divided by 29 1 Divide 2692 by -4. -673 What is 1110 divided by -6? -185 Divide -6 by 8. -3/4 -2 divided by -779 2/779 Divide 1134 by 6. 189 What is -84 divided by -16? 21/4 320 divided by 64 5 What is 100 divided by -20? -5 -975 divided by -25 39 Divide -318 by 53. -6 What is 15 divided by 135? 1/9 Divide 1440 by 480. 3 Calculate 3 divided by -73. -3/73 What is 265 divided by -4? -265/4 Calculate -2604 divided by 434. -6 -3125 divided by 125 -25 Divide 15290 by -3058. -5 7252 divided by -98 -74 Calculate 51 divided by 2. 51/2 Calculate 3 divided by -100. -3/100 What is -99 divided by 73? -99/73 Divide -159 by -17. 159/17 What is 12 divided by 64? 3/16 Calculate 5 divided by 1882. 5/1882 Divide 8643 by -3. -2881 Divide -94448 by -4. 23612 Calculate 5 divided by 63. 5/63 Divide -7302 by 3. -2434 What is -408 divided by 1? -408 Divide 2880 by -96. -30 176 divided by 44 4 Divide -672 by 3. -224 Calculate -4875 divided by -5. 975 Calculate 27 divided by 90. 3/10 Divide -120 by 4. -30 -10152 divided by -2 5076 -1 divided by 565 -1/565 50 divided by -108 -25/54 What is -100 divided by -25? 4 Calculate -114 divided by 57. -2 2 divided by 1003 2/1003 What is 1679 divided by 4? 1679/4 Divide 4030 by 2015. 2 Calculate 27 divided by -305. -27/305 What is -121 divided by 5? -121/5 What is 1 divided by -5? -1/5 Calculate -5832 divided by -216. 27 What is -7700 divided by 14? -550 What is 103 divided by 1? 103 What is 0 divided by -49? 0 37 divided by 12 37/12 What is 30480 divided by 5? 6096 Divide 231 by 105. 11/5 -354 divided by 6 -59 Calculate 116 divided by 12. 29/3 Divide -182 by 16. -91/8 Calculate 40 divided by -5. -8 What is -9	{ "pile_set_name": "DM Mathematics" }
08 0.0096 What is -0.136 times -0.06? 0.00816 -5 times -133 665 Work out -8 * -26. 208 120830.4 4833.2 -38 times 3.2 -121.6 -6 10.78 -64.68 -2.6-0.52 1.352 1.1 2.5 2.75 Calculate -1500-4. 6000 0.2 times -996 -199.2 Calculate -2-29.1. 58.2 Product of 8 and 12. 96 Product of 718 and -1. -718 24 * -5 -120 2080.43 6241.2 1 3939 3939 -0.30.0703 -0.02109 What is -2030 times -3? 6090 What is the product of -224.7 and -1? 224.7 Work out 40 0.3. 12 Calculate -0.140.042. -0.00588 What is -0.4 times -33.34? 13.336 -0.1 -365 36.5 What is the product of -0.8 and 116? -92.8 13-2 -26 Calculate -458-7. 3206 Work out 4 * 0. 0 Work out -0.3 * 8.077. -2.4231 -1 * 1.1 -1.1 Multiply 0.01 and -35.4. -0.354 Work out -0.1621 * 0.5. -0.08105 Calculate 126-0.008. -1.008 -3043 times -0.3 912.9 -7 0.4 -2.8 What is the product of -0.566 and 0.5? -0.283 Product of 1.31 and 2. 2.62 What is the product of 0.468 and -0.4? -0.1872 What is 64 times 43? 2752 -0.7-0.94 0.658 -7 -1620 11340 -4 * 50 -200 -1.4 * 0.25 -0.35 Multiply -9 and -0.1413. 1.2717 -0.202 times 1 -0.202 -4 times -22 88 Product of 11 and -2.9. -31.9 -0.7060.5 -0.353 Calculate 891. 89 Work out -0.07 * 74. -5.18 -5 * -8.3 41.5 Calculate 50.115. 0.575 Calculate -11.57-4. 46.28 0.033 times -0.053 -0.001749 Calculate -145-4. 580 What is 3799 times -5? -18995 Calculate 0.10.0029. 0.00029 Work out 100 * 0.1. 10 -3.87-0.03 0.1161 Product of 12 and -1118. -13416 Work out 78 7. 546 What is -419 times -14? 5866 0.17 * 1.14 0.1938 0.1 times -867 -86.7 Work out 3 * 18.22. 54.66 What is 295 times 0.2? 59 -50 * -0.1 5 What is 5 times -2370? -11850 Multiply 997 and -0.3. -299.1 What is -0.3 times 32? -9.6 0.03074 0.1228 -0.2522 -5.5 -890.5 -44.5 What is the product of 7 and -0.04? -0.28 98-0.02 -1.96 3.5245 857.5 0.3-0.69 -0.207 Product of -1.8 and -4. 7.2 What is -0.059 times 0.05? -0.00295 Multiply 0.4 and 0.448. 0.1792 5 times -32.3 -161.5 What is the product of 3 and 14? 42 78-0.1 -7.8 450.3-0.5 -225.15 Calculate -0.5-0.084. 0.042 -7552 times -4 30208 -22 43 -946 -150.06 -0.9 0.2 -0.0313 -0.00626 2.9 * -13 -37.7 Multiply 0.5 and -193. -96.5 Calculate 12.50. 0 Product of 1 and 5.31. 5.31 -0.3-86 25.8 -45.90.4 -18.36 Calculate 5-0.341. -1.705 Work out -98 * -0.2. 19.6 -1960 times 0.2 -392 -137.95 -689.5 260.21 5.46 0.11 * -22 -2.42 Product of 0 and -0.475. 0 What is 4 times -456? -1824 -1-13.2 13.2 What is -6 times 285? -1710 -0.1 times -1.278 0.1278 -358 times 0.021 -7.518 Multiply -2174 and -0.4. 869.6 Product of 0.0683 and 0.5. 0.03415 What is the product of 0.4 and 0.461? 0.1844 Multiply -977 and -2. 1954 Product of -319.3 and 0.3. -95.79 -1.7 2.2 -3.74 Calculate -0.178. -7.8 Product of 0.53 and -11. -5.83 Calculate -44.50.4. -17.8 Product of 219 and 0.26. 56.94 0.4 times -0.347 -0.1388 Work out -19 * 16. -304 What is the product of 0.32 and -10.2? -3.264 -0.45 times 7 -3.15 What is 12.2 times 0.1? 1.22 Calculate -0.3264. -1.304 Product of 13 and 8. 104 Calculate -0.30.0837. -0.02511 Product of -5.5 and -73. 401.5 -0.1 times -0.0022 0.00022 3784 * 0.4 1513.6 What is 89 times 1? 89 Product of -20.5 and -0.4. 8.2 0.284 times -0.4 -0.1136 Multiply 0 and -1.11. 0 -641 * -0.13 83.33 Product of 7 and -19. -133 Multiply 748 and -2. -1496 Product of -0.0001 and 4. -0.0004 386 * -0.1 -38.6 -5 times 0.59 -2.95 250.6 * 3 751.8 What is the product of -0.1 and -220? 22 What is 0.207 times -1.6? -0.3312 -0.50.22 -0.11 Product of -4.3 and 0.3. -1.29 Work out -1 4541. -4541 0.08 * 0.51 0.0408 What is the product of 13 and -0.84? -10.92 1.43 * 4 5.72 What is the product of -19 and 2.97? -56.43 What is the product of -9 and 2034? -18306 Work out -3 * -348. 1044 -0.30.047 -0.0141 Product of 4 and -2.9. -11.6 Calculate -120. -20 What is the product of -5 and -0.341? 1.705 Work out 0.09 * -0.107. -0.00963 What is the product of 111.35 and -0.3? -33.405 What is 5.5 times -109? -599.5 Multiply -293 and -9. 2637 Product of 49 and -24. -1176 Product of -220 and -11. 2420 Product of 0.3 and -6.1. -1.83 -36 times -11 396 Product of -0.2 and -23. 4.6 Product of 0.4 and 0.0589. 0.02356 What is -29 times 0.0242? -0.7018 0.15 times -0.2 -0.03 Calculate -3-15.6. 46.8 -1.1 times -63 69.3 Work out 0.3 437. 131.1 Product of -13161 and -1. 13161 0.05 times 0.02 0.001 Multiply -8.8 and -0.018. 0.1584 0.2 * -100 -20 What is 82 times -0.6? -49.2 0 * 4.1 0 -3 times 0.07447 -0.22341 What is 2 times 624? 1248 Work out 0.0124 * -0.3. -0.00372 Calculate -23-20. 460 Calculate -58-0.08. 4.64 Product of -32.7 and -3. 98.1 Multiply 46 and -0.4. -18.4 10-1.1 -11 What is 5 times -14? -70 Multiply -0.5 and -21. 10.5 -0.0681-2 0.1362 11 times 12.8 140.8 What is the product of -0.3 and -0.73? 0.219 Product of 29 and 1.3. 37.7 17672 * -1 -17672 Multiply 0.11 and -0.61. -0.0671 0.087 * 1 0.087 Product of 0.39 and -0.2. -0.078 Calculate -3-3919. 11757 -24479-2 48958 -1 * -5.2 5.2 Work out 0.22 * -0.047. -0.01034 What is the product of 2 and -54? -108 Calculate 56.8-6. -340.8 What is 0.0436 times 0.2? 0.00872 Multiply 127 and 103. 13081 Calculate -0.04-0.1. 0.004 What is 2 times -0.69? -1.38 Multiply -10.5 and 2. -21 Multiply -0.04 and -1.529. 0.06116 Product of 12 and 10. 120 What is the product of 1.67 and -0.3? -0.501 Work out 106.8 * 1. 106.8 Calculate 351-4. -1404 0.151 109 16.459 4 * -1301 -5204 What is 0.529 times 0.4? 0.2116 -947 times -0.4 378.8 What is -2 times 378? -756 0.2 times 0.0361 0.00722 Multiply 11 and -58. -638 Product of 13 and -0.1561. -2.0293 -2 * 0.062 -0.124 Product of 0.12 and 0.9. 0.108 0.1-15.4 -1.54 -0.34 -0.266 0.09044 What is -13 times -939? 12207 0 times 0.088 0 What is the product of 0.1 and 35? 3.5 -8 times -33 264 What is the product of -4 and 0.121? -0.484 Multiply -4 and -21. 84 0.1 times -0.0729 -0.00729 -242 * -0.2 48.4 Multiply -40 and 0.31. -12.4 Calculate 0.41-0.08. -0.0328 Calculate 1.7-1.99. -3.383 Work out -0.56 * -0.018. 0.01008 Multiply 19 and -209. -3971 -6821 * 0.4 -2728.4 -19974 -7988 0.48 2 0.96 -70 times 54 -3780 -57043 * -0.5 28521.5 What is the product of -5 and 1.06? -5.3 Work out -0.3 * -1428. 428.4 61025 6150 Calculate -2446-2. 4892 0.4 * -0.3 -0.12 120-7 -840 Calculate -0.31557. -467.1 What is 13 times -0.28? -3.64 What is 1.3 times 279? 362.7 Calculate -4-31. 124 0.022 -147 -3.234 0.1 * -5.5 -0.55 Work out 1616 * 2. 3232 Product of -0.2 and -0.011. 0.0022 Multiply 3 and 1390. 4170 What is the product of 4 and -1.9? -7.6 -4 times -10.4 41.6 What is the product of -55 and -5? 275 0.7 * -0.41 -0.287 What is the product of -0.5 and -914? 457 Calculate 1-19.2. -19.2 -1.436-4 5.744 Calculate -0.50.462. -0.231 Calculate 1.71-3. -5.13 What is -1.6 times 0.12? -0.192 What is 1751 times -0.4? -700.4 -0.6927 * 0.1 -0.06927 Multiply 0.12 and 0.038. 0.00456 Product of -31 and -0.19. 5.89 Work out -0.4 * 21. -8.4 12.71 2.71 Product of 3 and 672. 2016 What is the product of -0.1 and -940? 94 Work out -0.00051 5. -0.00255 Multiply 52 and 1. 52 3-8.3 -24.9 8840.2 176.8 Product of -0.3 and 0.02. -0.006 Product of 5 and 2. 10 What is -1759 times -15? 26385 Multiply 5.9 and 131. 772.9 What is -9 times -2.4? 21.6 Work out 0.4 * 1.957. 0.7828 5.50.037 0.2035 Work out 3960 0.4. 1584 What is 6 times -20? -120 Product of 0.1 and 0.516. 0.0516 Calculate 0.4543. 217.2 What is -3 times -101? 303 What is the product of 5 and -172? -860 What is -5 times 0.04298? -0.2149 Multiply 0.2 and -32. -6.4 Product of -65 and 5. -325 What is 1.4 times 35? 49 Calculate -28-0.5. 14 Work out 2.09 * 13. 27.17 Multiply 0.77 and -20. -15.4 Multiply -4.8 and -4. 19.2 01650 0 141 26 3666 What is the product of 1 and 9.98? 9.98 81 * 1.4 113.4 1 * 31 31 Product of 4 and 0.256. 1.024 Calculate 10490.03. 31.47 What is 0.5 times -2948? -1474 -208.65 -1043 Multiply -0.7 and 58.7. -41.09 What is the product of 5 and -291? -1455 -0.0965 * 2 -0.193 Work out 4 * 408.5. 1634 What is the product of 40 and 5? 200 Calculate 1-1.21. -1.21 -0.033 times 0.2 -0.0066 0.5 times -186 -93 Product of -0.6 and 65. -39 Calculate -1016.24. -4064.8 What is the product of -1 and -31.32? 31.32 Work out 0.3 * -1.6. -0.48 -1 * -5 5 Work out -0.06 * -6.91. 0.4146 0.0163*4 0.0652	{ "pile_set_name": "DM Mathematics" }
260))/(1/(-104)-2) 44 What is 24541/(-291)441/(-539)? 69 What is 1587720/15726/(-40)(-6)/9? 101 (-56)/(-6)5370/1253 40 Calculate (16/20)/(((-2568)/(-540))/(-107)). -18 (34364/(-20306))/((-2)/(-52)) -44 What is ((-5)/((-25)/(-24))5)/((-239424)/(-1117312))? -112 (308/(-18))/((15939/(-567))/(-253)) -154 (442/(3850704/(-2970)))/(6/16) -10/11 Calculate 2048/1536(-3)/16-284. 71 What is (180/(-8))/(-9)-15(-13)/546-28? -25 Calculate 860/(-559)(-5)/50-6. -12/13 What is the value of (92)/((3/5)/((-13684)/(-34210)))? 12 What is the value of ((-2(-47)/(-6298))/4)/((-1)/(-8))? -2/67 What is ((-1028)/(-497809))/(-414/364)? -2/149 What is (-196)/(-21)((-36)/(-126))/((-3)/(126/(-8)))? 14 ((-27)/4)/((-2063)/8252) 27 What is the value of 384/(-3)1174/(-3522)? 28 (-921)/2149238/(-36) 17/6 What is the value of (456/52)/((-83)/((-22659)/63))? 38 1/(((-32)/742487)/((-159)/(-4))) -106 Evaluate (2243/(-2243))/(34/(-10)). 5/17 What is the value of (52/(-77740)-46)/((12)/(-40))? -8/13 Calculate (-1)/((((-12)/4)/1)/((-642)/(-7597))). 2/71 Evaluate ((-2)/(-5))/(45526/13390). 2/17 What is the value of (-4776)/(-31840)(-3710)/(-42)(-4)/5? -53/5 Evaluate ((-728)/(-780))/(28/100)(-72)/(-20). 12 4(258/(-32))/(369/492) -43 Calculate (-5)/(-7)(-4)/(-35)(-44541)/(-12120). 3/10 Calculate (2(44/55)/(-4))/(36/7560). -84 Evaluate (-2742/(-2457))/((-1)/3). -18/13 8/(-3)((-9)/(4320/1400))/((-15)/27) -14 What is the value of (81/78)/((-85914)/(-6364))? 1/13 What is (3-20)/(((-39)/(-3510)-8)/(22/(-165)))? -90 What is the value of (-38)/((-8360)/740)-11? -37 Evaluate 77(1116/40920)/((-2)/(-40)). 42 What is the value of 1599/(-82)(-5)/(120/16)? 13 (((-440)/66)/(24/198))/(-11)(-86)/10 -43 Evaluate (-2)/(-4)-18(-25)/(3125/(-75)). -27/5 Calculate ((-195)/1)/((3/30)/(((-513)/810)/19)). 65 27/(-66)(15/30)/((-4)/163) 3/11 (-50)/((-1)/(-2)2705/(-541)) 20 What is the value of (-84)/18(-3036)/644? 22 What is the value of (63/71417)/(15/44)? 22/5 What is the value of (15/(-198))/((-132)/10164)? 35/6 What is the value of (((-48)/14)/((-45)/42))/(723/2415)? 48 (38592/(-11256))/(3/561) -64 What is the value of (568/639)/((-64)/(-48))? 2/3 Calculate 81(-30)/(-780). 4/13 What is -7(-15)/(-210)(9/(-10))/(-9)? -1/20 What is the value of (30/24)/(131/3144)? 30 Evaluate (9/(1071/(-68)))/((-190)/(-7)). -2/95 What is (160/(-120))/((6/32)/(10/((-400)/(-90))))? -16 What is the value of -63/(81/147)(-19)/665-105? -98 Evaluate (((-2)/10)/((-222)/370))/(1058/414). 3/23 Calculate (689/(-53))/(8944/32). -2/43 What is ((-2709)/387)/((13/13)/(30/(-14)))? 15 (-1)/(-60(-72)/380160) -88 What is the value of ((-2340)/(-312))/((-18)/(-3))? 5/4 Calculate (-10)/(26/((-12272)/(-120))7/(-21)). 118 Calculate (-14)/(-51)(2/3)/((-78)/351). -14/17 (-32)/(-4)(-4)/10(-40)/(-32) -4 What is -155/(-4)(-60)/90(-30)/(-25)? -15 Evaluate (-240)/(-198)3641/(-993). -40/9 What is (1155/(-45))/(-11)6(-3)/(-49)21? 18 Calculate (5177/31062)/(2/(-138)). -23/2 Calculate ((3/(75/160))/(252/(-14)))/(15/150). -32/9 ((-24)/(-465))/((-59)/((-17110)/(-116))) -4/31 Evaluate ((2/(-6))/(-1))/((-2560)/(-78720)). 41/4 What is the value of (((-30804)/(-128))/(-151))/(6/48)? -51/4 ((-270)/(-141))/((-9681)/(-303338)) 60 Evaluate ((7511/148)/29)/(21/6)10. 5 What is (121836/(-12496))/((-6)/(-16))? -26 ((-4)/14)/((7/476)/((-96)/(-768))) -17/7 What is (40/600-24)/((-1)/(-15))? -24 Calculate 16/((-5824)/780)-21. 45 Calculate (((-6)/(-4))/((-60)/(-9)))/(19563/49140). 9/10 What is the value of (8/(-12))/(572/(-4680)4)? 15/11 Evaluate (75120/(-16902))/((-14)/(-36)). -80/7 What is the value of 16/32(80/14)/(330/385)? 10/3 ((832/24)/(-26))/((-550)/(-33)) -2/25 Evaluate (-69)/69(-4)/(-88). -1/22 6/(-462)11049/(-5) 14 (((-6)/(84/(-14)))/7)/((-78)/6) -1/91 What is the value of (-1)/((14/63)/(63/((-3402)/12)))? 1 What is the value of (3/((-30)/4))/((-130)/(-2275))? -7 What is ((198/(-12))/33)/(35/(-50))? 5/7 What is (200/35)/(320/(-64))? -8/7 What is the value of (-7)/(-1)-149366/(-2481297)? 2/13 Evaluate 6/(-120)-5(-115)/(8280/42912). -149 Evaluate 50/(-805)39417/(-37540). 3/46 What is the value of (3510/91)/(790/1106)? 54 Calculate (30916/3668)/((28/49)/(-4)). -59 (-114)/(((10/44)/(-1))/((-950)/3135)) -152 Calculate (55/(12320/192))/(12/476). 34 Evaluate ((-116)/(-2))/(3002/(-4503)). -87 ((-2)/(36/45))/(14/((-1456)/(-65))) -4 Calculate (12/(-88))/((-29)/((-957)/(-6)))8/(-2). -3 54098/(-9836)2/2013 -1/183 Evaluate (-253)/(-66)130/5980. 1/12 ((-11)/(605/10))/((62/(-2))/1023) 6 What is (-1722)/(-2665)(-450)/(-105)? 36/13 Calculate (132/(-456))/((-182)/1729). 11/4 Calculate (-848(-705)/(-7520))/((-6)/(-4)). -53 What is (-105)/(-36)(-296)/11160/112? -25/6 Evaluate 4857/(-1824)32/(-42). 8/7 What is ((-49)/245938/(-7))/(3/((-30)/4))? -67 Calculate ((-2112)/(-5610)17)/((-6)/15). -16 Evaluate 46/(1/((-72)/648(-9)/(-2))). -23 Evaluate (-2)/46/356/29820-30. 4/71 Calculate (610/(-366))/(5/822)4/(-16)-2. -137 Evaluate (60/(-55))/(((-35)/(-385))/((-4)/(-44))). -12/11 What is ((-819)/105)/(208/(-800))? 30 4/(-771)(-1)/44814/(-112) -2/257 What is (80467/(-4804))/(1/((-12)/3))? 67 Calculate (424/11660)/((-4)/(-410))-11. -41 (2415/115)/((-56)/(-48)) 18 Calculate (260/364)/((-21)/(882/(-24))). 5/4 What is ((-300)/1440)/(44/8(-4)/((-704)/24))? -5/18 Evaluate (6/(-21)-7)/(1-3)27378/31941. -4/7 What is ((13992/(-5300))/(18/(-45)))/(((-2)/5)/2)? -33 Evaluate ((-93)/62)/((-30)/(-440)). -22 Calculate 319/1044-45(-4)/(-10). -11/2 38630/(-123616)(-8)/5 1/2 (-210)/(-126)(-9)/5804/1072 -9/4 What is ((-6)/(-28))/((-70)/((-215600)/(-210)))? -22/7 Calculate (-1)/(10/(-135))(-3)/((-18)/12). 27 Evaluate (-1026)/(-1197)1470/(-240). -21/4 What is (2/(-10)45/(-9))/(23/(2254/28))? 7/2 Calculate 7/(22/3080-35). -28 Evaluate ((-18)/57)/(((-39520)/240)/(-247)). -9/19 (-291106)/6167525/2 -59 (-104/(-16))/((23258/3609)/(8/45)) 2/29 What is ((-3149)/(-329))/(((-4)/14)/(114/(-57)))? 67 Evaluate 5029425/22353(-2)/(-9). 50 Evaluate (4(-9)/(-594))/((-356)/178). -1/33 Evaluate 215/(-645)1845/(-41). 15 What is the value of 3((-30)/(-60)104)/2? 78 What is (-7(-56)/196)/(2/33)? 33 (24(-28)/1344)/(-1) 1/2 Calculate (25/301)/(770/(-231)). -1/4 What is 16(-21)/(-48)(-3168)/(-3696)? 6 Calculate (-1)/23468/7803(-2295)/(-6). -85 Evaluate ((-30)/(-130))/((-19227)/(-4901)). 1/17 What is the value of (-944)/(-4)((-4)/(-80))/(9/(-225)5)? -59 What is the value of ((63/30)/(-1))/((-10)/150)2/24? 21/8 (1875(-21)/105)/5 -75 Evaluate ((-4)/(-10))/((-3)/(-6)(-66)/11220). -136 Calculate (-9(-5)/105444/111)/(10/(-35)). -6 What is (429663/32890)/(-479)(-10)/6? 1/22 What is (-208)/676(-884)/(-2380)? -4/35 Evaluate (-880)/(-88)2/(-4)(-2)/60. 1/6 What is the value of (40/(-80)0)/(-213)? 0 Calculate ((-506)/69)/(48/6(-2)/(-24)). -11 What is the value of ((-34)/68)/(9/26)2? -26/9 Calculate (1344/(-5040))/(14/(-45)). 6/7 4/(-4)399/18(-2)/1 33 What is the value of ((-107)/(-1284)-740)/((-10)/(-6))? -37 Calculate ((-53922)/4902)/((-1)/(-4)1). -44 (-2094/(-235)10/400)/((-1)/67) -67/5 What is the value of 16/20(2450/(-80))/(-49)-7? -7/2 Calculate (1321089/(-19866))/((2(-7)/(-10))/(-2)). 95 ((-198)/((-6)/1))/(((-325)/390)/((-50)/(-18))) -110 What is the value of ((-5)/4)/((-190)/3306)-5(-20)/(-25)? -87 What is ((-2)/3(-110)/(-110))/((-439)/3951)? 6 Evaluate (-5460)/(-43680)72/(-11). -9/11 What is the value of (1344/(-216))/(-14)-18? -8 What is the value of ((-31)/(279/(-6)))/((-46)/(-1035))? 15 What is the value of (1512/(-27))/(2/48(-22)/(-11))? -80 What is (1/((-114)/8))/(6214/9321)? -2/19 Calculate ((1/(-3))/((-9)/(-81)-3))/(22/(-22)). -1 What is ((-14)/(-42))/((128/(-144))/4)? -3/2 -4(6/(-2216))/(5/(-2)(-30)/50) 2/277 What is (((-13)/(1729/(-42)))/(160/1140))/((-10)/32)? -36/5 Evaluate (92(-64)/(-94208)20/3)/((-40)/(-3)). 1/32 What is the value of 12/(-33)4440/2880? -2/9 What is (-4)/1624/42(-420)/1050? 2/35 Evaluate (1242/2760)/((-867)/(-340)). 3/17 (-4641)/(-238)((-18)/(-21))/(135/(-840)) -104 What is ((-23495)/(-32893))/((-8)/(-14))? 5/4 ((3960/11616)/(27/24))/(1/12) 40/11 What is 51/(-18)((-1881)/374)/57? 1/4 27/((-810)/525)*(-21)/((-1323)/(-72)) 20 (567/504)/(1269/(-6))	{ "pile_set_name": "DM Mathematics" }
(w - 4)(w + 1)2 Let b = 71263/5412 - 488/41. Let k = b - -3/44. Find u, given that -1/3u*4 + 0u - 4/3u2 + 0 + ku*3 = 0. 0, 2 Determine s so that 1/6s*3 - 1/6s + 0s2 + 0 = 0. -1, 0, 1 Let i(r) be the second derivative of 0r*4 + 0 + 0r*2 - 3/20r*5 - 1/56r*7 + 1/10r*6 - 32r + 0r3. Suppose i(x) = 0. Calculate x. 0, 2 Let n(z) = 2z*3 + 8z*2 + 117z + 471. Let t be n(-4). Factor -3/5q2 - 3/5q*t + 3/5 + 3/5q. -3(q - 1)(q + 1)*2/5 Find n such that 2/3n - 1/3n4 + 1/3n*2 + 0 - 2/3n3 = 0. -2, -1, 0, 1 Let k(b) be the second derivative of b6/6 - 2b5 + 5b*4/2 + 20b*3/3 - 35b*2/2 - 12b + 2. Factor k(l). 5(l - 7)(l - 1)*2(l + 1) Let q(o) be the second derivative of -1/36o4 - 2/9o*3 - 31o - 1/2o2 + 0. Factor q(w). -(w + 1)(w + 3)/3 Let c(q) = q + 15. Suppose o - 5b + 4 = 0, -2o + 2b = -2b + 14. Let d be c(o). Factor 2w2 - dw*2 + 2w + 4w3 - 6w*3 + 4. -2(w - 1)(w + 1)(w + 2) Let n = 67 + -74. Let c = n + 7. Factor 0s - s3 + 0s*2 - 7/2s*5 + 9/2s4 + c. -s3(s - 1)(7s - 2)/2 Let x be 1488/(-32) - -36 - (-12 - -1). Factor t2 - t3 - 3/2t*4 - 1/2t*5 + 3/2t + x. -(t - 1)(t + 1)4/2 Let b be (-16)/40242/(-200). Let x = b - -2/125. Solve -3/2s2 - 1/2s*3 - x - 3/2s = 0. -1 Let g be 8/6-12(-7)/56. Factor 2/5 + 1/5ig - 3/5i. (i - 2)(i - 1)/5 Suppose 5y = 3n - 2 + 131, 0 = 2y - n - 51. Factor 2x3 - 27x*2 - 2x*3 + 3x*3 + yx + 0x3. 3x(x - 8)(x - 1) Determine o, given that -20o + 68o*2 - 70o*2 + 54o = 0. 0, 17 Let l(w) be the second derivative of 0w3 + w2 - 1/12w*4 + 0 - 2w + 1/60w5. Let g(x) be the first derivative of l(x). Factor g(c). c(c - 2) Let r(t) be the second derivative of -3t5/70 - t4/42 + t3/7 + t2/7 - 10t. Factor r(n). -2(n - 1)(n + 1)(3n + 1)/7 Let l(c) be the third derivative of -c*6/660 + 7c5/330 + c4/132 - 7c3/33 - 28c*2. Suppose l(m) = 0. What is m? -1, 1, 7 Let o be 0/(-2) - (1 - -2). Let d be (o - (-10)/3)21. Solve u*2 + 6u*2 + 2u*3 + du - 3u - 4 = 0. -2, 1/2 Let v = 84 + -87. Let h be v21/9016/(-84). Factor -h - 2/15n*5 + 2/5n - 4/15n3 - 4/15n*2 + 2/5n*4. -2(n - 1)*4(n + 1)/15 Let c = -355/19 + 19. Let o(a) = -a*2 + 38a - 103. Let y be o(35). Solve cby + 2/19 + 6/19b + 2/19b3 = 0. -1 Let y(b) be the first derivative of 3/35b*5 - 20 + 0b*4 + 0b*2 + 3/7b - 2/7b3. Factor y(n). 3(n - 1)*2(n + 1)*2/7 Let j be -3 + 2 - ((-342)/4 - -2). Let w = -81 + j. Suppose -wy3 - y2 + 3/2y + 1 = 0. What is y? -1, -2/3, 1 Let v be (322/(-28) - -11)0/3. Factor 3/5z2 + v + 0z. 3z2/5 Suppose -w - 19 = -2d, -2d + 8 + 16 = 4w. Factor 20i3 - 5i*4 - 20i - 12 + 28 - 1 - di2. -5(i - 3)(i - 1)2(i + 1) Let f(w) be the first derivative of -21w5/5 + 183w*4/4 + 25w*3 - 183w*2/2 - 54w + 185. Suppose f(g) = 0. What is g? -1, -2/7, 1, 9 Factor 4/3s4 - 32/3s*3 - 40/3s - 76/3s2 + 0. 4s(s - 10)(s + 1)*2/3 Let a(t) be the second derivative of -21t*5/20 + 18t*4 - 10t*3 - 7t - 30. Find m such that a(m) = 0. 0, 2/7, 10 Suppose 11m - 176 = -33. Let v be (m/(260/32))/1. Factor vh + 2/5h2 + 8/5. 2(h + 2)*2/5 Suppose 5r = -0r + 10. Suppose 0 = 5u + 3f - 35, 272 = 8u - 4f + 260. Let -3/5i*3 - 1/5i - 3/5ir + 0 - 1/5iu = 0. Calculate i. -1, 0 Let n(z) be the second derivative of -z5/20 + z*4/3 - 2z*3/3 - 2z + 1. Determine f so that n(f) = 0. 0, 2 Let c(o) be the third derivative of -o7/840 + o5/120 - 2o3/3 + 2o*2. Let f(a) be the first derivative of c(a). Solve f(n) = 0. -1, 0, 1 Let d = -1/1370 + 1097/1370. Suppose 8/5p - d - 4/5p2 = 0. What is p? 1 Let o = -35 - -4. Let c = -28 - o. Suppose -1/2b*2 - cb - 9/2 = 0. What is b? -3 Let k(a) = -16a3 + 11a*2 - 9a - 7. Let f(x) = -11x3 + 7x*2 - 6x - 5. Let t(r) = -7f(r) + 5k(r). Factor t(d). -3d(d - 1)*2 Suppose 10l - 8 = 14l. Let i be 34/40 - l/(-8). Find h, given that 12/5 + ih*2 - 12/5h = 0. 2 Let n(i) be the second derivative of -1/96i4 + 9i + 0i2 + 0 - 1/48i3. Solve n(h) = 0. -1, 0 Let b(d) be the first derivative of d6/75 - 4d5/125 - 4d*4/25 + 32d*3/75 + 16d*2/25 - 64d/25 - 680. Let b(k) = 0. What is k? -2, 2 Find z such that -2z3 - 2z3 - 40 - z3 + 237z2 - 272z*2 - 70z = 0. -4, -2, -1 Let f(u) be the first derivative of u*7/126 - 2u6/45 + u5/12 - u*4/18 + 16u + 34. Let p(w) be the first derivative of f(w). Suppose p(d) = 0. What is d? 0, 1, 2 Let a be 2 + 3 + (-55)/11. Suppose 0b + 7 = -2d + 5b, -3d - 3b + 21 = a. Factor 0 + 1/2v + 5/6v3 - 7/6v*2 - 1/6v*d. -v(v - 3)(v - 1)2/6 Let f = -8793/5 - -1767. Determine q so that -2/5q*3 - 16/5q*2 - fq - 36/5 = 0. -3, -2 Suppose 872m + 24 = 884m. Find n, given that -7/9n4 + 13/9n + 1/9n5 - 22/9n*2 + mn*3 - 1/3 = 0. 1, 3 Let n(g) = -g + 7. Let l be n(7). Suppose -4s + 3w = 5w + 6, -3s + 5w + 15 = 0. Suppose -h*2 - h - h + lh + sh = 0. What is h? -2, 0 Suppose -4l = 2i + 18, 0i = 3l - 4i + 30. Let n be 10(l/(-30) + 6/20). Determine f, given that 9/2f*4 + 3/2f*2 + 0 + 0f - 3/2fn - 9/2f*3 = 0. 0, 1 Let x be ((-2)/(-1))/24. Let y(p) = -p*3 - 5p*2 + 8p + 14. Let v be y(-6). Suppose -w*4 + 0w*3 + 2 + 2w*v - 3w*x - 6w*3 + 6w = 0. Calculate w. -1, -1/2, 1 Let q(g) be the third derivative of 0 + 6g2 - 2/15g*4 + 0g - 1/150g5 - 16/15g*3. Factor q(v). -2(v + 4)2/5 Let j(t) be the second derivative of -t5/50 - t*4/30 + 2t*3/15 + 20t. Factor j(m). -2m(m - 1)(m + 2)/5 Let y = -51 - -37. Let g(b) = -b4 + b3 - b + 1. Let m(h) = 9h*4 - 5h*3 - 6h*2 - 3h - 11. Let a(s) = yg(s) - 2m(s). Solve a(q) = 0. -1, 2 Let h be (30/16)/((-126)/(-840)). Solve 5/2u4 - hu*2 - 15/2u*3 + 0 + 5/2u*5 - 5u = 0 for u. -1, 0, 2 Let b = -189 + 189. Let f(v) be the first derivative of 0v2 + bv*3 + 0v - 1/2v4 + 3. Suppose f(p) = 0. Calculate p. 0 Let k(p) be the third derivative of p6/4 + p5/15 - p4/12 + 10p*2. Factor k(n). 2n(3n + 1)(5n - 1) Let r(x) be the first derivative of 4x3/15 - 6x*2 + 56x/5 + 147. Factor r(l). 4(l - 14)(l - 1)/5 Factor 7f - 14 - 2 + f2 - 2 - 4f. (f - 3)(f + 6) Let q(m) be the first derivative of -m4/5 - 14m*3/5 - 9m*2/5 + 4m + 103. Solve q(o) = 0 for o. -10, -1, 1/2 Let t(a) be the second derivative of -a*4/12 - 3a3/8 - a2/4 + 3a - 22. Solve t(f) = 0 for f. -2, -1/4 Let p = -113 - -116. Find l, given that -599 + l4 + 599 - pl*2 + 2l*3 = 0. -3, 0, 1 Suppose 4716o - 4686o = 0. Find x, given that ox - 4/7x4 + 0 + 0x*2 - 8/7x*3 = 0. -2, 0 Let w(p) be the first derivative of -49p*5/10 - 175p*4/8 + 18p*3 + 25p*2 + 8p - 117. Suppose w(j) = 0. Calculate j. -4, -2/7, 1 Suppose -q - 8 = -3q. Let a be 10/q - 33/(-22). Find k such that 34k*4 - 40k*3 + 20k*2 + 3 - ak*4 - 8k*5 - 5 = 0. -1/4, 1 Let f(b) be the third derivative of -13b*6/960 - 9b5/80 - b4/24 + 99b2. Let f(s) = 0. What is s? -4, -2/13, 0 Let o be (-7)/((-84)/(-18))(1 + -5). Let k be (-4)/8o2/(-2). Factor 17/2gk - 20g*2 + 0 + 8g - g*4. -g(g - 4)*2(2g - 1)/2 Let w(r) be the third derivative of -1/280r*6 + 16r*2 + 0 - 1/7r*4 - 9/140r*5 + 0r*3 + 0r. Suppose w(k) = 0. What is k? -8, -1, 0 Let x(u) = u*2 + 21. Let d be x(0). Let t be 2/7 - (-57)/d. Find r, given that -4r - 5r2 + 4r - r*4 + 2r*t + 4r*2 = 0. 0, 1 Let h(v) = 8v - 2. Let y be h(-1). Let p be y/45 + (-20)/(-9). Factor -6q - 5q2 - q2 + 3qp. -3q(q + 2) Factor -51a + 5a2 - a2 + 60 + 0a*2 + 44 - 9a. 4(a - 13)(a - 2) Let d be ((-4)/(-14))/(10/70). Suppose 5m = -2o + 8, dm - 2o + 12 = o. Solve -3/4z3 + 0z*2 - 27/4z*5 + m + 9/2z*4 + 0z = 0 for z. 0, 1/3 Let z = -27 - -34. Let x(a) = -a + 11. Let w be x(z). Solve -2c - c3 - 3c + w + 5c2 - c - 2c = 0. 1, 2 Let s(t) be the second derivative of t7/840 - t6/120 + t5/40 + t4/3 - 28t. Let v(g) be the third derivative of s(g). Find b such that v(b) = 0. 1 Let n(v) = -40v*3 + 55v*2 - 5v - 5. Suppose 20 - 24 = 4x. Let s(m) = m3 + m - 1. Let z(r) = xn(r) + 5*s(r). What is p in	{ "pile_set_name": "DM Mathematics" }
r, 0 = -4s - 3u + 2u + 24. What is the units digit of s? 7 Suppose -13y - 114 = -153. What is the hundreds digit of (7/(-2) + y)/((-3)/1560)? 2 Let o(u) = -5u + 6 - 12u*2 + 2u*3 - 3u*3 + 12u*2 + 5u*2. Suppose 2s = 5i - 2s, -4s + 36 = 4i. What is the units digit of o(i)? 2 Let o(p) = -p*3 + 6p*2 + 8p - 2. Let y be o(7). Suppose -3n + yl = -20, 5n - 4 = 5l + 16. Suppose nw = -2w + 248. What is the units digit of w? 4 Suppose -5h = o - 15, 0 = -2o - 0o - h + 3. Suppose o = 9q - 21q + 7020. What is the hundreds digit of q? 5 Suppose 0 = -3h + 2p + 50 + 85, -p = 2h - 97. Suppose -hs - 2442 = -50s. What is the units digit of s? 4 Let w(v) be the first derivative of v*3/3 - 3v*2 + 7v + 1. Let h = -1995 + 2008. What is the tens digit of w(h)? 9 Let c be (-43)/(-129) + 32/(-6). What is the units digit of (-2)/((-108)/20 - c)? 5 Let b = -2015 + 4086. Let p = -852 + b. What is the tens digit of p? 1 Let f be (20/60)/(22/22548). Let k = 3222 - f. What is the thousands digit of k? 1 Suppose 142471 = 19p - 206711. What is the units digit of p? 8 Suppose 0 = 4b + 5x - 1498, -5b = 3x - 0x - 1866. Let a(o) = -16o - 592. Let q be a(-37). Suppose v + 5v - b = q. What is the tens digit of v? 6 Let q be 1 - (1 + 3 - 201). Suppose 74c = 73c + q. What is the units digit of c? 8 Let r = -10080 - -20907. What is the tens digit of r? 2 Let a(k) = -7 + 51k - 55k - 18. What is the units digit of a(-35)? 5 Let o(i) = -13i*2 + 6 + 0 + 14i*2 - 3i*2 + 45i. What is the tens digit of o(13)? 5 Let y = 112497 + -31275. What is the hundreds digit of y? 2 Let z be 21/14 - 42/(-4). What is the tens digit of -76(25/(-4) + (-3)/z)? 9 Let u = -1577 - -1087. Let y = 58 - u. What is the tens digit of y? 4 Suppose 796z - 747z - 486325 = 0. What is the hundreds digit of z? 9 Let b(i) = 2i*2 - 2i - 916. What is the thousands digit of b(64)? 7 Let l = 30595 + -12011. What is the ten thousands digit of l? 1 Suppose 276x + 286x - 553x = 20412. What is the thousands digit of x? 2 Suppose -94a = -87a - 189. Let n = a + 116. What is the hundreds digit of n? 1 Let k(s) = 57s*2 + 39s - 559. What is the ten thousands digit of k(16)? 1 Suppose -g = h + 807, 7g = -h + 5g - 810. Let j = 2644 + h. What is the units digit of j? 0 What is the tens digit of 34211 + 4/((-44)/(-77))? 8 Let a be (-10)/6(-24)/20. What is the tens digit of ((9744/(-18))/(-7))/(a/9)? 4 Let h(a) = 13a2 + 13a + 48. What is the units digit of h(-13)? 6 Suppose -k + 5 = 5. What is the tens digit of (k - (-93)/(-2))(-48)/36? 6 Let z(m) = -m3 + 64m*2 + 83m - 120. What is the thousands digit of z(56)? 9 Let a(l) = 2l3 - 58l*2 + 24l - 438. What is the tens digit of a(35)? 0 Suppose 0 = -233l - 23 - 404 - 39. Let s(p) be the third derivative of -7p6/30 + p5/15 + 7p4/24 + 5p*3/6 - 2p*2. What is the units digit of s(l)? 1 Let s(z) = -99z - 8736. What is the units digit of s(-198)? 6 Let j(y) be the second derivative of y*5/20 + 13y*4/12 - 3y*3/2 + 12y*2 + 21y. Let w be j(-13). Let g = w + -40. What is the hundreds digit of g? 1 Let v(c) = -321c - 776. What is the hundreds digit of v(-46)? 9 Let t = -39389 - -79707. What is the ten thousands digit of t? 4 Suppose 38q - 74q - 69876 = -45q. What is the tens digit of q? 6 Let w(a) = 18a2 - 3 - 310a + 147a + 0 + 154a. What is the tens digit of w(-4)? 2 Suppose -2f - 8 = -2j, 2j = -j - 2f + 22. Suppose jo = 3o + 228. Suppose 0z = 4l + 3z - 319, o = l - 3z. What is the units digit of l? 9 What is the units digit of 3/(-2)2 + (551 - -4330)? 8 Let l = -2750 - -14860. What is the ten thousands digit of l? 1 Let q(u) = 233u - 6. Let a be q(4). Suppose -a = 75b - 77b. What is the tens digit of b? 6 What is the ten thousands digit of ((-84)/18)/14 - (2 - (-130377)/(-9))? 1 Suppose -11l + 14l = -8l + 110759. What is the thousands digit of l? 0 Let y be (-1)/(-2)1 - (-9)/(-2). Let q = y - -7. Suppose -3o = -4t - 19, qo + t - 4t - 18 = 0. What is the units digit of o? 5 Suppose 2v + 6f = 7f + 44599, -2v - 5f = -44605. What is the tens digit of v? 0 Suppose -3n - 13 = -10, 2n - 78 = -5y. Suppose -yv + 14653 = -13395. What is the units digit of v? 3 Let g = 160 + -243. Let w = g + 91. Suppose -3h - 1355 = -wh. What is the units digit of h? 1 Let f be (1 + 1)(-11)/(-11). Suppose -fq + 2k + 274 = 0, k = 2 + 3. What is the units digit of (q/3)/(2/3)? 1 Let d(o) = -36o3 + 15o*2 + 83o + 30. What is the thousands digit of d(-7)? 2 Suppose 5f = 2u - 21, -2f = 4 - 6. Suppose 0q = 3q + 9, -2q - 22 = -4h. Suppose ud - hd = 1197. What is the units digit of d? 3 Suppose 7g + 242 - 1901 = 0. Suppose g + 427 = 8u. What is the units digit of u? 3 Let x = 120 + -17. Suppose 143 = -3n - x. Let g = n + 117. What is the units digit of g? 5 Suppose -b + 5t = -12599, 63067 = 5b + 8t - 9t. What is the units digit of b? 4 Let o = 2782 - -6386. What is the thousands digit of o? 9 Suppose 32701 = 2p + 5f, -16346 = -288p + 287p - f. What is the ten thousands digit of p? 1 Let g(d) = 75d - 35. Let q be g(7). Suppose 4t + 2u - 380 = 0, 5u + 0u + q = 5t. What is the units digit of t? 6 Suppose 5090220 + 15958756 - 3998281 = 435o. What is the ten thousands digit of o? 3 Let o(v) = v3 - 60v*2 - 146v + 187. What is the units digit of o(63)? 6 Suppose -10n = -20124 - 24706. What is the hundreds digit of n? 4 Let v = 86 + -142. Let u = 220 + v. What is the hundreds digit of u? 1 Let d(j) be the first derivative of 9j2/2 - 9. Let n(z) = z2 + 10z. Let o(h) = -3d(h) + 2n(h). What is the tens digit of o(5)? 1 Suppose -4j + 84 = -2j. Suppose -5t + 27 = 2v + 3, 5v - 5t = -10. What is the units digit of j/3 - (v + (0 - 2))? 4 Suppose -232425 = -11a + 20091. What is the thousands digit of a? 2 Let s(j) = -43j - 251. Let i be s(-6). What is the hundreds digit of 138((-808)/(-48) - i)? 3 Let m(b) = -b*2 - 6b + 2. Let k be m(-5). Let i be (-3)/(-5)(k + -2). Suppose -w - 250 = -5x, 127 + 25 = ix - w. What is the tens digit of x? 4 Suppose -5w + 40 = -3r - 1980, 3w + 2r - 1212 = 0. Suppose 5u - 3z - 1404 = -354, -2z = 2u - w. What is the tens digit of u? 0 Let g(m) = 37m*2 + m + 5. Let s(r) = -73r*2 - 11. Let u(z) = 9g(z) + 4s(z). What is the hundreds digit of u(-3)? 3 Let f(h) = 105h - 149. Let y be f(11). What is the tens digit of (-8)/(-1) + -1 + y? 1 Let y be (1/((-10)/6))/(4/(-20)). Suppose 0 = 2p + v - 21 + 1, 4p - yv = 30. Suppose 11u - p = 10u. What is the units digit of u? 9 Let y(p) = p3 + 65p*2 + 83p + 362. What is the hundreds digit of y(-62)? 7 Let a = 46005 + -24671. What is the ten thousands digit of a? 2 Suppose 22g - 54g = 47g - 1415048. What is the tens digit of g? 1 Suppose 15n + 457 - 1672 = 0. What is the units digit of n? 1 Let i(y) = 6y3 - 29y*2 - 200y - 49. What is the tens digit of i(20)? 5 Let g = -469 - -435. Let c(a) = a*2 + 17a + 39. What is the tens digit of c(g)? 1 What is the tens digit of ((-1116)/(-434))/((-2)/(-2800))? 0 Let p(g) be the second derivative of 35g5 - g4/12 - g3/3 + g2 + 17g - 1. What is the hundreds digit of p(1)? 6 Let x(j) = -j + 10. Let h be x(8). Let r(l) = -147lh + 5 - l + 2l - l*3 + 148l2. What is the units digit of r(0)? 5 Let r(t) = -t3 + 11t2 + 29t + 9. Let v(c) = 5c2 + 2c + 4. Let z be v(-3). Suppose 3m - 3j = 45, -3m + j + z = -j. What is the units digit of r(m)? 8 Suppose -4j = -2m + 3434, m - 4j - 2073 = -364. Suppose -11o - m = -6015. What is the hundreds digit of o? 3 Let h be (0/3)/((-60)/20). Suppose 2w - p - 1208 = -3p, 5w + 4p - 3017 = h. What is the units digit of w? 1 Suppose -15y = -y - 82418. What is the hundreds digit of y? 8 Let k(j) = j*2 - 25j + 26. Let p be k(24). What is the tens digit of 1/p1088 - 4? 4 Let w = -64 - -64. Let t be (4 - w)/((-11)/11). What is the hundreds digit of (-1)/(2/177)t/3? 1 Let z be 4(-7)/(-266) - (-186)/38. Suppose 146 = 2g - 3o, -zg + 252 = -g + 4o. What is the units digit of g? 7 Let n = 46 + -52. Let z be 6(-3)/n + 5/(-5). Suppose -zg + 200 = -2t, -4g - 7t = -2t - 373. What is the tens digit of g? 9 Let k(a) = 25a*2 + 351a -	{ "pile_set_name": "DM Mathematics" }
18w + 4w - 26w - 2w*2 wrt w. -228w*2 - 4 What is the second derivative of -32g + 15g2 - 8g + 17g wrt g? 30 Let l be (-210)/(-168)2/15. Let s(h) be the second derivative of 0 - 3/2h2 + 2h - lh3. Differentiate s(z) with respect to z. -1 Let a(c) = c3 + c2 + c + 4. Let o be a(0). What is the derivative of -3 - ou*4 + 0 + 10u*4 - 2 wrt u? 24u3 Let n be 3/(9/(-6)) + 6. What is the third derivative of -q4 - 3q4 + 2q*2 + 5q*n + 3q*4 wrt q? 96q Suppose 0z + 5z + 66 = -4p, -4z - 48 = 2p. Let c be (-14)/(-35) + (-26)/z. Differentiate 3l*3 + 4 + 3l*c - 4l*3 - 5 with respect to l. 6l*2 Let t be (-4)/(-6) + 100/3. Let i be t/9 - (-4)/18. What is the third derivative of -5y*4 + 5yi - y4 + 4y4 - 2y*2 wrt y? 72y Let v be 22/(1 - -1). Suppose -2d = -3d + vh - 3, 0 = -5d + 4h + 3. What is the first derivative of -1 + 0 + c*4 + d wrt c? 4c*3 Let n(x) be the second derivative of -19x*6/30 - 14x*2 - 15x. Find the first derivative of n(u) wrt u. -76u3 Let f(g) be the second derivative of 9g*5/20 + 23g*4/12 + 5g. Find the third derivative of f(p) wrt p. 54 Let j(u) be the first derivative of u*2 - 6u + 2. Find the first derivative of j(p) wrt p. 2 Find the third derivative of 8r4 + 4r*3 + 8r*2 - 12r*3 + 8r*3 wrt r. 192r What is the second derivative of 8t + 2t*2 - 18t - 3t2 - 6t2 wrt t? -14 Let p(o) = o5 + 6o4 - 6o*3 - 7o. Let z(r) = -5r4 + 5r*3 + 6r. Let n(a) = -5p(a) - 6z(a). What is the second derivative of n(g) wrt g? -100g3 Let o(u) be the second derivative of -4u*5/5 - 13u*4/12 + 22u. Find the third derivative of o(r) wrt r. -96 Let i(r) = -2r3 + 12r*2 + 6r + 6. Let q(d) = -d*3 + 13d*2 + 5d + 5. Let x(l) = 2i(l) - 3q(l). Find the second derivative of x(u) wrt u. -6u - 30 Let d(f) be the second derivative of -f4 + 7f*3/6 - 8f. What is the second derivative of d(t) wrt t? -24 What is the first derivative of 8b2 - 28 - 14 + 6 - 8 wrt b? 16b Suppose 2k + 5k = 3k. Let t(d) be the second derivative of 0d*4 + 0 + kd*3 + d + 1/15d*6 + 0d*5 - 2d*2. What is the derivative of t(r) wrt r? 8r3 Let f(w) be the second derivative of -w7/210 + w5/60 + w3/2 + 3w. Let d(a) be the second derivative of f(a). What is the second derivative of d(t) wrt t? -24t Let t be (2 + 6/4)-2. Let g(x) = 3x*5 - 6x + 7. Let c(a) = 2a5 - 4a + 5. Let u(j) = tc(j) + 5g(j). What is the second derivative of u(z) wrt z? 20z3 Let j(m) = -15m*3 - 6m*2 - 6m + 14. Let l(c) = 30c3 + 13c*2 + 13c - 29. Let w(z) = 13j(z) + 6l(z). Find the first derivative of w(a) wrt a. -45a2 Suppose 0 = p - 5p + 20. What is the third derivative of -t*5 + 5t*5 - 4t*2 - 2t*p wrt t? 120t*2 Find the second derivative of 2 + 17f*2 - 9f*2 - 2 - 4f wrt f. 16 Let j be 10/(-30) - 22/(-48). Let v(y) be the third derivative of 0y + 0 - jy*4 + 3y*2 + 0y*3 + 1/30y5. What is the second derivative of v(c) wrt c? 4 Let q(f) = f3 - 2f2 - 2f + 1. Let h(z) = z3 + z2 + z. Let g(s) = 4h(s) + 2q(s). What is the derivative of g(v) wrt v? 18v2 Let d(l) be the second derivative of -13l6/30 - l4/6 - 13l. What is the third derivative of d(a) wrt a? -312a Let q(o) = -35o3 + 43o*2 - 2o - 2. Let s(x) = -105x3 + 129x*2 - 7x - 7. Let l(v) = -7q(v) + 2s(v). What is the third derivative of l(a) wrt a? 210 Let n(y) = -y3 + y2 - y + 1. Let r(t) = -11t5 + 2t*3 - 2t*2 - 3t - 2. Let s(j) = -2n(j) - r(j). What is the second derivative of s(z) wrt z? 220z*3 Let y(z) be the third derivative of 0z*4 - 3z*2 + 0z + 0 + 1/60z5 - 1/6z*3. What is the first derivative of y(q) wrt q? 2q What is the first derivative of -i*2 - 4 + 5 - 2i*2 wrt i? -6i Let v(y) = -16y4 + 9y + 7. Let o(i) = -4i4 + 2i + 2. Let w(j) = -18o(j) + 4v(j). What is the derivative of w(g) wrt g? 32g3 Let b = 3 - -3. Find the third derivative of -3g*6 + 4g*b + 2g*2 - 3g*6 wrt g. -240g3 Let x(s) = s4 + 3s3 - 14s. Let z(f) = 3f4 + 5f*3 - 27f. Let t(i) = -5x(i) + 3z(i). What is the second derivative of t(h) wrt h? 48h2 What is the second derivative of 17x - 42x4 + 24x*4 - 7x wrt x? -216x2 Let k(s) = -s. Let n(d) = -8d*2 + 10d. Let h(l) = k(l) + n(l). Find the second derivative of h(v) wrt v. -16 Let f(n) be the third derivative of 5n2 + 7/60n*5 + 0n*4 + 7/120n*6 + 0n*3 + 0n + 0. Find the third derivative of f(a) wrt a. 42 What is the third derivative of -k*5 + 6k2 - k4 + 252 - 503 + 254 wrt k? -60k2 - 24k Suppose -4 = 2f + 2f. Let s = f - -4. Find the third derivative of -5l4 + 3l*2 + 5l*4 + sl*5 wrt l. 180l2 Let t(a) be the third derivative of a7/35 - 7a4/24 - 5a*2. Find the second derivative of t(b) wrt b. 72b2 Let k(q) be the first derivative of q4/4 - 5q2/2 + 1. Find the second derivative of k(x) wrt x. 6x Let k(w) = 6. Let h(n) = -n*2 + 17. Let x(f) = 4h(f) - 11k(f). What is the first derivative of x(l) wrt l? -8l Let v(s) be the second derivative of -s*7/280 - 5s4/24 - s3/6 + 2s. Let h(b) be the second derivative of v(b). Find the first derivative of h(m) wrt m. -9m*2 Differentiate -12q*3 - 3 + 17q*3 - 3 wrt q. 15q2 Let k(c) be the first derivative of c7/105 - c4/8 + c2/2 + 1. Let m(s) be the second derivative of k(s). Find the second derivative of m(h) wrt h. 24h2 Let c(g) be the first derivative of 9g4 - g3/3 - 65g - 60. Differentiate c(d) wrt d. 108d*2 - 2d Let f be (-3)/(-5) - (-2)/5. Let k = f - 1. Find the second derivative of kp - 2p + p3 + p3 wrt p. 12p Let c(w) = w2 + 5w + 3. Suppose f - 4 = 3f + 2s, -4s = 2f - 2. Let r be c(f). Differentiate 16y - 16y - 2y4 + r with respect to y. -8y*3 Let l(m) be the first derivative of 0m*3 + 0m - 2m4 - 9 - 3/2m*2. What is the second derivative of l(a) wrt a? -48a Let m(x) = 61x3 + 2x - 4. Let v(i) = -i. Let f(o) = m(o) - 4v(o). What is the second derivative of f(h) wrt h? 366h What is the third derivative of 2q5 - q2 + 2q*2 + 6q*5 wrt q? 480q*2 Suppose -o = -1 - 1. Let w be 8/o - (-4)/(-2). Find the second derivative of 6q*2 - 4q2 - q - qw wrt q. 2 Let j(p) be the second derivative of -p*7/3 + 2p*4/3 - p. What is the third derivative of j(m) wrt m? -840m*2 Find the first derivative of 4o4 - o4 - 5o4 + 2 - 7 wrt o. -8o*3 Suppose 0 = 4p - 7 - 5. Find the second derivative of -3qp + 4q*3 - 3q + 3q3 - q3 wrt q. 18q Let f be 1 + 0 - (0 + -4). Find the second derivative of 2b + 15b*4 - 2b*f - 15b*4 wrt b. -40b*3 What is the second derivative of 4t*4 - 3t*2 - 32t*4 - 11 + 12 + 4t*2 + t wrt t? -336t*2 + 2 What is the first derivative of -14 - 23n*3 - 457n*2 + 457n*2 wrt n? -69n*2 Let j(z) be the first derivative of -1 + z + 0z*2 - 3/5z*5 + 0z*4 + 0z*3. What is the first derivative of j(b) wrt b? -12b*3 Let o(q) be the second derivative of 5q7/42 + q4/12 + 6q. Find the third derivative of o(h) wrt h. 300h*2 Suppose 2j - 10 + 6 = 0. Find the third derivative of 6r2 + 3r*5 - jr*2 - 12r*5 wrt r. -540r2 Let k(d) be the first derivative of -d7/14 - d*4/12 - 2d - 4. Let f(t) be the first derivative of k(t). Find the third derivative of f(p) wrt p. -180p2 Let x = -1 + 3. Let s(f) be the first derivative of x + f2 - 4f + 5f + 0f. Differentiate s(v) wrt v. 2 Let f(z) = -z - 6. Let d be f(-8). Find the third derivative of 2a3 + da*3 + 2a*2 + 5a*2 - 9a*2 wrt a. 24 Let w be 4(0 - (-3)/6). What is the first derivative of -w + 0g3 - g3 - 2 + 2 wrt g? -3g*2 What is the second derivative of -9y*5 + 0y + 26y5 + 3y + 0y wrt y? 340y3 Let s(c) = -c6 - c5 + c2 - c. Let j(q) = 4q6 + 8q*5 - 4q*2 + 8q. Let x(w) = -j(w) - 8s(w). Find the third derivative of x(u) wrt u. 480u*3 Let x be (5/(-375))/((-2)/5). Let m(g) be the third derivative of 0g*4 + 0 + 0g - 1/6g3 + xg*5 - 2g*2. Differentiate m(f) with respect to f. 4f Let x(u) be the first derivative of -47u4/4 + 22u + 11. What is the first derivative of x(k) wrt k? -141k*2 What is t	{ "pile_set_name": "DM Mathematics" }
he prime factors of 40967587? 40967587 List the prime factors of 8142111679. 13, 626316283 What are the prime factors of 565700470? 2, 5, 56570047 List the prime factors of 870092077. 870092077 What are the prime factors of 21994528? 2, 29, 137, 173 List the prime factors of 97811152. 2, 6113197 List the prime factors of 512997295. 5, 401, 255859 List the prime factors of 160219883. 17, 9424699 What are the prime factors of 1281959487? 3, 23, 1283, 1609 What are the prime factors of 214468544? 2, 3351071 What are the prime factors of 1782071258? 2, 11, 53, 463, 3301 List the prime factors of 2805017037. 3, 199, 4698521 List the prime factors of 95447180. 2, 5, 17, 41, 167 List the prime factors of 125877203. 6577, 19139 What are the prime factors of 681859938? 2, 3, 67, 1696169 List the prime factors of 6722449714. 2, 337, 2957, 3373 List the prime factors of 95122445. 5, 11, 1729499 What are the prime factors of 87293082? 2, 3, 14548847 What are the prime factors of 5047590849? 3, 7, 2447, 98227 List the prime factors of 815927985. 3, 5, 1249, 1613 List the prime factors of 91622484. 2, 3, 19, 29, 31, 149 List the prime factors of 126740175. 3, 5, 1689869 What are the prime factors of 2101269078? 2, 3, 419, 278609 List the prime factors of 72062014. 2, 17, 37, 57283 List the prime factors of 211978942. 2, 7, 15141353 What are the prime factors of 1133215556? 2, 11, 19, 101, 13421 List the prime factors of 614589. 3, 349, 587 What are the prime factors of 1073025245? 5, 83, 2585603 List the prime factors of 161007549. 3, 797, 67339 What are the prime factors of 165699943? 1129, 146767 What are the prime factors of 50082742? 2, 25041371 What are the prime factors of 92643287? 11, 23, 33289 List the prime factors of 332739001. 7, 19, 929, 2693 List the prime factors of 134856298. 2, 41, 409, 4021 What are the prime factors of 65742466? 2, 2003, 16411 List the prime factors of 57566470. 2, 5, 13, 23, 1481 List the prime factors of 2083651926. 2, 3, 23, 15098927 List the prime factors of 44179692. 2, 3, 149, 24709 List the prime factors of 498624158. 2, 249312079 What are the prime factors of 10556095? 5, 11, 191929 List the prime factors of 53182480. 2, 5, 13, 51137 List the prime factors of 511864433. 18089, 28297 What are the prime factors of 1993484079? 3, 221498231 What are the prime factors of 1222234400? 2, 5, 1527793 List the prime factors of 1363908193. 29, 47031317 List the prime factors of 446788227. 3, 67, 1009, 2203 List the prime factors of 51531350. 2, 5, 13, 79279 List the prime factors of 66700258. 2, 33350129 What are the prime factors of 52704297? 3, 79, 24709 List the prime factors of 1209775099. 13, 4817, 19319 List the prime factors of 261602033. 7, 11, 485347 List the prime factors of 761255102. 2, 19, 20033029 What are the prime factors of 33059402? 2, 16529701 List the prime factors of 415890152. 2, 43, 53, 22811 What are the prime factors of 21926975? 5, 7, 107, 1171 What are the prime factors of 1914056115? 3, 5, 29, 4400129 What are the prime factors of 160193750? 2, 5, 19, 71 What are the prime factors of 4668680239? 37, 10567, 11941 List the prime factors of 3193222534. 2, 1596611267 What are the prime factors of 1477464523? 2393, 617411 What are the prime factors of 90474204? 2, 3, 17, 443501 What are the prime factors of 345465499? 79, 4372981 List the prime factors of 3467391223. 3467391223 List the prime factors of 172253570. 2, 5, 97, 311, 571 List the prime factors of 8796758. 2, 71, 61949 What are the prime factors of 159154932? 2, 3, 2411, 5501 What are the prime factors of 124954821? 3, 13883869 What are the prime factors of 4880678995? 5, 6257, 156007 List the prime factors of 1289750816. 2, 61, 660733 List the prime factors of 2078166317. 313, 6639509 List the prime factors of 1152034783. 67, 17194549 List the prime factors of 138332093. 2161, 64013 What are the prime factors of 49530431? 23, 97, 149 What are the prime factors of 10082597? 7, 19, 41, 43 List the prime factors of 15096219. 3, 61, 82493 List the prime factors of 792136968. 2, 3, 7, 163, 28927 List the prime factors of 239561496. 2, 3, 79, 101, 139 What are the prime factors of 1430060219? 7, 204294317 List the prime factors of 122976557. 11, 67, 166861 What are the prime factors of 27398983? 211, 129853 List the prime factors of 167622690. 2, 3, 5, 5587423 List the prime factors of 5970253734. 2, 3, 991, 334693 What are the prime factors of 142589286? 2, 3, 7, 103, 10987 What are the prime factors of 1650455557? 17, 59, 811, 2029 What are the prime factors of 723489529? 7, 103355647 What are the prime factors of 104032707? 3, 17, 2039857 What are the prime factors of 7214872238? 2, 7, 515348017 What are the prime factors of 3271881124? 2, 47, 499, 34877 What are the prime factors of 4661469828? 2, 3, 661, 195893 List the prime factors of 16420986. 2, 3, 599, 1523 List the prime factors of 184295134. 2, 92147567 What are the prime factors of 16369760? 2, 5, 11, 71, 131 What are the prime factors of 120443453? 13, 17, 659, 827 List the prime factors of 145176886. 2, 72588443 What are the prime factors of 38960409? 3, 467, 27809 What are the prime factors of 504140658? 2, 3, 7, 12003349 What are the prime factors of 1130524316? 2, 151, 163, 11483 What are the prime factors of 206001378? 2, 3, 11, 1040411 List the prime factors of 89848039. 89848039 List the prime factors of 1768172526. 2, 3, 599, 163993 List the prime factors of 404366228. 2, 7, 97, 21269 List the prime factors of 399684273. 3, 167, 797773 What are the prime factors of 33685534? 2, 17, 241, 4111 List the prime factors of 4659813938. 2, 13, 23, 43, 7879 List the prime factors of 199604073. 3, 66534691 List the prime factors of 135905588. 2, 7, 13, 37, 10091 What are the prime factors of 243431561? 31, 457, 17183 List the prime factors of 276461043. 3, 92153681 What are the prime factors of 2207716936? 2, 79, 3493223 What are the prime factors of 34926086? 2, 13, 1343311 List the prime factors of 148839195. 3, 5, 9922613 What are the prime factors of 1984315804? 2, 496078951 List the prime factors of 35742614. 2, 17871307 What are the prime factors of 33806046? 2, 3, 5634341 List the prime factors of 219051102. 2, 3, 397, 91961 What are the prime factors of 31352028? 2, 3, 457, 5717 List the prime factors of 1008570738. 2, 3, 7, 24013589 List the prime factors of 1051170308. 2, 29, 1181, 7673 What are the prime factors of 478938718? 2, 83, 2885173 List the prime factors of 74057130. 2, 3, 5, 7, 2399 List the prime factors of 137838208. 2, 1076861 What are the prime factors of 425069685? 3, 5, 9445993 What are the prime factors of 861873668? 2, 19, 769, 14747 List the prime factors of 468261695. 5, 11, 29, 173, 1697 What are the prime factors of 9174717632? 2, 1201, 119363 List the prime factors of 1851244565. 5, 370248913 List the prime factors of 1301380807. 22993, 56599 List the prime factors of 1040194511. 181, 31751 List the prime factors of 37584520. 2, 5, 939613 List the prime factors of 26380560. 2, 3, 5, 109919 What are the prime factors of 24942498? 2, 3, 7, 593869 List the prime factors of 337373452. 2, 13, 6487951 What are the prime factors of 247696835? 5, 49539367 What are the prime factors of 24493722? 2, 3, 11, 71, 5227 List the prime factors of 82415224. 2, 10301903 List the prime factors of 1895204438. 2, 17, 19, 2933753 What are the prime factors of 6120026? 2, 11, 149, 1867 What are the prime factors of 35306080? 2, 5, 220663 What are the prime factors of 134725007? 23, 67, 87427 What are the prime factors of 3084986802? 2, 3, 359, 431, 3323 What are the prime factors of 199723777? 11, 43, 422249 List the prime factors of 21873134. 2, 29, 377123 List the prime factors of 60858211. 29, 2098559 List the prime factors of 922160472. 2, 3, 31, 37, 139, 241 List the prime factors of 41323378. 2, 20661689 What are the prime factors of 107498701? 17, 6323453 What are the prime factors of 66153233? 66153233 What are the prime factors of 55009461? 3, 13, 1410499 What are the prime factors of 1693261507? 7, 241894501 List the prime factors of 225905815. 5, 151, 299213 List the prime factors of 45399376. 2, 11, 31, 53, 157 List the prime factors of 1113996521. 11, 1012	{ "pile_set_name": "DM Mathematics" }
45, 34376? 2d3 - d2 - 10d + 33809 What is the t'th term of -381, -442, -457, -402, -253, 14, 423? 4t3 - t2 - 86t - 298 What is the d'th term of 172, 570, 1198, 2056, 3144? 115d2 + 53d + 4 What is the q'th term of 4297, 17156, 38587, 68590, 107165, 154312, 210031? 4286q2 + q + 10 What is the d'th term of -75034, -150067, -225096, -300121, -375142, -450159? 2d*2 - 75039d + 3 What is the k'th term of -8141, -32242, -72411, -128648, -200953, -289326, -393767? -8034k2 + k - 108 What is the u'th term of -1879, -1868, -1851, -1828, -1799, -1764? 3u*2 + 2u - 1884 What is the u'th term of -28, -9, 36, 119, 252, 447? 2u3 + u2 + 2u - 33 What is the o'th term of -904, -1847, -2790? -943o + 39 What is the q'th term of -1250, -2457, -3630, -4775, -5898, -7005? -q3 + 23q*2 - 1269q - 3 What is the h'th term of -39, 49, 209, 453, 793? 2h3 + 24h*2 + 2h - 67 What is the d'th term of -671, -2661, -5973, -10607, -16563, -23841, -32441? -661d2 - 7d - 3 What is the h'th term of -61777, -61793, -61809? -16h - 61761 What is the t'th term of 71, 758, 2657, 6374, 12515, 21686? 101t*3 - 20t - 10 What is the f'th term of -155074, -155078, -155086, -155098? -2f2 + 2f - 155074 What is the h'th term of 27, 297, 555, 795, 1011, 1197, 1347, 1455? -h*3 + 277h - 249 What is the c'th term of 87324, 174633, 261942, 349251, 436560, 523869? 87309c + 15 What is the o'th term of 95008, 95007, 95006, 95005? -o + 95009 What is the z'th term of -3405, -3412, -3419, -3426, -3433? -7z - 3398 What is the y'th term of -365, -381, -397, -413? -16y - 349 What is the c'th term of 592, 1148, 1686, 2194, 2660, 3072, 3418, 3686? -2c*3 + 3c*2 + 561c + 30 What is the q'th term of 1067, 2107, 3119, 4103, 5059, 5987, 6887? -14q2 + 1082q - 1 What is the p'th term of 142884, 142885, 142886, 142887? p + 142883 What is the g'th term of -153385, -153387, -153389, -153391, -153393, -153395? -2g - 153383 What is the y'th term of 33, -17, -125, -297, -539, -857, -1257? -y3 - 23y*2 + 26y + 31 What is the a'th term of -975, -1984, -2993, -4002, -5011? -1009a + 34 What is the m'th term of 113, 79, -21, -223, -563? -6m*3 + 3m*2 - m + 117 What is the v'th term of -275, -527, -753, -953, -1127, -1275? 13v*2 - 291v + 3 What is the y'th term of -43933, -43922, -43911, -43900, -43889? 11y - 43944 What is the z'th term of 5, 55, 139, 257, 409? 17z2 - z - 11 What is the c'th term of -63932, -63964, -63984, -63986, -63964, -63912, -63824, -63694? c3 - 39c - 63894 What is the z'th term of -396711, -396714, -396717? -3z - 396708 What is the g'th term of 745, 4231, 10049, 18205, 28705, 41555, 56761? g*3 + 1160g*2 - g - 415 What is the y'th term of -95963, -95949, -95913, -95843, -95727, -95553? 2y3 - y2 + 3y - 95967 What is the f'th term of 10, 92, 236, 442? 31f*2 - 11f - 10 What is the a'th term of -42693, -42696, -42699, -42702, -42705, -42708? -3a - 42690 What is the p'th term of 1733, 2111, 2495, 2885? 3p*2 + 369p + 1361 What is the t'th term of -14, -793, -2074, -3851, -6118, -8869, -12098, -15799? t*3 - 257t*2 - 15t + 257 What is the z'th term of 1260, 1245, 1236, 1233? 3z2 - 24z + 1281 What is the x'th term of -43997, -43998, -43999, -44000, -44001, -44002? -x - 43996 What is the v'th term of 46, 24, -26, -116, -258? -2v3 - 2v*2 - 2v + 52 What is the l'th term of -50, -83, -136, -203, -278, -355, -428, -491? l*3 - 16l*2 + 8l - 43 What is the g'th term of 99, 223, 425, 699, 1039, 1439? -g*3 + 45g*2 - 4g + 59 What is the s'th term of -11616, -11618, -11620, -11622, -11624? -2s - 11614 What is the f'th term of -7934, -15868, -23802, -31736? -7934f What is the n'th term of 748770, 748767, 748774, 748797, 748842, 748915, 749022, 749169? n3 - n2 - 7n + 748777 What is the c'th term of -534, -1424, -2668, -4260, -6194, -8464, -11064? c3 - 183c*2 - 348c - 4 What is the a'th term of 30579, 61163, 91747? 30584a - 5 What is the v'th term of -244, -384, -522, -658? v2 - 143v - 102 What is the r'th term of -274, -1062, -2370, -4198, -6546, -9414, -12802? -260r2 - 8r - 6 What is the x'th term of 1022, 4156, 9380, 16694, 26098? 1045x2 - x - 22 What is the t'th term of -6267, -12537, -18807? -6270t + 3 What is the x'th term of 366, 297, 224, 147, 66, -19, -108? -2x2 - 63x + 431 What is the j'th term of -449840, -899682, -1349524, -1799366, -2249208, -2699050? -449842j + 2 What is the y'th term of -1060, -4227, -9502, -16879, -26352? y3 - 1060y*2 + 6y - 7 What is the u'th term of 72, 108, 184, 306, 480, 712? u*3 + 14u*2 - 13u + 70 What is the s'th term of -234122, -234107, -234076, -234023, -233942? s*3 + 2s*2 + 2s - 234127 What is the m'th term of -26895, -107572, -242033, -430278, -672307, -968120, -1317717? -26892m2 - m - 2 What is the o'th term of -34081, -68159, -102237, -136315, -170393, -204471? -34078o - 3 What is the h'th term of -4071, -4128, -4223, -4356, -4527, -4736, -4983? -19h2 - 4052 What is the s'th term of -24, -30, -6, 66, 204, 426? 3s*3 - 3s*2 - 18s - 6 What is the k'th term of 539, 1885, 4051, 7031, 10819, 15409, 20795, 26971? -k*3 + 416k*2 + 105k + 19 What is the d'th term of -6603, -7135, -7667, -8199, -8731? -532d - 6071 What is the v'th term of -7709, -15232, -22755? -7523v - 186 What is the c'th term of -4074, -8142, -12210, -16278, -20346, -24414? -4068c - 6 What is the w'th term of 13, 162, 397, 718, 1125, 1618? 43w*2 + 20w - 50 What is the g'th term of -73, -184, -233, -106, 311, 1132, 2471, 4442? 19g3 - 83g*2 + 5g - 14 What is the a'th term of 13012, 12986, 12946, 12886, 12800, 12682? -a3 - a2 - 16a + 13030 What is the b'th term of 137962, 275927, 413890, 551851, 689810, 827767, 965722? -b2 + 137968b - 5 What is the b'th term of 33, 124, 369, 846, 1633? 13b3 - b2 + 3b + 18 What is the c'th term of 14368, 13953, 13268, 12319, 11112? c*3 - 141c*2 + c + 14507 What is the q'th term of 113916, 227828, 341740, 455652, 569564, 683476? 113912q + 4 What is the i'th term of 26, 17, -46, -175, -382? -2i3 - 15i*2 + 50i - 7 What is the y'th term of -98756, -98757, -98758, -98759? -y - 98755 What is the o'th term of -272507, -272504, -272501, -272498? 3o - 272510 What is the n'th term of 5722, 5321, 4920, 4519? -401n + 6123 What is the k'th term of 2500, 2502, 2502, 2500, 2496, 2490, 2482? -k*2 + 5k + 2496 What is the s'th term of -6425, -6441, -6483, -6563, -6693, -6885, -7151? -2s3 - s2 + s - 6423 What is the x'th term of 3020, 14983, 34912, 62801, 98644, 142435? -x3 + 3989x*2 + 3x - 971 What is the d'th term of -566, -533, -506, -491, -494, -521, -578? -d*3 + 3d*2 + 31d - 599 What is the g'th term of -363, -665, -1013, -1413, -1871, -2393, -2985? -g*3 - 17g*2 - 244g - 101 What is the j'th term of 70, 202, 452, 844, 1402, 2150, 3112? 4j3 + 35j2 - j + 32 What is the r'th term of 129, 259, 377, 477, 553, 599, 609? -r3 + 137r - 7 What is the v'th term of 749, 767, 785, 803, 821, 839? 18v + 731 What is the n'th term of 457, 765, 1073, 1381? 308n + 149 What is the m'th term of 1084588, 1084590, 1084592, 1084594, 1084596, 1084598? 2m + 1084586 What is the d'th term of 1032, 1072, 1112, 1152, 1192? 40d + 992 What is the g'th term of -1088, -2225, -3362, -4499, -5636? -1137g + 49 What is the r'th term of 2204, 4431, 6656, 8879, 11100, 13319? -r*2 + 2230r - 25 What is the m'th term of 90466, 90463, 90460, 90457, 90454, 90451? -3m + 90469 What is the p'th term of 141, 251, 341, 399, 413? -2p*3 + 2p*2 + 118p + 23 What is the w'th term of -1419, -5657, -12719, -22605? -1412w2 - 2w - 5 What is the k'th term of 91524, 91531, 91542, 91557, 91576? 2k2 + k + 91521 What is the m'th term of 5094, 10130, 15166, 20202, 25238, 30274? 5036m + 58 What is the w'th term of 32620, 32603, 32562, 32485, 32360, 32175, 31918, 31577? -2w3 - 3w + 32625 What is the h'th term of 21781, 87137, 196063, 348559, 544625, 784261, 1067467? 21785h2 + h - 5 What is the m'th term of 30, 275, 508, 723, 914, 1075? -m3 + 252m - 221 What is the v'th term of -2812, -2360, -1896, -1414, -908? v*3 + 445v - 3258 What is the a'th term of 7, 38, 33, -14, -109, -258? -a*3 - 12a**2	{ "pile_set_name": "DM Mathematics" }
