--- license: apache-2.0 --- This model can be used to generate an input caption from a SMILES string. ## Example Usage ```python from transformers import T5Tokenizer, T5ForConditionalGeneration tokenizer = T5Tokenizer.from_pretrained("laituan245/molt5-small-smiles2caption", model_max_length=512) model = T5ForConditionalGeneration.from_pretrained('laituan245/molt5-small-smiles2caption') input_text = 'C1=CC2=C(C(=C1)[O-])NC(=CC2=O)C(=O)O' input_ids = tokenizer(input_text, return_tensors="pt").input_ids outputs = model.generate(input_ids, num_beams=5, max_length=512) print(tokenizer.decode(outputs[0], skip_special_tokens=True)) ``` ## Paper For more information, please take a look at our paper. Paper: [Translation between Molecules and Natural Language](https://arxiv.org/abs/2204.11817) Authors: *Carl Edwards\*, Tuan Lai\*, Kevin Ros, Garrett Honke, Heng Ji*