cking 2 i and 2 r. 3/26 Two letters picked without replacement from uoufutftfuotttofhuf. What is prob of picking 1 h and 1 u? 5/171 Three letters picked without replacement from hhpphhhp. What is prob of picking 3 p? 1/56 Four letters picked without replacement from {i: 2, u: 7, n: 4, v: 1}. What is prob of picking 4 n? 1/1001 Calculate prob of picking 3 k and 1 l when four letters picked without replacement from {l: 1, i: 1, k: 1, y: 1, t: 1}. 0 Four letters picked without replacement from {n: 7, h: 2, e: 1, i: 3, o: 1, v: 4}. What is prob of picking 1 n, 2 o, and 1 h? 0 Calculate prob of picking 3 l and 1 o when four letters picked without replacement from ttlllvlvovlttlv. 4/273 What is prob of picking 1 h and 1 y when two letters picked without replacement from {e: 7, y: 1, h: 1}? 1/36 What is prob of picking 1 y, 1 v, and 2 o when four letters picked without replacement from {v: 2, o: 5, y: 3}? 2/7 Calculate prob of picking 2 q when two letters picked without replacement from bscqqqqqqbbsb. 5/26 Three letters picked without replacement from {r: 4, f: 2, d: 5}. Give prob of picking 1 f, 1 d, and 1 r. 8/33 What is prob of picking 3 j when three letters picked without replacement from {a: 9, r: 6, g: 1, j: 1}? 0 Three letters picked without replacement from hwlzqlo. Give prob of picking 2 q and 1 z. 0 Three letters picked without replacement from {r: 3, e: 17}. Give prob of picking 3 r. 1/1140 Four letters picked without replacement from yaaaayhu. Give prob of picking 1 h, 1 y, and 2 a. 6/35 What is prob of picking 2 l, 1 e, and 1 b when four letters picked without replacement from eleeeeblblelbleb? 2/13 Four letters picked without replacement from {q: 1, t: 12, z: 5}. What is prob of picking 1 q and 3 t? 11/153 Calculate prob of picking 3 w when three letters picked without replacement from {w: 4, b: 10}. 1/91 Two letters picked without replacement from ubymbbtuibtbibb. What is prob of picking 1 b and 1 y? 1/15 What is prob of picking 1 j and 1 c when two letters picked without replacement from {g: 2, c: 4, j: 1, i: 1}? 1/7 Three letters picked without replacement from nbrbqnznnbbnnbnbbnaz. Give prob of picking 3 b. 7/228 What is prob of picking 1 x and 1 d when two letters picked without replacement from {k: 1, e: 1, x: 2, n: 2, d: 2}? 1/7 What is prob of picking 1 l, 1 c, 1 h, and 1 v when four letters picked without replacement from hhhlhchtccvh? 2/55 What is prob of picking 1 p, 1 q, and 1 g when three letters picked without replacement from gpggkkkggffqfqkkqgg? 7/323 Calculate prob of picking 1 u, 1 g, and 1 l when three letters picked without replacement from fungfulw. 1/28 What is prob of picking 3 r and 1 j when four letters picked without replacement from {j: 7, r: 3, v: 4}? 1/143 Calculate prob of picking 2 f and 1 i when three letters picked without replacement from kfiifkiikfnknkiii. 21/680 Two letters picked without replacement from {u: 1, i: 2, w: 2, m: 1, h: 4}. Give prob of picking 2 i. 1/45 Calculate prob of picking 3 r when three letters picked without replacement from rkerrkerkrerer. 5/52 Three letters picked without replacement from {f: 3, s: 4, c: 7}. What is prob of picking 1 c and 2 f? 3/52 Calculate prob of picking 1 q and 1 r when two letters picked without replacement from {p: 1, q: 2, x: 1, r: 2}. 4/15 Three letters picked without replacement from {p: 9, g: 11}. Give prob of picking 3 p. 7/95 Calculate prob of picking 1 z and 3 d when four letters picked without replacement from {d: 3, z: 13}. 1/140 Two letters picked without replacement from llyllllyly. What is prob of picking 2 y? 1/15 Two letters picked without replacement from {i: 1, y: 2, x: 1, c: 3}. Give prob of picking 1 c and 1 x. 1/7 Three letters picked without replacement from jjkkkj. What is prob of picking 1 k and 2 j? 9/20 Four letters picked without replacement from {t: 2, v: 6}. Give prob of picking 2 v and 2 t. 3/14 Three letters picked without replacement from ffccccffff. What is prob of picking 1 f and 2 c? 3/10 Three letters picked without replacement from {z: 9}. What is prob of picking 3 z? 1 Two letters picked without replacement from bdbsdbbd. Give prob of picking 1 b and 1 s. 1/7 Calculate prob of picking 1 u and 1 m when two letters picked without replacement from {u: 1, m: 2}. 2/3 What is prob of picking 2 j when two letters picked without replacement from {e: 18, j: 2}? 1/190 Two letters picked without replacement from {u: 3, x: 1, i: 3, r: 4, q: 1, m: 3}. What is prob of picking 1 u and 1 m? 3/35 Three letters picked without replacement from {o: 7, r: 5}. What is prob of picking 3 r? 1/22 Three letters picked without replacement from ddduududdluddbxdu. Give prob of picking 2 u and 1 d. 9/68 What is prob of picking 1 a and 1 l when two letters picked without replacement from {a: 1, s: 1, r: 3, p: 1, k: 3, l: 9}? 1/17 Calculate prob of picking 2 a when two letters picked without replacement from {e: 1, a: 3, m: 1, c: 4, i: 2}. 3/55 Four letters picked without replacement from {h: 1, p: 1, t: 2, r: 1, x: 1, q: 2}. Give prob of picking 2 q, 1 h, and 1 x. 1/70 Four letters picked without replacement from igiigggiig. What is prob of picking 2 i and 2 g? 10/21 Three letters picked without replacement from xjxfnj. What is prob of picking 1 j and 2 x? 1/10 Calculate prob of picking 2 a when two letters picked without replacement from {k: 9, a: 9}. 4/17 Four letters picked without replacement from {s: 4, n: 5, z: 1}. Give prob of picking 4 s. 1/210 What is prob of picking 3 j and 1 x when four letters picked without replacement from ljyxldxljjj? 4/165 What is prob of picking 1 e and 2 o when three letters picked without replacement from nzoooleeoee? 8/55 What is prob of picking 2 q when two letters picked without replacement from qmqy? 1/6 Calculate prob of picking 3 u when three letters picked without replacement from {u: 13, s: 5}. 143/408 What is prob of picking 1 t and 1 j when two letters picked without replacement from {q: 6, p: 2, t: 1, j: 2, g: 7}? 2/153 Calculate prob of picking 1 j and 2 l when three letters picked without replacement from sljiisjcjijsjdljjjsi. 2/285 What is prob of picking 3 l and 1 v when four letters picked without replacement from {l: 7, a: 2, v: 4, c: 1}? 20/143 Calculate prob of picking 2 h and 1 v when three letters picked without replacement from rvshysh. 1/35 Calculate prob of picking 1 c, 1 a, and 1 o when three letters picked without replacement from tttooooooooocao. 2/91 What is prob of picking 2 s when two letters picked without replacement from {h: 4, k: 2, s: 2, m: 7, u: 1}? 1/120 Calculate prob of picking 1 f and 1 b when two letters picked without replacement from befzeeeeeeeeggee. 1/120 What is prob of picking 1 x and 3 m when four letters picked without replacement from mxmmmmxmmxmmmmmm? 33/70 Two letters picked without replacement from {k: 9, q: 7}. What is prob of picking 2 k? 3/10 Calculate prob of picking 1 q and 1 g when two letters picked without replacement from aaqagaaai. 1/36 What is prob of picking 3 h when three letters picked without replacement from hhhhhhhhhh? 1 What is prob of picking 1 v and 1 i when two letters picked without replacement from {i: 1, f: 1, v: 1, s: 2, m: 1, l: 1}? 1/21 What is prob of picking 2 t when two letters picked without replacement from {r: 4, t: 7}? 21/55 Three letters picked without replacement from {u: 9, h: 10, y: 1}. Give prob of picking 2 h and 1 y. 3/76 Calculate prob of picking 1 e and 3 m when four letters picked without replacement from {m: 4, e: 9, c: 1}. 36/1001 Calculate prob of picking 2 u when two letters picked without replacement from buccuubgczcuucza. 1/12 What is prob of picking 3 p when three letters picked without replacement from ppp? 1 Three letters picked without replacement from fzf. What is prob of picking 3 f? 0 Two letters picked without replacement from ppmmmtpmpt. Give prob of picking 1 p and 1 m. 16/45 Calculate prob of picking 1 c, 1 z, and 1 p when three letters picked without replacement from ozpzooooc. 1/42 Calculate prob of picking 1 u and 2 t when three letters picked without replacement from ppputpuutpttpu. 6/91 Calculate prob of picking 1 k, 1 u, and 1 i when three letters picked without replacement from ikvuvuiiuuiv	{ "pile_set_name": "DM Mathematics" }
utes are there between 5:30 AM and 7:08 AM? 98 What is 620 minutes after 10:18 AM? 8:38 PM What is 185 minutes after 10:19 AM? 1:24 PM What is 609 minutes before 6:46 PM? 8:37 AM What is 524 minutes after 5:29 AM? 2:13 PM How many minutes are there between 9:33 PM and 8:50 AM? 677 How many minutes are there between 12:51 PM and 8:15 PM? 444 How many minutes are there between 8:46 AM and 9:36 AM? 50 What is 578 minutes before 11:47 PM? 2:09 PM How many minutes are there between 5:12 PM and 4:09 AM? 657 What is 582 minutes after 10:24 PM? 8:06 AM What is 386 minutes after 1:22 PM? 7:48 PM What is 605 minutes before 6:42 PM? 8:37 AM How many minutes are there between 12:57 PM and 6:50 PM? 353 What is 195 minutes after 3:04 AM? 6:19 AM How many minutes are there between 5:57 PM and 11:24 PM? 327 What is 406 minutes before 11:30 AM? 4:44 AM How many minutes are there between 10:51 AM and 8:09 PM? 558 What is 204 minutes after 12:37 AM? 4:01 AM How many minutes are there between 4:24 PM and 10:40 PM? 376 What is 298 minutes before 8:35 AM? 3:37 AM What is 130 minutes after 4:16 AM? 6:26 AM What is 145 minutes before 10:30 AM? 8:05 AM How many minutes are there between 12:32 AM and 12:31 PM? 719 How many minutes are there between 9:16 AM and 6:40 PM? 564 What is 526 minutes after 7:56 PM? 4:42 AM What is 303 minutes before 10:53 PM? 5:50 PM How many minutes are there between 11:13 PM and 8:30 AM? 557 What is 249 minutes after 2:28 PM? 6:37 PM How many minutes are there between 8:32 PM and 6:19 AM? 587 How many minutes are there between 3:38 PM and 2:12 AM? 634 How many minutes are there between 7:55 AM and 4:45 PM? 530 How many minutes are there between 4:04 PM and 9:27 PM? 323 How many minutes are there between 12:40 PM and 8:04 PM? 444 How many minutes are there between 6:10 PM and 2:22 AM? 492 How many minutes are there between 4:52 PM and 9:26 PM? 274 What is 374 minutes after 3:08 PM? 9:22 PM How many minutes are there between 9:06 AM and 4:30 PM? 444 What is 587 minutes after 10:24 PM? 8:11 AM What is 355 minutes before 8:48 PM? 2:53 PM What is 430 minutes after 4:53 PM? 12:03 AM How many minutes are there between 1:15 PM and 4:10 PM? 175 What is 292 minutes after 2:43 PM? 7:35 PM What is 630 minutes before 10:46 PM? 12:16 PM What is 244 minutes after 12:21 AM? 4:25 AM What is 704 minutes after 9:55 PM? 9:39 AM How many minutes are there between 5:52 PM and 4:15 AM? 623 What is 539 minutes before 12:00 PM? 3:01 AM What is 564 minutes before 7:17 PM? 9:53 AM What is 609 minutes before 3:07 AM? 4:58 PM How many minutes are there between 5:26 PM and 7:16 PM? 110 What is 19 minutes before 4:47 PM? 4:28 PM How many minutes are there between 12:56 PM and 1:32 PM? 36 What is 240 minutes after 6:30 PM? 10:30 PM What is 246 minutes before 6:31 PM? 2:25 PM What is 91 minutes after 11:10 PM? 12:41 AM How many minutes are there between 2:03 PM and 5:27 PM? 204 What is 115 minutes after 8:04 PM? 9:59 PM What is 67 minutes before 9:21 PM? 8:14 PM What is 110 minutes before 12:28 AM? 10:38 PM How many minutes are there between 10:38 PM and 10:25 AM? 707 How many minutes are there between 9:21 PM and 6:49 AM? 568 How many minutes are there between 5:18 AM and 9:27 AM? 249 How many minutes are there between 6:17 AM and 1:54 PM? 457 What is 623 minutes after 8:59 PM? 7:22 AM How many minutes are there between 12:14 PM and 10:58 PM? 644 What is 592 minutes after 2:26 PM? 12:18 AM How many minutes are there between 4:04 AM and 7:41 AM? 217 How many minutes are there between 1:12 AM and 2:59 AM? 107 What is 69 minutes after 9:29 AM? 10:38 AM How many minutes are there between 7:55 PM and 12:50 AM? 295 What is 676 minutes after 10:19 AM? 9:35 PM How many minutes are there between 5:51 AM and 12:52 PM? 421 How many minutes are there between 2:06 PM and 9:48 PM? 462 How many minutes are there between 4:09 AM and 3:56 PM? 707 How many minutes are there between 9:17 PM and 7:29 AM? 612 What is 685 minutes after 12:28 PM? 11:53 PM How many minutes are there between 1:48 PM and 1:04 AM? 676 How many minutes are there between 5:56 PM and 3:32 AM? 576 How many minutes are there between 1:29 AM and 1:08 PM? 699 How many minutes are there between 7:42 AM and 9:37 AM? 115 How many minutes are there between 9:33 AM and 8:38 PM? 665 What is 549 minutes after 7:02 PM? 4:11 AM How many minutes are there between 9:39 AM and 5:03 PM? 444 What is 305 minutes after 7:56 PM? 1:01 AM How many minutes are there between 9:58 PM and 7:55 AM? 597 How many minutes are there between 6:18 AM and 8:00 AM? 102 How many minutes are there between 7:57 AM and 1:20 PM? 323 What is 367 minutes before 4:47 AM? 10:40 PM How many minutes are there between 2:27 PM and 12:58 AM? 631 What is 186 minutes after 10:10 AM? 1:16 PM What is 387 minutes before 9:33 AM? 3:06 AM What is 184 minutes before 10:19 PM? 7:15 PM How many minutes are there between 3:17 AM and 10:55 AM? 458 How many minutes are there between 11:56 PM and 3:10 AM? 194 What is 123 minutes after 3:13 PM? 5:16 PM What is 103 minutes before 12:12 PM? 10:29 AM What is 313 minutes before 5:29 AM? 12:16 AM How many minutes are there between 1:24 PM and 12:31 AM? 667 How many minutes are there between 8:24 AM and 7:53 PM? 689 How many minutes are there between 5:51 AM and 12:35 PM? 404 How many minutes are there between 4:34 AM and 7:57 AM? 203 How many minutes are there between 6:17 PM and 1:13 AM? 416 How many minutes are there between 8:53 AM and 12:48 PM? 235 What is 404 minutes before 12:45 AM? 6:01 PM What is 699 minutes before 4:38 PM? 4:59 AM What is 570 minutes before 9:24 PM? 11:54 AM How many minutes are there between 1:29 AM and 11:41 AM? 612 What is 184 minutes before 6:04 PM? 3:00 PM What is 121 minutes before 11:26 AM? 9:25 AM How many minutes are there between 5:35 AM and 4:14 PM? 639 How many minutes are there between 3:58 PM and 6:53 PM? 175 How many minutes are there between 10:58 PM and 8:45 AM? 587 What is 585 minutes after 5:41 PM? 3:26 AM How many minutes are there between 5:12 PM and 3:55 AM? 643 What is 706 minutes before 1:55 PM? 2:09 AM What is 444 minutes after 12:00 PM? 7:24 PM How many minutes are there between 7:52 PM and 4:03 AM? 491 What is 605 minutes after 4:44 PM? 2:49 AM How many minutes are there between 6:24 AM and 12:38 PM? 374 How many minutes are there between 1:30 PM and 3:00 PM? 90 What is 128 minutes after 12:24 PM? 2:32 PM How many minutes are there between 8:48 PM and 6:21 AM? 573 How many minutes are there between 7:34 PM and 3:58 AM? 504 What is 194 minutes before 7:29 PM? 4:15 PM How many minutes are there between 7:09 PM and 4:25 AM? 556 How many minutes are there between 3:23 PM and 1:08 AM? 585 What is 141 minutes after 3:20 AM? 5:41 AM What is 616 minutes before 4:36 AM? 6:20 PM How many minutes are there between 5:54 PM and 11:53 PM? 359 How many minutes are there between 5:18 AM and 12:41 PM? 443 What is 616 minutes before 10:25 AM? 12:09 AM How many minutes are there between 7:57 AM and 12:53 PM? 296 What is 454 minutes before 8:02 PM? 12:28 PM How many minutes are there between 11:03 AM and 12:50 PM? 107 What is 4 minutes after 3:28 PM? 3:32 PM How many minutes are there between 9:56 PM and 1:56 AM? 240 What is 300 minutes before 12:12 AM? 7:12 PM What is 97 minutes after 8:16 PM? 9:53 PM What is 414 minutes after 10:09 PM? 5:03 AM What is 481 minutes after 7:56 PM? 3:57 AM How many minutes are there between 6:28 PM and 2:49 AM? 501 What is 320 minutes after 5:13 PM? 10:33 PM How many minutes are there between 11:45 AM and 8:52 PM? 547 How many minutes are there between 7:56 AM and 2:41 PM? 405 How many minutes are there between 2:03 AM and 4:48 AM? 165 What is 167 minutes before 4:58 AM? 2:11 AM What is 170 minutes after 10:08 PM? 12:58 AM How many minutes are there between 1:57 PM and 9:43 PM? 466 How many minutes are there between 8:29 PM and 10:30 PM? 121 What is 186 minutes after 2:36 PM? 5:42 PM What is 246 minutes after 10:48 PM? 2:54 AM How many minutes are there between 8:36 PM and 1:49 AM? 313 What is 454 minutes after 5:04 PM? 12:38 AM What is 386 minutes before 6:05 PM? 11:39 AM What is 430 minutes after 11:16 PM? 6:26 AM How many minutes are there between 6:20 AM and 6:34 A	{ "pile_set_name": "DM Mathematics" }
e 3y + 4n = 77 + 738, 1080 = ty + 4n. Is y a composite number? True Let v(s) = -s*2 - 2s + 3. Let m be v(-7). Let a = m - 44. Let o = a - -217. Is o a prime number? False Let c = 1371 + -272. Is c a prime number? False Is (1181/4)/(18/504) prime? False Let l = -2245 + 1318. Let p = 2582 + l. Is p composite? True Let t(n) = -46n3 + 1. Let p be t(1). Let f be 300/p(-6)/8. Suppose fi - 913 = 262. Is i a composite number? True Suppose -9781 - 14554 = -5i. Is i a composite number? True Let a = 3319 - -2572. Is a prime? False Suppose z = 4t + 2z - 36, 5t - 60 = -5z. Let l be ((-36)/t)/(3/(-8)). Is (l/(-18))/(4/(-1146)) a composite number? False Let t(o) = -19o2 + 1 + 20o*2 - 2 - 7o. Let m be t(6). Let l(g) = g*3 + 8g*2 - 5g - 7. Is l(m) a composite number? True Let a be (-2)/(-11) + 35/(-11). Let v(n) = -1758n - 13. Is v(a) a prime number? True Suppose -f = -u + 3 + 3, 0 = 4u + 5f - 15. Is 1968 - (-7 - -4) - (u + -3) a composite number? True Let m(q) = -1. Let t(z) = z3 + 10z*2 + 2z + 3. Let f(o) = 2m(o) + t(o). Let a be f(-6). Suppose -h = 3h + v - 517, -4v = h - a. Is h a prime number? False Suppose 22n - 78023 = 11n. Is n a composite number? True Let c = -14 + 16. Suppose -6h - 915 = -x - ch, 2x - 1839 = -h. Is x a composite number? False Suppose 11 = 3s + 5. Suppose -sd + 448 = -3q + q, 2q + 667 = 3d. Suppose -90 - d = -3k. Is k a composite number? False Suppose d = -g + 413, -g = -3d + 816 + 403. Suppose -2s + d = -674. Is s a composite number? False Suppose -2v + 17385 + 4441 = 0. Is v a composite number? True Let x = -19 + 21. Suppose -144 = 3k + k + xd, k + 36 = -d. Is (-9)/k + (-1494)/(-8) prime? False Let o(w) = 34w*2 + 4w - 5w + 3 - 6. Is o(2) composite? False Let k(q) = -2q*3 + 5q*2 + 2q - 5. Let s be k(6). Let r = s + 1608. Is r prime? False Is (6 - (-2108)/3)/(20/930) prime? False Is (2/(-6))/(7 - (-1113988)/(-159141)) a composite number? False Let x(z) = z*2 - 5z - 4. Let o be x(7). Suppose -4g + 2g + o = 0. Suppose -gt = -t - 1708. Is t composite? True Let z = -17530 - -26187. Is z a prime number? False Suppose -45145 = -5t + 2i, 9056 = t - 23i + 28i. Is t prime? False Let h = -8 + 14. Let l be (-574)/6 + h/9. Let f = -6 - l. Is f a composite number? False Let d = -6 - -23. Let c = -14 + d. Suppose -co + 1330 = 5r, -4o = -8o + 2r + 1782. Is o a prime number? False Suppose -2z = -13 - 3. Suppose t - 2 = z. Is t - ((-1 - 2) + 0) composite? False Suppose -665 = -8k + 3k. Suppose -2l - k - 179 = -2s, 4s + 3l - 589 = 0. Suppose -39 = -2h + s. Is h a prime number? False Let y(n) = 2n3 - 21n*2 + 19n + 15. Let d(p) = p*3 - 10p*2 + 9p + 8. Let g = -34 + 39. Let c(k) = gd(k) - 3y(k). Is c(9) prime? True Let g be 7-3 - (-1 + -3). Let h(q) = -q3 - 16q*2 + 6. Is h(g) a prime number? False Let g be (-1)/((-18885)/(-9444) - 2). Is g/(-10)10/(-4) a composite number? False Is (-45)/5 + 2725 + -9 composite? False Suppose -10 - 8 = -c. Suppose -3t - 2w - 3w - c = 0, -3t - 18 = -3w. Is 30/t(-2138)/10 a prime number? True Suppose 5r - 3k = 321, -3k + 79 = 3r - 104. Suppose 62f - rf = -2459. Is f a prime number? True Let o = 5166 + -3619. Let l = -1012 + o. Is l prime? False Let t(s) = -13s - 4. Let o be t(-2). Suppose 5k + 7 = o. Let p(a) = 15a - 10. Is p(k) a composite number? True Suppose -s + 4q - 19 = -2, -10 = -2q. Let l be -1497((-5)/s + -2). Suppose b - 1081 = -5d, 0b - 4d + l = 5b. Is b prime? False Let q(m) = 32m + 15. Let r be q(-9). Is (-75)/(-30)(0 - (r + -1)) a prime number? False Is (18955/(-170))/(1/(-22)) a composite number? True Let d = 49 + -27. Suppose 0 = -24q + dq + 1388. Let n = q + -215. Is n a prime number? True Suppose 4m + m + 4y - 907 = 0, 5m - 3y = 921. Let v = -89 + m. Let g = v + -60. Is g a composite number? True Suppose 2y + 1038 = 5s - 2y, -2s = 5y - 435. Let d = 467 - s. Is d a composite number? False Is ((-11826)/7 - -2)/((-32)/112) a prime number? False Suppose 7l - 10196 = 3l + 4v, 4l - 5v - 10191 = 0. Is l composite? True Let i(g) = 6g2 - 6g - 5. Let s be i(-12). Suppose -3f - x - 4x + s = 0, -4f + 5x + 1218 = 0. Is f a prime number? True Suppose -12605 = -y + 10a - 5a, 2a + 12605 = y. Is y a prime number? False Let t = 9108 + 953. Is t prime? True Let p = -40 + -23. Let a be p/(-2)(-12)/(-9). Suppose m - 158 = o, -m + 4o + a = -101. Is m a composite number? False Let y(m) = m3 - 3m*2 - 2m - 5. Let c be (-105)/(-28) - 1/(-4). Let b be y(c). Is (-2)/b(-20 - 67) composite? True Suppose 5h + 2 = -z + 2h, -5z - 3h = 34. Let q be (-2)/z + (-77)/(-28). Suppose -5o - qj = -295, 4j - 295 = 4o - 9o. Is o a composite number? False Let h be ((-60)/(-36))/(5/6). Suppose -l + p - h = -5, -13 = 4l + p. Is (-841)/l + (-9)/6 composite? False Let q = 2 + -7. Is 1 + (-4168)/q + 36/90 a composite number? True Is 2-2 - (-42 - 18579) a prime number? True Is ((-80)/(-8))/(4/2866) a prime number? False Suppose -m - 233930 = -11m. Is m prime? False Suppose 0 = -167k + 162k + 9925. Is k prime? False Suppose 0 = -0o + 4o + 5j - 3, -4j = -5o + 14. Suppose -x + 322 = 2h, oh - x - 220 = 94. Is h composite? True Suppose 31s - 40 = 26s. Suppose -1342 = -sr + 6r. Is r a prime number? False Let u = 48 + -31. Let f = u - 14. Suppose 2j - 573 = -fy - 0j, 573 = 3y - j. Is y a prime number? True Let a = 7 + -6. Let k = a - -4. Suppose -kc + 288 = 2m, -m - 4c - 157 = -2m. Is m a composite number? False Let u(o) = 2o2 - 8o + 8. Let v be u(4). Suppose -17 - 87 = -vp. Is p a composite number? False Let u(r) be the second derivative of -r5/20 + r4/6 + r3/3 - 4r*2 - 10r. Is u(-7) a composite number? False Suppose -9 = -9f + 6f. Let h be (4 - f)/(-3 + 2). Is 489/(h - 20/(-8)) a prime number? False Suppose 4k - 2246 = -6y, 2k + 257 = 4y - 1231. Is y prime? True Let g be (19/(-6))/((-1)/(-4)). Is (-1)/(-2) + g371/(-4) prime? True Let v(g) = -g*3 + 5g*2 + 2g - 8. Let z(t) = t + 27. Let y be z(-22). Is v(y) a composite number? False Suppose -4 - 5 = 3j, -84850 = -5y - 5j. Is y a composite number? True Suppose -4z + 184 = -620. Let m be (9/(-6))/(3/(-10)). Suppose 8i = 5s + 3i - 945, 0 = s + mi - z. Is s prime? True Is (-7)/35 + 66056/5 a composite number? True Is (-9462)/(-15) + 3/15 composite? False Suppose 133535 = 17h - 38386. Is h a prime number? False Let b = 40 - 36. Suppose -bh + 1144 = -3q - 2q, -4h + 2q = -1156. Is h prime? False Suppose -3z - 9 = 12. Let f be 188/(8/(-3 - z)). Suppose 173 = 3x - f. Is x a composite number? False Suppose -3v - 12609 = -3b, -4v - 11 + 3 = 0. Is b composite? False Let o = -146 + -136. Let i = 427 + o. Is i + 4/(-1) + 2 a composite number? True Suppose -98712 = -19g + 14737. Is g composite? True Let b = 379 + -570. Let c = 713 + b. Suppose 5i = 2s - 526, -i = -2s + 3i + c. Is s a composite number? True Suppose 5h - 269 = -x + 220, 0 = 2x + h - 996. Let y = x + 1030. Is y prime? False Let f be (-210)/(-7)2/3. Suppose 16z - 4 = fz. Is 1/z1438/(-2) a composite number? False Let v(n) = n*3 + 13n*2 - 12n - 5. Is v(-10) composite? True Let h(d) = -6d2 - 11d - 12. Let a be h(-10). Is 3/(-6 + 0)a prime? True Let g = -46 - -47. Is -10((1 - g) + (-23)/2) composite? True Suppose 47b = 50b + 5q - 147527, 4b - 5q = 196656. Is b a prime number? True Suppose -2d + 10 = -0. Let x(a) = a*2 - 6a - 4. Let i be x(d). Let l(t) = -t*3 - 9t*2 - 8t + 7. Is l(i) a prime number? True Let z(r) = -r*3 - 17r*2 + 19r + 22. Let i be z(-18). Suppose -ij - 684 = -7072. Is j a composite number? False Let p = -42 - -36. Is (-8)/p - (-43043)/21 a composite number? True Suppose 7k = 225749 + 233444. Is k prime? True Let m(b) = -2b3 - 5b + 19. Is m(-6) composite? True Let q = 3081 - 1568. Is q prime? False Suppose 0 = -5k - 4h + 8537, 0 = 16k - 15k + 2h - 1705. Is k composite? False Let c(x) = 2x*2 - x - 2. Let n be c(3). Suppose 0 = 5m + n - 58. Let i = m + 170. Is i a prime number? True Let q = 2136 + 122. Is q a prime number? False Let n(f) = -2f3 + 7f*2 - f - 12. Let k be n(-16). Suppose -4v + 1120 = -k. Is v composite? False Suppose 0 = -3v - 34 + 25, -5k = 4*	{ "pile_set_name": "DM Mathematics" }
6 Suppose 0 = 2u - 2a + 26, 36 = -3u + 2a + 1. Calculate the common denominator of 44/5 and u/108(-237)/2. 40 Calculate the smallest common multiple of 4/(-26) - 7/((-364)/1880) and 4. 36 Let r be (-6)/(-15) + 135386/(-15928). Let z = r + -1/7964. Calculate the common denominator of z and 115/18. 90 Suppose 2j - 8 = -0j, -m - 3 = -j. Let g(f) = f2 - 6f + 4. Let t be g(5). Calculate the lowest common multiple of m and -21(t - (-2)/3). 7 Suppose -12d = -14d + 4. Suppose 33 = 3u + 6. Calculate the smallest common multiple of d and u. 18 Let p(v) = v - 7. Let u be p(11). Suppose 4k - u = 4. Calculate the lowest common multiple of 4 and k. 4 Let s = -1/94 + -1963/1034. Calculate the common denominator of (2 - -1)(-4)/(-40) and s. 110 Let r(i) = i*2 + 5i + 4. Let t be r(-4). Let c = 1 + 3. Suppose 7x - cx - 21 = t. What is the least common multiple of 4 and x? 28 What is the least common multiple of 12 and 45/616/6? 60 Let i = 3965 + -47659/12. Find the common denominator of -27/14 and i. 84 Find the common denominator of 2/(40/295) + -2 and -51/14. 28 Let t = -65 - -89. Calculate the lowest common multiple of t and 3. 24 Let d = -263431/6 + 2240309/51. Let v = d - -2/51. Find the common denominator of v and -29/10. 10 Suppose -2d + 4b = -14 - 46, 125 = 5d - 5b. Calculate the least common multiple of d and 34. 340 Let s = 2089 - 31313/15. Find the common denominator of -29/25 and s. 75 Let q = -292/3 + 347/4. Find the common denominator of 1/33 and q. 132 Let u(v) = -v2 - 6v - 6. Let k = 6 + 8. Suppose -4s + 2j = 26, -s - k = -0s - 2j. Calculate the smallest common multiple of u(s) and 6. 6 Suppose 2f - 2g = 0, -2f + 8 = 2g - 8. Calculate the least common multiple of 4 and f. 4 Let q(u) = u*2 + 12u + 17. What is the smallest common multiple of 10 and q(-11)? 30 Let h = -118198863/20 - -5913846. Let g = h + -3897. Find the common denominator of g and 73/8. 40 Let d(b) = b - 9. Let c be d(9). Let z(x) = x3 + x2 + x. Let q be z(c). Suppose -3 = -m - q. What is the lowest common multiple of 5 and m? 15 Let y = 11 + -8. Let l = y - 8. Let i(a) = -a + 5. What is the lowest common multiple of 7 and i(l)? 70 Let y be (1/8)/((-8)/(-269628)). Let o = y - 4207. What is the common denominator of o and -15/2? 16 Let v(i) = 3i3 - 2i*2 + 2i + 1. Let x be v(2). Let m = 33 - x. Calculate the least common multiple of 16 and m. 48 Let d be (-2)/(-16) + 8331/72. Let h = d - 2029/18. What is the common denominator of -33 and h? 9 Suppose 2166 = c + c. Calculate the common denominator of 6/15 + c/(-270) and 31/14. 126 Let t(p) = p - 10 + 0p + 10 + 10. Let a be t(-7). Calculate the lowest common multiple of 17/3 - (-1)/a and 4. 12 Let y(g) = -g3 - 5g*2 + 4. Let n be y(-5). Suppose 2d + 7 = 3k, -nk = 9 + 3. Calculate the common denominator of (-4)/d - 50/(-7) and -61/6. 42 Let o(t) = 2t2 + 3t + 13. Let y be o(12). Calculate the common denominator of 20/11 and y/40 - (-11)/55. 88 Let z be (-1)/(-4) + 4/(-16). Let h be -1 - (z - 0) - -10. What is the smallest common multiple of 9 and ((-66)/(-9))/(6/h)? 99 Let f(l) = 2l + 3. Let p be f(6). Calculate the common denominator of (-2)/5 - 27/p and -1/3. 15 Suppose -5i - 2k - 174 = 161, 0 = 2i + 4k + 150. Calculate the common denominator of -2 + (-3)/(-12)i and -67/6. 12 Suppose 2l - 5l = -24. Let s be (3 - 0)(-4)/(-6). Suppose -2y + s = -0. What is the lowest common multiple of y and l? 8 What is the smallest common multiple of (-35)/(-10) + 9/(-6) and 16? 16 Let k = -153 + 285. Calculate the common denominator of 5/2 and (-3)/k34 + -1. 22 Let p = 3031048 + -18138475/6. Let v = p + -7944. What is the common denominator of 0 + 85/8 + 0 and v? 24 Let n = 393433/22 + -17887. Find the common denominator of 55/18 and n. 198 Suppose 4p - 13 - 7 = -3v, 0 = p - 2. Suppose 4j = -vy + 8, 4j + 9 + 1 = -y. What is the lowest common multiple of 7 and y? 42 Suppose -3u = -5s + 65, 7u - 25 = -4s + 4u. Let j(d) = -12d + 26. Calculate the lowest common multiple of j(2) and s. 10 Let f = -2/1319 - 64607/15828. Let w(d) = -d3 + d2 + 2d - 2. Let p be w(2). What is the common denominator of 3 + p - 190/4 and f? 12 Suppose u = 6u - 55. What is the lowest common multiple of u and 2/(-9) + 47/9? 55 Suppose -81o + 83o - 204 = 0. What is the least common multiple of o and 10? 510 Find the common denominator of 61/16 and (267/8)/(0 + -3). 16 Let u(a) = a*2 + 5a + 3. Let t be u(-5). Suppose -3w + 47 = tv - 25, 3v = 2w + 52. What is the smallest common multiple of 6 and v? 60 Let c = -19110/5819 + 6/529. Calculate the common denominator of c and ((-240)/(-63))/((-6)/7). 99 What is the common denominator of -47/6 and 4 + 4 + 804/(-80)? 60 Let u = -9 - -18. Calculate the lowest common multiple of u and 4. 36 Let c(g) = -g*2 - 19. Let k be c(0). Let b = k - -29. Calculate the lowest common multiple of -3-2(-2)/(-4) and b. 30 Suppose -4p + 3t = -t - 40, -5p = t - 80. What is the smallest common multiple of p and 6? 30 Let k = -95/9 - 56/45. What is the common denominator of -25/3 and k? 15 Let v be ((-4)/4)/(-4 + 3). Calculate the least common multiple of (13 - (0 - 1))/v and 3. 42 Let o = 11983571/660 - 705328/33. Let t = -3222 - o. Calculate the common denominator of -53/(-72)-50 and t. 60 Let u(p) = -p + 2. Let k be u(1). Let h be (-19)/4 + k/(-4). Calculate the common denominator of (-2)/h - 88/10 and -45. 5 Let t(v) = -2v - 3. Calculate the lowest common multiple of t(-9) and 11. 165 Let n = -5 - -9. Let c(p) = p2 - 12p. Let m be c(12). Suppose -4o = -3x - 2o, m = 5x - 2o - 4. Calculate the least common multiple of n and x. 4 Suppose 0f - 3f = -3267. Let b = f + -10869/10. Find the common denominator of b and -127/6. 30 Let w(x) = -12x + 72. Calculate the smallest common multiple of w(4) and 24. 24 Let g = -20277/8 - -2541. Suppose 9 + 12 = -4d + z, -2d + z = 11. Let b(l) = -2l2 - 2l - 6. What is the common denominator of b(d) and g? 8 Suppose 2m + 1 = 3. Let l = -11 - -23. What is the least common multiple of m - 3 - (-1 + -3) and l? 12 Suppose 4z - 5 = 3z - 3c, z + 5c - 5 = 0. Suppose 10 = -2h, -26 = 3u - zu + 2h. What is the lowest common multiple of u and 8? 8 Suppose -5f = 0, 5a - 8f + 3f = 45. Calculate the least common multiple of 9 and a. 9 Let w = -25391/758 + -1/379. Let c = w - -1411/42. Find the common denominator of c and -38/7. 21 Let t = -52707 + 108629129/2061. Let c be (-7835)/18(-55)/10076. Let i = c - t. What is the common denominator of 71/16 and i? 16 Let v = 5/291 - 4711/3201. Find the common denominator of v and 2. 11 Find the common denominator of 2/(-5)730/16 and (-58)/(-9)(-9)/24. 12 Suppose 4c + 2w = 24, -w - 16 = -2c - 3w. Calculate the lowest common multiple of c and 10/4 + 1/(-2). 4 Let l be 9/15 - (-108)/20. Let f = -6 + l. Suppose f = j - 2j + 22. Calculate the smallest common multiple of j and 22. 22 What is the common denominator of 1665/6(-2)/(-70) and 25/3? 42 Let m be 69/21 + 2/(-7). Let d be (-1)/2 + 19/2. What is the smallest common multiple of 1 and m3/d - -9? 10 Suppose 5s = 3s + 4. Suppose c - 5j - 15 = 0, sj + 29 = 3c - 29. Let g(i) = 2i + 4. What is the lowest common multiple of g(4) and c? 60 Let m(w) = w2 + w + 8. Let p be m(0). Let g be -2 + 3 + -2 + p. Let z(b) = b + 1. What is the lowest common multiple of 8 and z(g)? 8 Calculate the smallest common multiple of 368/56 + (-6)/(-14) and 2. 14 Suppose 24 = -m + 3m. Suppose -l - m = 13. Calculate the common denominator of (-1 - -59)1/(-18) and l. 9 Let t = -7 - 0. Let x(p) = 0p + p*3 + 8 + 6p*2 - p - 5p - p. Calculate the lowest common multiple of x(t) and 11. 88 Let i(n) = 3n2 + 2n + 2. Let a be i(-2). Let s be (1/a)/(3/(-274659)). Let d = -9166 - s. What is the common denominator of -17/10 and d? 10 Let j(d) = d*2 + d + 2507. Let r be j(0). Let q = r - 15109/6. Calculate the common denominator of -73/10 and q. 30 Calculate the common denominator of 1/(-72)-3-50 and (4/(-28))/(24/490). 12 Let y = -28037/8 - -3494. What is the common denominator of 49/8 and y? 8 Let b be (2 - 0) + -3 + 4. Let a(i) = 0i*2 - bi + 7 - 5 + 4i*2. Calculate the smallest common multiple of a(2) and 22. 132 Let q	{ "pile_set_name": "DM Mathematics" }
(f3 - 3f + 3f) - 2f*4 - 4f*4 + 4f*4 + 5f*3 - 3f*3 - 3f*3 - 3f*4. -7f4 - f3 Expand (7 - 4 - 4 - i)(4 - 1 - 4)(3i + 3i - 5i). i2 + i Expand (16c + 8c - 5c)((-2 + 4 - 3)(-1 + 3 - 3) + 2 + 1 - 2). 38c Expand -6s*4 + 0s*4 + 2s*4 + (4s*4 - 2s4 - s4)(0 + 5 - 4). -3s*4 Expand (-k + 3k + 0k)(3 - 3 + 1) + (-2k + 2k + 2k)(-2 + 1 - 1) + 4k + 2k - 9k. -5k Expand 4w4 + 7w*4 - 9w*4 + (-3w + 3w - w2)(-w*2 - 4w + 4w). 3w*4 Expand (-3p - 3p2 + 3p)(5 + 1 + 2). -24p*2 Expand (2g + 3g - g)(1 - 2g3 - 1) + (-2g*3 - 2 + 2)(2g + 3g - 3g). -12g*4 Expand (2l + 6l + 2l)(-4l*2 + 4l2 - l3) + (2l - 1 + 1)(3l2 - 3l2 + l3). -8l4 Expand (-3w*4 + 0w*4 + 2w*4)(-4 + 4 + 2w) - 4w*5 - 4w*5 + 0w*5 + (-1 + 1 - 1)(-2w2 + 2w*5 + 2w*2). -12w*5 Expand (10 + 10 - 41)(-2 + y + 2)(-y2 + 3y*2 - 3y*2). 21y*3 Expand ((0b2 + b2 - 2b2)(-3b2 + 4b*2 - 4b2) - b4 + 5b4 - 3b*4)(-5b + 4b + 3b)(-1 - 3 + 3). -8b5 Expand 2l*2 - 2l*2 - 7l*2 + (-2 + 1 - 2)(3l + 2l*2 - 3l). -13l2 Expand (5r*3 - 4r3 + r3 + (-4r + 4r + 2r3)(-6 + 4 + 3))(0 + 0 - 2r). -8r4 Expand (-8d - 6 + 6)(-2d*2 + d - d)(4d2 - 5d2 - d2). -32d5 Expand (-4 + 0 + 1)(3 + 0 + 6)(-2 - 2 + 6)(j - 2 + 2). -54j Expand (-2 - 1 + 0)(4o - o - o) + 1 - 1 + 4o. -2o Expand 0i*3 + 3i*3 - 4i*3 + (-i + i - 2i*2)(-i - 3i + 2i) + 0i3 - 3i*3 + 5i*3 + 4i*2 + 2i*3 - 4i*2 - 6i + 7i3 + 6i. 14i3 Expand (-12v*3 + 19v - 19v)(3 - 5 + 3). -12v3 Expand (-6g + 3g + 4g)(9g - g + g). 9g2 Expand (0 + 3 + 1)(-5r - r + 3r) + 1 - 1 + r. -11r Expand (-6w + 6w - w)(-3 + 0 - 2w2 + 1). 2w*3 + 2w Expand (0k - k + 2k)(-4 + 4 - k)(9 + 7 + 6). -22k2 Expand (4k*2 + 0k*2 - 2k*2)(6k2 + 4k*2 - 6k*2). 8k*4 Expand (0 + 0 + 2)(0a3 + 4a*3 - 2a*3)(-16a2 + 0a*2 + 7a*2). -36a*5 Expand (-71y - 18 + 71y + 2y*2)(6y2 - 4y*2 - 3y*2). -2y*4 + 18y*2 Expand (-2k*3 + 2k*3 - 2k*3 + (-2k + k*2 + 2k)(2k - 6k + 5k))(-k - 2k + 0k)(4 + 0 - 2). 6k4 Expand 0y - 2 + 3 + y + (-y + 0y + 0y)(1 + 2 - 8). 6y + 1 Expand -4 + 4 - 2u4 - 8u4 + u4 + 0u4 + (u3 - 6u*3 + 3u*3)(0u + u - 3u). -5u4 Expand -5a - 6a2 + 5a + (-a - 2a + 4a)(1 - a - 1) + 3a2 - a2 - 3a2. -8a*2 Expand (-3l - l + 0l)(0l + l - 58 + 61). -4l*2 - 12l Expand (2 - 3 + 2)(l3 - 5l*3 + 3l*3) + 0l3 + l3 - 2l3 + (-1 - 1 + 0)(0l3 + 7l*3 - 3l*3). -10l*3 Expand (1 + 1 + d - 5)(0 - 2 + 1). -d + 3 Expand z + z + 0z + (-z + z + 2z)(-3 - 1 + 1). -4z Expand (-5q + q + 6q + 3 - 3 + q + (2q - 2 + 2)(5 - 4 + 1) + 3q + q - 5q)(2 + 0q - 3 + q). 6q2 - 6q Expand 2a5 - 4a*2 + 4a*2 + (-2 + 4 - 3)(-2a5 + 5a5 - a5) + 5a2 - 5a*2 - 2a*5 - 4a*5 - 2a*5 + 4a*5. -4a*5 Expand (-2m*5 + 2m*5 - 2m*5)(-2 + 0 + 0) + (0m + 0m - 3m3)(-4m2 - 19m*2 + 0m*2) + (0m + 0m - m)(m4 - m4 - m*4). 74m*5 Expand (14 - 12 + 6a + a)(-1 + a2 + 2a - 2a). 7a*3 + 2a*2 - 7a - 2 Expand (-2 + 5 - 1)(b + 0b - 2b - 3b + b + b + 0b + 2b - 4b + (-5b - b + 4b)(3 + 0 - 1) - 2 + b + 2 - b + 3b - 16b). -42b Expand (-2 - 1 - 1)(o*2 + 0o*2 + 0o*2)(-4o + 5 + 8o - 2o). -8o*3 - 20o*2 Expand (-2x*2 - 4x*2 + 2x*2)(0 - 2x - x3 + 0 - 1). 4x*5 + 8x*3 + 4x*2 Expand 2q*2 - 14q*2 + 6q2 + q2 + 0q2 + 0q*2 + (7q - 5q + 6q)(2q - 5q + 2q). -13q2 Expand (-2 - 1 + 2)(-2 + 2t + 2) - 52 + 52 - 115t. -117t Expand (-26x + 18x + 21x)(4x - x*4 - 4x). -13x5 Expand (0 + 4 - 2)(3u + u - 3u)(-2 + 0 + 0)(0 + 4 - 2)(2 - 4 + 1). 8u Expand (-2v2 + v - v + (-2v + 2v + 2v)(-1 + 1 - 2v) + 0v + 0v + 3v2)(-v + v + v*2)(4v - 5v - 8v). 27v*5 Expand (98 + 4q - 94 + 3q)(-2 - 2 + 2). -14q - 8 Expand (2r*2 - 47r*2 - 39r*2)(2r3 - r3 - 3r*3). 168r*5 Expand (1 - 3 + 4)(2 + 3 - 4)(-z4 - 5z5 + z4) + 5z5 - 3z*5 - 3z*5. -11z5 Expand (-m2 + 2m - 2m)(m - 4m + 0m) + m3 + 4m*3 - 2m*3. 6m*3 Expand 2s + 2 - 2 + 2s + 0s + 0s + (0s + 0s + s)(0 - 1 + 0) + 3s + 4s - 5s - 2s + 4 - 4 - 1. 3s - 1 Expand (0 - 1 - 2m + 0)(-m2 + 5m - 5m). 2m3 + m2 Expand -h*2 - 4h*2 + 2h*2 + (3h - 3h + 2h*2)(0 + 4 - 2) + 2h2 + 1 - 1 + 2h2 - h2 + 0h2. 4h*2 Expand (3l3 + l3 - 2l3 + (6l*3 - 3l3 - l3)(4 - 3 - 2) + 4l3 + l3 - 4l3 + l3 + 2l*3 - 5l*3)(l2 - 11 + 11). -l5 Expand (3m2 + 3m*2 - 3m*2)((0m2 + m2 + 0m*2)(4m + 3m - 5m) + 2m*3 - 4m3 - m3 - m2 + m2 - m*3). -6m*5 Expand (4 - 2 + 0)(-g + 4 - 4) + g - 8 + 8 + 2g - 3g + 3g. g Expand (-3l + 3l - l2)(-l + 0l + 3l) + (0l2 + 2l*3 + 0l*2)(-3 + 0 + 2). -4l3 Expand (0c - 2c + 0c)(5 - 3 - 3)(1 + 5 + 2). 16c Expand (-2t*2 + 4t2 - t2)(0 - 4 + 2) + 0t*2 + 4t2 - t2. t*2 Expand 2k*2 - 2k2 + k2 + (-6k + 6k + 5k)(1 + 0 + 1)(-2k + 4k + 0k). 21k2 Expand (0q*2 + 0q2 - q2)(-q + 2q + 0q) + 0q3 - q3 + 3q3 + 56q*3 - 100q*3 + 230q*3 + 293q*3. 480q*3 Expand (-3b*3 + 5b3 - b3)(1 - b2 - 1) + 7b*5 - 433b*3 + 433b*3. 6b*5 Expand -3u*2 + 0u + 2u - u + u2 + 2u2 - u2 + (-2u2 + 0u*2 + 4u*2)(-1 + 1 + 1). u*2 + u Expand (-j + 0j + 2j)(-2 + 4 + 2)(-3 + 5 - 4). -8j Expand (-2i3 - 5i*2 + 5i*2)(-2i + 2i + 2i) + 40i*4 + 52i*4 - 102i*4 + (0i - i - i)(2i*3 - 1 + 1). -18i*4 Expand (0w*2 - 3w*2 + 8w*2)(0w2 + 4w*2 - 3w*2). 5w*4 Expand (0r2 + r2 - 3r2)(5r3 + r3 - 7r*3) + (4r2 - r2 - r*2)(0r3 + 2r*3 + 0r3) - r5 - 2r5 + r5. 4r*5 Expand (-w + w - 3w)(3w*4 - 4w*4 - 2w*4) + (1 - 1 + 2w)(2w4 + w4 - 4w4) + w2 - w2 - 2w*5. 5w*5 Expand (1 + 2 - 1)(3 - w - 3)(4w4 + w4 + 3w4 + (-1 + 1 + 2w)(-2w*3 - 2w*3 + 3w*3)). -12w*5 Expand (-2z + 2z - 7z)(7 - 3 - 3)(0 + 1 + 0)(4z + 2z - 4z). -14z2 Expand (0 + 2 - 1 + (1 + 3 - 6)(2 - 4 + 4) - 2 + 3 - 3)(4h3 - h3 - h*3)(21 + 0 + 11). -320h3 Expand 12m + 6m - 3m + (m - m - 2m)(3 - 6 + 1) - 4m + 4m + 2m. 21m Expand (4f - 5f + 2f)(-2f - f2 + 2f) + 2f3 - 2f + 0f3 + 4f. f*3 + 2f Expand 2l + l3 - 2l + (3l2 + 9l - 9l)(-3l + 5l - 3l) + (-2l*3 + l - l)(-5 + 1 + 2). 2l3 Expand 2w*2 - 1 + 1 + (-9w*2 - 2 + 14w*2 + 3)(-2 - 1 + 0). -13w2 - 3 Expand (2b3 - b3 + b*3)(5b + 2b*2 - 5b) - 16b2 - 2b*5 + 16b*2. 2b*5 Expand (f - 3f - 2f)(3f2 - 3f*2 + 2f*3)(2f + 3f - 3f). -16f*5 Expand (-4w + 6w + w)(13w - w2 - 7w - 14w). -3w*3 - 24w*2 Expand (0i + i + 3i)(4i - 2i + 4i). 24i*2 Expand (-5q + 3q + q + q + q - 3q + (-3 + 0 + 7)(q + 2q - 5q))(-q2 - q4 + q*2). 10q*5 Expand (-v - 5v + 4v)(-8v2 - 7 - 15v*2 + 20v*2). 6v*3 + 14v Expand -142n2 + 142n2 + n4 + (0 + 2n2 + 0)(5 - 5 - n2). -n4 Expand (4 - 2 + 0)(2f + 0 + 0) + 5f - 4f - 3f - 2 + 2 + 3f + (3 + 2 - 4)(0 + 0 + 2f). 7f Expand (-u3 + 0u*3 + 2u*3)(3u2 - 6u - 5u2 + 3u). -2u5 - 3u*4 Expand (1 - 4 - 3)(-2q3 + 4q*3 + 3q*3)(-4q + 0q + 2q). 60q*4 Expand -16o*3 + 2o*5 + 16o*3 - 15o*4 + (1 + 5 - 4)(-2o3 - 2o*5 + 2o*3). -2o*5 - 15o*4 Expand (s - s + 3s*2)(-3 + 1 + 0)(4 - 1 + 0). -18s*2 Expand 3f5 - f5 + 0f5 - 4f*5 + 7f*5 + 8f*5 - 2f*3 + 2f3 + f5 + (-2f2 - f3 + 2f*2)(-2f2 + 3f - 3f) - 2f - f*5 + 2f. 15f5 Expand (-3j*3 + 16j*2 - 16j*2)(j*2 + 6 - 6 + 2j). -3j5 - 6j*4 Expand -5y + 2y - 2y - 2y - 2y + 6y + (3y - 2y + y)(-2 + 3 - 3). -7y Expand (2 + 1 - 1)(-5l + 3l + 0l) - l + 3l + 0l + (-2 + 0 + 4)(-7l + 5 + 2l + 9). -12l + 28 Expand (-4d + 0d + 0d + (-4 + 3 - 1)(2d - 1 + 1))((d + 5d - 4d)(-3d + 6d - d) + (3 - 3 + 1)(0d + 0d - d2)). -24d*3 Expand (-4 + 3 + 19)(-4f*4	{ "pile_set_name": "DM Mathematics" }
What is the units digit of q? 1 Let o = 6457 - 3717. What is the thousands digit of o? 2 Suppose 3f = -3i - 0i - 72, 5f - 4i + 84 = 0. Let p be (-6)/(-15)5f. Let g = p - -72. What is the units digit of g? 2 Let d(y) = -36y + 15. Let m be d(-8). Let h = m - 65. What is the units digit of h? 8 Let g = 4244 + -728. What is the tens digit of g? 1 Let i = -33 - -33. Suppose -3s + 2s + 22 = i. Let u = 84 - s. What is the tens digit of u? 6 Suppose -5x - 5n = -35, -3x - 3n - 3 = -8n. Let f(r) = 5r*2 + 13. What is the units digit of f(x)? 3 What is the hundreds digit of (-2)/(-4) + (-10285)/(-34)? 3 Suppose -5r = -22 + 2. Suppose -5m = -rv + 13 - 57, -24 = -m - 3v. What is the units digit of m? 2 Suppose -2m + 1368 = -y, -5y - 2748 = -4m - 0m. What is the tens digit of m? 8 Let f = 8 + 108. Suppose -z + f = 3x, -2z - 77 - 81 = -4x. Suppose -x = -w - 0w + o, 3w = -5o + 101. What is the tens digit of w? 3 Let x(m) = -m3 + 13m*2 - 11m - 10. Let b be x(12). Suppose br - 51 = 81. What is the units digit of r? 6 Let c be 26 - (-21 + 1)/(-4). Suppose 90 = 3k - 3s, -5k + 40 = 3s - 94. What is the units digit of (3/2)/(c/k)? 2 Suppose 0 = -i - s - 8 + 49, 3i - 4s = 144. What is the units digit of i? 4 Let l(i) = 125i*2 + 69i - 293. What is the tens digit of l(4)? 8 Let h = 32 + -45. Let k be (-2)/h + (-121)/(-143). Suppose -3x = -4x + 5d - k, 0 = 5d - 15. What is the units digit of x? 4 Let u(b) = 4 - 3 - 22b2 + 2b + 26b2. Let l be u(-1). Suppose 4w + w = k + 85, lw + 2k = 38. What is the tens digit of w? 1 Let a = -885 - -1359. What is the units digit of a? 4 Suppose -s = 61 - 66. Let t(k) = -k*2 - k + 45. Let f be t(0). Suppose -n + f = -4d, -64 + 319 = 5n - sd. What is the units digit of n? 3 Let p(a) = -13a - 21. What is the units digit of p(-5)? 4 Let w(n) = 1246n*2 - 2n + 1. What is the thousands digit of w(1)? 1 Let f = 152 - 101. What is the tens digit of f? 5 Let o(u) = -u*2 - 10u - 44. Let j be o(-12). Suppose -3d = -1 + 124. Let n = d - j. What is the units digit of n? 7 What is the hundreds digit of -3004(-5 + 15/(-12) + 6)? 7 Suppose 4u - 4f = 1692, 5f - 2f - 2123 = -5u. What is the hundreds digit of u? 4 Suppose 6w + 88 = 8914. What is the units digit of w? 1 Let b be 1/((-2)/24 + 9/27). Suppose v = 2, 90 + 20 = bd + 5v. What is the units digit of d? 5 Let w be (6 + -1)24/40. Suppose wd - 12 = 0, -z - 2d + 29 = 2z. Let t(x) = 2x + 8. What is the units digit of t(z)? 2 Let i be (-1)/(4/6 + -1). Suppose -3u = -5g + u - 4, 3 = -2g + 3u. Suppose g = 2b + 5k - 18 - 4, -2b = ik - 18. What is the units digit of b? 6 Let b(y) = -7y + 2. Let d = -23 + 16. Let j be b(d). Let f = j - 29. What is the tens digit of f? 2 Let j(s) = 16s + 18. Let q = -57 - -65. What is the hundreds digit of j(q)? 1 Let v(w) = -20 + w + 11 + 7. Let m be v(7). Let y = m - -6. What is the tens digit of y? 1 Suppose f + 2p + 26 = 3f, -2p = -4f + 54. Suppose 6y = 4 + f. What is the units digit of y? 3 Let l be -4((-14)/8 + 1). Let m(a) = -a2 + 4a - 1. Let y be m(l). Suppose -5i + 45 = -5w, 0 = 5i - yw - 26 - 7. What is the units digit of i? 5 Let f(g) = 26g - 201. What is the units digit of f(14)? 3 Suppose 2r = 62 + 86. Let z = r - 26. What is the units digit of z? 8 Let s = 22 - -6. Suppose -s = -0j - 4j + 4t, 2t = 3j - 24. Suppose -11 = f + 4c, -4f = c - j - 21. What is the units digit of f? 9 Suppose 0m - 6m = 0. Suppose -4u - g = -214, m = -2u - g + 39 + 67. What is the tens digit of u? 5 Let d(c) = 31c*3 + 3c*2 + 11c + 9. Let z(u) = -u - 1. Let l(b) = -d(b) - 6z(b). What is the tens digit of l(-1)? 3 Suppose 9 = -2w + 5w. Suppose 3 + 186 = wv. What is the tens digit of v? 6 Suppose -330 = -3p + 66. Suppose 2s = -0s - 4f + p, 0 = s + 5f - 60. What is the tens digit of s/4(-160)/(-56)? 5 Suppose -8661 = -16r + 13r. What is the units digit of r? 7 Let w(c) = 2c3 + 2c*2 - 1. Let v(u) = u + u - 16u - 5 + u*3 + 12u*2 - 6. Let p be v(-13). What is the tens digit of w(p)? 2 Let k(b) be the first derivative of 3b3 + b2 - 5b - 7. What is the tens digit of k(3)? 8 Let k(x) = x2 - 3x. Let u be k(3). Suppose -4j + 3j + 86 = u. What is the units digit of j? 6 Suppose -o + 2q + 92 = 0, -3o + 261 = 2q - 39. What is the units digit of o/2 + (2 - -2)/2? 1 Suppose -2z + z + 418 = 0. Let g = z - 159. Suppose 0 = -k - 6k + g. What is the units digit of k? 7 Let s(g) = -14g*2 + 5g - 10. Let y be s(2). What is the units digit of 0 + y/(-2) - (36 + -34)? 6 Suppose -2j + 5m = -0m - 27, 0 = 4j + 4m - 12. Let u(l) = -l3 + 7l*2 - 3l. Let r be u(j). Suppose 0 = -k + 4k - r. What is the units digit of k? 6 Suppose 0 + 10 = -2y + 5g, 3g - 18 = 2y. Let b = 106 + y. What is the units digit of b? 1 Suppose 4c = t + 2t + 99, 50 = 2c - 2t. Suppose 2d - d = 2. Suppose -5h + j = -60, dh + 4j = -0j + c. What is the tens digit of h? 1 Let b(x) = -x*3 - 8x*2 - 14x - 10. Let n be b(-6). Suppose 185 = 2c + i, -nc + i = -3i - 200. What is the tens digit of c? 9 Suppose -4i - v + 5 = 2v, -25 = -3i + 2v. Suppose -io + 6 + 14 = 0. Suppose -4j = -ow - 0w - 208, -5w = -3j + 154. What is the units digit of j? 3 Let w be (28/(-7))/(-11/1). Suppose -2b = -w, -6r + 3b + 409 = -r. What is the units digit of r? 3 Let y(b) = -10b - 6. Let r(t) = t + 1. Let h(j) = 4r(j) - y(j). Let g be h(-7). What is the tens digit of (g/(-12) + -3)6? 2 What is the tens digit of ((-260)/(-6))/((-18)/(-2268))? 6 Suppose -3o + 14 = 5. Suppose -of - l = -5f + 31, 5l + 35 = 2f. What is the units digit of f? 5 Let d(t) = t + 13. Let j be d(-9). Suppose -4w - 2i + 279 + 47 = 0, 3i - 325 = -jw. Suppose 23 = 3c - w. What is the units digit of c? 5 Suppose -2k - u = -7, -6 = -3u + 5u. Suppose -3r + kw = -168 - 470, 2w = -8. Let y = r - 146. What is the units digit of y? 0 Suppose -1911 - 2314 = -5f. What is the tens digit of f? 4 Suppose -3w + 0w = -633. Suppose -67 = 3z - w. Suppose j - 4j + z = 0. What is the units digit of j? 6 Suppose 5s = -c + 15525, 5s - 59c - 15545 = -64c. What is the thousands digit of s? 3 Suppose 0 = 2h - 0h + 10. Let z(b) = -2b - 2. Let c be z(h). Suppose 9w - cw = 44. What is the tens digit of w? 4 Let z(n) be the first derivative of 4n3 - 3n*2 + 5. What is the units digit of z(4)? 8 Let q = 14 + -11. Suppose z - 45 = 3w, 3z - 42 - 81 = -qw. Suppose 7v = 4v + z. What is the tens digit of v? 1 Let l = 7 + -4. Suppose -w = 5k - 9, k - 6k + 17 = lw. What is the units digit of k? 1 Suppose -6n = -2n - 44. Let a(l) = -l3 + 10l*2 + 8l - 4. Let q be a(n). Let o = -21 - q. What is the units digit of o? 6 Suppose -3d - 961 = -5t + 545, 3t - 2510 = 5d. Let m = d - -703. What is the hundreds digit of m? 2 Let o(d) = -7d + 25. Let n be o(10). Let t = n + 64. What is the tens digit of t? 1 Suppose 10m - 492 = -2m. Suppose -3s - m = -5x - 180, -5s - 4x + 244 = 0. What is the units digit of s? 8 Suppose -30l + 5351 = -1789. What is the hundreds digit of l? 2 What is the units digit of 8953/9 - (7 + 195/(-27))? 5 Let q = -625 - -1115. What is the units digit of q? 0 Let l(i) = -2i2 + 5i + 3. Let g be l(4). Let d = g + 9. Suppose 11 + 7 = 2u + 2w, d = -4u + 3w + 43. What is the units digit of u? 0 Suppose -5l + 9c = 13c - 1198, 5c = 5l - 1180. What is the hundreds digit of l? 2 Let t = 153 - 90. Let r = 209 - t. What is the tens digit of r? 4 Suppose 3t = -3p + 6, 4t - 10 = -t. Suppose -3j + 4l + 35 - 9 = 0, p = 5j - 4l - 46. What is the units digit of j? 0 Suppose 2f + 2f - 20 = 0. Suppose 4i - 4n = 13 + 3, 32 = 5i + n. Let d = i - f. What is the units digit of d? 1 Let r(p) be the first derivative of -p4/4 - p2/2 + p - 1. Let h be r(-3). Let z = h + -14. What is the tens digit of z? 1 Suppose -5t = 3 + 52. Let h = t - -16. Suppose 2z + 2 = 0, ha - z - 24 - 112 = 0. What is the units digit of a? 7 Let y(l) = 2l2 + 27l + 25. What is the hundreds digit of y(-18)? 1 Suppose -3s - 2l = l - 3, -2s + 10 = 4l. Let d be -3 + 4 + s + 6. Let y(p) = 4p + 14. What is the tens digit of y(d)? 3 Let z = -3 + 5. Suppose -3s = -5g - zs + 9, -	{ "pile_set_name": "DM Mathematics" }
13 What is the remainder when 728 is divided by -5 - (92/(-14) - 153/357)? 0 Let b be ((-25 - -24) + 9)/(1/(-10)). Let a = 206 + -106. Let t = b + a. What is the remainder when 78 is divided by t? 18 What is the remainder when ((-7980)/(-14))/(4 + 2 - 4) is divided by 98? 89 Suppose y + 43y = 27y + 442. Calculate the remainder when 79 is divided by y. 1 Let j(o) = 1146o + 4606. What is the remainder when 599 is divided by j(-4)? 5 Let r = 156 + 27. Let v = r - 60. Calculate the remainder when v is divided by 21/49 + 642/21. 30 Suppose y + 508 = o, -39o = -44o - y + 2558. What is the remainder when 514 is divided by o? 3 Let a(u) = u2 - u + 88. Let r be a(0). Suppose -7w + r + 10 = 0. What is the remainder when 20 is divided by w? 6 Let o = 8061 - 7476. What is the remainder when o is divided by 165? 90 Let f(c) = c + 1. Let r be f(-6). Let g(a) = a*3 - 21a*2 + 2a + 45. What is the remainder when g(21) is divided by 20/r(-45)/12? 12 Calculate the remainder when 376 is divided by 1((-2)/3 + 48/18). 0 Let q = -11298 - -11321. What is the remainder when 13246 is divided by q? 21 Let z(d) = 10d3 - 21d*2 - 5d - 5. Calculate the remainder when 849 is divided by z(3). 56 Let c(g) = 18 - 2g2 - 10g*2 - 5g*2 + 21g*2 - 33g. Calculate the remainder when 90 is divided by c(9). 0 Suppose 50c - 45c - 5 = 0, -4u + 73 = c. Calculate the remainder when 57 is divided by u. 3 Suppose 175 - 1651 = -41i. Suppose 5o - 529 = 2r, 0o + 122 = o + 5r. Calculate the remainder when o is divided by i. 35 Let h(d) = -6d + 10. Let p(i) = -5i + 10. Let j(u) = -6h(u) + 7p(u). Suppose -3w + 28 = -74. Calculate the remainder when w is divided by j(9). 15 Suppose 5q - 8197 = -2038 + 1906. What is the remainder when q is divided by 268? 5 Let l be (9/(-27) + 19/(-6))-2. Suppose -5y - 3x - 11 = 0, ly - 2 = 3y + 3x. Calculate the remainder when 3y + -8 + 37 is divided by 4. 2 Let i(r) = -r3 + 6r*2 + 3. Let x be i(6). Let o(v) = 11v + 2vx + 3v - 10 - 3v3 + 10v*2. What is the remainder when o(11) is divided by 6? 5 Let d be (-5)/(-7 - (-4 - 2)). Suppose -50 = -dm + 5w, -w = -3m + 3 + 19. Calculate the remainder when 41 is divided by m. 5 Suppose 0 = 5y + 376 - 76. What is the remainder when ((-9)/(-7 + -2) - (-1 + -77))1 is divided by ((-24)/(-10))/((-9)/y)? 15 Let q(u) = 33u + 2127. What is the remainder when q(-64) is divided by 11? 4 Let j = -8048 + 8697. What is the remainder when j is divided by 240? 169 Let h(u) = 28u*3 - 3u*2 + 2u + 1. Let x be 2 - (2 - -2) - -4. Calculate the remainder when h(x) is divided by 45. 37 Suppose 2z = 2j, 4 = -z + 2j - 0. Let r = 9356 - 9348. What is the remainder when r is divided by (-6)/z(-8)/6? 0 Let t(q) = 2q2 + 14q. Let u be t(-11). Suppose -s + u = s. What is the remainder when s is divided by 60/10(-6)/(-4)? 8 Let d = -4 - -7. Let y be -1 - -4 - (-1)/(d - 4). Suppose -4s = 0, 7l - ys = 2l + 55. What is the remainder when 42 is divided by l? 9 Let a(l) = -25l - 238. Let n be (2 + -11)2/(-6). Suppose n - 83 = -5k. What is the remainder when k is divided by a(-10)? 4 Suppose 4o - 2t = 96 - 26, -2o - 4t = -10. What is the remainder when 202 is divided by 344/(-6)o/(-10)? 32 Let c(p) = -29125p + 349537. Suppose -5n + 441 = -4n. Calculate the remainder when n is divided by c(12). 34 Let k be ((-12)/(-33))/(4/22). Let p(x) = 3x + 14. What is the remainder when k - (-27)/(-6)-22 is divided by p(4)? 23 Let i = -53289 - -53356. Let m = -1 + 4. Suppose z - 10 = -mo, 3z - 5o + o = 30. What is the remainder when i is divided by z? 7 Let b = -20 + 18. Let v be 36/12(80/(-6) - b). Let d = 66 + v. What is the remainder when d is divided by 7? 4 Let i(o) be the second derivative of 34o*3/3 - 49o*2 + 216o. Calculate the remainder when i(4) is divided by 35. 34 Let q be (-8 - 10/(-2)) + 150/30. Let s(d) = 191d3 - d. Let k be s(1). Suppose qp - k = -3p. Calculate the remainder when p is divided by 11. 5 Let v(p) = 17p*2 - 2p3 - 69 + p3 + 95p + 9 + 8p*2. Calculate the remainder when v(28) is divided by 34. 10 Suppose 14c - 7774 = 22c - 21c. What is the remainder when c is divided by 49 + (-2 + 3)/1? 48 Let s(r) = 7r - 71. Let m(h) = -14h + 144. Let o(l) = 6m(l) + 11s(l). Calculate the remainder when 78 is divided by o(9). 18 Suppose 10 = 3i - 2f, 3f - 4f + 10 = i. Calculate the remainder when i is divided by 2. 0 Suppose 395q - 387q - 1808 = 0. Calculate the remainder when 477 is divided by q. 25 Let g(t) = t*2 + 38t + 112. Let d = -7 + 69. Calculate the remainder when d is divided by g(-35). 6 Calculate the remainder when 14/(-4)(-27)/42(-1760)/(-33) is divided by 38. 6 Suppose 14j - 9j - 15 = 0, -3n + 81 = 2j. Calculate the remainder when 346 is divided by n. 21 Let k(a) = -17a3 + a2 + 5a + 8. Let j(f) = f*2 - 4f + 1. Let l be j(3). What is the remainder when k(l) is divided by 36? 30 Suppose -15600 = -177w + 102w. What is the remainder when w is divided by 111? 97 Let k(i) = 4i2 + 21i + 65. Let x(s) = -20s2 - 105s - 326. Let g(f) = 11k(f) + 2x(f). Calculate the remainder when g(-4) is divided by 13. 4 Suppose -2f + 1087 = u, -5f - 10u + 2700 = -5u. Calculate the remainder when f is divided by 523. 24 Suppose 60n = -12n + 3n + 138. Suppose -10 = -r - r. Suppose -rt + t + 36 = 0. What is the remainder when t is divided by n? 1 Let y be (1/(-1))/(4/(-16)). Suppose -4s - s + 8 = -3p, -ys - 5p = -36. Calculate the remainder when 104 is divided by (3 + -3 - -17) + s. 20 Let i(d) = 2d3 + 1. Let l(p) = -p + 4. Let o(k) = 11k - 118. Let j be o(11). What is the remainder when i(1) is divided by l(j)? 0 What is the remainder when (21/6)/((102/300)/17) is divided by 82? 11 Calculate the remainder when (4/(-30))/((-372)/1674)(-1 + 12806) is divided by 17. 16 Let c(o) = 6o + 37. Let x be c(-6). Suppose x = 3d - 4d + 3r, -4r - 16 = 0. Calculate the remainder when -14/4d is divided by 7. 6 Let k(g) = 3g2 + 10g - 423. What is the remainder when 767 is divided by k(-14)? 17 Suppose 0 = -4h + u + 2u + 246, -5u = h - 50. Calculate the remainder when h is divided by -4((-252)/(-16))/(-9). 4 Let u = -169 - -379. Let d = u + -115. What is the remainder when d is divided by 16? 15 Suppose 207 = 15u - 12u. Suppose -6r + 3r - 73 = -o, 4r + u = o. Let c = 112 - o. What is the remainder when c is divided by 18? 9 Let w = 19254 - 17489. Calculate the remainder when w is divided by 13. 10 Suppose 5k + 10 = 0, 69h - 2966 = 65h + 5k. What is the remainder when h is divided by 149? 143 Suppose 21b = -4066 - 2969. Let c = 339 + b. What is the remainder when 8 is divided by c? 0 Let n be ((-210)/(-49) + -4)49. Suppose n - 44 = -2p. Calculate the remainder when 132 is divided by p. 12 What is the remainder when 1145 is divided by (-36)/20((-196)/3 + (-12 - -19))? 95 Let r(b) = 19b - 119. Let g be r(8). What is the remainder when 38 is divided by ((-30)/(-4))/(g/22)? 3 Let a(d) = d*3 + 45d*2 - 50d - 152. Let k be a(-46). Suppose -28v - 68 = -kv. What is the remainder when v is divided by 4? 1 Let f(w) = -2w2 - 4w2 - w3 + 9 - 12w - w - w2. What is the remainder when 37 is divided by f(-4)? 11 Suppose -3g + 2k + 7 + 3 = 0, 10 = -2k. Suppose g = j - 12j + 517. What is the remainder when j is divided by 30? 17 Let r = 86 + -82. Let l = -10 + r. Let b(f) = f3 + 5f*2 - 9f - 8. What is the remainder when 11 is divided by b(l)? 1 Suppose -14y + 100 = -19y. What is the remainder when 93 is divided by y/(-2) - (-9 + 2 - -5)? 9 Let b = -277 - -257. Let u = -6 + 89. Let x = b + u. What is the remainder when x is divided by 13? 11 Suppose 2f - 3 = 23. Let w be 7 - f - 4-1. Calculate the remainder when (-17 - -14)5w is divided by 4. 2 Let p(z) = -1950z + 577. What is the remainder when p(0) is divided by 25? 2 Suppose k - 4o = -15, 0o + 5o - 22 = -2k. Let j be (-23 + 13)/((-5)/2). Suppose j = -19g + 23g. What is the remainder when g is divided by k? 0 Let q(x) = 2x*2 - 125x - 390. Calculate the remainder when q(92) is divided by 40. 38 Let m = -2704 - -2737. Calculate the remainder when 945 is divided by m. 21 Suppose 8m - 12m = 3y - 90, 0 = -3y + 5*	{ "pile_set_name": "DM Mathematics" }
2? (a) 3 (b) -375 (c) 204.8 (d) -1 (e) -1/3 a What is the nearest to -0.1 in 42, 0, -27.7, -0.4, -2? 0 Which is the closest to 0? (a) -185/3 (b) 4 (c) -1709 b What is the nearest to -11 in -0.5, 157, -2/11, -19? -19 What is the nearest to -1 in 9, 4, 50/1117, -2? -2 What is the nearest to 91 in -0.1, 1.2, -0.2, 4/83? 1.2 Which is the closest to 0.8? (a) 1/5 (b) -10.9 (c) 5/71 a What is the nearest to -3 in -72/109, 19/2, 5/3, 0.05? -72/109 Which is the nearest to 8? (a) 60 (b) 0.4 (c) -0.008 (d) -3 b What is the closest to 0.2 in 7, 69/5, -3, 0.1? 0.1 Which is the closest to 1/282? (a) -4 (b) 15/11 (c) -34/11 (d) 5 b What is the closest to -94/5 in 50/7, 0.1, -6.8, -1/3? -6.8 Which is the nearest to 2? (a) -5 (b) 14682 (c) 4 (d) -4/183 c Which is the closest to 4.3? (a) 2/9 (b) 66/5 (c) -104 a Which is the closest to -6? (a) 3/5 (b) 33 (c) 0.234 (d) 3 (e) -27 c What is the nearest to 2/51 in -6.5, 2/9, 0.4, -2/21, -9, 5? -2/21 What is the nearest to -2 in 5, -1/83, -1862? -1/83 What is the closest to -2/9 in 4, -5.7, -10.6, 0.4? 0.4 Which is the nearest to -6? (a) -5 (b) 0.48 (c) 0.3 (d) 3602 a What is the nearest to -1/3 in -1/6, -2/23, 1/9, -1.3, -0.22? -0.22 Which is the closest to 0.1? (a) 0.442 (b) 3 (c) -5 (d) 5 (e) 1/76 e Which is the nearest to -1/4? (a) 12856 (b) 0.3 (c) 4 (d) 325 (e) -3/5 e What is the closest to 3/4 in -12.7, -0.2, -0.06, -4, 352, 0.5? 0.5 Which is the closest to 0? (a) 20185 (b) -1 (c) -143 (d) -2/11 d Which is the nearest to 61? (a) -4 (b) -5 (c) -6 (d) 4 (e) -195 d What is the nearest to -2/21 in -0.05, 33/136, 2/7, -1? -0.05 What is the nearest to -4 in -1596284, -4, 2/9? -4 What is the nearest to -0.1 in -0.8, -0.057, 56221? -0.057 What is the closest to 1/14 in 2/15, -0.3, -1, -5, 295? 2/15 Which is the closest to 15.6774? (a) 0 (b) -2/7 (c) 4 (d) -5 c Which is the nearest to -1? (a) -0.3 (b) 2 (c) -2992 (d) -29321 a Which is the closest to -1/6? (a) -25 (b) -96 (c) 5.9 c What is the nearest to 2/4633 in -4/7, -2, 94? -4/7 What is the closest to -77 in -25, 0.439, 2, -0.4? -25 What is the nearest to 1/32 in 0.4, -1508, 0.5? 0.4 What is the nearest to 0 in 1.52, -6, -13, -46/3, 1/7, 5? 1/7 Which is the closest to -0.2? (a) 6 (b) 361 (c) 39 (d) -2 (e) 0.1 e Which is the closest to 2/13? (a) -568 (b) 1/8 (c) -2/13 (d) 1/3 (e) -26 (f) 1/4 b Which is the closest to 7.5? (a) -2/9 (b) 2/5 (c) 955 (d) -3 (e) 1/3 (f) -0.05 b Which is the closest to 0? (a) 262 (b) -5 (c) 0 (d) -9 c What is the closest to -1/3 in -0.1235, -6, -0.4, -1/5, -0.1? -0.4 What is the nearest to 273 in -7, 2, 39798? 2 Which is the closest to -0.2? (a) -1 (b) 3.3 (c) 0 (d) -1/666 (e) -4/3 (f) -10 d Which is the nearest to -2.9364? (a) -4 (b) -2/19 (c) 0.4 a Which is the nearest to 0.1? (a) 53 (b) 0 (c) -5 (d) 5 (e) 0.1 (f) -234 e Which is the closest to -1/3? (a) 4 (b) 1553/575 (c) 7 b What is the nearest to 2/3 in -0.1, 10499452, 2/3? 2/3 Which is the nearest to 1? (a) -4 (b) -0.5 (c) 169/23 (d) 5 (e) 3 (f) -2/9 f Which is the nearest to 0? (a) -0.4 (b) -5 (c) -0.5 (d) -10/89 (e) -7 (f) -2 d What is the closest to -2 in -619965, -0.3, -8? -0.3 What is the nearest to 15684 in 1/3, 0.5, -0.2, 14, 3? 14 Which is the nearest to 8? (a) 2/13 (b) -0.06 (c) -2.324 (d) -5 a What is the nearest to -2/5 in -1/4, 0.0113, 4/15, 2, -0.2? -1/4 Which is the closest to -0.04? (a) 2/17 (b) -4 (c) 0.04 (d) 1/41871 d What is the closest to -16 in -2.8, 4/5, 1246/11, 0? -2.8 What is the closest to -2 in 0, -2, 41, -1, -26, 269? -2 What is the nearest to -0.2 in 23, 33, 0.4, -0.2, 0.083? -0.2 What is the closest to 2/709 in -2, 44, -5, -1/8, 0.3? -1/8 Which is the nearest to 0.1? (a) 7394 (b) -50 (c) -1 c Which is the nearest to -841496? (a) 3/5 (b) -1/4 (c) 5 b Which is the nearest to -1/3? (a) 6 (b) -0.07 (c) 0.2 (d) 3385/8 (e) 3 b What is the nearest to -0.9 in 2, -0.2, -6, -3/11? -3/11 What is the closest to 0 in -0.1, 69, -17008? -0.1 Which is the nearest to 1? (a) -108556 (b) -2 (c) -3 b Which is the nearest to -2? (a) 2/13 (b) -0.2 (c) -2105 (d) -3 (e) -6.1 d What is the closest to -576/5 in -3/14, -13, -1, -7? -13 Which is the closest to -3? (a) 1 (b) 0.1 (c) -0.15 (d) -31 (e) 0.014 c What is the closest to 2/9 in 1241, 1/33, -6? 1/33 What is the nearest to 1/3 in -1, 267/4, 1/6, 0.37? 0.37 What is the nearest to 1/2 in -3, -1107630, 1/6? 1/6 Which is the nearest to 1/4? (a) -0.1 (b) -14.9 (c) 4 (d) -5 (e) 0.1 (f) 0.57 e Which is the closest to 1/10? (a) 15/113 (b) -1 (c) -4 (d) -0.13 a Which is the closest to 7? (a) -2 (b) 1/6 (c) -38 (d) 0.07 (e) 90 b Which is the closest to -30465? (a) -1/2 (b) -5 (c) 2/3 (d) 0 (e) -14/9 b What is the nearest to 0.02 in -6, -6/331, -0.2, -5, 3? -6/331 What is the nearest to 150/11 in -3/4, 3/10, 4/7, 2/5? 4/7 What is the nearest to -44 in -33464, -1/2, -3/5, 0? -3/5 Which is the nearest to -0.3? (a) 2/9 (b) 6 (c) -4 (d) -2.03 a Which is the closest to 2/9? (a) -1/6 (b) 3/8 (c) 7807 (d) 0.5 (e) -208 b Which is the nearest to 6? (a) 2/7 (b) -0.06 (c) -4 (d) -0.3 (e) -6 a Which is the nearest to -1? (a) 0.55 (b) 0.4 (c) -21 (d) 557 b What is the nearest to -1.8 in -1, -11/4, 3.6, 1/2, 2, 20? -1 What is the closest to 4 in -2/3, 12, -412, -3, 0.5? 0.5 What is the nearest to 2/15 in -2/5, 0, -1/193, -2/11, -5? 0 What is the closest to 16/7 in -75, 4, 31, -0.3, 1? 1 What is the nearest to -31 in 1/2, 361, 11.5? 1/2 Which is the closest to 77533? (a) 41 (b) -1/11 (c) -2/9 a What is the closest to 1 in -5, -394/3, 43? -5 What is the nearest to -8 in -4/5, -22421, 2/33? -4/5 Which is the closest to -1? (a) 13712103 (b) 0.2 (c) 2/9 b What is the nearest to 12 in -2/13, 30321, -1/4, 4, 0.04? 4 What is the closest to -0.5 in 65.9, 1/7, 0.2, 1428, -3? 1/7 Which is the closest to 15146? (a) -3/7 (b) 66 (c) -0.2 b Which is the closest to 0.0194? (a) 0.5 (b) -1/4 (c) 282 (d) 0.2 d What is the nearest to -11 in 0.1, 4140, 2, -1, -2? -2 What is the nearest to -1 in 5, 8, 0.3, 2, -699? 0.3 Which is the closest to -0.2? (a) 0.12 (b) 0 (c) 3 (d) -9/5 (e) 2/1713 b Which is the nearest to 1/4? (a) -15 (b) -1 (c) 4 (d) 5 (e) -4830 (f) -0.2 f Which is the nearest to -57? (a) 6/7 (b) 3 (c) -0.053 (d) 3/19 (e) -29 e Which is the closest to 56/3? (a) -11 (b) -100 (c) 0.026 (d) 5 (e) -3 d What is the nearest to -0.1 in 29/9, 17168, -1/5, -5/3? -1/5 Which is the closest to 168? (a) 10 (b) -1/4 (c) 220 (d) 6 (e) 0.2 c What is the closest to 1 in -23694, 0.3, -10, 19, 2? 0.3 Which is the closest to 3? (a) 7.47 (b) 5 (c) -1 (d) 0.14 (e) 0.02 b What is the closest to -0.8 in 50/11, 0.059, 6, 0.5, -3? 0.059 What is the nearest to 1 in 50, 15, 11652? 15 Which is the closest to 1.5? (a) 0.08 (b) 2/975 (c) 9 a What is the nearest to -2 in -1/5, -0.3, 7/12, -0.4, -0.05, -1/14? -0.4 Which is the nearest to -9/7? (a) 0 (b) -15 (c) 2 (d) 3 (e) -0.2058 e What is the closest to 0.632 in -3, 1.6, 2/1323? 2/1323 What is the nearest to -4967/6 in 1/5, 2/5, -1, -1/5, 0.26? -1 What is the closest to 0 in 4, -2/7, -5, 10470, -0.8? -2/7 What is the closest to 4 in 0.3, 238, 198, -0.5? 0.3 Which is the nearest to -1? (a) 3/1396 (b) 2/11 (c) 4/421 (d) -5 a Which is the nearest to 2/7? (a) -1594205 (b) -4 (c) -3 c Which is the nearest to -2/7? (a) 14 (b) -2/9 (c) 1/2 (d) 311 (e) 3 b What is the closest to -44 in 60, 6, -4, 9? -4 Which is the nearest to -4? (a) 0.3 (b) 8 (c) 0 (d) 15 (e) 95 c Which is the closest to 6758841? (a) -0.3 (b) 1 (c) -4 b Which is the closest to 1? (a) -1/5 (b) 3 (c) -3/11 (d) 9292 (e) 3/10 e What is the closest to -1 in -3, 18, -4/5, -244, -6? -4/5 What is the closest to 0.2 in -9, 2/13, -277, -0.01? 2/13 Which is the closest to -1/4? (a) -29751 (b) 2/19 (c) 2 (d) 65 (e) -5 b What is the nearest to 1 in -2/11, 159, -512, 2/3? 2/3 Which is the closest to -2/11? (a) -2 (b) -10448 (c) 6 a What is the closest to -933 in 1/12, -1, -0.1173, -4? -4 Which is the nearest to -0.03? (a) 2 (b) -2 (c) 4 (d) -2/11 (e) 0.4 (f) 4972 d Which is the closest to 1? (a) -4 (b) -183484 (c) 4	{ "pile_set_name": "DM Mathematics" }
. Let w = -6 + 5.56. Let j = w + 0.04. Which is greater: c or j? c Let p = -6 - -32. Suppose -l + p = 24. Suppose -lm + 0 + 2 = 0. Which is smaller: m or -5/16? -5/16 Suppose -296059 = -20y - 95599. Do y and 10023 have different values? False Let o = 300 + -523. Let g = 222.98 + o. Are g and -1/4 equal? False Let p = -2190.1 + 2190. Do p and -0.3621 have the same value? False Let c be 4/7(-7)/(-2). Let s be -2((-16028)/4600 + 4) - -1. Let h = 23916/7475 - s. Is c at least h? False Suppose 5n + 8 = n. Let i(g) = 19g - 5. Let b(t) = -17t + 5. Let w(x) = nb(x) - 3i(x). Let v be w(-1). Which is bigger: 27 or v? v Let t = 412 - 339. Suppose t - 75 = -2p. Do p and 24 have the same value? False Let b be ((-144)/(-16 - -4))/(3/(-1)). Let t(k) = -2k2 - 1. Let v be t(-2). Is v less than b? True Let z(u) = 187100u - 8. Let d be z(-1). Let b = d + 1314616/7. Let j = b - 698. Which is smaller: j or -4? -4 Let z = 5 - 5. Suppose z = 3x + 2x + 5. Let t be (1/42)/(368/69 + -6). Which is smaller: x or t? x Let v(z) = 3z2 + 25z - 298. Let b be v(-15). Is -182 >= b? False Let f = -68901 + 620989/9. Are f and 97 non-equal? True Suppose r = -0r - 42. Let s = 87 + r. Let t be 40/s6 + 2/3. Which is smaller: 4 or t? 4 Let y be 10/18 + 68352/(-123552). Which is greater: y or -1? y Suppose 42c - 31 = 11. Let h = 0.017 - 2.817. Which is smaller: c or h? h Let k = 211 - 147. Let m = -79.1 + 12.1. Let i = k + m. Which is greater: i or 4/9? 4/9 Let p = -8 + 8.1. Let i(y) = 379y*3 + 2y + 3. Let g be i(-1). Let m = 323 + g. Which is bigger: m or p? p Suppose 0 = -19y + 104y - 6y + 29546. Is y less than -372? True Suppose 2x + 6 = 12u - 8u, 5x = 4u - 21. Is 11/991 greater than or equal to u? True Let u be (-8528)/819 - 9 - 2/(-9). Is -18 greater than or equal to u? True Let o = -9365/11 - -847. Let p(g) = g. Let k(f) = -25f. Let w(i) = k(i) + 30p(i). Let h be w(-1). Which is smaller: o or h? h Let j = 1772 - 2000. Is j at most -2? True Suppose 18n = 19n - 950. Let u = -12359/13 + n. Suppose -5o - 5 = -0o. Which is smaller: o or u? o Suppose 0 = 2g, -4g = k - 546 + 8. Let d = k - 538. Which is smaller: d or 4/135? d Let p = 10 - 13. Let o(z) = 2z + 44. Let m be o(-9). Suppose -2u - m = 5g - 3, 0 = -u + 2g - 34. Which is smaller: p or u? u Let i = 12089 + -204853/17. Which is smaller: 39 or i? i Suppose l - 10 = 3l. Let v(c) = c. Let d(k) = -k3 - 9k*2 - 6k + 45. Let s(x) = -d(x) - 3v(x). Let o be s(-8). Is o < l? False Let q(f) be the second derivative of f4/4 - 35f*3/2 - 27f*2/2 - 2f + 6. Let d be q(30). Which is greater: -476 or d? -476 Suppose 0 = -5u - 3p + 63, 4u + p = 3u + 11. Let s be 5558/(-80) + (-6)/u. Let b = s + 513/8. Is -6 bigger than b? False Let d be (-3)/(-43) - (-11 + (-1310)/(-120)). Which is smaller: -721 or d? -721 Let w be ((-10)/(-1))/(-5) + (3 - -2). Let c be -21 + w/((-9)/(-3)). Is -19 at most c? False Suppose -23j = 215 - 1336 + 155. Let o(t) = -5t3 + 2t*2 + 3t. Let w be o(-2). Is w bigger than j? False Let l = -5761 + 5761.14. Which is greater: 5/11 or l? 5/11 Let w be (-174)/203(-6 - 1). Let i be 225 - (1 + (-12)/w). Which is smaller: i or 227? i Suppose 205g = 185g + 40. Which is smaller: -2328 or g? -2328 Let a = 77 - 77. Let o be a((-4)/8 + 0). Is 3 > o? True Let o be 20/84-39-7. Suppose -3a + 207 = -7i + 5i, o = a - 2i. Which is greater: 0.1 or a? a Suppose 0 = -y - 140 - 27. Let r = y - -499/3. Which is smaller: r or 0.061? r Let y be 5(17732/3120 - (-1)/(-12)). Are y and 558/19 unequal? True Let l(a) = -a + 16. Let q be l(6). Let z be (70/(-9))/q + (-3)/(-9). Which is smaller: z or 0? z Let m(k) = -121k - 29124. Let d be m(-239). Let l(a) = -51a - 2. Let f be l(4). Which is greater: f or d? d Let k = -38501.4 - -38493. Which is smaller: k or 65? k Let r(p) = p3 + 2p*2 - p - 6 + 1 + 12. Let v be r(-3). Is -151 at most as big as v? True Let r = 109 - 110. Let t = -55 - r. Let n = t + 54.1. Is 0 less than n? True Let k be -13 + -1 + (-11435)/(-2860). Let r = 11179 + -11178. Which is bigger: r or k? r Let s be 1/(-17) + 123430/112880 + -1. Is s < 0? False Let n be 1 + -1(-3 + 5). Let r = 764.07 + -758. Let x = -6.1 + r. Which is smaller: n or x? n Let q = 155 + -77. Let m(b) = -b2 + 30b - 24. Let x be m(29). Suppose y - 72 = xa - 2y, -3y = 5a + q. Is a smaller than -15? False Let j be 64/(-6)(17 + -23). Let f be 5 + 96/(-18) - j/(-12). Which is smaller: 6 or f? f Let h(r) = -r3 + 9r*2 - 4r - 96. Let w be h(8). Let f(j) = 7j - 9. Let q be f(-8). Let y = q - w. Which is greater: y or -3? y Let j(i) = -i2 + 8i - 13. Let u be j(6). Let z(y) = -22y3 - 2y*2 - 2y. Let m be z(u). Suppose 6k - m = 7k. Do -22 and k have the same value? True Let v be (-5)/(-90)-55 - -3. Suppose 3m = m - 5h + 53, -3m = -4h - 68. Suppose -mq = -23q. Which is greater: v or q? q Let o = -6.98 - -0.38. Let u = -46441.8 + 46442. Do o and u have the same value? False Let r(c) = -65c*2 - 1486c - 33. Let i be r(-12). Which is greater: i or 8437? i Suppose 6q + 3382 + 1646 = 0. Let r be (q/(-6))/((40/12)/(-10)). Is r >= -418? False Let v = 186/5 + -739/20. Let t = v - 51/220. Which is bigger: 0 or t? t Let c = 1505.64 + -245.54. Let g = c - 1211. Let p = -49 + g. Which is smaller: p or -5? -5 Let g(w) = 17w*2 + 10w - 13w2 - 3 + 11w*3 - 12w*3 - 7w*2. Let p be g(-6). Is 46 smaller than p? False Suppose 2k = -27 - 453. Let y = k - -144. Let p be 2/(-6) + y/36. Is 0.8 at most as big as p? False Let h = -20.5 + 30. Let v = h - 10.04. Let y = v + 0.51. Which is bigger: 2 or y? 2 Let i = -315/2 - -2763493/17546. Which is greater: -1 or i? i Let w(h) = -59h + 2118. Let g be w(35). Which is bigger: 1230/23 or g? 1230/23 Suppose -x - 3 = 3q - 4x, 5q - 3x + 1 = 0. Let o(z) = -5z + 25. Let f be o(-4). Let p be 66/f - (-6)/(-15). Is q at most p? True Let x = -0.5009 - -3.9009. Are x and 15.4 non-equal? True Suppose 120i - 116i = -5f + 929, 4f + 3i - 742 = 0. Which is smaller: 179 or f? 179 Let p = 534 + -524. Let y be (-5)/p - 1(-81)/160. Which is greater: y or 1/3? 1/3 Suppose -3y + 8y = -3i + 221, 10 = 5i. Suppose -74 = 128v - 129v + 4c, 3v = -c + 144. Is v not equal to y? True Let w(v) = v*3 - 10v*2 - 23v - 7. Let i be w(12). Suppose -5q = z - 6, 9q - z + i = 13q. Which is bigger: q or 2/523? q Let h(y) = y3 + 10y*2 - 21y - 211. Let q be h(-10). Which is bigger: q or 11/30? 11/30 Suppose -5r = -6r. Suppose 12 = -s - 3h + 4h, 4s - 3h + 51 = r. Let a = 9 + s. Which is greater: a or -3? -3 Let q = -58.61 + 44.61. Which is smaller: -30 or q? -30 Suppose 35a = -16a - 4a + 1430. Which is greater: 883 or a? 883 Let f = 112/151 + 75393/755. Is f <= 100? False Suppose -3 = 3n - 6, 2y + 2n + 376 = 0. Let m = 207 + y. Is 2 at most m? True Let f = 74 + -47. Let b(s) = -5s + 5s - 3s - f. Let c be b(-9). Which is bigger: c or 8/29? 8/29 Suppose 2j - 13h + 17h + 402 = 0, j + 195 = h. Let x = j - -181. Which is smaller: x or -10? x Let w(v) = v*3 - 4v*2 + 4v + 5. Let d be w(3). Let o = 0 + d. Suppose om = 188 + 132. Are 41 and m non-equal? True Let s = -579/296 + 287863/146520. Which is smaller: s or -1? -1 Let i = 40006/3 + -13336. Is i at most -1040? False Let w be (1 + -7)/(18/(-12)). Let m(u) = -20u + 102. Let f be m(w). Is f bigger than 24? False Let b be ((-2)/(-3)42/(-112))/(39778/16). Which is bigger: b or 0? 0 Let u = -25 - -10.6. Let v = -14.29 - u. Which is bigger: -0.02 or v? v Let c = -376 - -20677/55. Suppose 2o + 55 = -3k + 56, 0 = -5k + 5. Which is smaller: c or o? o Let t = 12 + -8. Suppose 32 = ta - 3a. Let j(x) = -5x - 4. Let z be j(-7). Is a smaller than z? False Let a be 1(-3 + 0 + 5). Suppose -au + 48 = 58. Which is smaller: u or 4/11? u Let v = 15954.781 - 15955. Let g = -0.1 - -0.1. Which is smaller: v or g? v Let v = -19264.1 - -19264. Which is greater: v or -3072? v Let b = 1672 - 1943. Do b and -1 have the same value? False Let z = 2/11117 - 333532/122287. Is z at least -2? False Let l = 15 - 9. Suppose lp = 9p - 12. Suppose 2n = pd - 38, 0 = -d - n - 0n + 11. Is d less than or equal to 10? True Let i = -3/37397 + 62714793/299176. Which is bigger: 211 or i? 211 Suppose 2*i	{ "pile_set_name": "DM Mathematics" }
10 - (4 + (3 - 0)) - 1. 2 -4 - (-13 - (-4 - -1)) 6 What is the value of 14 - (10 - 2) - 15? -9 What is -7 - -13 - (6 + (0 - -2))? -2 What is 2 - (-2 - (-1 - 1))? 2 -10 - (-7 - 2) - (2 - -2) -5 Evaluate -3 + (-1 - 0) + 3. -1 Calculate 7 + -4 - 0 - (2 - -2). -1 3 + ((-2 - -6) + -3 - 0) 4 What is the value of 1 + 3 + (3 - 5 - 4)? -2 What is (-1 - 3) + (-5 - -5)? -4 What is the value of 19 + -28 + (4 - 0)? -5 -3 + 8 - (0 + (-6 - -6)) 5 Calculate 24 + -20 + -11 + 6 + -3. -4 Evaluate 10 + 27 + -22 + (-10 - 1). 4 Calculate 6 - (-11 + 20) - 3. -6 What is 8 + (-18 - -7 - 3)? -6 Calculate 2 + -3 + 3 + -6 + -1. -5 Evaluate -14 + (20 - (15 - 3)). -6 Evaluate (5 - 7 - 19) + 11. -10 Evaluate -1 - (6 + -6) - 4. -5 Evaluate -9 + (6 - -10) - 10. -3 6 + (-4 - (14 - 7)) -5 What is the value of -1 + -1 + 5 - (-13 - -12)? 4 -8 - (3 - (5 - 3 - -5)) -4 What is the value of (-9 - -1) + 134 + -123? 3 Evaluate 37 + -38 - (1 + -11). 9 Evaluate (-4 - -1) + (-5 - (-2 - 2)). -4 1 - (2 - -3 - 3) -1 What is 2 - ((6 - 6 - -6) + 0)? -4 What is the value of (-7 + 0 - (-1 - 3)) + 0? -3 What is the value of 36 + -42 - ((2 - 2) + -9)? 3 What is the value of -4 + 2 + (-3 - -4)? -1 (-3 + -5 - -4) + 6 2 Calculate (0 - 7) + (19 - 6). 6 What is the value of 0 + -1 + (10 + -10 - -6)? 5 What is 7 + (0 + -20 - -5) + 7? -1 Evaluate 2 - (-8 - -7) - -3. 6 Evaluate 2 + -1 + (-2 - 1). -2 What is 7 + -7 + 1 + -1 - 1? -1 -2 + 2 + -2 + 2 0 What is -1 - (0 + -4 + 3 + -1)? 1 What is (113 - 112) + 1 + 4? 6 Calculate 32 + -36 - (-1 + 0 - 0). -3 What is the value of -6 + 17 + -8 - 2 - 6? -5 Evaluate (-13 - -19) + 9 + -17. -2 What is -2 + -7 + -55 + 70? 6 Evaluate 4 + -3 - (2 + -4). 3 Calculate 4 + -5 + (2 - 1). 0 What is 8 + (-4 - -2) - (22 - 21)? 5 Calculate (-14 - -22 - 10) + -4 + 0. -6 What is the value of -9 + -62 + 70 + -2 + -1? -4 Evaluate 11 + -19 + (-7 - -4). -11 What is 10 + -6 + 3 + -9 + -1? -3 13 - (10 - 4) - 14 -7 What is the value of (-4 - 0 - -5) + 0 + -6? -5 (0 - -7) + (-11 - -9) 5 -3 + 4 - (0 + (3 - 0)) -2 What is the value of -3 + -1 + (-3 - -3) + 11? 7 2 + -5 + (2 - (-10 + 4)) 5 Evaluate (1 - 0) + -2 - (6 - 8). 1 What is the value of 0 + -2 + -1 + 3 + 0? 0 What is the value of -7 + 0 + -5 + (4 - -6)? -2 What is -183 + 174 - (0 - 17)? 8 Evaluate -22 - -22 - (0 - (2 - 1)). 1 What is the value of 1 + (-6 - -4) - (10 + -6)? -5 What is 6 - (-9 + 23) - (2 + -15)? 5 Calculate (-3 - (-5 + 2)) + 0 - 4. -4 What is -3 - (-6 - 2) - 3? 2 Evaluate 0 + 5 + (17 - 28) - -2. -4 Calculate 0 + 3 + 0 + (38 - 36). 5 Evaluate -7 - (-1 - 5) - 3. -4 Evaluate 3 + 0 + 9 + 0 + -8. 4 What is the value of -6 + 6 + -1 + -6? -7 Calculate (0 - 1) + 7 + -7. -1 Evaluate 37 + -45 - (-5 + (2 - 2)). -3 Calculate -2 + (-5 - -7) + 0 + -4. -4 Evaluate (3 - 11) + 5 - (-1 + 5). -7 (-4 - 2) + (32 - 32) -6 Calculate -5 - (-13 + 9 + -3). 2 Evaluate 0 + 0 + 0 + -5. -5 Evaluate (4 - 14) + (1 - -2). -7 Calculate -1 + -1 - (2 - 6). 2 0 + (-1 - -3) + (-9 - -12) 5 Calculate (4 - 1) + (13 + -10 - 10). -4 Evaluate 8 + -2 + -6 + 2 + 2. 4 What is the value of -5 + 1 + -5 + 10? 1 (2 - 0) + 14 + -14 2 Evaluate (-5 - -20 - 14) + 2 + 1. 4 Evaluate (3 - 4) + (0 - -1) + -3. -3 What is the value of -5 + (11 + -8 - 2)? -4 Calculate -1 - (9 + -6 + -9 - -11). -6 What is the value of -3 - (14 + -2 + -2 - 7)? -6 What is the value of 1 + 4 - (1 + 2 + 5)? -3 What is 3 + 3 + (1 - 9)? -2 -3 - (4 + (-3 - (13 - 5))) 4 What is 10 - (14 - 5) - -6? 7 Evaluate -4 - (4 + (2 - -1) + -14). 3 Calculate 1 + 1 + -1 - (0 + -2). 3 What is the value of -2 + (5 - 0) + -4 + 2? 1 What is the value of 1 - (0 + (-1 + 0 - -3))? -1 What is 3 - (7 - 3 - (2 + 0))? 1 What is the value of (4 + -6 - (-2 + 1)) + 3? 2 What is the value of 2 - 4 - (4 - (0 - -2))? -4 Calculate 0 - (-4 - (-4 + 4 - -1)). 5 Calculate -13 + 8 + 13 - (0 + -1). 9 (5 - (-10 + 9)) + 0 + -1 5 (3 - -4) + -8 - -7 6 Evaluate 1 + -3 - (-8 - -11) - -1. -4 What is (2 - 0) + -3 + 3 - -2? 4 (1 - 3) + 70 + -65 3 Calculate -4 - (3 - (-3 - -9)). -1 Calculate -3 - (-10 + 5 - -3). -1 Calculate (90 - 77) + -8 + 0 + 2. 7 What is -8 + (-2 - -8) + (-3 - -1)? -4 (-3 + 3 - 3) + 4 + -1 0 What is the value of 29 + -34 - (-6 + 1)? 0 Evaluate (-2 + 3 - -5 - 4) + 4. 6 -3 - (-6 + (-4 - -9)) -2 What is 9 - (-9 - (-8 + -4))? 6 Evaluate 20 + -16 - (5 - -1). -2 -9 + -4 - (-10 - -2) -5 Evaluate (-8 - -4) + 3 + -2. -3 Evaluate -1 + 3 + -11 + 7. -2 Evaluate -1 - (-1 - (-10 + 6)). -4 What is the value of (-1 - 0) + (-4 - -12 - 5)? 2 Evaluate (-1 - -2) + -3 - 6 - -5. -3 Calculate (8 - 0) + (-32 - -29). 5 Calculate 3 - (1 - 2) - 4. 0 What is the value of -9 - (-49 - -46 - (1 - 6))? -11 What is the value of 4 - (-4 - (-5 - -2))? 5 Calculate (-8 - (-7 - (4 + -6))) + 11. 8 What is -11 + 8 + (-1 - 1) - 0? -5 What is 3 - (-8 + -11 + 17)? 5 Calculate (-1 + 3 - -1) + (12 - 14). 1 2 - 5 - 6 - -5 -4 What is -15 - (-7 - (-1 + 3))? -6 Evaluate -7 - (-12 - -5 - (4 + 2)). 6 Evaluate -2 - 0 - (0 + -3). 1 What is the value of (-5 - -4) + (-2 - 0)? -3 What is the value of -7 - -10 - (6 + -2 + 2)? -3 What is the value of -5 + (6 - 11) + 8? -2 Evaluate -2 - (-3 + (0 - -1)). 0 What is -3 + (0 - 4) - -4? -3 What is the value of 2 - (-1 + 4 - (14 - 12))? 1 What is the value of -6 + (7 - 2) - 2? -3 Calculate 1 + (1 - 2) - (-4 - 1). 5 Evaluate -4 + 1 + -4 + 11. 4 Evaluate -3 + -6 + 12 + -9. -6 What is the value of (-4 + 1 - (17 + -12)) + 2? -6 What is the value of 83 + -80 - ((-2 - -1) + 3)? 1 What is 0 + 0 - (6 + -2 + 1)? -5 Calculate (-10 - (-4 + 0)) + 9. 3 Calculate -10 - (2 + -4) - -7 - 5. -6 Calculate -6 + (25 - 12) + 2. 9 What is 2 - 2 - (0 + -3)? 3 Evaluate -3 - 1 - -1 - (-2 + 3). -4 Calculate (-1 - 1) + (52 - 49). 1 1 + (-2 - -4) - (-20 + 23) 0 What is -3 + (-2 + 5 - (3 + -3))? 0 What is (-2 - (3 + -7)) + 3? 5 (0 - (2 - 5)) + 0 + 0 3 What is the value of -95 + 95 + (-5 - 2)? -7 Evaluate -3 + -1 + 3 - -2. 1 What is 8 + (33 - 34) + 0 + 1? 8 What is the value of -1 - (-4 + (1 - -2))? 0 What is the value of -5 - (-4 + -8) - 2? 5 Evaluate -6 - 0 - (-20 - -12). 2 What is -4 + (3 - 0) + -1? -2 (-3 - (-7 - 2)) + -5 1 Evaluate -3 + (-2 - -2 - -4) + 2. 3 Calculate (15 - 9) + 1 + -6. 1 What is -2 + -3 - 1 - 2 - -6? -2 What is 7 - (-4 + (7 - -3))? 1 What is (-2 - 2) + (3 - (-5 - 0))? 4 Calculate -16 - -8 - (0 + -2). -6 What is the value of (-2 - 1) + 3 - 7? -7 What is the value of 2 + 3 + -1 + -2? 2 Calculate 3 + (-2 + 1 - -3). 5 Evaluate -1 + 6 + -53 + 52. 4 -2 + -1 + (7 - (7 - 7)) 4 -1 - 6 - (60 - 75) 8 Evaluate 0 - ((1 - 1) + 4). -4 -11 + 6 + 0 + 3 - -1 -1 Calculate (-4 - 0) + (-35 - -41). 2 Calculate -6 + 9 + -6 - -6. 3 Evaluate -3 + (0 - 0) + 5 + -5. -3 Calculate 0 + -1 + -3 + (2 - 2). -4 Calculate -5 + 2 - (-11 + (4 - 1)). 5 (-30 - -37) + (-2 - -3 - 7) 1 What is -2 + ((0 - 4) + 1 - -4)? -1 What is the value of (-3 - 2) + 0 + -4 + 5? -4 Calculate 0 + -7 - (-67 + 63). -3 What is -1 - ((0 - -4) + -1 + 3)? -7 Evaluate 2 + -2 + 6 + -5 + -3. -2 Evaluate (5 - 15 - -7) + -6 + 1. -8 Evaluate 2 + -5 + 3 + -8 + 4. -4 Evaluate (6 - 3) + (0 - -4) + -4. 3 What is the value of 0 + -1 + 4 + -39 + 32? -4 Calculate 2 + -7 - 15 - -10. -10 What is -6 + (0 + 1 - -3) + -3? -5 What is the value of -3 + 4 + 0 + -5? -4 Calculate 4 - (10 + (-4 - (4 - 6))). -4 Evaluate (18 - (-15 - -25)) + -7 + 0. 1 Evaluate 1 + -5 - -11 - (0 + 3). 4 What is -7 + (-3 - -7) + -2 + 2? -3 What is (7 - (4 - 12)) + -7? 8 Calculate 3 + 14 - 29 - (-4 + 0). -8 Evaluate -4 + -5 + 6 + -2 - 0. -5 What is the value of (-2 - -4) + -2 + 5 + -9? -4 What is the value of -4 + 7 - (-2 - -1 - -2)? 2 Calculate (7 - 1) + (3 - 1) + -3. 5 7 - (-2 - 3 - -7 - 3) 8 Calculate 0 - (-11 + (5 - 0)) - 17. -11 Calculate (-8 + -1 - -17) + (-1 - 1). 6 Calculate (-7 - -1) + 10 + -9 + 5. 0 What is (4 - 4) + 2 - 4? -2 Evaluate -4 + (2 - 0) + (5 - 5). -2 What is (72 - 63 - (7 - 1)) + -7? -4 Evaluate (152 - 149) + (0 - (0 + 1)). 2 Calculate -5 - -10 - 1 - (1 - -4). -1 Evaluate -2 - (0 + (1 - 1) + 3). -5 -20 - -23 - (1 + 1) 1 Evaluate -8 - (-1 + -6) - -4. 3 What is -3 + (4 - -2) + -4? -1 Calculate -1 + (-1 - -1) + -1 - 3. -5 1 + -4 + (6 + -4 - -1) 0 What is the value of -4 + 4 + 3 + 1? 4 What is the value of -14 + 2 + 7 - -5? 0 -2 - (-4 + 1 + -1 + 2) 0 What is the value of 2 + 6 + -5 + -2? 1 Evaluate 3 - (1 - 3 - -7). -2 What is the value of	{ "pile_set_name": "DM Mathematics" }
l - 18. Determine o, given that 27o*2 - 33o*2 + 392o*5 + 14o*2 + 231o*3 + 281o*l - 4 - 868o*4 - 40o = 0. -1/7, 1/2, 1 Factor 394/5i2 - 2/5i*3 - 394/5 + 2/5i. -2(i - 197)(i - 1)(i + 1)/5 Let x = -405723/91 - -58005/13. Solve 2/7n*4 + 128/7 - xn*3 - 192/7n + 104/7n2 = 0. 2, 4 Let x(u) be the third derivative of u8/1344 + 13u*7/210 + 2u*2 + 301u. Factor x(d). d*4(d + 52)/4 Let v(z) = -z*3 + 14z*2 + 227. Let n be v(15). Let s(j) be the first derivative of -1/15j*5 + 0j + 1/12j4 + 1/9j*3 - 1/6j*n + 3. Factor s(x). -x(x - 1)*2(x + 1)/3 Suppose 0 = -140v + 151v - 121. Suppose vg - 34 = 10. What is p in 2p + 0 + 18p2 + 8p*5 + 97/2p*3 + 36p*g = 0? -2, -1/4, 0 Let q(p) = 14998p + 165028. Let t be q(-11). Factor 0 - 1/2h4 - th*2 + 10h*3 + 0h. -h*2(h - 10)*2/2 Let s(y) be the third derivative of -2y*2 + 0y*4 - 4/15y*5 + 0y + 2/105y7 + 1/10y*6 - 9 + 0y*3. Factor s(h). 4h*2(h - 1)(h + 4) Suppose 2437 - 781 + 935t*2 - 1968t*2 - 664t - 2t3 + 955t*2 = 0. Calculate t. -23, -18, 2 Suppose 3n*2 - 13/4n + 1/4n3 + 0 = 0. What is n? -13, 0, 1 Factor -40d - 26 - 35 + d*2 - 68. (d - 43)(d + 3) Let w be -4 + (-26)/(-6) - 111/9. Let r be (-3)/w + -3(-3)/252. Let 0 - rt - 10/7t2 = 0. What is t? -1/5, 0 Let 69169/9o + 527/9o3 + 69695/9o*2 + 0 + 1/9o*4 = 0. What is o? -263, -1, 0 Suppose 7 = 8j - 1. Let q(a) = -10a3 - 2a*2 + 9a*3 + a + 2a*2 - j. Let x(u) = -2u*4 + 6u*3 - 6u + 4. Let v(o) = 2q(o) + x(o). Solve v(r) = 0. -1, 1 Let b(q) be the second derivative of 0q*4 + 49q + 1/150q5 - 2/5q*2 - 7/45q*3 + 0. Factor b(m). 2(m - 3)(m + 1)(m + 2)/15 Let y(w) = 11w - 11. Let f be y(1). Let c(r) be the second derivative of f - 1/72r*4 + 7/18r*3 - 14r - 13/12r2. Find s such that c(s) = 0. 1, 13 Let s = -874149/4 + 218538. Find r such that sr*5 + 3/4r*4 - 3r*2 - 3r*3 + 0r + 0 = 0. -2, -1, 0, 2 Let i = 446 + -432. Let w be -4(-65)/(-182)i/(-6). Determine r so that 25/3 + 1/3r2 + wr = 0. -5 Let d(n) be the third derivative of n*5/210 + 529n*4/42 + 279841n*3/21 + 15n*2 - 79. Factor d(s). 2(s + 529)*2/7 Let a = -31 + 33. Suppose -4 - 4 = -au. Let -9i2 + 38i*3 + 4i - 11i2 - 10i*3 - 12iu = 0. Calculate i. 0, 1/3, 1 Let d(z) = -z4 + z*2 - 2z + 1. Let m(h) = 5h4 + 4h3 + h2 + 10h - 13. Let b = 302 - 304. Let f(j) = bm(j) - 14d(j). What is l in f(l) = 0? -1, 1, 3 Let q(v) be the third derivative of -7v*6/24 - 59v*5/2 - 7625v*4/8 - 6250v*3/3 - 24v*2 - 6. Factor q(l). -5(l + 25)*2(7l + 4) Let v(c) be the second derivative of -c5/80 - c4/8 - c3/3 + 10c - 33. Determine u, given that v(u) = 0. -4, -2, 0 Let p(s) be the third derivative of s*5/45 + 5s*4/2 + 72s*3 + 2269s*2 + 2. Factor p(b). 4(b + 9)(b + 36)/3 Let d = 65942/76965 + 4/10995. What is v in 0 + 0v - 9/7v2 - dv*5 - 6/7v*3 + 3v4 = 0? -1/2, 0, 1, 3 Let x(a) be the second derivative of a7/14 - a*6 - 9a*5/20 + 35a*4 + 98a*3 - 4a - 14. Factor x(p). 3p(p - 7)*2(p + 2)2 Let u(d) be the third derivative of -d7/70 - 3d6/5 - 11d*5/10 + 3d*4 + 23d*3/2 + 163d*2 + 2d. Factor u(i). -3(i - 1)(i + 1)*2(i + 23) Let y(t) be the third derivative of -2t7/105 + 7t*6/30 + 73t*5/15 + 77t*4/6 - 104t*3 - 8661t*2. What is q in y(q) = 0? -4, -3, 1, 13 Let p(i) be the third derivative of 0i + 1/8i4 + 0 - 63i*2 + 0i*3 - 1/24i*6 + 1/30i*5. Factor p(o). -o(o - 1)(5o + 3) Let m(b) be the third derivative of 17b5/240 + 155b*4/96 + 3b3/4 + b2 - 188. Factor m(g). (g + 9)(17g + 2)/4 Let p = -5/11 + 41/66. Let l = 13/86 + 15/43. Solve 1/2m2 + p - lm - 1/6m3 = 0 for m. 1 Let v(p) be the third derivative of -p6/160 - 27p*5/40 - 95p*4/8 - 69p*3 + 5p*2 - 40p - 1. Factor v(i). -3(i + 2)(i + 6)(i + 46)/4 Let u = 3222308/5 - 644456. Find p, given that u + 4p + 3/5p2 = 0. -14/3, -2 Let g be ((-55)/(-100) + 979/44 + -22)5/7. Determine f, given that -2/7f2 + 6/7 - gf = 0. -3, 1 Let h(l) be the second derivative of -l*4/24 - 3l*3/2 + 115l*2/4 - 50l. Factor h(y). -(y - 5)(y + 23)/2 Let u = 7400541/5 + -1480108. Factor 34/5c + uc2 + 289/5. (c + 17)2/5 Find l such that -16l*4 - 30l*2 - 11 + 20l + 23 + 28 + 11l4 - 25l*3 = 0. -2, 1 Factor 707934 + 361a + 41a - 19034 - 151a + a*2 + 1409a. (a + 830)*2 Let v(c) be the second derivative of 0 + 1/15c*3 + 11/30c*4 - 3/5c*2 - 17c + 7/50c5. Factor v(g). 2(g + 1)*2(7g - 3)/5 Let o(z) be the first derivative of -z7/3780 + z6/810 + z5/180 - 205z*3/3 + 203. Let r(g) be the third derivative of o(g). Factor r(k). -2k(k - 3)(k + 1)/9 Let o(u) be the second derivative of u*6/10 + 177u*5/20 + 55u*4 + 4516u. Factor o(w). 3w2(w + 4)(w + 55) Let b be 50(-805)/(-700) + 13. Factor -6627/8g2 + bg - 3/2. -3(47g - 2)2/8 Let u(i) be the second derivative of i6/195 + 3i5/26 - 10i*4/39 - 20i*3/13 + 64i*2/13 - 2335i. Solve u(r) = 0. -16, -2, 1, 2 Let y = -1945 - -1098. Let a = y + 851. Solve -5/2p5 - p - 17/2p*a - 21/2p*3 - 11/2p*2 + 0 = 0. -1, -2/5, 0 Let y(i) be the third derivative of -1/60i*5 + 40i*2 + 0 + 0i + 1/24i4 - 1/120i*6 + 1/6i*3. Factor y(l). -(l - 1)(l + 1)*2 Let v(t) = -8t*3 + 30t*2 - 125t + 96. Let o(b) = 2b3 - 10b*2 + 42b - 32. Let z(n) = -14o(n) - 4v(n). Factor z(y). 4(y - 2)(y - 1)(y + 8) Let l = -115 - -189. Solve 132 - 22 + 79k*2 + 115k - lk2 = 0 for k. -22, -1 Suppose 3871o - 3745o + 2o*2 - 26 + 122 - 5o*2 + 168 = 0. What is o? -2, 44 Let i(o) = -o + 7. Let h be i(8). Let c = h - -3. Factor 309v*c - 5 + 14 - 6v - 312v2. -3(v - 1)(v + 3) Let u(g) be the third derivative of 0g*3 + 0g + 0 - 1/50g5 - 40g*2 - 13/20g*4. Factor u(k). -6k(k + 13)/5 Let t = 4765/12 - 397. Let a(z) be the second derivative of 0 - 1/2z*2 - tz*4 + 1/3z*3 + 6z. Determine d, given that a(d) = 0. 1 Suppose -35 = b - 5t - 39, 0 = 3b - 2t + 53. Let o be (104/28 - 4)/(45/b). Factor 2/15w*3 + 0w*2 - ow*4 + 0w + 0. -2w3(w - 1)/15 Let z(c) be the third derivative of -c6/360 + c4/24 - 21c3/2 + 64c*2. Let u(m) be the first derivative of z(m). Factor u(o). -(o - 1)(o + 1) Let v(r) be the first derivative of -r*3/27 + 179r*2/18 + 20r + 8476. Determine b, given that v(b) = 0. -1, 180 Let d(n) be the second derivative of n*4/4 - 63n*3 - 381n*2/2 + 1758n + 2. Factor d(q). 3(q - 127)(q + 1) Let r be (5 - (-52)/96-9)(-1)/((-66)/176). Factor 2w2 + 8 - 28/3w - rw4 + w3. -(w - 2)3(w + 3)/3 Let c = -22/749 + 4009/8988. Let k(x) be the second derivative of 5/12x4 - 1/6x*6 + cx*3 - 5/84x*7 + 0x*2 + 23x + 0x5 + 0. Factor k(a). -5a(a - 1)(a + 1)*3/2 Let g = -851 - -1320. Suppose 472k - 6 = gk. Factor 1/4y3 + yk + 0y + 0. y2(y + 4)/4 Let o(x) be the second derivative of x*4/12 - 12x*3 + 335x*2/2 - 165x - 10. Factor o(l). (l - 67)(l - 5) Let d be (-3 - 843) + -3 + 2. Let o = -9307/11 - d. What is n in on*4 + 0n + 8/11n3 + 4/11n*5 + 0 + 2/11n*2 = 0? -1, -1/2, 0 Let o(p) = 5p*2 - 3p*2 - 5 - p + 9p. Let s be o(-5). Factor 25 + v*2 - sv - 5v + 9v + 11v. (v + 5)2 Find l such that 1728l*4 + 14l + 222l2 + 350l*2 + 4l + 1251l3 + 348l*2 - 324l*5 - 653l*2 = 0. -1/3, -1/6, 0, 6 Factor 250o*3 - 15o*4 + 560o*2 - 122o*2 - 1180o + 427o2 + 60o*3 + 20o*4. 5o(o - 1)(o + 4)(o + 59) Let u(w) = -w2 - 43w - 40. Let y(d) = 2d2 + 85d + 100. Let i(l) = -11u(l) - 6y(l). Factor i(c). -(c + 5)(c + 32) Let u(l) be the second derivative of -l3/6 + 2l*2 + 7l. Let j be u(2). Factor -16q3 - q2 + 48q + q*j - 36 + 5q*2 + 3q*2 - 4q*4. -4(q - 1)*2(q + 3)*2 Let y(c) be the second derivative of 43c*6/21 + 291c*5/70 - 29c*4 - 460c*3/21 + 24c*2/7 - 5364c. What is a in y(a) = 0? -3, -2/5, 2/43, 2 Suppose 2k + 26 = 5f, 74k - 79k - 65 = -3f. Factor 6/7m*2 + f - 1/7m*3 - 9/7m. -m(m - 3)2/7 Let -2200h*2 - 138h*3 + 71h*3 + 334668h + 71h3 - 21933185 + 3303333 + 196h**2 = 0. Calculate h. 167 Let l(g) be the thir	{ "pile_set_name": "DM Mathematics" }
4, -16, -2286 Put 27, 9096, -4 in descending order. 9096, 27, -4 Put -5, 2, -7551614, 5 in increasing order. -7551614, -5, 2, 5 Sort 9, -229, 31438 in decreasing order. 31438, 9, -229 Sort 0.6, -8, -32.0441 in decreasing order. 0.6, -8, -32.0441 Sort -8, 6, 3, 633, -4 in decreasing order. 633, 6, 3, -4, -8 Put 2, -14, 3230425 in descending order. 3230425, 2, -14 Sort -2, -5, 3, 5, 6, -9, 22 in decreasing order. 22, 6, 5, 3, -2, -5, -9 Put -85, 5, 17, 10, -1, 1 in decreasing order. 17, 10, 5, 1, -1, -85 Put 1, 144, -2939 in descending order. 144, 1, -2939 Put -75, 2.3, -0.2, -1/50, -4 in ascending order. -75, -4, -0.2, -1/50, 2.3 Sort 0, -35, 4, 14671, 5 in ascending order. -35, 0, 4, 5, 14671 Sort 82, 1/6, 2, -27, 0.4, -3/4 in ascending order. -27, -3/4, 1/6, 0.4, 2, 82 Sort 2, -0.3, 26, -10/9463 in ascending order. -0.3, -10/9463, 2, 26 Sort -3, -48, 2, 2/23, 1.9 in descending order. 2, 1.9, 2/23, -3, -48 Put 561, 5, -933 in descending order. 561, 5, -933 Sort 5, -47, 1, -781, -1. -781, -47, -1, 1, 5 Put 18977, 58, -13 in decreasing order. 18977, 58, -13 Sort 6037, -6, -344 in increasing order. -344, -6, 6037 Sort 2/5, 1/7, 67, 0.06, -1, 1 in ascending order. -1, 0.06, 1/7, 2/5, 1, 67 Put 2, 0, -1, -122, 5, 32, -17 in decreasing order. 32, 5, 2, 0, -1, -17, -122 Sort -53781, 1.2, -1.9 in decreasing order. 1.2, -1.9, -53781 Put -0.1, 1, 15315 in descending order. 15315, 1, -0.1 Put -9, 6, 2/3, -0.07, 1/4, 107 in ascending order. -9, -0.07, 1/4, 2/3, 6, 107 Put -4, -1/2, 20, 69, 1549 in ascending order. -4, -1/2, 20, 69, 1549 Sort 4, 4/27, 1.99577 in descending order. 4, 1.99577, 4/27 Sort -3, 166821820, -2, 5 in descending order. 166821820, 5, -2, -3 Put 1, -24522, 4.03 in increasing order. -24522, 1, 4.03 Put -54811, 1.05, 0 in decreasing order. 1.05, 0, -54811 Sort 4, -1, 73, -5, 8, -233, -13 in descending order. 73, 8, 4, -1, -5, -13, -233 Sort 0.2, -8/69, -7, -36 in decreasing order. 0.2, -8/69, -7, -36 Sort 2/27, -0.4, -0.6, -81134 in decreasing order. 2/27, -0.4, -0.6, -81134 Sort -158, 3710, 4 in increasing order. -158, 4, 3710 Put -3, 4, -4, -84467, 5, -5 in descending order. 5, 4, -3, -4, -5, -84467 Sort -4, 7, -18, -3, 1, 1375, 3. -18, -4, -3, 1, 3, 7, 1375 Put 3, -5, -3, 1412, -23 in ascending order. -23, -5, -3, 3, 1412 Put -4, -330, 2, 1, 4, -196 in descending order. 4, 2, 1, -4, -196, -330 Put 7, -1, 1743935, 1 in descending order. 1743935, 7, 1, -1 Put 6, -607, 2, -10, 1/2 in decreasing order. 6, 2, 1/2, -10, -607 Sort -5, -1, 5, 59, 106, -53, -4 in descending order. 106, 59, 5, -1, -4, -5, -53 Sort 0.5, 0.7, 5, 3/2, 3, -258/25 in descending order. 5, 3, 3/2, 0.7, 0.5, -258/25 Sort -6, 6/17, 2/3, 1/28, 0.11. -6, 1/28, 0.11, 6/17, 2/3 Sort -1, 1262, -7, 6, 2 in ascending order. -7, -1, 2, 6, 1262 Sort 10, 1, 0, -3, 1075936 in increasing order. -3, 0, 1, 10, 1075936 Sort 3, 84, -88495 in descending order. 84, 3, -88495 Sort 2, -2, -1, -5, -487785 in ascending order. -487785, -5, -2, -1, 2 Put -0.8, -1/19, 964, -0.4 in ascending order. -0.8, -0.4, -1/19, 964 Sort -45, 2, -253670 in increasing order. -253670, -45, 2 Sort -1, 2, 0.32, 59.94, 1/3, 1/4. -1, 1/4, 0.32, 1/3, 2, 59.94 Sort 0.23, 5, 1/27, -1.8, -0.3 in increasing order. -1.8, -0.3, 1/27, 0.23, 5 Sort 21, -105, 1, 0, -29, -6, 5. -105, -29, -6, 0, 1, 5, 21 Sort -5, -7, -522/7, 27, -2, 0 in increasing order. -522/7, -7, -5, -2, 0, 27 Put 511, -1, -0.5, -2/85, -0.1 in descending order. 511, -2/85, -0.1, -0.5, -1 Put 0.4, -3, -218, 965 in descending order. 965, 0.4, -3, -218 Put 2/19, -5, -12, 118924 in descending order. 118924, 2/19, -5, -12 Sort 75/2, -1/5, -30, 10/3, 3, 0.3 in descending order. 75/2, 10/3, 3, 0.3, -1/5, -30 Sort 0.7, -82, -5, -27.797, 1. -82, -27.797, -5, 0.7, 1 Put -2, -54, -1, 3, 108 in decreasing order. 108, 3, -1, -2, -54 Put 1, -4/29, -13486, 0.4 in ascending order. -13486, -4/29, 0.4, 1 Sort 3, 3674, 7, 35, 4. 3, 4, 7, 35, 3674 Put -0.2, -27/2, 3614, 3/2, 1/3 in ascending order. -27/2, -0.2, 1/3, 3/2, 3614 Sort 4, -4, 7, 2, 5, -2, 726 in ascending order. -4, -2, 2, 4, 5, 7, 726 Sort -54/35, -6, -2, 0, 9 in ascending order. -6, -2, -54/35, 0, 9 Sort 3432, -89.08, -3 in decreasing order. 3432, -3, -89.08 Sort -51, -388, -19505 in increasing order. -19505, -388, -51 Sort 1, -10, -411, 236 in decreasing order. 236, 1, -10, -411 Sort -4, -5, -1, 2764, -480 in decreasing order. 2764, -1, -4, -5, -480 Put 132, -3, -2, 4, -4, -12, -1 in increasing order. -12, -4, -3, -2, -1, 4, 132 Sort 8/9, -1/4, -0.5, -71, 2/13, 5 in increasing order. -71, -0.5, -1/4, 2/13, 8/9, 5 Put 0.062, 5, 1.2, 1566 in descending order. 1566, 5, 1.2, 0.062 Sort -5, 5, -3, -18, -36, -2883, -4 in descending order. 5, -3, -4, -5, -18, -36, -2883 Put 2.3, 2.958, -107 in decreasing order. 2.958, 2.3, -107 Sort 4, -1053, 78743 in descending order. 78743, 4, -1053 Sort 2735, 6768, -1, 4, 3 in increasing order. -1, 3, 4, 2735, 6768 Put 8, 379, -2, 162 in decreasing order. 379, 162, 8, -2 Put -5, 0, 340416 in descending order. 340416, 0, -5 Put -493119, -34, -4, 2 in descending order. 2, -4, -34, -493119 Put 3, -143, 986917 in descending order. 986917, 3, -143 Put 8, -3, 4, 1, -1, 217911 in increasing order. -3, -1, 1, 4, 8, 217911 Sort 522.9, -3, -1932. -1932, -3, 522.9 Put 1, 297, 5, -11, -6 in descending order. 297, 5, 1, -6, -11 Put -34, 28.6, 1, -654, -1 in descending order. 28.6, 1, -1, -34, -654 Put 3.33, 27.2, 3, 0 in descending order. 27.2, 3.33, 3, 0 Sort -0.1756, 36, 1/13, -13. -13, -0.1756, 1/13, 36 Put 6, 26, -1024, -1, 23 in descending order. 26, 23, 6, -1, -1024 Put 1533, 1, 0, 11, 12, -8 in decreasing order. 1533, 12, 11, 1, 0, -8 Put -2/121, 0.4, -9, -1, 37, -0.3 in decreasing order. 37, 0.4, -2/121, -0.3, -1, -9 Sort 2, 3, 409098 in increasing order. 2, 3, 409098 Sort -3, 12, 24, 4, 18, 3. -3, 3, 4, 12, 18, 24 Put 4/5, -77/31, 40, -360, 3 in ascending order. -360, -77/31, 4/5, 3, 40 Sort -1, -657, 20, 8, -17, 0, -2 in decreasing order. 20, 8, 0, -1, -2, -17, -657 Sort -0.2, -373089, 0, -8, 0.1 in decreasing order. 0.1, 0, -0.2, -8, -373089 Sort -10/7, -2, -692, 1.1 in decreasing order. 1.1, -10/7, -2, -692 Sort -4, -1088, 4, -1, 1, 399, -5. -1088, -5, -4, -1, 1, 4, 399 Put -40, -19, -5, 17, 0, 1, 6 in increasing order. -40, -19, -5, 0, 1, 6, 17 Sort 0.106, -0.18, 0.1, 1/2, -0.034 in decreasing order. 1/2, 0.106, 0.1, -0.034, -0.18 Sort -145068192, 1/2, 4/5 in decreasing order. 4/5, 1/2, -145068192 Put -3, 2/3, -2255/14, 254 in descending order. 254, 2/3, -3, -2255/14 Put 0, 4, 4776, -2, 3418 in increasing order. -2, 0, 4, 3418, 4776 Sort -7, -4, -21, -51, -29 in decreasing order. -4, -7, -21, -29, -51 Sort -10913, 0.04, 1, -0.5 in decreasing order. 1, 0.04, -0.5, -10913 Sort -71441, 2, 5. -71441, 2, 5 Put 26, 1, -0.5, -1961 in decreasing order. 26, 1, -0.5, -1961 Put -0.1, 17, 1/94, -1/4, 7, 0.02 in increasing order. -1/4, -0.1, 1/94, 0.02, 7, 17 Sort 16833, -4, -2, 3, -5. -5, -4, -2, 3, 16833 Sort -2, 4, -5, -0.0326, -0.2, 1/22 in ascending order. -5, -2, -0.2, -0.0326, 1/22, 4 Put 5, -0.4, 1427/2, 4, -1287 in increasing order. -1287, -0.4, 4, 5, 1427/2 Sort 2, 640, 0, -2431 in ascending order. -2431, 0, 2, 640 Sort 4780, -1, -2, -8/13, -0.08 in increasing order. -2, -1, -8/13, -0.08, 4780 Put -23, 22, 88, -2 in increasing order. -23, -2, 22, 88 Sort -4.6, -1, 2, -3/5, -0.1, -1/4 in descending order. 2, -0.1, -1/4, -3/5, -1, -4.6 Put 3, 9.402, 5222, 3/4 in decreasing order. 5222, 9.402, 3, 3/4 Sort -7, -24, 5, -4, 121 in descending order. 121, 5, -4, -7, -24 Sort -3, -40, -4, 0.254873 in increasing order. -40, -4, -3, 0.254873 Sort -0.1, -2, 0.03, 4.08574 in ascending order. -2, -0.1, 0.03, 4.08574 Sort 0, -6, 72, 1, -5, -21 in ascending order. -21, -6, -5, 0, 1, 72 Sort 3, -3, -64881, 26 in increasing order. -64881, -3, 3, 26 Sort 4, 7, 252, -3875, 5 in decreasing order. 252, 7, 5, 4, -3875 Sort 189, -4, 2, -432, 28, -6 in increasing order. -432, -6, -4, 2, 28, 189 Put 0, 1, 0.18, -2/137, -1/3, 3 in descending order. 3, 1, 0.18, 0, -2/137, -1/3 Sort -9270462, 0, 5, 4 in descending order. 5, 4, 0, -9270462 Sort -256, 4, -4, 3, 288, -3, 2. -256, -4, -3, 2, 3, 4, 288 Put -12517, 1, 6, 5, 3, -16 in decreasing order. 6, 5, 3, 1, -16, -12517 Put 1, 2/11, 65, 1312, 2/5 in desce	{ "pile_set_name": "DM Mathematics" }
? (a) -2 (b) y (c) -1/3 b Let y = -0.2 + 0. Let s = 282.287 + -282. Let p = -0.287 + s. What is the third biggest value in y, 4, p, -4? y Let f = 80 + -148. Let x = f - -67.987. Let s = 0.063 + x. Which is the third smallest value? (a) -0.4 (b) -3/4 (c) s c Let p = 7.8519 - 2.8519. Which is the smallest value? (a) 2 (b) p (c) -0.7 (d) 1 (e) -0.06 c Let c be (17 - -5)/((-1)/(-6)). Suppose 4v - c = 4b, -b = 5v - 6 + 21. What is the second smallest value in -3, 2, b? -3 Let i = 5182 + -5177. Which is the biggest value? (a) 1/2 (b) -0.809 (c) i c Let t = 8686 - 8687. What is the biggest value in -2/57, 3, -2/5, t? 3 Let z = -175 + 207. Let w = -32.05 + z. What is the third biggest value in w, 1, -1? -1 Let q = -0.034 + -925.966. Let u = -925.6 - q. Which is the second smallest value? (a) -1/5 (b) 1 (c) u (d) -10 a Let g = -4215/2 + 21067/10. Which is the third smallest value? (a) g (b) 3 (c) 0.4 (d) 156.8 b Let t be ((-42)/(-20) - 2)-163990/(-1064). Which is the biggest value? (a) -0.3 (b) 1561 (c) 0.5 (d) t b Let l = 1003 - 998. Let g = 18 + -21. Which is the fourth biggest value? (a) l (b) -2/15 (c) -4 (d) g c Let g be 3 + (-105)/40 - 2730/10608. Let y be (-17)/(-4) + (-3)/12. Which is the third biggest value? (a) y (b) -9 (c) -1 (d) g c Let r(q) = -q3 - 6q*2 - 2q - 9. Let k be r(-6). Let u = 0.066173 + -1.066173. Which is the second smallest value? (a) u (b) -0.1 (c) 0.07 (d) k b Let q be (-1)/((-18)/40(-72)/54). Which is the second smallest value? (a) 2 (b) -1 (c) q (d) 0.3 b Let q = 361/5 - 72. Let r = -63929 - -63928.6. Which is the third smallest value? (a) r (b) -33 (c) q c Let z = 26773 + -26769. What is the biggest value in -0.0888, -1, z, -2? z Let y = 90.95 - 90. Let g = y - -90.05. Let i = g - 95. Which is the third smallest value? (a) i (b) 2 (c) -1/3 (d) 2/15 d Let t = 101 - -1243. Let k be (-6)/(-15)14/(t/40). Which is the third smallest value? (a) k (b) -4 (c) 1/21 a Let t = 2220 - 2218. Which is the biggest value? (a) t (b) 132 (c) -0.04 b Let v = 1 + -1.4. Let k = 144 + -141.61. Let u = k - 2.09. Which is the second biggest value? (a) 0.5 (b) v (c) 5 (d) u a Let k = 0.511 + -1.011. Let l = -21 + 16. Which is the fourth biggest value? (a) 4 (b) k (c) l (d) 6 c Let j be (-57)/14 + 11 + (-7)/1. What is the biggest value in -2/7, j, -0.3? j Let u be (8/(-84)-3)/((90/14)/(-5)). What is the biggest value in -23, u, 1/3? 1/3 Let j = -14 + 25. Let i = -0.034 - 0.206. Let d = 0.26 - i. Which is the biggest value? (a) j (b) 5 (c) d a Let o = 156 + -1090/7. Let d(h) = 11h + 72. Let n(s) = -2s. Let q(m) = d(m) + 3n(m). Let w be q(-15). What is the biggest value in 0, o, w? o Let q = -1.046 - -1.056. Let k be 8/(-6)((-30)/(-24) - 1). Which is the third biggest value? (a) q (b) k (c) 6/7 b Let t = -12374 + 12358. Let q be (-4)/18 - (-70)/72. Which is the third biggest value? (a) -0.3 (b) q (c) -0.1 (d) t a Let x(g) = -g3 + 17g*2 - 10g - 14. Let k be x(16). Let t be ((-41)/k)/((-1)/2). What is the third smallest value in -8, t, -1/3? t Suppose z + 54 = 53. Let d be (((-25)/20)/5)/(2 + z). What is the second smallest value in -1/2, -4/7, d, 0.4? -1/2 Let z = -0.282 - -0.082. Let q = -2.201 - -0.201. Let k = -0.08 - -0.2. Which is the second biggest value? (a) z (b) q (c) k a Let o = -0.9 + 0.5. Let n = 23359/2 - 11678. What is the third smallest value in n, o, 5, 4? 4 Let p = -1265 - -1270. Which is the smallest value? (a) -0.1 (b) p (c) -38 (d) -0.4 c Let n = 234 - 236.94. Let v = -3 - n. Suppose -c = -43c + 84. What is the smallest value in 4, c, v? v Suppose u = 5q + 23, -u + 59 - 60 = 3q. Which is the third smallest value? (a) q (b) -4 (c) 0.04 (d) -48 a Let a = 216203/4 + -53779. Let k = -272 + a. What is the fourth biggest value in 33, 2/3, k, 2? k Let m = -0.04 - -0.25. Let k(i) = i2 + i - 1. Let w be k(-2). Let s = 111 - 114. Which is the biggest value? (a) m (b) s (c) w c Let u = 26.7 - 28. Let j = 0.440709 + -0.640709. Which is the smallest value? (a) u (b) 3/5 (c) j a Let p be 32 + -39 - (-1 + 9). Let y(v) = 3v*2 + 14v + 4. Let q be y(-4). Let l = 14 + -10. What is the second biggest value in p, l, q? q Let v = 5544 + -5547. Let q = -3.4 - 0.6. Let j = -1 - q. Which is the second biggest value? (a) j (b) v (c) 1/5 c Let f be (654 + -3 + 3 + 5)-1. Let x = f + 664. Which is the biggest value? (a) -17 (b) x (c) -1/5 b Let p = 3.833 - -0.167. Suppose -366 = -61f - 61. Which is the smallest value? (a) f (b) 6/5 (c) p b Let r be 4/52 - (-8)/65. Let n be 2/(-3)(-6507)/126. Let s = -35 + n. Which is the fourth biggest value? (a) -4/3 (b) s (c) r (d) -0.1 a Let a = -4270.4 + 4271. What is the third biggest value in 1/4, 5, 3, a? a Let u = 0.16 - 3.66. Let t = u + 3.2. Let x = -4.7 + t. What is the second biggest value in -1, -1/3, 2, x? -1/3 Let c = 250 - 183. Let t = c + -63. Let b = 0.9 - 0.6. What is the second biggest value in t, b, -0.4, -2? b Let i = 544 - 537. Let g = 10 - i. What is the smallest value in g, -4, -52? -52 Let y = 1003 - 997. Which is the second biggest value? (a) -111 (b) -2 (c) y (d) -5 b Suppose 4w + q + 74 = 0, 27 = 3w + q + 83. Let k be ((-18)/(-12))/((-21)/w) + -1. Which is the smallest value? (a) 4 (b) 6 (c) k (d) 0 d Let k = -22/27 - -235/189. Let l = 68 - 5. Let v = l - 59. Which is the second smallest value? (a) 2/7 (b) -0.5 (c) v (d) k a Let r = -0.297 + 0.007. Let k(o) = -4o*2 + 621o + 466. Let n be k(156). What is the third smallest value in r, 1, 1/10, n? 1/10 Let k = 206/17 - 12. Let s = -5126 - -5121. Which is the second smallest value? (a) s (b) -1 (c) 3/5 (d) k b Let x = -7.033 - -6.313. What is the second biggest value in x, 2/3, -7? x Let s = 187.007 + -187. Let j = s + 0.393. What is the smallest value in 1/5, -0.4, j, -4? -4 Let r = 109.0798 + 0.1202. Let i = -109 + r. What is the biggest value in i, -1/2, -1/4? i Let h = 6866 + -6876. Which is the second biggest value? (a) 0.5 (b) -1/3 (c) h (d) 191 a Let l(o) = -5o3 - 136o*2 - 21o + 159. Let g be l(-27). Which is the biggest value? (a) 1.8 (b) 0 (c) -0.01 (d) g a Let d = 106 - 111.1. Let a = d - 0.9. Let q = 0.038 + 3.962. What is the biggest value in q, 1/6, a, -0.3? q Let b = -1676.6 + 465.6. What is the second smallest value in b, 1/4, 2? 1/4 Let s = 1.09 + -0.79. Let a = 7019 - 7015. What is the second smallest value in 4/5, -0.5, a, s? s Let i = 0.18 - -4.82. Let v = i + -10. Which is the third smallest value? (a) 1.8 (b) 0 (c) v a Let i = -19.6 + 0.6. Let h = -19 - i. Suppose -25g = 10 - 135. Which is the second smallest value? (a) -1/2 (b) h (c) g (d) 16 b Let r be 9/24 - (-273)/4164. Suppose -x = 4x + 30. Let z be x-2(140/(-48) + r). Which is the third biggest value? (a) z (b) -3/10 (c) 2/11 b Let w = -59.3 + 63. Let s = -12.7 + w. Which is the third biggest value? (a) 5 (b) -5 (c) s c Let m = 131.6 - 9.6. Let f = -62 + m. Let v = 76 - f. What is the third biggest value in 4, v, -0.3? -0.3 Let w = -173.9 + 169.9. What is the third biggest value in 7/4, w, 3, -2/7, 11? 7/4 Let t = 47.7 - 52. Let g = 36.3 + t. Let p = g - 36. What is the third biggest value in 8, p, 2? p Let d be 81/260 - (-4)/(-16). Let p = d + 6/65. Which is the second biggest value? (a) -1/4 (b) p (c) -4/3 a Let j be (3/30)/(1/2). Let v be ((-10)/4)/((-6)/(-4)) - (-1995)/855. Which is the fourth smallest value? (a) v (b) j (c) -0.15 (d) -2/9 a Suppose -5b + 8 = -3d, 0b + 2d + 8 = 4b. Let t be 1/11 + (-24)/1188285. What is the second biggest value in 0, b, t? 0 Let p = -866.6 - -866.3. What is the fourth smallest value in 2/11, -5, 12, 2/7, p? 2/7 Let u be (-4)/3(-1)/(-4). Let z = 115.679 + 0.321. Let f = 112 - z. Which is the fourth smallest value? (a) 4 (b) -3 (c) f (d) u a Let q = -14779 + 14775. What is the biggest value in 696, q, -2/5, -1/5, 0? 696 Let p = -26 + 28. Let x be ((-4)/p - (-256)/130)*5. Let l = 115 - 118. Which is the second biggest value? (a) x (b) l (c) 1 a Let z = 1.7268 - 1.8268. What is the smallest value in 68, 0.4, z? z Let y = 70.11 - 83.11. What is the fourth smallest value in 1/11, 5, 0.04, 2/3, y? 2/3 Let w = -8777/3 - -2926. Which	{ "pile_set_name": "DM Mathematics" }
r: v or p? v Suppose 3k = 2p + 32, -12 = k + 2p + 3p. Suppose 0 = -0w + 4w - k. Which is smaller: w or 3/2? 3/2 Let u be ((-2)/1)/((-32)/(-20) - 2). Let w(p) = p*2 + 7p + 3. Let r be w(-7). Is r less than u? True Let t(q) = 2q + 14. Let w be t(-8). Which is greater: w or -0.06? -0.06 Suppose 3x - 6x = 0. Suppose 3v + x = 24. Is v greater than 7? True Let m = -68 + 123. Is 54 >= m? False Let u = -3 + 1. Let v(t) = -3t3 - 3t*2 - 2. Let z(b) = 7b*3 + 6b*2 - b + 5. Let n(j) = -5v(j) - 2z(j). Let r be n(u). Which is bigger: -2 or r? r Let y = 12 - 10. Let l = -2 + 2.8. Let s = 0.2 + l. Which is smaller: s or y? s Let l = 4 + -9. Is l greater than or equal to -9? True Let d be ((-112)/108 - 4)3/(-4). Which is smaller: d or 3? 3 Let a be 348/(-41)1/(-63). Let g = 1/123 + a. Suppose 1 = 4z - 5z. Which is smaller: z or g? z Suppose -s - 3s - 10 = -b, -3b + 6 = 0. Is -13/9 bigger than s? True Let p = 25 + -32. Which is greater: p or -9? p Let q be ((-9)/(-6) - 1)/(2/(-44)). Is -9 bigger than q? True Let k be 117/72 - (-3)/8. Let b = 0 + 2. Suppose -3h = -h - 4d - 2, 0 = bh + 2d - k. Is 0 bigger than h? False Let h be 3/3 + 1 + -12. Let a = 9 + h. Let p be 3 + -1 + (-32)/14. Which is bigger: p or a? p Let a(p) = p + 9. Let k be a(10). Is k less than 19? False Let k = 59/160 - -1/32. Let n = -24.1 - -23. Let z = 1 + n. Is z greater than k? False Suppose 0m = 2m. Suppose -q + 5q = m. Which is greater: -4/7 or q? q Let j = -52/15 + 11/3. Let u be (0 + -1)/(2/2). Which is greater: u or j? j Let x(l) = -l*2 - 5l - 9. Let t be x(-5). Let g = t + 9. Is g not equal to -1? True Let k be (12/14)/(6/(-12)). Let v = 184/91 + k. Which is smaller: 0 or v? 0 Let t = -1 + 1. Let a = -82.93 - -83. Is t at most a? True Let x = 5 + -2. Suppose 5q = -4n + x, 5n + 0q = 4q + 14. Let g = -0.5 - 0.5. Which is bigger: g or n? n Let z = -0.17 - -0.07. Let l(t) = t3 + 3t*2 - 5t - 3. Let c be l(-4). Suppose 4 = -3x + c. Is z >= x? True Let f = 32/9 - 142/45. Suppose 0 = -2z - 10 + 8. Is f less than z? False Let c be 9/(-6)(-4)/(-6). Let d = -5 - c. Which is greater: -3 or d? -3 Let p(c) = c + 5. Let f be p(-4). Suppose 0 = -3m - 22 - 2. Let y be 10/m + (f - -1). Is 0 at least y? False Suppose -5y - 2b = -6b + 229, -4 = -4b. Let j = y + 224/5. Is -1 bigger than j? False Suppose -5 = -2u + c + 13, 4u - 40 = 4c. Which is bigger: 7 or u? u Suppose 4s - d - 15 = 4d, 0 = -s - 4d - 12. Let m be s - (1 + (-7)/9). Suppose 0 = 3p + 3j + 12, -26 = 5p + 4j - 11. Which is bigger: p or m? p Let k = -29 - -28. Which is greater: k or -2/51? -2/51 Suppose 6z - 5z + 17 = 5t, -t - 2z + 10 = 0. Let s be (5 - 6)/((-1)/5). Suppose -8 = -sy + 7. Is y greater than t? False Let h = 65 - 34. Is h greater than 1/2? True Let o = -0.22 + -0.08. Let d = 0.8 + o. Let q = 1.13 - 1.03. Is q at most as big as d? True Let k be (-861)/56(-8)/(-6). Is -22 greater than k? False Let p(n) = n*2 + 12n + 11. Let a be p(-10). Suppose 39 + 1 = -5j. Is j at most a? False Let p = 3 - 7. Let c be p/16 - (-34)/8. Which is greater: 0 or c? c Let z(t) be the third derivative of t4/24 + t3/3 - 2t*2. Suppose 4g - 5g = -2. Let i be z(g). Is 3 less than or equal to i? True Suppose -4w = -5a + 22, 2a = 4w + 27 - 11. Suppose -2o = -4q - 4 - 2, -5q - 2o = -15. Let i be (qa)/((-4)/2). Are 0 and i non-equal? True Let k(d) = -d*3 + 5d*2 + 2d - 6. Let a be k(5). Suppose m = c, am - 2c - 4 = -0c. Is 0 not equal to m? True Let m(a) = a - 7. Let h be m(7). Suppose h = -4n, 4n - 6 = -2w - 18. Let i = -4 - w. Does 2 = i? True Suppose 0 = a + 9 - 0. Let v be a/(-2)(-1)/3. Which is smaller: v or -3? -3 Let c(m) = -m2 + 5m - 7. Let l be c(5). Suppose 7y = 4y - 24. Is y at most as big as l? True Suppose -2c + 0c = 0. Let i(k) = k + 12. Let s be i(-9). Let x be s + (-42)/10 - 0. Which is greater: c or x? c Suppose 2i = w - 0i - 3, 0 = 4w + i + 6. Let q = w + 6. Let h = q + -5. Is 2/17 less than h? False Suppose -2n = n - 9. Let j = -2 + n. Suppose 0 = 2t - 7t. Is t >= j? False Let a be 2 - 0 - 0 - -1. Suppose -h - 12 - 13 = -5r, ah - 5 = -5r. Which is smaller: h or -4? h Let s = -6 - 0. Is -5 at most s? False Suppose 7 = 3x - 5n, -x + n = -2x + 5. Suppose 5 = -5f - 0. Let v(w) = -2w3 + w2. Let o be v(f). Which is smaller: o or x? o Let f = -16556417809918000005/232106 - -71331278855123. Let b = 1/33158 + f. Let y = -126 + b. Is -1 greater than y? False Let h = -0.6 + 0. Let w = 2.4 - h. Which is greater: -1 or w? w Let v = -18/5 - -16/5. Is v less than 0? True Let q(h) = -5h. Let f be q(-1). Let n = 4 - f. Is n <= 1/4? True Suppose 2x - 2d + 0 = -2, 3 = x + d. Suppose 5s = -2y + 8, 0s + 2s - 2y = -8. Let j be 2 + ((-21)/15 - s). Are x and j nonequal? True Let g(b) = -b3 + b2 - b + 14. Let r be g(0). Let u be (-14)/(-6)(-4)/r. Is 0 less than u? False Let v = -0.26 + 0.19. Do -2 and v have the same value? False Let j(s) = -3s*2 + 10s. Let z be j(4). Is -8 > z? False Suppose 0 = -l + 3u - 8, 5u - 15 = -3l + u. Let k = 0.41 - 0.21. Which is bigger: l or k? l Suppose -3i + 8i + 5 = 0, b = i - 117. Which is greater: -117 or b? -117 Let n be 1 - 0 - (-6)/(-6). Suppose 0x - x + 1 = n. Which is smaller: x or -1/4? -1/4 Let d = 5 - -38. Which is greater: 42 or d? d Let j(t) = 6t. Let v be j(1). Let m be 7/(-3) + v/(-9). Is -4 <= m? True Let w(y) = y3 + 4y*2 - 6y + 1. Let i be w(-5). Let x = i - 12. Which is smaller: x or -3? x Suppose -15 = -10p + 5p. Suppose 7h = -n + 2h - 3, -pn + h - 9 = 0. Do n and 0 have the same value? False Let v be ((150/80)/15)/((-2)/18). Which is greater: v or -2? v Let f = 3.9 + -4. Let v = f - -0.3. Let g = v + -0.3. Which is smaller: 0.1 or g? g Let u be (1/2)/((-1)/(-160)). Let r be (-5)/u4/(-5). Which is smaller: 1 or r? r Let n = 26 + -25. Are n and -7/3 unequal? True Suppose -3v = -6v - 60429. Let r = -1329391/66 - v. Let h = r - 6/11. Is h greater than or equal to 1? False Suppose -6 = -0o + o + 4k, 36 = 4o + k. Suppose 2b - s = -0s + 21, 0 = -3s - 9. Which is smaller: o or b? b Let s = -90 + 38. Let q = 313/6 + s. Does q = 1? False Let x = 0.89 - 0.79. Suppose 5q - 29 = 21. Which is smaller: x or q? x Let h = 116/5 - 23. Let b(x) = -x - 3. Let r be b(-3). Which is smaller: r or h? r Let k = 371/2 + -177. Let r be (2 - 158/12) + 2. Let j = r + k. Which is greater: j or -0.1? -0.1 Suppose 0 = -0f - 5f + 10. Suppose -fs = 2s. Suppose -2l - 4 = -4r, sr - l + 10 = 2r. Which is smaller: 2 or r? 2 Suppose 14t = -17 - 39. Is -2/15 equal to t? False Let w = 917/5 + -184. Let l be -2(-1 - (-12)/15). Is w bigger than l? False Let q be ((3/2)/3)/(2/(-64)). Does -14 = q? False Suppose 7p - 21 = -0p. Suppose 0 = 5l + pm + 10 + 14, 5l = 2m - 34. Let r = -9 - -4. Which is smaller: l or r? l Suppose -2h = 5t - 15, -t - 3 = h - 6. Let o be (-66)/42 - (-2 + 1). Is h at least o? True Let a be 194/(-18) + 10/(-45). Do -6 and a have different values? True Let c be 2/(-32 - (2 + 1)). Which is smaller: 1 or c? c Let a = 3 - 10. Is a greater than -7? False Suppose 0 = 6i - i - 5. Let y = 0.4 - -1.6. Let l = -1.9 + y. Is l != i? True Suppose 0 = -0d - 3d. Is d greater than 6/13? False Let x(z) = 6z2 - z - 13. Let c(o) = 5o*2 - 2o - 12. Let p(u) = 5c(u) - 4x(u). Let r be p(7). Let l = 1 + -1. Is l at most as big as r? False Suppose -10 + 37 = -3r. Let q be (-2)/r - (-4)/(-18). Suppose q = 2i + i. Which is bigger: i or 1? 1 Let q = -0.24 - -0.248. Which is bigger: -1 or q? q Let f = -20189485/188883 - 1/20987. Let u = 107 + f. Let s = -2 + 1. Is s <= u? True Suppose -2s + 16 = -6s. Let i(x) = x*2 - 1. Let o be i(2). Let d be (-12)/o2/s. Which is smaller: 3 or d? d Let y = 0 - -12. Suppose -y = -5p + 8. Let o(t) = t3 - 4t*2 + t - 2. Let v be o(p). Which is bigger: v or 3? 3 Suppose 3o + 2o + 10 = 0. Which is smaller: o or 0.2? o Let f be 156/8 + 3/183. Which is bigger: -1 or f? f Let l be (6/8)/((-5)/4). Suppose 0 = -5w - 10. Which is smaller: w or l? w Suppose 6b - 15 = 3b. Suppose -5u - 5 + 0 = 4q, q + 5 = -bu. Which is smaller: 3 or q? q Let r = 0.09 + -0.07. Let z = r + -0.12. Which is smaller: 0.3 or z? z Let x = 0.53 - 7.53. Wh	{ "pile_set_name": "DM Mathematics" }
be 1 - 2/422. Let o be 8/y(-20)/8. Is 6 a factor of n(o)? False Let a = 34 + -24. Is 5 a factor of a? True Let g = 14 - 9. Suppose -4b - r = -129, -gb - 4r = -0r - 164. Is b a multiple of 12? False Let b(i) = -2i3 - 2i*2 + 2i + 2. Let n be b(-3). Let q be 12/(-18) + n/(-6). Let v(a) = a*3 + 6a*2 - a + 6. Does 5 divide v(q)? False Let y(k) = 2k + 7. Let u be y(-5). Is 20 a factor of 15/(63/(-24) - u)? True Let t = -6 + 36. Does 10 divide t? True Suppose -4y + 0 = 8. Let s be y(30/(-4))/5. Suppose si - 7i - 46 = -n, -4n + i + 124 = 0. Is 12 a factor of n? False Let v(t) = t3 + t2 + 1. Let b(c) = 5c*3 + 8c*2 + 7c + 8. Let m(k) = -b(k) + 6v(k). Is 19 a factor of m(5)? True Suppose 2x - 5x = -6. Let s(l) = -4l*3 + 2l*2 + l. Let u be s(-1). Does 4 divide u + 0 - 2/x? True Let z(n) = -2n - 3. Let h be z(4). Let y = h - -7. Is (-117)/(-6) - 2/y a multiple of 7? False Suppose 154 = 6n - 62. Is n a multiple of 6? True Suppose 4t - 1 = 4w - 9, 4w - 8 = 5t. Suppose v - 3 = -tv. Does 18 divide 54/(-4)(-4)/v? True Let n = 83 - 35. Is n a multiple of 6? True Let f(g) = -g2 - 12g - 12. Is f(-8) even? True Let p(u) = -1 - 32u3 + 0 + 1 - u. Is p(-1) a multiple of 11? True Let l = 8 - -1. Suppose l = r - 0r. Does 6 divide r? False Is 14 a factor of 9/(-9) - -1151? True Let r(u) = 8u3 - 5u*2 + 5u + 2. Is 47 a factor of r(3)? True Let a be (4 - 1) + 15/5. Suppose ax - 3x = 162. Is x a multiple of 18? True Let o = 6 + -5. Does 15 divide o/(1 - 96/99)? False Suppose -3w - 2c - 7 = -4w, 4w - 18 = 3c. Suppose u = wu. Let g = u + 8. Is 8 a factor of g? True Let d be (24/5)/((-1)/(-5)). Suppose d = -3w - w. Let j(z) = -z3 - 6z*2 - 4z. Is j(w) a multiple of 9? False Suppose 0n - 3n = 2r - 69, 0 = -n + 4r + 23. Is n a multiple of 5? False Let f = -3 + 4. Let n be 22/5(9 + f). Suppose -y + 3y = n. Is 11 a factor of y? True Suppose i + 18 = -5x - 4, 0 = x - 3i + 14. Let m = 80 + -50. Is 10 a factor of (x/(-2))/(5/m)? False Let k(j) = -j*3 + 3j*2 + 2. Let z be k(3). Let a be (-36 + z)-1 - -2. Suppose -4t - 4i + a = -6i, -6 = -2t - 2i. Is t a multiple of 3? False Suppose 5s - 5 = -5m, 3m - 5m = 8. Suppose 3f - 7f + 154 = 3n, -2f - 198 = -4n. Suppose 3p + 3k = sp - n, -3k - 6 = 0. Does 15 divide p? False Suppose 0 = -j + 2j + 3. Let o = 12 + j. Does 2 divide o? False Suppose 2b = -0b - 12. Let q(g) = g3 + 7g*2 + 6g + 5. Is q(b) a multiple of 2? False Suppose 141 = 2p + 5x - 49, 0 = p - 5x - 65. Is 17 a factor of p? True Suppose z + z - 6 = -3c, 5z - 36 = 3c. Let a be z/(-8) + 135/20. Suppose i - 4 - a = 0. Does 10 divide i? True Let n(m) be the second derivative of m5/20 - m4/4 - m*3/2 - 3m*2/2 - 3m. Let q be n(4). Is 11 a factor of q/4 - (-174)/8? True Let b = 110 - 75. Let j = b - -18. Is j a multiple of 20? False Let m be (-2)/(-4)(36 - -2). Suppose -3h + 3p + 9 = 0, -5 + m = 4h - 5p. Suppose 0 = y - h - 3. Does 4 divide y? True Suppose 4a - 8a + 540 = 0. Let s = 196 - a. Is s a multiple of 17? False Suppose 0t = -3t - 24. Is 4/(-16) - 186/t a multiple of 9? False Suppose 0t = -5t - 35. Let u(m) = m2 + 6m + 1. Let k be u(t). Let p(y) = -y*3 + 7y*2 + 9y + 6. Does 12 divide p(k)? False Let d = -29 + 74. Is 15 a factor of d? True Let x(l) = l2 + l + 2. Let d(p) = -p2. Let r(y) = -5d(y) - x(y). Is 7 a factor of r(2)? False Let f = -6 - -4. Let w(l) = -5l - 2. Does 8 divide w(f)? True Suppose 100 = 13b - 11b. Is b a multiple of 10? True Suppose 2f = 175 - 61. Is 19 a factor of f? True Is 6 a factor of ((-2 - -22)3)/(3/2)? False Let d be 2 + 3(-4)/(-6). Suppose 2r + 17 = -0z + 3z, dr = -3z + 29. Does 6 divide z? False Suppose 0n + n = 8. Let y = n - -20. Does 19 divide y? False Let k = 111 + -54. Is k a multiple of 7? False Suppose 5h = -0h + 10. Suppose ha - a - 11 = 0. Let c = 19 - a. Is 4 a factor of c? True Suppose -5w = 3k - 3, 7w - 2w = 5k - 5. Suppose -3g + 63 - 18 = w. Is 15 a factor of g? True Let d = -10 + 12. Suppose -1 - 3 = 2i, 0 = s + di - 10. Is s a multiple of 14? True Suppose 9z = 6z + 90. Is z a multiple of 6? True Let r(z) = 18z3 - 5z*2 + 6z - 2. Does 18 divide r(2)? False Suppose 5o + 4v - 2v = 19, -8 = -4v. Suppose 0 = -5h + 5, -l = oh - h - 86. Suppose 8f = 4f + l. Is f a multiple of 10? False Let v(k) = k3 - k2 - k + 2. Let h be v(0). Let z(w) = w*3 + 4w*2 - 3w. Is 13 a factor of z(h)? False Suppose 22 + 9 = -4s + 3y, 0 = 2s - y + 13. Let c = -2 - s. Is 5 a factor of 4/630/c? True Suppose -4j + 146 = -2j. Let x be -2 - (-2)/1 - j. Is 9 a factor of x/(-4) - (-2)/(-8)? True Let s(l) = l + 3 - 3l + 0l. Let x = -16 - -12. Is s(x) a multiple of 11? True Let q(m) = m*3 + 7m*2 + 4m - 3. Is q(-5) a multiple of 27? True Let t = -7 - -21. Does 14 divide t? True Let v(w) = w*3 + 7w*2 - w - 7. Let z be v(-7). Suppose z = 4q - p - 106, 2q = p + 17 + 37. Does 13 divide q? True Let f(q) = -q2 + 13q - 12. Let n = -4 - -16. Let m be f(n). Suppose m = -p + 28 + 11. Does 13 divide p? True Let q(r) = 8r + 2. Is q(1) a multiple of 5? True Let v be (-2 - -46)3/6. Is v/(-3)(-3)/1 a multiple of 12? False Let a(n) be the first derivative of n4/4 - n3 + 2n*2 - 4n + 2. Does 16 divide a(4)? False Suppose 2d = 43 - 17. Is 5 a factor of d? False Suppose 3k = 13k - 1200. Is k a multiple of 13? False Let p be 2 + (-22 - -2). Suppose 2q + 3k = 79, 3q + 3k - 128 + 5 = p. Suppose -4s + 0s + q = 0. Is s a multiple of 11? True Let y(o) = -5o + 2. Let d be y(-1). Is 549/d - 15/35 a multiple of 26? True Let o(j) = 11j - 7. Let f be o(5). Let y = f - 17. Is y a multiple of 16? False Let q be 4/10 + 35/(-25). Let c be ((-2)/(-4) + q)0. Suppose -f + g + 4 + 11 = c, 0 = -f + 2g + 18. Does 6 divide f? True Let p(o) = -o*3 - 5o*2 - 6o - 6. Let g be p(-5). Let w = 6 + g. Is 30 a factor of w? True Let b(k) = -k*2 + 5k - 3. Let p = 3 + 1. Let g be b(p). Is 9 a factor of (4/10)/(g/45)? True Suppose -12s + 6s = -240. Is 4 a factor of s? True Is 9 a factor of (4 - 7)/(2/(-42)1)? True Let c be (4/(-3))/((-2)/3). Is (-675)/18c/(-3) a multiple of 9? False Suppose -w - 5 = 4w. Let f(l) = -9l - 1. Is f(w) a multiple of 3? False Let a = 7 + -6. Let i = 1 + a. Suppose 0j = ij - 16. Does 4 divide j? True Let t(j) = -5j3 - 1. Let o be t(-1). Suppose -2w = -3w + o. Suppose q - 4b = 0, 2q = 5q - wb - 32. Does 8 divide q? True Let j(d) = -d2 + 7d - 2. Let c(g) = -g3 + 5. Let s be c(0). Is j(s) a multiple of 8? True Let f(l) = l3 + 4l2 - 4l - 5. Let g be f(-5). Is 16 a factor of (-632)/g - (-3)/(-15)? False Let l(f) = 8f. Let p(h) = -h3 + 3h*2 + 4h + 2. Let d be p(4). Let w = d - 0. Is 16 a factor of l(w)? True Let h(x) = 2x2 + 5x + 8. Is 24 a factor of h(-8)? True Is ((-4)/(-10))/((-4)/(-340)) a multiple of 17? True Suppose -z + 2 = -0. Suppose d = zd - 98. Let f = d + -65. Does 11 divide f? True Suppose 0 = -d - 4l - 120, 0 = -0d + 2d - l + 258. Let o be d/(-10) - (-5)/25. Suppose -3 = -2m + o. Does 8 divide m? True Suppose 3x + 2t + 1 = -3t, -t = 5x - 35. Is x a multiple of 4? True Suppose -8k + 5k + 270 = 0. Is 10 a factor of k? True Let k(z) = 0 - 2 + 7 + 2z + 8z. Is 24 a factor of k(6)? False Let g be (3/9)/((-2)/(-30)). Let q = g + -2. Let z = q - -3. Is z a multiple of 6? True Let p(u) = 4u*2 - 9u - 3. Let g be p(7). Let i(v) = 6v2 - v. Let k be i(1). Suppose 0f - g = -kf. Is 14 a factor of f? False Suppose 6p = 3p + 12. Is (-3 - (-16)/p)5 a multiple of 5? True Suppose 3a - 2x - 34 = -x, -30 = -a + 5x. Let n(b) = -40b*2 + b. Let m be n(-1). Let p = a - m. Does 25 divide p? False Let v(o) = 7o - 5. Let l be (7 - 3)(3 - 2). Does 12 divide v(l)? False Suppose 5c - 10 = 5, 33 = -3x + 3c. Let z = -5 - x. Does 2 divide z? False Suppose g - 174 = -g - 3n, n = -2g + 178. Suppose 2k - g + 30 = o, 3k - 100 = -o. Does 17 divide k? False Suppose 0 = p - 0 - 5. Suppose -w - 4w = -p. Suppose 2 = -m - w, -51 = -5n + 2m. Is 6 a factor of n? False Suppose 10z + 174 = 13z - 3j, -4z + 272 = 4j. Is z a multiple of 9? True Suppose -2w + 4r = 0, 3w = -4r + 3r. Suppose 4m - 2*m - 6 = w. Suppose 0 = m	{ "pile_set_name": "DM Mathematics" }
1 - 2 - -3). 4 What is 0 - ((1 - 5) + (3 + 5 - 4))? 0 What is (3 - -12) + -33 - (-5 + (0 - 1))? -12 Calculate -82 + 76 - (1 + -17). 10 Calculate 9 - (4 + (3 - (4 + -2))). 4 Calculate (-6 - -7 - 9) + 11 + -4. -1 What is the value of (0 - 2 - -1) + -48 + 38? -11 Evaluate (-5 - 1) + (1 - (11 - (-2 + 10))). -8 -26 + (6 - -19) + -7 -8 Calculate 11 + (153 - 149) + 0 + 1. 16 6 - (9 - (0 + 3) - (2 + 1)) 3 Calculate 8 + (-16 - (-11 - 11)). 14 Evaluate (-11 - (-1 + -4)) + 30 - 10. 14 Calculate (21 - 15) + -14 - -23. 15 Calculate 15 - (-10 + 3 + 2 + 15 - 7). 12 -38 - -26 - -7 - (-3 - 25) 23 -9 + (-12 - (-1 + -3)) -17 -9 - (11 - 15 - -11) -16 Calculate 9 + 13 + -34 - -11. -1 What is the value of (-12 + 7 + 2 - -6) + (5 - 0)? 8 Calculate -13 - 0 - (-622 - -591). 18 What is the value of -10 - -1 - (-4 + 15 + -3 - -6)? -23 Evaluate (-38 - -57) + (1 - 21). -1 What is the value of 1 + -23 + (-55 - -63) - (-2 + 0)? -12 Evaluate 2 + (6 + 3 - 18). -7 Calculate 3 - (3 + -6) - -12 - 9. 9 Calculate -23 + 9 + -6 + 10. -10 What is the value of (12 - -16 - 40) + 0 + -2? -14 Evaluate 45 + -40 + (5 - (-3 - (5 - 3))). 15 What is the value of (-9 + -7 + 11 - 14) + 9? -10 Calculate -24 - (-38 - (33 + -17)). 30 Evaluate -19 + 6 + 2 + 20. 9 What is (-6 - -3) + (-33 - -35)? -1 What is -173 + 159 - (1 - 2 - -7) - -8? -12 Calculate 11 + (-13 - (-5 + 2)) + 2 + -1. 2 Calculate 2 + -23 + 16 + 7. 2 (-40 - -20 - (0 - (4 + -11))) + 7 -20 Calculate 20 + -25 + (6 - -6) + 11. 18 -83 + 74 - (0 + -1) -8 What is (8 - -1) + 9 + -6 + -6 - 3? 3 Evaluate -23 + -5 + 11 + 17 + -12. -12 What is (-55 - -60) + -2 + 9 + 2? 14 -319 - -323 - (15 + -1) -10 (22 - 43 - -27) + 30 36 Evaluate -1 + 1 + -29 + 24 - (-1 - 25). 21 What is 6 - (-7 + (-7 - (-9 + 6)))? 17 Calculate 6 + 18 + -34 + -10. -20 What is the value of (-3 - (-4 + 2)) + 1 + (96 - 95)? 1 What is the value of (3 + 0 + -4 - 5) + (-65 - -85)? 14 What is (-54 - -24) + -2 - -18? -14 Calculate -7 - (12 - (40 - 21)). 0 Calculate -121 + 121 + (27 - 1) + -9. 17 (24 - 63 - (3 + -22)) + 59 39 What is -11 + (37 - 27) + (26 - 1)? 24 What is the value of -22 - (14 + -20) - -14? -2 What is 22 - (4 - ((-2 - -8) + -9))? 15 2 + (7 - 0 - -1) 10 -19 + -9 + 12 + 6 -10 What is the value of (-24 - (18 + -27)) + 43? 28 Calculate -20 + 9 + (29 - 5). 13 Evaluate (-27 - 31) + 18 - -21. -19 Calculate (-3 - (6 + -16 - -14)) + 7. 0 What is the value of 4 + -2 + -6 - (-4 + 3 + 1)? -4 Evaluate -7 - 4 - (-4 - (8 - 3)). -2 What is the value of (-13 - (4 + 0 + (-4 - 2))) + -4? -15 (20 - (1 - -13)) + (3 - 4 - -4) 9 Calculate 0 + -13 + 19 + (20 - 28). -2 What is the value of 1 - -9 - (48 - 34) - 5? -9 Evaluate (4 - (6 + -10)) + 8 + -31 + 7. -8 What is the value of (-11 - -27) + -33 + (17 - 0)? 0 What is -7 + 4 + 0 + -18? -21 Evaluate (-1 - -9) + 0 + -8. 0 What is 5 + (-7 + 5 - 3) + 2? 2 Evaluate (0 - (-6 + 1)) + 5 + -1 + -2. 7 Calculate -13 + (-16 - (3 + (-14 - 2))). -16 Evaluate 15 - (-2 - 4 - -16) - 18 - 1. -14 What is the value of (14 - 27 - -11) + -3 + 1 - 5? -9 What is -9 - (-1 - -2) - (-112 - -104)? -2 Evaluate (-8 - (27 - 33)) + 19. 17 Calculate -11 + 3 + 9 + -2. -1 Calculate -15 + 7 + (1 - (11 + -7)). -11 Calculate -5 + (27 - (-8 + (5 - -12))). 13 Evaluate -54 + 38 + 1 + 0 + 4. -11 What is -4 - (-9 - (-6 + -1 + 1)) - -3? 2 -7 - ((-4 - -13) + -4) - 1 -13 What is 56 + -56 - (1 + -15)? 14 What is the value of (17 - 7) + (-5 - 5) - 5? -5 What is 13 + -5 - (0 - 4)? 12 What is the value of 7 - ((-4 - (-6 - 1)) + 0 + -7)? 11 Evaluate -14 + -3 + 27 - 24. -14 Calculate -14 + (-5 + 14 - 5) + 14. 4 Calculate -155 + 160 + (2 - 3 - 2). 2 What is 8 + -50 + 27 + 17? 2 31 + -15 + 3 - 17 2 20 + ((-2 - -12) + -21 - -7) 16 (-5 - 1) + 42 + -43 + 4 + -7 -10 What is the value of -4 + (-15 - -6) + 39 + 3? 29 1 + (2 - 3) + 11 - (-168 - -172) 7 (-8 - -17 - 12) + 18 15 What is the value of (-48 - (9 + -26)) + 4? -27 -13 + -3 + (-18 - -16) + 7 + 2 -9 Calculate -8 + 0 - 28 - -47. 11 Calculate ((-10 + 0 - -6) + 3 - 6) + 27. 20 Evaluate -39 + 9 - -15 - -27. 12 What is the value of (15 + 10 - 17) + -15? -7 What is 42 - (-3 + 37 - 7)? 15 Calculate 993 + -958 - (60 - 0). -25 What is the value of -56 + 52 + (1 - (1 - 5)) + 10? 11 What is -15 + (-3 - -3 - (24 + -20)) + 3? -16 What is the value of -14 - (14 + -2 - (11 + -4))? -19 (-11 - (9 - (12 + -15))) + 16 -7 Calculate 1 + 3 + -8 - 6. -10 -11 - (-6 + 8) - -9 -4 What is -9 + -6 + 5 + -7 - -6? -11 Evaluate 2 + (7 - -2 - (18 + 2 - 10)). 1 What is (6 + (1 - 2) - (15 + -18)) + -6? 2 11 - 1 - (36 + (24 - 32)) -18 Evaluate -1 + 5 + (-166 - -174). 12 What is (-3 - -14) + (4 + -11 - -9)? 13 What is 284 + -292 + -2 + -23? -33 What is the value of 6 + -2 - (348 - 333)? -11 -51 - (12 - 11) - (-1 + -17) -34 Calculate 7 + 0 + -3 + (-7 - 3 - -9). 3 Calculate 4 - (5 - (3 + -13 + (5 - -2))). -4 Evaluate -6 - (-18 - (3 - 7) - 12). 20 Calculate 5 + 3 - (35 + -36). 9 What is the value of 0 - -7 - (62 + (-55 - -27))? -27 Calculate (0 - 7) + (-27 - -27) + -1 + 5. -3 Evaluate -5 - (-17 + (21 - 10)). 1 -2 - (2 + 3) - (-3 + 0) -4 Calculate 0 + -7 + (-10 + 6 + 14 - 11). -8 Evaluate (18 - (8 + -6)) + -23. -7 (2 - 1) + 7 + -14 + 13 7 What is the value of -1 - -8 - (219 + -228)? 16 Calculate -4 + (-11 - (-20 + -4)). 9 Calculate (-1 - 0 - (64 + -64)) + -11. -12 -1 + (-9 - (-12 + 8) - -24) 18 What is the value of 1 + 3 + 2 + 15 + -28 + -4? -11 What is -2 - -1 - (4 + (-3 - (-6 - 0)))? -8 Evaluate (6 - 9) + 6 + -19 - -11 - -24. 19 Calculate (0 - 1) + 0 + (8 - (-3 - 1)). 11 (-12 - (31 + -17)) + 58 32 What is 4 + 2 + (-4 - (-17 + 5))? 14 Calculate 0 + 7 - (-84 + (41 - -32)). 18 Calculate 42 + (-25 - (-31 - -28)). 20 -2 + (1 + -16 - ((-13 - -7) + 3)) -14 31 + (35 - 18 - 33) 15 Calculate -32 + 52 + 5 - 40. -15 Evaluate (2 - -1 - 12) + -67 + 76. 0 Calculate 1 + -9 - 4 - (-17 - 1). 6 -4 - (-13 - -11 - 10) 8 12 - (42 + -14 - -1) -17 1 + -2 - (-561 + 543) 17 What is -7 + (16 - 2) + -9? -2 What is the value of 50 + -59 - (6 + -23)? 8 What is the value of 3162 + -3147 - (5 - -1)? 9 Evaluate (5 - (3 + 11 + -9)) + 1 + 4. 5 Calculate 0 + (-7 - -7) - (-74 - -91). -17 What is (1 - 0) + -12 - (-17 - (4 + 27))? 37 113 + -108 + -11 + -1 + 1 -6 Calculate (17 - 0) + (-5 - 2). 10 What is the value of (1 + -3 - 0) + -2 + 11 + 1? 8 What is the value of 2 + (2 - 3 - -4 - (-41 + 49))? -3 What is (8 - (40 - (-10 - -18))) + 8? -16 What is the value of 58 + -80 - (-20 + -14)? 12 Evaluate -5 + (-5 - -41 - 10) + -12 + 1. 10 Calculate 2 + -12 + 25 - 6. 9 What is -11 + (-5 - (-37 - -12))? 9 Evaluate 8 - (41 - (1 + 6 - (-9 - -8))). -25 What is the value of (-4 - 9 - (3 + -4 + -6)) + 5? -1 Evaluate (8 + -14 - 7) + (5 - -1). -7 Evaluate -3 - (-35 + (-3 - 8) - -9). 34 What is the value of (-4 - -6) + 0 - ((0 - 5) + -2)? 9 What is -9 - (10 + (5 + -5 - 19))? 0 (-5 - -6 - 4) + 0 + 2 - 4 -5 What is the value of 10 + 28 - ((7 - 12) + (6 - 2))? 39 Calculate -16 + 0 - (-53 - -14) - (1 - -3). 19 2 + -3 + 17 - (274 + -272) 14 -8 - (61 - (-33 + 71)) -31 Evaluate -33 - (-24 - (6 + 2)). -1 What is 0 - (-11 + (-24 - (-4 - -12)) + 5)? 38 What is the value of -17 + 60 + -43 + (6 - (-2 - -1))? 7 What is the value of 2 - 47 - (-3 - (12 + -21 + 17))? -34 Calculate (4 - (15 - 3) - (-8 + -3)) + 20. 23 Evaluate (9 - 8) + -7 - -10 - -1. 5 Evaluate (-27 - (14 + -17)) + 15. -9 What is -8 + 1 + 24 + 1? 18 -8 + 27 + -16 + (-2 - 0 - -7) 8 Calculate 118 + -123 + (0 - -25) + (-2 - -7). 25 What is (-4 - (22 + -4)) + (10 + -4 - 0)? -16 What is -2 + 0 + 6 - (123 - 126)? 7 What is the value of -3 + (-17 + 2 - 1) + -9? -28 What is (-4 - 0) + 5 + -7 + 13 + -1? 6 Evaluate 3 - (24 + -11) - -11 - -9. 10 Calculate 9 - -3 - (-18 - (-25 - 7)). -2 Calculate (7 - 15) + -33 + 43. 2 Evaluate -5 - (-2 + -9) - 4 - (-34 - -11). 25 What is the value of (2 - 1) + (-20 + 1 - -25)? 7 Calculate 0 + -15 + 17 - 4. -2 What is the value of -1 + -13 + -90 + 101? -3 Calculate 11 + -12 - -4 - (-8 - 0). 11 What is the value of 36 - 51 - (-6 + -1 + -1)? -7 -1 - (-8 - (1 + -2) - (420 - 438)) -12 Evaluate -12 + 0 + 8 + 13 + -18 + 35. 26 What is (-7 - (-5 - -13 - -13)) + (-1 - -1)? -28 What is the value of -10 - (-2 + -18 + 30) - -35? 15 Calculate -6 - (10 + 15 + -25). -6 Evaluate 31 + (-7 - (0 + 24)). 0 Evaluate -2 + -1 - 2 - (-9 + 34 + -30). 0 Evaluate -25 + 16 + -21 - -13. -17	{ "pile_set_name": "DM Mathematics" }
at is the common denominator of t((-21)/18)/7 and 81/2? 6 Let o = 53 + -45. What is the lowest common multiple of 34 and o? 136 Let p = 6 - 4. Let a be (27/15)/(p/(-8)). Let y = -961/80 - a. Calculate the common denominator of -7/4 and y. 16 Let m = -109/6 + 110/3. Calculate the common denominator of 36 and m. 2 Let c = 830 - 9082/11. What is the common denominator of 31/10 and c? 110 Suppose -4l + 8 = -a, 0 = -a + 3l - 2 - 3. Suppose -5f - p = -0p - 54, -af + p + 36 = 0. Calculate the smallest common multiple of 14 and f. 70 Let m be 970/(-8)(-6)/45. Let o be (-3)/(-9) + 666/(-28). Let c = o + m. What is the common denominator of c and 70/3? 21 Let x = 0 - -10. What is the smallest common multiple of 2 and x? 10 Let b be (-8)/(-12) - (-368)/6. Suppose 5m = 5g - 7 + b, -g - 3 = 0. Suppose -2x + 20 = m. What is the smallest common multiple of x and 10? 30 Let f = 9/8 - -101/24. Find the common denominator of 17/3 and f. 3 Suppose a = -q - 4 + 3, -4a + 2q = 28. Let o = a + 6. Find the common denominator of -115/12 and (-1)/o - (-51)/48. 48 Let q be 1/(((-2)/24)/(-1)). Suppose 2j - 3j + 4z = -q, -2j + 2z = -36. Calculate the lowest common multiple of j and 6. 60 Let l = -4229 - -67707/16. Calculate the common denominator of (-3)/6011-11 and l. 80 Let a be (-14861)/(-4) + (-2)/8. Let b = 576225 - 5799333/10. Let i = a + b. Find the common denominator of -41/18 and i. 90 Suppose -z = -4z + 48. What is the lowest common multiple of z and 16? 16 Let u(v) = -3v + 19. Let k be u(7). Find the common denominator of -1 + 1 + 51/(-8) and k/714/(-22). 88 Suppose v = 3, -28 = -3x - 2x + 4v. Let o = x + -4. What is the lowest common multiple of o and (24/(-14))/(27/(-126))? 8 What is the common denominator of 22/(-8) + (-11)/(-44) and -71/12? 12 Let c = -87 + 681/8. Calculate the common denominator of c and 91/2. 8 Let h be (987/(-245798))/((-8)/11331). Let k = 1/17557 + h. Let l = -1683 - -37005/22. Find the common denominator of k and l. 176 Find the common denominator of -71/30 and (-136)/(-300) + 1 - 2/15. 150 Let j = -2 - -9. Calculate the lowest common multiple of 1 and j. 7 Calculate the lowest common multiple of (6/7)/(10/35) and 7. 21 Suppose 2 = 3u - 4. Calculate the common denominator of 32/11 and (u/30)/((-6)/1545). 66 Let i(w) = w + 4. Suppose -5v - 3z + 4 = -5z, -2 = 5v + z. What is the least common multiple of 5/2 + 12/8 and i(v)? 4 Let i = 21620991566453/6480 - 3336572779. Let b = -1/1296 + i. What is the common denominator of b and 34/5? 5 Let d(o) = -o*3 + 3o2 + 5. Let a be d(5). What is the common denominator of 4/10 - 107/a and 4/12 + 42/(-9)? 9 Let v(u) = u2 - 11u + 8. Calculate the least common multiple of v(11) and 10. 40 Calculate the common denominator of 62/9 and ((-6)/18)/(2/(-228)). 9 Suppose 4x + 10 - 2 = 0. Let m = 0 - -12. What is the lowest common multiple of 11/x(-1 + -3) and m? 132 Let s be (2/(-158))/(116 - 1). Let n = s - 129003/36340. Let b = 2792 + -33479/12. What is the common denominator of n and b? 60 Suppose -2p + 8 = 3c, -5c + 4p + 35 = -15. Calculate the smallest common multiple of c and (-1 - -28) + -4. 66 Let r be (-24)/(-15)(-10)/(-4). Let i be (54/(-24))/(1/r). Find the common denominator of 5/2 and i/6017 + 0. 20 Let c be 56/63/(-2). Let l be (-699745)/(-210) - (-4)/c. Let j = l + -3344. What is the common denominator of j and -71/16? 48 Suppose 22 = 5x - 28. Let a = 3 + x. What is the lowest common multiple of a and 3? 39 Suppose 9m - 6m = 0. Suppose -5q + mq = -10. What is the smallest common multiple of q and 4? 4 Let d = 6203 + -37363/6. What is the common denominator of 55/9 and d? 18 What is the common denominator of 8/(-18) - (-4)/(-6) and 1893/(-42) + (-8)/(-14)? 18 Let h = 54 - 34. What is the least common multiple of h and 208/303? 80 Let p be 345/347 - (9 + -8). Let f = p - 14905/2776. What is the common denominator of 9/8 and f? 8 Suppose -y = -7 + 4. Suppose -4n = -yn - 2. Suppose nr - 19 = 5. Calculate the lowest common multiple of 10 and r. 60 Suppose -2d - 3d + 2n = -41, -4d - 4n + 16 = 0. Suppose -v = 11 + d. Find the common denominator of 38/11 and (v/(-189))/((-6)/(-448)). 99 Let s be (2 - 3) + 1 + -3. Let f be ((-10)/4)/(s/6). Suppose -fo + 2k + 51 = 0, -6o + o - 4k = -63. What is the least common multiple of o and 4? 44 Let v(d) = -d*2 + 8d - 8. Suppose -7 = -i - 2. Calculate the least common multiple of i and v(6). 20 Let v(b) = -b*3 - 5b*2 + 10b + 3. Let m be v(-7). Suppose 3p = 3a - 46 + 10, 2p = 3a - m. Calculate the least common multiple of 9 + 4/(2 + 0) and a. 77 Suppose 10 = -0g + 3g + 2q, -15 = -4g - 3q. Let v be 10/6(12 - g). Calculate the smallest common multiple of 1 - 1/((-2)/v) and 4. 44 Find the common denominator of 9/(-30)290/4 and -1/10. 20 Let w = 2375756/861 + -19316/7. Find the common denominator of w and 46/9. 369 Suppose 5j - 5 = 0, 2q + 3j = -0 + 3. Suppose qy - y = -8. Calculate the least common multiple of 1 - (4/(-6))/(4/6) and y. 8 Let o(w) = -w2 + 10w - 8. Let b be o(9). Let d be 6/b(-21)/(-6). Find the common denominator of 13/3 and d/35 - 48/10. 15 Calculate the common denominator of 20/7 and ((-8)/(-16))/((-5)/12). 35 Suppose -3p - 18 = -5p. Calculate the smallest common multiple of p and 10. 90 Let n = -4130 - -66047/16. Let s = -255558 + 3071509/12. Let q = s + -402. What is the common denominator of n and q? 48 Suppose -2w + 14 = 5q - 22, 0 = w - q - 4. What is the lowest common multiple of w and 3(10/3 - 0)? 40 Let c = 11 - 5. Calculate the least common multiple of 8 and c. 24 Let f(i) = 0i + 4i - i + 19i2 - 7. Let p be f(-8). What is the common denominator of 2/30p/6 and 37/2? 6 Let s = 1 + 1. Let i(n) = -2n + 1 + 2 + 3n*2 - 5. Calculate the lowest common multiple of 12 and i(s). 12 Calculate the common denominator of 1/(-3)(-474)/(-20) and (8/(-16))/(4/(-138)). 20 Suppose 2n + 35 = 6n + 5a, -4a = 3n - 27. Suppose -9p + 40 = -4p - nt, 12 = -4t. Let v = 13 - 6. What is the lowest common multiple of v and p? 35 Calculate the common denominator of (1/(-6))/((-12)/(-882)) and 4/2 + (-255)/24. 8 Let j be -1 + 1 + (-2 - -1). Calculate the common denominator of 75/(-8) - (2 + -4) and j + (1395/(-42))/(-5). 56 Suppose 3y + 16 = 4j, 0 = 5j - 10j + 5y + 15. Calculate the least common multiple of 14 and j. 14 What is the common denominator of (-9)/20 + 2/(-8) and (-1)/5 + -4 + 28/(-8)? 10 Suppose 5z - z = 44. What is the lowest common multiple of z and 11? 11 Let t = 648 - 1966/3. Find the common denominator of 24/11 and t. 33 Let u be (-6)/9 - 25569/6. Let a = u - -4237. What is the common denominator of a and 11/(-7) + 5/(-5)? 42 Suppose a + 2a + 70 = 5d, 0 = -2d + 10. What is the common denominator of (435/25)/(2/(-5)) and ((-189)/(-50))/((-9)/a)? 10 Let i = -39 + 21. Let j = -16 - i. Calculate the lowest common multiple of 6 and j. 6 Suppose -2 + 14 = 3v. What is the smallest common multiple of 2 and v? 4 What is the common denominator of 54/7 and -2 - (-5 + 4) - 11? 7 Suppose -3s = -4y - 51, -2s + 45 = -4y + 3s. Calculate the lowest common multiple of 4/(-5)y/2 and 4. 12 Let r be (-1)/(-3) - (-22)/6. Suppose rw + 15 = v - 0w, -5v + 3w + 7 = 0. What is the lowest common multiple of 10 and (1 - v)(8 - 0)? 80 Suppose -1 = 2o - o. Let y = 6 + o. Calculate the least common multiple of y and (-1 + -1 - 1)-3. 45 Let h be 18(8/(-6))/(-4). Calculate the smallest common multiple of (3/(-9))/((-2)/h) and 6. 6 Let p = -2431 - -21845/9. Calculate the common denominator of p and -36/11. 99 Let l(d) be the third derivative of 5d4/24 + d3/2 + d*2. Calculate the lowest common multiple of 6/((-77)/10 - -8) and l(3). 180 Let k = -1 - -7. What is the least common multiple of 20 + (-5)/(10/(-4)) and 4(-2)/(k/(-9))? 132 Let u(y) = -y*2 - 5y - 4. Suppose g + 4m = -18, -g - m - 15 = 2m. Let q be u(g). Find the common denominator of (156/(-15))/((-6)/q) and 10/11. 33 Calculate the common denominator of 37/78 and ((-1)/15)/(5 + 126/(-26)). 390 Suppose 0 = -5o + 2c - 4c + 80, 4c + 2 = -o. Calculate the least common multiple of 8 and o. 72 Suppose -2b - 3b = i - 24, -4i + 16 = 0. Let f(r) = -r3 + 3r*2 + 5r - 2. What is the l	{ "pile_set_name": "DM Mathematics" }
Let j be s(z). What is the highest common factor of j and 20? 20 Suppose 4m = 15 + 5, 5n + 5m = 355. Calculate the greatest common divisor of 6 and n. 6 Suppose 3s = 8 - 2. Suppose 122 = 5i - sn, 60 + 10 = 3i + 2n. Suppose 5d - 4m = 60, 5m - 5 + 60 = 5d. What is the greatest common divisor of d and i? 8 Suppose 36 - 4 = 4i. Let u(g) = 10g - 6. Let q be 0/(-3) + (7 - 0). Let f be u(q). What is the highest common factor of f and i? 8 Let b = -84 + 86. What is the greatest common factor of 18 and b? 2 Let r = -18 + 20. Suppose 0 = 2j + rj - 160. Suppose -3t = -3, -x + 2t + 2 + 1 = 0. Calculate the greatest common divisor of x and j. 5 Let a = -232 - -235. Suppose f + 200 = 5n, 86 = 4n + 2f - 88. Suppose 0 = -4b + n + 67. Calculate the highest common factor of a and b. 3 Let t = -18 - -28. Suppose -6a = -a - 50. What is the highest common divisor of t and a? 10 Let x(v) = 2v*3 + 34v*2 - 6v + 18. Let m be x(-17). Suppose 2 = -b + 5. Suppose r = br - m. What is the highest common factor of 24 and r? 12 Suppose 5a = 2s - 10 - 89, -198 = -5s - 4a. Let v = 29 + -23. Calculate the greatest common divisor of v and s. 6 Suppose -5l - 3y + 22 = 0, -18 = -5l + 3y - 5y. Suppose -li + 200 = 2i. Calculate the greatest common divisor of i and 20. 10 Let u be (-3)/9 + (-86)/(-6). What is the highest common divisor of 14 and u? 14 Let b = 10 + -7. Suppose 0 = 4o - 9 - b. What is the highest common divisor of 2 and o? 1 Suppose -k = -3k. Let y be 14(k - 1/(-2)). What is the greatest common divisor of 21 and y? 7 Suppose i + 2i = 36. Let z = 112 + -43. Suppose 4m + 7f - 81 = 2f, -f = 3m - z. Calculate the greatest common factor of m and i. 12 Suppose -2d + 4i + 34 = 0, 0d = d + 3i + 8. What is the highest common factor of d and 28? 7 Let c = -189 + 308. Calculate the highest common divisor of 51 and c. 17 Let q(w) = -1. Let n(p) = p - 3. Let x(s) = n(s) - 4q(s). Let r = 17 - 14. Let m be x(r). What is the greatest common factor of 28 and m? 4 Let k = 106 - -62. Let i be 30/(-105) + 298/14. Calculate the highest common divisor of i and k. 21 Suppose 3d + 0d = 408. Calculate the greatest common divisor of d and 17. 17 Let o be 6(3/(-9) - -3). Calculate the greatest common divisor of o and 176. 16 Suppose -17 = -i - m + 7, 2i = 4m + 54. Suppose -i = -3s + 2. Calculate the greatest common divisor of s and 99. 9 Let c = 10 - 20. Let r = -7 - c. Suppose 0x - rx + 255 = 0. Calculate the highest common factor of 17 and x. 17 Let z(t) = -t3 + t2 - 2. Let f be z(2). Let p = f + 16. What is the highest common factor of p and 50? 10 Let i(f) = -f2 + 10f + 10. Suppose -4h - 30 = -7h. Let d be i(h). Calculate the greatest common divisor of 10 and d. 10 Suppose -6m + 216 = 2m. Calculate the greatest common divisor of m and 9. 9 Suppose -4v - 2w - 20 - 4 = 0, w = -2. Let y be 6/((-17)/v + -3). Suppose 0 = -5g - 25, -g - 216 + 61 = -2j. Calculate the highest common factor of j and y. 15 Let r(u) = -u*3 + 5u*2 + 2u - 2. Suppose -5z = -2v - 14, 3v + 20 = 2z + 7v. Let g be r(z). What is the greatest common factor of 11 and g? 11 Let u be (2 + 1)/(33/880). What is the greatest common factor of u and 16? 16 Let v(q) = 2q*2 - 3q + 2. Let c be v(5). Suppose 5t = -2h + 132, -2t + c = 2h - 11. What is the greatest common divisor of 14 and t? 14 Let b be 3/7 - 5/((-210)/402). What is the highest common factor of 50 and b? 10 Suppose -6 - 4 = -2d. Let m = -2 - -6. Let n be (-2 - (-126)/8)m. What is the greatest common divisor of d and n? 5 Suppose -j + 18 = -0. What is the greatest common factor of j and 36? 18 Suppose 4p + 6p = 10. Calculate the highest common factor of p and 7. 1 Let l be 0/(-7) + (1 - -39). What is the greatest common divisor of l and 8? 8 Suppose 2t + 0 = 2s + 6, -3s + 3 = 3t. What is the highest common divisor of t and 8? 2 Let d = 16 + -8. Suppose z - 2b + 3 - 19 = 0, 2b = -d. Let a be (z/3)/418. Calculate the greatest common divisor of 12 and a. 12 Suppose 0w = -w + 14. Let k = w + -10. Suppose -3v + ky + 57 + 7 = 0, 5v - y - 118 = 0. What is the highest common factor of v and 6? 6 Suppose 5h = -5a + 95, 3 = -3h - 3. Suppose 0r + 3r = a. Calculate the highest common factor of r and 7. 7 Suppose -4u = 3p - 37 - 15, 0 = -3u + p + 26. What is the greatest common divisor of u and 10? 10 Let p be (5 - -1) + 0 - -1. Suppose 2j = -a + 2, 3 = 2j + 5a - 7. Suppose j = 17n - 19n + 28. What is the highest common factor of p and n? 7 Let q = 92 + -32. Calculate the greatest common divisor of 12 and q. 12 Suppose 4k = 2k + 5a - 2, -3k + 20 = 4a. Suppose n + l - 29 = -l, kl - 35 = -n. Let y = 59 - n. What is the greatest common factor of 54 and y? 18 Suppose -5z - 4o = -39, -5z + 3o = -19 - 13. Calculate the greatest common divisor of z and 35. 7 Let o = 35 - 25. Let k(h) = h*2 + h. Let n be k(-2). Let s be 2(-5)/(-2)n. What is the highest common divisor of s and o? 10 Let p = 14 - 9. What is the greatest common factor of p and 5? 5 Suppose h + i + i = 43, 63 = h - 3i. What is the highest common divisor of 34 and h? 17 Suppose i - 100 = 3l - 2l, i - 84 = -3l. Calculate the highest common divisor of i and 12. 12 Suppose 13 = 2s + 7. Suppose -5c + 2a + 41 = -25, 5c - 76 = -sa. Calculate the greatest common factor of 21 and c. 7 Let d = -33 + 34. What is the greatest common factor of d and 1? 1 Suppose -5u + 73 + 452 = 0. What is the highest common factor of u and 15? 15 Let z be 3 - ((-2 - -3) + -1). Suppose p = -zo + 20, -2p - 4o + 9o = -18. Suppose 4s - 28 = 2s. Calculate the greatest common factor of p and s. 14 Suppose r - 3q - 15 = 0, -5r - 21 = -8r - 3q. What is the highest common divisor of 72 and r? 9 Let x be (-363)/21 - (-6)/21. Let p = x - -29. Calculate the highest common divisor of 36 and p. 12 Suppose -4p + 8p = 12. Suppose -5x = -3y + 1, 2x - 3x + py - 5 = 0. Let r = x - 0. What is the highest common factor of 1 and r? 1 Let m = -10 - -7. Let h be (-2)/(-2) + -1 - m. Calculate the highest common divisor of 3 and h. 3 Let g(y) = -y - 1. Let k be g(-4). Let n(p) = -p*3 + 19p*2 - 20p + 39. Let o be n(18). Calculate the greatest common factor of k and o. 3 Let w be (-50)/(-4) - (-13)/(-26). Let r be (2/6)/((-1)/(-9)). Calculate the highest common divisor of w and r. 3 Let g(u) = u*3 + 14u2 - u - 12. Let b be g(-14). Let h be ((-1)/b)/((-3)/174). What is the greatest common factor of h and 203? 29 Let s(y) = -y2. Let k be s(-7). Let h = -28 - k. Calculate the greatest common factor of 168 and h. 21 Suppose -3i = 3u - 3 - 0, 0 = 4u + 4. Suppose -32 = 2g + ig. Let w = -5 - g. What is the greatest common divisor of 3 and w? 3 Let s = 6 + -4. Let i be ((-2)/(-4))/(1/s). What is the highest common divisor of 4 and i? 1 Let l(j) = -19j + 9. Let x(a) = -3a + 6. Let n be x(5). Let o be l(n). Suppose -o = -u - u. What is the highest common divisor of 10 and u? 10 Let m = -13 - -76. Suppose 4l = m - 15. What is the greatest common factor of 12 and l? 12 Suppose -3d + 2n - n + 10 = 0, 3n = 6. Calculate the greatest common divisor of d and 1. 1 Let r be ((-78)/(-3) - (0 + 1)) + -2. What is the highest common divisor of 23 and r? 23 Let j(t) = -t3 + 3t*2 + 13t - 9. Let k be j(5). Calculate the highest common divisor of 36 and k. 6 Suppose 0 = 3b - 3, -15 = 3r - 4b + b. Let z be (-2)/(-1 + (-5 - r)). What is the highest common divisor of 2 and z? 1 Suppose -86 = -14r + 96. Calculate the highest common factor of 247 and r. 13 Let b(c) = -c + 1. Suppose -2z = -4z - 8. Let d be b(z). Let j(f) = 3f + 4. Let o be j(7). What is the highest common divisor of o and d? 5 Suppose 2h - n - 30 = -0n, -4h + 4n + 52 = 0. Let w be ((-850)/(-5))/21. What is the greatest common factor of h and w? 17 Suppose -4k + 578 = 74. Suppose -k = -m - m. What is the greatest common factor of m and 7? 7 Let i be ((-20)/(-2))/((-11)/(-22)). Calculate the greatest common divisor of 10 and i. 10 Suppose 3g - g = 4f - 54, 17 = f + 3g. What is the greatest common factor of 14 and f? 14 Let j(a) = -a*3 + 8a*2 - 6a - 4. Let c be j(7). Suppose c*d - 54 = d. Let l = -12 - -30. Calculate the greatest common divisor of	{ "pile_set_name": "DM Mathematics" }
n = h - 10. Let s = 8 + 2. What is the least common multiple of s and n? 10 Let n = -719511/7 + 102971. Let s = n + -183. Find the common denominator of 24/5 and s. 35 What is the smallest common multiple of 16/4 - 1 - -1 and 9? 36 Let f = -857 + -3331. Let n be f/200 + 2/(-4). Let o = n - -707/50. What is the common denominator of o and 67/20? 20 Let c(y) = -y + 18. What is the lowest common multiple of c(15) and 4? 12 Let y(z) be the first derivative of -4z3/3 - z2/2 + 4z - 4. Find the common denominator of y(3) and -12/11. 11 Let k = 8798 - 131918/15. What is the common denominator of 29/3 and k? 15 Let x = -5 - -19. Suppose 3q - q - 4y = -12, -5y = -3q - x. Calculate the lowest common multiple of q and 1. 2 Find the common denominator of (-10)/(-35) - 1990/252 and 53/20. 180 Let b(y) = y3 - 2y*2 + 5y. Let x be b(-4). Let t = -2/2609 + 49579/10436. Find the common denominator of x/42(-6)/4 and t. 28 Let o be 120915/6 + 4/18. Let s = 20160 - o. Let a = -6/3635 + 287261/58160. Find the common denominator of a and s. 144 Let r(g) = 6g3 - g2 + 3g + 2. Let q(o) = o3 - o2 + o - 1. Let t = -4 - -9. Let s(f) = tq(f) - r(f). What is the least common multiple of 2 and s(-5)? 8 Suppose 0 = -3j + 4d + 1, -d + 16 - 2 = 4j. Suppose 0 = h + h. Suppose -12 = -hp - 2p. What is the smallest common multiple of j and p? 6 What is the common denominator of 107/6 and ((-1133)/(-165))/((-2)/5)? 6 Let f(q) = 11q*3 - 3q + 2. Calculate the lowest common multiple of f(1) and 5. 10 Let x(o) be the third derivative of -o*4/24 + 5o*3/3 - 2o*2. Let p be x(9). Calculate the common denominator of 69/8 and (8/10)/p-40. 8 Let m = -1981 - 75. Let l = 16469/8 + m. Calculate the common denominator of 14/22 - (-3 + 1) and l. 88 Let n = -221/2 + 86. Find the common denominator of n and 97/6. 6 Suppose 93 = 3p + 27. Calculate the lowest common multiple of 96 and p. 1056 What is the common denominator of -139/6 and (((-30)/32)/3)/((-18)/(-204))? 24 Suppose 0v - 3v + 6 = 0. Suppose 0 = -p - 2r + 5, -p - 5 = -vp - 3r. Let d = -21 + 31. What is the smallest common multiple of p and d? 10 Let w(d) = 3d. Let t = 3 - 1. What is the lowest common multiple of t and w(4)? 12 Let l = 127371/22 - 5792. Let v = -410 + 5771/14. Find the common denominator of l and v. 154 Let d = 2 - 0. Let a be (-26)/(-8) + 15/20. Suppose 4o - 5z = -2, -az = -o + 4 - 10. Calculate the least common multiple of o and d. 2 Calculate the common denominator of (-641)/105 + 3 + (-4)/(-20) and -79/18. 126 Suppose -5o = h - 30 - 8, -4o = -3h - 19. What is the lowest common multiple of o and 9? 63 Let i = 4235375651/4950 - 7700720/9. Let k = -51/50 - i. Let o = 17050/9 - 1892. Calculate the common denominator of k and o. 99 Let m = -5071/4 + 1258. Find the common denominator of m and (-879)/(-18) + 4/6. 4 Let o = -68 - -70. Calculate the lowest common multiple of 18 and o. 18 Let l = -5234 + 21037/4. Let x = 28579/5316 + 18/443. Find the common denominator of l and x. 12 Let b = -14323/6 + 2369. Let p be -34 - (-1 + -2 + 1). Calculate the common denominator of (-2)/(-4) - 132/p and b. 24 What is the common denominator of 127/12 and 202/(-12) + 2/1? 12 Suppose -3j + 2712 = -0j. Let c = j + -9073/10. What is the common denominator of c and -11/6? 30 Suppose 0 = 5y - 2r - 5, -y - 2r = -18 + 5. Calculate the lowest common multiple of 33 and y. 33 Suppose 3a - 4f - 63 = 0, 2f + 1 = 7. Suppose -5n - h - h + 25 = 0, 5n = -5h + a. Calculate the smallest common multiple of n and 9. 45 Calculate the smallest common multiple of 2 and (5 - 4) + 14/2. 8 Suppose d + d - 16 = 0. Suppose -42 = k - 4k. What is the lowest common multiple of k and d? 56 Let c be 1/5 + 124/(-20). Let l(x) = x2 + 6x + 4. Let u be l(c). Suppose ug - 4 = -s - 14, -2s + 2g = -10. Calculate the least common multiple of s and 2. 2 Let g = 1937461/635 - 15253/5. Let s = g - 4597/1270. Calculate the common denominator of 1/10 and s. 10 Let u(d) = -2d. Let j be u(2). Let c(g) = 2g2 - 7g - 2. Let a be c(-6). Calculate the common denominator of 47/8 and (-158)/a - j/14. 8 Find the common denominator of (-34)/(-48) - 10/30 and 44/7. 56 Suppose -i + f + 20 = 3f, -4i + 2f = -90. Calculate the lowest common multiple of i and 8. 88 Suppose c + k - 7 = -2c, -c = 3k + 11. Suppose 3v = y + 4 - 0, -2y + 22 = 4v. Calculate the lowest common multiple of c and y. 20 Suppose 0 = -3c + 2k + 42, -k - k = c - 14. Suppose 5l - 6 = c. Calculate the lowest common multiple of 12 - -412/(-16) and l. 36 Let j = -45 + 57. Suppose -3u - 9 = 0, -9 + 56 = 4x - 5u. Suppose 3y + 2t = 40, -2y + 3y + 2t - x = 0. Calculate the lowest common multiple of y and j. 48 Let q = -15837 + 316809/20. Let m = 148533/16 + -9287. Find the common denominator of q and m. 80 Let i = -60 + -251. Let q be 6/3 - 2414/8. Let b = q - i. Calculate the common denominator of 151/12 and b. 12 Calculate the common denominator of 131/12 and 55/(2 + -3 - -3). 12 Suppose -i + 2 = -0, -3s = -2i + 874. Let g = 561/2 + s. Calculate the common denominator of g and 0 + (-1 - (-7)/6). 6 Let q(v) = v2 - 3. Let k be q(5). Let p = k - 12. Let b = -15 - -26. Calculate the least common multiple of p and b. 110 Let o(n) = n2. Let y be o(3). Suppose -3 = -2m + 5. Calculate the smallest common multiple of 11 and m/10 - y/(-15). 11 Let g(q) = q + 6. Let u be g(-6). Calculate the smallest common multiple of (2 - 24)(-1)/2 and -5(1 + u - 2). 55 Let y = 6 + -9. Suppose 4u - u = 3. What is the smallest common multiple of u and (-2)/(-6) + (-2)/y? 1 Let o(m) = -m*2 - 11m + 9. Let x be o(-12). What is the common denominator of (-1)/(-2) - (-65)/(-4) and ((-14)/x)/(280/(-273))? 20 Let f(x) = -x*3 - 5x*2 + 10x. Let b be f(-8). Let p = b - 1235/11. Calculate the common denominator of 45 and p. 11 Let d = 207347/24 + -8641. Calculate the common denominator of d and 7/33. 264 Calculate the common denominator of 28/4051/(-14) and -33/7. 140 Let q(x) = x3 + 6x*2 - 8x - 1. Let r = 20 + -8. Calculate the smallest common multiple of r and q(-7). 12 Suppose -5y = -5l - 10y + 35, 0 = 2y + 10. Calculate the least common multiple of 3 and l. 12 Suppose -4u + 8 = 5y, 0y - 4y - 23 = -u. What is the smallest common multiple of u and 7? 7 Let u = 54 - 37. Calculate the least common multiple of 1 and u. 17 Let y = -2/681 + 7957/4086. What is the common denominator of y and 1/3 + 588/216? 18 Let j = -10/259 + -22991/1554. Calculate the common denominator of 77/4 and j. 12 Let i = -5821 + 34793/6. What is the common denominator of -29/34 and i? 102 Let v be (-360848)/(-294) + 1/(-3). Let w = v - 1227. Let s = w + 13/882. What is the common denominator of s and -115/14? 126 Suppose g + 2g - 519 = -3b, -2g = 4b - 698. Calculate the common denominator of 99/10 and 1240/b - (1 + 1). 110 Let l = -9813/10 + 983. What is the common denominator of -79/22 and l? 110 Let d(a) = -64a2 - 9a + 10. Let v be d(-8). Let r = v - -64265/16. Let b = -9619 + 153953/16. Find the common denominator of r and b. 16 Let m(y) = -y*2 - 7y + 1. Suppose 3u - 14 = 5u. Let z be (u + 0/(-3))1. What is the lowest common multiple of m(z) and 9? 9 Suppose t = 3m + 43, -m - t = -5t - 4. Let a = 34 + m. Calculate the least common multiple of (16/20)/((-1)/(-5)) and a. 36 Let z = 9357512322/36829 - 254080. Let y be 10533022/2833(-2)/(-936). Let a = z + y. Calculate the common denominator of -53/16 and a. 144 Let p = -8029/1180 + 1/236. Let a = 343/10 + p. Calculate the common denominator of 27/22 and a. 22 Let r = 66 + -58. Calculate the lowest common multiple of r and 68. 136 Let c be (73131/10098)/((-6)/(-9)). Let t = 10/187 + c. Calculate the common denominator of 83/2 and t. 12 Let f = -23966429/43131 - 10/14377. Let o = f + 26489/48. What is the common denominator of o and 101/10? 80 Let a = 4653 + -18709/4. Calculate the common denominator of 69/40 and a. 40 Let o = 11/135 - -173/2295. Calculate the common denominator of o and -32/7. 357 Suppose -3v + 3u = 4u - 113, 20 = 4u. Find the common denominator of (-8)/12 - (-10)/v and -15/8. 72 Let p be 3 + 26121/9216 + 0. Let u = 1/1024 - p. Find the common denominator of u and 43/8. 24 Suppose 4*d - d -	{ "pile_set_name": "DM Mathematics" }
p) = p*2 + 4p - 59. Let y be v(6). Let s be n(y). Solve -s = -4b + 6 for b. 3 Suppose 5h = -2v + 40, 393v - 388v + 24 = 3h. Solve o - ho = -42 for o. 6 Let r(q) = 5q + 4q2 - 8q*2 + 14q*2 - 3 - 4q*2. Let b(z) = -5z*2 - 5z + 3. Let k(m) = -7b(m) - 6r(m). Let s be k(3). Solve i - s = 1 for i. 4 Let u = 158 + -153. Suppose -55 = -ui - 2w, w = 13i - 10i - 22. Solve 0 = 5y - i + 4 for y. 1 Let v = -14642 - -14647. Solve 0 = -33q + vq - 112 for q. -4 Let j(s) = -2s*3 - 15s*2 + 9s + 8. Let y be j(-8). Solve y = 57d - 69d + 48 for d. 4 Suppose 4s - 8s = -12. Suppose sg - 8 = g. Solve gz + 0 = 16 for z. 4 Let v be (1 + 29)16/(-24). Let x(s) = 36 - 7s*2 + 8s*2 + 17s - 76 - 18. Let a be x(v). Solve -6 = ai + i for i. -2 Let i be -7(-17)/((-1428)/(-240)). Solve 3y + 26 = i for y. -2 Suppose 4s - 4 - 8 = 0. Let w = 1729 + -1729. Let l = -32 + 52. Solve w = p + sp - l for p. 5 Suppose 27s = 2y + 26s - 14, 8 = 5y + 2s. Solve -56 = yv - 52 for v. -1 Suppose 16k = 12k - 24. Let i be 2/k - (-141)/(-9). Let h = i - -20. Solve a = ha for a. 0 Let p = 836 - 771. Let l = p - 62. Solve 0 = -8q - l + 11 for q. 1 Suppose -16 = -4q - 0q - 4m, 27 = 5q - 2m. Suppose -qb + 43 = -37. Let h = 70 - 67. Solve j - b = -hj for j. 4 Let b = 55 - -2. Let p = b + -51. Suppose i - pi = 5q - 75, 2q + 6 = 0. Solve -i = 3x - 3 for x. -5 Let h = -27363 - -27455. Solve 39n + 64 = -h for n. -4 Let s = 84 - 76. Suppose -217 = sk - 39k. Solve kn = -24 - 4 for n. -4 Let j = -4 + 6. Let p be (-20)/110 - 422/(-22). Suppose ph - 18h = 0. Solve h = -d - j - 2 for d. -4 Suppose -104l = -102l - 4. Suppose -lq - u = -10, 12q + 2u = 7q + 23. Solve 5 - 8 = -qs for s. 1 Let l = 947 + -1931. Let d be ((-16)/(-9) - 2) + l/(-54). Solve 3m = -12 + d for m. 2 Let p be (24/(-28))/((-1)/((-14)/(-3))). Suppose p = -4q + 16. Suppose -n + 0n = qn. Solve n - 6 = -3y for y. 2 Let v be -435/(-40) + (-6)/4. Let x(z) = 2z - 2. Let f = -5 + 8. Let i be x(f). Solve vq - i = -8 for q. -2 Suppose 420 = -16r + 20r. Suppose -106t = -rt. Solve t = 41m - 46m - 25 for m. -5 Let w be (140/(-15))/14 + 1180/6. Suppose -wj - 88 = -207j. Solve 0 = -3t - j + 2 for t. -2 Let o = -422 + 423. Let x(a) = 15a - 4. Let p be x(o). Solve 0 = 2h + 9 - p for h. 1 Let b = -7806 - -7866. Solve -f - 61 = -b for f. -1 Suppose -8 = -4b - 2p, 290p - 295p - 7 = b. Solve -10i = bi - 78 for i. 6 Suppose 6 = -4q - w - 0, 4q + 4w = 0. Let f be 0/((3 - 6) + 1). Let o be f/q17/(-17). Solve o = -2p + 7p for p. 0 Let f(s) = 6s2 - 68s - 213. Let n be f(14). Solve nm = -36 - 41 for m. -7 Let d(t) = 34t*2 + 63t + 34. Let b be d(-4). Solve 0 = -3c - 338 + b for c. -4 Let l(m) = -3m*2 + 200m - 317. Let i be l(65). Solve 0 = -iz + 43z for z. 0 Let w be (-1342)/11 + (-2 - 0 - -2). Let o = w - -132. Solve -4m = m - o for m. 2 Let v(h) = -h2 - 309h - 3834. Let f be v(-13). Solve fs - 5 + 103 = 0 for s. -7 Let v(s) = s3 - 16s*2 + 16s - 13. Let i be v(15). Suppose 2m - 10 = 0, -2b + 4m = -b + 2. Suppose -2f = 4f - b. Solve fo = 4o - i for o. 2 Let h(q) = 14q - 1382. Let k be h(111). Solve kn - 156n - 16 = 0 for n. 1 Let a(q) = -q*2 - 9q + 9. Let s be a(-9). Suppose 7d = -2d + s. Solve -1 = 2m + d for m. -1 Let v = -186 + 76. Let s be -4(-5)/(-10)v/4. Let d be s/(-11)2/(-5). Solve -5q = -6q - d for q. -2 Suppose 0 = 4m + 3z - z - 80, -3z - 60 = -3m. Suppose -71l = -67l - m. Solve 2b - 11 + l = 0 for b. 3 Let o(h) = 46h - 46. Let x be 4/3 + (-35)/105. Let z be o(x). Solve -2g - 21 + 11 = z for g. -5 Let v be 1 + (150/54 - (-8)/36). Solve vz + 3z - z = 0 for z. 0 Suppose 4t + 33 = 2r - 9, 4r = -2t + 34. Solve -rf = -19 - 14 for f. 3 Suppose -2m - 5p - 16 = 0, -4m = 6p - 8p - 16. Suppose -3r = -r + 12. Let o = r - -6. Solve o = mb - 4b - 10 for b. -5 Let i = 253 - 225. Suppose 5o = 5f - 65, -2f - 6o = -10o - i. Solve -5t + 2t - f = 0 for t. -4 Let k = -12 + 22. Suppose 5d - kd = -25. Suppose 8i = d + 11. Solve 0 = s - is - 4 for s. -4 Let n(s) = s2 - 6s - 159. Let v be n(17). Solve 0 = -50q + vq for q. 0 Suppose -90r + 818 = 20r - 612. Let z be (-14 + -1)/(-3 + 2). Solve -zl = -rl - 2 for l. 1 Let l(k) = -k*3 - 8k*2 - 8k - 1. Suppose -5x - 5i - 55 = 0, -2x - 2i = -4x - 6. Let a be l(x). Suppose a = -6m + 12. Solve -m = q + 1 for q. -2 Suppose 0 = 181t - 184t. Suppose -3a + 3z - 2z + 32 = t, -4 = 2z. Let o = 16 + -16. Solve -3v + a - 22 = o for v. -4 Let p = 162 - 158. Suppose 4 = 3j - 4j - 3m, -j + 4 = -m. Solve -2k = -pk + j for k. 1 Suppose -4 = -6x + 7x. Let a be ((2 - x/(-2))/3)/1. Solve 3j + 15 = -aj for j. -5 Suppose -d - 639 = -10d. Let b be (d + -76)2/((-10)/3). Solve 0 = -6v + bv - 12 for v. -4 Let l(k) = -k*3 + 3k*2 - 4k + 3. Let p be l(2). Let f(s) = -21s - 1. Let y be f(p). Let o(h) = 8h*2 + 10h + 7. Let c be o(-1). Solve -cn = y - 5 for n. -3 Suppose m + 7i + 55 = 5i, -2m = -4i + 118. Let u = -57 - m. Solve -4g - 25 + 17 = u for g. -2 Let j = 8675 - 8662. Solve 19 = -jb + 32 for b. 1 Let a be 6/(-15) - (-34)/10. Let h(c) = -4c - 58. Let w be h(-14). Let x be 0 - w - (-114)/19. Solve am + x = 2 for m. -2 Let i = 0 - 0. Let d = -629 - -632. Suppose d + i = n. Solve n = -l + 2 for l. -1 Let h = 5853 + -5759. Solve -25j - 22j = -h for j. 2 Let i(f) = 8f*2 - 125f - 2. Let m be i(8). Let j = -486 - m. Solve 0 = -5b + jb - 5 for b. -5 Let n(b) = 3b3 + 22b*2 + 7b + 20. Let x be n(-9). Let w = x + 461. Solve -3q - 10 = -w for q. 1 Suppose 6h + 6h - 84 = 0. Let r be (2 + h)/(7/14). Suppose ro = 20o - 30. Solve -3q = -8q - o for q. -3 Suppose 0 = -211l + 132l + 2844. Solve -lp - 4p = 40 for p. -1 Let u(n) = n + 2. Let r be u(4). Suppose -ry + 105 = 57. Solve -3s = 14 - y for s. -2 Let u be 9/(-81) + 85376/(-288)(-2)/8. Solve ux + x = 375 for x. 5 Suppose -24 = -2x - 4q, -32 = -3x + 4q - 9q. Solve -f - 3 = -x for f. 1 Suppose 51u = 26u + 5175. Solve 0 = 201h - uh - 24 for h. -4 Let h(f) = -86f - 255. Let u be h(-3). Solve -391 = us - 385 for s. -2 Suppose 0l - 4 = -4l. Suppose 0 = -j + a - 5, -4a + 15 = -l. Let t = j + 6. Solve -5 = -tz + 10 for z. 3 Let k = 267 - 262. Let n be k - (1 - -1) - -12. Solve -g - n = 4g for g. -3 Let z(h) = 2h + 76. Let f be z(-27). Let g be (0/14)/(4 - 6). Solve -4w - f + 2 = g for w. -5 Let p(d) = d3 - 4d*2 - 5d + 3. Let f be p(5). Let x(z) = 2z3 - 12z*2 - z + 6. Let g = 200 + -194. Let t be x(g). Solve to + o = f for o. 3 Suppose 0 = -48a + 563 + 7536 - 947. Solve -a = 14z - 177 for z. 2 Let l(g) be the first derivative of -g*4/4 + 3g3 - g2/2 + 11g - 67. Let k be l(9). Solve -kv + 4 = -0v for v. 2 Suppose 4d - 2v - 92 = 0, 528 - 538 = -5v. Solve -12 = -26q + dq for q. 6 Suppose x - 35 = -5t, 6x - 5t - 15 = 2x. Let z be 42((-4)/22 - (-1335)/1958). Solve -61 = -xc - z for c. 4 Suppose 0q = 5q. Suppose q = 6s - s + 20. Let t be 1 - 4 - (s - 2). Solve -2g = -1 - t for g. 2 Let t be 14/(-28)0 + 19. Solve 5i - 9 = -t for i. -2 Suppose 5c - 30 = -5n, 3c - 2n = 4c - 9. Let d be ((-4 - -1)/12)/2. Let i be (-1 - d)/((-9)/(45/(-2))). Solve cp = ip + 8 for p. -4 Suppose 0 = -27m + 732 + 2022. Solve -172 = -35j - m for j. 2 Let m(b) = -10b2 + 60b + 23. Let v(s) = -5s2 + 29s + 11. Let r(n) = 3m(n) - 7v(n). Let c be r(5). Solve -i + 0 = c for i. -2 Suppose 9j - 103 - 527 = 0. Let x = j + -70. Solve x = 2v + v - 6v for v. 0 Let t(a) = -a3 + 12a*2 - 20a + 10. Let f = -35 - -45. Let b be t(f). Solve 2c = -b + 2 for c. -4 Let c be 88055/160 + (1/4)/1. Solve 0 = -2n + 411 - c for n. 4 Let l be 48/18(-225)/(-3). Let y = l + -196. Solve -28 = -6t - y for t. 4 Let t(z) = 2z*2 - 29z + 28. Let b(q) = q*2 - 27q + 40. Let g be b(26). Let i be t(g). Solve 0 = -iu + 19u + 15 for u. -3 Let j be (5 - 11)/122-2. Suppose -js - 14 = 5y - 57, 4y = -4s + 32. Solve -2p = -1 - y for p. 5 Let m(t) = -17t - 64. Let y be m(-5). Suppose -y = -8h + 19. Solve -17u + 18u - h = 0 for u. 5 Let j be (32/(-36))/4 - (-80)/(-45). Let o be (20/(-6) - j)(-735)/70. Solve 0 = -17g + og for g. 0 Suppose	{ "pile_set_name": "DM Mathematics" }
(p + 1)*2/5 Solve -2/9l*2 + 8 + 10/9l = 0. -4, 9 Let j(m) = -11m2 - 22m + 33. Let p(u) = 5u2 + 11u - 16. Let n(y) = 4j(y) + 9p(y). Factor n(a). (a - 1)(a + 12) Let t = 119 + -119. Factor 960q*2 - 2q + tq3 - 964q*2 + 6q*3. 2q(q - 1)(3q + 1) Solve 2/5y*3 + 24/5 - 14/5y*2 + 8/5y = 0 for y. -1, 2, 6 Let y(v) be the third derivative of -v*8/224 + 3v7/140 - v6/80 - 3v5/40 + v4/8 - 12v*2 - 5v. Suppose y(q) = 0. Calculate q. -1, 0, 1, 2 Let y = 27541/1232 - -13/176. What is h in 198/7h3 - 4/7 - yh*2 + 44/7h - 81/7h4 = 0? 2/9, 1 Let i(k) be the third derivative of k6/30 - 8k*5/15 + 10k*4/3 - 32k*3/3 - 6k*2 - 14. Factor i(o). 4(o - 4)(o - 2)2 Let u be (-5)/(-40)0(-11)/66. Factor -1/3n*4 - 3n*2 + 4/3n + 2n3 + u. -n(n - 4)(n - 1)2/3 Let u be ((-4)/(-240))/(4/5). Let j(p) be the third derivative of up*4 + 1/240p*5 + 0p + 0 + 0p3 + 4p2. What is b in j(b) = 0? -2, 0 Let l(p) be the second derivative of -p7/3780 + p6/540 + p5/60 + 5p4/12 + 16p. Let m(a) be the third derivative of l(a). Factor m(d). -2(d - 3)(d + 1)/3 Suppose -4 = i, 0z = -2z - i + 92. Suppose 0 = 47x - zx. Let -1/5d - 4/5d*5 + xd2 + 0 + d3 + 0d4 = 0. Calculate d. -1, -1/2, 0, 1/2, 1 Factor -74l*3 - 8 - 20 - 23l*3 - 36l*2 + 93l*3 - 60l. -4(l + 1)2(l + 7) Let q = -273 - -273. Let v(d) be the third derivative of 7d2 + 0 - 1/120d*6 + 0d - 1/24d4 + qd*3 + 1/30d*5. Factor v(p). -p(p - 1)*2 Suppose -14f + 8f = -7f. Let v(b) be the first derivative of fb + 3 + 2/3b*3 + 3b*2. Factor v(l). 2l(l + 3) Let a(i) be the second derivative of i6/39 - 9i*5/65 + 2i*4/13 + 8i*3/39 - 100i. Factor a(h). 2h(h - 2)*2(5h + 2)/13 Let b(i) be the first derivative of -2i*3/33 - 21i*2/11 - 40i/11 - 124. Factor b(a). -2(a + 1)(a + 20)/11 Factor 5/4c3 + 7/4c*2 + 0 + 1/4c*4 + 3/4c. c(c + 1)2(c + 3)/4 Let n(z) be the third derivative of z5/210 + z4/42 - 3z3 + 5z*2 - 9. Factor n(l). 2(l - 7)(l + 9)/7 Let i be 8/(-1) - (-32 - -17). Let o(s) be the first derivative of -i - 2/3s*3 + 4s*2 - 8s. Find y, given that o(y) = 0. 2 Let x(i) be the second derivative of i6/90 + i5/20 - i4/36 - i3/6 - 2i + 48. Find h, given that x(h) = 0. -3, -1, 0, 1 Suppose 2g + 3t = 21, -11 = -4g + 3t + 4. Let n(s) be the third derivative of -1/720s*g + 1/360s*5 + 0s*3 + 0 + 0s*4 + 4s*2 + 0s. Factor n(j). -j*2(j - 1)/6 Let d(m) be the first derivative of 4m4 - 152/3m*3 + 101/5m*5 - 4 - 35/6m*6 + 16m - 8m2. Solve d(u) = 0 for u. -1, -2/5, 2/7, 2 Let u = 3169 + -9304/3. Let x = -67 + u. Factor -1/6p*2 - 1/2 + xp. -(p - 3)(p - 1)/6 Let -5g*4 - 895g*2 - 200g*3 - 1807g - 1295g2 - 1805 - 1993g = 0. Calculate g. -19, -1 Let b(o) = o4 - o2 - 1. Let v(z) = -2z5 + 7z*4 + 4z*3 - 9z*2 - 2z - 3. Let w(h) = -5b(h) + v(h). What is n in w(n) = 0? -1, 1 Suppose 24 = d - 3v, 4d - 4v + 3v - 52 = 0. Suppose -s + 3x = -5, -d = -4s + 6x - 2x. Let 25/4z*s + 1/4 - 5/2z = 0. Calculate z. 1/5 Let m be (2 - (-1 + 3) - 2) + -12. Let v be (-1)/4 + m3/(-72). Solve -2/3q - 1/3 - vq2 = 0 for q. -1 Let s(g) = 6g*2 + 35g - 100. Let c(a) = 14a2 + 88a - 250. Let r(u) = 5c(u) - 12s(u). Factor r(l). -2(l - 5)2 Let f(n) = 3n*2 - 4n - 5n2 - n2 + 2. Let d = -7 - -5. Let s(c) = -4c*2 - 5c + 3. Let m(y) = ds(y) + 3f(y). Let m(a) = 0. What is a? -2, 0 Let f be (-5 - (-228)/45) + 147/63. Let -16/5r3 + 0r + fr2 + 4/5r*4 + 0 = 0. What is r? 0, 1, 3 Let q = 49 - 51. Let n be ((1/q)/(4/(-24)))/2. Let -3/2z*4 - 1/2z*2 - 1/2z*5 + 0 - nz*3 + 0z = 0. Calculate z. -1, 0 Suppose -51b = 25b - 107b. Solve b + 1/7g*3 + 0g + 6/7g2 = 0 for g. -6, 0 Factor 7220/3 + 5/3t*2 + 380/3t. 5(t + 38)2/3 Let b(c) be the third derivative of -c6/40 - 11c*5/40 + 43c*4/16 + 6c*3 + 169c*2. Factor b(m). -3(m - 3)(m + 8)(2m + 1)/2 Factor 64044a*3 - 64048a*3 + 4a + 0a. -4a(a - 1)(a + 1) Let h(w) be the second derivative of w*4/54 + 2w*3/27 - 5w*2/3 + 15w. Factor h(o). 2(o - 3)(o + 5)/9 Let w(v) = -11v3 + 12v*2 - 51v + 6. Let f(i) = -120i3 + 135i*2 - 560i + 65. Let r(q) = 6f(q) - 65w(q). Determine t, given that r(t) = 0. 0, 3 Let l be -2 - -5 - ((-105)/14 - -10). Factor 1/4d5 + d + 0 - ld4 + d2 - 3/4d3. d(d - 2)*2(d + 1)*2/4 Suppose -4y + 77 + 55 = 0. Let 8j4 + yj*3 - 38j*3 - 5j*2 + 2j*4 = 0. What is j? -1/2, 0, 1 Let m = 49 + -41. Suppose -j = j - m. Factor 1/2x*j - 1/2x2 - x3 + x + 0. x(x - 2)(x - 1)(x + 1)/2 Let r(m) = m2 + 3m - 14. Let k be r(-6). Solve ks2 + 4s + s*2 - 3s*2 + 4s*2 = 0. -2/3, 0 Suppose 5x*4 + 5x*5 - 6x*5 - 15x*4 + 3 + 6x*4 - 13x - 18x3 + 22x*2 + 11x4 = 0. Calculate x. 1, 3 Let h(a) be the second derivative of a5/30 - 7a3/9 - 2a*2 - 43a + 1. Factor h(w). 2(w - 3)(w + 1)(w + 2)/3 Solve 8/11w + 2/11w2 - 2/11w*3 - 8/11 = 0 for w. -2, 1, 2 Factor -50/13k - 22/13k2 + 2/13k*3 - 2. 2(k - 13)(k + 1)2/13 Let c(w) be the first derivative of w6/24 + w5/10 - 3w*4/16 - 357. Determine v, given that c(v) = 0. -3, 0, 1 Let k(s) be the second derivative of 9s*6/10 + 21s*5/5 + 61s*4/12 - 2s*2 - 65s. Determine b so that k(b) = 0. -2, -1, -1/3, 2/9 Suppose 0 = -3q + 5q + 3j - 1, -5q - 4j + 13 = 0. Factor -8/7v*3 - 4/7 - 4/7v*4 + 4/7v + 4/7vq + 8/7v*2. 4(v - 1)*3(v + 1)2/7 Let c(x) be the third derivative of x8/1344 - x7/840 - x6/160 + x5/48 - x4/48 + 17x2 + 2x. Suppose c(p) = 0. Calculate p. -2, 0, 1 Let -2p2 + 12p*4 - 23p*4 + 12p - 2p2 - 12p*3 + 15p*4 = 0. What is p? -1, 0, 1, 3 Factor 3p + 63p3 + 12p*2 - 28p*3 + 23p*2 + 144p*4 + 97p*3 - 64p*5. -p(p - 3)(4p + 1)*3 Factor -16/3 - 8/9s + 1/9s3 + 5/9s*2. (s - 3)(s + 4)*2/9 Let t be ((-100)/(-3))/((-2)/(-6)). Suppose -t = 4o - 8o. Find k, given that 29k*2 - 2k + 4k - ok*2 + 2k*3 = 0. -1, 0 Suppose -2l + 6 + 4 = 0. Suppose -m + lm = 16. Factor -30j - 12j2 - 27j*3 - 12j*4 + 27j + j*5 - mj*5 + 9j*3. -3j(j + 1)4 Suppose -4c = -7c - 3, -2g - 2c = -8. Let y be ((-19)/g - -4) + (-46)/(-70). Factor -yd + 2/7d3 + 0d*2 - 4/7. 2(d - 2)(d + 1)2/7 Let i = -11521/2 + 5762. Factor -1/4f*4 + if*2 + 0f + 1/4f3 + 0. -f2(f - 3)(f + 2)/4 Let q = 56001290/112761 - 7/10251. Let p = 497 - q. Find t such that -18/11t*4 + 30/11t*3 + 2t*2 + p - 2t = 0. -1, 1/3, 2 Let u(s) be the third derivative of s6/180 - s5/90 - s*4/18 - 24s*2 + 1. Let u(d) = 0. What is d? -1, 0, 2 Let -72b + 224b3 + 144b*4 + 36b*2 + 3b*5 - 148b*4 - 2b*5 - 25b*5 = 0. Calculate b. -3, -2/3, 0, 1/2, 3 Let p be 1229/(-6) + 5/(-30). Let q be (-32)/40 - p/225. Solve 0n - q + 1/9n2 = 0. -1, 1 Let g = 0 - -20. Suppose a + 2o - g = -2a, -1 = -o. Factor -aq*2 + 3/2q*5 - 15/2q*4 + 0q + 12q3 + 0. 3q*2(q - 2)*2(q - 1)/2 Let b(o) = 20o4 - 91o*3 - 129o*2 + 622o + 631. Let s(j) = 5j4 - 23j*3 - 32j*2 + 156j + 158. Let d(u) = -2b(u) + 9s(u). Factor d(f). 5(f - 4)2(f + 1)(f + 2) Let y(p) be the third derivative of 9p*2 + 0p*3 - 5/6p*4 - 1/42p*7 + 0p + 0p5 + 1/8p*6 + 0. Let y(k) = 0. Calculate k. -1, 0, 2 Let l(k) be the first derivative of 4k*5/5 + 6k*4 + 12k*3 - 8k*2 - 48k - 188. Solve l(y) = 0 for y. -3, -2, 1 Let w(m) = 9m4 - 20m*3 - 17m*2 + 78m - 45. Let q(j) = -4j4 + 10j*3 + 8j*2 - 38j + 22. Let i(c) = 5q(c) + 2w(c). Factor i(s). -2(s - 5)(s - 1)*2(s + 2) Solve -3a2 - 53a + 92a - 45a = 0. -2, 0 Let t = 2 - 4. Let n be (0 + t)(-11)/22. Factor 25u - 5u2 - 4 - n - 25. -5(u - 3)(u - 2) Find s such that 4s*5 + 200 + 96s*3 - 6s*5 - 3s5 - s3 - 170s2 - 60s = 0. -5, -1, 2 Suppose -4i = -r + 18, -28 = -r + 3i - 14. Determine z so that 8/11z + 0 + 2/11z*r = 0. -4, 0 Let k be 259/28 - -5(-64)/40. Factor -9/4 - 1/4y3 + ky*2 - 3/4y. -(y - 3)*2(y + 1)/4 Let r(t) be the second derivative of 0 + 13t - 2t*2 + 2/3t*3 - 1/12t*4. Suppose r(u) = 0. What is u? 2 Let t(u) = 3u*	{ "pile_set_name": "DM Mathematics" }
se 5f = n + 26, -2f - 11n = -12n - 11. Solve -8 = 2q - fk, -4q + 0q + k + 2 = 0 for q. 1 Let p = -7 + 9. Suppose -3v = px - 44, -v + x = -4x - 26. Let i = -14 + v. Solve -il - o - 3o = -22, o = -2l + 13 for l. 5 Let b = 319 - 312. Solve 2k + b = -g - 4, -24 = 3g + 3k for g. -5 Let s = -22 - -19. Let c be (-3)/(-2)(-4)/s. Let n be 5 - c - (2 - 4). Solve 3w = ni - w + 24, -4w = -4 for i. -4 Let r be 4/(-26) - (-1968)/624. Solve -2q + 19 = rw, 7 + 4 = 4q - 3w for q. 5 Suppose -3l = 4c - 0 - 19, 0 = c + l - 5. Solve -4 - c = 4i + 4k, 4i = -5k - 11 for i. 1 Suppose 0 = z + 2z - 3. Let s(w) = -2w - 40. Let p be s(-22). Let k = z + p. Solve 2x = kl + 20, -3l - 1 = -2x + 15 for l. -2 Suppose -10a = -146 + 126. Solve -3w - a = 4p - 4, 2p + 4w + 4 = 0 for p. 2 Suppose 4l - 7 - 1 = 0. Solve y + 10 = 4u, ly + 15 - 3 = 4u for u. 2 Let u = 110 + -50. Let s = 60 - u. Solve -l = -3k - 1, 0 = -sk + 3k - 3 for l. 4 Let z = 36 + -37. Let d be 4 - (z - -1 - -2). Solve -3 = 3p, -3 = -dx - 4p + 3 for x. 5 Let y be 5 + (-3 - -2)0. Let l(b) = b3 - 6b*2 + 6b - 3. Let h be l(y). Let j = -1 + 6. Solve -4r - 16 = -ht, -2t + t - jr = 20 for t. 0 Let g = -1029 - -1034. Solve 0 = 4r - 4, -4m - m + 25 = gr for m. 4 Suppose 0 = -3r + 2g + 8, 5g = 5r - 12 - 3. Solve 3m + 13 = -rz, 5z - 4z + 4m + 9 = 0 for z. -5 Let m = -71 + 119. Suppose -22g + m = -10g. Solve n + 11 = -gn - 2q, 0 = -2n - 5q - 17 for n. -1 Suppose -72b - 12 = -78b. Solve -5x = 4y - 7x - 16, 0 = -by - 5x - 16 for y. 2 Let m(k) = 29k - 112. Let q be m(4). Solve -qy = 3o, 3o = 3y - 8y for y. 0 Let a = 71 - 108. Let v be a/6 + 4/24. Let f be 6/18 - (-2)/v. Solve -19 = -3i + 2h, -3i + f = 4h - 7 for i. 5 Let k(l) = -46l - 90. Let t be k(-2). Solve 2y - 1 = -3j, -y + 4y - 8 = tj for y. 2 Let g be 1/(-2) + (2 - 73/(-2)). Suppose -4s - 2a + 66 = 0, -2a + g = 5s - 42. Solve -b + 5 = -3l - 3, 5l = 2b - s for b. 2 Let m(u) = -24u + 98. Let l be m(4). Solve 7v - lb + 1 = 4v, -3 = 2v + b for v. -1 Suppose -2k = j, -6k + 5k + 6 = -j. Solve 4m + 6 = -2l, m - 6 = km - l for m. -3 Let w = -6 + 9. Solve 4d = -wi - 7 - 13, 0 = -2i for d. -5 Let i(h) = -h3 - 4h*2 - 4h - 1. Suppose 16o = 21o + 15. Let q be i(o). Solve 7x + qs - 2 = 3x, -x = s - 2 for x. -1 Let d = 35 + -33. Suppose -t = -5o - 1 - 1, -3o = -dt + 4. Solve 8 = h - 2h + 2f, -2h - tf = 4 for h. -4 Let b(r) = -27r - 214. Let n be b(-8). Solve nq - 16 = -4d, -3q - 2q - d = -4 for q. 0 Suppose 4i - 8 = -4l, -2l + 8 = l + i. Solve -4o + 4a - 36 = 0, -5a + 38 = -3o + l for o. -5 Let t be ((-236)/30 - -8) + 58/15. Solve u + z = 3u - 6, 5z = tu - 6 for u. 4 Let f(b) = b. Let q be f(3). Let t be (3/(-2))/(q/(-8)). Suppose h = tx + 28, 1 = 4x + 5. Solve 0 = 4n + 4k - 28, -4n - k = k - h for n. 5 Let w = 41 + -39. Let a be w5/(-10)0. Solve 5l + 2 = -4x, 2l + 1 - 5 = a for x. -3 Let d be (-22)/77 + (-354)/(-14). Let p = d + -23. Let s = p - 0. Solve sj + 7 + 5 = 3l, -5l = -5j - 20 for l. 4 Let p(z) = 9z + 4. Let i be p(1). Let t = -7 + i. Solve -3k = -9 - t, 10 = 5x + 4k for x. -2 Suppose 2a - 5a = -48. Let n(s) = 5s - 31. Let v be n(24). Let b = v - 89. Solve -a = 4c + h, bh - 16 = 4c + 2h for c. -4 Let c = 208 + -115. Let i(h) = 1 - ch + 94h + h*2 - 4 + 2. Let l be i(2). Solve 0 = 2u + 2z - 8, 3u - u + lz = 8 for u. 4 Suppose -12x + 7x + 3s + 19 = 0, -3x - 3 = 3s. Solve -5v = -k - 8v - 7, -xv = 4 for k. -1 Let v be 9(-29)/(-12)(1 - -3). Let m = -83 + v. Solve 2y = 2h + 12, -3h - 3y + 12 = -mh for h. -3 Suppose -2j + 35 = 3. Let v = j - 13. Let m(l) = 4l*2 - 2l + 1. Let o be m(1). Solve z = g + o, -2g - vg + 4z - 16 = 0 for g. -4 Let o be 26/3 + (-16)/24. Let d(z) = -z3 + 9z*2 - 7z + 4. Let j be d(o). Solve -j = 4h, 0h = -2g + 3h + 3 for g. -3 Let a(z) = -z*3 - 3z - 2. Suppose 4r = -5h + 7, 0 = -0h + 2h - 3r + 11. Let s be a(h). Solve -15 = 4i + f, 0 = -5i - sf - 19 + 4 for i. -5 Let t(d) = -d*2 - 3d + 9. Let g be t(-4). Let h = 52 - 42. Solve 4c - s = -h, gs = -c - 3c - 22 for c. -3 Suppose -3 = -4c + 5. Suppose -cm + 4m = 0. Suppose 4n + 4o = 0, 13 = 3n - 5o - 11. Solve t + 2l - 1 = m, 3t - 2l = nl + 25 for t. 5 Let c(m) = m3 - m2 + 2. Let d be c(2). Let j(z) = 0z2 - dz3 - z2 - 3z3 + 1. Let s be j(-1). Solve -3a + s = 4k, -5a + 8 = -4k - 7 for k. 0 Let m(l) = -2l*3 + 64l*2 + l - 24. Let w be m(32). Solve 0 = t - wd + 6d - 9, -3t + 21 = -4d for t. 3 Let c be 5(3 + (-1 - 1))1. Solve 10 = cz + 5h, 0 = z - 3h + 6 for z. 0 Let v(n) = 4n + 10. Let k be v(-2). Solve -kw + q = -7 - 0, 3q + 1 = -4w for w. 2 Let a = -43 - -55. Suppose -a = -10n + 18. Solve 5c = 2j - j + 2, nc = j for j. 3 Let r be 19 - 6/3 - (-7 + 6). Suppose -r = -2m - 7m. Suppose 2k = -z + 6, 4z + k = -k + 12. Solve -m = -4f + 5i, 5f - 4i + zi + 6 = 0 for f. -2 Let t(u) = u - 4. Let w be t(9). Let n(m) = -3m - 3. Let s be n(-2). Suppose s = i + 3y, 0 = -0y + 3y. Solve 3f - i = q, w = -q + 4q - 2f for q. 3 Let d be ((-9)/(-2))/((-15)/(-150)). Suppose c + 2c = d. Solve 16 = -4n + 5w, 4n + 2w + 1 = -c for n. -4 Let f(w) = 34w + 512. Let a be f(-15). Solve 9 = -h - ay + 10, 4h - 10 = -5y for h. 5 Suppose -m + 5q = 12, -1 + 13 = 3m + q. Solve 11 = -mz - 2b + 10, 4b - 3 = -z for z. -1 Let z be (-5)/2(6 + (-252)/30). Solve 4o - 5 = -p, o + 20 = zo + 4p for o. 0 Let p(y) = 2y2 - y - 6. Let f be p(3). Suppose -14c + fc = 0. Suppose c = 2j - 5j + 12. Solve 16 = jv, -5h - v - 6 = -0 for h. -2 Let h be 10/20(10 + -2). Let y be 375/55 - (-2)/11. Suppose 0 = -2k + yk. Solve -5o + g - 23 = k, ho + 0o + 4g = -4 for o. -4 Let d = -22 + 22. Suppose d = -4l + 2u + 20, 4 = -l - 3u + 8u. Solve -2a - 4y - 5 = -3y, -3a - y = l for a. -1 Let t = -13 + 15. Suppose 0 = -2n + tl + 26, -3l = 4n - 11 - 6. Suppose 6y = ny - 10. Solve -3u - 4 = -2q + 6, 0 = q + 2u - y for q. 5 Let q(b) = b2 + 13b - 27. Let j be q(-13). Let x = j + 31. Suppose n = -xn. Solve 0 = s + 4w, 4s - s - 3w = n for s. 0 Suppose 0 = 5p - 87 - 33. Suppose 7h + 5h = p. Solve -hd + 4i = 5 + 9, 4d - i - 7 = 0 for d. 3 Suppose 3x - 27 = 3v, 3 = -3x - 0x. Let f be (5 - 0)(-4)/v. Solve fu = -3p - 2 + 1, -2u + 4p + 20 = 0 for u. 4 Suppose 68d = 14d + 162. Solve 2i - 4 = w, -i - 8 = di + 2w for i. 0 Suppose 0 = -2f + 6f - 12, 3n - 4f = -189. Let c = n - -62. Solve -2r - 3y = r - c, 0 = y for r. 1 Let z be ((-104)/(-78))/((-1)/(-6)). Solve 2u = 9g - 8g - 6, 4g + z = 0 for u. -4 Let w(i) = i - 9. Let o be w(9). Let h be (24/20)/(-4 - (-43)/10). Solve o = -hl - 3d - 11, -4d = 4l + 14 - 2 for l. -2 Let a be -128(-3 + 25/10). Suppose -5o + 6 + a = 0. Solve -3i + 6 = -b - 5, 0 = b - 4i + o for b. -2 Let j = 1008 + -1007. Solve u + j = -5g, 4 = g + 3g + 2u for g. -1 Let t = 3 - 2. Let y be -1 + (-3)/(-3)t. Suppose y = -27p + 32p. Solve -2l = -2b - 3l + 6, -l = p for b. 3 Let a = 192 + -190. Solve 2x - j - a = 0, j = -5x - 14 + 5 for x. -1 Let r be (6/2 - -1)/(0 - -1). Let m(a) = -a2 + 10a - 21. Let d be m(r). Solve 2s + 19 = 3g + ds, s + 6 = 2g for g. 5 Let u be 6/(-10) - (-5 - (-20)/50). Solve -ud = 3l + 18, 2l + 0d + 10 = -2d for l. -2 Let w(n) = 4n*3 + 3n*2 - 4n + 2. Let g be w(2). Let p = g + -38. Solve 2i + pi + 4 = 3v, 2 = -i - 3v for i. -2 Let g(o) = -3o2 - 27o + 2. Let a be g(-9). Solve 2c - 3v + 15 = 0, -15 = c - 2v - av for c. -3 Suppose -4o = 0, -5t - 4o - o = -40. Let q = 516 - 515. Let a = t + q. Solve 3x + au = 4u + 6, -2x + 5u - 21 = 0 for x. -3 Let n(s) = -4s + 112. Let o be n(28). Let u be (4/8)/((-1)/(-20)). Solve 0 = m + 2w - u, m + om = -5w + 25 for m. 0 Suppose 2k = h + 23, -5k + 109 = -4h + 44. Solve -4z - 2m = 2, 5z - m + k = 3 for z. -1 Let b = 121 + -42. Let l = b - 77. Solve 0 = -h - 2h + lv - 20, 16 = 4v for h. -4 Suppose z + 0z - 3p + 8 = 0, -2z + p + 4 = 0. Suppose 2f - zf = -50. Solve 2g + 1 + 14 = -5w, -f = 2w - 3g for w. -5 Let o(h) = h*3 - h + 16. Let w be o(0). Suppose -28 = -wp + 9*p. Solve -5	{ "pile_set_name": "DM Mathematics" }
et t(j) = -43j2 + 2j - 3j + 21j*2 + 24j*2. Let o(f) = -2f. Determine o(t(g)). -4g2 + 2g Let d(h) = 2h2. Let z(f) = 2f*2. Let k(b) = 5d(b) - 6z(b). Let n(q) = -7q. Determine n(k(g)). 14g2 Let g(v) = 50v*2. Let n(z) = 2z. Determine n(g(i)). 100i2 Let c(m) = m2. Let f(j) = -124j*2 + j. Give c(f(n)). 15376n*4 - 248n3 + n2 Let u(r) = -3r2 - 3. Let s(d) be the second derivative of d4/6 + 2d*2 + 5d. Let f(t) = 3s(t) + 4u(t). Let c(b) = 2b. Calculate f(c(g)). -24g2 Let b(v) be the second derivative of -v4/6 - 4v. Let m(g) be the first derivative of -g2/2 - 1. Calculate b(m(n)). -2n2 Let q(j) be the second derivative of j3/2 - 17j. Let v(g) = 12g*2. Calculate v(q(m)). 108m2 Let k(n) = n2. Let h(y) = -5y + 7. Let m(a) = -2a + 3. Let v(c) = -3h(c) + 7m(c). Determine k(v(i)). i*2 Let r(m) = 13m*2 - 3m. Let p(c) = 109c. Determine p(r(x)). 1417x*2 - 327x Let r(t) = -t + 29. Let s(i) = 4i. Determine r(s(c)). -4c + 29 Let p(v) = -3v. Let b(h) = h2 + 2h. Suppose -5q = 5r + 25, q + 11 = 2q - 3r. Let l(a) = -a*2 - a. Let f(c) = qb(c) - 2l(c). Calculate f(p(o)). 9o*2 Let h(y) = 4y. Let t(k) be the second derivative of 5k4/12 - k. Give h(t(w)). 20w2 Let s(f) = f2 - 8f + 9. Let w be s(7). Let d(j) = 3j*2 - 4j*2 + 2j*w. Let b(u) = 4u*2. Determine d(b(z)). 16z*4 Let w(k) = 5k - 7. Let n(g) = 2g. Calculate w(n(c)). 10c - 7 Let a(p) be the first derivative of -2p3/3 - 27. Let b(l) = -39l*2. Calculate b(a(x)). -156x*4 Let d(c) = -4c*2. Let p(n) = 23 - 2n*2 - 23. Calculate p(d(x)). -32x*4 Let i(n) = -5n + 3n - n. Let l(g) be the second derivative of -g3/6 - 2g. What is l(i(p))? 3p Let t(h) be the first derivative of h6/180 - 5h*3/3 - 2. Let c(d) be the third derivative of t(d). Let b(j) = 0j*2 + 3j*2 - 2j*2. Determine b(c(y)). 4y*4 Let d(u) = 138u*2. Let m(s) = -18s*2. Determine m(d(r)). -342792r*4 Let k(x) = -4x*2 + 6. Let z(h) = 71h. Calculate k(z(m)). -20164m2 + 6 Let i(c) = -c2. Suppose 16 = 3g + g. Let v = g + -2. Let t(h) = hv + h - h. Give i(t(u)). -u4 Let j(n) = 204n - 2n*2 + 169n - 338n. Let a(h) = 2h*2. What is a(j(u))? 8u*4 - 280u*3 + 2450u*2 Let z(a) = 6a. Let j(g) = 12g - 11. Let l(q) = q - 1. Let o(s) = -4j(s) + 44l(s). Give z(o(h)). -24h Let m(p) = 3p2 + 2. Let f(j) = 16j*2 + 11. Let x(v) = -2f(v) + 11m(v). Let r(b) = 28b. What is r(x(a))? 28a2 Let f(o) be the third derivative of -5o*4/24 - 4o2. Let a(p) = -p2 - p2 + p2. Determine f(a(w)). 5w2 Let t(x) = 6x. Let s(c) = -121c2. Determine s(t(m)). -4356m*2 Let i(v) = v + 3. Let k(a) = a + 5. Let q(b) = -5i(b) + 3k(b). Let w(m) = 7m - 2 + 2. Give w(q(d)). -14d Let l(n) = -23 + 23 + n + 3n. Let a(q) = -2q2. What is a(l(j))? -32j2 Let o(a) be the third derivative of a5/10 + 11a2. Let m(q) = -6q. What is o(m(b))? 216b2 Let r(n) = 2n. Suppose 2h - b = 4, 0 = 6h - 2h + 2b - 24. Suppose 0 = -3a + a. Let s(m) = hm - 3m + am. What is r(s(x))? 2x Let i(p) = 13p*2. Let a(f) = 53f*2. Let h(x) = -2a(x) + 9i(x). Let t(u) = 6u - 4. Let g(z) = -5z + 3. Let m(q) = 4g(q) + 3t(q). What is h(m(v))? 44v*2 Let p(y) = 3 + 4 + 3y - 7. Let l be (-9)/(-3)(-2)/(-3). Let q(a) = 6a - la - 6a. Give q(p(t)). -6t Suppose 0 = 4d - 9d + 20. Suppose -12 = -3h - 3l + 9, h = -dl + 22. Let k(x) = -2xh + 2x*2 - 3x2. Let n(y) = y2. Determine k(n(i)). -3i4 Let n(m) = -7m. Suppose 2a + 12 = 4r, -4r = -10 - 6. Let p(j) = -2j*a + 2 - 2. Determine p(n(h)). -98h*2 Let k(g) = -4g. Let q(y) be the first derivative of -y*2 - 4. Give q(k(n)). 8n Let h(o) = -16o + 35o - 18o. Let q(f) = 3f + 1. Let m be q(1). Let w(v) = -4 + m - v. Calculate h(w(l)). -l Let z(t) = -11t + 22t - 13t. Let p(s) = 65s - 2. Give z(p(v)). -130v + 4 Let k(r) = 2r*2. Let a(t) = 3t*2 - 6t. Let c(s) = 2s2 - 5s. Let h(b) = 5a(b) - 6c(b). Calculate h(k(z)). 12z4 Let g(b) = b2. Let o = 0 + -2. Let q = 0 - o. Let j(h) = -4h + qh + h. Give g(j(r)). r2 Let l(m) = 4. Let y(s) = -s - 1. Let n(z) = 5l(z) + 15y(z). Let i(q) = -23q + 7. Let b(p) = -5i(p) + 7n(p). Let r(v) = 2v. Calculate b(r(a)). 20a Let z(a) = -2360a. Let t(m) = -m. Calculate t(z(i)). 2360i Let a(x) = 3x. Let u(t) = 66t. Let f(o) = -63a(o) + 3u(o). Let s(c) = -3c. Determine f(s(r)). -27r Let i(s) = 26s2. Let f(k) = 9k. What is f(i(b))? 234b2 Let m(k) = 20k. Let r(o) = -15o2 - 13o. Give m(r(d)). -300d2 - 260d Let c(l) = 0l + 7l - 4 - 2l. Let a(r) = -6r + 5. Let u(o) = -4a(o) - 5c(o). Let h(j) = -3j. What is u(h(x))? 3x Let a(i) = -37i. Let m(u) = -66u*2. Calculate m(a(z)). -90354z*2 Let d(v) be the third derivative of 0v*4 + 0v - 1/60v5 + v2 + 0 + 0v*3. Let f(k) = 3k*2. What is d(f(s))? -9s4 Let r(t) be the second derivative of t7/420 - 5t4/12 - 4t. Let o(b) be the third derivative of r(b). Let w(k) = -3k. What is w(o(x))? -18x*2 Let c(i) be the third derivative of 1/24i*4 + 0i - 4i2 + 0i*3 + 0. Let j(b) = -3b. Give j(c(o)). -3o Let y(t) = -18t*2 - 2t + 15t2 + 0t - 10t2. Let l(d) = 2d. Calculate y(l(c)). -52c2 - 4c Let n(f) = -4 + 4 + f. Let i(m) = 4m. Let a(p) = 4i(p) - 12n(p). Let d(g) = -g. What is d(a(v))? -4v Let a(v) = 2v2. Let l(d) = -10d. Let m(q) be the first derivative of q*2 - 3. Let z(f) = -3l(f) - 14m(f). Calculate z(a(s)). 4s*2 Let i(k) = 9k - 2. Let x(h) = -h - 32. Calculate i(x(l)). -9l - 290 Let z be 4/((-2)/(-4) + 0). Let k = 11 - z. Let i(y) = -3y + 2y2 + ky. Let s(r) = r. Determine i(s(h)). 2h2 Let o(v) = -3v*2 + 6. Let b(q) = 9q*2 - 17. Let k(n) = -6b(n) - 17o(n). Let g(c) = 5c. Determine k(g(a)). -75a2 Let o(r) = -2r - 32. Let w(i) = -5i. Give o(w(f)). 10f - 32 Let f(s) be the third derivative of 0s4 + 0 + 1/30s*5 + 0s*3 + 0s - 8s2. Let b(a) = 3a. Give f(b(j)). 18j2 Let c(g) be the second derivative of -g4/4 + g. Let u(f) be the first derivative of -f2/2 - 25. Calculate c(u(x)). -3x*2 Let o(i) = -24i. Let w(a) = -9a2. Calculate o(w(n)). 216n*2 Let j be -2 - (-4)/33. Let y = 0 + j. Let p(n) = -1 - yn2 - n2 + 1. Let u(t) = 2t. Determine u(p(i)). -6i2 Let a(m) = 13m. Let z(k) = -3k2 - 801k + 801k. Determine a(z(w)). -39w*2 Let o(j) = j + 8. Let r be o(-8). Let c(i) be the third derivative of 0i3 + i2 - 1/60i5 + ri + 0 + 0i4. Let l(v) = -v. Determine l(c(q)). q2 Let x(d) = 2d*2. Let u(s) = 2s + 5s - 4s - 6s2 + 7 + 4s. Let g(n) = 4n2 - 5n - 5. Let c(z) = -7g(z) - 5u(z). Give c(x(r)). 8r4 Let o(z) = -1086z. Let y(u) = 2u. Determine o(y(p)). -2172p Let b(t) be the third derivative of 0t + 0 + 0t*4 + 1/15t*5 + 0t*3 - 2t*2. Let a(o) = -2o. What is a(b(p))? -8p2 Let y(v) = -3v + 2. Let j(l) = 1. Let w(g) = -2j(g) + y(g). Let a(s) be the first derivative of 0s + 1/2s2 + 2. Determine a(w(q)). -3q Let i(j) = j*2. Let a(t) = 30t - 3t - 5t. Calculate a(i(l)). 22l2 Let f(s) = 529s*2. Let n(j) = -11j. Give n(f(o)). -5819o2 Let y(t) = 425t + 4. Let c(m) = -m. Calculate c(y(b)). -425b - 4 Let t(h) = -3h*2. Let f(x) be the third derivative of 7x*5/60 + 8x*2. Give f(t(j)). 63j*4 Let q be (-17 - -13)21/(-4). Let l(c) = 3c2 - qc*2 + 6c*2 + 9c*2. Let f(r) = 5r. What is l(f(h))? -75h2 Let m(z) = -23z. Let f(i) be the first derivative of i*2/2 + 20. What is f(m(w))? -23w Suppose l + 6 = 5n - 0l, 2n - 20 = -4l. Let j(g) = 0 + 5g + 0 - ng. Let z(u) be the third derivative of u5/60 - u2. Calculate j(z(b)). 3b2 Let k(r) = 303r*2. Let p(f) = -2f*2. Give p(k(u)). -183618u4 Let q(s) be the second derivative of -s3/6 - 2s. Let y(j) = 5j*2. Determine y(q(l)). 5l*2 Let r(h) = -3h. Let d(i) = 966i. Determine d(r(w)). -2898w Let n(r) be the second derivative of -r*3/6 + 2r. Let q(k) = -k + 3k - 4k - k. Calculate n(q(w)). 3w Let i(o) = -6o. Let g(p) = 7p. Let u(v) = 5g(v) + 6i(v). Let c(t) = -t2 - 7t + 2. Let y be c(-7). Let z(s) = 2 - 4 + 2 - sy. What is z(u(j))? -j2 Let z(y) = 18y2 + 1. Let r(k) = 24k. Ca	{ "pile_set_name": "DM Mathematics" }
(c) = -23c - 26. Let d(f) = -v(f) - 6x(f). Let u be -1 + -1 + 1 + -5. Calculate d(u). -4 Let w(c) = -23c + 34. Let r(o) = -69o + 102. Let q(f) = 2r(f) - 7w(f). Let k(n) = -4n + 6. Let y(t) = 34k(t) + 6q(t). What is y(8)? 16 Let l(m) = -m3 + m2 + 2m - 2 - 3m2 + 1. Let x be (-2)/(6/(-15)) - 3. Suppose p - 14 = 4k + xp, -5p - 10 = 0. Determine l(k). 2 Let f(j) = -12j - 40. Let t be f(-6). Suppose -122 - 70 = -to. Let p(z) = 11z - 14. Let m(d) = d - 1. Let v(u) = 6m(u) - p(u). Determine v(o). -22 Let a(m) = -39m - 20. Let l(z) = 55z + 29. Let s(g) = -7a(g) - 5l(g). What is s(6)? -17 Let v(i) = 7i2 - i3 + 9i + 137 + 4i - 23i. Let l be v(8). Let q(r) = -2r + 9. Give q(l). 23 Let b(v) = -v3 + 12v*2 + 6v + 8. Let t be ((-18)/10)/((4/20)/1). Let c(y) = 2y3 - 25y*2 - 13y - 17. Let r(q) = tb(q) - 4c(q). Determine r(8). -20 Let b(r) be the third derivative of r4/4 - r3/6 + 6r2. Let x(k) = 11k - 2. Let c(i) = -7b(i) + 4x(i). Suppose -91 = 4g - 107. Determine c(g). 7 Let b(n) = -5n*2 + 7n - 22. Let k(m) = 6m2 - 8m + 25. Let j(p) = 7b(p) + 6k(p). Suppose -4x + 5x = 0, -c + x - 3 = 0. Determine j(c). 2 Let l(j) = -13j - 2321. Let b(z) = -35z - 6267. Let x(y) = 10b(y) - 27l(y). Let n be 0/(0/(-2) - 1). Give x(n). -3 Let m(o) = 4o2 - 4o - 3. Let w be m(3). Let y be (154/w)/((-2)/(-6)). Let i(h) = -16h3 + 8h*2 + yh*3 - 7h2. Give i(1). 7 Let v(b) = -b3 - b*2 + 3b + 23. Let c be (0/2)/(-34 + 39). Calculate v(c). 23 Let g = -2179 + 2164. Let h(p) = -7p - 103. Calculate h(g). 2 Let y(a) be the second derivative of -a5/20 - a4/2 + 3a*3/2 + 6a*2 + 1857a. Give y(-7). -2 Let k(b) = b*3 + 18b*2 - 17b + 19. Let f(n) = n3 + n2 - 7n + 1. Let a be f(-4). What is k(a)? -19 Let m(k) be the third derivative of k6/40 - 31k*5/30 - 11k*4/12 + 7k*3/3 - 598k*2. Determine m(21). -7 Let p(r) be the first derivative of -7r*2/2 + 10r - 27. Suppose 20u - 68u + 30u + 72 = 0. What is p(u)? -18 Let j(z) = -z + 28. Let a = 392 - 365. Let r be (-4)/816 + a. Determine j(r). 9 Suppose 2c + b = -17, 3b - 7b - 20 = 0. Let v be (-14)/c + (40/24)/(-5). Let u(q) = -3q*2 + 0q - q*3 + 2q - 2 + 5q2. Calculate u(v). 2 Let p(t) = -t2 + 6t. Let s(w) = -w*2 - 11w - 8. Let z(r) = -r - 10. Let f be z(0). Let i be s(f). Suppose -a = -i - 0, 3k = 4a + 10. Give p(k). 0 Let z be ((-10)/(-4))/((-185)/222). Suppose 5i - 2 = 8. Let l(s) = -2s - s*3 - 5s*i + 1 - 3s + s. What is l(z)? -5 Let c(s) = -s - 11. Suppose -2x = -11 + 3. Suppose 4g = 3g - xh, 0 = 4g + h. Give c(g). -11 Let i(w) be the second derivative of w5/20 + 4w4/3 + w3/2 + 27w2 + 139w. Calculate i(-16). 6 Let c(r) = 3r. Suppose 9m + 9m = 32m + 238. Calculate c(m). -51 Suppose 11s + 9 - 14 = 17. Let m(h) be the first derivative of -7 + 1/2hs + h. Give m(-1). 0 Let n(w) = w2 + 5w + 5. Suppose 4v = 2v - 4f - 20, -3v = 4f + 26. Let m be n(v). Let z(i) = -2i2 + 0i - 10i + mi. Give z(1). -1 Let h(v) = 9v2 - v. Suppose 0 = -4m - 3n + 97, -8m + 115 = -3m + 5n. Suppose -7 = 21t - m. Determine h(t). 8 Let y(k) = 6k - 5. Let j be 2/13 - (4 + (-714)/91). Let z be 93/15 - (-6)/(-30) - j. Calculate y(z). 7 Let y(w) = -w*3 - 2w*2 - 4w + 1. Let v(l) = 4l3 + 6l*2 + 13l - 4. Let u(j) = 2v(j) + 7y(j). Suppose 7k = 7 - 14. Determine u(k). -2 Let k(t) be the second derivative of -t7/2520 - t6/180 + t5/30 - 5t*4/12 + 4t*3/3 - 107t. Let s(w) be the third derivative of k(w). Give s(-7). -17 Let p(s) be the third derivative of -s6/120 + s5/15 + 5s4/24 - s3/2 + s2 - s + 352. Let b = 14 - 9. Give p(b). -3 Let x be (190/30 - 6) + 28/6. Suppose 0 = -3n - 3b - 9, -2n = -b + x - 2. Let h(o) = -3o2 - 3o. Determine h(n). -6 Let n(f) = 23f3 + 9f*2 - 12f - 19. Let c(p) = 9p3 + 5p*2 - 6p - 10. Let l(j) = 5c(j) - 2n(j). What is l(3)? 6 Let b(y) be the second derivative of y + 36 + 7/3y3 + 1/12y*4 - 9y*2. Determine b(-15). -3 Let t(d) = -2d*2 - 4d + 3. Let a(n) = 4n - 3n - n*3 + 8 - 2n - 3n2 - 6. Let u be a(-3). Suppose uo - 3x = -2x - 18, 4x + 4 = o. Determine t(o). -13 Let y(r) = -47r - 850. Let p be y(-18). Let k(i) = i*2 + 17i + 47. Determine k(p). -5 Let r(w) = w - 18. Suppose -5p + 507 = 28p + 6p. Give r(p). -5 Let v(t) = 10t*2 - t + 1. Let c(j) = -9j*2 + 7j + 5. Let h(f) = -c(f) - v(f). Let g = -18 + 11. Give h(g). -13 Let b(a) be the first derivative of -2a3/3 - 5a*2/2 - 3a + 2. Let h(u) = -2u3 - 28u*2 + 8u + 110. Let k be h(-14). Determine b(k). -1 Let j(c) = c*2 - 9c + 13. Let r(w) be the second derivative of -w*5/20 - 11w*4/12 + 3w*3/2 - 15w*2 - 128w. Let h be r(-12). What is j(h)? -5 Let y(f) = 3f2 + 20f - 65. Let o(a) = 2a2 + 2a - 1. Let r(j) = 2o(j) - y(j). Give r(9). 0 Suppose -3q = 2r + 21, 30 = -2q - 3r - r. Let b(f) = 3f*2 + 6f - 3. Give b(q). 6 Let v(y) = -8 - 8 + y*2 - 8 + 20. Let h be (-8 - (-234)/24)-4 - -2. What is v(h)? 21 Let m(l) = -2 - l*3 + 3l*2 + 1 + 6l*2 - 8l*2. Let s be ((-6)/18)/((-2)/6). Let t(j) = 3j*3 - 4j*2 + 5. Let f(z) = st(z) + 4m(z). Give f(0). 1 Let z(s) = 151s + 7079. Let t be z(-47). Let q(o) = -o*3 - 20o*2 - 43o - 120. What is q(t)? 6 Let p(g) = -4g - 6. Let n be 1(55/(-44))/((-1)/(-4)-1). Give p(n). -26 Let c(u) = -7u + 42. Suppose -19i + 66 + 38 - 9 = 0. Determine c(i). 7 Let o(v) = v - 2. Let u(b) = -6b + 5. Let y(k) = -5o(k) - u(k). Let i(p) = -2p. Let t(l) = -i(l) - y(l). Determine t(6). 1 Let n(t) = -t. Let l(i) = -i*2 + 20i - 88. Let h be l(13). Suppose 0 = -hs + 15s + 48. Give n(s). 4 Let z be ((-15)/5 + 2)-8. Let n(r) = 22r*2 - 4 - 5r*2 - 5r*2 - 13r*2 - zr. Calculate n(-6). 8 Let w(y) = -60406y + 141 - 218 + 60416y. Determine w(9). 13 Let c(h) be the first derivative of h4/8 + h3/3 - h*2 + 35h + 86. Let q(s) be the second derivative of c(s). What is q(1)? 5 Suppose 114 - 122 = -6k + 2k. Let m(u) be the second derivative of -u4/12 - u3/3 + u*2/2 + u. Calculate m(k). -7 Let g(n) be the third derivative of -5n*4/12 + 5n*3/3 - 166n*2 + 14n. Calculate g(-10). 110 Let v(f) = -68f2 + 12f - 12. Let b(y) = 59y2 - 10y + 13. Let w(k) = 7b(k) + 6v(k). Give w(-4). 91 Let w(z) be the first derivative of -z*3/3 - 9z*2 + 22z - 2544. Give w(-10). 102 Let m(g) = -14g3 - g2 - 2. Let b(p) = -p3 - p2 + p - 1. Let u(j) = -b(j) + m(j). Suppose 62y - 65y = 3q, -3y - 6 = -3q. Calculate u(y). 13 Let u(v) = v*2 - 85v + 1746. Let t be u(50). Let o(w) be the first derivative of w3/3 + w2/2 + 3w + 2. Give o(t). 15 Let l(d) = -d2 - 6d + 18. Suppose 577 = -33u + 115. Calculate l(u). -94 Let v = -101 + 70. Let t = v - -33. Let a(z) = -153z*t - 146z*2 - z + 298z2. Determine a(1). -2 Let m(k) = k3 - 2k2 - 4k. Suppose 22 = 14w - 6. Let j(n) = 2n*3 - 2n*2 - 6n - 1. Let b(l) = wj(l) - 3m(l). Give b(-3). -11 Let s be (-1(-9)/1)/1. Suppose s = 4c + 17. Let o(k) = -2k. Give o(c). 4 Let l(p) be the second derivative of -p4/12 - 2p*3 + 2p + 5. Let t(c) = -7c + 2. Let d be t(2). Let a be l(d). Let n(j) = j - 1. Give n(a). -1 Let v be 29/8 + 1 + 25/(-40). Suppose 15n - 19 = -vb + 12n, -5n = 3b - 17. Let a(c) = -c + 2c - 3 + 2c + 0c. Determine a(b). 9 Suppose 0h + 3h = 0. Suppose 5l - 58 + 18 = h. Let q(s) = -ls + 19s*3 - 1 - 18s*3 + 2 - 6s2. What is q(7)? -6 Let z(s) be the third derivative of s4/24 - 5s3/6 + 4s2. Let d = -615 - -615. What is z(d)? -5 Let s(d) = d + d2 + 5d + 15d + 4 - 15d. Let l = 5 - 11. What is s(l)? 4 Let k(w) = -w2 + 2w + 90. Let v = -1238 + 1249. Determine k(v). -9 Let t be -1 + (-2 - (-1 + -12)). Let q(z) be the first derivative of -1/4z4 + 10/3z*3 + 3 + 0z*2 + 2z. What is q(t)? 2 Let v(h) = -4h - 57. Let w be v(-9). Let o = 33 + w. Let a(z) = -z2 + o - 24 - z3 + 13. Determine a(1). -1 Let y(v) be the second derivative of v7/2520 - v6/72 + v5/60 - 3v4/2 - v2 + 2v - 56. Let q(l) be the third derivative of y(l). Determine q(9). -7 Let g(s) = -249s - 6719. Let u be g(-27). Let c(n) = -2n3 + 10n*2 - 11n + 8. Give c(u). -4 Let d(k) = -5k*2	{ "pile_set_name": "DM Mathematics" }
= h*3 + 9h*2 + 4h - 20. Let c be w(-8). Suppose -cz = -14z + 3546. Factor 3a - 3a*5 - 3a*3 + za*4 - 1779a*4 - 3a. -3a3(a + 1)*2 Let d(i) be the second derivative of -3i - 1/9i3 - 1/180i*6 - 16 + 0i*2 - 1/24i*5 - 1/9i*4. Factor d(l). -l(l + 1)(l + 2)2/6 Let k(n) be the third derivative of 1/30n*6 - 2/525n*7 - 1/75n*5 - n - 7/10n*4 + 0 + 12/5n*3 - 38n*2. What is s in k(s) = 0? -2, 1, 3 Let a(i) be the third derivative of 0i + 3/20i5 + 9/8i*4 + 1/120i*6 - 31i*2 - 1 + 9/2i3. Factor a(j). (j + 3)3 Let a(h) be the third derivative of -5h5/12 + 35h*4/6 + 10h*3 + 869h*2. Factor a(k). -5(k - 6)(5k + 2) Let k(v) be the second derivative of v*4/90 - 2v*3/5 - 8v*2/3 + 1198v. Factor k(x). 2(x - 20)(x + 2)/15 Let i(p) = -22p2 + 592p + 174. Let o(z) = -z*2 - 2z - 1. Let l = 584 + -590. Let r(h) = lo(h) - i(h). Factor r(m). 4(m - 21)(7m + 2) Let n(q) = q*3 - q - 1. Let u(h) = 221 + 14h*4 - 51h + 32h3 + 12h*2 + 37h*3 - 232 - 28h*3. Let f(x) = 5n(x) + u(x). Factor f(t). 2(t - 1)(t + 2)*2(7t + 2) Let c(m) be the third derivative of -m6/600 - 2m*5/75 + 11m*4/30 - 8m*3/5 + 110m*2. Solve c(b) = 0 for b. -12, 2 Let f be 1/(134/68 + -2). Let k = 37 + f. Suppose -15t - 2t2 - 2t2 - t3 + 4 + 14t + 2t*k = 0. Calculate t. -1, 1, 4 Let a = 601 + -595. Let b be (a/8)/(2/162). Factor 2/11t - 2/11t*b - 4/11t*2 + 4/11. -2(t - 1)(t + 1)(t + 2)/11 Let a(j) = 7j3 - 3j + 1. Let h(b) = 9b3 + 2b*2 - 4b. Let m(k) = 3a(k) - 2h(k). Let s be m(1). Let -3/2t + 1/2t*2 + s = 0. Calculate t. 1, 2 Suppose 5q - 18 = 4y + 3, -29 = -5q - 4y. Suppose 6g = 24, 0 = 5a - qg + 8 - 3. Suppose -3/7da - 3/7d + 0 + 6/7d2 = 0. Calculate d. 0, 1 Let j(i) = 11i*3 - 9i*2 + 42i - 38. Let t(v) = -31v3 + 26v*2 - 125v + 113. Let h(q) = 17j(q) + 6t(q). Factor h(p). (p - 4)(p - 1)(p + 8) Let n be 4(8 + 7) + 3. Suppose -60s*4 - 2 + 50s4 - 30 - s5 - 17s2 - 40s*3 - ns*2 - 80s = 0. Calculate s. -2 Let s(j) be the third derivative of -j7/210 - j6/72 + 43j4/12 + 22j*2. Let l(q) be the second derivative of s(q). Find p, given that l(p) = 0. -5/6, 0 Let v(h) be the first derivative of 76 - 2h*6 + 0h*2 + 0h + 5h3 + 15h*5 - 39/2h4. Find l such that v(l) = 0. 0, 1/4, 1, 5 Let d(w) be the first derivative of -w6/480 - w5/120 - w4/96 + 67w2/2 - 44. Let g(b) be the second derivative of d(b). Factor g(v). -v(v + 1)*2/4 Suppose -15 = -3u - 3. Suppose k + u = 2q, -11 = 3q + 5k - 17. Factor 12/5n*3 + 0 + 8/5n*4 + 2/5n*5 + 2/5n + 8/5nq. 2n(n + 1)4/5 Suppose 0 = -d - 2a + 9, 6d + 27 = 9d + 4a. Suppose 2o + t - d = 0, 3t = -3o + 4o - 1. Factor 16/5 + 8/5m*3 + 2/5m*o - 6/5m*2 - 4m. 2(m - 1)2(m + 2)(m + 4)/5 Suppose 2o + 2 = 2k, o + o = 3k - 7. Let x = 2203 - 2172. Find q such that 6q2 + x - 34 + q4 - 4q*o = 0. -1, 1 Suppose 0 = -9a - 0a + 45. Solve 190z*3 + 96z - 194z3 - az*2 - 3z*2 = 0. -6, 0, 4 Find h such that 224/11h + 2/11h4 + 8 + 52/11h*3 + 186/11h*2 = 0. -22, -2, -1 Let c(b) = 49 - 20 - 21 + 4b - 3b2. Let g(w) = -4w*2 + 4w + 9. Let p(k) = -5c(k) + 4g(k). Factor p(s). -(s + 2)*2 Factor 18i*4 + 2i*5 - 73360i + 62i2 - 26i*2 + 39i*3 + 73372i + i*5. 3i(i + 1)2(i + 2)*2 Let a(i) = -13i*2 + 86i + 545. Let u(s) = 8s2 - 45s - 273. Let v(f) = 3a(f) + 5u(f). Determine z, given that v(z) = 0. -18, -15 Let l(b) be the third derivative of -b7/70 + b6/20 + 61b5/20 + 89b*4/4 + 60b*3 - 8b*2 + 20b + 2. Solve l(c) = 0. -4, -3, -1, 10 Let c(v) = -213v2 + 1305v - 2550. Let q(n) = 290n2 - 1740n + 3400. Let i(l) = 15c(l) + 11q(l). Find x such that i(x) = 0. 2, 85 Let v = 80737 - 726625/9. What is u in -vu2 + 0 + 8/9u - 2/9u5 + 8/9u*4 - 2/3u*3 = 0? -1, 0, 1, 2 Let v(o) = 2o*2 + 2o - 3. Suppose 3k = k + 4d, 4k - 2d = 6. Let q(u) = -4uk + 2u + 4u2 + u2 - 3u + 1. Let l(r) = 3q(r) - 3v(r). Factor l(a). -3(a - 1)(a + 4) Suppose -40 + 12 = -4b - 4y, -3b + y = -5. Suppose bh = -5s + 20, 4s - h = -2h + 16. Factor 4/11n*2 + 0n + 6/11n3 + 0 + 2/11n*s. 2n*2(n + 1)(n + 2)/11 Let g(v) be the first derivative of -5/4v*4 + 40/3v*3 + 51 + 30v - 65/2v2. Let g(l) = 0. What is l? 1, 6 Let o be (5 + 0 - 1350/(-2640)-8)22. Factor -ot + 12 + 28/3t2 - 4/3t*3. -4(t - 3)*2(t - 1)/3 Suppose 344/21 - 26/7h - 2/21h*2 = 0. Calculate h. -43, 4 Factor -2/5c*3 - 16 + 6/5c*2 + 36/5c. -2(c - 5)(c - 2)(c + 4)/5 Let u = 3190 - 3190. Let f(z) be the first derivative of uz - 16/3z3 + 2/3z*6 + 17 - 16/5z*5 + 2z*2 + 6z*4. Factor f(i). 4i(i - 1)4 Let t(l) = -138915l*4 + 11907l*3 + 4164l*2 - 630l + 30. Let q(s) = -12s2 + 13s*2 + 57 + s - 56. Let b(w) = 6q(w) - t(w). Factor b(o). 3(5o + 1)(21o - 2)*3 Factor 7920j - 621j2 - 22369j*2 - 360 - 124 - 9259j*2 - 151j*2. -4(90j - 11)2 Factor 116s*5 - 227s5 - s2 - 18s4 + 70s*3 + 116s*5 - 17s*4 - 39s*2. 5s*2(s - 4)(s - 2)(s - 1) Let h = -29976 + 29978. Factor -14/5u4 + 30u*3 + 0u + 0 + 44/5uh. -2u*2(u - 11)(7u + 2)/5 Let m = 95 - 101. Let n(v) = v*3 + 3v*2 - 11v - 7. Let w(c) = c*3 + 4c*2 - 11c - 6. Let l(o) = mn(o) + 7w(o). Factor l(x). x(x - 1)(x + 11) Let c(f) be the second derivative of f*5/5 - 8f*4/3 - 6f*3 + 15f + 21. Find g, given that c(g) = 0. -1, 0, 9 Let f(d) = 2d3 + 122d*2 + 44d + 2686. Let c be f(-61). Factor 2/3r3 + 2r*c + 2/3 + 2r. 2(r + 1)3/3 Let v(u) be the second derivative of -u8/672 - u7/420 + u6/30 + u5/10 - 54u*2 + 16u - 5. Let c(i) be the first derivative of v(i). Factor c(t). -t*2(t - 3)(t + 2)2/2 Let u(k) = -10k*2 - 36647 + 7k*2 - 10k*2 - 1472k - 3050 - 28010. Let b(r) = -7r2 - 736r - 33853. Let c(h) = 5b(h) - 3u(h). What is x in c(x) = 0? -92 Let b = 752266 + -5265859/7. Let bs3 + 0 + 18/7s + 3s2 = 0. Calculate s. -6, -1, 0 Let f(q) be the third derivative of q6/780 - 13q*4/12 + 1732q*2. Factor f(d). 2d(d - 13)(d + 13)/13 Factor -11b + 46b*2 - 132b + 0b3 + 96b*2 + 3b*3 - 2b*3. b(b - 1)(b + 143) Let z = 3/1898 - -101/28470. Let r(y) be the second derivative of 0y*4 - 1/65y*5 + 0 + zy*6 - 7y - 1/13y2 + 2/39y*3. Factor r(x). 2(x - 1)*3(x + 1)/13 Let h(a) be the second derivative of a*4/4 + 1735a*3/2 + 2a - 47. Solve h(s) = 0. -1735, 0 Let w(h) be the third derivative of h*5/15 - 191h*4/6 + 380h*3/3 + 203h*2 + h + 1. Factor w(g). 4(g - 190)(g - 1) Let v = 15578/59 + -60247/236. Factor -s3 + 53/2s + v - 137/4s2. -(s - 1)(s + 35)(4s + 1)/4 Suppose 7l - 245 = -118 - 92. Let f(v) be the third derivative of 36v*2 + 0v + 1/30v6 + 2/15vl - v3 - 1/6v4 - 1/105v*7 + 0. Factor f(j). -2(j - 3)(j - 1)(j + 1)*2 Let v be (-876)/(-48) - (-150)/(-10). Let 3/2n*2 - 5n + vn3 - 5/4n*4 - 2 = 0. Calculate n. -1, -2/5, 2 Let u = 160 + -120. What is j in 44j*3 - 83j*3 + uj*3 = 0? 0 Suppose 27 - 30 = -r. Suppose -5s + 4 = -rs. Factor 2w + w*3 - 2w*2 - 8w + sw2 - w2. w(w - 3)(w + 2) Let l(a) = -a2 + a + 5. Let i be l(2). Suppose -3 + 25w*2 - 6w*3 + 5 + 45w*i + 43w + 55w2 = 0. What is w? -1, -2/39 Let i(r) = 4r*2 + 57r + 16. Let k be i(-14). Find a such that -1 + 161ak + 1 - 7a - 162a2 = 0. -7, 0 Let k(b) = -63b*2 - 1456b - 161. Let d be k(-23). Factor dh - 1/4h*5 - 3/4h*3 + 3/4h*4 + 0 + 1/4h2. -h2(h - 1)3/4 Factor -260w*2 - 107 - 432 - 84 - 729 + 1350w + 262w2. 2(w - 1)(w + 676) Let r(i) = -i2 - 2. Let k(p) be the third derivative of p5/30 - 2p*4 + 61p*3/6 - 79p*2 - p. Let j(s) = k(s) + 5r(s). Factor j(n). -3(n - 1)(n + 17) Let f(u) be the second derivative of -144u + 0 + 8u*3 - 576u*2 - 1/24u*4. Solve f(s) = 0. 48 Let t(y) be the second derivative of -1/25y*5 + 7/15y*4 - 153y + 1/5y3 - 1/105y*7 - 9/5y*2 - 1/15y*6 + 1. Solve t(p) = 0 for p. -3, -1, 1 Let l(k) = 3k*4 + 5k*3 + 26k*2 + 4. Let c(y) = -8y*4 - 16y*3 - 77y*2 - 11. Let o(z) = -4c(z) - 11*l(z). Determi	{ "pile_set_name": "DM Mathematics" }
Let w(v) = -v3 - v2 + 9. Let u be w(2). Sort z, 34, u in descending order. 34, z, u Suppose -5q + 28 = -9q. Let u be 0/(-1 - -5) - 3-1. Suppose -4w - 4p = -p + 6, 2p - 13 = uw. Put q, w, -4, 0 in descending order. 0, w, -4, q Let w = 34 - 33.9. Let y = -46 + 72. Let k = y + -29. Sort -3/2, k, w, 1/6 in descending order. 1/6, w, -3/2, k Let x = 17 - 13. Let d = 0.011 - -0.089. Let p = 6 + -4.8. Sort d, x, p in decreasing order. x, p, d Let w = 28 - 29.38. Let q = 0.02 - w. Let l = q + -1.5. Sort l, 1, 0.02 in decreasing order. 1, 0.02, l Let t = -0.08 + -0.42. Let l = -40.62 - 0.38. Let m = l + 41. Sort -2, m, t, -0.4 in decreasing order. m, -0.4, t, -2 Let g = 9159 + -9154. Let r(n) = -7n*2 - 2n + 1. Let i be r(1). Suppose 0 = -3q + 5v - 2, 0q + 2v = 4q + 12. Sort q, i, g, -1. i, q, -1, g Let w = -57 - -59. Suppose 12r = -r. Put r, -1, w, 3 in ascending order. -1, r, w, 3 Let a(y) = -2y3 + y2 - y - 1. Let l be a(-1). Let v = -935 + 934. Put 0.1, v, -4/3, l in increasing order. -4/3, v, 0.1, l Let z = -1466 - -1462. Sort 1, -20, z, 4 in increasing order. -20, z, 1, 4 Let o(b) = -18b + 1226. Let m be o(62). Sort m, -1, -2, 3. -2, -1, 3, m Let x be (0/(-2))/(2/(-2)). Suppose 3r + 0r = x. Suppose -55s + 27 = -133s + 51s. Sort 3, 1, r, s in ascending order. s, r, 1, 3 Let j = 691.7 + -692. Suppose 8v = -5 - 3. Sort v, 0.17, j. v, j, 0.17 Let h = 17 - 21.5. Let l = -4 - h. Let f = -3/2621 - -5275/28831. Put f, -2/9, l, 2 in descending order. 2, l, f, -2/9 Let h = -490.78 + 485. Let y = 7.78 + h. Put -5, 4, y, -4 in ascending order. -5, -4, y, 4 Let o be -2 + (-8)/((-288)/60). Put 4/5, -98, o, 4, -1/2 in descending order. 4, 4/5, o, -1/2, -98 Let k = 186 - 121. Suppose 39 + k = 4c - 4f, -3c - 2f = -78. Let x be 2/5-7 + c/(-130). Sort -2, x, -5, -18 in ascending order. -18, -5, x, -2 Suppose -211 = 189o + 6 - 28. Let y = -1 - -0.5. Let i = 3 - 3.4. Sort i, o, y. o, y, i Let h = -0.9413 + 1.0213. Suppose 2y - 2x = 0, -2y - x + 2x - 5 = 0. Put y, 5, h, 3 in decreasing order. 5, 3, h, y Suppose -33v - 46v = 11v. Sort 5, 6, v, -2, -16. -16, -2, v, 5, 6 Let a = -1068.8 - -990.8. Sort a, -1, 11 in ascending order. a, -1, 11 Let p = 0.96 + 1.88. Let y = -2.54 + p. Sort -2/15, -0.1, 2/3, y in descending order. 2/3, y, -0.1, -2/15 Let u(y) = -346 + 189 - 6y + 317. Let q be u(27). Put 3, 10, q, 2 in descending order. 10, 3, 2, q Let b = 203 + -169. Let k = 32 - b. Put 2/5, k, 14/9 in descending order. 14/9, 2/5, k Let f = -1 + -4. Suppose 0 = 841v - 842v + 8. Put v, f, -1 in descending order. v, -1, f Let k = 2 - -1. Suppose 5z = kc - c + 11, -5c + 19 = 3z. Suppose -5j - 36 = -2w - 0w, -j = 13w - 100. Put j, 2.6, z in decreasing order. z, 2.6, j Let v be 2/5 + 136(-39)/1560. Sort 2, 461, v in ascending order. v, 2, 461 Let a = -22621 - -22620. Suppose 3c - 28 = -c. Suppose -5t - 8 = c. Sort t, a, 2 in descending order. 2, a, t Let r = 9254 + -9251. Put -39, 1, r in ascending order. -39, 1, r Suppose 2m + 3 + 21 = -4y, -36 = 4m + 5y. Let z be ((-42)/(-3))/((-2)/(-1)) + -7. Put 2, z, m, -3 in descending order. 2, z, -3, m Let d(m) = 6m*2 + 505m + 100. Let s be d(-84). Put 3, -178, s in descending order. s, 3, -178 Let m = -17149 - -17152. Sort -5, -234/5, -0.3, m in increasing order. -234/5, -5, -0.3, m Let u = 0.8 - 0.3. Let z = -0.254421 - -0.554421. Put -10, z, u, -3 in increasing order. -10, -3, z, u Let n(a) = -a*2 + 5a + 5. Let w be n(6). Suppose 0 = b + 2b - 24. Let g(p) = -p3 + 9p*2 - 7p - 6. Let f be g(b). Put f, 1, w in descending order. f, 1, w Let s = -44.6 - -1.6. Let n = 42.95 + s. Let i = n - 2.95. Put 0.4, i, -5 in decreasing order. 0.4, i, -5 Suppose y + 3u - 4 = 0, u = 5y - 4u - 100. Suppose 4j = -y + 12. Let g(c) = -c + 1. Let z be g(5). Sort j, -3, z, 3. z, -3, j, 3 Let v = -955.824 + 964. Let l = v + -0.176. Put l, -1/10, -4/7 in descending order. l, -1/10, -4/7 Let s(w) = w*2 - 20w - 90. Let t be s(24). Let k be (-3)/12 + 75/(-4). Let v(q) = q*3 + 18q*2 - 20q - 21. Let p be v(k). Put -5, p, t in descending order. t, p, -5 Let b = -1817/312 - -571/104. Let l = 237/4 + -59. Sort b, l, -0.4, -0.8 in decreasing order. l, b, -0.4, -0.8 Let a = -1 - -5. Let o be (-38)/(a/(2 + 2)). Let y = 43 + o. Put -17, y, 3 in decreasing order. y, 3, -17 Let z be (4/(-10))/((-16)/160). Suppose 5s = -v - 24, zv + 12 = -7s + 8s. Sort s, 2, -5, 4 in decreasing order. 4, 2, s, -5 Let w be 10/(-4)(-15 - -11). Let g = 32402 - 32399. Put 26, w, -4, g in ascending order. -4, g, w, 26 Suppose 172o - 174o = 0. Suppose -g - 16 - 30 = o. Let h(i) = i2 + i. Let y be h(-1). Sort g, y, 5 in decreasing order. 5, y, g Suppose 14r - 18r = -4g, -5g - 2r = 28. Put g, 39, -1, 1 in descending order. 39, 1, -1, g Let h = -1/1113 + 1117/4452. Let a = 2.9 - 2.82. Let l = 13.08 - a. Sort -4, l, h in descending order. l, h, -4 Let l be -2(6/(-4) - 0). Suppose 207g = -293 - 328. Put g, 1, l, -5 in decreasing order. l, 1, g, -5 Suppose -8t = -35 + 27. Let k be -7 + (-1 + 0 - -4 - 0). Put k, t, -7 in decreasing order. t, k, -7 Suppose 1184 = 9l - 76. Let k = l + -140. Put 1, -5, k, 5 in increasing order. -5, k, 1, 5 Let s = -35 + 35. Let j = -3569 - -3584. Sort 1, s, -3, j in decreasing order. j, 1, s, -3 Let m = 0.602 - -1.95. Let i = m + -0.552. Sort i, 4, 51, 1 in decreasing order. 51, 4, i, 1 Let l = 2278 - 2281. Sort 3, 41, l, 5 in ascending order. l, 3, 5, 41 Let n be 3 - (8262/(-4134) - -5). Let x = 2065/1378 - n. Put 5, 4/19, x in decreasing order. 5, x, 4/19 Let d = 1715/4 - 429. Put 58, -0.2, 0.2, d in descending order. 58, 0.2, -0.2, d Let f = -4.91508 + -0.08492. Put -1, 226, -0.4, f in increasing order. f, -1, -0.4, 226 Let a be 01/(-3) - 5. Let t be 4/10 + (-198)/(-55). Suppose -2y = -2p - 2, 4y + tp - 2 = 7p. Sort a, y, 2 in ascending order. a, y, 2 Let y = 223 - 218. Suppose 11r - 24 = yr. Put 3, -4, r, -15 in descending order. r, 3, -4, -15 Let i = 1514 - 1469. Put i, 3, -0.4 in descending order. i, 3, -0.4 Let k = -3077 - -12309/4. Put 9, k, 0.4, -0.2, 470 in decreasing order. 470, 9, 0.4, k, -0.2 Let b = -17106 - -17106.2. Sort 0.5, b, -2/217. -2/217, b, 0.5 Let r = -4 - 1. Let x(l) = 376l - 7. Let p be x(-1). Let a = -381 - p. Sort r, 0.05, -0.3, a in descending order. a, 0.05, -0.3, r Suppose 5h + 9g - 13g + 487 = 0, 0 = -3h - 5g - 270. Let z = 35 + h. Sort -5, 5, z in decreasing order. 5, -5, z Let k = 797 + -1005. Let v be k + 205 - (2 - 1)/1. Let l be 1/(-2)(-20)/(-2). Put v, l, 21 in descending order. 21, v, l Let f = -0.49 - 8.51. Let c = -812 + 809. Sort c, f, -1, 2 in descending order. 2, -1, c, f Suppose 2 = -3m - 1. Let q = 340 - 399. Let o be ((-4)/6 + q + 59)6. Sort m, 3, o, 4 in ascending order. o, m, 3, 4 Suppose 4z + 0z - 1004 = 5j, 4j - 691 = -3z. Put z, -8, 3 in decreasing order. z, 3, -8 Suppose -514n - 10146 = -247n. Sort -0.1, -1/3, n, -1.7, 4. n, -1.7, -1/3, -0.1, 4 Let c(l) = -7l2 - 49l + 214. Let d be c(3). Put 18, d, -5, 3, -33 in increasing order. -33, -5, 3, d, 18 Let d be ((-105)/10 + 47 + -38)/((-6)/(-8)). Put 2, d, -2283 in decreasing order. 2, d, -2283 Let m be (396/28)/(-9) + (-6)/14. Let u = -6 - m. Put -1/4, u, 2/5 in decreasing order. 2/5, -1/4, u Let c = -167 + 172. Let i = 9 - 5. Suppose 2h - 6h - i = 0. Sort h, c, 4 in increasing order. h, 4, c Let k = 23251 - 23252. Sort 8, -3, 0, -2, k in descending order. 8, 0, k, -2, -3 Let s be 2091/408 + 18/(-16). Sort -5, -7, s, -4, 1 in descending order. s, 1, -4, -5, -7 Let j = 260 + -265. Let l = 23.69 + -0.69. Sort -1, l, j in decreasing order. l, -1, j Let m = 1 - 0. Let t be (2 + 1)68/(-51). Let g = -8 - -13. Sort g, m, -5, t. -5, t, m, g Suppose -16 = 2f + 4s - 28, 9f + 2s = 38. Suppose -2k + 5h = 12, -h = 2k + 3h - 6. Sort k, f, 27, 5 in decreasing order. 27, 5, f, k Suppose -5x - 1 - 3 = -2g, -10 = -5g + 3x. Suppose 5w + 10 = w + v, 5w - 3v + 16 = 0. Let t be ((-25)/(-10)4/5)/w. Sort t, g, 4, 0 in descending order. 4, g, 0, t Suppose -3f = -f. Let s = -1 - -0.9. Let v = 1.5 - 0.5. Put s, v, f in increasing order. s, f, v Let i(x) = -x + 3. Let f be i(2). Let w(z) = -545*z - 5447. Let g be w(-10). Sort f, g, -6, 2 in descending order.	{ "pile_set_name": "DM Mathematics" }
rty-two fifths of a milligram in micrograms? 6400 How many nanograms are there in 9/10 of a microgram? 900 How many micrograms are there in 5/8 of a milligram? 625 How many millilitres are there in eleven tenths of a litre? 1100 What is 33/5 of a tonne in kilograms? 6600 What is 3/50 of a centimeter in micrometers? 600 How many millilitres are there in 746721.5l? 746721500 What is fourty-seven quarters of a hour in minutes? 705 What is sixty-five thirds of a day in hours? 520 How many grams are there in 17.28309ug? 0.00001728309 What is one quarter of a gram in milligrams? 250 How many decades are there in 3/5 of a century? 6 How many millilitres are there in three fifths of a litre? 600 What is twenty ninths of a day in minutes? 3200 How many millilitres are there in 4.992866l? 4992.866 What is twelve sevenths of a week in days? 12 How many minutes are there in 234745.2ns? 0.00000391242 What is 25/2 of a hour in seconds? 45000 Convert 55.62996cm to millimeters. 556.2996 What is fifty-five halves of a microsecond in nanoseconds? 27500 How many millilitres are there in one quarter of a litre? 250 What is 3/25 of a kilometer in meters? 120 How many months are there in 37917.32 years? 455007.84 How many nanograms are there in one tenth of a milligram? 100000 How many micrometers are there in five eighths of a centimeter? 6250 What is thirty-two fifths of a litre in millilitres? 6400 How many millilitres are there in twenty-nine fifths of a litre? 5800 How many months are there in seven halves of a decade? 420 What is one twentieth of a century in years? 5 How many millimeters are there in 70345.45 kilometers? 70345450000 What is five quarters of a decade in months? 150 How many kilograms are there in 5.885476 grams? 0.005885476 Convert 6840.498ml to litres. 6.840498 What is 698.2414 years in centuries? 6.982414 Convert 68961.47l to millilitres. 68961470 What is three fifths of a day in minutes? 864 How many days are there in 5762.826 weeks? 40339.782 How many nanometers are there in 4.911391 micrometers? 4911.391 How many kilograms are there in eighteen fifths of a tonne? 3600 How many decades are there in 1/10 of a century? 1 What is 579.4759ug in milligrams? 0.5794759 How many years are there in 7/4 of a millennium? 1750 Convert 612.755 years to months. 7353.06 What is 0.7930418 millennia in years? 793.0418 Convert 43.0407 microseconds to milliseconds. 0.0430407 Convert 11.35416l to millilitres. 11354.16 What is thirteen quarters of a microgram in nanograms? 3250 What is 79.57351ml in litres? 0.07957351 How many millilitres are there in 7/4 of a litre? 1750 What is 40.74548 millilitres in litres? 0.04074548 How many millilitres are there in fifteen quarters of a litre? 3750 How many micrometers are there in 3/16 of a centimeter? 1875 What is 851.6694ml in litres? 0.8516694 What is one tenth of a tonne in kilograms? 100 How many centuries are there in 886.6751 millennia? 8866.751 What is one sixteenth of a meter in micrometers? 62500 How many decades are there in 13.38397 years? 1.338397 Convert 1353.536 grams to tonnes. 0.001353536 How many millilitres are there in 5/8 of a litre? 625 What is three fifths of a litre in millilitres? 600 What is 27/2 of a microsecond in nanoseconds? 13500 How many millilitres are there in 21/8 of a litre? 2625 How many grams are there in 57/2 of a kilogram? 28500 How many months are there in 199.2745 millennia? 2391294 Convert 45943.7 millennia to months. 551324400 What is eighteen fifths of a microgram in nanograms? 3600 How many minutes are there in fourty-six ninths of a day? 7360 Convert 5948.882 days to milliseconds. 513983404800 How many micrograms are there in 8.750502 kilograms? 8750502000 Convert 1557.223 millimeters to micrometers. 1557223 How many seconds are there in fifty-two thirds of a minute? 1040 How many micrometers are there in 110445.1mm? 110445100 What is 19/4 of a litre in millilitres? 4750 What is 914.586 hours in seconds? 3292509.6 How many millilitres are there in 781.2304 litres? 781230.4 What is 1218.116 days in nanoseconds? 105245222400000000 How many millilitres are there in 26/5 of a litre? 5200 How many litres are there in 0.6826781ml? 0.0006826781 Convert 8195.214 litres to millilitres. 8195214 How many seconds are there in one sixth of a hour? 600 Convert 41052.93 minutes to hours. 684.2155 How many tonnes are there in 0.0637378ug? 0.0000000000000637378 Convert 57.84175l to millilitres. 57841.75 How many minutes are there in 37/2 of a day? 26640 How many micrograms are there in eighty-one halves of a milligram? 40500 How many nanograms are there in seventy-seven halves of a microgram? 38500 What is 34641.13t in grams? 34641130000 Convert 3.688557 months to centuries. 0.0030737975 How many kilograms are there in three fifths of a tonne? 600 What is six fifths of a microgram in nanograms? 1200 What is 0.116176 decades in months? 13.94112 How many grams are there in 741843.3mg? 741.8433 What is seven thirds of a millennium in months? 28000 What is twenty-seven quarters of a litre in millilitres? 6750 What is 0.866079 grams in nanograms? 866079000 How many grams are there in 644151.7mg? 644.1517 How many minutes are there in 9/10 of a week? 9072 What is 59.709 microseconds in milliseconds? 0.059709 What is twenty-eight thirds of a century in months? 11200 How many millilitres are there in 21/5 of a litre? 4200 How many years are there in 4463.27 decades? 44632.7 Convert 5675.209 micrograms to milligrams. 5.675209 Convert 42.73191 micrograms to nanograms. 42731.91 Convert 67624.44mg to grams. 67.62444 What is 7852.601 nanometers in millimeters? 0.007852601 What is 23.7915846 nanoseconds in weeks? 0.0000000000000393379375 How many hours are there in four sevenths of a week? 96 Convert 530795.3 hours to microseconds. 1910863080000000 How many millilitres are there in ninety-one quarters of a litre? 22750 How many millilitres are there in six fifths of a litre? 1200 What is 37980.73 decades in months? 4557687.6 Convert 0.206638 centimeters to meters. 0.00206638 What is twenty-seven fifths of a meter in centimeters? 540 What is fifteen quarters of a gram in milligrams? 3750 How many millilitres are there in one fifth of a litre? 200 How many years are there in 9.23866 centuries? 923.866 How many micrometers are there in 37/5 of a centimeter? 74000 What is 713.7955 centuries in months? 856554.6 What is five quarters of a litre in millilitres? 1250 Convert 796542.6g to milligrams. 796542600 How many micrometers are there in nineteen quarters of a centimeter? 47500 What is seven quarters of a tonne in kilograms? 1750 Convert 46463.33 hours to nanoseconds. 167267988000000000 How many centimeters are there in 8446.365 nanometers? 0.0008446365 What is 3/25 of a second in milliseconds? 120 How many milliseconds are there in 1/16 of a minute? 3750 How many micrometers are there in 67.69444 centimeters? 676944.4 What is 0.2686768ng in micrograms? 0.0002686768 How many millilitres are there in 55448.7 litres? 55448700 What is 11/2 of a gram in milligrams? 5500 How many years are there in twenty-seven halves of a decade? 135 What is nine tenths of a millennium in months? 10800 What is 8229.049l in millilitres? 8229049 What is thirty-seven halves of a litre in millilitres? 18500 How many months are there in twenty-one fifths of a century? 5040 How many kilometers are there in 68821.73 millimeters? 0.06882173 Convert 587160.6 micrometers to meters. 0.5871606 How many micrograms are there in 99423.9mg? 99423900 Convert 907.4399m to millimeters. 907439.9 Convert 436.4615um to meters. 0.0004364615 What is one fifth of a hour in seconds? 720 What is 13/5 of a minute in seconds? 156 What is 1/10 of a kilogram in grams? 100 How many months are there in thirty-three fifths of a millennium? 79200 Convert 53200.04g to nanograms. 53200040000000 What is 2.680062ms in seconds? 0.002680062 What is 3/5 of a tonne in kilograms? 600 What is 26.31872mm in micrometers? 26318.72 How many days are there in 14083.317 minutes? 9.78008125 How many decades are there in 48/5 of a millennium? 960 What is 90.51044 millennia in decades? 9051.044 Convert 6.409731ng to micrograms. 0.006409731 How many hours are there in 28/3 o	{ "pile_set_name": "DM Mathematics" }
/(-3)q/12. Suppose i + d = 3i. Solve -3o + 8o - b = i, -4o = -3b - 6 for o. 0 Suppose 17 = 5m + 2. Solve -mu - 31 = 5b, 4u + 1 = 3b + 8 for b. -5 Let d(t) = 3t - 4. Let x be d(2). Solve -3l = -xl + 2, -4l - 16 = -2k for k. 4 Suppose 7 = -3d + 22. Let t = -27 - -53. Suppose -dk + t = 1. Solve kr - 1 = r + j, -4r = j + 9 for r. -1 Suppose -4m = 10 - 22. Solve -3n - k = -4, 2n - mk - 2 = -3n for n. 1 Suppose -4q = -13 - 7. Let j = q + -1. Solve 2m + 12 = -3y - 11, jm - 3y + 1 = 0 for m. -4 Let z be (18/15)/((-12)/(-30)). Solve -2n + 15 = -3p, 5n + z = -p - 2 for p. -5 Suppose 0 = -5h + 15. Solve -n - 4 = 0, b + n - 8 = -hb for b. 3 Let p be 10/(1 - (-1 + 0)). Let i be ((-12)/p)/(4/(-10)). Let v(y) = -y2 + 8y - 7. Let o be v(i). Solve 4h = 4, -8 = -ow - h - 2h for w. 1 Suppose -3h = 5h. Solve 2u - 14 = 3v, v = u - hv - 6 for u. 4 Let j(v) = 0v - v2 - 1 + 2v*2 + 4v. Let m be j(-5). Solve k = -4k + 4a + 14, 8 = 2k - ma for k. 2 Suppose -5p = -5d - 3 + 8, -5p = -4d + 3. Solve 5i = -5g + 10, -17 = 5g - di + 8 for g. -3 Let x = -41 + 44. Solve 2p + 1 = xa + 21, -3p = 2a - 4 for p. 4 Let j(k) = k*3 - 5k*2 - 7k - 7. Let h be j(6). Let n be 3/(-2) + h/(-2). Solve -3s + s = nf - 5, -2f + 26 = -4s for s. -5 Suppose 0 + 16 = 4v. Suppose -u - 5 = -m - v, 5m = 2u + 11. Solve -ui + 4 = -2d, -3d = -5i - 4d - 2 for i. 0 Let a = 13 + -13. Suppose 0 = 5r - 11 + 1. Suppose -x + v = 2x - 30, -rv - 33 = -3x. Solve -4g - 5u = -x, -3g + ag = -3u for g. 1 Suppose 0 = -3v + 8v - 20. Solve vm - 5n - 13 = 18, -4m - 4n + 4 = 0 for m. 4 Let o = 20 - 20. Solve ob = 3b + 3v - 18, 6 = 2b - v for b. 4 Let b = 10 + 9. Let p = b - 14. Solve z + 11 = -5g, 0 - 1 = -pg - 4z for g. -3 Let m(h) = 3h + 7. Let c be m(-7). Let z = c + 20. Suppose 0 = -2t - 3t + 120. Solve 3u + 4q - t = 0, -z + 0 = -2q for u. 4 Suppose f + 3f = 0. Suppose n - 4n + 42 = f. Suppose -4d + n - 2 = 0. Solve 0 = a - u - u + 9, 5u = da + 22 for a. 1 Suppose -16l + 2 = -15l. Solve 2b + 0v = v + l, -3v + 4 = 4b for b. 1 Let j(o) = -o3 + 82. Let p be j(0). Suppose 0 = -5s - 22 + p. Suppose 0 = -6a + 2a, -5a = 4w - s. Solve y + wy + 5m - 16 = 0, -m = -4y - 8 for y. -1 Let r be (-22)/(-6) - (-2)/(-3). Let j be 5/(10/(-4) + 2). Let g be (8 + 0)/(j/(-5)). Solve -gv - 23 = rq + 3, -4v + 5q = 10 for v. -5 Let w be -6 + 0 - (11 - 20). Solve -2f = 5b - wf - 25, -4b = 3f - 1 for b. 4 Let r = -9 - -13. Solve 2f - r = 2t, -2f - 11 = -3f + 4t for f. -1 Suppose -13 = o - 15. Solve 5q = -0q - oc + 13, 7 = 3q + 2c for q. 3 Suppose -3z - 3o = -4z + 3, -3o = 0. Solve 0x = -2j + zx - 25, 10 = 2x for j. -5 Let h(p) = 9p. Let i(k) = -4k. Let u(a) = 4h(a) + 10i(a). Let b be u(-1). Solve -5w + 4w - 13 = -3x, -25 = bw - 3x for w. -4 Suppose -3k + 2k = 68. Let z = k + 38. Let o be 2/(-5) + (-162)/z. Solve -5l + 5 - 35 = -5h, oh = 10 for l. -4 Let c(p) = -p - 1. Let l be c(-5). Solve -2r - 10 = 3t, 3r - l = 5r for t. -2 Suppose -4k = -9k + 50. Suppose -1 - 11 = -3t. Suppose -tw + 9w = 0. Solve -k = -4b - 2j + 18, w = -b - 4j + 21 for b. 5 Let j(i) = i*3 - 7i*2 + 2i - 9. Let z be j(7). Solve 2q + z = -3c, 4q - 54 = 4c - 14 for c. -5 Let n = -35 + 35. Suppose -d + 49 = -13. Suppose 3m = -2z + 35, 4z - 4m + 2m - d = n. Solve 0v = -5v + 25, l = 4v - z for l. 4 Suppose 5y + 5v = 10, 2y + 8 = 5y + v. Suppose -3 = -2d + 3z + 18, 5z - y = -3d. Solve 3o + 3k + k + 11 = 0, k = o + d for o. -5 Let i = 562 - 540. Suppose 1 = -5a + 21. Suppose -5y + 2 = 4v - 4, -8 = 4y. Solve -4d - ax = 27 - 3, -i = 2d + vx for d. -1 Let l(c) = -c - 3. Let s be l(-6). Let a = 3 - s. Solve -q - 1 = a, -5i - 16 = q - 0q for i. -3 Suppose 3p - 24 = 5f, -2f + 5p - 2 = -0f. Let k be 0 + -43/f. Let n(x) = x + 1. Let m be n(1). Solve 4z + 8 = -4s, -2s - mz = kz for s. -4 Let r = 48 + -24. Suppose 0 = 4a - a - 12. Suppose -r = -aq - 8. Solve -3k = -qb - 12, -2k - b = -0k - 8 for k. 4 Let c(x) = 7x*2 - 2x - 1. Let m be c(-1). Let r = -3 + m. Suppose -2f = -0f - 24. Solve f = 2a - ra - g, 0 = g for a. -4 Suppose 3s + 2 + 1 = 0. Let i = s + 3. Suppose 6 = d + if, 2d - 5f + 15 = -d. Solve -u = d, n - 5 = 5u - 1 for n. 4 Let u be ((-36)/54)/((-1)/15). Solve 4j = 13 + 7, 5k + 5j = u for k. -3 Let u = 28 + -25. Solve -2t = 6, ux - 19 = 7x + t for x. -4 Let h = 0 + 3. Let q be (-3)/(h/2 - 2). Let s(v) = -v. Let y be s(-3). Solve 5r - c + 6c - 10 = 0, -4c - q = -yr for r. 2 Suppose d = 3 + 1. Suppose c + 17 = 4q, c + dq = -0c + 7. Let t be (c/2)/(5/(-10)). Solve -5v - m = -2m, -3v = tm + 28 for v. -1 Let l(z) = z*3 + 11z*2 - z - 8. Let g be l(-11). Solve -5 = -v + 3t, -1 = -gv - 2t + 3 for v. 2 Let d = 14 - 8. Suppose -5v + 3v = -d. Solve vn - 5m - 17 = 0, -2n = -2m - 1 - 5 for n. -1 Suppose w + w - 26 = 2s, 2w = 3s + 29. Let a(i) = -5i3 + i2 - i + 1. Let p be a(1). Let d = p + w. Solve t = l - dl + 14, 3t - 4 = 4l for t. 4 Let h(d) = -3d + 7. Let y be h(-3). Solve -4f - 4b - 16 = 0, -b + y = -3f - 6b for f. -2 Let d be 7((-3)/3 + -1). Let c be (-4)/d - 114/(-42). Solve cu = 5r, 0 = 4u + 3r - r for u. 0 Let q = 2 + 5. Let l = -3 + q. Suppose 4w - 6w - 11 = -y, ly + 2w - 64 = 0. Solve -4m - 15 = 5c, 3c = -2c - 5m - y for c. -3 Let c = -61 + 66. Solve 2z - cf - 29 = 0, -2f = -4z + 2f + 28 for z. 2 Suppose 4t - 10 = 5r - t, 2r + t - 8 = 0. Solve 3z + 3w = -3, 2z + 8 = -rz - 2w for z. -3 Let n = 13 - 10. Solve 0 = 4h - a + 15, -5h + 2a = -na + 30 for h. -3 Suppose 3 = 4f + 4n + 15, -19 = 3f + 5n. Let d be (-5)/(-35)37. Solve 5s - 4z + 15 = -9z, 0 = -fs + dz + 19 for s. 2 Let z be 2 + (-40)/(-3 - -1). Solve 5f - 15 = 0, 4o - 4f + 2 = -z for o. -3 Let f(x) = x - 4. Let d be f(6). Suppose 3 + 0 = 3n + g, 4g - 12 = -dn. Suppose o = -no. Solve -5h + 16 = -w, 4w - 4h + 13 + 3 = o for w. -1 Suppose -72 = -z - 3z. Solve -4q = 2n - z, -2q - 2n + 21 = 3n for q. 3 Let c be ((-40)/24)/(1/(-3)). Solve 3g - 6x + x + c = 0, 0 = 5g + x - 29 for g. 5 Suppose -l + 1 = -r, 2r + 3r + 5l = 25. Solve 4 = p - 3s, -3p + rs = 2p - 20 for p. 4 Suppose -b - 2b = 0. Suppose -4n + 2n = b. Suppose -3i + ni + 42 = 0. Solve 3c - 9 = -3p, -p = -3c + p + i for c. 4 Suppose 0 = 3n - 12, f + 5n - 4n - 8 = 0. Let u be f/14 + (-22)/77. Solve -2w = -0v + 4v + 2, -4v + w + 1 = u for v. 0 Suppose -l = d - 0d, 0 = 4d - 5l - 9. Let h = 3 - d. Suppose 0w = -w. Solve -5x - 4 = -hg - 0, 3x = w for g. 2 Let x be (9 - 11)/(1/(-2)). Solve 0d + 4b = 3d - 1, d - 11 = xb for d. -5 Let l(q) = -q*2 + 7q - 7. Let t be l(5). Suppose -b - t = v - 2, -4v - 1 = 3b. Solve -4m - 3 - 1 = 5g, 5g - vm = 2 for g. 0 Let h(k) = k + 3. Let p be h(-5). Let u be (p/(-5))/(4/20). Solve 3 - 8 = 5b + ur, -25 = 5r for b. 1 Suppose 5z - z = 0. Solve 2u + 3s - 15 = z, -u + 3s - 10 = s for u. 0 Let h(y) = -y2 + 8y - 7. Let q be h(6). Let t(m) = 5m3 - m2 - m + 1. Let a be t(1). Let k = q + a. Solve 2r = -z - k, -r - 8 = -4z + 2r for z. -1 Let a(b) = -b + 8. Let u be a(6). Suppose 0 = -g - ug + 6. Suppose 0w = gw - 6. Solve -wq - 2d + 7 = 0, 8d - 14 = -4q + 3d for q. 1 Let f = 39 - 36. Suppose 0 = -3b + 2p + 93, 0b + 2b + 4p = 46. Solve -fl - b = 2l - 3c, 2l - 3c + 17 = 0 for l. -4 Let o(g) = g*3 - 6g*2 + 2g - 3. Let r be o(6). Let y = r + -9. Solve u - q = 4, -q + y = u - 2 for u. 3 Suppose 3j - 17 = -5b - 0j, 3b + 5j = 7. Solve 5y + 4t - 1 = -0, -5y + bt - 31 = 0 for y. -3 Let d = 5 - 5. Suppose -5v + 2v = -9. Suppose -2z - 4n + 0 + 30 = 0, 4z + n - 53 = 0. Solve du - z = -g + 2u, 0 = 5g + vu for g. 3 Suppose 0 = -3n - 0 + 9. Solve 0 = 2j + 2j + 3q + 31, nj + q = -17 for j. -4 Let d(w) be the third derivative of -w6/120 + w5/60 - w4/24 + 2w*3 - 2w*2. Let n be d(0). Solve 5u - 2h - n = 3u, -3u + 16 = -h for u. 5 Let l(z) = -z2 - 8z - 4. Let h be l(-7). Let x be 31 - 6/(1-3). Let k = x + -19. Solve 0 = -hu + i + k, -2u + 3u - i - 6 = 0 for u. 4 Let t be ((2 + -2)/2)/(-1). Let d = 2 + t. Supp	{ "pile_set_name": "DM Mathematics" }
pose -5n = -6n + t. List the prime factors of n. 3, 5 Let n(c) = 69c2 + 2c. Suppose b + 0 - 3 = 0, 3z - b = 0. List the prime factors of n(z). 71 Let u(n) = 73n*3 - 8 + 15 - 72n*3 + 18n*2 + 27 - 17n. What are the prime factors of u(-18)? 2, 5, 17 Let y = -17 + 7. Suppose -5l = -4m + 52, l = 3m + 2l - 20. Let x = m - y. List the prime factors of x. 2, 3 Suppose -4 = u + 5. Let j = -7 - u. Suppose 118 = jz - 18. What are the prime factors of z? 2, 17 Suppose 0 = 28u - 36u + 3896. What are the prime factors of u? 487 Let k(l) = 73l - 126. List the prime factors of k(11). 677 Let y(p) = p + 3. Let c be y(-7). Let v be ((-3)/3)/(2/c). Suppose 5h + 3s - 93 = 0, h + h = vs + 34. List the prime factors of h. 2, 3 Suppose -i + 3 + 27 = 0. Let m be 6/(-2) - (-6 + 1/(-1)). Suppose 5s + 19 = mn, -3s = -3n - 12 + i. List the prime factors of n. 11 Suppose 24x + 5397 = 42093. What are the prime factors of x? 11, 139 Suppose 31m + 12 = 35m. Suppose -mx + 23 = -118. What are the prime factors of x? 47 Let p be ((-10)/6)/(8/(-192)). Let z = 102 - p. Suppose -2r + r = -z. List the prime factors of r. 2, 31 Let o be (0 + -2)(-10)/(-4). Let y = 42 + o. What are the prime factors of y? 37 Let f be 14(-3)/(-6) + -1. Let i = 24 + f. List the prime factors of i. 2, 3, 5 Let j(f) = f*2 + 30f + 29. What are the prime factors of j(13)? 2, 3, 7 Let v(g) = -2g + 22. Let b be v(10). Suppose 5t - 230 = -4p, 17 + 75 = bt - 3p. List the prime factors of t. 2, 23 Suppose 2n = -3d + 1131, 4n - 8d = -6d + 2286. List the prime factors of n. 2, 3, 5, 19 What are the prime factors of (-60)/(-4)(7 - (-2132)/10)? 3, 367 Let d be (294/35 + 6)/(2/150). Suppose -4o = 5n - d, n - 300 = -2o - 90. List the prime factors of n. 2, 5, 11 Let y(a) = 3a + 12. Let b be y(-11). Let k be ((-12)/(-5))/(b/70). What are the prime factors of k(-3 + 18/8)? 2, 3 Let o = -33 - -106. List the prime factors of o. 73 Let s = 841 - -173. List the prime factors of s. 2, 3, 13 Suppose 140k - 120k - 26960 = 0. What are the prime factors of k? 2, 337 Let w(v) = -3v - 4 - 3 - 5. Let n(p) = -p. Let f be n(6). List the prime factors of w(f). 2, 3 Suppose p = 4z + 1, 0p + p - 9 = -4z. Suppose -3g + 11 = p. List the prime factors of g/(2/(-3 - -37)). 2, 17 What are the prime factors of 94766/49 + 17? 3, 647 Let m be -15 + 2/(-8) + 10/8. List the prime factors of 8/m(-6972)/24. 2, 83 Let f(y) be the second derivative of y5/20 - y4/4 - y3 - 7y*2 - 11y. What are the prime factors of f(6)? 2, 29 Let i = -11 - -23. Suppose -3k - 5h = -4 - 6, 0 = 5k + h - 24. Suppose 3n - i = 0, 5r + n = kn + 189. List the prime factors of r. 41 Let f(d) be the third derivative of -d*5/120 + 13d*4/12 - 2d*3/3 + 9d*2. Let b(a) be the first derivative of f(a). What are the prime factors of b(10)? 2 Suppose 39f - 44f - 2r + 391 = 0, 4f + 5r = 323. List the prime factors of f. 7, 11 Suppose 3038 = 5n - j, -n = j - 336 - 274. List the prime factors of n. 2, 19 Let s(i) = 28i*2 - 4. Let v be s(-4). Suppose -14n = -10n - v. List the prime factors of n. 3, 37 List the prime factors of 2/5 - (-32039)/115. 3, 31 Let x(o) = o2 - 1. Let z(a) = -3a*2 + 4a + 13. Let b(i) = 4x(i) + z(i). Let q be b(-6). Let r = q - 4. What are the prime factors of r? 17 Suppose 0 = 3b - 8b + 4i - 31, 5i = 5b + 30. Let w(c) = c*3 + 6c*2 - 18c - 5. What are the prime factors of w(b)? 2, 3 Let f = 20 + -31. Let o be (1 - f)/(3 - 2). Suppose 0 = -7l + l + o. What are the prime factors of l? 2 Let m(g) = 5g*2 - 4g. Let v be m(3). Suppose u - 51 = v. Suppose -2s = -0s - u. List the prime factors of s. 2, 3, 7 Let n(d) = d*2 + d - 63. Let k be n(0). Suppose -3g - 51 = 4h, -2h - h - 5g = 41. Let u = h - k. What are the prime factors of u? 3, 17 Let c(q) = -90q*3 + 3q*2 + 2q + 1. List the prime factors of c(-1). 2, 23 Suppose 183o - 5j - 20572 = 179o, -4o = -2j - 20584. What are the prime factors of o? 2, 3, 11, 13 Let q = 125 + -71. Suppose q = 4f - 2f. Suppose -23r + fr - 136 = 0. What are the prime factors of r? 2, 17 Suppose -4j + f = -1410, 101j - 3f = 98j + 1062. What are the prime factors of j? 2, 11 Let z(x) = 3x*2 + 1. Let k be z(-1). Suppose -5w + 2w = m - 69, -5m - kw + 312 = 0. Suppose 2v + 3v - m = 0. What are the prime factors of v? 2, 3 Suppose 44810 = 46r - 103218. What are the prime factors of r? 2, 1609 Suppose -40283 = -18a + 35911. List the prime factors of a. 3, 17, 83 Suppose 6b - 43 = -7. Let r(x) = -x*3 + 7x*2 - 10x + 13. Let f be r(b). Let w = f + 49. List the prime factors of w. 2, 19 Let m(u) = -92u - 15. Let d be m(-3). Let v = d + -84. List the prime factors of v. 3, 59 Let r be (5/(-2))/((-2)/4). Suppose -2n + rn + u = -5, 0 = 2n - 3u - 4. List the prime factors of 363/((-3)/n). 2, 3 Let u = 30 + -23. Let x(w) = 5w2 + uw*2 + 2w + 1 - 2. List the prime factors of x(2). 3, 17 Suppose 0h - 25 = 5h, 5h + 13 = -3n. Suppose ny + y = 10. Suppose yq = 31 + 5. What are the prime factors of q? 2, 3 Let c be 1/4 + 45/12 + 0. Suppose -211 = -cg + 5. List the prime factors of g. 2, 3 Let k = 5193 - -213. List the prime factors of k. 2, 3, 17, 53 Let r(g) = 4g*3 - 3g*2 - 2g + 1. Suppose 9 = 4w - 3. What are the prime factors of r(w)? 2, 19 Let l = 1564 - -147. List the prime factors of l. 29, 59 Let m(i) = -19i - 11. Let t(k) = -57k - 32. Let w(r) = -11m(r) + 4t(r). Let n be w(-5). Let y = n + -22. What are the prime factors of y? 2, 3, 11 Suppose 2 = -3h + 2a, 9a - 4a - 14 = 3h. List the prime factors of h. 2 Suppose -7a + 4 = -5a. Suppose 0 + 3 = -v, -5v - 63 = au. Let j = 27 - u. List the prime factors of j. 3, 17 Suppose 3t - 5t + 41 = -5x, 2x = 2. Let v = 36 - t. List the prime factors of v. 13 Suppose -5n = d - 6750, 5n + 3267 - 10002 = 2d. What are the prime factors of n? 19, 71 Let l = 294 - 276. What are the prime factors of l? 2, 3 Let f = -2926 - -5870. List the prime factors of f. 2, 23 List the prime factors of 6/8 - 44880/(-64). 2, 3, 13 Let g be 154/4 - 12/(-24). Let u be 8/(-52) + 162/g. Let k(a) = -a3 + 7a*2 - 6a + 5. List the prime factors of k(u). 29 Suppose v = 2 + 1. Let n = 99 - 142. Let l = v - n. List the prime factors of l. 2, 23 Let q be 25(0 - (2 + -3)). List the prime factors of (2 + 2 - 3)q. 5 Let d(z) = 40z + 74. What are the prime factors of d(9)? 2, 7, 31 Let i be (2 + (-27)/(-2))-2. Let j = i - -55. What are the prime factors of j? 2, 3 Let o(f) = -28f + 196. Let p(z) = -9z + 66. Let r(n) = -4o(n) + 11p(n). List the prime factors of r(30). 2, 83 Let w be -4 + 8 - 4 - -18. Let l = 76 - w. What are the prime factors of l? 2, 29 Let o = 41 + 17. Suppose 2n - 3n - o = 0. Let f = -35 - n. What are the prime factors of f? 23 List the prime factors of 1790((-5)/30)/(5/(-15)). 5, 179 List the prime factors of (-3)/2 - (-4074)/12. 2, 13 Let i = 5 - 2. Suppose 0 = 4c + iw - 0 - 16, -c + 2w + 15 = 0. What are the prime factors of c? 7 Let f = 3819 - 2906. What are the prime factors of f? 11, 83 Suppose g = -2g + i + 1597, -5g + 3i = -2659. List the prime factors of g. 13, 41 Let c(b) = -2b*2 - 2b + 1. Let k be c(-2). What are the prime factors of -1 + (-226)/k - (-18)/(-54)? 2, 37 Suppose -24 = j + 75. Let v = j + 182. Suppose 0 = -3x + v + 70. What are the prime factors of x? 3, 17 Let s(g) = -6g*3 - 66g*2 - 26g - 3. List the prime factors of s(-14). 3889 Suppose 3m + 9m - 972 = 0. Let j = m + -10. List the prime factors of j. 71 Let r(l) = l*2 + 6l + 1. Let c be r(-4). Let u(a) = -a*3 - 6a*2 - 2a. List the prime factors of u(c). 3, 7 Suppose 0 = 2k + 719 - 131. Let p = k + 583. List the prime factors of p. 17 Let h = 14 - 6. Let y(s) = 13 + 76s + 3s2 - 3 + 55s - 149s. List the prime factors of y(h). 2, 29 Let w(i) be the first derivative of i4/4 - 5i*3/3 - 8i + 5. What are the prime factors of w(6)? 2, 7 Let z(p) = p*2 + 8p - 4. Let t be z(-7). Let m = 147 - 128. Let d = t + m. What are the prime factors of d? 2 Let b(x) = x3 - x2 - 8x + 6. Let s(k) = -2k - 3. Let w be s(-4). Let m be b(w). Let n = 108 - m. What are the prime factors of n? 2, 3, 7 Let f(x) = -30*x - 14. Let l be f(-	{ "pile_set_name": "DM Mathematics" }
148042 and 2753? 407559626 3089217 times -63 -194620671 -499583931 times -0.1 49958393.1 Multiply -1295607.74 and -0.3. 388682.322 83 * -22622 -1877626 What is 0.05 times 22212? 1110.6 12990.860.26 3377.6236 -11 -115166.69 1266833.59 -28-698802 19566456 Multiply -2382165 and -22. 52407630 Calculate -0.6620.31. -372.186 Calculate 0-71133521. 0 Product of 7 and -6978683. -48850781 What is 0.1364 times -6704? -914.4256 Product of 5.28 and -15036.3. -79391.664 What is the product of -0.05 and -67895.8? 3394.79 Work out -96155 0.002. -192.31 Work out -1.06 * -2012.593. 2133.34858 -13.034 times 0.56 -7.29904 0.1314193067 1845098.71 5777163 times 8 46217304 -251.46 1926 -484311.96 11 * 189021717 2079238887 Product of 9.749 and -0.079. -0.770171 What is 81 times -47.178? -3821.418 Product of 34860325 and -5. -174301625 Product of -5 and -37.18545. 185.92725 Calculate -167-222.5. 37157.5 321675638 65026914 -18657.41 times 14 -261203.74 -957.5 * -211.8 202798.5 Work out 0.483 * -0.0705. -0.0340515 What is the product of 11498.2 and -0.0081? -93.13542 -1 times -36979.75 36979.75 3 times 5424534 16273602 -679 * -118963 80775877 -149112274 -33907614 Product of 0 and -9917154. 0 Multiply 0 and 7164296. 0 0.2-8300.8 -1660.16 What is the product of 6.637 and 2870.3? 19050.1811 -23938444 * -0.2 4787688.8 Product of 105278199 and 0. 0 What is the product of 0.3464 and 24882? 8619.1248 2-2982.157 -5964.314 169 times 55645 9404005 What is the product of 3341 and -117012? -390937092 Work out 620382 32. 19852224 What is the product of -0.027 and -0.099773? 0.002693871 2580756-10 -25807560 What is 0.3 times -32247515? -9674254.5 -635528 -2456 1560856768 0.12738908 * -19 -2.42039252 -296.97-1815 539000.55 -84.8 times 994 -84291.2 Product of 2.28122 and -3.63. -8.2808286 2-78374831 -156749662 1177401 * 0.5 588700.5 What is the product of 164 and -1657418? -271816552 What is the product of 2 and -862767? -1725534 Multiply 6212743 and -23. -142893089 -214.33 * -129 27648.57 275159-1.9 -522802.1 Calculate -10523-0.376. 3956.648 Multiply -5 and -6179.755. 30898.775 -58.86799-1 58.86799 -6957654 times -60 417459240 -1.7 times -43.159727 73.3715359 5 times 5.191709 25.958545 Product of -670210 and 8.4. -5629764 0.06228998760 1797923.12 Work out 0.10791735 * -7. -0.75542145 Product of -114735 and 9. -1032615 Product of -0.5 and -0.048936701. 0.0244683505 -0.0373-1.1636 0.04340228 What is 306245 times 76.3? 23366493.5 What is 0 times -21305947? 0 28.18 68231 1922749.58 Work out 0.52 * -3385494. -1760456.88 Calculate -25.24534.96. -882.5652 Product of -1 and -1344403. 1344403 Calculate -488718-0.1. 48871.8 -0.043542-1.092 0.047547864 Calculate -50458.2-0.12. 6054.984 What is the product of -0.192 and -0.13515? 0.0259488 What is -46.513 times 9.02? -419.54726 Product of -37.54 and -781. 29318.74 833461 * 0.823 685938.403 Multiply 6 and 314.6258. 1887.7548 What is the product of -302 and 250731? -75720762 Multiply -367004 and 24. -8808096 1 * 0.7392574 0.7392574 Calculate 25.396932.1. 176006.019 Work out -5.356 -1.34942. 7.22749352 -985.493 times 0.2 -197.0986 Product of -1373 and 38.607. -53007.411 What is the product of -0.03 and 118.97517? -3.5692551 Calculate 2018442. 1696842 What is 6.1 times -103.49083? -631.294063 Calculate 27.07233.5. 906.912 -58 * -131.572 7631.176 What is -0.8 times -303216? 242572.8 Multiply 110837 and -488. -54088456 Multiply 10057 and -1468. -14763676 What is the product of -16260 and 2404? -39089040 Calculate 562.178450.8. 449.74276 Work out 87174480 -3. -261523440 Multiply -182024 and 32. -5824768 What is the product of 0.8305105 and -0.2? -0.1661021 Work out 0.83 * -3230.23. -2681.0909 Calculate -3-10915623. 32746869 Work out -0.002615 1. -0.002615 What is the product of 189294391 and 4? 757177564 Multiply -0.0421 and -15656. 659.1176 What is -195 times 1265.091? -246692.745 Calculate 29936-11.58. -346658.88 -1 times 0.01056099 -0.01056099 Work out -1 33736.3. -33736.3 Calculate 51876.82-0.2. -10375.364 -1520254-0.7 1064177.8 Calculate 0.23399445-8. -1.8719556 -11-3149076 34639836 0.078441 times -108 -8.471628 0.1124 times 409231 45997.5644 Work out -149797 * 0.287. -42991.739 Product of -2636 and -0.041031. 108.157716 What is -243 times -4632? 1125576 0.03 * -14607523 -438225.69 What is the product of 5 and 7395039? 36975195 What is -1497.51208 times 5? -7487.5604 34111871 3411187 Multiply 14 and -76.983. -1077.762 Calculate 5.7-6.24662. -35.605734 Multiply 11871.9 and 66. 783545.4 35516 times -0.134 -4759.144 Work out 1.58302 * -214. -338.76628 44.61193 8609.73 Calculate -0.1-495395. 49539.5 Multiply 96836 and -0.208. -20141.888 What is 20058 times 39.77? 797706.66 Work out -0.5 * 6.575326. -3.287663 What is the product of -1 and -26651734? 26651734 What is the product of -0.1 and -0.00681119? 0.000681119 -0.0386 times 35.57 -1.373002 What is -3 times -114135230? 342405690 What is the product of -2 and 3388552? -6777104 Work out 15868 * 267.5. 4244690 Multiply 676003462 and 5. 3380017310 -0.490.6001996 -0.294097804 Product of -1649.9 and 476.2. -785682.38 -0.007 0.33942123 -0.00237594861 What is the product of 394.41291 and 0.03? 11.8323873 Multiply 1818482 and -2. -3636964 Product of 45 and -26304. -1183680 Work out 0.02 * -3154.15874. -63.0831748 What is 0.140605 times -31? -4.358755 10157383 * 0.1 1015738.3 1.1877 * 6 7.1262 What is 23408 times -119? -2785552 Work out -6478 * 0.38707. -2507.43946 Work out -59 * -603428. 35602252 -0.07679 * 458 -35.16982 What is the product of -16.091 and -1539? 24764.049 Calculate 2.7576912. 33.09228 Work out 479.3 0.0119. 5.70367 118 * 55836 6588648 Multiply 4.51 and 3366.4. 15182.464 Product of -0.027978 and 3365. -94.14597 21.364684 1377769.2 3240879 -34 -110189886 What is the product of 5 and 33367.59? 166837.95 206010 * 9.5 1957095 Multiply 14452822 and -3. -43358466 What is 9.9 times 154857? 1533084.3 0.18 times -7.35869 -1.3245642 Work out -607110 * 444. -269556840 Work out -2503010 * -0.47. 1176414.7 Product of 74 and -0.90158. -66.71692 What is the product of 4.67604 and -0.18? -0.8416872 What is -325284.77 times -0.2? 65056.954 Work out -1194548 * 1.6. -1911276.8 1.16 * 2628276 3048800.16 Calculate 3301.43-3.4. -11224.862 -5.8037 times -6.9 40.04553 Multiply -0.058527 and -14. 0.819378 Multiply 0 and 0.190327. 0 What is 73554 times 21? 1544634 Work out -0.0576435 0.3. -0.01729305 Product of -117664 and -186. 21885504 Multiply 0.044 and -165777. -7294.188 114347-78 -8919066 16615217 0.28 4652260.76 Work out -0.4 * -351613.4. 140645.36 Calculate -0.12763.824. -91.65888 What is 0.00060908 times -3? -0.00182724 What is the product of -426.43 and 565? -240932.95 9.2947-286 -2658.2842 Product of 0.3 and 56461411. 16938423.3 What is the product of 0.06 and 345480? 20728.8 -485.86 times 895 -434844.7 Product of 0.2 and 1277.1008. 255.42016 Work out 0.4 * -3339984. -1335993.6 Multiply -0.53 and -0.396205. 0.20998865 Work out 1.4 * 10922224. 15291113.6 -46632302 * 4 -186529208 -2.288 times -2.366 5.413408 Multiply -0.8 and -1902482. 1521985.6 0.524098222.4 12049111.2 Work out -0.29 12604.4. -3655.276 -1.18-0.0465354 0.054911772 -54.354052 -0.03 1.63062156 What is 195667.6 times -1? -195667.6 -0.09224813 -443.7586 -7947002 2 -15894004 Multiply 1 and 523.907. 523.907 What is 10 times 0.02335591? 0.2335591 What is -0.2 times -583682.7? 116736.54 What is the product of 0.2 and 297.5631? 59.51262 -6399893 times 3.4 -21759636.2 2170.6 * -219 -475361.4 4923351-4 -19693404 What is the product of -298713 and -8.1? 2419575.3 What is -6.27864 times 1.7? -10.673688 -97610113 times 1 -97610113 Product of 18744 and 8125. 152295000 What is the product of 51.55 and -2451? -126349.05 637835572 times -0.3 -191350671.6 What is 166.068 times -92.3? -15328.0764 Work out -3110 2.15. -6686.5 70235.14 times -15 -1053527.1 What is the product of -0.1267 and 11257.8? -1426.36326 Calculate -1.61.7170066. -2.74721056 Product of 1.134 and -1075. -1219.05 What is the product of -409 and -702930? 287498370 Calculate 29200054.3. 15855600 -139135 times 62 -8626370 Product of -26 and -717626.4. 18658286.4 Multiply 19.37 and 2482. 48076.34 What is the	{ "pile_set_name": "DM Mathematics" }
6, g = 4r + r + 8. Let b be ((-8)/g)/(2/3). Let k be (0 + b - 2) + 7. Let u(i) = 7i - 1. What is kq(j) + u(j)? j - 1 Let a(p) = -93p + 5. Let o(w) = -5720w + 308. Determine -308a(b) + 5o(b). 44b Let z(m) = 7m3 + 6m*2 + 6m - 4. Let g(w) = -w3 - w2 - w + 1. Let l be -3 + (-5)/(15/(-6)). Calculate lz(r) - 4g(r). -3r3 - 2r*2 - 2r Let v(g) = -2g2 - 3g - 3. Let l(x) = -6x2 - 10x - 10. Calculate 6l(f) - 20v(f). 4f2 Let r(u) = u + 9. Let h(x) = -8. Calculate 6h(b) + 5r(b). 5b - 3 Let a(b) = -b. Let q(h) = -h*2 + 2h + 25. Let i be q(-4). Let x(j) = 2j + 1. Calculate ix(m) + 4a(m). -2m + 1 Let z(w) = w*3 - 3w*2 - 6w. Let p(l) be the third derivative of l*5/30 + 5l*4/24 - 6l*2. What is 3p(s) + 2z(s)? 2s*3 + 3s Let k(v) = -v*2 - 1. Let q(g) = 10g*3 + 20g*2 + 20. Give 20k(s) + q(s). 10s3 Let c(t) = t2 + 4t + 30. Let m be c(-5). Let p(u) = 5u3 + 2u*2. Let k(n) = 84n*3 + 35n*2. What is mp(o) - 2k(o)? 7o*3 Let f(j) = -2j*3 + 2j*2 + 2j - 1. Let b(x) be the first derivative of -3x4/2 + 2x*3 + 7x*2/2 - 3x - 4. Calculate -2b(d) + 7f(d). -2d3 + 2d*2 - 1 Let f(w) = -w + 9. Let t(n) = 4. Let p(s) = 4f(s) - 7t(s). Let v(a) = -a + 2. Let l be 3/(-4)-62. What is lv(y) - 2p(y)? -y + 2 Suppose -2j + 24 = -3p, -4j + p + p + 32 = 0. Let d = 14 - 10. Let i(l) = -9 - d - 2 - 17l. Let h(n) = 8n + 7. Determine ji(v) + 13h(v). 2v + 1 Let r(i) = -2i - 1. Let p(z) = -5z - 1. Let w(d) = -6d - 1. Let j(x) = 4p(x) - 3w(x). Calculate 4j(c) - 3r(c). -2c - 1 Let w(b) = -9b*2 + 10b + 2. Let a(u) = 7u2 - 9u - 2. Determine 4a(o) + 3w(o). o*2 - 6o - 2 Let n(w) = -w*2 + 7. Let u(m) = 3. Let o(s) = 0 - 3 - 5. Let q(x) = 4o(x) + 11u(x). Let k(y) = -y2 + 10y - 11. Let g be k(9). What is gn(t) + 14q(t)? 2t2 Let d(q) = -8q*2. Let x(p) = -15p*2. Calculate -11d(u) + 6x(u). -2u*2 Let a(b) = -b + 1. Suppose 2o = 5f - 6 - 1, -4f = 5o + 1. Let x(k) = -3k - 1. Let y be x(-1). Let i(g) = g - 1. Calculate fi(l) + ya(l). -l + 1 Let c be 32/10 + (-4)/20. Let a(g) = -cg + 9g - g - 4. Let n = 3 + -8. Let f(w) = -6w + 5. Give na(b) - 4f(b). -b Let c(y) = -1. Let d(f) = f - 2. Let x(g) = 2c(g) - d(g). Let v(s) = 2s2 + 2s. Determine v(p) + x(p). 2p2 + p Let s(f) = -2f3 - f2. Let z(k) = -k*2 - 1. Let r(a) = 3a - 20. Let o be r(7). What is os(j) - 2z(j)? -2j3 + j2 + 2 Let z(h) = 2h - 1 - h + 0h + h. Let l(r) be the third derivative of r4/24 - 3r*2. Calculate -4l(q) + z(q). -2q - 1 Suppose -4s - s - 2n - 21 = 0, 10 = 5n. Let w(v) = 3v3 + 5v*2 + 4v - 3. Let z(j) = -2j3 - 4j*2 - 4j + 2. Calculate sz(c) - 4w(c). -2c3 + 4c + 2 Let c(t) = -5 + 6t - 7t - 2t. Let s(w) = -4w - 6. Determine 6c(o) - 5s(o). 2o Let m(h) = -h2 + 3h + 3. Let g(n) = n*2 - n - 1. Give -12g(s) - 4m(s). -8s*2 Suppose 0 = 4a - 3u - 11 - 22, 4a = -3u + 15. Let c(w) = 6w - 3. Let d = -49 - -32. Let m(z) = 2z - 1. Calculate ac(f) + dm(f). 2f - 1 Let l(b) be the second derivative of 5b4/12 + 4b. Let s(g) = g*2. Give -2l(q) + 11s(q). q2 Let g(v) = -6v - 34v3 + 32v*3 + 7v*2 - 4 + 4. Let c = 6 + -1. Let i(y) = -2y*3 + 6y*2 - 5y. Let b be -2 - (-1 - 3/(-1)). Give bg(j) + ci(j). -2j3 + 2j*2 - j Let z(c) = -4c*3 - 22c - 3. Let w(q) = 11q3 + 66q + 8. Determine 3w(v) + 8z(v). v*3 + 22v Let m be (6/(-14))/(37/(-777)). Let t(d) = -8d3 - 9d*2 - 5. Let l(j) = 4j*3 + 4j*2 + 2. Determine ml(c) + 4t(c). 4c3 - 2 Let z(r) = r2 - r. Let n(y) = -6y3 + 2y*2 - 7y - 4. Let g(s) = 7s3 - 2s*2 + 8s + 5. Let p(k) = 4g(k) + 5n(k). Calculate p(f) - 3z(f). -2f3 - f2 Let d(b) be the first derivative of -7b2/2 - 4b + 34. Let g = 5 - 13. Let w(x) = 11x + 6. Calculate gd(j) - 5w(j). j + 2 Let g(h) = 2h - 23h2 - 23h*3 + 5h + 16h - 3h. Let s(n) = -8n3 - 8n*2 + 7n. Calculate -6g(m) + 17s(m). 2m3 + 2m*2 - m Let i = -17 + 23. Let m = i + -12. Let q(u) = -4u + 2. Let n(c) = -11c + 6. What is mn(a) + 17q(a)? -2a - 2 Let k(b) = -8b + 5. Let c(h) = -h + 1. Let u(x) = -4c(x) + k(x). Let p = -17 + 25. Let d(l) = 13l + 8l - 3 - pl. Calculate 2d(j) + 7u(j). -2j + 1 Let p(w) = -8w + 2. Let s(h) = 15h - 3. Let k(o) = -7p(o) - 3s(o). Let f(n) = -5n + 2. Give 9f(g) + 4k(g). -g - 2 Let i(s) = s3 - 3s*2 - s + 3. Let c be i(3). Let n = c + -3. Let k(g) = -4g - 3. Let o(r) = 7r + 5. Calculate no(h) - 5k(h). -h Let c(a) = a2 + 2a - 2. Let w be c(-3). Let g(x) = -x - 1. Let k(q) be the first derivative of q*3/3 + q - 198. Give wk(p) - g(p). p2 + p + 2 Let a(k) = -k3 + 14k2 - 13k + 2. Let w be a(13). Let t(u) = 4u - wu + u + 2u. Let p(v) = -5v - 3v + 2v. Calculate 4p(i) + 5t(i). i Let z(g) = -g. Let l(k) = 6k + 2. Suppose -3o - 3v + 12 = -6v, 0 = -2v. Let n = 6 - 5. Give nl(w) + oz(w). 2w + 2 Let m(h) = 7h + 5. Let f(t) = 3t + 2. Let b be 4/(-3)12/(-8). Calculate bm(s) - 5f(s). -s Suppose -3p + 72 = 66. Let f(i) = i + 1. Let x(q) = 4q + 3. Let g(d) = 3f(d) - x(d). Let w(a) = -a. What is pg(c) - 3w(c)? c Let h(n) = -17n2 + 4n - 4. Let z(w) = -51w2 + 11w - 11. Calculate -11h(p) + 4z(p). -17p2 Let q(g) = -7g + 4. Suppose 3f + 10 = -2x - 0, -4x - f = 30. Suppose 3a - 6 = 3z, -4z - 16 = -2a - 2. Let w(i) = 11i - 6. Determine xq(l) + zw(l). l - 2 Let d(x) = -x*2 - x. Let s(r) = 6r*2 + 6r. Let w be 4/(-24) + 85/6. Give wd(h) + 2s(h). -2h2 - 2h Let i(m) = -m*3 + 3m*2 - 3m - 2. Let o = -20 - -25. Let c(z) = 2z - 1 - 3 - 2z*2 + o + 0z. What is -3c(x) - 2i(x)? 2x3 + 1 Let m(a) be the second derivative of -1/2a*3 + 0 + 9/20a*5 + 0a*4 + 7/2a*2 - 4a. Let z(y) = 4y3 - y + 3. Determine 2m(w) - 5z(w). -2w*3 - w - 1 Let v(o) = 2o - 2. Let j = 125 - 111. Let k(d) = -10d + 10. Calculate jv(g) + 3k(g). -2g + 2 Let w(n) = 3n3 + 2n2. Let h(b) = -b3 + b*2 - 1. Give -2h(d) + w(d). 5d3 + 2 Suppose -6i - 12i = -72. Let b(q) = -2q*3 - 4q*2 - 4q - 5. Let y(l) = -2l3 - 5l*2 - 5l - 6. Give iy(d) - 5b(d). 2d3 + 1 Let y(u) = 4u*3 - 2u*2 - 2u + 1. Let z(p) = 21p3 - 11p*2 - 11p + 6. Determine 11y(s) - 2z(s). 2s3 - 1 Let y(v) = -v3 + 3v*2 - 1. Let q be y(2). Let x(b) = 16 + 8b*3 - 2b*q + 19b*2 - 3b2. Let w(t) = -t3 - 3t2 - 3. Calculate -16w(u) - 3x(u). -2u*3 Let f(m) = 67m - 3. Let k(q) = -45q + 2. Determine -5f(h) - 7k(h). -20h + 1 Suppose 4w - 4f = -4, 5w + 0f - 1 = -f. Let k(j) = j - 3 + 3j + w. Let o be 12/(-1) + -2. Let l(p) = 5p - 4. Calculate ok(q) + 3l(q). -q Let y = -18 + 22. Let q(j) = -2j*2 + j + 2. Let t(b) = b. Calculate yt(s) - q(s). 2s2 + 3s - 2 Let x(h) be the third derivative of -h*6/120 + 7h*5/60 + 7h*4/24 - 7h*3/6 - 8h2. Let c(z) = -z3 + 6z2 + 6z - 6. What is -7c(k) + 6x(k)? k3 Let s(a) = a2 + a + 1. Let h(w) = -21w2 - 5w - 5. Determine h(z) + 5s(z). -16z*2 Let i(q) = 5q + 1. Let d = -3 + 0. Let t(p) = 1. Let l(z) = -9z - 4. Let h(k) = -l(k) - 2t(k). What is dh(m) + 5i(m)? -2m - 1 Let a(u) = u2 + 4u + 1. Let j be a(-3). Let t(m) = 4m2 + 4m + 3. Let g(w) = -5w2 - 5w - 4. Let r = -30 + 27. Determine jg(z) + rt(z). -2z2 - 2z - 1 Let x(t) = 7t2 - 2t + 2. Let c(o) = 29o2 - 9o + 9. Suppose -3u - 31 = -2v, -2u - 3u + v - 47 = 0. What is ux(z) + 2c(z)? -5z2 Let a(b) = -2b - 15. Let q(y) = 2y + 14. Calculate 3a(p) + 4q(p). 2p + 11 Let y(i) = -16i2 + 10i - 118. Let b(f) = -5f2 + 3f - 39. Give -10b(c) + 3y(c). 2c2 + 36 Let m(d) = 4d - 7. Suppose 11 + 4 = 5g. Suppose 14 = gh - h. Let q(y) = -3y + 5. What is hq(k) + 5m(k)? -k Let z(w) = 5w*3 + 2w*2 - 7w. Let t(v) = 9v3 + 4v*2 - 14v. What is -6t(x) + 11z(x)? x*3 - 2x*2 + 7x Let v(m) = -m - 1. Let c(k) = 2k + 4. Let x = 13 + -10. Give xv(n) + c(n). -n + 1 Suppose 0 = 2m - 17 + 5. Let j(b) = 9b*2 - 11b + 7. Let x(c) = -5c2 + 6c - 4. What is mj(i) + 11x(i)? -i2 - 2 Let y(v) = -v2 - 2. Let g(i) = i*2 + 1. What is 5g(o) + 2y(o)? 3o*2 + 1 Let a(w) = 15w*2 + w - 13. Let k(g) = -4g**2 + 3. Let f(	{ "pile_set_name": "DM Mathematics" }
= 10g + 116. What is the remainder when w is divided by g? 28 Let g(d) = -75d - 97. What is the remainder when g(-3) is divided by (-160)/(-6) - (-2 + 48/18)? 24 Let w(y) = -y*3 - 5y*2 - 68y - 285. What is the remainder when 789 is divided by w(-5)? 19 Calculate the remainder when 576 is divided by 9/33-2 - 99524/(-1969). 26 What is the remainder when 199 is divided by 7/(-1) - (-1 + -455)/19? 12 Suppose -5z + 127 = 2b, -17b = -4z - 15b + 80. Calculate the remainder when 1653 is divided by z. 20 Let r = -233 - -502. Let z = r - 142. What is the remainder when z is divided by 48? 31 Let h = 192 + -198. Calculate the remainder when 4/h - 7554/(-18) is divided by 30. 29 Let s(c) = 3c2 + 3c - 5. Let i be 1 + -1 + (-3 - 3). Calculate the remainder when s(i) is divided by (52/26)/((-1)/(-12)). 13 Calculate the remainder when 1446 is divided by (-327)/(-109)(4 + 152/12). 46 Suppose 45f - 34314 = -47f + 5522. Calculate the remainder when f is divided by 201. 31 Suppose -17i + 5043 = 5i + 19i. What is the remainder when i is divided by 5? 3 Let a(d) = d*3 - 17d*2 - d - 160. Calculate the remainder when 768 is divided by a(18). 38 Let i = 128 - -51. Suppose -30g + 1363 = -5g + 4g. Calculate the remainder when i is divided by g. 38 Let x(m) = -m*3 - 10m*2 - 61m - 461. What is the remainder when 467 is divided by x(-9)? 5 Calculate the remainder when 856 is divided by ((-108)/(-20))/((-30)/(-100)). 10 Suppose 5g + a = 204, g - 44 = 4a - 20. Suppose -5m - 8m = -1911. Calculate the remainder when m is divided by g. 27 Suppose 0 = j - 2d - 8, d = -3j + 3. Suppose -2a + j = -2. Suppose ab + 13 = 3b. Calculate the remainder when 48 is divided by b. 9 Calculate the remainder when 553 is divided by ((-2748)/96)/(2/(-16)). 95 Suppose 2t + 31 = -2i - 19, 3t - 2i + 100 = 0. Calculate the remainder when (12/10)/((-15)/(-2750)) is divided by 4/t - 842/(-15). 52 What is the remainder when 1202 is divided by 24 + -15(-3382)/285? 192 Suppose 30x - 10x + 120 = 0. Calculate the remainder when 124 is divided by 9 + 140/6 - 4/x. 25 Let n be -2(4 + 90/(-12)). Suppose -50 = -na - 3a. Calculate the remainder when a is divided by (-6)/10 + (-13)/(-5). 1 Calculate the remainder when 517 is divided by (34/4)/(45/90). 7 Let q be 0 - 21/(-1). Suppose -c = -3p + qp - 2, -31 = 5p + 2c. Let h(g) = g*3 + 8g*2 + 9g - 8. What is the remainder when 85 is divided by h(p)? 19 Let j(u) = 44u2 + 3u - 3. What is the remainder when 172 is divided by j(1)? 40 Calculate the remainder when 24 + 31 - -9(-6)/9 is divided by 8. 1 Let b(d) = -16d - 374. What is the remainder when 28 is divided by b(-24)? 8 Calculate the remainder when 1021 is divided by (-14)/(-20)6 - (-185)/(-925). 1 Suppose 429 = 7y - 915. Suppose -22t = -6t - y. Calculate the remainder when 56 is divided by t. 8 Let y(h) = -h*3 + 22h*2 + 2h - 26. Let n be 99/(-6)(3 + (-11)/3). Suppose -3v - 176 = -nv. Calculate the remainder when 47 is divided by y(v). 11 What is the remainder when 9/(-6)1(-6916)/78 is divided by 108? 25 Calculate the remainder when 591 is divided by 32/(-20)(-19)/(190/100). 15 Let b = 8 + 3. Suppose 459a - 5320 = 326a. What is the remainder when a is divided by b? 7 Suppose -3y = 3y + 6. What is the remainder when 1545/12 + 9/(-12) is divided by (6/y)/(-3)(-43)/(-2)? 42 Suppose -4 = -2l - 0l. Suppose -14 = -0k - lk. What is the remainder when -5 - -2 - -7 - -8 is divided by k? 5 Let o(i) be the second derivative of i5/20 - i4/12 - i3/6 + i2 + 14i. What is the remainder when (-1 - -1) + 10 + -2 + -1 is divided by o(2)? 3 Suppose 5w = -9t + 10t + 3, 3w - 11 = -4t. Suppose tc - 10c = -1472. What is the remainder when c is divided by 31? 29 Suppose 0 = 2l + 5x - 43, l - 4l = -2x - 74. Suppose 8r = 14r - 1284. Calculate the remainder when r is divided by l. 22 Let u(n) = 0n - 9 + 3 - 7 - 3n. Suppose 661 + 935 = 42g. What is the remainder when g is divided by u(-11)? 18 Let s(o) = 44o2 + o + 1. Let y be s(-1). Let n = y + -30. Let q(x) = -x3 - 24x2 - x + 31. Calculate the remainder when q(-24) is divided by n. 13 Let d = 114 + -78. Let i(k) = k2 - 90k + 1762. Calculate the remainder when i(66) is divided by d. 34 Let q = 177 - 147. Suppose 0 = qb - 3b - 1377. What is the remainder when b is divided by 22? 7 Let z(j) = 13j + 17. Let l be z(-1). Suppose -h = -lm + 311, 3m + 4h - 9h = 246. Calculate the remainder when m is divided by 27. 23 Let u be 5/(-3)240/(-50). Calculate the remainder when (7 - -172) + (u - 1) is divided by 39. 30 Let k be 496/2 + (0/2 - 2). Suppose 8y - k = 7y - 4p, 2p = y - 264. What is the remainder when y is divided by 37? 36 Suppose 14h = 30h - 895 - 849. Let b(z) = z3 + 6z*2 + z. What is the remainder when h is divided by b(-4)? 25 What is the remainder when 658 is divided by -2 - 10 - (-51 - -7)? 18 Suppose 0 = 6s + 4h - 686, -2h - 217 = -4s + 231. What is the remainder when s is divided by 53? 7 Suppose 4o - 2y - 236 = 0, -300 = -5o + 36y - 31y. Calculate the remainder when 3484 is divided by o. 4 Suppose 0 = -2t - 14p - 12, 5t + 61 - 139 = p. Suppose 0k = -3k. Suppose k = 4m + m - 45. What is the remainder when t is divided by m? 6 Let n = 9208 + -9113. Calculate the remainder when 260 is divided by n. 70 Suppose 4b + 5c - 3592 - 874 = 0, 4b - 2c - 4480 = 0. Calculate the remainder when b is divided by 23. 15 Let y(t) = 17t - 1218. What is the remainder when 746 is divided by y(78)? 98 Let b = -33415 + 33498. What is the remainder when 315 is divided by b? 66 Suppose 0 = -19s - 9s + 140. Suppose -3y = 4b - 221, -42 = 2b + sy - 135. Let c = 20 + 1. Calculate the remainder when b is divided by c. 17 Suppose 0 = -t - 4c + 47, -2c = t + 6 - 43. What is the remainder when 69 + -2 + 1 - (-5 - -1) is divided by t? 18 Let r = -43297 - -44267. What is the remainder when r is divided by 81? 79 Suppose -4 = -3l + 5. Let b(n) = n*2 - 2n + 4. What is the remainder when ((-68)/(-17))/(-2 - -16) + (12825/(-21))/(-15) is divided by b(l)? 6 Let z = -1681 + 1693. Calculate the remainder when 177 is divided by z. 9 Let n(k) = -13623k + 13622k + 61 + 42. What is the remainder when n(0) is divided by 24? 7 Let t = 42 + -49. Let p(v) = v*3 + 6v*2 - 10v - 21. Let x be p(t). What is the remainder when x + 666/10 - (-2)/5 is divided by 14? 11 Let j(g) = 2g - 50. Let i be j(9). Let x = i - -52. Calculate the remainder when (0 - (-3)/(-2))-36 is divided by x. 14 Let z be (20 - -13)(8/6 - 2). What is the remainder when z/(9 + 448/(-49)) is divided by 10? 4 Let u = 450 + -342. Suppose 3f - 5d = 135, 3f - 7d + 11d - u = 0. What is the remainder when 114 is divided by f? 34 Suppose -4v - 12r + 51 = -7r, -5v + 30 = -5r. Let j = -507 + 551. What is the remainder when j is divided by v? 8 Let t = -34 + 74. Suppose -37l - 36 = -tl. Let u = 29 + -11. Calculate the remainder when u is divided by l. 6 Let q(n) = n3 - 26n*2 - 153n + 21. Calculate the remainder when 285 is divided by q(31). 36 Suppose 178q - 2505 = 11q. Suppose 45 = 4y - 291. Calculate the remainder when y is divided by q. 9 Suppose 7r - 2r - 129 = -3h, 5h = -2r + 63. Calculate the remainder when (-2)/9 - 107088/(-1242) is divided by r. 14 Let r = 455 - 426. Suppose -26t - 462 = -rt - 3n, -5n - 184 = -t. Calculate the remainder when t is divided by 41. 36 Suppose 9 - 12 = -u - y, -4u + 12 = -2y. Let z(m) = -2m + 12 - m + 5m - 5m. Calculate the remainder when 13 is divided by z(u). 1 Suppose -5180 = -35o + 7o. Suppose -o = -18h + 157. Calculate the remainder when 54 is divided by h. 16 Suppose -7310j = -7273j - 222. Calculate the remainder when 20 is divided by j. 2 Suppose 101m = 106m - 2400. Suppose -7l + 10 + m = 0. Calculate the remainder when l is divided by 25. 20 Let y(m) = -2732m - 16162. What is the remainder when 1345 is divided by y(-6)? 195 What is the remainder when 197 is divided by 13 - 13 - (5 - 833/7)? 83 Let v = 6 - -12. Let g = -48 - -108. What is the remainder when v is divided by 5 + g/(-6) + (15 - -4)? 4 Let a be 3/((-3903)/489 - -8). Let l = a + -157. What is the remainder when 15 is divided by l? 3 Suppose 5v + 2	{ "pile_set_name": "DM Mathematics" }
) = -q*2 - 5q - 5. Let v be x(-4). Which is the closest to 0? (a) v (b) d (c) u a Let l be 0 + (6 - 0) + -1. Let w = -0.16 + 20.16. Let p = 23 - w. What is the nearest to 0 in -4, l, p? p Let x = -163 - -159. Which is the closest to 0? (a) x (b) -22 (c) 5 a Suppose 18v = -18 - 36. What is the nearest to 22.3 in -2/5, v, 0.2? 0.2 Suppose -2k - 2k = -5g + 21, 0 = -5k - 3g + 20. Let u = 0.017 - 6.617. Let l = 7 + u. Which is the nearest to k? (a) 3 (b) l (c) -0.5 b Let l be 2/(-54)3 + (-4767)/(-17550). Let n = -1/150 + l. Let g = -0.9 - -1. What is the closest to 1/4 in g, n, -1/3? n Let s = 0.01 - -0.05. Let m = s + 3.94. Let h = 2.5 + -3.5. Which is the nearest to -1/2? (a) 0.3 (b) h (c) m b Let u = -6 - -11. Let g = 2.1 - 1.1. Let x = 1.3 - g. Which is the nearest to -1? (a) x (b) u (c) 0 c Let j = -111 - -111.1. Which is the closest to 1/2? (a) j (b) -9 (c) -3/7 (d) -0.1 a Suppose 9 = -3r, -14 + 65 = -5y + 3r. Let n be 8/y(-30)/(-4). Let s = -2.1 + 2. Which is the nearest to s? (a) 1 (b) 3 (c) n a Suppose -10p + 50 + 0 = 0. Which is the closest to 39? (a) 0.1 (b) p (c) -3 b Let t be (9/8 + -1)(-276)/(-46). Let n = -4.8 + 0.8. Which is the nearest to t? (a) 0.2 (b) 0.4 (c) n b Let k = -616 + 616.06. Which is the closest to -0.1? (a) k (b) 0.2 (c) 2 (d) 0.1 a Let r(u) = -4u + 12. Let s be r(3). Which is the closest to s? (a) 2 (b) -4 (c) -14 a Suppose -3o - 5p - 30 = -8, -o + 2p = 0. What is the nearest to 0.1 in 1, 0.2, o, -0.29? 0.2 Let b = 3 - 3. Let a = 1 - b. Let t = 0.032 + -1.032. What is the closest to t in a, 0, 2/3? 0 Let x = 0 - 3. Let r be (-6054)/5355 - 8/(-12). Let m = -3/85 - r. Which is the closest to 0? (a) x (b) -5 (c) m c Suppose 3c + 3 = -6. Let v(f) = f*3 + 12f*2 + f + 8. Suppose -w + 8 = -z - 3w, 5w + 2 = -z. Let a be v(z). What is the nearest to 0.1 in c, 0.3, a? 0.3 Let q be 2/(-5) - (-8)/10. Let s = -11 + 21. Let j = 9 - s. What is the nearest to j in q, -3, -1? -1 Let m be (-74)/12 - (-1 - 5). What is the closest to -1 in 4, 2/5, m, 0.2? m Let g = -1054 + 1053. Let m = -1 + 1. What is the nearest to m in 0.5, g, -2? 0.5 Let b = 6.85 + -6.85. What is the nearest to -15 in -5, 0.2, 2, b? -5 Let v = 24.95 + -25. Let f = v + -1.95. Let s = -2.3 - f. What is the closest to 1/4 in -0.1, -1/3, s? -0.1 Let g = 126/5 - 26. Let z = 99/2 - 49. Which is the nearest to 4? (a) g (b) -3/7 (c) z c Let n be -5 - 9/(-22)(-1400)/(-105). What is the closest to n in -1/10, 0.3, 4? 0.3 Let i = -178 - -1598/9. Let q = -156 + 152. Which is the closest to 1? (a) i (b) 2 (c) q b Let w = 152 - 607/4. Which is the closest to -0.1? (a) -4 (b) w (c) -3/14 c Let x be 8/(-32) + (-6)/(-8). Let y = 156/5 + -31. Let q = -5.1 + 10.1. What is the closest to x in y, q, -6? y Let s = -287.9 - -288. Let j(x) = x*2 + 4x - 5. Let i be j(-4). Let d = i - -6. What is the closest to s in d, 3, -0.2? -0.2 Suppose -3d + 3 = -4w - 3, 4d = -4w + 36. Let s be ((-52)/(-8) - d) + 22/(-28). What is the closest to s in -1/3, 3, -3? -1/3 Let r(i) = -i*3 - 9i*2 + 10i + 2. Suppose 4z = -48 + 8. Let a be r(z). What is the closest to 5 in -1, a, 3? 3 Let y(n) = n3 - n2 - n + 1765. Let x be y(0). Let s = x - 660. Let v be (-4)/26 + (-272)/s. Which is the closest to 2/5? (a) v (b) -2/13 (c) 5 b Let j = -2454.5 + 2454. What is the nearest to -6 in j, -0.4, -0.3, -1.2? -1.2 Let y = 672 + -671. What is the nearest to -0.1 in 0.2, -50, y, 0? 0 Let l = -54 + 59. Which is the closest to 2/7? (a) l (b) -1 (c) 9 b Let p = -0.598 + -0.402. Suppose -z = -2z + 10. Suppose -3d - z = 2d. Which is the closest to p? (a) 3 (b) 5 (c) d c Suppose -5w = -5x + 70, 4x - 4w - w - 56 = 0. Suppose -k = -3k + 6, k + 1 = -4t. Which is the nearest to -1? (a) x (b) t (c) 1/3 b Let x = -24 - -42. Let n = x + -18.4. Let u = -3.2 - -0.2. Which is the closest to n? (a) 1/3 (b) u (c) -1 c Let u = 4.7827 - -0.2173. Which is the closest to 0.1? (a) u (b) 2 (c) -7 (d) 3 b Let u = 271 + -269. What is the closest to 1 in 5, u, 3? u Let s = 13 - 7. Let x = s + -6.4. Let v = -12 + 10. What is the closest to -1 in v, x, -0.5? -0.5 Let g be 1 + 3 - (0 + -1). Let n = 56 - 53. Let w = -117.3 - -117. Which is the nearest to -1? (a) w (b) g (c) n a Suppose -3 - 21 = -2t. Suppose -2r = 5c + 4 + 2, c = 5r - t. Let i = -1.2 - -0.2. What is the nearest to 2 in r, i, -5? r Let w = -3219 - -3218. Let x = 1/14 - -9/70. What is the nearest to w in 4, 0.07, x? 0.07 Let w be ((-18)/63)/(20/(-30)). Let t = 4 - 3. What is the closest to 0 in 5/4, t, w? w Let i = 544 + -539. Which is the closest to i? (a) -0.5 (b) -5 (c) 3/7 c Let g be -1 + (0 - 0) - 0. Let i = -0.55 + -53.45. Let s = i + 53.6. What is the nearest to g in 1/3, s, -1/4? s Let w be ((-7)/14)/(1/(-58)). Let t be w/(-104) - 8/(-52). Let j = -497/60 + 41/5. Which is the nearest to -1/2? (a) -1/5 (b) j (c) t a Suppose -2a - 19 = -3. Let v be (-100)/(-28) - a/(-14). What is the closest to -2/5 in -5, v, -3/2? -3/2 Let g = -0.765 + -0.235. Let y = 6 - 5.95. Let m = y + -0.25. Which is the nearest to g? (a) m (b) 0.1 (c) -0.5 c Let d = 0.203 + -6.203. Which is the nearest to d? (a) -3/11 (b) -1/12 (c) 1 a Suppose 2d - 4d = 4. Let n = -445 - -438. Which is the nearest to 0.1? (a) d (b) n (c) 2/9 c Let u = -3.17 + 0.17. Let y(z) = z + 8. Let l be y(-6). Suppose -d + 3t = d + 17, 4t - 18 = -ld. Which is the nearest to d? (a) 4 (b) u (c) -4 b Let q(f) = -2f2 + 49f + 135. Let g be q(27). Which is the nearest to -2? (a) -3 (b) 0.03 (c) 0.2 (d) g a Let n = 28.414 + -28.8. Let m = n + 0.086. Let g = -4 - -1. Which is the closest to g? (a) -3 (b) 3 (c) m a Let u = 0.3 + 0.2. Let d = 1 - u. Let t be 588/(-945) + 2/9. Which is the nearest to t? (a) 1/3 (b) d (c) 1/4 c Let k = -16.99 - -13.99. Which is the nearest to 20? (a) k (b) 0.1 (c) 4 (d) -7 c Let g = -19 - -19.23. Let d = 0.07 + g. Let i = 13 - 15. What is the nearest to 2 in -1, d, i? d Let o be (-2)/(-16) + (-1407)/(-72) + -18. What is the nearest to 0.1 in 5, 3, o? o Let z be (2 + -3)/((-50)/30). What is the closest to -11 in -1, z, -0.1, -1/6? -1 Let i = -168 + 151. What is the closest to -0.1 in i, 1/9, -2, 0.5? 1/9 Let f = 22.9 - 23. Let t = 55 + -55.2. What is the closest to 2/35 in -1/3, t, f? f Let i = -0.092 + 2.092. Let m = i + -4. What is the nearest to m in -0.4, 1/4, 6? -0.4 Let k = 0.43 - 0.03. Let i be (1 + 0)(-2 - -3). Let j = i + -2/5. What is the closest to 1 in 3, k, j? j Let f(n) = -13n + n - 5 + 10n - 20. Let i be f(-12). Which is the closest to i? (a) -0.2 (b) 5 (c) -5 a Let g = -42.6 - -46.6. What is the closest to 0.3 in g, -1, -0.4? -0.4 Let d = -54 + 80. Let p = -26.3 + d. Which is the closest to 3/7? (a) 3/7 (b) p (c) -3 a Suppose 0 = 3o + t - 10, 14 = -o - 2t + 6t. Let v = 1.396 - -1.604. Which is the closest to 1.4? (a) o (b) v (c) -2/7 a Let k = -475 + 473. What is the nearest to -2 in k, -2/17, -0.1? k Let m = 454.7 + -455. What is the nearest to -1 in m, -4/5, 25, 3/7? -4/5 Let p be 6/105(-5)/(-2)2. Let s = 0.8 + -1.5. Let d = -0.4 - s. Which is the nearest to 1? (a) 2 (b) d (c) p b Let p = 3 + -3.2. Let b = 18.6 + -18.5. Let k = -0.31 - -1.31. What is the closest to p in k, 5, b? b Let k = 488 - 488.1. Let g be (-44)/14 - -2 - -1. Let y(d) = -d*2 - 3d - 3. Let s be y(-2). Which is the nearest to k? (a) g (b) s (c) -1/3 a Let h = 1682/5 + -336. Which is the nearest to h? (a) -0.4 (b) -4 (c) -0.21 (d) 0.2 d Let h be (-1 + 1/(-2))322/(-483). Which is the closest to -1/2? (a) h (b) -10 (c) -1/10 c Let l = -0.62 + 0.6. Let j = -17 - -17.18. Let t = j - l. What is the closest to -2 in -0.1, t, -2/9? -2/9 Let h = -21.43 + 26.43. Which is the nearest to 2? (a) h (b) 3 (c) 0.1 (d) -3 b Let j = -1.3 - 3.7. Let c be (0(-8)/96)/(-5). What is the closest to c in -3, -4, j? -3 Let v = 0 - -1. Let q = 150.32 - -3.68. Let h = q + -157. What is the closest to v in -1, h, -5? -1 Let n = 0.2 - 0.3. Let g = -2.9 + n. Let q = -2 + 5. What is the closest to q in -0.1, 3/5, g? 3/5 Let i = 1397 - 1398. What is the nearest to i in -1, 1, 3/5, -0.19? -1 Suppose -372 = k + 3*k. Let o = k + 275/3. What is the nearest to 2 i	{ "pile_set_name": "DM Mathematics" }
, what is 3 + -22? -13 In base 6, what is 0 + -215? -215 In base 8, what is -51 - 4? -55 In base 2, what is 1101111 + 1010100? 11000011 In base 4, what is -3 - 10030? -10033 In base 7, what is 12 - -63? 105 In base 13, what is 65 - -1? 66 In base 5, what is -3 - -1101? 1043 In base 2, what is -1000100001 - -1000001? -111100000 In base 11, what is 36753 - 4? 3674a In base 3, what is -200 - 21? -221 In base 9, what is 1132 + 4? 1136 In base 14, what is -3 + 20? 1b In base 14, what is 1 - 32? -31 In base 15, what is -1e3 - -e? -1d4 In base 7, what is -103 - 6? -112 In base 12, what is -5 - -188? 183 In base 15, what is 2 - 88? -86 In base 9, what is -274 - -3? -271 In base 16, what is 1 + 1f5? 1f6 In base 6, what is 20 - -245? 305 In base 2, what is 11 + -1111011? -1111000 In base 2, what is -101 + 100100011? 100011110 In base 4, what is -1030 + 2? -1022 In base 2, what is -11001 - -11000? -1 In base 9, what is 2 + -256? -254 In base 13, what is -127 + 9? -11b In base 11, what is -7 - -2239? 2232 In base 8, what is 1 - 132? -131 In base 11, what is -1756 - -2? -1754 In base 5, what is 20 + 12? 32 In base 8, what is -152 - -4? -146 In base 3, what is 11 + 1022100? 1022111 In base 5, what is -1300 - -20? -1230 In base 5, what is 412 + 30? 442 In base 4, what is -2 + -1211321? -1211323 In base 2, what is -110 + 110111100? 110110110 In base 2, what is -1000 + -100101? -101101 In base 12, what is a5 + -12? 93 In base 11, what is 2 - a9? -a7 In base 4, what is 23 - 121? -32 In base 4, what is -1103 + 1102? -1 In base 7, what is -103 + 5? -65 In base 16, what is -1 + -e4? -e5 In base 10, what is 1769 - 1? 1768 In base 12, what is 460 + -34? 428 In base 2, what is 11 - -10? 101 In base 16, what is 9 - 2f4? -2eb In base 2, what is 10 - -100010? 100100 In base 15, what is 0 - 269d? -269d In base 11, what is 39 + 5? 43 In base 12, what is 4 + 178a? 1792 In base 8, what is 4 - -321? 325 In base 15, what is 3 + 27? 2a In base 3, what is 11 + -12211? -12200 In base 11, what is -3 + 1? -2 In base 5, what is -1 + 12203? 12202 In base 7, what is -26 - -2132? 2103 In base 9, what is 5 - 1525? -1520 In base 14, what is -5 - -cb? c6 In base 2, what is 1101 + 10111? 100100 In base 8, what is -3 + 60? 55 In base 15, what is 8c + 8? 95 In base 13, what is 2c + 27? 56 In base 12, what is 4 - -94? 98 In base 16, what is -2a7 - 6? -2ad In base 12, what is -5 + b? 6 In base 6, what is -430 - 2? -432 In base 15, what is -19 + d? -b In base 10, what is -70 - -2? -68 In base 15, what is 7213 - -5? 7218 In base 13, what is -2 - -b? 9 In base 16, what is 5 - -1c0? 1c5 In base 9, what is -36 + 300? 253 In base 12, what is 2 - 3222? -3220 In base 15, what is -5 + -101b? -1021 In base 13, what is -4a + 1b? -2c In base 6, what is 31 - 351? -320 In base 6, what is 10 + -1101? -1051 In base 6, what is 11 - 555? -544 In base 7, what is -1 + -3346? -3350 In base 11, what is 31 + 49? 7a In base 11, what is -183a + 4? -1836 In base 11, what is 1 - -1371? 1372 In base 12, what is -61 - 42? -a3 In base 4, what is -210 - 10? -220 In base 14, what is -d + 3? -a In base 15, what is -a + 20c? 202 In base 10, what is 0 + 424? 424 In base 15, what is 6 - 81? -7a In base 16, what is 79 - -4? 7d In base 8, what is 32 - -2? 34 In base 3, what is -1 + -210? -211 In base 9, what is 5 + 1347? 1353 In base 5, what is -40 + -2321? -2411 In base 7, what is 221 - -3? 224 In base 2, what is 1100011 - 101110? 110101 In base 9, what is -3 + -5150? -5153 In base 13, what is -258 - 3? -25b In base 16, what is -141 + -4? -145 In base 7, what is -2031 - 1? -2032 In base 9, what is -10 - -4218? 4208 In base 2, what is 1001001 - 0? 1001001 In base 13, what is 11 + 9? 1a In base 11, what is 7724 - -4? 7728 In base 4, what is 3 + -213220? -213211 In base 5, what is -3 - 114? -122 In base 12, what is 673 - 3? 670 In base 15, what is -2 - -9b? 99 In base 5, what is -22 + 10120? 10043 In base 3, what is 2020200 + -12? 2020111 In base 10, what is -3 - -788? 785 In base 9, what is -13 - -2? -11 In base 3, what is -2000120 + -1? -2000121 In base 6, what is 150054 + 4? 150102 In base 8, what is 27 + 76? 125 In base 4, what is 2 - -30103? 30111 In base 16, what is -5 - -3ff? 3fa In base 14, what is -8 - -42? 38 In base 4, what is -21123 + 1? -21122 In base 16, what is a + -1e? -14 In base 11, what is 77a3 - 4? 779a In base 3, what is -2211 - 10? -2221 In base 12, what is 2a + -30? -2 In base 4, what is -3122 - -2? -3120 In base 13, what is 5 - -56? 5b In base 12, what is 130 - -1? 131 In base 3, what is 2 + -11211002? -11211000 In base 13, what is 3bb + 2? 3c0 In base 13, what is 29 - -5? 31 In base 4, what is -2 - -202? 200 In base 2, what is 1010 + 1? 1011 In base 6, what is 214 - 5? 205 In base 7, what is -50 - 5? -55 In base 4, what is -32333 + 3? -32330 In base 4, what is 10310 - -11? 10321 In base 7, what is 1125 - 0? 1125 In base 4, what is -12210 + 0? -12210 In base 15, what is -7 - -7d? 76 In base 11, what is 684 - 5? 67a In base 5, what is -10 - -1121? 1111 In base 4, what is 12301 - 11? 12230 In base 15, what is -18 - -e? -9 In base 3, what is 110110222 + 0? 110110222 In base 4, what is -210 - 0? -210 In base 6, what is 2 - 411? -405 In base 6, what is -1 + 30231? 30230 In base 4, what is -321231 + -10? -321301 In base 6, what is -53 + 253? 200 In base 9, what is -3 + -168? -172 In base 15, what is -2 + -55? -57 In base 15, what is 36 + -83? -4c In base 16, what is -b2 - 1? -b3 In base 3, what is -2102 + 12? -2020 In base 9, what is 4 + -68? -64 In base 7, what is 160 - 60? 100 In base 3, what is 1111011 - 10? 1111001 In base 5, what is -103 - 10? -113 In base 5, what is 111344 - -2? 111401 In base 15, what is -5 - -19? 14 In base 13, what is 1 - -227? 228 In base 7, what is 565 + 3? 601 In base 10, what is -524 - 1? -525 In base 6, what is -5 - 1410? -1415 In base 6, what is -1101 - -4? -1053 In base 14, what is -104 - 12? -116 In base 12, what is 1a + 22? 40 In base 10, what is -1 + -897? -898 In base 5, what is 1 + 1043? 1044 In base 3, what is -12 - 120120? -120202 In base 5, what is 103 + 214? 322 In base 13, what is -5 + -42? -47 In base 8, what is -37 + -26? -65 In base 14, what is -6 - -137? 131 In base 13, what is 0 + -86? -86 In base 4, what is -11 - -103330? 103313 In base 4, what is -112113233 - 1? -112113300 In base 12, what is 4 - -2578? 2580 In base 8, what is 1417 - 12? 1405 In base 7, what is 26 - -1? 30 In base 5, what is 1410 - 2? 1403 In base 8, what is 7 + 216? 225 In base 6, what is 0 + -151? -151 In base 10, what is 127 - -1? 128 In base 11, what is 0 + 1210? 1210 In base 15, what is 0 - -81? 81 In base 7, what is -2 + -106? -111 In base 5, what is -14221 + 10? -14211 In base 4, what is -32320 - 2? -32322 In base 6, what is 1 - -113? 114 In base 6, what is -132 + -524? -1100 In base 4, what is 103 - 11? 32 In base 2, what is -101011110 - -11011? -101000011 In base 2, what is -11100100 - -11? -11100001 In base 10, what is 111 - 4? 107 In base 9, what is -716 + -3? -720 In base 4, what is 13023 - 2? 13021 In base 10, what is -3 - -1527? 1524 In base 6, what is 303 - -2? 305 In base 15, what is 1 + a4? a5 In base 4, what is 2 - 11300? -11232 In base 13, what is -292 - 0? -292 In base 5, what is -2110 + 2? -2103 In base 2, what is 1011110100100 - 11? 1011110100001 In base 6, what is 131 + -133? -2 In base 15, what is -dd7 - -4? -dd3 In base 15, what is 13a + -3? 137 In base 2, what is 11010001 - -1011? 11011100 In base 13, what is 6b1a + -2? 6b18 In base 2, what is 1110101 + 11100? 10010001 In base 11, what is -3 + -30? -33 In base 8, what is 167 - -5? 174 In base 8, what is 2007 - 5? 2002 In base 15, what is 359 - 0? 359 In base 13, what is -3 - 2cc? -302 In base 12, what is b56 + -5? b51 In base 9, what is -3 - -320? 316 In base 16, what is 2 - -b9? bb In base 8, what is 5022 - -5? 5027 In base 5, what is -110 + 0? -110 In base 3, what is -20002 + -1101? -21110 In base 11, what is -2053 + 1? -2052 In base 2, what is -11010 + 1? -11001 In base 6, what is -1 + 0? -1 In base 15, what is 367 - 3? 364 In base 7, what is 103 - 5? 65 In base 3, what is -1012022 + 0? -1012022 In base 8, what is 122 + -13? 107 In base 11, what is -2827 - 5? -2831 In base 9, what is -5 + 5182? 5176 In base 2, what	{ "pile_set_name": "DM Mathematics" }
ommon denominator of 3/23264 and -31/116320. 116320 What is the common denominator of 89/620380 and -26/1395855? 5583420 Calculate the lowest common multiple of 736 and 5312. 122176 What is the smallest common multiple of 7664 and 8992? 4307168 What is the common denominator of -53/23 and -63/39836? 39836 What is the common denominator of -1/49 and 127/7434? 52038 Find the common denominator of 103/13320 and 109/55680. 6180480 Find the common denominator of -21/1010426 and 1/22. 11114686 Find the common denominator of 21/12016 and -93/80. 60080 Calculate the common denominator of -7/34 and -25/101072. 1718224 What is the smallest common multiple of 11550 and 221550? 2437050 What is the least common multiple of 10 and 5534? 27670 What is the smallest common multiple of 66 and 131508? 1446588 Calculate the common denominator of 41/76769 and 89/42. 460614 What is the smallest common multiple of 8840 and 132? 291720 Calculate the common denominator of -37/228 and 127/161880. 161880 Calculate the common denominator of -32/11 and -31/10331167. 10331167 Calculate the lowest common multiple of 1625 and 11. 17875 What is the least common multiple of 11200 and 14400? 100800 What is the common denominator of -119/80 and 113/24480? 24480 Calculate the least common multiple of 185197 and 1353. 6111501 What is the smallest common multiple of 479502 and 169236? 2877012 What is the smallest common multiple of 468 and 300? 11700 Calculate the common denominator of 15/70768 and 131/53076. 212304 Find the common denominator of 51/569875 and 82/15. 1709625 Calculate the common denominator of -39/10 and -13/8090. 8090 Find the common denominator of -115/9842 and -89/22792. 433048 Calculate the common denominator of -23/33725 and 97/570. 202350 Find the common denominator of -13/7106 and 53/165. 106590 Find the common denominator of -55/6 and -25/41392. 124176 Find the common denominator of -27/1360 and -133/390. 53040 What is the common denominator of 45/37811 and 99/10? 378110 Calculate the lowest common multiple of 35450 and 20. 70900 Find the common denominator of -7/725202 and 46/99. 7977222 Find the common denominator of 79/9800 and 31/1610. 225400 Calculate the smallest common multiple of 128322 and 16. 1026576 What is the smallest common multiple of 14352 and 2691? 43056 Calculate the least common multiple of 136 and 57222. 228888 Calculate the lowest common multiple of 1592 and 52. 20696 What is the smallest common multiple of 11350 and 11350? 11350 What is the common denominator of -4/108689 and -2/543445? 543445 Calculate the smallest common multiple of 7820 and 89930. 179860 What is the smallest common multiple of 733239 and 3? 733239 What is the smallest common multiple of 1520 and 70? 10640 What is the smallest common multiple of 54460 and 599060? 599060 What is the lowest common multiple of 3672 and 1683? 40392 What is the smallest common multiple of 13098 and 5698? 1008546 Calculate the common denominator of -89/1672 and 89/880. 16720 Find the common denominator of -79/3230612 and -61/68. 3230612 What is the common denominator of 20/413 and 57/7? 413 What is the least common multiple of 12396 and 9? 37188 Calculate the least common multiple of 1368 and 1414. 967176 Find the common denominator of 71/334166 and 23/167083. 334166 Calculate the common denominator of 89/1668 and 19/3336. 3336 Find the common denominator of -71/270 and 101/58464. 876960 What is the smallest common multiple of 26048 and 9620? 1693120 What is the least common multiple of 8580 and 600? 85800 What is the smallest common multiple of 259 and 69819? 488733 What is the smallest common multiple of 3872 and 277376? 3051136 What is the smallest common multiple of 2178 and 7260? 21780 Calculate the lowest common multiple of 10 and 584668. 2923340 What is the common denominator of -49/8 and 35/19728? 19728 Find the common denominator of 57/206 and -27/2014. 207442 Find the common denominator of 131/630 and 47/103530. 310590 What is the least common multiple of 66 and 433656? 4770216 Calculate the smallest common multiple of 8 and 1384. 1384 Calculate the common denominator of -1/307675 and -107/99250. 3076750 Calculate the common denominator of 47/237 and 127/30. 2370 Calculate the least common multiple of 21120 and 121. 232320 What is the least common multiple of 1 and 2581459? 2581459 What is the smallest common multiple of 137190 and 5695? 9191730 Calculate the common denominator of 95/1016 and -71/378. 192024 Find the common denominator of 59/10233 and -25/37. 378621 What is the common denominator of 53/138 and -61/14214? 14214 What is the smallest common multiple of 2472 and 4326? 17304 Calculate the smallest common multiple of 1335 and 320. 85440 Calculate the common denominator of 99/3940 and 57/4. 3940 What is the least common multiple of 164 and 47? 7708 What is the least common multiple of 24 and 1595778? 6383112 What is the lowest common multiple of 13782 and 351? 1612494 What is the common denominator of 73/4 and -83/35894? 71788 What is the common denominator of 73/869506 and -75/16? 6956048 Calculate the least common multiple of 13270 and 164548. 822740 Find the common denominator of 97/72 and 97/45900. 91800 Find the common denominator of 67/180 and -99/1652. 74340 Find the common denominator of 27/2888 and 11/37544. 37544 What is the common denominator of 62/10115 and -79/765? 91035 What is the least common multiple of 5 and 21477? 107385 Find the common denominator of -127/6 and -97/198. 198 Find the common denominator of 60/6601 and -33/644. 26404 Find the common denominator of -37/1500 and -113/69000. 69000 Calculate the least common multiple of 68 and 934. 31756 Calculate the lowest common multiple of 144 and 7776. 7776 What is the common denominator of 7/10 and 101/1150? 1150 Calculate the smallest common multiple of 13845 and 195. 13845 Calculate the least common multiple of 12 and 134328. 134328 Find the common denominator of -53/5516 and 61/112. 22064 Calculate the lowest common multiple of 25284 and 70434. 986076 Find the common denominator of -59/24910 and 7/9964. 49820 What is the common denominator of 40/31 and 73/3410? 3410 Calculate the least common multiple of 162 and 10404. 93636 Calculate the least common multiple of 6129 and 15663. 140967 Calculate the least common multiple of 1412 and 3384. 1194552 Calculate the common denominator of -62/2705 and 53/7220. 3906020 What is the least common multiple of 196 and 1148? 8036 Calculate the common denominator of 113/38110 and -85/60976. 304880 Find the common denominator of 109/17800 and 39/4. 17800 What is the common denominator of 101/50780 and -7/25390? 50780 What is the least common multiple of 261 and 145? 1305 What is the smallest common multiple of 345348 and 954? 345348 What is the least common multiple of 372 and 120? 3720 Calculate the common denominator of -77/34294 and -19/137176. 137176 Find the common denominator of -7/12 and 55/1281. 5124 What is the common denominator of 173/1134 and 125/11634? 314118 Calculate the smallest common multiple of 1359 and 17969. 161721 What is the least common multiple of 320 and 542464? 2712320 What is the lowest common multiple of 108285 and 28876? 433140 Calculate the common denominator of 25/12 and 193/49140. 49140 What is the lowest common multiple of 47051 and 3? 141153 Calculate the least common multiple of 132564 and 99423. 397692 Calculate the smallest common multiple of 29819670 and 10. 29819670 Calculate the smallest common multiple of 30 and 6880. 20640 What is the least common multiple of 5346 and 55? 26730 Find the common denominator of -47/33 and -7/226. 7458 What is the smallest common multiple of 24 and 4911? 39288 Calculate the lowest common multiple of 109780 and 3992. 219560 Calculate the common denominator of 1/2696 and 43/292. 196808 What is the common denominator of 91/6904 and 3/120820? 241640 Find the common denominator of -2/221 and 18/296803. 296803 What is the lowest common multiple of 336 and 47232? 330624 Calculate the lowest common multiple of 82863 and 15066. 165726 Calculate the least common multiple of 145 and 20677. 103385 Calculate the common denominator of -28/4707 and -26/230643. 230643 Calculate the common denominator of	{ "pile_set_name": "DM Mathematics" }
2 - 3s - 6 What is the a'th term of -4369, -4378, -4391, -4408, -4429, -4454? -2a2 - 3a - 4364 What is the m'th term of -70, -683, -2354, -5611, -10982, -18995, -30178? -88m3 - m2 + 6m + 13 What is the u'th term of -100, -103, 56, 449, 1148, 2225? 12u3 + 9u*2 - 114u - 7 What is the t'th term of -1720, -3462, -5224, -7006, -8808, -10630? -10t2 - 1712t + 2 What is the o'th term of -1166, -1155, -1130, -1085, -1014, -911, -770? o3 + o2 + o - 1169 What is the m'th term of -4967381, -4967380, -4967379, -4967378? m - 4967382 What is the u'th term of -1519, -3092, -4739, -6496, -8399, -10484, -12787, -15344? -6u3 - u2 - 1528u + 16 What is the o'th term of -1272, -1282, -1300, -1326, -1360? -4o2 + 2o - 1270 What is the b'th term of -1061, -870, -563, -146, 375? -b*3 + 64b*2 + 6b - 1130 What is the r'th term of -54, -356, -1206, -2880, -5654, -9804? -46r3 + 2r*2 + 14r - 24 What is the a'th term of 5922, 23667, 53258, 94701, 148002? a*3 + 5917a*2 - 13a + 17 What is the x'th term of 2, 52, 94, 128, 154, 172, 182? -4x2 + 62x - 56 What is the z'th term of 39043, 39149, 39255, 39361, 39467, 39573? 106z + 38937 What is the n'th term of -17403, -17401, -17397, -17391? n2 - n - 17403 What is the z'th term of -479749, -479739, -479729, -479719, -479709, -479699? 10z - 479759 What is the d'th term of -336, -324, -342, -390? -15d2 + 57d - 378 What is the x'th term of 7611, 15271, 22931, 30591, 38251, 45911? 7660x - 49 What is the l'th term of 155207, 155212, 155217, 155222, 155227? 5l + 155202 What is the n'th term of 109662, 219336, 329022, 438726, 548454? n*3 + 109667n - 6 What is the l'th term of 1533, 3090, 4651, 6216, 7785, 9358? 2l2 + 1551l - 20 What is the y'th term of -6523, -6537, -6551, -6565? -14y - 6509 What is the v'th term of -3597, -7188, -10779, -14370? -3591v - 6 What is the a'th term of -1176693, -2353383, -3530073, -4706763? -1176690a - 3 What is the q'th term of -22031, -44083, -66135, -88187, -110239? -22052q + 21 What is the z'th term of -820, -1502, -2198, -2914, -3656? -z3 - z2 - 672z - 146 What is the y'th term of -10658, -10659, -10660, -10661, -10662, -10663? -y - 10657 What is the m'th term of 3294, 3300, 3318, 3354, 3414, 3504? m3 - m + 3294 What is the o'th term of 3469, 3520, 3571? 51o + 3418 What is the s'th term of 68766, 137561, 206370, 275199, 344054, 412941, 481866? s3 + s2 + 68785s - 21 What is the q'th term of 35, -67, -203, -385, -625, -935, -1327, -1813? -2q*3 - 5q*2 - 73q + 115 What is the q'th term of -512, -1722, -3630, -6230, -9516, -13482? q*3 - 355q*2 - 152q - 6 What is the n'th term of 229, 227, 209, 169, 101, -1, -143, -331? -n*3 - 2n*2 + 11n + 221 What is the x'th term of 12489, 24978, 37467, 49956? 12489x What is the s'th term of -545, -1076, -1605, -2132, -2657, -3180, -3701? s2 - 534s - 12 What is the p'th term of -27404, -27403, -27402, -27401? p - 27405 What is the w'th term of 20746, 41481, 62218, 82963, 103722, 124501? w*3 - 5w*2 + 20743w + 7 What is the q'th term of 9032, 9030, 9028, 9026, 9024? -2q + 9034 What is the z'th term of 0, -55, -244, -609, -1192, -2035, -3180, -4669? -7z*3 - 25z*2 + 69z - 37 What is the z'th term of -641, -703, -873, -1205, -1753, -2571? -9z3 + z - 633 What is the m'th term of -205596, -205598, -205600, -205602? -2m - 205594 What is the s'th term of 1948, 7775, 17484, 31075, 48548, 69903? 1941s2 + 4s + 3 What is the v'th term of 96724, 96725, 96726, 96727, 96728, 96729? v + 96723 What is the y'th term of -4423, -8841, -13257, -17671, -22083? y*2 - 4421y - 3 What is the z'th term of 802, 2125, 3446, 4765, 6082, 7397? -z*2 + 1326z - 523 What is the x'th term of -1614, -6441, -14484, -25743, -40218, -57909? -1608x2 - 3x - 3 What is the o'th term of 127, 682, 1911, 4066, 7399, 12162, 18607, 26986? 42o3 + 85o*2 + 6o - 6 What is the z'th term of 25, 226, 749, 1750, 3385? 26z3 + 5z*2 + 4z - 10 What is the k'th term of -23436, -23523, -23668, -23871, -24132, -24451, -24828? -29k2 - 23407 What is the c'th term of -7392, -15199, -23008, -30819? -c2 - 7804c + 413 What is the k'th term of -47236, -94481, -141726? -47245k + 9 What is the w'th term of 615, 1235, 1847, 2457, 3071, 3695, 4335? w3 - 10w*2 + 643w - 19 What is the u'th term of -26, -157, -374, -677? -43u2 - 2u + 19 What is the q'th term of -155, -283, -421, -509, -487? 10q3 - 65q*2 - 3q - 97 What is the d'th term of 24, -113, -422, -903, -1556? -86d2 + 121d - 11 What is the f'th term of 26972, 53943, 80914, 107885, 134856, 161827? 26971f + 1 What is the x'th term of 57, 25, -71, -225, -431, -683, -975? x3 - 38x*2 + 75x + 19 What is the x'th term of 12092, 23934, 35778, 47624, 59472? x*2 + 11839x + 252 What is the l'th term of 130949, 130957, 130965, 130973? 8l + 130941 What is the u'th term of 1762, 3538, 5330, 7138, 8962? 8u*2 + 1752u + 2 What is the l'th term of -76348, -76320, -76292, -76264, -76236, -76208? 28l - 76376 What is the o'th term of -430640, -430638, -430636, -430634? 2o - 430642 What is the h'th term of -604258, -604256, -604254, -604252, -604250? 2h - 604260 What is the j'th term of 8804, 35359, 79614, 141563, 221200? -j3 + 8856j*2 - 6j - 45 What is the h'th term of 18340, 73275, 164834, 293017, 457824, 659255, 897310? 18312h2 - h + 29 What is the c'th term of -98801, -98802, -98803, -98804? -c - 98800 What is the j'th term of 4231, 8464, 12697, 16930? 4233j - 2 What is the b'th term of -4760, -7092, -9424, -11756, -14088? -2332b - 2428 What is the y'th term of -5, -19, -55, -125, -241, -415, -659, -985? -2y3 + y2 - 3y - 1 What is the s'th term of -32, -6, 70, 220, 468, 838? 4s3 + s2 - 5s - 32 What is the b'th term of -53450, -53508, -53568, -53630, -53694, -53760? -b2 - 55b - 53394 What is the n'th term of 25, 293, 559, 823, 1085? -n*2 + 271n - 245 What is the g'th term of 1031, 1033, 1029, 1013, 979, 921? -g*3 + 3g*2 + 1029 What is the v'th term of -136510, -273016, -409522, -546028, -682534, -819040? -136506v - 4 What is the m'th term of -3403, -3370, -3313, -3232, -3127, -2998? 12m2 - 3m - 3412 What is the x'th term of 591, 739, 985, 1329, 1771, 2311, 2949? 49x2 + x + 541 What is the w'th term of -672, -651, -602, -513, -372, -167, 114, 483? 2w*3 + 2w2 + w - 677 What is the u'th term of 186, 161, 110, 27, -94? -u3 - 7u2 + 3u + 191 What is the k'th term of 384, 727, 1070? 343k + 41 What is the g'th term of 155, 139, 123, 107, 91, 75? -16g + 171 What is the n'th term of 1530, 3230, 4930, 6630, 8330, 10030? 1700n - 170 What is the n'th term of -54, -73, -80, -57, 14, 151, 372? 3n*3 - 12n*2 - 4n - 41 What is the a'th term of 4800, 5310, 5820, 6330? 510a + 4290 What is the y'th term of 63088, 63095, 63102, 63109? 7y + 63081 What is the o'th term of 459489, 459475, 459461, 459447, 459433? -14o + 459503 What is the s'th term of 137, 96, 39, -28, -99, -168, -229? s3 - 14s*2 - 6s + 156 What is the h'th term of 497, 2017, 4565, 8147, 12769, 18437? h*3 + 508h*2 - 11h - 1 What is the g'th term of 95, 465, 1097, 1991, 3147? 131g2 - 23g - 13 What is the g'th term of -284574, -284577, -284582, -284589, -284598, -284609? -g*2 - 284573 What is the h'th term of 203, 436, 721, 1058, 1447? 26h*2 + 155h + 22 What is the j'th term of -697, -2646, -5841, -10282, -15969, -22902, -31081? -623j2 - 80j + 6 What is the l'th term of 6375, 6435, 6495, 6555, 6615? 60l + 6315 What is the c'th term of 172798, 345595, 518392? 172797c + 1 What is the p'th term of -8022, -7966, -7872, -7740, -7570, -7362, -7116? 19p2 - p - 8040 What is the o'th term of 48, 365, 1244, 2973, 5840, 10133? 48o*3 - 7o*2 + 2o + 5 What is the v'th term of 367, 2971, 10017, 23725, 46315, 80007, 127021? 370v3 + v2 + 11v - 15 What is the q'th term of -267, -355, -337, -207, 41, 413? q*3 + 47q*2 - 236q - 79 What is the o'th term of -742, -1113, -1498, -1903, -2334? -o3 - o2 - 361o - 379 What is the z'th term of 11215, 11214, 11213, 11212? -z + 11216 What is the i'th term of -139, -209, -279? -70i - 69 What is the q'th term of 1434890, 2869781, 4304672? 1434891*q - 1 What is the z'th t	{ "pile_set_name": "DM Mathematics" }
out replacement from enuunnl? 3/35 Calculate prob of picking 1 e and 2 b when three letters picked without replacement from bbeebbrrrb. 1/6 Four letters picked without replacement from {p: 8, z: 2, y: 4}. What is prob of picking 2 y and 2 p? 24/143 Two letters picked without replacement from {w: 3, e: 3, z: 1}. Give prob of picking 1 w and 1 e. 3/7 Calculate prob of picking 1 f and 1 v when two letters picked without replacement from evoozffe. 1/14 Calculate prob of picking 1 a and 1 b when two letters picked without replacement from azbzzvaazanaa. 1/13 Three letters picked without replacement from {h: 3, u: 2, t: 15}. What is prob of picking 3 h? 1/1140 Two letters picked without replacement from {u: 3, d: 7, a: 2, r: 3, x: 4}. What is prob of picking 1 r and 1 a? 2/57 Calculate prob of picking 1 y and 1 r when two letters picked without replacement from {p: 1, f: 1, a: 2, r: 1, y: 2, j: 1}. 1/14 Two letters picked without replacement from kjjjkjikeozji. Give prob of picking 1 j and 1 k. 5/26 Two letters picked without replacement from {j: 7, r: 2}. Give prob of picking 2 r. 1/36 Two letters picked without replacement from izzzizzyyiyzi. What is prob of picking 1 z and 1 y? 3/13 What is prob of picking 3 o when three letters picked without replacement from {h: 6, o: 4}? 1/30 Two letters picked without replacement from {g: 3, s: 3, e: 1, x: 5, l: 1, q: 5}. Give prob of picking 1 x and 1 q. 25/153 Three letters picked without replacement from {s: 2, w: 1, c: 1, a: 2, k: 1, p: 2}. Give prob of picking 1 w, 1 k, and 1 c. 1/84 Four letters picked without replacement from {i: 12, q: 3}. What is prob of picking 1 i and 3 q? 4/455 Calculate prob of picking 2 r when two letters picked without replacement from {a: 4, r: 6}. 1/3 Three letters picked without replacement from {j: 2, g: 2, c: 3, i: 1, e: 3, p: 3}. Give prob of picking 2 c and 1 e. 9/364 Calculate prob of picking 3 k when three letters picked without replacement from kkkjjkkkkkkkkkkkkkkk. 68/95 Four letters picked without replacement from {k: 5, w: 3, i: 2, e: 7}. What is prob of picking 2 i, 1 e, and 1 k? 1/68 Calculate prob of picking 1 k, 2 j, and 1 b when four letters picked without replacement from kkkikkjkokjibijakioj. 16/1615 What is prob of picking 2 w when two letters picked without replacement from {w: 6, e: 4}? 1/3 Two letters picked without replacement from kxqyski. Give prob of picking 1 i and 1 y. 1/21 What is prob of picking 1 q, 1 e, and 1 b when three letters picked without replacement from {e: 3, b: 1, w: 1, t: 2, q: 1, m: 3}? 1/55 Two letters picked without replacement from {l: 2, p: 2, a: 5, h: 2, z: 1, k: 2}. What is prob of picking 1 l and 1 k? 4/91 Two letters picked without replacement from {v: 2, y: 4, x: 8}. What is prob of picking 2 y? 6/91 Two letters picked without replacement from {i: 1, b: 1, e: 1, f: 1, s: 1}. What is prob of picking 1 s and 1 i? 1/10 What is prob of picking 4 s when four letters picked without replacement from wsvssvswsw? 1/42 Two letters picked without replacement from {t: 1, a: 1, e: 2}. What is prob of picking 1 a and 1 e? 1/3 Three letters picked without replacement from ggiigigiiggigi. What is prob of picking 3 g? 5/52 Calculate prob of picking 2 i when two letters picked without replacement from {m: 8, i: 4, w: 2, c: 1}. 2/35 Two letters picked without replacement from {j: 1, r: 4, a: 6, k: 3, h: 2, e: 2}. What is prob of picking 1 h and 1 k? 2/51 What is prob of picking 1 s, 1 k, and 1 a when three letters picked without replacement from {a: 2, x: 1, i: 1, f: 1, k: 1, s: 1}? 2/35 What is prob of picking 1 d and 1 m when two letters picked without replacement from {m: 2, d: 8}? 16/45 Three letters picked without replacement from hhjjjhhhjj. Give prob of picking 3 j. 1/12 Calculate prob of picking 2 a and 2 k when four letters picked without replacement from {m: 5, a: 2, k: 8}. 4/195 Three letters picked without replacement from {a: 5, r: 3, k: 6, l: 3}. What is prob of picking 1 l and 2 a? 3/68 Calculate prob of picking 1 m and 2 k when three letters picked without replacement from mskssskmk. 1/14 Two letters picked without replacement from eeeeeexxeexxee. Give prob of picking 2 x. 6/91 Calculate prob of picking 1 q and 2 u when three letters picked without replacement from uuuujuuuujuuqqu. 22/91 Calculate prob of picking 1 j and 3 p when four letters picked without replacement from ppjjpjpppppppjpppj. 143/306 What is prob of picking 2 x when two letters picked without replacement from {k: 3, x: 4, l: 1, u: 2}? 2/15 What is prob of picking 1 s and 1 f when two letters picked without replacement from {o: 6, b: 8, f: 3, s: 1}? 1/51 Three letters picked without replacement from {s: 2, o: 4}. Give prob of picking 2 o and 1 s. 3/5 What is prob of picking 1 x and 1 z when two letters picked without replacement from lxlxxxxxzxzx? 8/33 Calculate prob of picking 2 o and 1 k when three letters picked without replacement from {o: 8, k: 5}. 70/143 Four letters picked without replacement from llluuuullll. What is prob of picking 1 u and 3 l? 14/33 Four letters picked without replacement from qeqeqqeq. What is prob of picking 3 e and 1 q? 1/14 What is prob of picking 2 m and 1 n when three letters picked without replacement from nnmnnmmmmnmn? 9/22 Calculate prob of picking 1 h and 1 p when two letters picked without replacement from {p: 2, h: 6, x: 9}. 3/34 Three letters picked without replacement from nnnnnnnnccnnncnnncn. Give prob of picking 3 n. 455/969 Calculate prob of picking 1 k, 2 g, and 1 n when four letters picked without replacement from {g: 2, w: 1, k: 4, f: 2, n: 1}. 2/105 Two letters picked without replacement from {g: 7, h: 5}. Give prob of picking 2 h. 5/33 Two letters picked without replacement from hihithtttihihh. What is prob of picking 2 h? 15/91 Four letters picked without replacement from eeeeheehhheehhheeee. Give prob of picking 2 e and 2 h. 231/646 Four letters picked without replacement from eseeeeeeeeseeese. What is prob of picking 2 e and 2 s? 9/70 Four letters picked without replacement from wvvoovwww. What is prob of picking 1 w, 2 o, and 1 v? 2/21 Four letters picked without replacement from {r: 4, p: 2, w: 3, s: 6}. What is prob of picking 1 r, 2 s, and 1 p? 8/91 Four letters picked without replacement from {k: 9, u: 3, w: 1, m: 1, a: 1, h: 3}. Give prob of picking 2 h and 2 k. 3/85 Three letters picked without replacement from dskwwwwdkdwkwds. Give prob of picking 3 k. 1/455 Three letters picked without replacement from {t: 11, j: 9}. What is prob of picking 1 j and 2 t? 33/76 Four letters picked without replacement from onunxnaxuoanananuona. Give prob of picking 2 x, 1 a, and 1 n. 7/969 Calculate prob of picking 1 o and 2 x when three letters picked without replacement from gyxyowyyojxxxyx. 4/91 Four letters picked without replacement from qqvexvvvxaevvavvfqvv. Give prob of picking 1 v and 3 x. 0 Calculate prob of picking 2 s when two letters picked without replacement from {s: 4}. 1 Four letters picked without replacement from thtrhhtttrrhh. What is prob of picking 4 t? 1/143 Three letters picked without replacement from hhhhppyppoviypy. What is prob of picking 2 y and 1 p? 3/91 Two letters picked without replacement from goxjf. What is prob of picking 1 f and 1 g? 1/10 Two letters picked without replacement from {c: 17, r: 1}. What is prob of picking 2 c? 8/9 Four letters picked without replacement from {o: 2, k: 8, e: 5}. What is prob of picking 3 e and 1 o? 4/273 Calculate prob of picking 1 n and 1 x when two letters picked without replacement from {x: 1, i: 1, m: 6, e: 6, n: 1}. 1/105 Calculate prob of picking 2 y when two letters picked without replacement from {y: 13, c: 3, w: 1}. 39/68 Calculate prob of picking 1 f and 1 m when two letters picked without replacement from tgfggmgfjfsmffgmg. 15/136 Two letters picked without replacement from vvvvfvvvvvvvvvfffv. What is prob of picking 1 f and 1 v? 56/153 Two letters picked without replacement from {a: 5, l: 1, c: 2, v: 1, s: 1}. What is prob of picking 2 a? 2/9 Calculate prob of picking 1 r, 1 e, and 1 t when three letters picked without replacement from gateree. 3/35 Two letters picked without replacement from {y: 1, j: 1, b: 1, u: 1, s: 1, t: 2}. What is	{ "pile_set_name": "DM Mathematics" }
22). Suppose 264 = 5g + 2k, cg - 2k - 75 = 181. Does 10 divide g? False Suppose -33q + 26322 = -31q - 2m, 0 = -3q + 4m + 39483. Is q a multiple of 41? True Let f = -13066 - -22023. Is 13 a factor of f? True Let r(f) = 1830f*3 + 20f*2 - 7f - 19. Is 20 a factor of r(3)? False Suppose -15 = -3a + 2s, 2a - s - s = 12. Suppose 0 = -3u - ao + 2716 - 259, o = -3u + 2447. Suppose 0 = 6b - u + 160. Is 10 a factor of b? False Let s(l) = 6l - 118. Let u be s(20). Suppose -1 = -k, -5b = -0b + uk - 2357. Is b a multiple of 62? False Let l(d) = 3d3 - d2 + 4d. Is 42 a factor of l(3)? True Let s = -16799 - -20143. Is 44 a factor of s? True Does 19 divide (172/215 + (-27439)/(-20))/(4/32)? True Is 2/25 - (-5660434)/2075 a multiple of 88? True Let b = 252 + -123. Suppose 0 = -5g + 121 + b. Is 3 a factor of g? False Is 7647 + -18(-14)/28 a multiple of 88? True Suppose 7p - 194 = 3628. Is p a multiple of 80? False Let l = -122 - -122. Suppose 15s - 2439 + 99 = l. Does 13 divide s? True Let x be (260/(-3))/(-2) - (-5)/(-15). Suppose x = -7f - 118. Let l = f + 33. Is 5 a factor of l? True Let l(c) = 80c2 - 31c + 440. Is l(13) a multiple of 4? False Let r = 1582 + -130. Is r a multiple of 33? True Let y be 97010/(-30) + 2/(-3). Let q = 424 + y. Does 3 divide q? False Let g(c) = -2c*2 - c. Let t be g(2). Let x be t/(-55) + 3471/(-33). Let j = x - -275. Does 14 divide j? False Suppose r = -3v + 58157, v - 3r - 19952 = -593. Does 39 divide v? True Suppose -2715395 = -207h - 843287. Does 28 divide h? True Suppose 66p - 38p = 0. Is 40560/42 - p - 2/(-7) a multiple of 69? True Let y(p) = -p*3 + 40p*2 + 63p + 68. Is 68 a factor of y(-12)? True Let q be 0 - (-327)/12 - 9/(-12). Does 9 divide 6/8 + 8267/q? False Let q(y) = -y*3 - 7y*2 - y - 8. Let b be q(-7). Let v be (12 + -13)3b - 406. Is 9 a factor of (-8)/(-20) + v/(-5)? True Suppose 2m + 0 = -2, 5s - 23 = 3m. Suppose 0 = -3i - 5n + 94, si + 0n = 3n + 164. Suppose -79 + i = -k. Is k a multiple of 31? False Suppose -682k = -716k + 2720. Let w be (-1)/(-21/102). Let f = k - w. Does 29 divide f? True Let y = 91058 + -64475. Does 67 divide y? False Is 320/(-140)(-27622)/8 a multiple of 44? False Let c = -105 - -111. Let t be ((-60)/(-25) - 6)20/c. Let z(r) = -r*2 - 20r + 12. Is z(t) a multiple of 9? True Is 44 a factor of 176/(-48)-3274? True Let t = -39 - -103. Let o = 64 - t. Suppose -3g - 3s + 116 = 17, o = 5s - 25. Is g a multiple of 28? True Let v = 98 + -93. Is v36 + 0/(-114) a multiple of 9? True Let d be 0/(-4) + (16 - 3) + -3. Let j(o) = o*2 + 2o - 30. Let f be j(d). Suppose -3m = -w - 15 - f, 27 = m - 3w. Does 24 divide m? False Let d be (-2)/43(-1 - 1). Suppose -4i + j = -0 - d, 2i = 2j - 6. Suppose iu = -2u + 160. Does 3 divide u? False Suppose 6g - 61570 = 4u, -6g + 8g = 5u + 20516. Does 33 divide g? True Let b = -9652 - -32870. Does 94 divide b? True Suppose 2v = 4l - 4972, -l - 3v + 1116 = -141. Is l a multiple of 53? False Suppose -294l + 690559 = -3564209. Does 108 divide l? True Let o be 614/(18/(-63) + (-20)/(-21)). Suppose 2z + 186 + 182 = 2b, 4z = 5b - o. Is 37 a factor of b? True Let p(u) = 360u2 - 200u - 1168. Does 36 divide p(-6)? False Suppose -m + 110 = 4m. Let f be ((-11)/m)/((-1)/6). Is -3 - (-3)/f - (-35)/1 a multiple of 11? True Suppose -2y + 5y + 23176 = 5p, 0 = -5p - 5y + 23160. Is p a multiple of 41? False Let z be -10(-21)/633/2. Suppose o - 18 = k - 2, zo - 72 = k. Is o a multiple of 8? False Let z(w) = -1730w*3 + w - 1. Does 48 divide z(-1)? True Does 103 divide (-1(0 + 1))/(1220058/305018 + -4)? False Suppose g = -4t + 26, -3g + 1 = -t - 7g. Suppose 0 = 3n - tn + 1308. Let p = n - 167. Is 21 a factor of p? False Let x(h) = 3h*2 - 13h - 20. Let u be x(11). Let l = u - 156. Does 4 divide l? True Suppose 61q = 47q + 24108. Is 14 a factor of q? True Let k(f) = -2f3 - 46f*2 - 3f + 50. Let p be k(-24). Suppose -37u + 11u + p = 0. Does 2 divide u? False Is (-4 - 5/(-20)14)/((-21)/251412) a multiple of 26? False Suppose -477 - 67 = -3r - 5l, -5l - 346 = -2r. Suppose -3a - 2u + 200 = 2a, r = 4a - 2u. Is a even? True Let v(u) = -u*3 - 16u*2 + 14u - 13. Let t be v(-15). Let o = t - -635. Suppose i - o + 67 = 0. Does 30 divide i? True Let i = -1614 - -6333. Is i a multiple of 33? True Let w(m) = -2m3 + 15m*2 - 25m + 61. Let t be w(11). Let a = t + 2021. Is 12 a factor of a? True Let n = 68 - -120. Suppose 13b + 32 = n. Does 6 divide b? True Suppose 20u - 6455 = 129225. Is u a multiple of 212? True Suppose -2i = -2x + 3i + 9, 21 = -4x - 3i. Let f(z) = -44z - 4. Let a be f(x). Suppose 8 = v - a. Does 17 divide v? True Let c = 4524 + -4128. Does 27 divide c? False Let u(r) = -200r2 + 5r - 6. Let a be u(-5). Let o = a + 2580. Is 6 a factor of o/(-27) + (-8)/(-36)? False Let i(k) = -11k + 388. Let m be i(35). Suppose 26x - 4807 = mx. Is x a multiple of 19? True Let y be 3 + 1 + (-1054)/(-2). Suppose 3b + 57 = -5o + 606, -b + 183 = -4o. Suppose 2q - 5l = 232, -3q = 2l + b - y. Is 19 a factor of q? False Let j(t) = 4t2 + 3t - 2. Let r be j(-2). Let o(w) = 4w2 + 17w - 176. Is o(r) a multiple of 108? True Let o be (-1)/((-4)/((-84)/(-3))). Suppose -11f + of = -1972. Suppose -5s + 187 = -f. Does 24 divide s? False Let j(k) = -k + 20. Let x be j(7). Suppose xw = -948 + 5654. Is 23 a factor of w? False Let m(g) = -g*3 + 41g*2 - 76g - 74. Let n be m(39). Let v(s) = 12s2 + 7s - 20. Is 15 a factor of v(n)? False Let a be 6 + 1 - (-15 - (8 + -28)). Suppose -5g + 1635 = -5n, -g - 315 = -2g - an. Is 15 a factor of g? False Let l(m) = -848m3 + m2 + m - 2. Let i be l(1). Let v = i + 1098. Is 50 a factor of v? True Let a = 97 - 94. Suppose 0g - ag = -4w - 3022, 0 = -5g + w + 5048. Does 94 divide g? False Let v = -3388 - -3280. Let w = 340 + -82. Let q = v + w. Does 15 divide q? True Let w(u) = -7u + 1. Let b be w(-7). Let o be 19 + -26 + -65. Let g = b + o. Is 6 a factor of g? False Let h(j) = j2 + 1. Let d(u) = 5u*2 + 6u + 3. Let z(b) = d(b) - 4h(b). Let y be z(-7). Suppose -ya + 11a - 1085 = 0. Is a a multiple of 31? True Let a(p) = -p2 + 416p + 8946. Is 18 a factor of a(0)? True Let i(r) = r*2 - 14r - 48. Is i(48) a multiple of 20? False Let d(k) = -13k + 30. Let y be d(2). Suppose 11l - 8l = -12, -yl + 140 = v. Is v a multiple of 3? True Let f(d) be the second derivative of 109d3/6 - 132d*2 + 49d. Does 39 divide f(6)? True Let b(q) = -q*2 - 5q - 2. Let j be b(-3). Suppose 6s = s - 3v + 3384, 2s + jv = 1362. Suppose 62c + s = 67c. Is c a multiple of 27? True Is 176 a factor of (-11 + 24/72)-2277? True Let t = 105 + -12. Suppose -o + 469 + t = 0. Is o a multiple of 48? False Let o(a) = a2 - 14a + 20. Let f be o(17). Let b = f - 8. Does 12 divide 3951/b - (-4)/14? False Let x = -1 + 1. Let q(m) = 44m + 482. Let w be q(-11). Is 26 a factor of w/(-3)(234/3 + x)? True Let f = -2354 + 2716. Is 47 a factor of f? False Let m be 24 + 0 - (-10)/(-2). Let c(f) = 13f + 152. Is c(m) a multiple of 19? True Does 145 divide 9/3 - (2 - -444)/(12/(-138))? False Suppose -11v = -9v + 5o - 21986, 3v - 3o - 33021 = 0. Is v a multiple of 112? False Suppose -c + 5i + 1729 = -2782, -18c = 2i - 80738. Is 47 a factor of c? False Let t(z) = -3z*3 - 6z*2 - 5z - 7. Let g be t(-4). Does 7 divide (-678)/(-1) - (g - 110)? True Is 165/(-330) - (-2 - (-68317)/(-2)) a multiple of 35? True Let z be (-24)/6 + 2 + 20. Suppose zf - 216 = 16f. Is 9 a factor of f? True Let y be -12(-5 + 8)/6. Is 9 a factor of ((-28)/6)/(y/126)? False Let p(u) = -14u3 - u2 + 2u - 4. Let b be p(2). Let j = 146 + b. Is 2 a factor of j? True Suppose 24s = 14s + 60. Suppose s = -23v + 26v. Is ((-14)/43)/((-1)/v) a multiple of 7? True Let a be (-1)/(4/3) + 1018/(-8). Let m = a - -408. Is 40 a factor of m? True Suppose 25 - 1 = -6s. Let u(c) = -11c*3 + 3c*2 + 5c + 15. Does 26 divide u(s)? False Let l(j) = -j*2 + 12j - 13. Let w be l(11). Is 8 a factor of (1/w)/(20/(-7680))? True Let t = 22 + 8. Let j(c) = 8c3 - 4. Let d be j(3). Suppose -d + t = -7p. Is p a multiple of 10? False Suppose 107 +	{ "pile_set_name": "DM Mathematics" }
at is the v'th term of 2801, 14883, 35025, 63233, 99513, 143871, 196313, 256845? v*3 + 4024v*2 + 3v - 1227 What is the l'th term of -59419122, -59419118, -59419114? 4l - 59419126 What is the f'th term of -40414, -79557, -118700, -157843? -39143f - 1271 What is the y'th term of 608729, 1217497, 1826295, 2435129, 3044005, 3652929, 4261907? y*3 + 9y*2 + 608734y - 15 What is the y'th term of 14634, 15081, 15570, 16107, 16698, 17349, 18066? y*3 + 15y*2 + 395y + 14223 What is the i'th term of -167430613, -334861235, -502291857, -669722479, -837153101, -1004583723? -167430622i + 9 What is the n'th term of -18013, -11752, -5491, 770, 7031? 6261n - 24274 What is the m'th term of -2016833, -8067360, -18151581, -32269502, -50421129, -72606468, -98825525, -129078306? -m*3 - 2016841m*2 + 3m + 6 What is the s'th term of 201855, 201790, 201673, 201498, 201259, 200950, 200565? -s*3 - 20s*2 + 2s + 201874 What is the f'th term of 75, -2944, -9069, -18300? -1553f2 + 1640f - 12 What is the m'th term of -12853, -20644, -28437, -36232, -44029, -51828? -m*2 - 7788m - 5064 What is the g'th term of 84173, 168455, 252827, 337289? 45g2 + 84147g - 19 What is the n'th term of 576, 1165, 1822, 2583, 3484, 4561? 6n3 - 2n*2 + 553n + 19 What is the s'th term of 1046118, 2092240, 3138362? 1046122s - 4 What is the g'th term of -104376, -418349, -941636, -1674237, -2616152? -104657g*2 - 2g + 283 What is the f'th term of 990, -3046, -9772, -19188, -31294, -46090, -63576? -1345f2 - f + 2336 What is the k'th term of -277191, -277601, -278285, -279243, -280475, -281981? -137k*2 + k - 277055 What is the p'th term of -54811, -108483, -162155, -215827, -269499? -53672p - 1139 What is the w'th term of -350709, -1402638, -3155847, -5610336, -8766105? -350640w2 - 9w - 60 What is the w'th term of 32245821, 32245839, 32245857? 18w + 32245803 What is the c'th term of -11077, -7128, 3577, 24416, 58767, 110008, 181517? 563c*3 + 8c - 11648 What is the d'th term of 7032522, 7032523, 7032524, 7032525? d + 7032521 What is the f'th term of -777, -1870, -3339, -5184? -188f2 - 529f - 60 What is the b'th term of 2847, 10813, 24159, 42885, 66991? 2690b2 - 104b + 261 What is the u'th term of 6232905, 6232912, 6232921, 6232932, 6232945, 6232960? u*2 + 4u + 6232900 What is the m'th term of -9875408, -79003323, -266636240, -632026661, -1234427088, -2133090023, -3387267968? -9875417m3 + m2 + m + 7 What is the d'th term of -2783, -7651, -14611, -23663, -34807, -48043? -1046d*2 - 1730d - 7 What is the b'th term of -14020, -56149, -126370, -224683, -351088? -14046b2 + 9b + 17 What is the p'th term of 16019732, 32039468, 48059204, 64078940? 16019736p - 4 What is the w'th term of 9843101, 9843112, 9843139, 9843188, 9843265, 9843376, 9843527? w3 + 2w*2 - 2w + 9843100 What is the n'th term of 12727, 26078, 39475, 52924, 66431, 80002, 93643, 107360? n*3 + 17n*2 + 13293n - 584 What is the b'th term of 3850731, 15402922, 34656573, 61611684, 96268255, 138626286? 3850730b2 + b What is the s'th term of 19926, 39592, 58998, 78144? -130s*2 + 20056s What is the k'th term of -15523, -32071, -48621, -65173, -81727? -k*2 - 16545k + 1023 What is the z'th term of -427, -1449, -3041, -5203, -7935, -11237, -15109? -285z2 - 167z + 25 What is the b'th term of 4056, 31763, 106932, 253293, 494576, 854511? 3955b3 + b2 + 19b + 81 What is the n'th term of 712, 917, 634, -137, -1396? -244n2 + 937n + 19 What is the t'th term of 62008, 123535, 185024, 246457, 307816? -3t3 - t2 + 61551t + 461 What is the i'th term of -198703, -397329, -595955? -198626i - 77 What is the u'th term of -148340056, -148340057, -148340058, -148340059, -148340060? -u - 148340055 What is the n'th term of 184092, 192952, 201810, 210666, 219520, 228372? -n2 + 8863n + 175230 What is the b'th term of 62073, 124586, 187109, 249648, 312209, 374798, 437421? b3 - b2 + 62509b - 436 What is the k'th term of 1685879, 1685760, 1685641, 1685522, 1685403, 1685284? -119k + 1685998 What is the j'th term of 2754, 5488, 8278, 11130, 14050, 17044, 20118, 23278? j*3 + 22j*2 + 2661j + 70 What is the y'th term of 236, 3645, 14310, 36311, 73728, 130641? 680y3 - 452y*2 + 5y + 3 What is the y'th term of 2625800, 5251435, 7877070, 10502705, 13128340? 2625635y + 165 What is the h'th term of -22541, -22541, -22547, -22559, -22577, -22601, -22631? -3h*2 + 9h - 22547 What is the p'th term of -417478, -1669969, -3757462, -6679957? -417501p2 + 12p + 11 What is the a'th term of -65117, -130167, -195225, -260291, -325365, -390447? -4a2 - 65038a - 75 What is the h'th term of 1128622, 2257083, 3385544, 4514005, 5642466, 6770927? 1128461h + 161 What is the h'th term of 370, 3207, 11008, 26287, 51558, 89335? 419h*3 - 32h*2 - 17 What is the s'th term of -17368, -75298, -173796, -312862, -492496, -712698? -20284s*2 + 2922s - 6 What is the r'th term of -14018, -56107, -126328, -224741, -351406, -506383, -689732, -901513? -10r3 - 14006r2 - r - 1 What is the h'th term of 74572, 148623, 222672, 296719, 370764, 444807? -h2 + 74054h + 519 What is the n'th term of -718072, -718082, -718100, -718126, -718160? -4n*2 + 2n - 718070 What is the l'th term of -3868, -7829, -11790? -3961l + 93 What is the v'th term of 15033, 28550, 42067, 55584, 69101, 82618? 13517v + 1516 What is the g'th term of -88165, -88211, -88287, -88393, -88529, -88695? -15g2 - g - 88149 What is the o'th term of -9727957, -38911842, -87551651, -155647384? -9727962o*2 + o + 4 What is the z'th term of 6191, 7133, 8705, 10907, 13739? 315z*2 - 3z + 5879 What is the t'th term of 14240, 27368, 39404, 50348, 60200, 68960? -546t2 + 14766t + 20 What is the d'th term of 4353, 18902, 43665, 78642? 5107d2 - 772d + 18 What is the r'th term of -60797, -62756, -66021, -70592, -76469, -83652, -92141? -653r2 - 60144 What is the v'th term of 28322, 52639, 76956, 101273? 24317v + 4005 What is the x'th term of -1092, -4541, -10590, -19485, -31472, -46797, -65706? -41x3 - 1054x2 + 3 What is the z'th term of -1300, -6411, -14914, -26803, -42072? z3 - 1702z2 - 12z + 413 What is the u'th term of 782, 1517, 2140, 2597, 2834? -9u3 - 2u*2 + 804u - 11 What is the s'th term of 234, 290, 336, 372, 398? -5s2 + 71s + 168 What is the k'th term of -28028, -56035, -84026, -111995, -139936, -167843? k*3 + 2k*2 - 28020k - 11 What is the l'th term of -122979, -123018, -123089, -123198, -123351, -123554? -l*3 - 10l*2 - 2l - 122966 What is the d'th term of -2633, -10370, -23191, -41036, -63845, -91558, -124115? 10d3 - 2602d*2 - d - 40 What is the y'th term of -182707, -365450, -548267, -731194, -914267, -1097522, -1280995, -1464722? -6y3 - y2 - 182698y - 2 What is the h'th term of 4034, 21015, 37996, 54977, 71958? 16981h - 12947 What is the d'th term of 0, -248, -808, -1800, -3344, -5560, -8568? -20d3 - 36d*2 + 56 What is the g'th term of -1970006, -3940001, -5909996, -7879991, -9849986, -11819981? -1969995g - 11 What is the t'th term of 15744, 13278, 10824, 8388, 5976, 3594, 1248? t*3 - 2473t + 18216 What is the u'th term of 15096390, 30192837, 45289272, 60385689, 75482082, 90578445, 105674772, 120771057? -u*3 + 15096454u - 63 What is the v'th term of -349, -916, -1847, -3316, -5497? -29v3 - 8v*2 - 340v + 28 What is the j'th term of 4288691, 8577371, 12866051, 17154731, 21443411? 4288680j + 11 What is the j'th term of 93787673, 93787674, 93787675, 93787676? j + 93787672 What is the r'th term of 9436, 9633, 10168, 11209, 12924, 15481, 19048? 28r3 + r2 - 2r + 9409 What is the w'th term of -41516217, -41516219, -41516221, -41516223, -41516225? -2w - 41516215 What is the v'th term of 5392858, 10785687, 16178516, 21571345, 26964174? 5392829v + 29 What is the y'th term of 1889696, 1889742, 1889818, 1889924? 15y*2 + y + 1889680 What is the j'th term of -144206842, -288413678, -432620514, -576827350, -721034186, -865241022? -144206836j - 6 What is the d'th term of -7585, -32587, -74259, -132601, -207613? -8335d2 + 3d + 747 What is the j'th term of -385987, -385958, -385915, -385864, -385811? -j*3 + 13j*2 - 3j - 385996 Wh	{ "pile_set_name": "DM Mathematics" }
v). Calculate the greatest common divisor of g and 108. 27 Suppose 0 = -4k - 10q + 11q + 972, 0 = 3k + 3q - 714. What is the highest common divisor of k and 8591? 121 Suppose -4k - 270 = -6u, -226 = -5u + 46k - 43k. Calculate the highest common factor of 47611 and u. 47 Suppose 0 = -4n + 12198 + 19078. Suppose -n = -18r + 3845. What is the highest common factor of 81 and r? 81 Let o(x) = 4 - 3 - 2 + 190x. Let j be o(1). Let f be 1476/(-1107) + ((-67)/3)/(-1). What is the highest common divisor of f and j? 21 Let w be (1126 - -1)228/1862(27 + 1). What is the highest common divisor of 2944 and w? 184 Let x = 150 + -50. Let y = 141 - x. Let i = -3517 + 3599. Calculate the highest common factor of y and i. 41 Let s(z) = 5z*2 - 5z - 2. Let f be s(-4). Suppose -173 = -l - 145. What is the highest common divisor of f and l? 14 Suppose -66p = 140p - 65p - 36519. Suppose -267 - 66 = -3b. Calculate the greatest common factor of b and p. 37 Let z(k) = 56k2 - 11k + 110. Let v be z(8). What is the highest common factor of 6 and v? 6 Let g be (112/3)/(392/1176). What is the greatest common divisor of 581 and g? 7 Suppose 2d - 319 - 23 = 0. Let r(t) = t2 + 21t + 87. Let b be r(-17). What is the highest common divisor of d and b? 19 Let b = 14 - -10. Let j(t) be the second derivative of t4/12 + t3/2 - 60t2 - 211t. Let f be j(12). What is the greatest common divisor of f and b? 12 Let g be (-16)/3(-6 - 0). Suppose 25d - 44 = 31. Suppose -do + 12n + 27 = 9n, 3 = o + 5n. What is the greatest common factor of o and g? 8 Let i(l) = -1 + 13l + 18l*2 - 2l + l*3 + 8. Let h be i(-16). Suppose -4o = -11o + h. Calculate the highest common divisor of o and 196. 49 Let l = -159 + 340. Let j = -151 + l. Calculate the highest common divisor of j and 150. 30 Let r(y) = -80 + y3 + 18y*2 + 21 - 9y - 7. Let a be r(-18). Let n be -7((-18)/21 + 0). What is the highest common factor of n and a? 6 Suppose -2h = 2h - 256. Let w = 79 - -3. Let x = w - h. What is the highest common divisor of x and 36? 18 Suppose -36z = -18z - 1188. Let q(s) = -3s + 2. Let h be q(-14). Calculate the highest common divisor of z and h. 22 Let m be -15 + (-322)/(-23) + 0 + 846. Calculate the highest common divisor of m and 55. 5 Let r(f) = 7f + 74. Let k be r(23). Suppose 143 = 2o + 2o - 5w, -5o - 5w + k = 0. What is the highest common divisor of o and 168? 42 Let v = -9633 - -9771. What is the highest common factor of v and 12282? 138 Let t be (380/(-19))/(-10)164. What is the greatest common divisor of 976 and t? 16 Suppose 0 = -60q + 4039 + 641. Suppose 358 = 8s - 3074. Calculate the highest common factor of s and q. 39 Suppose 2m + 4m - 12 = 0. Let s be 162/12 + 1/m. Suppose 5l = -5u + 15, 8u - 2l - 22 = 6u. Calculate the highest common factor of u and s. 7 Let v = 6754 - 3714. What is the highest common divisor of 64 and v? 32 Suppose 5k + 2h = -1051, -k + h + 212 = -2k. Let t = k + 374. Calculate the highest common factor of 22 and t. 11 Suppose -3v + 293 = -1012. Suppose -b + 5f = 0, 52b = 47b - 3f + 168. Calculate the greatest common divisor of v and b. 15 Let p = -2515 + 2743. Calculate the highest common factor of 1273 and p. 19 Let q(y) = -y3 + 13y*2 - y - 121. Let d be q(12). What is the highest common divisor of 5577 and d? 11 Let u = 368 - 341. Let m be (-2)/(-18) - ((-1914)/u + -1). What is the greatest common factor of m and 252? 36 Let s be 158/(1 + 3 + -2 + 0). Suppose 3p - s = 77. Calculate the greatest common factor of p and 182. 26 Let a(b) = -3b2 + 20b + 10. Let j be a(7). What is the greatest common divisor of j and 219? 3 Let w(l) = 85l - 1240. Let i be w(22). What is the highest common divisor of 5250 and i? 210 Let b = -2598 - -4193. Let r(a) = 6a*2 - 11a + 16. Let w be r(1). Calculate the greatest common factor of b and w. 11 Let p be ((-102 - -2)/1)/((-200)/(-105) - 2). Calculate the highest common factor of p and 60. 30 Let s be (-2268)/(-10)2(42 + 148/(-4)). Calculate the highest common factor of s and 84. 84 Suppose 0 = p - 2y - 26 + 2, -p = y - 12. Suppose -k = -98 + p. Suppose 2m + k = 6m + 2s, 3m = -3s + 57. What is the greatest common factor of m and 11? 11 Suppose s - 17 = 78. Let g(v) = v*2 + 18v + 4. Let z be g(0). Let i be ((-1197)/252)/((-1)/z). What is the highest common divisor of s and i? 19 Let s = -59 + 146. Suppose -276 = -9r - s. Let f(c) = 3c*2 + 7c - 5. Let k be f(5). What is the highest common divisor of r and k? 21 Suppose -4a - 5g + 5024 + 6339 = 0, 0 = -5a - 9g + 14223. Calculate the greatest common factor of 96 and a. 48 Suppose -3a = 3t - 222, -5t - 53a + 382 = -50a. Let u(k) = 10k. Let g be u(2). Calculate the greatest common factor of t and g. 20 Suppose 0 = 123x - 19598 - 14708 + 11920. Calculate the highest common factor of 1664 and x. 26 Let w(l) be the first derivative of -3/4l*4 - 6l - 1/2l2 + 1/3l*3 - 26. Let s be w(-2). Calculate the greatest common factor of 16 and s. 8 Let d = 3 - -36. Suppose -2c + 5c - d = 0. Suppose -u = -6u + 715. What is the greatest common divisor of u and c? 13 Let f = -78 - -144. Suppose -3j = 2l - 24, -3j = -3l + 28 + 23. Suppose p - 41 + l = 2x, -3p + 68 = -x. Calculate the greatest common divisor of p and f. 22 Let j be (254 - -1)34/85. Let h = j - 254. Let d be h/(-57)(-9)/(-4). What is the greatest common divisor of 30 and d? 6 Let t be -2 - (-2 + -3 + 3). Suppose -7g + 10g - 168 = t. Let o be 1/(-3) + (-2947)/(-21). Calculate the greatest common factor of o and g. 28 Let b be 4/10 - (-1496)/10. Suppose -7a = -104a + 970. Calculate the greatest common divisor of a and b. 10 Suppose -q + 6 = -4q. Let x be (-8)/(-2) + -221. Let o be (1 - x/q)-3. Calculate the highest common factor of o and 18. 18 Suppose -5w - 7u + 449 = 0, -19w + 2u = -16w - 257. Let g(i) = 2i2 - 5i + 24. Let p be g(10). Calculate the greatest common factor of p and w. 87 Let i(z) = z + 12 - 5z + 11z - 6z + z3 - 11z - z2. Let p be i(4). Calculate the highest common divisor of p and 250. 10 Let a = 78 - 24. Let x(p) = -p3 + 40p2 + 371p - 198. Let q be x(-9). Calculate the highest common divisor of a and q. 54 Let n = -23017 + 23077. What is the highest common divisor of 132 and n? 12 Let p = -136 - -138. Suppose 49 = pj + 5z, -z = -4j - 2z + 89. Calculate the greatest common factor of 154 and j. 22 Let v = -15 + 105. Suppose 5x + 0b - 28 = -3b, -x + b + 12 = 0. Let s be (x/(-10))/((-3)/v). Calculate the highest common factor of s and 36. 12 Let q = 6400 - 6398. Let x(w) = -w2 - 7w + 6. Let y be x(-7). Suppose -b = -2c + y, 2 + 13 = 5c + 5b. What is the highest common divisor of c and q? 1 Suppose 16r = 3s + 620, -17s + 22 = r - 13s. Calculate the greatest common factor of 16 and r. 2 Let w be 93/45 - 485/(-25). Suppose 0 = m - 2g - w, -4g = 1 + 15. What is the highest common divisor of m and 4? 4 Suppose 2838 = 4n - 5t, -31n + 5t = -32n + 672. Suppose 10 = v + 3g - 50, 0 = -v - 5g + 64. Calculate the greatest common factor of n and v. 54 Suppose 6q - 8q + 80 = 0. Let d = 359 + q. Suppose -3y + 0y = -d. Calculate the greatest common factor of y and 19. 19 Let p = 51 + -3. Let d(h) = 16h*2 - 62h + 2. Let r be d(7). What is the greatest common factor of p and r? 16 Suppose -18v + 1044 = 198. Let t = v + -33. What is the highest common factor of 56 and t? 14 Suppose 3p + 11 - 2 = 0, 0 = -4n + 5p + 7. Let v be (n - 312/(-3))(1 - 0). Let k be v + (-9)/(36/(-8)). What is the highest common factor of k and 13? 13 Let m(s) = -609s + 3858. Let x be m(6). What is the greatest common factor of 2754 and x? 102 Let d = -28553 + 28573. Calculate the greatest common factor of 10705 and d. 5 Let a be (-26)/2(-3 + (-2 - -2)). Suppose -300 = -44s + as. Let w = s - -281. Calculate the greatest common factor of 31 and w. 31 Let u(f) = 33 + 4006f + 15 - 4068f. Let v be u(-8). Calculate the highest common factor of v and 34. 34 Suppose 2m + 10b + 4 = 6b, 0 = 4m + 3b + 23. Let i be (m + 9)/((-1)/(-150)). Calculate the highest common factor of 50 and i. 50 Let v = -130 + 240. Let n(m) = m*2 - 27m - 336. Let c be n(-12). What is the highest com	{ "pile_set_name": "DM Mathematics" }
terms in -25243 + 2i3 + 25243. 2i*3 Collect the terms in -5d*3 - 4d*2 + 4d*2. -5d*3 Collect the terms in -335w + 2w2 + 334w + 6w2. 8w*2 - w Collect the terms in 53 - 29 - 4k - 24. -4k Collect the terms in 5h*3 + 1443h - 1443h. 5h*3 Collect the terms in 23f*3 - 283f*2 + 283f*2. 23f*3 Collect the terms in 7u*3 + 3u*2 - 421 - 3u*2 + 419 + 0u*3. 7u*3 - 2 Collect the terms in 42a - 99a + 69a. 12a Collect the terms in 28f*2 + 2f - 2f + 6f*2. 34f*2 Collect the terms in -12j + 48j - 31j. 5j Collect the terms in 996q*3 - 499q*3 - 492q*3. 5q*3 Collect the terms in -1 + z - 19z - 12z - 3z. -33z - 1 Collect the terms in -6t*3 + 35t - 62t + 27t. -6t3 Collect the terms in 684c - 11 + 11. 684c Collect the terms in -12u*3 + 94u + 11u3 + 83u - 177u. -u3 Collect the terms in -4l - 82l3 + 0l - l. -82l3 - 5l Collect the terms in -177a2 - 679a*2 + 180a*2 - 188a*2. -864a*2 Collect the terms in -33d*2 + 4d*2 - 54d*2. -83d*2 Collect the terms in -38c*3 - 8c*3 - 36c*3 + 109c*3. 27c*3 Collect the terms in -2 + 561w*2 + 2. 561w2 Collect the terms in w2 + 0w2 - 1 + 17 - 13w*2. -12w*2 + 16 Collect the terms in 4l3 - l3 - 8l3 - 7l*3. -12l*3 Collect the terms in -2d - 2d3 + 2d + 3d3 - 9d. d*3 - 9d Collect the terms in 12o + 72o - 87o. -3o Collect the terms in -2p - 179 - 152 + 331. -2p Collect the terms in -m*3 - 12m*3 + 3m*3 + 8m*3 + 5m*3. 3m*3 Collect the terms in 8a + 85a + 5a. 98a Collect the terms in -5i*3 - 2i*3 - 3i*3 + 2i*3. -8i*3 Collect the terms in 1714a + 2a2 + 2 + 0a*2 - 1714a. 2a2 + 2 Collect the terms in -16k + 6k3 + 4k*3 + 16k. 10k3 Collect the terms in -582t*3 + 266t*3 + 314t*3. -2t*3 Collect the terms in -105c*2 + 110c*2 - 4c2. c2 Collect the terms in -k*2 + 232k - 232k. -k2 Collect the terms in 17q - 50q + 22q + 13q. 2q Collect the terms in -15 - 12 - 2x2 + 27 - 90x*2. -92x*2 Collect the terms in 22d*2 - 7d*2 - 4d*2 - 8d*2. 3d*2 Collect the terms in -4 - 1 + 2234h + 5. 2234h Collect the terms in -8j*2 - 9j*2 + 12j*2. -5j*2 Collect the terms in 32z*2 - 56z*2 + 20z*2. -4z*2 Collect the terms in 0p - 36p2 + 0p + 12p2. -24p*2 Collect the terms in -4t - 10t - 3t - 2t. -19t Collect the terms in 52 + 18w2 - 52. 18w*2 Collect the terms in -5a + 8a + 13a*2 - 3a. 13a2 Collect the terms in -993o - 3o2 - 1001o + 2992o - 998o. -3o2 Collect the terms in 29s + 24s - 53s - 7s3. -7s*3 Collect the terms in 0q*3 + 8q*3 - 4q*3. 4q*3 Collect the terms in 149h*3 - 585h*3 + 141h*3 + 147h*3 + 149h3. h3 Collect the terms in -69n3 - 36n*3 + 102n*3. -3n*3 Collect the terms in -56h*2 + 121h*2 - 61h*2. 4h*2 Collect the terms in -31 + 2g*3 + 15 + 16. 2g*3 Collect the terms in -29v + 11v - 5v. -23v Collect the terms in -l3 - 8 + 31 - 10 - 13. -l3 Collect the terms in 0p - 10p + 9p - 40. -p - 40 Collect the terms in -9710u2 + 4871u*2 + 4853u*2. 14u*2 Collect the terms in -22539y*3 + 11266y*3 + 11272y3. -y3 Collect the terms in -2189j - 2196j - 2190j + 8764j - 2190j. -j Collect the terms in -2y + 3y + 2y + 5y. 8y Collect the terms in 1068 - 2v3 - 227 + 3v3. v3 + 841 Collect the terms in 41u - 96u + 54u. -u Collect the terms in t2 + 0t*2 - 2t*2 - 4t*2. -5t*2 Collect the terms in -2d*3 + 216d*2 - 216d*2. -2d*3 Collect the terms in -18h*2 - 20h*2 - 4h*3 + 38h*2. -4h*3 Collect the terms in 0 - 460r*2 + 0 + 463r*2. 3r*2 Collect the terms in -2n*2 + 0n - 9 + n*2 + 0n. -n*2 - 9 Collect the terms in 70s - 31s + 78s - 9s. 108s Collect the terms in 2d2 - 8d*2 - 7d*3 + 6d*2. -7d*3 Collect the terms in 3s*2 + 2s*2 + 5s2 - 1 + s2. 11s2 - 1 Collect the terms in -15x + 8x + 6x. -x Collect the terms in -1 + 3r2 - 100r*3 + 4 - 3r*2. -100r3 + 3 Collect the terms in 2 - 5 + 3 - x2 - 3x2. -4x*2 Collect the terms in 6f*2 - 7f*2 + 2f2. f2 Collect the terms in 7z - 11z - 5z. -9z Collect the terms in -4y2 + 20y - 7y - 13y. -4y2 Collect the terms in 0v*3 - 9v*3 + 2v*3 + 6v3. -v3 Collect the terms in 52i2 - 6i*2 - 26i*2 - 2i*2. 18i*2 Collect the terms in -4d - 2d2 + 2d + 2d. -2d*2 Collect the terms in 8q - 501q2 - 8q. -501q2 Collect the terms in 1602 + 2b*3 - 3204 + 1602. 2b*3 Collect the terms in 2b*2 + 459 - 231 - 228. 2b*2 Collect the terms in 10n - 23n + 12n*2 + 13n. 12n2 Collect the terms in -5z - 118 + 118. -5z Collect the terms in 6 - 6 + 74g*2 - 65g*2. 9g*2 Collect the terms in 133 - 265 - 2g + 132. -2g Collect the terms in -4p - 5p - 11p. -20p Collect the terms in 9d - 7d3 - 3d - 6d. -7d*3 Collect the terms in 28475s*2 - 28475s*2 - 2s*3. -2s*3 Collect the terms in 9u + 4u - 6u + u. 8u Collect the terms in -2 + 10 - 8 - 5u*3. -5u*3 Collect the terms in -413w + 830w - 415w. 2w Collect the terms in -h + 2h - 9h2 - 5h. -9h2 - 4h Collect the terms in 421 - 421 + 4g2. 4g*2 Collect the terms in 41t*3 - 41t*3 - 18t*3. -18t*3 Collect the terms in 17z + 18z - 64z + 19z. -10z Collect the terms in -58h + 2h*2 + 100h + 0h2 - 42h. 2h2 Collect the terms in -31i - 34i + 24i. -41i Collect the terms in -11k + 11k - 194k*3. -194k*3 Collect the terms in 5b*3 - 4b3 - b3 + b3. b3 Collect the terms in -4c3 + 28c*3 + 6c*3 - 14c*3. 16c*3 Collect the terms in 9g + 0g + 6g + 6g - 22g. -g Collect the terms in 30g3 + 17g*2 - 17g*2. 30g*3 Collect the terms in -41o*3 + 98o*3 + 59o*3. 116o*3 Collect the terms in 73810h*2 + h - h - 73795h*2. 15h*2 Collect the terms in 12s - 33 + 30 + 3s. 15s - 3 Collect the terms in -3a + a + a. -a Collect the terms in 25q*2 + 4q - 4q - 24q2. q2 Collect the terms in -13d - 4 + 4 + 20d. 7d Collect the terms in 39 - 39 + r2. r2 Collect the terms in 2674 - 2674 - 3c*3. -3c*3 Collect the terms in 4l2 - l2 + 7l2. 10l*2 Collect the terms in 12d*3 + 6d*3 - 6d*3. 12d*3 Collect the terms in 6x + 2x - 22x. -14x Collect the terms in 5u - 6u + 3u + 3 - 3u. -u + 3 Collect the terms in 2q2 + q2 + 12 - 12 - 14q2. -11q*2 Collect the terms in 30y + 33y - 71y. -8y Collect the terms in 9p + 2p + 6p - p + p. 17p Collect the terms in -1764s*2 + 1764s*2 - 3s*3 + 5s*3. 2s*3 Collect the terms in 931t*2 - 19 + 19. 931t*2 Collect the terms in 12k - 42k + 7k + 13k + 12k. 2k Collect the terms in -13q*3 + 35q*3 - 20q*3. 2q*3 Collect the terms in -2n*3 + 4n*3 - 3n*3 + 4n*3 + 20. 3n*3 + 20 Collect the terms in 0w*3 + 11w*3 + 9w*3. 20w*3 Collect the terms in 0v*2 + 8v*2 + 2v*2. 10v*2 Collect the terms in 67t*3 + 80t*3 - 42t*3. 105t*3 Collect the terms in 24p + 15p + 20p - 62p. -3p Collect the terms in 3r2 - 3r*2 - 3 + 137r*3. 137r*3 - 3 Collect the terms in -2p - 2p - 3p*3 + 0p + 4p. -3p*3 Collect the terms in -7j*2 + 0j2 - j2 + 6j2. -2j*2 Collect the terms in 21q*2 + 0 + 0 - 23q*2. -2q*2 Collect the terms in 81x - 6 + 8 - 2. 81x Collect the terms in -31 - 4c + 31. -4c Collect the terms in 62r*3 - 74r*3 + 14r*3. 2r*3 Collect the terms in 21633k*2 - 43264k*2 + 21635k*2. 4k*2 Collect the terms in -2397a + 2a3 + 2397a. 2a3 Collect the terms in 23s*2 - 13s*2 - 12s*2. -2s*2 Collect the terms in -2d + 1950 + 2d - 1950 - d. -d Collect the terms in -3f*2 + 13f*2 - 8f*2. 2f*2 Collect the terms in 9a - 2a - 12a. -5a Collect the terms in 13c + 9c + 13c - 33c. 2c Collect the terms in -3g + 9g*2 - 2g + 5g. 9g*2 Collect the terms in -24 + 11 + 14g + 14. 14g + 1 Collect the terms in -13 + p3 - 12 - 1. p3 - 26 Collect the terms in 6h + 1 + 2h2 + h - 1. 2h*2 + 7h Collect the terms in -79 + 3p2 - 6p*2 + 79. -3p*2 Collect the terms in -190 - 5h + 190. -5h Collect the terms in 20b**2 +	{ "pile_set_name": "DM Mathematics" }
- y + 1. Determine gr(p) + 16b(p). -4p2 Let l(s) = 140s + 30. Let j(x) = x + 2. What is 15j(t) - l(t)? -125t Let b(s) = s3 + s2 + s - 1. Let d(p) = 5p3 + 4p*2 + 4p - 2. Let n be (-22)/(0 + 0 + -1). Suppose -2 = 5i - n. Calculate ib(u) - d(u). -u*3 - 2 Let c(a) = -9a + 3a + 2a - 8a. Let v(u) = 4u. Suppose 0 = -29d - 28d + 399. Calculate dv(q) + 2c(q). 4q Let u(j) = -7j + 7. Let z be (2 + 6)/((-40)/20). Let s(n) = 6n - 7. Give zu(t) - 5s(t). -2t + 7 Let x(w) = 9w + 7. Let g(l) = l. Give 4g(i) + x(i). 13i + 7 Let t = -9 + 11. Suppose 2r - t = -0. Suppose -m + 2 = -s, 0 = -s + 3m + r + 5. Let q(p) = p + 2. Let i(l) = -l - 2. Give sq(w) - 5i(w). -w - 2 Let a(l) = -l3 + 17l*2 - 3l - 3. Let n(w) = 3w3 - 34w*2 + 5w + 5. Give -5a(j) - 3n(j). -4j3 + 17j*2 Let j(b) = 2b - 8. Let u(z) = 16z + 11. Let r(g) = 5g - 1. Let p(f) = -4r(f) + u(f). What is 5j(d) + 3p(d)? -2d + 5 Let m(w) = 8w3 + 4w*2 - 2w + 8. Let k(x) = -2x3 + x2 + x + 1. What is 2k(i) + m(i)? 4i3 + 6i*2 + 10 Let m = 40 - 34. Suppose -7u = -5u + m. Let g(a) = -a. Let h(k) = 4k - 2. Give ug(c) - h(c). -c + 2 Let o(h) = -4h*2 + 4h - 5. Let x(d) be the third derivative of -1/60d5 + 1/24d*4 + 0d + 0 - 2d2 - 1/6d*3. What is -2o(r) + 10x(r)? -2r*2 + 2r Let z(l) be the third derivative of l*5/20 - 5l*3/2 + 138l*2 + 19l. Let o(g) = 3 + 0 - 2. Calculate 15o(r) + z(r). 3r*2 Let n(w) = -2w*2 - 4w + 14. Let b(x) = -2x2 - 6x + 16. What is -2b(a) + 3n(a)? -2a2 + 10 Let l(m) = -7m + 9. Let i(u) = 4u - 5. Let k be 2/10 - (-26)/(-5). Let x be (0 - 4) + (1 - 0). Calculate ki(w) + xl(w). w - 2 Let p = 16 + -20. Let n be (-2)/p + 15/(-10). Let u(w) be the first derivative of w2 - 2w - 2. Let h(b) = 1. Give nu(q) - 2h(q). -2q Let n(h) = 3h + 2. Let g(k) = -36k - 17. Determine g(d) + 2n(d). -30d - 13 Let z(x) = -4x*2 - 4x + 9. Let b(c) = -9c2 - 9c + 19. Determine -6b(m) + 14z(m). -2m2 - 2m + 12 Let m(c) be the second derivative of -c*3/6 + 2c*2 - 12c + 1. Let r(p) = -p + 6. Give 7m(x) - 5r(x). -2x - 2 Let y be (-22)/8 + 2/(-8). Let i(u) = -2u*2 + 3u. Suppose -3l + 0d - 7 = 5d, -l = 4d + 14. Let t(g) = -g - lg + 2g*2 + 5g. Determine yt(q) - 2i(q). -2q2 Let w(j) = 120j*2 - 2j + 2. Let c(q) = 40199q2 - 671q + 671. What is 2c(g) - 671w(g)? -122g2 Let z(l) = 2l + 1. Let y(a) = 510a + 40. Calculate 3y(c) - 120z(c). 1290c Let d(h) be the second derivative of h*2/2 + 99h - 5. Suppose 19 = 2j - 5w + 6, -4w = -j + 11. Let u(n) = n2 - n - 2. Calculate ju(i) - d(i). -i*2 + i + 1 Let m(d) = 8d*2 - 7d - 2. Let i(f) = 3f2 - f - 1. Determine 4i(b) - m(b). 4b2 + 3b - 2 Let s(x) = 7x2 - 6x - 18. Let g(k) = -k*2 + k + 1. Determine -6g(a) - s(a). -a*2 + 12 Let s(a) = 5a + 44. Let n(c) = -3c - 27. Let z(r) = -8n(r) - 5s(r). Let v(f) = f + 8. Give 3v(i) + 5z(i). -2i + 4 Let d(y) = y3 - y2. Let x(j) = -j*3 - 7j2 - 5. Let b(a) = -a3 - 9a2 - 6. Let f(o) = 5b(o) - 6x(o). Determine 3d(z) - f(z). 2z3 Let c(p) = -9p*2 + 10p + 6. Let r(s) = -10s2 + 12s + 7. Let d(u) = -5c(u) + 4r(u). Let v(b) = 135b2 - 55b - 55. Calculate -55d(f) + 2v(f). -5f2 Let k(l) = -l3 + 9l*2 + 12l + 6. Let b(y) = y*3 - 18y*2 - 22y - 11. Give 6b(v) + 11k(v). -5v3 - 9v*2 Let f(y) = 22y - 1. Let z = 1420 + -1437. Let j(g) = 65g - 3. Determine zf(v) + 6j(v). 16v - 1 Let g(r) = 891r2 + 15r - 5. Let q(v) = 8464v2 + 144v - 48. Determine -48g(s) + 5q(s). -448s2 Let s(u) = u - 1. Let o(r) = 6r - 9. Let q(h) = o(h) - 4s(h). Let i(k) = 1. What is 10i(g) + 2q(g)? 4g Let x(f) be the first derivative of 3f4/4 + 2f*2 + 2f + 1. Let m(y) = y*3 + y + 1. Suppose -12g + 330 = 342. What is gx(j) + 4m(j)? j*3 + 2 Let p(u) = 77880u*2. Let o(z) = 944z*2. What is -413o(f) + 5p(f)? -472f*2 Suppose 2y + 22 = 4r, -30y + 29 = 5r - 33y. Let v(k) = k3 + k2 - k. Let s(f) = -2f2 - f - 3f + 3f3 + 6f*2. Determine rv(o) - s(o). o*3 Let p = -530 + 532. Let u(h) = 6h*2 - 27. Let o(c) = 1. Calculate pu(j) + 54o(j). 12j*2 Let t(m) = 7m*2 - 4m - 13. Let h(x) = -x*2 + x. Give -6h(p) - t(p). -p*2 - 2p + 13 Let g be (-2)/(1(-2)/5). Let j(x) = -x. Let w = -3769 - -3768. Let k(z) = -2z. What is gj(d) + wk(d)? -3d Let i(d) = -d + 2. Suppose h - 3f + 3 = 0, 4h + 4f - 18 = f. Let a(z) = -2 + 4 - 3. Determine ha(v) + i(v). -v - 1 Let f = 1 - 7. Let u(z) = 3z - 3. Let m(v) = -11v2 - 5v*2 + 17v - 17 + 19v2 - 4v*2. What is fm(h) + 34u(h)? 6h*2 Let p(u) be the first derivative of -9/2u*2 - 4 + 0u. Let c(j) = -j. Let t(d) = 10d. Let y(h) = 44c(h) + 4t(h). Give 2p(k) - 5y(k). 2k Let i(p) = -p*3 + 8p*2 + 9p + 6. Let c be i(9). Suppose 6u - c = 3u. Let g(n) = -56 + 56 + un. Let a(m) = -m. Calculate -5a(w) - g(w). 3w Suppose 2k - 3i = -11, 23 + 7 = 5k + 4i. Let p(d) = kd2 + d2 - 2 - d + d*2 + 0. Let o(b) = -7b*2 + 2b + 3. What is 6o(x) + 10p(x)? -2x2 + 2x - 2 Let v(k) = k + 1. Let g = 1994 - 1993. Let r(u) = -u. Determine gr(t) - v(t). -2t - 1 Let f(h) = 3h3 + h2 + 25h + 4. Let c(m) = 12m3 + 5m*2 + 100m + 18. Calculate 2c(p) - 9f(p). -3p3 + p2 - 25p Let c(o) = 8o + 5o - 14o. Let q(d) = -10d*2 + d - 1. Let h be q(1). Let s = -7 - h. Let f(l) = 2l. Calculate sf(j) + 7c(j). -j Let k(b) = -3b3 - 5b*2 + 5. Let c(x) = -8x*3 - 14x*2 + 14. Calculate -5c(m) + 14k(m). -2m*3 Let v(h) = 5h*3 + 3h*2 - 5. Let l(q) = -4q*3 - 2q*2 + 4. Let n be (-8)/10165/66. Determine nv(z) - 3l(z). 2z3 - 2 Let w be 46/(-22) + 12/132. Let u(q) = -4q*3 + 2q + 1. Let a(r) = 0r + 2r*3 + 1 - 3r3 - r2 + r. Determine wa(l) + u(l). -2l*3 + 2l*2 - 1 Let j(d) = -5d*2 - 2d + 2. Suppose n = 2l + l - 5, 3l - 25 = 5n. Let v = l + 1. Let t(p) = p - v - 3 - p + 4p + 11p2. What is 7j(y) + 3t(y)? -2y*2 - 2y + 2 Let a(b) = 14b2 - 5b - 14. Let s = 0 + 18. Suppose 0 = -2c + j + s, 0j = 5c + 3j - 34. Let z(p) = 5p2 - 2p - 5. Calculate cz(q) - 3a(q). -2q2 - q + 2 Let q(b) = 4b - 1. Let r(x) = -5x + 1. Let d(v) = -28v + 5. Let n(s) = 2d(s) - 11r(s). Give n(k) + q(k). 3k - 2 Let n(p) = -11p - 30. Let i(z) = -4z - 11. What is -8i(x) + 3n(x)? -x - 2 Let v(a) = -a3 + a2 - 1. Let l(y) = 6y*3 - 4y*2 + 4. Suppose 2x + 4 = 6x. Let o be (1395/(-21))/(-15) + 3/(-7). Give ov(r) + xl(r). 2r*3 Let l = 29 - 17. Let b = l + -17. Let f(m) = 4m + 5. Let k(x) = 5x + 6. Let r(i) = -i3 - 3i*2 + 3i + 2. Let q be r(-4). Give bk(c) + qf(c). -c Let w(r) = r3 - r2 + r - 1. Let b(z) = -81z - 195. Let o be b(-2). Let h(y) = -22y*3 + 33y*2 - 33y + 33. Determine ow(m) - h(m). -11m3 Let n = 2 - 0. Let i(q) = -qn - 4q - 3q + 6q. Let d(v) = -v2 + 2v - 2. Suppose -15c - 57 = -42. What is cd(x) - i(x)? 2x2 - x + 2 Let a(z) = -16z*2 - 11z - 11. Let u be 1 - -384 - (20 - 20). Let f be (-12)/(-10)u/14. Let i(v) = -3v*2 - 2v - 2. Calculate fi(w) - 6a(w). -3w2 Let r(l) = 2l + 1. Suppose s + 3 = 4. Let o(g) = -1. Give sr(u) - 3o(u). 2u + 4 Let p(z) = -z2 - 2z + 2. Let j(w) = 77w2 + 75w*2 + 78w*2 - 10w + 10 - 234w2. Calculate 3j(x) - 14p(x). 2x*2 - 2x + 2 Let r(l) be the third derivative of -5l4/24 - 13l*3/6 - 284l*2. Let a(x) = -6x - 13. Determine 4a(o) - 5r(o). o + 13 Let f(q) = -q*2 - 2q + 3. Let t(k) be the first derivative of k3/3 - k2/2 - k - 185. Determine f(b) + 3t(b). 2b*2 - 5b Let k(n) = 0 - n - 5 + 4. Let f = 137 - 128. Let i(y) = -2y - 1 + fy - 8y. What is 3i(a) - k(a)? -2a - 2 Let u = -24 + 34. Let z = 21 - u. Let j(a) = 2a + 6. Let b be j(-5). Let l(m) = 3m + 17. Let f(d) = d + 6. Determine bl(x) + zf(x). -x - 2 Let h(x) be the first derivative of x4/2 - 5x*3/3 - 8x - 112. Let n(q) = 3q3 - 6q*2 - 9. Calculate 6h(k) - 5n(k). -3k*3 - 3 Let j(v) = 116v*3 + 3v - 3. Let k(b) = b - 1. What is j(p) - 3k(p)? 116p*3 Let b(k) = -6k*2 - k - 1. Let p(z) = -13z*2 - 3z - 2. Determine 5b(n) - 2p(n). -4n2 + n - 1 Let n(c) = 3c*2 - 5c + 2. Let r(q) = 13*	{ "pile_set_name": "DM Mathematics" }
13k6/40 + 123k*5/80 - 125k*4/48 + 7k*3/4 + 16k - 29. Let q(p) = 0. What is p? -42, 0, 1 Factor -256/3f - 4/9f*3 + 100/9f*2 + 208. -4(f - 13)(f - 6)2/9 What is h in 7h*5 + 4 + 0h*2 - 1732h*4 + 1716h*4 - 4 + 11h*3 - 2h*2 = 0? 0, 2/7, 1 Let w = 307723/45 + -6838. Let v(p) be the second derivative of -23/15p*5 + 175/9p*3 - wp*6 + 0 - 125/3p*2 + 5/9p*4 - 1/63p*7 - 24p. Factor v(o). -2(o - 1)2(o + 5)3/3 Let q(w) be the third derivative of w5/60 + 7w4/4 + 60w*3 + 8519w*2. Solve q(h) = 0 for h. -30, -12 Let k(l) = -48l*3 - 1010l*2 + 7612l - 17183. Let w(q) = 4q3 + 92q*2 - 692q + 1562. Let y(b) = 2k(b) + 23w(b). Factor y(u). -4(u - 13)(u - 6)(u - 5) Let l(x) = -x3 - 6x2 + 6. Let n be l(-6). Let v(o) = -o3 - 11o2 + 30o - 18. Let s(a) = -a3 + a2. Let t(q) = ns(q) - 2v(q). Factor t(u). -4(u - 3)2(u - 1) Let r(n) = -28n + 227. Let y(o) = 78o + 866. Let k be y(-11). Let f be r(k). Factor 289/11m4 - 76/11m - 646/11mf + 4/11 + 39m2. (m - 1)2(17m - 2)*2/11 Factor -9k*2 - 69/2k - 1/2k3 + 44. -(k - 1)(k + 8)(k + 11)/2 Let w(q) = 13q*3 - 115q*2 + 936q - 1771. Let v(f) = -15f3 + 111f*2 - 936f + 1770. Let r(c) = -5v(c) - 6w(c). Factor r(z). -3(z - 37)(z - 4)*2 Let r = 224 + -1343/6. Let n(h) be the third derivative of 19h*2 - rh*4 + 0h*3 + 1/60h*5 + 0 + 0h. Solve n(m) = 0. 0, 4 Let r(y) be the first derivative of -9 - 10y2 + 22/3y*3 + 5y*4 - 22y. Let g(n) = n3 + n2 - n - 1. Let h(o) = -44g(o) + 2r(o). Factor h(b). -4b(b - 1)(b + 1) Let l = -62/3353 - -13308739/36883. Factor -126/11h - l - 1/11h2. -(h + 63)2/11 Let s(l) be the third derivative of -l8/1344 + l7/168 + l6/96 - 5l*5/48 - 5l*4/12 - 2l*3/3 + 2327l2. Factor s(r). -(r - 4)2(r + 1)3/4 Let d(h) = -h4 + 14h*3 + 36h*2 + 21h - 12. Let x(a) = 2a4 - 42a*3 - 106a*2 - 62a + 32. Let r(q) = -8d(q) - 3x(q). Factor r(p). 2p(p + 1)(p + 3)2 Let h be -15/20-12. Factor w4 + 4w + 3w2 + 6w*3 - 4 - 2w*h - 8w*3 + 0w. (w - 2)*2(w - 1)(w + 1) Let x(y) be the first derivative of -y5/4 + 5y*4/6 + 20y*3/3 - 63y + 10. Let v(h) be the first derivative of x(h). Determine k, given that v(k) = 0. -2, 0, 4 Suppose 0u - 1/4u*3 + 151/4u*2 + 0 = 0. Calculate u. 0, 151 Factor -32/5s*2 + 4/5s*3 - 148/5s + 176/5. 4(s - 11)(s - 1)(s + 4)/5 Let s be 78/(-52) + 27/434. Let o = s - 225. Factor -45/4u2 + 5/4u*o - 5 + 5/4u*4 + 55/4u. 5(u - 1)3(u + 4)/4 Let c be 80/20(153/(-18))/(-17). Suppose -5a - 1 + 31/4a3 - 11/4a*5 + 17/4a*c - 13/4a*4 = 0. What is a? -2, -1, -2/11, 1 Let o(z) be the second derivative of -19/2z*4 - 18 - 1/2z*3 - z - 1083/20z*5 + 0z*2. Factor o(l). -3l(19l + 1)*2 Let w(g) = 4g*2 - g. Let x(j) = 19j*2 + 2j - 6. Let c = -817 + 812. Let f(s) = cw(s) + x(s). Factor f(q). -(q - 6)(q - 1) Factor 21/5o2 + 0 + 12/5o + 6/5o3 - 3/5o*4. -3o(o - 4)(o + 1)*2/5 Factor -1/4o*3 - 27/2 + 1/4o + 27/2o2. -(o - 54)(o - 1)(o + 1)/4 Let i(a) be the second derivative of -a6/10 - 33a*5/2 - 27a*4 + 55a*3 + 327a*2/2 - 1096a. Suppose i(u) = 0. What is u? -109, -1, 1 Let y be (-66)/84/18-6. Let z be (8/7)/(y/((-308)/(-24))). Factor -zc + 2/3c*2 + 0. 2c(c - 2)/3 Let g(u) be the second derivative of 20/3u*3 - 26 - 3u + 30u2 - 1/4u*5 - 25/12u*4. Factor g(o). -5(o - 2)(o + 1)(o + 6) Let b(r) be the third derivative of r*7/120 + 17r*6/240 - 103r*5/240 + 7r*4/48 - 8r*2 - 136r - 2. What is w in b(w) = 0? -7, 0, 1/7, 2 Let b(l) = -5l2 - 4l + 229. Let q(z) = -19z2 + 2z + 917. Let p(c) = 22b(c) - 6q(c). Suppose p(v) = 0. Calculate v. -4, 29 Find x, given that -285 - 793x - 127x - 1017 - 4x2 + 386 = 0. -229, -1 Let a(o) = 481o + 169796. Let h be a(-353). Determine l so that -5/2l - 1/6l*h + 7/6 + 3/2l2 = 0. 1, 7 Let l = -225 - -227. Factor -o3 - 48 - 7o + 19o*3 - 3o*4 - 3o*l - 65o. -3(o - 4)2(o + 1)*2 Let q(n) be the second derivative of -3n*5/20 - 63n*4/4 - 1323n*3/2 - 27783n*2/2 + 129n - 3. Factor q(j). -3(j + 21)3 Let f(g) be the first derivative of g5/20 + 15g*4/2 + 450g*3 + 13500g*2 - 142g + 102. Let m(v) be the first derivative of f(v). Solve m(i) = 0. -30 Let t = 88 - 79. Suppose -2g + t = 3i, 2i - g - 6 = -5g. Factor 0w2 - 12w - iw2 + 28w - 75 + 14w. -3(w - 5)2 Let k = 10122 - 10119. Let g(c) be the third derivative of -c2 + 3/20c6 + 13/20c5 + c4 + 1/2ck + 5 + 0c. Factor g(v). 3(v + 1)2(6v + 1) Let a(m) = -m3 + 4m*2 - 33m - 26. Let n(s) = -2s - 2. Let t(i) = a(i) - 14n(i). What is r in t(r) = 0? 1, 2 Suppose 1601 = -192p + 3905. Factor 13/2n + pn2 + 2n*4 + 17/2n3 + 1. (n + 1)2(n + 2)(4n + 1)/2 Let x(q) = 764q*2 + 4q - 4. Let k be x(1). Let j = -762 + k. Factor 5/6dj + 3/2d - 1/3. (d + 2)(5d - 1)/6 Let a be 42944/976(-12)/(-154). Determine j, given that 3/7j*2 + 48/7 + aj = 0. -4 Determine o so that -831o - 859o + 406o + 246o*3 + 3750 + 120o*2 - 141o - 243o3 = 0. -50, 5 Let y(b) = b3 + 7b*2 + 8b + 14. Let j be 130/412/(-15). Let n be y(j). Find r, given that r*2 - 3r + 5rn + 3r*3 + 0r*2 + 0r - 6 = 0. -2, -1, 1 Let t(l) = 34l - 486. Let h(r) = -18r + 243. Let b(n) = 13h(n) + 6t(n). Let u be b(8). Factor u + 3/4j3 + 15/4j*2 + 6j. 3(j + 1)(j + 2)*2/4 Suppose a + 3l = -3, 4l = -0a - a - 7. Suppose 0 = -3p - ap + 672. Determine o so that 148o + 14o*2 + 6o*2 + p + 0 = 0. -7, -2/5 Let z = 2/109547 - -39546461/328641. Factor -38/3l - z - 1/3l2. -(l + 19)2/3 Suppose -4v - 16 = h, 3h + 16 = 7h. Let m(a) = -29a2 + 40a + 21. Let w(o) = 44o2 - 60o - 32. Let k(y) = vw(y) - 8m(y). Let k(r) = 0. Calculate r. -1/3, 2 Suppose -4u - 5 = -25. Let i be (-16)/(-88) - 31896/(-264). Suppose -2t*5 - 126t4 + tu - 3t2 - 7t*3 + it*4 = 0. What is t? -3, -1, 0 Let d = -48 - -52. Suppose di + i = 30. Factor -1 - 3y - 3y*2 - 4 + 5 + i. -3(y - 1)(y + 2) Factor -22/3o*2 + 0 + 20o - 4/9o3 + 2/9o*4. 2o(o - 5)(o - 3)(o + 6)/9 Let k(w) be the first derivative of 5w*3/3 + 11795w*2/2 - 11800w - 12974. Factor k(d). 5(d - 1)(d + 2360) Let u(q) be the first derivative of q*5/5 + 125q*4/12 + 319q*3/9 + 275q*2/6 + 26q + 203. Find v such that u(v) = 0. -39, -1, -2/3 Let k = 287340 - 287338. Factor -21/4j - 3/2 + 3j*k. 3(j - 2)(4j + 1)/4 Let p(r) be the third derivative of -9r6/40 - 993r*5/20 - 164r*4 - 218r3 - r2 - 433r. Determine k, given that p(k) = 0. -109, -2/3 Let y(d) be the third derivative of 11/4d*4 - 1/20d*5 + 0d + 23/2d3 + 0 - 89d*2. Factor y(c). -3(c - 23)(c + 1) Let m(c) be the first derivative of 23/6c*3 + 0c + 112 + 3/4c2 - 13/4c*4. Determine w so that m(w) = 0. -3/26, 0, 1 Let r(l) = 33l*2 - 6l + 6. Let u(k) = 2k2 - 7. Let g(z) = -2z*2 + 6. Let w(a) = -6g(a) - 5u(a). Let s(i) = -r(i) + 18w(i). Find h such that s(h) = 0. -4, 2 Suppose -797 = -445f - 101f + 295. Let 2/5 + 2/5b5 + 4b*3 + 2b*4 + 2b + 4bf = 0. Calculate b. -1 Let w be 3/(-1)76/42. Let g(s) = s4 + s3 - 16s*2 - s - 5. Let l(x) = 9x*2 + 3. Let h(p) = wg(p) - 5l(p). Determine d, given that h(d) = 0. -1, 0, 1 Let v(o) be the third derivative of 1/480o*6 - 1/80o*5 + 0o*3 + o + 0 + 1/48o*4 - 7o*2. Find j, given that v(j) = 0. 0, 1, 2 Let p be ((-21)/15(-324)/21)/(5838/4170). Determine b so that -180/7b - 75/7 - pb*2 = 0. -5/6 Let m be (0 - 28)((-66)/(-24) + -3). Suppose -ma = a - 16. Factor -59l - 6l2 - 144 + al*2 + 11l. -4(l + 6)2 Suppose -3s + 2 = -4. Let n be (30 + -16)/((-280)/(-48)). Factor nl + 2 + 2/5l*s. 2(l + 1)(l + 5)/5 Let s(r) be the first derivative of 2r*5/35 + 3r*4/14 - 22r*3/7 + 53r*2/7 - 48r/7 + 1766. Factor s(h). 2(h - 3)(h - 1)*2(h + 8)/7 Let m(j) = j*3 + 16j*2 + 17j + 6. Let h be m(-15). Let c be (-52)/h + 18/(-12). Factor -1/6x2 + 5/6 - cx. -(x - 1)(x + 5)/6 Let n be (-220)/6642/(-5). Let i be ((-15)/(-4))/(1/n). Let -49q2 - 51q*2 + iq*2 + 5q = 0. Calculate q. -1, 0 Let a(r) be the third	{ "pile_set_name": "DM Mathematics" }
e number? True Let y = 7320 + -17351. Let v = y - -18432. Is v prime? False Suppose -3 - 12 = -5n + t, -4t - 15 = -5n. Let d(c) = 29c*2 + 8c + 4. Let v(a) = -29a2 - 9a - 5. Let q(x) = nv(x) + 4d(x). Is q(8) a prime number? False Let w(f) = -58188f + 6569. Is w(-6) a composite number? False Suppose 0j - 5j = -5, 0 = -3x + 4j + 5. Suppose 8a - 3a - 5q - 3510 = 0, 0 = -xa - 3q + 2100. Is a prime? True Let d = -578556 - -1558625. Is d composite? False Let f(o) = -4o2 - 9o - 7. Let q(y) = 21y2 + 46y + 34. Let n(p) = -11f(p) - 2q(p). Let b be n(-4). Suppose 8t + 7405 = bt. Is t prime? True Let u be ((-2)/(-6))/((-20)/(-300)). Suppose ux = -l + 3l - 1453, 4l + 2x - 2870 = 0. Is l a composite number? False Let y(b) = 43b + 14531. Is y(0) a composite number? True Suppose 2z = -5z - 3395. Let h be z/(-7) + 8/(-28). Suppose -h - 25 = -2t. Is t prime? True Suppose 114o + 34o - 5o = 136583161. Is o a composite number? False Suppose c - 37088 = -5s, 5s - 10873 = -2c + 63293. Is c prime? False Suppose -6 = 2d + d. Let t(c) = c. Let a be t(2). Is d + (a - -1) + 2136/2 a prime number? True Let b(j) = -20410j3 + j2 + 3j + 3. Is b(-1) composite? False Suppose 2f + 454219 = 7f - 3j, 4j = 4f - 363372. Is f prime? False Suppose -2y - 12 = -4p - 0, 2p - 22 = -3y. Let j be 176/(-154) - (-308)/98. Suppose 2u - 16367 - 4407 = yg, -2u - jg = -20786. Is u a prime number? True Suppose o - a - 24 = -o, -68 = -4o - 3a. Is (1 + 1)o(-647)/(-4) a composite number? True Let y(f) = -f*3 - 4f*2 - 6f - 8. Let c be y(-3). Suppose c = -4u + 7893. Suppose 10q = 11q - u. Is q composite? False Suppose 33b - 6b - 62b = -185605. Is b a prime number? True Is (6/18)/((-2 + 1)/(-2270001)) a composite number? False Let a be (40/(-8) + 8)(-3995)/(-3). Suppose v = a + 666. Is v composite? True Let n(q) = -2q*3 + 11q*2 + 17q + 3. Suppose 17z + 106 + 64 = 0. Is n(z) a composite number? True Suppose -8n = -13n + 385. Is (n/14)/1112254 prime? False Let m = -16 - -18. Suppose 0 = f - mp - 1355, 0f - 4072 = -3f - p. Is f composite? True Let a = 1023156 - 354837. Is a a composite number? True Let y(g) = 6333g - 10. Suppose -17x - 294 + 311 = 0. Is y(x) a composite number? False Let b(q) = q2 - 14q + 23. Let v be b(2). Is 1/2 + 36635/34 + v composite? True Let l = 5657 - 4020. Is l a composite number? False Let o(m) = -25m - 1. Let g be o(-2). Suppose -143557i + 21060 = -143539i. Let k = g + i. Is k a prime number? False Let y = -93680 - -148971. Is y a prime number? True Suppose -5j = -4a - 4 - 1, -2a + j = -5. Suppose -4y = 2t + 2, -t = -y - 10 + a. Suppose 0r = 5r + v - 4200, 5v + 2492 = tr. Is r composite? False Let r be 9/12 + 6/(-8). Let g(z) = -z*2 - z - 254. Let v be g(r). Let b = 547 + v. Is b composite? False Let a = -78 - -63. Let k be 12/(-6) - (-2 + 1). Is ((-1167)/9)/(((-5)/a)/k) a prime number? True Let t be ((-2650)/3)/((-4)/6). Let x = t - 679. Is (9/(-18))/((-1)/x) a composite number? True Let j = -72 + 75. Let b be 120654/21 + j/(-7). Let r = b + -2718. Is r a composite number? True Let c be (-4)/(-12) + 4/6. Suppose 3u - c - 10 = g, -5u + 25 = -5g. Suppose 0 = uq + 576 - 3693. Is q a prime number? True Let i = -91 + 91. Suppose 0 = 2x - 4v + 1994, 4x + ix = 3v - 4003. Let y = x - -2390. Is y prime? False Is ((-7239745)/(-35))/((-153)/(-1071)) composite? False Let m = -12 + -4. Is ((-2210)/(-4) + -1)/((-8)/m) a composite number? False Let o be (-3)/24 - ((-3868)/(-32) - 2). Let x be (-45110)/(-14) + 17/o. Let f = 5417 - x. Is f a composite number? True Is 451357 - 8 - (0 + -8) composite? True Let d(s) = 64s2 - 9. Let j(h) = -32h*2 + 4. Let t(b) = 3d(b) + 5j(b). Let i be t(-4). Suppose 5w + 4o = 631, -o = -4w - 4o + i. Is w a prime number? True Suppose -168973 = -6j - j. Suppose 3d - 2640 + 14723 = 2y, 4y + 3d - j = 0. Is y a prime number? True Let g = 851628 + -531095. Is g a composite number? False Let d = -4505 + 7431. Suppose -3t + d = 5s - 320, 3222 = 3t - 3s. Is t composite? True Suppose -322j = 27j - 30688617. Is j prime? False Let i(v) = -10v2 - 20v + 25. Let o(y) = -29y2 - 59y + 74. Let t(r) = 17i(r) - 6o(r). Is t(10) composite? False Let o be (96/40)/(12/(-1280)). Let g = o - -339. Is g a prime number? True Suppose 3m = 2t - 81 + 21, -5t = 3m + 81. Let w(n) = -n*3 - 21n*2 - 9n + 49. Is w(m) a composite number? True Suppose -3d + u - 3u = 13970, 2d = -3u - 9310. Let c(f) = -10f - 49. Let a be c(-5). Is ((-1)/(-2))/(a + d/4660) a composite number? True Suppose -3o + 6969 = 5s, -1575 = -o + 5s + 788. Is o prime? True Let l = -31 + 26. Let a(c) = -2c2 - 8c + 12. Let x be a(l). Suppose 6h = h + 20, -xh = -2o + 3306. Is o a prime number? True Let w = 3447970 + -2447547. Is w prime? True Suppose 3a + 10582 = 2w, -3w - 4a = -6w + 15875. Is w prime? True Suppose -16d + 22 = -74. Let j(t) = 10t*3 - 5t*2 - 11t + 29. Is j(d) a prime number? False Let z = 1391 + -947. Suppose -2s - q + 634 = 0, -253 - 381 = -2s + 3q. Let t = z - s. Is t a composite number? False Let h(f) = -1022f - 35. Let o be h(-19). Suppose -150y - 4s - o = -153y, 2y = -4s + 12902. Is y prime? False Suppose 101143 = 4g - 5c - 1077046, -c = -3. Is g prime? True Suppose 0 = 5a - 2k - 4679501, 3k + 2807706 = 608a - 605a. Is a a composite number? False Let p(r) = -2r2 - 6r. Let h be p(-3). Suppose n = 5v - 5574, -2n - 2236 = -2v - hn. Is v prime? False Let c = -148 + 69. Let p = c - -79. Is -14 - -18 - (p - 1773) composite? False Let a be 1(3 + -1) - -9. Suppose -aq + 10236 = -5q. Suppose -t + 4k + q = 3k, 3t - 5158 = -5k. Is t composite? True Let a(i) = -i2 + 112i + 998. Is a(97) a composite number? True Let d = 163 - 242. Let b = 147 + d. Suppose 9q - b = 7q. Is q a composite number? True Let h(p) = -p*3 - 8p*2 + 9p - 36. Let j be h(-11). Let x = j + -166. Is x prime? False Suppose 0 = 17x - 512 + 427. Suppose xd + 3f = -2f + 46010, -4d + 3f = -36773. Is d composite? True Let r(o) = -2603o - 747. Is r(-12) composite? True Let f(s) = 10s*2 + 57s - 15. Let k be f(-6). Let b be 2 + -4 + (-9)/(-1). Suppose kx = -3c + bx + 3533, 0 = -c + 5x + 1196. Is c composite? False Suppose -w - 4a + 56114 = 0, -22a + 15 = -17a. Is w a prime number? False Suppose 3k = 1353n - 1348n - 792089, 2n + 3k - 316802 = 0. Is n composite? True Let v be -5117/(-30)-2. Is (-1138)/1v/26 a composite number? True Let o = -7654 + 16519. Suppose 5m = 5s - 8910, 0m + o = 5s + 4m. Is s a composite number? False Suppose -1 = -2t - 5. Let c be (-4 - 11/t) + 21/(-6). Is 0 - (-8)/c - -1401 a prime number? False Let c be 6/36 - 29/(-6). Suppose -4v + 2v - 1650 = -5u, -v + c = 0. Suppose 3s = b + 397, 2b + u + 196 = 4s. Is s prime? False Let o be (-12)/(-8) + 3/2. Suppose -5p = 5q - 3605, -op + 4p - 2 = 0. Suppose 5t - 4t - q = 0. Is t prime? True Let c(x) = 51x - 7. Let m be c(-4). Let y = m + 494. Let o = 1190 - y. Is o prime? True Suppose 0 = -6l + 2l - 405340. Is (l/(-130))/((-2)/(-4)) prime? True Let m = -20 - -23. Suppose 0 = -mu - 5f + 2f + 12033, -8024 = -2u - 3f. Is u a composite number? True Suppose -2f = 3h - 5608, 3f - 5600 = f - 5h. Let s = 2637 + f. Is s composite? True Let k(b) = -b3 + 11b*2 + 11b + 19. Let g be k(12). Suppose 9m = gm + 6114. Is m composite? True Let d = -1517 + 2417. Suppose -27s + 30s = d. Let w = s + -173. Is w prime? True Let h(d) = -2d3 + 57d*2 + 28d + 45. Let l be h(29). Suppose -4 + 84 = 5j. Is l/(j/(-4)) + 37 a composite number? True Suppose 2n + 89888 = 4g, -56g + 52g + 5n = -89906. Is g a composite number? False Suppose 10741 + 49079 = 12y. Let m = 8682 - y. Is m prime? True Suppose -32993 - 37464 = -7t + 93392. Is t composite? True Let q(s) = 12s2 - 12s + 23. Let d = -196 - -207. Is q(d) prime? False Suppose 2v = -v. Suppose v = 8i + 2680 - 12952. Let l = 1837 - i. Is l prime? False Let b(n) = -n*3 + 11n*2 - 7n + 19. Let z(q) = -q*2 - 22q + 10. Let l = -142 - -120. Let v be z(l). Is b(v) prime? False Suppose 4z + 29792 = 2v, 4v - 66024 = 3z - 6435. Suppose -60054 + 22801 = -5a - s, 2a = -2*s + v.	{ "pile_set_name": "DM Mathematics" }
is 201100 - 12220001022? -12212022222 In base 2, what is -101011001000 + -11011010001110? -100000101010110 In base 5, what is 300223 - -2111213? 2411441 In base 9, what is -52378 + 1004? -51374 In base 6, what is 1 - -2402125512? 2402125513 In base 14, what is 10acd585 + 3? 10acd588 In base 4, what is -2 - 1313303212322? -1313303212330 In base 6, what is 24 + -11414032541? -11414032513 In base 11, what is -94 - 454473? -454557 In base 12, what is -19942 + 16? -19928 In base 3, what is -100200 - -1122121111002? 1122121010102 In base 14, what is -26 - c4c5a? -c4c82 In base 13, what is -3a314 - -777? -3986a In base 16, what is -1a + 7173c? 71722 In base 6, what is -102203332 - -14? -102203314 In base 9, what is -16341130 - 2? -16341132 In base 16, what is a8 + 119d7c? 119e24 In base 9, what is -511780 + 1674? -510105 In base 9, what is 4423178 - 0? 4423178 In base 6, what is -3 + -12342114? -12342121 In base 3, what is 100 + 102220202011220? 102220202012020 In base 13, what is -72 + -a49129? -a4919b In base 13, what is -676b60b - -4? -676b607 In base 8, what is -2266 + 60556? 56270 In base 11, what is 8525 + 14554? 21a79 In base 6, what is -3003342 + 2003? -3001335 In base 3, what is 1122211011 - -1010000? 1200221011 In base 14, what is -ca1b - 27a? -cc97 In base 11, what is -13936a533 + -3? -13936a536 In base 11, what is 932 - -1189? 2010 In base 6, what is 343235043 + 2? 343235045 In base 5, what is -10323 + 32110111? 32044233 In base 10, what is -154 + -387498? -387652 In base 13, what is 624745 - -48? 624790 In base 4, what is -13 - -102030002123? 102030002110 In base 11, what is 26 - 31a80aa? -31a8084 In base 8, what is 16575 + -6502? 10073 In base 11, what is 5a16923 - 4? 5a1691a In base 15, what is -1e - 69d02a? -69d049 In base 12, what is -26823011 + -3? -26823014 In base 16, what is -15b + -14d1? -162c In base 6, what is 3 - 20455443511? -20455443504 In base 10, what is 19616820 + -15? 19616805 In base 11, what is -3 + 91235000? 91234aa8 In base 16, what is -9ac + -62c? -fd8 In base 10, what is -1741 + -914? -2655 In base 10, what is -238 + -89448? -89686 In base 15, what is a + -1620ad? -1620a3 In base 9, what is 1 - 4766682? -4766681 In base 2, what is -10 + -110100001110111011000110? -110100001110111011001000 In base 8, what is 342 - 3052040? -3051476 In base 15, what is 8067092 - 5? 806708c In base 7, what is -2 + -22535020? -22535022 In base 9, what is 17516 - -3858? 22475 In base 13, what is a + -bb0064? -bb0057 In base 2, what is -111101010110100 + 1010011101? -111100000010111 In base 10, what is -481406 - 365? -481771 In base 3, what is -10100 + -1011122102012? -1011122112112 In base 3, what is 20 - 210020011021? -210020011001 In base 13, what is 59 - -117399? 117425 In base 10, what is -3491225 + -25? -3491250 In base 13, what is -2a459 - 4b6? -2a942 In base 13, what is 10 + 34a4303? 34a4313 In base 7, what is -4115 - -123? -3662 In base 16, what is -bc + -6099? -6155 In base 11, what is -1 - -698291a? 6982919 In base 5, what is -323323021 - 22? -323323043 In base 13, what is 338a - 4697? -130a In base 7, what is -623430 + 10336? -613061 In base 13, what is 3659a + 757? 37024 In base 2, what is 1110111110100000111011 + 10001? 1110111110100001001100 In base 12, what is 15442 + -300? 15142 In base 16, what is 2ec - -92c2? 95ae In base 6, what is 30104 + -1042442? -1012334 In base 13, what is 1c290 - 68? 1c225 In base 8, what is -53063356 + 2? -53063354 In base 10, what is 13751 + -6079? 7672 In base 6, what is -13544 - 44004? -101552 In base 3, what is -1011121222 - -122202202? -111212020 In base 13, what is -c8491 - 8? -c8499 In base 12, what is -201855b - 2a? -2018589 In base 16, what is 1d2 - 16d9c? -16bca In base 12, what is 108a + -11555? -10487 In base 14, what is c4563 - -4? c4567 In base 16, what is -14d3120d + 0? -14d3120d In base 2, what is -110111000101001100100 - -111? -110111000101001011101 In base 3, what is -121101 - -2212102202? 2211211101 In base 5, what is -142014343 + -11? -142014404 In base 13, what is 157a8c13 - -1? 157a8c14 In base 3, what is -20201010221100 - 210? -20201010222010 In base 16, what is -d - 4a0df? -4a0ec In base 12, what is b6 - 31a8? -30b2 In base 15, what is -65 + -52bd9? -52c4e In base 11, what is -1477103 - -5? -14770a9 In base 4, what is -330023310 - -22203? -330001101 In base 5, what is -30 - 113342201? -113342231 In base 2, what is -1000100110101010001 + 10011001110? -1000100100010000011 In base 16, what is 88e724 + 1? 88e725 In base 14, what is -12c3311 + 1? -12c3310 In base 4, what is -2 + 13011020311? 13011020303 In base 10, what is -906 - -16371? 15465 In base 16, what is -36730 + 2? -3672e In base 7, what is 1304225 - -2101? 1306326 In base 10, what is 77546 + 2756? 80302 In base 13, what is 142759b1 - -4? 142759b5 In base 12, what is -30822b - 1? -308230 In base 9, what is 1185 - 31465? -30270 In base 15, what is 1e677 - 856? 1dd21 In base 15, what is -ae667 - -c? -ae65a In base 15, what is 348 - 314? 34 In base 11, what is 1719070 - 14? 1719057 In base 10, what is 30 - -1941401? 1941431 In base 14, what is 9973519 + 4? 997351d In base 9, what is -5 + 165372006? 165372001 In base 4, what is 302030223 + -2201? 302022022 In base 11, what is -4 + -174a331? -174a335 In base 4, what is -2331211 + 211203? -2120002 In base 6, what is 135 + -11154152? -11154013 In base 7, what is 362 - 1152443? -1152051 In base 13, what is -465 + -b208? -b670 In base 14, what is d + -4d443? -4d434 In base 5, what is -202043234 + -3443? -202102232 In base 13, what is 3872 + 1782? 5324 In base 16, what is 82357 - 45? 82312 In base 6, what is 3 + -25034134? -25034131 In base 2, what is -1001110001000100 - -111101000010? -1000110100000010 In base 5, what is -21313204300 + 1? -21313204244 In base 13, what is -54346 + -122? -54468 In base 10, what is -6423 + -14905? -21328 In base 10, what is -4467589 - 2? -4467591 In base 5, what is -12243421 + -2334? -12301310 In base 4, what is 111131021 - 32331? 111032030 In base 5, what is -332012 + -24344? -411411 In base 5, what is 2010401 + -203? 2010143 In base 14, what is 533 + -10ad80? -10a84b In base 4, what is 0 - 120032230133? -120032230133 In base 3, what is -1112101011101 + -1122212? -1112102211020 In base 10, what is -3004 + -13791? -16795 In base 5, what is -10 + 33403323333? 33403323323 In base 3, what is 1212 - -21212011211? 21212020200 In base 9, what is 1470775007 - -4? 1470775012 In base 9, what is 435176055 + 1? 435176056 In base 2, what is 100000011001110100 + 100101111? 100000011110100011 In base 9, what is 34014585 + 0? 34014585 In base 9, what is -32674346 + -3? -32674350 In base 10, what is 483 - -60258? 60741 In base 7, what is -16356 - 365422? -415111 In base 16, what is 121043c6 - -3? 121043c9 In base 10, what is 4863517 + -20? 4863497 In base 16, what is 2fb - -5ab? 8a6 In base 7, what is 1 - 15140041? -15140040 In base 12, what is 7 - 231224? -231219 In base 6, what is -20 - -141250454? 141250434 In base 7, what is -2 + 6311454455? 6311454453 In base 9, what is 4 - 45044? -45040 In base 8, what is -51 + 1352421? 1352350 In base 4, what is 13232 - -33321? 113213 In base 2, what is 111111111110101011110 - 100? 111111111110101011010 In base 9, what is 2 - -1043501614? 1043501616 In base 12, what is -51 + -212b1? -21342 In base 16, what is bf68fd + 5? bf6902 In base 6, what is -22133304 - 1121? -22134425 In base 6, what is -101452 - -142215? 40323 In base 10, what is -12688 - -227? -12461 In base 5, what is 102 + -333133? -333031 In base 14, what is 8 + -4c11920? -4c11916 In base 2, what is 110100101110001 - 100110? 110100101001011 In base 5, what is 130001 - 1040? 123411 In base 4, what is 3222200021 - -132? 3222200213 In base 4, what is 11 + 1102020031? 1102020102 In base 15, what is 132983 - -9? 13298c In base 14, what is -134 - -39b96? 39a62 In base 16, what is -5da153 + 4? -5da14f In base 16, what is -41e154 + 1b? -41e139 In base 4, what is 1221210133210 - -2? 1221210133212 In base 12, what is -4 - 603493? -603497 In base 15, what is -48 + -3c1e5? -3c23d In base 15, what is -480 + 3169? 2bd9 In base 11, what is -40854885 + -3? -40854888 In base 2, what is -1 + 101010011110011011011? 101010011110011011010 In base 10, what is 1302 + 29518?	{ "pile_set_name": "DM Mathematics" }
he y'th term of 34, 26, 6, -32, -94, -186? -y*3 - y + 36 What is the i'th term of -36, -300, -1010, -2388, -4656, -8036? -37i3 - i2 - 2i + 4 What is the a'th term of -1316, -1315, -1312, -1307, -1300? a2 - 2a - 1315 What is the p'th term of 86, 114, 142? 28p + 58 What is the z'th term of -50, -30, 16, 100, 234, 430, 700? 2z3 + z2 + 3z - 56 What is the v'th term of -30, -35, -8, 57, 166, 325? v3 + 10v*2 - 42v + 1 What is the h'th term of -67, -81, -103, -133, -171? -4h2 - 2h - 61 What is the t'th term of -157, -125, -89, -49? 2t2 + 26t - 185 What is the a'th term of 101, 110, 133, 176, 245? a3 + a2 - a + 100 What is the z'th term of -18, 91, 384, 951, 1882, 3267, 5196? 15z3 + 2z*2 - 2z - 33 What is the l'th term of 1026, 2038, 3036, 4014, 4966? -l3 - l2 + 1022l + 6 What is the i'th term of 21, 64, 123, 204, 313, 456, 639, 868? i3 + 2i*2 + 30i - 12 What is the z'th term of -138, -139, -140, -141? -z - 137 What is the i'th term of -21, 80, 351, 876, 1739, 3024? 14i3 + i2 - 36 What is the w'th term of -852, -850, -848? 2w - 854 What is the l'th term of 4327, 8649, 12971? 4322l + 5 What is the n'th term of -1, 2, 11, 26, 47? 3n*2 - 6n + 2 What is the f'th term of -50, -172, -372, -650? -39f2 - 5f - 6 What is the x'th term of 23, 38, 67, 116, 191? x3 + x2 + 5x + 16 What is the q'th term of 10, 53, 126, 229, 362, 525? 15q*2 - 2q - 3 What is the g'th term of 42, 55, 72, 93? 2g2 + 7g + 33 What is the z'th term of -10, -43, -98, -175, -274? -11z2 + 1 What is the d'th term of -197, -190, -181, -170, -157, -142? d2 + 4d - 202 What is the n'th term of -1639, -3277, -4915, -6553? -1638n - 1 What is the b'th term of -12689, -12700, -12725, -12770, -12841, -12944, -13085, -13270? -b3 - b2 - b - 12686 What is the r'th term of 3868, 7739, 11614, 15493? 2r*2 + 3865r + 1 What is the o'th term of -103, -117, -131, -145, -159? -14o - 89 What is the f'th term of 13, 16, 21, 28, 37, 48, 61? f2 + 12 What is the g'th term of 15, 7, -5, -21, -41, -65, -93? -2g*2 - 2g + 19 What is the u'th term of -431, -435, -439, -443, -447, -451? -4u - 427 What is the a'th term of -68, -80, -94, -110, -128, -148? -a2 - 9a - 58 What is the o'th term of 45, 120, 227, 366? 16o2 + 27o + 2 What is the z'th term of 50, 99, 180, 293, 438, 615? 16z2 + z + 33 What is the y'th term of 13, 20, 25, 22, 5? -y3 + 5y2 - y + 10 What is the t'th term of -84, -177, -282, -405, -552? -t3 - 86t + 3 What is the x'th term of -3, -29, -51, -69, -83, -93, -99? 2x*2 - 32x + 27 What is the o'th term of -128, -132, -136? -4o - 124 What is the z'th term of -179, -180, -183, -188, -195, -204? -z2 + 2z - 180 What is the m'th term of -6, -1, 8, 21, 38, 59? 2m2 - m - 7 What is the n'th term of 39, 61, 83, 105, 127? 22n + 17 What is the z'th term of 131, 129, 125, 119, 111? -z2 + z + 131 What is the w'th term of -116, -216, -314, -410, -504? w2 - 103w - 14 What is the r'th term of 81, 98, 139, 216, 341, 526, 783, 1124? 2r*3 + 3r + 76 What is the l'th term of -15, -47, -103, -195, -335? -2l3 - 18l + 5 What is the u'th term of -5, -24, -59, -110, -177, -260? -8u2 + 5u - 2 What is the g'th term of 100, 93, 86? -7g + 107 What is the d'th term of -63, -209, -453, -795, -1235, -1773? -49d2 + d - 15 What is the c'th term of 59514, 59515, 59516, 59517, 59518, 59519? c + 59513 What is the b'th term of 2, -5, -14, -25, -38, -53? -b2 - 4b + 7 What is the q'th term of 36, 40, 44, 48, 52, 56? 4q + 32 What is the y'th term of -274, -274, -290, -328, -394? -y*3 - 2y*2 + 13y - 284 What is the u'th term of -3, 10, 37, 84, 157, 262? u3 + u2 + 3u - 8 What is the y'th term of 57, 61, 67, 75, 85? y2 + y + 55 What is the l'th term of 35, 144, 325, 578, 903, 1300, 1769? 36l*2 + l - 2 What is the x'th term of -110, -113, -116, -119, -122, -125? -3x - 107 What is the r'th term of 199, 195, 181, 151, 99, 19, -95, -249? -r3 + r2 + 199 What is the i'th term of 2, -1, -18, -55, -118? -i3 - i2 + 7i - 3 What is the h'th term of -14, -25, -40, -59, -82, -109, -140? -2h*2 - 5h - 7 What is the y'th term of 110, 120, 116, 92, 42, -40, -160? -y3 - y2 + 20y + 92 What is the i'th term of 53, 202, 451, 800? 50i*2 - i + 4 What is the h'th term of 1054, 1055, 1056? h + 1053 What is the o'th term of 136, 141, 146, 151? 5o + 131 What is the u'th term of 51, 95, 127, 141, 131, 91? -u*3 + 51u + 1 What is the c'th term of 1862, 1853, 1830, 1787, 1718? -c3 - c2 + c + 1863 What is the v'th term of 159, 327, 507, 699, 903? 6v2 + 150v + 3 What is the n'th term of -2, -4, -28, -86, -190? -2n3 + n2 + 9n - 10 What is the n'th term of 50, 275, 838, 1907, 3650, 6235, 9830? 28n3 + n2 + 26n - 5 What is the t'th term of -730, -740, -750, -760? -10t - 720 What is the g'th term of -1, -6, -29, -82, -177, -326, -541? -2g*3 + 3g*2 - 2 What is the q'th term of 6868, 6869, 6870, 6871, 6872, 6873? q + 6867 What is the f'th term of -1, 7, 19, 35, 55, 79? 2f*2 + 2f - 5 What is the m'th term of -609, -598, -587, -576, -565, -554? 11m - 620 What is the o'th term of 175, 346, 517, 688, 859? 171o + 4 What is the i'th term of -292, -294, -306, -334, -384? -i3 + i2 + 2i - 294 What is the n'th term of -3, -4, -5, -6, -7? -n - 2 What is the z'th term of -197, -202, -207, -212, -217, -222? -5z - 192 What is the f'th term of -1233, -2445, -3623, -4749, -5805? 3f3 - f2 - 1230f - 5 What is the f'th term of -82, -162, -246, -334? -2f2 - 74f - 6 What is the l'th term of 564, 565, 564, 561? -l*2 + 4l + 561 What is the o'th term of 6, -59, -124? -65o + 71 What is the c'th term of -82, -167, -268, -391, -542, -727, -952, -1223? -c3 - 2c*2 - 72c - 7 What is the n'th term of -307, -308, -309? -n - 306 What is the u'th term of 118, 222, 326, 430, 534? 104u + 14 What is the b'th term of -4434, -4430, -4416, -4386, -4334? b3 - b2 - 4434 What is the x'th term of -76, -91, -106, -121? -15x - 61 What is the l'th term of -59, -18, 31, 94, 177, 286? l*3 - 2l*2 + 40l - 98 What is the h'th term of -273, -272, -271, -270? h - 274 What is the v'th term of -421, -420, -419, -418, -417? v - 422 What is the h'th term of -46, -22, 24, 92, 182, 294, 428? 11h2 - 9h - 48 What is the x'th term of 45, 40, 27, 0, -47? -x*3 + 2x*2 - 4x + 48 What is the d'th term of 199, 198, 197, 196? -d + 200 What is the t'th term of 16, 39, 64, 85, 96, 91, 64? -t*3 + 7t*2 + 9t + 1 What is the g'th term of 8, 27, 58, 101, 156? 6g2 + g + 1 What is the f'th term of -5, -14, -7, 16, 55, 110, 181? 8f*2 - 33f + 20 What is the r'th term of 6, 27, 58, 99, 150, 211? 5r2 + 6r - 5 What is the y'th term of 382, 467, 608, 805, 1058? 28y2 + y + 353 What is the f'th term of -121, -468, -1051, -1876, -2949, -4276? -f3 - 112f*2 - 4f - 4 What is the d'th term of -1495, -1501, -1521, -1561, -1627, -1725, -1861? -d3 - d2 + 4d - 1497 What is the m'th term of -1887, -1891, -1907, -1941, -1999, -2087, -2211? -m3 + 3m - 1889 What is the d'th term of -346, -345, -344, -343, -342, -341? d - 347 What is the t'th term of 53, 49, 45, 41? -4t + 57 What is the p'th term of -9, -27, -39, -39, -21? p3 - 3p*2 - 16p + 9 What is the d'th term of -365, -745, -1139, -1553, -1993, -2465, -2975? -d3 - d2 - 370d + 7 What is the p'th term of 72, 73, 74? p + 71 What is the z'th term of -7, -51, -129, -241? -17z*2 + 7z + 3 What is the v'th term of -26, -21, -18, -17? -v*2 + 8v - 33 What is the f'th term of -166, -172, -180, -190, -202, -216? -f*2 - 3f - 162 What is the h'th term of -52, -53, -56, -61, -68? -h*2 + 2h - 53 What is the m'th term of -28, -82, -160, -256, -364, -478, -592, -700? m*3 - 18m*2 - 7m - 4 What is the k'th term of 20, 31, 42, 53? 11k + 9 What is the d'th term of -7777, -15548, -23317, -31084? d2 - 7774d - 4 What is the l'th term of 32, 89, 194, 353, 572, 857? l*3 + 18l*2 - 4l + 17 What is the q'th term of 126, 125, 122, 117, 110? -q*2 + 2q + 125 What is the b'th term of 432, 1670, 3734, 6624, 10340, 14882? 413b2 - b + 20 What is the n'th term of -2205, -4415, -6627, -8841, -11057, -13275, -15495? -n2 - 2207n + 3 What is the f'th term	{ "pile_set_name": "DM Mathematics" }
21/n(11/3)n*(1/5)(nnn(-11))/n)(-1/12) assuming n is positive. n(-113/180) Simplify (l9/(l*(-11)l))(-9)/(l(-7)/l*(-1/4)l3/l(-1/2)) assuming l is positive. l(-671/4) Simplify (t(-2/15)(t/(t(1/4)/t))/t)(2/97)(((t*(2/5)t)/t)/t*4)/(t/(tt*5t)t4/t) assuming t is positive. t(-1709/2910) Simplify (((kk/(k/k*(1/5)))/(k/(kk(-2/17))))/((k/k17)/(k/(k/k(-15)))))15 assuming k is positive. k*(531/17) Simplify (c(c/c*3)/cc7)(-16)/((cc/c7)/c(-2/7))(-1/13) assuming c is positive. c(-7313/91) Simplify (x/x(-5)xx(-7)x*(-2/3)x*(-1/5)xxx)/(x((xx((xx*6x)/x)/x)/x)/xx(-2/23))(13/5) assuming x is positive. x(-1093/69) Simplify (((((kk/((k*0kk)/k)kk)/k)(6/7))(3/46))(-16))(-33) assuming k is positive. k(9504/161) Simplify ((j(21/4)jj(-37))(-15))(1/7) assuming j is positive. j(1845/28) Simplify ((l(-2))(19/5))(-15)((l(1/3))(-2/47))47 assuming l is positive. l(340/3) Simplify ((u*17/(uu*(24/5)/uu))/(u/(uu/(u/(u(-2/31)u))))(2/83))(6/23) assuming u is positive. u(866268/295895) Simplify ((j/j(-1/13))*(2/101)(jj/(j(2/35)j))(2/93))(-47) assuming j is positive. j*(-2785502/1424605) Simplify (r/(rr/r*(-3/4))r*(-2/5)(rr0)(3/16))/(r3r/(rrr(1/8)))(-4) assuming r is positive. r(443/80) Simplify ((o(-16))36/(o(-1/54)/oo/((o(-10)/oo)/o)o))(-9) assuming o is positive. o(31751/6) Simplify (((d/d(3/5))/d)/((d/(dd*(-5/6)d)d)/d))/(d/(d/((dd*(-1/2)d)/d))d)(-25/2)(d*(-2)d(-2/21))22 assuming d is positive. d*(-3889/140) Simplify (((((k(((k/k*(4/7))/k)/kkk)/k)/k)/k)/kk*(-7/4)k)/(k(-2/23)/(k/k(1/34))))(8/9) assuming k is positive. k(-49570/24633) Simplify (((ww(5/2)www)/wwww(-9)(www*(-10)w)/w(3/5))(-23))(-12/7) assuming w is positive. w(-1794/5) Simplify ((d(-3/4))(-36)/(d*(2/29)d(((dd/d*(1/9)d)/ddd)/d)/d))(3/16) assuming d is positive. d(6275/1392) Simplify (z*(-2/5)z)/((zz(-1/6))/z)(z1/z)28(((z/z(-15))/z)/zzz(2/5)z)35 assuming z is positive. z(17243/30) Simplify ((ll(-2/3)l)/ll(1/2))(2/95)(l*(-2/7)l/(l/l*4l))/(l1)39 assuming l is positive. l(-14471/399) Simplify ((q44q)/q)(-42)((q/(q/(q*(-32)qqq)q))/q)30 assuming q is positive. q(-2778) Simplify ((n(-1/46)/nn/(nn13))/((n8n)/(n*(-6/5)n)))(-15) assuming n is positive. n(16023/46) Simplify (c/(c*(2/19)/c)cc3)(-9)/((c(4/7)/c(c*(-3/5)/c)/c)/((cc/(cc/((c(-3)cc)/c)cc))/(c/c(-2/17)))) assuming c is positive. c(-623377/11305) Simplify (g(6/11)/(g/(gg*(23/6)))(gg/(g/(g(1/27)/g))g)/(g/g(-6/37)))(-3/20) assuming g is positive. g(-93487/146520) Simplify (r/r(-11)r4)19/(r5r(2/11))(-11/4) assuming r is positive. r*(1273/4) Simplify ((y/(yy*(1/2)y))/(yyy*(2/11)yy))/((y(2/9)/y)/yy*(1/3)/y)(y1)14/(y(-2/5)/(y/(y5y))) assuming y is positive. y(6101/990) Simplify (m(2/15)m6)12/((m0)(-36))(2/37) assuming m is positive. m(368/5) Simplify (d/d0)45(d(2/3))(1/40)(((d/(d/d(1/7)))/d)/(d/d(2/17)))/(d/(d/(d*(3/2)d))d(ddd(3/4)/d)/d) assuming d is positive. d(139327/3570) Simplify ((q*(-10)q*(3/5)q*(3/5)qqq(-6))(-1))(-20) assuming q is positive. q(-256) Simplify ((a*(-11)aa/a3aa)/(a2aaa/(a(1/26)/a)))(-9/13) assuming a is positive. a(3735/338) Simplify ((z/z(-3/5))(-43)/(z4(z3/z)/z))43 assuming z is positive. z(-15867/5) Simplify ((g(-1/2))(-29)/((g(gg(g*14g)/gg)/ggg)/g(2/41)))(2/43) assuming g is positive. g(-365/1763) Simplify ((yy*8y)(-12)/(y(2/15))(2/17))(-2/113) assuming y is positive. y(61208/28815) Simplify ((((p/p(-2/9)p)(-38))50)(-1/21))(-24) assuming p is positive. p(-304000/63) Simplify ((s4s*3)/(ss(-2/5))(-1/19))/(((s/((s(-2)/s)/s))/s)/s(-5)((s/(s/s(-1)))/s)/s6) assuming s is positive. s(573/95) Simplify (((yy/(y*(-4)y))(-1/9)/(y11y14))(-1/31))(3/4) assuming y is positive. y(115/186) Simplify (((w/(w/w(-1/2))(w(ww2)/w)/w)(5/7))(-40))47 assuming w is positive. w(-14100/7) Simplify ((((w/(w(-7)ww)w)/w)/w)/(w/(w(-2/3)ww)))(31/2)/((w(1/2))23ww(-5/2)w/(w/w*5ww)) assuming w is positive. w(209/3) Simplify (((m/m1)(-15)/(m(-2/11)/m(-5/6)))6)(-21) assuming m is positive. m(903/11) Simplify (((f(-2/5))12/(ff(2/7))24)(-10/11))(-1/19) assuming f is positive. f*(-2496/1463) Simplify (cc/(cc(11/4))c5)(-41)(c(1/2)cc4c)/(c*2c/(c/c(1/2))) assuming c is positive. c(-517/4) Simplify (kk0)(1/4)k*6kk0(k*(1/5)(k((k6/k)/k)/kk)/k)(-3/10) assuming k is positive. k(599/100) Simplify ((o/o*(-1/3)oo)/(o((o*(-2/11)/o)/o)/o)o(-1/4)/o(-1))/((o*(-2/13)o(-3))/(o(2/5)o(-2/21))) assuming o is positive. o(584009/60060) Simplify (k/k(2/9))(4/31)(k/k*(-1/9)k)/kk(4/7)(k(-1/3))29/(k/(k*1kk)kkk(-2/27)/k) assuming k is positive. k(-39898/5859) Simplify ((c/(c*(1/4)c))(7/6))(-36)/((c1)(3/7)(c(-1))(5/3)) assuming c is positive. c(493/42) Simplify ((d6/d(-1/8))/(d2d(1/4)))/(d(10/3)/(ddd/d*(-3/14)d))(-27/7) assuming d is positive. d(187/392) Simplify ((r*(-2/27)r)/(rr(-11)))(-18)(r7/r(-9))/(r/(r/(r*(-3/11)/rr))((r/r(4/7))/rr)/r) assuming r is positive. r(-41539/231) Simplify ((t(-1/2))23)(-40)/(t/(t/t*(3/8)t)t/t(-3/5))(2/3) assuming t is positive. t(9187/20) Simplify (l(-27)l*(-24)l/(l(ll/l*(-3))/l)ll/(l/l12l))(1/17) assuming l is positive. l(-43/17) Simplify (z/z*(2/7)z(-9/2))(-5)(z/(z(-2/3)/z)z*(3/5))/((zz*(3/7)z)/zz(-8)/z) assuming z is positive. z(893/30) Simplify ((i(-1))(-3)/(ii/i*(-4/3)i(i12i)/i))(1/43) assuming i is positive. i(-40/129) Simplify (((u/(uu/u0))(-5/3)/((u(7/6)/u)/uu/u9))(-15/4))(8/5) assuming u is positive. u(-63) Simplify ((w(-2/7))(-13/2)((w/(w/(www/(w/(www/(w/w(-1)))))))/w)(-13/5))/(ww*12/www/(w/w(4/3)))(13/2) assuming w is positive. w(-20267/210) Simplify (((rr/(rr(1/8)))/rr(rr*(-10))/rrrrrr*(-1/6)rr/((r/(r/(r1/r)))/r))39)(-20) assuming r is positive. r(3575/2) Simplify (x(-2/11)x(2/11))35x/((xx*(-4)/x)/x)x*(-2/13)/x((x/(x/((xx(-3/5)x)/xx)))/x)/xx/x(-5) assuming x is positive. x(666/65) Simplify ((j/j*(-1)j)(-49)/(j(2/7)j5))/((j3/j)/((j/j6)/jj)j4/j(2/17)) assuming j is positive. j(-19417/119) Simplify ((p/((((p/p(-14))/pp)/p)/p))/(p*(2/25)p))*(-17)/(pp*(-12)p*(-2)pp)(4/13) assuming p is positive. p(73367/325) Simplify (fff(-6/5))/(f(-15)/f)(f11)36 assuming f is positive. f(2064/5) Simplify (i(-36))33/(i(-5/8)/i(1/3)) assuming i is positive. i(-28489/24) Simplify b(-4)/(b/b0)(b(bb/(bb(-1/3)))/b)/(b/(b(1/8)/b))(b(-2/5))(-6/13)/((b/b(3/8)b)/((b/b1)/b)) assuming b is positive. b(-3113/390) Simplify (u(2/7))(-13)(u(-2/5))(2/9)((uu/(uuu/(u0u)))(-6/17))(-2/63) assuming u is positive. u(-1198/315) Simplify (m5m3/m)/(m(1/2))(-2/7)(m/m*(-2/9)mm(-4/5)mm)22 assuming m is positive. m(25966/315) Simplify ((w1)(-7))(-5/3)((w(w/(w/w0))/ww)(1/30))(-1/19) assuming w is positive. w*(6649/570) Simplify ((((h/((hh*(-2/175)h)/h))/h)/(h/(hh(-41)/h)))/(h36h/((hh(-37))/hh)))28 assuming h is positive. h(-81192/25) Simplify ((((jjj/(j/(j*(4/9)/j))j)/((jj6)/j))/((j3/j)/(j/j(-2/7))))(-21/2))(-1/41) assuming j is positive. j(-269/246) Simplify ((((z(1/10)/z)/z(-1/2))/(z0)(1/14))(-4))(-2/13) assuming z is positive. z(-16/65) Simplify ((y/(y/(yy*(4/5))))/(((yyy/((yy*(-3/4)/y)/y))/yy)/yy))(-26)/(((y(-3)/y)/((y/(yy*(-2/7)))/yy))/(y*2y/y(3/4))) assuming y is positive. y(11653/140) Simplify ((mm(-5/4))(-1/24)(m/((mm(2/33)mm)/m))38)(-39) assuming m is positive. m(553137/352) Simplify ((uu/u21)(-38)/((u(1/10)/u)/u)(-2/17))**(-4/25) ass	{ "pile_set_name": "DM Mathematics" }
2 1110101101 11100011000 (base 2) to base 5 24231 Convert 135335 (base 7) to base 4. 12110222 What is 1330 (base 9) in base 3? 1101000 Convert -210011212 (base 3) to base 11. -10667 Convert -322 (base 11) to base 7. -1062 -fba (base 16) to base 9 -5463 Convert 11100010110 (base 2) to base 11. 13aa What is -65d5 (base 15) in base 6? -243515 Convert 136 (base 12) to base 16. ba What is 165 (base 16) in base 9? 436 Convert 623f (base 16) to base 11. 17995 What is 98b (base 12) in base 6? 10255 1857 (base 11) to base 9 3213 Convert 530414 (base 6) to base 9. 64781 20202131 (base 4) to base 5 2104343 Convert -2b6 (base 13) to base 7. -1264 What is -51 (base 14) in base 8? -107 What is 10000111 (base 2) in base 3? 12000 What is -ae64 (base 15) in base 11? -25881 What is -6712 (base 8) in base 12? -2062 -251 (base 13) to base 5 -3104 Convert -2709 (base 10) to base 9. -3640 What is -5557 (base 11) in base 2? -1110010011010 What is -18d7 (base 15) in base 6? -40521 -1610 (base 8) to base 12 -634 What is -296 (base 14) in base 8? -1014 What is 1c8 (base 15) in base 11? 346 100000 (base 3) to base 6 1043 What is 435 (base 11) in base 16? 20a -1507 (base 15) to base 13 -2089 Convert 1231113 (base 4) to base 3. 100121020 What is -32c6 (base 15) in base 12? -6289 What is 2d5 (base 14) in base 8? 1103 39 (base 16) to base 13 45 -101000010 (base 2) to base 16 -142 Convert -6205 (base 7) to base 13. -ca3 122ac (base 14) to base 5 2410243 434 (base 9) to base 12 257 2122 (base 6) to base 13 2b1 Convert -57288 (base 9) to base 12. -1a0b2 157a (base 12) to base 7 10261 -18b0 (base 13) to base 11 -2857 Convert -3424 (base 9) to base 4. -213211 What is -863 (base 14) in base 12? -b5b What is -64620 (base 8) in base 7? -141534 15573 (base 8) to base 5 211120 What is -1133331 (base 4) in base 16? -17fd What is 574 (base 16) in base 5? 21041 -2130030 (base 4) to base 12 -5950 110101111 (base 2) to base 8 657 What is 2221022 (base 3) in base 12? 12a5 What is 13114 (base 5) in base 6? 4442 Convert 568 (base 9) to base 10. 467 13000302 (base 4) to base 3 1110101210 What is 10220 (base 4) in base 10? 296 What is -6000 (base 7) in base 10? -2058 What is 1368 (base 11) in base 16? 6e8 What is 3b4 (base 15) in base 8? 1514 -7008 (base 12) to base 4 -2331020 -10012203 (base 5) to base 16 -134cd Convert -305 (base 15) to base 16. -2a8 -2253 (base 9) to base 11 -1287 Convert -1821 (base 9) to base 11. -105a Convert -22011 (base 6) to base 9. -4137 -10311 (base 4) to base 5 -2214 -3822 (base 13) to base 15 -2566 406 (base 12) to base 5 4312 -19758 (base 10) to base 6 -231250 63460 (base 7) to base 5 1000143 -1313 (base 6) to base 8 -515 What is -212100 (base 4) in base 3? -10100200 -94a2 (base 14) to base 13 -b87c What is 20445 (base 6) in base 12? 1725 Convert -2a4 (base 13) to base 10. -472 What is -421 (base 11) in base 12? -363 What is -1415055 (base 6) in base 2? -10011100100101011 2101100110 (base 3) to base 15 dd76 Convert -706 (base 8) to base 16. -1c6 Convert 4473 (base 11) to base 15. 1b28 23000 (base 4) to base 14 384 -1506 (base 8) to base 3 -1011001 -1521 (base 7) to base 5 -4403 What is 33122 (base 4) in base 8? 1732 Convert -9a3a (base 11) to base 7. -53402 What is 172 (base 10) in base 7? 334 What is 265 (base 11) in base 13? 1b1 What is -1231 (base 8) in base 5? -10130 -28085 (base 11) to base 2 -1001110001010111 What is -10002002 (base 3) in base 4? -203003 657 (base 12) to base 4 32203 Convert b8ad (base 15) to base 5. 2222323 Convert 330 (base 15) to base 7. 2046 What is 5250 (base 10) in base 4? 1102002 Convert 2829 (base 16) to base 4. 2200221 3067 (base 8) to base 11 1217 Convert 28487 (base 9) to base 12. b251 3065 (base 7) to base 6 4552 What is 11234 (base 6) in base 5? 22411 What is 1324 (base 7) in base 10? 508 Convert 127 (base 15) to base 5. 2022 -79 (base 16) to base 2 -1111001 520 (base 8) to base 15 176 What is -11413 (base 5) in base 14? -454 Convert -1312 (base 10) to base 6. -10024 -19561 (base 11) to base 12 -13964 -1100242 (base 6) to base 8 -152402 What is -3371 (base 8) in base 10? -1785 What is 101010000001011 (base 2) in base 13? 9a40 30893 (base 11) to base 9 67642 What is 123504 (base 7) in base 14? 84ab Convert a39 (base 12) to base 3. 2001000 201440 (base 6) to base 14 5b44 Convert -4a7a (base 12) to base 16. -20fe 10376 (base 9) to base 16 1ad9 What is 123144 (base 5) in base 10? 4799 -450 (base 15) to base 5 -12400 -212010010 (base 3) to base 10 -16851 What is 27206 (base 10) in base 2? 110101001000110 -7653 (base 9) to base 16 -1605 -10323010 (base 4) to base 12 -b804 What is -387 (base 13) in base 3? -211220 Convert -2304 (base 5) to base 15. -16e What is 5226 (base 8) in base 5? 41320 What is 65 (base 14) in base 3? 10022 13037 (base 11) to base 12 a982 -524 (base 9) to base 7 -1150 Convert -1411 (base 5) to base 11. -1a0 What is -1043230 (base 5) in base 8? -44205 Convert 312103 (base 4) to base 14. 13a3 Convert 1331030 (base 5) to base 14. 9bb9 What is a95 (base 11) in base 2? 10100100010 Convert -404d (base 15) to base 11. -a21a Convert -2ba (base 16) to base 4. -22322 Convert -10225 (base 9) to base 6. -51122 Convert 79600 (base 10) to base 12. 3a094 331000 (base 5) to base 12 66bb What is -11405 (base 9) in base 5? -220434 What is 11101101 (base 2) in base 3? 22210 Convert 13515 (base 8) to base 2. 1011101001101 What is 204256 (base 7) in base 5? 2111000 Convert 31642 (base 7) to base 9. 11714 138 (base 12) to base 16 bc What is 491 (base 15) in base 9? 1371 What is 185 (base 12) in base 7? 500 What is -17086 (base 12) in base 8? -100246 -240243 (base 5) to base 2 -10001001110111 What is -13003003 (base 4) in base 15? -8847 Convert 2504 (base 6) to base 8. 1150 What is 5014 (base 6) in base 4? 101002 Convert -2206 (base 8) to base 5. -14113 What is -222003 (base 5) in base 11? -5909 -3b5 (base 16) to base 14 -4bb -15 (base 16) to base 10 -21 Convert 27606 (base 10) to base 11. 19817 Convert 10b6 (base 13) to base 10. 2346 -2616 (base 11) to base 3 -11200010 12301 (base 6) to base 7 5233 What is 110110101100 (base 2) in base 9? 4718 Convert 1310 (base 15) to base 7. 14565 Convert -656c (base 13) to base 6. -145205 What is -82e (base 16) in base 12? -1266 What is -12132 (base 5) in base 6? -4125 Convert -1100010101 (base 2) to base 16. -315 63a (base 11) to base 2 1100000001 What is 12300 (base 4) in base 5? 3212 607 (base 9) to base 5 3433 db (base 15) to base 3 21122 What is -2140 (base 7) in base 12? -537 -3134 (base 5) to base 11 -351 -30032 (base 4) to base 9 -1058 39238 (base 10) to base 2 1001100101000110 What is 101011010 (base 2) in base 11? 295 Convert -137c7 (base 15) to base 10. -62512 What is 1a2 (base 15) in base 2? 101111001 What is 249 (base 11) in base 6? 1211 12113 (base 4) to base 6 1515 What is 142122 (base 5) in base 6? 43212 What is 496 (base 11) in base 9? 724 -122 (base 14) to base 2 -11100010 Convert 68187 (base 9) to base 12. 222ba What is 141125 (base 7) in base 15? 7e32 What is -6024 (base 9) in base 10? -4396 Convert -4143 (base 5) to base 11. -459 -320 (base 13) to base 7 -1361 -10110101010 (base 3) to base 8 -204746 Convert -25150 (base 9) to base 6. -210113 Convert e7b3 (base 15) to base 7. 262560 What is 13005 (base 7) in base 4? 311223 What is -114 (base 16) in base 10? -276 What is -1d48 (base 15) in base 16? -18e0 What is 413303 (base 5) in base 6? 142510 What is 11120200 (base 3) in base 2? 110100001011 Convert -103010 (base 5) to base 9. -4724 10342 (base 10) to base 13 4927 -23423 (base 8) to base 13 -4726 What is -252054 (base 6) in base 8? -53742 What is -221 (base 8) in base 4? -2101 What is -110102202 (base 3) in base 2? -10001101101001 What is -130204 (base 5) in base 4? -1032332 6ab (base 14) to base 6 10051 -102ca (base 15) to base 2 -1100100001000001 What is -a8c (base 14) in base 9? -2765 Convert -f08 (base 16) to base 9. -5245 Convert -30013 (base 6) to base 3. -12100100 Convert -540 (base 9) to base 5. -3231 11001010011 (base 2) to base 11 1242 -24642 (base 7) to base 16 -1962 -316 (base 8) to base 2 -11001110 What is -1100010010010111 (base 2) in base 5? -3102302 13110 (base 4) to base 9 570 Convert 1717 (base 11) to base 10. 2196 What is 100202201 (base 3) in base 16?	{ "pile_set_name": "DM Mathematics" }
et y(h) = -11h + 157. Determine y(8). 69 Let p(t) = -160t*2 - 3t + 2. Calculate p(-1). -155 Let s(g) = 2g2 - g - 64. What is s(-5)? -9 Let b(h) = 3h*2 - 311h + 3152. Calculate b(11). 94 Let p(b) = -191b - 82. Calculate p(-2). 300 Let m(j) = 80j + 795. Determine m(-10). -5 Let d(t) = 6t2 + 59t + 1. What is d(-14)? 351 Let f(r) = -33r2 - 9r - 12. Give f(-3). -282 Let r(l) = -218l2 - 27l - 28. What is r(-1)? -219 Let c(p) = -7798p - 23388. What is c(-3)? 6 Let x(d) = -d2 + 8186d - 49077. Give x(6). 3 Let c(m) = 28m2 - 551m - 182. Determine c(20). -2 Let a(z) = 3z2 + 8z - 2. Calculate a(-3). 1 Let g(w) = w*2 + 11w - 143. What is g(-21)? 67 Let k(g) = -g*3 + 103g*2 + 116g - 1159. Determine k(104). 89 Let k(x) = 335x + 1338. What is k(-4)? -2 Let r(i) = -74i*2 - 26i - 26. Calculate r(-1). -74 Let h(r) = -516r - 2078. What is h(-4)? -14 Let n(z) = 3z*2 + 30z + 111. Determine n(-23). 1008 Let u(o) = o*2 + 20o - 911. Give u(21). -50 Let z(g) = 2344g - 16402. What is z(7)? 6 Let m(n) = -12n*2 + 9n + 17. Give m(-5). -328 Let b(u) = -13u + 5. Determine b(0). 5 Let t(x) = -17x*2 + 76x - 227. Determine t(3). -152 Let d(m) = m*3 + 11m*2 + 26m + 72. Give d(-10). -88 Let x(a) = 1069a - 26672. What is x(25)? 53 Let z(h) = 177h - 1668. Calculate z(9). -75 Let h(u) = -u*3 - 4u*2 + 47u + 185. Determine h(-7). 3 Let a(t) = 7t2 + 120t + 490. Determine a(-4). 122 Let j(a) = 119a2 - 4045a - 19. Calculate j(34). 15 Let s(z) = -z*3 - 14z*2 + 63z + 984. What is s(-13)? -4 Let m(d) = 2d3 + 41d*2 - 19d + 76. What is m(-21)? 34 Let y(t) = -2t3 + 29t*2 + 19t - 758. Determine y(13). -4 Let s(v) = -4v3 - 8v - 21. Determine s(-2). 27 Let l(x) = -7x - 87. What is l(3)? -108 Let y(u) = -544u - 1627. Determine y(-3). 5 Let t(j) = 33j2 + 2077j - 128. Calculate t(-63). -2 Let o(w) = 28w2 - 643w - 11. Determine o(23). 12 Let y(n) = n*2 + 156n - 2193. Give y(13). 4 Let q(s) = -s*3 + 82s*2 - 1241s + 101. Determine q(62). 39 Let p(w) = w*3 - 19w*2 + 39w - 383. Determine p(18). -5 Let c(p) = p*2 - 248p + 1217. Give c(5). 2 Let d(i) = -14i - 269. Calculate d(-19). -3 Let z(u) = 9u*2 + 125u - 1579. Determine z(8). -3 Let h(k) = -162k3 + 4k*2 + 2k - 2. Calculate h(-1). 162 Let h(v) = -15v2 - 28v - 10. What is h(-4)? -138 Let z(l) = 4l + 147. Give z(-25). 47 Let f(h) = -h2 - 32h + 318. Determine f(-43). -155 Let l(f) = -157f - 14130. Determine l(-90). 0 Let m(r) = r3 - 6r*2 + 11r - 17. Determine m(5). 13 Let b(k) = k*2 - 58k + 615. Calculate b(44). -1 Let c(b) = 2b2 - 24b + 10. Give c(12). 10 Let o(y) = y*3 + 89y*2 + 255y - 253. Give o(-86). 5 Let c(q) = -5q2 - 37q + 955. Determine c(-18). 1 Let a(n) = 4n3 + n2 - 3n - 3. Give a(3). 105 Let b(n) = 165n - 675. Calculate b(3). -180 Let f(k) = -k2 - 14k + 353. Determine f(17). -174 Let k(u) = -u*2 + 96u - 1166. Determine k(81). 49 Let p(b) = -4487b - 4334. Determine p(-1). 153 Let b(l) = -845l + 37186. Calculate b(44). 6 Let x(g) = g*3 + 14g*2 + 51g - 20. What is x(-8)? -44 Let n(v) = 2v2 - 37v + 18. Calculate n(21). 123 Let q(o) = -82o - 1168. Determine q(-14). -20 Let h(n) = -2463n + 19691. Calculate h(8). -13 Let x(c) = -c3 + c2 + 48c - 130. What is x(3)? -4 Let f(x) = -2x*3 + 63x*2 + 322x + 78. Determine f(36). 6 Let o(g) = -1150g2 + 12652g - 12. Calculate o(11). 10 Let u(i) = -3i + 19. What is u(21)? -44 Let c(o) = o2 - 20o + 74. Calculate c(14). -10 Let h(j) = -21j2 + 216j + 175. Determine h(11). 10 Let p(c) = -c*2 - 16c - 31. Determine p(-2). -3 Let y(c) = c*3 - 70c*2 - 133c - 777. Give y(72). 15 Let y(i) = i*2 + 1123i + 10030. What is y(-9)? 4 Let h(z) = 12z2 + 89z + 33. Calculate h(-7). -2 Let z(a) = 3a3 - 42a*2 - 35a - 83. Calculate z(15). 67 Let t(l) = 249l - 667. Give t(2). -169 Let a(v) = -3v*3 - 322v*2 - 415v + 951. Calculate a(-106). -3 Let o(k) = k*2 - 447k - 1749. Determine o(-4). 55 Let c(k) = 44k3 + 3k*2 - 11k + 8. Calculate c(1). 44 Let r(c) = -2c3 + 224c*2 + 242c - 1799. What is r(113)? 9 Let z(d) = d*2 - 81d - 1220. What is z(-13)? 2 Let h(k) = 985k - 39384. Calculate h(40). 16 Let g(x) = -18x + 1403. Calculate g(54). 431 Let h(n) = -n*2 + 9n - 54. Calculate h(0). -54 Let f(b) = 1788b - 21451. Give f(12). 5 Let n(a) = -9a - 640. What is n(-71)? -1 Let z(k) = k*3 - 9k*2 - 133k + 1247. What is z(11)? 26 Let d(q) = -5q3 + 77q*2 + 136q + 18. Determine d(17). 18 Let b(p) = -385p + 11168. Give b(29). 3 Let y(o) = 4o*2 - 677o - 6411. What is y(-9)? 6 Let j(a) = 8a3 + a2 - 123a + 122. What is j(1)? 8 Let m(j) = -2j2 - 33j + 1761. Give m(-39). 6 Let y(n) = -3n2 - 123n - 1098. Calculate y(-13). -6 Let x(v) = -2v2 - 51v + 883. Give x(12). -17 Let n(t) = -15t2 - t - 7. Determine n(0). -7 Let z(p) = 3p*2 - 2356p + 17. What is z(0)? 17 Let l(i) = 3i2 - 135i + 1304. Determine l(31). 2 Let d(x) = -62x + 30. Give d(0). 30 Let a(x) = -9x + 5. Calculate a(3). -22 Let o(z) = 12z + 40. Determine o(-49). -548 Let h(f) = 10f - 769. Calculate h(64). -129 Let i(x) = -x*2 - 10x - 344. What is i(-20)? -544 Let c(j) = j*2 - 20j + 102. Determine c(10). 2 Let c(s) = -31s - 2924. Calculate c(-97). 83 Let h(f) = -54f + 3743. Determine h(64). 287 Let g(n) = 5063n + 10149. Calculate g(-2). 23 Let c(n) = -5n - 255. What is c(-38)? -65 Let a(q) = -279q + 9768. Give a(35). 3 Let g(h) = h3 + 12h*2 - 45h - 647. What is g(-10)? 3 Let t(q) = -69q + 9213. Give t(133). 36 Let b(c) = -1112c - 5555. Calculate b(-5). 5 Let y(d) = -8d3 + 4d*2 + 6d - 29. Calculate y(3). -191 Let q(o) = 2o3 + 211o*2 - 109o - 337. Determine q(-106). -19 Let i(x) = x*3 + 68x*2 - 3x - 216. What is i(-68)? -12 Let r(b) = -15b - 682. Give r(-43). -37 Let w(r) = -r3 - 105r*2 + 216r + 206. Determine w(-107). -8 Let f(r) = -35r2 - 7r - 6. Calculate f(2). -160 Let w(q) = -q*2 + 99q + 543. Calculate w(104). 23 Let p(g) = -g*2 + 50g + 128. Give p(53). -31 Let p(q) = q*2 - 2q + 17. Give p(5). 32 Let v(i) = -i3 - i2 + 43i - 11. Determine v(0). -11 Let w(p) = -18p*2 + 87p - 72. Determine w(4). -12 Let b(y) = -y*3 - 2y*2 - 9y - 22. Determine b(-5). 98 Let c(t) = 13t2 + 288t + 1108. What is c(-5)? -7 Let w(i) = -2193i + 5. Calculate w(0). 5 Let u(z) = z2 + 37z + 446. Determine u(-40). 566 Let b(r) = 23r + 86. Calculate b(-3). 17 Let c(y) = -140y*2 - 26041y - 174. Give c(-186). 12 Let k(l) = 114l - 6604. Determine k(58). 8 Let y(c) = c3 + 12c*2 + 27c - 21. Give y(-9). -21 Let d(z) = -z*3 + 8z*2 + 7z - 42. Give d(9). -60 Let g(a) = 133a + 1210. Determine g(-9). 13 Let a(s) = 169s - 2597. Give a(13). -400 Let a(z) = -2z3 - 52z*2 - 36z - 23. Determine a(-25). -373 Let h(w) = -49w + 50. Calculate h(1). 1 Let t(b) = -3b*2 + 38b + 39. Give t(14). -17 Let y(t) = -2t3 - 32t*2 + 33t. What is y(-17)? 17 Let h(k) = k*2 + 102k + 2240. Determine h(-70). 0 Let j(l) = -15l2 + 50l + 58. What is j(4)? 18 Let q(y) = 4750y - 61738. Determine q(13). 12 Let s(i) = -i3 - 14i*2 - 37i + 49. Determine s(-13). 361 Let c(o) = o*3 - 12o*2 + 25o - 214. Give c(12). 86 Let g(y) = -57y - 2259. Give g(-39). -36 Let d(h) = -6h3 - h2 - 34h - 35. Determine d(-1). 4 Let r(t) = t2 + 5t - 2. Determine r(-8). 22 Let u(o) = -o*2 - 4o + 27. Give u(4). -5 Let k(q) = -110q - 5612. Give k(-51). -2 Let i(z) = -163z*2 + 4z - 1. Give i(1). -160 Let a(v) = -381v - 80002. What is a(-210)? 8 Let p(f) = f3 + 30f*2 + 2049. Give p(-32). 1 Let a(g) = -2g*2 - 149g + 801. Determine a(5). 6 Let y(d) = -3d3 + 18d*2 - 71d + 428. Determine y(6). 2 Let m(g) = 3g3 - 2g*2 - 2g + 3. What is m(5)? 318 Let w(r) = 2r2 + 245r + 1865. Give w(-8). 33 Let j(t) = 184t - 2861. What is j(16)? 83 Let w(c) = c3 - 51c*2 - 369c + 4. What is w(-7)? -255 Let o(u) = -u*2 - 35u - 23. Determine o(-2). 43 Let a(l) = 678l - 4064. Calculate a(6). 4 Let h(o) = -10o*2 - 216o + 7. Calculate h(-19). 501 Let j(s) = 10s - 829. Calculate j(70). -129 Let k(n) = 8810n - 35246. Determine k(4). -6 Let u(s) = 2s3 - 23s*2 - 358s + 4150	{ "pile_set_name": "DM Mathematics" }
olve -11w - 5w = 80 for w. -5 Solve 8f + 15 + 1 = 0 for f. -2 Solve 140b + 45 = 125b for b. -3 Solve -2u + 150 = 23u for u. 6 Solve 53 + 76 = 43i for i. 3 Solve -12y + 15 = 3 for y. 1 Solve -4a - 140 = -32a for a. 5 Solve 0 = 9b - 8b + 5 for b. -5 Solve -6w + 128 = 110 for w. 3 Solve 5h + 263 = 258 for h. -1 Solve 4n - 1 = 3n for n. 1 Solve 9n = -41 + 5 for n. -4 Solve -17l = -4l + 52 for l. -4 Solve 83 = -21z - 22 for z. -5 Solve 0 = 127w - 129w for w. 0 Solve 31z = 39z + 56 for z. -7 Solve 10p - 2p = 8 for p. 1 Solve -2v - 8 = -2 for v. -3 Solve 5t = 16t + 55 for t. -5 Solve -1705f + 4 = -1704f for f. 4 Solve 0 = -11h - 5h - 64 for h. -4 Solve 2t + 13 = 11 for t. -1 Solve -5a + 24 = -1 for a. 5 Solve -12b + 87 = 135 for b. -4 Solve b - 3 = 2 for b. 5 Solve 0d - d - 2d = 0 for d. 0 Solve 10 = -6x - 20 for x. -5 Solve 6n = -4n - 30 for n. -3 Solve -79d + 52d + 108 = 0 for d. 4 Solve -123 = -8t - 163 for t. -5 Solve 27v - 74 - 115 = 0 for v. 7 Solve 0 = 56o - 54o - 6 for o. 3 Solve 398 - 418 = 20n for n. -1 Solve -15b - 55 = 20 for b. -5 Solve -37b = -47b + 40 for b. 4 Solve 3b = 14 - 8 for b. 2 Solve 0 = -142a + 143a + 8 for a. -8 Solve -947g - 56 = -939g for g. -7 Solve 0 = 97u - 42 + 818 for u. -8 Solve 0 = -72b + 56b - 48 for b. -3 Solve 130 = 7z + 102 for z. 4 Solve -60h = -38h + 22 for h. -1 Solve 4q - 12q - 3q = 0 for q. 0 Solve 4z + 24 = -2z for z. -4 Solve 5s + 6 = 21 for s. 3 Solve -261y = -269y + 8 for y. 1 Solve -11t + 19t - 8 = 0 for t. 1 Solve 0 = 50h - 49h + 5 for h. -5 Solve -32x + 30x + 8 = 0 for x. 4 Solve 7 + 3 = 5t for t. 2 Solve 77x - 10x - 268 = 0 for x. 4 Solve 27 = -755v + 758v for v. 9 Solve s = 2s - 5 for s. 5 Solve -26y = -9y + 17 for y. -1 Solve 360c - 49 = 367c for c. -7 Solve -52q - 435 = 93q for q. -3 Solve 6u + 25 - 25 = 0 for u. 0 Solve -28m = -52m + 72 for m. 3 Solve -14j = 13 + 1 for j. -1 Solve 0 = 106t - 103t + 12 for t. -4 Solve -43z + 294 = -7 for z. 7 Solve 6f + 32 = 14f for f. 4 Solve 40 = -10l + 110 for l. 7 Solve -9 = -3637h + 3636h for h. 9 Solve 21g + 139 = 307 for g. 8 Solve 0 = -6y - 265 + 247 for y. -3 Solve 12s - 25 = 7s for s. 5 Solve -36 = -3q - 6q for q. 4 Solve -211 + 232 = 7f for f. 3 Solve 0 = -11s + 14s + 15 for s. -5 Solve 282 = -83q - 50 for q. -4 Solve q = 110 - 109 for q. 1 Solve 4h - 9h - 20 = 0 for h. -4 Solve 12a - 46 = -22 for a. 2 Solve 7r = -13r for r. 0 Solve 14 = 6w + w for w. 2 Solve 9s = -5s + 42 for s. 3 Solve 0 = 12c + 364 - 472 for c. 9 Solve 42t = 39t + 6 for t. 2 Solve -14v - 146 = -76 for v. -5 Solve 0 = y - 27y + 130 for y. 5 Solve -806l = -804l + 8 for l. -4 Solve 0 = 38k - 45k - 21 for k. -3 Solve 0 = -7d - 2 - 26 for d. -4 Solve -f + 19 = 24 for f. -5 Solve 8b - 60 = -7b for b. 4 Solve -12k + 5k = 0 for k. 0 Solve 54o - 42o = -48 for o. -4 Solve 217l - 194l - 161 = 0 for l. 7 Solve 9x = -3 + 12 for x. 1 Solve -2t = t for t. 0 Solve 0 = 5f + 5f + 20 for f. -2 Solve 0 = -6x - 1 - 29 for x. -5 Solve 0 = -9g - 1014 + 1050 for g. 4 Solve -18c - 18 = 144 for c. -9 Solve 2964 = -11v + 2920 for v. -4 Solve 155 = 38o - 7o for o. 5 Solve -13g + 10g = -6 for g. 2 Solve -9 = -18c + 27 for c. 2 Solve 0 = -16n - 1 + 17 for n. 1 Solve 0 = 33z - 29 + 62 for z. -1 Solve 15h + 233 - 218 = 0 for h. -1 Solve -146p = -51p - 665 for p. 7 Solve 220b + 9 = 217b for b. -3 Solve -8g + 10 = -3g for g. 2 Solve 15s = 2s - 52 for s. -4 Solve 231c - 239c = 48 for c. -6 Solve -17f = 20f - 37 for f. 1 Solve 331z = 300z - 31 for z. -1 Solve -28 + 18 = 2x for x. -5 Solve -49j - 5j - 3j = 0 for j. 0 Solve 310l = 312l - 12 for l. 6 Solve 17y - 15 = 20y for y. -5 Solve 0 = -138b + 1777 - 259 for b. 11 Solve -2k = -4k + 8 for k. 4 Solve 7 = -286z + 279z for z. -1 Solve -8i - 33 = -1 for i. -4 Solve -6g + 1 + 5 = 0 for g. 1 Solve 49x - 164 = -17 for x. 3 Solve 74 = -27d - 61 for d. -5 Solve 29z - 26z = 6 for z. 2 Solve 8s + 9 = -23 for s. -4 Solve 0 = 11x - 5 + 38 for x. -3 Solve 12s - 45 = -9 for s. 3 Solve 0 = 14c - 2c + 12 for c. -1 Solve -177 = 10n - 187 for n. 1 Solve -2w + 264 = 31w for w. 8 Solve 11b + 10 - 76 = 0 for b. 6 Solve -1 - 87 = 11n for n. -8 Solve 97d - 15 = 100d for d. -5 Solve 34x + 173 = -65 for x. -7 Solve -2c = -0 + 2 for c. -1 Solve 37d + 21 = -16 for d. -1 Solve 0 = -y - 9y for y. 0 Solve 8t + 6 = 5t for t. -2 Solve 39o = 35o + 16 for o. 4 Solve 214 = -8m + 126 for m. -11 Solve -60z + 160 = -92z for z. -5 Solve 0 = 15n - 7n + 48 for n. -6 Solve 21i + 121 = 226 for i. 5 Solve -18d + 12 + 60 = 0 for d. 4 Solve -84t = 48 + 372 for t. -5 Solve -13r - 50 = -11 for r. -3 Solve -6z = -4z - 10 for z. 5 Solve 30 + 10 = 8f for f. 5 Solve 9r = 25r + 80 for r. -5 Solve -106 = 280i - 227i for i. -2 Solve 6s = -2s + 40 for s. 5 Solve 26 = 10q - 24 for q. 5 Solve 2o = 28 - 36 for o. -4 Solve -971 = 6p - 965 for p. -1 Solve 3 - 11 = -8o for o. 1 Solve -10 - 146 = 26m for m. -6 Solve 0 = 9p - 18 + 27 for p. -1 Solve 7c - 2 = -44 for c. -6 Solve 0 = 10k + 3374 - 3384 for k. 1 Solve -11n - 892 = -804 for n. -8 Solve 4d = 2d - 4 for d. -2 Solve -78d + 79d + 3 = 0 for d. -3 Solve -12 = 8k - 4 for k. -1 Solve 3a - 122 = -113 for a. 3 Solve -8 = 4i - 0 for i. -2 Solve 2m = 6m - 20 for m. 5 Solve 33l = 35l - 2 for l. 1 Solve 70m - 63m = 42 for m. 6 Solve 320z + 156 = 294z for z. -6 Solve 4b = -4b - 16 for b. -2 Solve -8 = 22m + 124 for m. -6 Solve -31d + 24 - 334 = 0 for d. -10 Solve 9h + 137 - 146 = 0 for h. 1 Solve -2o - 26o = 84 for o. -3 Solve -11 = 4z - 7 for z. -1 Solve 6 = 4j - 6 for j. 3 Solve 0 = 2a - 19 + 11 for a. 4 Solve t + 0 + 5 = 0 for t. -5 Solve -4i = -5i for i. 0 Solve 0 = 2v + 10 - 4 for v. -3 Solve 28w = 54w + 104 for w. -4 Solve 6m + 8 = -22 for m. -5 Solve -328y - 54 = -346y for y. 3 Solve -71 = -41z + 52 for z. 3 Solve -17 = -6f - 23 for f. -1 Solve -46m + 24 = -52m for m. -4 Solve -4m + 11m - 14 = 0 for m. 2 Solve -368f + 375f = -28 for f. -4 Solve 12g - 5 = 13g for g. -5 Solve 0 = -21x + 60 + 3 for x. 3 Solve 5z + 204 = 164 for z. -8 Solve 53 = -4m + 49 for m. -1 Solve 0 = -8f - 22 - 18 for f. -5 Solve -39 = 85c + 46 for c. -1 Solve 6 = 3l - 0 for l. 2 Solve 0 = -18v - 9v - 135 for v. -5 Solve 0 = 168u - 164u - 12 for u. 3 Solve -49b + 12 = -55b for b. -2 Solve l + 373 = 370 for l. -3 Solve -91 - 84 = 25d for d. -7 Solve 9o - 434 = -488 for o. -6 Solve 3z - 80 = 19z for z. -5 Solve -8 = 571y - 567y for y. -2 Solve 73b - 9 = 82b for b. -1 Solve -19q - 162 = -48 for q. -6 Solve 8k - 15 - 25 = 0 for k. 5 Solve -7r = -128 + 184 for r. -8 Solve -4g + 3g = -4 for g. 4 Solve 4w + 5 = 13 for w. 2 Solve -65l - 6l + 142 = 0 for l. 2 Solve -58p = -77 + 193 for p. -2 Solve 348 - 420 = 12x for x. -6 Solve 0 = -29i - 26 - 61 for i. -3 Solve -2 = -116m + 118m for m. -1 Solve 8z + 40 = 16z for z. 5 Solve 22q + 91 = 179 for q. 4 Solve 51i + 67 = -137 for i. -4 Solve 25q - 1 = -26 for q. -1 Solve 5 = 4g + g for g. 1 Solve -2w + 10w = 0 for w. 0 Solve 13 = -16v - 3 for v. -1 Solve 26h - 14h = -12 for h. -1 Solve 4 = -i + 8 for i. 4 Solve 13z - 19z = -18 for z. 3 Solve 54 = 4a + 54 for a. 0 Solve n - 9 + 12 = 0 for n. -3 Solve 292 = -5p + 322 for p. 6 Solve 35 - 7 = -7y for y. -4 Solve 503i - 509i = 0 for i. 0 Solve 0w + 9 = -3w for w. -3 Solve -73k + 77k = 20 for k. 5 Solve 16w - 4w + 24 = 0 for w. -2 Solve 148d = 45d + 515 for d. 5 Solve 39l - 58 = -19 for l. 1 Solve -4v + 9 - 5 = 0 for v. 1 Solve 37f = 352 + 55 for f. 11 Solve 0 = 128h - 133h + 25 for h. 5 Solve 5a - 68 = -12a for a. 4 Solve 0x + 11x + 55 = 0 for x. -5 Solve 39w + 2w = -287 for w. -7 Solve 12i - 19 - 5 = 0 for i. 2 Solve 68 = -18f - 4 for f. -4 Solve 46v - 1 = 45 for v. 1 Solve -o = 16o - 119 for o. 7 Solve -27f + 15f - 48 = 0 for f. -4 Solve 61m - 64m - 12 = 0 for m. -4 Solve 2 = -8q + 6q for q. -1 Solve -26q + 54 = 2 for q. 2 Solve 4f + 4 = 12 for f. 2 Solve -5l + 10l = 30 for l. 6 Solve 48 = -10m + 8 for m. -4 Solve 5i - 2i = 12 for i. 4 Solve 0 = -13q + 9 + 17 for	{ "pile_set_name": "DM Mathematics" }
. Suppose -6t - f - 1 = -3t, nt - 3f - 3 = 0. Solve t = 2k - 5k + 6 for k. 2 Let y be (-2 - -128)5(-2)/(-30). Solve 0 = 19g + y + 15 for g. -3 Let i(y) = y3 + 9y*2 + 4y + 2. Let k be i(-9). Let h = k - -37. Solve 3 = -hw - 0 for w. -1 Suppose 2c = -m + 3c + 118, 10 = -5c. Suppose 14d - 164 = m. Solve s - d = -4s for s. 4 Suppose 0 = 2o + 266 - 296. Solve 7v + o = 2v for v. -3 Let y = -215 - -227. Solve 4z + 0 = y for z. 3 Let l be 8 + (6 - 256/(-8)). Solve 36 - l = 2r for r. -5 Let a = -8 + 10. Solve -4 = 6o + a for o. -1 Suppose -5p + 3f = 3, -4f - 4 = 5p - 8f. Solve p = -6a + a for a. 0 Suppose x + 21x - 594 = 0. Solve 3q = 27 - x for q. 0 Let v(x) = x*3 + 4x*2 - x - 2. Let d be v(-4). Suppose -2p = 3p - 100. Suppose 0 = -3k + du + 15, p = 5k + 2u - 5. Solve 0 = 2f + k + 1 for f. -3 Suppose -6u + 4u - c = -12, -3c + 18 = 3u. Suppose un = -2n + 2n. Solve j = -1 - n for j. -1 Let b(v) = v + 2. Let f be b(2). Suppose 5n - 25 + 10 = -5l, 3n = 4l - 26. Suppose fx + lo = 7 + 3, -4x + 5o - 10 = 0. Solve 4r + 9 + 7 = x for r. -4 Let z be ((-1)/((-3)/4))/((-2)/(-18)). Suppose -7c + 13c = z. Solve 2 = -2g - c for g. -2 Let a = -712 - -714. Solve 9c + a = 10c for c. 2 Let v(w) = -w2 - 9w - 15. Let p be v(-7). Let z be -3 - (2/p - 3). Solve -5t = -zt - 12 for t. 4 Let g(v) = -v*3 + 2v*2 + 5v + 6. Let i be g(-2). Suppose 3w - 23 = 6w - 4r, w - 2r + 7 = 0. Let q be i/8(-120)/w. Solve 5d + q = -5 for d. -5 Suppose -5j = -0j. Let t be 15 - (0 + 7 - -6). Solve j = tg + 2g for g. 0 Let n = -203 + 219. Solve 13f + 15 = nf for f. 5 Let m(d) = -d*2 + d + 2. Let a be m(2). Suppose -n - 2j = n + 2, a = 3n - j + 15. Let k = n - -7. Solve -1 + k = 2q for q. 1 Suppose -5i + 34 = n, 37 = -4n + 5n + 2i. Let y = -37 + n. Solve yj - 4 = j for j. 4 Let d = -15 + 3. Let n = d + -1. Let q = n - -18. Solve -q = -j + 6j for j. -1 Let u(s) = -14s - 28. Let t be u(-3). Solve t = i + 19 for i. -5 Let t = -759 - -780. Solve 0 = -5o - 4 - t for o. -5 Let u be (0 + 0)/(0 + -3). Let y be u/(-3 - 16/(-4)). Let a be (-2 - y - 0) + 4. Solve -w + a = 3 for w. -1 Let w be (-64)/2 + (1 - 2). Let p = w - -33. Solve -n + 1 + 4 = p for n. 5 Let s = -95 + 100. Suppose -u - s = -2n - n, 5 = -n + 2u. Solve 0 = 2t - nt - 2 for t. -2 Suppose 0 = 4y + 30 - 6. Let s be (4/y)/((-59)/(-15) - 4). Solve i + s = -i for i. -5 Let l(g) = 2g*3 - 20g*2 - 5g + 51. Let v be l(10). Suppose 2 = 2r - 0. Solve -2d = -r - v for d. 1 Let g = -1317 - -1322. Solve 0 = -2u - gu - 28 for u. -4 Let v(x) = -x*2 + 5x + 12. Let k be v(6). Suppose -n = kn. Solve nu = 2u for u. 0 Let t = -113 + 104. Let r(a) = a2 + 12a + 29. Let u be r(t). Solve -6p = -up for p. 0 Let i = 93 + -90. Solve -i = -3g - 0 for g. 1 Suppose -3o + 45 = 2z, 4o - 37 = 2o + z. Suppose 0 = 7i - oi + 30. Let a(p) = p3 - p2 + p + 10. Let d be a(0). Solve 0 = iu + 5 + d for u. -5 Let m be (-2 + -2 + 0)-1. Suppose 0 = mj + 2k - 30, 8k = 5k + 9. Solve 3l = l - j for l. -3 Suppose -32k = -25 - 7. Solve -n + 0n = k for n. -1 Let u be 18 - 11/((-66)/(-36)). Solve x - 5x = -u for x. 3 Let n(i) be the second derivative of -i4/12 - i3/3 + i2 - 4i. Let y be n(-2). Solve -ya = 2a - 12 for a. 3 Suppose 5x + 4o - 1 = 1, -o - 2 = 0. Let b be (-2 - -1)(1 - 1). Let j be b - x - (9 - 14). Solve -jz = z - 4 for z. 1 Let o be (12/(-8))/(6/(-92)). Suppose 5x - o = -8. Solve 0 = xn - 0 - 3 for n. 1 Let w be (-2 + 3 + -2)-5. Let l = 5 - w. Solve -2p - 2p = l for p. 0 Let u(z) = z3 + 9z*2 + z + 11. Let o(v) = -4v + 3. Let m be o(3). Let g be u(m). Let d = g - -2. Solve -3l - d = l for l. -1 Let b = 10413 - 10411. Let h = 10 + -3. Solve -hc = -bc + 25 for c. -5 Suppose -6l + 28 = -2l - 4w, -w = -1. Suppose 3h + 4i - l = h, 4h - i = 16. Solve -4 = hn + 4 for n. -2 Let p(g) be the second derivative of 5g3/6 - 5g*2/2 + 13g. Let m be p(2). Solve -h + mh = 16 for h. 4 Let p be 0 - (3 + -2 - 7). Suppose -2t - 3t = -y + 61, -4y + 134 = 2t. Let k = y - 26. Solve u = pu + k for u. -2 Suppose -3o - 4k = 0, 4o + 0o = -2k. Let n be (-11 + 8)((-40)/(-12))/5. Let p be o/(1 + (-1 - n)). Solve pt + 1 = t for t. 1 Suppose -2v + 3 = -5. Suppose 0 = -m - 2m + 18. Suppose 5y = -4u + 31, -y = y - m. Solve -u = vb - 0 for b. -1 Suppose 47h - 276 = 147. Solve ho = -2o - 33 for o. -3 Suppose 18o - 14o = 0. Let z be 2 - -1 - (3 + -2). Suppose o = -4n + 6 - z. Solve -3g + 7 = n for g. 2 Let v = -207 + 202. Let f be -9(-1 - 0 - 0). Let o = f + v. Solve 8 = 4r - o for r. 3 Suppose f + 5d = 5, 48d - 43d + 15 = 3f. Solve -f = -2y - 1 for y. 2 Suppose 19 = 4x - x - 5v, x - 4 = 4v. Suppose -23 = -5a - x. Suppose 2m + a = -4u - m, 0 = -u - 3m - 12. Solve u - 5 = 2s for s. -1 Let m(z) = 31z - 1. Let d be m(1). Let u be ((-15)/d)/((-1)/8). Solve a + a = u for a. 2 Suppose -q = 2s - 18, -4q + 2s = 3s - 86. Solve 0 = o - q + 19 for o. 3 Let a = 199 + 11. Suppose 0 = -5w + 2v + a, -5v = 2w - 4v - 75. Suppose -4h + 3c = 4c - w, -4c = -16. Solve -4i = -i - h for i. 3 Let h(w) = -w + 8. Let i be h(0). Suppose -5o - i = -9o. Solve -3 = ob - 5b for b. 1 Suppose -p = h - 7, 2h - 4p + 1 = 3h. Let f(r) = -r + 24. Let o be f(h). Solve 3z - 8z = -o for z. 3 Let b be -10 - -24 - 12 - (-4 - -1). Solve 18 + 7 = -bi for i. -5 Let g(a) = -1 + 2 - 4 - 1 - a. Suppose -5k = -4k - 3t, 4 = -2t. Let p be g(k). Solve z = -pz for z. 0 Suppose 5z + 76 = -64. Let t = z + 48. Suppose -5o + 5 = -t. Solve -11 - 9 = -ok for k. 4 Let j(g) = 30g + 6. Let l be j(-2). Let b = 54 + l. Solve bk = 4k for k. 0 Let t be (((-16)/9)/4)/((-9)/81). Solve t = 2i - 0 for i. 2 Suppose 5s - 1 = 4. Let w be (-12)/(-30) + 26/10. Solve 4y - s = w for y. 1 Let d be (96/72)/((-1)/(-45)). Solve -27q - 21 = d for q. -3 Suppose -2k = 3f + 3, -3k - 4f + 5 = 9. Solve k = -3y + y - y for y. 0 Let c be (-7)/28-227. Suppose 29 + 20 = cb. Solve -5j = -2 + b for j. -1 Suppose 4h - 3h - 2l + 3 = 0, 0 = -3h + 5l - 7. Let k = 70 + -68. Suppose p = z + 3, 7 + 2 = kp - 5z. Solve h + 5 = -pj for j. -3 Let j(q) = q - 4. Let z be (-3 - -2 - -1) + 29. Let u = z - 21. Let t be j(u). Solve -3o + 11 = -t for o. 5 Let j(x) = 47x - 253. Let s be j(6). Solve 0 = -4d - 41 + s for d. -3 Suppose 0 = 7m - 8m. Suppose r = 3r. Suppose -5c + 8c - 6 = r. Solve cv - v + 1 = m for v. -1 Let z(g) = -2g*2 - 56g + 2. Let w be z(-28). Solve 0 = -wc - 3 - 1 for c. -2 Let a = -1395 - -1421. Solve 26v - 13v - a = 0 for v. 2 Let t = 18 + -3. Suppose -12 + t = 3i. Solve i + 4 = -5k for k. -1 Suppose 6m + 28 = 28. Solve -4i + 4 - 8 = m for i. -1 Suppose -30 = 8t - 13t. Solve -3u = -u - t for u. 3 Let a be 15/(-90) - (-19)/6. Suppose -aq - u - 3u = -12, -u = -q + 4. Suppose qm + 10 = 9m. Solve c - m - 1 = 0 for c. 3 Let m(p) = -5p3 + 3p*2 + 8p - 9. Let c(h) = h*3 - h + 1. Let t(v) = -4c(v) - m(v). Let w be t(4). Suppose 4d - wd = -3. Solve k - 2 = d for k. 5 Let z be 0 + (4 - (3 - -20)). Let k = z - 3. Let q = -17 - k. Solve 8 = qx - x for x. 2 Suppose -2o = -y + 3, -2o + 18 = 15y - 13y. Solve yk + 8 = 22 for k. 2 Let p(m) = 4m2 + 2m - 1. Let f(j) = -7j2 - 5j + 3. Let k(t) = 3f(t) + 5p(t). Let c be k(-5). Solve 0w - 16 = -cw for w. 4 Suppose -4m + 5w + 21 = 8w, -2w = -2m. Let g(x) = x2 - 7x + 8. Let r be g(7). Solve -l - ml = r for l. -2 Suppose 0x + 2x - f = 2, 0 = x + 5f - 12. Suppose 28 = 6d + 10. Solve -1 - d = -xw for w. 2 Let u(r) = 2r + 22. Let w be u(-9). Suppose -wa + 4 = 5t - 2, 0 = -3a - 4t + 4. Solve k = -ak for k. 0 Suppose 16 = -4p - 3r + 47, 35 = 5p + 3r. Let w(i) = -i*2 + 8i - 2 - 2i + 0i*2. Let f be w(p). Solve -f = -4j + 10 for j. 4 Let u be (148/(-8))/(3/6)-1. Let m = -26 + u. Solve -4i + m + 5 = 0 for i. 4 Suppose -2z = -4o - 24, 3o - 3z = -19 - 2. Let p be 4/o20/(-8). Solve 6v - pv + 8 = 0 for v. -2 Let b be 20/3 + 2/(-3). Let i(f) = -f3 + 38f*2 - 217f + 4. Let o be i(31). Solve od + 14 = -b for d. -5 Suppose 3y - 4 + 1 = 0. Suppose 0 = q + y - 4. Suppose -qn + 8n - 15 = 0. Solve 2*i = 11 - n for i. 4 Let v = 5	{ "pile_set_name": "DM Mathematics" }
0u + 296/7u*3 - 3260/7u*2. 4u(u - 5)2(u + 84)/7 Let p be ((-5)/3)/((2/18)/(110/(-660))). Find u such that 6u3 + 1/2u*2 - 6u + 2 - pu4 = 0. -1, 2/5, 1, 2 Let w be (-2 - (-32)/6)/((-38)/(-228)). Let n be (81/(-36))/((-25)/w). Suppose -12/5p + 12/5p3 + 12/5 - 3/5p*4 - np*2 = 0. Calculate p. -1, 1, 2 Let c(o) = 6o*2 + 20o - 40. Let h be c(11). Determine s, given that s + 294 + h - 48s - 73s + 3s2 = 0. 20 Let w(f) = 28f + 31. Let z be w(-1). Let x(g) be the first derivative of -2/9g2 - 14 - 34/27g*z + 0g. Factor x(h). -2h(17h + 2)/9 Let x(v) be the third derivative of v7/210 - v6/18 + v5/10 + 3v*4/2 + 71v*3/6 + 24v*2. Let c(h) be the first derivative of x(h). Factor c(p). 4(p - 3)*2(p + 1) Let h = 309 + -369. Let k be (7 - 320/h) + (4 - -1). Determine w so that 8/3 + 52/3w - 68/3w*2 + 20w*4 - kw*3 = 0. -1, -2/15, 1 Let c be 8/(-14) + (-66)/7282/(-705). Factor -4/5p4 + 12/5p*3 + 0 - cp + 0p2. -4p(p - 2)2(p + 1)/5 Let u(y) be the third derivative of 0y3 + 0y - 1/420y7 - 67y*2 - 1/60y*6 - 1/8y*4 - 2 + 11/120y*5. Find j, given that u(j) = 0. -6, 0, 1 Factor -4056 - 2/3y*4 - 1994/3y*2 + 116/3y*3 + 3016y. -2(y - 26)2(y - 3)*2/3 Let k(t) be the second derivative of -13t10/3024 - t9/336 + t*8/672 + 29t*4/6 + 88t. Let l(s) be the third derivative of k(s). Factor l(m). -5m3(2m + 1)(13m - 2) Let c(h) be the first derivative of -2h7/525 - h6/75 - h*5/75 - 29h*2/2 + h + 250. Let y(v) be the second derivative of c(v). Let y(u) = 0. What is u? -1, 0 Let n be -1753(6 + 544/(-90)). Let q = n - 384/5. Factor -qu + 2/9u*2 + 0. 2u(u - 5)/9 Let f be -8(-6)/(-4)-10. Let z = 132 - 130. Find c, given that -c + 6c - 3cz + 0c + fc3 - 80c*4 - 42c*2 = 0. 0, 1/4, 1 Let p = 3356 - 10066/3. Let b(c) be the first derivative of -pc + 4 - 2/3c3 + 1/6c4 + c2. Factor b(z). 2(z - 1)3/3 Let w be (-2)/6 - (-211)/3. Solve -4q*2 + wq + 2q3 - 54q - 14q2 = 0. 0, 1, 8 Find i, given that 1/3i*2 - 95/3i + 150 = 0. 5, 90 Let u(l) be the third derivative of -l*8/1008 - 47l*7/630 - 91l6/360 - l5/4 + 48l2 + 23l. Factor u(d). -d*2(d + 1)*2(d + 45)/3 Suppose q - 2o - 9 = 10, 3q - 2o = 45. Suppose 11 = -y + q. Factor p2 + 2p - p*5 + 3p*3 + 4p*y + 6p*4 - 7p*4. -p(p - 2)(p + 1)3 Suppose -28u = -33u + 170. Find v, given that -26v*3 - 3v*5 + 12v + 43v + 39v*4 - 39v*2 - 37v*3 + uv - 23v = 0. -1, 0, 1, 2, 11 Let p = -4342 + 4342. Let l(z) be the third derivative of p + 1/12z*4 + 1/960z*6 + 0z + 7/480z5 + 1/4z*3 + 3z*2. What is f in l(f) = 0? -3, -2 Suppose 9358 = 21x - 11789. Let k = -1005 + x. Find z such that 0 - 2/21z + 0z*4 - 2/21z*5 + 4/21z*3 + 0z*k = 0. -1, 0, 1 Let v = -258 - -260. Determine f so that -13f*4 + 16f*4 + 25f*3 + 10f*4 + 5f*5 + 7f*4 + 10f*v = 0. -2, -1, 0 Factor -2/3o*3 + 22/3o*2 + 6 - 38/3o. -2(o - 9)(o - 1)*2/3 Let t = -6285439/10 - -628544. Suppose 0f - 722/5f2 - tf*4 + 38/5f*3 + 0 = 0. Calculate f. 0, 38 Suppose -3p - 30 = 5u, 0 = 2u - 2p - 2p - 40. Suppose -24/7z3 - 4/7z*4 - 16/7z + u - 36/7z2 = 0. Calculate z. -4, -1, 0 Let f(v) be the second derivative of 3v*4/2 + 43v*3/6 + 77v*2/2 + v - 101. Let z(w) = -28w*2 - 64w - 116. Let h(j) = -8f(j) - 5z(j). Factor h(y). -4(y + 3)2 Let q(u) be the second derivative of -1 - 3/2u*2 + 1/4u*4 + 3/20u*5 + 7u - 1/2u3. Find a such that q(a) = 0. -1, 1 Let -1552 - 2n*4 - 1170n - 1060 + 3276 + 346n2 + 162n*3 = 0. Calculate n. -4, 1, 83 Let k be 33/(-66)(2 + 4)(-4)/6. Factor -48/5h + 32/5 + 18/5hk. 2(3h - 4)2/5 Let x be 14/5 - (-6)/30. Suppose 3i - 16 = -xt + t, -2t + 4 = 0. Factor 5o5 - 3o*5 - 128o*4 + 130o*i. 2o*4(o + 1) Let y be ((2/15)/((-40)/(-15)))/((-10)/(-360)). Determine c so that -yc2 + 186/5c - 3c3 - 72/5 = 0. -4, 2/5, 3 Let s(m) be the first derivative of -m2/2 - 12m - 4. Let n be s(-14). Factor -o*2 + 4 - 5o + 15o + 2o*n - 6o. (o + 2)*2 Let x be 125/(-8790)(-16)/(-20). Let m = 149360/6153 - x. Find g, given that -124/7g - mg*2 - 25/7g*3 - 24/7 = 0. -6, -2/5 Let v = -220243 - -220343. Factor -v - 30k - 9/4k2. -(3k + 20)*2/4 Solve 22i*3 + 0 + 15/2i*4 + 0i*2 + 1/2i*5 + 0i = 0 for i. -11, -4, 0 Let t(b) be the second derivative of -b*4/3 + 112b*3/3 + 610b*2 - 1527b. Factor t(w). -4(w - 61)(w + 5) Let q be 15(-1 + (-16)/(-10)). Suppose 6o - qo + 12 = 0. Factor -10y*2 + y + 6y*2 + 3y*3 + 18 - oy - 2y3. (y - 3)2(y + 2) Let f(b) be the second derivative of b7/840 - b5/40 + 4b4/3 + 3b*2 - b - 74. Let k(r) be the third derivative of f(r). Suppose k(v) = 0. What is v? -1, 1 Suppose -177f - 91f + 73132 - 73954 + 2f*2 = 0. Calculate f. -3, 137 Factor -61t*2 + 6t*2 - 180 + 215526t - 215886t. -5(t + 6)(11t + 6) Let h(p) = -5p2 - 40p + 2. Let z be h(-8). Let b be 8 + -6 + -1 + z. Let 0c2 + 4/3c + 2/3 - 2/3c4 - 4/3c*b = 0. What is c? -1, 1 Let o be 1/(-2)-496114/6080. Factor om - 1/5m2 - 81/5. -(m - 9)2/5 Let p(j) be the second derivative of 84j - 3/140j*5 + 0 + 384/7j*2 - 144/7j*3 + 33/28j*4. Factor p(i). -3(i - 16)*2(i - 1)/7 Let l(w) = 142w + w3 + 123w - w*2 - 268w. Let y(a) = -5a4 - 45a*3 + 105a*2 + 395a. Let h(b) = -25l(b) - y(b). Factor h(k). 5k(k - 4)(k + 4)*2 Let i(d) = 6d*2 - 87d + 957. Let h(l) = -9l2 + 177l - 1915. Let u(b) = -3h(b) - 5i(b). Factor u(z). -3(z - 8)(z + 40) Let r(t) be the second derivative of -5t4/12 - 375t*3/2 - 1115t*2 + t + 840. Factor r(s). -5(s + 2)(s + 223) Let x(y) be the first derivative of -2y*3/33 + 98y*2/11 - 930y/11 + 2116. Suppose x(q) = 0. Calculate q. 5, 93 Let q be (-2)/(-3)(3 - (-9)/2). Suppose -2w = qw - w. Solve r4 - 5r*3 + 14r*2 - 6r*4 + wr*4 - 15r + 11r2 = 0 for r. -3, 0, 1 Let c(q) be the third derivative of 16/105q*7 - 70q*2 + 79/15q*5 + 0q + 8q3 + 28/3q*4 + 43/30q*6 + 0. Determine g so that c(g) = 0. -2, -1, -3/8 Let q be (-1115)/(-105) - 100/(-2100). Factor 128/3 + 2/3g*2 + qg. 2(g + 8)2/3 Let v(h) be the second derivative of h7/21 + 112h*6/15 + 649h*5/2 + 3025h*4/3 + 748h. Factor v(b). 2b2(b + 2)(b + 55)2 Let k = -624574 + 5621168/9. Find g, given that -10/3g - kg2 - 28/9 = 0. -14, -1 Factor -84681u - 3/4u3 - 5476038 - 873/2u*2. -3(u + 194)*3/4 Suppose -37n = -13n - 48. Factor -181 - 34g - ng2 + 10g - g*2 - 244 + 377. -3(g + 4)*2 Suppose -3j = 4w - 78, 4w = -8891j + 8892j - 10. Let 16/13rw - 16/13r - 2/13r4 - 12/13r2 + 14/13 = 0. Calculate r. -1, 1, 7 Let s(c) be the third derivative of c7/630 + 23c6/40 + 41c*5/12 + 613c*4/72 + 34c*3/3 + 210c2 - 1. Factor s(b). (b + 1)3(b + 204)/3 Let p = 243 - 270. Let g = p - -27. Factor 2/5d*2 - 2/5d*4 + 2/5d*3 - 2/5d*5 + g + 0d. -2d2(d - 1)(d + 1)2/5 Let v(w) = -5w*2 + 4w - 7. Let t(d) = -13d2 + 8d - 15. Let b(x) = -2t(x) + 5v(x). Solve b(p) = 0. -5, 1 Solve 16/3o3 - 1 + 5/3o*4 - 16/3o - 2/3o2 = 0. -3, -1, -1/5, 1 Let n(g) = g3 - 13g*2 + 36g + 2. Let t be n(9). Let q = 3 + 2. Factor 20u - qu3 - 23 - u2 + 3 + 6ut. -5(u - 2)(u - 1)(u + 2) Factor 2505z + 279z*2 - 45z*3 - 79z*2 - 5z*4 - 2265z. -5z(z - 4)(z + 1)(z + 12) Suppose 2110/3y + 512y*2 + 300 + 4y*4 + 340/3y*3 - 2/3y*5 = 0. Calculate y. -5, -1, 18 Let m(z) be the first derivative of 260/3z*3 + 36 + 58z*4 + 0z + 28/5z5 + 28z*2. Factor m(s). 4s(s + 1)(s + 7)(7s + 2) Let w(u) be the second derivative of -u*8/280 - 6u*7/175 - 3u*6/25 - 4u*5/25 - 23u*2 + 26u. Let x(q) be the first derivative of w(q). Factor x(y). -6y2(y + 2)*3/5 Let b = 1656708/5 - 331338. Suppose -3p*2 - 3/5 + bp = 0. Calculate p. 1/5, 1 Let h be ((-51)/(-4))/(((-22)/8)/(-11)). Let o = h + -45. Factor -i + 3i2 - i + oi - 18 - i. 3(i - 2)(i + 3) Let m(f) be the second derivative of f*4/4 - 525f*3 + 826875f*2/2 + 7f + 31. Factor m(v). 3(v - 525)2 Let n(o) be the first derivative of -o4/6 - 322o*3/9 - 106o**2 +	{ "pile_set_name": "DM Mathematics" }